From 5e6cd0090f646bcb4fa902ec3fe049c92a59287e Mon Sep 17 00:00:00 2001 From: fupan Date: Tue, 7 Aug 2018 16:39:55 +0800 Subject: [PATCH] containerd-shim-v2: add the shim v2 required vendors Add the vendors required by containerd shim v2. Signed-off-by: fupan --- Gopkg.lock | 114 +- Gopkg.toml | 4 + vendor/github.com/Microsoft/go-winio/LICENSE | 22 + .../Microsoft/go-winio/archive/tar/LICENSE | 27 + .../github.com/Microsoft/go-winio/backup.go | 280 + vendor/github.com/Microsoft/go-winio/ea.go | 137 + vendor/github.com/Microsoft/go-winio/file.go | 307 + .../github.com/Microsoft/go-winio/fileinfo.go | 61 + vendor/github.com/Microsoft/go-winio/pipe.go | 421 ++ .../Microsoft/go-winio/privilege.go | 202 + .../github.com/Microsoft/go-winio/reparse.go | 128 + vendor/github.com/Microsoft/go-winio/sd.go | 98 + .../github.com/Microsoft/go-winio/syscall.go | 3 + .../Microsoft/go-winio/zsyscall_windows.go | 520 ++ vendor/github.com/Microsoft/hcsshim/LICENSE | 21 + .../Microsoft/hcsshim/cmd/runhcs/LICENSE | 191 + .../Microsoft/hcsshim/cmd/runhcs/NOTICE | 22 + .../github.com/Microsoft/hcsshim/container.go | 192 + vendor/github.com/Microsoft/hcsshim/errors.go | 257 + .../github.com/Microsoft/hcsshim/hcsshim.go | 28 + .../Microsoft/hcsshim/hnsendpoint.go | 94 + .../Microsoft/hcsshim/hnsglobals.go | 16 + .../Microsoft/hcsshim/hnsnetwork.go | 36 + .../github.com/Microsoft/hcsshim/hnspolicy.go | 57 + .../Microsoft/hcsshim/hnspolicylist.go | 47 + .../Microsoft/hcsshim/hnssupport.go | 13 + .../github.com/Microsoft/hcsshim/interface.go | 114 + .../hcsshim/internal/guestrequest/types.go | 85 + .../Microsoft/hcsshim/internal/guid/guid.go | 69 + .../hcsshim/internal/hcs/callback.go | 81 + .../Microsoft/hcsshim/internal/hcs/cgo.go | 7 + .../Microsoft/hcsshim/internal/hcs/errors.go | 279 + .../Microsoft/hcsshim/internal/hcs/hcs.go | 48 + .../Microsoft/hcsshim/internal/hcs/process.go | 427 ++ .../Microsoft/hcsshim/internal/hcs/system.go | 585 ++ .../Microsoft/hcsshim/internal/hcs/utils.go | 33 + .../hcsshim/internal/hcs/waithelper.go | 63 + .../Microsoft/hcsshim/internal/hcs/watcher.go | 30 + .../hcsshim/internal/hcs/zsyscall_windows.go | 462 ++ .../hcsshim/internal/hcserror/hcserror.go | 51 + .../Microsoft/hcsshim/internal/hns/hns.go | 23 + .../hcsshim/internal/hns/hnsendpoint.go | 260 + .../hcsshim/internal/hns/hnsfuncs.go | 42 + .../hcsshim/internal/hns/hnsglobals.go | 28 + .../hcsshim/internal/hns/hnsnetwork.go | 141 + .../hcsshim/internal/hns/hnspolicy.go | 98 + .../hcsshim/internal/hns/hnspolicylist.go | 202 + .../hcsshim/internal/hns/hnssupport.go | 49 + .../hcsshim/internal/hns/namespace.go | 110 + .../hcsshim/internal/hns/zsyscall_windows.go | 74 + .../hcsshim/internal/interop/interop.go | 27 + .../internal/interop/zsyscall_windows.go | 48 + .../hcsshim/internal/longpath/longpath.go | 24 + .../hcsshim/internal/mergemaps/merge.go | 52 + .../hcsshim/internal/safefile/safeopen.go | 431 ++ .../internal/safefile/zsyscall_windows.go | 79 + .../hcsshim/internal/schema1/schema1.go | 245 + .../hcsshim/internal/schema2/attachment.go | 31 + .../hcsshim/internal/schema2/battery.go | 13 + .../schema2/cache_query_stats_response.go | 19 + .../hcsshim/internal/schema2/chipset.go | 25 + .../hcsshim/internal/schema2/close_handle.go | 15 + .../hcsshim/internal/schema2/com_port.go | 18 + .../internal/schema2/compute_system.go | 27 + .../hcsshim/internal/schema2/configuration.go | 72 + .../hcsshim/internal/schema2/console_size.go | 17 + .../hcsshim/internal/schema2/container.go | 35 + .../container_credential_guard_state.go | 25 + .../schema2/container_memory_information.go | 26 + .../hcsshim/internal/schema2/device.go | 16 + .../hcsshim/internal/schema2/devices.go | 43 + .../internal/schema2/enhanced_mode_video.go | 15 + .../internal/schema2/flexible_io_device.go | 19 + .../internal/schema2/guest_connection.go | 19 + .../internal/schema2/guest_connection_info.go | 21 + .../internal/schema2/guest_crash_reporting.go | 15 + .../hcsshim/internal/schema2/guest_os.go | 15 + .../hcsshim/internal/schema2/guest_state.go | 22 + .../hcsshim/internal/schema2/hosted_system.go | 17 + .../hcsshim/internal/schema2/hv_socket.go | 17 + .../hcsshim/internal/schema2/hv_socket_2.go | 16 + .../schema2/hv_socket_service_config.go | 22 + .../schema2/hv_socket_system_config.go | 22 + .../hcsshim/internal/schema2/keyboard.go | 13 + .../hcsshim/internal/schema2/layer.go | 22 + .../internal/schema2/mapped_directory.go | 21 + .../hcsshim/internal/schema2/mapped_pipe.go | 19 + .../hcsshim/internal/schema2/memory.go | 15 + .../hcsshim/internal/schema2/memory_2.go | 25 + .../schema2/memory_information_for_vm.go | 19 + .../hcsshim/internal/schema2/memory_stats.go | 20 + .../schema2/modify_setting_request.go | 20 + .../hcsshim/internal/schema2/mouse.go | 13 + .../internal/schema2/network_adapter.go | 17 + .../hcsshim/internal/schema2/networking.go | 24 + .../internal/schema2/pause_notification.go | 16 + .../hcsshim/internal/schema2/pause_options.go | 18 + .../hcsshim/internal/schema2/plan9.go | 15 + .../hcsshim/internal/schema2/plan9_share.go | 26 + .../internal/schema2/process_details.go | 34 + .../schema2/process_modify_request.go | 20 + .../internal/schema2/process_parameters.go | 47 + .../internal/schema2/process_status.go | 22 + .../hcsshim/internal/schema2/processor.go | 19 + .../hcsshim/internal/schema2/processor_2.go | 21 + .../internal/schema2/processor_stats.go | 20 + .../hcsshim/internal/schema2/properties.go | 47 + .../internal/schema2/property_query.go | 16 + .../schema2/rdp_connection_options.go | 17 + .../internal/schema2/registry_changes.go | 17 + .../hcsshim/internal/schema2/registry_key.go | 19 + .../internal/schema2/registry_value.go | 31 + .../hcsshim/internal/schema2/restore_state.go | 19 + .../hcsshim/internal/schema2/save_options.go | 19 + .../hcsshim/internal/schema2/scsi.go | 16 + .../schema2/shared_memory_configuration.go | 15 + .../internal/schema2/shared_memory_region.go | 23 + .../schema2/shared_memory_region_info.go | 17 + .../internal/schema2/silo_properties.go | 18 + .../hcsshim/internal/schema2/statistics.go | 30 + .../hcsshim/internal/schema2/storage.go | 21 + .../hcsshim/internal/schema2/storage_qo_s.go | 17 + .../hcsshim/internal/schema2/storage_stats.go | 22 + .../hcsshim/internal/schema2/topology.go | 17 + .../hcsshim/internal/schema2/uefi.go | 21 + .../internal/schema2/uefi_boot_entry.go | 23 + .../hcsshim/internal/schema2/version.go | 17 + .../hcsshim/internal/schema2/video_monitor.go | 19 + .../internal/schema2/virtual_machine.go | 29 + .../internal/schema2/virtual_node_info.go | 21 + .../schema2/virtual_p_mem_controller.go | 20 + .../internal/schema2/virtual_p_mem_device.go | 19 + .../hcsshim/internal/schema2/virtual_smb.go | 17 + .../internal/schema2/virtual_smb_share.go | 21 + .../schema2/virtual_smb_share_options.go | 63 + .../hcsshim/internal/schema2/vm_memory.go | 27 + .../schema2/windows_crash_reporting.go | 17 + .../hcsshim/internal/timeout/timeout.go | 70 + .../hcsshim/internal/wclayer/activatelayer.go | 25 + .../hcsshim/internal/wclayer/baselayer.go | 173 + .../hcsshim/internal/wclayer/createlayer.go | 23 + .../internal/wclayer/createscratchlayer.go | 31 + .../internal/wclayer/deactivatelayer.go | 22 + .../hcsshim/internal/wclayer/destroylayer.go | 23 + .../internal/wclayer/expandscratchsize.go | 22 + .../hcsshim/internal/wclayer/exportlayer.go | 147 + .../internal/wclayer/getlayermountpath.go | 49 + .../internal/wclayer/getsharedbaseimages.go | 26 + .../hcsshim/internal/wclayer/grantvmaccess.go | 24 + .../hcsshim/internal/wclayer/importlayer.go | 206 + .../hcsshim/internal/wclayer/layerexists.go | 25 + .../hcsshim/internal/wclayer/layerid.go | 13 + .../hcsshim/internal/wclayer/layerutils.go | 96 + .../hcsshim/internal/wclayer/legacy.go | 815 +++ .../hcsshim/internal/wclayer/nametoguid.go | 24 + .../hcsshim/internal/wclayer/preparelayer.go | 40 + .../hcsshim/internal/wclayer/processimage.go | 23 + .../internal/wclayer/unpreparelayer.go | 23 + .../hcsshim/internal/wclayer/wclayer.go | 37 + .../internal/wclayer/zsyscall_windows.go | 597 ++ vendor/github.com/Microsoft/hcsshim/layer.go | 110 + .../Microsoft/hcsshim/mksyscall_windows.go | 938 +++ .../Microsoft/hcsshim/pkg/go-runhcs/LICENSE | 201 + .../Microsoft/hcsshim/pkg/go-runhcs/NOTICE | 22 + .../github.com/Microsoft/hcsshim/process.go | 72 + .../Microsoft/hcsshim/zsyscall_windows.go | 52 + vendor/github.com/containerd/console/LICENSE | 191 + .../github.com/containerd/console/console.go | 78 + .../containerd/console/console_linux.go | 275 + .../containerd/console/console_unix.go | 158 + .../containerd/console/console_windows.go | 216 + .../containerd/console/tc_darwin.go | 53 + .../containerd/console/tc_freebsd.go | 45 + .../github.com/containerd/console/tc_linux.go | 49 + .../containerd/console/tc_openbsd_cgo.go | 51 + .../containerd/console/tc_openbsd_nocgo.go | 47 + .../containerd/console/tc_solaris_cgo.go | 51 + .../containerd/console/tc_solaris_nocgo.go | 47 + .../github.com/containerd/console/tc_unix.go | 91 + .../github.com/containerd/containerd/LICENSE | 191 + .../github.com/containerd/containerd/NOTICE | 16 + .../containerd/api/events/container.pb.go | 1238 ++++ .../containerd/api/events/content.pb.go | 329 + .../containerd/containerd/api/events/doc.go | 19 + .../containerd/api/events/image.pb.go | 949 +++ .../containerd/api/events/namespace.pb.go | 950 +++ .../containerd/api/events/snapshot.pb.go | 704 ++ .../containerd/api/events/task.pb.go | 2610 ++++++++ .../containerd/api/types/descriptor.pb.go | 410 ++ .../containerd/containerd/api/types/doc.go | 17 + .../containerd/api/types/metrics.pb.go | 412 ++ .../containerd/api/types/mount.pb.go | 456 ++ .../containerd/api/types/platform.pb.go | 394 ++ .../containerd/api/types/task/task.pb.go | 890 +++ .../containerd/containerd/errdefs/errors.go | 78 + .../containerd/containerd/errdefs/grpc.go | 138 + .../containerd/containerd/events/events.go | 81 + .../containerd/containerd/log/context.go | 90 + .../containerd/mount/lookup_unix.go | 53 + .../containerd/mount/lookup_unsupported.go | 29 + .../containerd/containerd/mount/mount.go | 40 + .../containerd/mount/mount_linux.go | 308 + .../containerd/containerd/mount/mount_unix.go | 41 + .../containerd/mount/mount_windows.go | 105 + .../containerd/containerd/mount/mountinfo.go | 56 + .../containerd/mount/mountinfo_freebsd.go | 61 + .../containerd/mount/mountinfo_linux.go | 135 + .../containerd/mount/mountinfo_unsupported.go | 34 + .../containerd/containerd/mount/temp.go | 73 + .../containerd/containerd/mount/temp_unix.go | 64 + .../containerd/mount/temp_unsupported.go | 29 + .../containerd/namespaces/context.go | 79 + .../containerd/containerd/namespaces/grpc.go | 61 + .../containerd/containerd/namespaces/store.go | 37 + .../containerd/namespaces/validate.go | 83 + .../containerd/containerd/runtime/events.go | 42 + .../containerd/containerd/runtime/monitor.go | 70 + .../containerd/containerd/runtime/runtime.go | 72 + .../containerd/containerd/runtime/task.go | 132 + .../containerd/runtime/task_list.go | 130 + .../containerd/containerd/runtime/typeurl.go | 34 + .../containerd/runtime/v2/shim/reaper_unix.go | 110 + .../containerd/runtime/v2/shim/shim.go | 257 + .../containerd/runtime/v2/shim/shim_darwin.go | 29 + .../containerd/runtime/v2/shim/shim_linux.go | 30 + .../containerd/runtime/v2/shim/shim_unix.go | 117 + .../runtime/v2/shim/shim_windows.go | 182 + .../containerd/runtime/v2/shim/util.go | 120 + .../containerd/runtime/v2/shim/util_unix.go | 70 + .../runtime/v2/shim/util_windows.go | 80 + .../containerd/runtime/v2/task/doc.go | 17 + .../containerd/runtime/v2/task/shim.pb.go | 5693 +++++++++++++++++ .../containerd/containerd/sys/env.go | 33 + .../containerd/containerd/sys/epoll.go | 36 + .../containerd/containerd/sys/fds.go | 34 + .../containerd/containerd/sys/filesys_unix.go | 26 + .../containerd/sys/filesys_windows.go | 263 + .../containerd/containerd/sys/mount_linux.go | 119 + .../containerd/containerd/sys/oom_unix.go | 47 + .../containerd/containerd/sys/oom_windows.go | 24 + .../containerd/containerd/sys/proc.go | 80 + .../containerd/containerd/sys/reaper.go | 69 + .../containerd/containerd/sys/reaper_linux.go | 52 + .../containerd/containerd/sys/socket_unix.go | 80 + .../containerd/sys/socket_windows.go | 32 + .../containerd/containerd/sys/stat_bsd.go | 44 + .../containerd/containerd/sys/stat_unix.go | 44 + .../containerd/sys/subprocess_unsafe_linux.go | 30 + .../containerd/sys/subprocess_unsafe_linux.s | 15 + vendor/github.com/containerd/fifo/LICENSE | 201 + vendor/github.com/containerd/fifo/fifo.go | 236 + .../containerd/fifo/handle_linux.go | 97 + .../containerd/fifo/handle_nolinux.go | 65 + .../containerd/fifo/mkfifo_nosolaris.go | 25 + .../containerd/fifo/mkfifo_solaris.go | 27 + vendor/github.com/containerd/go-runc/LICENSE | 201 + .../containerd/go-runc/command_linux.go | 41 + .../containerd/go-runc/command_other.go | 35 + .../github.com/containerd/go-runc/console.go | 165 + .../containerd/go-runc/container.go | 30 + .../github.com/containerd/go-runc/events.go | 100 + vendor/github.com/containerd/go-runc/io.go | 218 + .../github.com/containerd/go-runc/io_unix.go | 76 + .../containerd/go-runc/io_windows.go | 62 + .../github.com/containerd/go-runc/monitor.go | 76 + vendor/github.com/containerd/go-runc/runc.go | 707 ++ vendor/github.com/containerd/go-runc/utils.go | 107 + vendor/github.com/containerd/ttrpc/LICENSE | 201 + vendor/github.com/containerd/ttrpc/channel.go | 154 + vendor/github.com/containerd/ttrpc/client.go | 284 + vendor/github.com/containerd/ttrpc/codec.go | 42 + vendor/github.com/containerd/ttrpc/config.go | 39 + .../github.com/containerd/ttrpc/handshake.go | 50 + vendor/github.com/containerd/ttrpc/server.go | 456 ++ .../github.com/containerd/ttrpc/services.go | 150 + vendor/github.com/containerd/ttrpc/types.go | 42 + .../containerd/ttrpc/unixcreds_linux.go | 108 + vendor/github.com/containerd/typeurl/LICENSE | 191 + vendor/github.com/containerd/typeurl/types.go | 158 + .../opencontainers/go-digest/LICENSE.code | 191 + .../opencontainers/go-digest/LICENSE.docs | 425 ++ .../opencontainers/go-digest/algorithm.go | 192 + .../opencontainers/go-digest/digest.go | 156 + .../opencontainers/go-digest/digester.go | 39 + .../opencontainers/go-digest/doc.go | 56 + .../opencontainers/go-digest/verifiers.go | 45 + .../runc/libcontainer/system/linux.go | 136 + .../runc/libcontainer/system/proc.go | 113 + .../libcontainer/system/syscall_linux_386.go | 25 + .../libcontainer/system/syscall_linux_64.go | 25 + .../libcontainer/system/syscall_linux_arm.go | 25 + .../runc/libcontainer/system/sysconfig.go | 12 + .../libcontainer/system/sysconfig_notcgo.go | 15 + .../runc/libcontainer/system/unsupported.go | 9 + .../runc/libcontainer/system/xattrs_linux.go | 35 + 295 files changed, 39944 insertions(+), 1 deletion(-) create mode 100644 vendor/github.com/Microsoft/go-winio/LICENSE create mode 100644 vendor/github.com/Microsoft/go-winio/archive/tar/LICENSE create mode 100644 vendor/github.com/Microsoft/go-winio/backup.go create mode 100644 vendor/github.com/Microsoft/go-winio/ea.go create mode 100644 vendor/github.com/Microsoft/go-winio/file.go create mode 100644 vendor/github.com/Microsoft/go-winio/fileinfo.go create mode 100644 vendor/github.com/Microsoft/go-winio/pipe.go create mode 100644 vendor/github.com/Microsoft/go-winio/privilege.go create mode 100644 vendor/github.com/Microsoft/go-winio/reparse.go create mode 100644 vendor/github.com/Microsoft/go-winio/sd.go create mode 100644 vendor/github.com/Microsoft/go-winio/syscall.go create mode 100644 vendor/github.com/Microsoft/go-winio/zsyscall_windows.go create mode 100644 vendor/github.com/Microsoft/hcsshim/LICENSE create mode 100644 vendor/github.com/Microsoft/hcsshim/cmd/runhcs/LICENSE create mode 100644 vendor/github.com/Microsoft/hcsshim/cmd/runhcs/NOTICE create mode 100644 vendor/github.com/Microsoft/hcsshim/container.go create mode 100644 vendor/github.com/Microsoft/hcsshim/errors.go create mode 100644 vendor/github.com/Microsoft/hcsshim/hcsshim.go create mode 100644 vendor/github.com/Microsoft/hcsshim/hnsendpoint.go create mode 100644 vendor/github.com/Microsoft/hcsshim/hnsglobals.go create mode 100644 vendor/github.com/Microsoft/hcsshim/hnsnetwork.go create mode 100644 vendor/github.com/Microsoft/hcsshim/hnspolicy.go create mode 100644 vendor/github.com/Microsoft/hcsshim/hnspolicylist.go create mode 100644 vendor/github.com/Microsoft/hcsshim/hnssupport.go create mode 100644 vendor/github.com/Microsoft/hcsshim/interface.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/hcs/cgo.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/hcs/utils.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/hcserror/hcserror.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/hns/hns.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/hns/hnsglobals.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicylist.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/hns/hnssupport.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/hns/namespace.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/hns/zsyscall_windows.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/interop/zsyscall_windows.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/longpath/longpath.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/mergemaps/merge.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/safefile/safeopen.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/safefile/zsyscall_windows.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/battery.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/chipset.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/container_credential_guard_state.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/device.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_connection.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_connection_info.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_state.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_service_config.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_system_config.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/keyboard.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_2.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/modify_setting_request.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/mouse.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9_share.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/restore_state.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/save_options.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/scsi.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/storage.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_machine.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_controller.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/timeout/timeout.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/wclayer/activatelayer.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/wclayer/baselayer.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/wclayer/createlayer.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/wclayer/createscratchlayer.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/wclayer/deactivatelayer.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/wclayer/destroylayer.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/wclayer/exportlayer.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/wclayer/getlayermountpath.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/wclayer/getsharedbaseimages.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/wclayer/grantvmaccess.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/wclayer/importlayer.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerexists.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/wclayer/legacy.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/wclayer/preparelayer.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/wclayer/processimage.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/wclayer/unpreparelayer.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go create mode 100644 vendor/github.com/Microsoft/hcsshim/layer.go create mode 100644 vendor/github.com/Microsoft/hcsshim/mksyscall_windows.go create mode 100644 vendor/github.com/Microsoft/hcsshim/pkg/go-runhcs/LICENSE create mode 100644 vendor/github.com/Microsoft/hcsshim/pkg/go-runhcs/NOTICE create mode 100644 vendor/github.com/Microsoft/hcsshim/process.go create mode 100644 vendor/github.com/Microsoft/hcsshim/zsyscall_windows.go create mode 100644 vendor/github.com/containerd/console/LICENSE create mode 100644 vendor/github.com/containerd/console/console.go create mode 100644 vendor/github.com/containerd/console/console_linux.go create mode 100644 vendor/github.com/containerd/console/console_unix.go create mode 100644 vendor/github.com/containerd/console/console_windows.go create mode 100644 vendor/github.com/containerd/console/tc_darwin.go create mode 100644 vendor/github.com/containerd/console/tc_freebsd.go create mode 100644 vendor/github.com/containerd/console/tc_linux.go create mode 100644 vendor/github.com/containerd/console/tc_openbsd_cgo.go create mode 100644 vendor/github.com/containerd/console/tc_openbsd_nocgo.go create mode 100644 vendor/github.com/containerd/console/tc_solaris_cgo.go create mode 100644 vendor/github.com/containerd/console/tc_solaris_nocgo.go create mode 100644 vendor/github.com/containerd/console/tc_unix.go create mode 100644 vendor/github.com/containerd/containerd/LICENSE create mode 100644 vendor/github.com/containerd/containerd/NOTICE create mode 100644 vendor/github.com/containerd/containerd/api/events/container.pb.go create mode 100644 vendor/github.com/containerd/containerd/api/events/content.pb.go create mode 100644 vendor/github.com/containerd/containerd/api/events/doc.go create mode 100644 vendor/github.com/containerd/containerd/api/events/image.pb.go create mode 100644 vendor/github.com/containerd/containerd/api/events/namespace.pb.go create mode 100644 vendor/github.com/containerd/containerd/api/events/snapshot.pb.go create mode 100644 vendor/github.com/containerd/containerd/api/events/task.pb.go create mode 100644 vendor/github.com/containerd/containerd/api/types/descriptor.pb.go create mode 100644 vendor/github.com/containerd/containerd/api/types/doc.go create mode 100644 vendor/github.com/containerd/containerd/api/types/metrics.pb.go create mode 100644 vendor/github.com/containerd/containerd/api/types/mount.pb.go create mode 100644 vendor/github.com/containerd/containerd/api/types/platform.pb.go create mode 100644 vendor/github.com/containerd/containerd/api/types/task/task.pb.go create mode 100644 vendor/github.com/containerd/containerd/errdefs/errors.go create mode 100644 vendor/github.com/containerd/containerd/errdefs/grpc.go create mode 100644 vendor/github.com/containerd/containerd/events/events.go create mode 100644 vendor/github.com/containerd/containerd/log/context.go create mode 100644 vendor/github.com/containerd/containerd/mount/lookup_unix.go create mode 100644 vendor/github.com/containerd/containerd/mount/lookup_unsupported.go create mode 100644 vendor/github.com/containerd/containerd/mount/mount.go create mode 100644 vendor/github.com/containerd/containerd/mount/mount_linux.go create mode 100644 vendor/github.com/containerd/containerd/mount/mount_unix.go create mode 100644 vendor/github.com/containerd/containerd/mount/mount_windows.go create mode 100644 vendor/github.com/containerd/containerd/mount/mountinfo.go create mode 100644 vendor/github.com/containerd/containerd/mount/mountinfo_freebsd.go create mode 100644 vendor/github.com/containerd/containerd/mount/mountinfo_linux.go create mode 100644 vendor/github.com/containerd/containerd/mount/mountinfo_unsupported.go create mode 100644 vendor/github.com/containerd/containerd/mount/temp.go create mode 100644 vendor/github.com/containerd/containerd/mount/temp_unix.go create mode 100644 vendor/github.com/containerd/containerd/mount/temp_unsupported.go create mode 100644 vendor/github.com/containerd/containerd/namespaces/context.go create mode 100644 vendor/github.com/containerd/containerd/namespaces/grpc.go create mode 100644 vendor/github.com/containerd/containerd/namespaces/store.go create mode 100644 vendor/github.com/containerd/containerd/namespaces/validate.go create mode 100644 vendor/github.com/containerd/containerd/runtime/events.go create mode 100644 vendor/github.com/containerd/containerd/runtime/monitor.go create mode 100644 vendor/github.com/containerd/containerd/runtime/runtime.go create mode 100644 vendor/github.com/containerd/containerd/runtime/task.go create mode 100644 vendor/github.com/containerd/containerd/runtime/task_list.go create mode 100644 vendor/github.com/containerd/containerd/runtime/typeurl.go create mode 100644 vendor/github.com/containerd/containerd/runtime/v2/shim/reaper_unix.go create mode 100644 vendor/github.com/containerd/containerd/runtime/v2/shim/shim.go create mode 100644 vendor/github.com/containerd/containerd/runtime/v2/shim/shim_darwin.go create mode 100644 vendor/github.com/containerd/containerd/runtime/v2/shim/shim_linux.go create mode 100644 vendor/github.com/containerd/containerd/runtime/v2/shim/shim_unix.go create mode 100644 vendor/github.com/containerd/containerd/runtime/v2/shim/shim_windows.go create mode 100644 vendor/github.com/containerd/containerd/runtime/v2/shim/util.go create mode 100644 vendor/github.com/containerd/containerd/runtime/v2/shim/util_unix.go create mode 100644 vendor/github.com/containerd/containerd/runtime/v2/shim/util_windows.go create mode 100644 vendor/github.com/containerd/containerd/runtime/v2/task/doc.go create mode 100644 vendor/github.com/containerd/containerd/runtime/v2/task/shim.pb.go create mode 100644 vendor/github.com/containerd/containerd/sys/env.go create mode 100644 vendor/github.com/containerd/containerd/sys/epoll.go create mode 100644 vendor/github.com/containerd/containerd/sys/fds.go create mode 100644 vendor/github.com/containerd/containerd/sys/filesys_unix.go create mode 100644 vendor/github.com/containerd/containerd/sys/filesys_windows.go create mode 100644 vendor/github.com/containerd/containerd/sys/mount_linux.go create mode 100644 vendor/github.com/containerd/containerd/sys/oom_unix.go create mode 100644 vendor/github.com/containerd/containerd/sys/oom_windows.go create mode 100644 vendor/github.com/containerd/containerd/sys/proc.go create mode 100644 vendor/github.com/containerd/containerd/sys/reaper.go create mode 100644 vendor/github.com/containerd/containerd/sys/reaper_linux.go create mode 100644 vendor/github.com/containerd/containerd/sys/socket_unix.go create mode 100644 vendor/github.com/containerd/containerd/sys/socket_windows.go create mode 100644 vendor/github.com/containerd/containerd/sys/stat_bsd.go create mode 100644 vendor/github.com/containerd/containerd/sys/stat_unix.go create mode 100644 vendor/github.com/containerd/containerd/sys/subprocess_unsafe_linux.go create mode 100644 vendor/github.com/containerd/containerd/sys/subprocess_unsafe_linux.s create mode 100644 vendor/github.com/containerd/fifo/LICENSE create mode 100644 vendor/github.com/containerd/fifo/fifo.go create mode 100644 vendor/github.com/containerd/fifo/handle_linux.go create mode 100644 vendor/github.com/containerd/fifo/handle_nolinux.go create mode 100644 vendor/github.com/containerd/fifo/mkfifo_nosolaris.go create mode 100644 vendor/github.com/containerd/fifo/mkfifo_solaris.go create mode 100644 vendor/github.com/containerd/go-runc/LICENSE create mode 100644 vendor/github.com/containerd/go-runc/command_linux.go create mode 100644 vendor/github.com/containerd/go-runc/command_other.go create mode 100644 vendor/github.com/containerd/go-runc/console.go create mode 100644 vendor/github.com/containerd/go-runc/container.go create mode 100644 vendor/github.com/containerd/go-runc/events.go create mode 100644 vendor/github.com/containerd/go-runc/io.go create mode 100644 vendor/github.com/containerd/go-runc/io_unix.go create mode 100644 vendor/github.com/containerd/go-runc/io_windows.go create mode 100644 vendor/github.com/containerd/go-runc/monitor.go create mode 100644 vendor/github.com/containerd/go-runc/runc.go create mode 100644 vendor/github.com/containerd/go-runc/utils.go create mode 100644 vendor/github.com/containerd/ttrpc/LICENSE create mode 100644 vendor/github.com/containerd/ttrpc/channel.go create mode 100644 vendor/github.com/containerd/ttrpc/client.go create mode 100644 vendor/github.com/containerd/ttrpc/codec.go create mode 100644 vendor/github.com/containerd/ttrpc/config.go create mode 100644 vendor/github.com/containerd/ttrpc/handshake.go create mode 100644 vendor/github.com/containerd/ttrpc/server.go create mode 100644 vendor/github.com/containerd/ttrpc/services.go create mode 100644 vendor/github.com/containerd/ttrpc/types.go create mode 100644 vendor/github.com/containerd/ttrpc/unixcreds_linux.go create mode 100644 vendor/github.com/containerd/typeurl/LICENSE create mode 100644 vendor/github.com/containerd/typeurl/types.go create mode 100644 vendor/github.com/opencontainers/go-digest/LICENSE.code create mode 100644 vendor/github.com/opencontainers/go-digest/LICENSE.docs create mode 100644 vendor/github.com/opencontainers/go-digest/algorithm.go create mode 100644 vendor/github.com/opencontainers/go-digest/digest.go create mode 100644 vendor/github.com/opencontainers/go-digest/digester.go create mode 100644 vendor/github.com/opencontainers/go-digest/doc.go create mode 100644 vendor/github.com/opencontainers/go-digest/verifiers.go create mode 100644 vendor/github.com/opencontainers/runc/libcontainer/system/linux.go create mode 100644 vendor/github.com/opencontainers/runc/libcontainer/system/proc.go create mode 100644 vendor/github.com/opencontainers/runc/libcontainer/system/syscall_linux_386.go create mode 100644 vendor/github.com/opencontainers/runc/libcontainer/system/syscall_linux_64.go create mode 100644 vendor/github.com/opencontainers/runc/libcontainer/system/syscall_linux_arm.go create mode 100644 vendor/github.com/opencontainers/runc/libcontainer/system/sysconfig.go create mode 100644 vendor/github.com/opencontainers/runc/libcontainer/system/sysconfig_notcgo.go create mode 100644 vendor/github.com/opencontainers/runc/libcontainer/system/unsupported.go create mode 100644 vendor/github.com/opencontainers/runc/libcontainer/system/xattrs_linux.go diff --git a/Gopkg.lock b/Gopkg.lock index db8ef77463..1f6eaa7434 100644 --- a/Gopkg.lock +++ b/Gopkg.lock @@ -9,6 +9,37 @@ revision = "b26d9c308763d68093482582cea63d69be07a0f0" version = "v0.3.0" +[[projects]] + digest = "1:2be791e7b333ff7c06f8fb3dc18a7d70580e9399dbdffd352621d067ff260b6e" + name = "github.com/Microsoft/go-winio" + packages = ["."] + pruneopts = "NUT" + revision = "97e4973ce50b2ff5f09635a57e2b88a037aae829" + version = "v0.4.11" + +[[projects]] + digest = "1:46df22fa970c4b4384851338ada3a67f32d1c1400d27aa69b09e493dd01bb8bf" + name = "github.com/Microsoft/hcsshim" + packages = [ + ".", + "internal/guestrequest", + "internal/guid", + "internal/hcs", + "internal/hcserror", + "internal/hns", + "internal/interop", + "internal/longpath", + "internal/mergemaps", + "internal/safefile", + "internal/schema1", + "internal/schema2", + "internal/timeout", + "internal/wclayer", + ] + pruneopts = "NUT" + revision = "4f64a598035b09da04155f7dfd76b63edf04fca1" + version = "v0.8.1" + [[projects]] digest = "1:3ac89be767202cf44b33eec1b41b3c6255ec1c79d893304ff621cceada4e53d0" name = "github.com/clearcontainers/proxy" @@ -35,6 +66,34 @@ pruneopts = "NUT" revision = "5017d4e9a9cf2d4381db99eacd9baf84b95bfb14" +[[projects]] + branch = "master" + digest = "1:da4daad2ec1737eec4ebeeed7afedb631711f96bbac0c361a17a4d0369d00c6d" + name = "github.com/containerd/console" + packages = ["."] + pruneopts = "NUT" + revision = "0650fd9eeb50bab4fc99dceb9f2e14cf58f36e7f" + +[[projects]] + digest = "1:d9120dea4d91818f1c859242cb96825faf6d375a4e0231263ecaec5905143757" + name = "github.com/containerd/containerd" + packages = [ + "api/events", + "api/types", + "api/types/task", + "errdefs", + "events", + "log", + "mount", + "namespaces", + "runtime", + "runtime/v2/shim", + "runtime/v2/task", + "sys", + ] + pruneopts = "NUT" + revision = "29eab28b8e4e18231b6b2f077ab653c719d25dd5" + [[projects]] digest = "1:3d1a50e9f27c661df8c5552e7f2f6b9d2a8b641c65aeac7373f8a5c60d9f6856" name = "github.com/containerd/cri-containerd" @@ -42,6 +101,38 @@ pruneopts = "NUT" revision = "3d382e2f5dabe3bae62ceb9ded56bdee847008ee" +[[projects]] + branch = "master" + digest = "1:a16d601cf7295c29ccc3e7711be788bca1376e1f22e0826929f8883ed36c7c99" + name = "github.com/containerd/fifo" + packages = ["."] + pruneopts = "NUT" + revision = "3d5202aec260678c48179c56f40e6f38a095738c" + +[[projects]] + branch = "master" + digest = "1:4455e7f226d40cb6e52bb570cc246e667cdfc6370ec2e8c3b6d5b8993ad38eeb" + name = "github.com/containerd/go-runc" + packages = ["."] + pruneopts = "NUT" + revision = "5a6d9f37cfa36b15efba46dc7ea349fa9b7143c3" + +[[projects]] + branch = "master" + digest = "1:1b7f9015632851c458c7b713d1a29c9d763c5a2bd85c4e3731139e198b2df2c8" + name = "github.com/containerd/ttrpc" + packages = ["."] + pruneopts = "NUT" + revision = "f51df4475b76e0ab0315ee0684bef0703a070e6b" + +[[projects]] + branch = "master" + digest = "1:07ac073876dbf7df80789ba4c2959a969200b34875a34fc13848f76d60b51551" + name = "github.com/containerd/typeurl" + packages = ["."] + pruneopts = "NUT" + revision = "461401dc8f19d80baa4b70178935e4501286c00b" + [[projects]] digest = "1:827ed8a74e55981880c4d77f8472d638bceb899188104ba7bf24a9548fd97292" name = "github.com/containernetworking/cni" @@ -186,12 +277,21 @@ revision = "d0303fe809921458f417bcf828397a65db30a7e4" [[projects]] - digest = "1:7876a956f7aa42e9830566efbe4278e2963ae0c723b472a0dba27d5fffd066ab" + digest = "1:e0cc8395ea893c898ff5eb0850f4d9851c1f57c78c232304a026379a47a552d0" + name = "github.com/opencontainers/go-digest" + packages = ["."] + pruneopts = "NUT" + revision = "279bed98673dd5bef374d3b6e4b09e2af76183bf" + version = "v1.0.0-rc1" + +[[projects]] + digest = "1:26537bc93f1e164bbc305117029de9933656ff81c4549609939212aca20a4710" name = "github.com/opencontainers/runc" packages = [ "libcontainer/configs", "libcontainer/seccomp", "libcontainer/specconv", + "libcontainer/system", "libcontainer/utils", ] pruneopts = "NUT" @@ -424,7 +524,18 @@ "github.com/clearcontainers/proxy/api", "github.com/clearcontainers/proxy/client", "github.com/containerd/cgroups", + "github.com/containerd/containerd/api/events", + "github.com/containerd/containerd/api/types/task", + "github.com/containerd/containerd/errdefs", + "github.com/containerd/containerd/events", + "github.com/containerd/containerd/mount", + "github.com/containerd/containerd/namespaces", + "github.com/containerd/containerd/runtime", + "github.com/containerd/containerd/runtime/v2/shim", + "github.com/containerd/containerd/runtime/v2/task", "github.com/containerd/cri-containerd/pkg/annotations", + "github.com/containerd/fifo", + "github.com/containerd/typeurl", "github.com/containernetworking/plugins/pkg/ns", "github.com/dlespiau/covertool/pkg/cover", "github.com/docker/go-units", @@ -443,6 +554,7 @@ "github.com/opencontainers/runtime-spec/specs-go", "github.com/opentracing/opentracing-go", "github.com/opentracing/opentracing-go/log", + "github.com/pkg/errors", "github.com/safchain/ethtool", "github.com/sirupsen/logrus", "github.com/sirupsen/logrus/hooks/syslog", diff --git a/Gopkg.toml b/Gopkg.toml index bc8c70752f..10115f9a5b 100644 --- a/Gopkg.toml +++ b/Gopkg.toml @@ -66,6 +66,10 @@ name = "github.com/safchain/ethtool" revision = "79559b488d8848b53a8e34c330140c3fc37ee246" +[[constraint]] + name = "github.com/containerd/containerd" + revision = "29eab28b8e4e18231b6b2f077ab653c719d25dd5" + [[override]] branch = "master" name = "github.com/hashicorp/yamux" diff --git a/vendor/github.com/Microsoft/go-winio/LICENSE b/vendor/github.com/Microsoft/go-winio/LICENSE new file mode 100644 index 0000000000..b8b569d774 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/LICENSE @@ -0,0 +1,22 @@ +The MIT License (MIT) + +Copyright (c) 2015 Microsoft + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. + diff --git a/vendor/github.com/Microsoft/go-winio/archive/tar/LICENSE b/vendor/github.com/Microsoft/go-winio/archive/tar/LICENSE new file mode 100644 index 0000000000..7448756763 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/archive/tar/LICENSE @@ -0,0 +1,27 @@ +Copyright (c) 2012 The Go Authors. All rights reserved. + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions are +met: + + * Redistributions of source code must retain the above copyright +notice, this list of conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above +copyright notice, this list of conditions and the following disclaimer +in the documentation and/or other materials provided with the +distribution. + * Neither the name of Google Inc. nor the names of its +contributors may be used to endorse or promote products derived from +this software without specific prior written permission. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +"AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/vendor/github.com/Microsoft/go-winio/backup.go b/vendor/github.com/Microsoft/go-winio/backup.go new file mode 100644 index 0000000000..2be34af431 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/backup.go @@ -0,0 +1,280 @@ +// +build windows + +package winio + +import ( + "encoding/binary" + "errors" + "fmt" + "io" + "io/ioutil" + "os" + "runtime" + "syscall" + "unicode/utf16" +) + +//sys backupRead(h syscall.Handle, b []byte, bytesRead *uint32, abort bool, processSecurity bool, context *uintptr) (err error) = BackupRead +//sys backupWrite(h syscall.Handle, b []byte, bytesWritten *uint32, abort bool, processSecurity bool, context *uintptr) (err error) = BackupWrite + +const ( + BackupData = uint32(iota + 1) + BackupEaData + BackupSecurity + BackupAlternateData + BackupLink + BackupPropertyData + BackupObjectId + BackupReparseData + BackupSparseBlock + BackupTxfsData +) + +const ( + StreamSparseAttributes = uint32(8) +) + +const ( + WRITE_DAC = 0x40000 + WRITE_OWNER = 0x80000 + ACCESS_SYSTEM_SECURITY = 0x1000000 +) + +// BackupHeader represents a backup stream of a file. +type BackupHeader struct { + Id uint32 // The backup stream ID + Attributes uint32 // Stream attributes + Size int64 // The size of the stream in bytes + Name string // The name of the stream (for BackupAlternateData only). + Offset int64 // The offset of the stream in the file (for BackupSparseBlock only). +} + +type win32StreamId struct { + StreamId uint32 + Attributes uint32 + Size uint64 + NameSize uint32 +} + +// BackupStreamReader reads from a stream produced by the BackupRead Win32 API and produces a series +// of BackupHeader values. +type BackupStreamReader struct { + r io.Reader + bytesLeft int64 +} + +// NewBackupStreamReader produces a BackupStreamReader from any io.Reader. +func NewBackupStreamReader(r io.Reader) *BackupStreamReader { + return &BackupStreamReader{r, 0} +} + +// Next returns the next backup stream and prepares for calls to Read(). It skips the remainder of the current stream if +// it was not completely read. +func (r *BackupStreamReader) Next() (*BackupHeader, error) { + if r.bytesLeft > 0 { + if s, ok := r.r.(io.Seeker); ok { + // Make sure Seek on io.SeekCurrent sometimes succeeds + // before trying the actual seek. + if _, err := s.Seek(0, io.SeekCurrent); err == nil { + if _, err = s.Seek(r.bytesLeft, io.SeekCurrent); err != nil { + return nil, err + } + r.bytesLeft = 0 + } + } + if _, err := io.Copy(ioutil.Discard, r); err != nil { + return nil, err + } + } + var wsi win32StreamId + if err := binary.Read(r.r, binary.LittleEndian, &wsi); err != nil { + return nil, err + } + hdr := &BackupHeader{ + Id: wsi.StreamId, + Attributes: wsi.Attributes, + Size: int64(wsi.Size), + } + if wsi.NameSize != 0 { + name := make([]uint16, int(wsi.NameSize/2)) + if err := binary.Read(r.r, binary.LittleEndian, name); err != nil { + return nil, err + } + hdr.Name = syscall.UTF16ToString(name) + } + if wsi.StreamId == BackupSparseBlock { + if err := binary.Read(r.r, binary.LittleEndian, &hdr.Offset); err != nil { + return nil, err + } + hdr.Size -= 8 + } + r.bytesLeft = hdr.Size + return hdr, nil +} + +// Read reads from the current backup stream. +func (r *BackupStreamReader) Read(b []byte) (int, error) { + if r.bytesLeft == 0 { + return 0, io.EOF + } + if int64(len(b)) > r.bytesLeft { + b = b[:r.bytesLeft] + } + n, err := r.r.Read(b) + r.bytesLeft -= int64(n) + if err == io.EOF { + err = io.ErrUnexpectedEOF + } else if r.bytesLeft == 0 && err == nil { + err = io.EOF + } + return n, err +} + +// BackupStreamWriter writes a stream compatible with the BackupWrite Win32 API. +type BackupStreamWriter struct { + w io.Writer + bytesLeft int64 +} + +// NewBackupStreamWriter produces a BackupStreamWriter on top of an io.Writer. +func NewBackupStreamWriter(w io.Writer) *BackupStreamWriter { + return &BackupStreamWriter{w, 0} +} + +// WriteHeader writes the next backup stream header and prepares for calls to Write(). +func (w *BackupStreamWriter) WriteHeader(hdr *BackupHeader) error { + if w.bytesLeft != 0 { + return fmt.Errorf("missing %d bytes", w.bytesLeft) + } + name := utf16.Encode([]rune(hdr.Name)) + wsi := win32StreamId{ + StreamId: hdr.Id, + Attributes: hdr.Attributes, + Size: uint64(hdr.Size), + NameSize: uint32(len(name) * 2), + } + if hdr.Id == BackupSparseBlock { + // Include space for the int64 block offset + wsi.Size += 8 + } + if err := binary.Write(w.w, binary.LittleEndian, &wsi); err != nil { + return err + } + if len(name) != 0 { + if err := binary.Write(w.w, binary.LittleEndian, name); err != nil { + return err + } + } + if hdr.Id == BackupSparseBlock { + if err := binary.Write(w.w, binary.LittleEndian, hdr.Offset); err != nil { + return err + } + } + w.bytesLeft = hdr.Size + return nil +} + +// Write writes to the current backup stream. +func (w *BackupStreamWriter) Write(b []byte) (int, error) { + if w.bytesLeft < int64(len(b)) { + return 0, fmt.Errorf("too many bytes by %d", int64(len(b))-w.bytesLeft) + } + n, err := w.w.Write(b) + w.bytesLeft -= int64(n) + return n, err +} + +// BackupFileReader provides an io.ReadCloser interface on top of the BackupRead Win32 API. +type BackupFileReader struct { + f *os.File + includeSecurity bool + ctx uintptr +} + +// NewBackupFileReader returns a new BackupFileReader from a file handle. If includeSecurity is true, +// Read will attempt to read the security descriptor of the file. +func NewBackupFileReader(f *os.File, includeSecurity bool) *BackupFileReader { + r := &BackupFileReader{f, includeSecurity, 0} + return r +} + +// Read reads a backup stream from the file by calling the Win32 API BackupRead(). +func (r *BackupFileReader) Read(b []byte) (int, error) { + var bytesRead uint32 + err := backupRead(syscall.Handle(r.f.Fd()), b, &bytesRead, false, r.includeSecurity, &r.ctx) + if err != nil { + return 0, &os.PathError{"BackupRead", r.f.Name(), err} + } + runtime.KeepAlive(r.f) + if bytesRead == 0 { + return 0, io.EOF + } + return int(bytesRead), nil +} + +// Close frees Win32 resources associated with the BackupFileReader. It does not close +// the underlying file. +func (r *BackupFileReader) Close() error { + if r.ctx != 0 { + backupRead(syscall.Handle(r.f.Fd()), nil, nil, true, false, &r.ctx) + runtime.KeepAlive(r.f) + r.ctx = 0 + } + return nil +} + +// BackupFileWriter provides an io.WriteCloser interface on top of the BackupWrite Win32 API. +type BackupFileWriter struct { + f *os.File + includeSecurity bool + ctx uintptr +} + +// NewBackupFileWriter returns a new BackupFileWriter from a file handle. If includeSecurity is true, +// Write() will attempt to restore the security descriptor from the stream. +func NewBackupFileWriter(f *os.File, includeSecurity bool) *BackupFileWriter { + w := &BackupFileWriter{f, includeSecurity, 0} + return w +} + +// Write restores a portion of the file using the provided backup stream. +func (w *BackupFileWriter) Write(b []byte) (int, error) { + var bytesWritten uint32 + err := backupWrite(syscall.Handle(w.f.Fd()), b, &bytesWritten, false, w.includeSecurity, &w.ctx) + if err != nil { + return 0, &os.PathError{"BackupWrite", w.f.Name(), err} + } + runtime.KeepAlive(w.f) + if int(bytesWritten) != len(b) { + return int(bytesWritten), errors.New("not all bytes could be written") + } + return len(b), nil +} + +// Close frees Win32 resources associated with the BackupFileWriter. It does not +// close the underlying file. +func (w *BackupFileWriter) Close() error { + if w.ctx != 0 { + backupWrite(syscall.Handle(w.f.Fd()), nil, nil, true, false, &w.ctx) + runtime.KeepAlive(w.f) + w.ctx = 0 + } + return nil +} + +// OpenForBackup opens a file or directory, potentially skipping access checks if the backup +// or restore privileges have been acquired. +// +// If the file opened was a directory, it cannot be used with Readdir(). +func OpenForBackup(path string, access uint32, share uint32, createmode uint32) (*os.File, error) { + winPath, err := syscall.UTF16FromString(path) + if err != nil { + return nil, err + } + h, err := syscall.CreateFile(&winPath[0], access, share, nil, createmode, syscall.FILE_FLAG_BACKUP_SEMANTICS|syscall.FILE_FLAG_OPEN_REPARSE_POINT, 0) + if err != nil { + err = &os.PathError{Op: "open", Path: path, Err: err} + return nil, err + } + return os.NewFile(uintptr(h), path), nil +} diff --git a/vendor/github.com/Microsoft/go-winio/ea.go b/vendor/github.com/Microsoft/go-winio/ea.go new file mode 100644 index 0000000000..4051c1b33b --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/ea.go @@ -0,0 +1,137 @@ +package winio + +import ( + "bytes" + "encoding/binary" + "errors" +) + +type fileFullEaInformation struct { + NextEntryOffset uint32 + Flags uint8 + NameLength uint8 + ValueLength uint16 +} + +var ( + fileFullEaInformationSize = binary.Size(&fileFullEaInformation{}) + + errInvalidEaBuffer = errors.New("invalid extended attribute buffer") + errEaNameTooLarge = errors.New("extended attribute name too large") + errEaValueTooLarge = errors.New("extended attribute value too large") +) + +// ExtendedAttribute represents a single Windows EA. +type ExtendedAttribute struct { + Name string + Value []byte + Flags uint8 +} + +func parseEa(b []byte) (ea ExtendedAttribute, nb []byte, err error) { + var info fileFullEaInformation + err = binary.Read(bytes.NewReader(b), binary.LittleEndian, &info) + if err != nil { + err = errInvalidEaBuffer + return + } + + nameOffset := fileFullEaInformationSize + nameLen := int(info.NameLength) + valueOffset := nameOffset + int(info.NameLength) + 1 + valueLen := int(info.ValueLength) + nextOffset := int(info.NextEntryOffset) + if valueLen+valueOffset > len(b) || nextOffset < 0 || nextOffset > len(b) { + err = errInvalidEaBuffer + return + } + + ea.Name = string(b[nameOffset : nameOffset+nameLen]) + ea.Value = b[valueOffset : valueOffset+valueLen] + ea.Flags = info.Flags + if info.NextEntryOffset != 0 { + nb = b[info.NextEntryOffset:] + } + return +} + +// DecodeExtendedAttributes decodes a list of EAs from a FILE_FULL_EA_INFORMATION +// buffer retrieved from BackupRead, ZwQueryEaFile, etc. +func DecodeExtendedAttributes(b []byte) (eas []ExtendedAttribute, err error) { + for len(b) != 0 { + ea, nb, err := parseEa(b) + if err != nil { + return nil, err + } + + eas = append(eas, ea) + b = nb + } + return +} + +func writeEa(buf *bytes.Buffer, ea *ExtendedAttribute, last bool) error { + if int(uint8(len(ea.Name))) != len(ea.Name) { + return errEaNameTooLarge + } + if int(uint16(len(ea.Value))) != len(ea.Value) { + return errEaValueTooLarge + } + entrySize := uint32(fileFullEaInformationSize + len(ea.Name) + 1 + len(ea.Value)) + withPadding := (entrySize + 3) &^ 3 + nextOffset := uint32(0) + if !last { + nextOffset = withPadding + } + info := fileFullEaInformation{ + NextEntryOffset: nextOffset, + Flags: ea.Flags, + NameLength: uint8(len(ea.Name)), + ValueLength: uint16(len(ea.Value)), + } + + err := binary.Write(buf, binary.LittleEndian, &info) + if err != nil { + return err + } + + _, err = buf.Write([]byte(ea.Name)) + if err != nil { + return err + } + + err = buf.WriteByte(0) + if err != nil { + return err + } + + _, err = buf.Write(ea.Value) + if err != nil { + return err + } + + _, err = buf.Write([]byte{0, 0, 0}[0 : withPadding-entrySize]) + if err != nil { + return err + } + + return nil +} + +// EncodeExtendedAttributes encodes a list of EAs into a FILE_FULL_EA_INFORMATION +// buffer for use with BackupWrite, ZwSetEaFile, etc. +func EncodeExtendedAttributes(eas []ExtendedAttribute) ([]byte, error) { + var buf bytes.Buffer + for i := range eas { + last := false + if i == len(eas)-1 { + last = true + } + + err := writeEa(&buf, &eas[i], last) + if err != nil { + return nil, err + } + } + return buf.Bytes(), nil +} diff --git a/vendor/github.com/Microsoft/go-winio/file.go b/vendor/github.com/Microsoft/go-winio/file.go new file mode 100644 index 0000000000..4334ff1cbe --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/file.go @@ -0,0 +1,307 @@ +// +build windows + +package winio + +import ( + "errors" + "io" + "runtime" + "sync" + "sync/atomic" + "syscall" + "time" +) + +//sys cancelIoEx(file syscall.Handle, o *syscall.Overlapped) (err error) = CancelIoEx +//sys createIoCompletionPort(file syscall.Handle, port syscall.Handle, key uintptr, threadCount uint32) (newport syscall.Handle, err error) = CreateIoCompletionPort +//sys getQueuedCompletionStatus(port syscall.Handle, bytes *uint32, key *uintptr, o **ioOperation, timeout uint32) (err error) = GetQueuedCompletionStatus +//sys setFileCompletionNotificationModes(h syscall.Handle, flags uint8) (err error) = SetFileCompletionNotificationModes + +type atomicBool int32 + +func (b *atomicBool) isSet() bool { return atomic.LoadInt32((*int32)(b)) != 0 } +func (b *atomicBool) setFalse() { atomic.StoreInt32((*int32)(b), 0) } +func (b *atomicBool) setTrue() { atomic.StoreInt32((*int32)(b), 1) } +func (b *atomicBool) swap(new bool) bool { + var newInt int32 + if new { + newInt = 1 + } + return atomic.SwapInt32((*int32)(b), newInt) == 1 +} + +const ( + cFILE_SKIP_COMPLETION_PORT_ON_SUCCESS = 1 + cFILE_SKIP_SET_EVENT_ON_HANDLE = 2 +) + +var ( + ErrFileClosed = errors.New("file has already been closed") + ErrTimeout = &timeoutError{} +) + +type timeoutError struct{} + +func (e *timeoutError) Error() string { return "i/o timeout" } +func (e *timeoutError) Timeout() bool { return true } +func (e *timeoutError) Temporary() bool { return true } + +type timeoutChan chan struct{} + +var ioInitOnce sync.Once +var ioCompletionPort syscall.Handle + +// ioResult contains the result of an asynchronous IO operation +type ioResult struct { + bytes uint32 + err error +} + +// ioOperation represents an outstanding asynchronous Win32 IO +type ioOperation struct { + o syscall.Overlapped + ch chan ioResult +} + +func initIo() { + h, err := createIoCompletionPort(syscall.InvalidHandle, 0, 0, 0xffffffff) + if err != nil { + panic(err) + } + ioCompletionPort = h + go ioCompletionProcessor(h) +} + +// win32File implements Reader, Writer, and Closer on a Win32 handle without blocking in a syscall. +// It takes ownership of this handle and will close it if it is garbage collected. +type win32File struct { + handle syscall.Handle + wg sync.WaitGroup + wgLock sync.RWMutex + closing atomicBool + readDeadline deadlineHandler + writeDeadline deadlineHandler +} + +type deadlineHandler struct { + setLock sync.Mutex + channel timeoutChan + channelLock sync.RWMutex + timer *time.Timer + timedout atomicBool +} + +// makeWin32File makes a new win32File from an existing file handle +func makeWin32File(h syscall.Handle) (*win32File, error) { + f := &win32File{handle: h} + ioInitOnce.Do(initIo) + _, err := createIoCompletionPort(h, ioCompletionPort, 0, 0xffffffff) + if err != nil { + return nil, err + } + err = setFileCompletionNotificationModes(h, cFILE_SKIP_COMPLETION_PORT_ON_SUCCESS|cFILE_SKIP_SET_EVENT_ON_HANDLE) + if err != nil { + return nil, err + } + f.readDeadline.channel = make(timeoutChan) + f.writeDeadline.channel = make(timeoutChan) + return f, nil +} + +func MakeOpenFile(h syscall.Handle) (io.ReadWriteCloser, error) { + return makeWin32File(h) +} + +// closeHandle closes the resources associated with a Win32 handle +func (f *win32File) closeHandle() { + f.wgLock.Lock() + // Atomically set that we are closing, releasing the resources only once. + if !f.closing.swap(true) { + f.wgLock.Unlock() + // cancel all IO and wait for it to complete + cancelIoEx(f.handle, nil) + f.wg.Wait() + // at this point, no new IO can start + syscall.Close(f.handle) + f.handle = 0 + } else { + f.wgLock.Unlock() + } +} + +// Close closes a win32File. +func (f *win32File) Close() error { + f.closeHandle() + return nil +} + +// prepareIo prepares for a new IO operation. +// The caller must call f.wg.Done() when the IO is finished, prior to Close() returning. +func (f *win32File) prepareIo() (*ioOperation, error) { + f.wgLock.RLock() + if f.closing.isSet() { + f.wgLock.RUnlock() + return nil, ErrFileClosed + } + f.wg.Add(1) + f.wgLock.RUnlock() + c := &ioOperation{} + c.ch = make(chan ioResult) + return c, nil +} + +// ioCompletionProcessor processes completed async IOs forever +func ioCompletionProcessor(h syscall.Handle) { + for { + var bytes uint32 + var key uintptr + var op *ioOperation + err := getQueuedCompletionStatus(h, &bytes, &key, &op, syscall.INFINITE) + if op == nil { + panic(err) + } + op.ch <- ioResult{bytes, err} + } +} + +// asyncIo processes the return value from ReadFile or WriteFile, blocking until +// the operation has actually completed. +func (f *win32File) asyncIo(c *ioOperation, d *deadlineHandler, bytes uint32, err error) (int, error) { + if err != syscall.ERROR_IO_PENDING { + return int(bytes), err + } + + if f.closing.isSet() { + cancelIoEx(f.handle, &c.o) + } + + var timeout timeoutChan + if d != nil { + d.channelLock.Lock() + timeout = d.channel + d.channelLock.Unlock() + } + + var r ioResult + select { + case r = <-c.ch: + err = r.err + if err == syscall.ERROR_OPERATION_ABORTED { + if f.closing.isSet() { + err = ErrFileClosed + } + } + case <-timeout: + cancelIoEx(f.handle, &c.o) + r = <-c.ch + err = r.err + if err == syscall.ERROR_OPERATION_ABORTED { + err = ErrTimeout + } + } + + // runtime.KeepAlive is needed, as c is passed via native + // code to ioCompletionProcessor, c must remain alive + // until the channel read is complete. + runtime.KeepAlive(c) + return int(r.bytes), err +} + +// Read reads from a file handle. +func (f *win32File) Read(b []byte) (int, error) { + c, err := f.prepareIo() + if err != nil { + return 0, err + } + defer f.wg.Done() + + if f.readDeadline.timedout.isSet() { + return 0, ErrTimeout + } + + var bytes uint32 + err = syscall.ReadFile(f.handle, b, &bytes, &c.o) + n, err := f.asyncIo(c, &f.readDeadline, bytes, err) + runtime.KeepAlive(b) + + // Handle EOF conditions. + if err == nil && n == 0 && len(b) != 0 { + return 0, io.EOF + } else if err == syscall.ERROR_BROKEN_PIPE { + return 0, io.EOF + } else { + return n, err + } +} + +// Write writes to a file handle. +func (f *win32File) Write(b []byte) (int, error) { + c, err := f.prepareIo() + if err != nil { + return 0, err + } + defer f.wg.Done() + + if f.writeDeadline.timedout.isSet() { + return 0, ErrTimeout + } + + var bytes uint32 + err = syscall.WriteFile(f.handle, b, &bytes, &c.o) + n, err := f.asyncIo(c, &f.writeDeadline, bytes, err) + runtime.KeepAlive(b) + return n, err +} + +func (f *win32File) SetReadDeadline(deadline time.Time) error { + return f.readDeadline.set(deadline) +} + +func (f *win32File) SetWriteDeadline(deadline time.Time) error { + return f.writeDeadline.set(deadline) +} + +func (f *win32File) Flush() error { + return syscall.FlushFileBuffers(f.handle) +} + +func (d *deadlineHandler) set(deadline time.Time) error { + d.setLock.Lock() + defer d.setLock.Unlock() + + if d.timer != nil { + if !d.timer.Stop() { + <-d.channel + } + d.timer = nil + } + d.timedout.setFalse() + + select { + case <-d.channel: + d.channelLock.Lock() + d.channel = make(chan struct{}) + d.channelLock.Unlock() + default: + } + + if deadline.IsZero() { + return nil + } + + timeoutIO := func() { + d.timedout.setTrue() + close(d.channel) + } + + now := time.Now() + duration := deadline.Sub(now) + if deadline.After(now) { + // Deadline is in the future, set a timer to wait + d.timer = time.AfterFunc(duration, timeoutIO) + } else { + // Deadline is in the past. Cancel all pending IO now. + timeoutIO() + } + return nil +} diff --git a/vendor/github.com/Microsoft/go-winio/fileinfo.go b/vendor/github.com/Microsoft/go-winio/fileinfo.go new file mode 100644 index 0000000000..ada2fbab63 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/fileinfo.go @@ -0,0 +1,61 @@ +// +build windows + +package winio + +import ( + "os" + "runtime" + "syscall" + "unsafe" +) + +//sys getFileInformationByHandleEx(h syscall.Handle, class uint32, buffer *byte, size uint32) (err error) = GetFileInformationByHandleEx +//sys setFileInformationByHandle(h syscall.Handle, class uint32, buffer *byte, size uint32) (err error) = SetFileInformationByHandle + +const ( + fileBasicInfo = 0 + fileIDInfo = 0x12 +) + +// FileBasicInfo contains file access time and file attributes information. +type FileBasicInfo struct { + CreationTime, LastAccessTime, LastWriteTime, ChangeTime syscall.Filetime + FileAttributes uint32 + pad uint32 // padding +} + +// GetFileBasicInfo retrieves times and attributes for a file. +func GetFileBasicInfo(f *os.File) (*FileBasicInfo, error) { + bi := &FileBasicInfo{} + if err := getFileInformationByHandleEx(syscall.Handle(f.Fd()), fileBasicInfo, (*byte)(unsafe.Pointer(bi)), uint32(unsafe.Sizeof(*bi))); err != nil { + return nil, &os.PathError{Op: "GetFileInformationByHandleEx", Path: f.Name(), Err: err} + } + runtime.KeepAlive(f) + return bi, nil +} + +// SetFileBasicInfo sets times and attributes for a file. +func SetFileBasicInfo(f *os.File, bi *FileBasicInfo) error { + if err := setFileInformationByHandle(syscall.Handle(f.Fd()), fileBasicInfo, (*byte)(unsafe.Pointer(bi)), uint32(unsafe.Sizeof(*bi))); err != nil { + return &os.PathError{Op: "SetFileInformationByHandle", Path: f.Name(), Err: err} + } + runtime.KeepAlive(f) + return nil +} + +// FileIDInfo contains the volume serial number and file ID for a file. This pair should be +// unique on a system. +type FileIDInfo struct { + VolumeSerialNumber uint64 + FileID [16]byte +} + +// GetFileID retrieves the unique (volume, file ID) pair for a file. +func GetFileID(f *os.File) (*FileIDInfo, error) { + fileID := &FileIDInfo{} + if err := getFileInformationByHandleEx(syscall.Handle(f.Fd()), fileIDInfo, (*byte)(unsafe.Pointer(fileID)), uint32(unsafe.Sizeof(*fileID))); err != nil { + return nil, &os.PathError{Op: "GetFileInformationByHandleEx", Path: f.Name(), Err: err} + } + runtime.KeepAlive(f) + return fileID, nil +} diff --git a/vendor/github.com/Microsoft/go-winio/pipe.go b/vendor/github.com/Microsoft/go-winio/pipe.go new file mode 100644 index 0000000000..d99eedb648 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/pipe.go @@ -0,0 +1,421 @@ +// +build windows + +package winio + +import ( + "errors" + "io" + "net" + "os" + "syscall" + "time" + "unsafe" +) + +//sys connectNamedPipe(pipe syscall.Handle, o *syscall.Overlapped) (err error) = ConnectNamedPipe +//sys createNamedPipe(name string, flags uint32, pipeMode uint32, maxInstances uint32, outSize uint32, inSize uint32, defaultTimeout uint32, sa *syscall.SecurityAttributes) (handle syscall.Handle, err error) [failretval==syscall.InvalidHandle] = CreateNamedPipeW +//sys createFile(name string, access uint32, mode uint32, sa *syscall.SecurityAttributes, createmode uint32, attrs uint32, templatefile syscall.Handle) (handle syscall.Handle, err error) [failretval==syscall.InvalidHandle] = CreateFileW +//sys getNamedPipeInfo(pipe syscall.Handle, flags *uint32, outSize *uint32, inSize *uint32, maxInstances *uint32) (err error) = GetNamedPipeInfo +//sys getNamedPipeHandleState(pipe syscall.Handle, state *uint32, curInstances *uint32, maxCollectionCount *uint32, collectDataTimeout *uint32, userName *uint16, maxUserNameSize uint32) (err error) = GetNamedPipeHandleStateW +//sys localAlloc(uFlags uint32, length uint32) (ptr uintptr) = LocalAlloc + +const ( + cERROR_PIPE_BUSY = syscall.Errno(231) + cERROR_NO_DATA = syscall.Errno(232) + cERROR_PIPE_CONNECTED = syscall.Errno(535) + cERROR_SEM_TIMEOUT = syscall.Errno(121) + + cPIPE_ACCESS_DUPLEX = 0x3 + cFILE_FLAG_FIRST_PIPE_INSTANCE = 0x80000 + cSECURITY_SQOS_PRESENT = 0x100000 + cSECURITY_ANONYMOUS = 0 + + cPIPE_REJECT_REMOTE_CLIENTS = 0x8 + + cPIPE_UNLIMITED_INSTANCES = 255 + + cNMPWAIT_USE_DEFAULT_WAIT = 0 + cNMPWAIT_NOWAIT = 1 + + cPIPE_TYPE_MESSAGE = 4 + + cPIPE_READMODE_MESSAGE = 2 +) + +var ( + // ErrPipeListenerClosed is returned for pipe operations on listeners that have been closed. + // This error should match net.errClosing since docker takes a dependency on its text. + ErrPipeListenerClosed = errors.New("use of closed network connection") + + errPipeWriteClosed = errors.New("pipe has been closed for write") +) + +type win32Pipe struct { + *win32File + path string +} + +type win32MessageBytePipe struct { + win32Pipe + writeClosed bool + readEOF bool +} + +type pipeAddress string + +func (f *win32Pipe) LocalAddr() net.Addr { + return pipeAddress(f.path) +} + +func (f *win32Pipe) RemoteAddr() net.Addr { + return pipeAddress(f.path) +} + +func (f *win32Pipe) SetDeadline(t time.Time) error { + f.SetReadDeadline(t) + f.SetWriteDeadline(t) + return nil +} + +// CloseWrite closes the write side of a message pipe in byte mode. +func (f *win32MessageBytePipe) CloseWrite() error { + if f.writeClosed { + return errPipeWriteClosed + } + err := f.win32File.Flush() + if err != nil { + return err + } + _, err = f.win32File.Write(nil) + if err != nil { + return err + } + f.writeClosed = true + return nil +} + +// Write writes bytes to a message pipe in byte mode. Zero-byte writes are ignored, since +// they are used to implement CloseWrite(). +func (f *win32MessageBytePipe) Write(b []byte) (int, error) { + if f.writeClosed { + return 0, errPipeWriteClosed + } + if len(b) == 0 { + return 0, nil + } + return f.win32File.Write(b) +} + +// Read reads bytes from a message pipe in byte mode. A read of a zero-byte message on a message +// mode pipe will return io.EOF, as will all subsequent reads. +func (f *win32MessageBytePipe) Read(b []byte) (int, error) { + if f.readEOF { + return 0, io.EOF + } + n, err := f.win32File.Read(b) + if err == io.EOF { + // If this was the result of a zero-byte read, then + // it is possible that the read was due to a zero-size + // message. Since we are simulating CloseWrite with a + // zero-byte message, ensure that all future Read() calls + // also return EOF. + f.readEOF = true + } else if err == syscall.ERROR_MORE_DATA { + // ERROR_MORE_DATA indicates that the pipe's read mode is message mode + // and the message still has more bytes. Treat this as a success, since + // this package presents all named pipes as byte streams. + err = nil + } + return n, err +} + +func (s pipeAddress) Network() string { + return "pipe" +} + +func (s pipeAddress) String() string { + return string(s) +} + +// DialPipe connects to a named pipe by path, timing out if the connection +// takes longer than the specified duration. If timeout is nil, then we use +// a default timeout of 5 seconds. (We do not use WaitNamedPipe.) +func DialPipe(path string, timeout *time.Duration) (net.Conn, error) { + var absTimeout time.Time + if timeout != nil { + absTimeout = time.Now().Add(*timeout) + } else { + absTimeout = time.Now().Add(time.Second * 2) + } + var err error + var h syscall.Handle + for { + h, err = createFile(path, syscall.GENERIC_READ|syscall.GENERIC_WRITE, 0, nil, syscall.OPEN_EXISTING, syscall.FILE_FLAG_OVERLAPPED|cSECURITY_SQOS_PRESENT|cSECURITY_ANONYMOUS, 0) + if err != cERROR_PIPE_BUSY { + break + } + if time.Now().After(absTimeout) { + return nil, ErrTimeout + } + + // Wait 10 msec and try again. This is a rather simplistic + // view, as we always try each 10 milliseconds. + time.Sleep(time.Millisecond * 10) + } + if err != nil { + return nil, &os.PathError{Op: "open", Path: path, Err: err} + } + + var flags uint32 + err = getNamedPipeInfo(h, &flags, nil, nil, nil) + if err != nil { + return nil, err + } + + f, err := makeWin32File(h) + if err != nil { + syscall.Close(h) + return nil, err + } + + // If the pipe is in message mode, return a message byte pipe, which + // supports CloseWrite(). + if flags&cPIPE_TYPE_MESSAGE != 0 { + return &win32MessageBytePipe{ + win32Pipe: win32Pipe{win32File: f, path: path}, + }, nil + } + return &win32Pipe{win32File: f, path: path}, nil +} + +type acceptResponse struct { + f *win32File + err error +} + +type win32PipeListener struct { + firstHandle syscall.Handle + path string + securityDescriptor []byte + config PipeConfig + acceptCh chan (chan acceptResponse) + closeCh chan int + doneCh chan int +} + +func makeServerPipeHandle(path string, securityDescriptor []byte, c *PipeConfig, first bool) (syscall.Handle, error) { + var flags uint32 = cPIPE_ACCESS_DUPLEX | syscall.FILE_FLAG_OVERLAPPED + if first { + flags |= cFILE_FLAG_FIRST_PIPE_INSTANCE + } + + var mode uint32 = cPIPE_REJECT_REMOTE_CLIENTS + if c.MessageMode { + mode |= cPIPE_TYPE_MESSAGE + } + + sa := &syscall.SecurityAttributes{} + sa.Length = uint32(unsafe.Sizeof(*sa)) + if securityDescriptor != nil { + len := uint32(len(securityDescriptor)) + sa.SecurityDescriptor = localAlloc(0, len) + defer localFree(sa.SecurityDescriptor) + copy((*[0xffff]byte)(unsafe.Pointer(sa.SecurityDescriptor))[:], securityDescriptor) + } + h, err := createNamedPipe(path, flags, mode, cPIPE_UNLIMITED_INSTANCES, uint32(c.OutputBufferSize), uint32(c.InputBufferSize), 0, sa) + if err != nil { + return 0, &os.PathError{Op: "open", Path: path, Err: err} + } + return h, nil +} + +func (l *win32PipeListener) makeServerPipe() (*win32File, error) { + h, err := makeServerPipeHandle(l.path, l.securityDescriptor, &l.config, false) + if err != nil { + return nil, err + } + f, err := makeWin32File(h) + if err != nil { + syscall.Close(h) + return nil, err + } + return f, nil +} + +func (l *win32PipeListener) makeConnectedServerPipe() (*win32File, error) { + p, err := l.makeServerPipe() + if err != nil { + return nil, err + } + + // Wait for the client to connect. + ch := make(chan error) + go func(p *win32File) { + ch <- connectPipe(p) + }(p) + + select { + case err = <-ch: + if err != nil { + p.Close() + p = nil + } + case <-l.closeCh: + // Abort the connect request by closing the handle. + p.Close() + p = nil + err = <-ch + if err == nil || err == ErrFileClosed { + err = ErrPipeListenerClosed + } + } + return p, err +} + +func (l *win32PipeListener) listenerRoutine() { + closed := false + for !closed { + select { + case <-l.closeCh: + closed = true + case responseCh := <-l.acceptCh: + var ( + p *win32File + err error + ) + for { + p, err = l.makeConnectedServerPipe() + // If the connection was immediately closed by the client, try + // again. + if err != cERROR_NO_DATA { + break + } + } + responseCh <- acceptResponse{p, err} + closed = err == ErrPipeListenerClosed + } + } + syscall.Close(l.firstHandle) + l.firstHandle = 0 + // Notify Close() and Accept() callers that the handle has been closed. + close(l.doneCh) +} + +// PipeConfig contain configuration for the pipe listener. +type PipeConfig struct { + // SecurityDescriptor contains a Windows security descriptor in SDDL format. + SecurityDescriptor string + + // MessageMode determines whether the pipe is in byte or message mode. In either + // case the pipe is read in byte mode by default. The only practical difference in + // this implementation is that CloseWrite() is only supported for message mode pipes; + // CloseWrite() is implemented as a zero-byte write, but zero-byte writes are only + // transferred to the reader (and returned as io.EOF in this implementation) + // when the pipe is in message mode. + MessageMode bool + + // InputBufferSize specifies the size the input buffer, in bytes. + InputBufferSize int32 + + // OutputBufferSize specifies the size the input buffer, in bytes. + OutputBufferSize int32 +} + +// ListenPipe creates a listener on a Windows named pipe path, e.g. \\.\pipe\mypipe. +// The pipe must not already exist. +func ListenPipe(path string, c *PipeConfig) (net.Listener, error) { + var ( + sd []byte + err error + ) + if c == nil { + c = &PipeConfig{} + } + if c.SecurityDescriptor != "" { + sd, err = SddlToSecurityDescriptor(c.SecurityDescriptor) + if err != nil { + return nil, err + } + } + h, err := makeServerPipeHandle(path, sd, c, true) + if err != nil { + return nil, err + } + // Create a client handle and connect it. This results in the pipe + // instance always existing, so that clients see ERROR_PIPE_BUSY + // rather than ERROR_FILE_NOT_FOUND. This ties the first instance + // up so that no other instances can be used. This would have been + // cleaner if the Win32 API matched CreateFile with ConnectNamedPipe + // instead of CreateNamedPipe. (Apparently created named pipes are + // considered to be in listening state regardless of whether any + // active calls to ConnectNamedPipe are outstanding.) + h2, err := createFile(path, 0, 0, nil, syscall.OPEN_EXISTING, cSECURITY_SQOS_PRESENT|cSECURITY_ANONYMOUS, 0) + if err != nil { + syscall.Close(h) + return nil, err + } + // Close the client handle. The server side of the instance will + // still be busy, leading to ERROR_PIPE_BUSY instead of + // ERROR_NOT_FOUND, as long as we don't close the server handle, + // or disconnect the client with DisconnectNamedPipe. + syscall.Close(h2) + l := &win32PipeListener{ + firstHandle: h, + path: path, + securityDescriptor: sd, + config: *c, + acceptCh: make(chan (chan acceptResponse)), + closeCh: make(chan int), + doneCh: make(chan int), + } + go l.listenerRoutine() + return l, nil +} + +func connectPipe(p *win32File) error { + c, err := p.prepareIo() + if err != nil { + return err + } + defer p.wg.Done() + + err = connectNamedPipe(p.handle, &c.o) + _, err = p.asyncIo(c, nil, 0, err) + if err != nil && err != cERROR_PIPE_CONNECTED { + return err + } + return nil +} + +func (l *win32PipeListener) Accept() (net.Conn, error) { + ch := make(chan acceptResponse) + select { + case l.acceptCh <- ch: + response := <-ch + err := response.err + if err != nil { + return nil, err + } + if l.config.MessageMode { + return &win32MessageBytePipe{ + win32Pipe: win32Pipe{win32File: response.f, path: l.path}, + }, nil + } + return &win32Pipe{win32File: response.f, path: l.path}, nil + case <-l.doneCh: + return nil, ErrPipeListenerClosed + } +} + +func (l *win32PipeListener) Close() error { + select { + case l.closeCh <- 1: + <-l.doneCh + case <-l.doneCh: + } + return nil +} + +func (l *win32PipeListener) Addr() net.Addr { + return pipeAddress(l.path) +} diff --git a/vendor/github.com/Microsoft/go-winio/privilege.go b/vendor/github.com/Microsoft/go-winio/privilege.go new file mode 100644 index 0000000000..9c83d36fe5 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/privilege.go @@ -0,0 +1,202 @@ +// +build windows + +package winio + +import ( + "bytes" + "encoding/binary" + "fmt" + "runtime" + "sync" + "syscall" + "unicode/utf16" + + "golang.org/x/sys/windows" +) + +//sys adjustTokenPrivileges(token windows.Token, releaseAll bool, input *byte, outputSize uint32, output *byte, requiredSize *uint32) (success bool, err error) [true] = advapi32.AdjustTokenPrivileges +//sys impersonateSelf(level uint32) (err error) = advapi32.ImpersonateSelf +//sys revertToSelf() (err error) = advapi32.RevertToSelf +//sys openThreadToken(thread syscall.Handle, accessMask uint32, openAsSelf bool, token *windows.Token) (err error) = advapi32.OpenThreadToken +//sys getCurrentThread() (h syscall.Handle) = GetCurrentThread +//sys lookupPrivilegeValue(systemName string, name string, luid *uint64) (err error) = advapi32.LookupPrivilegeValueW +//sys lookupPrivilegeName(systemName string, luid *uint64, buffer *uint16, size *uint32) (err error) = advapi32.LookupPrivilegeNameW +//sys lookupPrivilegeDisplayName(systemName string, name *uint16, buffer *uint16, size *uint32, languageId *uint32) (err error) = advapi32.LookupPrivilegeDisplayNameW + +const ( + SE_PRIVILEGE_ENABLED = 2 + + ERROR_NOT_ALL_ASSIGNED syscall.Errno = 1300 + + SeBackupPrivilege = "SeBackupPrivilege" + SeRestorePrivilege = "SeRestorePrivilege" +) + +const ( + securityAnonymous = iota + securityIdentification + securityImpersonation + securityDelegation +) + +var ( + privNames = make(map[string]uint64) + privNameMutex sync.Mutex +) + +// PrivilegeError represents an error enabling privileges. +type PrivilegeError struct { + privileges []uint64 +} + +func (e *PrivilegeError) Error() string { + s := "" + if len(e.privileges) > 1 { + s = "Could not enable privileges " + } else { + s = "Could not enable privilege " + } + for i, p := range e.privileges { + if i != 0 { + s += ", " + } + s += `"` + s += getPrivilegeName(p) + s += `"` + } + return s +} + +// RunWithPrivilege enables a single privilege for a function call. +func RunWithPrivilege(name string, fn func() error) error { + return RunWithPrivileges([]string{name}, fn) +} + +// RunWithPrivileges enables privileges for a function call. +func RunWithPrivileges(names []string, fn func() error) error { + privileges, err := mapPrivileges(names) + if err != nil { + return err + } + runtime.LockOSThread() + defer runtime.UnlockOSThread() + token, err := newThreadToken() + if err != nil { + return err + } + defer releaseThreadToken(token) + err = adjustPrivileges(token, privileges, SE_PRIVILEGE_ENABLED) + if err != nil { + return err + } + return fn() +} + +func mapPrivileges(names []string) ([]uint64, error) { + var privileges []uint64 + privNameMutex.Lock() + defer privNameMutex.Unlock() + for _, name := range names { + p, ok := privNames[name] + if !ok { + err := lookupPrivilegeValue("", name, &p) + if err != nil { + return nil, err + } + privNames[name] = p + } + privileges = append(privileges, p) + } + return privileges, nil +} + +// EnableProcessPrivileges enables privileges globally for the process. +func EnableProcessPrivileges(names []string) error { + return enableDisableProcessPrivilege(names, SE_PRIVILEGE_ENABLED) +} + +// DisableProcessPrivileges disables privileges globally for the process. +func DisableProcessPrivileges(names []string) error { + return enableDisableProcessPrivilege(names, 0) +} + +func enableDisableProcessPrivilege(names []string, action uint32) error { + privileges, err := mapPrivileges(names) + if err != nil { + return err + } + + p, _ := windows.GetCurrentProcess() + var token windows.Token + err = windows.OpenProcessToken(p, windows.TOKEN_ADJUST_PRIVILEGES|windows.TOKEN_QUERY, &token) + if err != nil { + return err + } + + defer token.Close() + return adjustPrivileges(token, privileges, action) +} + +func adjustPrivileges(token windows.Token, privileges []uint64, action uint32) error { + var b bytes.Buffer + binary.Write(&b, binary.LittleEndian, uint32(len(privileges))) + for _, p := range privileges { + binary.Write(&b, binary.LittleEndian, p) + binary.Write(&b, binary.LittleEndian, action) + } + prevState := make([]byte, b.Len()) + reqSize := uint32(0) + success, err := adjustTokenPrivileges(token, false, &b.Bytes()[0], uint32(len(prevState)), &prevState[0], &reqSize) + if !success { + return err + } + if err == ERROR_NOT_ALL_ASSIGNED { + return &PrivilegeError{privileges} + } + return nil +} + +func getPrivilegeName(luid uint64) string { + var nameBuffer [256]uint16 + bufSize := uint32(len(nameBuffer)) + err := lookupPrivilegeName("", &luid, &nameBuffer[0], &bufSize) + if err != nil { + return fmt.Sprintf("", luid) + } + + var displayNameBuffer [256]uint16 + displayBufSize := uint32(len(displayNameBuffer)) + var langID uint32 + err = lookupPrivilegeDisplayName("", &nameBuffer[0], &displayNameBuffer[0], &displayBufSize, &langID) + if err != nil { + return fmt.Sprintf("", string(utf16.Decode(nameBuffer[:bufSize]))) + } + + return string(utf16.Decode(displayNameBuffer[:displayBufSize])) +} + +func newThreadToken() (windows.Token, error) { + err := impersonateSelf(securityImpersonation) + if err != nil { + return 0, err + } + + var token windows.Token + err = openThreadToken(getCurrentThread(), syscall.TOKEN_ADJUST_PRIVILEGES|syscall.TOKEN_QUERY, false, &token) + if err != nil { + rerr := revertToSelf() + if rerr != nil { + panic(rerr) + } + return 0, err + } + return token, nil +} + +func releaseThreadToken(h windows.Token) { + err := revertToSelf() + if err != nil { + panic(err) + } + h.Close() +} diff --git a/vendor/github.com/Microsoft/go-winio/reparse.go b/vendor/github.com/Microsoft/go-winio/reparse.go new file mode 100644 index 0000000000..fc1ee4d3a3 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/reparse.go @@ -0,0 +1,128 @@ +package winio + +import ( + "bytes" + "encoding/binary" + "fmt" + "strings" + "unicode/utf16" + "unsafe" +) + +const ( + reparseTagMountPoint = 0xA0000003 + reparseTagSymlink = 0xA000000C +) + +type reparseDataBuffer struct { + ReparseTag uint32 + ReparseDataLength uint16 + Reserved uint16 + SubstituteNameOffset uint16 + SubstituteNameLength uint16 + PrintNameOffset uint16 + PrintNameLength uint16 +} + +// ReparsePoint describes a Win32 symlink or mount point. +type ReparsePoint struct { + Target string + IsMountPoint bool +} + +// UnsupportedReparsePointError is returned when trying to decode a non-symlink or +// mount point reparse point. +type UnsupportedReparsePointError struct { + Tag uint32 +} + +func (e *UnsupportedReparsePointError) Error() string { + return fmt.Sprintf("unsupported reparse point %x", e.Tag) +} + +// DecodeReparsePoint decodes a Win32 REPARSE_DATA_BUFFER structure containing either a symlink +// or a mount point. +func DecodeReparsePoint(b []byte) (*ReparsePoint, error) { + tag := binary.LittleEndian.Uint32(b[0:4]) + return DecodeReparsePointData(tag, b[8:]) +} + +func DecodeReparsePointData(tag uint32, b []byte) (*ReparsePoint, error) { + isMountPoint := false + switch tag { + case reparseTagMountPoint: + isMountPoint = true + case reparseTagSymlink: + default: + return nil, &UnsupportedReparsePointError{tag} + } + nameOffset := 8 + binary.LittleEndian.Uint16(b[4:6]) + if !isMountPoint { + nameOffset += 4 + } + nameLength := binary.LittleEndian.Uint16(b[6:8]) + name := make([]uint16, nameLength/2) + err := binary.Read(bytes.NewReader(b[nameOffset:nameOffset+nameLength]), binary.LittleEndian, &name) + if err != nil { + return nil, err + } + return &ReparsePoint{string(utf16.Decode(name)), isMountPoint}, nil +} + +func isDriveLetter(c byte) bool { + return (c >= 'a' && c <= 'z') || (c >= 'A' && c <= 'Z') +} + +// EncodeReparsePoint encodes a Win32 REPARSE_DATA_BUFFER structure describing a symlink or +// mount point. +func EncodeReparsePoint(rp *ReparsePoint) []byte { + // Generate an NT path and determine if this is a relative path. + var ntTarget string + relative := false + if strings.HasPrefix(rp.Target, `\\?\`) { + ntTarget = `\??\` + rp.Target[4:] + } else if strings.HasPrefix(rp.Target, `\\`) { + ntTarget = `\??\UNC\` + rp.Target[2:] + } else if len(rp.Target) >= 2 && isDriveLetter(rp.Target[0]) && rp.Target[1] == ':' { + ntTarget = `\??\` + rp.Target + } else { + ntTarget = rp.Target + relative = true + } + + // The paths must be NUL-terminated even though they are counted strings. + target16 := utf16.Encode([]rune(rp.Target + "\x00")) + ntTarget16 := utf16.Encode([]rune(ntTarget + "\x00")) + + size := int(unsafe.Sizeof(reparseDataBuffer{})) - 8 + size += len(ntTarget16)*2 + len(target16)*2 + + tag := uint32(reparseTagMountPoint) + if !rp.IsMountPoint { + tag = reparseTagSymlink + size += 4 // Add room for symlink flags + } + + data := reparseDataBuffer{ + ReparseTag: tag, + ReparseDataLength: uint16(size), + SubstituteNameOffset: 0, + SubstituteNameLength: uint16((len(ntTarget16) - 1) * 2), + PrintNameOffset: uint16(len(ntTarget16) * 2), + PrintNameLength: uint16((len(target16) - 1) * 2), + } + + var b bytes.Buffer + binary.Write(&b, binary.LittleEndian, &data) + if !rp.IsMountPoint { + flags := uint32(0) + if relative { + flags |= 1 + } + binary.Write(&b, binary.LittleEndian, flags) + } + + binary.Write(&b, binary.LittleEndian, ntTarget16) + binary.Write(&b, binary.LittleEndian, target16) + return b.Bytes() +} diff --git a/vendor/github.com/Microsoft/go-winio/sd.go b/vendor/github.com/Microsoft/go-winio/sd.go new file mode 100644 index 0000000000..db1b370a1b --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/sd.go @@ -0,0 +1,98 @@ +// +build windows + +package winio + +import ( + "syscall" + "unsafe" +) + +//sys lookupAccountName(systemName *uint16, accountName string, sid *byte, sidSize *uint32, refDomain *uint16, refDomainSize *uint32, sidNameUse *uint32) (err error) = advapi32.LookupAccountNameW +//sys convertSidToStringSid(sid *byte, str **uint16) (err error) = advapi32.ConvertSidToStringSidW +//sys convertStringSecurityDescriptorToSecurityDescriptor(str string, revision uint32, sd *uintptr, size *uint32) (err error) = advapi32.ConvertStringSecurityDescriptorToSecurityDescriptorW +//sys convertSecurityDescriptorToStringSecurityDescriptor(sd *byte, revision uint32, secInfo uint32, sddl **uint16, sddlSize *uint32) (err error) = advapi32.ConvertSecurityDescriptorToStringSecurityDescriptorW +//sys localFree(mem uintptr) = LocalFree +//sys getSecurityDescriptorLength(sd uintptr) (len uint32) = advapi32.GetSecurityDescriptorLength + +const ( + cERROR_NONE_MAPPED = syscall.Errno(1332) +) + +type AccountLookupError struct { + Name string + Err error +} + +func (e *AccountLookupError) Error() string { + if e.Name == "" { + return "lookup account: empty account name specified" + } + var s string + switch e.Err { + case cERROR_NONE_MAPPED: + s = "not found" + default: + s = e.Err.Error() + } + return "lookup account " + e.Name + ": " + s +} + +type SddlConversionError struct { + Sddl string + Err error +} + +func (e *SddlConversionError) Error() string { + return "convert " + e.Sddl + ": " + e.Err.Error() +} + +// LookupSidByName looks up the SID of an account by name +func LookupSidByName(name string) (sid string, err error) { + if name == "" { + return "", &AccountLookupError{name, cERROR_NONE_MAPPED} + } + + var sidSize, sidNameUse, refDomainSize uint32 + err = lookupAccountName(nil, name, nil, &sidSize, nil, &refDomainSize, &sidNameUse) + if err != nil && err != syscall.ERROR_INSUFFICIENT_BUFFER { + return "", &AccountLookupError{name, err} + } + sidBuffer := make([]byte, sidSize) + refDomainBuffer := make([]uint16, refDomainSize) + err = lookupAccountName(nil, name, &sidBuffer[0], &sidSize, &refDomainBuffer[0], &refDomainSize, &sidNameUse) + if err != nil { + return "", &AccountLookupError{name, err} + } + var strBuffer *uint16 + err = convertSidToStringSid(&sidBuffer[0], &strBuffer) + if err != nil { + return "", &AccountLookupError{name, err} + } + sid = syscall.UTF16ToString((*[0xffff]uint16)(unsafe.Pointer(strBuffer))[:]) + localFree(uintptr(unsafe.Pointer(strBuffer))) + return sid, nil +} + +func SddlToSecurityDescriptor(sddl string) ([]byte, error) { + var sdBuffer uintptr + err := convertStringSecurityDescriptorToSecurityDescriptor(sddl, 1, &sdBuffer, nil) + if err != nil { + return nil, &SddlConversionError{sddl, err} + } + defer localFree(sdBuffer) + sd := make([]byte, getSecurityDescriptorLength(sdBuffer)) + copy(sd, (*[0xffff]byte)(unsafe.Pointer(sdBuffer))[:len(sd)]) + return sd, nil +} + +func SecurityDescriptorToSddl(sd []byte) (string, error) { + var sddl *uint16 + // The returned string length seems to including an aribtrary number of terminating NULs. + // Don't use it. + err := convertSecurityDescriptorToStringSecurityDescriptor(&sd[0], 1, 0xff, &sddl, nil) + if err != nil { + return "", err + } + defer localFree(uintptr(unsafe.Pointer(sddl))) + return syscall.UTF16ToString((*[0xffff]uint16)(unsafe.Pointer(sddl))[:]), nil +} diff --git a/vendor/github.com/Microsoft/go-winio/syscall.go b/vendor/github.com/Microsoft/go-winio/syscall.go new file mode 100644 index 0000000000..20d64cf41d --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/syscall.go @@ -0,0 +1,3 @@ +package winio + +//go:generate go run $GOROOT/src/syscall/mksyscall_windows.go -output zsyscall_windows.go file.go pipe.go sd.go fileinfo.go privilege.go backup.go diff --git a/vendor/github.com/Microsoft/go-winio/zsyscall_windows.go b/vendor/github.com/Microsoft/go-winio/zsyscall_windows.go new file mode 100644 index 0000000000..3f527639a4 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/zsyscall_windows.go @@ -0,0 +1,520 @@ +// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT + +package winio + +import ( + "syscall" + "unsafe" + + "golang.org/x/sys/windows" +) + +var _ unsafe.Pointer + +// Do the interface allocations only once for common +// Errno values. +const ( + errnoERROR_IO_PENDING = 997 +) + +var ( + errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) +) + +// errnoErr returns common boxed Errno values, to prevent +// allocations at runtime. +func errnoErr(e syscall.Errno) error { + switch e { + case 0: + return nil + case errnoERROR_IO_PENDING: + return errERROR_IO_PENDING + } + // TODO: add more here, after collecting data on the common + // error values see on Windows. (perhaps when running + // all.bat?) + return e +} + +var ( + modkernel32 = windows.NewLazySystemDLL("kernel32.dll") + modadvapi32 = windows.NewLazySystemDLL("advapi32.dll") + + procCancelIoEx = modkernel32.NewProc("CancelIoEx") + procCreateIoCompletionPort = modkernel32.NewProc("CreateIoCompletionPort") + procGetQueuedCompletionStatus = modkernel32.NewProc("GetQueuedCompletionStatus") + procSetFileCompletionNotificationModes = modkernel32.NewProc("SetFileCompletionNotificationModes") + procConnectNamedPipe = modkernel32.NewProc("ConnectNamedPipe") + procCreateNamedPipeW = modkernel32.NewProc("CreateNamedPipeW") + procCreateFileW = modkernel32.NewProc("CreateFileW") + procWaitNamedPipeW = modkernel32.NewProc("WaitNamedPipeW") + procGetNamedPipeInfo = modkernel32.NewProc("GetNamedPipeInfo") + procGetNamedPipeHandleStateW = modkernel32.NewProc("GetNamedPipeHandleStateW") + procLocalAlloc = modkernel32.NewProc("LocalAlloc") + procLookupAccountNameW = modadvapi32.NewProc("LookupAccountNameW") + procConvertSidToStringSidW = modadvapi32.NewProc("ConvertSidToStringSidW") + procConvertStringSecurityDescriptorToSecurityDescriptorW = modadvapi32.NewProc("ConvertStringSecurityDescriptorToSecurityDescriptorW") + procConvertSecurityDescriptorToStringSecurityDescriptorW = modadvapi32.NewProc("ConvertSecurityDescriptorToStringSecurityDescriptorW") + procLocalFree = modkernel32.NewProc("LocalFree") + procGetSecurityDescriptorLength = modadvapi32.NewProc("GetSecurityDescriptorLength") + procGetFileInformationByHandleEx = modkernel32.NewProc("GetFileInformationByHandleEx") + procSetFileInformationByHandle = modkernel32.NewProc("SetFileInformationByHandle") + procAdjustTokenPrivileges = modadvapi32.NewProc("AdjustTokenPrivileges") + procImpersonateSelf = modadvapi32.NewProc("ImpersonateSelf") + procRevertToSelf = modadvapi32.NewProc("RevertToSelf") + procOpenThreadToken = modadvapi32.NewProc("OpenThreadToken") + procGetCurrentThread = modkernel32.NewProc("GetCurrentThread") + procLookupPrivilegeValueW = modadvapi32.NewProc("LookupPrivilegeValueW") + procLookupPrivilegeNameW = modadvapi32.NewProc("LookupPrivilegeNameW") + procLookupPrivilegeDisplayNameW = modadvapi32.NewProc("LookupPrivilegeDisplayNameW") + procBackupRead = modkernel32.NewProc("BackupRead") + procBackupWrite = modkernel32.NewProc("BackupWrite") +) + +func cancelIoEx(file syscall.Handle, o *syscall.Overlapped) (err error) { + r1, _, e1 := syscall.Syscall(procCancelIoEx.Addr(), 2, uintptr(file), uintptr(unsafe.Pointer(o)), 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func createIoCompletionPort(file syscall.Handle, port syscall.Handle, key uintptr, threadCount uint32) (newport syscall.Handle, err error) { + r0, _, e1 := syscall.Syscall6(procCreateIoCompletionPort.Addr(), 4, uintptr(file), uintptr(port), uintptr(key), uintptr(threadCount), 0, 0) + newport = syscall.Handle(r0) + if newport == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func getQueuedCompletionStatus(port syscall.Handle, bytes *uint32, key *uintptr, o **ioOperation, timeout uint32) (err error) { + r1, _, e1 := syscall.Syscall6(procGetQueuedCompletionStatus.Addr(), 5, uintptr(port), uintptr(unsafe.Pointer(bytes)), uintptr(unsafe.Pointer(key)), uintptr(unsafe.Pointer(o)), uintptr(timeout), 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func setFileCompletionNotificationModes(h syscall.Handle, flags uint8) (err error) { + r1, _, e1 := syscall.Syscall(procSetFileCompletionNotificationModes.Addr(), 2, uintptr(h), uintptr(flags), 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func connectNamedPipe(pipe syscall.Handle, o *syscall.Overlapped) (err error) { + r1, _, e1 := syscall.Syscall(procConnectNamedPipe.Addr(), 2, uintptr(pipe), uintptr(unsafe.Pointer(o)), 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func createNamedPipe(name string, flags uint32, pipeMode uint32, maxInstances uint32, outSize uint32, inSize uint32, defaultTimeout uint32, sa *syscall.SecurityAttributes) (handle syscall.Handle, err error) { + var _p0 *uint16 + _p0, err = syscall.UTF16PtrFromString(name) + if err != nil { + return + } + return _createNamedPipe(_p0, flags, pipeMode, maxInstances, outSize, inSize, defaultTimeout, sa) +} + +func _createNamedPipe(name *uint16, flags uint32, pipeMode uint32, maxInstances uint32, outSize uint32, inSize uint32, defaultTimeout uint32, sa *syscall.SecurityAttributes) (handle syscall.Handle, err error) { + r0, _, e1 := syscall.Syscall9(procCreateNamedPipeW.Addr(), 8, uintptr(unsafe.Pointer(name)), uintptr(flags), uintptr(pipeMode), uintptr(maxInstances), uintptr(outSize), uintptr(inSize), uintptr(defaultTimeout), uintptr(unsafe.Pointer(sa)), 0) + handle = syscall.Handle(r0) + if handle == syscall.InvalidHandle { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func createFile(name string, access uint32, mode uint32, sa *syscall.SecurityAttributes, createmode uint32, attrs uint32, templatefile syscall.Handle) (handle syscall.Handle, err error) { + var _p0 *uint16 + _p0, err = syscall.UTF16PtrFromString(name) + if err != nil { + return + } + return _createFile(_p0, access, mode, sa, createmode, attrs, templatefile) +} + +func _createFile(name *uint16, access uint32, mode uint32, sa *syscall.SecurityAttributes, createmode uint32, attrs uint32, templatefile syscall.Handle) (handle syscall.Handle, err error) { + r0, _, e1 := syscall.Syscall9(procCreateFileW.Addr(), 7, uintptr(unsafe.Pointer(name)), uintptr(access), uintptr(mode), uintptr(unsafe.Pointer(sa)), uintptr(createmode), uintptr(attrs), uintptr(templatefile), 0, 0) + handle = syscall.Handle(r0) + if handle == syscall.InvalidHandle { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func waitNamedPipe(name string, timeout uint32) (err error) { + var _p0 *uint16 + _p0, err = syscall.UTF16PtrFromString(name) + if err != nil { + return + } + return _waitNamedPipe(_p0, timeout) +} + +func _waitNamedPipe(name *uint16, timeout uint32) (err error) { + r1, _, e1 := syscall.Syscall(procWaitNamedPipeW.Addr(), 2, uintptr(unsafe.Pointer(name)), uintptr(timeout), 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func getNamedPipeInfo(pipe syscall.Handle, flags *uint32, outSize *uint32, inSize *uint32, maxInstances *uint32) (err error) { + r1, _, e1 := syscall.Syscall6(procGetNamedPipeInfo.Addr(), 5, uintptr(pipe), uintptr(unsafe.Pointer(flags)), uintptr(unsafe.Pointer(outSize)), uintptr(unsafe.Pointer(inSize)), uintptr(unsafe.Pointer(maxInstances)), 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func getNamedPipeHandleState(pipe syscall.Handle, state *uint32, curInstances *uint32, maxCollectionCount *uint32, collectDataTimeout *uint32, userName *uint16, maxUserNameSize uint32) (err error) { + r1, _, e1 := syscall.Syscall9(procGetNamedPipeHandleStateW.Addr(), 7, uintptr(pipe), uintptr(unsafe.Pointer(state)), uintptr(unsafe.Pointer(curInstances)), uintptr(unsafe.Pointer(maxCollectionCount)), uintptr(unsafe.Pointer(collectDataTimeout)), uintptr(unsafe.Pointer(userName)), uintptr(maxUserNameSize), 0, 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func localAlloc(uFlags uint32, length uint32) (ptr uintptr) { + r0, _, _ := syscall.Syscall(procLocalAlloc.Addr(), 2, uintptr(uFlags), uintptr(length), 0) + ptr = uintptr(r0) + return +} + +func lookupAccountName(systemName *uint16, accountName string, sid *byte, sidSize *uint32, refDomain *uint16, refDomainSize *uint32, sidNameUse *uint32) (err error) { + var _p0 *uint16 + _p0, err = syscall.UTF16PtrFromString(accountName) + if err != nil { + return + } + return _lookupAccountName(systemName, _p0, sid, sidSize, refDomain, refDomainSize, sidNameUse) +} + +func _lookupAccountName(systemName *uint16, accountName *uint16, sid *byte, sidSize *uint32, refDomain *uint16, refDomainSize *uint32, sidNameUse *uint32) (err error) { + r1, _, e1 := syscall.Syscall9(procLookupAccountNameW.Addr(), 7, uintptr(unsafe.Pointer(systemName)), uintptr(unsafe.Pointer(accountName)), uintptr(unsafe.Pointer(sid)), uintptr(unsafe.Pointer(sidSize)), uintptr(unsafe.Pointer(refDomain)), uintptr(unsafe.Pointer(refDomainSize)), uintptr(unsafe.Pointer(sidNameUse)), 0, 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func convertSidToStringSid(sid *byte, str **uint16) (err error) { + r1, _, e1 := syscall.Syscall(procConvertSidToStringSidW.Addr(), 2, uintptr(unsafe.Pointer(sid)), uintptr(unsafe.Pointer(str)), 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func convertStringSecurityDescriptorToSecurityDescriptor(str string, revision uint32, sd *uintptr, size *uint32) (err error) { + var _p0 *uint16 + _p0, err = syscall.UTF16PtrFromString(str) + if err != nil { + return + } + return _convertStringSecurityDescriptorToSecurityDescriptor(_p0, revision, sd, size) +} + +func _convertStringSecurityDescriptorToSecurityDescriptor(str *uint16, revision uint32, sd *uintptr, size *uint32) (err error) { + r1, _, e1 := syscall.Syscall6(procConvertStringSecurityDescriptorToSecurityDescriptorW.Addr(), 4, uintptr(unsafe.Pointer(str)), uintptr(revision), uintptr(unsafe.Pointer(sd)), uintptr(unsafe.Pointer(size)), 0, 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func convertSecurityDescriptorToStringSecurityDescriptor(sd *byte, revision uint32, secInfo uint32, sddl **uint16, sddlSize *uint32) (err error) { + r1, _, e1 := syscall.Syscall6(procConvertSecurityDescriptorToStringSecurityDescriptorW.Addr(), 5, uintptr(unsafe.Pointer(sd)), uintptr(revision), uintptr(secInfo), uintptr(unsafe.Pointer(sddl)), uintptr(unsafe.Pointer(sddlSize)), 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func localFree(mem uintptr) { + syscall.Syscall(procLocalFree.Addr(), 1, uintptr(mem), 0, 0) + return +} + +func getSecurityDescriptorLength(sd uintptr) (len uint32) { + r0, _, _ := syscall.Syscall(procGetSecurityDescriptorLength.Addr(), 1, uintptr(sd), 0, 0) + len = uint32(r0) + return +} + +func getFileInformationByHandleEx(h syscall.Handle, class uint32, buffer *byte, size uint32) (err error) { + r1, _, e1 := syscall.Syscall6(procGetFileInformationByHandleEx.Addr(), 4, uintptr(h), uintptr(class), uintptr(unsafe.Pointer(buffer)), uintptr(size), 0, 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func setFileInformationByHandle(h syscall.Handle, class uint32, buffer *byte, size uint32) (err error) { + r1, _, e1 := syscall.Syscall6(procSetFileInformationByHandle.Addr(), 4, uintptr(h), uintptr(class), uintptr(unsafe.Pointer(buffer)), uintptr(size), 0, 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func adjustTokenPrivileges(token windows.Token, releaseAll bool, input *byte, outputSize uint32, output *byte, requiredSize *uint32) (success bool, err error) { + var _p0 uint32 + if releaseAll { + _p0 = 1 + } else { + _p0 = 0 + } + r0, _, e1 := syscall.Syscall6(procAdjustTokenPrivileges.Addr(), 6, uintptr(token), uintptr(_p0), uintptr(unsafe.Pointer(input)), uintptr(outputSize), uintptr(unsafe.Pointer(output)), uintptr(unsafe.Pointer(requiredSize))) + success = r0 != 0 + if true { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func impersonateSelf(level uint32) (err error) { + r1, _, e1 := syscall.Syscall(procImpersonateSelf.Addr(), 1, uintptr(level), 0, 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func revertToSelf() (err error) { + r1, _, e1 := syscall.Syscall(procRevertToSelf.Addr(), 0, 0, 0, 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func openThreadToken(thread syscall.Handle, accessMask uint32, openAsSelf bool, token *windows.Token) (err error) { + var _p0 uint32 + if openAsSelf { + _p0 = 1 + } else { + _p0 = 0 + } + r1, _, e1 := syscall.Syscall6(procOpenThreadToken.Addr(), 4, uintptr(thread), uintptr(accessMask), uintptr(_p0), uintptr(unsafe.Pointer(token)), 0, 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func getCurrentThread() (h syscall.Handle) { + r0, _, _ := syscall.Syscall(procGetCurrentThread.Addr(), 0, 0, 0, 0) + h = syscall.Handle(r0) + return +} + +func lookupPrivilegeValue(systemName string, name string, luid *uint64) (err error) { + var _p0 *uint16 + _p0, err = syscall.UTF16PtrFromString(systemName) + if err != nil { + return + } + var _p1 *uint16 + _p1, err = syscall.UTF16PtrFromString(name) + if err != nil { + return + } + return _lookupPrivilegeValue(_p0, _p1, luid) +} + +func _lookupPrivilegeValue(systemName *uint16, name *uint16, luid *uint64) (err error) { + r1, _, e1 := syscall.Syscall(procLookupPrivilegeValueW.Addr(), 3, uintptr(unsafe.Pointer(systemName)), uintptr(unsafe.Pointer(name)), uintptr(unsafe.Pointer(luid))) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func lookupPrivilegeName(systemName string, luid *uint64, buffer *uint16, size *uint32) (err error) { + var _p0 *uint16 + _p0, err = syscall.UTF16PtrFromString(systemName) + if err != nil { + return + } + return _lookupPrivilegeName(_p0, luid, buffer, size) +} + +func _lookupPrivilegeName(systemName *uint16, luid *uint64, buffer *uint16, size *uint32) (err error) { + r1, _, e1 := syscall.Syscall6(procLookupPrivilegeNameW.Addr(), 4, uintptr(unsafe.Pointer(systemName)), uintptr(unsafe.Pointer(luid)), uintptr(unsafe.Pointer(buffer)), uintptr(unsafe.Pointer(size)), 0, 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func lookupPrivilegeDisplayName(systemName string, name *uint16, buffer *uint16, size *uint32, languageId *uint32) (err error) { + var _p0 *uint16 + _p0, err = syscall.UTF16PtrFromString(systemName) + if err != nil { + return + } + return _lookupPrivilegeDisplayName(_p0, name, buffer, size, languageId) +} + +func _lookupPrivilegeDisplayName(systemName *uint16, name *uint16, buffer *uint16, size *uint32, languageId *uint32) (err error) { + r1, _, e1 := syscall.Syscall6(procLookupPrivilegeDisplayNameW.Addr(), 5, uintptr(unsafe.Pointer(systemName)), uintptr(unsafe.Pointer(name)), uintptr(unsafe.Pointer(buffer)), uintptr(unsafe.Pointer(size)), uintptr(unsafe.Pointer(languageId)), 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func backupRead(h syscall.Handle, b []byte, bytesRead *uint32, abort bool, processSecurity bool, context *uintptr) (err error) { + var _p0 *byte + if len(b) > 0 { + _p0 = &b[0] + } + var _p1 uint32 + if abort { + _p1 = 1 + } else { + _p1 = 0 + } + var _p2 uint32 + if processSecurity { + _p2 = 1 + } else { + _p2 = 0 + } + r1, _, e1 := syscall.Syscall9(procBackupRead.Addr(), 7, uintptr(h), uintptr(unsafe.Pointer(_p0)), uintptr(len(b)), uintptr(unsafe.Pointer(bytesRead)), uintptr(_p1), uintptr(_p2), uintptr(unsafe.Pointer(context)), 0, 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func backupWrite(h syscall.Handle, b []byte, bytesWritten *uint32, abort bool, processSecurity bool, context *uintptr) (err error) { + var _p0 *byte + if len(b) > 0 { + _p0 = &b[0] + } + var _p1 uint32 + if abort { + _p1 = 1 + } else { + _p1 = 0 + } + var _p2 uint32 + if processSecurity { + _p2 = 1 + } else { + _p2 = 0 + } + r1, _, e1 := syscall.Syscall9(procBackupWrite.Addr(), 7, uintptr(h), uintptr(unsafe.Pointer(_p0)), uintptr(len(b)), uintptr(unsafe.Pointer(bytesWritten)), uintptr(_p1), uintptr(_p2), uintptr(unsafe.Pointer(context)), 0, 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} diff --git a/vendor/github.com/Microsoft/hcsshim/LICENSE b/vendor/github.com/Microsoft/hcsshim/LICENSE new file mode 100644 index 0000000000..49d21669ae --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/LICENSE @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2015 Microsoft + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. \ No newline at end of file diff --git a/vendor/github.com/Microsoft/hcsshim/cmd/runhcs/LICENSE b/vendor/github.com/Microsoft/hcsshim/cmd/runhcs/LICENSE new file mode 100644 index 0000000000..27448585ad --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/cmd/runhcs/LICENSE @@ -0,0 +1,191 @@ + + Apache License + Version 2.0, January 2004 + http://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + Copyright 2014 Docker, Inc. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. diff --git a/vendor/github.com/Microsoft/hcsshim/cmd/runhcs/NOTICE b/vendor/github.com/Microsoft/hcsshim/cmd/runhcs/NOTICE new file mode 100644 index 0000000000..e40e442072 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/cmd/runhcs/NOTICE @@ -0,0 +1,22 @@ +runhcs is a fork of runc. + +The following is runc's legal notice. + +--- + +runc + +Copyright 2012-2015 Docker, Inc. + +This product includes software developed at Docker, Inc. (http://www.docker.com). + +The following is courtesy of our legal counsel: + +Use and transfer of Docker may be subject to certain restrictions by the +United States and other governments. +It is your responsibility to ensure that your use and/or transfer does not +violate applicable laws. + +For more information, please see http://www.bis.doc.gov + +See also http://www.apache.org/dev/crypto.html and/or seek legal counsel. \ No newline at end of file diff --git a/vendor/github.com/Microsoft/hcsshim/container.go b/vendor/github.com/Microsoft/hcsshim/container.go new file mode 100644 index 0000000000..e142c31544 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/container.go @@ -0,0 +1,192 @@ +package hcsshim + +import ( + "fmt" + "os" + "time" + + "github.com/Microsoft/hcsshim/internal/hcs" + "github.com/Microsoft/hcsshim/internal/mergemaps" + "github.com/Microsoft/hcsshim/internal/schema1" +) + +// ContainerProperties holds the properties for a container and the processes running in that container +type ContainerProperties = schema1.ContainerProperties + +// MemoryStats holds the memory statistics for a container +type MemoryStats = schema1.MemoryStats + +// ProcessorStats holds the processor statistics for a container +type ProcessorStats = schema1.ProcessorStats + +// StorageStats holds the storage statistics for a container +type StorageStats = schema1.StorageStats + +// NetworkStats holds the network statistics for a container +type NetworkStats = schema1.NetworkStats + +// Statistics is the structure returned by a statistics call on a container +type Statistics = schema1.Statistics + +// ProcessList is the structure of an item returned by a ProcessList call on a container +type ProcessListItem = schema1.ProcessListItem + +// MappedVirtualDiskController is the structure of an item returned by a MappedVirtualDiskList call on a container +type MappedVirtualDiskController = schema1.MappedVirtualDiskController + +// Type of Request Support in ModifySystem +type RequestType = schema1.RequestType + +// Type of Resource Support in ModifySystem +type ResourceType = schema1.ResourceType + +// RequestType const +const ( + Add = schema1.Add + Remove = schema1.Remove + Network = schema1.Network +) + +// ResourceModificationRequestResponse is the structure used to send request to the container to modify the system +// Supported resource types are Network and Request Types are Add/Remove +type ResourceModificationRequestResponse = schema1.ResourceModificationRequestResponse + +type container struct { + system *hcs.System +} + +// createComputeSystemAdditionalJSON is read from the environment at initialisation +// time. It allows an environment variable to define additional JSON which +// is merged in the CreateComputeSystem call to HCS. +var createContainerAdditionalJSON []byte + +func init() { + createContainerAdditionalJSON = ([]byte)(os.Getenv("HCSSHIM_CREATECONTAINER_ADDITIONALJSON")) +} + +// CreateContainer creates a new container with the given configuration but does not start it. +func CreateContainer(id string, c *ContainerConfig) (Container, error) { + fullConfig, err := mergemaps.MergeJSON(c, createContainerAdditionalJSON) + if err != nil { + return nil, fmt.Errorf("failed to merge additional JSON '%s': %s", createContainerAdditionalJSON, err) + } + + system, err := hcs.CreateComputeSystem(id, fullConfig) + if err != nil { + return nil, err + } + return &container{system}, err +} + +// OpenContainer opens an existing container by ID. +func OpenContainer(id string) (Container, error) { + system, err := hcs.OpenComputeSystem(id) + if err != nil { + return nil, err + } + return &container{system}, err +} + +// GetContainers gets a list of the containers on the system that match the query +func GetContainers(q ComputeSystemQuery) ([]ContainerProperties, error) { + return hcs.GetComputeSystems(q) +} + +// Start synchronously starts the container. +func (container *container) Start() error { + return convertSystemError(container.system.Start(), container) +} + +// Shutdown requests a container shutdown, but it may not actually be shutdown until Wait() succeeds. +func (container *container) Shutdown() error { + return convertSystemError(container.system.Shutdown(), container) +} + +// Terminate requests a container terminate, but it may not actually be terminated until Wait() succeeds. +func (container *container) Terminate() error { + return convertSystemError(container.system.Terminate(), container) +} + +// Waits synchronously waits for the container to shutdown or terminate. +func (container *container) Wait() error { + return convertSystemError(container.system.Wait(), container) +} + +// WaitTimeout synchronously waits for the container to terminate or the duration to elapse. It +// returns false if timeout occurs. +func (container *container) WaitTimeout(t time.Duration) error { + return convertSystemError(container.system.WaitTimeout(t), container) +} + +// Pause pauses the execution of a container. +func (container *container) Pause() error { + return convertSystemError(container.system.Pause(), container) +} + +// Resume resumes the execution of a container. +func (container *container) Resume() error { + return convertSystemError(container.system.Resume(), container) +} + +// HasPendingUpdates returns true if the container has updates pending to install +func (container *container) HasPendingUpdates() (bool, error) { + return false, nil +} + +// Statistics returns statistics for the container. This is a legacy v1 call +func (container *container) Statistics() (Statistics, error) { + properties, err := container.system.Properties(schema1.PropertyTypeStatistics) + if err != nil { + return Statistics{}, convertSystemError(err, container) + } + + return properties.Statistics, nil +} + +// ProcessList returns an array of ProcessListItems for the container. This is a legacy v1 call +func (container *container) ProcessList() ([]ProcessListItem, error) { + properties, err := container.system.Properties(schema1.PropertyTypeProcessList) + if err != nil { + return nil, convertSystemError(err, container) + } + + return properties.ProcessList, nil +} + +// This is a legacy v1 call +func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskController, error) { + properties, err := container.system.Properties(schema1.PropertyTypeMappedVirtualDisk) + if err != nil { + return nil, convertSystemError(err, container) + } + + return properties.MappedVirtualDiskControllers, nil +} + +// CreateProcess launches a new process within the container. +func (container *container) CreateProcess(c *ProcessConfig) (Process, error) { + p, err := container.system.CreateProcess(c) + if err != nil { + return nil, convertSystemError(err, container) + } + return &process{p}, nil +} + +// OpenProcess gets an interface to an existing process within the container. +func (container *container) OpenProcess(pid int) (Process, error) { + p, err := container.system.OpenProcess(pid) + if err != nil { + return nil, convertSystemError(err, container) + } + return &process{p}, nil +} + +// Close cleans up any state associated with the container but does not terminate or wait for it. +func (container *container) Close() error { + return convertSystemError(container.system.Close(), container) +} + +// Modify the System +func (container *container) Modify(config *ResourceModificationRequestResponse) error { + return convertSystemError(container.system.Modify(config), container) +} diff --git a/vendor/github.com/Microsoft/hcsshim/errors.go b/vendor/github.com/Microsoft/hcsshim/errors.go new file mode 100644 index 0000000000..63efa23c7a --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/errors.go @@ -0,0 +1,257 @@ +package hcsshim + +import ( + "fmt" + "syscall" + + "github.com/Microsoft/hcsshim/internal/hns" + + "github.com/Microsoft/hcsshim/internal/hcs" + "github.com/Microsoft/hcsshim/internal/hcserror" +) + +var ( + // ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists = hcs.exist + ErrComputeSystemDoesNotExist = hcs.ErrComputeSystemDoesNotExist + + // ErrElementNotFound is an error encountered when the object being referenced does not exist + ErrElementNotFound = hcs.ErrElementNotFound + + // ErrElementNotFound is an error encountered when the object being referenced does not exist + ErrNotSupported = hcs.ErrNotSupported + + // ErrInvalidData is an error encountered when the request being sent to hcs is invalid/unsupported + // decimal -2147024883 / hex 0x8007000d + ErrInvalidData = hcs.ErrInvalidData + + // ErrHandleClose is an error encountered when the handle generating the notification being waited on has been closed + ErrHandleClose = hcs.ErrHandleClose + + // ErrAlreadyClosed is an error encountered when using a handle that has been closed by the Close method + ErrAlreadyClosed = hcs.ErrAlreadyClosed + + // ErrInvalidNotificationType is an error encountered when an invalid notification type is used + ErrInvalidNotificationType = hcs.ErrInvalidNotificationType + + // ErrInvalidProcessState is an error encountered when the process is not in a valid state for the requested operation + ErrInvalidProcessState = hcs.ErrInvalidProcessState + + // ErrTimeout is an error encountered when waiting on a notification times out + ErrTimeout = hcs.ErrTimeout + + // ErrUnexpectedContainerExit is the error encountered when a container exits while waiting for + // a different expected notification + ErrUnexpectedContainerExit = hcs.ErrUnexpectedContainerExit + + // ErrUnexpectedProcessAbort is the error encountered when communication with the compute service + // is lost while waiting for a notification + ErrUnexpectedProcessAbort = hcs.ErrUnexpectedProcessAbort + + // ErrUnexpectedValue is an error encountered when hcs returns an invalid value + ErrUnexpectedValue = hcs.ErrUnexpectedValue + + // ErrVmcomputeAlreadyStopped is an error encountered when a shutdown or terminate request is made on a stopped container + ErrVmcomputeAlreadyStopped = hcs.ErrVmcomputeAlreadyStopped + + // ErrVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously + ErrVmcomputeOperationPending = hcs.ErrVmcomputeOperationPending + + // ErrVmcomputeOperationInvalidState is an error encountered when the compute system is not in a valid state for the requested operation + ErrVmcomputeOperationInvalidState = hcs.ErrVmcomputeOperationInvalidState + + // ErrProcNotFound is an error encountered when the the process cannot be found + ErrProcNotFound = hcs.ErrProcNotFound + + // ErrVmcomputeOperationAccessIsDenied is an error which can be encountered when enumerating compute systems in RS1/RS2 + // builds when the underlying silo might be in the process of terminating. HCS was fixed in RS3. + ErrVmcomputeOperationAccessIsDenied = hcs.ErrVmcomputeOperationAccessIsDenied + + // ErrVmcomputeInvalidJSON is an error encountered when the compute system does not support/understand the messages sent by management + ErrVmcomputeInvalidJSON = hcs.ErrVmcomputeInvalidJSON + + // ErrVmcomputeUnknownMessage is an error encountered guest compute system doesn't support the message + ErrVmcomputeUnknownMessage = hcs.ErrVmcomputeUnknownMessage + + // ErrNotSupported is an error encountered when hcs doesn't support the request + ErrPlatformNotSupported = hcs.ErrPlatformNotSupported +) + +type EndpointNotFoundError = hns.EndpointNotFoundError +type NetworkNotFoundError = hns.NetworkNotFoundError + +// ProcessError is an error encountered in HCS during an operation on a Process object +type ProcessError struct { + Process *process + Operation string + ExtraInfo string + Err error + Events []hcs.ErrorEvent +} + +// ContainerError is an error encountered in HCS during an operation on a Container object +type ContainerError struct { + Container *container + Operation string + ExtraInfo string + Err error + Events []hcs.ErrorEvent +} + +func (e *ContainerError) Error() string { + if e == nil { + return "" + } + + if e.Container == nil { + return "unexpected nil container for error: " + e.Err.Error() + } + + s := "container " + e.Container.system.ID() + + if e.Operation != "" { + s += " encountered an error during " + e.Operation + } + + switch e.Err.(type) { + case nil: + break + case syscall.Errno: + s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, hcserror.Win32FromError(e.Err)) + default: + s += fmt.Sprintf(": %s", e.Err.Error()) + } + + for _, ev := range e.Events { + s += "\n" + ev.String() + } + + if e.ExtraInfo != "" { + s += " extra info: " + e.ExtraInfo + } + + return s +} + +func makeContainerError(container *container, operation string, extraInfo string, err error) error { + // Don't double wrap errors + if _, ok := err.(*ContainerError); ok { + return err + } + containerError := &ContainerError{Container: container, Operation: operation, ExtraInfo: extraInfo, Err: err} + return containerError +} + +func (e *ProcessError) Error() string { + if e == nil { + return "" + } + + if e.Process == nil { + return "Unexpected nil process for error: " + e.Err.Error() + } + + s := fmt.Sprintf("process %d in container %s", e.Process.p.Pid(), e.Process.p.SystemID()) + if e.Operation != "" { + s += " encountered an error during " + e.Operation + } + + switch e.Err.(type) { + case nil: + break + case syscall.Errno: + s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, hcserror.Win32FromError(e.Err)) + default: + s += fmt.Sprintf(": %s", e.Err.Error()) + } + + for _, ev := range e.Events { + s += "\n" + ev.String() + } + + return s +} + +func makeProcessError(process *process, operation string, extraInfo string, err error) error { + // Don't double wrap errors + if _, ok := err.(*ProcessError); ok { + return err + } + processError := &ProcessError{Process: process, Operation: operation, ExtraInfo: extraInfo, Err: err} + return processError +} + +// IsNotExist checks if an error is caused by the Container or Process not existing. +// Note: Currently, ErrElementNotFound can mean that a Process has either +// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist +// will currently return true when the error is ErrElementNotFound or ErrProcNotFound. +func IsNotExist(err error) bool { + if _, ok := err.(EndpointNotFoundError); ok { + return true + } + if _, ok := err.(NetworkNotFoundError); ok { + return true + } + return hcs.IsNotExist(getInnerError(err)) +} + +// IsAlreadyClosed checks if an error is caused by the Container or Process having been +// already closed by a call to the Close() method. +func IsAlreadyClosed(err error) bool { + return hcs.IsAlreadyClosed(getInnerError(err)) +} + +// IsPending returns a boolean indicating whether the error is that +// the requested operation is being completed in the background. +func IsPending(err error) bool { + return hcs.IsPending(getInnerError(err)) +} + +// IsTimeout returns a boolean indicating whether the error is caused by +// a timeout waiting for the operation to complete. +func IsTimeout(err error) bool { + return hcs.IsTimeout(getInnerError(err)) +} + +// IsAlreadyStopped returns a boolean indicating whether the error is caused by +// a Container or Process being already stopped. +// Note: Currently, ErrElementNotFound can mean that a Process has either +// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist +// will currently return true when the error is ErrElementNotFound or ErrProcNotFound. +func IsAlreadyStopped(err error) bool { + return hcs.IsAlreadyStopped(getInnerError(err)) +} + +// IsNotSupported returns a boolean indicating whether the error is caused by +// unsupported platform requests +// Note: Currently Unsupported platform requests can be mean either +// ErrVmcomputeInvalidJSON, ErrInvalidData, ErrNotSupported or ErrVmcomputeUnknownMessage +// is thrown from the Platform +func IsNotSupported(err error) bool { + return hcs.IsNotSupported(getInnerError(err)) +} + +func getInnerError(err error) error { + switch pe := err.(type) { + case nil: + return nil + case *ContainerError: + err = pe.Err + case *ProcessError: + err = pe.Err + } + return err +} + +func convertSystemError(err error, c *container) error { + if serr, ok := err.(*hcs.SystemError); ok { + return &ContainerError{Container: c, Operation: serr.Op, ExtraInfo: serr.Extra, Err: serr.Err, Events: serr.Events} + } + return err +} + +func convertProcessError(err error, p *process) error { + if perr, ok := err.(*hcs.ProcessError); ok { + return &ProcessError{Process: p, Operation: perr.Op, Err: perr.Err, Events: perr.Events} + } + return err +} diff --git a/vendor/github.com/Microsoft/hcsshim/hcsshim.go b/vendor/github.com/Microsoft/hcsshim/hcsshim.go new file mode 100644 index 0000000000..ceb3ac85ee --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/hcsshim.go @@ -0,0 +1,28 @@ +// Shim for the Host Compute Service (HCS) to manage Windows Server +// containers and Hyper-V containers. + +package hcsshim + +import ( + "syscall" + + "github.com/Microsoft/hcsshim/internal/hcserror" +) + +//go:generate go run mksyscall_windows.go -output zsyscall_windows.go hcsshim.go + +//sys SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) = iphlpapi.SetCurrentThreadCompartmentId + +const ( + // Specific user-visible exit codes + WaitErrExecFailed = 32767 + + ERROR_GEN_FAILURE = hcserror.ERROR_GEN_FAILURE + ERROR_SHUTDOWN_IN_PROGRESS = syscall.Errno(1115) + WSAEINVAL = syscall.Errno(10022) + + // Timeout on wait calls + TimeoutInfinite = 0xFFFFFFFF +) + +type HcsError = hcserror.HcsError diff --git a/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go b/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go new file mode 100644 index 0000000000..eb013d2c42 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go @@ -0,0 +1,94 @@ +package hcsshim + +import ( + "github.com/Microsoft/hcsshim/internal/hns" +) + +// HNSEndpoint represents a network endpoint in HNS +type HNSEndpoint = hns.HNSEndpoint + +// Namespace represents a Compartment. +type Namespace = hns.Namespace + +//SystemType represents the type of the system on which actions are done +type SystemType string + +// SystemType const +const ( + ContainerType SystemType = "Container" + VirtualMachineType SystemType = "VirtualMachine" + HostType SystemType = "Host" +) + +// EndpointAttachDetachRequest is the structure used to send request to the container to modify the system +// Supported resource types are Network and Request Types are Add/Remove +type EndpointAttachDetachRequest = hns.EndpointAttachDetachRequest + +// EndpointResquestResponse is object to get the endpoint request response +type EndpointResquestResponse = hns.EndpointResquestResponse + +// HNSEndpointRequest makes a HNS call to modify/query a network endpoint +func HNSEndpointRequest(method, path, request string) (*HNSEndpoint, error) { + return hns.HNSEndpointRequest(method, path, request) +} + +// HNSListEndpointRequest makes a HNS call to query the list of available endpoints +func HNSListEndpointRequest() ([]HNSEndpoint, error) { + return hns.HNSListEndpointRequest() +} + +// HotAttachEndpoint makes a HCS Call to attach the endpoint to the container +func HotAttachEndpoint(containerID string, endpointID string) error { + return modifyNetworkEndpoint(containerID, endpointID, Add) +} + +// HotDetachEndpoint makes a HCS Call to detach the endpoint from the container +func HotDetachEndpoint(containerID string, endpointID string) error { + return modifyNetworkEndpoint(containerID, endpointID, Remove) +} + +// ModifyContainer corresponding to the container id, by sending a request +func modifyContainer(id string, request *ResourceModificationRequestResponse) error { + container, err := OpenContainer(id) + if err != nil { + if IsNotExist(err) { + return ErrComputeSystemDoesNotExist + } + return getInnerError(err) + } + defer container.Close() + err = container.Modify(request) + if err != nil { + if IsNotSupported(err) { + return ErrPlatformNotSupported + } + return getInnerError(err) + } + + return nil +} + +func modifyNetworkEndpoint(containerID string, endpointID string, request RequestType) error { + requestMessage := &ResourceModificationRequestResponse{ + Resource: Network, + Request: request, + Data: endpointID, + } + err := modifyContainer(containerID, requestMessage) + + if err != nil { + return err + } + + return nil +} + +// GetHNSEndpointByID get the Endpoint by ID +func GetHNSEndpointByID(endpointID string) (*HNSEndpoint, error) { + return hns.GetHNSEndpointByID(endpointID) +} + +// GetHNSEndpointByName gets the endpoint filtered by Name +func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) { + return hns.GetHNSEndpointByName(endpointName) +} diff --git a/vendor/github.com/Microsoft/hcsshim/hnsglobals.go b/vendor/github.com/Microsoft/hcsshim/hnsglobals.go new file mode 100644 index 0000000000..2b53819047 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/hnsglobals.go @@ -0,0 +1,16 @@ +package hcsshim + +import ( + "github.com/Microsoft/hcsshim/internal/hns" +) + +type HNSGlobals = hns.HNSGlobals +type HNSVersion = hns.HNSVersion + +var ( + HNSVersion1803 = hns.HNSVersion1803 +) + +func GetHNSGlobals() (*HNSGlobals, error) { + return hns.GetHNSGlobals() +} diff --git a/vendor/github.com/Microsoft/hcsshim/hnsnetwork.go b/vendor/github.com/Microsoft/hcsshim/hnsnetwork.go new file mode 100644 index 0000000000..f775fa1d07 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/hnsnetwork.go @@ -0,0 +1,36 @@ +package hcsshim + +import ( + "github.com/Microsoft/hcsshim/internal/hns" +) + +// Subnet is assoicated with a network and represents a list +// of subnets available to the network +type Subnet = hns.Subnet + +// MacPool is assoicated with a network and represents a list +// of macaddresses available to the network +type MacPool = hns.MacPool + +// HNSNetwork represents a network in HNS +type HNSNetwork = hns.HNSNetwork + +// HNSNetworkRequest makes a call into HNS to update/query a single network +func HNSNetworkRequest(method, path, request string) (*HNSNetwork, error) { + return hns.HNSNetworkRequest(method, path, request) +} + +// HNSListNetworkRequest makes a HNS call to query the list of available networks +func HNSListNetworkRequest(method, path, request string) ([]HNSNetwork, error) { + return hns.HNSListNetworkRequest(method, path, request) +} + +// GetHNSNetworkByID +func GetHNSNetworkByID(networkID string) (*HNSNetwork, error) { + return hns.GetHNSNetworkByID(networkID) +} + +// GetHNSNetworkName filtered by Name +func GetHNSNetworkByName(networkName string) (*HNSNetwork, error) { + return hns.GetHNSNetworkByName(networkName) +} diff --git a/vendor/github.com/Microsoft/hcsshim/hnspolicy.go b/vendor/github.com/Microsoft/hcsshim/hnspolicy.go new file mode 100644 index 0000000000..a3e03ff8fc --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/hnspolicy.go @@ -0,0 +1,57 @@ +package hcsshim + +import ( + "github.com/Microsoft/hcsshim/internal/hns" +) + +// Type of Request Support in ModifySystem +type PolicyType = hns.PolicyType + +// RequestType const +const ( + Nat = hns.Nat + ACL = hns.ACL + PA = hns.PA + VLAN = hns.VLAN + VSID = hns.VSID + VNet = hns.VNet + L2Driver = hns.L2Driver + Isolation = hns.Isolation + QOS = hns.QOS + OutboundNat = hns.OutboundNat + ExternalLoadBalancer = hns.ExternalLoadBalancer + Route = hns.Route +) + +type NatPolicy = hns.NatPolicy + +type QosPolicy = hns.QosPolicy + +type IsolationPolicy = hns.IsolationPolicy + +type VlanPolicy = hns.VlanPolicy + +type VsidPolicy = hns.VsidPolicy + +type PaPolicy = hns.PaPolicy + +type OutboundNatPolicy = hns.OutboundNatPolicy + +type ActionType = hns.ActionType +type DirectionType = hns.DirectionType +type RuleType = hns.RuleType + +const ( + Allow = hns.Allow + Block = hns.Block + + In = hns.In + Out = hns.Out + + Host = hns.Host + Switch = hns.Switch +) + +type ACLPolicy = hns.ACLPolicy + +type Policy = hns.Policy diff --git a/vendor/github.com/Microsoft/hcsshim/hnspolicylist.go b/vendor/github.com/Microsoft/hcsshim/hnspolicylist.go new file mode 100644 index 0000000000..12c2b97029 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/hnspolicylist.go @@ -0,0 +1,47 @@ +package hcsshim + +import ( + "github.com/Microsoft/hcsshim/internal/hns" +) + +// RoutePolicy is a structure defining schema for Route based Policy +type RoutePolicy = hns.RoutePolicy + +// ELBPolicy is a structure defining schema for ELB LoadBalancing based Policy +type ELBPolicy = hns.ELBPolicy + +// LBPolicy is a structure defining schema for LoadBalancing based Policy +type LBPolicy = hns.LBPolicy + +// PolicyList is a structure defining schema for Policy list request +type PolicyList = hns.PolicyList + +// HNSPolicyListRequest makes a call into HNS to update/query a single network +func HNSPolicyListRequest(method, path, request string) (*PolicyList, error) { + return hns.HNSPolicyListRequest(method, path, request) +} + +// HNSListPolicyListRequest gets all the policy list +func HNSListPolicyListRequest() ([]PolicyList, error) { + return hns.HNSListPolicyListRequest() +} + +// PolicyListRequest makes a HNS call to modify/query a network policy list +func PolicyListRequest(method, path, request string) (*PolicyList, error) { + return hns.PolicyListRequest(method, path, request) +} + +// GetPolicyListByID get the policy list by ID +func GetPolicyListByID(policyListID string) (*PolicyList, error) { + return hns.GetPolicyListByID(policyListID) +} + +// AddLoadBalancer policy list for the specified endpoints +func AddLoadBalancer(endpoints []HNSEndpoint, isILB bool, isDSR bool, sourceVIP, vip string, protocol uint16, internalPort uint16, externalPort uint16) (*PolicyList, error) { + return hns.AddLoadBalancer(endpoints, isILB, isDSR, sourceVIP, vip, protocol, internalPort, externalPort) +} + +// AddRoute adds route policy list for the specified endpoints +func AddRoute(endpoints []HNSEndpoint, destinationPrefix string, nextHop string, encapEnabled bool) (*PolicyList, error) { + return hns.AddRoute(endpoints, destinationPrefix, nextHop, encapEnabled) +} diff --git a/vendor/github.com/Microsoft/hcsshim/hnssupport.go b/vendor/github.com/Microsoft/hcsshim/hnssupport.go new file mode 100644 index 0000000000..69405244b6 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/hnssupport.go @@ -0,0 +1,13 @@ +package hcsshim + +import ( + "github.com/Microsoft/hcsshim/internal/hns" +) + +type HNSSupportedFeatures = hns.HNSSupportedFeatures + +type HNSAclFeatures = hns.HNSAclFeatures + +func GetHNSSupportedFeatures() HNSSupportedFeatures { + return hns.GetHNSSupportedFeatures() +} diff --git a/vendor/github.com/Microsoft/hcsshim/interface.go b/vendor/github.com/Microsoft/hcsshim/interface.go new file mode 100644 index 0000000000..5b91e0cc55 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/interface.go @@ -0,0 +1,114 @@ +package hcsshim + +import ( + "io" + "time" + + "github.com/Microsoft/hcsshim/internal/schema1" +) + +// ProcessConfig is used as both the input of Container.CreateProcess +// and to convert the parameters to JSON for passing onto the HCS +type ProcessConfig = schema1.ProcessConfig + +type Layer = schema1.Layer +type MappedDir = schema1.MappedDir +type MappedPipe = schema1.MappedPipe +type HvRuntime = schema1.HvRuntime +type MappedVirtualDisk = schema1.MappedVirtualDisk + +// AssignedDevice represents a device that has been directly assigned to a container +// +// NOTE: Support added in RS5 +type AssignedDevice = schema1.AssignedDevice + +// ContainerConfig is used as both the input of CreateContainer +// and to convert the parameters to JSON for passing onto the HCS +type ContainerConfig = schema1.ContainerConfig + +type ComputeSystemQuery = schema1.ComputeSystemQuery + +// Container represents a created (but not necessarily running) container. +type Container interface { + // Start synchronously starts the container. + Start() error + + // Shutdown requests a container shutdown, but it may not actually be shutdown until Wait() succeeds. + Shutdown() error + + // Terminate requests a container terminate, but it may not actually be terminated until Wait() succeeds. + Terminate() error + + // Waits synchronously waits for the container to shutdown or terminate. + Wait() error + + // WaitTimeout synchronously waits for the container to terminate or the duration to elapse. It + // returns false if timeout occurs. + WaitTimeout(time.Duration) error + + // Pause pauses the execution of a container. + Pause() error + + // Resume resumes the execution of a container. + Resume() error + + // HasPendingUpdates returns true if the container has updates pending to install. + HasPendingUpdates() (bool, error) + + // Statistics returns statistics for a container. + Statistics() (Statistics, error) + + // ProcessList returns details for the processes in a container. + ProcessList() ([]ProcessListItem, error) + + // MappedVirtualDisks returns virtual disks mapped to a utility VM, indexed by controller + MappedVirtualDisks() (map[int]MappedVirtualDiskController, error) + + // CreateProcess launches a new process within the container. + CreateProcess(c *ProcessConfig) (Process, error) + + // OpenProcess gets an interface to an existing process within the container. + OpenProcess(pid int) (Process, error) + + // Close cleans up any state associated with the container but does not terminate or wait for it. + Close() error + + // Modify the System + Modify(config *ResourceModificationRequestResponse) error +} + +// Process represents a running or exited process. +type Process interface { + // Pid returns the process ID of the process within the container. + Pid() int + + // Kill signals the process to terminate but does not wait for it to finish terminating. + Kill() error + + // Wait waits for the process to exit. + Wait() error + + // WaitTimeout waits for the process to exit or the duration to elapse. It returns + // false if timeout occurs. + WaitTimeout(time.Duration) error + + // ExitCode returns the exit code of the process. The process must have + // already terminated. + ExitCode() (int, error) + + // ResizeConsole resizes the console of the process. + ResizeConsole(width, height uint16) error + + // Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing + // these pipes does not close the underlying pipes; it should be possible to + // call this multiple times to get multiple interfaces. + Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, error) + + // CloseStdin closes the write side of the stdin pipe so that the process is + // notified on the read side that there is no more data in stdin. + CloseStdin() error + + // Close cleans up any state associated with the process but does not kill + // or wait on it. + Close() error +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go b/vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go new file mode 100644 index 0000000000..9f926c6be7 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go @@ -0,0 +1,85 @@ +package guestrequest + +import "github.com/Microsoft/hcsshim/internal/schema2" + +// Arguably, many of these (at least CombinedLayers) should have been generated +// by swagger. +// +// This will also change package name due to an inbound breaking change. + +// This class is used by a modify request to add or remove a combined layers +// structure in the guest. For windows, the GCS applies a filter in ContainerRootPath +// using the specified layers as the parent content. Ignores property ScratchPath +// since the container path is already the scratch path. For linux, the GCS unions +// the specified layers and ScratchPath together, placing the resulting union +// filesystem at ContainerRootPath. +type CombinedLayers struct { + ContainerRootPath string `json:"ContainerRootPath,omitempty"` + Layers []hcsschema.Layer `json:"Layers,omitempty"` + ScratchPath string `json:"ScratchPath,omitempty"` +} + +// Defines the schema for hosted settings passed to GCS and/or OpenGCS + +// SCSI. Scratch space for remote file-system commands, or R/W layer for containers +type LCOWMappedVirtualDisk struct { + MountPath string `json:"MountPath,omitempty"` // /tmp/scratch for an LCOW utility VM being used as a service VM + Lun uint8 `json:"Lun,omitempty"` + Controller uint8 `json:"Controller,omitempty"` + ReadOnly bool `json:"ReadOnly,omitempty"` +} + +type WCOWMappedVirtualDisk struct { + ContainerPath string `json:"ContainerPath,omitempty"` + Lun int32 `json:"Lun,omitempty"` +} + +type LCOWMappedDirectory struct { + MountPath string `json:"MountPath,omitempty"` + Port int32 `json:"Port,omitempty"` + ShareName string `json:"ShareName,omitempty"` // If empty not using ANames (not currently supported) + ReadOnly bool `json:"ReadOnly,omitempty"` +} + +// Read-only layers over VPMem +type LCOWMappedVPMemDevice struct { + DeviceNumber uint32 `json:"DeviceNumber,omitempty"` + MountPath string `json:"MountPath,omitempty"` // /tmp/pN +} + +type ResourceType string + +const ( + // These are constants for v2 schema modify guest requests. + ResourceTypeMappedDirectory ResourceType = "MappedDirectory" + ResourceTypeMappedVirtualDisk ResourceType = "MappedVirtualDisk" + ResourceTypeNetwork ResourceType = "Network" + ResourceTypeNetworkNamespace ResourceType = "NetworkNamespace" + ResourceTypeCombinedLayers ResourceType = "CombinedLayers" + ResourceTypeVPMemDevice ResourceType = "VPMemDevice" +) + +// GuestRequest is for modify commands passed to the guest. +type GuestRequest struct { + RequestType string `json:"RequestType,omitempty"` + ResourceType ResourceType `json:"ResourceType,omitempty"` + Settings interface{} `json:"Settings,omitempty"` +} + +type NetworkModifyRequest struct { + AdapterId string `json:"AdapterId,omitempty"` + RequestType string `json:"RequestType,omitempty"` + Settings interface{} `json:"Settings,omitempty"` +} + +type RS4NetworkModifyRequest struct { + AdapterInstanceId string `json:"AdapterInstanceId,omitempty"` + RequestType string `json:"RequestType,omitempty"` + Settings interface{} `json:"Settings,omitempty"` +} + +// SignalProcessOptions is the options passed to either WCOW or LCOW +// to signal a given process. +type SignalProcessOptions struct { + Signal int `json:,omitempty` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go b/vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go new file mode 100644 index 0000000000..e9e45c0306 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go @@ -0,0 +1,69 @@ +package guid + +import ( + "crypto/rand" + "encoding/json" + "fmt" + "io" + "strconv" + "strings" +) + +var _ = (json.Marshaler)(&GUID{}) +var _ = (json.Unmarshaler)(&GUID{}) + +type GUID [16]byte + +func New() GUID { + g := GUID{} + _, err := io.ReadFull(rand.Reader, g[:]) + if err != nil { + panic(err) + } + return g +} + +func (g GUID) String() string { + return fmt.Sprintf("%02x%02x%02x%02x-%02x%02x-%02x%02x-%02x-%02x", g[3], g[2], g[1], g[0], g[5], g[4], g[7], g[6], g[8:10], g[10:]) +} + +func FromString(s string) GUID { + if len(s) != 36 { + panic(fmt.Sprintf("invalid GUID length: %d", len(s))) + } + if s[8] != '-' || s[13] != '-' || s[18] != '-' || s[23] != '-' { + panic("invalid GUID format") + } + indexOrder := [16]int{ + 0, 2, 4, 6, + 9, 11, + 14, 16, + 19, 21, + 24, 26, 28, 30, 32, 34, + } + byteOrder := [16]int{ + 3, 2, 1, 0, + 5, 4, + 7, 6, + 8, 9, + 10, 11, 12, 13, 14, 15, + } + var g GUID + for i, x := range indexOrder { + b, err := strconv.ParseInt(s[x:x+2], 16, 16) + if err != nil { + panic(err) + } + g[byteOrder[i]] = byte(b) + } + return g +} + +func (g GUID) MarshalJSON() ([]byte, error) { + return json.Marshal(g.String()) +} + +func (g *GUID) UnmarshalJSON(data []byte) error { + *g = FromString(strings.Trim(string(data), "\"")) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go new file mode 100644 index 0000000000..e41c40ec8f --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go @@ -0,0 +1,81 @@ +package hcs + +import ( + "sync" + "syscall" + + "github.com/Microsoft/hcsshim/internal/interop" +) + +var ( + nextCallback uintptr + callbackMap = map[uintptr]*notifcationWatcherContext{} + callbackMapLock = sync.RWMutex{} + + notificationWatcherCallback = syscall.NewCallback(notificationWatcher) + + // Notifications for HCS_SYSTEM handles + hcsNotificationSystemExited hcsNotification = 0x00000001 + hcsNotificationSystemCreateCompleted hcsNotification = 0x00000002 + hcsNotificationSystemStartCompleted hcsNotification = 0x00000003 + hcsNotificationSystemPauseCompleted hcsNotification = 0x00000004 + hcsNotificationSystemResumeCompleted hcsNotification = 0x00000005 + + // Notifications for HCS_PROCESS handles + hcsNotificationProcessExited hcsNotification = 0x00010000 + + // Common notifications + hcsNotificationInvalid hcsNotification = 0x00000000 + hcsNotificationServiceDisconnect hcsNotification = 0x01000000 +) + +type hcsNotification uint32 +type notificationChannel chan error + +type notifcationWatcherContext struct { + channels notificationChannels + handle hcsCallback +} + +type notificationChannels map[hcsNotification]notificationChannel + +func newChannels() notificationChannels { + channels := make(notificationChannels) + + channels[hcsNotificationSystemExited] = make(notificationChannel, 1) + channels[hcsNotificationSystemCreateCompleted] = make(notificationChannel, 1) + channels[hcsNotificationSystemStartCompleted] = make(notificationChannel, 1) + channels[hcsNotificationSystemPauseCompleted] = make(notificationChannel, 1) + channels[hcsNotificationSystemResumeCompleted] = make(notificationChannel, 1) + channels[hcsNotificationProcessExited] = make(notificationChannel, 1) + channels[hcsNotificationServiceDisconnect] = make(notificationChannel, 1) + return channels +} +func closeChannels(channels notificationChannels) { + close(channels[hcsNotificationSystemExited]) + close(channels[hcsNotificationSystemCreateCompleted]) + close(channels[hcsNotificationSystemStartCompleted]) + close(channels[hcsNotificationSystemPauseCompleted]) + close(channels[hcsNotificationSystemResumeCompleted]) + close(channels[hcsNotificationProcessExited]) + close(channels[hcsNotificationServiceDisconnect]) +} + +func notificationWatcher(notificationType hcsNotification, callbackNumber uintptr, notificationStatus uintptr, notificationData *uint16) uintptr { + var result error + if int32(notificationStatus) < 0 { + result = interop.Win32FromHresult(notificationStatus) + } + + callbackMapLock.RLock() + context := callbackMap[callbackNumber] + callbackMapLock.RUnlock() + + if context == nil { + return 0 + } + + context.channels[notificationType] <- result + + return 0 +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/cgo.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/cgo.go new file mode 100644 index 0000000000..3669c34aa2 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/cgo.go @@ -0,0 +1,7 @@ +package hcs + +import "C" + +// This import is needed to make the library compile as CGO because HCSSHIM +// only works with CGO due to callbacks from HCS comming back from a C thread +// which is not supported without CGO. See https://github.com/golang/go/issues/10973 diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go new file mode 100644 index 0000000000..7471f5cc13 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go @@ -0,0 +1,279 @@ +package hcs + +import ( + "encoding/json" + "errors" + "fmt" + "syscall" + + "github.com/Microsoft/hcsshim/internal/interop" + "github.com/sirupsen/logrus" +) + +var ( + // ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists + ErrComputeSystemDoesNotExist = syscall.Errno(0xc037010e) + + // ErrElementNotFound is an error encountered when the object being referenced does not exist + ErrElementNotFound = syscall.Errno(0x490) + + // ErrElementNotFound is an error encountered when the object being referenced does not exist + ErrNotSupported = syscall.Errno(0x32) + + // ErrInvalidData is an error encountered when the request being sent to hcs is invalid/unsupported + // decimal -2147024883 / hex 0x8007000d + ErrInvalidData = syscall.Errno(0xd) + + // ErrHandleClose is an error encountered when the handle generating the notification being waited on has been closed + ErrHandleClose = errors.New("hcsshim: the handle generating this notification has been closed") + + // ErrAlreadyClosed is an error encountered when using a handle that has been closed by the Close method + ErrAlreadyClosed = errors.New("hcsshim: the handle has already been closed") + + // ErrInvalidNotificationType is an error encountered when an invalid notification type is used + ErrInvalidNotificationType = errors.New("hcsshim: invalid notification type") + + // ErrInvalidProcessState is an error encountered when the process is not in a valid state for the requested operation + ErrInvalidProcessState = errors.New("the process is in an invalid state for the attempted operation") + + // ErrTimeout is an error encountered when waiting on a notification times out + ErrTimeout = errors.New("hcsshim: timeout waiting for notification") + + // ErrUnexpectedContainerExit is the error encountered when a container exits while waiting for + // a different expected notification + ErrUnexpectedContainerExit = errors.New("unexpected container exit") + + // ErrUnexpectedProcessAbort is the error encountered when communication with the compute service + // is lost while waiting for a notification + ErrUnexpectedProcessAbort = errors.New("lost communication with compute service") + + // ErrUnexpectedValue is an error encountered when hcs returns an invalid value + ErrUnexpectedValue = errors.New("unexpected value returned from hcs") + + // ErrVmcomputeAlreadyStopped is an error encountered when a shutdown or terminate request is made on a stopped container + ErrVmcomputeAlreadyStopped = syscall.Errno(0xc0370110) + + // ErrVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously + ErrVmcomputeOperationPending = syscall.Errno(0xC0370103) + + // ErrVmcomputeOperationInvalidState is an error encountered when the compute system is not in a valid state for the requested operation + ErrVmcomputeOperationInvalidState = syscall.Errno(0xc0370105) + + // ErrProcNotFound is an error encountered when the the process cannot be found + ErrProcNotFound = syscall.Errno(0x7f) + + // ErrVmcomputeOperationAccessIsDenied is an error which can be encountered when enumerating compute systems in RS1/RS2 + // builds when the underlying silo might be in the process of terminating. HCS was fixed in RS3. + ErrVmcomputeOperationAccessIsDenied = syscall.Errno(0x5) + + // ErrVmcomputeInvalidJSON is an error encountered when the compute system does not support/understand the messages sent by management + ErrVmcomputeInvalidJSON = syscall.Errno(0xc037010d) + + // ErrVmcomputeUnknownMessage is an error encountered guest compute system doesn't support the message + ErrVmcomputeUnknownMessage = syscall.Errno(0xc037010b) + + // ErrNotSupported is an error encountered when hcs doesn't support the request + ErrPlatformNotSupported = errors.New("unsupported platform request") +) + +type ErrorEvent struct { + Message string `json:"Message,omitempty"` // Fully formated error message + StackTrace string `json:"StackTrace,omitempty"` // Stack trace in string form + Provider string `json:"Provider,omitempty"` + EventID uint16 `json:"EventId,omitempty"` + Flags uint32 `json:"Flags,omitempty"` + Source string `json:"Source,omitempty"` + //Data []EventData `json:"Data,omitempty"` // Omit this as HCS doesn't encode this well. It's more confusing to include. It is however logged in debug mode (see processHcsResult function) +} + +type hcsResult struct { + Error int32 + ErrorMessage string + ErrorEvents []ErrorEvent `json:"ErrorEvents,omitempty"` +} + +func (ev *ErrorEvent) String() string { + evs := "[Event Detail: " + ev.Message + if ev.StackTrace != "" { + evs += " Stack Trace: " + ev.StackTrace + } + if ev.Provider != "" { + evs += " Provider: " + ev.Provider + } + if ev.EventID != 0 { + evs = fmt.Sprintf("%s EventID: %d", evs, ev.EventID) + } + if ev.Flags != 0 { + evs = fmt.Sprintf("%s flags: %d", evs, ev.Flags) + } + if ev.Source != "" { + evs += " Source: " + ev.Source + } + evs += "]" + return evs +} + +func processHcsResult(resultp *uint16) []ErrorEvent { + if resultp != nil { + resultj := interop.ConvertAndFreeCoTaskMemString(resultp) + logrus.Debugf("Result: %s", resultj) + result := &hcsResult{} + if err := json.Unmarshal([]byte(resultj), result); err != nil { + logrus.Warnf("Could not unmarshal HCS result %s: %s", resultj, err) + return nil + } + return result.ErrorEvents + } + return nil +} + +type HcsError struct { + Op string + Err error + Events []ErrorEvent +} + +func (e *HcsError) Error() string { + s := e.Op + ": " + e.Err.Error() + for _, ev := range e.Events { + s += "\n" + ev.String() + } + return s +} + +// ProcessError is an error encountered in HCS during an operation on a Process object +type ProcessError struct { + SystemID string + Pid int + Op string + Err error + Events []ErrorEvent +} + +// SystemError is an error encountered in HCS during an operation on a Container object +type SystemError struct { + ID string + Op string + Err error + Extra string + Events []ErrorEvent +} + +func (e *SystemError) Error() string { + s := e.Op + " " + e.ID + ": " + e.Err.Error() + for _, ev := range e.Events { + s += "\n" + ev.String() + } + if e.Extra != "" { + s += "\n(extra info: " + e.Extra + ")" + } + return s +} + +func makeSystemError(system *System, op string, extra string, err error, events []ErrorEvent) error { + // Don't double wrap errors + if _, ok := err.(*SystemError); ok { + return err + } + return &SystemError{ + ID: system.ID(), + Op: op, + Extra: extra, + Err: err, + Events: events, + } +} + +func (e *ProcessError) Error() string { + s := fmt.Sprintf("%s %s:%d: %s", e.Op, e.SystemID, e.Pid, e.Err.Error()) + for _, ev := range e.Events { + s += "\n" + ev.String() + } + return s +} + +func makeProcessError(process *Process, op string, err error, events []ErrorEvent) error { + // Don't double wrap errors + if _, ok := err.(*ProcessError); ok { + return err + } + return &ProcessError{ + Pid: process.Pid(), + SystemID: process.SystemID(), + Op: op, + Err: err, + Events: events, + } +} + +// IsNotExist checks if an error is caused by the Container or Process not existing. +// Note: Currently, ErrElementNotFound can mean that a Process has either +// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist +// will currently return true when the error is ErrElementNotFound or ErrProcNotFound. +func IsNotExist(err error) bool { + err = getInnerError(err) + return err == ErrComputeSystemDoesNotExist || + err == ErrElementNotFound || + err == ErrProcNotFound +} + +// IsAlreadyClosed checks if an error is caused by the Container or Process having been +// already closed by a call to the Close() method. +func IsAlreadyClosed(err error) bool { + err = getInnerError(err) + return err == ErrAlreadyClosed +} + +// IsPending returns a boolean indicating whether the error is that +// the requested operation is being completed in the background. +func IsPending(err error) bool { + err = getInnerError(err) + return err == ErrVmcomputeOperationPending +} + +// IsTimeout returns a boolean indicating whether the error is caused by +// a timeout waiting for the operation to complete. +func IsTimeout(err error) bool { + err = getInnerError(err) + return err == ErrTimeout +} + +// IsAlreadyStopped returns a boolean indicating whether the error is caused by +// a Container or Process being already stopped. +// Note: Currently, ErrElementNotFound can mean that a Process has either +// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist +// will currently return true when the error is ErrElementNotFound or ErrProcNotFound. +func IsAlreadyStopped(err error) bool { + err = getInnerError(err) + return err == ErrVmcomputeAlreadyStopped || + err == ErrElementNotFound || + err == ErrProcNotFound +} + +// IsNotSupported returns a boolean indicating whether the error is caused by +// unsupported platform requests +// Note: Currently Unsupported platform requests can be mean either +// ErrVmcomputeInvalidJSON, ErrInvalidData, ErrNotSupported or ErrVmcomputeUnknownMessage +// is thrown from the Platform +func IsNotSupported(err error) bool { + err = getInnerError(err) + // If Platform doesn't recognize or support the request sent, below errors are seen + return err == ErrVmcomputeInvalidJSON || + err == ErrInvalidData || + err == ErrNotSupported || + err == ErrVmcomputeUnknownMessage +} + +func getInnerError(err error) error { + switch pe := err.(type) { + case nil: + return nil + case *HcsError: + err = pe.Err + case *SystemError: + err = pe.Err + case *ProcessError: + err = pe.Err + } + return err +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go new file mode 100644 index 0000000000..b0d49cbcf1 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go @@ -0,0 +1,48 @@ +// Shim for the Host Compute Service (HCS) to manage Windows Server +// containers and Hyper-V containers. + +package hcs + +import ( + "syscall" +) + +//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hcs.go + +//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems? +//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem? +//sys hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem? +//sys hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem? +//sys hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem? +//sys hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem? +//sys hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem? +//sys hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem? +//sys hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem? +//sys hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties? +//sys hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem? +//sys hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback? +//sys hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback? + +//sys hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess? +//sys hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess? +//sys hcsCloseProcess(process hcsProcess) (hr error) = vmcompute.HcsCloseProcess? +//sys hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess? +//sys hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) = vmcompute.HcsTerminateProcess? +//sys hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo? +//sys hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties? +//sys hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess? +//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties? +//sys hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback? +//sys hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback? + +type hcsSystem syscall.Handle +type hcsProcess syscall.Handle +type hcsCallback syscall.Handle + +type hcsProcessInformation struct { + ProcessId uint32 + Reserved uint32 + StdInput syscall.Handle + StdOutput syscall.Handle + StdError syscall.Handle +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go new file mode 100644 index 0000000000..d356cdc4d6 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go @@ -0,0 +1,427 @@ +package hcs + +import ( + "encoding/json" + "fmt" + "io" + "sync" + "syscall" + "time" + + "github.com/Microsoft/hcsshim/internal/guestrequest" + "github.com/Microsoft/hcsshim/internal/interop" + "github.com/sirupsen/logrus" +) + +// ContainerError is an error encountered in HCS +type Process struct { + handleLock sync.RWMutex + handle hcsProcess + processID int + system *System + cachedPipes *cachedPipes + callbackNumber uintptr +} + +type cachedPipes struct { + stdIn syscall.Handle + stdOut syscall.Handle + stdErr syscall.Handle +} + +type processModifyRequest struct { + Operation string + ConsoleSize *consoleSize `json:",omitempty"` + CloseHandle *closeHandle `json:",omitempty"` +} + +type consoleSize struct { + Height uint16 + Width uint16 +} + +type closeHandle struct { + Handle string +} + +type ProcessStatus struct { + ProcessID uint32 + Exited bool + ExitCode uint32 + LastWaitResult int32 +} + +const ( + stdIn string = "StdIn" + stdOut string = "StdOut" + stdErr string = "StdErr" +) + +const ( + modifyConsoleSize string = "ConsoleSize" + modifyCloseHandle string = "CloseHandle" +) + +// Pid returns the process ID of the process within the container. +func (process *Process) Pid() int { + return process.processID +} + +// SystemID returns the ID of the process's compute system. +func (process *Process) SystemID() string { + return process.system.ID() +} + +// Signal signals the process with `options`. +func (process *Process) Signal(options guestrequest.SignalProcessOptions) error { + process.handleLock.RLock() + defer process.handleLock.RUnlock() + operation := "Signal" + title := "hcsshim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + if process.handle == 0 { + return makeProcessError(process, operation, ErrAlreadyClosed, nil) + } + + optionsb, err := json.Marshal(options) + if err != nil { + return err + } + + optionsStr := string(optionsb) + + var resultp *uint16 + completed := false + go syscallWatcher(fmt.Sprintf("SignalProcess %s: %d", process.SystemID(), process.Pid()), &completed) + err = hcsSignalProcess(process.handle, optionsStr, &resultp) + completed = true + events := processHcsResult(resultp) + if err != nil { + return makeProcessError(process, operation, err, events) + } + + logrus.Debugf(title+" succeeded processid=%d", process.processID) + return nil +} + +// Kill signals the process to terminate but does not wait for it to finish terminating. +func (process *Process) Kill() error { + process.handleLock.RLock() + defer process.handleLock.RUnlock() + operation := "Kill" + title := "hcsshim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + if process.handle == 0 { + return makeProcessError(process, operation, ErrAlreadyClosed, nil) + } + + var resultp *uint16 + completed := false + go syscallWatcher(fmt.Sprintf("TerminateProcess %s: %d", process.SystemID(), process.Pid()), &completed) + err := hcsTerminateProcess(process.handle, &resultp) + completed = true + events := processHcsResult(resultp) + if err != nil { + return makeProcessError(process, operation, err, events) + } + + logrus.Debugf(title+" succeeded processid=%d", process.processID) + return nil +} + +// Wait waits for the process to exit. +func (process *Process) Wait() error { + operation := "Wait" + title := "hcsshim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + err := waitForNotification(process.callbackNumber, hcsNotificationProcessExited, nil) + if err != nil { + return makeProcessError(process, operation, err, nil) + } + + logrus.Debugf(title+" succeeded processid=%d", process.processID) + return nil +} + +// WaitTimeout waits for the process to exit or the duration to elapse. It returns +// false if timeout occurs. +func (process *Process) WaitTimeout(timeout time.Duration) error { + operation := "WaitTimeout" + title := "hcsshim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + err := waitForNotification(process.callbackNumber, hcsNotificationProcessExited, &timeout) + if err != nil { + return makeProcessError(process, operation, err, nil) + } + + logrus.Debugf(title+" succeeded processid=%d", process.processID) + return nil +} + +// ResizeConsole resizes the console of the process. +func (process *Process) ResizeConsole(width, height uint16) error { + process.handleLock.RLock() + defer process.handleLock.RUnlock() + operation := "ResizeConsole" + title := "hcsshim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + if process.handle == 0 { + return makeProcessError(process, operation, ErrAlreadyClosed, nil) + } + + modifyRequest := processModifyRequest{ + Operation: modifyConsoleSize, + ConsoleSize: &consoleSize{ + Height: height, + Width: width, + }, + } + + modifyRequestb, err := json.Marshal(modifyRequest) + if err != nil { + return err + } + + modifyRequestStr := string(modifyRequestb) + + var resultp *uint16 + err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp) + events := processHcsResult(resultp) + if err != nil { + return makeProcessError(process, operation, err, events) + } + + logrus.Debugf(title+" succeeded processid=%d", process.processID) + return nil +} + +func (process *Process) Properties() (*ProcessStatus, error) { + process.handleLock.RLock() + defer process.handleLock.RUnlock() + operation := "Properties" + title := "hcsshim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + if process.handle == 0 { + return nil, makeProcessError(process, operation, ErrAlreadyClosed, nil) + } + + var ( + resultp *uint16 + propertiesp *uint16 + ) + completed := false + go syscallWatcher(fmt.Sprintf("GetProcessProperties %s: %d", process.SystemID(), process.Pid()), &completed) + err := hcsGetProcessProperties(process.handle, &propertiesp, &resultp) + completed = true + events := processHcsResult(resultp) + if err != nil { + return nil, makeProcessError(process, operation, err, events) + } + + if propertiesp == nil { + return nil, ErrUnexpectedValue + } + propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp) + + properties := &ProcessStatus{} + if err := json.Unmarshal(propertiesRaw, properties); err != nil { + return nil, makeProcessError(process, operation, err, nil) + } + + logrus.Debugf(title+" succeeded processid=%d, properties=%s", process.processID, propertiesRaw) + return properties, nil +} + +// ExitCode returns the exit code of the process. The process must have +// already terminated. +func (process *Process) ExitCode() (int, error) { + operation := "ExitCode" + properties, err := process.Properties() + if err != nil { + return 0, makeProcessError(process, operation, err, nil) + } + + if properties.Exited == false { + return 0, makeProcessError(process, operation, ErrInvalidProcessState, nil) + } + + if properties.LastWaitResult != 0 { + return 0, makeProcessError(process, operation, syscall.Errno(properties.LastWaitResult), nil) + } + + return int(properties.ExitCode), nil +} + +// Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing +// these pipes does not close the underlying pipes; it should be possible to +// call this multiple times to get multiple interfaces. +func (process *Process) Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, error) { + process.handleLock.RLock() + defer process.handleLock.RUnlock() + operation := "Stdio" + title := "hcsshim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + if process.handle == 0 { + return nil, nil, nil, makeProcessError(process, operation, ErrAlreadyClosed, nil) + } + + var stdIn, stdOut, stdErr syscall.Handle + + if process.cachedPipes == nil { + var ( + processInfo hcsProcessInformation + resultp *uint16 + ) + err := hcsGetProcessInfo(process.handle, &processInfo, &resultp) + events := processHcsResult(resultp) + if err != nil { + return nil, nil, nil, makeProcessError(process, operation, err, events) + } + + stdIn, stdOut, stdErr = processInfo.StdInput, processInfo.StdOutput, processInfo.StdError + } else { + // Use cached pipes + stdIn, stdOut, stdErr = process.cachedPipes.stdIn, process.cachedPipes.stdOut, process.cachedPipes.stdErr + + // Invalidate the cache + process.cachedPipes = nil + } + + pipes, err := makeOpenFiles([]syscall.Handle{stdIn, stdOut, stdErr}) + if err != nil { + return nil, nil, nil, makeProcessError(process, operation, err, nil) + } + + logrus.Debugf(title+" succeeded processid=%d", process.processID) + return pipes[0], pipes[1], pipes[2], nil +} + +// CloseStdin closes the write side of the stdin pipe so that the process is +// notified on the read side that there is no more data in stdin. +func (process *Process) CloseStdin() error { + process.handleLock.RLock() + defer process.handleLock.RUnlock() + operation := "CloseStdin" + title := "hcsshim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + if process.handle == 0 { + return makeProcessError(process, operation, ErrAlreadyClosed, nil) + } + + modifyRequest := processModifyRequest{ + Operation: modifyCloseHandle, + CloseHandle: &closeHandle{ + Handle: stdIn, + }, + } + + modifyRequestb, err := json.Marshal(modifyRequest) + if err != nil { + return err + } + + modifyRequestStr := string(modifyRequestb) + + var resultp *uint16 + err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp) + events := processHcsResult(resultp) + if err != nil { + return makeProcessError(process, operation, err, events) + } + + logrus.Debugf(title+" succeeded processid=%d", process.processID) + return nil +} + +// Close cleans up any state associated with the process but does not kill +// or wait on it. +func (process *Process) Close() error { + process.handleLock.Lock() + defer process.handleLock.Unlock() + operation := "Close" + title := "hcsshim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + // Don't double free this + if process.handle == 0 { + return nil + } + + if err := process.unregisterCallback(); err != nil { + return makeProcessError(process, operation, err, nil) + } + + if err := hcsCloseProcess(process.handle); err != nil { + return makeProcessError(process, operation, err, nil) + } + + process.handle = 0 + + logrus.Debugf(title+" succeeded processid=%d", process.processID) + return nil +} + +func (process *Process) registerCallback() error { + context := ¬ifcationWatcherContext{ + channels: newChannels(), + } + + callbackMapLock.Lock() + callbackNumber := nextCallback + nextCallback++ + callbackMap[callbackNumber] = context + callbackMapLock.Unlock() + + var callbackHandle hcsCallback + err := hcsRegisterProcessCallback(process.handle, notificationWatcherCallback, callbackNumber, &callbackHandle) + if err != nil { + return err + } + context.handle = callbackHandle + process.callbackNumber = callbackNumber + + return nil +} + +func (process *Process) unregisterCallback() error { + callbackNumber := process.callbackNumber + + callbackMapLock.RLock() + context := callbackMap[callbackNumber] + callbackMapLock.RUnlock() + + if context == nil { + return nil + } + + handle := context.handle + + if handle == 0 { + return nil + } + + // hcsUnregisterProcessCallback has its own syncronization + // to wait for all callbacks to complete. We must NOT hold the callbackMapLock. + err := hcsUnregisterProcessCallback(handle) + if err != nil { + return err + } + + closeChannels(context.channels) + + callbackMapLock.Lock() + callbackMap[callbackNumber] = nil + callbackMapLock.Unlock() + + handle = 0 + + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go new file mode 100644 index 0000000000..57afd5ec6b --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go @@ -0,0 +1,585 @@ +package hcs + +import ( + "encoding/json" + "fmt" + "os" + "strconv" + "sync" + "syscall" + "time" + + "github.com/Microsoft/hcsshim/internal/interop" + "github.com/Microsoft/hcsshim/internal/schema1" + "github.com/Microsoft/hcsshim/internal/timeout" + "github.com/sirupsen/logrus" +) + +// currentContainerStarts is used to limit the number of concurrent container +// starts. +var currentContainerStarts containerStarts + +type containerStarts struct { + maxParallel int + inProgress int + sync.Mutex +} + +func init() { + mpsS := os.Getenv("HCSSHIM_MAX_PARALLEL_START") + if len(mpsS) > 0 { + mpsI, err := strconv.Atoi(mpsS) + if err != nil || mpsI < 0 { + return + } + currentContainerStarts.maxParallel = mpsI + } +} + +type System struct { + handleLock sync.RWMutex + handle hcsSystem + id string + callbackNumber uintptr +} + +// CreateComputeSystem creates a new compute system with the given configuration but does not start it. +func CreateComputeSystem(id string, hcsDocumentInterface interface{}) (*System, error) { + operation := "CreateComputeSystem" + title := "hcsshim::" + operation + + computeSystem := &System{ + id: id, + } + + hcsDocumentB, err := json.Marshal(hcsDocumentInterface) + if err != nil { + return nil, err + } + + hcsDocument := string(hcsDocumentB) + logrus.Debugf(title+" ID=%s config=%s", id, hcsDocument) + + var ( + resultp *uint16 + identity syscall.Handle + ) + completed := false + go syscallWatcher(fmt.Sprintf("CreateCompleteSystem %s: %s", id, hcsDocument), &completed) + createError := hcsCreateComputeSystem(id, hcsDocument, identity, &computeSystem.handle, &resultp) + completed = true + + if createError == nil || IsPending(createError) { + if err := computeSystem.registerCallback(); err != nil { + // Terminate the compute system if it still exists. We're okay to + // ignore a failure here. + computeSystem.Terminate() + return nil, makeSystemError(computeSystem, operation, "", err, nil) + } + } + + events, err := processAsyncHcsResult(createError, resultp, computeSystem.callbackNumber, hcsNotificationSystemCreateCompleted, &timeout.SystemCreate) + if err != nil { + if err == ErrTimeout { + // Terminate the compute system if it still exists. We're okay to + // ignore a failure here. + computeSystem.Terminate() + } + return nil, makeSystemError(computeSystem, operation, hcsDocument, err, events) + } + + logrus.Debugf(title+" succeeded id=%s handle=%d", id, computeSystem.handle) + return computeSystem, nil +} + +// OpenComputeSystem opens an existing compute system by ID. +func OpenComputeSystem(id string) (*System, error) { + operation := "OpenComputeSystem" + title := "hcsshim::" + operation + logrus.Debugf(title+" ID=%s", id) + + computeSystem := &System{ + id: id, + } + + var ( + handle hcsSystem + resultp *uint16 + ) + err := hcsOpenComputeSystem(id, &handle, &resultp) + events := processHcsResult(resultp) + if err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, events) + } + + computeSystem.handle = handle + + if err := computeSystem.registerCallback(); err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) + } + + logrus.Debugf(title+" succeeded id=%s handle=%d", id, handle) + return computeSystem, nil +} + +// GetComputeSystems gets a list of the compute systems on the system that match the query +func GetComputeSystems(q schema1.ComputeSystemQuery) ([]schema1.ContainerProperties, error) { + operation := "GetComputeSystems" + title := "hcsshim::" + operation + + queryb, err := json.Marshal(q) + if err != nil { + return nil, err + } + + query := string(queryb) + logrus.Debugf(title+" query=%s", query) + + var ( + resultp *uint16 + computeSystemsp *uint16 + ) + completed := false + go syscallWatcher(fmt.Sprintf("GetComputeSystems %s:", query), &completed) + err = hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp) + completed = true + events := processHcsResult(resultp) + if err != nil { + return nil, &HcsError{Op: operation, Err: err, Events: events} + } + + if computeSystemsp == nil { + return nil, ErrUnexpectedValue + } + computeSystemsRaw := interop.ConvertAndFreeCoTaskMemBytes(computeSystemsp) + computeSystems := []schema1.ContainerProperties{} + if err := json.Unmarshal(computeSystemsRaw, &computeSystems); err != nil { + return nil, err + } + + logrus.Debugf(title + " succeeded") + return computeSystems, nil +} + +// Start synchronously starts the computeSystem. +func (computeSystem *System) Start() error { + computeSystem.handleLock.RLock() + defer computeSystem.handleLock.RUnlock() + title := "hcsshim::ComputeSystem::Start ID=" + computeSystem.ID() + logrus.Debugf(title) + + if computeSystem.handle == 0 { + return makeSystemError(computeSystem, "Start", "", ErrAlreadyClosed, nil) + } + + // This is a very simple backoff-retry loop to limit the number + // of parallel container starts if environment variable + // HCSSHIM_MAX_PARALLEL_START is set to a positive integer. + // It should generally only be used as a workaround to various + // platform issues that exist between RS1 and RS4 as of Aug 2018 + if currentContainerStarts.maxParallel > 0 { + for { + currentContainerStarts.Lock() + if currentContainerStarts.inProgress < currentContainerStarts.maxParallel { + currentContainerStarts.inProgress++ + currentContainerStarts.Unlock() + break + } + if currentContainerStarts.inProgress == currentContainerStarts.maxParallel { + currentContainerStarts.Unlock() + time.Sleep(100 * time.Millisecond) + } + } + // Make sure we decrement the count when we are done. + defer func() { + currentContainerStarts.Lock() + currentContainerStarts.inProgress-- + currentContainerStarts.Unlock() + }() + } + + var resultp *uint16 + completed := false + go syscallWatcher(fmt.Sprintf("StartComputeSystem %s:", computeSystem.ID()), &completed) + err := hcsStartComputeSystem(computeSystem.handle, "", &resultp) + completed = true + events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemStartCompleted, &timeout.SystemStart) + if err != nil { + return makeSystemError(computeSystem, "Start", "", err, events) + } + + logrus.Debugf(title + " succeeded") + return nil +} + +// ID returns the compute system's identifier. +func (computeSystem *System) ID() string { + return computeSystem.id +} + +// Shutdown requests a compute system shutdown, if IsPending() on the error returned is true, +// it may not actually be shut down until Wait() succeeds. +func (computeSystem *System) Shutdown() error { + computeSystem.handleLock.RLock() + defer computeSystem.handleLock.RUnlock() + title := "hcsshim::ComputeSystem::Shutdown" + logrus.Debugf(title) + if computeSystem.handle == 0 { + return makeSystemError(computeSystem, "Shutdown", "", ErrAlreadyClosed, nil) + } + + var resultp *uint16 + completed := false + go syscallWatcher(fmt.Sprintf("ShutdownComputeSystem %s:", computeSystem.ID()), &completed) + err := hcsShutdownComputeSystem(computeSystem.handle, "", &resultp) + completed = true + events := processHcsResult(resultp) + if err != nil { + return makeSystemError(computeSystem, "Shutdown", "", err, events) + } + + logrus.Debugf(title + " succeeded") + return nil +} + +// Terminate requests a compute system terminate, if IsPending() on the error returned is true, +// it may not actually be shut down until Wait() succeeds. +func (computeSystem *System) Terminate() error { + computeSystem.handleLock.RLock() + defer computeSystem.handleLock.RUnlock() + title := "hcsshim::ComputeSystem::Terminate ID=" + computeSystem.ID() + logrus.Debugf(title) + + if computeSystem.handle == 0 { + return makeSystemError(computeSystem, "Terminate", "", ErrAlreadyClosed, nil) + } + + var resultp *uint16 + completed := false + go syscallWatcher(fmt.Sprintf("TerminateComputeSystem %s:", computeSystem.ID()), &completed) + err := hcsTerminateComputeSystem(computeSystem.handle, "", &resultp) + completed = true + events := processHcsResult(resultp) + if err != nil { + return makeSystemError(computeSystem, "Terminate", "", err, events) + } + + logrus.Debugf(title + " succeeded") + return nil +} + +// Wait synchronously waits for the compute system to shutdown or terminate. +func (computeSystem *System) Wait() error { + title := "hcsshim::ComputeSystem::Wait ID=" + computeSystem.ID() + logrus.Debugf(title) + + err := waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, nil) + if err != nil { + return makeSystemError(computeSystem, "Wait", "", err, nil) + } + + logrus.Debugf(title + " succeeded") + return nil +} + +// WaitTimeout synchronously waits for the compute system to terminate or the duration to elapse. +// If the timeout expires, IsTimeout(err) == true +func (computeSystem *System) WaitTimeout(timeout time.Duration) error { + title := "hcsshim::ComputeSystem::WaitTimeout ID=" + computeSystem.ID() + logrus.Debugf(title) + + err := waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, &timeout) + if err != nil { + return makeSystemError(computeSystem, "WaitTimeout", "", err, nil) + } + + logrus.Debugf(title + " succeeded") + return nil +} + +func (computeSystem *System) Properties(types ...schema1.PropertyType) (*schema1.ContainerProperties, error) { + computeSystem.handleLock.RLock() + defer computeSystem.handleLock.RUnlock() + + queryj, err := json.Marshal(schema1.PropertyQuery{types}) + if err != nil { + return nil, makeSystemError(computeSystem, "Properties", "", err, nil) + } + + var resultp, propertiesp *uint16 + completed := false + go syscallWatcher(fmt.Sprintf("GetComputeSystemProperties %s:", computeSystem.ID()), &completed) + err = hcsGetComputeSystemProperties(computeSystem.handle, string(queryj), &propertiesp, &resultp) + completed = true + events := processHcsResult(resultp) + if err != nil { + return nil, makeSystemError(computeSystem, "Properties", "", err, events) + } + + if propertiesp == nil { + return nil, ErrUnexpectedValue + } + propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp) + properties := &schema1.ContainerProperties{} + if err := json.Unmarshal(propertiesRaw, properties); err != nil { + return nil, makeSystemError(computeSystem, "Properties", "", err, nil) + } + return properties, nil +} + +// Pause pauses the execution of the computeSystem. This feature is not enabled in TP5. +func (computeSystem *System) Pause() error { + computeSystem.handleLock.RLock() + defer computeSystem.handleLock.RUnlock() + title := "hcsshim::ComputeSystem::Pause ID=" + computeSystem.ID() + logrus.Debugf(title) + + if computeSystem.handle == 0 { + return makeSystemError(computeSystem, "Pause", "", ErrAlreadyClosed, nil) + } + + var resultp *uint16 + completed := false + go syscallWatcher(fmt.Sprintf("PauseComputeSystem %s:", computeSystem.ID()), &completed) + err := hcsPauseComputeSystem(computeSystem.handle, "", &resultp) + completed = true + events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemPauseCompleted, &timeout.SystemPause) + if err != nil { + return makeSystemError(computeSystem, "Pause", "", err, events) + } + + logrus.Debugf(title + " succeeded") + return nil +} + +// Resume resumes the execution of the computeSystem. This feature is not enabled in TP5. +func (computeSystem *System) Resume() error { + computeSystem.handleLock.RLock() + defer computeSystem.handleLock.RUnlock() + title := "hcsshim::ComputeSystem::Resume ID=" + computeSystem.ID() + logrus.Debugf(title) + + if computeSystem.handle == 0 { + return makeSystemError(computeSystem, "Resume", "", ErrAlreadyClosed, nil) + } + + var resultp *uint16 + completed := false + go syscallWatcher(fmt.Sprintf("ResumeComputeSystem %s:", computeSystem.ID()), &completed) + err := hcsResumeComputeSystem(computeSystem.handle, "", &resultp) + completed = true + events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemResumeCompleted, &timeout.SystemResume) + if err != nil { + return makeSystemError(computeSystem, "Resume", "", err, events) + } + + logrus.Debugf(title + " succeeded") + return nil +} + +// CreateProcess launches a new process within the computeSystem. +func (computeSystem *System) CreateProcess(c interface{}) (*Process, error) { + computeSystem.handleLock.RLock() + defer computeSystem.handleLock.RUnlock() + title := "hcsshim::ComputeSystem::CreateProcess ID=" + computeSystem.ID() + var ( + processInfo hcsProcessInformation + processHandle hcsProcess + resultp *uint16 + ) + + if computeSystem.handle == 0 { + return nil, makeSystemError(computeSystem, "CreateProcess", "", ErrAlreadyClosed, nil) + } + + configurationb, err := json.Marshal(c) + if err != nil { + return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil) + } + + configuration := string(configurationb) + logrus.Debugf(title+" config=%s", configuration) + + completed := false + go syscallWatcher(fmt.Sprintf("CreateProcess %s: %s", computeSystem.ID(), configuration), &completed) + err = hcsCreateProcess(computeSystem.handle, configuration, &processInfo, &processHandle, &resultp) + completed = true + events := processHcsResult(resultp) + if err != nil { + return nil, makeSystemError(computeSystem, "CreateProcess", configuration, err, events) + } + + process := &Process{ + handle: processHandle, + processID: int(processInfo.ProcessId), + system: computeSystem, + cachedPipes: &cachedPipes{ + stdIn: processInfo.StdInput, + stdOut: processInfo.StdOutput, + stdErr: processInfo.StdError, + }, + } + + if err := process.registerCallback(); err != nil { + return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil) + } + + logrus.Debugf(title+" succeeded processid=%d", process.processID) + return process, nil +} + +// OpenProcess gets an interface to an existing process within the computeSystem. +func (computeSystem *System) OpenProcess(pid int) (*Process, error) { + computeSystem.handleLock.RLock() + defer computeSystem.handleLock.RUnlock() + title := "hcsshim::ComputeSystem::OpenProcess ID=" + computeSystem.ID() + logrus.Debugf(title+" processid=%d", pid) + var ( + processHandle hcsProcess + resultp *uint16 + ) + + if computeSystem.handle == 0 { + return nil, makeSystemError(computeSystem, "OpenProcess", "", ErrAlreadyClosed, nil) + } + + completed := false + go syscallWatcher(fmt.Sprintf("OpenProcess %s: %d", computeSystem.ID(), pid), &completed) + err := hcsOpenProcess(computeSystem.handle, uint32(pid), &processHandle, &resultp) + completed = true + events := processHcsResult(resultp) + if err != nil { + return nil, makeSystemError(computeSystem, "OpenProcess", "", err, events) + } + + process := &Process{ + handle: processHandle, + processID: pid, + system: computeSystem, + } + + if err := process.registerCallback(); err != nil { + return nil, makeSystemError(computeSystem, "OpenProcess", "", err, nil) + } + + logrus.Debugf(title+" succeeded processid=%s", process.processID) + return process, nil +} + +// Close cleans up any state associated with the compute system but does not terminate or wait for it. +func (computeSystem *System) Close() error { + computeSystem.handleLock.Lock() + defer computeSystem.handleLock.Unlock() + title := "hcsshim::ComputeSystem::Close ID=" + computeSystem.ID() + logrus.Debugf(title) + + // Don't double free this + if computeSystem.handle == 0 { + return nil + } + + if err := computeSystem.unregisterCallback(); err != nil { + return makeSystemError(computeSystem, "Close", "", err, nil) + } + + completed := false + go syscallWatcher(fmt.Sprintf("CloseComputeSystem %s:", computeSystem.ID()), &completed) + err := hcsCloseComputeSystem(computeSystem.handle) + completed = true + if err != nil { + return makeSystemError(computeSystem, "Close", "", err, nil) + } + + computeSystem.handle = 0 + + logrus.Debugf(title + " succeeded") + return nil +} + +func (computeSystem *System) registerCallback() error { + context := ¬ifcationWatcherContext{ + channels: newChannels(), + } + + callbackMapLock.Lock() + callbackNumber := nextCallback + nextCallback++ + callbackMap[callbackNumber] = context + callbackMapLock.Unlock() + + var callbackHandle hcsCallback + err := hcsRegisterComputeSystemCallback(computeSystem.handle, notificationWatcherCallback, callbackNumber, &callbackHandle) + if err != nil { + return err + } + context.handle = callbackHandle + computeSystem.callbackNumber = callbackNumber + + return nil +} + +func (computeSystem *System) unregisterCallback() error { + callbackNumber := computeSystem.callbackNumber + + callbackMapLock.RLock() + context := callbackMap[callbackNumber] + callbackMapLock.RUnlock() + + if context == nil { + return nil + } + + handle := context.handle + + if handle == 0 { + return nil + } + + // hcsUnregisterComputeSystemCallback has its own syncronization + // to wait for all callbacks to complete. We must NOT hold the callbackMapLock. + err := hcsUnregisterComputeSystemCallback(handle) + if err != nil { + return err + } + + closeChannels(context.channels) + + callbackMapLock.Lock() + callbackMap[callbackNumber] = nil + callbackMapLock.Unlock() + + handle = 0 + + return nil +} + +// Modifies the System by sending a request to HCS +func (computeSystem *System) Modify(config interface{}) error { + computeSystem.handleLock.RLock() + defer computeSystem.handleLock.RUnlock() + title := "hcsshim::Modify ID=" + computeSystem.id + + if computeSystem.handle == 0 { + return makeSystemError(computeSystem, "Modify", "", ErrAlreadyClosed, nil) + } + + requestJSON, err := json.Marshal(config) + if err != nil { + return err + } + + requestString := string(requestJSON) + logrus.Debugf(title + " " + requestString) + + var resultp *uint16 + completed := false + go syscallWatcher(fmt.Sprintf("ModifyComputeSystem %s: %s", computeSystem.ID(), requestString), &completed) + err = hcsModifyComputeSystem(computeSystem.handle, requestString, &resultp) + completed = true + events := processHcsResult(resultp) + if err != nil { + return makeSystemError(computeSystem, "Modify", requestString, err, events) + } + logrus.Debugf(title + " succeeded ") + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/utils.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/utils.go new file mode 100644 index 0000000000..a638677ed5 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/utils.go @@ -0,0 +1,33 @@ +package hcs + +import ( + "io" + "syscall" + + "github.com/Microsoft/go-winio" +) + +// makeOpenFiles calls winio.MakeOpenFile for each handle in a slice but closes all the handles +// if there is an error. +func makeOpenFiles(hs []syscall.Handle) (_ []io.ReadWriteCloser, err error) { + fs := make([]io.ReadWriteCloser, len(hs)) + for i, h := range hs { + if h != syscall.Handle(0) { + if err == nil { + fs[i], err = winio.MakeOpenFile(h) + } + if err != nil { + syscall.Close(h) + } + } + } + if err != nil { + for _, f := range fs { + if f != nil { + f.Close() + } + } + return nil, err + } + return fs, nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go new file mode 100644 index 0000000000..91e212c574 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go @@ -0,0 +1,63 @@ +package hcs + +import ( + "time" + + "github.com/sirupsen/logrus" +) + +func processAsyncHcsResult(err error, resultp *uint16, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) ([]ErrorEvent, error) { + events := processHcsResult(resultp) + if IsPending(err) { + return nil, waitForNotification(callbackNumber, expectedNotification, timeout) + } + + return events, err +} + +func waitForNotification(callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error { + callbackMapLock.RLock() + channels := callbackMap[callbackNumber].channels + callbackMapLock.RUnlock() + + expectedChannel := channels[expectedNotification] + if expectedChannel == nil { + logrus.Errorf("unknown notification type in waitForNotification %x", expectedNotification) + return ErrInvalidNotificationType + } + + var c <-chan time.Time + if timeout != nil { + timer := time.NewTimer(*timeout) + c = timer.C + defer timer.Stop() + } + + select { + case err, ok := <-expectedChannel: + if !ok { + return ErrHandleClose + } + return err + case err, ok := <-channels[hcsNotificationSystemExited]: + if !ok { + return ErrHandleClose + } + // If the expected notification is hcsNotificationSystemExited which of the two selects + // chosen is random. Return the raw error if hcsNotificationSystemExited is expected + if channels[hcsNotificationSystemExited] == expectedChannel { + return err + } + return ErrUnexpectedContainerExit + case _, ok := <-channels[hcsNotificationServiceDisconnect]: + if !ok { + return ErrHandleClose + } + // hcsNotificationServiceDisconnect should never be an expected notification + // it does not need the same handling as hcsNotificationSystemExited + return ErrUnexpectedProcessAbort + case <-c: + return ErrTimeout + } + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go new file mode 100644 index 0000000000..6b94bc9ff8 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go @@ -0,0 +1,30 @@ +package hcs + +import ( + "time" + + "github.com/Microsoft/hcsshim/internal/timeout" + "github.com/sirupsen/logrus" +) + +// syscallWatcher is used as a very simple goroutine around calls into +// the platform. In some cases, we have seen HCS APIs not returning due to +// various bugs, and the goroutine making the syscall ends up not returning, +// prior to its async callback. By spinning up a syscallWatcher, it allows +// us to at least log a warning if a syscall doesn't complete in a reasonable +// amount of time. +// +// Usage is: +// +// completed := false +// go syscallWatcher("some description", &completed) +// +// completed = true +// +func syscallWatcher(description string, syscallCompleted *bool) { + time.Sleep(timeout.SyscallWatcher) + if *syscallCompleted { + return + } + logrus.Warnf("%s: Did not complete within %s. This may indicate a platform issue. If it appears to be making no forward progress, obtain the stacks and see is there is a syscall stuck in the platform API for a significant length of time.", description, timeout.SyscallWatcher) +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go new file mode 100644 index 0000000000..925c65e28d --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go @@ -0,0 +1,462 @@ +// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT + +package hcs + +import ( + "syscall" + "unsafe" + + "github.com/Microsoft/hcsshim/internal/interop" + "golang.org/x/sys/windows" +) + +var _ unsafe.Pointer + +// Do the interface allocations only once for common +// Errno values. +const ( + errnoERROR_IO_PENDING = 997 +) + +var ( + errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) +) + +// errnoErr returns common boxed Errno values, to prevent +// allocations at runtime. +func errnoErr(e syscall.Errno) error { + switch e { + case 0: + return nil + case errnoERROR_IO_PENDING: + return errERROR_IO_PENDING + } + // TODO: add more here, after collecting data on the common + // error values see on Windows. (perhaps when running + // all.bat?) + return e +} + +var ( + modvmcompute = windows.NewLazySystemDLL("vmcompute.dll") + + procHcsEnumerateComputeSystems = modvmcompute.NewProc("HcsEnumerateComputeSystems") + procHcsCreateComputeSystem = modvmcompute.NewProc("HcsCreateComputeSystem") + procHcsOpenComputeSystem = modvmcompute.NewProc("HcsOpenComputeSystem") + procHcsCloseComputeSystem = modvmcompute.NewProc("HcsCloseComputeSystem") + procHcsStartComputeSystem = modvmcompute.NewProc("HcsStartComputeSystem") + procHcsShutdownComputeSystem = modvmcompute.NewProc("HcsShutdownComputeSystem") + procHcsTerminateComputeSystem = modvmcompute.NewProc("HcsTerminateComputeSystem") + procHcsPauseComputeSystem = modvmcompute.NewProc("HcsPauseComputeSystem") + procHcsResumeComputeSystem = modvmcompute.NewProc("HcsResumeComputeSystem") + procHcsGetComputeSystemProperties = modvmcompute.NewProc("HcsGetComputeSystemProperties") + procHcsModifyComputeSystem = modvmcompute.NewProc("HcsModifyComputeSystem") + procHcsRegisterComputeSystemCallback = modvmcompute.NewProc("HcsRegisterComputeSystemCallback") + procHcsUnregisterComputeSystemCallback = modvmcompute.NewProc("HcsUnregisterComputeSystemCallback") + procHcsCreateProcess = modvmcompute.NewProc("HcsCreateProcess") + procHcsOpenProcess = modvmcompute.NewProc("HcsOpenProcess") + procHcsCloseProcess = modvmcompute.NewProc("HcsCloseProcess") + procHcsTerminateProcess = modvmcompute.NewProc("HcsTerminateProcess") + + procHcsGetProcessInfo = modvmcompute.NewProc("HcsGetProcessInfo") + procHcsGetProcessProperties = modvmcompute.NewProc("HcsGetProcessProperties") + procHcsModifyProcess = modvmcompute.NewProc("HcsModifyProcess") + procHcsGetServiceProperties = modvmcompute.NewProc("HcsGetServiceProperties") + procHcsRegisterProcessCallback = modvmcompute.NewProc("HcsRegisterProcessCallback") + procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback") +) + +func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(query) + if hr != nil { + return + } + return _hcsEnumerateComputeSystems(_p0, computeSystems, result) +} + +func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result **uint16) (hr error) { + if hr = procHcsEnumerateComputeSystems.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsEnumerateComputeSystems.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(computeSystems)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(configuration) + if hr != nil { + return + } + return _hcsCreateComputeSystem(_p0, _p1, identity, computeSystem, result) +} + +func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) { + if hr = procHcsCreateComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsCreateComputeSystem.Addr(), 5, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(configuration)), uintptr(identity), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)), 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _hcsOpenComputeSystem(_p0, computeSystem, result) +} + +func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16) (hr error) { + if hr = procHcsOpenComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsOpenComputeSystem.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) { + if hr = procHcsCloseComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsCloseComputeSystem.Addr(), 1, uintptr(computeSystem), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsStartComputeSystem(computeSystem, _p0, result) +} + +func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { + if hr = procHcsStartComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsStartComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsShutdownComputeSystem(computeSystem, _p0, result) +} + +func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { + if hr = procHcsShutdownComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsShutdownComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsTerminateComputeSystem(computeSystem, _p0, result) +} + +func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { + if hr = procHcsTerminateComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsTerminateComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsPauseComputeSystem(computeSystem, _p0, result) +} + +func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { + if hr = procHcsPauseComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsPauseComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsResumeComputeSystem(computeSystem, _p0, result) +} + +func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { + if hr = procHcsResumeComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsResumeComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(propertyQuery) + if hr != nil { + return + } + return _hcsGetComputeSystemProperties(computeSystem, _p0, properties, result) +} + +func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { + if hr = procHcsGetComputeSystemProperties.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsGetComputeSystemProperties.Addr(), 4, uintptr(computeSystem), uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(configuration) + if hr != nil { + return + } + return _hcsModifyComputeSystem(computeSystem, _p0, result) +} + +func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, result **uint16) (hr error) { + if hr = procHcsModifyComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsModifyComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(configuration)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) { + if hr = procHcsRegisterComputeSystemCallback.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsRegisterComputeSystemCallback.Addr(), 4, uintptr(computeSystem), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) { + if hr = procHcsUnregisterComputeSystemCallback.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsUnregisterComputeSystemCallback.Addr(), 1, uintptr(callbackHandle), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(processParameters) + if hr != nil { + return + } + return _hcsCreateProcess(computeSystem, _p0, processInformation, process, result) +} + +func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) { + if hr = procHcsCreateProcess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsCreateProcess.Addr(), 5, uintptr(computeSystem), uintptr(unsafe.Pointer(processParameters)), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) { + if hr = procHcsOpenProcess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsOpenProcess.Addr(), 4, uintptr(computeSystem), uintptr(pid), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsCloseProcess(process hcsProcess) (hr error) { + if hr = procHcsCloseProcess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsCloseProcess.Addr(), 1, uintptr(process), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) { + if hr = procHcsTerminateProcess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 2, uintptr(process), uintptr(unsafe.Pointer(result)), 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsSignalProcess(process, _p0, result) +} + +func _hcsSignalProcess(process hcsProcess, options *uint16, result **uint16) (hr error) { + if hr = procHcsTerminateProcess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) { + if hr = procHcsGetProcessInfo.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsGetProcessInfo.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) { + if hr = procHcsGetProcessProperties.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsGetProcessProperties.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processProperties)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(settings) + if hr != nil { + return + } + return _hcsModifyProcess(process, _p0, result) +} + +func _hcsModifyProcess(process hcsProcess, settings *uint16, result **uint16) (hr error) { + if hr = procHcsModifyProcess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsModifyProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(propertyQuery) + if hr != nil { + return + } + return _hcsGetServiceProperties(_p0, properties, result) +} + +func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { + if hr = procHcsGetServiceProperties.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsGetServiceProperties.Addr(), 3, uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) { + if hr = procHcsRegisterProcessCallback.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsRegisterProcessCallback.Addr(), 4, uintptr(process), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) { + if hr = procHcsUnregisterProcessCallback.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsUnregisterProcessCallback.Addr(), 1, uintptr(callbackHandle), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcserror/hcserror.go b/vendor/github.com/Microsoft/hcsshim/internal/hcserror/hcserror.go new file mode 100644 index 0000000000..c8d362c66c --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcserror/hcserror.go @@ -0,0 +1,51 @@ +package hcserror + +import ( + "fmt" + "syscall" +) + +const ERROR_GEN_FAILURE = syscall.Errno(31) + +type HcsError struct { + title string + rest string + Err error +} + +func (e *HcsError) Error() string { + s := e.title + if len(s) > 0 && s[len(s)-1] != ' ' { + s += " " + } + s += fmt.Sprintf("failed in Win32: %s (0x%x)", e.Err, Win32FromError(e.Err)) + if e.rest != "" { + if e.rest[0] != ' ' { + s += " " + } + s += e.rest + } + return s +} + +func New(err error, title, rest string) error { + // Pass through DLL errors directly since they do not originate from HCS. + if _, ok := err.(*syscall.DLLError); ok { + return err + } + return &HcsError{title, rest, err} +} + +func Errorf(err error, title, format string, a ...interface{}) error { + return New(err, title, fmt.Sprintf(format, a...)) +} + +func Win32FromError(err error) uint32 { + if herr, ok := err.(*HcsError); ok { + return Win32FromError(herr.Err) + } + if code, ok := err.(syscall.Errno); ok { + return uint32(code) + } + return uint32(ERROR_GEN_FAILURE) +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hns.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hns.go new file mode 100644 index 0000000000..b2e475f53c --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hns.go @@ -0,0 +1,23 @@ +package hns + +import "fmt" + +//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hns.go + +//sys _hnsCall(method string, path string, object string, response **uint16) (hr error) = vmcompute.HNSCall? + +type EndpointNotFoundError struct { + EndpointName string +} + +func (e EndpointNotFoundError) Error() string { + return fmt.Sprintf("Endpoint %s not found", e.EndpointName) +} + +type NetworkNotFoundError struct { + NetworkName string +} + +func (e NetworkNotFoundError) Error() string { + return fmt.Sprintf("Network %s not found", e.NetworkName) +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go new file mode 100644 index 0000000000..ce636458c0 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go @@ -0,0 +1,260 @@ +package hns + +import ( + "encoding/json" + "net" + + "github.com/sirupsen/logrus" +) + +// HNSEndpoint represents a network endpoint in HNS +type HNSEndpoint struct { + Id string `json:"ID,omitempty"` + Name string `json:",omitempty"` + VirtualNetwork string `json:",omitempty"` + VirtualNetworkName string `json:",omitempty"` + Policies []json.RawMessage `json:",omitempty"` + MacAddress string `json:",omitempty"` + IPAddress net.IP `json:",omitempty"` + DNSSuffix string `json:",omitempty"` + DNSServerList string `json:",omitempty"` + GatewayAddress string `json:",omitempty"` + EnableInternalDNS bool `json:",omitempty"` + DisableICC bool `json:",omitempty"` + PrefixLength uint8 `json:",omitempty"` + IsRemoteEndpoint bool `json:",omitempty"` + Namespace *Namespace `json:",omitempty"` +} + +//SystemType represents the type of the system on which actions are done +type SystemType string + +// SystemType const +const ( + ContainerType SystemType = "Container" + VirtualMachineType SystemType = "VirtualMachine" + HostType SystemType = "Host" +) + +// EndpointAttachDetachRequest is the structure used to send request to the container to modify the system +// Supported resource types are Network and Request Types are Add/Remove +type EndpointAttachDetachRequest struct { + ContainerID string `json:"ContainerId,omitempty"` + SystemType SystemType `json:"SystemType"` + CompartmentID uint16 `json:"CompartmentId,omitempty"` + VirtualNICName string `json:"VirtualNicName,omitempty"` +} + +// EndpointResquestResponse is object to get the endpoint request response +type EndpointResquestResponse struct { + Success bool + Error string +} + +// HNSEndpointRequest makes a HNS call to modify/query a network endpoint +func HNSEndpointRequest(method, path, request string) (*HNSEndpoint, error) { + endpoint := &HNSEndpoint{} + err := hnsCall(method, "/endpoints/"+path, request, &endpoint) + if err != nil { + return nil, err + } + + return endpoint, nil +} + +// HNSListEndpointRequest makes a HNS call to query the list of available endpoints +func HNSListEndpointRequest() ([]HNSEndpoint, error) { + var endpoint []HNSEndpoint + err := hnsCall("GET", "/endpoints/", "", &endpoint) + if err != nil { + return nil, err + } + + return endpoint, nil +} + +// GetHNSEndpointByID get the Endpoint by ID +func GetHNSEndpointByID(endpointID string) (*HNSEndpoint, error) { + return HNSEndpointRequest("GET", endpointID, "") +} + +// GetHNSEndpointByName gets the endpoint filtered by Name +func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) { + hnsResponse, err := HNSListEndpointRequest() + if err != nil { + return nil, err + } + for _, hnsEndpoint := range hnsResponse { + if hnsEndpoint.Name == endpointName { + return &hnsEndpoint, nil + } + } + return nil, EndpointNotFoundError{EndpointName: endpointName} +} + +// Create Endpoint by sending EndpointRequest to HNS. TODO: Create a separate HNS interface to place all these methods +func (endpoint *HNSEndpoint) Create() (*HNSEndpoint, error) { + operation := "Create" + title := "hcsshim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + + jsonString, err := json.Marshal(endpoint) + if err != nil { + return nil, err + } + return HNSEndpointRequest("POST", "", string(jsonString)) +} + +// Delete Endpoint by sending EndpointRequest to HNS +func (endpoint *HNSEndpoint) Delete() (*HNSEndpoint, error) { + operation := "Delete" + title := "hcsshim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + + return HNSEndpointRequest("DELETE", endpoint.Id, "") +} + +// Update Endpoint +func (endpoint *HNSEndpoint) Update() (*HNSEndpoint, error) { + operation := "Update" + title := "hcsshim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + jsonString, err := json.Marshal(endpoint) + if err != nil { + return nil, err + } + err = hnsCall("POST", "/endpoints/"+endpoint.Id, string(jsonString), &endpoint) + + return endpoint, err +} + +// ApplyACLPolicy applies a set of ACL Policies on the Endpoint +func (endpoint *HNSEndpoint) ApplyACLPolicy(policies ...*ACLPolicy) error { + operation := "ApplyACLPolicy" + title := "hcsshim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + + for _, policy := range policies { + if policy == nil { + continue + } + jsonString, err := json.Marshal(policy) + if err != nil { + return err + } + endpoint.Policies = append(endpoint.Policies, jsonString) + } + + _, err := endpoint.Update() + return err +} + +// ContainerAttach attaches an endpoint to container +func (endpoint *HNSEndpoint) ContainerAttach(containerID string, compartmentID uint16) error { + operation := "ContainerAttach" + title := "hcsshim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + + requestMessage := &EndpointAttachDetachRequest{ + ContainerID: containerID, + CompartmentID: compartmentID, + SystemType: ContainerType, + } + response := &EndpointResquestResponse{} + jsonString, err := json.Marshal(requestMessage) + if err != nil { + return err + } + return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response) +} + +// ContainerDetach detaches an endpoint from container +func (endpoint *HNSEndpoint) ContainerDetach(containerID string) error { + operation := "ContainerDetach" + title := "hcsshim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + + requestMessage := &EndpointAttachDetachRequest{ + ContainerID: containerID, + SystemType: ContainerType, + } + response := &EndpointResquestResponse{} + + jsonString, err := json.Marshal(requestMessage) + if err != nil { + return err + } + return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response) +} + +// HostAttach attaches a nic on the host +func (endpoint *HNSEndpoint) HostAttach(compartmentID uint16) error { + operation := "HostAttach" + title := "hcsshim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + requestMessage := &EndpointAttachDetachRequest{ + CompartmentID: compartmentID, + SystemType: HostType, + } + response := &EndpointResquestResponse{} + + jsonString, err := json.Marshal(requestMessage) + if err != nil { + return err + } + return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response) + +} + +// HostDetach detaches a nic on the host +func (endpoint *HNSEndpoint) HostDetach() error { + operation := "HostDetach" + title := "hcsshim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + requestMessage := &EndpointAttachDetachRequest{ + SystemType: HostType, + } + response := &EndpointResquestResponse{} + + jsonString, err := json.Marshal(requestMessage) + if err != nil { + return err + } + return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response) +} + +// VirtualMachineNICAttach attaches a endpoint to a virtual machine +func (endpoint *HNSEndpoint) VirtualMachineNICAttach(virtualMachineNICName string) error { + operation := "VirtualMachineNicAttach" + title := "hcsshim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + requestMessage := &EndpointAttachDetachRequest{ + VirtualNICName: virtualMachineNICName, + SystemType: VirtualMachineType, + } + response := &EndpointResquestResponse{} + + jsonString, err := json.Marshal(requestMessage) + if err != nil { + return err + } + return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response) +} + +// VirtualMachineNICDetach detaches a endpoint from a virtual machine +func (endpoint *HNSEndpoint) VirtualMachineNICDetach() error { + operation := "VirtualMachineNicDetach" + title := "hcsshim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + + requestMessage := &EndpointAttachDetachRequest{ + SystemType: VirtualMachineType, + } + response := &EndpointResquestResponse{} + + jsonString, err := json.Marshal(requestMessage) + if err != nil { + return err + } + return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response) +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go new file mode 100644 index 0000000000..969d1b263b --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go @@ -0,0 +1,42 @@ +package hns + +import ( + "encoding/json" + "fmt" + + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/Microsoft/hcsshim/internal/interop" + "github.com/sirupsen/logrus" +) + +func hnsCall(method, path, request string, returnResponse interface{}) error { + var responseBuffer *uint16 + logrus.Debugf("[%s]=>[%s] Request : %s", method, path, request) + + err := _hnsCall(method, path, request, &responseBuffer) + if err != nil { + return hcserror.New(err, "hnsCall ", "") + } + response := interop.ConvertAndFreeCoTaskMemString(responseBuffer) + + hnsresponse := &hnsResponse{} + if err = json.Unmarshal([]byte(response), &hnsresponse); err != nil { + return err + } + + if !hnsresponse.Success { + return fmt.Errorf("HNS failed with error : %s", hnsresponse.Error) + } + + if len(hnsresponse.Output) == 0 { + return nil + } + + logrus.Debugf("Network Response : %s", hnsresponse.Output) + err = json.Unmarshal(hnsresponse.Output, returnResponse) + if err != nil { + return err + } + + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsglobals.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsglobals.go new file mode 100644 index 0000000000..a8d8cc56ae --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsglobals.go @@ -0,0 +1,28 @@ +package hns + +type HNSGlobals struct { + Version HNSVersion `json:"Version"` +} + +type HNSVersion struct { + Major int `json:"Major"` + Minor int `json:"Minor"` +} + +var ( + HNSVersion1803 = HNSVersion{Major: 7, Minor: 2} +) + +func GetHNSGlobals() (*HNSGlobals, error) { + var version HNSVersion + err := hnsCall("GET", "/globals/version", "", &version) + if err != nil { + return nil, err + } + + globals := &HNSGlobals{ + Version: version, + } + + return globals, nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go new file mode 100644 index 0000000000..7e859de912 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go @@ -0,0 +1,141 @@ +package hns + +import ( + "encoding/json" + "net" + + "github.com/sirupsen/logrus" +) + +// Subnet is assoicated with a network and represents a list +// of subnets available to the network +type Subnet struct { + AddressPrefix string `json:",omitempty"` + GatewayAddress string `json:",omitempty"` + Policies []json.RawMessage `json:",omitempty"` +} + +// MacPool is assoicated with a network and represents a list +// of macaddresses available to the network +type MacPool struct { + StartMacAddress string `json:",omitempty"` + EndMacAddress string `json:",omitempty"` +} + +// HNSNetwork represents a network in HNS +type HNSNetwork struct { + Id string `json:"ID,omitempty"` + Name string `json:",omitempty"` + Type string `json:",omitempty"` + NetworkAdapterName string `json:",omitempty"` + SourceMac string `json:",omitempty"` + Policies []json.RawMessage `json:",omitempty"` + MacPools []MacPool `json:",omitempty"` + Subnets []Subnet `json:",omitempty"` + DNSSuffix string `json:",omitempty"` + DNSServerList string `json:",omitempty"` + DNSServerCompartment uint32 `json:",omitempty"` + ManagementIP string `json:",omitempty"` + AutomaticDNS bool `json:",omitempty"` +} + +type hnsNetworkResponse struct { + Success bool + Error string + Output HNSNetwork +} + +type hnsResponse struct { + Success bool + Error string + Output json.RawMessage +} + +// HNSNetworkRequest makes a call into HNS to update/query a single network +func HNSNetworkRequest(method, path, request string) (*HNSNetwork, error) { + var network HNSNetwork + err := hnsCall(method, "/networks/"+path, request, &network) + if err != nil { + return nil, err + } + + return &network, nil +} + +// HNSListNetworkRequest makes a HNS call to query the list of available networks +func HNSListNetworkRequest(method, path, request string) ([]HNSNetwork, error) { + var network []HNSNetwork + err := hnsCall(method, "/networks/"+path, request, &network) + if err != nil { + return nil, err + } + + return network, nil +} + +// GetHNSNetworkByID +func GetHNSNetworkByID(networkID string) (*HNSNetwork, error) { + return HNSNetworkRequest("GET", networkID, "") +} + +// GetHNSNetworkName filtered by Name +func GetHNSNetworkByName(networkName string) (*HNSNetwork, error) { + hsnnetworks, err := HNSListNetworkRequest("GET", "", "") + if err != nil { + return nil, err + } + for _, hnsnetwork := range hsnnetworks { + if hnsnetwork.Name == networkName { + return &hnsnetwork, nil + } + } + return nil, NetworkNotFoundError{NetworkName: networkName} +} + +// Create Network by sending NetworkRequest to HNS. +func (network *HNSNetwork) Create() (*HNSNetwork, error) { + operation := "Create" + title := "hcsshim::HNSNetwork::" + operation + logrus.Debugf(title+" id=%s", network.Id) + + jsonString, err := json.Marshal(network) + if err != nil { + return nil, err + } + return HNSNetworkRequest("POST", "", string(jsonString)) +} + +// Delete Network by sending NetworkRequest to HNS +func (network *HNSNetwork) Delete() (*HNSNetwork, error) { + operation := "Delete" + title := "hcsshim::HNSNetwork::" + operation + logrus.Debugf(title+" id=%s", network.Id) + + return HNSNetworkRequest("DELETE", network.Id, "") +} + +// Creates an endpoint on the Network. +func (network *HNSNetwork) NewEndpoint(ipAddress net.IP, macAddress net.HardwareAddr) *HNSEndpoint { + return &HNSEndpoint{ + VirtualNetwork: network.Id, + IPAddress: ipAddress, + MacAddress: string(macAddress), + } +} + +func (network *HNSNetwork) CreateEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) { + operation := "CreateEndpoint" + title := "hcsshim::HNSNetwork::" + operation + logrus.Debugf(title+" id=%s, endpointId=%s", network.Id, endpoint.Id) + + endpoint.VirtualNetwork = network.Id + return endpoint.Create() +} + +func (network *HNSNetwork) CreateRemoteEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) { + operation := "CreateRemoteEndpoint" + title := "hcsshim::HNSNetwork::" + operation + logrus.Debugf(title+" id=%s", network.Id) + endpoint.IsRemoteEndpoint = true + return network.CreateEndpoint(endpoint) +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go new file mode 100644 index 0000000000..2318a4fce2 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go @@ -0,0 +1,98 @@ +package hns + +// Type of Request Support in ModifySystem +type PolicyType string + +// RequestType const +const ( + Nat PolicyType = "NAT" + ACL PolicyType = "ACL" + PA PolicyType = "PA" + VLAN PolicyType = "VLAN" + VSID PolicyType = "VSID" + VNet PolicyType = "VNET" + L2Driver PolicyType = "L2Driver" + Isolation PolicyType = "Isolation" + QOS PolicyType = "QOS" + OutboundNat PolicyType = "OutBoundNAT" + ExternalLoadBalancer PolicyType = "ELB" + Route PolicyType = "ROUTE" +) + +type NatPolicy struct { + Type PolicyType `json:"Type"` + Protocol string + InternalPort uint16 + ExternalPort uint16 +} + +type QosPolicy struct { + Type PolicyType `json:"Type"` + MaximumOutgoingBandwidthInBytes uint64 +} + +type IsolationPolicy struct { + Type PolicyType `json:"Type"` + VLAN uint + VSID uint + InDefaultIsolation bool +} + +type VlanPolicy struct { + Type PolicyType `json:"Type"` + VLAN uint +} + +type VsidPolicy struct { + Type PolicyType `json:"Type"` + VSID uint +} + +type PaPolicy struct { + Type PolicyType `json:"Type"` + PA string `json:"PA"` +} + +type OutboundNatPolicy struct { + Policy + VIP string `json:"VIP,omitempty"` + Exceptions []string `json:"ExceptionList,omitempty"` +} + +type ActionType string +type DirectionType string +type RuleType string + +const ( + Allow ActionType = "Allow" + Block ActionType = "Block" + + In DirectionType = "In" + Out DirectionType = "Out" + + Host RuleType = "Host" + Switch RuleType = "Switch" +) + +type ACLPolicy struct { + Type PolicyType `json:"Type"` + Id string `json:"Id,omitempty"` + Protocol uint16 + Protocols string `json:"Protocols,omitempty"` + InternalPort uint16 + Action ActionType + Direction DirectionType + LocalAddresses string + RemoteAddresses string + LocalPorts string `json:"LocalPorts,omitempty"` + LocalPort uint16 + RemotePorts string `json:"RemotePorts,omitempty"` + RemotePort uint16 + RuleType RuleType `json:"RuleType,omitempty"` + Priority uint16 + ServiceName string +} + +type Policy struct { + Type PolicyType `json:"Type"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicylist.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicylist.go new file mode 100644 index 0000000000..cc98b49e0a --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicylist.go @@ -0,0 +1,202 @@ +package hns + +import ( + "encoding/json" + + "github.com/sirupsen/logrus" +) + +// RoutePolicy is a structure defining schema for Route based Policy +type RoutePolicy struct { + Policy + DestinationPrefix string `json:"DestinationPrefix,omitempty"` + NextHop string `json:"NextHop,omitempty"` + EncapEnabled bool `json:"NeedEncap,omitempty"` +} + +// ELBPolicy is a structure defining schema for ELB LoadBalancing based Policy +type ELBPolicy struct { + LBPolicy + SourceVIP string `json:"SourceVIP,omitempty"` + VIPs []string `json:"VIPs,omitempty"` + ILB bool `json:"ILB,omitempty"` + DSR bool `json:"IsDSR,omitempty"` +} + +// LBPolicy is a structure defining schema for LoadBalancing based Policy +type LBPolicy struct { + Policy + Protocol uint16 `json:"Protocol,omitempty"` + InternalPort uint16 + ExternalPort uint16 +} + +// PolicyList is a structure defining schema for Policy list request +type PolicyList struct { + ID string `json:"ID,omitempty"` + EndpointReferences []string `json:"References,omitempty"` + Policies []json.RawMessage `json:"Policies,omitempty"` +} + +// HNSPolicyListRequest makes a call into HNS to update/query a single network +func HNSPolicyListRequest(method, path, request string) (*PolicyList, error) { + var policy PolicyList + err := hnsCall(method, "/policylists/"+path, request, &policy) + if err != nil { + return nil, err + } + + return &policy, nil +} + +// HNSListPolicyListRequest gets all the policy list +func HNSListPolicyListRequest() ([]PolicyList, error) { + var plist []PolicyList + err := hnsCall("GET", "/policylists/", "", &plist) + if err != nil { + return nil, err + } + + return plist, nil +} + +// PolicyListRequest makes a HNS call to modify/query a network policy list +func PolicyListRequest(method, path, request string) (*PolicyList, error) { + policylist := &PolicyList{} + err := hnsCall(method, "/policylists/"+path, request, &policylist) + if err != nil { + return nil, err + } + + return policylist, nil +} + +// GetPolicyListByID get the policy list by ID +func GetPolicyListByID(policyListID string) (*PolicyList, error) { + return PolicyListRequest("GET", policyListID, "") +} + +// Create PolicyList by sending PolicyListRequest to HNS. +func (policylist *PolicyList) Create() (*PolicyList, error) { + operation := "Create" + title := "hcsshim::PolicyList::" + operation + logrus.Debugf(title+" id=%s", policylist.ID) + jsonString, err := json.Marshal(policylist) + if err != nil { + return nil, err + } + return PolicyListRequest("POST", "", string(jsonString)) +} + +// Delete deletes PolicyList +func (policylist *PolicyList) Delete() (*PolicyList, error) { + operation := "Delete" + title := "hcsshim::PolicyList::" + operation + logrus.Debugf(title+" id=%s", policylist.ID) + + return PolicyListRequest("DELETE", policylist.ID, "") +} + +// AddEndpoint add an endpoint to a Policy List +func (policylist *PolicyList) AddEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) { + operation := "AddEndpoint" + title := "hcsshim::PolicyList::" + operation + logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id) + + _, err := policylist.Delete() + if err != nil { + return nil, err + } + + // Add Endpoint to the Existing List + policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id) + + return policylist.Create() +} + +// RemoveEndpoint removes an endpoint from the Policy List +func (policylist *PolicyList) RemoveEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) { + operation := "RemoveEndpoint" + title := "hcsshim::PolicyList::" + operation + logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id) + + _, err := policylist.Delete() + if err != nil { + return nil, err + } + + elementToRemove := "/endpoints/" + endpoint.Id + + var references []string + + for _, endpointReference := range policylist.EndpointReferences { + if endpointReference == elementToRemove { + continue + } + references = append(references, endpointReference) + } + policylist.EndpointReferences = references + return policylist.Create() +} + +// AddLoadBalancer policy list for the specified endpoints +func AddLoadBalancer(endpoints []HNSEndpoint, isILB bool, isDSR bool, sourceVIP, vip string, protocol uint16, internalPort uint16, externalPort uint16) (*PolicyList, error) { + operation := "AddLoadBalancer" + title := "hcsshim::PolicyList::" + operation + logrus.Debugf(title+" endpointId=%v, isILB=%v, sourceVIP=%s, vip=%s, protocol=%v, internalPort=%v, externalPort=%v", endpoints, isILB, sourceVIP, vip, protocol, internalPort, externalPort) + + policylist := &PolicyList{} + + elbPolicy := &ELBPolicy{ + SourceVIP: sourceVIP, + ILB: isILB, + DSR: isDSR, + } + + if len(vip) > 0 { + elbPolicy.VIPs = []string{vip} + } + elbPolicy.Type = ExternalLoadBalancer + elbPolicy.Protocol = protocol + elbPolicy.InternalPort = internalPort + elbPolicy.ExternalPort = externalPort + + for _, endpoint := range endpoints { + policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id) + } + + jsonString, err := json.Marshal(elbPolicy) + if err != nil { + return nil, err + } + policylist.Policies = append(policylist.Policies, jsonString) + return policylist.Create() +} + +// AddRoute adds route policy list for the specified endpoints +func AddRoute(endpoints []HNSEndpoint, destinationPrefix string, nextHop string, encapEnabled bool) (*PolicyList, error) { + operation := "AddRoute" + title := "hcsshim::PolicyList::" + operation + logrus.Debugf(title+" destinationPrefix:%s", destinationPrefix) + + policylist := &PolicyList{} + + rPolicy := &RoutePolicy{ + DestinationPrefix: destinationPrefix, + NextHop: nextHop, + EncapEnabled: encapEnabled, + } + rPolicy.Type = Route + + for _, endpoint := range endpoints { + policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id) + } + + jsonString, err := json.Marshal(rPolicy) + if err != nil { + return nil, err + } + + policylist.Policies = append(policylist.Policies, jsonString) + return policylist.Create() +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnssupport.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnssupport.go new file mode 100644 index 0000000000..d5efba7f28 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnssupport.go @@ -0,0 +1,49 @@ +package hns + +import ( + "github.com/sirupsen/logrus" +) + +type HNSSupportedFeatures struct { + Acl HNSAclFeatures `json:"ACL"` +} + +type HNSAclFeatures struct { + AclAddressLists bool `json:"AclAddressLists"` + AclNoHostRulePriority bool `json:"AclHostRulePriority"` + AclPortRanges bool `json:"AclPortRanges"` + AclRuleId bool `json:"AclRuleId"` +} + +func GetHNSSupportedFeatures() HNSSupportedFeatures { + var hnsFeatures HNSSupportedFeatures + + globals, err := GetHNSGlobals() + if err != nil { + // Expected on pre-1803 builds, all features will be false/unsupported + logrus.Debugf("Unable to obtain HNS globals: %s", err) + return hnsFeatures + } + + hnsFeatures.Acl = HNSAclFeatures{ + AclAddressLists: isHNSFeatureSupported(globals.Version, HNSVersion1803), + AclNoHostRulePriority: isHNSFeatureSupported(globals.Version, HNSVersion1803), + AclPortRanges: isHNSFeatureSupported(globals.Version, HNSVersion1803), + AclRuleId: isHNSFeatureSupported(globals.Version, HNSVersion1803), + } + + return hnsFeatures +} + +func isHNSFeatureSupported(currentVersion HNSVersion, minVersionSupported HNSVersion) bool { + if currentVersion.Major < minVersionSupported.Major { + return false + } + if currentVersion.Major > minVersionSupported.Major { + return true + } + if currentVersion.Minor < minVersionSupported.Minor { + return false + } + return true +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/namespace.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/namespace.go new file mode 100644 index 0000000000..45e2281b07 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/namespace.go @@ -0,0 +1,110 @@ +package hns + +import ( + "encoding/json" + "fmt" + "os" + "path" + "strings" +) + +type namespaceRequest struct { + IsDefault bool `json:",omitempty"` +} + +type namespaceEndpointRequest struct { + ID string `json:"Id"` +} + +type NamespaceResource struct { + Type string + Data json.RawMessage +} + +type namespaceResourceRequest struct { + Type string + Data interface{} +} + +type Namespace struct { + ID string + IsDefault bool `json:",omitempty"` + ResourceList []NamespaceResource `json:",omitempty"` +} + +func issueNamespaceRequest(id *string, method, subpath string, request interface{}) (*Namespace, error) { + var err error + hnspath := "/namespaces/" + if id != nil { + hnspath = path.Join(hnspath, *id) + } + if subpath != "" { + hnspath = path.Join(hnspath, subpath) + } + var reqJSON []byte + if request != nil { + if reqJSON, err = json.Marshal(request); err != nil { + return nil, err + } + } + var ns Namespace + err = hnsCall(method, hnspath, string(reqJSON), &ns) + if err != nil { + if strings.Contains(err.Error(), "Element not found.") { + return nil, os.ErrNotExist + } + return nil, fmt.Errorf("%s %s: %s", method, hnspath, err) + } + return &ns, err +} + +func CreateNamespace() (string, error) { + req := namespaceRequest{} + ns, err := issueNamespaceRequest(nil, "POST", "", &req) + if err != nil { + return "", err + } + return ns.ID, nil +} + +func RemoveNamespace(id string) error { + _, err := issueNamespaceRequest(&id, "DELETE", "", nil) + return err +} + +func GetNamespaceEndpoints(id string) ([]string, error) { + ns, err := issueNamespaceRequest(&id, "GET", "", nil) + if err != nil { + return nil, err + } + var endpoints []string + for _, rsrc := range ns.ResourceList { + if rsrc.Type == "Endpoint" { + var endpoint namespaceEndpointRequest + err = json.Unmarshal(rsrc.Data, &endpoint) + if err != nil { + return nil, fmt.Errorf("unmarshal endpoint: %s", err) + } + endpoints = append(endpoints, endpoint.ID) + } + } + return endpoints, nil +} + +func AddNamespaceEndpoint(id string, endpointID string) error { + resource := namespaceResourceRequest{ + Type: "Endpoint", + Data: namespaceEndpointRequest{endpointID}, + } + _, err := issueNamespaceRequest(&id, "POST", "addresource", &resource) + return err +} + +func RemoveNamespaceEndpoint(id string, endpointID string) error { + resource := namespaceResourceRequest{ + Type: "Endpoint", + Data: namespaceEndpointRequest{endpointID}, + } + _, err := issueNamespaceRequest(&id, "POST", "removeresource", &resource) + return err +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/zsyscall_windows.go new file mode 100644 index 0000000000..863e3429c7 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/zsyscall_windows.go @@ -0,0 +1,74 @@ +// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT + +package hns + +import ( + "syscall" + "unsafe" + + "github.com/Microsoft/hcsshim/internal/interop" + "golang.org/x/sys/windows" +) + +var _ unsafe.Pointer + +// Do the interface allocations only once for common +// Errno values. +const ( + errnoERROR_IO_PENDING = 997 +) + +var ( + errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) +) + +// errnoErr returns common boxed Errno values, to prevent +// allocations at runtime. +func errnoErr(e syscall.Errno) error { + switch e { + case 0: + return nil + case errnoERROR_IO_PENDING: + return errERROR_IO_PENDING + } + // TODO: add more here, after collecting data on the common + // error values see on Windows. (perhaps when running + // all.bat?) + return e +} + +var ( + modvmcompute = windows.NewLazySystemDLL("vmcompute.dll") + + procHNSCall = modvmcompute.NewProc("HNSCall") +) + +func _hnsCall(method string, path string, object string, response **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(method) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(path) + if hr != nil { + return + } + var _p2 *uint16 + _p2, hr = syscall.UTF16PtrFromString(object) + if hr != nil { + return + } + return __hnsCall(_p0, _p1, _p2, response) +} + +func __hnsCall(method *uint16, path *uint16, object *uint16, response **uint16) (hr error) { + if hr = procHNSCall.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHNSCall.Addr(), 4, uintptr(unsafe.Pointer(method)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(object)), uintptr(unsafe.Pointer(response)), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go b/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go new file mode 100644 index 0000000000..f10c88d08c --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go @@ -0,0 +1,27 @@ +package interop + +import ( + "syscall" + "unsafe" +) + +//go:generate go run $GOROOT/src/syscall/mksyscall_windows.go -output zsyscall_windows.go interop.go + +//sys coTaskMemFree(buffer unsafe.Pointer) = ole32.CoTaskMemFree + +func ConvertAndFreeCoTaskMemString(buffer *uint16) string { + str := syscall.UTF16ToString((*[1 << 29]uint16)(unsafe.Pointer(buffer))[:]) + coTaskMemFree(unsafe.Pointer(buffer)) + return str +} + +func ConvertAndFreeCoTaskMemBytes(buffer *uint16) []byte { + return []byte(ConvertAndFreeCoTaskMemString(buffer)) +} + +func Win32FromHresult(hr uintptr) syscall.Errno { + if hr&0x1fff0000 == 0x00070000 { + return syscall.Errno(hr & 0xffff) + } + return syscall.Errno(hr) +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/interop/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/interop/zsyscall_windows.go new file mode 100644 index 0000000000..2f5bf8f555 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/interop/zsyscall_windows.go @@ -0,0 +1,48 @@ +// Code generated by 'go generate'; DO NOT EDIT. + +package interop + +import ( + "syscall" + "unsafe" + + "golang.org/x/sys/windows" +) + +var _ unsafe.Pointer + +// Do the interface allocations only once for common +// Errno values. +const ( + errnoERROR_IO_PENDING = 997 +) + +var ( + errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) +) + +// errnoErr returns common boxed Errno values, to prevent +// allocations at runtime. +func errnoErr(e syscall.Errno) error { + switch e { + case 0: + return nil + case errnoERROR_IO_PENDING: + return errERROR_IO_PENDING + } + // TODO: add more here, after collecting data on the common + // error values see on Windows. (perhaps when running + // all.bat?) + return e +} + +var ( + modole32 = windows.NewLazySystemDLL("ole32.dll") + + procCoTaskMemFree = modole32.NewProc("CoTaskMemFree") +) + +func coTaskMemFree(buffer unsafe.Pointer) { + syscall.Syscall(procCoTaskMemFree.Addr(), 1, uintptr(buffer), 0, 0) + return +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/longpath/longpath.go b/vendor/github.com/Microsoft/hcsshim/internal/longpath/longpath.go new file mode 100644 index 0000000000..e5b8b85e09 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/longpath/longpath.go @@ -0,0 +1,24 @@ +package longpath + +import ( + "path/filepath" + "strings" +) + +// LongAbs makes a path absolute and returns it in NT long path form. +func LongAbs(path string) (string, error) { + if strings.HasPrefix(path, `\\?\`) || strings.HasPrefix(path, `\\.\`) { + return path, nil + } + if !filepath.IsAbs(path) { + absPath, err := filepath.Abs(path) + if err != nil { + return "", err + } + path = absPath + } + if strings.HasPrefix(path, `\\`) { + return `\\?\UNC\` + path[2:], nil + } + return `\\?\` + path, nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/mergemaps/merge.go b/vendor/github.com/Microsoft/hcsshim/internal/mergemaps/merge.go new file mode 100644 index 0000000000..7e95efb30d --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/mergemaps/merge.go @@ -0,0 +1,52 @@ +package mergemaps + +import "encoding/json" + +// Merge recursively merges map `fromMap` into map `ToMap`. Any pre-existing values +// in ToMap are overwritten. Values in fromMap are added to ToMap. +// From http://stackoverflow.com/questions/40491438/merging-two-json-strings-in-golang +func Merge(fromMap, ToMap interface{}) interface{} { + switch fromMap := fromMap.(type) { + case map[string]interface{}: + ToMap, ok := ToMap.(map[string]interface{}) + if !ok { + return fromMap + } + for keyToMap, valueToMap := range ToMap { + if valueFromMap, ok := fromMap[keyToMap]; ok { + fromMap[keyToMap] = Merge(valueFromMap, valueToMap) + } else { + fromMap[keyToMap] = valueToMap + } + } + case nil: + // merge(nil, map[string]interface{...}) -> map[string]interface{...} + ToMap, ok := ToMap.(map[string]interface{}) + if ok { + return ToMap + } + } + return fromMap +} + +// MergeJSON merges the contents of a JSON string into an object representation, +// returning a new object suitable for translating to JSON. +func MergeJSON(object interface{}, additionalJSON []byte) (interface{}, error) { + if len(additionalJSON) == 0 { + return object, nil + } + objectJSON, err := json.Marshal(object) + if err != nil { + return nil, err + } + var objectMap, newMap map[string]interface{} + err = json.Unmarshal(objectJSON, &objectMap) + if err != nil { + return nil, err + } + err = json.Unmarshal(additionalJSON, &newMap) + if err != nil { + return nil, err + } + return Merge(newMap, objectMap), nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/safefile/safeopen.go b/vendor/github.com/Microsoft/hcsshim/internal/safefile/safeopen.go new file mode 100644 index 0000000000..0c0b1159f2 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/safefile/safeopen.go @@ -0,0 +1,431 @@ +package safefile + +import ( + "errors" + "io" + "os" + "path/filepath" + "strings" + "syscall" + "unicode/utf16" + "unsafe" + + "github.com/Microsoft/hcsshim/internal/longpath" + + winio "github.com/Microsoft/go-winio" +) + +//go:generate go run $GOROOT\src\syscall\mksyscall_windows.go -output zsyscall_windows.go safeopen.go + +//sys ntCreateFile(handle *uintptr, accessMask uint32, oa *objectAttributes, iosb *ioStatusBlock, allocationSize *uint64, fileAttributes uint32, shareAccess uint32, createDisposition uint32, createOptions uint32, eaBuffer *byte, eaLength uint32) (status uint32) = ntdll.NtCreateFile +//sys ntSetInformationFile(handle uintptr, iosb *ioStatusBlock, information uintptr, length uint32, class uint32) (status uint32) = ntdll.NtSetInformationFile +//sys rtlNtStatusToDosError(status uint32) (winerr error) = ntdll.RtlNtStatusToDosErrorNoTeb +//sys localAlloc(flags uint32, size int) (ptr uintptr) = kernel32.LocalAlloc +//sys localFree(ptr uintptr) = kernel32.LocalFree + +type ioStatusBlock struct { + Status, Information uintptr +} + +type objectAttributes struct { + Length uintptr + RootDirectory uintptr + ObjectName uintptr + Attributes uintptr + SecurityDescriptor uintptr + SecurityQoS uintptr +} + +type unicodeString struct { + Length uint16 + MaximumLength uint16 + Buffer uintptr +} + +type fileLinkInformation struct { + ReplaceIfExists bool + RootDirectory uintptr + FileNameLength uint32 + FileName [1]uint16 +} + +type fileDispositionInformationEx struct { + Flags uintptr +} + +const ( + _FileLinkInformation = 11 + _FileDispositionInformationEx = 64 + + FILE_READ_ATTRIBUTES = 0x0080 + FILE_WRITE_ATTRIBUTES = 0x0100 + DELETE = 0x10000 + + FILE_OPEN = 1 + FILE_CREATE = 2 + + FILE_DIRECTORY_FILE = 0x00000001 + FILE_SYNCHRONOUS_IO_NONALERT = 0x00000020 + FILE_DELETE_ON_CLOSE = 0x00001000 + FILE_OPEN_FOR_BACKUP_INTENT = 0x00004000 + FILE_OPEN_REPARSE_POINT = 0x00200000 + + FILE_DISPOSITION_DELETE = 0x00000001 + + _OBJ_DONT_REPARSE = 0x1000 + + _STATUS_REPARSE_POINT_ENCOUNTERED = 0xC000050B +) + +func OpenRoot(path string) (*os.File, error) { + longpath, err := longpath.LongAbs(path) + if err != nil { + return nil, err + } + return winio.OpenForBackup(longpath, syscall.GENERIC_READ, syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, syscall.OPEN_EXISTING) +} + +func ntRelativePath(path string) ([]uint16, error) { + path = filepath.Clean(path) + if strings.Contains(":", path) { + // Since alternate data streams must follow the file they + // are attached to, finding one here (out of order) is invalid. + return nil, errors.New("path contains invalid character `:`") + } + fspath := filepath.FromSlash(path) + if len(fspath) > 0 && fspath[0] == '\\' { + return nil, errors.New("expected relative path") + } + + path16 := utf16.Encode(([]rune)(fspath)) + if len(path16) > 32767 { + return nil, syscall.ENAMETOOLONG + } + + return path16, nil +} + +// openRelativeInternal opens a relative path from the given root, failing if +// any of the intermediate path components are reparse points. +func openRelativeInternal(path string, root *os.File, accessMask uint32, shareFlags uint32, createDisposition uint32, flags uint32) (*os.File, error) { + var ( + h uintptr + iosb ioStatusBlock + oa objectAttributes + ) + + path16, err := ntRelativePath(path) + if err != nil { + return nil, err + } + + if root == nil || root.Fd() == 0 { + return nil, errors.New("missing root directory") + } + + upathBuffer := localAlloc(0, int(unsafe.Sizeof(unicodeString{}))+len(path16)*2) + defer localFree(upathBuffer) + + upath := (*unicodeString)(unsafe.Pointer(upathBuffer)) + upath.Length = uint16(len(path16) * 2) + upath.MaximumLength = upath.Length + upath.Buffer = upathBuffer + unsafe.Sizeof(*upath) + copy((*[32768]uint16)(unsafe.Pointer(upath.Buffer))[:], path16) + + oa.Length = unsafe.Sizeof(oa) + oa.ObjectName = upathBuffer + oa.RootDirectory = uintptr(root.Fd()) + oa.Attributes = _OBJ_DONT_REPARSE + status := ntCreateFile( + &h, + accessMask|syscall.SYNCHRONIZE, + &oa, + &iosb, + nil, + 0, + shareFlags, + createDisposition, + FILE_OPEN_FOR_BACKUP_INTENT|FILE_SYNCHRONOUS_IO_NONALERT|flags, + nil, + 0, + ) + if status != 0 { + return nil, rtlNtStatusToDosError(status) + } + + fullPath, err := longpath.LongAbs(filepath.Join(root.Name(), path)) + if err != nil { + syscall.Close(syscall.Handle(h)) + return nil, err + } + + return os.NewFile(h, fullPath), nil +} + +// OpenRelative opens a relative path from the given root, failing if +// any of the intermediate path components are reparse points. +func OpenRelative(path string, root *os.File, accessMask uint32, shareFlags uint32, createDisposition uint32, flags uint32) (*os.File, error) { + f, err := openRelativeInternal(path, root, accessMask, shareFlags, createDisposition, flags) + if err != nil { + err = &os.PathError{Op: "open", Path: filepath.Join(root.Name(), path), Err: err} + } + return f, err +} + +// LinkRelative creates a hard link from oldname to newname (relative to oldroot +// and newroot), failing if any of the intermediate path components are reparse +// points. +func LinkRelative(oldname string, oldroot *os.File, newname string, newroot *os.File) error { + // Open the old file. + oldf, err := openRelativeInternal( + oldname, + oldroot, + syscall.FILE_WRITE_ATTRIBUTES, + syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, + FILE_OPEN, + 0, + ) + if err != nil { + return &os.LinkError{Op: "link", Old: filepath.Join(oldroot.Name(), oldname), New: filepath.Join(newroot.Name(), newname), Err: err} + } + defer oldf.Close() + + // Open the parent of the new file. + var parent *os.File + parentPath := filepath.Dir(newname) + if parentPath != "." { + parent, err = openRelativeInternal( + parentPath, + newroot, + syscall.GENERIC_READ, + syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, + FILE_OPEN, + FILE_DIRECTORY_FILE) + if err != nil { + return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(newroot.Name(), newname), Err: err} + } + defer parent.Close() + + fi, err := winio.GetFileBasicInfo(parent) + if err != nil { + return err + } + if (fi.FileAttributes & syscall.FILE_ATTRIBUTE_REPARSE_POINT) != 0 { + return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(newroot.Name(), newname), Err: rtlNtStatusToDosError(_STATUS_REPARSE_POINT_ENCOUNTERED)} + } + + } else { + parent = newroot + } + + // Issue an NT call to create the link. This will be safe because NT will + // not open any more directories to create the link, so it cannot walk any + // more reparse points. + newbase := filepath.Base(newname) + newbase16, err := ntRelativePath(newbase) + if err != nil { + return err + } + + size := int(unsafe.Offsetof(fileLinkInformation{}.FileName)) + len(newbase16)*2 + linkinfoBuffer := localAlloc(0, size) + defer localFree(linkinfoBuffer) + linkinfo := (*fileLinkInformation)(unsafe.Pointer(linkinfoBuffer)) + linkinfo.RootDirectory = parent.Fd() + linkinfo.FileNameLength = uint32(len(newbase16) * 2) + copy((*[32768]uint16)(unsafe.Pointer(&linkinfo.FileName[0]))[:], newbase16) + + var iosb ioStatusBlock + status := ntSetInformationFile( + oldf.Fd(), + &iosb, + linkinfoBuffer, + uint32(size), + _FileLinkInformation, + ) + if status != 0 { + return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(parent.Name(), newbase), Err: rtlNtStatusToDosError(status)} + } + + return nil +} + +// deleteOnClose marks a file to be deleted when the handle is closed. +func deleteOnClose(f *os.File) error { + disposition := fileDispositionInformationEx{Flags: FILE_DISPOSITION_DELETE} + var iosb ioStatusBlock + status := ntSetInformationFile( + f.Fd(), + &iosb, + uintptr(unsafe.Pointer(&disposition)), + uint32(unsafe.Sizeof(disposition)), + _FileDispositionInformationEx, + ) + if status != 0 { + return rtlNtStatusToDosError(status) + } + return nil +} + +// clearReadOnly clears the readonly attribute on a file. +func clearReadOnly(f *os.File) error { + bi, err := winio.GetFileBasicInfo(f) + if err != nil { + return err + } + if bi.FileAttributes&syscall.FILE_ATTRIBUTE_READONLY == 0 { + return nil + } + sbi := winio.FileBasicInfo{ + FileAttributes: bi.FileAttributes &^ syscall.FILE_ATTRIBUTE_READONLY, + } + if sbi.FileAttributes == 0 { + sbi.FileAttributes = syscall.FILE_ATTRIBUTE_NORMAL + } + return winio.SetFileBasicInfo(f, &sbi) +} + +// RemoveRelative removes a file or directory relative to a root, failing if any +// intermediate path components are reparse points. +func RemoveRelative(path string, root *os.File) error { + f, err := openRelativeInternal( + path, + root, + FILE_READ_ATTRIBUTES|FILE_WRITE_ATTRIBUTES|DELETE, + syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, + FILE_OPEN, + FILE_OPEN_REPARSE_POINT) + if err == nil { + defer f.Close() + err = deleteOnClose(f) + if err == syscall.ERROR_ACCESS_DENIED { + // Maybe the file is marked readonly. Clear the bit and retry. + clearReadOnly(f) + err = deleteOnClose(f) + } + } + if err != nil { + return &os.PathError{Op: "remove", Path: filepath.Join(root.Name(), path), Err: err} + } + return nil +} + +// RemoveAllRelative removes a directory tree relative to a root, failing if any +// intermediate path components are reparse points. +func RemoveAllRelative(path string, root *os.File) error { + fi, err := LstatRelative(path, root) + if err != nil { + if os.IsNotExist(err) { + return nil + } + return err + } + fileAttributes := fi.Sys().(*syscall.Win32FileAttributeData).FileAttributes + if fileAttributes&syscall.FILE_ATTRIBUTE_DIRECTORY == 0 || fileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT != 0 { + // If this is a reparse point, it can't have children. Simple remove will do. + err := RemoveRelative(path, root) + if err == nil || os.IsNotExist(err) { + return nil + } + return err + } + + // It is necessary to use os.Open as Readdirnames does not work with + // OpenRelative. This is safe because the above lstatrelative fails + // if the target is outside the root, and we know this is not a + // symlink from the above FILE_ATTRIBUTE_REPARSE_POINT check. + fd, err := os.Open(filepath.Join(root.Name(), path)) + if err != nil { + if os.IsNotExist(err) { + // Race. It was deleted between the Lstat and Open. + // Return nil per RemoveAll's docs. + return nil + } + return err + } + + // Remove contents & return first error. + for { + names, err1 := fd.Readdirnames(100) + for _, name := range names { + err1 := RemoveAllRelative(path+string(os.PathSeparator)+name, root) + if err == nil { + err = err1 + } + } + if err1 == io.EOF { + break + } + // If Readdirnames returned an error, use it. + if err == nil { + err = err1 + } + if len(names) == 0 { + break + } + } + fd.Close() + + // Remove directory. + err1 := RemoveRelative(path, root) + if err1 == nil || os.IsNotExist(err1) { + return nil + } + if err == nil { + err = err1 + } + return err +} + +// MkdirRelative creates a directory relative to a root, failing if any +// intermediate path components are reparse points. +func MkdirRelative(path string, root *os.File) error { + f, err := openRelativeInternal( + path, + root, + 0, + syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, + FILE_CREATE, + FILE_DIRECTORY_FILE) + if err == nil { + f.Close() + } else { + err = &os.PathError{Op: "mkdir", Path: filepath.Join(root.Name(), path), Err: err} + } + return err +} + +// LstatRelative performs a stat operation on a file relative to a root, failing +// if any intermediate path components are reparse points. +func LstatRelative(path string, root *os.File) (os.FileInfo, error) { + f, err := openRelativeInternal( + path, + root, + FILE_READ_ATTRIBUTES, + syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, + FILE_OPEN, + FILE_OPEN_REPARSE_POINT) + if err != nil { + return nil, &os.PathError{Op: "stat", Path: filepath.Join(root.Name(), path), Err: err} + } + defer f.Close() + return f.Stat() +} + +// EnsureNotReparsePointRelative validates that a given file (relative to a +// root) and all intermediate path components are not a reparse points. +func EnsureNotReparsePointRelative(path string, root *os.File) error { + // Perform an open with OBJ_DONT_REPARSE but without specifying FILE_OPEN_REPARSE_POINT. + f, err := OpenRelative( + path, + root, + 0, + syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, + FILE_OPEN, + 0) + if err != nil { + return err + } + f.Close() + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/safefile/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/safefile/zsyscall_windows.go new file mode 100644 index 0000000000..709b9d3475 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/safefile/zsyscall_windows.go @@ -0,0 +1,79 @@ +// Code generated by 'go generate'; DO NOT EDIT. + +package safefile + +import ( + "syscall" + "unsafe" + + "golang.org/x/sys/windows" +) + +var _ unsafe.Pointer + +// Do the interface allocations only once for common +// Errno values. +const ( + errnoERROR_IO_PENDING = 997 +) + +var ( + errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) +) + +// errnoErr returns common boxed Errno values, to prevent +// allocations at runtime. +func errnoErr(e syscall.Errno) error { + switch e { + case 0: + return nil + case errnoERROR_IO_PENDING: + return errERROR_IO_PENDING + } + // TODO: add more here, after collecting data on the common + // error values see on Windows. (perhaps when running + // all.bat?) + return e +} + +var ( + modntdll = windows.NewLazySystemDLL("ntdll.dll") + modkernel32 = windows.NewLazySystemDLL("kernel32.dll") + + procNtCreateFile = modntdll.NewProc("NtCreateFile") + procNtSetInformationFile = modntdll.NewProc("NtSetInformationFile") + procRtlNtStatusToDosErrorNoTeb = modntdll.NewProc("RtlNtStatusToDosErrorNoTeb") + procLocalAlloc = modkernel32.NewProc("LocalAlloc") + procLocalFree = modkernel32.NewProc("LocalFree") +) + +func ntCreateFile(handle *uintptr, accessMask uint32, oa *objectAttributes, iosb *ioStatusBlock, allocationSize *uint64, fileAttributes uint32, shareAccess uint32, createDisposition uint32, createOptions uint32, eaBuffer *byte, eaLength uint32) (status uint32) { + r0, _, _ := syscall.Syscall12(procNtCreateFile.Addr(), 11, uintptr(unsafe.Pointer(handle)), uintptr(accessMask), uintptr(unsafe.Pointer(oa)), uintptr(unsafe.Pointer(iosb)), uintptr(unsafe.Pointer(allocationSize)), uintptr(fileAttributes), uintptr(shareAccess), uintptr(createDisposition), uintptr(createOptions), uintptr(unsafe.Pointer(eaBuffer)), uintptr(eaLength), 0) + status = uint32(r0) + return +} + +func ntSetInformationFile(handle uintptr, iosb *ioStatusBlock, information uintptr, length uint32, class uint32) (status uint32) { + r0, _, _ := syscall.Syscall6(procNtSetInformationFile.Addr(), 5, uintptr(handle), uintptr(unsafe.Pointer(iosb)), uintptr(information), uintptr(length), uintptr(class), 0) + status = uint32(r0) + return +} + +func rtlNtStatusToDosError(status uint32) (winerr error) { + r0, _, _ := syscall.Syscall(procRtlNtStatusToDosErrorNoTeb.Addr(), 1, uintptr(status), 0, 0) + if r0 != 0 { + winerr = syscall.Errno(r0) + } + return +} + +func localAlloc(flags uint32, size int) (ptr uintptr) { + r0, _, _ := syscall.Syscall(procLocalAlloc.Addr(), 2, uintptr(flags), uintptr(size), 0) + ptr = uintptr(r0) + return +} + +func localFree(ptr uintptr) { + syscall.Syscall(procLocalFree.Addr(), 1, uintptr(ptr), 0, 0) + return +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go b/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go new file mode 100644 index 0000000000..995433ace6 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go @@ -0,0 +1,245 @@ +package schema1 + +import ( + "encoding/json" + "time" + + "github.com/Microsoft/hcsshim/internal/schema2" +) + +// ProcessConfig is used as both the input of Container.CreateProcess +// and to convert the parameters to JSON for passing onto the HCS +type ProcessConfig struct { + ApplicationName string `json:",omitempty"` + CommandLine string `json:",omitempty"` + CommandArgs []string `json:",omitempty"` // Used by Linux Containers on Windows + User string `json:",omitempty"` + WorkingDirectory string `json:",omitempty"` + Environment map[string]string `json:",omitempty"` + EmulateConsole bool `json:",omitempty"` + CreateStdInPipe bool `json:",omitempty"` + CreateStdOutPipe bool `json:",omitempty"` + CreateStdErrPipe bool `json:",omitempty"` + ConsoleSize [2]uint `json:",omitempty"` + CreateInUtilityVm bool `json:",omitempty"` // Used by Linux Containers on Windows + OCISpecification *json.RawMessage `json:",omitempty"` // Used by Linux Containers on Windows +} + +type Layer struct { + ID string + Path string +} + +type MappedDir struct { + HostPath string + ContainerPath string + ReadOnly bool + BandwidthMaximum uint64 + IOPSMaximum uint64 + CreateInUtilityVM bool + // LinuxMetadata - Support added in 1803/RS4+. + LinuxMetadata bool `json:",omitempty"` +} + +type MappedPipe struct { + HostPath string + ContainerPipeName string +} + +type HvRuntime struct { + ImagePath string `json:",omitempty"` + SkipTemplate bool `json:",omitempty"` + LinuxInitrdFile string `json:",omitempty"` // File under ImagePath on host containing an initrd image for starting a Linux utility VM + LinuxKernelFile string `json:",omitempty"` // File under ImagePath on host containing a kernel for starting a Linux utility VM + LinuxBootParameters string `json:",omitempty"` // Additional boot parameters for starting a Linux Utility VM in initrd mode + BootSource string `json:",omitempty"` // "Vhd" for Linux Utility VM booting from VHD + WritableBootSource bool `json:",omitempty"` // Linux Utility VM booting from VHD +} + +type MappedVirtualDisk struct { + HostPath string `json:",omitempty"` // Path to VHD on the host + ContainerPath string // Platform-specific mount point path in the container + CreateInUtilityVM bool `json:",omitempty"` + ReadOnly bool `json:",omitempty"` + Cache string `json:",omitempty"` // "" (Unspecified); "Disabled"; "Enabled"; "Private"; "PrivateAllowSharing" + AttachOnly bool `json:",omitempty:` +} + +// AssignedDevice represents a device that has been directly assigned to a container +// +// NOTE: Support added in RS5 +type AssignedDevice struct { + // InterfaceClassGUID of the device to assign to container. + InterfaceClassGUID string `json:"InterfaceClassGuid,omitempty"` +} + +// ContainerConfig is used as both the input of CreateContainer +// and to convert the parameters to JSON for passing onto the HCS +type ContainerConfig struct { + SystemType string // HCS requires this to be hard-coded to "Container" + Name string // Name of the container. We use the docker ID. + Owner string `json:",omitempty"` // The management platform that created this container + VolumePath string `json:",omitempty"` // Windows volume path for scratch space. Used by Windows Server Containers only. Format \\?\\Volume{GUID} + IgnoreFlushesDuringBoot bool `json:",omitempty"` // Optimization hint for container startup in Windows + LayerFolderPath string `json:",omitempty"` // Where the layer folders are located. Used by Windows Server Containers only. Format %root%\windowsfilter\containerID + Layers []Layer // List of storage layers. Required for Windows Server and Hyper-V Containers. Format ID=GUID;Path=%root%\windowsfilter\layerID + Credentials string `json:",omitempty"` // Credentials information + ProcessorCount uint32 `json:",omitempty"` // Number of processors to assign to the container. + ProcessorWeight uint64 `json:",omitempty"` // CPU shares (relative weight to other containers with cpu shares). Range is from 1 to 10000. A value of 0 results in default shares. + ProcessorMaximum int64 `json:",omitempty"` // Specifies the portion of processor cycles that this container can use as a percentage times 100. Range is from 1 to 10000. A value of 0 results in no limit. + StorageIOPSMaximum uint64 `json:",omitempty"` // Maximum Storage IOPS + StorageBandwidthMaximum uint64 `json:",omitempty"` // Maximum Storage Bandwidth in bytes per second + StorageSandboxSize uint64 `json:",omitempty"` // Size in bytes that the container system drive should be expanded to if smaller + MemoryMaximumInMB int64 `json:",omitempty"` // Maximum memory available to the container in Megabytes + HostName string `json:",omitempty"` // Hostname + MappedDirectories []MappedDir `json:",omitempty"` // List of mapped directories (volumes/mounts) + MappedPipes []MappedPipe `json:",omitempty"` // List of mapped Windows named pipes + HvPartition bool // True if it a Hyper-V Container + NetworkSharedContainerName string `json:",omitempty"` // Name (ID) of the container that we will share the network stack with. + EndpointList []string `json:",omitempty"` // List of networking endpoints to be attached to container + HvRuntime *HvRuntime `json:",omitempty"` // Hyper-V container settings. Used by Hyper-V containers only. Format ImagePath=%root%\BaseLayerID\UtilityVM + Servicing bool `json:",omitempty"` // True if this container is for servicing + AllowUnqualifiedDNSQuery bool `json:",omitempty"` // True to allow unqualified DNS name resolution + DNSSearchList string `json:",omitempty"` // Comma seperated list of DNS suffixes to use for name resolution + ContainerType string `json:",omitempty"` // "Linux" for Linux containers on Windows. Omitted otherwise. + TerminateOnLastHandleClosed bool `json:",omitempty"` // Should HCS terminate the container once all handles have been closed + MappedVirtualDisks []MappedVirtualDisk `json:",omitempty"` // Array of virtual disks to mount at start + AssignedDevices []AssignedDevice `json:",omitempty"` // Array of devices to assign. NOTE: Support added in RS5 +} + +type ComputeSystemQuery struct { + IDs []string `json:"Ids,omitempty"` + Types []string `json:",omitempty"` + Names []string `json:",omitempty"` + Owners []string `json:",omitempty"` +} + +type PropertyType string + +const ( + PropertyTypeStatistics PropertyType = "Statistics" // V1 and V2 + PropertyTypeProcessList = "ProcessList" // V1 and V2 + PropertyTypeMappedVirtualDisk = "MappedVirtualDisk" // Not supported in V2 schema call + PropertyTypeGuestConnection = "GuestConnection" // V1 and V2. Nil return from HCS before RS5 +) + +type PropertyQuery struct { + PropertyTypes []PropertyType `json:",omitempty"` +} + +// ContainerProperties holds the properties for a container and the processes running in that container +type ContainerProperties struct { + ID string `json:"Id"` + State string + Name string + SystemType string + Owner string + SiloGUID string `json:"SiloGuid,omitempty"` + RuntimeID string `json:"RuntimeId,omitempty"` + IsRuntimeTemplate bool `json:",omitempty"` + RuntimeImagePath string `json:",omitempty"` + Stopped bool `json:",omitempty"` + ExitType string `json:",omitempty"` + AreUpdatesPending bool `json:",omitempty"` + ObRoot string `json:",omitempty"` + Statistics Statistics `json:",omitempty"` + ProcessList []ProcessListItem `json:",omitempty"` + MappedVirtualDiskControllers map[int]MappedVirtualDiskController `json:",omitempty"` + GuestConnectionInfo GuestConnectionInfo `json:",omitempty"` +} + +// MemoryStats holds the memory statistics for a container +type MemoryStats struct { + UsageCommitBytes uint64 `json:"MemoryUsageCommitBytes,omitempty"` + UsageCommitPeakBytes uint64 `json:"MemoryUsageCommitPeakBytes,omitempty"` + UsagePrivateWorkingSetBytes uint64 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"` +} + +// ProcessorStats holds the processor statistics for a container +type ProcessorStats struct { + TotalRuntime100ns uint64 `json:",omitempty"` + RuntimeUser100ns uint64 `json:",omitempty"` + RuntimeKernel100ns uint64 `json:",omitempty"` +} + +// StorageStats holds the storage statistics for a container +type StorageStats struct { + ReadCountNormalized uint64 `json:",omitempty"` + ReadSizeBytes uint64 `json:",omitempty"` + WriteCountNormalized uint64 `json:",omitempty"` + WriteSizeBytes uint64 `json:",omitempty"` +} + +// NetworkStats holds the network statistics for a container +type NetworkStats struct { + BytesReceived uint64 `json:",omitempty"` + BytesSent uint64 `json:",omitempty"` + PacketsReceived uint64 `json:",omitempty"` + PacketsSent uint64 `json:",omitempty"` + DroppedPacketsIncoming uint64 `json:",omitempty"` + DroppedPacketsOutgoing uint64 `json:",omitempty"` + EndpointId string `json:",omitempty"` + InstanceId string `json:",omitempty"` +} + +// Statistics is the structure returned by a statistics call on a container +type Statistics struct { + Timestamp time.Time `json:",omitempty"` + ContainerStartTime time.Time `json:",omitempty"` + Uptime100ns uint64 `json:",omitempty"` + Memory MemoryStats `json:",omitempty"` + Processor ProcessorStats `json:",omitempty"` + Storage StorageStats `json:",omitempty"` + Network []NetworkStats `json:",omitempty"` +} + +// ProcessList is the structure of an item returned by a ProcessList call on a container +type ProcessListItem struct { + CreateTimestamp time.Time `json:",omitempty"` + ImageName string `json:",omitempty"` + KernelTime100ns uint64 `json:",omitempty"` + MemoryCommitBytes uint64 `json:",omitempty"` + MemoryWorkingSetPrivateBytes uint64 `json:",omitempty"` + MemoryWorkingSetSharedBytes uint64 `json:",omitempty"` + ProcessId uint32 `json:",omitempty"` + UserTime100ns uint64 `json:",omitempty"` +} + +// MappedVirtualDiskController is the structure of an item returned by a MappedVirtualDiskList call on a container +type MappedVirtualDiskController struct { + MappedVirtualDisks map[int]MappedVirtualDisk `json:",omitempty"` +} + +// GuestDefinedCapabilities is part of the GuestConnectionInfo returned by a GuestConnection call on a utility VM +type GuestDefinedCapabilities struct { + NamespaceAddRequestSupported bool `json:",omitempty"` + SignalProcessSupported bool `json:",omitempty"` +} + +// GuestConnectionInfo is the structure of an iterm return by a GuestConnection call on a utility VM +type GuestConnectionInfo struct { + SupportedSchemaVersions []hcsschema.Version `json:",omitempty"` + ProtocolVersion uint32 `json:",omitempty"` + GuestDefinedCapabilities GuestDefinedCapabilities `json:",omitempty"` +} + +// Type of Request Support in ModifySystem +type RequestType string + +// Type of Resource Support in ModifySystem +type ResourceType string + +// RequestType const +const ( + Add RequestType = "Add" + Remove RequestType = "Remove" + Network ResourceType = "Network" +) + +// ResourceModificationRequestResponse is the structure used to send request to the container to modify the system +// Supported resource types are Network and Request Types are Add/Remove +type ResourceModificationRequestResponse struct { + Resource ResourceType `json:"ResourceType"` + Data interface{} `json:"Settings"` + Request RequestType `json:"RequestType,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go new file mode 100644 index 0000000000..09456cbc21 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go @@ -0,0 +1,31 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Attachment struct { + + Type_ string `json:"Type,omitempty"` + + Path string `json:"Path,omitempty"` + + IgnoreFlushes bool `json:"IgnoreFlushes,omitempty"` + + CachingMode string `json:"CachingMode,omitempty"` + + NoWriteHardening bool `json:"NoWriteHardening,omitempty"` + + DisableExpansionOptimization bool `json:"DisableExpansionOptimization,omitempty"` + + IgnoreRelativeLocator bool `json:"IgnoreRelativeLocator,omitempty"` + + CaptureIoAttributionContext bool `json:"CaptureIoAttributionContext,omitempty"` + + ReadOnly bool `json:"ReadOnly,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/battery.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/battery.go new file mode 100644 index 0000000000..ecbbed4c23 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/battery.go @@ -0,0 +1,13 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Battery struct { +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go new file mode 100644 index 0000000000..243779eab6 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go @@ -0,0 +1,19 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type CacheQueryStatsResponse struct { + + L3OccupancyBytes int32 `json:"L3OccupancyBytes,omitempty"` + + L3TotalBwBytes int32 `json:"L3TotalBwBytes,omitempty"` + + L3LocalBwBytes int32 `json:"L3LocalBwBytes,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/chipset.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/chipset.go new file mode 100644 index 0000000000..3fb24e2505 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/chipset.go @@ -0,0 +1,25 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Chipset struct { + + Uefi *Uefi `json:"Uefi,omitempty"` + + IsNumLockDisabled bool `json:"IsNumLockDisabled,omitempty"` + + BaseBoardSerialNumber string `json:"BaseBoardSerialNumber,omitempty"` + + ChassisSerialNumber string `json:"ChassisSerialNumber,omitempty"` + + ChassisAssetTag string `json:"ChassisAssetTag,omitempty"` + + UseUtc bool `json:"UseUtc,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go new file mode 100644 index 0000000000..88f01707a7 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type CloseHandle struct { + + Handle string `json:"Handle,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go new file mode 100644 index 0000000000..c665be3d5a --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go @@ -0,0 +1,18 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// ComPort specifies the named pipe that will be used for the port, with empty string indicating a disconnected port. +type ComPort struct { + + NamedPipe string `json:"NamedPipe,omitempty"` + + OptimizeForDebugger bool `json:"OptimizeForDebugger,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go new file mode 100644 index 0000000000..85785d2858 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go @@ -0,0 +1,27 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type ComputeSystem struct { + + Owner string `json:"Owner,omitempty"` + + SchemaVersion *Version `json:"SchemaVersion,omitempty"` + + HostingSystemId string `json:"HostingSystemId,omitempty"` + + HostedSystem *HostedSystem `json:"HostedSystem,omitempty"` + + Container *Container `json:"Container,omitempty"` + + VirtualMachine *VirtualMachine `json:"VirtualMachine,omitempty"` + + ShouldTerminateOnLastHandleClosed bool `json:"ShouldTerminateOnLastHandleClosed,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go new file mode 100644 index 0000000000..1a47db7d95 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go @@ -0,0 +1,72 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +import ( + "net/http" +) + +// contextKeys are used to identify the type of value in the context. +// Since these are string, it is possible to get a short description of the +// context key for logging and debugging using key.String(). + +type contextKey string + +func (c contextKey) String() string { + return "auth " + string(c) +} + +var ( + // ContextOAuth2 takes a oauth2.TokenSource as authentication for the request. + ContextOAuth2 = contextKey("token") + + // ContextBasicAuth takes BasicAuth as authentication for the request. + ContextBasicAuth = contextKey("basic") + + // ContextAccessToken takes a string oauth2 access token as authentication for the request. + ContextAccessToken = contextKey("accesstoken") + + // ContextAPIKey takes an APIKey as authentication for the request + ContextAPIKey = contextKey("apikey") +) + +// BasicAuth provides basic http authentication to a request passed via context using ContextBasicAuth +type BasicAuth struct { + UserName string `json:"userName,omitempty"` + Password string `json:"password,omitempty"` +} + +// APIKey provides API key based authentication to a request passed via context using ContextAPIKey +type APIKey struct { + Key string + Prefix string +} + +type Configuration struct { + BasePath string `json:"basePath,omitempty"` + Host string `json:"host,omitempty"` + Scheme string `json:"scheme,omitempty"` + DefaultHeader map[string]string `json:"defaultHeader,omitempty"` + UserAgent string `json:"userAgent,omitempty"` + HTTPClient *http.Client +} + +func NewConfiguration() *Configuration { + cfg := &Configuration{ + BasePath: "https://localhost", + DefaultHeader: make(map[string]string), + UserAgent: "Swagger-Codegen/2.1.0/go", + } + return cfg +} + +func (c *Configuration) AddDefaultHeader(key string, value string) { + c.DefaultHeader[key] = value +} \ No newline at end of file diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go new file mode 100644 index 0000000000..adbe07fe55 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type ConsoleSize struct { + + Height int32 `json:"Height,omitempty"` + + Width int32 `json:"Width,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go new file mode 100644 index 0000000000..17dce28bc7 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go @@ -0,0 +1,35 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Container struct { + + GuestOs *GuestOs `json:"GuestOs,omitempty"` + + Storage *Storage `json:"Storage,omitempty"` + + MappedDirectories []MappedDirectory `json:"MappedDirectories,omitempty"` + + MappedPipes []MappedPipe `json:"MappedPipes,omitempty"` + + Memory *Memory `json:"Memory,omitempty"` + + Processor *Processor `json:"Processor,omitempty"` + + Networking *Networking `json:"Networking,omitempty"` + + HvSocket *HvSocket `json:"HvSocket,omitempty"` + + ContainerCredentialGuard *ContainerCredentialGuardState `json:"ContainerCredentialGuard,omitempty"` + + RegistryChanges *RegistryChanges `json:"RegistryChanges,omitempty"` + + AssignedDevices []Device `json:"AssignedDevices,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_credential_guard_state.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_credential_guard_state.go new file mode 100644 index 0000000000..0f8f644379 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_credential_guard_state.go @@ -0,0 +1,25 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type ContainerCredentialGuardState struct { + + // Authentication cookie for calls to a Container Credential Guard instance. + Cookie string `json:"Cookie,omitempty"` + + // Name of the RPC endpoint of the Container Credential Guard instance. + RpcEndpoint string `json:"RpcEndpoint,omitempty"` + + // Transport used for the configured Container Credential Guard instance. + Transport string `json:"Transport,omitempty"` + + // Credential spec used for the configured Container Credential Guard instance. + CredentialSpec string `json:"CredentialSpec,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go new file mode 100644 index 0000000000..754797e213 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go @@ -0,0 +1,26 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// memory usage as viewed from within the container +type ContainerMemoryInformation struct { + + TotalPhysicalBytes int32 `json:"TotalPhysicalBytes,omitempty"` + + TotalUsage int32 `json:"TotalUsage,omitempty"` + + CommittedBytes int32 `json:"CommittedBytes,omitempty"` + + SharedCommittedBytes int32 `json:"SharedCommittedBytes,omitempty"` + + CommitLimitBytes int32 `json:"CommitLimitBytes,omitempty"` + + PeakCommitmentBytes int32 `json:"PeakCommitmentBytes,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/device.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/device.go new file mode 100644 index 0000000000..ca319bbbce --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/device.go @@ -0,0 +1,16 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Device struct { + + // The interface class guid of the device to assign to container. + InterfaceClassGuid string `json:"InterfaceClassGuid,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go new file mode 100644 index 0000000000..b2191c571d --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go @@ -0,0 +1,43 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Devices struct { + + ComPorts map[string]ComPort `json:"ComPorts,omitempty"` + + Scsi map[string]Scsi `json:"Scsi,omitempty"` + + VirtualPMem *VirtualPMemController `json:"VirtualPMem,omitempty"` + + NetworkAdapters map[string]NetworkAdapter `json:"NetworkAdapters,omitempty"` + + VideoMonitor *VideoMonitor `json:"VideoMonitor,omitempty"` + + Keyboard *Keyboard `json:"Keyboard,omitempty"` + + Mouse *Mouse `json:"Mouse,omitempty"` + + HvSocket *HvSocket2 `json:"HvSocket,omitempty"` + + EnhancedModeVideo *EnhancedModeVideo `json:"EnhancedModeVideo,omitempty"` + + GuestCrashReporting *GuestCrashReporting `json:"GuestCrashReporting,omitempty"` + + VirtualSmb *VirtualSmb `json:"VirtualSmb,omitempty"` + + Plan9 *Plan9 `json:"Plan9,omitempty"` + + Battery *Battery `json:"Battery,omitempty"` + + FlexibleIov map[string]FlexibleIoDevice `json:"FlexibleIov,omitempty"` + + SharedMemory *SharedMemoryConfiguration `json:"SharedMemory,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go new file mode 100644 index 0000000000..4fe592f711 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type EnhancedModeVideo struct { + + ConnectionOptions *RdpConnectionOptions `json:"ConnectionOptions,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go new file mode 100644 index 0000000000..51011afe40 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go @@ -0,0 +1,19 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type FlexibleIoDevice struct { + + EmulatorId string `json:"EmulatorId,omitempty"` + + HostingModel string `json:"HostingModel,omitempty"` + + Configuration []string `json:"Configuration,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_connection.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_connection.go new file mode 100644 index 0000000000..7db29495b3 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_connection.go @@ -0,0 +1,19 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type GuestConnection struct { + + // Use Vsock rather than Hyper-V sockets to communicate with the guest service. + UseVsock bool `json:"UseVsock,omitempty"` + + // Don't disconnect the guest connection when pausing the virtual machine. + UseConnectedSuspend bool `json:"UseConnectedSuspend,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_connection_info.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_connection_info.go new file mode 100644 index 0000000000..8a369bab71 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_connection_info.go @@ -0,0 +1,21 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// Information about the guest. +type GuestConnectionInfo struct { + + // Each schema version x.y stands for the range of versions a.b where a==x and b<=y. This list comes from the SupportedSchemaVersions field in GcsCapabilities. + SupportedSchemaVersions []Version `json:"SupportedSchemaVersions,omitempty"` + + ProtocolVersion int32 `json:"ProtocolVersion,omitempty"` + + GuestDefinedCapabilities *interface{} `json:"GuestDefinedCapabilities,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go new file mode 100644 index 0000000000..c5fa767352 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type GuestCrashReporting struct { + + WindowsCrashSettings *WindowsCrashReporting `json:"WindowsCrashSettings,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go new file mode 100644 index 0000000000..c708fc7c3f --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type GuestOs struct { + + HostName string `json:"HostName,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_state.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_state.go new file mode 100644 index 0000000000..ef1eec8865 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_state.go @@ -0,0 +1,22 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type GuestState struct { + + // The path to an existing file uses for persistent guest state storage. An empty string indicates the system should initialize new transient, in-memory guest state. + GuestStateFilePath string `json:"GuestStateFilePath,omitempty"` + + // The path to an existing file for persistent runtime state storage. An empty string indicates the system should initialize new transient, in-memory runtime state. + RuntimeStateFilePath string `json:"RuntimeStateFilePath,omitempty"` + + // If true, the guest state and runtime state files will be used as templates to populate transient, in-memory state instead of using the files as persistent backing store. + ForceTransientState bool `json:"ForceTransientState,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go new file mode 100644 index 0000000000..0797584c51 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type HostedSystem struct { + + SchemaVersion *Version `json:"SchemaVersion,omitempty"` + + Container *Container `json:"Container,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go new file mode 100644 index 0000000000..ef9ffb8dd9 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type HvSocket struct { + + Config *HvSocketSystemConfig `json:"Config,omitempty"` + + EnablePowerShellDirect bool `json:"EnablePowerShellDirect,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go new file mode 100644 index 0000000000..a19ba15c15 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go @@ -0,0 +1,16 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// HvSocket configuration for a VM +type HvSocket2 struct { + + HvSocketConfig *HvSocketSystemConfig `json:"HvSocketConfig,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_service_config.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_service_config.go new file mode 100644 index 0000000000..a848e91e69 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_service_config.go @@ -0,0 +1,22 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type HvSocketServiceConfig struct { + + // SDDL string that HvSocket will check before allowing a host process to bind to this specific service. If not specified, defaults to the system DefaultBindSecurityDescriptor, defined in HvSocketSystemWpConfig in V1. + BindSecurityDescriptor string `json:"BindSecurityDescriptor,omitempty"` + + // SDDL string that HvSocket will check before allowing a host process to connect to this specific service. If not specified, defaults to the system DefaultConnectSecurityDescriptor, defined in HvSocketSystemWpConfig in V1. + ConnectSecurityDescriptor string `json:"ConnectSecurityDescriptor,omitempty"` + + // If true, HvSocket will process wildcard binds for this service/system combination. Wildcard binds are secured in the registry at SOFTWARE/Microsoft/Windows NT/CurrentVersion/Virtualization/HvSocket/WildcardDescriptors + AllowWildcardBinds bool `json:"AllowWildcardBinds,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_system_config.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_system_config.go new file mode 100644 index 0000000000..69f4f9d39b --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_system_config.go @@ -0,0 +1,22 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// This is the HCS Schema version of the HvSocket configuration. The VMWP version is located in Config.Devices.IC in V1. +type HvSocketSystemConfig struct { + + // SDDL string that HvSocket will check before allowing a host process to bind to an unlisted service for this specific container/VM (not wildcard binds). + DefaultBindSecurityDescriptor string `json:"DefaultBindSecurityDescriptor,omitempty"` + + // SDDL string that HvSocket will check before allowing a host process to connect to an unlisted service in the VM/container. + DefaultConnectSecurityDescriptor string `json:"DefaultConnectSecurityDescriptor,omitempty"` + + ServiceTable map[string]HvSocketServiceConfig `json:"ServiceTable,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/keyboard.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/keyboard.go new file mode 100644 index 0000000000..3d3fa3b1c7 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/keyboard.go @@ -0,0 +1,13 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Keyboard struct { +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go new file mode 100644 index 0000000000..b63b8ef12c --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go @@ -0,0 +1,22 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Layer struct { + + Id string `json:"Id,omitempty"` + + Path string `json:"Path,omitempty"` + + PathType string `json:"PathType,omitempty"` + + // Unspecified defaults to Enabled + Cache string `json:"Cache,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go new file mode 100644 index 0000000000..a823a6d3b8 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go @@ -0,0 +1,21 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type MappedDirectory struct { + + HostPath string `json:"HostPath,omitempty"` + + HostPathType string `json:"HostPathType,omitempty"` + + ContainerPath string `json:"ContainerPath,omitempty"` + + ReadOnly bool `json:"ReadOnly,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go new file mode 100644 index 0000000000..2d1d2604a9 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go @@ -0,0 +1,19 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type MappedPipe struct { + + ContainerPipeName string `json:"ContainerPipeName,omitempty"` + + HostPath string `json:"HostPath,omitempty"` + + HostPathType string `json:"HostPathType,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go new file mode 100644 index 0000000000..e1d135a3a4 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Memory struct { + + SizeInMB int32 `json:"SizeInMB,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_2.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_2.go new file mode 100644 index 0000000000..27d0b8c483 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_2.go @@ -0,0 +1,25 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Memory2 struct { + SizeInMB int32 `json:"SizeInMB,omitempty"` + + AllowOvercommit bool `json:"AllowOvercommit,omitempty"` + + EnableHotHint bool `json:"EnableHotHint,omitempty"` + + EnableColdHint bool `json:"EnableColdHint,omitempty"` + + EnableEpf bool `json:"EnableEpf,omitempty"` + + // EnableDeferredCommit is private in the schema. If regenerated need to add back. + EnableDeferredCommit bool `json:"EnableDeferredCommit,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go new file mode 100644 index 0000000000..bdd87dffd8 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go @@ -0,0 +1,19 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type MemoryInformationForVm struct { + + VirtualNodeCount int32 `json:"VirtualNodeCount,omitempty"` + + VirtualMachineMemory *VmMemory `json:"VirtualMachineMemory,omitempty"` + + VirtualNodes []VirtualNodeInfo `json:"VirtualNodes,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go new file mode 100644 index 0000000000..6214970f69 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go @@ -0,0 +1,20 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// Memory runtime statistics +type MemoryStats struct { + + MemoryUsageCommitBytes int32 `json:"MemoryUsageCommitBytes,omitempty"` + + MemoryUsageCommitPeakBytes int32 `json:"MemoryUsageCommitPeakBytes,omitempty"` + + MemoryUsagePrivateWorkingSetBytes int32 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/modify_setting_request.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/modify_setting_request.go new file mode 100644 index 0000000000..d29455a3e4 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/modify_setting_request.go @@ -0,0 +1,20 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type ModifySettingRequest struct { + ResourcePath string `json:"ResourcePath,omitempty"` + + RequestType string `json:"RequestType,omitempty"` + + Settings interface{} `json:"Settings,omitempty"` // NOTE: Swagger generated as *interface{}. Locally updated + + GuestRequest interface{} `json:"GuestRequest,omitempty"` // NOTE: Swagger generated as *interface{}. Locally updated +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mouse.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mouse.go new file mode 100644 index 0000000000..ccf8b938f3 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mouse.go @@ -0,0 +1,13 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Mouse struct { +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go new file mode 100644 index 0000000000..c586f66c25 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type NetworkAdapter struct { + + EndpointId string `json:"EndpointId,omitempty"` + + MacAddress string `json:"MacAddress,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go new file mode 100644 index 0000000000..12c47827c5 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go @@ -0,0 +1,24 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Networking struct { + + AllowUnqualifiedDnsQuery bool `json:"AllowUnqualifiedDnsQuery,omitempty"` + + DnsSearchList string `json:"DnsSearchList,omitempty"` + + NetworkSharedContainerName string `json:"NetworkSharedContainerName,omitempty"` + + // Guid in windows; string in linux + Namespace string `json:"Namespace,omitempty"` + + NetworkAdapters []string `json:"NetworkAdapters,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go new file mode 100644 index 0000000000..1cd70d1790 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go @@ -0,0 +1,16 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// Notification data that is indicated to components running in the Virtual Machine. +type PauseNotification struct { + + Reason string `json:"Reason,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go new file mode 100644 index 0000000000..780a5cae2c --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go @@ -0,0 +1,18 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// Options for HcsPauseComputeSystem +type PauseOptions struct { + + SuspensionLevel string `json:"SuspensionLevel,omitempty"` + + HostedNotification *PauseNotification `json:"HostedNotification,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go new file mode 100644 index 0000000000..705c677e1f --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Plan9 struct { + + Shares []Plan9Share `json:"Shares,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9_share.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9_share.go new file mode 100644 index 0000000000..b2bc58b83c --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9_share.go @@ -0,0 +1,26 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Plan9Share struct { + + Name string `json:"Name,omitempty"` + + // The name by which the guest operation system can access this share, via the aname parameter in the Plan9 protocol. + AccessName string `json:"AccessName,omitempty"` + + Path string `json:"Path,omitempty"` + + Port int32 `json:"Port,omitempty"` + + ReadOnly bool `json:"ReadOnly,omitempty"` + + UseShareRootIdentity bool `json:"UseShareRootIdentity,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go new file mode 100644 index 0000000000..63e0b7f8fe --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go @@ -0,0 +1,34 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +import ( + "time" +) + +// Information about a process running in a container +type ProcessDetails struct { + + ProcessId int32 `json:"ProcessId,omitempty"` + + ImageName string `json:"ImageName,omitempty"` + + CreateTimestamp time.Time `json:"CreateTimestamp,omitempty"` + + UserTime100ns int32 `json:"UserTime100ns,omitempty"` + + KernelTime100ns int32 `json:"KernelTime100ns,omitempty"` + + MemoryCommitBytes int32 `json:"MemoryCommitBytes,omitempty"` + + MemoryWorkingSetPrivateBytes int32 `json:"MemoryWorkingSetPrivateBytes,omitempty"` + + MemoryWorkingSetSharedBytes int32 `json:"MemoryWorkingSetSharedBytes,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go new file mode 100644 index 0000000000..29bc2e3d00 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go @@ -0,0 +1,20 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// Passed to HcsRpc_ModifyProcess +type ProcessModifyRequest struct { + + Operation string `json:"Operation,omitempty"` + + ConsoleSize *ConsoleSize `json:"ConsoleSize,omitempty"` + + CloseHandle *CloseHandle `json:"CloseHandle,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go new file mode 100644 index 0000000000..470c55734e --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go @@ -0,0 +1,47 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type ProcessParameters struct { + + ApplicationName string `json:"ApplicationName,omitempty"` + + CommandLine string `json:"CommandLine,omitempty"` + + // optional alternative to CommandLine, currently only supported by Linux GCS + CommandArgs []string `json:"CommandArgs,omitempty"` + + User string `json:"User,omitempty"` + + WorkingDirectory string `json:"WorkingDirectory,omitempty"` + + Environment map[string]string `json:"Environment,omitempty"` + + // if set, will run as low-privilege process + RestrictedToken bool `json:"RestrictedToken,omitempty"` + + // if set, ignore StdErrPipe + EmulateConsole bool `json:"EmulateConsole,omitempty"` + + CreateStdInPipe bool `json:"CreateStdInPipe,omitempty"` + + CreateStdOutPipe bool `json:"CreateStdOutPipe,omitempty"` + + CreateStdErrPipe bool `json:"CreateStdErrPipe,omitempty"` + + // height then width + ConsoleSize []int32 `json:"ConsoleSize,omitempty"` + + // if set, find an existing session for the user and create the process in it + UseExistingLogin bool `json:"UseExistingLogin,omitempty"` + + // if set, use the legacy console instead of conhost + UseLegacyConsole bool `json:"UseLegacyConsole,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go new file mode 100644 index 0000000000..20793d1503 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go @@ -0,0 +1,22 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// Status of a process running in a container +type ProcessStatus struct { + + ProcessId int32 `json:"ProcessId,omitempty"` + + Exited bool `json:"Exited,omitempty"` + + ExitCode int32 `json:"ExitCode,omitempty"` + + LastWaitResult int32 `json:"LastWaitResult,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go new file mode 100644 index 0000000000..7a60b0245a --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go @@ -0,0 +1,19 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Processor struct { + + Count int32 `json:"Count,omitempty"` + + Maximum int32 `json:"Maximum,omitempty"` + + Weight int32 `json:"Weight,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go new file mode 100644 index 0000000000..40d3e7356d --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go @@ -0,0 +1,21 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Processor2 struct { + + Count int32 `json:"Count,omitempty"` + + Limit int32 `json:"Limit,omitempty"` + + Weight int32 `json:"Weight,omitempty"` + + ExposeVirtualizationExtensions bool `json:"ExposeVirtualizationExtensions,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go new file mode 100644 index 0000000000..9d3b77e572 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go @@ -0,0 +1,20 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// CPU runtime statistics +type ProcessorStats struct { + + TotalRuntime100ns int32 `json:"TotalRuntime100ns,omitempty"` + + RuntimeUser100ns int32 `json:"RuntimeUser100ns,omitempty"` + + RuntimeKernel100ns int32 `json:"RuntimeKernel100ns,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go new file mode 100644 index 0000000000..6db2a48f66 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go @@ -0,0 +1,47 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Properties struct { + + Id string `json:"Id,omitempty"` + + SystemType string `json:"SystemType,omitempty"` + + RuntimeOsType string `json:"RuntimeOsType,omitempty"` + + Name string `json:"Name,omitempty"` + + Owner string `json:"Owner,omitempty"` + + RuntimeId string `json:"RuntimeId,omitempty"` + + RuntimeTemplateId string `json:"RuntimeTemplateId,omitempty"` + + State string `json:"State,omitempty"` + + Stopped bool `json:"Stopped,omitempty"` + + ExitType string `json:"ExitType,omitempty"` + + Memory *MemoryInformationForVm `json:"Memory,omitempty"` + + Statistics *Statistics `json:"Statistics,omitempty"` + + ProcessList []ProcessDetails `json:"ProcessList,omitempty"` + + TerminateOnLastHandleClosed bool `json:"TerminateOnLastHandleClosed,omitempty"` + + HostingSystemId string `json:"HostingSystemId,omitempty"` + + SharedMemoryRegionInfo []SharedMemoryRegionInfo `json:"SharedMemoryRegionInfo,omitempty"` + + GuestConnectionInfo *GuestConnectionInfo `json:"GuestConnectionInfo,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go new file mode 100644 index 0000000000..22b92ffdfd --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go @@ -0,0 +1,16 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// By default the basic properties will be returned. This query provides a way to request specific properties. +type PropertyQuery struct { + + PropertyTypes []string `json:"PropertyTypes,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go new file mode 100644 index 0000000000..97e4531283 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type RdpConnectionOptions struct { + + AccessSids []string `json:"AccessSids,omitempty"` + + NamedPipe string `json:"NamedPipe,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go new file mode 100644 index 0000000000..fa574ccc80 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type RegistryChanges struct { + + AddValues []RegistryValue `json:"AddValues,omitempty"` + + DeleteKeys []RegistryKey `json:"DeleteKeys,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go new file mode 100644 index 0000000000..fab03bc60b --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go @@ -0,0 +1,19 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type RegistryKey struct { + + Hive string `json:"Hive,omitempty"` + + Name string `json:"Name,omitempty"` + + Volatile bool `json:"Volatile,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go new file mode 100644 index 0000000000..1589f48413 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go @@ -0,0 +1,31 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type RegistryValue struct { + + Key *RegistryKey `json:"Key,omitempty"` + + Name string `json:"Name,omitempty"` + + Type_ string `json:"Type,omitempty"` + + // One and only one value type must be set. + StringValue string `json:"StringValue,omitempty"` + + BinaryValue string `json:"BinaryValue,omitempty"` + + DWordValue int32 `json:"DWordValue,omitempty"` + + QWordValue int32 `json:"QWordValue,omitempty"` + + // Only used if RegistryValueType is CustomType The data is in BinaryValue + CustomType int32 `json:"CustomType,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/restore_state.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/restore_state.go new file mode 100644 index 0000000000..778ff58735 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/restore_state.go @@ -0,0 +1,19 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type RestoreState struct { + + // The path to the save state file to restore the system from. + SaveStateFilePath string `json:"SaveStateFilePath,omitempty"` + + // The ID of the template system to clone this new system off of. An empty string indicates the system should not be cloned from a template. + TemplateSystemId string `json:"TemplateSystemId,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/save_options.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/save_options.go new file mode 100644 index 0000000000..e55fa1d98a --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/save_options.go @@ -0,0 +1,19 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type SaveOptions struct { + + // The type of save operation to be performed. + SaveType string `json:"SaveType,omitempty"` + + // The path to the file that will container the saved state. + SaveStateFilePath string `json:"SaveStateFilePath,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/scsi.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/scsi.go new file mode 100644 index 0000000000..bf253a470b --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/scsi.go @@ -0,0 +1,16 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Scsi struct { + + // Map of attachments, where the key is the integer LUN number on the controller. + Attachments map[string]Attachment `json:"Attachments,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go new file mode 100644 index 0000000000..bd573f6cd4 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type SharedMemoryConfiguration struct { + + Regions []SharedMemoryRegion `json:"Regions,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go new file mode 100644 index 0000000000..a57b2cba73 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go @@ -0,0 +1,23 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type SharedMemoryRegion struct { + + SectionName string `json:"SectionName,omitempty"` + + StartOffset int32 `json:"StartOffset,omitempty"` + + Length int32 `json:"Length,omitempty"` + + AllowGuestWrite bool `json:"AllowGuestWrite,omitempty"` + + HiddenFromGuest bool `json:"HiddenFromGuest,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go new file mode 100644 index 0000000000..d9a50cc7da --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type SharedMemoryRegionInfo struct { + + SectionName string `json:"SectionName,omitempty"` + + GuestPhysicalAddress int32 `json:"GuestPhysicalAddress,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go new file mode 100644 index 0000000000..599c06e8aa --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go @@ -0,0 +1,18 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// Silo job information +type SiloProperties struct { + + Enabled bool `json:"Enabled,omitempty"` + + JobName string `json:"JobName,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go new file mode 100644 index 0000000000..5cb3ed93b5 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go @@ -0,0 +1,30 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +import ( + "time" +) + +// Runtime statistics for a container +type Statistics struct { + + Timestamp time.Time `json:"Timestamp,omitempty"` + + ContainerStartTime time.Time `json:"ContainerStartTime,omitempty"` + + Uptime100ns int32 `json:"Uptime100ns,omitempty"` + + Processor *ProcessorStats `json:"Processor,omitempty"` + + Memory *MemoryStats `json:"Memory,omitempty"` + + Storage *StorageStats `json:"Storage,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage.go new file mode 100644 index 0000000000..2627af9132 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage.go @@ -0,0 +1,21 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Storage struct { + + // List of layers that describe the parent hierarchy for a container's storage. These layers combined together, presented as a disposable and/or committable working storage, are used by the container to record all changes done to the parent layers. + Layers []Layer `json:"Layers,omitempty"` + + // Path that points to the scratch space of a container, where parent layers are combined together to present a new disposable and/or committable layer with the changes done during its runtime. + Path string `json:"Path,omitempty"` + + QoS *StorageQoS `json:"QoS,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go new file mode 100644 index 0000000000..8c5255df1e --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type StorageQoS struct { + + IopsMaximum int32 `json:"IopsMaximum,omitempty"` + + BandwidthMaximum int32 `json:"BandwidthMaximum,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go new file mode 100644 index 0000000000..198ea57d75 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go @@ -0,0 +1,22 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// Storage runtime statistics +type StorageStats struct { + + ReadCountNormalized int32 `json:"ReadCountNormalized,omitempty"` + + ReadSizeBytes int32 `json:"ReadSizeBytes,omitempty"` + + WriteCountNormalized int32 `json:"WriteCountNormalized,omitempty"` + + WriteSizeBytes int32 `json:"WriteSizeBytes,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go new file mode 100644 index 0000000000..af2e3c8234 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Topology struct { + + Memory *Memory2 `json:"Memory,omitempty"` + + Processor *Processor2 `json:"Processor,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go new file mode 100644 index 0000000000..ba91178f96 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go @@ -0,0 +1,21 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Uefi struct { + + EnableDebugger bool `json:"EnableDebugger,omitempty"` + + SecureBootTemplateId string `json:"SecureBootTemplateId,omitempty"` + + BootThis *UefiBootEntry `json:"BootThis,omitempty"` + + Console string `json:"Console,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go new file mode 100644 index 0000000000..6620fb2bcf --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go @@ -0,0 +1,23 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type UefiBootEntry struct { + + DeviceType string `json:"DeviceType,omitempty"` + + DevicePath string `json:"DevicePath,omitempty"` + + DiskNumber int32 `json:"DiskNumber,omitempty"` + + OptionalData string `json:"OptionalData,omitempty"` + + VmbFsRootPath string `json:"VmbFsRootPath,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go new file mode 100644 index 0000000000..62c0e4d12a --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Version struct { + + Major int32 `json:"Major,omitempty"` + + Minor int32 `json:"Minor,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go new file mode 100644 index 0000000000..0958e56062 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go @@ -0,0 +1,19 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type VideoMonitor struct { + + HorizontalResolution int32 `json:"HorizontalResolution,omitempty"` + + VerticalResolution int32 `json:"VerticalResolution,omitempty"` + + ConnectionOptions *RdpConnectionOptions `json:"ConnectionOptions,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_machine.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_machine.go new file mode 100644 index 0000000000..11f39eea7b --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_machine.go @@ -0,0 +1,29 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type VirtualMachine struct { + + Chipset *Chipset `json:"Chipset,omitempty"` + + ComputeTopology *Topology `json:"ComputeTopology,omitempty"` + + Devices *Devices `json:"Devices,omitempty"` + + GuestState *GuestState `json:"GuestState,omitempty"` + + RestoreState *RestoreState `json:"RestoreState,omitempty"` + + RegistryChanges *RegistryChanges `json:"RegistryChanges,omitempty"` + + StorageQoS *StorageQoS `json:"StorageQoS,omitempty"` + + GuestConnection *GuestConnection `json:"GuestConnection,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go new file mode 100644 index 0000000000..48402d8ecb --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go @@ -0,0 +1,21 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type VirtualNodeInfo struct { + + VirtualNodeIndex int32 `json:"VirtualNodeIndex,omitempty"` + + PhysicalNodeNumber int32 `json:"PhysicalNodeNumber,omitempty"` + + VirtualProcessorCount int32 `json:"VirtualProcessorCount,omitempty"` + + MemoryUsageInPages int32 `json:"MemoryUsageInPages,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_controller.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_controller.go new file mode 100644 index 0000000000..f5b7f3e38c --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_controller.go @@ -0,0 +1,20 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type VirtualPMemController struct { + Devices map[string]VirtualPMemDevice `json:"Devices,omitempty"` + + MaximumCount uint32 `json:"MaximumCount,omitempty"` + + MaximumSizeBytes uint64 `json:"MaximumSizeBytes,omitempty"` + + Backing string `json:"Backing,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go new file mode 100644 index 0000000000..47714444aa --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go @@ -0,0 +1,19 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type VirtualPMemDevice struct { + + HostPath string `json:"HostPath,omitempty"` + + ReadOnly bool `json:"ReadOnly,omitempty"` + + ImageFormat string `json:"ImageFormat,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go new file mode 100644 index 0000000000..76131b3a71 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type VirtualSmb struct { + + Shares []VirtualSmbShare `json:"Shares,omitempty"` + + DirectFileMappingInMB int64 `json:"DirectFileMappingInMB,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go new file mode 100644 index 0000000000..b50098a423 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go @@ -0,0 +1,21 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type VirtualSmbShare struct { + + Name string `json:"Name,omitempty"` + + Path string `json:"Path,omitempty"` + + AllowedFiles []string `json:"AllowedFiles,omitempty"` + + Options *VirtualSmbShareOptions `json:"Options,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go new file mode 100644 index 0000000000..c1894279dc --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go @@ -0,0 +1,63 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type VirtualSmbShareOptions struct { + + ReadOnly bool `json:"ReadOnly,omitempty"` + + // convert exclusive access to shared read access + ShareRead bool `json:"ShareRead,omitempty"` + + // all opens will use cached I/O + CacheIo bool `json:"CacheIo,omitempty"` + + // disable oplock support + NoOplocks bool `json:"NoOplocks,omitempty"` + + // Acquire the backup privilege when attempting to open + TakeBackupPrivilege bool `json:"TakeBackupPrivilege,omitempty"` + + // Use the identity of the share root when opening + UseShareRootIdentity bool `json:"UseShareRootIdentity,omitempty"` + + // disable Direct Mapping + NoDirectmap bool `json:"NoDirectmap,omitempty"` + + // disable Byterange locks + NoLocks bool `json:"NoLocks,omitempty"` + + // disable Directory CHange Notifications + NoDirnotify bool `json:"NoDirnotify,omitempty"` + + // share is use for VM shared memory + VmSharedMemory bool `json:"VmSharedMemory,omitempty"` + + // allow access only to the files specified in AllowedFiles + RestrictFileAccess bool `json:"RestrictFileAccess,omitempty"` + + // disable all oplocks except Level II + ForceLevelIIOplocks bool `json:"ForceLevelIIOplocks,omitempty"` + + // Allow the host to reparse this base layer + ReparseBaseLayer bool `json:"ReparseBaseLayer,omitempty"` + + // Enable pseudo-oplocks + PseudoOplocks bool `json:"PseudoOplocks,omitempty"` + + // All opens will use non-cached IO + NonCacheIo bool `json:"NonCacheIo,omitempty"` + + // Enable pseudo directory change notifications + PseudoDirnotify bool `json:"PseudoDirnotify,omitempty"` + + // Block directory enumeration, renames, and deletes. + SingleFileMapping bool `json:"SingleFileMapping,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go new file mode 100644 index 0000000000..39f628667c --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go @@ -0,0 +1,27 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type VmMemory struct { + + AvailableMemory int32 `json:"AvailableMemory,omitempty"` + + AvailableMemoryBuffer int32 `json:"AvailableMemoryBuffer,omitempty"` + + ReservedMemory int32 `json:"ReservedMemory,omitempty"` + + AssignedMemory int32 `json:"AssignedMemory,omitempty"` + + SlpActive bool `json:"SlpActive,omitempty"` + + BalancingEnabled bool `json:"BalancingEnabled,omitempty"` + + DmOperationInProgress bool `json:"DmOperationInProgress,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go new file mode 100644 index 0000000000..cf632bbc83 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type WindowsCrashReporting struct { + + DumpFileName string `json:"DumpFileName,omitempty"` + + MaxDumpSize int64 `json:"MaxDumpSize,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/timeout/timeout.go b/vendor/github.com/Microsoft/hcsshim/internal/timeout/timeout.go new file mode 100644 index 0000000000..ff3b6572e6 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/timeout/timeout.go @@ -0,0 +1,70 @@ +package timeout + +import ( + "os" + "strconv" + "time" +) + +var ( + // defaultTimeout is the timeout for most operations that is not overridden. + defaultTimeout = 4 * time.Minute + + // defaultTimeoutTestdRetry is the retry loop timeout for testd to respond + // for a disk to come online in LCOW. + defaultTimeoutTestdRetry = 5 * time.Second +) + +// External variables for HCSShim consumers to use. +var ( + // SystemCreate is the timeout for creating a compute system + SystemCreate time.Duration = defaultTimeout + + // SystemStart is the timeout for starting a compute system + SystemStart time.Duration = defaultTimeout + + // SystemPause is the timeout for pausing a compute system + SystemPause time.Duration = defaultTimeout + + // SystemResume is the timeout for resuming a compute system + SystemResume time.Duration = defaultTimeout + + // SyscallWatcher is the timeout before warning of a potential stuck platform syscall. + SyscallWatcher time.Duration = defaultTimeout + + // Tar2VHD is the timeout for the tar2vhd operation to complete + Tar2VHD time.Duration = defaultTimeout + + // ExternalCommandToStart is the timeout for external commands to start + ExternalCommandToStart = defaultTimeout + + // ExternalCommandToComplete is the timeout for external commands to complete. + // Generally this means copying data from their stdio pipes. + ExternalCommandToComplete = defaultTimeout + + // TestDRetryLoop is the timeout for testd retry loop when onlining a SCSI disk in LCOW + TestDRetryLoop = defaultTimeoutTestdRetry +) + +func init() { + SystemCreate = durationFromEnvironment("HCSSHIM_TIMEOUT_SYSTEMCREATE", SystemCreate) + SystemStart = durationFromEnvironment("HCSSHIM_TIMEOUT_SYSTEMSTART", SystemStart) + SystemPause = durationFromEnvironment("HCSSHIM_TIMEOUT_SYSTEMPAUSE", SystemPause) + SystemResume = durationFromEnvironment("HCSSHIM_TIMEOUT_SYSTEMRESUME", SystemResume) + SyscallWatcher = durationFromEnvironment("HCSSHIM_TIMEOUT_SYSCALLWATCHER", SyscallWatcher) + Tar2VHD = durationFromEnvironment("HCSSHIM_TIMEOUT_TAR2VHD", Tar2VHD) + ExternalCommandToStart = durationFromEnvironment("HCSSHIM_TIMEOUT_EXTERNALCOMMANDSTART", ExternalCommandToStart) + ExternalCommandToComplete = durationFromEnvironment("HCSSHIM_TIMEOUT_EXTERNALCOMMANDCOMPLETE", ExternalCommandToComplete) + TestDRetryLoop = durationFromEnvironment("HCSSHIM_TIMEOUT_TESTDRETRYLOOP", TestDRetryLoop) +} + +func durationFromEnvironment(env string, defaultValue time.Duration) time.Duration { + envTimeout := os.Getenv(env) + if len(envTimeout) > 0 { + e, err := strconv.Atoi(envTimeout) + if err == nil && e > 0 { + return time.Second * time.Duration(e) + } + } + return defaultValue +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/activatelayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/activatelayer.go new file mode 100644 index 0000000000..3a0d4bc58e --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/activatelayer.go @@ -0,0 +1,25 @@ +package wclayer + +import ( + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/sirupsen/logrus" +) + +// ActivateLayer will find the layer with the given id and mount it's filesystem. +// For a read/write layer, the mounted filesystem will appear as a volume on the +// host, while a read-only layer is generally expected to be a no-op. +// An activated layer must later be deactivated via DeactivateLayer. +func ActivateLayer(path string) error { + title := "hcsshim::ActivateLayer " + logrus.Debugf(title+"path %s", path) + + err := activateLayer(&stdDriverInfo, path) + if err != nil { + err = hcserror.Errorf(err, title, "path=%s", path) + logrus.Error(err) + return err + } + + logrus.Debugf(title+" - succeeded path=%s", path) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/baselayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/baselayer.go new file mode 100644 index 0000000000..5784241dfa --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/baselayer.go @@ -0,0 +1,173 @@ +package wclayer + +import ( + "errors" + "os" + "path/filepath" + "syscall" + + "github.com/Microsoft/go-winio" + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/Microsoft/hcsshim/internal/safefile" +) + +type baseLayerWriter struct { + root *os.File + f *os.File + bw *winio.BackupFileWriter + err error + hasUtilityVM bool + dirInfo []dirInfo +} + +type dirInfo struct { + path string + fileInfo winio.FileBasicInfo +} + +// reapplyDirectoryTimes reapplies directory modification, creation, etc. times +// after processing of the directory tree has completed. The times are expected +// to be ordered such that parent directories come before child directories. +func reapplyDirectoryTimes(root *os.File, dis []dirInfo) error { + for i := range dis { + di := &dis[len(dis)-i-1] // reverse order: process child directories first + f, err := safefile.OpenRelative(di.path, root, syscall.GENERIC_READ|syscall.GENERIC_WRITE, syscall.FILE_SHARE_READ, safefile.FILE_OPEN, safefile.FILE_DIRECTORY_FILE) + if err != nil { + return err + } + + err = winio.SetFileBasicInfo(f, &di.fileInfo) + f.Close() + if err != nil { + return err + } + } + return nil +} + +func (w *baseLayerWriter) closeCurrentFile() error { + if w.f != nil { + err := w.bw.Close() + err2 := w.f.Close() + w.f = nil + w.bw = nil + if err != nil { + return err + } + if err2 != nil { + return err2 + } + } + return nil +} + +func (w *baseLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) (err error) { + defer func() { + if err != nil { + w.err = err + } + }() + + err = w.closeCurrentFile() + if err != nil { + return err + } + + if filepath.ToSlash(name) == `UtilityVM/Files` { + w.hasUtilityVM = true + } + + var f *os.File + defer func() { + if f != nil { + f.Close() + } + }() + + extraFlags := uint32(0) + if fileInfo.FileAttributes&syscall.FILE_ATTRIBUTE_DIRECTORY != 0 { + extraFlags |= safefile.FILE_DIRECTORY_FILE + if fileInfo.FileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT == 0 { + w.dirInfo = append(w.dirInfo, dirInfo{name, *fileInfo}) + } + } + + mode := uint32(syscall.GENERIC_READ | syscall.GENERIC_WRITE | winio.WRITE_DAC | winio.WRITE_OWNER | winio.ACCESS_SYSTEM_SECURITY) + f, err = safefile.OpenRelative(name, w.root, mode, syscall.FILE_SHARE_READ, safefile.FILE_CREATE, extraFlags) + if err != nil { + return hcserror.New(err, "Failed to safefile.OpenRelative", name) + } + + err = winio.SetFileBasicInfo(f, fileInfo) + if err != nil { + return hcserror.New(err, "Failed to SetFileBasicInfo", name) + } + + w.f = f + w.bw = winio.NewBackupFileWriter(f, true) + f = nil + return nil +} + +func (w *baseLayerWriter) AddLink(name string, target string) (err error) { + defer func() { + if err != nil { + w.err = err + } + }() + + err = w.closeCurrentFile() + if err != nil { + return err + } + + return safefile.LinkRelative(target, w.root, name, w.root) +} + +func (w *baseLayerWriter) Remove(name string) error { + return errors.New("base layer cannot have tombstones") +} + +func (w *baseLayerWriter) Write(b []byte) (int, error) { + n, err := w.bw.Write(b) + if err != nil { + w.err = err + } + return n, err +} + +func (w *baseLayerWriter) Close() error { + defer func() { + w.root.Close() + w.root = nil + }() + err := w.closeCurrentFile() + if err != nil { + return err + } + if w.err == nil { + // Restore the file times of all the directories, since they may have + // been modified by creating child directories. + err = reapplyDirectoryTimes(w.root, w.dirInfo) + if err != nil { + return err + } + + err = ProcessBaseLayer(w.root.Name()) + if err != nil { + return err + } + + if w.hasUtilityVM { + err := safefile.EnsureNotReparsePointRelative("UtilityVM", w.root) + if err != nil { + return err + } + err = ProcessUtilityVMImage(filepath.Join(w.root.Name(), "UtilityVM")) + if err != nil { + return err + } + } + } + return w.err +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createlayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createlayer.go new file mode 100644 index 0000000000..d158177308 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createlayer.go @@ -0,0 +1,23 @@ +package wclayer + +import ( + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/sirupsen/logrus" +) + +// CreateLayer creates a new, empty, read-only layer on the filesystem based on +// the parent layer provided. +func CreateLayer(path, parent string) error { + title := "hcsshim::CreateLayer " + logrus.Debugf(title+"ID %s parent %s", path, parent) + + err := createLayer(&stdDriverInfo, path, parent) + if err != nil { + err = hcserror.Errorf(err, title, "path=%s parent=%s", path, parent) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"- succeeded path=%s parent=%s", path, parent) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createscratchlayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createscratchlayer.go new file mode 100644 index 0000000000..bf2fece198 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createscratchlayer.go @@ -0,0 +1,31 @@ +package wclayer + +import ( + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/sirupsen/logrus" +) + +// CreateScratchLayer creates and populates new read-write layer for use by a container. +// This requires both the id of the direct parent layer, as well as the full list +// of paths to all parent layers up to the base (and including the direct parent +// whose id was provided). +func CreateScratchLayer(path string, parentLayerPaths []string) error { + title := "hcsshim::CreateScratchLayer " + logrus.Debugf(title+"path %s", path) + + // Generate layer descriptors + layers, err := layerPathsToDescriptors(parentLayerPaths) + if err != nil { + return err + } + + err = createSandboxLayer(&stdDriverInfo, path, 0, layers) + if err != nil { + err = hcserror.Errorf(err, title, "path=%s", path) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"- succeeded path=%s", path) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/deactivatelayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/deactivatelayer.go new file mode 100644 index 0000000000..b998f8a193 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/deactivatelayer.go @@ -0,0 +1,22 @@ +package wclayer + +import ( + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/sirupsen/logrus" +) + +// DeactivateLayer will dismount a layer that was mounted via ActivateLayer. +func DeactivateLayer(path string) error { + title := "hcsshim::DeactivateLayer " + logrus.Debugf(title+"path %s", path) + + err := deactivateLayer(&stdDriverInfo, path) + if err != nil { + err = hcserror.Errorf(err, title, "path=%s", path) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"succeeded path=%s", path) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/destroylayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/destroylayer.go new file mode 100644 index 0000000000..dc14cecc47 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/destroylayer.go @@ -0,0 +1,23 @@ +package wclayer + +import ( + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/sirupsen/logrus" +) + +// DestroyLayer will remove the on-disk files representing the layer with the given +// path, including that layer's containing folder, if any. +func DestroyLayer(path string) error { + title := "hcsshim::DestroyLayer " + logrus.Debugf(title+"path %s", path) + + err := destroyLayer(&stdDriverInfo, path) + if err != nil { + err = hcserror.Errorf(err, title, "path=%s", path) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"succeeded path=%s", path) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go new file mode 100644 index 0000000000..7832bb452e --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go @@ -0,0 +1,22 @@ +package wclayer + +import ( + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/sirupsen/logrus" +) + +// ExpandScratchSize expands the size of a layer to at least size bytes. +func ExpandScratchSize(path string, size uint64) error { + title := "hcsshim::ExpandScratchSize " + logrus.Debugf(title+"path=%s size=%d", path, size) + + err := expandSandboxSize(&stdDriverInfo, path, size) + if err != nil { + err = hcserror.Errorf(err, title, "path=%s size=%d", path, size) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"- succeeded path=%s size=%d", path, size) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/exportlayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/exportlayer.go new file mode 100644 index 0000000000..c6b3480ce7 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/exportlayer.go @@ -0,0 +1,147 @@ +package wclayer + +import ( + "io" + "io/ioutil" + "os" + "syscall" + + "github.com/Microsoft/go-winio" + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/Microsoft/hcsshim/internal/interop" + "github.com/sirupsen/logrus" +) + +// ExportLayer will create a folder at exportFolderPath and fill that folder with +// the transport format version of the layer identified by layerId. This transport +// format includes any metadata required for later importing the layer (using +// ImportLayer), and requires the full list of parent layer paths in order to +// perform the export. +func ExportLayer(path string, exportFolderPath string, parentLayerPaths []string) error { + title := "hcsshim::ExportLayer " + logrus.Debugf(title+"path %s folder %s", path, exportFolderPath) + + // Generate layer descriptors + layers, err := layerPathsToDescriptors(parentLayerPaths) + if err != nil { + return err + } + + err = exportLayer(&stdDriverInfo, path, exportFolderPath, layers) + if err != nil { + err = hcserror.Errorf(err, title, "path=%s folder=%s", path, exportFolderPath) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"succeeded path=%s folder=%s", path, exportFolderPath) + return nil +} + +type LayerReader interface { + Next() (string, int64, *winio.FileBasicInfo, error) + Read(b []byte) (int, error) + Close() error +} + +// FilterLayerReader provides an interface for extracting the contents of an on-disk layer. +type FilterLayerReader struct { + context uintptr +} + +// Next reads the next available file from a layer, ensuring that parent directories are always read +// before child files and directories. +// +// Next returns the file's relative path, size, and basic file metadata. Read() should be used to +// extract a Win32 backup stream with the remainder of the metadata and the data. +func (r *FilterLayerReader) Next() (string, int64, *winio.FileBasicInfo, error) { + var fileNamep *uint16 + fileInfo := &winio.FileBasicInfo{} + var deleted uint32 + var fileSize int64 + err := exportLayerNext(r.context, &fileNamep, fileInfo, &fileSize, &deleted) + if err != nil { + if err == syscall.ERROR_NO_MORE_FILES { + err = io.EOF + } else { + err = hcserror.New(err, "ExportLayerNext", "") + } + return "", 0, nil, err + } + fileName := interop.ConvertAndFreeCoTaskMemString(fileNamep) + if deleted != 0 { + fileInfo = nil + } + if fileName[0] == '\\' { + fileName = fileName[1:] + } + return fileName, fileSize, fileInfo, nil +} + +// Read reads from the current file's Win32 backup stream. +func (r *FilterLayerReader) Read(b []byte) (int, error) { + var bytesRead uint32 + err := exportLayerRead(r.context, b, &bytesRead) + if err != nil { + return 0, hcserror.New(err, "ExportLayerRead", "") + } + if bytesRead == 0 { + return 0, io.EOF + } + return int(bytesRead), nil +} + +// Close frees resources associated with the layer reader. It will return an +// error if there was an error while reading the layer or of the layer was not +// completely read. +func (r *FilterLayerReader) Close() (err error) { + if r.context != 0 { + err = exportLayerEnd(r.context) + if err != nil { + err = hcserror.New(err, "ExportLayerEnd", "") + } + r.context = 0 + } + return +} + +// NewLayerReader returns a new layer reader for reading the contents of an on-disk layer. +// The caller must have taken the SeBackupPrivilege privilege +// to call this and any methods on the resulting LayerReader. +func NewLayerReader(path string, parentLayerPaths []string) (LayerReader, error) { + if procExportLayerBegin.Find() != nil { + // The new layer reader is not available on this Windows build. Fall back to the + // legacy export code path. + exportPath, err := ioutil.TempDir("", "hcs") + if err != nil { + return nil, err + } + err = ExportLayer(path, exportPath, parentLayerPaths) + if err != nil { + os.RemoveAll(exportPath) + return nil, err + } + return &legacyLayerReaderWrapper{newLegacyLayerReader(exportPath)}, nil + } + + layers, err := layerPathsToDescriptors(parentLayerPaths) + if err != nil { + return nil, err + } + r := &FilterLayerReader{} + err = exportLayerBegin(&stdDriverInfo, path, layers, &r.context) + if err != nil { + return nil, hcserror.New(err, "ExportLayerBegin", "") + } + return r, err +} + +type legacyLayerReaderWrapper struct { + *legacyLayerReader +} + +func (r *legacyLayerReaderWrapper) Close() error { + err := r.legacyLayerReader.Close() + os.RemoveAll(r.root) + return err +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getlayermountpath.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getlayermountpath.go new file mode 100644 index 0000000000..8c37549a0e --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getlayermountpath.go @@ -0,0 +1,49 @@ +package wclayer + +import ( + "syscall" + + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/sirupsen/logrus" +) + +// GetLayerMountPath will look for a mounted layer with the given path and return +// the path at which that layer can be accessed. This path may be a volume path +// if the layer is a mounted read-write layer, otherwise it is expected to be the +// folder path at which the layer is stored. +func GetLayerMountPath(path string) (string, error) { + title := "hcsshim::GetLayerMountPath " + logrus.Debugf(title+"path %s", path) + + var mountPathLength uintptr + mountPathLength = 0 + + // Call the procedure itself. + logrus.Debugf("Calling proc (1)") + err := getLayerMountPath(&stdDriverInfo, path, &mountPathLength, nil) + if err != nil { + err = hcserror.Errorf(err, title, "(first call) path=%s", path) + logrus.Error(err) + return "", err + } + + // Allocate a mount path of the returned length. + if mountPathLength == 0 { + return "", nil + } + mountPathp := make([]uint16, mountPathLength) + mountPathp[0] = 0 + + // Call the procedure again + logrus.Debugf("Calling proc (2)") + err = getLayerMountPath(&stdDriverInfo, path, &mountPathLength, &mountPathp[0]) + if err != nil { + err = hcserror.Errorf(err, title, "(second call) path=%s", path) + logrus.Error(err) + return "", err + } + + mountPath := syscall.UTF16ToString(mountPathp[0:]) + logrus.Debugf(title+"succeeded path=%s mountPath=%s", path, mountPath) + return mountPath, nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getsharedbaseimages.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getsharedbaseimages.go new file mode 100644 index 0000000000..10899c68af --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getsharedbaseimages.go @@ -0,0 +1,26 @@ +package wclayer + +import ( + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/Microsoft/hcsshim/internal/interop" + "github.com/sirupsen/logrus" +) + +// GetSharedBaseImages will enumerate the images stored in the common central +// image store and return descriptive info about those images for the purpose +// of registering them with the graphdriver, graph, and tagstore. +func GetSharedBaseImages() (imageData string, err error) { + title := "hcsshim::GetSharedBaseImages " + + logrus.Debugf("Calling proc") + var buffer *uint16 + err = getBaseImages(&buffer) + if err != nil { + err = hcserror.New(err, title, "") + logrus.Error(err) + return + } + imageData = interop.ConvertAndFreeCoTaskMemString(buffer) + logrus.Debugf(title+" - succeeded output=%s", imageData) + return +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/grantvmaccess.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/grantvmaccess.go new file mode 100644 index 0000000000..d86e678275 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/grantvmaccess.go @@ -0,0 +1,24 @@ +package wclayer + +import ( + "fmt" + + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/sirupsen/logrus" +) + +// GrantVmAccess adds access to a file for a given VM +func GrantVmAccess(vmid string, filepath string) error { + title := fmt.Sprintf("hcsshim::GrantVmAccess id:%s path:%s ", vmid, filepath) + logrus.Debugf(title) + + err := grantVmAccess(vmid, filepath) + if err != nil { + err = hcserror.Errorf(err, title, "path=%s", filepath) + logrus.Error(err) + return err + } + + logrus.Debugf(title + " - succeeded") + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/importlayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/importlayer.go new file mode 100644 index 0000000000..c978450f82 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/importlayer.go @@ -0,0 +1,206 @@ +package wclayer + +import ( + "errors" + "io/ioutil" + "os" + "path/filepath" + + "github.com/Microsoft/go-winio" + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/Microsoft/hcsshim/internal/safefile" + "github.com/sirupsen/logrus" +) + +// ImportLayer will take the contents of the folder at importFolderPath and import +// that into a layer with the id layerId. Note that in order to correctly populate +// the layer and interperet the transport format, all parent layers must already +// be present on the system at the paths provided in parentLayerPaths. +func ImportLayer(path string, importFolderPath string, parentLayerPaths []string) error { + title := "hcsshim::ImportLayer " + logrus.Debugf(title+"path %s folder %s", path, importFolderPath) + + // Generate layer descriptors + layers, err := layerPathsToDescriptors(parentLayerPaths) + if err != nil { + return err + } + + err = importLayer(&stdDriverInfo, path, importFolderPath, layers) + if err != nil { + err = hcserror.Errorf(err, title, "path=%s folder=%s", path, importFolderPath) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"succeeded path=%s folder=%s", path, importFolderPath) + return nil +} + +// LayerWriter is an interface that supports writing a new container image layer. +type LayerWriter interface { + // Add adds a file to the layer with given metadata. + Add(name string, fileInfo *winio.FileBasicInfo) error + // AddLink adds a hard link to the layer. The target must already have been added. + AddLink(name string, target string) error + // Remove removes a file that was present in a parent layer from the layer. + Remove(name string) error + // Write writes data to the current file. The data must be in the format of a Win32 + // backup stream. + Write(b []byte) (int, error) + // Close finishes the layer writing process and releases any resources. + Close() error +} + +// FilterLayerWriter provides an interface to write the contents of a layer to the file system. +type FilterLayerWriter struct { + context uintptr +} + +// Add adds a file or directory to the layer. The file's parent directory must have already been added. +// +// name contains the file's relative path. fileInfo contains file times and file attributes; the rest +// of the file metadata and the file data must be written as a Win32 backup stream to the Write() method. +// winio.BackupStreamWriter can be used to facilitate this. +func (w *FilterLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) error { + if name[0] != '\\' { + name = `\` + name + } + err := importLayerNext(w.context, name, fileInfo) + if err != nil { + return hcserror.New(err, "ImportLayerNext", "") + } + return nil +} + +// AddLink adds a hard link to the layer. The target of the link must have already been added. +func (w *FilterLayerWriter) AddLink(name string, target string) error { + return errors.New("hard links not yet supported") +} + +// Remove removes a file from the layer. The file must have been present in the parent layer. +// +// name contains the file's relative path. +func (w *FilterLayerWriter) Remove(name string) error { + if name[0] != '\\' { + name = `\` + name + } + err := importLayerNext(w.context, name, nil) + if err != nil { + return hcserror.New(err, "ImportLayerNext", "") + } + return nil +} + +// Write writes more backup stream data to the current file. +func (w *FilterLayerWriter) Write(b []byte) (int, error) { + err := importLayerWrite(w.context, b) + if err != nil { + err = hcserror.New(err, "ImportLayerWrite", "") + return 0, err + } + return len(b), err +} + +// Close completes the layer write operation. The error must be checked to ensure that the +// operation was successful. +func (w *FilterLayerWriter) Close() (err error) { + if w.context != 0 { + err = importLayerEnd(w.context) + if err != nil { + err = hcserror.New(err, "ImportLayerEnd", "") + } + w.context = 0 + } + return +} + +type legacyLayerWriterWrapper struct { + *legacyLayerWriter + path string + parentLayerPaths []string +} + +func (r *legacyLayerWriterWrapper) Close() error { + defer os.RemoveAll(r.root.Name()) + defer r.legacyLayerWriter.CloseRoots() + err := r.legacyLayerWriter.Close() + if err != nil { + return err + } + + if err = ImportLayer(r.destRoot.Name(), r.path, r.parentLayerPaths); err != nil { + return err + } + for _, name := range r.Tombstones { + if err = safefile.RemoveRelative(name, r.destRoot); err != nil && !os.IsNotExist(err) { + return err + } + } + // Add any hard links that were collected. + for _, lnk := range r.PendingLinks { + if err = safefile.RemoveRelative(lnk.Path, r.destRoot); err != nil && !os.IsNotExist(err) { + return err + } + if err = safefile.LinkRelative(lnk.Target, lnk.TargetRoot, lnk.Path, r.destRoot); err != nil { + return err + } + } + // Prepare the utility VM for use if one is present in the layer. + if r.HasUtilityVM { + err := safefile.EnsureNotReparsePointRelative("UtilityVM", r.destRoot) + if err != nil { + return err + } + err = ProcessUtilityVMImage(filepath.Join(r.destRoot.Name(), "UtilityVM")) + if err != nil { + return err + } + } + return nil +} + +// NewLayerWriter returns a new layer writer for creating a layer on disk. +// The caller must have taken the SeBackupPrivilege and SeRestorePrivilege privileges +// to call this and any methods on the resulting LayerWriter. +func NewLayerWriter(path string, parentLayerPaths []string) (LayerWriter, error) { + if len(parentLayerPaths) == 0 { + // This is a base layer. It gets imported differently. + f, err := safefile.OpenRoot(path) + if err != nil { + return nil, err + } + return &baseLayerWriter{ + root: f, + }, nil + } + + if procImportLayerBegin.Find() != nil { + // The new layer reader is not available on this Windows build. Fall back to the + // legacy export code path. + importPath, err := ioutil.TempDir("", "hcs") + if err != nil { + return nil, err + } + w, err := newLegacyLayerWriter(importPath, parentLayerPaths, path) + if err != nil { + return nil, err + } + return &legacyLayerWriterWrapper{ + legacyLayerWriter: w, + path: importPath, + parentLayerPaths: parentLayerPaths, + }, nil + } + layers, err := layerPathsToDescriptors(parentLayerPaths) + if err != nil { + return nil, err + } + + w := &FilterLayerWriter{} + err = importLayerBegin(&stdDriverInfo, path, layers, &w.context) + if err != nil { + return nil, hcserror.New(err, "ImportLayerStart", "") + } + return w, nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerexists.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerexists.go new file mode 100644 index 0000000000..71287ff8a7 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerexists.go @@ -0,0 +1,25 @@ +package wclayer + +import ( + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/sirupsen/logrus" +) + +// LayerExists will return true if a layer with the given id exists and is known +// to the system. +func LayerExists(path string) (bool, error) { + title := "hcsshim::LayerExists " + logrus.Debugf(title+"path %s", path) + + // Call the procedure itself. + var exists uint32 + err := layerExists(&stdDriverInfo, path, &exists) + if err != nil { + err = hcserror.Errorf(err, title, "path=%s", path) + logrus.Error(err) + return false, err + } + + logrus.Debugf(title+"succeeded path=%s exists=%d", path, exists) + return exists != 0, nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go new file mode 100644 index 0000000000..90df3bedce --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go @@ -0,0 +1,13 @@ +package wclayer + +import ( + "path/filepath" + + "github.com/Microsoft/hcsshim/internal/guid" +) + +// LayerID returns the layer ID of a layer on disk. +func LayerID(path string) (guid.GUID, error) { + _, file := filepath.Split(path) + return NameToGuid(file) +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go new file mode 100644 index 0000000000..a1b8b98826 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go @@ -0,0 +1,96 @@ +package wclayer + +// This file contains utility functions to support storage (graph) related +// functionality. + +import ( + "syscall" + + "github.com/Microsoft/hcsshim/internal/guid" + "github.com/sirupsen/logrus" +) + +/* To pass into syscall, we need a struct matching the following: +enum GraphDriverType +{ + DiffDriver, + FilterDriver +}; + +struct DriverInfo { + GraphDriverType Flavour; + LPCWSTR HomeDir; +}; +*/ + +type driverInfo struct { + Flavour int + HomeDirp *uint16 +} + +var ( + utf16EmptyString uint16 + stdDriverInfo = driverInfo{1, &utf16EmptyString} +) + +/* To pass into syscall, we need a struct matching the following: +typedef struct _WC_LAYER_DESCRIPTOR { + + // + // The ID of the layer + // + + GUID LayerId; + + // + // Additional flags + // + + union { + struct { + ULONG Reserved : 31; + ULONG Dirty : 1; // Created from sandbox as a result of snapshot + }; + ULONG Value; + } Flags; + + // + // Path to the layer root directory, null-terminated + // + + PCWSTR Path; + +} WC_LAYER_DESCRIPTOR, *PWC_LAYER_DESCRIPTOR; +*/ +type WC_LAYER_DESCRIPTOR struct { + LayerId guid.GUID + Flags uint32 + Pathp *uint16 +} + +func layerPathsToDescriptors(parentLayerPaths []string) ([]WC_LAYER_DESCRIPTOR, error) { + // Array of descriptors that gets constructed. + var layers []WC_LAYER_DESCRIPTOR + + for i := 0; i < len(parentLayerPaths); i++ { + g, err := LayerID(parentLayerPaths[i]) + if err != nil { + logrus.Debugf("Failed to convert name to guid %s", err) + return nil, err + } + + p, err := syscall.UTF16PtrFromString(parentLayerPaths[i]) + if err != nil { + logrus.Debugf("Failed conversion of parentLayerPath to pointer %s", err) + return nil, err + } + + layers = append(layers, WC_LAYER_DESCRIPTOR{ + LayerId: g, + Flags: 0, + Pathp: p, + }) + } + + return layers, nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/legacy.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/legacy.go new file mode 100644 index 0000000000..b8ea5d2632 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/legacy.go @@ -0,0 +1,815 @@ +package wclayer + +import ( + "bufio" + "encoding/binary" + "errors" + "fmt" + "io" + "io/ioutil" + "os" + "path/filepath" + "strings" + "syscall" + + "github.com/Microsoft/go-winio" + "github.com/Microsoft/hcsshim/internal/longpath" + "github.com/Microsoft/hcsshim/internal/safefile" +) + +var errorIterationCanceled = errors.New("") + +var mutatedUtilityVMFiles = map[string]bool{ + `EFI\Microsoft\Boot\BCD`: true, + `EFI\Microsoft\Boot\BCD.LOG`: true, + `EFI\Microsoft\Boot\BCD.LOG1`: true, + `EFI\Microsoft\Boot\BCD.LOG2`: true, +} + +const ( + filesPath = `Files` + hivesPath = `Hives` + utilityVMPath = `UtilityVM` + utilityVMFilesPath = `UtilityVM\Files` +) + +func openFileOrDir(path string, mode uint32, createDisposition uint32) (file *os.File, err error) { + return winio.OpenForBackup(path, mode, syscall.FILE_SHARE_READ, createDisposition) +} + +func hasPathPrefix(p, prefix string) bool { + return strings.HasPrefix(p, prefix) && len(p) > len(prefix) && p[len(prefix)] == '\\' +} + +type fileEntry struct { + path string + fi os.FileInfo + err error +} + +type legacyLayerReader struct { + root string + result chan *fileEntry + proceed chan bool + currentFile *os.File + backupReader *winio.BackupFileReader +} + +// newLegacyLayerReader returns a new LayerReader that can read the Windows +// container layer transport format from disk. +func newLegacyLayerReader(root string) *legacyLayerReader { + r := &legacyLayerReader{ + root: root, + result: make(chan *fileEntry), + proceed: make(chan bool), + } + go r.walk() + return r +} + +func readTombstones(path string) (map[string]([]string), error) { + tf, err := os.Open(filepath.Join(path, "tombstones.txt")) + if err != nil { + return nil, err + } + defer tf.Close() + s := bufio.NewScanner(tf) + if !s.Scan() || s.Text() != "\xef\xbb\xbfVersion 1.0" { + return nil, errors.New("Invalid tombstones file") + } + + ts := make(map[string]([]string)) + for s.Scan() { + t := filepath.Join(filesPath, s.Text()[1:]) // skip leading `\` + dir := filepath.Dir(t) + ts[dir] = append(ts[dir], t) + } + if err = s.Err(); err != nil { + return nil, err + } + + return ts, nil +} + +func (r *legacyLayerReader) walkUntilCancelled() error { + root, err := longpath.LongAbs(r.root) + if err != nil { + return err + } + + r.root = root + ts, err := readTombstones(r.root) + if err != nil { + return err + } + + err = filepath.Walk(r.root, func(path string, info os.FileInfo, err error) error { + if err != nil { + return err + } + + // Indirect fix for https://github.com/moby/moby/issues/32838#issuecomment-343610048. + // Handle failure from what may be a golang bug in the conversion of + // UTF16 to UTF8 in files which are left in the recycle bin. Os.Lstat + // which is called by filepath.Walk will fail when a filename contains + // unicode characters. Skip the recycle bin regardless which is goodness. + if strings.EqualFold(path, filepath.Join(r.root, `Files\$Recycle.Bin`)) && info.IsDir() { + return filepath.SkipDir + } + + if path == r.root || path == filepath.Join(r.root, "tombstones.txt") || strings.HasSuffix(path, ".$wcidirs$") { + return nil + } + + r.result <- &fileEntry{path, info, nil} + if !<-r.proceed { + return errorIterationCanceled + } + + // List all the tombstones. + if info.IsDir() { + relPath, err := filepath.Rel(r.root, path) + if err != nil { + return err + } + if dts, ok := ts[relPath]; ok { + for _, t := range dts { + r.result <- &fileEntry{filepath.Join(r.root, t), nil, nil} + if !<-r.proceed { + return errorIterationCanceled + } + } + } + } + return nil + }) + if err == errorIterationCanceled { + return nil + } + if err == nil { + return io.EOF + } + return err +} + +func (r *legacyLayerReader) walk() { + defer close(r.result) + if !<-r.proceed { + return + } + + err := r.walkUntilCancelled() + if err != nil { + for { + r.result <- &fileEntry{err: err} + if !<-r.proceed { + return + } + } + } +} + +func (r *legacyLayerReader) reset() { + if r.backupReader != nil { + r.backupReader.Close() + r.backupReader = nil + } + if r.currentFile != nil { + r.currentFile.Close() + r.currentFile = nil + } +} + +func findBackupStreamSize(r io.Reader) (int64, error) { + br := winio.NewBackupStreamReader(r) + for { + hdr, err := br.Next() + if err != nil { + if err == io.EOF { + err = nil + } + return 0, err + } + if hdr.Id == winio.BackupData { + return hdr.Size, nil + } + } +} + +func (r *legacyLayerReader) Next() (path string, size int64, fileInfo *winio.FileBasicInfo, err error) { + r.reset() + r.proceed <- true + fe := <-r.result + if fe == nil { + err = errors.New("LegacyLayerReader closed") + return + } + if fe.err != nil { + err = fe.err + return + } + + path, err = filepath.Rel(r.root, fe.path) + if err != nil { + return + } + + if fe.fi == nil { + // This is a tombstone. Return a nil fileInfo. + return + } + + if fe.fi.IsDir() && hasPathPrefix(path, filesPath) { + fe.path += ".$wcidirs$" + } + + f, err := openFileOrDir(fe.path, syscall.GENERIC_READ, syscall.OPEN_EXISTING) + if err != nil { + return + } + defer func() { + if f != nil { + f.Close() + } + }() + + fileInfo, err = winio.GetFileBasicInfo(f) + if err != nil { + return + } + + if !hasPathPrefix(path, filesPath) { + size = fe.fi.Size() + r.backupReader = winio.NewBackupFileReader(f, false) + if path == hivesPath || path == filesPath { + // The Hives directory has a non-deterministic file time because of the + // nature of the import process. Use the times from System_Delta. + var g *os.File + g, err = os.Open(filepath.Join(r.root, hivesPath, `System_Delta`)) + if err != nil { + return + } + attr := fileInfo.FileAttributes + fileInfo, err = winio.GetFileBasicInfo(g) + g.Close() + if err != nil { + return + } + fileInfo.FileAttributes = attr + } + + // The creation time and access time get reset for files outside of the Files path. + fileInfo.CreationTime = fileInfo.LastWriteTime + fileInfo.LastAccessTime = fileInfo.LastWriteTime + + } else { + // The file attributes are written before the backup stream. + var attr uint32 + err = binary.Read(f, binary.LittleEndian, &attr) + if err != nil { + return + } + fileInfo.FileAttributes = attr + beginning := int64(4) + + // Find the accurate file size. + if !fe.fi.IsDir() { + size, err = findBackupStreamSize(f) + if err != nil { + err = &os.PathError{Op: "findBackupStreamSize", Path: fe.path, Err: err} + return + } + } + + // Return back to the beginning of the backup stream. + _, err = f.Seek(beginning, 0) + if err != nil { + return + } + } + + r.currentFile = f + f = nil + return +} + +func (r *legacyLayerReader) Read(b []byte) (int, error) { + if r.backupReader == nil { + if r.currentFile == nil { + return 0, io.EOF + } + return r.currentFile.Read(b) + } + return r.backupReader.Read(b) +} + +func (r *legacyLayerReader) Seek(offset int64, whence int) (int64, error) { + if r.backupReader == nil { + if r.currentFile == nil { + return 0, errors.New("no current file") + } + return r.currentFile.Seek(offset, whence) + } + return 0, errors.New("seek not supported on this stream") +} + +func (r *legacyLayerReader) Close() error { + r.proceed <- false + <-r.result + r.reset() + return nil +} + +type pendingLink struct { + Path, Target string + TargetRoot *os.File +} + +type pendingDir struct { + Path string + Root *os.File +} + +type legacyLayerWriter struct { + root *os.File + destRoot *os.File + parentRoots []*os.File + currentFile *os.File + bufWriter *bufio.Writer + currentFileName string + currentFileRoot *os.File + backupWriter *winio.BackupFileWriter + Tombstones []string + HasUtilityVM bool + uvmDi []dirInfo + addedFiles map[string]bool + PendingLinks []pendingLink + pendingDirs []pendingDir + currentIsDir bool +} + +// newLegacyLayerWriter returns a LayerWriter that can write the contaler layer +// transport format to disk. +func newLegacyLayerWriter(root string, parentRoots []string, destRoot string) (w *legacyLayerWriter, err error) { + w = &legacyLayerWriter{ + addedFiles: make(map[string]bool), + } + defer func() { + if err != nil { + w.CloseRoots() + w = nil + } + }() + w.root, err = safefile.OpenRoot(root) + if err != nil { + return + } + w.destRoot, err = safefile.OpenRoot(destRoot) + if err != nil { + return + } + for _, r := range parentRoots { + f, err := safefile.OpenRoot(r) + if err != nil { + return w, err + } + w.parentRoots = append(w.parentRoots, f) + } + w.bufWriter = bufio.NewWriterSize(ioutil.Discard, 65536) + return +} + +func (w *legacyLayerWriter) CloseRoots() { + if w.root != nil { + w.root.Close() + w.root = nil + } + if w.destRoot != nil { + w.destRoot.Close() + w.destRoot = nil + } + for i := range w.parentRoots { + w.parentRoots[i].Close() + } + w.parentRoots = nil +} + +func (w *legacyLayerWriter) initUtilityVM() error { + if !w.HasUtilityVM { + err := safefile.MkdirRelative(utilityVMPath, w.destRoot) + if err != nil { + return err + } + // Server 2016 does not support multiple layers for the utility VM, so + // clone the utility VM from the parent layer into this layer. Use hard + // links to avoid unnecessary copying, since most of the files are + // immutable. + err = cloneTree(w.parentRoots[0], w.destRoot, utilityVMFilesPath, mutatedUtilityVMFiles) + if err != nil { + return fmt.Errorf("cloning the parent utility VM image failed: %s", err) + } + w.HasUtilityVM = true + } + return nil +} + +func (w *legacyLayerWriter) reset() error { + err := w.bufWriter.Flush() + if err != nil { + return err + } + w.bufWriter.Reset(ioutil.Discard) + if w.currentIsDir { + r := w.currentFile + br := winio.NewBackupStreamReader(r) + // Seek to the beginning of the backup stream, skipping the fileattrs + if _, err := r.Seek(4, io.SeekStart); err != nil { + return err + } + + for { + bhdr, err := br.Next() + if err == io.EOF { + // end of backupstream data + break + } + if err != nil { + return err + } + switch bhdr.Id { + case winio.BackupReparseData: + // The current file is a `.$wcidirs$` metadata file that + // describes a directory reparse point. Delete the placeholder + // directory to prevent future files being added into the + // destination of the reparse point during the ImportLayer call + if err := safefile.RemoveRelative(w.currentFileName, w.currentFileRoot); err != nil { + return err + } + w.pendingDirs = append(w.pendingDirs, pendingDir{Path: w.currentFileName, Root: w.currentFileRoot}) + default: + // ignore all other stream types, as we only care about directory reparse points + } + } + w.currentIsDir = false + } + if w.backupWriter != nil { + w.backupWriter.Close() + w.backupWriter = nil + } + if w.currentFile != nil { + w.currentFile.Close() + w.currentFile = nil + w.currentFileName = "" + w.currentFileRoot = nil + } + return nil +} + +// copyFileWithMetadata copies a file using the backup/restore APIs in order to preserve metadata +func copyFileWithMetadata(srcRoot, destRoot *os.File, subPath string, isDir bool) (fileInfo *winio.FileBasicInfo, err error) { + src, err := safefile.OpenRelative( + subPath, + srcRoot, + syscall.GENERIC_READ|winio.ACCESS_SYSTEM_SECURITY, + syscall.FILE_SHARE_READ, + safefile.FILE_OPEN, + safefile.FILE_OPEN_REPARSE_POINT) + if err != nil { + return nil, err + } + defer src.Close() + srcr := winio.NewBackupFileReader(src, true) + defer srcr.Close() + + fileInfo, err = winio.GetFileBasicInfo(src) + if err != nil { + return nil, err + } + + extraFlags := uint32(0) + if isDir { + extraFlags |= safefile.FILE_DIRECTORY_FILE + } + dest, err := safefile.OpenRelative( + subPath, + destRoot, + syscall.GENERIC_READ|syscall.GENERIC_WRITE|winio.WRITE_DAC|winio.WRITE_OWNER|winio.ACCESS_SYSTEM_SECURITY, + syscall.FILE_SHARE_READ, + safefile.FILE_CREATE, + extraFlags) + if err != nil { + return nil, err + } + defer dest.Close() + + err = winio.SetFileBasicInfo(dest, fileInfo) + if err != nil { + return nil, err + } + + destw := winio.NewBackupFileWriter(dest, true) + defer func() { + cerr := destw.Close() + if err == nil { + err = cerr + } + }() + + _, err = io.Copy(destw, srcr) + if err != nil { + return nil, err + } + + return fileInfo, nil +} + +// cloneTree clones a directory tree using hard links. It skips hard links for +// the file names in the provided map and just copies those files. +func cloneTree(srcRoot *os.File, destRoot *os.File, subPath string, mutatedFiles map[string]bool) error { + var di []dirInfo + err := safefile.EnsureNotReparsePointRelative(subPath, srcRoot) + if err != nil { + return err + } + err = filepath.Walk(filepath.Join(srcRoot.Name(), subPath), func(srcFilePath string, info os.FileInfo, err error) error { + if err != nil { + return err + } + + relPath, err := filepath.Rel(srcRoot.Name(), srcFilePath) + if err != nil { + return err + } + + fileAttributes := info.Sys().(*syscall.Win32FileAttributeData).FileAttributes + // Directories, reparse points, and files that will be mutated during + // utility VM import must be copied. All other files can be hard linked. + isReparsePoint := fileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT != 0 + // In go1.9, FileInfo.IsDir() returns false if the directory is also a symlink. + // See: https://github.com/golang/go/commit/1989921aef60c83e6f9127a8448fb5ede10e9acc + // Fixes the problem by checking syscall.FILE_ATTRIBUTE_DIRECTORY directly + isDir := fileAttributes&syscall.FILE_ATTRIBUTE_DIRECTORY != 0 + + if isDir || isReparsePoint || mutatedFiles[relPath] { + fi, err := copyFileWithMetadata(srcRoot, destRoot, relPath, isDir) + if err != nil { + return err + } + if isDir && !isReparsePoint { + di = append(di, dirInfo{path: relPath, fileInfo: *fi}) + } + } else { + err = safefile.LinkRelative(relPath, srcRoot, relPath, destRoot) + if err != nil { + return err + } + } + + return nil + }) + if err != nil { + return err + } + + return reapplyDirectoryTimes(destRoot, di) +} + +func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) error { + if err := w.reset(); err != nil { + return err + } + + if name == utilityVMPath { + return w.initUtilityVM() + } + + name = filepath.Clean(name) + if hasPathPrefix(name, utilityVMPath) { + if !w.HasUtilityVM { + return errors.New("missing UtilityVM directory") + } + if !hasPathPrefix(name, utilityVMFilesPath) && name != utilityVMFilesPath { + return errors.New("invalid UtilityVM layer") + } + createDisposition := uint32(safefile.FILE_OPEN) + if (fileInfo.FileAttributes & syscall.FILE_ATTRIBUTE_DIRECTORY) != 0 { + st, err := safefile.LstatRelative(name, w.destRoot) + if err != nil && !os.IsNotExist(err) { + return err + } + if st != nil { + // Delete the existing file/directory if it is not the same type as this directory. + existingAttr := st.Sys().(*syscall.Win32FileAttributeData).FileAttributes + if (uint32(fileInfo.FileAttributes)^existingAttr)&(syscall.FILE_ATTRIBUTE_DIRECTORY|syscall.FILE_ATTRIBUTE_REPARSE_POINT) != 0 { + if err = safefile.RemoveAllRelative(name, w.destRoot); err != nil { + return err + } + st = nil + } + } + if st == nil { + if err = safefile.MkdirRelative(name, w.destRoot); err != nil { + return err + } + } + if fileInfo.FileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT == 0 { + w.uvmDi = append(w.uvmDi, dirInfo{path: name, fileInfo: *fileInfo}) + } + } else { + // Overwrite any existing hard link. + err := safefile.RemoveRelative(name, w.destRoot) + if err != nil && !os.IsNotExist(err) { + return err + } + createDisposition = safefile.FILE_CREATE + } + + f, err := safefile.OpenRelative( + name, + w.destRoot, + syscall.GENERIC_READ|syscall.GENERIC_WRITE|winio.WRITE_DAC|winio.WRITE_OWNER|winio.ACCESS_SYSTEM_SECURITY, + syscall.FILE_SHARE_READ, + createDisposition, + safefile.FILE_OPEN_REPARSE_POINT, + ) + if err != nil { + return err + } + defer func() { + if f != nil { + f.Close() + safefile.RemoveRelative(name, w.destRoot) + } + }() + + err = winio.SetFileBasicInfo(f, fileInfo) + if err != nil { + return err + } + + w.backupWriter = winio.NewBackupFileWriter(f, true) + w.bufWriter.Reset(w.backupWriter) + w.currentFile = f + w.currentFileName = name + w.currentFileRoot = w.destRoot + w.addedFiles[name] = true + f = nil + return nil + } + + fname := name + if (fileInfo.FileAttributes & syscall.FILE_ATTRIBUTE_DIRECTORY) != 0 { + err := safefile.MkdirRelative(name, w.root) + if err != nil { + return err + } + fname += ".$wcidirs$" + w.currentIsDir = true + } + + f, err := safefile.OpenRelative(fname, w.root, syscall.GENERIC_READ|syscall.GENERIC_WRITE, syscall.FILE_SHARE_READ, safefile.FILE_CREATE, 0) + if err != nil { + return err + } + defer func() { + if f != nil { + f.Close() + safefile.RemoveRelative(fname, w.root) + } + }() + + strippedFi := *fileInfo + strippedFi.FileAttributes = 0 + err = winio.SetFileBasicInfo(f, &strippedFi) + if err != nil { + return err + } + + if hasPathPrefix(name, hivesPath) { + w.backupWriter = winio.NewBackupFileWriter(f, false) + w.bufWriter.Reset(w.backupWriter) + } else { + w.bufWriter.Reset(f) + // The file attributes are written before the stream. + err = binary.Write(w.bufWriter, binary.LittleEndian, uint32(fileInfo.FileAttributes)) + if err != nil { + w.bufWriter.Reset(ioutil.Discard) + return err + } + } + + w.currentFile = f + w.currentFileName = name + w.currentFileRoot = w.root + w.addedFiles[name] = true + f = nil + return nil +} + +func (w *legacyLayerWriter) AddLink(name string, target string) error { + if err := w.reset(); err != nil { + return err + } + + target = filepath.Clean(target) + var roots []*os.File + if hasPathPrefix(target, filesPath) { + // Look for cross-layer hard link targets in the parent layers, since + // nothing is in the destination path yet. + roots = w.parentRoots + } else if hasPathPrefix(target, utilityVMFilesPath) { + // Since the utility VM is fully cloned into the destination path + // already, look for cross-layer hard link targets directly in the + // destination path. + roots = []*os.File{w.destRoot} + } + + if roots == nil || (!hasPathPrefix(name, filesPath) && !hasPathPrefix(name, utilityVMFilesPath)) { + return errors.New("invalid hard link in layer") + } + + // Find to try the target of the link in a previously added file. If that + // fails, search in parent layers. + var selectedRoot *os.File + if _, ok := w.addedFiles[target]; ok { + selectedRoot = w.destRoot + } else { + for _, r := range roots { + if _, err := safefile.LstatRelative(target, r); err != nil { + if !os.IsNotExist(err) { + return err + } + } else { + selectedRoot = r + break + } + } + if selectedRoot == nil { + return fmt.Errorf("failed to find link target for '%s' -> '%s'", name, target) + } + } + + // The link can't be written until after the ImportLayer call. + w.PendingLinks = append(w.PendingLinks, pendingLink{ + Path: name, + Target: target, + TargetRoot: selectedRoot, + }) + w.addedFiles[name] = true + return nil +} + +func (w *legacyLayerWriter) Remove(name string) error { + name = filepath.Clean(name) + if hasPathPrefix(name, filesPath) { + w.Tombstones = append(w.Tombstones, name) + } else if hasPathPrefix(name, utilityVMFilesPath) { + err := w.initUtilityVM() + if err != nil { + return err + } + // Make sure the path exists; os.RemoveAll will not fail if the file is + // already gone, and this needs to be a fatal error for diagnostics + // purposes. + if _, err := safefile.LstatRelative(name, w.destRoot); err != nil { + return err + } + err = safefile.RemoveAllRelative(name, w.destRoot) + if err != nil { + return err + } + } else { + return fmt.Errorf("invalid tombstone %s", name) + } + + return nil +} + +func (w *legacyLayerWriter) Write(b []byte) (int, error) { + if w.backupWriter == nil && w.currentFile == nil { + return 0, errors.New("closed") + } + return w.bufWriter.Write(b) +} + +func (w *legacyLayerWriter) Close() error { + if err := w.reset(); err != nil { + return err + } + if err := safefile.RemoveRelative("tombstones.txt", w.root); err != nil && !os.IsNotExist(err) { + return err + } + for _, pd := range w.pendingDirs { + err := safefile.MkdirRelative(pd.Path, pd.Root) + if err != nil { + return err + } + } + if w.HasUtilityVM { + err := reapplyDirectoryTimes(w.destRoot, w.uvmDi) + if err != nil { + return err + } + } + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go new file mode 100644 index 0000000000..741994ba4d --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go @@ -0,0 +1,24 @@ +package wclayer + +import ( + "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/sirupsen/logrus" +) + +// NameToGuid converts the given string into a GUID using the algorithm in the +// Host Compute Service, ensuring GUIDs generated with the same string are common +// across all clients. +func NameToGuid(name string) (id guid.GUID, err error) { + title := "hcsshim::NameToGuid " + + err = nameToGuid(name, &id) + if err != nil { + err = hcserror.Errorf(err, title, "name=%s", name) + logrus.Error(err) + return + } + + logrus.Debugf(title+"name:%s guid:%s", name, id.String()) + return +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/preparelayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/preparelayer.go new file mode 100644 index 0000000000..bd4005dc4f --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/preparelayer.go @@ -0,0 +1,40 @@ +package wclayer + +import ( + "sync" + + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/sirupsen/logrus" +) + +var prepareLayerLock sync.Mutex + +// PrepareLayer finds a mounted read-write layer matching path and enables the +// the filesystem filter for use on that layer. This requires the paths to all +// parent layers, and is necessary in order to view or interact with the layer +// as an actual filesystem (reading and writing files, creating directories, etc). +// Disabling the filter must be done via UnprepareLayer. +func PrepareLayer(path string, parentLayerPaths []string) error { + title := "hcsshim::PrepareLayer " + logrus.Debugf(title+"path %s", path) + + // Generate layer descriptors + layers, err := layerPathsToDescriptors(parentLayerPaths) + if err != nil { + return err + } + + // This lock is a temporary workaround for a Windows bug. Only allowing one + // call to prepareLayer at a time vastly reduces the chance of a timeout. + prepareLayerLock.Lock() + defer prepareLayerLock.Unlock() + err = prepareLayer(&stdDriverInfo, path, layers) + if err != nil { + err = hcserror.Errorf(err, title, "path=%s", path) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"succeeded path=%s", path) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/processimage.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/processimage.go new file mode 100644 index 0000000000..884207c3ed --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/processimage.go @@ -0,0 +1,23 @@ +package wclayer + +import "os" + +// ProcessBaseLayer post-processes a base layer that has had its files extracted. +// The files should have been extracted to \Files. +func ProcessBaseLayer(path string) error { + err := processBaseImage(path) + if err != nil { + return &os.PathError{Op: "ProcessBaseLayer", Path: path, Err: err} + } + return nil +} + +// ProcessUtilityVMImage post-processes a utility VM image that has had its files extracted. +// The files should have been extracted to \Files. +func ProcessUtilityVMImage(path string) error { + err := processUtilityImage(path) + if err != nil { + return &os.PathError{Op: "ProcessUtilityVMImage", Path: path, Err: err} + } + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/unpreparelayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/unpreparelayer.go new file mode 100644 index 0000000000..5f1b4f4f4e --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/unpreparelayer.go @@ -0,0 +1,23 @@ +package wclayer + +import ( + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/sirupsen/logrus" +) + +// UnprepareLayer disables the filesystem filter for the read-write layer with +// the given id. +func UnprepareLayer(path string) error { + title := "hcsshim::UnprepareLayer " + logrus.Debugf(title+"path %s", path) + + err := unprepareLayer(&stdDriverInfo, path) + if err != nil { + err = hcserror.Errorf(err, title, "path=%s", path) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"succeeded path=%s", path) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go new file mode 100644 index 0000000000..768a6f2f16 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go @@ -0,0 +1,37 @@ +package wclayer + +import "github.com/Microsoft/hcsshim/internal/guid" + +//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go -winio wclayer.go + +//sys activateLayer(info *driverInfo, id string) (hr error) = vmcompute.ActivateLayer? +//sys copyLayer(info *driverInfo, srcId string, dstId string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.CopyLayer? +//sys createLayer(info *driverInfo, id string, parent string) (hr error) = vmcompute.CreateLayer? +//sys createSandboxLayer(info *driverInfo, id string, parent uintptr, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.CreateSandboxLayer? +//sys expandSandboxSize(info *driverInfo, id string, size uint64) (hr error) = vmcompute.ExpandSandboxSize? +//sys deactivateLayer(info *driverInfo, id string) (hr error) = vmcompute.DeactivateLayer? +//sys destroyLayer(info *driverInfo, id string) (hr error) = vmcompute.DestroyLayer? +//sys exportLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.ExportLayer? +//sys getLayerMountPath(info *driverInfo, id string, length *uintptr, buffer *uint16) (hr error) = vmcompute.GetLayerMountPath? +//sys getBaseImages(buffer **uint16) (hr error) = vmcompute.GetBaseImages? +//sys importLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.ImportLayer? +//sys layerExists(info *driverInfo, id string, exists *uint32) (hr error) = vmcompute.LayerExists? +//sys nameToGuid(name string, guid *_guid) (hr error) = vmcompute.NameToGuid? +//sys prepareLayer(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.PrepareLayer? +//sys unprepareLayer(info *driverInfo, id string) (hr error) = vmcompute.UnprepareLayer? +//sys processBaseImage(path string) (hr error) = vmcompute.ProcessBaseImage? +//sys processUtilityImage(path string) (hr error) = vmcompute.ProcessUtilityImage? + +//sys importLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) = vmcompute.ImportLayerBegin? +//sys importLayerNext(context uintptr, fileName string, fileInfo *winio.FileBasicInfo) (hr error) = vmcompute.ImportLayerNext? +//sys importLayerWrite(context uintptr, buffer []byte) (hr error) = vmcompute.ImportLayerWrite? +//sys importLayerEnd(context uintptr) (hr error) = vmcompute.ImportLayerEnd? + +//sys exportLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) = vmcompute.ExportLayerBegin? +//sys exportLayerNext(context uintptr, fileName **uint16, fileInfo *winio.FileBasicInfo, fileSize *int64, deleted *uint32) (hr error) = vmcompute.ExportLayerNext? +//sys exportLayerRead(context uintptr, buffer []byte, bytesRead *uint32) (hr error) = vmcompute.ExportLayerRead? +//sys exportLayerEnd(context uintptr) (hr error) = vmcompute.ExportLayerEnd? + +//sys grantVmAccess(vmid string, filepath string) (hr error) = vmcompute.GrantVmAccess? + +type _guid = guid.GUID diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go new file mode 100644 index 0000000000..cb813aa3d4 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go @@ -0,0 +1,597 @@ +// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT + +package wclayer + +import ( + "syscall" + "unsafe" + + "github.com/Microsoft/go-winio" + "github.com/Microsoft/hcsshim/internal/interop" + "golang.org/x/sys/windows" +) + +var _ unsafe.Pointer + +// Do the interface allocations only once for common +// Errno values. +const ( + errnoERROR_IO_PENDING = 997 +) + +var ( + errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) +) + +// errnoErr returns common boxed Errno values, to prevent +// allocations at runtime. +func errnoErr(e syscall.Errno) error { + switch e { + case 0: + return nil + case errnoERROR_IO_PENDING: + return errERROR_IO_PENDING + } + // TODO: add more here, after collecting data on the common + // error values see on Windows. (perhaps when running + // all.bat?) + return e +} + +var ( + modvmcompute = windows.NewLazySystemDLL("vmcompute.dll") + + procActivateLayer = modvmcompute.NewProc("ActivateLayer") + procCopyLayer = modvmcompute.NewProc("CopyLayer") + procCreateLayer = modvmcompute.NewProc("CreateLayer") + procCreateSandboxLayer = modvmcompute.NewProc("CreateSandboxLayer") + procExpandSandboxSize = modvmcompute.NewProc("ExpandSandboxSize") + procDeactivateLayer = modvmcompute.NewProc("DeactivateLayer") + procDestroyLayer = modvmcompute.NewProc("DestroyLayer") + procExportLayer = modvmcompute.NewProc("ExportLayer") + procGetLayerMountPath = modvmcompute.NewProc("GetLayerMountPath") + procGetBaseImages = modvmcompute.NewProc("GetBaseImages") + procImportLayer = modvmcompute.NewProc("ImportLayer") + procLayerExists = modvmcompute.NewProc("LayerExists") + procNameToGuid = modvmcompute.NewProc("NameToGuid") + procPrepareLayer = modvmcompute.NewProc("PrepareLayer") + procUnprepareLayer = modvmcompute.NewProc("UnprepareLayer") + procProcessBaseImage = modvmcompute.NewProc("ProcessBaseImage") + procProcessUtilityImage = modvmcompute.NewProc("ProcessUtilityImage") + procImportLayerBegin = modvmcompute.NewProc("ImportLayerBegin") + procImportLayerNext = modvmcompute.NewProc("ImportLayerNext") + procImportLayerWrite = modvmcompute.NewProc("ImportLayerWrite") + procImportLayerEnd = modvmcompute.NewProc("ImportLayerEnd") + procExportLayerBegin = modvmcompute.NewProc("ExportLayerBegin") + procExportLayerNext = modvmcompute.NewProc("ExportLayerNext") + procExportLayerRead = modvmcompute.NewProc("ExportLayerRead") + procExportLayerEnd = modvmcompute.NewProc("ExportLayerEnd") + procGrantVmAccess = modvmcompute.NewProc("GrantVmAccess") +) + +func activateLayer(info *driverInfo, id string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _activateLayer(info, _p0) +} + +func _activateLayer(info *driverInfo, id *uint16) (hr error) { + if hr = procActivateLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procActivateLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func copyLayer(info *driverInfo, srcId string, dstId string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(srcId) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(dstId) + if hr != nil { + return + } + return _copyLayer(info, _p0, _p1, descriptors) +} + +func _copyLayer(info *driverInfo, srcId *uint16, dstId *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p2 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p2 = &descriptors[0] + } + if hr = procCopyLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procCopyLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(srcId)), uintptr(unsafe.Pointer(dstId)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func createLayer(info *driverInfo, id string, parent string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(parent) + if hr != nil { + return + } + return _createLayer(info, _p0, _p1) +} + +func _createLayer(info *driverInfo, id *uint16, parent *uint16) (hr error) { + if hr = procCreateLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procCreateLayer.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(parent))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func createSandboxLayer(info *driverInfo, id string, parent uintptr, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _createSandboxLayer(info, _p0, parent, descriptors) +} + +func _createSandboxLayer(info *driverInfo, id *uint16, parent uintptr, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p1 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p1 = &descriptors[0] + } + if hr = procCreateSandboxLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procCreateSandboxLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(parent), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func expandSandboxSize(info *driverInfo, id string, size uint64) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _expandSandboxSize(info, _p0, size) +} + +func _expandSandboxSize(info *driverInfo, id *uint16, size uint64) (hr error) { + if hr = procExpandSandboxSize.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procExpandSandboxSize.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(size)) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func deactivateLayer(info *driverInfo, id string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _deactivateLayer(info, _p0) +} + +func _deactivateLayer(info *driverInfo, id *uint16) (hr error) { + if hr = procDeactivateLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procDeactivateLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func destroyLayer(info *driverInfo, id string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _destroyLayer(info, _p0) +} + +func _destroyLayer(info *driverInfo, id *uint16) (hr error) { + if hr = procDestroyLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procDestroyLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func exportLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(path) + if hr != nil { + return + } + return _exportLayer(info, _p0, _p1, descriptors) +} + +func _exportLayer(info *driverInfo, id *uint16, path *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p2 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p2 = &descriptors[0] + } + if hr = procExportLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procExportLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func getLayerMountPath(info *driverInfo, id string, length *uintptr, buffer *uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _getLayerMountPath(info, _p0, length, buffer) +} + +func _getLayerMountPath(info *driverInfo, id *uint16, length *uintptr, buffer *uint16) (hr error) { + if hr = procGetLayerMountPath.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procGetLayerMountPath.Addr(), 4, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(length)), uintptr(unsafe.Pointer(buffer)), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func getBaseImages(buffer **uint16) (hr error) { + if hr = procGetBaseImages.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procGetBaseImages.Addr(), 1, uintptr(unsafe.Pointer(buffer)), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func importLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(path) + if hr != nil { + return + } + return _importLayer(info, _p0, _p1, descriptors) +} + +func _importLayer(info *driverInfo, id *uint16, path *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p2 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p2 = &descriptors[0] + } + if hr = procImportLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procImportLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func layerExists(info *driverInfo, id string, exists *uint32) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _layerExists(info, _p0, exists) +} + +func _layerExists(info *driverInfo, id *uint16, exists *uint32) (hr error) { + if hr = procLayerExists.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procLayerExists.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(exists))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func nameToGuid(name string, guid *_guid) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(name) + if hr != nil { + return + } + return _nameToGuid(_p0, guid) +} + +func _nameToGuid(name *uint16, guid *_guid) (hr error) { + if hr = procNameToGuid.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procNameToGuid.Addr(), 2, uintptr(unsafe.Pointer(name)), uintptr(unsafe.Pointer(guid)), 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func prepareLayer(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _prepareLayer(info, _p0, descriptors) +} + +func _prepareLayer(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p1 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p1 = &descriptors[0] + } + if hr = procPrepareLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procPrepareLayer.Addr(), 4, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func unprepareLayer(info *driverInfo, id string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _unprepareLayer(info, _p0) +} + +func _unprepareLayer(info *driverInfo, id *uint16) (hr error) { + if hr = procUnprepareLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procUnprepareLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func processBaseImage(path string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(path) + if hr != nil { + return + } + return _processBaseImage(_p0) +} + +func _processBaseImage(path *uint16) (hr error) { + if hr = procProcessBaseImage.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procProcessBaseImage.Addr(), 1, uintptr(unsafe.Pointer(path)), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func processUtilityImage(path string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(path) + if hr != nil { + return + } + return _processUtilityImage(_p0) +} + +func _processUtilityImage(path *uint16) (hr error) { + if hr = procProcessUtilityImage.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procProcessUtilityImage.Addr(), 1, uintptr(unsafe.Pointer(path)), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func importLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _importLayerBegin(info, _p0, descriptors, context) +} + +func _importLayerBegin(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) { + var _p1 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p1 = &descriptors[0] + } + if hr = procImportLayerBegin.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procImportLayerBegin.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), uintptr(unsafe.Pointer(context)), 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func importLayerNext(context uintptr, fileName string, fileInfo *winio.FileBasicInfo) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(fileName) + if hr != nil { + return + } + return _importLayerNext(context, _p0, fileInfo) +} + +func _importLayerNext(context uintptr, fileName *uint16, fileInfo *winio.FileBasicInfo) (hr error) { + if hr = procImportLayerNext.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procImportLayerNext.Addr(), 3, uintptr(context), uintptr(unsafe.Pointer(fileName)), uintptr(unsafe.Pointer(fileInfo))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func importLayerWrite(context uintptr, buffer []byte) (hr error) { + var _p0 *byte + if len(buffer) > 0 { + _p0 = &buffer[0] + } + if hr = procImportLayerWrite.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procImportLayerWrite.Addr(), 3, uintptr(context), uintptr(unsafe.Pointer(_p0)), uintptr(len(buffer))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func importLayerEnd(context uintptr) (hr error) { + if hr = procImportLayerEnd.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procImportLayerEnd.Addr(), 1, uintptr(context), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func exportLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _exportLayerBegin(info, _p0, descriptors, context) +} + +func _exportLayerBegin(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) { + var _p1 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p1 = &descriptors[0] + } + if hr = procExportLayerBegin.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procExportLayerBegin.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), uintptr(unsafe.Pointer(context)), 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func exportLayerNext(context uintptr, fileName **uint16, fileInfo *winio.FileBasicInfo, fileSize *int64, deleted *uint32) (hr error) { + if hr = procExportLayerNext.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procExportLayerNext.Addr(), 5, uintptr(context), uintptr(unsafe.Pointer(fileName)), uintptr(unsafe.Pointer(fileInfo)), uintptr(unsafe.Pointer(fileSize)), uintptr(unsafe.Pointer(deleted)), 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func exportLayerRead(context uintptr, buffer []byte, bytesRead *uint32) (hr error) { + var _p0 *byte + if len(buffer) > 0 { + _p0 = &buffer[0] + } + if hr = procExportLayerRead.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procExportLayerRead.Addr(), 4, uintptr(context), uintptr(unsafe.Pointer(_p0)), uintptr(len(buffer)), uintptr(unsafe.Pointer(bytesRead)), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func exportLayerEnd(context uintptr) (hr error) { + if hr = procExportLayerEnd.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procExportLayerEnd.Addr(), 1, uintptr(context), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func grantVmAccess(vmid string, filepath string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(vmid) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(filepath) + if hr != nil { + return + } + return _grantVmAccess(_p0, _p1) +} + +func _grantVmAccess(vmid *uint16, filepath *uint16) (hr error) { + if hr = procGrantVmAccess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procGrantVmAccess.Addr(), 2, uintptr(unsafe.Pointer(vmid)), uintptr(unsafe.Pointer(filepath)), 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} diff --git a/vendor/github.com/Microsoft/hcsshim/layer.go b/vendor/github.com/Microsoft/hcsshim/layer.go new file mode 100644 index 0000000000..d143efc49a --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/layer.go @@ -0,0 +1,110 @@ +package hcsshim + +import ( + "crypto/sha1" + "path/filepath" + + "github.com/Microsoft/hcsshim/internal/guid" + + "github.com/Microsoft/hcsshim/internal/wclayer" +) + +func layerPath(info *DriverInfo, id string) string { + return filepath.Join(info.HomeDir, id) +} + +func ActivateLayer(info DriverInfo, id string) error { + return wclayer.ActivateLayer(layerPath(&info, id)) +} +func CreateLayer(info DriverInfo, id, parent string) error { + return wclayer.CreateLayer(layerPath(&info, id), parent) +} + +// New clients should use CreateScratchLayer instead. Kept in to preserve API compatibility. +func CreateSandboxLayer(info DriverInfo, layerId, parentId string, parentLayerPaths []string) error { + return wclayer.CreateScratchLayer(layerPath(&info, layerId), parentLayerPaths) +} +func CreateScratchLayer(info DriverInfo, layerId, parentId string, parentLayerPaths []string) error { + return wclayer.CreateScratchLayer(layerPath(&info, layerId), parentLayerPaths) +} +func DeactivateLayer(info DriverInfo, id string) error { + return wclayer.DeactivateLayer(layerPath(&info, id)) +} +func DestroyLayer(info DriverInfo, id string) error { + return wclayer.DestroyLayer(layerPath(&info, id)) +} + +// New clients should use ExpandScratchSize instead. Kept in to preserve API compatibility. +func ExpandSandboxSize(info DriverInfo, layerId string, size uint64) error { + return wclayer.ExpandScratchSize(layerPath(&info, layerId), size) +} +func ExpandScratchSize(info DriverInfo, layerId string, size uint64) error { + return wclayer.ExpandScratchSize(layerPath(&info, layerId), size) +} +func ExportLayer(info DriverInfo, layerId string, exportFolderPath string, parentLayerPaths []string) error { + return wclayer.ExportLayer(layerPath(&info, layerId), exportFolderPath, parentLayerPaths) +} +func GetLayerMountPath(info DriverInfo, id string) (string, error) { + return wclayer.GetLayerMountPath(layerPath(&info, id)) +} +func GetSharedBaseImages() (imageData string, err error) { + return wclayer.GetSharedBaseImages() +} +func ImportLayer(info DriverInfo, layerID string, importFolderPath string, parentLayerPaths []string) error { + return wclayer.ImportLayer(layerPath(&info, layerID), importFolderPath, parentLayerPaths) +} +func LayerExists(info DriverInfo, id string) (bool, error) { + return wclayer.LayerExists(layerPath(&info, id)) +} +func PrepareLayer(info DriverInfo, layerId string, parentLayerPaths []string) error { + return wclayer.PrepareLayer(layerPath(&info, layerId), parentLayerPaths) +} +func ProcessBaseLayer(path string) error { + return wclayer.ProcessBaseLayer(path) +} +func ProcessUtilityVMImage(path string) error { + return wclayer.ProcessUtilityVMImage(path) +} +func UnprepareLayer(info DriverInfo, layerId string) error { + return wclayer.UnprepareLayer(layerPath(&info, layerId)) +} + +type DriverInfo struct { + Flavour int + HomeDir string +} + +type FilterLayerReader = wclayer.FilterLayerReader +type FilterLayerWriter = wclayer.FilterLayerWriter + +type GUID [16]byte + +func NameToGuid(name string) (id GUID, err error) { + g, err := wclayer.NameToGuid(name) + return GUID(g), err +} + +func NewGUID(source string) *GUID { + h := sha1.Sum([]byte(source)) + var g GUID + copy(g[0:], h[0:16]) + return &g +} + +func (g *GUID) ToString() string { + return (guid.GUID)(*g).String() +} + +type LayerReader = wclayer.LayerReader + +func NewLayerReader(info DriverInfo, layerID string, parentLayerPaths []string) (LayerReader, error) { + return wclayer.NewLayerReader(layerPath(&info, layerID), parentLayerPaths) +} + +type LayerWriter = wclayer.LayerWriter + +func NewLayerWriter(info DriverInfo, layerID string, parentLayerPaths []string) (LayerWriter, error) { + return wclayer.NewLayerWriter(layerPath(&info, layerID), parentLayerPaths) +} + +type WC_LAYER_DESCRIPTOR = wclayer.WC_LAYER_DESCRIPTOR diff --git a/vendor/github.com/Microsoft/hcsshim/mksyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/mksyscall_windows.go new file mode 100644 index 0000000000..8219793347 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/mksyscall_windows.go @@ -0,0 +1,938 @@ +// Copyright 2013 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build ignore + +/* +mksyscall_windows generates windows system call bodies + +It parses all files specified on command line containing function +prototypes (like syscall_windows.go) and prints system call bodies +to standard output. + +The prototypes are marked by lines beginning with "//sys" and read +like func declarations if //sys is replaced by func, but: + +* The parameter lists must give a name for each argument. This + includes return parameters. + +* The parameter lists must give a type for each argument: + the (x, y, z int) shorthand is not allowed. + +* If the return parameter is an error number, it must be named err. + +* If go func name needs to be different from it's winapi dll name, + the winapi name could be specified at the end, after "=" sign, like + //sys LoadLibrary(libname string) (handle uint32, err error) = LoadLibraryA + +* Each function that returns err needs to supply a condition, that + return value of winapi will be tested against to detect failure. + This would set err to windows "last-error", otherwise it will be nil. + The value can be provided at end of //sys declaration, like + //sys LoadLibrary(libname string) (handle uint32, err error) [failretval==-1] = LoadLibraryA + and is [failretval==0] by default. + +Usage: + mksyscall_windows [flags] [path ...] + +The flags are: + -output + Specify output file name (outputs to console if blank). + -trace + Generate print statement after every syscall. +*/ +package main + +import ( + "bufio" + "bytes" + "errors" + "flag" + "fmt" + "go/format" + "go/parser" + "go/token" + "io" + "io/ioutil" + "log" + "os" + "path/filepath" + "runtime" + "sort" + "strconv" + "strings" + "text/template" +) + +var ( + filename = flag.String("output", "", "output file name (standard output if omitted)") + printTraceFlag = flag.Bool("trace", false, "generate print statement after every syscall") + systemDLL = flag.Bool("systemdll", true, "whether all DLLs should be loaded from the Windows system directory") + winio = flag.Bool("winio", false, "import go-winio") +) + +func trim(s string) string { + return strings.Trim(s, " \t") +} + +var packageName string + +func packagename() string { + return packageName +} + +func syscalldot() string { + if packageName == "syscall" { + return "" + } + return "syscall." +} + +// Param is function parameter +type Param struct { + Name string + Type string + fn *Fn + tmpVarIdx int +} + +// tmpVar returns temp variable name that will be used to represent p during syscall. +func (p *Param) tmpVar() string { + if p.tmpVarIdx < 0 { + p.tmpVarIdx = p.fn.curTmpVarIdx + p.fn.curTmpVarIdx++ + } + return fmt.Sprintf("_p%d", p.tmpVarIdx) +} + +// BoolTmpVarCode returns source code for bool temp variable. +func (p *Param) BoolTmpVarCode() string { + const code = `var %s uint32 + if %s { + %s = 1 + } else { + %s = 0 + }` + tmp := p.tmpVar() + return fmt.Sprintf(code, tmp, p.Name, tmp, tmp) +} + +// SliceTmpVarCode returns source code for slice temp variable. +func (p *Param) SliceTmpVarCode() string { + const code = `var %s *%s + if len(%s) > 0 { + %s = &%s[0] + }` + tmp := p.tmpVar() + return fmt.Sprintf(code, tmp, p.Type[2:], p.Name, tmp, p.Name) +} + +// StringTmpVarCode returns source code for string temp variable. +func (p *Param) StringTmpVarCode() string { + errvar := p.fn.Rets.ErrorVarName() + if errvar == "" { + errvar = "_" + } + tmp := p.tmpVar() + const code = `var %s %s + %s, %s = %s(%s)` + s := fmt.Sprintf(code, tmp, p.fn.StrconvType(), tmp, errvar, p.fn.StrconvFunc(), p.Name) + if errvar == "-" { + return s + } + const morecode = ` + if %s != nil { + return + }` + return s + fmt.Sprintf(morecode, errvar) +} + +// TmpVarCode returns source code for temp variable. +func (p *Param) TmpVarCode() string { + switch { + case p.Type == "bool": + return p.BoolTmpVarCode() + case strings.HasPrefix(p.Type, "[]"): + return p.SliceTmpVarCode() + default: + return "" + } +} + +// TmpVarHelperCode returns source code for helper's temp variable. +func (p *Param) TmpVarHelperCode() string { + if p.Type != "string" { + return "" + } + return p.StringTmpVarCode() +} + +// SyscallArgList returns source code fragments representing p parameter +// in syscall. Slices are translated into 2 syscall parameters: pointer to +// the first element and length. +func (p *Param) SyscallArgList() []string { + t := p.HelperType() + var s string + switch { + case t[0] == '*': + s = fmt.Sprintf("unsafe.Pointer(%s)", p.Name) + case t == "bool": + s = p.tmpVar() + case strings.HasPrefix(t, "[]"): + return []string{ + fmt.Sprintf("uintptr(unsafe.Pointer(%s))", p.tmpVar()), + fmt.Sprintf("uintptr(len(%s))", p.Name), + } + default: + s = p.Name + } + return []string{fmt.Sprintf("uintptr(%s)", s)} +} + +// IsError determines if p parameter is used to return error. +func (p *Param) IsError() bool { + return p.Name == "err" && p.Type == "error" +} + +// HelperType returns type of parameter p used in helper function. +func (p *Param) HelperType() string { + if p.Type == "string" { + return p.fn.StrconvType() + } + return p.Type +} + +// join concatenates parameters ps into a string with sep separator. +// Each parameter is converted into string by applying fn to it +// before conversion. +func join(ps []*Param, fn func(*Param) string, sep string) string { + if len(ps) == 0 { + return "" + } + a := make([]string, 0) + for _, p := range ps { + a = append(a, fn(p)) + } + return strings.Join(a, sep) +} + +// Rets describes function return parameters. +type Rets struct { + Name string + Type string + ReturnsError bool + FailCond string +} + +// ErrorVarName returns error variable name for r. +func (r *Rets) ErrorVarName() string { + if r.ReturnsError { + return "err" + } + if r.Type == "error" { + return r.Name + } + return "" +} + +// ToParams converts r into slice of *Param. +func (r *Rets) ToParams() []*Param { + ps := make([]*Param, 0) + if len(r.Name) > 0 { + ps = append(ps, &Param{Name: r.Name, Type: r.Type}) + } + if r.ReturnsError { + ps = append(ps, &Param{Name: "err", Type: "error"}) + } + return ps +} + +// List returns source code of syscall return parameters. +func (r *Rets) List() string { + s := join(r.ToParams(), func(p *Param) string { return p.Name + " " + p.Type }, ", ") + if len(s) > 0 { + s = "(" + s + ")" + } + return s +} + +// PrintList returns source code of trace printing part correspondent +// to syscall return values. +func (r *Rets) PrintList() string { + return join(r.ToParams(), func(p *Param) string { return fmt.Sprintf(`"%s=", %s, `, p.Name, p.Name) }, `", ", `) +} + +// SetReturnValuesCode returns source code that accepts syscall return values. +func (r *Rets) SetReturnValuesCode() string { + if r.Name == "" && !r.ReturnsError { + return "" + } + retvar := "r0" + if r.Name == "" { + retvar = "r1" + } + errvar := "_" + if r.ReturnsError { + errvar = "e1" + } + return fmt.Sprintf("%s, _, %s := ", retvar, errvar) +} + +func (r *Rets) useLongHandleErrorCode(retvar string) string { + const code = `if %s { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = %sEINVAL + } + }` + cond := retvar + " == 0" + if r.FailCond != "" { + cond = strings.Replace(r.FailCond, "failretval", retvar, 1) + } + return fmt.Sprintf(code, cond, syscalldot()) +} + +// SetErrorCode returns source code that sets return parameters. +func (r *Rets) SetErrorCode() string { + const code = `if r0 != 0 { + %s = %sErrno(r0) + }` + const hrCode = `if int32(r0) < 0 { + %s = interop.Win32FromHresult(r0) + }` + if r.Name == "" && !r.ReturnsError { + return "" + } + if r.Name == "" { + return r.useLongHandleErrorCode("r1") + } + if r.Type == "error" { + if r.Name == "hr" { + return fmt.Sprintf(hrCode, r.Name) + } else { + return fmt.Sprintf(code, r.Name, syscalldot()) + } + } + s := "" + switch { + case r.Type[0] == '*': + s = fmt.Sprintf("%s = (%s)(unsafe.Pointer(r0))", r.Name, r.Type) + case r.Type == "bool": + s = fmt.Sprintf("%s = r0 != 0", r.Name) + default: + s = fmt.Sprintf("%s = %s(r0)", r.Name, r.Type) + } + if !r.ReturnsError { + return s + } + return s + "\n\t" + r.useLongHandleErrorCode(r.Name) +} + +// Fn describes syscall function. +type Fn struct { + Name string + Params []*Param + Rets *Rets + PrintTrace bool + confirmproc bool + dllname string + dllfuncname string + src string + // TODO: get rid of this field and just use parameter index instead + curTmpVarIdx int // insure tmp variables have uniq names +} + +// extractParams parses s to extract function parameters. +func extractParams(s string, f *Fn) ([]*Param, error) { + s = trim(s) + if s == "" { + return nil, nil + } + a := strings.Split(s, ",") + ps := make([]*Param, len(a)) + for i := range ps { + s2 := trim(a[i]) + b := strings.Split(s2, " ") + if len(b) != 2 { + b = strings.Split(s2, "\t") + if len(b) != 2 { + return nil, errors.New("Could not extract function parameter from \"" + s2 + "\"") + } + } + ps[i] = &Param{ + Name: trim(b[0]), + Type: trim(b[1]), + fn: f, + tmpVarIdx: -1, + } + } + return ps, nil +} + +// extractSection extracts text out of string s starting after start +// and ending just before end. found return value will indicate success, +// and prefix, body and suffix will contain correspondent parts of string s. +func extractSection(s string, start, end rune) (prefix, body, suffix string, found bool) { + s = trim(s) + if strings.HasPrefix(s, string(start)) { + // no prefix + body = s[1:] + } else { + a := strings.SplitN(s, string(start), 2) + if len(a) != 2 { + return "", "", s, false + } + prefix = a[0] + body = a[1] + } + a := strings.SplitN(body, string(end), 2) + if len(a) != 2 { + return "", "", "", false + } + return prefix, a[0], a[1], true +} + +// newFn parses string s and return created function Fn. +func newFn(s string) (*Fn, error) { + s = trim(s) + f := &Fn{ + Rets: &Rets{}, + src: s, + PrintTrace: *printTraceFlag, + } + // function name and args + prefix, body, s, found := extractSection(s, '(', ')') + if !found || prefix == "" { + return nil, errors.New("Could not extract function name and parameters from \"" + f.src + "\"") + } + f.Name = prefix + var err error + f.Params, err = extractParams(body, f) + if err != nil { + return nil, err + } + // return values + _, body, s, found = extractSection(s, '(', ')') + if found { + r, err := extractParams(body, f) + if err != nil { + return nil, err + } + switch len(r) { + case 0: + case 1: + if r[0].IsError() { + f.Rets.ReturnsError = true + } else { + f.Rets.Name = r[0].Name + f.Rets.Type = r[0].Type + } + case 2: + if !r[1].IsError() { + return nil, errors.New("Only last windows error is allowed as second return value in \"" + f.src + "\"") + } + f.Rets.ReturnsError = true + f.Rets.Name = r[0].Name + f.Rets.Type = r[0].Type + default: + return nil, errors.New("Too many return values in \"" + f.src + "\"") + } + } + // fail condition + _, body, s, found = extractSection(s, '[', ']') + if found { + f.Rets.FailCond = body + } + // dll and dll function names + s = trim(s) + if s == "" { + return f, nil + } + if !strings.HasPrefix(s, "=") { + return nil, errors.New("Could not extract dll name from \"" + f.src + "\"") + } + s = trim(s[1:]) + a := strings.Split(s, ".") + switch len(a) { + case 1: + f.dllfuncname = a[0] + case 2: + f.dllname = a[0] + f.dllfuncname = a[1] + default: + return nil, errors.New("Could not extract dll name from \"" + f.src + "\"") + } + if f.dllfuncname[len(f.dllfuncname)-1] == '?' { + f.confirmproc = true + f.dllfuncname = f.dllfuncname[0 : len(f.dllfuncname)-1] + } + return f, nil +} + +// DLLName returns DLL name for function f. +func (f *Fn) DLLName() string { + if f.dllname == "" { + return "kernel32" + } + return f.dllname +} + +// DLLName returns DLL function name for function f. +func (f *Fn) DLLFuncName() string { + if f.dllfuncname == "" { + return f.Name + } + return f.dllfuncname +} + +func (f *Fn) ConfirmProc() bool { + return f.confirmproc +} + +// ParamList returns source code for function f parameters. +func (f *Fn) ParamList() string { + return join(f.Params, func(p *Param) string { return p.Name + " " + p.Type }, ", ") +} + +// HelperParamList returns source code for helper function f parameters. +func (f *Fn) HelperParamList() string { + return join(f.Params, func(p *Param) string { return p.Name + " " + p.HelperType() }, ", ") +} + +// ParamPrintList returns source code of trace printing part correspondent +// to syscall input parameters. +func (f *Fn) ParamPrintList() string { + return join(f.Params, func(p *Param) string { return fmt.Sprintf(`"%s=", %s, `, p.Name, p.Name) }, `", ", `) +} + +// ParamCount return number of syscall parameters for function f. +func (f *Fn) ParamCount() int { + n := 0 + for _, p := range f.Params { + n += len(p.SyscallArgList()) + } + return n +} + +// SyscallParamCount determines which version of Syscall/Syscall6/Syscall9/... +// to use. It returns parameter count for correspondent SyscallX function. +func (f *Fn) SyscallParamCount() int { + n := f.ParamCount() + switch { + case n <= 3: + return 3 + case n <= 6: + return 6 + case n <= 9: + return 9 + case n <= 12: + return 12 + case n <= 15: + return 15 + default: + panic("too many arguments to system call") + } +} + +// Syscall determines which SyscallX function to use for function f. +func (f *Fn) Syscall() string { + c := f.SyscallParamCount() + if c == 3 { + return syscalldot() + "Syscall" + } + return syscalldot() + "Syscall" + strconv.Itoa(c) +} + +// SyscallParamList returns source code for SyscallX parameters for function f. +func (f *Fn) SyscallParamList() string { + a := make([]string, 0) + for _, p := range f.Params { + a = append(a, p.SyscallArgList()...) + } + for len(a) < f.SyscallParamCount() { + a = append(a, "0") + } + return strings.Join(a, ", ") +} + +// HelperCallParamList returns source code of call into function f helper. +func (f *Fn) HelperCallParamList() string { + a := make([]string, 0, len(f.Params)) + for _, p := range f.Params { + s := p.Name + if p.Type == "string" { + s = p.tmpVar() + } + a = append(a, s) + } + return strings.Join(a, ", ") +} + +// IsUTF16 is true, if f is W (utf16) function. It is false +// for all A (ascii) functions. +func (_ *Fn) IsUTF16() bool { + return true +} + +// StrconvFunc returns name of Go string to OS string function for f. +func (f *Fn) StrconvFunc() string { + if f.IsUTF16() { + return syscalldot() + "UTF16PtrFromString" + } + return syscalldot() + "BytePtrFromString" +} + +// StrconvType returns Go type name used for OS string for f. +func (f *Fn) StrconvType() string { + if f.IsUTF16() { + return "*uint16" + } + return "*byte" +} + +// HasStringParam is true, if f has at least one string parameter. +// Otherwise it is false. +func (f *Fn) HasStringParam() bool { + for _, p := range f.Params { + if p.Type == "string" { + return true + } + } + return false +} + +var uniqDllFuncName = make(map[string]bool) + +// IsNotDuplicate is true if f is not a duplicated function +func (f *Fn) IsNotDuplicate() bool { + funcName := f.DLLFuncName() + if uniqDllFuncName[funcName] == false { + uniqDllFuncName[funcName] = true + return true + } + return false +} + +// HelperName returns name of function f helper. +func (f *Fn) HelperName() string { + if !f.HasStringParam() { + return f.Name + } + return "_" + f.Name +} + +// Source files and functions. +type Source struct { + Funcs []*Fn + Files []string + StdLibImports []string + ExternalImports []string +} + +func (src *Source) Import(pkg string) { + src.StdLibImports = append(src.StdLibImports, pkg) + sort.Strings(src.StdLibImports) +} + +func (src *Source) ExternalImport(pkg string) { + src.ExternalImports = append(src.ExternalImports, pkg) + sort.Strings(src.ExternalImports) +} + +// ParseFiles parses files listed in fs and extracts all syscall +// functions listed in sys comments. It returns source files +// and functions collection *Source if successful. +func ParseFiles(fs []string) (*Source, error) { + src := &Source{ + Funcs: make([]*Fn, 0), + Files: make([]string, 0), + StdLibImports: []string{ + "unsafe", + }, + ExternalImports: make([]string, 0), + } + for _, file := range fs { + if err := src.ParseFile(file); err != nil { + return nil, err + } + } + return src, nil +} + +// DLLs return dll names for a source set src. +func (src *Source) DLLs() []string { + uniq := make(map[string]bool) + r := make([]string, 0) + for _, f := range src.Funcs { + name := f.DLLName() + if _, found := uniq[name]; !found { + uniq[name] = true + r = append(r, name) + } + } + return r +} + +// ParseFile adds additional file path to a source set src. +func (src *Source) ParseFile(path string) error { + file, err := os.Open(path) + if err != nil { + return err + } + defer file.Close() + + s := bufio.NewScanner(file) + for s.Scan() { + t := trim(s.Text()) + if len(t) < 7 { + continue + } + if !strings.HasPrefix(t, "//sys") { + continue + } + t = t[5:] + if !(t[0] == ' ' || t[0] == '\t') { + continue + } + f, err := newFn(t[1:]) + if err != nil { + return err + } + src.Funcs = append(src.Funcs, f) + } + if err := s.Err(); err != nil { + return err + } + src.Files = append(src.Files, path) + + // get package name + fset := token.NewFileSet() + _, err = file.Seek(0, 0) + if err != nil { + return err + } + pkg, err := parser.ParseFile(fset, "", file, parser.PackageClauseOnly) + if err != nil { + return err + } + packageName = pkg.Name.Name + + return nil +} + +// IsStdRepo returns true if src is part of standard library. +func (src *Source) IsStdRepo() (bool, error) { + if len(src.Files) == 0 { + return false, errors.New("no input files provided") + } + abspath, err := filepath.Abs(src.Files[0]) + if err != nil { + return false, err + } + goroot := runtime.GOROOT() + if runtime.GOOS == "windows" { + abspath = strings.ToLower(abspath) + goroot = strings.ToLower(goroot) + } + sep := string(os.PathSeparator) + if !strings.HasSuffix(goroot, sep) { + goroot += sep + } + return strings.HasPrefix(abspath, goroot), nil +} + +// Generate output source file from a source set src. +func (src *Source) Generate(w io.Writer) error { + const ( + pkgStd = iota // any package in std library + pkgXSysWindows // x/sys/windows package + pkgOther + ) + isStdRepo, err := src.IsStdRepo() + if err != nil { + return err + } + var pkgtype int + switch { + case isStdRepo: + pkgtype = pkgStd + case packageName == "windows": + // TODO: this needs better logic than just using package name + pkgtype = pkgXSysWindows + default: + pkgtype = pkgOther + } + if *systemDLL { + switch pkgtype { + case pkgStd: + src.Import("internal/syscall/windows/sysdll") + case pkgXSysWindows: + default: + src.ExternalImport("golang.org/x/sys/windows") + } + } + src.ExternalImport("github.com/Microsoft/hcsshim/internal/interop") + if *winio { + src.ExternalImport("github.com/Microsoft/go-winio") + } + if packageName != "syscall" { + src.Import("syscall") + } + funcMap := template.FuncMap{ + "packagename": packagename, + "syscalldot": syscalldot, + "newlazydll": func(dll string) string { + arg := "\"" + dll + ".dll\"" + if !*systemDLL { + return syscalldot() + "NewLazyDLL(" + arg + ")" + } + switch pkgtype { + case pkgStd: + return syscalldot() + "NewLazyDLL(sysdll.Add(" + arg + "))" + case pkgXSysWindows: + return "NewLazySystemDLL(" + arg + ")" + default: + return "windows.NewLazySystemDLL(" + arg + ")" + } + }, + } + t := template.Must(template.New("main").Funcs(funcMap).Parse(srcTemplate)) + err = t.Execute(w, src) + if err != nil { + return errors.New("Failed to execute template: " + err.Error()) + } + return nil +} + +func usage() { + fmt.Fprintf(os.Stderr, "usage: mksyscall_windows [flags] [path ...]\n") + flag.PrintDefaults() + os.Exit(1) +} + +func main() { + flag.Usage = usage + flag.Parse() + if len(flag.Args()) <= 0 { + fmt.Fprintf(os.Stderr, "no files to parse provided\n") + usage() + } + + src, err := ParseFiles(flag.Args()) + if err != nil { + log.Fatal(err) + } + + var buf bytes.Buffer + if err := src.Generate(&buf); err != nil { + log.Fatal(err) + } + + data, err := format.Source(buf.Bytes()) + if err != nil { + log.Fatal(err) + } + if *filename == "" { + _, err = os.Stdout.Write(data) + } else { + err = ioutil.WriteFile(*filename, data, 0644) + } + if err != nil { + log.Fatal(err) + } +} + +// TODO: use println instead to print in the following template +const srcTemplate = ` + +{{define "main"}}// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT + +package {{packagename}} + +import ( +{{range .StdLibImports}}"{{.}}" +{{end}} + +{{range .ExternalImports}}"{{.}}" +{{end}} +) + +var _ unsafe.Pointer + +// Do the interface allocations only once for common +// Errno values. +const ( + errnoERROR_IO_PENDING = 997 +) + +var ( + errERROR_IO_PENDING error = {{syscalldot}}Errno(errnoERROR_IO_PENDING) +) + +// errnoErr returns common boxed Errno values, to prevent +// allocations at runtime. +func errnoErr(e {{syscalldot}}Errno) error { + switch e { + case 0: + return nil + case errnoERROR_IO_PENDING: + return errERROR_IO_PENDING + } + // TODO: add more here, after collecting data on the common + // error values see on Windows. (perhaps when running + // all.bat?) + return e +} + +var ( +{{template "dlls" .}} +{{template "funcnames" .}}) +{{range .Funcs}}{{if .HasStringParam}}{{template "helperbody" .}}{{end}}{{template "funcbody" .}}{{end}} +{{end}} + +{{/* help functions */}} + +{{define "dlls"}}{{range .DLLs}} mod{{.}} = {{newlazydll .}} +{{end}}{{end}} + +{{define "funcnames"}}{{range .Funcs}}{{if .IsNotDuplicate}} proc{{.DLLFuncName}} = mod{{.DLLName}}.NewProc("{{.DLLFuncName}}"){{end}} +{{end}}{{end}} + +{{define "helperbody"}} +func {{.Name}}({{.ParamList}}) {{template "results" .}}{ +{{template "helpertmpvars" .}} return {{.HelperName}}({{.HelperCallParamList}}) +} +{{end}} + +{{define "funcbody"}} +func {{.HelperName}}({{.HelperParamList}}) {{template "results" .}}{ +{{template "tmpvars" .}} {{template "syscallcheck" .}}{{template "syscall" .}} +{{template "seterror" .}}{{template "printtrace" .}} return +} +{{end}} + +{{define "helpertmpvars"}}{{range .Params}}{{if .TmpVarHelperCode}} {{.TmpVarHelperCode}} +{{end}}{{end}}{{end}} + +{{define "tmpvars"}}{{range .Params}}{{if .TmpVarCode}} {{.TmpVarCode}} +{{end}}{{end}}{{end}} + +{{define "results"}}{{if .Rets.List}}{{.Rets.List}} {{end}}{{end}} + +{{define "syscall"}}{{.Rets.SetReturnValuesCode}}{{.Syscall}}(proc{{.DLLFuncName}}.Addr(), {{.ParamCount}}, {{.SyscallParamList}}){{end}} + +{{define "syscallcheck"}}{{if .ConfirmProc}}if {{.Rets.ErrorVarName}} = proc{{.DLLFuncName}}.Find(); {{.Rets.ErrorVarName}} != nil { + return +} +{{end}}{{end}} + + +{{define "seterror"}}{{if .Rets.SetErrorCode}} {{.Rets.SetErrorCode}} +{{end}}{{end}} + +{{define "printtrace"}}{{if .PrintTrace}} print("SYSCALL: {{.Name}}(", {{.ParamPrintList}}") (", {{.Rets.PrintList}}")\n") +{{end}}{{end}} + +` diff --git a/vendor/github.com/Microsoft/hcsshim/pkg/go-runhcs/LICENSE b/vendor/github.com/Microsoft/hcsshim/pkg/go-runhcs/LICENSE new file mode 100644 index 0000000000..261eeb9e9f --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/pkg/go-runhcs/LICENSE @@ -0,0 +1,201 @@ + Apache License + Version 2.0, January 2004 + http://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + APPENDIX: How to apply the Apache License to your work. + + To apply the Apache License to your work, attach the following + boilerplate notice, with the fields enclosed by brackets "[]" + replaced with your own identifying information. (Don't include + the brackets!) The text should be enclosed in the appropriate + comment syntax for the file format. We also recommend that a + file or class name and description of purpose be included on the + same "printed page" as the copyright notice for easier + identification within third-party archives. + + Copyright [yyyy] [name of copyright owner] + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. diff --git a/vendor/github.com/Microsoft/hcsshim/pkg/go-runhcs/NOTICE b/vendor/github.com/Microsoft/hcsshim/pkg/go-runhcs/NOTICE new file mode 100644 index 0000000000..5f9d59f13c --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/pkg/go-runhcs/NOTICE @@ -0,0 +1,22 @@ +go-runhcs is a fork of go-runc + +The following is runc's legal notice. + +--- + +runc + +Copyright 2012-2015 Docker, Inc. + +This product includes software developed at Docker, Inc. (http://www.docker.com). + +The following is courtesy of our legal counsel: + +Use and transfer of Docker may be subject to certain restrictions by the +United States and other governments. +It is your responsibility to ensure that your use and/or transfer does not +violate applicable laws. + +For more information, please see http://www.bis.doc.gov + +See also http://www.apache.org/dev/crypto.html and/or seek legal counsel. \ No newline at end of file diff --git a/vendor/github.com/Microsoft/hcsshim/process.go b/vendor/github.com/Microsoft/hcsshim/process.go new file mode 100644 index 0000000000..ca8acbb7c2 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/process.go @@ -0,0 +1,72 @@ +package hcsshim + +import ( + "io" + "time" + + "github.com/Microsoft/hcsshim/internal/hcs" +) + +// ContainerError is an error encountered in HCS +type process struct { + p *hcs.Process +} + +// Pid returns the process ID of the process within the container. +func (process *process) Pid() int { + return process.p.Pid() +} + +// Kill signals the process to terminate but does not wait for it to finish terminating. +func (process *process) Kill() error { + return convertProcessError(process.p.Kill(), process) +} + +// Wait waits for the process to exit. +func (process *process) Wait() error { + return convertProcessError(process.p.Wait(), process) +} + +// WaitTimeout waits for the process to exit or the duration to elapse. It returns +// false if timeout occurs. +func (process *process) WaitTimeout(timeout time.Duration) error { + return convertProcessError(process.p.WaitTimeout(timeout), process) +} + +// ExitCode returns the exit code of the process. The process must have +// already terminated. +func (process *process) ExitCode() (int, error) { + code, err := process.p.ExitCode() + if err != nil { + err = convertProcessError(err, process) + } + return code, err +} + +// ResizeConsole resizes the console of the process. +func (process *process) ResizeConsole(width, height uint16) error { + return convertProcessError(process.p.ResizeConsole(width, height), process) +} + +// Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing +// these pipes does not close the underlying pipes; it should be possible to +// call this multiple times to get multiple interfaces. +func (process *process) Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, error) { + stdin, stdout, stderr, err := process.p.Stdio() + if err != nil { + err = convertProcessError(err, process) + } + return stdin, stdout, stderr, err +} + +// CloseStdin closes the write side of the stdin pipe so that the process is +// notified on the read side that there is no more data in stdin. +func (process *process) CloseStdin() error { + return convertProcessError(process.p.CloseStdin(), process) +} + +// Close cleans up any state associated with the process but does not kill +// or wait on it. +func (process *process) Close() error { + return convertProcessError(process.p.Close(), process) +} diff --git a/vendor/github.com/Microsoft/hcsshim/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/zsyscall_windows.go new file mode 100644 index 0000000000..cd471295b8 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/zsyscall_windows.go @@ -0,0 +1,52 @@ +// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT + +package hcsshim + +import ( + "syscall" + "unsafe" + + "github.com/Microsoft/hcsshim/internal/interop" + "golang.org/x/sys/windows" +) + +var _ unsafe.Pointer + +// Do the interface allocations only once for common +// Errno values. +const ( + errnoERROR_IO_PENDING = 997 +) + +var ( + errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) +) + +// errnoErr returns common boxed Errno values, to prevent +// allocations at runtime. +func errnoErr(e syscall.Errno) error { + switch e { + case 0: + return nil + case errnoERROR_IO_PENDING: + return errERROR_IO_PENDING + } + // TODO: add more here, after collecting data on the common + // error values see on Windows. (perhaps when running + // all.bat?) + return e +} + +var ( + modiphlpapi = windows.NewLazySystemDLL("iphlpapi.dll") + + procSetCurrentThreadCompartmentId = modiphlpapi.NewProc("SetCurrentThreadCompartmentId") +) + +func SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) { + r0, _, _ := syscall.Syscall(procSetCurrentThreadCompartmentId.Addr(), 1, uintptr(compartmentId), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} diff --git a/vendor/github.com/containerd/console/LICENSE b/vendor/github.com/containerd/console/LICENSE new file mode 100644 index 0000000000..584149b6ee --- /dev/null +++ b/vendor/github.com/containerd/console/LICENSE @@ -0,0 +1,191 @@ + + Apache License + Version 2.0, January 2004 + https://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + Copyright The containerd Authors + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + https://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. diff --git a/vendor/github.com/containerd/console/console.go b/vendor/github.com/containerd/console/console.go new file mode 100644 index 0000000000..c187a9b412 --- /dev/null +++ b/vendor/github.com/containerd/console/console.go @@ -0,0 +1,78 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package console + +import ( + "errors" + "io" + "os" +) + +var ErrNotAConsole = errors.New("provided file is not a console") + +type Console interface { + io.Reader + io.Writer + io.Closer + + // Resize resizes the console to the provided window size + Resize(WinSize) error + // ResizeFrom resizes the calling console to the size of the + // provided console + ResizeFrom(Console) error + // SetRaw sets the console in raw mode + SetRaw() error + // DisableEcho disables echo on the console + DisableEcho() error + // Reset restores the console to its orignal state + Reset() error + // Size returns the window size of the console + Size() (WinSize, error) + // Fd returns the console's file descriptor + Fd() uintptr + // Name returns the console's file name + Name() string +} + +// WinSize specifies the window size of the console +type WinSize struct { + // Height of the console + Height uint16 + // Width of the console + Width uint16 + x uint16 + y uint16 +} + +// Current returns the current processes console +func Current() Console { + c, err := ConsoleFromFile(os.Stdin) + if err != nil { + // stdin should always be a console for the design + // of this function + panic(err) + } + return c +} + +// ConsoleFromFile returns a console using the provided file +func ConsoleFromFile(f *os.File) (Console, error) { + if err := checkConsole(f); err != nil { + return nil, err + } + return newMaster(f) +} diff --git a/vendor/github.com/containerd/console/console_linux.go b/vendor/github.com/containerd/console/console_linux.go new file mode 100644 index 0000000000..42274e100e --- /dev/null +++ b/vendor/github.com/containerd/console/console_linux.go @@ -0,0 +1,275 @@ +// +build linux + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package console + +import ( + "io" + "os" + "sync" + + "golang.org/x/sys/unix" +) + +const ( + maxEvents = 128 +) + +// Epoller manages multiple epoll consoles using edge-triggered epoll api so we +// dont have to deal with repeated wake-up of EPOLLER or EPOLLHUP. +// For more details, see: +// - https://github.com/systemd/systemd/pull/4262 +// - https://github.com/moby/moby/issues/27202 +// +// Example usage of Epoller and EpollConsole can be as follow: +// +// epoller, _ := NewEpoller() +// epollConsole, _ := epoller.Add(console) +// go epoller.Wait() +// var ( +// b bytes.Buffer +// wg sync.WaitGroup +// ) +// wg.Add(1) +// go func() { +// io.Copy(&b, epollConsole) +// wg.Done() +// }() +// // perform I/O on the console +// epollConsole.Shutdown(epoller.CloseConsole) +// wg.Wait() +// epollConsole.Close() +type Epoller struct { + efd int + mu sync.Mutex + fdMapping map[int]*EpollConsole +} + +// NewEpoller returns an instance of epoller with a valid epoll fd. +func NewEpoller() (*Epoller, error) { + efd, err := unix.EpollCreate1(unix.EPOLL_CLOEXEC) + if err != nil { + return nil, err + } + return &Epoller{ + efd: efd, + fdMapping: make(map[int]*EpollConsole), + }, nil +} + +// Add creates an epoll console based on the provided console. The console will +// be registered with EPOLLET (i.e. using edge-triggered notification) and its +// file descriptor will be set to non-blocking mode. After this, user should use +// the return console to perform I/O. +func (e *Epoller) Add(console Console) (*EpollConsole, error) { + sysfd := int(console.Fd()) + // Set sysfd to non-blocking mode + if err := unix.SetNonblock(sysfd, true); err != nil { + return nil, err + } + + ev := unix.EpollEvent{ + Events: unix.EPOLLIN | unix.EPOLLOUT | unix.EPOLLRDHUP | unix.EPOLLET, + Fd: int32(sysfd), + } + if err := unix.EpollCtl(e.efd, unix.EPOLL_CTL_ADD, sysfd, &ev); err != nil { + return nil, err + } + ef := &EpollConsole{ + Console: console, + sysfd: sysfd, + readc: sync.NewCond(&sync.Mutex{}), + writec: sync.NewCond(&sync.Mutex{}), + } + e.mu.Lock() + e.fdMapping[sysfd] = ef + e.mu.Unlock() + return ef, nil +} + +// Wait starts the loop to wait for its consoles' notifications and signal +// appropriate console that it can perform I/O. +func (e *Epoller) Wait() error { + events := make([]unix.EpollEvent, maxEvents) + for { + n, err := unix.EpollWait(e.efd, events, -1) + if err != nil { + // EINTR: The call was interrupted by a signal handler before either + // any of the requested events occurred or the timeout expired + if err == unix.EINTR { + continue + } + return err + } + for i := 0; i < n; i++ { + ev := &events[i] + // the console is ready to be read from + if ev.Events&(unix.EPOLLIN|unix.EPOLLHUP|unix.EPOLLERR) != 0 { + if epfile := e.getConsole(int(ev.Fd)); epfile != nil { + epfile.signalRead() + } + } + // the console is ready to be written to + if ev.Events&(unix.EPOLLOUT|unix.EPOLLHUP|unix.EPOLLERR) != 0 { + if epfile := e.getConsole(int(ev.Fd)); epfile != nil { + epfile.signalWrite() + } + } + } + } +} + +// CloseConsole unregisters the console's file descriptor from epoll interface +func (e *Epoller) CloseConsole(fd int) error { + e.mu.Lock() + defer e.mu.Unlock() + delete(e.fdMapping, fd) + return unix.EpollCtl(e.efd, unix.EPOLL_CTL_DEL, fd, &unix.EpollEvent{}) +} + +func (e *Epoller) getConsole(sysfd int) *EpollConsole { + e.mu.Lock() + f := e.fdMapping[sysfd] + e.mu.Unlock() + return f +} + +// Close closes the epoll fd +func (e *Epoller) Close() error { + return unix.Close(e.efd) +} + +// EpollConsole acts like a console but registers its file descriptor with an +// epoll fd and uses epoll API to perform I/O. +type EpollConsole struct { + Console + readc *sync.Cond + writec *sync.Cond + sysfd int + closed bool +} + +// Read reads up to len(p) bytes into p. It returns the number of bytes read +// (0 <= n <= len(p)) and any error encountered. +// +// If the console's read returns EAGAIN or EIO, we assume that it's a +// temporary error because the other side went away and wait for the signal +// generated by epoll event to continue. +func (ec *EpollConsole) Read(p []byte) (n int, err error) { + var read int + ec.readc.L.Lock() + defer ec.readc.L.Unlock() + for { + read, err = ec.Console.Read(p[n:]) + n += read + if err != nil { + var hangup bool + if perr, ok := err.(*os.PathError); ok { + hangup = (perr.Err == unix.EAGAIN || perr.Err == unix.EIO) + } else { + hangup = (err == unix.EAGAIN || err == unix.EIO) + } + // if the other end disappear, assume this is temporary and wait for the + // signal to continue again. Unless we didnt read anything and the + // console is already marked as closed then we should exit + if hangup && !(n == 0 && len(p) > 0 && ec.closed) { + ec.readc.Wait() + continue + } + } + break + } + // if we didnt read anything then return io.EOF to end gracefully + if n == 0 && len(p) > 0 && err == nil { + err = io.EOF + } + // signal for others that we finished the read + ec.readc.Signal() + return n, err +} + +// Writes len(p) bytes from p to the console. It returns the number of bytes +// written from p (0 <= n <= len(p)) and any error encountered that caused +// the write to stop early. +// +// If writes to the console returns EAGAIN or EIO, we assume that it's a +// temporary error because the other side went away and wait for the signal +// generated by epoll event to continue. +func (ec *EpollConsole) Write(p []byte) (n int, err error) { + var written int + ec.writec.L.Lock() + defer ec.writec.L.Unlock() + for { + written, err = ec.Console.Write(p[n:]) + n += written + if err != nil { + var hangup bool + if perr, ok := err.(*os.PathError); ok { + hangup = (perr.Err == unix.EAGAIN || perr.Err == unix.EIO) + } else { + hangup = (err == unix.EAGAIN || err == unix.EIO) + } + // if the other end disappears, assume this is temporary and wait for the + // signal to continue again. + if hangup { + ec.writec.Wait() + continue + } + } + // unrecoverable error, break the loop and return the error + break + } + if n < len(p) && err == nil { + err = io.ErrShortWrite + } + // signal for others that we finished the write + ec.writec.Signal() + return n, err +} + +// Shutdown closes the file descriptor and signals call waiters for this fd. +// It accepts a callback which will be called with the console's fd. The +// callback typically will be used to do further cleanup such as unregister the +// console's fd from the epoll interface. +// User should call Shutdown and wait for all I/O operation to be finished +// before closing the console. +func (ec *EpollConsole) Shutdown(close func(int) error) error { + ec.readc.L.Lock() + defer ec.readc.L.Unlock() + ec.writec.L.Lock() + defer ec.writec.L.Unlock() + + ec.readc.Broadcast() + ec.writec.Broadcast() + ec.closed = true + return close(ec.sysfd) +} + +// signalRead signals that the console is readable. +func (ec *EpollConsole) signalRead() { + ec.readc.L.Lock() + ec.readc.Signal() + ec.readc.L.Unlock() +} + +// signalWrite signals that the console is writable. +func (ec *EpollConsole) signalWrite() { + ec.writec.L.Lock() + ec.writec.Signal() + ec.writec.L.Unlock() +} diff --git a/vendor/github.com/containerd/console/console_unix.go b/vendor/github.com/containerd/console/console_unix.go new file mode 100644 index 0000000000..a4a8d1267b --- /dev/null +++ b/vendor/github.com/containerd/console/console_unix.go @@ -0,0 +1,158 @@ +// +build darwin freebsd linux openbsd solaris + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package console + +import ( + "os" + + "golang.org/x/sys/unix" +) + +// NewPty creates a new pty pair +// The master is returned as the first console and a string +// with the path to the pty slave is returned as the second +func NewPty() (Console, string, error) { + f, err := os.OpenFile("/dev/ptmx", unix.O_RDWR|unix.O_NOCTTY|unix.O_CLOEXEC, 0) + if err != nil { + return nil, "", err + } + slave, err := ptsname(f) + if err != nil { + return nil, "", err + } + if err := unlockpt(f); err != nil { + return nil, "", err + } + m, err := newMaster(f) + if err != nil { + return nil, "", err + } + return m, slave, nil +} + +type master struct { + f *os.File + original *unix.Termios +} + +func (m *master) Read(b []byte) (int, error) { + return m.f.Read(b) +} + +func (m *master) Write(b []byte) (int, error) { + return m.f.Write(b) +} + +func (m *master) Close() error { + return m.f.Close() +} + +func (m *master) Resize(ws WinSize) error { + return tcswinsz(m.f.Fd(), ws) +} + +func (m *master) ResizeFrom(c Console) error { + ws, err := c.Size() + if err != nil { + return err + } + return m.Resize(ws) +} + +func (m *master) Reset() error { + if m.original == nil { + return nil + } + return tcset(m.f.Fd(), m.original) +} + +func (m *master) getCurrent() (unix.Termios, error) { + var termios unix.Termios + if err := tcget(m.f.Fd(), &termios); err != nil { + return unix.Termios{}, err + } + return termios, nil +} + +func (m *master) SetRaw() error { + rawState, err := m.getCurrent() + if err != nil { + return err + } + rawState = cfmakeraw(rawState) + rawState.Oflag = rawState.Oflag | unix.OPOST + return tcset(m.f.Fd(), &rawState) +} + +func (m *master) DisableEcho() error { + rawState, err := m.getCurrent() + if err != nil { + return err + } + rawState.Lflag = rawState.Lflag &^ unix.ECHO + return tcset(m.f.Fd(), &rawState) +} + +func (m *master) Size() (WinSize, error) { + return tcgwinsz(m.f.Fd()) +} + +func (m *master) Fd() uintptr { + return m.f.Fd() +} + +func (m *master) Name() string { + return m.f.Name() +} + +// checkConsole checks if the provided file is a console +func checkConsole(f *os.File) error { + var termios unix.Termios + if tcget(f.Fd(), &termios) != nil { + return ErrNotAConsole + } + return nil +} + +func newMaster(f *os.File) (Console, error) { + m := &master{ + f: f, + } + t, err := m.getCurrent() + if err != nil { + return nil, err + } + m.original = &t + return m, nil +} + +// ClearONLCR sets the necessary tty_ioctl(4)s to ensure that a pty pair +// created by us acts normally. In particular, a not-very-well-known default of +// Linux unix98 ptys is that they have +onlcr by default. While this isn't a +// problem for terminal emulators, because we relay data from the terminal we +// also relay that funky line discipline. +func ClearONLCR(fd uintptr) error { + return setONLCR(fd, false) +} + +// SetONLCR sets the necessary tty_ioctl(4)s to ensure that a pty pair +// created by us acts as intended for a terminal emulator. +func SetONLCR(fd uintptr) error { + return setONLCR(fd, true) +} diff --git a/vendor/github.com/containerd/console/console_windows.go b/vendor/github.com/containerd/console/console_windows.go new file mode 100644 index 0000000000..62dbe1c033 --- /dev/null +++ b/vendor/github.com/containerd/console/console_windows.go @@ -0,0 +1,216 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package console + +import ( + "fmt" + "os" + + "github.com/pkg/errors" + "golang.org/x/sys/windows" +) + +var ( + vtInputSupported bool + ErrNotImplemented = errors.New("not implemented") +) + +func (m *master) initStdios() { + m.in = windows.Handle(os.Stdin.Fd()) + if err := windows.GetConsoleMode(m.in, &m.inMode); err == nil { + // Validate that windows.ENABLE_VIRTUAL_TERMINAL_INPUT is supported, but do not set it. + if err = windows.SetConsoleMode(m.in, m.inMode|windows.ENABLE_VIRTUAL_TERMINAL_INPUT); err == nil { + vtInputSupported = true + } + // Unconditionally set the console mode back even on failure because SetConsoleMode + // remembers invalid bits on input handles. + windows.SetConsoleMode(m.in, m.inMode) + } else { + fmt.Printf("failed to get console mode for stdin: %v\n", err) + } + + m.out = windows.Handle(os.Stdout.Fd()) + if err := windows.GetConsoleMode(m.out, &m.outMode); err == nil { + if err := windows.SetConsoleMode(m.out, m.outMode|windows.ENABLE_VIRTUAL_TERMINAL_PROCESSING); err == nil { + m.outMode |= windows.ENABLE_VIRTUAL_TERMINAL_PROCESSING + } else { + windows.SetConsoleMode(m.out, m.outMode) + } + } else { + fmt.Printf("failed to get console mode for stdout: %v\n", err) + } + + m.err = windows.Handle(os.Stderr.Fd()) + if err := windows.GetConsoleMode(m.err, &m.errMode); err == nil { + if err := windows.SetConsoleMode(m.err, m.errMode|windows.ENABLE_VIRTUAL_TERMINAL_PROCESSING); err == nil { + m.errMode |= windows.ENABLE_VIRTUAL_TERMINAL_PROCESSING + } else { + windows.SetConsoleMode(m.err, m.errMode) + } + } else { + fmt.Printf("failed to get console mode for stderr: %v\n", err) + } +} + +type master struct { + in windows.Handle + inMode uint32 + + out windows.Handle + outMode uint32 + + err windows.Handle + errMode uint32 +} + +func (m *master) SetRaw() error { + if err := makeInputRaw(m.in, m.inMode); err != nil { + return err + } + + // Set StdOut and StdErr to raw mode, we ignore failures since + // windows.DISABLE_NEWLINE_AUTO_RETURN might not be supported on this version of + // Windows. + + windows.SetConsoleMode(m.out, m.outMode|windows.DISABLE_NEWLINE_AUTO_RETURN) + + windows.SetConsoleMode(m.err, m.errMode|windows.DISABLE_NEWLINE_AUTO_RETURN) + + return nil +} + +func (m *master) Reset() error { + for _, s := range []struct { + fd windows.Handle + mode uint32 + }{ + {m.in, m.inMode}, + {m.out, m.outMode}, + {m.err, m.errMode}, + } { + if err := windows.SetConsoleMode(s.fd, s.mode); err != nil { + return errors.Wrap(err, "unable to restore console mode") + } + } + + return nil +} + +func (m *master) Size() (WinSize, error) { + var info windows.ConsoleScreenBufferInfo + err := windows.GetConsoleScreenBufferInfo(m.out, &info) + if err != nil { + return WinSize{}, errors.Wrap(err, "unable to get console info") + } + + winsize := WinSize{ + Width: uint16(info.Window.Right - info.Window.Left + 1), + Height: uint16(info.Window.Bottom - info.Window.Top + 1), + } + + return winsize, nil +} + +func (m *master) Resize(ws WinSize) error { + return ErrNotImplemented +} + +func (m *master) ResizeFrom(c Console) error { + return ErrNotImplemented +} + +func (m *master) DisableEcho() error { + mode := m.inMode &^ windows.ENABLE_ECHO_INPUT + mode |= windows.ENABLE_PROCESSED_INPUT + mode |= windows.ENABLE_LINE_INPUT + + if err := windows.SetConsoleMode(m.in, mode); err != nil { + return errors.Wrap(err, "unable to set console to disable echo") + } + + return nil +} + +func (m *master) Close() error { + return nil +} + +func (m *master) Read(b []byte) (int, error) { + return os.Stdin.Read(b) +} + +func (m *master) Write(b []byte) (int, error) { + return os.Stdout.Write(b) +} + +func (m *master) Fd() uintptr { + return uintptr(m.in) +} + +// on windows, console can only be made from os.Std{in,out,err}, hence there +// isnt a single name here we can use. Return a dummy "console" value in this +// case should be sufficient. +func (m *master) Name() string { + return "console" +} + +// makeInputRaw puts the terminal (Windows Console) connected to the given +// file descriptor into raw mode +func makeInputRaw(fd windows.Handle, mode uint32) error { + // See + // -- https://msdn.microsoft.com/en-us/library/windows/desktop/ms686033(v=vs.85).aspx + // -- https://msdn.microsoft.com/en-us/library/windows/desktop/ms683462(v=vs.85).aspx + + // Disable these modes + mode &^= windows.ENABLE_ECHO_INPUT + mode &^= windows.ENABLE_LINE_INPUT + mode &^= windows.ENABLE_MOUSE_INPUT + mode &^= windows.ENABLE_WINDOW_INPUT + mode &^= windows.ENABLE_PROCESSED_INPUT + + // Enable these modes + mode |= windows.ENABLE_EXTENDED_FLAGS + mode |= windows.ENABLE_INSERT_MODE + mode |= windows.ENABLE_QUICK_EDIT_MODE + + if vtInputSupported { + mode |= windows.ENABLE_VIRTUAL_TERMINAL_INPUT + } + + if err := windows.SetConsoleMode(fd, mode); err != nil { + return errors.Wrap(err, "unable to set console to raw mode") + } + + return nil +} + +func checkConsole(f *os.File) error { + var mode uint32 + if err := windows.GetConsoleMode(windows.Handle(f.Fd()), &mode); err != nil { + return err + } + return nil +} + +func newMaster(f *os.File) (Console, error) { + if f != os.Stdin && f != os.Stdout && f != os.Stderr { + return nil, errors.New("creating a console from a file is not supported on windows") + } + m := &master{} + m.initStdios() + return m, nil +} diff --git a/vendor/github.com/containerd/console/tc_darwin.go b/vendor/github.com/containerd/console/tc_darwin.go new file mode 100644 index 0000000000..b0128abb0c --- /dev/null +++ b/vendor/github.com/containerd/console/tc_darwin.go @@ -0,0 +1,53 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package console + +import ( + "fmt" + "os" + "unsafe" + + "golang.org/x/sys/unix" +) + +const ( + cmdTcGet = unix.TIOCGETA + cmdTcSet = unix.TIOCSETA +) + +func ioctl(fd, flag, data uintptr) error { + if _, _, err := unix.Syscall(unix.SYS_IOCTL, fd, flag, data); err != 0 { + return err + } + return nil +} + +// unlockpt unlocks the slave pseudoterminal device corresponding to the master pseudoterminal referred to by f. +// unlockpt should be called before opening the slave side of a pty. +func unlockpt(f *os.File) error { + var u int32 + return ioctl(f.Fd(), unix.TIOCPTYUNLK, uintptr(unsafe.Pointer(&u))) +} + +// ptsname retrieves the name of the first available pts for the given master. +func ptsname(f *os.File) (string, error) { + n, err := unix.IoctlGetInt(int(f.Fd()), unix.TIOCPTYGNAME) + if err != nil { + return "", err + } + return fmt.Sprintf("/dev/pts/%d", n), nil +} diff --git a/vendor/github.com/containerd/console/tc_freebsd.go b/vendor/github.com/containerd/console/tc_freebsd.go new file mode 100644 index 0000000000..04583a6156 --- /dev/null +++ b/vendor/github.com/containerd/console/tc_freebsd.go @@ -0,0 +1,45 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package console + +import ( + "fmt" + "os" + + "golang.org/x/sys/unix" +) + +const ( + cmdTcGet = unix.TIOCGETA + cmdTcSet = unix.TIOCSETA +) + +// unlockpt unlocks the slave pseudoterminal device corresponding to the master pseudoterminal referred to by f. +// unlockpt should be called before opening the slave side of a pty. +// This does not exist on FreeBSD, it does not allocate controlling terminals on open +func unlockpt(f *os.File) error { + return nil +} + +// ptsname retrieves the name of the first available pts for the given master. +func ptsname(f *os.File) (string, error) { + n, err := unix.IoctlGetInt(int(f.Fd()), unix.TIOCGPTN) + if err != nil { + return "", err + } + return fmt.Sprintf("/dev/pts/%d", n), nil +} diff --git a/vendor/github.com/containerd/console/tc_linux.go b/vendor/github.com/containerd/console/tc_linux.go new file mode 100644 index 0000000000..1bdd68e6d5 --- /dev/null +++ b/vendor/github.com/containerd/console/tc_linux.go @@ -0,0 +1,49 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package console + +import ( + "fmt" + "os" + "unsafe" + + "golang.org/x/sys/unix" +) + +const ( + cmdTcGet = unix.TCGETS + cmdTcSet = unix.TCSETS +) + +// unlockpt unlocks the slave pseudoterminal device corresponding to the master pseudoterminal referred to by f. +// unlockpt should be called before opening the slave side of a pty. +func unlockpt(f *os.File) error { + var u int32 + if _, _, err := unix.Syscall(unix.SYS_IOCTL, f.Fd(), unix.TIOCSPTLCK, uintptr(unsafe.Pointer(&u))); err != 0 { + return err + } + return nil +} + +// ptsname retrieves the name of the first available pts for the given master. +func ptsname(f *os.File) (string, error) { + var u uint32 + if _, _, err := unix.Syscall(unix.SYS_IOCTL, f.Fd(), unix.TIOCGPTN, uintptr(unsafe.Pointer(&u))); err != 0 { + return "", err + } + return fmt.Sprintf("/dev/pts/%d", u), nil +} diff --git a/vendor/github.com/containerd/console/tc_openbsd_cgo.go b/vendor/github.com/containerd/console/tc_openbsd_cgo.go new file mode 100644 index 0000000000..f0cec06a72 --- /dev/null +++ b/vendor/github.com/containerd/console/tc_openbsd_cgo.go @@ -0,0 +1,51 @@ +// +build openbsd,cgo + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package console + +import ( + "os" + + "golang.org/x/sys/unix" +) + +//#include +import "C" + +const ( + cmdTcGet = unix.TIOCGETA + cmdTcSet = unix.TIOCSETA +) + +// ptsname retrieves the name of the first available pts for the given master. +func ptsname(f *os.File) (string, error) { + ptspath, err := C.ptsname(C.int(f.Fd())) + if err != nil { + return "", err + } + return C.GoString(ptspath), nil +} + +// unlockpt unlocks the slave pseudoterminal device corresponding to the master pseudoterminal referred to by f. +// unlockpt should be called before opening the slave side of a pty. +func unlockpt(f *os.File) error { + if _, err := C.grantpt(C.int(f.Fd())); err != nil { + return err + } + return nil +} diff --git a/vendor/github.com/containerd/console/tc_openbsd_nocgo.go b/vendor/github.com/containerd/console/tc_openbsd_nocgo.go new file mode 100644 index 0000000000..daccce2058 --- /dev/null +++ b/vendor/github.com/containerd/console/tc_openbsd_nocgo.go @@ -0,0 +1,47 @@ +// +build openbsd,!cgo + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +// +// Implementing the functions below requires cgo support. Non-cgo stubs +// versions are defined below to enable cross-compilation of source code +// that depends on these functions, but the resultant cross-compiled +// binaries cannot actually be used. If the stub function(s) below are +// actually invoked they will display an error message and cause the +// calling process to exit. +// + +package console + +import ( + "os" + + "golang.org/x/sys/unix" +) + +const ( + cmdTcGet = unix.TIOCGETA + cmdTcSet = unix.TIOCSETA +) + +func ptsname(f *os.File) (string, error) { + panic("ptsname() support requires cgo.") +} + +func unlockpt(f *os.File) error { + panic("unlockpt() support requires cgo.") +} diff --git a/vendor/github.com/containerd/console/tc_solaris_cgo.go b/vendor/github.com/containerd/console/tc_solaris_cgo.go new file mode 100644 index 0000000000..e36a68edd1 --- /dev/null +++ b/vendor/github.com/containerd/console/tc_solaris_cgo.go @@ -0,0 +1,51 @@ +// +build solaris,cgo + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package console + +import ( + "os" + + "golang.org/x/sys/unix" +) + +//#include +import "C" + +const ( + cmdTcGet = unix.TCGETS + cmdTcSet = unix.TCSETS +) + +// ptsname retrieves the name of the first available pts for the given master. +func ptsname(f *os.File) (string, error) { + ptspath, err := C.ptsname(C.int(f.Fd())) + if err != nil { + return "", err + } + return C.GoString(ptspath), nil +} + +// unlockpt unlocks the slave pseudoterminal device corresponding to the master pseudoterminal referred to by f. +// unlockpt should be called before opening the slave side of a pty. +func unlockpt(f *os.File) error { + if _, err := C.grantpt(C.int(f.Fd())); err != nil { + return err + } + return nil +} diff --git a/vendor/github.com/containerd/console/tc_solaris_nocgo.go b/vendor/github.com/containerd/console/tc_solaris_nocgo.go new file mode 100644 index 0000000000..eb0bd2c36b --- /dev/null +++ b/vendor/github.com/containerd/console/tc_solaris_nocgo.go @@ -0,0 +1,47 @@ +// +build solaris,!cgo + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +// +// Implementing the functions below requires cgo support. Non-cgo stubs +// versions are defined below to enable cross-compilation of source code +// that depends on these functions, but the resultant cross-compiled +// binaries cannot actually be used. If the stub function(s) below are +// actually invoked they will display an error message and cause the +// calling process to exit. +// + +package console + +import ( + "os" + + "golang.org/x/sys/unix" +) + +const ( + cmdTcGet = unix.TCGETS + cmdTcSet = unix.TCSETS +) + +func ptsname(f *os.File) (string, error) { + panic("ptsname() support requires cgo.") +} + +func unlockpt(f *os.File) error { + panic("unlockpt() support requires cgo.") +} diff --git a/vendor/github.com/containerd/console/tc_unix.go b/vendor/github.com/containerd/console/tc_unix.go new file mode 100644 index 0000000000..7ae773c53e --- /dev/null +++ b/vendor/github.com/containerd/console/tc_unix.go @@ -0,0 +1,91 @@ +// +build darwin freebsd linux openbsd solaris + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package console + +import ( + "golang.org/x/sys/unix" +) + +func tcget(fd uintptr, p *unix.Termios) error { + termios, err := unix.IoctlGetTermios(int(fd), cmdTcGet) + if err != nil { + return err + } + *p = *termios + return nil +} + +func tcset(fd uintptr, p *unix.Termios) error { + return unix.IoctlSetTermios(int(fd), cmdTcSet, p) +} + +func tcgwinsz(fd uintptr) (WinSize, error) { + var ws WinSize + + uws, err := unix.IoctlGetWinsize(int(fd), unix.TIOCGWINSZ) + if err != nil { + return ws, err + } + + // Translate from unix.Winsize to console.WinSize + ws.Height = uws.Row + ws.Width = uws.Col + ws.x = uws.Xpixel + ws.y = uws.Ypixel + return ws, nil +} + +func tcswinsz(fd uintptr, ws WinSize) error { + // Translate from console.WinSize to unix.Winsize + + var uws unix.Winsize + uws.Row = ws.Height + uws.Col = ws.Width + uws.Xpixel = ws.x + uws.Ypixel = ws.y + + return unix.IoctlSetWinsize(int(fd), unix.TIOCSWINSZ, &uws) +} + +func setONLCR(fd uintptr, enable bool) error { + var termios unix.Termios + if err := tcget(fd, &termios); err != nil { + return err + } + if enable { + // Set +onlcr so we can act like a real terminal + termios.Oflag |= unix.ONLCR + } else { + // Set -onlcr so we don't have to deal with \r. + termios.Oflag &^= unix.ONLCR + } + return tcset(fd, &termios) +} + +func cfmakeraw(t unix.Termios) unix.Termios { + t.Iflag &^= (unix.IGNBRK | unix.BRKINT | unix.PARMRK | unix.ISTRIP | unix.INLCR | unix.IGNCR | unix.ICRNL | unix.IXON) + t.Oflag &^= unix.OPOST + t.Lflag &^= (unix.ECHO | unix.ECHONL | unix.ICANON | unix.ISIG | unix.IEXTEN) + t.Cflag &^= (unix.CSIZE | unix.PARENB) + t.Cflag &^= unix.CS8 + t.Cc[unix.VMIN] = 1 + t.Cc[unix.VTIME] = 0 + + return t +} diff --git a/vendor/github.com/containerd/containerd/LICENSE b/vendor/github.com/containerd/containerd/LICENSE new file mode 100644 index 0000000000..584149b6ee --- /dev/null +++ b/vendor/github.com/containerd/containerd/LICENSE @@ -0,0 +1,191 @@ + + Apache License + Version 2.0, January 2004 + https://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + Copyright The containerd Authors + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + https://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. diff --git a/vendor/github.com/containerd/containerd/NOTICE b/vendor/github.com/containerd/containerd/NOTICE new file mode 100644 index 0000000000..8915f02773 --- /dev/null +++ b/vendor/github.com/containerd/containerd/NOTICE @@ -0,0 +1,16 @@ +Docker +Copyright 2012-2015 Docker, Inc. + +This product includes software developed at Docker, Inc. (https://www.docker.com). + +The following is courtesy of our legal counsel: + + +Use and transfer of Docker may be subject to certain restrictions by the +United States and other governments. +It is your responsibility to ensure that your use and/or transfer does not +violate applicable laws. + +For more information, please see https://www.bis.doc.gov + +See also https://www.apache.org/dev/crypto.html and/or seek legal counsel. diff --git a/vendor/github.com/containerd/containerd/api/events/container.pb.go b/vendor/github.com/containerd/containerd/api/events/container.pb.go new file mode 100644 index 0000000000..c89d97f3ee --- /dev/null +++ b/vendor/github.com/containerd/containerd/api/events/container.pb.go @@ -0,0 +1,1238 @@ +// Code generated by protoc-gen-gogo. DO NOT EDIT. +// source: github.com/containerd/containerd/api/events/container.proto + +/* + Package events is a generated protocol buffer package. + + It is generated from these files: + github.com/containerd/containerd/api/events/container.proto + github.com/containerd/containerd/api/events/content.proto + github.com/containerd/containerd/api/events/image.proto + github.com/containerd/containerd/api/events/namespace.proto + github.com/containerd/containerd/api/events/snapshot.proto + github.com/containerd/containerd/api/events/task.proto + + It has these top-level messages: + ContainerCreate + ContainerUpdate + ContainerDelete + ContentDelete + ImageCreate + ImageUpdate + ImageDelete + NamespaceCreate + NamespaceUpdate + NamespaceDelete + SnapshotPrepare + SnapshotCommit + SnapshotRemove + TaskCreate + TaskStart + TaskDelete + TaskIO + TaskExit + TaskOOM + TaskExecAdded + TaskExecStarted + TaskPaused + TaskResumed + TaskCheckpointed +*/ +package events + +import proto "github.com/gogo/protobuf/proto" +import fmt "fmt" +import math "math" +import google_protobuf "github.com/gogo/protobuf/types" + +// skipping weak import gogoproto "github.com/gogo/protobuf/gogoproto" +// skipping weak import containerd_plugin "github.com/containerd/containerd/protobuf/plugin" + +import typeurl "github.com/containerd/typeurl" + +import strings "strings" +import reflect "reflect" +import sortkeys "github.com/gogo/protobuf/sortkeys" + +import io "io" + +// Reference imports to suppress errors if they are not otherwise used. +var _ = proto.Marshal +var _ = fmt.Errorf +var _ = math.Inf + +// This is a compile-time assertion to ensure that this generated file +// is compatible with the proto package it is being compiled against. +// A compilation error at this line likely means your copy of the +// proto package needs to be updated. +const _ = proto.GoGoProtoPackageIsVersion2 // please upgrade the proto package + +type ContainerCreate struct { + ID string `protobuf:"bytes,1,opt,name=id,proto3" json:"id,omitempty"` + Image string `protobuf:"bytes,2,opt,name=image,proto3" json:"image,omitempty"` + Runtime *ContainerCreate_Runtime `protobuf:"bytes,3,opt,name=runtime" json:"runtime,omitempty"` +} + +func (m *ContainerCreate) Reset() { *m = ContainerCreate{} } +func (*ContainerCreate) ProtoMessage() {} +func (*ContainerCreate) Descriptor() ([]byte, []int) { return fileDescriptorContainer, []int{0} } + +type ContainerCreate_Runtime struct { + Name string `protobuf:"bytes,1,opt,name=name,proto3" json:"name,omitempty"` + Options *google_protobuf.Any `protobuf:"bytes,2,opt,name=options" json:"options,omitempty"` +} + +func (m *ContainerCreate_Runtime) Reset() { *m = ContainerCreate_Runtime{} } +func (*ContainerCreate_Runtime) ProtoMessage() {} +func (*ContainerCreate_Runtime) Descriptor() ([]byte, []int) { + return fileDescriptorContainer, []int{0, 0} +} + +type ContainerUpdate struct { + ID string `protobuf:"bytes,1,opt,name=id,proto3" json:"id,omitempty"` + Image string `protobuf:"bytes,2,opt,name=image,proto3" json:"image,omitempty"` + Labels map[string]string `protobuf:"bytes,3,rep,name=labels" json:"labels,omitempty" protobuf_key:"bytes,1,opt,name=key,proto3" protobuf_val:"bytes,2,opt,name=value,proto3"` + SnapshotKey string `protobuf:"bytes,4,opt,name=snapshot_key,json=snapshotKey,proto3" json:"snapshot_key,omitempty"` +} + +func (m *ContainerUpdate) Reset() { *m = ContainerUpdate{} } +func (*ContainerUpdate) ProtoMessage() {} +func (*ContainerUpdate) Descriptor() ([]byte, []int) { return fileDescriptorContainer, []int{1} } + +type ContainerDelete struct { + ID string `protobuf:"bytes,1,opt,name=id,proto3" json:"id,omitempty"` +} + +func (m *ContainerDelete) Reset() { *m = ContainerDelete{} } +func (*ContainerDelete) ProtoMessage() {} +func (*ContainerDelete) Descriptor() ([]byte, []int) { return fileDescriptorContainer, []int{2} } + +func init() { + proto.RegisterType((*ContainerCreate)(nil), "containerd.events.ContainerCreate") + proto.RegisterType((*ContainerCreate_Runtime)(nil), "containerd.events.ContainerCreate.Runtime") + proto.RegisterType((*ContainerUpdate)(nil), "containerd.events.ContainerUpdate") + proto.RegisterType((*ContainerDelete)(nil), "containerd.events.ContainerDelete") +} + +// Field returns the value for the given fieldpath as a string, if defined. +// If the value is not defined, the second value will be false. +func (m *ContainerCreate) Field(fieldpath []string) (string, bool) { + if len(fieldpath) == 0 { + return "", false + } + + switch fieldpath[0] { + case "id": + return string(m.ID), len(m.ID) > 0 + case "image": + return string(m.Image), len(m.Image) > 0 + case "runtime": + // NOTE(stevvooe): This is probably not correct in many cases. + // We assume that the target message also implements the Field + // method, which isn't likely true in a lot of cases. + // + // If you have a broken build and have found this comment, + // you may be closer to a solution. + if m.Runtime == nil { + return "", false + } + + return m.Runtime.Field(fieldpath[1:]) + } + return "", false +} + +// Field returns the value for the given fieldpath as a string, if defined. +// If the value is not defined, the second value will be false. +func (m *ContainerCreate_Runtime) Field(fieldpath []string) (string, bool) { + if len(fieldpath) == 0 { + return "", false + } + + switch fieldpath[0] { + case "name": + return string(m.Name), len(m.Name) > 0 + case "options": + decoded, err := typeurl.UnmarshalAny(m.Options) + if err != nil { + return "", false + } + + adaptor, ok := decoded.(interface{ Field([]string) (string, bool) }) + if !ok { + return "", false + } + return adaptor.Field(fieldpath[1:]) + } + return "", false +} + +// Field returns the value for the given fieldpath as a string, if defined. +// If the value is not defined, the second value will be false. +func (m *ContainerUpdate) Field(fieldpath []string) (string, bool) { + if len(fieldpath) == 0 { + return "", false + } + + switch fieldpath[0] { + case "id": + return string(m.ID), len(m.ID) > 0 + case "image": + return string(m.Image), len(m.Image) > 0 + case "labels": + // Labels fields have been special-cased by name. If this breaks, + // add better special casing to fieldpath plugin. + if len(m.Labels) == 0 { + return "", false + } + value, ok := m.Labels[strings.Join(fieldpath[1:], ".")] + return value, ok + case "snapshot_key": + return string(m.SnapshotKey), len(m.SnapshotKey) > 0 + } + return "", false +} + +// Field returns the value for the given fieldpath as a string, if defined. +// If the value is not defined, the second value will be false. +func (m *ContainerDelete) Field(fieldpath []string) (string, bool) { + if len(fieldpath) == 0 { + return "", false + } + + switch fieldpath[0] { + case "id": + return string(m.ID), len(m.ID) > 0 + } + return "", false +} +func (m *ContainerCreate) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *ContainerCreate) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.ID) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintContainer(dAtA, i, uint64(len(m.ID))) + i += copy(dAtA[i:], m.ID) + } + if len(m.Image) > 0 { + dAtA[i] = 0x12 + i++ + i = encodeVarintContainer(dAtA, i, uint64(len(m.Image))) + i += copy(dAtA[i:], m.Image) + } + if m.Runtime != nil { + dAtA[i] = 0x1a + i++ + i = encodeVarintContainer(dAtA, i, uint64(m.Runtime.Size())) + n1, err := m.Runtime.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n1 + } + return i, nil +} + +func (m *ContainerCreate_Runtime) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *ContainerCreate_Runtime) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.Name) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintContainer(dAtA, i, uint64(len(m.Name))) + i += copy(dAtA[i:], m.Name) + } + if m.Options != nil { + dAtA[i] = 0x12 + i++ + i = encodeVarintContainer(dAtA, i, uint64(m.Options.Size())) + n2, err := m.Options.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n2 + } + return i, nil +} + +func (m *ContainerUpdate) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *ContainerUpdate) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.ID) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintContainer(dAtA, i, uint64(len(m.ID))) + i += copy(dAtA[i:], m.ID) + } + if len(m.Image) > 0 { + dAtA[i] = 0x12 + i++ + i = encodeVarintContainer(dAtA, i, uint64(len(m.Image))) + i += copy(dAtA[i:], m.Image) + } + if len(m.Labels) > 0 { + for k, _ := range m.Labels { + dAtA[i] = 0x1a + i++ + v := m.Labels[k] + mapSize := 1 + len(k) + sovContainer(uint64(len(k))) + 1 + len(v) + sovContainer(uint64(len(v))) + i = encodeVarintContainer(dAtA, i, uint64(mapSize)) + dAtA[i] = 0xa + i++ + i = encodeVarintContainer(dAtA, i, uint64(len(k))) + i += copy(dAtA[i:], k) + dAtA[i] = 0x12 + i++ + i = encodeVarintContainer(dAtA, i, uint64(len(v))) + i += copy(dAtA[i:], v) + } + } + if len(m.SnapshotKey) > 0 { + dAtA[i] = 0x22 + i++ + i = encodeVarintContainer(dAtA, i, uint64(len(m.SnapshotKey))) + i += copy(dAtA[i:], m.SnapshotKey) + } + return i, nil +} + +func (m *ContainerDelete) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *ContainerDelete) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.ID) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintContainer(dAtA, i, uint64(len(m.ID))) + i += copy(dAtA[i:], m.ID) + } + return i, nil +} + +func encodeVarintContainer(dAtA []byte, offset int, v uint64) int { + for v >= 1<<7 { + dAtA[offset] = uint8(v&0x7f | 0x80) + v >>= 7 + offset++ + } + dAtA[offset] = uint8(v) + return offset + 1 +} +func (m *ContainerCreate) Size() (n int) { + var l int + _ = l + l = len(m.ID) + if l > 0 { + n += 1 + l + sovContainer(uint64(l)) + } + l = len(m.Image) + if l > 0 { + n += 1 + l + sovContainer(uint64(l)) + } + if m.Runtime != nil { + l = m.Runtime.Size() + n += 1 + l + sovContainer(uint64(l)) + } + return n +} + +func (m *ContainerCreate_Runtime) Size() (n int) { + var l int + _ = l + l = len(m.Name) + if l > 0 { + n += 1 + l + sovContainer(uint64(l)) + } + if m.Options != nil { + l = m.Options.Size() + n += 1 + l + sovContainer(uint64(l)) + } + return n +} + +func (m *ContainerUpdate) Size() (n int) { + var l int + _ = l + l = len(m.ID) + if l > 0 { + n += 1 + l + sovContainer(uint64(l)) + } + l = len(m.Image) + if l > 0 { + n += 1 + l + sovContainer(uint64(l)) + } + if len(m.Labels) > 0 { + for k, v := range m.Labels { + _ = k + _ = v + mapEntrySize := 1 + len(k) + sovContainer(uint64(len(k))) + 1 + len(v) + sovContainer(uint64(len(v))) + n += mapEntrySize + 1 + sovContainer(uint64(mapEntrySize)) + } + } + l = len(m.SnapshotKey) + if l > 0 { + n += 1 + l + sovContainer(uint64(l)) + } + return n +} + +func (m *ContainerDelete) Size() (n int) { + var l int + _ = l + l = len(m.ID) + if l > 0 { + n += 1 + l + sovContainer(uint64(l)) + } + return n +} + +func sovContainer(x uint64) (n int) { + for { + n++ + x >>= 7 + if x == 0 { + break + } + } + return n +} +func sozContainer(x uint64) (n int) { + return sovContainer(uint64((x << 1) ^ uint64((int64(x) >> 63)))) +} +func (this *ContainerCreate) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&ContainerCreate{`, + `ID:` + fmt.Sprintf("%v", this.ID) + `,`, + `Image:` + fmt.Sprintf("%v", this.Image) + `,`, + `Runtime:` + strings.Replace(fmt.Sprintf("%v", this.Runtime), "ContainerCreate_Runtime", "ContainerCreate_Runtime", 1) + `,`, + `}`, + }, "") + return s +} +func (this *ContainerCreate_Runtime) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&ContainerCreate_Runtime{`, + `Name:` + fmt.Sprintf("%v", this.Name) + `,`, + `Options:` + strings.Replace(fmt.Sprintf("%v", this.Options), "Any", "google_protobuf.Any", 1) + `,`, + `}`, + }, "") + return s +} +func (this *ContainerUpdate) String() string { + if this == nil { + return "nil" + } + keysForLabels := make([]string, 0, len(this.Labels)) + for k, _ := range this.Labels { + keysForLabels = append(keysForLabels, k) + } + sortkeys.Strings(keysForLabels) + mapStringForLabels := "map[string]string{" + for _, k := range keysForLabels { + mapStringForLabels += fmt.Sprintf("%v: %v,", k, this.Labels[k]) + } + mapStringForLabels += "}" + s := strings.Join([]string{`&ContainerUpdate{`, + `ID:` + fmt.Sprintf("%v", this.ID) + `,`, + `Image:` + fmt.Sprintf("%v", this.Image) + `,`, + `Labels:` + mapStringForLabels + `,`, + `SnapshotKey:` + fmt.Sprintf("%v", this.SnapshotKey) + `,`, + `}`, + }, "") + return s +} +func (this *ContainerDelete) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&ContainerDelete{`, + `ID:` + fmt.Sprintf("%v", this.ID) + `,`, + `}`, + }, "") + return s +} +func valueToStringContainer(v interface{}) string { + rv := reflect.ValueOf(v) + if rv.IsNil() { + return "nil" + } + pv := reflect.Indirect(rv).Interface() + return fmt.Sprintf("*%v", pv) +} +func (m *ContainerCreate) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowContainer + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: ContainerCreate: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: ContainerCreate: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowContainer + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthContainer + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ID = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Image", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowContainer + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthContainer + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Image = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 3: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Runtime", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowContainer + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthContainer + } + postIndex := iNdEx + msglen + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Runtime == nil { + m.Runtime = &ContainerCreate_Runtime{} + } + if err := m.Runtime.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipContainer(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthContainer + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *ContainerCreate_Runtime) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowContainer + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: Runtime: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: Runtime: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Name", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowContainer + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthContainer + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Name = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Options", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowContainer + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthContainer + } + postIndex := iNdEx + msglen + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Options == nil { + m.Options = &google_protobuf.Any{} + } + if err := m.Options.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipContainer(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthContainer + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *ContainerUpdate) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowContainer + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: ContainerUpdate: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: ContainerUpdate: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowContainer + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthContainer + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ID = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Image", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowContainer + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthContainer + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Image = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 3: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Labels", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowContainer + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthContainer + } + postIndex := iNdEx + msglen + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Labels == nil { + m.Labels = make(map[string]string) + } + var mapkey string + var mapvalue string + for iNdEx < postIndex { + entryPreIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowContainer + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + if fieldNum == 1 { + var stringLenmapkey uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowContainer + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLenmapkey |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLenmapkey := int(stringLenmapkey) + if intStringLenmapkey < 0 { + return ErrInvalidLengthContainer + } + postStringIndexmapkey := iNdEx + intStringLenmapkey + if postStringIndexmapkey > l { + return io.ErrUnexpectedEOF + } + mapkey = string(dAtA[iNdEx:postStringIndexmapkey]) + iNdEx = postStringIndexmapkey + } else if fieldNum == 2 { + var stringLenmapvalue uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowContainer + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLenmapvalue |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLenmapvalue := int(stringLenmapvalue) + if intStringLenmapvalue < 0 { + return ErrInvalidLengthContainer + } + postStringIndexmapvalue := iNdEx + intStringLenmapvalue + if postStringIndexmapvalue > l { + return io.ErrUnexpectedEOF + } + mapvalue = string(dAtA[iNdEx:postStringIndexmapvalue]) + iNdEx = postStringIndexmapvalue + } else { + iNdEx = entryPreIndex + skippy, err := skipContainer(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthContainer + } + if (iNdEx + skippy) > postIndex { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + m.Labels[mapkey] = mapvalue + iNdEx = postIndex + case 4: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field SnapshotKey", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowContainer + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthContainer + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.SnapshotKey = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipContainer(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthContainer + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *ContainerDelete) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowContainer + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: ContainerDelete: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: ContainerDelete: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowContainer + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthContainer + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ID = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipContainer(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthContainer + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func skipContainer(dAtA []byte) (n int, err error) { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowContainer + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + wireType := int(wire & 0x7) + switch wireType { + case 0: + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowContainer + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + iNdEx++ + if dAtA[iNdEx-1] < 0x80 { + break + } + } + return iNdEx, nil + case 1: + iNdEx += 8 + return iNdEx, nil + case 2: + var length int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowContainer + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + length |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + iNdEx += length + if length < 0 { + return 0, ErrInvalidLengthContainer + } + return iNdEx, nil + case 3: + for { + var innerWire uint64 + var start int = iNdEx + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowContainer + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + innerWire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + innerWireType := int(innerWire & 0x7) + if innerWireType == 4 { + break + } + next, err := skipContainer(dAtA[start:]) + if err != nil { + return 0, err + } + iNdEx = start + next + } + return iNdEx, nil + case 4: + return iNdEx, nil + case 5: + iNdEx += 4 + return iNdEx, nil + default: + return 0, fmt.Errorf("proto: illegal wireType %d", wireType) + } + } + panic("unreachable") +} + +var ( + ErrInvalidLengthContainer = fmt.Errorf("proto: negative length found during unmarshaling") + ErrIntOverflowContainer = fmt.Errorf("proto: integer overflow") +) + +func init() { + proto.RegisterFile("github.com/containerd/containerd/api/events/container.proto", fileDescriptorContainer) +} + +var fileDescriptorContainer = []byte{ + // 413 bytes of a gzipped FileDescriptorProto + 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0x94, 0x92, 0xc1, 0x0a, 0xd3, 0x30, + 0x18, 0xc7, 0x97, 0x76, 0x6e, 0x98, 0x0a, 0x6a, 0x18, 0x52, 0x7b, 0xa8, 0x73, 0xa7, 0xe9, 0x21, + 0x85, 0x7a, 0x51, 0x77, 0xd1, 0x6d, 0x0a, 0xa2, 0x82, 0x14, 0x84, 0xe1, 0x45, 0xd2, 0x35, 0xeb, + 0x82, 0x6d, 0x52, 0xda, 0x74, 0xd0, 0x9b, 0x8f, 0xe2, 0xe3, 0xec, 0xe8, 0xc1, 0x83, 0x27, 0x71, + 0x05, 0xdf, 0xc0, 0x07, 0x90, 0x26, 0xeb, 0x56, 0x14, 0x95, 0x9d, 0xfa, 0xcf, 0xd7, 0xff, 0x3f, + 0xdf, 0xf7, 0xfb, 0x08, 0x9c, 0xc5, 0x4c, 0x6e, 0xcb, 0x10, 0xaf, 0x45, 0xea, 0xad, 0x05, 0x97, + 0x84, 0x71, 0x9a, 0x47, 0x5d, 0x49, 0x32, 0xe6, 0xd1, 0x1d, 0xe5, 0xb2, 0x38, 0x57, 0x71, 0x96, + 0x0b, 0x29, 0xd0, 0xcd, 0xb3, 0x0d, 0x6b, 0x8b, 0x73, 0x3b, 0x16, 0x22, 0x4e, 0xa8, 0xa7, 0x0c, + 0x61, 0xb9, 0xf1, 0x08, 0xaf, 0xb4, 0xdb, 0x19, 0xc5, 0x22, 0x16, 0x4a, 0x7a, 0x8d, 0x3a, 0x56, + 0x9f, 0xfc, 0x77, 0x80, 0xd3, 0x55, 0x59, 0x52, 0xc6, 0x8c, 0x7b, 0x1b, 0x46, 0x93, 0x28, 0x23, + 0x72, 0xab, 0x6f, 0x98, 0x7c, 0x01, 0xf0, 0xfa, 0xa2, 0xb5, 0x2f, 0x72, 0x4a, 0x24, 0x45, 0xb7, + 0xa0, 0xc1, 0x22, 0x1b, 0x8c, 0xc1, 0xf4, 0xea, 0x7c, 0x50, 0x7f, 0xbb, 0x63, 0xbc, 0x58, 0x06, + 0x06, 0x8b, 0xd0, 0x08, 0x5e, 0x61, 0x29, 0x89, 0xa9, 0x6d, 0x34, 0xbf, 0x02, 0x7d, 0x40, 0x4b, + 0x38, 0xcc, 0x4b, 0x2e, 0x59, 0x4a, 0x6d, 0x73, 0x0c, 0xa6, 0x96, 0x7f, 0x1f, 0xff, 0x41, 0x86, + 0x7f, 0x6b, 0x81, 0x03, 0x9d, 0x08, 0xda, 0xa8, 0xf3, 0x1a, 0x0e, 0x8f, 0x35, 0x84, 0x60, 0x9f, + 0x93, 0x94, 0xea, 0x01, 0x02, 0xa5, 0x11, 0x86, 0x43, 0x91, 0x49, 0x26, 0x78, 0xa1, 0x9a, 0x5b, + 0xfe, 0x08, 0xeb, 0x5d, 0xe1, 0x16, 0x10, 0x3f, 0xe5, 0x55, 0xd0, 0x9a, 0x26, 0x3f, 0xba, 0x58, + 0x6f, 0xb3, 0xe8, 0x72, 0xac, 0xe7, 0x70, 0x90, 0x90, 0x90, 0x26, 0x85, 0x6d, 0x8e, 0xcd, 0xa9, + 0xe5, 0xe3, 0x7f, 0x51, 0xe9, 0x0e, 0xf8, 0x95, 0x0a, 0x3c, 0xe3, 0x32, 0xaf, 0x82, 0x63, 0x1a, + 0xdd, 0x85, 0xd7, 0x0a, 0x4e, 0xb2, 0x62, 0x2b, 0xe4, 0xfb, 0x0f, 0xb4, 0xb2, 0xfb, 0xaa, 0x89, + 0xd5, 0xd6, 0x5e, 0xd2, 0xca, 0x79, 0x04, 0xad, 0x4e, 0x12, 0xdd, 0x80, 0x66, 0x63, 0xd4, 0xf8, + 0x8d, 0x6c, 0x26, 0xdc, 0x91, 0xa4, 0x3c, 0x4d, 0xa8, 0x0e, 0x8f, 0x8d, 0x87, 0x60, 0x72, 0xaf, + 0x83, 0xb9, 0xa4, 0x09, 0xfd, 0x3b, 0xe6, 0xfc, 0xcd, 0xfe, 0xe0, 0xf6, 0xbe, 0x1e, 0xdc, 0xde, + 0xc7, 0xda, 0x05, 0xfb, 0xda, 0x05, 0x9f, 0x6b, 0x17, 0x7c, 0xaf, 0x5d, 0xf0, 0xe9, 0xa7, 0x0b, + 0xde, 0xf9, 0x17, 0x3c, 0xe5, 0x99, 0xfe, 0xac, 0xc0, 0xca, 0x08, 0x07, 0x6a, 0xff, 0x0f, 0x7e, + 0x05, 0x00, 0x00, 0xff, 0xff, 0xf5, 0x09, 0xe0, 0xd6, 0x0b, 0x03, 0x00, 0x00, +} diff --git a/vendor/github.com/containerd/containerd/api/events/content.pb.go b/vendor/github.com/containerd/containerd/api/events/content.pb.go new file mode 100644 index 0000000000..87648d1938 --- /dev/null +++ b/vendor/github.com/containerd/containerd/api/events/content.pb.go @@ -0,0 +1,329 @@ +// Code generated by protoc-gen-gogo. DO NOT EDIT. +// source: github.com/containerd/containerd/api/events/content.proto + +package events + +import proto "github.com/gogo/protobuf/proto" +import fmt "fmt" +import math "math" + +// skipping weak import gogoproto "github.com/gogo/protobuf/gogoproto" +// skipping weak import containerd_plugin "github.com/containerd/containerd/protobuf/plugin" + +import github_com_opencontainers_go_digest "github.com/opencontainers/go-digest" + +import strings "strings" +import reflect "reflect" + +import io "io" + +// Reference imports to suppress errors if they are not otherwise used. +var _ = proto.Marshal +var _ = fmt.Errorf +var _ = math.Inf + +type ContentDelete struct { + Digest github_com_opencontainers_go_digest.Digest `protobuf:"bytes,1,opt,name=digest,proto3,customtype=github.com/opencontainers/go-digest.Digest" json:"digest"` +} + +func (m *ContentDelete) Reset() { *m = ContentDelete{} } +func (*ContentDelete) ProtoMessage() {} +func (*ContentDelete) Descriptor() ([]byte, []int) { return fileDescriptorContent, []int{0} } + +func init() { + proto.RegisterType((*ContentDelete)(nil), "containerd.events.ContentDelete") +} + +// Field returns the value for the given fieldpath as a string, if defined. +// If the value is not defined, the second value will be false. +func (m *ContentDelete) Field(fieldpath []string) (string, bool) { + if len(fieldpath) == 0 { + return "", false + } + + switch fieldpath[0] { + case "digest": + return string(m.Digest), len(m.Digest) > 0 + } + return "", false +} +func (m *ContentDelete) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *ContentDelete) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.Digest) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintContent(dAtA, i, uint64(len(m.Digest))) + i += copy(dAtA[i:], m.Digest) + } + return i, nil +} + +func encodeVarintContent(dAtA []byte, offset int, v uint64) int { + for v >= 1<<7 { + dAtA[offset] = uint8(v&0x7f | 0x80) + v >>= 7 + offset++ + } + dAtA[offset] = uint8(v) + return offset + 1 +} +func (m *ContentDelete) Size() (n int) { + var l int + _ = l + l = len(m.Digest) + if l > 0 { + n += 1 + l + sovContent(uint64(l)) + } + return n +} + +func sovContent(x uint64) (n int) { + for { + n++ + x >>= 7 + if x == 0 { + break + } + } + return n +} +func sozContent(x uint64) (n int) { + return sovContent(uint64((x << 1) ^ uint64((int64(x) >> 63)))) +} +func (this *ContentDelete) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&ContentDelete{`, + `Digest:` + fmt.Sprintf("%v", this.Digest) + `,`, + `}`, + }, "") + return s +} +func valueToStringContent(v interface{}) string { + rv := reflect.ValueOf(v) + if rv.IsNil() { + return "nil" + } + pv := reflect.Indirect(rv).Interface() + return fmt.Sprintf("*%v", pv) +} +func (m *ContentDelete) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowContent + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: ContentDelete: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: ContentDelete: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Digest", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowContent + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthContent + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Digest = github_com_opencontainers_go_digest.Digest(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipContent(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthContent + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func skipContent(dAtA []byte) (n int, err error) { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowContent + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + wireType := int(wire & 0x7) + switch wireType { + case 0: + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowContent + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + iNdEx++ + if dAtA[iNdEx-1] < 0x80 { + break + } + } + return iNdEx, nil + case 1: + iNdEx += 8 + return iNdEx, nil + case 2: + var length int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowContent + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + length |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + iNdEx += length + if length < 0 { + return 0, ErrInvalidLengthContent + } + return iNdEx, nil + case 3: + for { + var innerWire uint64 + var start int = iNdEx + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowContent + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + innerWire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + innerWireType := int(innerWire & 0x7) + if innerWireType == 4 { + break + } + next, err := skipContent(dAtA[start:]) + if err != nil { + return 0, err + } + iNdEx = start + next + } + return iNdEx, nil + case 4: + return iNdEx, nil + case 5: + iNdEx += 4 + return iNdEx, nil + default: + return 0, fmt.Errorf("proto: illegal wireType %d", wireType) + } + } + panic("unreachable") +} + +var ( + ErrInvalidLengthContent = fmt.Errorf("proto: negative length found during unmarshaling") + ErrIntOverflowContent = fmt.Errorf("proto: integer overflow") +) + +func init() { + proto.RegisterFile("github.com/containerd/containerd/api/events/content.proto", fileDescriptorContent) +} + +var fileDescriptorContent = []byte{ + // 228 bytes of a gzipped FileDescriptorProto + 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0xe2, 0xb2, 0x4c, 0xcf, 0x2c, 0xc9, + 0x28, 0x4d, 0xd2, 0x4b, 0xce, 0xcf, 0xd5, 0x4f, 0xce, 0xcf, 0x2b, 0x49, 0xcc, 0xcc, 0x4b, 0x2d, + 0x4a, 0x41, 0x66, 0x26, 0x16, 0x64, 0xea, 0xa7, 0x96, 0xa5, 0xe6, 0x95, 0x14, 0x83, 0x45, 0x53, + 0xf3, 0x4a, 0xf4, 0x0a, 0x8a, 0xf2, 0x4b, 0xf2, 0x85, 0x04, 0x11, 0x8a, 0xf4, 0x20, 0x0a, 0xa4, + 0x44, 0xd2, 0xf3, 0xd3, 0xf3, 0xc1, 0xb2, 0xfa, 0x20, 0x16, 0x44, 0xa1, 0x94, 0x03, 0x41, 0x3b, + 0xc0, 0xea, 0x92, 0x4a, 0xd3, 0xf4, 0x0b, 0x72, 0x4a, 0xd3, 0x33, 0xf3, 0xf4, 0xd3, 0x32, 0x53, + 0x73, 0x52, 0x0a, 0x12, 0x4b, 0x32, 0x20, 0x26, 0x28, 0x45, 0x73, 0xf1, 0x3a, 0x43, 0xec, 0x76, + 0x49, 0xcd, 0x49, 0x2d, 0x49, 0x15, 0xf2, 0xe2, 0x62, 0x4b, 0xc9, 0x4c, 0x4f, 0x2d, 0x2e, 0x91, + 0x60, 0x54, 0x60, 0xd4, 0xe0, 0x74, 0x32, 0x3a, 0x71, 0x4f, 0x9e, 0xe1, 0xd6, 0x3d, 0x79, 0x2d, + 0x24, 0xab, 0xf2, 0x0b, 0x52, 0xf3, 0xe0, 0x76, 0x14, 0xeb, 0xa7, 0xe7, 0xeb, 0x42, 0xb4, 0xe8, + 0xb9, 0x80, 0xa9, 0x20, 0xa8, 0x09, 0x4e, 0x01, 0x27, 0x1e, 0xca, 0x31, 0xdc, 0x78, 0x28, 0xc7, + 0xd0, 0xf0, 0x48, 0x8e, 0xf1, 0xc4, 0x23, 0x39, 0xc6, 0x0b, 0x8f, 0xe4, 0x18, 0x1f, 0x3c, 0x92, + 0x63, 0x5c, 0xf0, 0x45, 0x8e, 0x31, 0xca, 0x88, 0x84, 0x00, 0xb2, 0x86, 0x50, 0x11, 0x0c, 0x11, + 0x8c, 0x49, 0x6c, 0x60, 0x97, 0x1b, 0x03, 0x02, 0x00, 0x00, 0xff, 0xff, 0x4b, 0x78, 0x99, 0xee, + 0x61, 0x01, 0x00, 0x00, +} diff --git a/vendor/github.com/containerd/containerd/api/events/doc.go b/vendor/github.com/containerd/containerd/api/events/doc.go new file mode 100644 index 0000000000..354bef79fd --- /dev/null +++ b/vendor/github.com/containerd/containerd/api/events/doc.go @@ -0,0 +1,19 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +// Package events has protobuf types for various events that are used in +// containerd. +package events diff --git a/vendor/github.com/containerd/containerd/api/events/image.pb.go b/vendor/github.com/containerd/containerd/api/events/image.pb.go new file mode 100644 index 0000000000..8197005b6e --- /dev/null +++ b/vendor/github.com/containerd/containerd/api/events/image.pb.go @@ -0,0 +1,949 @@ +// Code generated by protoc-gen-gogo. DO NOT EDIT. +// source: github.com/containerd/containerd/api/events/image.proto + +package events + +import proto "github.com/gogo/protobuf/proto" +import fmt "fmt" +import math "math" + +// skipping weak import containerd_plugin "github.com/containerd/containerd/protobuf/plugin" + +import strings "strings" +import reflect "reflect" +import sortkeys "github.com/gogo/protobuf/sortkeys" + +import io "io" + +// Reference imports to suppress errors if they are not otherwise used. +var _ = proto.Marshal +var _ = fmt.Errorf +var _ = math.Inf + +type ImageCreate struct { + Name string `protobuf:"bytes,1,opt,name=name,proto3" json:"name,omitempty"` + Labels map[string]string `protobuf:"bytes,2,rep,name=labels" json:"labels,omitempty" protobuf_key:"bytes,1,opt,name=key,proto3" protobuf_val:"bytes,2,opt,name=value,proto3"` +} + +func (m *ImageCreate) Reset() { *m = ImageCreate{} } +func (*ImageCreate) ProtoMessage() {} +func (*ImageCreate) Descriptor() ([]byte, []int) { return fileDescriptorImage, []int{0} } + +type ImageUpdate struct { + Name string `protobuf:"bytes,1,opt,name=name,proto3" json:"name,omitempty"` + Labels map[string]string `protobuf:"bytes,2,rep,name=labels" json:"labels,omitempty" protobuf_key:"bytes,1,opt,name=key,proto3" protobuf_val:"bytes,2,opt,name=value,proto3"` +} + +func (m *ImageUpdate) Reset() { *m = ImageUpdate{} } +func (*ImageUpdate) ProtoMessage() {} +func (*ImageUpdate) Descriptor() ([]byte, []int) { return fileDescriptorImage, []int{1} } + +type ImageDelete struct { + Name string `protobuf:"bytes,1,opt,name=name,proto3" json:"name,omitempty"` +} + +func (m *ImageDelete) Reset() { *m = ImageDelete{} } +func (*ImageDelete) ProtoMessage() {} +func (*ImageDelete) Descriptor() ([]byte, []int) { return fileDescriptorImage, []int{2} } + +func init() { + proto.RegisterType((*ImageCreate)(nil), "containerd.services.images.v1.ImageCreate") + proto.RegisterType((*ImageUpdate)(nil), "containerd.services.images.v1.ImageUpdate") + proto.RegisterType((*ImageDelete)(nil), "containerd.services.images.v1.ImageDelete") +} + +// Field returns the value for the given fieldpath as a string, if defined. +// If the value is not defined, the second value will be false. +func (m *ImageCreate) Field(fieldpath []string) (string, bool) { + if len(fieldpath) == 0 { + return "", false + } + + switch fieldpath[0] { + case "name": + return string(m.Name), len(m.Name) > 0 + case "labels": + // Labels fields have been special-cased by name. If this breaks, + // add better special casing to fieldpath plugin. + if len(m.Labels) == 0 { + return "", false + } + value, ok := m.Labels[strings.Join(fieldpath[1:], ".")] + return value, ok + } + return "", false +} + +// Field returns the value for the given fieldpath as a string, if defined. +// If the value is not defined, the second value will be false. +func (m *ImageUpdate) Field(fieldpath []string) (string, bool) { + if len(fieldpath) == 0 { + return "", false + } + + switch fieldpath[0] { + case "name": + return string(m.Name), len(m.Name) > 0 + case "labels": + // Labels fields have been special-cased by name. If this breaks, + // add better special casing to fieldpath plugin. + if len(m.Labels) == 0 { + return "", false + } + value, ok := m.Labels[strings.Join(fieldpath[1:], ".")] + return value, ok + } + return "", false +} + +// Field returns the value for the given fieldpath as a string, if defined. +// If the value is not defined, the second value will be false. +func (m *ImageDelete) Field(fieldpath []string) (string, bool) { + if len(fieldpath) == 0 { + return "", false + } + + switch fieldpath[0] { + case "name": + return string(m.Name), len(m.Name) > 0 + } + return "", false +} +func (m *ImageCreate) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *ImageCreate) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.Name) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintImage(dAtA, i, uint64(len(m.Name))) + i += copy(dAtA[i:], m.Name) + } + if len(m.Labels) > 0 { + for k, _ := range m.Labels { + dAtA[i] = 0x12 + i++ + v := m.Labels[k] + mapSize := 1 + len(k) + sovImage(uint64(len(k))) + 1 + len(v) + sovImage(uint64(len(v))) + i = encodeVarintImage(dAtA, i, uint64(mapSize)) + dAtA[i] = 0xa + i++ + i = encodeVarintImage(dAtA, i, uint64(len(k))) + i += copy(dAtA[i:], k) + dAtA[i] = 0x12 + i++ + i = encodeVarintImage(dAtA, i, uint64(len(v))) + i += copy(dAtA[i:], v) + } + } + return i, nil +} + +func (m *ImageUpdate) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *ImageUpdate) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.Name) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintImage(dAtA, i, uint64(len(m.Name))) + i += copy(dAtA[i:], m.Name) + } + if len(m.Labels) > 0 { + for k, _ := range m.Labels { + dAtA[i] = 0x12 + i++ + v := m.Labels[k] + mapSize := 1 + len(k) + sovImage(uint64(len(k))) + 1 + len(v) + sovImage(uint64(len(v))) + i = encodeVarintImage(dAtA, i, uint64(mapSize)) + dAtA[i] = 0xa + i++ + i = encodeVarintImage(dAtA, i, uint64(len(k))) + i += copy(dAtA[i:], k) + dAtA[i] = 0x12 + i++ + i = encodeVarintImage(dAtA, i, uint64(len(v))) + i += copy(dAtA[i:], v) + } + } + return i, nil +} + +func (m *ImageDelete) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *ImageDelete) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.Name) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintImage(dAtA, i, uint64(len(m.Name))) + i += copy(dAtA[i:], m.Name) + } + return i, nil +} + +func encodeVarintImage(dAtA []byte, offset int, v uint64) int { + for v >= 1<<7 { + dAtA[offset] = uint8(v&0x7f | 0x80) + v >>= 7 + offset++ + } + dAtA[offset] = uint8(v) + return offset + 1 +} +func (m *ImageCreate) Size() (n int) { + var l int + _ = l + l = len(m.Name) + if l > 0 { + n += 1 + l + sovImage(uint64(l)) + } + if len(m.Labels) > 0 { + for k, v := range m.Labels { + _ = k + _ = v + mapEntrySize := 1 + len(k) + sovImage(uint64(len(k))) + 1 + len(v) + sovImage(uint64(len(v))) + n += mapEntrySize + 1 + sovImage(uint64(mapEntrySize)) + } + } + return n +} + +func (m *ImageUpdate) Size() (n int) { + var l int + _ = l + l = len(m.Name) + if l > 0 { + n += 1 + l + sovImage(uint64(l)) + } + if len(m.Labels) > 0 { + for k, v := range m.Labels { + _ = k + _ = v + mapEntrySize := 1 + len(k) + sovImage(uint64(len(k))) + 1 + len(v) + sovImage(uint64(len(v))) + n += mapEntrySize + 1 + sovImage(uint64(mapEntrySize)) + } + } + return n +} + +func (m *ImageDelete) Size() (n int) { + var l int + _ = l + l = len(m.Name) + if l > 0 { + n += 1 + l + sovImage(uint64(l)) + } + return n +} + +func sovImage(x uint64) (n int) { + for { + n++ + x >>= 7 + if x == 0 { + break + } + } + return n +} +func sozImage(x uint64) (n int) { + return sovImage(uint64((x << 1) ^ uint64((int64(x) >> 63)))) +} +func (this *ImageCreate) String() string { + if this == nil { + return "nil" + } + keysForLabels := make([]string, 0, len(this.Labels)) + for k, _ := range this.Labels { + keysForLabels = append(keysForLabels, k) + } + sortkeys.Strings(keysForLabels) + mapStringForLabels := "map[string]string{" + for _, k := range keysForLabels { + mapStringForLabels += fmt.Sprintf("%v: %v,", k, this.Labels[k]) + } + mapStringForLabels += "}" + s := strings.Join([]string{`&ImageCreate{`, + `Name:` + fmt.Sprintf("%v", this.Name) + `,`, + `Labels:` + mapStringForLabels + `,`, + `}`, + }, "") + return s +} +func (this *ImageUpdate) String() string { + if this == nil { + return "nil" + } + keysForLabels := make([]string, 0, len(this.Labels)) + for k, _ := range this.Labels { + keysForLabels = append(keysForLabels, k) + } + sortkeys.Strings(keysForLabels) + mapStringForLabels := "map[string]string{" + for _, k := range keysForLabels { + mapStringForLabels += fmt.Sprintf("%v: %v,", k, this.Labels[k]) + } + mapStringForLabels += "}" + s := strings.Join([]string{`&ImageUpdate{`, + `Name:` + fmt.Sprintf("%v", this.Name) + `,`, + `Labels:` + mapStringForLabels + `,`, + `}`, + }, "") + return s +} +func (this *ImageDelete) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&ImageDelete{`, + `Name:` + fmt.Sprintf("%v", this.Name) + `,`, + `}`, + }, "") + return s +} +func valueToStringImage(v interface{}) string { + rv := reflect.ValueOf(v) + if rv.IsNil() { + return "nil" + } + pv := reflect.Indirect(rv).Interface() + return fmt.Sprintf("*%v", pv) +} +func (m *ImageCreate) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowImage + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: ImageCreate: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: ImageCreate: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Name", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowImage + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthImage + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Name = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Labels", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowImage + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthImage + } + postIndex := iNdEx + msglen + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Labels == nil { + m.Labels = make(map[string]string) + } + var mapkey string + var mapvalue string + for iNdEx < postIndex { + entryPreIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowImage + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + if fieldNum == 1 { + var stringLenmapkey uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowImage + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLenmapkey |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLenmapkey := int(stringLenmapkey) + if intStringLenmapkey < 0 { + return ErrInvalidLengthImage + } + postStringIndexmapkey := iNdEx + intStringLenmapkey + if postStringIndexmapkey > l { + return io.ErrUnexpectedEOF + } + mapkey = string(dAtA[iNdEx:postStringIndexmapkey]) + iNdEx = postStringIndexmapkey + } else if fieldNum == 2 { + var stringLenmapvalue uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowImage + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLenmapvalue |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLenmapvalue := int(stringLenmapvalue) + if intStringLenmapvalue < 0 { + return ErrInvalidLengthImage + } + postStringIndexmapvalue := iNdEx + intStringLenmapvalue + if postStringIndexmapvalue > l { + return io.ErrUnexpectedEOF + } + mapvalue = string(dAtA[iNdEx:postStringIndexmapvalue]) + iNdEx = postStringIndexmapvalue + } else { + iNdEx = entryPreIndex + skippy, err := skipImage(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthImage + } + if (iNdEx + skippy) > postIndex { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + m.Labels[mapkey] = mapvalue + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipImage(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthImage + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *ImageUpdate) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowImage + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: ImageUpdate: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: ImageUpdate: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Name", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowImage + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthImage + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Name = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Labels", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowImage + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthImage + } + postIndex := iNdEx + msglen + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Labels == nil { + m.Labels = make(map[string]string) + } + var mapkey string + var mapvalue string + for iNdEx < postIndex { + entryPreIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowImage + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + if fieldNum == 1 { + var stringLenmapkey uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowImage + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLenmapkey |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLenmapkey := int(stringLenmapkey) + if intStringLenmapkey < 0 { + return ErrInvalidLengthImage + } + postStringIndexmapkey := iNdEx + intStringLenmapkey + if postStringIndexmapkey > l { + return io.ErrUnexpectedEOF + } + mapkey = string(dAtA[iNdEx:postStringIndexmapkey]) + iNdEx = postStringIndexmapkey + } else if fieldNum == 2 { + var stringLenmapvalue uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowImage + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLenmapvalue |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLenmapvalue := int(stringLenmapvalue) + if intStringLenmapvalue < 0 { + return ErrInvalidLengthImage + } + postStringIndexmapvalue := iNdEx + intStringLenmapvalue + if postStringIndexmapvalue > l { + return io.ErrUnexpectedEOF + } + mapvalue = string(dAtA[iNdEx:postStringIndexmapvalue]) + iNdEx = postStringIndexmapvalue + } else { + iNdEx = entryPreIndex + skippy, err := skipImage(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthImage + } + if (iNdEx + skippy) > postIndex { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + m.Labels[mapkey] = mapvalue + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipImage(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthImage + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *ImageDelete) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowImage + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: ImageDelete: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: ImageDelete: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Name", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowImage + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthImage + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Name = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipImage(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthImage + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func skipImage(dAtA []byte) (n int, err error) { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowImage + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + wireType := int(wire & 0x7) + switch wireType { + case 0: + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowImage + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + iNdEx++ + if dAtA[iNdEx-1] < 0x80 { + break + } + } + return iNdEx, nil + case 1: + iNdEx += 8 + return iNdEx, nil + case 2: + var length int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowImage + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + length |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + iNdEx += length + if length < 0 { + return 0, ErrInvalidLengthImage + } + return iNdEx, nil + case 3: + for { + var innerWire uint64 + var start int = iNdEx + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowImage + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + innerWire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + innerWireType := int(innerWire & 0x7) + if innerWireType == 4 { + break + } + next, err := skipImage(dAtA[start:]) + if err != nil { + return 0, err + } + iNdEx = start + next + } + return iNdEx, nil + case 4: + return iNdEx, nil + case 5: + iNdEx += 4 + return iNdEx, nil + default: + return 0, fmt.Errorf("proto: illegal wireType %d", wireType) + } + } + panic("unreachable") +} + +var ( + ErrInvalidLengthImage = fmt.Errorf("proto: negative length found during unmarshaling") + ErrIntOverflowImage = fmt.Errorf("proto: integer overflow") +) + +func init() { + proto.RegisterFile("github.com/containerd/containerd/api/events/image.proto", fileDescriptorImage) +} + +var fileDescriptorImage = []byte{ + // 292 bytes of a gzipped FileDescriptorProto + 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0xe2, 0x32, 0x4f, 0xcf, 0x2c, 0xc9, + 0x28, 0x4d, 0xd2, 0x4b, 0xce, 0xcf, 0xd5, 0x4f, 0xce, 0xcf, 0x2b, 0x49, 0xcc, 0xcc, 0x4b, 0x2d, + 0x4a, 0x41, 0x66, 0x26, 0x16, 0x64, 0xea, 0xa7, 0x96, 0xa5, 0xe6, 0x95, 0x14, 0xeb, 0x67, 0xe6, + 0x26, 0xa6, 0xa7, 0xea, 0x15, 0x14, 0xe5, 0x97, 0xe4, 0x0b, 0xc9, 0x22, 0x94, 0xe8, 0x15, 0xa7, + 0x16, 0x95, 0x65, 0x26, 0xa7, 0x16, 0xeb, 0x81, 0x15, 0x14, 0xeb, 0x95, 0x19, 0x4a, 0x39, 0x10, + 0x34, 0x17, 0x6c, 0x4c, 0x52, 0x69, 0x9a, 0x7e, 0x41, 0x4e, 0x69, 0x7a, 0x66, 0x9e, 0x7e, 0x5a, + 0x66, 0x6a, 0x4e, 0x4a, 0x41, 0x62, 0x49, 0x06, 0xc4, 0x02, 0xa5, 0x35, 0x8c, 0x5c, 0xdc, 0x9e, + 0x20, 0xf3, 0x9c, 0x8b, 0x52, 0x13, 0x4b, 0x52, 0x85, 0x84, 0xb8, 0x58, 0xf2, 0x12, 0x73, 0x53, + 0x25, 0x18, 0x15, 0x18, 0x35, 0x38, 0x83, 0xc0, 0x6c, 0x21, 0x3f, 0x2e, 0xb6, 0x9c, 0xc4, 0xa4, + 0xd4, 0x9c, 0x62, 0x09, 0x26, 0x05, 0x66, 0x0d, 0x6e, 0x23, 0x33, 0x3d, 0xbc, 0xae, 0xd2, 0x43, + 0x32, 0x4f, 0xcf, 0x07, 0xac, 0xd1, 0x35, 0xaf, 0xa4, 0xa8, 0x32, 0x08, 0x6a, 0x8a, 0x94, 0x25, + 0x17, 0x37, 0x92, 0xb0, 0x90, 0x00, 0x17, 0x73, 0x76, 0x6a, 0x25, 0xd4, 0x46, 0x10, 0x53, 0x48, + 0x84, 0x8b, 0xb5, 0x2c, 0x31, 0xa7, 0x34, 0x55, 0x82, 0x09, 0x2c, 0x06, 0xe1, 0x58, 0x31, 0x59, + 0x30, 0x22, 0x9c, 0x1b, 0x5a, 0x90, 0x42, 0x55, 0xe7, 0x42, 0xcc, 0xa3, 0xb6, 0x73, 0x15, 0xa1, + 0xae, 0x75, 0x49, 0xcd, 0x49, 0xc5, 0xee, 0x5a, 0xa7, 0x80, 0x13, 0x0f, 0xe5, 0x18, 0x6e, 0x3c, + 0x94, 0x63, 0x68, 0x78, 0x24, 0xc7, 0x78, 0xe2, 0x91, 0x1c, 0xe3, 0x85, 0x47, 0x72, 0x8c, 0x0f, + 0x1e, 0xc9, 0x31, 0x2e, 0xf8, 0x22, 0xc7, 0x18, 0x65, 0x44, 0x42, 0xc2, 0xb1, 0x86, 0x50, 0x11, + 0x0c, 0x49, 0x6c, 0xe0, 0xb8, 0x35, 0x06, 0x04, 0x00, 0x00, 0xff, 0xff, 0x41, 0x80, 0x92, 0x17, + 0x77, 0x02, 0x00, 0x00, +} diff --git a/vendor/github.com/containerd/containerd/api/events/namespace.pb.go b/vendor/github.com/containerd/containerd/api/events/namespace.pb.go new file mode 100644 index 0000000000..1c81f9fc44 --- /dev/null +++ b/vendor/github.com/containerd/containerd/api/events/namespace.pb.go @@ -0,0 +1,950 @@ +// Code generated by protoc-gen-gogo. DO NOT EDIT. +// source: github.com/containerd/containerd/api/events/namespace.proto + +package events + +import proto "github.com/gogo/protobuf/proto" +import fmt "fmt" +import math "math" + +// skipping weak import gogoproto "github.com/gogo/protobuf/gogoproto" +// skipping weak import containerd_plugin "github.com/containerd/containerd/protobuf/plugin" + +import strings "strings" +import reflect "reflect" +import sortkeys "github.com/gogo/protobuf/sortkeys" + +import io "io" + +// Reference imports to suppress errors if they are not otherwise used. +var _ = proto.Marshal +var _ = fmt.Errorf +var _ = math.Inf + +type NamespaceCreate struct { + Name string `protobuf:"bytes,1,opt,name=name,proto3" json:"name,omitempty"` + Labels map[string]string `protobuf:"bytes,2,rep,name=labels" json:"labels,omitempty" protobuf_key:"bytes,1,opt,name=key,proto3" protobuf_val:"bytes,2,opt,name=value,proto3"` +} + +func (m *NamespaceCreate) Reset() { *m = NamespaceCreate{} } +func (*NamespaceCreate) ProtoMessage() {} +func (*NamespaceCreate) Descriptor() ([]byte, []int) { return fileDescriptorNamespace, []int{0} } + +type NamespaceUpdate struct { + Name string `protobuf:"bytes,1,opt,name=name,proto3" json:"name,omitempty"` + Labels map[string]string `protobuf:"bytes,2,rep,name=labels" json:"labels,omitempty" protobuf_key:"bytes,1,opt,name=key,proto3" protobuf_val:"bytes,2,opt,name=value,proto3"` +} + +func (m *NamespaceUpdate) Reset() { *m = NamespaceUpdate{} } +func (*NamespaceUpdate) ProtoMessage() {} +func (*NamespaceUpdate) Descriptor() ([]byte, []int) { return fileDescriptorNamespace, []int{1} } + +type NamespaceDelete struct { + Name string `protobuf:"bytes,1,opt,name=name,proto3" json:"name,omitempty"` +} + +func (m *NamespaceDelete) Reset() { *m = NamespaceDelete{} } +func (*NamespaceDelete) ProtoMessage() {} +func (*NamespaceDelete) Descriptor() ([]byte, []int) { return fileDescriptorNamespace, []int{2} } + +func init() { + proto.RegisterType((*NamespaceCreate)(nil), "containerd.events.NamespaceCreate") + proto.RegisterType((*NamespaceUpdate)(nil), "containerd.events.NamespaceUpdate") + proto.RegisterType((*NamespaceDelete)(nil), "containerd.events.NamespaceDelete") +} + +// Field returns the value for the given fieldpath as a string, if defined. +// If the value is not defined, the second value will be false. +func (m *NamespaceCreate) Field(fieldpath []string) (string, bool) { + if len(fieldpath) == 0 { + return "", false + } + + switch fieldpath[0] { + case "name": + return string(m.Name), len(m.Name) > 0 + case "labels": + // Labels fields have been special-cased by name. If this breaks, + // add better special casing to fieldpath plugin. + if len(m.Labels) == 0 { + return "", false + } + value, ok := m.Labels[strings.Join(fieldpath[1:], ".")] + return value, ok + } + return "", false +} + +// Field returns the value for the given fieldpath as a string, if defined. +// If the value is not defined, the second value will be false. +func (m *NamespaceUpdate) Field(fieldpath []string) (string, bool) { + if len(fieldpath) == 0 { + return "", false + } + + switch fieldpath[0] { + case "name": + return string(m.Name), len(m.Name) > 0 + case "labels": + // Labels fields have been special-cased by name. If this breaks, + // add better special casing to fieldpath plugin. + if len(m.Labels) == 0 { + return "", false + } + value, ok := m.Labels[strings.Join(fieldpath[1:], ".")] + return value, ok + } + return "", false +} + +// Field returns the value for the given fieldpath as a string, if defined. +// If the value is not defined, the second value will be false. +func (m *NamespaceDelete) Field(fieldpath []string) (string, bool) { + if len(fieldpath) == 0 { + return "", false + } + + switch fieldpath[0] { + case "name": + return string(m.Name), len(m.Name) > 0 + } + return "", false +} +func (m *NamespaceCreate) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *NamespaceCreate) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.Name) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintNamespace(dAtA, i, uint64(len(m.Name))) + i += copy(dAtA[i:], m.Name) + } + if len(m.Labels) > 0 { + for k, _ := range m.Labels { + dAtA[i] = 0x12 + i++ + v := m.Labels[k] + mapSize := 1 + len(k) + sovNamespace(uint64(len(k))) + 1 + len(v) + sovNamespace(uint64(len(v))) + i = encodeVarintNamespace(dAtA, i, uint64(mapSize)) + dAtA[i] = 0xa + i++ + i = encodeVarintNamespace(dAtA, i, uint64(len(k))) + i += copy(dAtA[i:], k) + dAtA[i] = 0x12 + i++ + i = encodeVarintNamespace(dAtA, i, uint64(len(v))) + i += copy(dAtA[i:], v) + } + } + return i, nil +} + +func (m *NamespaceUpdate) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *NamespaceUpdate) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.Name) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintNamespace(dAtA, i, uint64(len(m.Name))) + i += copy(dAtA[i:], m.Name) + } + if len(m.Labels) > 0 { + for k, _ := range m.Labels { + dAtA[i] = 0x12 + i++ + v := m.Labels[k] + mapSize := 1 + len(k) + sovNamespace(uint64(len(k))) + 1 + len(v) + sovNamespace(uint64(len(v))) + i = encodeVarintNamespace(dAtA, i, uint64(mapSize)) + dAtA[i] = 0xa + i++ + i = encodeVarintNamespace(dAtA, i, uint64(len(k))) + i += copy(dAtA[i:], k) + dAtA[i] = 0x12 + i++ + i = encodeVarintNamespace(dAtA, i, uint64(len(v))) + i += copy(dAtA[i:], v) + } + } + return i, nil +} + +func (m *NamespaceDelete) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *NamespaceDelete) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.Name) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintNamespace(dAtA, i, uint64(len(m.Name))) + i += copy(dAtA[i:], m.Name) + } + return i, nil +} + +func encodeVarintNamespace(dAtA []byte, offset int, v uint64) int { + for v >= 1<<7 { + dAtA[offset] = uint8(v&0x7f | 0x80) + v >>= 7 + offset++ + } + dAtA[offset] = uint8(v) + return offset + 1 +} +func (m *NamespaceCreate) Size() (n int) { + var l int + _ = l + l = len(m.Name) + if l > 0 { + n += 1 + l + sovNamespace(uint64(l)) + } + if len(m.Labels) > 0 { + for k, v := range m.Labels { + _ = k + _ = v + mapEntrySize := 1 + len(k) + sovNamespace(uint64(len(k))) + 1 + len(v) + sovNamespace(uint64(len(v))) + n += mapEntrySize + 1 + sovNamespace(uint64(mapEntrySize)) + } + } + return n +} + +func (m *NamespaceUpdate) Size() (n int) { + var l int + _ = l + l = len(m.Name) + if l > 0 { + n += 1 + l + sovNamespace(uint64(l)) + } + if len(m.Labels) > 0 { + for k, v := range m.Labels { + _ = k + _ = v + mapEntrySize := 1 + len(k) + sovNamespace(uint64(len(k))) + 1 + len(v) + sovNamespace(uint64(len(v))) + n += mapEntrySize + 1 + sovNamespace(uint64(mapEntrySize)) + } + } + return n +} + +func (m *NamespaceDelete) Size() (n int) { + var l int + _ = l + l = len(m.Name) + if l > 0 { + n += 1 + l + sovNamespace(uint64(l)) + } + return n +} + +func sovNamespace(x uint64) (n int) { + for { + n++ + x >>= 7 + if x == 0 { + break + } + } + return n +} +func sozNamespace(x uint64) (n int) { + return sovNamespace(uint64((x << 1) ^ uint64((int64(x) >> 63)))) +} +func (this *NamespaceCreate) String() string { + if this == nil { + return "nil" + } + keysForLabels := make([]string, 0, len(this.Labels)) + for k, _ := range this.Labels { + keysForLabels = append(keysForLabels, k) + } + sortkeys.Strings(keysForLabels) + mapStringForLabels := "map[string]string{" + for _, k := range keysForLabels { + mapStringForLabels += fmt.Sprintf("%v: %v,", k, this.Labels[k]) + } + mapStringForLabels += "}" + s := strings.Join([]string{`&NamespaceCreate{`, + `Name:` + fmt.Sprintf("%v", this.Name) + `,`, + `Labels:` + mapStringForLabels + `,`, + `}`, + }, "") + return s +} +func (this *NamespaceUpdate) String() string { + if this == nil { + return "nil" + } + keysForLabels := make([]string, 0, len(this.Labels)) + for k, _ := range this.Labels { + keysForLabels = append(keysForLabels, k) + } + sortkeys.Strings(keysForLabels) + mapStringForLabels := "map[string]string{" + for _, k := range keysForLabels { + mapStringForLabels += fmt.Sprintf("%v: %v,", k, this.Labels[k]) + } + mapStringForLabels += "}" + s := strings.Join([]string{`&NamespaceUpdate{`, + `Name:` + fmt.Sprintf("%v", this.Name) + `,`, + `Labels:` + mapStringForLabels + `,`, + `}`, + }, "") + return s +} +func (this *NamespaceDelete) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&NamespaceDelete{`, + `Name:` + fmt.Sprintf("%v", this.Name) + `,`, + `}`, + }, "") + return s +} +func valueToStringNamespace(v interface{}) string { + rv := reflect.ValueOf(v) + if rv.IsNil() { + return "nil" + } + pv := reflect.Indirect(rv).Interface() + return fmt.Sprintf("*%v", pv) +} +func (m *NamespaceCreate) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowNamespace + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: NamespaceCreate: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: NamespaceCreate: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Name", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowNamespace + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthNamespace + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Name = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Labels", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowNamespace + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthNamespace + } + postIndex := iNdEx + msglen + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Labels == nil { + m.Labels = make(map[string]string) + } + var mapkey string + var mapvalue string + for iNdEx < postIndex { + entryPreIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowNamespace + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + if fieldNum == 1 { + var stringLenmapkey uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowNamespace + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLenmapkey |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLenmapkey := int(stringLenmapkey) + if intStringLenmapkey < 0 { + return ErrInvalidLengthNamespace + } + postStringIndexmapkey := iNdEx + intStringLenmapkey + if postStringIndexmapkey > l { + return io.ErrUnexpectedEOF + } + mapkey = string(dAtA[iNdEx:postStringIndexmapkey]) + iNdEx = postStringIndexmapkey + } else if fieldNum == 2 { + var stringLenmapvalue uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowNamespace + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLenmapvalue |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLenmapvalue := int(stringLenmapvalue) + if intStringLenmapvalue < 0 { + return ErrInvalidLengthNamespace + } + postStringIndexmapvalue := iNdEx + intStringLenmapvalue + if postStringIndexmapvalue > l { + return io.ErrUnexpectedEOF + } + mapvalue = string(dAtA[iNdEx:postStringIndexmapvalue]) + iNdEx = postStringIndexmapvalue + } else { + iNdEx = entryPreIndex + skippy, err := skipNamespace(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthNamespace + } + if (iNdEx + skippy) > postIndex { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + m.Labels[mapkey] = mapvalue + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipNamespace(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthNamespace + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *NamespaceUpdate) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowNamespace + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: NamespaceUpdate: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: NamespaceUpdate: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Name", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowNamespace + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthNamespace + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Name = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Labels", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowNamespace + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthNamespace + } + postIndex := iNdEx + msglen + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Labels == nil { + m.Labels = make(map[string]string) + } + var mapkey string + var mapvalue string + for iNdEx < postIndex { + entryPreIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowNamespace + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + if fieldNum == 1 { + var stringLenmapkey uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowNamespace + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLenmapkey |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLenmapkey := int(stringLenmapkey) + if intStringLenmapkey < 0 { + return ErrInvalidLengthNamespace + } + postStringIndexmapkey := iNdEx + intStringLenmapkey + if postStringIndexmapkey > l { + return io.ErrUnexpectedEOF + } + mapkey = string(dAtA[iNdEx:postStringIndexmapkey]) + iNdEx = postStringIndexmapkey + } else if fieldNum == 2 { + var stringLenmapvalue uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowNamespace + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLenmapvalue |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLenmapvalue := int(stringLenmapvalue) + if intStringLenmapvalue < 0 { + return ErrInvalidLengthNamespace + } + postStringIndexmapvalue := iNdEx + intStringLenmapvalue + if postStringIndexmapvalue > l { + return io.ErrUnexpectedEOF + } + mapvalue = string(dAtA[iNdEx:postStringIndexmapvalue]) + iNdEx = postStringIndexmapvalue + } else { + iNdEx = entryPreIndex + skippy, err := skipNamespace(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthNamespace + } + if (iNdEx + skippy) > postIndex { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + m.Labels[mapkey] = mapvalue + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipNamespace(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthNamespace + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *NamespaceDelete) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowNamespace + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: NamespaceDelete: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: NamespaceDelete: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Name", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowNamespace + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthNamespace + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Name = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipNamespace(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthNamespace + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func skipNamespace(dAtA []byte) (n int, err error) { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowNamespace + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + wireType := int(wire & 0x7) + switch wireType { + case 0: + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowNamespace + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + iNdEx++ + if dAtA[iNdEx-1] < 0x80 { + break + } + } + return iNdEx, nil + case 1: + iNdEx += 8 + return iNdEx, nil + case 2: + var length int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowNamespace + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + length |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + iNdEx += length + if length < 0 { + return 0, ErrInvalidLengthNamespace + } + return iNdEx, nil + case 3: + for { + var innerWire uint64 + var start int = iNdEx + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowNamespace + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + innerWire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + innerWireType := int(innerWire & 0x7) + if innerWireType == 4 { + break + } + next, err := skipNamespace(dAtA[start:]) + if err != nil { + return 0, err + } + iNdEx = start + next + } + return iNdEx, nil + case 4: + return iNdEx, nil + case 5: + iNdEx += 4 + return iNdEx, nil + default: + return 0, fmt.Errorf("proto: illegal wireType %d", wireType) + } + } + panic("unreachable") +} + +var ( + ErrInvalidLengthNamespace = fmt.Errorf("proto: negative length found during unmarshaling") + ErrIntOverflowNamespace = fmt.Errorf("proto: integer overflow") +) + +func init() { + proto.RegisterFile("github.com/containerd/containerd/api/events/namespace.proto", fileDescriptorNamespace) +} + +var fileDescriptorNamespace = []byte{ + // 296 bytes of a gzipped FileDescriptorProto + 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0xe2, 0xb2, 0x4e, 0xcf, 0x2c, 0xc9, + 0x28, 0x4d, 0xd2, 0x4b, 0xce, 0xcf, 0xd5, 0x4f, 0xce, 0xcf, 0x2b, 0x49, 0xcc, 0xcc, 0x4b, 0x2d, + 0x4a, 0x41, 0x66, 0x26, 0x16, 0x64, 0xea, 0xa7, 0x96, 0xa5, 0xe6, 0x95, 0x14, 0xeb, 0xe7, 0x25, + 0xe6, 0xa6, 0x16, 0x17, 0x24, 0x26, 0xa7, 0xea, 0x15, 0x14, 0xe5, 0x97, 0xe4, 0x0b, 0x09, 0x22, + 0x94, 0xe9, 0x41, 0x94, 0x48, 0x89, 0xa4, 0xe7, 0xa7, 0xe7, 0x83, 0x65, 0xf5, 0x41, 0x2c, 0x88, + 0x42, 0x29, 0x07, 0x82, 0xb6, 0x80, 0xd5, 0x25, 0x95, 0xa6, 0xe9, 0x17, 0xe4, 0x94, 0xa6, 0x67, + 0xe6, 0xe9, 0xa7, 0x65, 0xa6, 0xe6, 0xa4, 0x14, 0x24, 0x96, 0x64, 0x40, 0x4c, 0x50, 0x5a, 0xc1, + 0xc8, 0xc5, 0xef, 0x07, 0xb3, 0xde, 0xb9, 0x28, 0x35, 0xb1, 0x24, 0x55, 0x48, 0x88, 0x8b, 0x05, + 0xe4, 0x22, 0x09, 0x46, 0x05, 0x46, 0x0d, 0xce, 0x20, 0x30, 0x5b, 0xc8, 0x8d, 0x8b, 0x2d, 0x27, + 0x31, 0x29, 0x35, 0xa7, 0x58, 0x82, 0x49, 0x81, 0x59, 0x83, 0xdb, 0x48, 0x4f, 0x0f, 0xc3, 0x8d, + 0x7a, 0x68, 0xe6, 0xe8, 0xf9, 0x80, 0x35, 0xb8, 0xe6, 0x95, 0x14, 0x55, 0x06, 0x41, 0x75, 0x4b, + 0x59, 0x72, 0x71, 0x23, 0x09, 0x0b, 0x09, 0x70, 0x31, 0x67, 0xa7, 0x56, 0x42, 0x6d, 0x02, 0x31, + 0x85, 0x44, 0xb8, 0x58, 0xcb, 0x12, 0x73, 0x4a, 0x53, 0x25, 0x98, 0xc0, 0x62, 0x10, 0x8e, 0x15, + 0x93, 0x05, 0x23, 0xaa, 0x53, 0x43, 0x0b, 0x52, 0xa8, 0xe2, 0x54, 0x88, 0x39, 0xd4, 0x76, 0xaa, + 0x2a, 0x92, 0x4b, 0x5d, 0x52, 0x73, 0x52, 0xb1, 0xbb, 0xd4, 0x29, 0xe0, 0xc4, 0x43, 0x39, 0x86, + 0x1b, 0x0f, 0xe5, 0x18, 0x1a, 0x1e, 0xc9, 0x31, 0x9e, 0x78, 0x24, 0xc7, 0x78, 0xe1, 0x91, 0x1c, + 0xe3, 0x83, 0x47, 0x72, 0x8c, 0x0b, 0xbe, 0xc8, 0x31, 0x46, 0x19, 0x91, 0x90, 0x84, 0xac, 0x21, + 0x54, 0x04, 0x43, 0x04, 0x63, 0x12, 0x1b, 0x38, 0x66, 0x8d, 0x01, 0x01, 0x00, 0x00, 0xff, 0xff, + 0x00, 0x50, 0x87, 0x59, 0x83, 0x02, 0x00, 0x00, +} diff --git a/vendor/github.com/containerd/containerd/api/events/snapshot.pb.go b/vendor/github.com/containerd/containerd/api/events/snapshot.pb.go new file mode 100644 index 0000000000..e1f8f5c588 --- /dev/null +++ b/vendor/github.com/containerd/containerd/api/events/snapshot.pb.go @@ -0,0 +1,704 @@ +// Code generated by protoc-gen-gogo. DO NOT EDIT. +// source: github.com/containerd/containerd/api/events/snapshot.proto + +package events + +import proto "github.com/gogo/protobuf/proto" +import fmt "fmt" +import math "math" + +// skipping weak import containerd_plugin "github.com/containerd/containerd/protobuf/plugin" + +import strings "strings" +import reflect "reflect" + +import io "io" + +// Reference imports to suppress errors if they are not otherwise used. +var _ = proto.Marshal +var _ = fmt.Errorf +var _ = math.Inf + +type SnapshotPrepare struct { + Key string `protobuf:"bytes,1,opt,name=key,proto3" json:"key,omitempty"` + Parent string `protobuf:"bytes,2,opt,name=parent,proto3" json:"parent,omitempty"` +} + +func (m *SnapshotPrepare) Reset() { *m = SnapshotPrepare{} } +func (*SnapshotPrepare) ProtoMessage() {} +func (*SnapshotPrepare) Descriptor() ([]byte, []int) { return fileDescriptorSnapshot, []int{0} } + +type SnapshotCommit struct { + Key string `protobuf:"bytes,1,opt,name=key,proto3" json:"key,omitempty"` + Name string `protobuf:"bytes,2,opt,name=name,proto3" json:"name,omitempty"` +} + +func (m *SnapshotCommit) Reset() { *m = SnapshotCommit{} } +func (*SnapshotCommit) ProtoMessage() {} +func (*SnapshotCommit) Descriptor() ([]byte, []int) { return fileDescriptorSnapshot, []int{1} } + +type SnapshotRemove struct { + Key string `protobuf:"bytes,1,opt,name=key,proto3" json:"key,omitempty"` +} + +func (m *SnapshotRemove) Reset() { *m = SnapshotRemove{} } +func (*SnapshotRemove) ProtoMessage() {} +func (*SnapshotRemove) Descriptor() ([]byte, []int) { return fileDescriptorSnapshot, []int{2} } + +func init() { + proto.RegisterType((*SnapshotPrepare)(nil), "containerd.events.SnapshotPrepare") + proto.RegisterType((*SnapshotCommit)(nil), "containerd.events.SnapshotCommit") + proto.RegisterType((*SnapshotRemove)(nil), "containerd.events.SnapshotRemove") +} + +// Field returns the value for the given fieldpath as a string, if defined. +// If the value is not defined, the second value will be false. +func (m *SnapshotPrepare) Field(fieldpath []string) (string, bool) { + if len(fieldpath) == 0 { + return "", false + } + + switch fieldpath[0] { + case "key": + return string(m.Key), len(m.Key) > 0 + case "parent": + return string(m.Parent), len(m.Parent) > 0 + } + return "", false +} + +// Field returns the value for the given fieldpath as a string, if defined. +// If the value is not defined, the second value will be false. +func (m *SnapshotCommit) Field(fieldpath []string) (string, bool) { + if len(fieldpath) == 0 { + return "", false + } + + switch fieldpath[0] { + case "key": + return string(m.Key), len(m.Key) > 0 + case "name": + return string(m.Name), len(m.Name) > 0 + } + return "", false +} + +// Field returns the value for the given fieldpath as a string, if defined. +// If the value is not defined, the second value will be false. +func (m *SnapshotRemove) Field(fieldpath []string) (string, bool) { + if len(fieldpath) == 0 { + return "", false + } + + switch fieldpath[0] { + case "key": + return string(m.Key), len(m.Key) > 0 + } + return "", false +} +func (m *SnapshotPrepare) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *SnapshotPrepare) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.Key) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintSnapshot(dAtA, i, uint64(len(m.Key))) + i += copy(dAtA[i:], m.Key) + } + if len(m.Parent) > 0 { + dAtA[i] = 0x12 + i++ + i = encodeVarintSnapshot(dAtA, i, uint64(len(m.Parent))) + i += copy(dAtA[i:], m.Parent) + } + return i, nil +} + +func (m *SnapshotCommit) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *SnapshotCommit) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.Key) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintSnapshot(dAtA, i, uint64(len(m.Key))) + i += copy(dAtA[i:], m.Key) + } + if len(m.Name) > 0 { + dAtA[i] = 0x12 + i++ + i = encodeVarintSnapshot(dAtA, i, uint64(len(m.Name))) + i += copy(dAtA[i:], m.Name) + } + return i, nil +} + +func (m *SnapshotRemove) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *SnapshotRemove) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.Key) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintSnapshot(dAtA, i, uint64(len(m.Key))) + i += copy(dAtA[i:], m.Key) + } + return i, nil +} + +func encodeVarintSnapshot(dAtA []byte, offset int, v uint64) int { + for v >= 1<<7 { + dAtA[offset] = uint8(v&0x7f | 0x80) + v >>= 7 + offset++ + } + dAtA[offset] = uint8(v) + return offset + 1 +} +func (m *SnapshotPrepare) Size() (n int) { + var l int + _ = l + l = len(m.Key) + if l > 0 { + n += 1 + l + sovSnapshot(uint64(l)) + } + l = len(m.Parent) + if l > 0 { + n += 1 + l + sovSnapshot(uint64(l)) + } + return n +} + +func (m *SnapshotCommit) Size() (n int) { + var l int + _ = l + l = len(m.Key) + if l > 0 { + n += 1 + l + sovSnapshot(uint64(l)) + } + l = len(m.Name) + if l > 0 { + n += 1 + l + sovSnapshot(uint64(l)) + } + return n +} + +func (m *SnapshotRemove) Size() (n int) { + var l int + _ = l + l = len(m.Key) + if l > 0 { + n += 1 + l + sovSnapshot(uint64(l)) + } + return n +} + +func sovSnapshot(x uint64) (n int) { + for { + n++ + x >>= 7 + if x == 0 { + break + } + } + return n +} +func sozSnapshot(x uint64) (n int) { + return sovSnapshot(uint64((x << 1) ^ uint64((int64(x) >> 63)))) +} +func (this *SnapshotPrepare) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&SnapshotPrepare{`, + `Key:` + fmt.Sprintf("%v", this.Key) + `,`, + `Parent:` + fmt.Sprintf("%v", this.Parent) + `,`, + `}`, + }, "") + return s +} +func (this *SnapshotCommit) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&SnapshotCommit{`, + `Key:` + fmt.Sprintf("%v", this.Key) + `,`, + `Name:` + fmt.Sprintf("%v", this.Name) + `,`, + `}`, + }, "") + return s +} +func (this *SnapshotRemove) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&SnapshotRemove{`, + `Key:` + fmt.Sprintf("%v", this.Key) + `,`, + `}`, + }, "") + return s +} +func valueToStringSnapshot(v interface{}) string { + rv := reflect.ValueOf(v) + if rv.IsNil() { + return "nil" + } + pv := reflect.Indirect(rv).Interface() + return fmt.Sprintf("*%v", pv) +} +func (m *SnapshotPrepare) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowSnapshot + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: SnapshotPrepare: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: SnapshotPrepare: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Key", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowSnapshot + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthSnapshot + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Key = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Parent", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowSnapshot + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthSnapshot + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Parent = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipSnapshot(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthSnapshot + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *SnapshotCommit) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowSnapshot + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: SnapshotCommit: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: SnapshotCommit: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Key", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowSnapshot + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthSnapshot + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Key = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Name", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowSnapshot + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthSnapshot + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Name = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipSnapshot(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthSnapshot + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *SnapshotRemove) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowSnapshot + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: SnapshotRemove: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: SnapshotRemove: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Key", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowSnapshot + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthSnapshot + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Key = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipSnapshot(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthSnapshot + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func skipSnapshot(dAtA []byte) (n int, err error) { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowSnapshot + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + wireType := int(wire & 0x7) + switch wireType { + case 0: + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowSnapshot + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + iNdEx++ + if dAtA[iNdEx-1] < 0x80 { + break + } + } + return iNdEx, nil + case 1: + iNdEx += 8 + return iNdEx, nil + case 2: + var length int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowSnapshot + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + length |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + iNdEx += length + if length < 0 { + return 0, ErrInvalidLengthSnapshot + } + return iNdEx, nil + case 3: + for { + var innerWire uint64 + var start int = iNdEx + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowSnapshot + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + innerWire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + innerWireType := int(innerWire & 0x7) + if innerWireType == 4 { + break + } + next, err := skipSnapshot(dAtA[start:]) + if err != nil { + return 0, err + } + iNdEx = start + next + } + return iNdEx, nil + case 4: + return iNdEx, nil + case 5: + iNdEx += 4 + return iNdEx, nil + default: + return 0, fmt.Errorf("proto: illegal wireType %d", wireType) + } + } + panic("unreachable") +} + +var ( + ErrInvalidLengthSnapshot = fmt.Errorf("proto: negative length found during unmarshaling") + ErrIntOverflowSnapshot = fmt.Errorf("proto: integer overflow") +) + +func init() { + proto.RegisterFile("github.com/containerd/containerd/api/events/snapshot.proto", fileDescriptorSnapshot) +} + +var fileDescriptorSnapshot = []byte{ + // 235 bytes of a gzipped FileDescriptorProto + 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0xe2, 0xb2, 0x4a, 0xcf, 0x2c, 0xc9, + 0x28, 0x4d, 0xd2, 0x4b, 0xce, 0xcf, 0xd5, 0x4f, 0xce, 0xcf, 0x2b, 0x49, 0xcc, 0xcc, 0x4b, 0x2d, + 0x4a, 0x41, 0x66, 0x26, 0x16, 0x64, 0xea, 0xa7, 0x96, 0xa5, 0xe6, 0x95, 0x14, 0xeb, 0x17, 0xe7, + 0x25, 0x16, 0x14, 0x67, 0xe4, 0x97, 0xe8, 0x15, 0x14, 0xe5, 0x97, 0xe4, 0x0b, 0x09, 0x22, 0x54, + 0xe9, 0x41, 0x54, 0x48, 0x39, 0x10, 0x34, 0x0e, 0xac, 0x35, 0xa9, 0x34, 0x4d, 0xbf, 0x20, 0xa7, + 0x34, 0x3d, 0x33, 0x4f, 0x3f, 0x2d, 0x33, 0x35, 0x27, 0xa5, 0x20, 0xb1, 0x24, 0x03, 0x62, 0xa8, + 0x92, 0x35, 0x17, 0x7f, 0x30, 0xd4, 0x9a, 0x80, 0xa2, 0xd4, 0x82, 0xc4, 0xa2, 0x54, 0x21, 0x01, + 0x2e, 0xe6, 0xec, 0xd4, 0x4a, 0x09, 0x46, 0x05, 0x46, 0x0d, 0xce, 0x20, 0x10, 0x53, 0x48, 0x8c, + 0x8b, 0x0d, 0x24, 0x93, 0x57, 0x22, 0xc1, 0x04, 0x16, 0x84, 0xf2, 0x94, 0xcc, 0xb8, 0xf8, 0x60, + 0x9a, 0x9d, 0xf3, 0x73, 0x73, 0x33, 0x4b, 0xb0, 0xe8, 0x15, 0xe2, 0x62, 0xc9, 0x4b, 0xcc, 0x4d, + 0x85, 0xea, 0x04, 0xb3, 0x95, 0x94, 0x10, 0xfa, 0x82, 0x52, 0x73, 0xf3, 0xcb, 0xb0, 0xd8, 0xe9, + 0x14, 0x70, 0xe2, 0xa1, 0x1c, 0xc3, 0x8d, 0x87, 0x72, 0x0c, 0x0d, 0x8f, 0xe4, 0x18, 0x4f, 0x3c, + 0x92, 0x63, 0xbc, 0xf0, 0x48, 0x8e, 0xf1, 0xc1, 0x23, 0x39, 0xc6, 0x05, 0x5f, 0xe4, 0x18, 0xa3, + 0x8c, 0x48, 0x08, 0x47, 0x6b, 0x08, 0x15, 0xc1, 0x90, 0xc4, 0x06, 0xf6, 0xb3, 0x31, 0x20, 0x00, + 0x00, 0xff, 0xff, 0x69, 0x66, 0xa9, 0x2a, 0x86, 0x01, 0x00, 0x00, +} diff --git a/vendor/github.com/containerd/containerd/api/events/task.pb.go b/vendor/github.com/containerd/containerd/api/events/task.pb.go new file mode 100644 index 0000000000..b0a6c2c242 --- /dev/null +++ b/vendor/github.com/containerd/containerd/api/events/task.pb.go @@ -0,0 +1,2610 @@ +// Code generated by protoc-gen-gogo. DO NOT EDIT. +// source: github.com/containerd/containerd/api/events/task.proto + +package events + +import proto "github.com/gogo/protobuf/proto" +import fmt "fmt" +import math "math" + +// skipping weak import gogoproto "github.com/gogo/protobuf/gogoproto" +import _ "github.com/gogo/protobuf/types" +import containerd_types "github.com/containerd/containerd/api/types" + +// skipping weak import containerd_plugin "github.com/containerd/containerd/protobuf/plugin" + +import time "time" + +import types "github.com/gogo/protobuf/types" + +import strings "strings" +import reflect "reflect" + +import io "io" + +// Reference imports to suppress errors if they are not otherwise used. +var _ = proto.Marshal +var _ = fmt.Errorf +var _ = math.Inf +var _ = time.Kitchen + +type TaskCreate struct { + ContainerID string `protobuf:"bytes,1,opt,name=container_id,json=containerId,proto3" json:"container_id,omitempty"` + Bundle string `protobuf:"bytes,2,opt,name=bundle,proto3" json:"bundle,omitempty"` + Rootfs []*containerd_types.Mount `protobuf:"bytes,3,rep,name=rootfs" json:"rootfs,omitempty"` + IO *TaskIO `protobuf:"bytes,4,opt,name=io" json:"io,omitempty"` + Checkpoint string `protobuf:"bytes,5,opt,name=checkpoint,proto3" json:"checkpoint,omitempty"` + Pid uint32 `protobuf:"varint,6,opt,name=pid,proto3" json:"pid,omitempty"` +} + +func (m *TaskCreate) Reset() { *m = TaskCreate{} } +func (*TaskCreate) ProtoMessage() {} +func (*TaskCreate) Descriptor() ([]byte, []int) { return fileDescriptorTask, []int{0} } + +type TaskStart struct { + ContainerID string `protobuf:"bytes,1,opt,name=container_id,json=containerId,proto3" json:"container_id,omitempty"` + Pid uint32 `protobuf:"varint,2,opt,name=pid,proto3" json:"pid,omitempty"` +} + +func (m *TaskStart) Reset() { *m = TaskStart{} } +func (*TaskStart) ProtoMessage() {} +func (*TaskStart) Descriptor() ([]byte, []int) { return fileDescriptorTask, []int{1} } + +type TaskDelete struct { + ContainerID string `protobuf:"bytes,1,opt,name=container_id,json=containerId,proto3" json:"container_id,omitempty"` + Pid uint32 `protobuf:"varint,2,opt,name=pid,proto3" json:"pid,omitempty"` + ExitStatus uint32 `protobuf:"varint,3,opt,name=exit_status,json=exitStatus,proto3" json:"exit_status,omitempty"` + ExitedAt time.Time `protobuf:"bytes,4,opt,name=exited_at,json=exitedAt,stdtime" json:"exited_at"` +} + +func (m *TaskDelete) Reset() { *m = TaskDelete{} } +func (*TaskDelete) ProtoMessage() {} +func (*TaskDelete) Descriptor() ([]byte, []int) { return fileDescriptorTask, []int{2} } + +type TaskIO struct { + Stdin string `protobuf:"bytes,1,opt,name=stdin,proto3" json:"stdin,omitempty"` + Stdout string `protobuf:"bytes,2,opt,name=stdout,proto3" json:"stdout,omitempty"` + Stderr string `protobuf:"bytes,3,opt,name=stderr,proto3" json:"stderr,omitempty"` + Terminal bool `protobuf:"varint,4,opt,name=terminal,proto3" json:"terminal,omitempty"` +} + +func (m *TaskIO) Reset() { *m = TaskIO{} } +func (*TaskIO) ProtoMessage() {} +func (*TaskIO) Descriptor() ([]byte, []int) { return fileDescriptorTask, []int{3} } + +type TaskExit struct { + ContainerID string `protobuf:"bytes,1,opt,name=container_id,json=containerId,proto3" json:"container_id,omitempty"` + ID string `protobuf:"bytes,2,opt,name=id,proto3" json:"id,omitempty"` + Pid uint32 `protobuf:"varint,3,opt,name=pid,proto3" json:"pid,omitempty"` + ExitStatus uint32 `protobuf:"varint,4,opt,name=exit_status,json=exitStatus,proto3" json:"exit_status,omitempty"` + ExitedAt time.Time `protobuf:"bytes,5,opt,name=exited_at,json=exitedAt,stdtime" json:"exited_at"` +} + +func (m *TaskExit) Reset() { *m = TaskExit{} } +func (*TaskExit) ProtoMessage() {} +func (*TaskExit) Descriptor() ([]byte, []int) { return fileDescriptorTask, []int{4} } + +type TaskOOM struct { + ContainerID string `protobuf:"bytes,1,opt,name=container_id,json=containerId,proto3" json:"container_id,omitempty"` +} + +func (m *TaskOOM) Reset() { *m = TaskOOM{} } +func (*TaskOOM) ProtoMessage() {} +func (*TaskOOM) Descriptor() ([]byte, []int) { return fileDescriptorTask, []int{5} } + +type TaskExecAdded struct { + ContainerID string `protobuf:"bytes,1,opt,name=container_id,json=containerId,proto3" json:"container_id,omitempty"` + ExecID string `protobuf:"bytes,2,opt,name=exec_id,json=execId,proto3" json:"exec_id,omitempty"` +} + +func (m *TaskExecAdded) Reset() { *m = TaskExecAdded{} } +func (*TaskExecAdded) ProtoMessage() {} +func (*TaskExecAdded) Descriptor() ([]byte, []int) { return fileDescriptorTask, []int{6} } + +type TaskExecStarted struct { + ContainerID string `protobuf:"bytes,1,opt,name=container_id,json=containerId,proto3" json:"container_id,omitempty"` + ExecID string `protobuf:"bytes,2,opt,name=exec_id,json=execId,proto3" json:"exec_id,omitempty"` + Pid uint32 `protobuf:"varint,3,opt,name=pid,proto3" json:"pid,omitempty"` +} + +func (m *TaskExecStarted) Reset() { *m = TaskExecStarted{} } +func (*TaskExecStarted) ProtoMessage() {} +func (*TaskExecStarted) Descriptor() ([]byte, []int) { return fileDescriptorTask, []int{7} } + +type TaskPaused struct { + ContainerID string `protobuf:"bytes,1,opt,name=container_id,json=containerId,proto3" json:"container_id,omitempty"` +} + +func (m *TaskPaused) Reset() { *m = TaskPaused{} } +func (*TaskPaused) ProtoMessage() {} +func (*TaskPaused) Descriptor() ([]byte, []int) { return fileDescriptorTask, []int{8} } + +type TaskResumed struct { + ContainerID string `protobuf:"bytes,1,opt,name=container_id,json=containerId,proto3" json:"container_id,omitempty"` +} + +func (m *TaskResumed) Reset() { *m = TaskResumed{} } +func (*TaskResumed) ProtoMessage() {} +func (*TaskResumed) Descriptor() ([]byte, []int) { return fileDescriptorTask, []int{9} } + +type TaskCheckpointed struct { + ContainerID string `protobuf:"bytes,1,opt,name=container_id,json=containerId,proto3" json:"container_id,omitempty"` + Checkpoint string `protobuf:"bytes,2,opt,name=checkpoint,proto3" json:"checkpoint,omitempty"` +} + +func (m *TaskCheckpointed) Reset() { *m = TaskCheckpointed{} } +func (*TaskCheckpointed) ProtoMessage() {} +func (*TaskCheckpointed) Descriptor() ([]byte, []int) { return fileDescriptorTask, []int{10} } + +func init() { + proto.RegisterType((*TaskCreate)(nil), "containerd.events.TaskCreate") + proto.RegisterType((*TaskStart)(nil), "containerd.events.TaskStart") + proto.RegisterType((*TaskDelete)(nil), "containerd.events.TaskDelete") + proto.RegisterType((*TaskIO)(nil), "containerd.events.TaskIO") + proto.RegisterType((*TaskExit)(nil), "containerd.events.TaskExit") + proto.RegisterType((*TaskOOM)(nil), "containerd.events.TaskOOM") + proto.RegisterType((*TaskExecAdded)(nil), "containerd.events.TaskExecAdded") + proto.RegisterType((*TaskExecStarted)(nil), "containerd.events.TaskExecStarted") + proto.RegisterType((*TaskPaused)(nil), "containerd.events.TaskPaused") + proto.RegisterType((*TaskResumed)(nil), "containerd.events.TaskResumed") + proto.RegisterType((*TaskCheckpointed)(nil), "containerd.events.TaskCheckpointed") +} + +// Field returns the value for the given fieldpath as a string, if defined. +// If the value is not defined, the second value will be false. +func (m *TaskCreate) Field(fieldpath []string) (string, bool) { + if len(fieldpath) == 0 { + return "", false + } + + switch fieldpath[0] { + // unhandled: rootfs + // unhandled: pid + case "container_id": + return string(m.ContainerID), len(m.ContainerID) > 0 + case "bundle": + return string(m.Bundle), len(m.Bundle) > 0 + case "io": + // NOTE(stevvooe): This is probably not correct in many cases. + // We assume that the target message also implements the Field + // method, which isn't likely true in a lot of cases. + // + // If you have a broken build and have found this comment, + // you may be closer to a solution. + if m.IO == nil { + return "", false + } + + return m.IO.Field(fieldpath[1:]) + case "checkpoint": + return string(m.Checkpoint), len(m.Checkpoint) > 0 + } + return "", false +} + +// Field returns the value for the given fieldpath as a string, if defined. +// If the value is not defined, the second value will be false. +func (m *TaskStart) Field(fieldpath []string) (string, bool) { + if len(fieldpath) == 0 { + return "", false + } + + switch fieldpath[0] { + // unhandled: pid + case "container_id": + return string(m.ContainerID), len(m.ContainerID) > 0 + } + return "", false +} + +// Field returns the value for the given fieldpath as a string, if defined. +// If the value is not defined, the second value will be false. +func (m *TaskDelete) Field(fieldpath []string) (string, bool) { + if len(fieldpath) == 0 { + return "", false + } + + switch fieldpath[0] { + // unhandled: pid + // unhandled: exit_status + // unhandled: exited_at + case "container_id": + return string(m.ContainerID), len(m.ContainerID) > 0 + } + return "", false +} + +// Field returns the value for the given fieldpath as a string, if defined. +// If the value is not defined, the second value will be false. +func (m *TaskIO) Field(fieldpath []string) (string, bool) { + if len(fieldpath) == 0 { + return "", false + } + + switch fieldpath[0] { + case "stdin": + return string(m.Stdin), len(m.Stdin) > 0 + case "stdout": + return string(m.Stdout), len(m.Stdout) > 0 + case "stderr": + return string(m.Stderr), len(m.Stderr) > 0 + case "terminal": + return fmt.Sprint(m.Terminal), true + } + return "", false +} + +// Field returns the value for the given fieldpath as a string, if defined. +// If the value is not defined, the second value will be false. +func (m *TaskExit) Field(fieldpath []string) (string, bool) { + if len(fieldpath) == 0 { + return "", false + } + + switch fieldpath[0] { + // unhandled: pid + // unhandled: exit_status + // unhandled: exited_at + case "container_id": + return string(m.ContainerID), len(m.ContainerID) > 0 + case "id": + return string(m.ID), len(m.ID) > 0 + } + return "", false +} + +// Field returns the value for the given fieldpath as a string, if defined. +// If the value is not defined, the second value will be false. +func (m *TaskOOM) Field(fieldpath []string) (string, bool) { + if len(fieldpath) == 0 { + return "", false + } + + switch fieldpath[0] { + case "container_id": + return string(m.ContainerID), len(m.ContainerID) > 0 + } + return "", false +} + +// Field returns the value for the given fieldpath as a string, if defined. +// If the value is not defined, the second value will be false. +func (m *TaskExecAdded) Field(fieldpath []string) (string, bool) { + if len(fieldpath) == 0 { + return "", false + } + + switch fieldpath[0] { + case "container_id": + return string(m.ContainerID), len(m.ContainerID) > 0 + case "exec_id": + return string(m.ExecID), len(m.ExecID) > 0 + } + return "", false +} + +// Field returns the value for the given fieldpath as a string, if defined. +// If the value is not defined, the second value will be false. +func (m *TaskExecStarted) Field(fieldpath []string) (string, bool) { + if len(fieldpath) == 0 { + return "", false + } + + switch fieldpath[0] { + // unhandled: pid + case "container_id": + return string(m.ContainerID), len(m.ContainerID) > 0 + case "exec_id": + return string(m.ExecID), len(m.ExecID) > 0 + } + return "", false +} + +// Field returns the value for the given fieldpath as a string, if defined. +// If the value is not defined, the second value will be false. +func (m *TaskPaused) Field(fieldpath []string) (string, bool) { + if len(fieldpath) == 0 { + return "", false + } + + switch fieldpath[0] { + case "container_id": + return string(m.ContainerID), len(m.ContainerID) > 0 + } + return "", false +} + +// Field returns the value for the given fieldpath as a string, if defined. +// If the value is not defined, the second value will be false. +func (m *TaskResumed) Field(fieldpath []string) (string, bool) { + if len(fieldpath) == 0 { + return "", false + } + + switch fieldpath[0] { + case "container_id": + return string(m.ContainerID), len(m.ContainerID) > 0 + } + return "", false +} + +// Field returns the value for the given fieldpath as a string, if defined. +// If the value is not defined, the second value will be false. +func (m *TaskCheckpointed) Field(fieldpath []string) (string, bool) { + if len(fieldpath) == 0 { + return "", false + } + + switch fieldpath[0] { + case "container_id": + return string(m.ContainerID), len(m.ContainerID) > 0 + case "checkpoint": + return string(m.Checkpoint), len(m.Checkpoint) > 0 + } + return "", false +} +func (m *TaskCreate) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *TaskCreate) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.ContainerID) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintTask(dAtA, i, uint64(len(m.ContainerID))) + i += copy(dAtA[i:], m.ContainerID) + } + if len(m.Bundle) > 0 { + dAtA[i] = 0x12 + i++ + i = encodeVarintTask(dAtA, i, uint64(len(m.Bundle))) + i += copy(dAtA[i:], m.Bundle) + } + if len(m.Rootfs) > 0 { + for _, msg := range m.Rootfs { + dAtA[i] = 0x1a + i++ + i = encodeVarintTask(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if m.IO != nil { + dAtA[i] = 0x22 + i++ + i = encodeVarintTask(dAtA, i, uint64(m.IO.Size())) + n1, err := m.IO.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n1 + } + if len(m.Checkpoint) > 0 { + dAtA[i] = 0x2a + i++ + i = encodeVarintTask(dAtA, i, uint64(len(m.Checkpoint))) + i += copy(dAtA[i:], m.Checkpoint) + } + if m.Pid != 0 { + dAtA[i] = 0x30 + i++ + i = encodeVarintTask(dAtA, i, uint64(m.Pid)) + } + return i, nil +} + +func (m *TaskStart) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *TaskStart) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.ContainerID) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintTask(dAtA, i, uint64(len(m.ContainerID))) + i += copy(dAtA[i:], m.ContainerID) + } + if m.Pid != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintTask(dAtA, i, uint64(m.Pid)) + } + return i, nil +} + +func (m *TaskDelete) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *TaskDelete) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.ContainerID) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintTask(dAtA, i, uint64(len(m.ContainerID))) + i += copy(dAtA[i:], m.ContainerID) + } + if m.Pid != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintTask(dAtA, i, uint64(m.Pid)) + } + if m.ExitStatus != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintTask(dAtA, i, uint64(m.ExitStatus)) + } + dAtA[i] = 0x22 + i++ + i = encodeVarintTask(dAtA, i, uint64(types.SizeOfStdTime(m.ExitedAt))) + n2, err := types.StdTimeMarshalTo(m.ExitedAt, dAtA[i:]) + if err != nil { + return 0, err + } + i += n2 + return i, nil +} + +func (m *TaskIO) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *TaskIO) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.Stdin) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintTask(dAtA, i, uint64(len(m.Stdin))) + i += copy(dAtA[i:], m.Stdin) + } + if len(m.Stdout) > 0 { + dAtA[i] = 0x12 + i++ + i = encodeVarintTask(dAtA, i, uint64(len(m.Stdout))) + i += copy(dAtA[i:], m.Stdout) + } + if len(m.Stderr) > 0 { + dAtA[i] = 0x1a + i++ + i = encodeVarintTask(dAtA, i, uint64(len(m.Stderr))) + i += copy(dAtA[i:], m.Stderr) + } + if m.Terminal { + dAtA[i] = 0x20 + i++ + if m.Terminal { + dAtA[i] = 1 + } else { + dAtA[i] = 0 + } + i++ + } + return i, nil +} + +func (m *TaskExit) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *TaskExit) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.ContainerID) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintTask(dAtA, i, uint64(len(m.ContainerID))) + i += copy(dAtA[i:], m.ContainerID) + } + if len(m.ID) > 0 { + dAtA[i] = 0x12 + i++ + i = encodeVarintTask(dAtA, i, uint64(len(m.ID))) + i += copy(dAtA[i:], m.ID) + } + if m.Pid != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintTask(dAtA, i, uint64(m.Pid)) + } + if m.ExitStatus != 0 { + dAtA[i] = 0x20 + i++ + i = encodeVarintTask(dAtA, i, uint64(m.ExitStatus)) + } + dAtA[i] = 0x2a + i++ + i = encodeVarintTask(dAtA, i, uint64(types.SizeOfStdTime(m.ExitedAt))) + n3, err := types.StdTimeMarshalTo(m.ExitedAt, dAtA[i:]) + if err != nil { + return 0, err + } + i += n3 + return i, nil +} + +func (m *TaskOOM) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *TaskOOM) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.ContainerID) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintTask(dAtA, i, uint64(len(m.ContainerID))) + i += copy(dAtA[i:], m.ContainerID) + } + return i, nil +} + +func (m *TaskExecAdded) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *TaskExecAdded) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.ContainerID) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintTask(dAtA, i, uint64(len(m.ContainerID))) + i += copy(dAtA[i:], m.ContainerID) + } + if len(m.ExecID) > 0 { + dAtA[i] = 0x12 + i++ + i = encodeVarintTask(dAtA, i, uint64(len(m.ExecID))) + i += copy(dAtA[i:], m.ExecID) + } + return i, nil +} + +func (m *TaskExecStarted) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *TaskExecStarted) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.ContainerID) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintTask(dAtA, i, uint64(len(m.ContainerID))) + i += copy(dAtA[i:], m.ContainerID) + } + if len(m.ExecID) > 0 { + dAtA[i] = 0x12 + i++ + i = encodeVarintTask(dAtA, i, uint64(len(m.ExecID))) + i += copy(dAtA[i:], m.ExecID) + } + if m.Pid != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintTask(dAtA, i, uint64(m.Pid)) + } + return i, nil +} + +func (m *TaskPaused) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *TaskPaused) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.ContainerID) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintTask(dAtA, i, uint64(len(m.ContainerID))) + i += copy(dAtA[i:], m.ContainerID) + } + return i, nil +} + +func (m *TaskResumed) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *TaskResumed) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.ContainerID) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintTask(dAtA, i, uint64(len(m.ContainerID))) + i += copy(dAtA[i:], m.ContainerID) + } + return i, nil +} + +func (m *TaskCheckpointed) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *TaskCheckpointed) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.ContainerID) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintTask(dAtA, i, uint64(len(m.ContainerID))) + i += copy(dAtA[i:], m.ContainerID) + } + if len(m.Checkpoint) > 0 { + dAtA[i] = 0x12 + i++ + i = encodeVarintTask(dAtA, i, uint64(len(m.Checkpoint))) + i += copy(dAtA[i:], m.Checkpoint) + } + return i, nil +} + +func encodeVarintTask(dAtA []byte, offset int, v uint64) int { + for v >= 1<<7 { + dAtA[offset] = uint8(v&0x7f | 0x80) + v >>= 7 + offset++ + } + dAtA[offset] = uint8(v) + return offset + 1 +} +func (m *TaskCreate) Size() (n int) { + var l int + _ = l + l = len(m.ContainerID) + if l > 0 { + n += 1 + l + sovTask(uint64(l)) + } + l = len(m.Bundle) + if l > 0 { + n += 1 + l + sovTask(uint64(l)) + } + if len(m.Rootfs) > 0 { + for _, e := range m.Rootfs { + l = e.Size() + n += 1 + l + sovTask(uint64(l)) + } + } + if m.IO != nil { + l = m.IO.Size() + n += 1 + l + sovTask(uint64(l)) + } + l = len(m.Checkpoint) + if l > 0 { + n += 1 + l + sovTask(uint64(l)) + } + if m.Pid != 0 { + n += 1 + sovTask(uint64(m.Pid)) + } + return n +} + +func (m *TaskStart) Size() (n int) { + var l int + _ = l + l = len(m.ContainerID) + if l > 0 { + n += 1 + l + sovTask(uint64(l)) + } + if m.Pid != 0 { + n += 1 + sovTask(uint64(m.Pid)) + } + return n +} + +func (m *TaskDelete) Size() (n int) { + var l int + _ = l + l = len(m.ContainerID) + if l > 0 { + n += 1 + l + sovTask(uint64(l)) + } + if m.Pid != 0 { + n += 1 + sovTask(uint64(m.Pid)) + } + if m.ExitStatus != 0 { + n += 1 + sovTask(uint64(m.ExitStatus)) + } + l = types.SizeOfStdTime(m.ExitedAt) + n += 1 + l + sovTask(uint64(l)) + return n +} + +func (m *TaskIO) Size() (n int) { + var l int + _ = l + l = len(m.Stdin) + if l > 0 { + n += 1 + l + sovTask(uint64(l)) + } + l = len(m.Stdout) + if l > 0 { + n += 1 + l + sovTask(uint64(l)) + } + l = len(m.Stderr) + if l > 0 { + n += 1 + l + sovTask(uint64(l)) + } + if m.Terminal { + n += 2 + } + return n +} + +func (m *TaskExit) Size() (n int) { + var l int + _ = l + l = len(m.ContainerID) + if l > 0 { + n += 1 + l + sovTask(uint64(l)) + } + l = len(m.ID) + if l > 0 { + n += 1 + l + sovTask(uint64(l)) + } + if m.Pid != 0 { + n += 1 + sovTask(uint64(m.Pid)) + } + if m.ExitStatus != 0 { + n += 1 + sovTask(uint64(m.ExitStatus)) + } + l = types.SizeOfStdTime(m.ExitedAt) + n += 1 + l + sovTask(uint64(l)) + return n +} + +func (m *TaskOOM) Size() (n int) { + var l int + _ = l + l = len(m.ContainerID) + if l > 0 { + n += 1 + l + sovTask(uint64(l)) + } + return n +} + +func (m *TaskExecAdded) Size() (n int) { + var l int + _ = l + l = len(m.ContainerID) + if l > 0 { + n += 1 + l + sovTask(uint64(l)) + } + l = len(m.ExecID) + if l > 0 { + n += 1 + l + sovTask(uint64(l)) + } + return n +} + +func (m *TaskExecStarted) Size() (n int) { + var l int + _ = l + l = len(m.ContainerID) + if l > 0 { + n += 1 + l + sovTask(uint64(l)) + } + l = len(m.ExecID) + if l > 0 { + n += 1 + l + sovTask(uint64(l)) + } + if m.Pid != 0 { + n += 1 + sovTask(uint64(m.Pid)) + } + return n +} + +func (m *TaskPaused) Size() (n int) { + var l int + _ = l + l = len(m.ContainerID) + if l > 0 { + n += 1 + l + sovTask(uint64(l)) + } + return n +} + +func (m *TaskResumed) Size() (n int) { + var l int + _ = l + l = len(m.ContainerID) + if l > 0 { + n += 1 + l + sovTask(uint64(l)) + } + return n +} + +func (m *TaskCheckpointed) Size() (n int) { + var l int + _ = l + l = len(m.ContainerID) + if l > 0 { + n += 1 + l + sovTask(uint64(l)) + } + l = len(m.Checkpoint) + if l > 0 { + n += 1 + l + sovTask(uint64(l)) + } + return n +} + +func sovTask(x uint64) (n int) { + for { + n++ + x >>= 7 + if x == 0 { + break + } + } + return n +} +func sozTask(x uint64) (n int) { + return sovTask(uint64((x << 1) ^ uint64((int64(x) >> 63)))) +} +func (this *TaskCreate) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&TaskCreate{`, + `ContainerID:` + fmt.Sprintf("%v", this.ContainerID) + `,`, + `Bundle:` + fmt.Sprintf("%v", this.Bundle) + `,`, + `Rootfs:` + strings.Replace(fmt.Sprintf("%v", this.Rootfs), "Mount", "containerd_types.Mount", 1) + `,`, + `IO:` + strings.Replace(fmt.Sprintf("%v", this.IO), "TaskIO", "TaskIO", 1) + `,`, + `Checkpoint:` + fmt.Sprintf("%v", this.Checkpoint) + `,`, + `Pid:` + fmt.Sprintf("%v", this.Pid) + `,`, + `}`, + }, "") + return s +} +func (this *TaskStart) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&TaskStart{`, + `ContainerID:` + fmt.Sprintf("%v", this.ContainerID) + `,`, + `Pid:` + fmt.Sprintf("%v", this.Pid) + `,`, + `}`, + }, "") + return s +} +func (this *TaskDelete) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&TaskDelete{`, + `ContainerID:` + fmt.Sprintf("%v", this.ContainerID) + `,`, + `Pid:` + fmt.Sprintf("%v", this.Pid) + `,`, + `ExitStatus:` + fmt.Sprintf("%v", this.ExitStatus) + `,`, + `ExitedAt:` + strings.Replace(strings.Replace(this.ExitedAt.String(), "Timestamp", "google_protobuf2.Timestamp", 1), `&`, ``, 1) + `,`, + `}`, + }, "") + return s +} +func (this *TaskIO) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&TaskIO{`, + `Stdin:` + fmt.Sprintf("%v", this.Stdin) + `,`, + `Stdout:` + fmt.Sprintf("%v", this.Stdout) + `,`, + `Stderr:` + fmt.Sprintf("%v", this.Stderr) + `,`, + `Terminal:` + fmt.Sprintf("%v", this.Terminal) + `,`, + `}`, + }, "") + return s +} +func (this *TaskExit) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&TaskExit{`, + `ContainerID:` + fmt.Sprintf("%v", this.ContainerID) + `,`, + `ID:` + fmt.Sprintf("%v", this.ID) + `,`, + `Pid:` + fmt.Sprintf("%v", this.Pid) + `,`, + `ExitStatus:` + fmt.Sprintf("%v", this.ExitStatus) + `,`, + `ExitedAt:` + strings.Replace(strings.Replace(this.ExitedAt.String(), "Timestamp", "google_protobuf2.Timestamp", 1), `&`, ``, 1) + `,`, + `}`, + }, "") + return s +} +func (this *TaskOOM) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&TaskOOM{`, + `ContainerID:` + fmt.Sprintf("%v", this.ContainerID) + `,`, + `}`, + }, "") + return s +} +func (this *TaskExecAdded) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&TaskExecAdded{`, + `ContainerID:` + fmt.Sprintf("%v", this.ContainerID) + `,`, + `ExecID:` + fmt.Sprintf("%v", this.ExecID) + `,`, + `}`, + }, "") + return s +} +func (this *TaskExecStarted) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&TaskExecStarted{`, + `ContainerID:` + fmt.Sprintf("%v", this.ContainerID) + `,`, + `ExecID:` + fmt.Sprintf("%v", this.ExecID) + `,`, + `Pid:` + fmt.Sprintf("%v", this.Pid) + `,`, + `}`, + }, "") + return s +} +func (this *TaskPaused) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&TaskPaused{`, + `ContainerID:` + fmt.Sprintf("%v", this.ContainerID) + `,`, + `}`, + }, "") + return s +} +func (this *TaskResumed) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&TaskResumed{`, + `ContainerID:` + fmt.Sprintf("%v", this.ContainerID) + `,`, + `}`, + }, "") + return s +} +func (this *TaskCheckpointed) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&TaskCheckpointed{`, + `ContainerID:` + fmt.Sprintf("%v", this.ContainerID) + `,`, + `Checkpoint:` + fmt.Sprintf("%v", this.Checkpoint) + `,`, + `}`, + }, "") + return s +} +func valueToStringTask(v interface{}) string { + rv := reflect.ValueOf(v) + if rv.IsNil() { + return "nil" + } + pv := reflect.Indirect(rv).Interface() + return fmt.Sprintf("*%v", pv) +} +func (m *TaskCreate) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: TaskCreate: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: TaskCreate: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ContainerID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthTask + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ContainerID = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Bundle", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthTask + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Bundle = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 3: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Rootfs", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthTask + } + postIndex := iNdEx + msglen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Rootfs = append(m.Rootfs, &containerd_types.Mount{}) + if err := m.Rootfs[len(m.Rootfs)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 4: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field IO", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthTask + } + postIndex := iNdEx + msglen + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.IO == nil { + m.IO = &TaskIO{} + } + if err := m.IO.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 5: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Checkpoint", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthTask + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Checkpoint = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 6: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Pid", wireType) + } + m.Pid = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Pid |= (uint32(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipTask(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthTask + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *TaskStart) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: TaskStart: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: TaskStart: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ContainerID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthTask + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ContainerID = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Pid", wireType) + } + m.Pid = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Pid |= (uint32(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipTask(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthTask + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *TaskDelete) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: TaskDelete: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: TaskDelete: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ContainerID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthTask + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ContainerID = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Pid", wireType) + } + m.Pid = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Pid |= (uint32(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field ExitStatus", wireType) + } + m.ExitStatus = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.ExitStatus |= (uint32(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + case 4: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ExitedAt", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthTask + } + postIndex := iNdEx + msglen + if postIndex > l { + return io.ErrUnexpectedEOF + } + if err := types.StdTimeUnmarshal(&m.ExitedAt, dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipTask(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthTask + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *TaskIO) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: TaskIO: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: TaskIO: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Stdin", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthTask + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Stdin = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Stdout", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthTask + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Stdout = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 3: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Stderr", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthTask + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Stderr = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 4: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Terminal", wireType) + } + var v int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + v |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + m.Terminal = bool(v != 0) + default: + iNdEx = preIndex + skippy, err := skipTask(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthTask + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *TaskExit) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: TaskExit: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: TaskExit: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ContainerID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthTask + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ContainerID = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthTask + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ID = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Pid", wireType) + } + m.Pid = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Pid |= (uint32(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + case 4: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field ExitStatus", wireType) + } + m.ExitStatus = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.ExitStatus |= (uint32(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + case 5: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ExitedAt", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthTask + } + postIndex := iNdEx + msglen + if postIndex > l { + return io.ErrUnexpectedEOF + } + if err := types.StdTimeUnmarshal(&m.ExitedAt, dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipTask(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthTask + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *TaskOOM) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: TaskOOM: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: TaskOOM: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ContainerID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthTask + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ContainerID = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipTask(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthTask + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *TaskExecAdded) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: TaskExecAdded: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: TaskExecAdded: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ContainerID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthTask + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ContainerID = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ExecID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthTask + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ExecID = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipTask(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthTask + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *TaskExecStarted) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: TaskExecStarted: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: TaskExecStarted: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ContainerID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthTask + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ContainerID = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ExecID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthTask + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ExecID = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Pid", wireType) + } + m.Pid = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Pid |= (uint32(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipTask(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthTask + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *TaskPaused) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: TaskPaused: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: TaskPaused: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ContainerID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthTask + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ContainerID = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipTask(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthTask + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *TaskResumed) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: TaskResumed: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: TaskResumed: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ContainerID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthTask + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ContainerID = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipTask(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthTask + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *TaskCheckpointed) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: TaskCheckpointed: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: TaskCheckpointed: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ContainerID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthTask + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ContainerID = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Checkpoint", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthTask + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Checkpoint = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipTask(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthTask + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func skipTask(dAtA []byte) (n int, err error) { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowTask + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + wireType := int(wire & 0x7) + switch wireType { + case 0: + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowTask + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + iNdEx++ + if dAtA[iNdEx-1] < 0x80 { + break + } + } + return iNdEx, nil + case 1: + iNdEx += 8 + return iNdEx, nil + case 2: + var length int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowTask + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + length |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + iNdEx += length + if length < 0 { + return 0, ErrInvalidLengthTask + } + return iNdEx, nil + case 3: + for { + var innerWire uint64 + var start int = iNdEx + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowTask + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + innerWire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + innerWireType := int(innerWire & 0x7) + if innerWireType == 4 { + break + } + next, err := skipTask(dAtA[start:]) + if err != nil { + return 0, err + } + iNdEx = start + next + } + return iNdEx, nil + case 4: + return iNdEx, nil + case 5: + iNdEx += 4 + return iNdEx, nil + default: + return 0, fmt.Errorf("proto: illegal wireType %d", wireType) + } + } + panic("unreachable") +} + +var ( + ErrInvalidLengthTask = fmt.Errorf("proto: negative length found during unmarshaling") + ErrIntOverflowTask = fmt.Errorf("proto: integer overflow") +) + +func init() { + proto.RegisterFile("github.com/containerd/containerd/api/events/task.proto", fileDescriptorTask) +} + +var fileDescriptorTask = []byte{ + // 637 bytes of a gzipped FileDescriptorProto + 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0xb4, 0x95, 0xcd, 0x6e, 0xd3, 0x40, + 0x10, 0xc7, 0x63, 0xa7, 0x75, 0x93, 0x09, 0x55, 0x8b, 0x55, 0x41, 0xc8, 0xc1, 0x8e, 0xcc, 0x25, + 0x27, 0x5b, 0x04, 0x89, 0x0b, 0x42, 0x6a, 0xd2, 0x70, 0xc8, 0xa1, 0x4a, 0x71, 0x7b, 0xa8, 0xb8, + 0x44, 0x4e, 0x76, 0x93, 0x2c, 0x8d, 0xbd, 0x96, 0x3d, 0x46, 0x45, 0xe2, 0xc0, 0x23, 0xf0, 0x08, + 0x3c, 0x05, 0xcf, 0xd0, 0x03, 0x07, 0x8e, 0x9c, 0x02, 0xf5, 0x03, 0x70, 0xe2, 0x01, 0xd0, 0x7a, + 0x1d, 0xb7, 0x50, 0xf1, 0x65, 0x89, 0x53, 0x76, 0x66, 0x67, 0xff, 0x33, 0xf3, 0xdb, 0xc9, 0x1a, + 0x1e, 0xcd, 0x19, 0x2e, 0x92, 0x89, 0x3d, 0xe5, 0xbe, 0x33, 0xe5, 0x01, 0x7a, 0x2c, 0xa0, 0x11, + 0xb9, 0xbe, 0xf4, 0x42, 0xe6, 0xd0, 0x97, 0x34, 0xc0, 0xd8, 0x41, 0x2f, 0x3e, 0xb3, 0xc3, 0x88, + 0x23, 0xd7, 0x6f, 0x5f, 0x45, 0xd8, 0x72, 0xb7, 0xb5, 0x37, 0xe7, 0x73, 0x9e, 0xed, 0x3a, 0x62, + 0x25, 0x03, 0x5b, 0xe6, 0x9c, 0xf3, 0xf9, 0x92, 0x3a, 0x99, 0x35, 0x49, 0x66, 0x0e, 0x32, 0x9f, + 0xc6, 0xe8, 0xf9, 0x61, 0x1e, 0xf0, 0x77, 0x15, 0xe0, 0xab, 0x90, 0xc6, 0x8e, 0xcf, 0x93, 0x00, + 0xf3, 0x73, 0xfb, 0x7f, 0x3c, 0x57, 0xa4, 0x0c, 0x97, 0xc9, 0x9c, 0x05, 0xce, 0x8c, 0xd1, 0x25, + 0x09, 0x3d, 0x5c, 0x48, 0x05, 0xeb, 0xab, 0x02, 0x70, 0xe2, 0xc5, 0x67, 0x07, 0x11, 0xf5, 0x90, + 0xea, 0x5d, 0xb8, 0x55, 0x1c, 0x1e, 0x33, 0xd2, 0x54, 0xda, 0x4a, 0xa7, 0xde, 0xdf, 0x49, 0x57, + 0x66, 0xe3, 0x60, 0xed, 0x1f, 0x0e, 0xdc, 0x46, 0x11, 0x34, 0x24, 0xfa, 0x1d, 0xd0, 0x26, 0x49, + 0x40, 0x96, 0xb4, 0xa9, 0x8a, 0x68, 0x37, 0xb7, 0x74, 0x07, 0xb4, 0x88, 0x73, 0x9c, 0xc5, 0xcd, + 0x6a, 0xbb, 0xda, 0x69, 0x74, 0xef, 0xda, 0xd7, 0x78, 0x65, 0xbd, 0xd8, 0x87, 0xa2, 0x17, 0x37, + 0x0f, 0xd3, 0x1f, 0x80, 0xca, 0x78, 0x73, 0xa3, 0xad, 0x74, 0x1a, 0xdd, 0x7b, 0xf6, 0x0d, 0xb8, + 0xb6, 0xa8, 0x73, 0x38, 0xea, 0x6b, 0xe9, 0xca, 0x54, 0x87, 0x23, 0x57, 0x65, 0x5c, 0x37, 0x00, + 0xa6, 0x0b, 0x3a, 0x3d, 0x0b, 0x39, 0x0b, 0xb0, 0xb9, 0x99, 0xe5, 0xbf, 0xe6, 0xd1, 0x77, 0xa1, + 0x1a, 0x32, 0xd2, 0xd4, 0xda, 0x4a, 0x67, 0xdb, 0x15, 0x4b, 0xeb, 0x19, 0xd4, 0x85, 0xce, 0x31, + 0x7a, 0x11, 0x96, 0x6a, 0x37, 0x97, 0x54, 0xaf, 0x24, 0xdf, 0xe7, 0x0c, 0x07, 0x74, 0x49, 0x4b, + 0x32, 0xbc, 0x21, 0xaa, 0x9b, 0xd0, 0xa0, 0xe7, 0x0c, 0xc7, 0x31, 0x7a, 0x98, 0x08, 0x84, 0x62, + 0x07, 0x84, 0xeb, 0x38, 0xf3, 0xe8, 0x3d, 0xa8, 0x0b, 0x8b, 0x92, 0xb1, 0x87, 0x39, 0xb4, 0x96, + 0x2d, 0x07, 0xcd, 0x5e, 0xdf, 0xba, 0x7d, 0xb2, 0x1e, 0xb4, 0x7e, 0xed, 0x62, 0x65, 0x56, 0xde, + 0x7e, 0x36, 0x15, 0xb7, 0x26, 0x8f, 0xf5, 0xd0, 0x7a, 0x01, 0x9a, 0x64, 0xaa, 0xef, 0xc1, 0x66, + 0x8c, 0x84, 0x05, 0xb2, 0x58, 0x57, 0x1a, 0xe2, 0x66, 0x63, 0x24, 0x3c, 0xc1, 0xf5, 0xcd, 0x4a, + 0x2b, 0xf7, 0xd3, 0x28, 0xca, 0xca, 0x92, 0x7e, 0x1a, 0x45, 0x7a, 0x0b, 0x6a, 0x48, 0x23, 0x9f, + 0x05, 0xde, 0x32, 0xab, 0xa8, 0xe6, 0x16, 0xb6, 0xf5, 0x41, 0x81, 0x9a, 0x48, 0xf6, 0xf4, 0x9c, + 0x61, 0xc9, 0x31, 0x53, 0x73, 0x42, 0xf5, 0x7c, 0x04, 0x06, 0xae, 0xca, 0x0a, 0x74, 0xd5, 0x5f, + 0xa2, 0xdb, 0xf8, 0x3d, 0xba, 0xcd, 0x52, 0xe8, 0x9e, 0xc0, 0x96, 0xe8, 0x66, 0x34, 0x3a, 0x2c, + 0xd3, 0x8c, 0xb5, 0x80, 0x6d, 0x09, 0x83, 0x4e, 0x7b, 0x84, 0x50, 0x52, 0x8a, 0xc8, 0x7d, 0xd8, + 0xa2, 0xe7, 0x74, 0x3a, 0x2e, 0xb0, 0x40, 0xba, 0x32, 0x35, 0xa1, 0x39, 0x1c, 0xb8, 0x9a, 0xd8, + 0x1a, 0x12, 0xeb, 0x35, 0xec, 0xac, 0x33, 0x65, 0x33, 0xff, 0x1f, 0x73, 0xdd, 0xbc, 0x0a, 0x6b, + 0x5f, 0xfe, 0x33, 0x8e, 0xbc, 0x24, 0x2e, 0x97, 0xd8, 0xea, 0x41, 0x43, 0x28, 0xb8, 0x34, 0x4e, + 0xfc, 0x92, 0x12, 0x33, 0xd8, 0xcd, 0x9e, 0xb8, 0xe2, 0x59, 0x28, 0xc9, 0xe0, 0xc7, 0xc7, 0x46, + 0xfd, 0xf9, 0xb1, 0xe9, 0x1f, 0x5d, 0x5c, 0x1a, 0x95, 0x4f, 0x97, 0x46, 0xe5, 0x4d, 0x6a, 0x28, + 0x17, 0xa9, 0xa1, 0x7c, 0x4c, 0x0d, 0xe5, 0x4b, 0x6a, 0x28, 0xef, 0xbe, 0x19, 0xca, 0xf3, 0xee, + 0x3f, 0x7c, 0x65, 0x1e, 0xcb, 0x9f, 0xd3, 0xca, 0x69, 0x75, 0xa2, 0x65, 0x13, 0xf9, 0xf0, 0x7b, + 0x00, 0x00, 0x00, 0xff, 0xff, 0x07, 0x69, 0x62, 0x9d, 0xa6, 0x06, 0x00, 0x00, +} diff --git a/vendor/github.com/containerd/containerd/api/types/descriptor.pb.go b/vendor/github.com/containerd/containerd/api/types/descriptor.pb.go new file mode 100644 index 0000000000..93e88c0dc2 --- /dev/null +++ b/vendor/github.com/containerd/containerd/api/types/descriptor.pb.go @@ -0,0 +1,410 @@ +// Code generated by protoc-gen-gogo. DO NOT EDIT. +// source: github.com/containerd/containerd/api/types/descriptor.proto + +/* + Package types is a generated protocol buffer package. + + It is generated from these files: + github.com/containerd/containerd/api/types/descriptor.proto + github.com/containerd/containerd/api/types/metrics.proto + github.com/containerd/containerd/api/types/mount.proto + github.com/containerd/containerd/api/types/platform.proto + + It has these top-level messages: + Descriptor + Metric + Mount + Platform +*/ +package types + +import proto "github.com/gogo/protobuf/proto" +import fmt "fmt" +import math "math" + +// skipping weak import gogoproto "github.com/gogo/protobuf/gogoproto" + +import github_com_opencontainers_go_digest "github.com/opencontainers/go-digest" + +import strings "strings" +import reflect "reflect" + +import io "io" + +// Reference imports to suppress errors if they are not otherwise used. +var _ = proto.Marshal +var _ = fmt.Errorf +var _ = math.Inf + +// This is a compile-time assertion to ensure that this generated file +// is compatible with the proto package it is being compiled against. +// A compilation error at this line likely means your copy of the +// proto package needs to be updated. +const _ = proto.GoGoProtoPackageIsVersion2 // please upgrade the proto package + +// Descriptor describes a blob in a content store. +// +// This descriptor can be used to reference content from an +// oci descriptor found in a manifest. +// See https://godoc.org/github.com/opencontainers/image-spec/specs-go/v1#Descriptor +type Descriptor struct { + MediaType string `protobuf:"bytes,1,opt,name=media_type,json=mediaType,proto3" json:"media_type,omitempty"` + Digest github_com_opencontainers_go_digest.Digest `protobuf:"bytes,2,opt,name=digest,proto3,customtype=github.com/opencontainers/go-digest.Digest" json:"digest"` + Size_ int64 `protobuf:"varint,3,opt,name=size,proto3" json:"size,omitempty"` +} + +func (m *Descriptor) Reset() { *m = Descriptor{} } +func (*Descriptor) ProtoMessage() {} +func (*Descriptor) Descriptor() ([]byte, []int) { return fileDescriptorDescriptor, []int{0} } + +func init() { + proto.RegisterType((*Descriptor)(nil), "containerd.types.Descriptor") +} +func (m *Descriptor) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *Descriptor) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.MediaType) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintDescriptor(dAtA, i, uint64(len(m.MediaType))) + i += copy(dAtA[i:], m.MediaType) + } + if len(m.Digest) > 0 { + dAtA[i] = 0x12 + i++ + i = encodeVarintDescriptor(dAtA, i, uint64(len(m.Digest))) + i += copy(dAtA[i:], m.Digest) + } + if m.Size_ != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintDescriptor(dAtA, i, uint64(m.Size_)) + } + return i, nil +} + +func encodeVarintDescriptor(dAtA []byte, offset int, v uint64) int { + for v >= 1<<7 { + dAtA[offset] = uint8(v&0x7f | 0x80) + v >>= 7 + offset++ + } + dAtA[offset] = uint8(v) + return offset + 1 +} +func (m *Descriptor) Size() (n int) { + var l int + _ = l + l = len(m.MediaType) + if l > 0 { + n += 1 + l + sovDescriptor(uint64(l)) + } + l = len(m.Digest) + if l > 0 { + n += 1 + l + sovDescriptor(uint64(l)) + } + if m.Size_ != 0 { + n += 1 + sovDescriptor(uint64(m.Size_)) + } + return n +} + +func sovDescriptor(x uint64) (n int) { + for { + n++ + x >>= 7 + if x == 0 { + break + } + } + return n +} +func sozDescriptor(x uint64) (n int) { + return sovDescriptor(uint64((x << 1) ^ uint64((int64(x) >> 63)))) +} +func (this *Descriptor) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&Descriptor{`, + `MediaType:` + fmt.Sprintf("%v", this.MediaType) + `,`, + `Digest:` + fmt.Sprintf("%v", this.Digest) + `,`, + `Size_:` + fmt.Sprintf("%v", this.Size_) + `,`, + `}`, + }, "") + return s +} +func valueToStringDescriptor(v interface{}) string { + rv := reflect.ValueOf(v) + if rv.IsNil() { + return "nil" + } + pv := reflect.Indirect(rv).Interface() + return fmt.Sprintf("*%v", pv) +} +func (m *Descriptor) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowDescriptor + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: Descriptor: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: Descriptor: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field MediaType", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowDescriptor + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthDescriptor + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.MediaType = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Digest", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowDescriptor + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthDescriptor + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Digest = github_com_opencontainers_go_digest.Digest(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Size_", wireType) + } + m.Size_ = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowDescriptor + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Size_ |= (int64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipDescriptor(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthDescriptor + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func skipDescriptor(dAtA []byte) (n int, err error) { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowDescriptor + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + wireType := int(wire & 0x7) + switch wireType { + case 0: + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowDescriptor + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + iNdEx++ + if dAtA[iNdEx-1] < 0x80 { + break + } + } + return iNdEx, nil + case 1: + iNdEx += 8 + return iNdEx, nil + case 2: + var length int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowDescriptor + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + length |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + iNdEx += length + if length < 0 { + return 0, ErrInvalidLengthDescriptor + } + return iNdEx, nil + case 3: + for { + var innerWire uint64 + var start int = iNdEx + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowDescriptor + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + innerWire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + innerWireType := int(innerWire & 0x7) + if innerWireType == 4 { + break + } + next, err := skipDescriptor(dAtA[start:]) + if err != nil { + return 0, err + } + iNdEx = start + next + } + return iNdEx, nil + case 4: + return iNdEx, nil + case 5: + iNdEx += 4 + return iNdEx, nil + default: + return 0, fmt.Errorf("proto: illegal wireType %d", wireType) + } + } + panic("unreachable") +} + +var ( + ErrInvalidLengthDescriptor = fmt.Errorf("proto: negative length found during unmarshaling") + ErrIntOverflowDescriptor = fmt.Errorf("proto: integer overflow") +) + +func init() { + proto.RegisterFile("github.com/containerd/containerd/api/types/descriptor.proto", fileDescriptorDescriptor) +} + +var fileDescriptorDescriptor = []byte{ + // 234 bytes of a gzipped FileDescriptorProto + 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0xe2, 0xb2, 0x4e, 0xcf, 0x2c, 0xc9, + 0x28, 0x4d, 0xd2, 0x4b, 0xce, 0xcf, 0xd5, 0x4f, 0xce, 0xcf, 0x2b, 0x49, 0xcc, 0xcc, 0x4b, 0x2d, + 0x4a, 0x41, 0x66, 0x26, 0x16, 0x64, 0xea, 0x97, 0x54, 0x16, 0xa4, 0x16, 0xeb, 0xa7, 0xa4, 0x16, + 0x27, 0x17, 0x65, 0x16, 0x94, 0xe4, 0x17, 0xe9, 0x15, 0x14, 0xe5, 0x97, 0xe4, 0x0b, 0x09, 0x20, + 0x94, 0xe9, 0x81, 0x95, 0x48, 0x89, 0xa4, 0xe7, 0xa7, 0xe7, 0x83, 0x25, 0xf5, 0x41, 0x2c, 0x88, + 0x3a, 0xa5, 0x6e, 0x46, 0x2e, 0x2e, 0x17, 0xb8, 0x66, 0x21, 0x59, 0x2e, 0xae, 0xdc, 0xd4, 0x94, + 0xcc, 0xc4, 0x78, 0x90, 0x1e, 0x09, 0x46, 0x05, 0x46, 0x0d, 0xce, 0x20, 0x4e, 0xb0, 0x48, 0x48, + 0x65, 0x41, 0xaa, 0x90, 0x17, 0x17, 0x5b, 0x4a, 0x66, 0x7a, 0x6a, 0x71, 0x89, 0x04, 0x13, 0x48, + 0xca, 0xc9, 0xe8, 0xc4, 0x3d, 0x79, 0x86, 0x5b, 0xf7, 0xe4, 0xb5, 0x90, 0x9c, 0x9a, 0x5f, 0x90, + 0x9a, 0x07, 0xb7, 0xbc, 0x58, 0x3f, 0x3d, 0x5f, 0x17, 0xa2, 0x45, 0xcf, 0x05, 0x4c, 0x05, 0x41, + 0x4d, 0x10, 0x12, 0xe2, 0x62, 0x29, 0xce, 0xac, 0x4a, 0x95, 0x60, 0x56, 0x60, 0xd4, 0x60, 0x0e, + 0x02, 0xb3, 0x9d, 0xbc, 0x4e, 0x3c, 0x94, 0x63, 0xb8, 0xf1, 0x50, 0x8e, 0xa1, 0xe1, 0x91, 0x1c, + 0xe3, 0x89, 0x47, 0x72, 0x8c, 0x17, 0x1e, 0xc9, 0x31, 0x3e, 0x78, 0x24, 0xc7, 0x18, 0x65, 0x40, + 0x7c, 0x60, 0x58, 0x83, 0xc9, 0x08, 0x86, 0x24, 0x36, 0xb0, 0x17, 0x8d, 0x01, 0x01, 0x00, 0x00, + 0xff, 0xff, 0xea, 0xac, 0x78, 0x9a, 0x49, 0x01, 0x00, 0x00, +} diff --git a/vendor/github.com/containerd/containerd/api/types/doc.go b/vendor/github.com/containerd/containerd/api/types/doc.go new file mode 100644 index 0000000000..475b465ed4 --- /dev/null +++ b/vendor/github.com/containerd/containerd/api/types/doc.go @@ -0,0 +1,17 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package types diff --git a/vendor/github.com/containerd/containerd/api/types/metrics.pb.go b/vendor/github.com/containerd/containerd/api/types/metrics.pb.go new file mode 100644 index 0000000000..52e9f40a5a --- /dev/null +++ b/vendor/github.com/containerd/containerd/api/types/metrics.pb.go @@ -0,0 +1,412 @@ +// Code generated by protoc-gen-gogo. DO NOT EDIT. +// source: github.com/containerd/containerd/api/types/metrics.proto + +package types + +import proto "github.com/gogo/protobuf/proto" +import fmt "fmt" +import math "math" + +// skipping weak import gogoproto "github.com/gogo/protobuf/gogoproto" +import google_protobuf1 "github.com/gogo/protobuf/types" +import _ "github.com/gogo/protobuf/types" + +import time "time" + +import types1 "github.com/gogo/protobuf/types" + +import strings "strings" +import reflect "reflect" + +import io "io" + +// Reference imports to suppress errors if they are not otherwise used. +var _ = proto.Marshal +var _ = fmt.Errorf +var _ = math.Inf +var _ = time.Kitchen + +type Metric struct { + Timestamp time.Time `protobuf:"bytes,1,opt,name=timestamp,stdtime" json:"timestamp"` + ID string `protobuf:"bytes,2,opt,name=id,proto3" json:"id,omitempty"` + Data *google_protobuf1.Any `protobuf:"bytes,3,opt,name=data" json:"data,omitempty"` +} + +func (m *Metric) Reset() { *m = Metric{} } +func (*Metric) ProtoMessage() {} +func (*Metric) Descriptor() ([]byte, []int) { return fileDescriptorMetrics, []int{0} } + +func init() { + proto.RegisterType((*Metric)(nil), "containerd.types.Metric") +} +func (m *Metric) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *Metric) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + dAtA[i] = 0xa + i++ + i = encodeVarintMetrics(dAtA, i, uint64(types1.SizeOfStdTime(m.Timestamp))) + n1, err := types1.StdTimeMarshalTo(m.Timestamp, dAtA[i:]) + if err != nil { + return 0, err + } + i += n1 + if len(m.ID) > 0 { + dAtA[i] = 0x12 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(len(m.ID))) + i += copy(dAtA[i:], m.ID) + } + if m.Data != nil { + dAtA[i] = 0x1a + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Data.Size())) + n2, err := m.Data.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n2 + } + return i, nil +} + +func encodeVarintMetrics(dAtA []byte, offset int, v uint64) int { + for v >= 1<<7 { + dAtA[offset] = uint8(v&0x7f | 0x80) + v >>= 7 + offset++ + } + dAtA[offset] = uint8(v) + return offset + 1 +} +func (m *Metric) Size() (n int) { + var l int + _ = l + l = types1.SizeOfStdTime(m.Timestamp) + n += 1 + l + sovMetrics(uint64(l)) + l = len(m.ID) + if l > 0 { + n += 1 + l + sovMetrics(uint64(l)) + } + if m.Data != nil { + l = m.Data.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + return n +} + +func sovMetrics(x uint64) (n int) { + for { + n++ + x >>= 7 + if x == 0 { + break + } + } + return n +} +func sozMetrics(x uint64) (n int) { + return sovMetrics(uint64((x << 1) ^ uint64((int64(x) >> 63)))) +} +func (this *Metric) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&Metric{`, + `Timestamp:` + strings.Replace(strings.Replace(this.Timestamp.String(), "Timestamp", "google_protobuf2.Timestamp", 1), `&`, ``, 1) + `,`, + `ID:` + fmt.Sprintf("%v", this.ID) + `,`, + `Data:` + strings.Replace(fmt.Sprintf("%v", this.Data), "Any", "google_protobuf1.Any", 1) + `,`, + `}`, + }, "") + return s +} +func valueToStringMetrics(v interface{}) string { + rv := reflect.ValueOf(v) + if rv.IsNil() { + return "nil" + } + pv := reflect.Indirect(rv).Interface() + return fmt.Sprintf("*%v", pv) +} +func (m *Metric) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: Metric: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: Metric: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Timestamp", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex > l { + return io.ErrUnexpectedEOF + } + if err := types1.StdTimeUnmarshal(&m.Timestamp, dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ID = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 3: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Data", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Data == nil { + m.Data = &google_protobuf1.Any{} + } + if err := m.Data.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func skipMetrics(dAtA []byte) (n int, err error) { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowMetrics + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + wireType := int(wire & 0x7) + switch wireType { + case 0: + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowMetrics + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + iNdEx++ + if dAtA[iNdEx-1] < 0x80 { + break + } + } + return iNdEx, nil + case 1: + iNdEx += 8 + return iNdEx, nil + case 2: + var length int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowMetrics + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + length |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + iNdEx += length + if length < 0 { + return 0, ErrInvalidLengthMetrics + } + return iNdEx, nil + case 3: + for { + var innerWire uint64 + var start int = iNdEx + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowMetrics + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + innerWire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + innerWireType := int(innerWire & 0x7) + if innerWireType == 4 { + break + } + next, err := skipMetrics(dAtA[start:]) + if err != nil { + return 0, err + } + iNdEx = start + next + } + return iNdEx, nil + case 4: + return iNdEx, nil + case 5: + iNdEx += 4 + return iNdEx, nil + default: + return 0, fmt.Errorf("proto: illegal wireType %d", wireType) + } + } + panic("unreachable") +} + +var ( + ErrInvalidLengthMetrics = fmt.Errorf("proto: negative length found during unmarshaling") + ErrIntOverflowMetrics = fmt.Errorf("proto: integer overflow") +) + +func init() { + proto.RegisterFile("github.com/containerd/containerd/api/types/metrics.proto", fileDescriptorMetrics) +} + +var fileDescriptorMetrics = []byte{ + // 258 bytes of a gzipped FileDescriptorProto + 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0xe2, 0xb2, 0x48, 0xcf, 0x2c, 0xc9, + 0x28, 0x4d, 0xd2, 0x4b, 0xce, 0xcf, 0xd5, 0x4f, 0xce, 0xcf, 0x2b, 0x49, 0xcc, 0xcc, 0x4b, 0x2d, + 0x4a, 0x41, 0x66, 0x26, 0x16, 0x64, 0xea, 0x97, 0x54, 0x16, 0xa4, 0x16, 0xeb, 0xe7, 0xa6, 0x96, + 0x14, 0x65, 0x26, 0x17, 0xeb, 0x15, 0x14, 0xe5, 0x97, 0xe4, 0x0b, 0x09, 0x20, 0xd4, 0xe8, 0x81, + 0xe5, 0xa5, 0x44, 0xd2, 0xf3, 0xd3, 0xf3, 0xc1, 0x92, 0xfa, 0x20, 0x16, 0x44, 0x9d, 0x94, 0x64, + 0x7a, 0x7e, 0x7e, 0x7a, 0x4e, 0xaa, 0x3e, 0x98, 0x97, 0x54, 0x9a, 0xa6, 0x9f, 0x98, 0x57, 0x09, + 0x95, 0x92, 0x47, 0x97, 0x2a, 0xc9, 0xcc, 0x4d, 0x2d, 0x2e, 0x49, 0xcc, 0x2d, 0x80, 0x28, 0x50, + 0xea, 0x63, 0xe4, 0x62, 0xf3, 0x05, 0xdb, 0x2a, 0xe4, 0xc4, 0xc5, 0x09, 0x97, 0x95, 0x60, 0x54, + 0x60, 0xd4, 0xe0, 0x36, 0x92, 0xd2, 0x83, 0xe8, 0xd7, 0x83, 0xe9, 0xd7, 0x0b, 0x81, 0xa9, 0x70, + 0xe2, 0x38, 0x71, 0x4f, 0x9e, 0x61, 0xc2, 0x7d, 0x79, 0xc6, 0x20, 0x84, 0x36, 0x21, 0x31, 0x2e, + 0xa6, 0xcc, 0x14, 0x09, 0x26, 0x05, 0x46, 0x0d, 0x4e, 0x27, 0xb6, 0x47, 0xf7, 0xe4, 0x99, 0x3c, + 0x5d, 0x82, 0x98, 0x32, 0x53, 0x84, 0x34, 0xb8, 0x58, 0x52, 0x12, 0x4b, 0x12, 0x25, 0x98, 0xc1, + 0xc6, 0x8a, 0x60, 0x18, 0xeb, 0x98, 0x57, 0x19, 0x04, 0x56, 0xe1, 0xe4, 0x75, 0xe2, 0xa1, 0x1c, + 0xc3, 0x8d, 0x87, 0x72, 0x0c, 0x0d, 0x8f, 0xe4, 0x18, 0x4f, 0x3c, 0x92, 0x63, 0xbc, 0xf0, 0x48, + 0x8e, 0xf1, 0xc1, 0x23, 0x39, 0xc6, 0x28, 0x03, 0xe2, 0x03, 0xd2, 0x1a, 0x4c, 0x46, 0x30, 0x24, + 0xb1, 0x81, 0x6d, 0x30, 0x06, 0x04, 0x00, 0x00, 0xff, 0xff, 0xde, 0x0d, 0x02, 0xfe, 0x85, 0x01, + 0x00, 0x00, +} diff --git a/vendor/github.com/containerd/containerd/api/types/mount.pb.go b/vendor/github.com/containerd/containerd/api/types/mount.pb.go new file mode 100644 index 0000000000..f7a9c3c1fe --- /dev/null +++ b/vendor/github.com/containerd/containerd/api/types/mount.pb.go @@ -0,0 +1,456 @@ +// Code generated by protoc-gen-gogo. DO NOT EDIT. +// source: github.com/containerd/containerd/api/types/mount.proto + +package types + +import proto "github.com/gogo/protobuf/proto" +import fmt "fmt" +import math "math" + +// skipping weak import gogoproto "github.com/gogo/protobuf/gogoproto" + +import strings "strings" +import reflect "reflect" + +import io "io" + +// Reference imports to suppress errors if they are not otherwise used. +var _ = proto.Marshal +var _ = fmt.Errorf +var _ = math.Inf + +// Mount describes mounts for a container. +// +// This type is the lingua franca of ContainerD. All services provide mounts +// to be used with the container at creation time. +// +// The Mount type follows the structure of the mount syscall, including a type, +// source, target and options. +type Mount struct { + // Type defines the nature of the mount. + Type string `protobuf:"bytes,1,opt,name=type,proto3" json:"type,omitempty"` + // Source specifies the name of the mount. Depending on mount type, this + // may be a volume name or a host path, or even ignored. + Source string `protobuf:"bytes,2,opt,name=source,proto3" json:"source,omitempty"` + // Target path in container + Target string `protobuf:"bytes,3,opt,name=target,proto3" json:"target,omitempty"` + // Options specifies zero or more fstab style mount options. + Options []string `protobuf:"bytes,4,rep,name=options" json:"options,omitempty"` +} + +func (m *Mount) Reset() { *m = Mount{} } +func (*Mount) ProtoMessage() {} +func (*Mount) Descriptor() ([]byte, []int) { return fileDescriptorMount, []int{0} } + +func init() { + proto.RegisterType((*Mount)(nil), "containerd.types.Mount") +} +func (m *Mount) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *Mount) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.Type) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintMount(dAtA, i, uint64(len(m.Type))) + i += copy(dAtA[i:], m.Type) + } + if len(m.Source) > 0 { + dAtA[i] = 0x12 + i++ + i = encodeVarintMount(dAtA, i, uint64(len(m.Source))) + i += copy(dAtA[i:], m.Source) + } + if len(m.Target) > 0 { + dAtA[i] = 0x1a + i++ + i = encodeVarintMount(dAtA, i, uint64(len(m.Target))) + i += copy(dAtA[i:], m.Target) + } + if len(m.Options) > 0 { + for _, s := range m.Options { + dAtA[i] = 0x22 + i++ + l = len(s) + for l >= 1<<7 { + dAtA[i] = uint8(uint64(l)&0x7f | 0x80) + l >>= 7 + i++ + } + dAtA[i] = uint8(l) + i++ + i += copy(dAtA[i:], s) + } + } + return i, nil +} + +func encodeVarintMount(dAtA []byte, offset int, v uint64) int { + for v >= 1<<7 { + dAtA[offset] = uint8(v&0x7f | 0x80) + v >>= 7 + offset++ + } + dAtA[offset] = uint8(v) + return offset + 1 +} +func (m *Mount) Size() (n int) { + var l int + _ = l + l = len(m.Type) + if l > 0 { + n += 1 + l + sovMount(uint64(l)) + } + l = len(m.Source) + if l > 0 { + n += 1 + l + sovMount(uint64(l)) + } + l = len(m.Target) + if l > 0 { + n += 1 + l + sovMount(uint64(l)) + } + if len(m.Options) > 0 { + for _, s := range m.Options { + l = len(s) + n += 1 + l + sovMount(uint64(l)) + } + } + return n +} + +func sovMount(x uint64) (n int) { + for { + n++ + x >>= 7 + if x == 0 { + break + } + } + return n +} +func sozMount(x uint64) (n int) { + return sovMount(uint64((x << 1) ^ uint64((int64(x) >> 63)))) +} +func (this *Mount) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&Mount{`, + `Type:` + fmt.Sprintf("%v", this.Type) + `,`, + `Source:` + fmt.Sprintf("%v", this.Source) + `,`, + `Target:` + fmt.Sprintf("%v", this.Target) + `,`, + `Options:` + fmt.Sprintf("%v", this.Options) + `,`, + `}`, + }, "") + return s +} +func valueToStringMount(v interface{}) string { + rv := reflect.ValueOf(v) + if rv.IsNil() { + return "nil" + } + pv := reflect.Indirect(rv).Interface() + return fmt.Sprintf("*%v", pv) +} +func (m *Mount) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMount + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: Mount: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: Mount: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Type", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMount + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthMount + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Type = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Source", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMount + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthMount + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Source = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 3: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Target", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMount + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthMount + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Target = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 4: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Options", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMount + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthMount + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Options = append(m.Options, string(dAtA[iNdEx:postIndex])) + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipMount(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMount + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func skipMount(dAtA []byte) (n int, err error) { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowMount + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + wireType := int(wire & 0x7) + switch wireType { + case 0: + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowMount + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + iNdEx++ + if dAtA[iNdEx-1] < 0x80 { + break + } + } + return iNdEx, nil + case 1: + iNdEx += 8 + return iNdEx, nil + case 2: + var length int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowMount + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + length |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + iNdEx += length + if length < 0 { + return 0, ErrInvalidLengthMount + } + return iNdEx, nil + case 3: + for { + var innerWire uint64 + var start int = iNdEx + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowMount + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + innerWire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + innerWireType := int(innerWire & 0x7) + if innerWireType == 4 { + break + } + next, err := skipMount(dAtA[start:]) + if err != nil { + return 0, err + } + iNdEx = start + next + } + return iNdEx, nil + case 4: + return iNdEx, nil + case 5: + iNdEx += 4 + return iNdEx, nil + default: + return 0, fmt.Errorf("proto: illegal wireType %d", wireType) + } + } + panic("unreachable") +} + +var ( + ErrInvalidLengthMount = fmt.Errorf("proto: negative length found during unmarshaling") + ErrIntOverflowMount = fmt.Errorf("proto: integer overflow") +) + +func init() { + proto.RegisterFile("github.com/containerd/containerd/api/types/mount.proto", fileDescriptorMount) +} + +var fileDescriptorMount = []byte{ + // 202 bytes of a gzipped FileDescriptorProto + 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0xe2, 0x32, 0x4b, 0xcf, 0x2c, 0xc9, + 0x28, 0x4d, 0xd2, 0x4b, 0xce, 0xcf, 0xd5, 0x4f, 0xce, 0xcf, 0x2b, 0x49, 0xcc, 0xcc, 0x4b, 0x2d, + 0x4a, 0x41, 0x66, 0x26, 0x16, 0x64, 0xea, 0x97, 0x54, 0x16, 0xa4, 0x16, 0xeb, 0xe7, 0xe6, 0x97, + 0xe6, 0x95, 0xe8, 0x15, 0x14, 0xe5, 0x97, 0xe4, 0x0b, 0x09, 0x20, 0x54, 0xe8, 0x81, 0x65, 0xa5, + 0x44, 0xd2, 0xf3, 0xd3, 0xf3, 0xc1, 0x92, 0xfa, 0x20, 0x16, 0x44, 0x9d, 0x52, 0x2a, 0x17, 0xab, + 0x2f, 0x48, 0x9b, 0x90, 0x10, 0x17, 0x0b, 0x48, 0x9d, 0x04, 0xa3, 0x02, 0xa3, 0x06, 0x67, 0x10, + 0x98, 0x2d, 0x24, 0xc6, 0xc5, 0x56, 0x9c, 0x5f, 0x5a, 0x94, 0x9c, 0x2a, 0xc1, 0x04, 0x16, 0x85, + 0xf2, 0x40, 0xe2, 0x25, 0x89, 0x45, 0xe9, 0xa9, 0x25, 0x12, 0xcc, 0x10, 0x71, 0x08, 0x4f, 0x48, + 0x82, 0x8b, 0x3d, 0xbf, 0xa0, 0x24, 0x33, 0x3f, 0xaf, 0x58, 0x82, 0x45, 0x81, 0x59, 0x83, 0x33, + 0x08, 0xc6, 0x75, 0xf2, 0x3a, 0xf1, 0x50, 0x8e, 0xe1, 0xc6, 0x43, 0x39, 0x86, 0x86, 0x47, 0x72, + 0x8c, 0x27, 0x1e, 0xc9, 0x31, 0x5e, 0x78, 0x24, 0xc7, 0xf8, 0xe0, 0x91, 0x1c, 0x63, 0x94, 0x01, + 0xf1, 0x1e, 0xb4, 0x06, 0x93, 0x11, 0x0c, 0x49, 0x6c, 0x60, 0xb7, 0x1b, 0x03, 0x02, 0x00, 0x00, + 0xff, 0xff, 0x82, 0x1c, 0x02, 0x18, 0x1d, 0x01, 0x00, 0x00, +} diff --git a/vendor/github.com/containerd/containerd/api/types/platform.pb.go b/vendor/github.com/containerd/containerd/api/types/platform.pb.go new file mode 100644 index 0000000000..ba9a3bf881 --- /dev/null +++ b/vendor/github.com/containerd/containerd/api/types/platform.pb.go @@ -0,0 +1,394 @@ +// Code generated by protoc-gen-gogo. DO NOT EDIT. +// source: github.com/containerd/containerd/api/types/platform.proto + +package types + +import proto "github.com/gogo/protobuf/proto" +import fmt "fmt" +import math "math" + +// skipping weak import gogoproto "github.com/gogo/protobuf/gogoproto" + +import strings "strings" +import reflect "reflect" + +import io "io" + +// Reference imports to suppress errors if they are not otherwise used. +var _ = proto.Marshal +var _ = fmt.Errorf +var _ = math.Inf + +// Platform follows the structure of the OCI platform specification, from +// descriptors. +type Platform struct { + OS string `protobuf:"bytes,1,opt,name=os,proto3" json:"os,omitempty"` + Architecture string `protobuf:"bytes,2,opt,name=architecture,proto3" json:"architecture,omitempty"` + Variant string `protobuf:"bytes,3,opt,name=variant,proto3" json:"variant,omitempty"` +} + +func (m *Platform) Reset() { *m = Platform{} } +func (*Platform) ProtoMessage() {} +func (*Platform) Descriptor() ([]byte, []int) { return fileDescriptorPlatform, []int{0} } + +func init() { + proto.RegisterType((*Platform)(nil), "containerd.types.Platform") +} +func (m *Platform) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *Platform) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.OS) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintPlatform(dAtA, i, uint64(len(m.OS))) + i += copy(dAtA[i:], m.OS) + } + if len(m.Architecture) > 0 { + dAtA[i] = 0x12 + i++ + i = encodeVarintPlatform(dAtA, i, uint64(len(m.Architecture))) + i += copy(dAtA[i:], m.Architecture) + } + if len(m.Variant) > 0 { + dAtA[i] = 0x1a + i++ + i = encodeVarintPlatform(dAtA, i, uint64(len(m.Variant))) + i += copy(dAtA[i:], m.Variant) + } + return i, nil +} + +func encodeVarintPlatform(dAtA []byte, offset int, v uint64) int { + for v >= 1<<7 { + dAtA[offset] = uint8(v&0x7f | 0x80) + v >>= 7 + offset++ + } + dAtA[offset] = uint8(v) + return offset + 1 +} +func (m *Platform) Size() (n int) { + var l int + _ = l + l = len(m.OS) + if l > 0 { + n += 1 + l + sovPlatform(uint64(l)) + } + l = len(m.Architecture) + if l > 0 { + n += 1 + l + sovPlatform(uint64(l)) + } + l = len(m.Variant) + if l > 0 { + n += 1 + l + sovPlatform(uint64(l)) + } + return n +} + +func sovPlatform(x uint64) (n int) { + for { + n++ + x >>= 7 + if x == 0 { + break + } + } + return n +} +func sozPlatform(x uint64) (n int) { + return sovPlatform(uint64((x << 1) ^ uint64((int64(x) >> 63)))) +} +func (this *Platform) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&Platform{`, + `OS:` + fmt.Sprintf("%v", this.OS) + `,`, + `Architecture:` + fmt.Sprintf("%v", this.Architecture) + `,`, + `Variant:` + fmt.Sprintf("%v", this.Variant) + `,`, + `}`, + }, "") + return s +} +func valueToStringPlatform(v interface{}) string { + rv := reflect.ValueOf(v) + if rv.IsNil() { + return "nil" + } + pv := reflect.Indirect(rv).Interface() + return fmt.Sprintf("*%v", pv) +} +func (m *Platform) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowPlatform + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: Platform: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: Platform: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field OS", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowPlatform + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthPlatform + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.OS = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Architecture", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowPlatform + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthPlatform + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Architecture = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 3: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Variant", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowPlatform + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthPlatform + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Variant = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipPlatform(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthPlatform + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func skipPlatform(dAtA []byte) (n int, err error) { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowPlatform + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + wireType := int(wire & 0x7) + switch wireType { + case 0: + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowPlatform + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + iNdEx++ + if dAtA[iNdEx-1] < 0x80 { + break + } + } + return iNdEx, nil + case 1: + iNdEx += 8 + return iNdEx, nil + case 2: + var length int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowPlatform + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + length |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + iNdEx += length + if length < 0 { + return 0, ErrInvalidLengthPlatform + } + return iNdEx, nil + case 3: + for { + var innerWire uint64 + var start int = iNdEx + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowPlatform + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + innerWire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + innerWireType := int(innerWire & 0x7) + if innerWireType == 4 { + break + } + next, err := skipPlatform(dAtA[start:]) + if err != nil { + return 0, err + } + iNdEx = start + next + } + return iNdEx, nil + case 4: + return iNdEx, nil + case 5: + iNdEx += 4 + return iNdEx, nil + default: + return 0, fmt.Errorf("proto: illegal wireType %d", wireType) + } + } + panic("unreachable") +} + +var ( + ErrInvalidLengthPlatform = fmt.Errorf("proto: negative length found during unmarshaling") + ErrIntOverflowPlatform = fmt.Errorf("proto: integer overflow") +) + +func init() { + proto.RegisterFile("github.com/containerd/containerd/api/types/platform.proto", fileDescriptorPlatform) +} + +var fileDescriptorPlatform = []byte{ + // 205 bytes of a gzipped FileDescriptorProto + 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0xe2, 0xb2, 0x4c, 0xcf, 0x2c, 0xc9, + 0x28, 0x4d, 0xd2, 0x4b, 0xce, 0xcf, 0xd5, 0x4f, 0xce, 0xcf, 0x2b, 0x49, 0xcc, 0xcc, 0x4b, 0x2d, + 0x4a, 0x41, 0x66, 0x26, 0x16, 0x64, 0xea, 0x97, 0x54, 0x16, 0xa4, 0x16, 0xeb, 0x17, 0xe4, 0x24, + 0x96, 0xa4, 0xe5, 0x17, 0xe5, 0xea, 0x15, 0x14, 0xe5, 0x97, 0xe4, 0x0b, 0x09, 0x20, 0x14, 0xe9, + 0x81, 0x15, 0x48, 0x89, 0xa4, 0xe7, 0xa7, 0xe7, 0x83, 0x25, 0xf5, 0x41, 0x2c, 0x88, 0x3a, 0xa5, + 0x04, 0x2e, 0x8e, 0x00, 0xa8, 0x4e, 0x21, 0x31, 0x2e, 0xa6, 0xfc, 0x62, 0x09, 0x46, 0x05, 0x46, + 0x0d, 0x4e, 0x27, 0xb6, 0x47, 0xf7, 0xe4, 0x99, 0xfc, 0x83, 0x83, 0x98, 0xf2, 0x8b, 0x85, 0x94, + 0xb8, 0x78, 0x12, 0x8b, 0x92, 0x33, 0x32, 0x4b, 0x52, 0x93, 0x4b, 0x4a, 0x8b, 0x52, 0x25, 0x98, + 0x40, 0x2a, 0x82, 0x50, 0xc4, 0x84, 0x24, 0xb8, 0xd8, 0xcb, 0x12, 0x8b, 0x32, 0x13, 0xf3, 0x4a, + 0x24, 0x98, 0xc1, 0xd2, 0x30, 0xae, 0x93, 0xd7, 0x89, 0x87, 0x72, 0x0c, 0x37, 0x1e, 0xca, 0x31, + 0x34, 0x3c, 0x92, 0x63, 0x3c, 0xf1, 0x48, 0x8e, 0xf1, 0xc2, 0x23, 0x39, 0xc6, 0x07, 0x8f, 0xe4, + 0x18, 0xa3, 0x0c, 0x88, 0xf7, 0x9e, 0x35, 0x98, 0x8c, 0x60, 0x48, 0x62, 0x03, 0x3b, 0xdb, 0x18, + 0x10, 0x00, 0x00, 0xff, 0xff, 0x05, 0xaa, 0xda, 0xa1, 0x1b, 0x01, 0x00, 0x00, +} diff --git a/vendor/github.com/containerd/containerd/api/types/task/task.pb.go b/vendor/github.com/containerd/containerd/api/types/task/task.pb.go new file mode 100644 index 0000000000..437abe8f4c --- /dev/null +++ b/vendor/github.com/containerd/containerd/api/types/task/task.pb.go @@ -0,0 +1,890 @@ +// Code generated by protoc-gen-gogo. DO NOT EDIT. +// source: github.com/containerd/containerd/api/types/task/task.proto + +/* + Package task is a generated protocol buffer package. + + It is generated from these files: + github.com/containerd/containerd/api/types/task/task.proto + + It has these top-level messages: + Process + ProcessInfo +*/ +package task + +import proto "github.com/gogo/protobuf/proto" +import fmt "fmt" +import math "math" + +// skipping weak import gogoproto "github.com/gogo/protobuf/gogoproto" +import _ "github.com/gogo/protobuf/types" +import google_protobuf2 "github.com/gogo/protobuf/types" + +import time "time" + +import types "github.com/gogo/protobuf/types" + +import strings "strings" +import reflect "reflect" + +import io "io" + +// Reference imports to suppress errors if they are not otherwise used. +var _ = proto.Marshal +var _ = fmt.Errorf +var _ = math.Inf +var _ = time.Kitchen + +// This is a compile-time assertion to ensure that this generated file +// is compatible with the proto package it is being compiled against. +// A compilation error at this line likely means your copy of the +// proto package needs to be updated. +const _ = proto.GoGoProtoPackageIsVersion2 // please upgrade the proto package + +type Status int32 + +const ( + StatusUnknown Status = 0 + StatusCreated Status = 1 + StatusRunning Status = 2 + StatusStopped Status = 3 + StatusPaused Status = 4 + StatusPausing Status = 5 +) + +var Status_name = map[int32]string{ + 0: "UNKNOWN", + 1: "CREATED", + 2: "RUNNING", + 3: "STOPPED", + 4: "PAUSED", + 5: "PAUSING", +} +var Status_value = map[string]int32{ + "UNKNOWN": 0, + "CREATED": 1, + "RUNNING": 2, + "STOPPED": 3, + "PAUSED": 4, + "PAUSING": 5, +} + +func (x Status) String() string { + return proto.EnumName(Status_name, int32(x)) +} +func (Status) EnumDescriptor() ([]byte, []int) { return fileDescriptorTask, []int{0} } + +type Process struct { + ContainerID string `protobuf:"bytes,1,opt,name=container_id,json=containerId,proto3" json:"container_id,omitempty"` + ID string `protobuf:"bytes,2,opt,name=id,proto3" json:"id,omitempty"` + Pid uint32 `protobuf:"varint,3,opt,name=pid,proto3" json:"pid,omitempty"` + Status Status `protobuf:"varint,4,opt,name=status,proto3,enum=containerd.v1.types.Status" json:"status,omitempty"` + Stdin string `protobuf:"bytes,5,opt,name=stdin,proto3" json:"stdin,omitempty"` + Stdout string `protobuf:"bytes,6,opt,name=stdout,proto3" json:"stdout,omitempty"` + Stderr string `protobuf:"bytes,7,opt,name=stderr,proto3" json:"stderr,omitempty"` + Terminal bool `protobuf:"varint,8,opt,name=terminal,proto3" json:"terminal,omitempty"` + ExitStatus uint32 `protobuf:"varint,9,opt,name=exit_status,json=exitStatus,proto3" json:"exit_status,omitempty"` + ExitedAt time.Time `protobuf:"bytes,10,opt,name=exited_at,json=exitedAt,stdtime" json:"exited_at"` +} + +func (m *Process) Reset() { *m = Process{} } +func (*Process) ProtoMessage() {} +func (*Process) Descriptor() ([]byte, []int) { return fileDescriptorTask, []int{0} } + +type ProcessInfo struct { + // PID is the process ID. + Pid uint32 `protobuf:"varint,1,opt,name=pid,proto3" json:"pid,omitempty"` + // Info contains additional process information. + // + // Info varies by platform. + Info *google_protobuf2.Any `protobuf:"bytes,2,opt,name=info" json:"info,omitempty"` +} + +func (m *ProcessInfo) Reset() { *m = ProcessInfo{} } +func (*ProcessInfo) ProtoMessage() {} +func (*ProcessInfo) Descriptor() ([]byte, []int) { return fileDescriptorTask, []int{1} } + +func init() { + proto.RegisterType((*Process)(nil), "containerd.v1.types.Process") + proto.RegisterType((*ProcessInfo)(nil), "containerd.v1.types.ProcessInfo") + proto.RegisterEnum("containerd.v1.types.Status", Status_name, Status_value) +} +func (m *Process) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *Process) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.ContainerID) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintTask(dAtA, i, uint64(len(m.ContainerID))) + i += copy(dAtA[i:], m.ContainerID) + } + if len(m.ID) > 0 { + dAtA[i] = 0x12 + i++ + i = encodeVarintTask(dAtA, i, uint64(len(m.ID))) + i += copy(dAtA[i:], m.ID) + } + if m.Pid != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintTask(dAtA, i, uint64(m.Pid)) + } + if m.Status != 0 { + dAtA[i] = 0x20 + i++ + i = encodeVarintTask(dAtA, i, uint64(m.Status)) + } + if len(m.Stdin) > 0 { + dAtA[i] = 0x2a + i++ + i = encodeVarintTask(dAtA, i, uint64(len(m.Stdin))) + i += copy(dAtA[i:], m.Stdin) + } + if len(m.Stdout) > 0 { + dAtA[i] = 0x32 + i++ + i = encodeVarintTask(dAtA, i, uint64(len(m.Stdout))) + i += copy(dAtA[i:], m.Stdout) + } + if len(m.Stderr) > 0 { + dAtA[i] = 0x3a + i++ + i = encodeVarintTask(dAtA, i, uint64(len(m.Stderr))) + i += copy(dAtA[i:], m.Stderr) + } + if m.Terminal { + dAtA[i] = 0x40 + i++ + if m.Terminal { + dAtA[i] = 1 + } else { + dAtA[i] = 0 + } + i++ + } + if m.ExitStatus != 0 { + dAtA[i] = 0x48 + i++ + i = encodeVarintTask(dAtA, i, uint64(m.ExitStatus)) + } + dAtA[i] = 0x52 + i++ + i = encodeVarintTask(dAtA, i, uint64(types.SizeOfStdTime(m.ExitedAt))) + n1, err := types.StdTimeMarshalTo(m.ExitedAt, dAtA[i:]) + if err != nil { + return 0, err + } + i += n1 + return i, nil +} + +func (m *ProcessInfo) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *ProcessInfo) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if m.Pid != 0 { + dAtA[i] = 0x8 + i++ + i = encodeVarintTask(dAtA, i, uint64(m.Pid)) + } + if m.Info != nil { + dAtA[i] = 0x12 + i++ + i = encodeVarintTask(dAtA, i, uint64(m.Info.Size())) + n2, err := m.Info.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n2 + } + return i, nil +} + +func encodeVarintTask(dAtA []byte, offset int, v uint64) int { + for v >= 1<<7 { + dAtA[offset] = uint8(v&0x7f | 0x80) + v >>= 7 + offset++ + } + dAtA[offset] = uint8(v) + return offset + 1 +} +func (m *Process) Size() (n int) { + var l int + _ = l + l = len(m.ContainerID) + if l > 0 { + n += 1 + l + sovTask(uint64(l)) + } + l = len(m.ID) + if l > 0 { + n += 1 + l + sovTask(uint64(l)) + } + if m.Pid != 0 { + n += 1 + sovTask(uint64(m.Pid)) + } + if m.Status != 0 { + n += 1 + sovTask(uint64(m.Status)) + } + l = len(m.Stdin) + if l > 0 { + n += 1 + l + sovTask(uint64(l)) + } + l = len(m.Stdout) + if l > 0 { + n += 1 + l + sovTask(uint64(l)) + } + l = len(m.Stderr) + if l > 0 { + n += 1 + l + sovTask(uint64(l)) + } + if m.Terminal { + n += 2 + } + if m.ExitStatus != 0 { + n += 1 + sovTask(uint64(m.ExitStatus)) + } + l = types.SizeOfStdTime(m.ExitedAt) + n += 1 + l + sovTask(uint64(l)) + return n +} + +func (m *ProcessInfo) Size() (n int) { + var l int + _ = l + if m.Pid != 0 { + n += 1 + sovTask(uint64(m.Pid)) + } + if m.Info != nil { + l = m.Info.Size() + n += 1 + l + sovTask(uint64(l)) + } + return n +} + +func sovTask(x uint64) (n int) { + for { + n++ + x >>= 7 + if x == 0 { + break + } + } + return n +} +func sozTask(x uint64) (n int) { + return sovTask(uint64((x << 1) ^ uint64((int64(x) >> 63)))) +} +func (this *Process) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&Process{`, + `ContainerID:` + fmt.Sprintf("%v", this.ContainerID) + `,`, + `ID:` + fmt.Sprintf("%v", this.ID) + `,`, + `Pid:` + fmt.Sprintf("%v", this.Pid) + `,`, + `Status:` + fmt.Sprintf("%v", this.Status) + `,`, + `Stdin:` + fmt.Sprintf("%v", this.Stdin) + `,`, + `Stdout:` + fmt.Sprintf("%v", this.Stdout) + `,`, + `Stderr:` + fmt.Sprintf("%v", this.Stderr) + `,`, + `Terminal:` + fmt.Sprintf("%v", this.Terminal) + `,`, + `ExitStatus:` + fmt.Sprintf("%v", this.ExitStatus) + `,`, + `ExitedAt:` + strings.Replace(strings.Replace(this.ExitedAt.String(), "Timestamp", "google_protobuf1.Timestamp", 1), `&`, ``, 1) + `,`, + `}`, + }, "") + return s +} +func (this *ProcessInfo) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&ProcessInfo{`, + `Pid:` + fmt.Sprintf("%v", this.Pid) + `,`, + `Info:` + strings.Replace(fmt.Sprintf("%v", this.Info), "Any", "google_protobuf2.Any", 1) + `,`, + `}`, + }, "") + return s +} +func valueToStringTask(v interface{}) string { + rv := reflect.ValueOf(v) + if rv.IsNil() { + return "nil" + } + pv := reflect.Indirect(rv).Interface() + return fmt.Sprintf("*%v", pv) +} +func (m *Process) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: Process: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: Process: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ContainerID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthTask + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ContainerID = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthTask + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ID = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Pid", wireType) + } + m.Pid = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Pid |= (uint32(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + case 4: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Status", wireType) + } + m.Status = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Status |= (Status(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + case 5: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Stdin", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthTask + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Stdin = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 6: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Stdout", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthTask + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Stdout = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 7: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Stderr", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthTask + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Stderr = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 8: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Terminal", wireType) + } + var v int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + v |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + m.Terminal = bool(v != 0) + case 9: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field ExitStatus", wireType) + } + m.ExitStatus = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.ExitStatus |= (uint32(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + case 10: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ExitedAt", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthTask + } + postIndex := iNdEx + msglen + if postIndex > l { + return io.ErrUnexpectedEOF + } + if err := types.StdTimeUnmarshal(&m.ExitedAt, dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipTask(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthTask + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *ProcessInfo) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: ProcessInfo: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: ProcessInfo: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Pid", wireType) + } + m.Pid = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Pid |= (uint32(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Info", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowTask + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthTask + } + postIndex := iNdEx + msglen + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Info == nil { + m.Info = &google_protobuf2.Any{} + } + if err := m.Info.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipTask(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthTask + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func skipTask(dAtA []byte) (n int, err error) { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowTask + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + wireType := int(wire & 0x7) + switch wireType { + case 0: + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowTask + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + iNdEx++ + if dAtA[iNdEx-1] < 0x80 { + break + } + } + return iNdEx, nil + case 1: + iNdEx += 8 + return iNdEx, nil + case 2: + var length int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowTask + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + length |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + iNdEx += length + if length < 0 { + return 0, ErrInvalidLengthTask + } + return iNdEx, nil + case 3: + for { + var innerWire uint64 + var start int = iNdEx + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowTask + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + innerWire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + innerWireType := int(innerWire & 0x7) + if innerWireType == 4 { + break + } + next, err := skipTask(dAtA[start:]) + if err != nil { + return 0, err + } + iNdEx = start + next + } + return iNdEx, nil + case 4: + return iNdEx, nil + case 5: + iNdEx += 4 + return iNdEx, nil + default: + return 0, fmt.Errorf("proto: illegal wireType %d", wireType) + } + } + panic("unreachable") +} + +var ( + ErrInvalidLengthTask = fmt.Errorf("proto: negative length found during unmarshaling") + ErrIntOverflowTask = fmt.Errorf("proto: integer overflow") +) + +func init() { + proto.RegisterFile("github.com/containerd/containerd/api/types/task/task.proto", fileDescriptorTask) +} + +var fileDescriptorTask = []byte{ + // 545 bytes of a gzipped FileDescriptorProto + 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0x6c, 0x90, 0x3f, 0x6f, 0xd3, 0x40, + 0x18, 0xc6, 0x7d, 0x6e, 0xeb, 0xa6, 0xe7, 0xb6, 0x18, 0x13, 0x55, 0xc6, 0x20, 0xdb, 0xea, 0x64, + 0x31, 0xd8, 0x22, 0xdd, 0xd8, 0xf2, 0x4f, 0xc8, 0x42, 0x72, 0x23, 0x27, 0x11, 0x6c, 0x91, 0x13, + 0x5f, 0xcc, 0xa9, 0xcd, 0x9d, 0x65, 0x9f, 0x81, 0x6c, 0x8c, 0xa8, 0x13, 0x5f, 0xa0, 0x13, 0x7c, + 0x0a, 0x3e, 0x41, 0x46, 0x26, 0xc4, 0x14, 0xa8, 0x3f, 0x09, 0x3a, 0xdb, 0x49, 0x23, 0x60, 0x39, + 0xbd, 0xef, 0xf3, 0x7b, 0xee, 0xbd, 0xf7, 0x1e, 0xf8, 0x22, 0xc6, 0xec, 0x6d, 0x3e, 0x75, 0x66, + 0x74, 0xe1, 0xce, 0x28, 0x61, 0x21, 0x26, 0x28, 0x8d, 0x76, 0xcb, 0x30, 0xc1, 0x2e, 0x5b, 0x26, + 0x28, 0x73, 0x59, 0x98, 0x5d, 0x95, 0x87, 0x93, 0xa4, 0x94, 0x51, 0xf5, 0xd1, 0xbd, 0xcb, 0x79, + 0xf7, 0xdc, 0x29, 0x4d, 0x7a, 0x33, 0xa6, 0x31, 0x2d, 0xb9, 0xcb, 0xab, 0xca, 0xaa, 0x9b, 0x31, + 0xa5, 0xf1, 0x35, 0x72, 0xcb, 0x6e, 0x9a, 0xcf, 0x5d, 0x86, 0x17, 0x28, 0x63, 0xe1, 0x22, 0xa9, + 0x0d, 0x8f, 0xff, 0x36, 0x84, 0x64, 0x59, 0xa1, 0xf3, 0x42, 0x84, 0x87, 0x83, 0x94, 0xce, 0x50, + 0x96, 0xa9, 0x2d, 0x78, 0xbc, 0x7d, 0x74, 0x82, 0x23, 0x0d, 0x58, 0xc0, 0x3e, 0xea, 0x3c, 0x28, + 0xd6, 0xa6, 0xdc, 0xdd, 0xe8, 0x5e, 0x2f, 0x90, 0xb7, 0x26, 0x2f, 0x52, 0xcf, 0xa0, 0x88, 0x23, + 0x4d, 0x2c, 0x9d, 0x52, 0xb1, 0x36, 0x45, 0xaf, 0x17, 0x88, 0x38, 0x52, 0x15, 0xb8, 0x97, 0xe0, + 0x48, 0xdb, 0xb3, 0x80, 0x7d, 0x12, 0xf0, 0x52, 0xbd, 0x80, 0x52, 0xc6, 0x42, 0x96, 0x67, 0xda, + 0xbe, 0x05, 0xec, 0xd3, 0xd6, 0x13, 0xe7, 0x3f, 0x3f, 0x74, 0x86, 0xa5, 0x25, 0xa8, 0xad, 0x6a, + 0x13, 0x1e, 0x64, 0x2c, 0xc2, 0x44, 0x3b, 0xe0, 0x2f, 0x04, 0x55, 0xa3, 0x9e, 0xf1, 0x51, 0x11, + 0xcd, 0x99, 0x26, 0x95, 0x72, 0xdd, 0xd5, 0x3a, 0x4a, 0x53, 0xed, 0x70, 0xab, 0xa3, 0x34, 0x55, + 0x75, 0xd8, 0x60, 0x28, 0x5d, 0x60, 0x12, 0x5e, 0x6b, 0x0d, 0x0b, 0xd8, 0x8d, 0x60, 0xdb, 0xab, + 0x26, 0x94, 0xd1, 0x07, 0xcc, 0x26, 0xf5, 0x6e, 0x47, 0xe5, 0xc2, 0x90, 0x4b, 0xd5, 0x2a, 0x6a, + 0x1b, 0x1e, 0xf1, 0x0e, 0x45, 0x93, 0x90, 0x69, 0xd0, 0x02, 0xb6, 0xdc, 0xd2, 0x9d, 0x2a, 0x50, + 0x67, 0x13, 0xa8, 0x33, 0xda, 0x24, 0xde, 0x69, 0xac, 0xd6, 0xa6, 0xf0, 0xf9, 0x97, 0x09, 0x82, + 0x46, 0x75, 0xad, 0xcd, 0xce, 0x3d, 0x28, 0xd7, 0x19, 0x7b, 0x64, 0x4e, 0x37, 0xd9, 0x80, 0xfb, + 0x6c, 0x6c, 0xb8, 0x8f, 0xc9, 0x9c, 0x96, 0x39, 0xca, 0xad, 0xe6, 0x3f, 0xe3, 0xdb, 0x64, 0x19, + 0x94, 0x8e, 0x67, 0x3f, 0x00, 0x94, 0xea, 0xc5, 0x0c, 0x78, 0x38, 0xf6, 0x5f, 0xf9, 0x97, 0xaf, + 0x7d, 0x45, 0xd0, 0x1f, 0xde, 0xdc, 0x5a, 0x27, 0x15, 0x18, 0x93, 0x2b, 0x42, 0xdf, 0x13, 0xce, + 0xbb, 0x41, 0xbf, 0x3d, 0xea, 0xf7, 0x14, 0xb0, 0xcb, 0xbb, 0x29, 0x0a, 0x19, 0x8a, 0x38, 0x0f, + 0xc6, 0xbe, 0xef, 0xf9, 0x2f, 0x15, 0x71, 0x97, 0x07, 0x39, 0x21, 0x98, 0xc4, 0x9c, 0x0f, 0x47, + 0x97, 0x83, 0x41, 0xbf, 0xa7, 0xec, 0xed, 0xf2, 0x21, 0xa3, 0x49, 0x82, 0x22, 0xf5, 0x29, 0x94, + 0x06, 0xed, 0xf1, 0xb0, 0xdf, 0x53, 0xf6, 0x75, 0xe5, 0xe6, 0xd6, 0x3a, 0xae, 0xf0, 0x20, 0xcc, + 0xb3, 0x6a, 0x3a, 0xa7, 0x7c, 0xfa, 0xc1, 0xee, 0x6d, 0x8e, 0x31, 0x89, 0xf5, 0xd3, 0x4f, 0x5f, + 0x0c, 0xe1, 0xdb, 0x57, 0xa3, 0xfe, 0x4d, 0x47, 0x5b, 0xdd, 0x19, 0xc2, 0xcf, 0x3b, 0x43, 0xf8, + 0x58, 0x18, 0x60, 0x55, 0x18, 0xe0, 0x7b, 0x61, 0x80, 0xdf, 0x85, 0x01, 0xde, 0x08, 0x53, 0xa9, + 0x0c, 0xe2, 0xe2, 0x4f, 0x00, 0x00, 0x00, 0xff, 0xff, 0xc3, 0x32, 0xd2, 0x86, 0x50, 0x03, 0x00, + 0x00, +} diff --git a/vendor/github.com/containerd/containerd/errdefs/errors.go b/vendor/github.com/containerd/containerd/errdefs/errors.go new file mode 100644 index 0000000000..40427fc5a5 --- /dev/null +++ b/vendor/github.com/containerd/containerd/errdefs/errors.go @@ -0,0 +1,78 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +// Package errdefs defines the common errors used throughout containerd +// packages. +// +// Use with errors.Wrap and error.Wrapf to add context to an error. +// +// To detect an error class, use the IsXXX functions to tell whether an error +// is of a certain type. +// +// The functions ToGRPC and FromGRPC can be used to map server-side and +// client-side errors to the correct types. +package errdefs + +import "github.com/pkg/errors" + +// Definitions of common error types used throughout containerd. All containerd +// errors returned by most packages will map into one of these errors classes. +// Packages should return errors of these types when they want to instruct a +// client to take a particular action. +// +// For the most part, we just try to provide local grpc errors. Most conditions +// map very well to those defined by grpc. +var ( + ErrUnknown = errors.New("unknown") // used internally to represent a missed mapping. + ErrInvalidArgument = errors.New("invalid argument") + ErrNotFound = errors.New("not found") + ErrAlreadyExists = errors.New("already exists") + ErrFailedPrecondition = errors.New("failed precondition") + ErrUnavailable = errors.New("unavailable") + ErrNotImplemented = errors.New("not implemented") // represents not supported and unimplemented +) + +// IsInvalidArgument returns true if the error is due to an invalid argument +func IsInvalidArgument(err error) bool { + return errors.Cause(err) == ErrInvalidArgument +} + +// IsNotFound returns true if the error is due to a missing object +func IsNotFound(err error) bool { + return errors.Cause(err) == ErrNotFound +} + +// IsAlreadyExists returns true if the error is due to an already existing +// metadata item +func IsAlreadyExists(err error) bool { + return errors.Cause(err) == ErrAlreadyExists +} + +// IsFailedPrecondition returns true if an operation could not proceed to the +// lack of a particular condition +func IsFailedPrecondition(err error) bool { + return errors.Cause(err) == ErrFailedPrecondition +} + +// IsUnavailable returns true if the error is due to a resource being unavailable +func IsUnavailable(err error) bool { + return errors.Cause(err) == ErrUnavailable +} + +// IsNotImplemented returns true if the error is due to not being implemented +func IsNotImplemented(err error) bool { + return errors.Cause(err) == ErrNotImplemented +} diff --git a/vendor/github.com/containerd/containerd/errdefs/grpc.go b/vendor/github.com/containerd/containerd/errdefs/grpc.go new file mode 100644 index 0000000000..4eab03ab86 --- /dev/null +++ b/vendor/github.com/containerd/containerd/errdefs/grpc.go @@ -0,0 +1,138 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package errdefs + +import ( + "strings" + + "github.com/pkg/errors" + "google.golang.org/grpc/codes" + "google.golang.org/grpc/status" +) + +// ToGRPC will attempt to map the backend containerd error into a grpc error, +// using the original error message as a description. +// +// Further information may be extracted from certain errors depending on their +// type. +// +// If the error is unmapped, the original error will be returned to be handled +// by the regular grpc error handling stack. +func ToGRPC(err error) error { + if err == nil { + return nil + } + + if isGRPCError(err) { + // error has already been mapped to grpc + return err + } + + switch { + case IsInvalidArgument(err): + return status.Errorf(codes.InvalidArgument, err.Error()) + case IsNotFound(err): + return status.Errorf(codes.NotFound, err.Error()) + case IsAlreadyExists(err): + return status.Errorf(codes.AlreadyExists, err.Error()) + case IsFailedPrecondition(err): + return status.Errorf(codes.FailedPrecondition, err.Error()) + case IsUnavailable(err): + return status.Errorf(codes.Unavailable, err.Error()) + case IsNotImplemented(err): + return status.Errorf(codes.Unimplemented, err.Error()) + } + + return err +} + +// ToGRPCf maps the error to grpc error codes, assembling the formatting string +// and combining it with the target error string. +// +// This is equivalent to errors.ToGRPC(errors.Wrapf(err, format, args...)) +func ToGRPCf(err error, format string, args ...interface{}) error { + return ToGRPC(errors.Wrapf(err, format, args...)) +} + +// FromGRPC returns the underlying error from a grpc service based on the grpc error code +func FromGRPC(err error) error { + if err == nil { + return nil + } + + var cls error // divide these into error classes, becomes the cause + + switch code(err) { + case codes.InvalidArgument: + cls = ErrInvalidArgument + case codes.AlreadyExists: + cls = ErrAlreadyExists + case codes.NotFound: + cls = ErrNotFound + case codes.Unavailable: + cls = ErrUnavailable + case codes.FailedPrecondition: + cls = ErrFailedPrecondition + case codes.Unimplemented: + cls = ErrNotImplemented + default: + cls = ErrUnknown + } + + msg := rebaseMessage(cls, err) + if msg != "" { + err = errors.Wrapf(cls, msg) + } else { + err = errors.WithStack(cls) + } + + return err +} + +// rebaseMessage removes the repeats for an error at the end of an error +// string. This will happen when taking an error over grpc then remapping it. +// +// Effectively, we just remove the string of cls from the end of err if it +// appears there. +func rebaseMessage(cls error, err error) string { + desc := errDesc(err) + clss := cls.Error() + if desc == clss { + return "" + } + + return strings.TrimSuffix(desc, ": "+clss) +} + +func isGRPCError(err error) bool { + _, ok := status.FromError(err) + return ok +} + +func code(err error) codes.Code { + if s, ok := status.FromError(err); ok { + return s.Code() + } + return codes.Unknown +} + +func errDesc(err error) string { + if s, ok := status.FromError(err); ok { + return s.Message() + } + return err.Error() +} diff --git a/vendor/github.com/containerd/containerd/events/events.go b/vendor/github.com/containerd/containerd/events/events.go new file mode 100644 index 0000000000..b7eb86f1eb --- /dev/null +++ b/vendor/github.com/containerd/containerd/events/events.go @@ -0,0 +1,81 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package events + +import ( + "context" + "time" + + "github.com/containerd/typeurl" + "github.com/gogo/protobuf/types" +) + +// Envelope provides the packaging for an event. +type Envelope struct { + Timestamp time.Time + Namespace string + Topic string + Event *types.Any +} + +// Field returns the value for the given fieldpath as a string, if defined. +// If the value is not defined, the second value will be false. +func (e *Envelope) Field(fieldpath []string) (string, bool) { + if len(fieldpath) == 0 { + return "", false + } + + switch fieldpath[0] { + // unhandled: timestamp + case "namespace": + return e.Namespace, len(e.Namespace) > 0 + case "topic": + return e.Topic, len(e.Topic) > 0 + case "event": + decoded, err := typeurl.UnmarshalAny(e.Event) + if err != nil { + return "", false + } + + adaptor, ok := decoded.(interface { + Field([]string) (string, bool) + }) + if !ok { + return "", false + } + return adaptor.Field(fieldpath[1:]) + } + return "", false +} + +// Event is a generic interface for any type of event +type Event interface{} + +// Publisher posts the event. +type Publisher interface { + Publish(ctx context.Context, topic string, event Event) error +} + +// Forwarder forwards an event to the underlying event bus +type Forwarder interface { + Forward(ctx context.Context, envelope *Envelope) error +} + +// Subscriber allows callers to subscribe to events +type Subscriber interface { + Subscribe(ctx context.Context, filters ...string) (ch <-chan *Envelope, errs <-chan error) +} diff --git a/vendor/github.com/containerd/containerd/log/context.go b/vendor/github.com/containerd/containerd/log/context.go new file mode 100644 index 0000000000..3fab96b858 --- /dev/null +++ b/vendor/github.com/containerd/containerd/log/context.go @@ -0,0 +1,90 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package log + +import ( + "context" + "sync/atomic" + + "github.com/sirupsen/logrus" +) + +var ( + // G is an alias for GetLogger. + // + // We may want to define this locally to a package to get package tagged log + // messages. + G = GetLogger + + // L is an alias for the the standard logger. + L = logrus.NewEntry(logrus.StandardLogger()) +) + +type ( + loggerKey struct{} +) + +// TraceLevel is the log level for tracing. Trace level is lower than debug level, +// and is usually used to trace detailed behavior of the program. +const TraceLevel = logrus.Level(uint32(logrus.DebugLevel + 1)) + +// RFC3339NanoFixed is time.RFC3339Nano with nanoseconds padded using zeros to +// ensure the formatted time is always the same number of characters. +const RFC3339NanoFixed = "2006-01-02T15:04:05.000000000Z07:00" + +// ParseLevel takes a string level and returns the Logrus log level constant. +// It supports trace level. +func ParseLevel(lvl string) (logrus.Level, error) { + if lvl == "trace" { + return TraceLevel, nil + } + return logrus.ParseLevel(lvl) +} + +// WithLogger returns a new context with the provided logger. Use in +// combination with logger.WithField(s) for great effect. +func WithLogger(ctx context.Context, logger *logrus.Entry) context.Context { + return context.WithValue(ctx, loggerKey{}, logger) +} + +// GetLogger retrieves the current logger from the context. If no logger is +// available, the default logger is returned. +func GetLogger(ctx context.Context) *logrus.Entry { + logger := ctx.Value(loggerKey{}) + + if logger == nil { + return L + } + + return logger.(*logrus.Entry) +} + +// Trace logs a message at level Trace with the log entry passed-in. +func Trace(e *logrus.Entry, args ...interface{}) { + level := logrus.Level(atomic.LoadUint32((*uint32)(&e.Logger.Level))) + if level >= TraceLevel { + e.Debug(args...) + } +} + +// Tracef logs a message at level Trace with the log entry passed-in. +func Tracef(e *logrus.Entry, format string, args ...interface{}) { + level := logrus.Level(atomic.LoadUint32((*uint32)(&e.Logger.Level))) + if level >= TraceLevel { + e.Debugf(format, args...) + } +} diff --git a/vendor/github.com/containerd/containerd/mount/lookup_unix.go b/vendor/github.com/containerd/containerd/mount/lookup_unix.go new file mode 100644 index 0000000000..e8b0a0b483 --- /dev/null +++ b/vendor/github.com/containerd/containerd/mount/lookup_unix.go @@ -0,0 +1,53 @@ +// +build !windows + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package mount + +import ( + "path/filepath" + "sort" + "strings" + + "github.com/pkg/errors" +) + +// Lookup returns the mount info corresponds to the path. +func Lookup(dir string) (Info, error) { + dir = filepath.Clean(dir) + + mounts, err := Self() + if err != nil { + return Info{}, err + } + + // Sort descending order by Info.Mountpoint + sort.SliceStable(mounts, func(i, j int) bool { + return mounts[j].Mountpoint < mounts[i].Mountpoint + }) + for _, m := range mounts { + // Note that m.{Major, Minor} are generally unreliable for our purpose here + // https://www.spinics.net/lists/linux-btrfs/msg58908.html + // Note that device number is not checked here, because for overlayfs files + // may have different device number with the mountpoint. + if strings.HasPrefix(dir, m.Mountpoint) { + return m, nil + } + } + + return Info{}, errors.Errorf("failed to find the mount info for %q", dir) +} diff --git a/vendor/github.com/containerd/containerd/mount/lookup_unsupported.go b/vendor/github.com/containerd/containerd/mount/lookup_unsupported.go new file mode 100644 index 0000000000..46ec66a904 --- /dev/null +++ b/vendor/github.com/containerd/containerd/mount/lookup_unsupported.go @@ -0,0 +1,29 @@ +// +build windows + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package mount + +import ( + "fmt" + "runtime" +) + +// Lookup returns the mount info corresponds to the path. +func Lookup(dir string) (Info, error) { + return Info{}, fmt.Errorf("mount.Lookup is not implemented on %s/%s", runtime.GOOS, runtime.GOARCH) +} diff --git a/vendor/github.com/containerd/containerd/mount/mount.go b/vendor/github.com/containerd/containerd/mount/mount.go new file mode 100644 index 0000000000..b25556b2e0 --- /dev/null +++ b/vendor/github.com/containerd/containerd/mount/mount.go @@ -0,0 +1,40 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package mount + +// Mount is the lingua franca of containerd. A mount represents a +// serialized mount syscall. Components either emit or consume mounts. +type Mount struct { + // Type specifies the host-specific of the mount. + Type string + // Source specifies where to mount from. Depending on the host system, this + // can be a source path or device. + Source string + // Options contains zero or more fstab-style mount options. Typically, + // these are platform specific. + Options []string +} + +// All mounts all the provided mounts to the provided target +func All(mounts []Mount, target string) error { + for _, m := range mounts { + if err := m.Mount(target); err != nil { + return err + } + } + return nil +} diff --git a/vendor/github.com/containerd/containerd/mount/mount_linux.go b/vendor/github.com/containerd/containerd/mount/mount_linux.go new file mode 100644 index 0000000000..b5a16148ac --- /dev/null +++ b/vendor/github.com/containerd/containerd/mount/mount_linux.go @@ -0,0 +1,308 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package mount + +import ( + "fmt" + "os" + "path" + "strings" + "time" + + "github.com/containerd/containerd/sys" + "github.com/pkg/errors" + "golang.org/x/sys/unix" +) + +var pagesize = 4096 + +func init() { + pagesize = os.Getpagesize() +} + +// Mount to the provided target path +func (m *Mount) Mount(target string) error { + var ( + chdir string + options = m.Options + ) + + // avoid hitting one page limit of mount argument buffer + // + // NOTE: 512 is a buffer during pagesize check. + if m.Type == "overlay" && optionsSize(options) >= pagesize-512 { + chdir, options = compactLowerdirOption(options) + } + + flags, data := parseMountOptions(options) + if len(data) > pagesize { + return errors.Errorf("mount options is too long") + } + + // propagation types. + const ptypes = unix.MS_SHARED | unix.MS_PRIVATE | unix.MS_SLAVE | unix.MS_UNBINDABLE + + // Ensure propagation type change flags aren't included in other calls. + oflags := flags &^ ptypes + + // In the case of remounting with changed data (data != ""), need to call mount (moby/moby#34077). + if flags&unix.MS_REMOUNT == 0 || data != "" { + // Initial call applying all non-propagation flags for mount + // or remount with changed data + if err := mountAt(chdir, m.Source, target, m.Type, uintptr(oflags), data); err != nil { + return err + } + } + + if flags&ptypes != 0 { + // Change the propagation type. + const pflags = ptypes | unix.MS_REC | unix.MS_SILENT + if err := unix.Mount("", target, "", uintptr(flags&pflags), ""); err != nil { + return err + } + } + + const broflags = unix.MS_BIND | unix.MS_RDONLY + if oflags&broflags == broflags { + // Remount the bind to apply read only. + return unix.Mount("", target, "", uintptr(oflags|unix.MS_REMOUNT), "") + } + return nil +} + +// Unmount the provided mount path with the flags +func Unmount(target string, flags int) error { + if err := unmount(target, flags); err != nil && err != unix.EINVAL { + return err + } + return nil +} + +func unmount(target string, flags int) error { + for i := 0; i < 50; i++ { + if err := unix.Unmount(target, flags); err != nil { + switch err { + case unix.EBUSY: + time.Sleep(50 * time.Millisecond) + continue + default: + return err + } + } + return nil + } + return errors.Wrapf(unix.EBUSY, "failed to unmount target %s", target) +} + +// UnmountAll repeatedly unmounts the given mount point until there +// are no mounts remaining (EINVAL is returned by mount), which is +// useful for undoing a stack of mounts on the same mount point. +func UnmountAll(mount string, flags int) error { + for { + if err := unmount(mount, flags); err != nil { + // EINVAL is returned if the target is not a + // mount point, indicating that we are + // done. It can also indicate a few other + // things (such as invalid flags) which we + // unfortunately end up squelching here too. + if err == unix.EINVAL { + return nil + } + return err + } + } +} + +// parseMountOptions takes fstab style mount options and parses them for +// use with a standard mount() syscall +func parseMountOptions(options []string) (int, string) { + var ( + flag int + data []string + ) + flags := map[string]struct { + clear bool + flag int + }{ + "async": {true, unix.MS_SYNCHRONOUS}, + "atime": {true, unix.MS_NOATIME}, + "bind": {false, unix.MS_BIND}, + "defaults": {false, 0}, + "dev": {true, unix.MS_NODEV}, + "diratime": {true, unix.MS_NODIRATIME}, + "dirsync": {false, unix.MS_DIRSYNC}, + "exec": {true, unix.MS_NOEXEC}, + "mand": {false, unix.MS_MANDLOCK}, + "noatime": {false, unix.MS_NOATIME}, + "nodev": {false, unix.MS_NODEV}, + "nodiratime": {false, unix.MS_NODIRATIME}, + "noexec": {false, unix.MS_NOEXEC}, + "nomand": {true, unix.MS_MANDLOCK}, + "norelatime": {true, unix.MS_RELATIME}, + "nostrictatime": {true, unix.MS_STRICTATIME}, + "nosuid": {false, unix.MS_NOSUID}, + "rbind": {false, unix.MS_BIND | unix.MS_REC}, + "relatime": {false, unix.MS_RELATIME}, + "remount": {false, unix.MS_REMOUNT}, + "ro": {false, unix.MS_RDONLY}, + "rw": {true, unix.MS_RDONLY}, + "strictatime": {false, unix.MS_STRICTATIME}, + "suid": {true, unix.MS_NOSUID}, + "sync": {false, unix.MS_SYNCHRONOUS}, + } + for _, o := range options { + // If the option does not exist in the flags table or the flag + // is not supported on the platform, + // then it is a data value for a specific fs type + if f, exists := flags[o]; exists && f.flag != 0 { + if f.clear { + flag &^= f.flag + } else { + flag |= f.flag + } + } else { + data = append(data, o) + } + } + return flag, strings.Join(data, ",") +} + +// compactLowerdirOption updates overlay lowdir option and returns the common +// dir among all the lowdirs. +func compactLowerdirOption(opts []string) (string, []string) { + idx, dirs := findOverlayLowerdirs(opts) + if idx == -1 || len(dirs) == 1 { + // no need to compact if there is only one lowerdir + return "", opts + } + + // find out common dir + commondir := longestCommonPrefix(dirs) + if commondir == "" { + return "", opts + } + + // NOTE: the snapshot id is based on digits. + // in order to avoid to get snapshots/x, should be back to parent dir. + // however, there is assumption that the common dir is ${root}/io.containerd.v1.overlayfs/snapshots. + commondir = path.Dir(commondir) + if commondir == "/" { + return "", opts + } + commondir = commondir + "/" + + newdirs := make([]string, 0, len(dirs)) + for _, dir := range dirs { + newdirs = append(newdirs, dir[len(commondir):]) + } + + newopts := copyOptions(opts) + newopts = append(newopts[:idx], newopts[idx+1:]...) + newopts = append(newopts, fmt.Sprintf("lowerdir=%s", strings.Join(newdirs, ":"))) + return commondir, newopts +} + +// findOverlayLowerdirs returns the index of lowerdir in mount's options and +// all the lowerdir target. +func findOverlayLowerdirs(opts []string) (int, []string) { + var ( + idx = -1 + prefix = "lowerdir=" + ) + + for i, opt := range opts { + if strings.HasPrefix(opt, prefix) { + idx = i + break + } + } + + if idx == -1 { + return -1, nil + } + return idx, strings.Split(opts[idx][len(prefix):], ":") +} + +// longestCommonPrefix finds the longest common prefix in the string slice. +func longestCommonPrefix(strs []string) string { + if len(strs) == 0 { + return "" + } else if len(strs) == 1 { + return strs[0] + } + + // find out the min/max value by alphabetical order + min, max := strs[0], strs[0] + for _, str := range strs[1:] { + if min > str { + min = str + } + if max < str { + max = str + } + } + + // find out the common part between min and max + for i := 0; i < len(min) && i < len(max); i++ { + if min[i] != max[i] { + return min[:i] + } + } + return min +} + +// copyOptions copies the options. +func copyOptions(opts []string) []string { + if len(opts) == 0 { + return nil + } + + acopy := make([]string, len(opts)) + copy(acopy, opts) + return acopy +} + +// optionsSize returns the byte size of options of mount. +func optionsSize(opts []string) int { + size := 0 + for _, opt := range opts { + size += len(opt) + } + return size +} + +func mountAt(chdir string, source, target, fstype string, flags uintptr, data string) error { + if chdir == "" { + return unix.Mount(source, target, fstype, flags, data) + } + + f, err := os.Open(chdir) + if err != nil { + return errors.Wrap(err, "failed to mountat") + } + defer f.Close() + + fs, err := f.Stat() + if err != nil { + return errors.Wrap(err, "failed to mountat") + } + + if !fs.IsDir() { + return errors.Wrap(errors.Errorf("%s is not dir", chdir), "failed to mountat") + } + return errors.Wrap(sys.FMountat(f.Fd(), source, target, fstype, flags, data), "failed to mountat") +} diff --git a/vendor/github.com/containerd/containerd/mount/mount_unix.go b/vendor/github.com/containerd/containerd/mount/mount_unix.go new file mode 100644 index 0000000000..6741293f89 --- /dev/null +++ b/vendor/github.com/containerd/containerd/mount/mount_unix.go @@ -0,0 +1,41 @@ +// +build darwin freebsd + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package mount + +import "github.com/pkg/errors" + +var ( + // ErrNotImplementOnUnix is returned for methods that are not implemented + ErrNotImplementOnUnix = errors.New("not implemented under unix") +) + +// Mount is not implemented on this platform +func (m *Mount) Mount(target string) error { + return ErrNotImplementOnUnix +} + +// Unmount is not implemented on this platform +func Unmount(mount string, flags int) error { + return ErrNotImplementOnUnix +} + +// UnmountAll is not implemented on this platform +func UnmountAll(mount string, flags int) error { + return ErrNotImplementOnUnix +} diff --git a/vendor/github.com/containerd/containerd/mount/mount_windows.go b/vendor/github.com/containerd/containerd/mount/mount_windows.go new file mode 100644 index 0000000000..5de25c4e0a --- /dev/null +++ b/vendor/github.com/containerd/containerd/mount/mount_windows.go @@ -0,0 +1,105 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package mount + +import ( + "encoding/json" + "path/filepath" + "strings" + + "github.com/Microsoft/hcsshim" + "github.com/pkg/errors" +) + +var ( + // ErrNotImplementOnWindows is returned when an action is not implemented for windows + ErrNotImplementOnWindows = errors.New("not implemented under windows") +) + +// Mount to the provided target +func (m *Mount) Mount(target string) error { + if m.Type != "windows-layer" { + return errors.Errorf("invalid windows mount type: '%s'", m.Type) + } + + home, layerID := filepath.Split(m.Source) + + parentLayerPaths, err := m.GetParentPaths() + if err != nil { + return err + } + + var di = hcsshim.DriverInfo{ + HomeDir: home, + } + + if err = hcsshim.ActivateLayer(di, layerID); err != nil { + return errors.Wrapf(err, "failed to activate layer %s", m.Source) + } + defer func() { + if err != nil { + hcsshim.DeactivateLayer(di, layerID) + } + }() + + if err = hcsshim.PrepareLayer(di, layerID, parentLayerPaths); err != nil { + return errors.Wrapf(err, "failed to prepare layer %s", m.Source) + } + return nil +} + +// ParentLayerPathsFlag is the options flag used to represent the JSON encoded +// list of parent layers required to use the layer +const ParentLayerPathsFlag = "parentLayerPaths=" + +// GetParentPaths of the mount +func (m *Mount) GetParentPaths() ([]string, error) { + var parentLayerPaths []string + for _, option := range m.Options { + if strings.HasPrefix(option, ParentLayerPathsFlag) { + err := json.Unmarshal([]byte(option[len(ParentLayerPathsFlag):]), &parentLayerPaths) + if err != nil { + return nil, errors.Wrap(err, "failed to unmarshal parent layer paths from mount") + } + } + } + return parentLayerPaths, nil +} + +// Unmount the mount at the provided path +func Unmount(mount string, flags int) error { + var ( + home, layerID = filepath.Split(mount) + di = hcsshim.DriverInfo{ + HomeDir: home, + } + ) + + if err := hcsshim.UnprepareLayer(di, layerID); err != nil { + return errors.Wrapf(err, "failed to unprepare layer %s", mount) + } + if err := hcsshim.DeactivateLayer(di, layerID); err != nil { + return errors.Wrapf(err, "failed to deactivate layer %s", mount) + } + + return nil +} + +// UnmountAll unmounts from the provided path +func UnmountAll(mount string, flags int) error { + return Unmount(mount, flags) +} diff --git a/vendor/github.com/containerd/containerd/mount/mountinfo.go b/vendor/github.com/containerd/containerd/mount/mountinfo.go new file mode 100644 index 0000000000..e7a68402f5 --- /dev/null +++ b/vendor/github.com/containerd/containerd/mount/mountinfo.go @@ -0,0 +1,56 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package mount + +// Info reveals information about a particular mounted filesystem. This +// struct is populated from the content in the /proc//mountinfo file. +type Info struct { + // ID is a unique identifier of the mount (may be reused after umount). + ID int + + // Parent indicates the ID of the mount parent (or of self for the top of the + // mount tree). + Parent int + + // Major indicates one half of the device ID which identifies the device class. + Major int + + // Minor indicates one half of the device ID which identifies a specific + // instance of device. + Minor int + + // Root of the mount within the filesystem. + Root string + + // Mountpoint indicates the mount point relative to the process's root. + Mountpoint string + + // Options represents mount-specific options. + Options string + + // Optional represents optional fields. + Optional string + + // FSType indicates the type of filesystem, such as EXT3. + FSType string + + // Source indicates filesystem specific information or "none". + Source string + + // VFSOptions represents per super block options. + VFSOptions string +} diff --git a/vendor/github.com/containerd/containerd/mount/mountinfo_freebsd.go b/vendor/github.com/containerd/containerd/mount/mountinfo_freebsd.go new file mode 100644 index 0000000000..bbe79767e3 --- /dev/null +++ b/vendor/github.com/containerd/containerd/mount/mountinfo_freebsd.go @@ -0,0 +1,61 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package mount + +/* +#include +#include +#include +*/ +import "C" + +import ( + "fmt" + "reflect" + "unsafe" +) + +// Self retrieves a list of mounts for the current running process. +func Self() ([]Info, error) { + var rawEntries *C.struct_statfs + + count := int(C.getmntinfo(&rawEntries, C.MNT_WAIT)) + if count == 0 { + return nil, fmt.Errorf("Failed to call getmntinfo") + } + + var entries []C.struct_statfs + header := (*reflect.SliceHeader)(unsafe.Pointer(&entries)) + header.Cap = count + header.Len = count + header.Data = uintptr(unsafe.Pointer(rawEntries)) + + var out []Info + for _, entry := range entries { + var mountinfo Info + mountinfo.Mountpoint = C.GoString(&entry.f_mntonname[0]) + mountinfo.Source = C.GoString(&entry.f_mntfromname[0]) + mountinfo.FSType = C.GoString(&entry.f_fstypename[0]) + out = append(out, mountinfo) + } + return out, nil +} + +// PID collects the mounts for a specific process ID. +func PID(pid int) ([]Info, error) { + return nil, fmt.Errorf("mountinfo.PID is not implemented on freebsd") +} diff --git a/vendor/github.com/containerd/containerd/mount/mountinfo_linux.go b/vendor/github.com/containerd/containerd/mount/mountinfo_linux.go new file mode 100644 index 0000000000..a986f8f4ea --- /dev/null +++ b/vendor/github.com/containerd/containerd/mount/mountinfo_linux.go @@ -0,0 +1,135 @@ +// +build linux + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package mount + +import ( + "bufio" + "fmt" + "io" + "os" + "strconv" + "strings" +) + +// Self retrieves a list of mounts for the current running process. +func Self() ([]Info, error) { + f, err := os.Open("/proc/self/mountinfo") + if err != nil { + return nil, err + } + defer f.Close() + + return parseInfoFile(f) +} + +func parseInfoFile(r io.Reader) ([]Info, error) { + s := bufio.NewScanner(r) + out := []Info{} + + for s.Scan() { + if err := s.Err(); err != nil { + return nil, err + } + + /* + 36 35 98:0 /mnt1 /mnt2 rw,noatime master:1 - ext3 /dev/root rw,errors=continue + (1)(2)(3) (4) (5) (6) (7) (8) (9) (10) (11) + (1) mount ID: unique identifier of the mount (may be reused after umount) + (2) parent ID: ID of parent (or of self for the top of the mount tree) + (3) major:minor: value of st_dev for files on filesystem + (4) root: root of the mount within the filesystem + (5) mount point: mount point relative to the process's root + (6) mount options: per mount options + (7) optional fields: zero or more fields of the form "tag[:value]" + (8) separator: marks the end of the optional fields + (9) filesystem type: name of filesystem of the form "type[.subtype]" + (10) mount source: filesystem specific information or "none" + (11) super options: per super block options + */ + + text := s.Text() + fields := strings.Split(text, " ") + numFields := len(fields) + if numFields < 10 { + // should be at least 10 fields + return nil, fmt.Errorf("Parsing '%s' failed: not enough fields (%d)", text, numFields) + } + p := Info{} + // ignore any numbers parsing errors, as there should not be any + p.ID, _ = strconv.Atoi(fields[0]) + p.Parent, _ = strconv.Atoi(fields[1]) + mm := strings.Split(fields[2], ":") + if len(mm) != 2 { + return nil, fmt.Errorf("Parsing '%s' failed: unexpected minor:major pair %s", text, mm) + } + p.Major, _ = strconv.Atoi(mm[0]) + p.Minor, _ = strconv.Atoi(mm[1]) + + p.Root = fields[3] + p.Mountpoint = fields[4] + p.Options = fields[5] + + // one or more optional fields, when a separator (-) + i := 6 + for ; i < numFields && fields[i] != "-"; i++ { + switch i { + case 6: + p.Optional = fields[6] + default: + /* NOTE there might be more optional fields before the separator + such as fields[7]...fields[N] (where N < separatorIndex), + although as of Linux kernel 4.15 the only known ones are + mount propagation flags in fields[6]. The correct + behavior is to ignore any unknown optional fields. + */ + } + } + if i == numFields { + return nil, fmt.Errorf("Parsing '%s' failed: missing separator ('-')", text) + } + // There should be 3 fields after the separator... + if i+4 > numFields { + return nil, fmt.Errorf("Parsing '%s' failed: not enough fields after a separator", text) + } + // ... but in Linux <= 3.9 mounting a cifs with spaces in a share name + // (like "//serv/My Documents") _may_ end up having a space in the last field + // of mountinfo (like "unc=//serv/My Documents"). Since kernel 3.10-rc1, cifs + // option unc= is ignored, so a space should not appear. In here we ignore + // those "extra" fields caused by extra spaces. + p.FSType = fields[i+1] + p.Source = fields[i+2] + p.VFSOptions = fields[i+3] + + out = append(out, p) + } + return out, nil +} + +// PID collects the mounts for a specific process ID. If the process +// ID is unknown, it is better to use `Self` which will inspect +// "/proc/self/mountinfo" instead. +func PID(pid int) ([]Info, error) { + f, err := os.Open(fmt.Sprintf("/proc/%d/mountinfo", pid)) + if err != nil { + return nil, err + } + defer f.Close() + + return parseInfoFile(f) +} diff --git a/vendor/github.com/containerd/containerd/mount/mountinfo_unsupported.go b/vendor/github.com/containerd/containerd/mount/mountinfo_unsupported.go new file mode 100644 index 0000000000..eba602f1a6 --- /dev/null +++ b/vendor/github.com/containerd/containerd/mount/mountinfo_unsupported.go @@ -0,0 +1,34 @@ +// +build !linux,!freebsd,!solaris freebsd,!cgo solaris,!cgo + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package mount + +import ( + "fmt" + "runtime" +) + +// Self retrieves a list of mounts for the current running process. +func Self() ([]Info, error) { + return nil, fmt.Errorf("mountinfo.Self is not implemented on %s/%s", runtime.GOOS, runtime.GOARCH) +} + +// PID collects the mounts for a specific process ID. +func PID(pid int) ([]Info, error) { + return nil, fmt.Errorf("mountinfo.PID is not implemented on %s/%s", runtime.GOOS, runtime.GOARCH) +} diff --git a/vendor/github.com/containerd/containerd/mount/temp.go b/vendor/github.com/containerd/containerd/mount/temp.go new file mode 100644 index 0000000000..9dc4010fee --- /dev/null +++ b/vendor/github.com/containerd/containerd/mount/temp.go @@ -0,0 +1,73 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package mount + +import ( + "context" + "io/ioutil" + "os" + + "github.com/containerd/containerd/log" + "github.com/pkg/errors" +) + +var tempMountLocation = getTempDir() + +// WithTempMount mounts the provided mounts to a temp dir, and pass the temp dir to f. +// The mounts are valid during the call to the f. +// Finally we will unmount and remove the temp dir regardless of the result of f. +func WithTempMount(ctx context.Context, mounts []Mount, f func(root string) error) (err error) { + root, uerr := ioutil.TempDir(tempMountLocation, "containerd-mount") + if uerr != nil { + return errors.Wrapf(uerr, "failed to create temp dir") + } + // We use Remove here instead of RemoveAll. + // The RemoveAll will delete the temp dir and all children it contains. + // When the Unmount fails, RemoveAll will incorrectly delete data from + // the mounted dir. However, if we use Remove, even though we won't + // successfully delete the temp dir and it may leak, we won't loss data + // from the mounted dir. + // For details, please refer to #1868 #1785. + defer func() { + if uerr = os.Remove(root); uerr != nil { + log.G(ctx).WithError(uerr).WithField("dir", root).Errorf("failed to remove mount temp dir") + } + }() + + // We should do defer first, if not we will not do Unmount when only a part of Mounts are failed. + defer func() { + if uerr = UnmountAll(root, 0); uerr != nil { + uerr = errors.Wrapf(uerr, "failed to unmount %s", root) + if err == nil { + err = uerr + } else { + err = errors.Wrap(err, uerr.Error()) + } + } + }() + if uerr = All(mounts, root); uerr != nil { + return errors.Wrapf(uerr, "failed to mount %s", root) + } + return errors.Wrapf(f(root), "mount callback failed on %s", root) +} + +func getTempDir() string { + if xdg := os.Getenv("XDG_RUNTIME_DIR"); xdg != "" { + return xdg + } + return os.TempDir() +} diff --git a/vendor/github.com/containerd/containerd/mount/temp_unix.go b/vendor/github.com/containerd/containerd/mount/temp_unix.go new file mode 100644 index 0000000000..3d490e8a70 --- /dev/null +++ b/vendor/github.com/containerd/containerd/mount/temp_unix.go @@ -0,0 +1,64 @@ +// +build !windows + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package mount + +import ( + "os" + "path/filepath" + "sort" + "strings" +) + +// SetTempMountLocation sets the temporary mount location +func SetTempMountLocation(root string) error { + root, err := filepath.Abs(root) + if err != nil { + return err + } + if err := os.MkdirAll(root, 0700); err != nil { + return err + } + tempMountLocation = root + return nil +} + +// CleanupTempMounts all temp mounts and remove the directories +func CleanupTempMounts(flags int) (warnings []error, err error) { + mounts, err := Self() + if err != nil { + return nil, err + } + var toUnmount []string + for _, m := range mounts { + if strings.HasPrefix(m.Mountpoint, tempMountLocation) { + toUnmount = append(toUnmount, m.Mountpoint) + } + } + sort.Sort(sort.Reverse(sort.StringSlice(toUnmount))) + for _, path := range toUnmount { + if err := UnmountAll(path, flags); err != nil { + warnings = append(warnings, err) + continue + } + if err := os.Remove(path); err != nil { + warnings = append(warnings, err) + } + } + return warnings, nil +} diff --git a/vendor/github.com/containerd/containerd/mount/temp_unsupported.go b/vendor/github.com/containerd/containerd/mount/temp_unsupported.go new file mode 100644 index 0000000000..942be4128a --- /dev/null +++ b/vendor/github.com/containerd/containerd/mount/temp_unsupported.go @@ -0,0 +1,29 @@ +// +build windows + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package mount + +// SetTempMountLocation sets the temporary mount location +func SetTempMountLocation(root string) error { + return nil +} + +// CleanupTempMounts all temp mounts and remove the directories +func CleanupTempMounts(flags int) ([]error, error) { + return nil, nil +} diff --git a/vendor/github.com/containerd/containerd/namespaces/context.go b/vendor/github.com/containerd/containerd/namespaces/context.go new file mode 100644 index 0000000000..cc5621a68f --- /dev/null +++ b/vendor/github.com/containerd/containerd/namespaces/context.go @@ -0,0 +1,79 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package namespaces + +import ( + "context" + "os" + + "github.com/containerd/containerd/errdefs" + "github.com/pkg/errors" +) + +const ( + // NamespaceEnvVar is the environment variable key name + NamespaceEnvVar = "CONTAINERD_NAMESPACE" + // Default is the name of the default namespace + Default = "default" +) + +type namespaceKey struct{} + +// WithNamespace sets a given namespace on the context +func WithNamespace(ctx context.Context, namespace string) context.Context { + ctx = context.WithValue(ctx, namespaceKey{}, namespace) // set our key for namespace + + // also store on the grpc headers so it gets picked up by any clients that + // are using this. + return withGRPCNamespaceHeader(ctx, namespace) +} + +// NamespaceFromEnv uses the namespace defined in CONTAINERD_NAMESPACE or +// default +func NamespaceFromEnv(ctx context.Context) context.Context { + namespace := os.Getenv(NamespaceEnvVar) + if namespace == "" { + namespace = Default + } + return WithNamespace(ctx, namespace) +} + +// Namespace returns the namespace from the context. +// +// The namespace is not guaranteed to be valid. +func Namespace(ctx context.Context) (string, bool) { + namespace, ok := ctx.Value(namespaceKey{}).(string) + if !ok { + return fromGRPCHeader(ctx) + } + + return namespace, ok +} + +// NamespaceRequired returns the valid namepace from the context or an error. +func NamespaceRequired(ctx context.Context) (string, error) { + namespace, ok := Namespace(ctx) + if !ok || namespace == "" { + return "", errors.Wrapf(errdefs.ErrFailedPrecondition, "namespace is required") + } + + if err := Validate(namespace); err != nil { + return "", errors.Wrap(err, "namespace validation") + } + + return namespace, nil +} diff --git a/vendor/github.com/containerd/containerd/namespaces/grpc.go b/vendor/github.com/containerd/containerd/namespaces/grpc.go new file mode 100644 index 0000000000..6991460da6 --- /dev/null +++ b/vendor/github.com/containerd/containerd/namespaces/grpc.go @@ -0,0 +1,61 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package namespaces + +import ( + "context" + + "google.golang.org/grpc/metadata" +) + +const ( + // GRPCHeader defines the header name for specifying a containerd namespace. + GRPCHeader = "containerd-namespace" +) + +// NOTE(stevvooe): We can stub this file out if we don't want a grpc dependency here. + +func withGRPCNamespaceHeader(ctx context.Context, namespace string) context.Context { + // also store on the grpc headers so it gets picked up by any clients that + // are using this. + nsheader := metadata.Pairs(GRPCHeader, namespace) + md, ok := metadata.FromOutgoingContext(ctx) // merge with outgoing context. + if !ok { + md = nsheader + } else { + // order ensures the latest is first in this list. + md = metadata.Join(nsheader, md) + } + + return metadata.NewOutgoingContext(ctx, md) +} + +func fromGRPCHeader(ctx context.Context) (string, bool) { + // try to extract for use in grpc servers. + md, ok := metadata.FromIncomingContext(ctx) + if !ok { + // TODO(stevvooe): Check outgoing context? + return "", false + } + + values := md[GRPCHeader] + if len(values) == 0 { + return "", false + } + + return values[0], true +} diff --git a/vendor/github.com/containerd/containerd/namespaces/store.go b/vendor/github.com/containerd/containerd/namespaces/store.go new file mode 100644 index 0000000000..0b5c985691 --- /dev/null +++ b/vendor/github.com/containerd/containerd/namespaces/store.go @@ -0,0 +1,37 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package namespaces + +import "context" + +// Store provides introspection about namespaces. +// +// Note that these are slightly different than other objects, which are record +// oriented. A namespace is really just a name and a set of labels. Objects +// that belong to a namespace are returned when the namespace is assigned to a +// given context. +// +// +type Store interface { + Create(ctx context.Context, namespace string, labels map[string]string) error + Labels(ctx context.Context, namespace string) (map[string]string, error) + SetLabel(ctx context.Context, namespace, key, value string) error + List(ctx context.Context) ([]string, error) + + // Delete removes the namespace. The namespace must be empty to be deleted. + Delete(ctx context.Context, namespace string) error +} diff --git a/vendor/github.com/containerd/containerd/namespaces/validate.go b/vendor/github.com/containerd/containerd/namespaces/validate.go new file mode 100644 index 0000000000..222da3ea43 --- /dev/null +++ b/vendor/github.com/containerd/containerd/namespaces/validate.go @@ -0,0 +1,83 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +// Package namespaces provides tools for working with namespaces across +// containerd. +// +// Namespaces collect resources such as containers and images, into a unique +// identifier space. This means that two applications can use the same +// identifiers and not conflict while using containerd. +// +// This package can be used to ensure that client and server functions +// correctly store the namespace on the context. +package namespaces + +import ( + "regexp" + + "github.com/containerd/containerd/errdefs" + "github.com/pkg/errors" +) + +const ( + maxLength = 76 + alpha = `[A-Za-z]` + alphanum = `[A-Za-z0-9]+` + label = alpha + alphanum + `(:?[-]+` + alpha + alphanum + `)*` +) + +var ( + // namespaceRe validates that a namespace matches valid identifiers. + // + // Rules for domains, defined in RFC 1035, section 2.3.1, are used for + // namespaces. + namespaceRe = regexp.MustCompile(reAnchor(label + reGroup("[.]"+reGroup(label)) + "*")) +) + +// Validate returns nil if the string s is a valid namespace. +// +// To allow such namespace identifiers to be used across various contexts +// safely, the character set has been restricted to that defined for domains in +// RFC 1035, section 2.3.1. This will make namespace identifiers safe for use +// across networks, filesystems and other media. +// +// The identifier specification departs from RFC 1035 in that it allows +// "labels" to start with number and only enforces a total length restriction +// of 76 characters. +// +// While the character set may be expanded in the future, namespace identifiers +// are guaranteed to be safely used as filesystem path components. +// +// For the most part, this doesn't need to be called directly when using the +// context-oriented functions. +func Validate(s string) error { + if len(s) > maxLength { + return errors.Wrapf(errdefs.ErrInvalidArgument, "namespace %q greater than maximum length (%d characters)", s, maxLength) + } + + if !namespaceRe.MatchString(s) { + return errors.Wrapf(errdefs.ErrInvalidArgument, "namespace %q must match %v", s, namespaceRe) + } + return nil +} + +func reGroup(s string) string { + return `(?:` + s + `)` +} + +func reAnchor(s string) string { + return `^` + s + `$` +} diff --git a/vendor/github.com/containerd/containerd/runtime/events.go b/vendor/github.com/containerd/containerd/runtime/events.go new file mode 100644 index 0000000000..4a064c8854 --- /dev/null +++ b/vendor/github.com/containerd/containerd/runtime/events.go @@ -0,0 +1,42 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package runtime + +const ( + // TaskCreateEventTopic for task create + TaskCreateEventTopic = "/tasks/create" + // TaskStartEventTopic for task start + TaskStartEventTopic = "/tasks/start" + // TaskOOMEventTopic for task oom + TaskOOMEventTopic = "/tasks/oom" + // TaskExitEventTopic for task exit + TaskExitEventTopic = "/tasks/exit" + // TaskDeleteEventTopic for task delete + TaskDeleteEventTopic = "/tasks/delete" + // TaskExecAddedEventTopic for task exec create + TaskExecAddedEventTopic = "/tasks/exec-added" + // TaskExecStartedEventTopic for task exec start + TaskExecStartedEventTopic = "/tasks/exec-started" + // TaskPausedEventTopic for task pause + TaskPausedEventTopic = "/tasks/paused" + // TaskResumedEventTopic for task resume + TaskResumedEventTopic = "/tasks/resumed" + // TaskCheckpointedEventTopic for task checkpoint + TaskCheckpointedEventTopic = "/tasks/checkpointed" + // TaskUnknownTopic for unknown task events + TaskUnknownTopic = "/tasks/?" +) diff --git a/vendor/github.com/containerd/containerd/runtime/monitor.go b/vendor/github.com/containerd/containerd/runtime/monitor.go new file mode 100644 index 0000000000..eb07ebdb4a --- /dev/null +++ b/vendor/github.com/containerd/containerd/runtime/monitor.go @@ -0,0 +1,70 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package runtime + +// TaskMonitor provides an interface for monitoring of containers within containerd +type TaskMonitor interface { + // Monitor adds the provided container to the monitor + Monitor(Task) error + // Stop stops and removes the provided container from the monitor + Stop(Task) error +} + +// NewMultiTaskMonitor returns a new TaskMonitor broadcasting to the provided monitors +func NewMultiTaskMonitor(monitors ...TaskMonitor) TaskMonitor { + return &multiTaskMonitor{ + monitors: monitors, + } +} + +// NewNoopMonitor is a task monitor that does nothing +func NewNoopMonitor() TaskMonitor { + return &noopTaskMonitor{} +} + +type noopTaskMonitor struct { +} + +func (mm *noopTaskMonitor) Monitor(c Task) error { + return nil +} + +func (mm *noopTaskMonitor) Stop(c Task) error { + return nil +} + +type multiTaskMonitor struct { + monitors []TaskMonitor +} + +func (mm *multiTaskMonitor) Monitor(c Task) error { + for _, m := range mm.monitors { + if err := m.Monitor(c); err != nil { + return err + } + } + return nil +} + +func (mm *multiTaskMonitor) Stop(c Task) error { + for _, m := range mm.monitors { + if err := m.Stop(c); err != nil { + return err + } + } + return nil +} diff --git a/vendor/github.com/containerd/containerd/runtime/runtime.go b/vendor/github.com/containerd/containerd/runtime/runtime.go new file mode 100644 index 0000000000..1b3f87c152 --- /dev/null +++ b/vendor/github.com/containerd/containerd/runtime/runtime.go @@ -0,0 +1,72 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package runtime + +import ( + "context" + "time" + + "github.com/containerd/containerd/mount" + "github.com/gogo/protobuf/types" +) + +// IO holds process IO information +type IO struct { + Stdin string + Stdout string + Stderr string + Terminal bool +} + +// CreateOpts contains task creation data +type CreateOpts struct { + // Spec is the OCI runtime spec + Spec *types.Any + // Rootfs mounts to perform to gain access to the container's filesystem + Rootfs []mount.Mount + // IO for the container's main process + IO IO + // Checkpoint digest to restore container state + Checkpoint string + // RuntimeOptions for the runtime + RuntimeOptions *types.Any + // TaskOptions received for the task + TaskOptions *types.Any + // Runtime to use + Runtime string +} + +// Exit information for a process +type Exit struct { + Pid uint32 + Status uint32 + Timestamp time.Time +} + +// PlatformRuntime is responsible for the creation and management of +// tasks and processes for a platform. +type PlatformRuntime interface { + // ID of the runtime + ID() string + // Create creates a task with the provided id and options. + Create(ctx context.Context, id string, opts CreateOpts) (Task, error) + // Get returns a task. + Get(context.Context, string) (Task, error) + // Tasks returns all the current tasks for the runtime. + // Any container runs at most one task at a time. + Tasks(context.Context, bool) ([]Task, error) +} diff --git a/vendor/github.com/containerd/containerd/runtime/task.go b/vendor/github.com/containerd/containerd/runtime/task.go new file mode 100644 index 0000000000..981e290c68 --- /dev/null +++ b/vendor/github.com/containerd/containerd/runtime/task.go @@ -0,0 +1,132 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package runtime + +import ( + "context" + "time" + + "github.com/gogo/protobuf/types" +) + +// TaskInfo provides task specific information +type TaskInfo struct { + ID string + Runtime string + Spec []byte + Namespace string +} + +// Process is a runtime object for an executing process inside a container +type Process interface { + ID() string + // State returns the process state + State(context.Context) (State, error) + // Kill signals a container + Kill(context.Context, uint32, bool) error + // Pty resizes the processes pty/console + ResizePty(context.Context, ConsoleSize) error + // CloseStdin closes the processes stdin + CloseIO(context.Context) error + // Start the container's user defined process + Start(context.Context) error + // Wait for the process to exit + Wait(context.Context) (*Exit, error) + // Delete deletes the process + Delete(context.Context) (*Exit, error) +} + +// Task is the runtime object for an executing container +type Task interface { + Process + + // Namespace that the task exists in + Namespace() string + // Pause pauses the container process + Pause(context.Context) error + // Resume unpauses the container process + Resume(context.Context) error + // Exec adds a process into the container + Exec(context.Context, string, ExecOpts) (Process, error) + // Pids returns all pids + Pids(context.Context) ([]ProcessInfo, error) + // Checkpoint checkpoints a container to an image with live system data + Checkpoint(context.Context, string, *types.Any) error + // Update sets the provided resources to a running task + Update(context.Context, *types.Any) error + // Process returns a process within the task for the provided id + Process(context.Context, string) (Process, error) + // Stats returns runtime specific metrics for a task + Stats(context.Context) (*types.Any, error) +} + +// ExecOpts provides additional options for additional processes running in a task +type ExecOpts struct { + Spec *types.Any + IO IO +} + +// ConsoleSize of a pty or windows terminal +type ConsoleSize struct { + Width uint32 + Height uint32 +} + +// Status is the runtime status of a task and/or process +type Status int + +const ( + // CreatedStatus when a process has been created + CreatedStatus Status = iota + 1 + // RunningStatus when a process is running + RunningStatus + // StoppedStatus when a process has stopped + StoppedStatus + // DeletedStatus when a process has been deleted + DeletedStatus + // PausedStatus when a process is paused + PausedStatus + // PausingStatus when a process is currently pausing + PausingStatus +) + +// State information for a process +type State struct { + // Status is the current status of the container + Status Status + // Pid is the main process id for the container + Pid uint32 + // ExitStatus of the process + // Only valid if the Status is Stopped + ExitStatus uint32 + // ExitedAt is the time at which the process exited + // Only valid if the Status is Stopped + ExitedAt time.Time + Stdin string + Stdout string + Stderr string + Terminal bool +} + +// ProcessInfo holds platform specific process information +type ProcessInfo struct { + // Pid is the process ID + Pid uint32 + // Info includes additional process information + // Info varies by platform + Info interface{} +} diff --git a/vendor/github.com/containerd/containerd/runtime/task_list.go b/vendor/github.com/containerd/containerd/runtime/task_list.go new file mode 100644 index 0000000000..b92c6e01cd --- /dev/null +++ b/vendor/github.com/containerd/containerd/runtime/task_list.go @@ -0,0 +1,130 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package runtime + +import ( + "context" + "sync" + + "github.com/containerd/containerd/namespaces" + "github.com/pkg/errors" +) + +var ( + // ErrTaskNotExists is returned when a task does not exist + ErrTaskNotExists = errors.New("task does not exist") + // ErrTaskAlreadyExists is returned when a task already exists + ErrTaskAlreadyExists = errors.New("task already exists") +) + +// NewTaskList returns a new TaskList +func NewTaskList() *TaskList { + return &TaskList{ + tasks: make(map[string]map[string]Task), + } +} + +// TaskList holds and provides locking around tasks +type TaskList struct { + mu sync.Mutex + tasks map[string]map[string]Task +} + +// Get a task +func (l *TaskList) Get(ctx context.Context, id string) (Task, error) { + l.mu.Lock() + defer l.mu.Unlock() + namespace, err := namespaces.NamespaceRequired(ctx) + if err != nil { + return nil, err + } + tasks, ok := l.tasks[namespace] + if !ok { + return nil, ErrTaskNotExists + } + t, ok := tasks[id] + if !ok { + return nil, ErrTaskNotExists + } + return t, nil +} + +// GetAll tasks under a namespace +func (l *TaskList) GetAll(ctx context.Context, noNS bool) ([]Task, error) { + l.mu.Lock() + defer l.mu.Unlock() + var o []Task + if noNS { + for ns := range l.tasks { + for _, t := range l.tasks[ns] { + o = append(o, t) + } + } + return o, nil + } + namespace, err := namespaces.NamespaceRequired(ctx) + if err != nil { + return nil, err + } + tasks, ok := l.tasks[namespace] + if !ok { + return o, nil + } + for _, t := range tasks { + o = append(o, t) + } + return o, nil +} + +// Add a task +func (l *TaskList) Add(ctx context.Context, t Task) error { + namespace, err := namespaces.NamespaceRequired(ctx) + if err != nil { + return err + } + return l.AddWithNamespace(namespace, t) +} + +// AddWithNamespace adds a task with the provided namespace +func (l *TaskList) AddWithNamespace(namespace string, t Task) error { + l.mu.Lock() + defer l.mu.Unlock() + + id := t.ID() + if _, ok := l.tasks[namespace]; !ok { + l.tasks[namespace] = make(map[string]Task) + } + if _, ok := l.tasks[namespace][id]; ok { + return errors.Wrap(ErrTaskAlreadyExists, id) + } + l.tasks[namespace][id] = t + return nil +} + +// Delete a task +func (l *TaskList) Delete(ctx context.Context, id string) { + l.mu.Lock() + defer l.mu.Unlock() + namespace, err := namespaces.NamespaceRequired(ctx) + if err != nil { + return + } + tasks, ok := l.tasks[namespace] + if ok { + delete(tasks, id) + } +} diff --git a/vendor/github.com/containerd/containerd/runtime/typeurl.go b/vendor/github.com/containerd/containerd/runtime/typeurl.go new file mode 100644 index 0000000000..eb54e250f3 --- /dev/null +++ b/vendor/github.com/containerd/containerd/runtime/typeurl.go @@ -0,0 +1,34 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package runtime + +import ( + "strconv" + + "github.com/containerd/typeurl" + specs "github.com/opencontainers/runtime-spec/specs-go" +) + +func init() { + const prefix = "types.containerd.io" + // register TypeUrls for commonly marshaled external types + major := strconv.Itoa(specs.VersionMajor) + typeurl.Register(&specs.Spec{}, prefix, "opencontainers/runtime-spec", major, "Spec") + typeurl.Register(&specs.Process{}, prefix, "opencontainers/runtime-spec", major, "Process") + typeurl.Register(&specs.LinuxResources{}, prefix, "opencontainers/runtime-spec", major, "LinuxResources") + typeurl.Register(&specs.WindowsResources{}, prefix, "opencontainers/runtime-spec", major, "WindowsResources") +} diff --git a/vendor/github.com/containerd/containerd/runtime/v2/shim/reaper_unix.go b/vendor/github.com/containerd/containerd/runtime/v2/shim/reaper_unix.go new file mode 100644 index 0000000000..2937f1a9ef --- /dev/null +++ b/vendor/github.com/containerd/containerd/runtime/v2/shim/reaper_unix.go @@ -0,0 +1,110 @@ +// +build !windows + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package shim + +import ( + "os/exec" + "sync" + "time" + + "github.com/containerd/containerd/sys" + runc "github.com/containerd/go-runc" + "github.com/pkg/errors" +) + +// ErrNoSuchProcess is returned when the process no longer exists +var ErrNoSuchProcess = errors.New("no such process") + +const bufferSize = 32 + +// Reap should be called when the process receives an SIGCHLD. Reap will reap +// all exited processes and close their wait channels +func Reap() error { + now := time.Now() + exits, err := sys.Reap(false) + Default.Lock() + for c := range Default.subscribers { + for _, e := range exits { + c <- runc.Exit{ + Timestamp: now, + Pid: e.Pid, + Status: e.Status, + } + } + + } + Default.Unlock() + return err +} + +// Default is the default monitor initialized for the package +var Default = &Monitor{ + subscribers: make(map[chan runc.Exit]struct{}), +} + +// Monitor monitors the underlying system for process status changes +type Monitor struct { + sync.Mutex + + subscribers map[chan runc.Exit]struct{} +} + +// Start starts the command a registers the process with the reaper +func (m *Monitor) Start(c *exec.Cmd) (chan runc.Exit, error) { + ec := m.Subscribe() + if err := c.Start(); err != nil { + m.Unsubscribe(ec) + return nil, err + } + return ec, nil +} + +// Wait blocks until a process is signal as dead. +// User should rely on the value of the exit status to determine if the +// command was successful or not. +func (m *Monitor) Wait(c *exec.Cmd, ec chan runc.Exit) (int, error) { + for e := range ec { + if e.Pid == c.Process.Pid { + // make sure we flush all IO + c.Wait() + m.Unsubscribe(ec) + return e.Status, nil + } + } + // return no such process if the ec channel is closed and no more exit + // events will be sent + return -1, ErrNoSuchProcess +} + +// Subscribe to process exit changes +func (m *Monitor) Subscribe() chan runc.Exit { + c := make(chan runc.Exit, bufferSize) + m.Lock() + m.subscribers[c] = struct{}{} + m.Unlock() + return c +} + +// Unsubscribe to process exit changes +func (m *Monitor) Unsubscribe(c chan runc.Exit) { + m.Lock() + delete(m.subscribers, c) + close(c) + m.Unlock() +} diff --git a/vendor/github.com/containerd/containerd/runtime/v2/shim/shim.go b/vendor/github.com/containerd/containerd/runtime/v2/shim/shim.go new file mode 100644 index 0000000000..da2a2e8879 --- /dev/null +++ b/vendor/github.com/containerd/containerd/runtime/v2/shim/shim.go @@ -0,0 +1,257 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package shim + +import ( + "context" + "flag" + "fmt" + "os" + "runtime" + "runtime/debug" + "strings" + "time" + + "github.com/containerd/containerd/events" + "github.com/containerd/containerd/log" + "github.com/containerd/containerd/namespaces" + shimapi "github.com/containerd/containerd/runtime/v2/task" + "github.com/containerd/ttrpc" + "github.com/gogo/protobuf/proto" + "github.com/pkg/errors" + "github.com/sirupsen/logrus" +) + +// Client for a shim server +type Client struct { + service shimapi.TaskService + context context.Context + signals chan os.Signal +} + +// Init func for the creation of a shim server +type Init func(context.Context, string, events.Publisher) (Shim, error) + +// Shim server interface +type Shim interface { + shimapi.TaskService + Cleanup(ctx context.Context) (*shimapi.DeleteResponse, error) + StartShim(ctx context.Context, id, containerdBinary, containerdAddress string) (string, error) +} + +var ( + debugFlag bool + idFlag string + namespaceFlag string + socketFlag string + addressFlag string + containerdBinaryFlag string + action string +) + +func parseFlags() { + flag.BoolVar(&debugFlag, "debug", false, "enable debug output in logs") + flag.StringVar(&namespaceFlag, "namespace", "", "namespace that owns the shim") + flag.StringVar(&idFlag, "id", "", "id of the task") + flag.StringVar(&socketFlag, "socket", "", "abstract socket path to serve") + + flag.StringVar(&addressFlag, "address", "", "grpc address back to main containerd") + flag.StringVar(&containerdBinaryFlag, "publish-binary", "containerd", "path to publish binary (used for publishing events)") + + flag.Parse() + action = flag.Arg(0) +} + +func setRuntime() { + debug.SetGCPercent(40) + go func() { + for range time.Tick(30 * time.Second) { + debug.FreeOSMemory() + } + }() + if os.Getenv("GOMAXPROCS") == "" { + // If GOMAXPROCS hasn't been set, we default to a value of 2 to reduce + // the number of Go stacks present in the shim. + runtime.GOMAXPROCS(2) + } +} + +func setLogger(ctx context.Context, id string) error { + logrus.SetFormatter(&logrus.TextFormatter{ + TimestampFormat: log.RFC3339NanoFixed, + FullTimestamp: true, + }) + if debugFlag { + logrus.SetLevel(logrus.DebugLevel) + } + f, err := openLog(ctx, id) + if err != nil { + return err + } + logrus.SetOutput(f) + return nil +} + +// Run initializes and runs a shim server +func Run(id string, initFunc Init) { + if err := run(id, initFunc); err != nil { + fmt.Fprintf(os.Stderr, "%s: %s\n", id, err) + os.Exit(1) + } +} + +func run(id string, initFunc Init) error { + parseFlags() + setRuntime() + + signals, err := setupSignals() + if err != nil { + return err + } + if err := subreaper(); err != nil { + return err + } + publisher := &remoteEventsPublisher{ + address: addressFlag, + containerdBinaryPath: containerdBinaryFlag, + } + if namespaceFlag == "" { + return fmt.Errorf("shim namespace cannot be empty") + } + ctx := namespaces.WithNamespace(context.Background(), namespaceFlag) + ctx = log.WithLogger(ctx, log.G(ctx).WithField("runtime", id)) + + service, err := initFunc(ctx, idFlag, publisher) + if err != nil { + return err + } + switch action { + case "delete": + logger := logrus.WithFields(logrus.Fields{ + "pid": os.Getpid(), + "namespace": namespaceFlag, + }) + go handleSignals(logger, signals) + response, err := service.Cleanup(ctx) + if err != nil { + return err + } + data, err := proto.Marshal(response) + if err != nil { + return err + } + if _, err := os.Stdout.Write(data); err != nil { + return err + } + return nil + case "start": + address, err := service.StartShim(ctx, idFlag, containerdBinaryFlag, addressFlag) + if err != nil { + return err + } + if _, err := os.Stdout.WriteString(address); err != nil { + return err + } + return nil + default: + if err := setLogger(ctx, idFlag); err != nil { + return err + } + client := NewShimClient(ctx, service, signals) + return client.Serve() + } +} + +// NewShimClient creates a new shim server client +func NewShimClient(ctx context.Context, svc shimapi.TaskService, signals chan os.Signal) *Client { + s := &Client{ + service: svc, + context: ctx, + signals: signals, + } + return s +} + +// Serve the shim server +func (s *Client) Serve() error { + dump := make(chan os.Signal, 32) + setupDumpStacks(dump) + + path, err := os.Getwd() + if err != nil { + return err + } + server, err := newServer() + if err != nil { + return errors.Wrap(err, "failed creating server") + } + + logrus.Debug("registering ttrpc server") + shimapi.RegisterTaskService(server, s.service) + + if err := serve(s.context, server, socketFlag); err != nil { + return err + } + logger := logrus.WithFields(logrus.Fields{ + "pid": os.Getpid(), + "path": path, + "namespace": namespaceFlag, + }) + go func() { + for range dump { + dumpStacks(logger) + } + }() + return handleSignals(logger, s.signals) +} + +// serve serves the ttrpc API over a unix socket at the provided path +// this function does not block +func serve(ctx context.Context, server *ttrpc.Server, path string) error { + l, err := serveListener(path) + if err != nil { + return err + } + go func() { + defer l.Close() + if err := server.Serve(ctx, l); err != nil && + !strings.Contains(err.Error(), "use of closed network connection") { + logrus.WithError(err).Fatal("containerd-shim: ttrpc server failure") + } + }() + return nil +} + +func dumpStacks(logger *logrus.Entry) { + var ( + buf []byte + stackSize int + ) + bufferLen := 16384 + for stackSize == len(buf) { + buf = make([]byte, bufferLen) + stackSize = runtime.Stack(buf, true) + bufferLen *= 2 + } + buf = buf[:stackSize] + logger.Infof("=== BEGIN goroutine stack dump ===\n%s\n=== END goroutine stack dump ===", buf) +} + +type remoteEventsPublisher struct { + address string + containerdBinaryPath string +} diff --git a/vendor/github.com/containerd/containerd/runtime/v2/shim/shim_darwin.go b/vendor/github.com/containerd/containerd/runtime/v2/shim/shim_darwin.go new file mode 100644 index 0000000000..314b45cb54 --- /dev/null +++ b/vendor/github.com/containerd/containerd/runtime/v2/shim/shim_darwin.go @@ -0,0 +1,29 @@ +// +build darwin + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package shim + +import "github.com/containerd/ttrpc" + +func newServer() (*ttrpc.Server, error) { + return ttrpc.NewServer() +} + +func subreaper() error { + return nil +} diff --git a/vendor/github.com/containerd/containerd/runtime/v2/shim/shim_linux.go b/vendor/github.com/containerd/containerd/runtime/v2/shim/shim_linux.go new file mode 100644 index 0000000000..7ad2a72620 --- /dev/null +++ b/vendor/github.com/containerd/containerd/runtime/v2/shim/shim_linux.go @@ -0,0 +1,30 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package shim + +import ( + "github.com/containerd/containerd/sys" + "github.com/containerd/ttrpc" +) + +func newServer() (*ttrpc.Server, error) { + return ttrpc.NewServer(ttrpc.WithServerHandshaker(ttrpc.UnixSocketRequireSameUser())) +} + +func subreaper() error { + return sys.SetSubreaper(1) +} diff --git a/vendor/github.com/containerd/containerd/runtime/v2/shim/shim_unix.go b/vendor/github.com/containerd/containerd/runtime/v2/shim/shim_unix.go new file mode 100644 index 0000000000..6f1ef6e284 --- /dev/null +++ b/vendor/github.com/containerd/containerd/runtime/v2/shim/shim_unix.go @@ -0,0 +1,117 @@ +// +build !windows + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package shim + +import ( + "bytes" + "context" + "io" + "net" + "os" + "os/exec" + "os/signal" + "syscall" + + "github.com/containerd/containerd/events" + "github.com/containerd/containerd/namespaces" + "github.com/containerd/fifo" + "github.com/containerd/typeurl" + "github.com/pkg/errors" + "github.com/sirupsen/logrus" + "golang.org/x/sys/unix" +) + +// setupSignals creates a new signal handler for all signals and sets the shim as a +// sub-reaper so that the container processes are reparented +func setupSignals() (chan os.Signal, error) { + signals := make(chan os.Signal, 32) + signal.Notify(signals, unix.SIGTERM, unix.SIGINT, unix.SIGCHLD, unix.SIGPIPE) + return signals, nil +} + +func setupDumpStacks(dump chan<- os.Signal) { + signal.Notify(dump, syscall.SIGUSR1) +} + +func serveListener(path string) (net.Listener, error) { + var ( + l net.Listener + err error + ) + if path == "" { + l, err = net.FileListener(os.NewFile(3, "socket")) + path = "[inherited from parent]" + } else { + if len(path) > 106 { + return nil, errors.Errorf("%q: unix socket path too long (> 106)", path) + } + l, err = net.Listen("unix", "\x00"+path) + } + if err != nil { + return nil, err + } + logrus.WithField("socket", path).Debug("serving api on abstract socket") + return l, nil +} + +func handleSignals(logger *logrus.Entry, signals chan os.Signal) error { + logger.Info("starting signal loop") + for { + select { + case s := <-signals: + switch s { + case unix.SIGCHLD: + if err := Reap(); err != nil { + logger.WithError(err).Error("reap exit status") + } + case unix.SIGPIPE: + } + } + } +} + +func openLog(ctx context.Context, _ string) (io.Writer, error) { + return fifo.OpenFifo(context.Background(), "log", unix.O_WRONLY, 0700) +} + +func (l *remoteEventsPublisher) Publish(ctx context.Context, topic string, event events.Event) error { + ns, _ := namespaces.Namespace(ctx) + encoded, err := typeurl.MarshalAny(event) + if err != nil { + return err + } + data, err := encoded.Marshal() + if err != nil { + return err + } + cmd := exec.CommandContext(ctx, l.containerdBinaryPath, "--address", l.address, "publish", "--topic", topic, "--namespace", ns) + cmd.Stdin = bytes.NewReader(data) + c, err := Default.Start(cmd) + if err != nil { + return err + } + status, err := Default.Wait(cmd, c) + if err != nil { + return err + } + if status != 0 { + return errors.New("failed to publish event") + } + return nil +} diff --git a/vendor/github.com/containerd/containerd/runtime/v2/shim/shim_windows.go b/vendor/github.com/containerd/containerd/runtime/v2/shim/shim_windows.go new file mode 100644 index 0000000000..4e94e7b5df --- /dev/null +++ b/vendor/github.com/containerd/containerd/runtime/v2/shim/shim_windows.go @@ -0,0 +1,182 @@ +// +build windows + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package shim + +import ( + "bytes" + "context" + "fmt" + "io" + "net" + "os" + "os/exec" + "sync" + "unsafe" + + winio "github.com/Microsoft/go-winio" + "github.com/containerd/containerd/events" + "github.com/containerd/containerd/namespaces" + "github.com/containerd/ttrpc" + "github.com/containerd/typeurl" + "github.com/pkg/errors" + "github.com/sirupsen/logrus" + "golang.org/x/sys/windows" +) + +// setupSignals creates a new signal handler for all signals +func setupSignals() (chan os.Signal, error) { + signals := make(chan os.Signal, 32) + return signals, nil +} + +func newServer() (*ttrpc.Server, error) { + return ttrpc.NewServer() +} + +func subreaper() error { + return nil +} + +type fakeSignal struct { +} + +func (fs *fakeSignal) String() string { + return "" +} + +func (fs *fakeSignal) Signal() { +} + +func setupDumpStacks(dump chan<- os.Signal) { + // Windows does not support signals like *nix systems. So instead of + // trapping on SIGUSR1 to dump stacks, we wait on a Win32 event to be + // signaled. ACL'd to builtin administrators and local system + event := "Global\\containerd-shim-runhcs-v1-" + fmt.Sprint(os.Getpid()) + ev, _ := windows.UTF16PtrFromString(event) + sd, err := winio.SddlToSecurityDescriptor("D:P(A;;GA;;;BA)(A;;GA;;;SY)") + if err != nil { + logrus.Errorf("failed to get security descriptor for debug stackdump event %s: %s", event, err.Error()) + return + } + var sa windows.SecurityAttributes + sa.Length = uint32(unsafe.Sizeof(sa)) + sa.InheritHandle = 1 + sa.SecurityDescriptor = uintptr(unsafe.Pointer(&sd[0])) + h, err := windows.CreateEvent(&sa, 0, 0, ev) + if h == 0 || err != nil { + logrus.Errorf("failed to create debug stackdump event %s: %s", event, err.Error()) + return + } + go func() { + logrus.Debugf("Stackdump - waiting signal at %s", event) + for { + windows.WaitForSingleObject(h, windows.INFINITE) + dump <- new(fakeSignal) + } + }() +} + +// serve serves the ttrpc API over a unix socket at the provided path +// this function does not block +func serveListener(path string) (net.Listener, error) { + if path == "" { + return nil, errors.New("'socket' must be npipe path") + } + l, err := winio.ListenPipe(path, nil) + if err != nil { + return nil, err + } + logrus.WithField("socket", path).Debug("serving api on npipe socket") + return l, nil +} + +func handleSignals(logger *logrus.Entry, signals chan os.Signal) error { + logger.Info("starting signal loop") + for { + select { + case s := <-signals: + switch s { + case os.Interrupt: + break + } + } + } +} + +type deferredShimWriteLogger struct { + ctx context.Context + + wg sync.WaitGroup + + c net.Conn + conerr error +} + +func (dswl *deferredShimWriteLogger) Write(p []byte) (int, error) { + dswl.wg.Wait() + if dswl.c == nil { + return 0, dswl.conerr + } + return dswl.c.Write(p) +} + +// openLog on Windows acts as the server of the log pipe. This allows the +// containerd daemon to independently restart and reconnect to the logs. +func openLog(ctx context.Context, id string) (io.Writer, error) { + ns, err := namespaces.NamespaceRequired(ctx) + if err != nil { + return nil, err + } + l, err := winio.ListenPipe(fmt.Sprintf("\\\\.\\pipe\\containerd-shim-%s-%s-log", ns, id), nil) + if err != nil { + return nil, err + } + dswl := &deferredShimWriteLogger{ + ctx: ctx, + } + // TODO: JTERRY75 - this will not work with restarts. Only the first + // connection will work and all +1 connections will return 'use of closed + // network connection'. Make this reconnect aware. + dswl.wg.Add(1) + go func() { + c, conerr := l.Accept() + if conerr != nil { + l.Close() + dswl.conerr = conerr + } + dswl.c = c + dswl.wg.Done() + }() + return dswl, nil +} + +func (l *remoteEventsPublisher) Publish(ctx context.Context, topic string, event events.Event) error { + ns, _ := namespaces.Namespace(ctx) + encoded, err := typeurl.MarshalAny(event) + if err != nil { + return err + } + data, err := encoded.Marshal() + if err != nil { + return err + } + cmd := exec.CommandContext(ctx, l.containerdBinaryPath, "--address", l.address, "publish", "--topic", topic, "--namespace", ns) + cmd.Stdin = bytes.NewReader(data) + return cmd.Run() +} diff --git a/vendor/github.com/containerd/containerd/runtime/v2/shim/util.go b/vendor/github.com/containerd/containerd/runtime/v2/shim/util.go new file mode 100644 index 0000000000..ca028a6834 --- /dev/null +++ b/vendor/github.com/containerd/containerd/runtime/v2/shim/util.go @@ -0,0 +1,120 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package shim + +import ( + "context" + "fmt" + "net" + "os" + "os/exec" + "path/filepath" + "strings" + "time" + + "github.com/containerd/containerd/namespaces" + "github.com/pkg/errors" +) + +const shimBinaryFormat = "containerd-shim-%s-%s" + +// Command returns the shim command with the provided args and configuration +func Command(ctx context.Context, runtime, containerdAddress, path string, cmdArgs ...string) (*exec.Cmd, error) { + ns, err := namespaces.NamespaceRequired(ctx) + if err != nil { + return nil, err + } + self, err := os.Executable() + if err != nil { + return nil, err + } + args := []string{ + "-namespace", ns, + "-address", containerdAddress, + "-publish-binary", self, + } + args = append(args, cmdArgs...) + name := BinaryName(runtime) + var cmdPath string + var lerr error + if cmdPath, lerr = exec.LookPath(name); lerr != nil { + if eerr, ok := lerr.(*exec.Error); ok { + if eerr.Err == exec.ErrNotFound { + return nil, errors.Wrapf(os.ErrNotExist, "runtime %q binary not installed %q", runtime, name) + } + } + } + cmdPath, err = filepath.Abs(cmdPath) + if err != nil { + return nil, err + } + cmd := exec.Command(cmdPath, args...) + cmd.Dir = path + cmd.Env = append(os.Environ(), "GOMAXPROCS=2") + cmd.SysProcAttr = getSysProcAttr() + return cmd, nil +} + +// BinaryName returns the shim binary name from the runtime name +func BinaryName(runtime string) string { + parts := strings.Split(runtime, ".") + // TODO: add validation for runtime + return fmt.Sprintf(shimBinaryFormat, parts[len(parts)-2], parts[len(parts)-1]) +} + +// Connect to the provided address +func Connect(address string, d func(string, time.Duration) (net.Conn, error)) (net.Conn, error) { + return d(address, 100*time.Second) +} + +// WritePidFile writes a pid file atomically +func WritePidFile(path string, pid int) error { + path, err := filepath.Abs(path) + if err != nil { + return err + } + tempPath := filepath.Join(filepath.Dir(path), fmt.Sprintf(".%s", filepath.Base(path))) + f, err := os.OpenFile(tempPath, os.O_RDWR|os.O_CREATE|os.O_EXCL|os.O_SYNC, 0666) + if err != nil { + return err + } + _, err = fmt.Fprintf(f, "%d", pid) + f.Close() + if err != nil { + return err + } + return os.Rename(tempPath, path) +} + +// WriteAddress writes a address file atomically +func WriteAddress(path, address string) error { + path, err := filepath.Abs(path) + if err != nil { + return err + } + tempPath := filepath.Join(filepath.Dir(path), fmt.Sprintf(".%s", filepath.Base(path))) + f, err := os.OpenFile(tempPath, os.O_RDWR|os.O_CREATE|os.O_EXCL|os.O_SYNC, 0666) + if err != nil { + return err + } + _, err = f.WriteString(address) + f.Close() + if err != nil { + return err + } + return os.Rename(tempPath, path) +} diff --git a/vendor/github.com/containerd/containerd/runtime/v2/shim/util_unix.go b/vendor/github.com/containerd/containerd/runtime/v2/shim/util_unix.go new file mode 100644 index 0000000000..262fe2b363 --- /dev/null +++ b/vendor/github.com/containerd/containerd/runtime/v2/shim/util_unix.go @@ -0,0 +1,70 @@ +// +build !windows + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package shim + +import ( + "context" + "net" + "path/filepath" + "strings" + "syscall" + "time" + + "github.com/containerd/containerd/namespaces" + "github.com/containerd/containerd/sys" + "github.com/pkg/errors" +) + +func getSysProcAttr() *syscall.SysProcAttr { + return &syscall.SysProcAttr{ + Setpgid: true, + } +} + +// SetScore sets the oom score for a process +func SetScore(pid int) error { + return sys.SetOOMScore(pid, sys.OOMScoreMaxKillable) +} + +// SocketAddress returns an abstract socket address +func SocketAddress(ctx context.Context, id string) (string, error) { + ns, err := namespaces.NamespaceRequired(ctx) + if err != nil { + return "", err + } + return filepath.Join(string(filepath.Separator), "containerd-shim", ns, id, "shim.sock"), nil +} + +// AnonDialer returns a dialer for an abstract socket +func AnonDialer(address string, timeout time.Duration) (net.Conn, error) { + address = strings.TrimPrefix(address, "unix://") + return net.DialTimeout("unix", "\x00"+address, timeout) +} + +// NewSocket returns a new socket +func NewSocket(address string) (*net.UnixListener, error) { + if len(address) > 106 { + return nil, errors.Errorf("%q: unix socket path too long (> 106)", address) + } + l, err := net.Listen("unix", "\x00"+address) + if err != nil { + return nil, errors.Wrapf(err, "failed to listen to abstract unix socket %q", address) + } + return l.(*net.UnixListener), nil +} diff --git a/vendor/github.com/containerd/containerd/runtime/v2/shim/util_windows.go b/vendor/github.com/containerd/containerd/runtime/v2/shim/util_windows.go new file mode 100644 index 0000000000..be9e661ae7 --- /dev/null +++ b/vendor/github.com/containerd/containerd/runtime/v2/shim/util_windows.go @@ -0,0 +1,80 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package shim + +import ( + "context" + "fmt" + "net" + "os" + "syscall" + "time" + + winio "github.com/Microsoft/go-winio" + "github.com/containerd/containerd/namespaces" + "github.com/pkg/errors" +) + +func getSysProcAttr() *syscall.SysProcAttr { + return nil +} + +// SetScore sets the oom score for a process +func SetScore(pid int) error { + return nil +} + +// SocketAddress returns a npipe address +func SocketAddress(ctx context.Context, id string) (string, error) { + ns, err := namespaces.NamespaceRequired(ctx) + if err != nil { + return "", err + } + return fmt.Sprintf("\\\\.\\pipe\\containerd-shim-%s-%s-pipe", ns, id), nil +} + +// AnonDialer returns a dialer for a npipe +func AnonDialer(address string, timeout time.Duration) (net.Conn, error) { + var c net.Conn + var lastError error + start := time.Now() + for { + remaining := timeout - time.Now().Sub(start) + if remaining <= 0 { + lastError = errors.Errorf("timed out waiting for npipe %s", address) + break + } + c, lastError = winio.DialPipe(address, &remaining) + if lastError == nil { + break + } + if !os.IsNotExist(lastError) { + break + } + time.Sleep(10 * time.Millisecond) + } + return c, lastError +} + +// NewSocket returns a new npipe listener +func NewSocket(address string) (net.Listener, error) { + l, err := winio.ListenPipe(address, nil) + if err != nil { + return nil, errors.Wrapf(err, "failed to listen to npipe %s", address) + } + return l, nil +} diff --git a/vendor/github.com/containerd/containerd/runtime/v2/task/doc.go b/vendor/github.com/containerd/containerd/runtime/v2/task/doc.go new file mode 100644 index 0000000000..f933dd8d41 --- /dev/null +++ b/vendor/github.com/containerd/containerd/runtime/v2/task/doc.go @@ -0,0 +1,17 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package task diff --git a/vendor/github.com/containerd/containerd/runtime/v2/task/shim.pb.go b/vendor/github.com/containerd/containerd/runtime/v2/task/shim.pb.go new file mode 100644 index 0000000000..9caefd7580 --- /dev/null +++ b/vendor/github.com/containerd/containerd/runtime/v2/task/shim.pb.go @@ -0,0 +1,5693 @@ +// Code generated by protoc-gen-gogo. DO NOT EDIT. +// source: github.com/containerd/containerd/runtime/v2/task/shim.proto + +/* + Package task is a generated protocol buffer package. + + It is generated from these files: + github.com/containerd/containerd/runtime/v2/task/shim.proto + + It has these top-level messages: + CreateTaskRequest + CreateTaskResponse + DeleteRequest + DeleteResponse + ExecProcessRequest + ExecProcessResponse + ResizePtyRequest + StateRequest + StateResponse + KillRequest + CloseIORequest + PidsRequest + PidsResponse + CheckpointTaskRequest + UpdateTaskRequest + StartRequest + StartResponse + WaitRequest + WaitResponse + StatsRequest + StatsResponse + ConnectRequest + ConnectResponse + ShutdownRequest + PauseRequest + ResumeRequest +*/ +package task + +import proto "github.com/gogo/protobuf/proto" +import fmt "fmt" +import math "math" +import google_protobuf "github.com/gogo/protobuf/types" +import google_protobuf1 "github.com/gogo/protobuf/types" + +// skipping weak import gogoproto "github.com/gogo/protobuf/gogoproto" +import _ "github.com/gogo/protobuf/types" +import containerd_types "github.com/containerd/containerd/api/types" +import containerd_v1_types "github.com/containerd/containerd/api/types/task" + +import time "time" + +import types "github.com/gogo/protobuf/types" + +import strings "strings" +import reflect "reflect" + +import context "context" +import ttrpc "github.com/containerd/ttrpc" + +import io "io" + +// Reference imports to suppress errors if they are not otherwise used. +var _ = proto.Marshal +var _ = fmt.Errorf +var _ = math.Inf +var _ = time.Kitchen + +// This is a compile-time assertion to ensure that this generated file +// is compatible with the proto package it is being compiled against. +// A compilation error at this line likely means your copy of the +// proto package needs to be updated. +const _ = proto.GoGoProtoPackageIsVersion2 // please upgrade the proto package + +type CreateTaskRequest struct { + ID string `protobuf:"bytes,1,opt,name=id,proto3" json:"id,omitempty"` + Bundle string `protobuf:"bytes,2,opt,name=bundle,proto3" json:"bundle,omitempty"` + Rootfs []*containerd_types.Mount `protobuf:"bytes,3,rep,name=rootfs" json:"rootfs,omitempty"` + Terminal bool `protobuf:"varint,4,opt,name=terminal,proto3" json:"terminal,omitempty"` + Stdin string `protobuf:"bytes,5,opt,name=stdin,proto3" json:"stdin,omitempty"` + Stdout string `protobuf:"bytes,6,opt,name=stdout,proto3" json:"stdout,omitempty"` + Stderr string `protobuf:"bytes,7,opt,name=stderr,proto3" json:"stderr,omitempty"` + Checkpoint string `protobuf:"bytes,8,opt,name=checkpoint,proto3" json:"checkpoint,omitempty"` + ParentCheckpoint string `protobuf:"bytes,9,opt,name=parent_checkpoint,json=parentCheckpoint,proto3" json:"parent_checkpoint,omitempty"` + Options *google_protobuf.Any `protobuf:"bytes,10,opt,name=options" json:"options,omitempty"` +} + +func (m *CreateTaskRequest) Reset() { *m = CreateTaskRequest{} } +func (*CreateTaskRequest) ProtoMessage() {} +func (*CreateTaskRequest) Descriptor() ([]byte, []int) { return fileDescriptorShim, []int{0} } + +type CreateTaskResponse struct { + Pid uint32 `protobuf:"varint,1,opt,name=pid,proto3" json:"pid,omitempty"` +} + +func (m *CreateTaskResponse) Reset() { *m = CreateTaskResponse{} } +func (*CreateTaskResponse) ProtoMessage() {} +func (*CreateTaskResponse) Descriptor() ([]byte, []int) { return fileDescriptorShim, []int{1} } + +type DeleteRequest struct { + ID string `protobuf:"bytes,1,opt,name=id,proto3" json:"id,omitempty"` + ExecID string `protobuf:"bytes,2,opt,name=exec_id,json=execId,proto3" json:"exec_id,omitempty"` +} + +func (m *DeleteRequest) Reset() { *m = DeleteRequest{} } +func (*DeleteRequest) ProtoMessage() {} +func (*DeleteRequest) Descriptor() ([]byte, []int) { return fileDescriptorShim, []int{2} } + +type DeleteResponse struct { + Pid uint32 `protobuf:"varint,1,opt,name=pid,proto3" json:"pid,omitempty"` + ExitStatus uint32 `protobuf:"varint,2,opt,name=exit_status,json=exitStatus,proto3" json:"exit_status,omitempty"` + ExitedAt time.Time `protobuf:"bytes,3,opt,name=exited_at,json=exitedAt,stdtime" json:"exited_at"` +} + +func (m *DeleteResponse) Reset() { *m = DeleteResponse{} } +func (*DeleteResponse) ProtoMessage() {} +func (*DeleteResponse) Descriptor() ([]byte, []int) { return fileDescriptorShim, []int{3} } + +type ExecProcessRequest struct { + ID string `protobuf:"bytes,1,opt,name=id,proto3" json:"id,omitempty"` + ExecID string `protobuf:"bytes,2,opt,name=exec_id,json=execId,proto3" json:"exec_id,omitempty"` + Terminal bool `protobuf:"varint,3,opt,name=terminal,proto3" json:"terminal,omitempty"` + Stdin string `protobuf:"bytes,4,opt,name=stdin,proto3" json:"stdin,omitempty"` + Stdout string `protobuf:"bytes,5,opt,name=stdout,proto3" json:"stdout,omitempty"` + Stderr string `protobuf:"bytes,6,opt,name=stderr,proto3" json:"stderr,omitempty"` + Spec *google_protobuf.Any `protobuf:"bytes,7,opt,name=spec" json:"spec,omitempty"` +} + +func (m *ExecProcessRequest) Reset() { *m = ExecProcessRequest{} } +func (*ExecProcessRequest) ProtoMessage() {} +func (*ExecProcessRequest) Descriptor() ([]byte, []int) { return fileDescriptorShim, []int{4} } + +type ExecProcessResponse struct { +} + +func (m *ExecProcessResponse) Reset() { *m = ExecProcessResponse{} } +func (*ExecProcessResponse) ProtoMessage() {} +func (*ExecProcessResponse) Descriptor() ([]byte, []int) { return fileDescriptorShim, []int{5} } + +type ResizePtyRequest struct { + ID string `protobuf:"bytes,1,opt,name=id,proto3" json:"id,omitempty"` + ExecID string `protobuf:"bytes,2,opt,name=exec_id,json=execId,proto3" json:"exec_id,omitempty"` + Width uint32 `protobuf:"varint,3,opt,name=width,proto3" json:"width,omitempty"` + Height uint32 `protobuf:"varint,4,opt,name=height,proto3" json:"height,omitempty"` +} + +func (m *ResizePtyRequest) Reset() { *m = ResizePtyRequest{} } +func (*ResizePtyRequest) ProtoMessage() {} +func (*ResizePtyRequest) Descriptor() ([]byte, []int) { return fileDescriptorShim, []int{6} } + +type StateRequest struct { + ID string `protobuf:"bytes,1,opt,name=id,proto3" json:"id,omitempty"` + ExecID string `protobuf:"bytes,2,opt,name=exec_id,json=execId,proto3" json:"exec_id,omitempty"` +} + +func (m *StateRequest) Reset() { *m = StateRequest{} } +func (*StateRequest) ProtoMessage() {} +func (*StateRequest) Descriptor() ([]byte, []int) { return fileDescriptorShim, []int{7} } + +type StateResponse struct { + ID string `protobuf:"bytes,1,opt,name=id,proto3" json:"id,omitempty"` + Bundle string `protobuf:"bytes,2,opt,name=bundle,proto3" json:"bundle,omitempty"` + Pid uint32 `protobuf:"varint,3,opt,name=pid,proto3" json:"pid,omitempty"` + Status containerd_v1_types.Status `protobuf:"varint,4,opt,name=status,proto3,enum=containerd.v1.types.Status" json:"status,omitempty"` + Stdin string `protobuf:"bytes,5,opt,name=stdin,proto3" json:"stdin,omitempty"` + Stdout string `protobuf:"bytes,6,opt,name=stdout,proto3" json:"stdout,omitempty"` + Stderr string `protobuf:"bytes,7,opt,name=stderr,proto3" json:"stderr,omitempty"` + Terminal bool `protobuf:"varint,8,opt,name=terminal,proto3" json:"terminal,omitempty"` + ExitStatus uint32 `protobuf:"varint,9,opt,name=exit_status,json=exitStatus,proto3" json:"exit_status,omitempty"` + ExitedAt time.Time `protobuf:"bytes,10,opt,name=exited_at,json=exitedAt,stdtime" json:"exited_at"` +} + +func (m *StateResponse) Reset() { *m = StateResponse{} } +func (*StateResponse) ProtoMessage() {} +func (*StateResponse) Descriptor() ([]byte, []int) { return fileDescriptorShim, []int{8} } + +type KillRequest struct { + ID string `protobuf:"bytes,1,opt,name=id,proto3" json:"id,omitempty"` + ExecID string `protobuf:"bytes,2,opt,name=exec_id,json=execId,proto3" json:"exec_id,omitempty"` + Signal uint32 `protobuf:"varint,3,opt,name=signal,proto3" json:"signal,omitempty"` + All bool `protobuf:"varint,4,opt,name=all,proto3" json:"all,omitempty"` +} + +func (m *KillRequest) Reset() { *m = KillRequest{} } +func (*KillRequest) ProtoMessage() {} +func (*KillRequest) Descriptor() ([]byte, []int) { return fileDescriptorShim, []int{9} } + +type CloseIORequest struct { + ID string `protobuf:"bytes,1,opt,name=id,proto3" json:"id,omitempty"` + ExecID string `protobuf:"bytes,2,opt,name=exec_id,json=execId,proto3" json:"exec_id,omitempty"` + Stdin bool `protobuf:"varint,3,opt,name=stdin,proto3" json:"stdin,omitempty"` +} + +func (m *CloseIORequest) Reset() { *m = CloseIORequest{} } +func (*CloseIORequest) ProtoMessage() {} +func (*CloseIORequest) Descriptor() ([]byte, []int) { return fileDescriptorShim, []int{10} } + +type PidsRequest struct { + ID string `protobuf:"bytes,1,opt,name=id,proto3" json:"id,omitempty"` +} + +func (m *PidsRequest) Reset() { *m = PidsRequest{} } +func (*PidsRequest) ProtoMessage() {} +func (*PidsRequest) Descriptor() ([]byte, []int) { return fileDescriptorShim, []int{11} } + +type PidsResponse struct { + Processes []*containerd_v1_types.ProcessInfo `protobuf:"bytes,1,rep,name=processes" json:"processes,omitempty"` +} + +func (m *PidsResponse) Reset() { *m = PidsResponse{} } +func (*PidsResponse) ProtoMessage() {} +func (*PidsResponse) Descriptor() ([]byte, []int) { return fileDescriptorShim, []int{12} } + +type CheckpointTaskRequest struct { + ID string `protobuf:"bytes,1,opt,name=id,proto3" json:"id,omitempty"` + Path string `protobuf:"bytes,2,opt,name=path,proto3" json:"path,omitempty"` + Options *google_protobuf.Any `protobuf:"bytes,3,opt,name=options" json:"options,omitempty"` +} + +func (m *CheckpointTaskRequest) Reset() { *m = CheckpointTaskRequest{} } +func (*CheckpointTaskRequest) ProtoMessage() {} +func (*CheckpointTaskRequest) Descriptor() ([]byte, []int) { return fileDescriptorShim, []int{13} } + +type UpdateTaskRequest struct { + ID string `protobuf:"bytes,1,opt,name=id,proto3" json:"id,omitempty"` + Resources *google_protobuf.Any `protobuf:"bytes,2,opt,name=resources" json:"resources,omitempty"` +} + +func (m *UpdateTaskRequest) Reset() { *m = UpdateTaskRequest{} } +func (*UpdateTaskRequest) ProtoMessage() {} +func (*UpdateTaskRequest) Descriptor() ([]byte, []int) { return fileDescriptorShim, []int{14} } + +type StartRequest struct { + ID string `protobuf:"bytes,1,opt,name=id,proto3" json:"id,omitempty"` + ExecID string `protobuf:"bytes,2,opt,name=exec_id,json=execId,proto3" json:"exec_id,omitempty"` +} + +func (m *StartRequest) Reset() { *m = StartRequest{} } +func (*StartRequest) ProtoMessage() {} +func (*StartRequest) Descriptor() ([]byte, []int) { return fileDescriptorShim, []int{15} } + +type StartResponse struct { + Pid uint32 `protobuf:"varint,1,opt,name=pid,proto3" json:"pid,omitempty"` +} + +func (m *StartResponse) Reset() { *m = StartResponse{} } +func (*StartResponse) ProtoMessage() {} +func (*StartResponse) Descriptor() ([]byte, []int) { return fileDescriptorShim, []int{16} } + +type WaitRequest struct { + ID string `protobuf:"bytes,1,opt,name=id,proto3" json:"id,omitempty"` + ExecID string `protobuf:"bytes,2,opt,name=exec_id,json=execId,proto3" json:"exec_id,omitempty"` +} + +func (m *WaitRequest) Reset() { *m = WaitRequest{} } +func (*WaitRequest) ProtoMessage() {} +func (*WaitRequest) Descriptor() ([]byte, []int) { return fileDescriptorShim, []int{17} } + +type WaitResponse struct { + ExitStatus uint32 `protobuf:"varint,1,opt,name=exit_status,json=exitStatus,proto3" json:"exit_status,omitempty"` + ExitedAt time.Time `protobuf:"bytes,2,opt,name=exited_at,json=exitedAt,stdtime" json:"exited_at"` +} + +func (m *WaitResponse) Reset() { *m = WaitResponse{} } +func (*WaitResponse) ProtoMessage() {} +func (*WaitResponse) Descriptor() ([]byte, []int) { return fileDescriptorShim, []int{18} } + +type StatsRequest struct { + ID string `protobuf:"bytes,1,opt,name=id,proto3" json:"id,omitempty"` +} + +func (m *StatsRequest) Reset() { *m = StatsRequest{} } +func (*StatsRequest) ProtoMessage() {} +func (*StatsRequest) Descriptor() ([]byte, []int) { return fileDescriptorShim, []int{19} } + +type StatsResponse struct { + Stats *google_protobuf.Any `protobuf:"bytes,1,opt,name=stats" json:"stats,omitempty"` +} + +func (m *StatsResponse) Reset() { *m = StatsResponse{} } +func (*StatsResponse) ProtoMessage() {} +func (*StatsResponse) Descriptor() ([]byte, []int) { return fileDescriptorShim, []int{20} } + +type ConnectRequest struct { + ID string `protobuf:"bytes,1,opt,name=id,proto3" json:"id,omitempty"` +} + +func (m *ConnectRequest) Reset() { *m = ConnectRequest{} } +func (*ConnectRequest) ProtoMessage() {} +func (*ConnectRequest) Descriptor() ([]byte, []int) { return fileDescriptorShim, []int{21} } + +type ConnectResponse struct { + ShimPid uint32 `protobuf:"varint,1,opt,name=shim_pid,json=shimPid,proto3" json:"shim_pid,omitempty"` + TaskPid uint32 `protobuf:"varint,2,opt,name=task_pid,json=taskPid,proto3" json:"task_pid,omitempty"` + Version string `protobuf:"bytes,3,opt,name=version,proto3" json:"version,omitempty"` +} + +func (m *ConnectResponse) Reset() { *m = ConnectResponse{} } +func (*ConnectResponse) ProtoMessage() {} +func (*ConnectResponse) Descriptor() ([]byte, []int) { return fileDescriptorShim, []int{22} } + +type ShutdownRequest struct { + ID string `protobuf:"bytes,1,opt,name=id,proto3" json:"id,omitempty"` + Now bool `protobuf:"varint,2,opt,name=now,proto3" json:"now,omitempty"` +} + +func (m *ShutdownRequest) Reset() { *m = ShutdownRequest{} } +func (*ShutdownRequest) ProtoMessage() {} +func (*ShutdownRequest) Descriptor() ([]byte, []int) { return fileDescriptorShim, []int{23} } + +type PauseRequest struct { + ID string `protobuf:"bytes,1,opt,name=id,proto3" json:"id,omitempty"` +} + +func (m *PauseRequest) Reset() { *m = PauseRequest{} } +func (*PauseRequest) ProtoMessage() {} +func (*PauseRequest) Descriptor() ([]byte, []int) { return fileDescriptorShim, []int{24} } + +type ResumeRequest struct { + ID string `protobuf:"bytes,1,opt,name=id,proto3" json:"id,omitempty"` +} + +func (m *ResumeRequest) Reset() { *m = ResumeRequest{} } +func (*ResumeRequest) ProtoMessage() {} +func (*ResumeRequest) Descriptor() ([]byte, []int) { return fileDescriptorShim, []int{25} } + +func init() { + proto.RegisterType((*CreateTaskRequest)(nil), "containerd.task.v2.CreateTaskRequest") + proto.RegisterType((*CreateTaskResponse)(nil), "containerd.task.v2.CreateTaskResponse") + proto.RegisterType((*DeleteRequest)(nil), "containerd.task.v2.DeleteRequest") + proto.RegisterType((*DeleteResponse)(nil), "containerd.task.v2.DeleteResponse") + proto.RegisterType((*ExecProcessRequest)(nil), "containerd.task.v2.ExecProcessRequest") + proto.RegisterType((*ExecProcessResponse)(nil), "containerd.task.v2.ExecProcessResponse") + proto.RegisterType((*ResizePtyRequest)(nil), "containerd.task.v2.ResizePtyRequest") + proto.RegisterType((*StateRequest)(nil), "containerd.task.v2.StateRequest") + proto.RegisterType((*StateResponse)(nil), "containerd.task.v2.StateResponse") + proto.RegisterType((*KillRequest)(nil), "containerd.task.v2.KillRequest") + proto.RegisterType((*CloseIORequest)(nil), "containerd.task.v2.CloseIORequest") + proto.RegisterType((*PidsRequest)(nil), "containerd.task.v2.PidsRequest") + proto.RegisterType((*PidsResponse)(nil), "containerd.task.v2.PidsResponse") + proto.RegisterType((*CheckpointTaskRequest)(nil), "containerd.task.v2.CheckpointTaskRequest") + proto.RegisterType((*UpdateTaskRequest)(nil), "containerd.task.v2.UpdateTaskRequest") + proto.RegisterType((*StartRequest)(nil), "containerd.task.v2.StartRequest") + proto.RegisterType((*StartResponse)(nil), "containerd.task.v2.StartResponse") + proto.RegisterType((*WaitRequest)(nil), "containerd.task.v2.WaitRequest") + proto.RegisterType((*WaitResponse)(nil), "containerd.task.v2.WaitResponse") + proto.RegisterType((*StatsRequest)(nil), "containerd.task.v2.StatsRequest") + proto.RegisterType((*StatsResponse)(nil), "containerd.task.v2.StatsResponse") + proto.RegisterType((*ConnectRequest)(nil), "containerd.task.v2.ConnectRequest") + proto.RegisterType((*ConnectResponse)(nil), "containerd.task.v2.ConnectResponse") + proto.RegisterType((*ShutdownRequest)(nil), "containerd.task.v2.ShutdownRequest") + proto.RegisterType((*PauseRequest)(nil), "containerd.task.v2.PauseRequest") + proto.RegisterType((*ResumeRequest)(nil), "containerd.task.v2.ResumeRequest") +} +func (m *CreateTaskRequest) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *CreateTaskRequest) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.ID) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintShim(dAtA, i, uint64(len(m.ID))) + i += copy(dAtA[i:], m.ID) + } + if len(m.Bundle) > 0 { + dAtA[i] = 0x12 + i++ + i = encodeVarintShim(dAtA, i, uint64(len(m.Bundle))) + i += copy(dAtA[i:], m.Bundle) + } + if len(m.Rootfs) > 0 { + for _, msg := range m.Rootfs { + dAtA[i] = 0x1a + i++ + i = encodeVarintShim(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if m.Terminal { + dAtA[i] = 0x20 + i++ + if m.Terminal { + dAtA[i] = 1 + } else { + dAtA[i] = 0 + } + i++ + } + if len(m.Stdin) > 0 { + dAtA[i] = 0x2a + i++ + i = encodeVarintShim(dAtA, i, uint64(len(m.Stdin))) + i += copy(dAtA[i:], m.Stdin) + } + if len(m.Stdout) > 0 { + dAtA[i] = 0x32 + i++ + i = encodeVarintShim(dAtA, i, uint64(len(m.Stdout))) + i += copy(dAtA[i:], m.Stdout) + } + if len(m.Stderr) > 0 { + dAtA[i] = 0x3a + i++ + i = encodeVarintShim(dAtA, i, uint64(len(m.Stderr))) + i += copy(dAtA[i:], m.Stderr) + } + if len(m.Checkpoint) > 0 { + dAtA[i] = 0x42 + i++ + i = encodeVarintShim(dAtA, i, uint64(len(m.Checkpoint))) + i += copy(dAtA[i:], m.Checkpoint) + } + if len(m.ParentCheckpoint) > 0 { + dAtA[i] = 0x4a + i++ + i = encodeVarintShim(dAtA, i, uint64(len(m.ParentCheckpoint))) + i += copy(dAtA[i:], m.ParentCheckpoint) + } + if m.Options != nil { + dAtA[i] = 0x52 + i++ + i = encodeVarintShim(dAtA, i, uint64(m.Options.Size())) + n1, err := m.Options.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n1 + } + return i, nil +} + +func (m *CreateTaskResponse) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *CreateTaskResponse) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if m.Pid != 0 { + dAtA[i] = 0x8 + i++ + i = encodeVarintShim(dAtA, i, uint64(m.Pid)) + } + return i, nil +} + +func (m *DeleteRequest) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *DeleteRequest) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.ID) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintShim(dAtA, i, uint64(len(m.ID))) + i += copy(dAtA[i:], m.ID) + } + if len(m.ExecID) > 0 { + dAtA[i] = 0x12 + i++ + i = encodeVarintShim(dAtA, i, uint64(len(m.ExecID))) + i += copy(dAtA[i:], m.ExecID) + } + return i, nil +} + +func (m *DeleteResponse) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *DeleteResponse) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if m.Pid != 0 { + dAtA[i] = 0x8 + i++ + i = encodeVarintShim(dAtA, i, uint64(m.Pid)) + } + if m.ExitStatus != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintShim(dAtA, i, uint64(m.ExitStatus)) + } + dAtA[i] = 0x1a + i++ + i = encodeVarintShim(dAtA, i, uint64(types.SizeOfStdTime(m.ExitedAt))) + n2, err := types.StdTimeMarshalTo(m.ExitedAt, dAtA[i:]) + if err != nil { + return 0, err + } + i += n2 + return i, nil +} + +func (m *ExecProcessRequest) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *ExecProcessRequest) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.ID) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintShim(dAtA, i, uint64(len(m.ID))) + i += copy(dAtA[i:], m.ID) + } + if len(m.ExecID) > 0 { + dAtA[i] = 0x12 + i++ + i = encodeVarintShim(dAtA, i, uint64(len(m.ExecID))) + i += copy(dAtA[i:], m.ExecID) + } + if m.Terminal { + dAtA[i] = 0x18 + i++ + if m.Terminal { + dAtA[i] = 1 + } else { + dAtA[i] = 0 + } + i++ + } + if len(m.Stdin) > 0 { + dAtA[i] = 0x22 + i++ + i = encodeVarintShim(dAtA, i, uint64(len(m.Stdin))) + i += copy(dAtA[i:], m.Stdin) + } + if len(m.Stdout) > 0 { + dAtA[i] = 0x2a + i++ + i = encodeVarintShim(dAtA, i, uint64(len(m.Stdout))) + i += copy(dAtA[i:], m.Stdout) + } + if len(m.Stderr) > 0 { + dAtA[i] = 0x32 + i++ + i = encodeVarintShim(dAtA, i, uint64(len(m.Stderr))) + i += copy(dAtA[i:], m.Stderr) + } + if m.Spec != nil { + dAtA[i] = 0x3a + i++ + i = encodeVarintShim(dAtA, i, uint64(m.Spec.Size())) + n3, err := m.Spec.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n3 + } + return i, nil +} + +func (m *ExecProcessResponse) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *ExecProcessResponse) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + return i, nil +} + +func (m *ResizePtyRequest) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *ResizePtyRequest) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.ID) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintShim(dAtA, i, uint64(len(m.ID))) + i += copy(dAtA[i:], m.ID) + } + if len(m.ExecID) > 0 { + dAtA[i] = 0x12 + i++ + i = encodeVarintShim(dAtA, i, uint64(len(m.ExecID))) + i += copy(dAtA[i:], m.ExecID) + } + if m.Width != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintShim(dAtA, i, uint64(m.Width)) + } + if m.Height != 0 { + dAtA[i] = 0x20 + i++ + i = encodeVarintShim(dAtA, i, uint64(m.Height)) + } + return i, nil +} + +func (m *StateRequest) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *StateRequest) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.ID) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintShim(dAtA, i, uint64(len(m.ID))) + i += copy(dAtA[i:], m.ID) + } + if len(m.ExecID) > 0 { + dAtA[i] = 0x12 + i++ + i = encodeVarintShim(dAtA, i, uint64(len(m.ExecID))) + i += copy(dAtA[i:], m.ExecID) + } + return i, nil +} + +func (m *StateResponse) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *StateResponse) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.ID) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintShim(dAtA, i, uint64(len(m.ID))) + i += copy(dAtA[i:], m.ID) + } + if len(m.Bundle) > 0 { + dAtA[i] = 0x12 + i++ + i = encodeVarintShim(dAtA, i, uint64(len(m.Bundle))) + i += copy(dAtA[i:], m.Bundle) + } + if m.Pid != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintShim(dAtA, i, uint64(m.Pid)) + } + if m.Status != 0 { + dAtA[i] = 0x20 + i++ + i = encodeVarintShim(dAtA, i, uint64(m.Status)) + } + if len(m.Stdin) > 0 { + dAtA[i] = 0x2a + i++ + i = encodeVarintShim(dAtA, i, uint64(len(m.Stdin))) + i += copy(dAtA[i:], m.Stdin) + } + if len(m.Stdout) > 0 { + dAtA[i] = 0x32 + i++ + i = encodeVarintShim(dAtA, i, uint64(len(m.Stdout))) + i += copy(dAtA[i:], m.Stdout) + } + if len(m.Stderr) > 0 { + dAtA[i] = 0x3a + i++ + i = encodeVarintShim(dAtA, i, uint64(len(m.Stderr))) + i += copy(dAtA[i:], m.Stderr) + } + if m.Terminal { + dAtA[i] = 0x40 + i++ + if m.Terminal { + dAtA[i] = 1 + } else { + dAtA[i] = 0 + } + i++ + } + if m.ExitStatus != 0 { + dAtA[i] = 0x48 + i++ + i = encodeVarintShim(dAtA, i, uint64(m.ExitStatus)) + } + dAtA[i] = 0x52 + i++ + i = encodeVarintShim(dAtA, i, uint64(types.SizeOfStdTime(m.ExitedAt))) + n4, err := types.StdTimeMarshalTo(m.ExitedAt, dAtA[i:]) + if err != nil { + return 0, err + } + i += n4 + return i, nil +} + +func (m *KillRequest) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *KillRequest) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.ID) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintShim(dAtA, i, uint64(len(m.ID))) + i += copy(dAtA[i:], m.ID) + } + if len(m.ExecID) > 0 { + dAtA[i] = 0x12 + i++ + i = encodeVarintShim(dAtA, i, uint64(len(m.ExecID))) + i += copy(dAtA[i:], m.ExecID) + } + if m.Signal != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintShim(dAtA, i, uint64(m.Signal)) + } + if m.All { + dAtA[i] = 0x20 + i++ + if m.All { + dAtA[i] = 1 + } else { + dAtA[i] = 0 + } + i++ + } + return i, nil +} + +func (m *CloseIORequest) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *CloseIORequest) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.ID) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintShim(dAtA, i, uint64(len(m.ID))) + i += copy(dAtA[i:], m.ID) + } + if len(m.ExecID) > 0 { + dAtA[i] = 0x12 + i++ + i = encodeVarintShim(dAtA, i, uint64(len(m.ExecID))) + i += copy(dAtA[i:], m.ExecID) + } + if m.Stdin { + dAtA[i] = 0x18 + i++ + if m.Stdin { + dAtA[i] = 1 + } else { + dAtA[i] = 0 + } + i++ + } + return i, nil +} + +func (m *PidsRequest) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *PidsRequest) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.ID) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintShim(dAtA, i, uint64(len(m.ID))) + i += copy(dAtA[i:], m.ID) + } + return i, nil +} + +func (m *PidsResponse) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *PidsResponse) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.Processes) > 0 { + for _, msg := range m.Processes { + dAtA[i] = 0xa + i++ + i = encodeVarintShim(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + return i, nil +} + +func (m *CheckpointTaskRequest) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *CheckpointTaskRequest) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.ID) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintShim(dAtA, i, uint64(len(m.ID))) + i += copy(dAtA[i:], m.ID) + } + if len(m.Path) > 0 { + dAtA[i] = 0x12 + i++ + i = encodeVarintShim(dAtA, i, uint64(len(m.Path))) + i += copy(dAtA[i:], m.Path) + } + if m.Options != nil { + dAtA[i] = 0x1a + i++ + i = encodeVarintShim(dAtA, i, uint64(m.Options.Size())) + n5, err := m.Options.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n5 + } + return i, nil +} + +func (m *UpdateTaskRequest) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *UpdateTaskRequest) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.ID) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintShim(dAtA, i, uint64(len(m.ID))) + i += copy(dAtA[i:], m.ID) + } + if m.Resources != nil { + dAtA[i] = 0x12 + i++ + i = encodeVarintShim(dAtA, i, uint64(m.Resources.Size())) + n6, err := m.Resources.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n6 + } + return i, nil +} + +func (m *StartRequest) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *StartRequest) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.ID) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintShim(dAtA, i, uint64(len(m.ID))) + i += copy(dAtA[i:], m.ID) + } + if len(m.ExecID) > 0 { + dAtA[i] = 0x12 + i++ + i = encodeVarintShim(dAtA, i, uint64(len(m.ExecID))) + i += copy(dAtA[i:], m.ExecID) + } + return i, nil +} + +func (m *StartResponse) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *StartResponse) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if m.Pid != 0 { + dAtA[i] = 0x8 + i++ + i = encodeVarintShim(dAtA, i, uint64(m.Pid)) + } + return i, nil +} + +func (m *WaitRequest) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *WaitRequest) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.ID) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintShim(dAtA, i, uint64(len(m.ID))) + i += copy(dAtA[i:], m.ID) + } + if len(m.ExecID) > 0 { + dAtA[i] = 0x12 + i++ + i = encodeVarintShim(dAtA, i, uint64(len(m.ExecID))) + i += copy(dAtA[i:], m.ExecID) + } + return i, nil +} + +func (m *WaitResponse) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *WaitResponse) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if m.ExitStatus != 0 { + dAtA[i] = 0x8 + i++ + i = encodeVarintShim(dAtA, i, uint64(m.ExitStatus)) + } + dAtA[i] = 0x12 + i++ + i = encodeVarintShim(dAtA, i, uint64(types.SizeOfStdTime(m.ExitedAt))) + n7, err := types.StdTimeMarshalTo(m.ExitedAt, dAtA[i:]) + if err != nil { + return 0, err + } + i += n7 + return i, nil +} + +func (m *StatsRequest) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *StatsRequest) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.ID) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintShim(dAtA, i, uint64(len(m.ID))) + i += copy(dAtA[i:], m.ID) + } + return i, nil +} + +func (m *StatsResponse) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *StatsResponse) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if m.Stats != nil { + dAtA[i] = 0xa + i++ + i = encodeVarintShim(dAtA, i, uint64(m.Stats.Size())) + n8, err := m.Stats.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n8 + } + return i, nil +} + +func (m *ConnectRequest) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *ConnectRequest) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.ID) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintShim(dAtA, i, uint64(len(m.ID))) + i += copy(dAtA[i:], m.ID) + } + return i, nil +} + +func (m *ConnectResponse) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *ConnectResponse) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if m.ShimPid != 0 { + dAtA[i] = 0x8 + i++ + i = encodeVarintShim(dAtA, i, uint64(m.ShimPid)) + } + if m.TaskPid != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintShim(dAtA, i, uint64(m.TaskPid)) + } + if len(m.Version) > 0 { + dAtA[i] = 0x1a + i++ + i = encodeVarintShim(dAtA, i, uint64(len(m.Version))) + i += copy(dAtA[i:], m.Version) + } + return i, nil +} + +func (m *ShutdownRequest) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *ShutdownRequest) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.ID) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintShim(dAtA, i, uint64(len(m.ID))) + i += copy(dAtA[i:], m.ID) + } + if m.Now { + dAtA[i] = 0x10 + i++ + if m.Now { + dAtA[i] = 1 + } else { + dAtA[i] = 0 + } + i++ + } + return i, nil +} + +func (m *PauseRequest) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *PauseRequest) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.ID) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintShim(dAtA, i, uint64(len(m.ID))) + i += copy(dAtA[i:], m.ID) + } + return i, nil +} + +func (m *ResumeRequest) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *ResumeRequest) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.ID) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintShim(dAtA, i, uint64(len(m.ID))) + i += copy(dAtA[i:], m.ID) + } + return i, nil +} + +func encodeVarintShim(dAtA []byte, offset int, v uint64) int { + for v >= 1<<7 { + dAtA[offset] = uint8(v&0x7f | 0x80) + v >>= 7 + offset++ + } + dAtA[offset] = uint8(v) + return offset + 1 +} +func (m *CreateTaskRequest) Size() (n int) { + var l int + _ = l + l = len(m.ID) + if l > 0 { + n += 1 + l + sovShim(uint64(l)) + } + l = len(m.Bundle) + if l > 0 { + n += 1 + l + sovShim(uint64(l)) + } + if len(m.Rootfs) > 0 { + for _, e := range m.Rootfs { + l = e.Size() + n += 1 + l + sovShim(uint64(l)) + } + } + if m.Terminal { + n += 2 + } + l = len(m.Stdin) + if l > 0 { + n += 1 + l + sovShim(uint64(l)) + } + l = len(m.Stdout) + if l > 0 { + n += 1 + l + sovShim(uint64(l)) + } + l = len(m.Stderr) + if l > 0 { + n += 1 + l + sovShim(uint64(l)) + } + l = len(m.Checkpoint) + if l > 0 { + n += 1 + l + sovShim(uint64(l)) + } + l = len(m.ParentCheckpoint) + if l > 0 { + n += 1 + l + sovShim(uint64(l)) + } + if m.Options != nil { + l = m.Options.Size() + n += 1 + l + sovShim(uint64(l)) + } + return n +} + +func (m *CreateTaskResponse) Size() (n int) { + var l int + _ = l + if m.Pid != 0 { + n += 1 + sovShim(uint64(m.Pid)) + } + return n +} + +func (m *DeleteRequest) Size() (n int) { + var l int + _ = l + l = len(m.ID) + if l > 0 { + n += 1 + l + sovShim(uint64(l)) + } + l = len(m.ExecID) + if l > 0 { + n += 1 + l + sovShim(uint64(l)) + } + return n +} + +func (m *DeleteResponse) Size() (n int) { + var l int + _ = l + if m.Pid != 0 { + n += 1 + sovShim(uint64(m.Pid)) + } + if m.ExitStatus != 0 { + n += 1 + sovShim(uint64(m.ExitStatus)) + } + l = types.SizeOfStdTime(m.ExitedAt) + n += 1 + l + sovShim(uint64(l)) + return n +} + +func (m *ExecProcessRequest) Size() (n int) { + var l int + _ = l + l = len(m.ID) + if l > 0 { + n += 1 + l + sovShim(uint64(l)) + } + l = len(m.ExecID) + if l > 0 { + n += 1 + l + sovShim(uint64(l)) + } + if m.Terminal { + n += 2 + } + l = len(m.Stdin) + if l > 0 { + n += 1 + l + sovShim(uint64(l)) + } + l = len(m.Stdout) + if l > 0 { + n += 1 + l + sovShim(uint64(l)) + } + l = len(m.Stderr) + if l > 0 { + n += 1 + l + sovShim(uint64(l)) + } + if m.Spec != nil { + l = m.Spec.Size() + n += 1 + l + sovShim(uint64(l)) + } + return n +} + +func (m *ExecProcessResponse) Size() (n int) { + var l int + _ = l + return n +} + +func (m *ResizePtyRequest) Size() (n int) { + var l int + _ = l + l = len(m.ID) + if l > 0 { + n += 1 + l + sovShim(uint64(l)) + } + l = len(m.ExecID) + if l > 0 { + n += 1 + l + sovShim(uint64(l)) + } + if m.Width != 0 { + n += 1 + sovShim(uint64(m.Width)) + } + if m.Height != 0 { + n += 1 + sovShim(uint64(m.Height)) + } + return n +} + +func (m *StateRequest) Size() (n int) { + var l int + _ = l + l = len(m.ID) + if l > 0 { + n += 1 + l + sovShim(uint64(l)) + } + l = len(m.ExecID) + if l > 0 { + n += 1 + l + sovShim(uint64(l)) + } + return n +} + +func (m *StateResponse) Size() (n int) { + var l int + _ = l + l = len(m.ID) + if l > 0 { + n += 1 + l + sovShim(uint64(l)) + } + l = len(m.Bundle) + if l > 0 { + n += 1 + l + sovShim(uint64(l)) + } + if m.Pid != 0 { + n += 1 + sovShim(uint64(m.Pid)) + } + if m.Status != 0 { + n += 1 + sovShim(uint64(m.Status)) + } + l = len(m.Stdin) + if l > 0 { + n += 1 + l + sovShim(uint64(l)) + } + l = len(m.Stdout) + if l > 0 { + n += 1 + l + sovShim(uint64(l)) + } + l = len(m.Stderr) + if l > 0 { + n += 1 + l + sovShim(uint64(l)) + } + if m.Terminal { + n += 2 + } + if m.ExitStatus != 0 { + n += 1 + sovShim(uint64(m.ExitStatus)) + } + l = types.SizeOfStdTime(m.ExitedAt) + n += 1 + l + sovShim(uint64(l)) + return n +} + +func (m *KillRequest) Size() (n int) { + var l int + _ = l + l = len(m.ID) + if l > 0 { + n += 1 + l + sovShim(uint64(l)) + } + l = len(m.ExecID) + if l > 0 { + n += 1 + l + sovShim(uint64(l)) + } + if m.Signal != 0 { + n += 1 + sovShim(uint64(m.Signal)) + } + if m.All { + n += 2 + } + return n +} + +func (m *CloseIORequest) Size() (n int) { + var l int + _ = l + l = len(m.ID) + if l > 0 { + n += 1 + l + sovShim(uint64(l)) + } + l = len(m.ExecID) + if l > 0 { + n += 1 + l + sovShim(uint64(l)) + } + if m.Stdin { + n += 2 + } + return n +} + +func (m *PidsRequest) Size() (n int) { + var l int + _ = l + l = len(m.ID) + if l > 0 { + n += 1 + l + sovShim(uint64(l)) + } + return n +} + +func (m *PidsResponse) Size() (n int) { + var l int + _ = l + if len(m.Processes) > 0 { + for _, e := range m.Processes { + l = e.Size() + n += 1 + l + sovShim(uint64(l)) + } + } + return n +} + +func (m *CheckpointTaskRequest) Size() (n int) { + var l int + _ = l + l = len(m.ID) + if l > 0 { + n += 1 + l + sovShim(uint64(l)) + } + l = len(m.Path) + if l > 0 { + n += 1 + l + sovShim(uint64(l)) + } + if m.Options != nil { + l = m.Options.Size() + n += 1 + l + sovShim(uint64(l)) + } + return n +} + +func (m *UpdateTaskRequest) Size() (n int) { + var l int + _ = l + l = len(m.ID) + if l > 0 { + n += 1 + l + sovShim(uint64(l)) + } + if m.Resources != nil { + l = m.Resources.Size() + n += 1 + l + sovShim(uint64(l)) + } + return n +} + +func (m *StartRequest) Size() (n int) { + var l int + _ = l + l = len(m.ID) + if l > 0 { + n += 1 + l + sovShim(uint64(l)) + } + l = len(m.ExecID) + if l > 0 { + n += 1 + l + sovShim(uint64(l)) + } + return n +} + +func (m *StartResponse) Size() (n int) { + var l int + _ = l + if m.Pid != 0 { + n += 1 + sovShim(uint64(m.Pid)) + } + return n +} + +func (m *WaitRequest) Size() (n int) { + var l int + _ = l + l = len(m.ID) + if l > 0 { + n += 1 + l + sovShim(uint64(l)) + } + l = len(m.ExecID) + if l > 0 { + n += 1 + l + sovShim(uint64(l)) + } + return n +} + +func (m *WaitResponse) Size() (n int) { + var l int + _ = l + if m.ExitStatus != 0 { + n += 1 + sovShim(uint64(m.ExitStatus)) + } + l = types.SizeOfStdTime(m.ExitedAt) + n += 1 + l + sovShim(uint64(l)) + return n +} + +func (m *StatsRequest) Size() (n int) { + var l int + _ = l + l = len(m.ID) + if l > 0 { + n += 1 + l + sovShim(uint64(l)) + } + return n +} + +func (m *StatsResponse) Size() (n int) { + var l int + _ = l + if m.Stats != nil { + l = m.Stats.Size() + n += 1 + l + sovShim(uint64(l)) + } + return n +} + +func (m *ConnectRequest) Size() (n int) { + var l int + _ = l + l = len(m.ID) + if l > 0 { + n += 1 + l + sovShim(uint64(l)) + } + return n +} + +func (m *ConnectResponse) Size() (n int) { + var l int + _ = l + if m.ShimPid != 0 { + n += 1 + sovShim(uint64(m.ShimPid)) + } + if m.TaskPid != 0 { + n += 1 + sovShim(uint64(m.TaskPid)) + } + l = len(m.Version) + if l > 0 { + n += 1 + l + sovShim(uint64(l)) + } + return n +} + +func (m *ShutdownRequest) Size() (n int) { + var l int + _ = l + l = len(m.ID) + if l > 0 { + n += 1 + l + sovShim(uint64(l)) + } + if m.Now { + n += 2 + } + return n +} + +func (m *PauseRequest) Size() (n int) { + var l int + _ = l + l = len(m.ID) + if l > 0 { + n += 1 + l + sovShim(uint64(l)) + } + return n +} + +func (m *ResumeRequest) Size() (n int) { + var l int + _ = l + l = len(m.ID) + if l > 0 { + n += 1 + l + sovShim(uint64(l)) + } + return n +} + +func sovShim(x uint64) (n int) { + for { + n++ + x >>= 7 + if x == 0 { + break + } + } + return n +} +func sozShim(x uint64) (n int) { + return sovShim(uint64((x << 1) ^ uint64((int64(x) >> 63)))) +} +func (this *CreateTaskRequest) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&CreateTaskRequest{`, + `ID:` + fmt.Sprintf("%v", this.ID) + `,`, + `Bundle:` + fmt.Sprintf("%v", this.Bundle) + `,`, + `Rootfs:` + strings.Replace(fmt.Sprintf("%v", this.Rootfs), "Mount", "containerd_types.Mount", 1) + `,`, + `Terminal:` + fmt.Sprintf("%v", this.Terminal) + `,`, + `Stdin:` + fmt.Sprintf("%v", this.Stdin) + `,`, + `Stdout:` + fmt.Sprintf("%v", this.Stdout) + `,`, + `Stderr:` + fmt.Sprintf("%v", this.Stderr) + `,`, + `Checkpoint:` + fmt.Sprintf("%v", this.Checkpoint) + `,`, + `ParentCheckpoint:` + fmt.Sprintf("%v", this.ParentCheckpoint) + `,`, + `Options:` + strings.Replace(fmt.Sprintf("%v", this.Options), "Any", "google_protobuf.Any", 1) + `,`, + `}`, + }, "") + return s +} +func (this *CreateTaskResponse) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&CreateTaskResponse{`, + `Pid:` + fmt.Sprintf("%v", this.Pid) + `,`, + `}`, + }, "") + return s +} +func (this *DeleteRequest) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&DeleteRequest{`, + `ID:` + fmt.Sprintf("%v", this.ID) + `,`, + `ExecID:` + fmt.Sprintf("%v", this.ExecID) + `,`, + `}`, + }, "") + return s +} +func (this *DeleteResponse) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&DeleteResponse{`, + `Pid:` + fmt.Sprintf("%v", this.Pid) + `,`, + `ExitStatus:` + fmt.Sprintf("%v", this.ExitStatus) + `,`, + `ExitedAt:` + strings.Replace(strings.Replace(this.ExitedAt.String(), "Timestamp", "google_protobuf3.Timestamp", 1), `&`, ``, 1) + `,`, + `}`, + }, "") + return s +} +func (this *ExecProcessRequest) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&ExecProcessRequest{`, + `ID:` + fmt.Sprintf("%v", this.ID) + `,`, + `ExecID:` + fmt.Sprintf("%v", this.ExecID) + `,`, + `Terminal:` + fmt.Sprintf("%v", this.Terminal) + `,`, + `Stdin:` + fmt.Sprintf("%v", this.Stdin) + `,`, + `Stdout:` + fmt.Sprintf("%v", this.Stdout) + `,`, + `Stderr:` + fmt.Sprintf("%v", this.Stderr) + `,`, + `Spec:` + strings.Replace(fmt.Sprintf("%v", this.Spec), "Any", "google_protobuf.Any", 1) + `,`, + `}`, + }, "") + return s +} +func (this *ExecProcessResponse) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&ExecProcessResponse{`, + `}`, + }, "") + return s +} +func (this *ResizePtyRequest) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&ResizePtyRequest{`, + `ID:` + fmt.Sprintf("%v", this.ID) + `,`, + `ExecID:` + fmt.Sprintf("%v", this.ExecID) + `,`, + `Width:` + fmt.Sprintf("%v", this.Width) + `,`, + `Height:` + fmt.Sprintf("%v", this.Height) + `,`, + `}`, + }, "") + return s +} +func (this *StateRequest) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&StateRequest{`, + `ID:` + fmt.Sprintf("%v", this.ID) + `,`, + `ExecID:` + fmt.Sprintf("%v", this.ExecID) + `,`, + `}`, + }, "") + return s +} +func (this *StateResponse) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&StateResponse{`, + `ID:` + fmt.Sprintf("%v", this.ID) + `,`, + `Bundle:` + fmt.Sprintf("%v", this.Bundle) + `,`, + `Pid:` + fmt.Sprintf("%v", this.Pid) + `,`, + `Status:` + fmt.Sprintf("%v", this.Status) + `,`, + `Stdin:` + fmt.Sprintf("%v", this.Stdin) + `,`, + `Stdout:` + fmt.Sprintf("%v", this.Stdout) + `,`, + `Stderr:` + fmt.Sprintf("%v", this.Stderr) + `,`, + `Terminal:` + fmt.Sprintf("%v", this.Terminal) + `,`, + `ExitStatus:` + fmt.Sprintf("%v", this.ExitStatus) + `,`, + `ExitedAt:` + strings.Replace(strings.Replace(this.ExitedAt.String(), "Timestamp", "google_protobuf3.Timestamp", 1), `&`, ``, 1) + `,`, + `}`, + }, "") + return s +} +func (this *KillRequest) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&KillRequest{`, + `ID:` + fmt.Sprintf("%v", this.ID) + `,`, + `ExecID:` + fmt.Sprintf("%v", this.ExecID) + `,`, + `Signal:` + fmt.Sprintf("%v", this.Signal) + `,`, + `All:` + fmt.Sprintf("%v", this.All) + `,`, + `}`, + }, "") + return s +} +func (this *CloseIORequest) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&CloseIORequest{`, + `ID:` + fmt.Sprintf("%v", this.ID) + `,`, + `ExecID:` + fmt.Sprintf("%v", this.ExecID) + `,`, + `Stdin:` + fmt.Sprintf("%v", this.Stdin) + `,`, + `}`, + }, "") + return s +} +func (this *PidsRequest) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&PidsRequest{`, + `ID:` + fmt.Sprintf("%v", this.ID) + `,`, + `}`, + }, "") + return s +} +func (this *PidsResponse) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&PidsResponse{`, + `Processes:` + strings.Replace(fmt.Sprintf("%v", this.Processes), "ProcessInfo", "containerd_v1_types.ProcessInfo", 1) + `,`, + `}`, + }, "") + return s +} +func (this *CheckpointTaskRequest) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&CheckpointTaskRequest{`, + `ID:` + fmt.Sprintf("%v", this.ID) + `,`, + `Path:` + fmt.Sprintf("%v", this.Path) + `,`, + `Options:` + strings.Replace(fmt.Sprintf("%v", this.Options), "Any", "google_protobuf.Any", 1) + `,`, + `}`, + }, "") + return s +} +func (this *UpdateTaskRequest) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&UpdateTaskRequest{`, + `ID:` + fmt.Sprintf("%v", this.ID) + `,`, + `Resources:` + strings.Replace(fmt.Sprintf("%v", this.Resources), "Any", "google_protobuf.Any", 1) + `,`, + `}`, + }, "") + return s +} +func (this *StartRequest) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&StartRequest{`, + `ID:` + fmt.Sprintf("%v", this.ID) + `,`, + `ExecID:` + fmt.Sprintf("%v", this.ExecID) + `,`, + `}`, + }, "") + return s +} +func (this *StartResponse) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&StartResponse{`, + `Pid:` + fmt.Sprintf("%v", this.Pid) + `,`, + `}`, + }, "") + return s +} +func (this *WaitRequest) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&WaitRequest{`, + `ID:` + fmt.Sprintf("%v", this.ID) + `,`, + `ExecID:` + fmt.Sprintf("%v", this.ExecID) + `,`, + `}`, + }, "") + return s +} +func (this *WaitResponse) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&WaitResponse{`, + `ExitStatus:` + fmt.Sprintf("%v", this.ExitStatus) + `,`, + `ExitedAt:` + strings.Replace(strings.Replace(this.ExitedAt.String(), "Timestamp", "google_protobuf3.Timestamp", 1), `&`, ``, 1) + `,`, + `}`, + }, "") + return s +} +func (this *StatsRequest) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&StatsRequest{`, + `ID:` + fmt.Sprintf("%v", this.ID) + `,`, + `}`, + }, "") + return s +} +func (this *StatsResponse) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&StatsResponse{`, + `Stats:` + strings.Replace(fmt.Sprintf("%v", this.Stats), "Any", "google_protobuf.Any", 1) + `,`, + `}`, + }, "") + return s +} +func (this *ConnectRequest) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&ConnectRequest{`, + `ID:` + fmt.Sprintf("%v", this.ID) + `,`, + `}`, + }, "") + return s +} +func (this *ConnectResponse) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&ConnectResponse{`, + `ShimPid:` + fmt.Sprintf("%v", this.ShimPid) + `,`, + `TaskPid:` + fmt.Sprintf("%v", this.TaskPid) + `,`, + `Version:` + fmt.Sprintf("%v", this.Version) + `,`, + `}`, + }, "") + return s +} +func (this *ShutdownRequest) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&ShutdownRequest{`, + `ID:` + fmt.Sprintf("%v", this.ID) + `,`, + `Now:` + fmt.Sprintf("%v", this.Now) + `,`, + `}`, + }, "") + return s +} +func (this *PauseRequest) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&PauseRequest{`, + `ID:` + fmt.Sprintf("%v", this.ID) + `,`, + `}`, + }, "") + return s +} +func (this *ResumeRequest) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&ResumeRequest{`, + `ID:` + fmt.Sprintf("%v", this.ID) + `,`, + `}`, + }, "") + return s +} +func valueToStringShim(v interface{}) string { + rv := reflect.ValueOf(v) + if rv.IsNil() { + return "nil" + } + pv := reflect.Indirect(rv).Interface() + return fmt.Sprintf("*%v", pv) +} + +type TaskService interface { + State(ctx context.Context, req *StateRequest) (*StateResponse, error) + Create(ctx context.Context, req *CreateTaskRequest) (*CreateTaskResponse, error) + Start(ctx context.Context, req *StartRequest) (*StartResponse, error) + Delete(ctx context.Context, req *DeleteRequest) (*DeleteResponse, error) + Pids(ctx context.Context, req *PidsRequest) (*PidsResponse, error) + Pause(ctx context.Context, req *PauseRequest) (*google_protobuf1.Empty, error) + Resume(ctx context.Context, req *ResumeRequest) (*google_protobuf1.Empty, error) + Checkpoint(ctx context.Context, req *CheckpointTaskRequest) (*google_protobuf1.Empty, error) + Kill(ctx context.Context, req *KillRequest) (*google_protobuf1.Empty, error) + Exec(ctx context.Context, req *ExecProcessRequest) (*google_protobuf1.Empty, error) + ResizePty(ctx context.Context, req *ResizePtyRequest) (*google_protobuf1.Empty, error) + CloseIO(ctx context.Context, req *CloseIORequest) (*google_protobuf1.Empty, error) + Update(ctx context.Context, req *UpdateTaskRequest) (*google_protobuf1.Empty, error) + Wait(ctx context.Context, req *WaitRequest) (*WaitResponse, error) + Stats(ctx context.Context, req *StatsRequest) (*StatsResponse, error) + Connect(ctx context.Context, req *ConnectRequest) (*ConnectResponse, error) + Shutdown(ctx context.Context, req *ShutdownRequest) (*google_protobuf1.Empty, error) +} + +func RegisterTaskService(srv *ttrpc.Server, svc TaskService) { + srv.Register("containerd.task.v2.Task", map[string]ttrpc.Method{ + "State": func(ctx context.Context, unmarshal func(interface{}) error) (interface{}, error) { + var req StateRequest + if err := unmarshal(&req); err != nil { + return nil, err + } + return svc.State(ctx, &req) + }, + "Create": func(ctx context.Context, unmarshal func(interface{}) error) (interface{}, error) { + var req CreateTaskRequest + if err := unmarshal(&req); err != nil { + return nil, err + } + return svc.Create(ctx, &req) + }, + "Start": func(ctx context.Context, unmarshal func(interface{}) error) (interface{}, error) { + var req StartRequest + if err := unmarshal(&req); err != nil { + return nil, err + } + return svc.Start(ctx, &req) + }, + "Delete": func(ctx context.Context, unmarshal func(interface{}) error) (interface{}, error) { + var req DeleteRequest + if err := unmarshal(&req); err != nil { + return nil, err + } + return svc.Delete(ctx, &req) + }, + "Pids": func(ctx context.Context, unmarshal func(interface{}) error) (interface{}, error) { + var req PidsRequest + if err := unmarshal(&req); err != nil { + return nil, err + } + return svc.Pids(ctx, &req) + }, + "Pause": func(ctx context.Context, unmarshal func(interface{}) error) (interface{}, error) { + var req PauseRequest + if err := unmarshal(&req); err != nil { + return nil, err + } + return svc.Pause(ctx, &req) + }, + "Resume": func(ctx context.Context, unmarshal func(interface{}) error) (interface{}, error) { + var req ResumeRequest + if err := unmarshal(&req); err != nil { + return nil, err + } + return svc.Resume(ctx, &req) + }, + "Checkpoint": func(ctx context.Context, unmarshal func(interface{}) error) (interface{}, error) { + var req CheckpointTaskRequest + if err := unmarshal(&req); err != nil { + return nil, err + } + return svc.Checkpoint(ctx, &req) + }, + "Kill": func(ctx context.Context, unmarshal func(interface{}) error) (interface{}, error) { + var req KillRequest + if err := unmarshal(&req); err != nil { + return nil, err + } + return svc.Kill(ctx, &req) + }, + "Exec": func(ctx context.Context, unmarshal func(interface{}) error) (interface{}, error) { + var req ExecProcessRequest + if err := unmarshal(&req); err != nil { + return nil, err + } + return svc.Exec(ctx, &req) + }, + "ResizePty": func(ctx context.Context, unmarshal func(interface{}) error) (interface{}, error) { + var req ResizePtyRequest + if err := unmarshal(&req); err != nil { + return nil, err + } + return svc.ResizePty(ctx, &req) + }, + "CloseIO": func(ctx context.Context, unmarshal func(interface{}) error) (interface{}, error) { + var req CloseIORequest + if err := unmarshal(&req); err != nil { + return nil, err + } + return svc.CloseIO(ctx, &req) + }, + "Update": func(ctx context.Context, unmarshal func(interface{}) error) (interface{}, error) { + var req UpdateTaskRequest + if err := unmarshal(&req); err != nil { + return nil, err + } + return svc.Update(ctx, &req) + }, + "Wait": func(ctx context.Context, unmarshal func(interface{}) error) (interface{}, error) { + var req WaitRequest + if err := unmarshal(&req); err != nil { + return nil, err + } + return svc.Wait(ctx, &req) + }, + "Stats": func(ctx context.Context, unmarshal func(interface{}) error) (interface{}, error) { + var req StatsRequest + if err := unmarshal(&req); err != nil { + return nil, err + } + return svc.Stats(ctx, &req) + }, + "Connect": func(ctx context.Context, unmarshal func(interface{}) error) (interface{}, error) { + var req ConnectRequest + if err := unmarshal(&req); err != nil { + return nil, err + } + return svc.Connect(ctx, &req) + }, + "Shutdown": func(ctx context.Context, unmarshal func(interface{}) error) (interface{}, error) { + var req ShutdownRequest + if err := unmarshal(&req); err != nil { + return nil, err + } + return svc.Shutdown(ctx, &req) + }, + }) +} + +type taskClient struct { + client *ttrpc.Client +} + +func NewTaskClient(client *ttrpc.Client) TaskService { + return &taskClient{ + client: client, + } +} + +func (c *taskClient) State(ctx context.Context, req *StateRequest) (*StateResponse, error) { + var resp StateResponse + if err := c.client.Call(ctx, "containerd.task.v2.Task", "State", req, &resp); err != nil { + return nil, err + } + return &resp, nil +} + +func (c *taskClient) Create(ctx context.Context, req *CreateTaskRequest) (*CreateTaskResponse, error) { + var resp CreateTaskResponse + if err := c.client.Call(ctx, "containerd.task.v2.Task", "Create", req, &resp); err != nil { + return nil, err + } + return &resp, nil +} + +func (c *taskClient) Start(ctx context.Context, req *StartRequest) (*StartResponse, error) { + var resp StartResponse + if err := c.client.Call(ctx, "containerd.task.v2.Task", "Start", req, &resp); err != nil { + return nil, err + } + return &resp, nil +} + +func (c *taskClient) Delete(ctx context.Context, req *DeleteRequest) (*DeleteResponse, error) { + var resp DeleteResponse + if err := c.client.Call(ctx, "containerd.task.v2.Task", "Delete", req, &resp); err != nil { + return nil, err + } + return &resp, nil +} + +func (c *taskClient) Pids(ctx context.Context, req *PidsRequest) (*PidsResponse, error) { + var resp PidsResponse + if err := c.client.Call(ctx, "containerd.task.v2.Task", "Pids", req, &resp); err != nil { + return nil, err + } + return &resp, nil +} + +func (c *taskClient) Pause(ctx context.Context, req *PauseRequest) (*google_protobuf1.Empty, error) { + var resp google_protobuf1.Empty + if err := c.client.Call(ctx, "containerd.task.v2.Task", "Pause", req, &resp); err != nil { + return nil, err + } + return &resp, nil +} + +func (c *taskClient) Resume(ctx context.Context, req *ResumeRequest) (*google_protobuf1.Empty, error) { + var resp google_protobuf1.Empty + if err := c.client.Call(ctx, "containerd.task.v2.Task", "Resume", req, &resp); err != nil { + return nil, err + } + return &resp, nil +} + +func (c *taskClient) Checkpoint(ctx context.Context, req *CheckpointTaskRequest) (*google_protobuf1.Empty, error) { + var resp google_protobuf1.Empty + if err := c.client.Call(ctx, "containerd.task.v2.Task", "Checkpoint", req, &resp); err != nil { + return nil, err + } + return &resp, nil +} + +func (c *taskClient) Kill(ctx context.Context, req *KillRequest) (*google_protobuf1.Empty, error) { + var resp google_protobuf1.Empty + if err := c.client.Call(ctx, "containerd.task.v2.Task", "Kill", req, &resp); err != nil { + return nil, err + } + return &resp, nil +} + +func (c *taskClient) Exec(ctx context.Context, req *ExecProcessRequest) (*google_protobuf1.Empty, error) { + var resp google_protobuf1.Empty + if err := c.client.Call(ctx, "containerd.task.v2.Task", "Exec", req, &resp); err != nil { + return nil, err + } + return &resp, nil +} + +func (c *taskClient) ResizePty(ctx context.Context, req *ResizePtyRequest) (*google_protobuf1.Empty, error) { + var resp google_protobuf1.Empty + if err := c.client.Call(ctx, "containerd.task.v2.Task", "ResizePty", req, &resp); err != nil { + return nil, err + } + return &resp, nil +} + +func (c *taskClient) CloseIO(ctx context.Context, req *CloseIORequest) (*google_protobuf1.Empty, error) { + var resp google_protobuf1.Empty + if err := c.client.Call(ctx, "containerd.task.v2.Task", "CloseIO", req, &resp); err != nil { + return nil, err + } + return &resp, nil +} + +func (c *taskClient) Update(ctx context.Context, req *UpdateTaskRequest) (*google_protobuf1.Empty, error) { + var resp google_protobuf1.Empty + if err := c.client.Call(ctx, "containerd.task.v2.Task", "Update", req, &resp); err != nil { + return nil, err + } + return &resp, nil +} + +func (c *taskClient) Wait(ctx context.Context, req *WaitRequest) (*WaitResponse, error) { + var resp WaitResponse + if err := c.client.Call(ctx, "containerd.task.v2.Task", "Wait", req, &resp); err != nil { + return nil, err + } + return &resp, nil +} + +func (c *taskClient) Stats(ctx context.Context, req *StatsRequest) (*StatsResponse, error) { + var resp StatsResponse + if err := c.client.Call(ctx, "containerd.task.v2.Task", "Stats", req, &resp); err != nil { + return nil, err + } + return &resp, nil +} + +func (c *taskClient) Connect(ctx context.Context, req *ConnectRequest) (*ConnectResponse, error) { + var resp ConnectResponse + if err := c.client.Call(ctx, "containerd.task.v2.Task", "Connect", req, &resp); err != nil { + return nil, err + } + return &resp, nil +} + +func (c *taskClient) Shutdown(ctx context.Context, req *ShutdownRequest) (*google_protobuf1.Empty, error) { + var resp google_protobuf1.Empty + if err := c.client.Call(ctx, "containerd.task.v2.Task", "Shutdown", req, &resp); err != nil { + return nil, err + } + return &resp, nil +} +func (m *CreateTaskRequest) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: CreateTaskRequest: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: CreateTaskRequest: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ID = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Bundle", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Bundle = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 3: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Rootfs", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + msglen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Rootfs = append(m.Rootfs, &containerd_types.Mount{}) + if err := m.Rootfs[len(m.Rootfs)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 4: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Terminal", wireType) + } + var v int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + v |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + m.Terminal = bool(v != 0) + case 5: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Stdin", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Stdin = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 6: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Stdout", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Stdout = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 7: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Stderr", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Stderr = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 8: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Checkpoint", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Checkpoint = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 9: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ParentCheckpoint", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ParentCheckpoint = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 10: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Options", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + msglen + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Options == nil { + m.Options = &google_protobuf.Any{} + } + if err := m.Options.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipShim(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthShim + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *CreateTaskResponse) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: CreateTaskResponse: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: CreateTaskResponse: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Pid", wireType) + } + m.Pid = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Pid |= (uint32(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipShim(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthShim + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *DeleteRequest) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: DeleteRequest: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: DeleteRequest: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ID = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ExecID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ExecID = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipShim(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthShim + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *DeleteResponse) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: DeleteResponse: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: DeleteResponse: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Pid", wireType) + } + m.Pid = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Pid |= (uint32(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field ExitStatus", wireType) + } + m.ExitStatus = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.ExitStatus |= (uint32(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ExitedAt", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + msglen + if postIndex > l { + return io.ErrUnexpectedEOF + } + if err := types.StdTimeUnmarshal(&m.ExitedAt, dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipShim(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthShim + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *ExecProcessRequest) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: ExecProcessRequest: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: ExecProcessRequest: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ID = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ExecID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ExecID = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Terminal", wireType) + } + var v int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + v |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + m.Terminal = bool(v != 0) + case 4: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Stdin", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Stdin = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 5: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Stdout", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Stdout = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 6: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Stderr", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Stderr = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 7: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Spec", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + msglen + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Spec == nil { + m.Spec = &google_protobuf.Any{} + } + if err := m.Spec.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipShim(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthShim + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *ExecProcessResponse) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: ExecProcessResponse: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: ExecProcessResponse: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + default: + iNdEx = preIndex + skippy, err := skipShim(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthShim + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *ResizePtyRequest) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: ResizePtyRequest: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: ResizePtyRequest: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ID = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ExecID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ExecID = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Width", wireType) + } + m.Width = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Width |= (uint32(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + case 4: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Height", wireType) + } + m.Height = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Height |= (uint32(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipShim(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthShim + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *StateRequest) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: StateRequest: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: StateRequest: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ID = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ExecID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ExecID = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipShim(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthShim + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *StateResponse) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: StateResponse: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: StateResponse: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ID = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Bundle", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Bundle = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Pid", wireType) + } + m.Pid = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Pid |= (uint32(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + case 4: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Status", wireType) + } + m.Status = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Status |= (containerd_v1_types.Status(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + case 5: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Stdin", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Stdin = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 6: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Stdout", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Stdout = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 7: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Stderr", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Stderr = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 8: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Terminal", wireType) + } + var v int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + v |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + m.Terminal = bool(v != 0) + case 9: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field ExitStatus", wireType) + } + m.ExitStatus = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.ExitStatus |= (uint32(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + case 10: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ExitedAt", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + msglen + if postIndex > l { + return io.ErrUnexpectedEOF + } + if err := types.StdTimeUnmarshal(&m.ExitedAt, dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipShim(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthShim + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *KillRequest) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: KillRequest: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: KillRequest: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ID = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ExecID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ExecID = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Signal", wireType) + } + m.Signal = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Signal |= (uint32(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + case 4: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field All", wireType) + } + var v int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + v |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + m.All = bool(v != 0) + default: + iNdEx = preIndex + skippy, err := skipShim(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthShim + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *CloseIORequest) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: CloseIORequest: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: CloseIORequest: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ID = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ExecID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ExecID = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Stdin", wireType) + } + var v int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + v |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + m.Stdin = bool(v != 0) + default: + iNdEx = preIndex + skippy, err := skipShim(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthShim + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *PidsRequest) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: PidsRequest: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: PidsRequest: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ID = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipShim(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthShim + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *PidsResponse) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: PidsResponse: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: PidsResponse: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Processes", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + msglen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Processes = append(m.Processes, &containerd_v1_types.ProcessInfo{}) + if err := m.Processes[len(m.Processes)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipShim(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthShim + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *CheckpointTaskRequest) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: CheckpointTaskRequest: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: CheckpointTaskRequest: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ID = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Path", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Path = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 3: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Options", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + msglen + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Options == nil { + m.Options = &google_protobuf.Any{} + } + if err := m.Options.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipShim(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthShim + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *UpdateTaskRequest) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: UpdateTaskRequest: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: UpdateTaskRequest: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ID = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Resources", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + msglen + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Resources == nil { + m.Resources = &google_protobuf.Any{} + } + if err := m.Resources.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipShim(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthShim + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *StartRequest) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: StartRequest: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: StartRequest: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ID = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ExecID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ExecID = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipShim(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthShim + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *StartResponse) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: StartResponse: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: StartResponse: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Pid", wireType) + } + m.Pid = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Pid |= (uint32(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipShim(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthShim + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *WaitRequest) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: WaitRequest: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: WaitRequest: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ID = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ExecID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ExecID = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipShim(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthShim + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *WaitResponse) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: WaitResponse: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: WaitResponse: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field ExitStatus", wireType) + } + m.ExitStatus = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.ExitStatus |= (uint32(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ExitedAt", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + msglen + if postIndex > l { + return io.ErrUnexpectedEOF + } + if err := types.StdTimeUnmarshal(&m.ExitedAt, dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipShim(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthShim + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *StatsRequest) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: StatsRequest: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: StatsRequest: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ID = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipShim(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthShim + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *StatsResponse) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: StatsResponse: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: StatsResponse: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Stats", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + msglen + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Stats == nil { + m.Stats = &google_protobuf.Any{} + } + if err := m.Stats.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipShim(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthShim + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *ConnectRequest) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: ConnectRequest: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: ConnectRequest: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ID = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipShim(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthShim + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *ConnectResponse) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: ConnectResponse: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: ConnectResponse: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field ShimPid", wireType) + } + m.ShimPid = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.ShimPid |= (uint32(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TaskPid", wireType) + } + m.TaskPid = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TaskPid |= (uint32(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Version", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Version = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipShim(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthShim + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *ShutdownRequest) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: ShutdownRequest: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: ShutdownRequest: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ID = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Now", wireType) + } + var v int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + v |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + m.Now = bool(v != 0) + default: + iNdEx = preIndex + skippy, err := skipShim(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthShim + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *PauseRequest) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: PauseRequest: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: PauseRequest: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ID = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipShim(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthShim + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *ResumeRequest) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: ResumeRequest: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: ResumeRequest: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowShim + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthShim + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ID = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipShim(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthShim + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func skipShim(dAtA []byte) (n int, err error) { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowShim + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + wireType := int(wire & 0x7) + switch wireType { + case 0: + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowShim + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + iNdEx++ + if dAtA[iNdEx-1] < 0x80 { + break + } + } + return iNdEx, nil + case 1: + iNdEx += 8 + return iNdEx, nil + case 2: + var length int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowShim + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + length |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + iNdEx += length + if length < 0 { + return 0, ErrInvalidLengthShim + } + return iNdEx, nil + case 3: + for { + var innerWire uint64 + var start int = iNdEx + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowShim + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + innerWire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + innerWireType := int(innerWire & 0x7) + if innerWireType == 4 { + break + } + next, err := skipShim(dAtA[start:]) + if err != nil { + return 0, err + } + iNdEx = start + next + } + return iNdEx, nil + case 4: + return iNdEx, nil + case 5: + iNdEx += 4 + return iNdEx, nil + default: + return 0, fmt.Errorf("proto: illegal wireType %d", wireType) + } + } + panic("unreachable") +} + +var ( + ErrInvalidLengthShim = fmt.Errorf("proto: negative length found during unmarshaling") + ErrIntOverflowShim = fmt.Errorf("proto: integer overflow") +) + +func init() { + proto.RegisterFile("github.com/containerd/containerd/runtime/v2/task/shim.proto", fileDescriptorShim) +} + +var fileDescriptorShim = []byte{ + // 1240 bytes of a gzipped FileDescriptorProto + 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0xac, 0x58, 0xdb, 0x6f, 0x1b, 0xc5, + 0x17, 0xee, 0xfa, 0xb2, 0xb6, 0x8f, 0xeb, 0x34, 0x9d, 0x5f, 0x9a, 0xdf, 0xd6, 0x95, 0x6c, 0x77, + 0x4b, 0x83, 0x01, 0xc9, 0x16, 0xae, 0xe0, 0x81, 0x48, 0xa0, 0xdc, 0xa8, 0x4c, 0x0b, 0x89, 0xb6, + 0x45, 0x45, 0xbc, 0x58, 0x1b, 0xef, 0xc4, 0x5e, 0xc5, 0xde, 0x59, 0x76, 0x66, 0x73, 0x41, 0x42, + 0xe2, 0x89, 0x07, 0x9e, 0xf8, 0xb3, 0xf2, 0xc0, 0x03, 0x12, 0x2f, 0xbc, 0x10, 0xa8, 0xff, 0x12, + 0x34, 0x17, 0xc7, 0x6b, 0x67, 0xd7, 0x4e, 0x2a, 0xbf, 0x44, 0x73, 0x76, 0xbe, 0x39, 0x33, 0xe7, + 0xcc, 0x77, 0xbe, 0x33, 0x31, 0x6c, 0xf6, 0x5c, 0xd6, 0x0f, 0x0f, 0x1b, 0x5d, 0x32, 0x6c, 0x76, + 0x89, 0xc7, 0x6c, 0xd7, 0xc3, 0x81, 0x13, 0x1d, 0x06, 0xa1, 0xc7, 0xdc, 0x21, 0x6e, 0x9e, 0xb4, + 0x9a, 0xcc, 0xa6, 0xc7, 0x4d, 0xda, 0x77, 0x87, 0x0d, 0x3f, 0x20, 0x8c, 0x20, 0x34, 0x81, 0x35, + 0xf8, 0x5c, 0xe3, 0xa4, 0x55, 0x7e, 0xd8, 0x23, 0xa4, 0x37, 0xc0, 0x4d, 0x81, 0x38, 0x0c, 0x8f, + 0x9a, 0xb6, 0x77, 0x2e, 0xe1, 0xe5, 0x47, 0xb3, 0x53, 0x78, 0xe8, 0xb3, 0xf1, 0xe4, 0x5a, 0x8f, + 0xf4, 0x88, 0x18, 0x36, 0xf9, 0x48, 0x7d, 0xad, 0xce, 0x2e, 0xe1, 0x47, 0xa1, 0xcc, 0x1e, 0xfa, + 0x0a, 0xf0, 0xe9, 0xc2, 0xf3, 0xdb, 0xbe, 0xdb, 0x64, 0xe7, 0x3e, 0xa6, 0xcd, 0x21, 0x09, 0x3d, + 0xa6, 0xd6, 0x7d, 0x76, 0x8b, 0x75, 0x22, 0x6c, 0x11, 0x9f, 0x58, 0x6b, 0xfe, 0x99, 0x82, 0xfb, + 0x3b, 0x01, 0xb6, 0x19, 0x7e, 0x6d, 0xd3, 0x63, 0x0b, 0xff, 0x10, 0x62, 0xca, 0xd0, 0x3a, 0xa4, + 0x5c, 0xc7, 0xd0, 0x6a, 0x5a, 0xbd, 0xb0, 0xad, 0x8f, 0x2e, 0xab, 0xa9, 0xf6, 0xae, 0x95, 0x72, + 0x1d, 0xb4, 0x0e, 0xfa, 0x61, 0xe8, 0x39, 0x03, 0x6c, 0xa4, 0xf8, 0x9c, 0xa5, 0x2c, 0xd4, 0x04, + 0x3d, 0x20, 0x84, 0x1d, 0x51, 0x23, 0x5d, 0x4b, 0xd7, 0x8b, 0xad, 0xff, 0x37, 0xa2, 0xd9, 0xe4, + 0x1b, 0x37, 0xbe, 0xe6, 0x07, 0xb6, 0x14, 0x0c, 0x95, 0x21, 0xcf, 0x70, 0x30, 0x74, 0x3d, 0x7b, + 0x60, 0x64, 0x6a, 0x5a, 0x3d, 0x6f, 0x5d, 0xd9, 0x68, 0x0d, 0xb2, 0x94, 0x39, 0xae, 0x67, 0x64, + 0xc5, 0x1e, 0xd2, 0xe0, 0x5b, 0x53, 0xe6, 0x90, 0x90, 0x19, 0xba, 0xdc, 0x5a, 0x5a, 0xea, 0x3b, + 0x0e, 0x02, 0x23, 0x77, 0xf5, 0x1d, 0x07, 0x01, 0xaa, 0x00, 0x74, 0xfb, 0xb8, 0x7b, 0xec, 0x13, + 0xd7, 0x63, 0x46, 0x5e, 0xcc, 0x45, 0xbe, 0xa0, 0x8f, 0xe0, 0xbe, 0x6f, 0x07, 0xd8, 0x63, 0x9d, + 0x08, 0xac, 0x20, 0x60, 0xab, 0x72, 0x62, 0x67, 0x02, 0x6e, 0x40, 0x8e, 0xf8, 0xcc, 0x25, 0x1e, + 0x35, 0xa0, 0xa6, 0xd5, 0x8b, 0xad, 0xb5, 0x86, 0xbc, 0xcc, 0xc6, 0xf8, 0x32, 0x1b, 0x5b, 0xde, + 0xb9, 0x35, 0x06, 0x99, 0x1b, 0x80, 0xa2, 0x49, 0xa5, 0x3e, 0xf1, 0x28, 0x46, 0xab, 0x90, 0xf6, + 0x55, 0x5a, 0x4b, 0x16, 0x1f, 0x9a, 0x2f, 0xa1, 0xb4, 0x8b, 0x07, 0x98, 0xe1, 0x45, 0x89, 0x7f, + 0x02, 0x39, 0x7c, 0x86, 0xbb, 0x1d, 0xd7, 0x91, 0x99, 0xdf, 0x86, 0xd1, 0x65, 0x55, 0xdf, 0x3b, + 0xc3, 0xdd, 0xf6, 0xae, 0xa5, 0xf3, 0xa9, 0xb6, 0x63, 0xfe, 0xa2, 0xc1, 0xca, 0xd8, 0x5d, 0xd2, + 0x96, 0xa8, 0x0a, 0x45, 0x7c, 0xe6, 0xb2, 0x0e, 0x65, 0x36, 0x0b, 0xa9, 0xf0, 0x56, 0xb2, 0x80, + 0x7f, 0x7a, 0x25, 0xbe, 0xa0, 0x2d, 0x28, 0x70, 0x0b, 0x3b, 0x1d, 0x9b, 0x19, 0x69, 0x11, 0x6d, + 0xf9, 0x5a, 0xb4, 0xaf, 0xc7, 0xd4, 0xdd, 0xce, 0x5f, 0x5c, 0x56, 0xef, 0xfc, 0xf6, 0x4f, 0x55, + 0xb3, 0xf2, 0x72, 0xd9, 0x16, 0x33, 0xff, 0xd6, 0x00, 0xf1, 0xb3, 0x1d, 0x04, 0xa4, 0x8b, 0x29, + 0x5d, 0x46, 0x70, 0x53, 0x8c, 0x49, 0x27, 0x31, 0x26, 0x13, 0xcf, 0x98, 0x6c, 0x02, 0x63, 0xf4, + 0x29, 0xc6, 0xd4, 0x21, 0x43, 0x7d, 0xdc, 0x15, 0x3c, 0x4a, 0xba, 0x61, 0x81, 0x30, 0x1f, 0xc0, + 0xff, 0xa6, 0xc2, 0x93, 0xc9, 0x36, 0x7f, 0x82, 0x55, 0x0b, 0x53, 0xf7, 0x47, 0x7c, 0xc0, 0xce, + 0x97, 0x12, 0xf3, 0x1a, 0x64, 0x4f, 0x5d, 0x87, 0xf5, 0x45, 0xc0, 0x25, 0x4b, 0x1a, 0xfc, 0xfc, + 0x7d, 0xec, 0xf6, 0xfa, 0x4c, 0x84, 0x5b, 0xb2, 0x94, 0x65, 0xbe, 0x80, 0xbb, 0xfc, 0x0a, 0x97, + 0xc3, 0xa5, 0xdf, 0x53, 0x50, 0x52, 0xde, 0x14, 0x95, 0x6e, 0xab, 0x09, 0x8a, 0x7a, 0xe9, 0x09, + 0xf5, 0x9e, 0xf1, 0xc4, 0x0b, 0xd6, 0xf1, 0x83, 0xaf, 0xb4, 0x1e, 0x45, 0x55, 0xe2, 0xe4, 0x63, + 0x25, 0x14, 0x92, 0x86, 0x96, 0x82, 0x2e, 0x49, 0x0d, 0xa2, 0xec, 0xc9, 0xcf, 0xb0, 0x67, 0xa6, + 0x22, 0x0a, 0xf3, 0x2b, 0x02, 0xde, 0xa9, 0x22, 0x18, 0x14, 0x5f, 0xb8, 0x83, 0xc1, 0x52, 0x58, + 0xc1, 0x63, 0x74, 0x7b, 0xe3, 0x3a, 0x28, 0x59, 0xca, 0xe2, 0x09, 0xb7, 0x07, 0x63, 0x39, 0xe5, + 0x43, 0xb3, 0x0b, 0x2b, 0x3b, 0x03, 0x42, 0x71, 0x7b, 0x7f, 0x59, 0x74, 0x94, 0x57, 0x21, 0xeb, + 0x4f, 0x1a, 0xe6, 0x53, 0x28, 0x1e, 0xb8, 0xce, 0xa2, 0x22, 0x37, 0xbf, 0x81, 0xbb, 0x12, 0xa6, + 0xe8, 0xf4, 0x39, 0x14, 0x7c, 0x59, 0x3f, 0x98, 0x1a, 0x9a, 0xe8, 0x1a, 0xb5, 0x58, 0x3e, 0xa8, + 0x2a, 0x6b, 0x7b, 0x47, 0xc4, 0x9a, 0x2c, 0x31, 0x29, 0x3c, 0x98, 0x08, 0xf4, 0x4d, 0x7a, 0x17, + 0x82, 0x8c, 0x6f, 0xb3, 0xbe, 0x62, 0xa9, 0x18, 0x47, 0x75, 0x3d, 0x7d, 0x13, 0x5d, 0xef, 0xc0, + 0xfd, 0x6f, 0x7d, 0xe7, 0x86, 0xcd, 0xb2, 0x05, 0x85, 0x00, 0x53, 0x12, 0x06, 0x5d, 0x2c, 0x75, + 0x36, 0xc9, 0xfd, 0x04, 0xa6, 0x6a, 0x38, 0x60, 0x4b, 0xa9, 0xe1, 0xc7, 0xa2, 0x84, 0xb9, 0xb3, + 0xc4, 0x06, 0xf4, 0x15, 0x14, 0xdf, 0xd8, 0xee, 0x72, 0xb6, 0x0b, 0xe0, 0xae, 0xf4, 0xa5, 0x76, + 0x9b, 0xa9, 0x2b, 0x6d, 0x7e, 0x5d, 0xa5, 0xde, 0xa9, 0xae, 0x36, 0xa4, 0xe6, 0x2d, 0x64, 0xdf, + 0xa6, 0x54, 0xb3, 0x09, 0xfd, 0x3e, 0xe4, 0x5c, 0xb6, 0x99, 0x3c, 0x56, 0xd2, 0xc5, 0x48, 0x88, + 0x59, 0x87, 0x95, 0x1d, 0xe2, 0x79, 0xb8, 0xbb, 0x28, 0x4f, 0xa6, 0x0d, 0xf7, 0xae, 0x90, 0x6a, + 0xa3, 0x87, 0x90, 0xe7, 0xaf, 0xcc, 0xce, 0x24, 0xf1, 0x39, 0x6e, 0x1f, 0xb8, 0x0e, 0x9f, 0xe2, + 0x2f, 0x31, 0x31, 0x25, 0xfb, 0x70, 0x8e, 0xdb, 0x7c, 0xca, 0x80, 0xdc, 0x09, 0x0e, 0xa8, 0x4b, + 0x64, 0xb1, 0x15, 0xac, 0xb1, 0x69, 0x6e, 0xc2, 0xbd, 0x57, 0xfd, 0x90, 0x39, 0xe4, 0xd4, 0x5b, + 0x74, 0x6b, 0xab, 0x90, 0xf6, 0xc8, 0xa9, 0x70, 0x9d, 0xb7, 0xf8, 0x90, 0xa7, 0xeb, 0xc0, 0x0e, + 0xe9, 0xa2, 0x16, 0x61, 0xbe, 0x0f, 0x25, 0x0b, 0xd3, 0x70, 0xb8, 0x08, 0xd8, 0xfa, 0x15, 0x20, + 0xc3, 0x6b, 0x01, 0xbd, 0x84, 0xac, 0x68, 0x17, 0x68, 0xaa, 0x88, 0xd5, 0x43, 0xba, 0x11, 0xed, + 0x4b, 0xe5, 0xc7, 0x73, 0x10, 0x2a, 0x69, 0x6f, 0x40, 0x97, 0xef, 0x27, 0xf4, 0x34, 0x0e, 0x7c, + 0xed, 0xc1, 0x5a, 0xde, 0x58, 0x04, 0x53, 0x8e, 0xe5, 0x31, 0x03, 0x96, 0x78, 0xcc, 0xab, 0xd2, + 0x4b, 0x3c, 0x66, 0xa4, 0x9e, 0xf6, 0x41, 0x97, 0xef, 0x2d, 0x14, 0x0b, 0x9e, 0x7a, 0xda, 0x95, + 0xcd, 0x79, 0x10, 0xe5, 0xb0, 0x0d, 0x19, 0x2e, 0x92, 0xa8, 0x1a, 0x87, 0x8d, 0xa8, 0x6c, 0xb9, + 0x96, 0x0c, 0x50, 0xae, 0xb6, 0x20, 0x2b, 0xae, 0x3a, 0x3e, 0xd2, 0x28, 0x0b, 0xca, 0xeb, 0xd7, + 0xc8, 0xbf, 0xc7, 0xff, 0x99, 0x41, 0x3b, 0xa0, 0x4b, 0x16, 0xc4, 0x87, 0x37, 0xc5, 0x90, 0x44, + 0x27, 0xfb, 0x00, 0x91, 0x87, 0xf4, 0x07, 0xb1, 0xf7, 0x14, 0xa7, 0xe3, 0x89, 0x0e, 0xbf, 0x80, + 0x0c, 0x6f, 0xa5, 0xf1, 0x39, 0x8a, 0x34, 0xd9, 0x44, 0x07, 0x5f, 0x42, 0x86, 0x2b, 0x17, 0x8a, + 0xe5, 0xcc, 0xf5, 0x67, 0x6b, 0xa2, 0x9f, 0x36, 0x14, 0xae, 0x9e, 0x7b, 0xe8, 0xbd, 0x84, 0x0c, + 0x4d, 0xbd, 0x06, 0x13, 0x5d, 0xed, 0x41, 0x4e, 0x35, 0x6a, 0x14, 0x4b, 0x93, 0xe9, 0x2e, 0x9e, + 0xe8, 0xe6, 0x39, 0xe8, 0xb2, 0x3d, 0xc5, 0x97, 0xcd, 0xb5, 0xd6, 0x35, 0x27, 0xb4, 0x0c, 0x97, + 0xf2, 0xf8, 0x1c, 0x47, 0x1a, 0x46, 0x3c, 0x0f, 0xa7, 0xba, 0x80, 0x12, 0x06, 0x9a, 0x2c, 0x0c, + 0x74, 0xa1, 0x30, 0x4c, 0x58, 0x6d, 0x41, 0x4e, 0x09, 0x6c, 0x42, 0xa2, 0xa6, 0x74, 0xba, 0xfc, + 0x64, 0x2e, 0x46, 0xf9, 0x7c, 0x0e, 0xf9, 0xb1, 0xa2, 0xa2, 0xd8, 0x05, 0x33, 0x7a, 0x9b, 0x94, + 0xb5, 0xed, 0xfd, 0x8b, 0xb7, 0x95, 0x3b, 0x7f, 0xbd, 0xad, 0xdc, 0xf9, 0x79, 0x54, 0xd1, 0x2e, + 0x46, 0x15, 0xed, 0x8f, 0x51, 0x45, 0xfb, 0x77, 0x54, 0xd1, 0xbe, 0xff, 0xe4, 0xb6, 0xbf, 0x4c, + 0x6c, 0xf2, 0x3f, 0xdf, 0xa5, 0x0e, 0x75, 0xb1, 0xc5, 0xb3, 0xff, 0x02, 0x00, 0x00, 0xff, 0xff, + 0x11, 0x4c, 0x17, 0x02, 0xdb, 0x10, 0x00, 0x00, +} diff --git a/vendor/github.com/containerd/containerd/sys/env.go b/vendor/github.com/containerd/containerd/sys/env.go new file mode 100644 index 0000000000..8450d62758 --- /dev/null +++ b/vendor/github.com/containerd/containerd/sys/env.go @@ -0,0 +1,33 @@ +// +build !windows + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package sys + +import "golang.org/x/sys/unix" + +// RunningPrivileged returns true if the effective user ID of the +// calling process is 0 +func RunningPrivileged() bool { + return unix.Geteuid() == 0 +} + +// RunningUnprivileged returns true if the effective user ID of the +// calling process is not 0 +func RunningUnprivileged() bool { + return !RunningPrivileged() +} diff --git a/vendor/github.com/containerd/containerd/sys/epoll.go b/vendor/github.com/containerd/containerd/sys/epoll.go new file mode 100644 index 0000000000..683f38eea8 --- /dev/null +++ b/vendor/github.com/containerd/containerd/sys/epoll.go @@ -0,0 +1,36 @@ +// +build linux + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package sys + +import "golang.org/x/sys/unix" + +// EpollCreate1 directly calls unix.EpollCreate1 +func EpollCreate1(flag int) (int, error) { + return unix.EpollCreate1(flag) +} + +// EpollCtl directly calls unix.EpollCtl +func EpollCtl(epfd int, op int, fd int, event *unix.EpollEvent) error { + return unix.EpollCtl(epfd, op, fd, event) +} + +// EpollWait directly calls unix.EpollWait +func EpollWait(epfd int, events []unix.EpollEvent, msec int) (int, error) { + return unix.EpollWait(epfd, events, msec) +} diff --git a/vendor/github.com/containerd/containerd/sys/fds.go b/vendor/github.com/containerd/containerd/sys/fds.go new file mode 100644 index 0000000000..db3cf702f4 --- /dev/null +++ b/vendor/github.com/containerd/containerd/sys/fds.go @@ -0,0 +1,34 @@ +// +build !windows,!darwin + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package sys + +import ( + "io/ioutil" + "path/filepath" + "strconv" +) + +// GetOpenFds returns the number of open fds for the process provided by pid +func GetOpenFds(pid int) (int, error) { + dirs, err := ioutil.ReadDir(filepath.Join("/proc", strconv.Itoa(pid), "fd")) + if err != nil { + return -1, err + } + return len(dirs), nil +} diff --git a/vendor/github.com/containerd/containerd/sys/filesys_unix.go b/vendor/github.com/containerd/containerd/sys/filesys_unix.go new file mode 100644 index 0000000000..700f44efa9 --- /dev/null +++ b/vendor/github.com/containerd/containerd/sys/filesys_unix.go @@ -0,0 +1,26 @@ +// +build !windows + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package sys + +import "os" + +// ForceRemoveAll on unix is just a wrapper for os.RemoveAll +func ForceRemoveAll(path string) error { + return os.RemoveAll(path) +} diff --git a/vendor/github.com/containerd/containerd/sys/filesys_windows.go b/vendor/github.com/containerd/containerd/sys/filesys_windows.go new file mode 100644 index 0000000000..dc880c3427 --- /dev/null +++ b/vendor/github.com/containerd/containerd/sys/filesys_windows.go @@ -0,0 +1,263 @@ +// +build windows + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package sys + +import ( + "os" + "path/filepath" + "regexp" + "strings" + "syscall" + "unsafe" + + winio "github.com/Microsoft/go-winio" + "github.com/Microsoft/hcsshim" +) + +// MkdirAllWithACL is a wrapper for MkdirAll that creates a directory +// ACL'd for Builtin Administrators and Local System. +func MkdirAllWithACL(path string, perm os.FileMode) error { + return mkdirall(path, true) +} + +// MkdirAll implementation that is volume path aware for Windows. +func MkdirAll(path string, _ os.FileMode) error { + return mkdirall(path, false) +} + +// mkdirall is a custom version of os.MkdirAll modified for use on Windows +// so that it is both volume path aware, and can create a directory with +// a DACL. +func mkdirall(path string, adminAndLocalSystem bool) error { + if re := regexp.MustCompile(`^\\\\\?\\Volume{[a-z0-9-]+}$`); re.MatchString(path) { + return nil + } + + // The rest of this method is largely copied from os.MkdirAll and should be kept + // as-is to ensure compatibility. + + // Fast path: if we can tell whether path is a directory or file, stop with success or error. + dir, err := os.Stat(path) + if err == nil { + if dir.IsDir() { + return nil + } + return &os.PathError{ + Op: "mkdir", + Path: path, + Err: syscall.ENOTDIR, + } + } + + // Slow path: make sure parent exists and then call Mkdir for path. + i := len(path) + for i > 0 && os.IsPathSeparator(path[i-1]) { // Skip trailing path separator. + i-- + } + + j := i + for j > 0 && !os.IsPathSeparator(path[j-1]) { // Scan backward over element. + j-- + } + + if j > 1 { + // Create parent + err = mkdirall(path[0:j-1], false) + if err != nil { + return err + } + } + + // Parent now exists; invoke os.Mkdir or mkdirWithACL and use its result. + if adminAndLocalSystem { + err = mkdirWithACL(path) + } else { + err = os.Mkdir(path, 0) + } + + if err != nil { + // Handle arguments like "foo/." by + // double-checking that directory doesn't exist. + dir, err1 := os.Lstat(path) + if err1 == nil && dir.IsDir() { + return nil + } + return err + } + return nil +} + +// mkdirWithACL creates a new directory. If there is an error, it will be of +// type *PathError. . +// +// This is a modified and combined version of os.Mkdir and syscall.Mkdir +// in golang to cater for creating a directory am ACL permitting full +// access, with inheritance, to any subfolder/file for Built-in Administrators +// and Local System. +func mkdirWithACL(name string) error { + sa := syscall.SecurityAttributes{Length: 0} + sddl := "D:P(A;OICI;GA;;;BA)(A;OICI;GA;;;SY)" + sd, err := winio.SddlToSecurityDescriptor(sddl) + if err != nil { + return &os.PathError{Op: "mkdir", Path: name, Err: err} + } + sa.Length = uint32(unsafe.Sizeof(sa)) + sa.InheritHandle = 1 + sa.SecurityDescriptor = uintptr(unsafe.Pointer(&sd[0])) + + namep, err := syscall.UTF16PtrFromString(name) + if err != nil { + return &os.PathError{Op: "mkdir", Path: name, Err: err} + } + + e := syscall.CreateDirectory(namep, &sa) + if e != nil { + return &os.PathError{Op: "mkdir", Path: name, Err: e} + } + return nil +} + +// IsAbs is a platform-specific wrapper for filepath.IsAbs. On Windows, +// golang filepath.IsAbs does not consider a path \windows\system32 as absolute +// as it doesn't start with a drive-letter/colon combination. However, in +// docker we need to verify things such as WORKDIR /windows/system32 in +// a Dockerfile (which gets translated to \windows\system32 when being processed +// by the daemon. This SHOULD be treated as absolute from a docker processing +// perspective. +func IsAbs(path string) bool { + if !filepath.IsAbs(path) { + if !strings.HasPrefix(path, string(os.PathSeparator)) { + return false + } + } + return true +} + +// The origin of the functions below here are the golang OS and syscall packages, +// slightly modified to only cope with files, not directories due to the +// specific use case. +// +// The alteration is to allow a file on Windows to be opened with +// FILE_FLAG_SEQUENTIAL_SCAN (particular for docker load), to avoid eating +// the standby list, particularly when accessing large files such as layer.tar. + +// CreateSequential creates the named file with mode 0666 (before umask), truncating +// it if it already exists. If successful, methods on the returned +// File can be used for I/O; the associated file descriptor has mode +// O_RDWR. +// If there is an error, it will be of type *PathError. +func CreateSequential(name string) (*os.File, error) { + return OpenFileSequential(name, os.O_RDWR|os.O_CREATE|os.O_TRUNC, 0) +} + +// OpenSequential opens the named file for reading. If successful, methods on +// the returned file can be used for reading; the associated file +// descriptor has mode O_RDONLY. +// If there is an error, it will be of type *PathError. +func OpenSequential(name string) (*os.File, error) { + return OpenFileSequential(name, os.O_RDONLY, 0) +} + +// OpenFileSequential is the generalized open call; most users will use Open +// or Create instead. +// If there is an error, it will be of type *PathError. +func OpenFileSequential(name string, flag int, _ os.FileMode) (*os.File, error) { + if name == "" { + return nil, &os.PathError{Op: "open", Path: name, Err: syscall.ENOENT} + } + r, errf := syscallOpenFileSequential(name, flag, 0) + if errf == nil { + return r, nil + } + return nil, &os.PathError{Op: "open", Path: name, Err: errf} +} + +func syscallOpenFileSequential(name string, flag int, _ os.FileMode) (file *os.File, err error) { + r, e := syscallOpenSequential(name, flag|syscall.O_CLOEXEC, 0) + if e != nil { + return nil, e + } + return os.NewFile(uintptr(r), name), nil +} + +func makeInheritSa() *syscall.SecurityAttributes { + var sa syscall.SecurityAttributes + sa.Length = uint32(unsafe.Sizeof(sa)) + sa.InheritHandle = 1 + return &sa +} + +func syscallOpenSequential(path string, mode int, _ uint32) (fd syscall.Handle, err error) { + if len(path) == 0 { + return syscall.InvalidHandle, syscall.ERROR_FILE_NOT_FOUND + } + pathp, err := syscall.UTF16PtrFromString(path) + if err != nil { + return syscall.InvalidHandle, err + } + var access uint32 + switch mode & (syscall.O_RDONLY | syscall.O_WRONLY | syscall.O_RDWR) { + case syscall.O_RDONLY: + access = syscall.GENERIC_READ + case syscall.O_WRONLY: + access = syscall.GENERIC_WRITE + case syscall.O_RDWR: + access = syscall.GENERIC_READ | syscall.GENERIC_WRITE + } + if mode&syscall.O_CREAT != 0 { + access |= syscall.GENERIC_WRITE + } + if mode&syscall.O_APPEND != 0 { + access &^= syscall.GENERIC_WRITE + access |= syscall.FILE_APPEND_DATA + } + sharemode := uint32(syscall.FILE_SHARE_READ | syscall.FILE_SHARE_WRITE) + var sa *syscall.SecurityAttributes + if mode&syscall.O_CLOEXEC == 0 { + sa = makeInheritSa() + } + var createmode uint32 + switch { + case mode&(syscall.O_CREAT|syscall.O_EXCL) == (syscall.O_CREAT | syscall.O_EXCL): + createmode = syscall.CREATE_NEW + case mode&(syscall.O_CREAT|syscall.O_TRUNC) == (syscall.O_CREAT | syscall.O_TRUNC): + createmode = syscall.CREATE_ALWAYS + case mode&syscall.O_CREAT == syscall.O_CREAT: + createmode = syscall.OPEN_ALWAYS + case mode&syscall.O_TRUNC == syscall.O_TRUNC: + createmode = syscall.TRUNCATE_EXISTING + default: + createmode = syscall.OPEN_EXISTING + } + // Use FILE_FLAG_SEQUENTIAL_SCAN rather than FILE_ATTRIBUTE_NORMAL as implemented in golang. + //https://msdn.microsoft.com/en-us/library/windows/desktop/aa363858(v=vs.85).aspx + const fileFlagSequentialScan = 0x08000000 // FILE_FLAG_SEQUENTIAL_SCAN + h, e := syscall.CreateFile(pathp, access, sharemode, sa, createmode, fileFlagSequentialScan, 0) + return h, e +} + +// ForceRemoveAll is the same as os.RemoveAll, but uses hcsshim.DestroyLayer in order +// to delete container layers. +func ForceRemoveAll(path string) error { + info := hcsshim.DriverInfo{ + HomeDir: filepath.Dir(path), + } + + return hcsshim.DestroyLayer(info, filepath.Base(path)) +} diff --git a/vendor/github.com/containerd/containerd/sys/mount_linux.go b/vendor/github.com/containerd/containerd/sys/mount_linux.go new file mode 100644 index 0000000000..a9eee9b73a --- /dev/null +++ b/vendor/github.com/containerd/containerd/sys/mount_linux.go @@ -0,0 +1,119 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package sys + +import ( + "runtime" + "syscall" + "unsafe" + + "github.com/pkg/errors" + "golang.org/x/sys/unix" +) + +// FMountat performs mount from the provided directory. +func FMountat(dirfd uintptr, source, target, fstype string, flags uintptr, data string) error { + var ( + sourceP, targetP, fstypeP, dataP *byte + pid uintptr + ws unix.WaitStatus + err error + errno syscall.Errno + ) + + sourceP, err = syscall.BytePtrFromString(source) + if err != nil { + return err + } + + targetP, err = syscall.BytePtrFromString(target) + if err != nil { + return err + } + + fstypeP, err = syscall.BytePtrFromString(fstype) + if err != nil { + return err + } + + if data != "" { + dataP, err = syscall.BytePtrFromString(data) + if err != nil { + return err + } + } + + runtime.LockOSThread() + defer runtime.UnlockOSThread() + + pid, errno = forkAndMountat(dirfd, + uintptr(unsafe.Pointer(sourceP)), + uintptr(unsafe.Pointer(targetP)), + uintptr(unsafe.Pointer(fstypeP)), + flags, + uintptr(unsafe.Pointer(dataP))) + + if errno != 0 { + return errors.Wrap(errno, "failed to fork thread") + } + + _, err = unix.Wait4(int(pid), &ws, 0, nil) + for err == syscall.EINTR { + _, err = unix.Wait4(int(pid), &ws, 0, nil) + } + + if err != nil { + return errors.Wrapf(err, "failed to find pid=%d process", pid) + } + + errno = syscall.Errno(ws.ExitStatus()) + if errno != 0 { + return errors.Wrap(errno, "failed to mount") + } + return nil +} + +// forkAndMountat will fork thread, change working dir and mount. +// +// precondition: the runtime OS thread must be locked. +func forkAndMountat(dirfd uintptr, source, target, fstype, flags, data uintptr) (pid uintptr, errno syscall.Errno) { + // block signal during clone + beforeFork() + + // the cloned thread shares the open file descriptor, but the thread + // never be reused by runtime. + pid, _, errno = syscall.RawSyscall6(syscall.SYS_CLONE, uintptr(syscall.SIGCHLD)|syscall.CLONE_FILES, 0, 0, 0, 0, 0) + if errno != 0 || pid != 0 { + // restore all signals + afterFork() + return + } + + // restore all signals + afterForkInChild() + + // change working dir + _, _, errno = syscall.RawSyscall(syscall.SYS_FCHDIR, dirfd, 0, 0) + if errno != 0 { + goto childerr + } + _, _, errno = syscall.RawSyscall6(syscall.SYS_MOUNT, source, target, fstype, flags, data, 0) + +childerr: + syscall.RawSyscall(syscall.SYS_EXIT, uintptr(errno), 0, 0) + panic("unreachable") +} diff --git a/vendor/github.com/containerd/containerd/sys/oom_unix.go b/vendor/github.com/containerd/containerd/sys/oom_unix.go new file mode 100644 index 0000000000..7192efec1c --- /dev/null +++ b/vendor/github.com/containerd/containerd/sys/oom_unix.go @@ -0,0 +1,47 @@ +// +build !windows + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package sys + +import ( + "fmt" + "os" + "strconv" + + "github.com/opencontainers/runc/libcontainer/system" +) + +// OOMScoreMaxKillable is the maximum score keeping the process killable by the oom killer +const OOMScoreMaxKillable = -999 + +// SetOOMScore sets the oom score for the provided pid +func SetOOMScore(pid, score int) error { + path := fmt.Sprintf("/proc/%d/oom_score_adj", pid) + f, err := os.OpenFile(path, os.O_WRONLY, 0) + if err != nil { + return err + } + defer f.Close() + if _, err = f.WriteString(strconv.Itoa(score)); err != nil { + if os.IsPermission(err) && (system.RunningInUserNS() || RunningUnprivileged()) { + return nil + } + return err + } + return nil +} diff --git a/vendor/github.com/containerd/containerd/sys/oom_windows.go b/vendor/github.com/containerd/containerd/sys/oom_windows.go new file mode 100644 index 0000000000..f44bcebd1e --- /dev/null +++ b/vendor/github.com/containerd/containerd/sys/oom_windows.go @@ -0,0 +1,24 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package sys + +// SetOOMScore sets the oom score for the process +// +// Not implemented on Windows +func SetOOMScore(pid, score int) error { + return nil +} diff --git a/vendor/github.com/containerd/containerd/sys/proc.go b/vendor/github.com/containerd/containerd/sys/proc.go new file mode 100644 index 0000000000..496eb1fea1 --- /dev/null +++ b/vendor/github.com/containerd/containerd/sys/proc.go @@ -0,0 +1,80 @@ +// +build linux + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package sys + +import ( + "bufio" + "fmt" + "os" + "strconv" + "strings" + + "github.com/opencontainers/runc/libcontainer/system" +) + +const nanoSecondsPerSecond = 1e9 + +var clockTicksPerSecond = uint64(system.GetClockTicks()) + +// GetSystemCPUUsage returns the host system's cpu usage in +// nanoseconds. An error is returned if the format of the underlying +// file does not match. +// +// Uses /proc/stat defined by POSIX. Looks for the cpu +// statistics line and then sums up the first seven fields +// provided. See `man 5 proc` for details on specific field +// information. +func GetSystemCPUUsage() (uint64, error) { + var line string + f, err := os.Open("/proc/stat") + if err != nil { + return 0, err + } + bufReader := bufio.NewReaderSize(nil, 128) + defer func() { + bufReader.Reset(nil) + f.Close() + }() + bufReader.Reset(f) + err = nil + for err == nil { + line, err = bufReader.ReadString('\n') + if err != nil { + break + } + parts := strings.Fields(line) + switch parts[0] { + case "cpu": + if len(parts) < 8 { + return 0, fmt.Errorf("bad format of cpu stats") + } + var totalClockTicks uint64 + for _, i := range parts[1:8] { + v, err := strconv.ParseUint(i, 10, 64) + if err != nil { + return 0, fmt.Errorf("error parsing cpu stats") + } + totalClockTicks += v + } + return (totalClockTicks * nanoSecondsPerSecond) / + clockTicksPerSecond, nil + } + } + return 0, fmt.Errorf("bad stats format") +} diff --git a/vendor/github.com/containerd/containerd/sys/reaper.go b/vendor/github.com/containerd/containerd/sys/reaper.go new file mode 100644 index 0000000000..d08ccccfbc --- /dev/null +++ b/vendor/github.com/containerd/containerd/sys/reaper.go @@ -0,0 +1,69 @@ +// +build !windows + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package sys + +import ( + "golang.org/x/sys/unix" +) + +// Exit is the wait4 information from an exited process +type Exit struct { + Pid int + Status int +} + +// Reap reaps all child processes for the calling process and returns their +// exit information +func Reap(wait bool) (exits []Exit, err error) { + var ( + ws unix.WaitStatus + rus unix.Rusage + ) + flag := unix.WNOHANG + if wait { + flag = 0 + } + for { + pid, err := unix.Wait4(-1, &ws, flag, &rus) + if err != nil { + if err == unix.ECHILD { + return exits, nil + } + return exits, err + } + if pid <= 0 { + return exits, nil + } + exits = append(exits, Exit{ + Pid: pid, + Status: exitStatus(ws), + }) + } +} + +const exitSignalOffset = 128 + +// exitStatus returns the correct exit status for a process based on if it +// was signaled or exited cleanly +func exitStatus(status unix.WaitStatus) int { + if status.Signaled() { + return exitSignalOffset + int(status.Signal()) + } + return status.ExitStatus() +} diff --git a/vendor/github.com/containerd/containerd/sys/reaper_linux.go b/vendor/github.com/containerd/containerd/sys/reaper_linux.go new file mode 100644 index 0000000000..ecb0bd031e --- /dev/null +++ b/vendor/github.com/containerd/containerd/sys/reaper_linux.go @@ -0,0 +1,52 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package sys + +import ( + "unsafe" + + "golang.org/x/sys/unix" +) + +// If arg2 is nonzero, set the "child subreaper" attribute of the +// calling process; if arg2 is zero, unset the attribute. When a +// process is marked as a child subreaper, all of the children +// that it creates, and their descendants, will be marked as +// having a subreaper. In effect, a subreaper fulfills the role +// of init(1) for its descendant processes. Upon termination of +// a process that is orphaned (i.e., its immediate parent has +// already terminated) and marked as having a subreaper, the +// nearest still living ancestor subreaper will receive a SIGCHLD +// signal and be able to wait(2) on the process to discover its +// termination status. +const setChildSubreaper = 36 + +// SetSubreaper sets the value i as the subreaper setting for the calling process +func SetSubreaper(i int) error { + return unix.Prctl(setChildSubreaper, uintptr(i), 0, 0, 0) +} + +// GetSubreaper returns the subreaper setting for the calling process +func GetSubreaper() (int, error) { + var i uintptr + + if err := unix.Prctl(unix.PR_GET_CHILD_SUBREAPER, uintptr(unsafe.Pointer(&i)), 0, 0, 0); err != nil { + return -1, err + } + + return int(i), nil +} diff --git a/vendor/github.com/containerd/containerd/sys/socket_unix.go b/vendor/github.com/containerd/containerd/sys/socket_unix.go new file mode 100644 index 0000000000..0dbca0e333 --- /dev/null +++ b/vendor/github.com/containerd/containerd/sys/socket_unix.go @@ -0,0 +1,80 @@ +// +build !windows + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package sys + +import ( + "net" + "os" + "path/filepath" + + "github.com/pkg/errors" + "golang.org/x/sys/unix" +) + +// CreateUnixSocket creates a unix socket and returns the listener +func CreateUnixSocket(path string) (net.Listener, error) { + // BSDs have a 104 limit + if len(path) > 104 { + return nil, errors.Errorf("%q: unix socket path too long (> 104)", path) + } + if err := os.MkdirAll(filepath.Dir(path), 0660); err != nil { + return nil, err + } + if err := unix.Unlink(path); err != nil && !os.IsNotExist(err) { + return nil, err + } + return net.Listen("unix", path) +} + +// GetLocalListener returns a listerner out of a unix socket. +func GetLocalListener(path string, uid, gid int) (net.Listener, error) { + // Ensure parent directory is created + if err := mkdirAs(filepath.Dir(path), uid, gid); err != nil { + return nil, err + } + + l, err := CreateUnixSocket(path) + if err != nil { + return l, err + } + + if err := os.Chmod(path, 0660); err != nil { + l.Close() + return nil, err + } + + if err := os.Chown(path, uid, gid); err != nil { + l.Close() + return nil, err + } + + return l, nil +} + +func mkdirAs(path string, uid, gid int) error { + if _, err := os.Stat(path); err == nil || !os.IsNotExist(err) { + return err + } + + if err := os.Mkdir(path, 0770); err != nil { + return err + } + + return os.Chown(path, uid, gid) +} diff --git a/vendor/github.com/containerd/containerd/sys/socket_windows.go b/vendor/github.com/containerd/containerd/sys/socket_windows.go new file mode 100644 index 0000000000..3ee7679b49 --- /dev/null +++ b/vendor/github.com/containerd/containerd/sys/socket_windows.go @@ -0,0 +1,32 @@ +// +build windows + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package sys + +import ( + "net" + + "github.com/Microsoft/go-winio" +) + +// GetLocalListener returns a Listernet out of a named pipe. +// `path` must be of the form of `\\.\pipe\` +// (see https://msdn.microsoft.com/en-us/library/windows/desktop/aa365150) +func GetLocalListener(path string, uid, gid int) (net.Listener, error) { + return winio.ListenPipe(path, nil) +} diff --git a/vendor/github.com/containerd/containerd/sys/stat_bsd.go b/vendor/github.com/containerd/containerd/sys/stat_bsd.go new file mode 100644 index 0000000000..b9c95d90d7 --- /dev/null +++ b/vendor/github.com/containerd/containerd/sys/stat_bsd.go @@ -0,0 +1,44 @@ +// +build darwin freebsd + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package sys + +import ( + "syscall" + "time" +) + +// StatAtime returns the access time from a stat struct +func StatAtime(st *syscall.Stat_t) syscall.Timespec { + return st.Atimespec +} + +// StatCtime returns the created time from a stat struct +func StatCtime(st *syscall.Stat_t) syscall.Timespec { + return st.Ctimespec +} + +// StatMtime returns the modified time from a stat struct +func StatMtime(st *syscall.Stat_t) syscall.Timespec { + return st.Mtimespec +} + +// StatATimeAsTime returns the access time as a time.Time +func StatATimeAsTime(st *syscall.Stat_t) time.Time { + return time.Unix(int64(st.Atimespec.Sec), int64(st.Atimespec.Nsec)) // nolint: unconvert +} diff --git a/vendor/github.com/containerd/containerd/sys/stat_unix.go b/vendor/github.com/containerd/containerd/sys/stat_unix.go new file mode 100644 index 0000000000..21a666dff8 --- /dev/null +++ b/vendor/github.com/containerd/containerd/sys/stat_unix.go @@ -0,0 +1,44 @@ +// +build linux solaris + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package sys + +import ( + "syscall" + "time" +) + +// StatAtime returns the Atim +func StatAtime(st *syscall.Stat_t) syscall.Timespec { + return st.Atim +} + +// StatCtime returns the Ctim +func StatCtime(st *syscall.Stat_t) syscall.Timespec { + return st.Ctim +} + +// StatMtime returns the Mtim +func StatMtime(st *syscall.Stat_t) syscall.Timespec { + return st.Mtim +} + +// StatATimeAsTime returns st.Atim as a time.Time +func StatATimeAsTime(st *syscall.Stat_t) time.Time { + return time.Unix(int64(st.Atim.Sec), int64(st.Atim.Nsec)) // nolint: unconvert +} diff --git a/vendor/github.com/containerd/containerd/sys/subprocess_unsafe_linux.go b/vendor/github.com/containerd/containerd/sys/subprocess_unsafe_linux.go new file mode 100644 index 0000000000..6e40a9c7d7 --- /dev/null +++ b/vendor/github.com/containerd/containerd/sys/subprocess_unsafe_linux.go @@ -0,0 +1,30 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package sys + +import ( + _ "unsafe" // required for go:linkname. +) + +//go:linkname beforeFork syscall.runtime_BeforeFork +func beforeFork() + +//go:linkname afterFork syscall.runtime_AfterFork +func afterFork() + +//go:linkname afterForkInChild syscall.runtime_AfterForkInChild +func afterForkInChild() diff --git a/vendor/github.com/containerd/containerd/sys/subprocess_unsafe_linux.s b/vendor/github.com/containerd/containerd/sys/subprocess_unsafe_linux.s new file mode 100644 index 0000000000..c073fa4ad7 --- /dev/null +++ b/vendor/github.com/containerd/containerd/sys/subprocess_unsafe_linux.s @@ -0,0 +1,15 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ diff --git a/vendor/github.com/containerd/fifo/LICENSE b/vendor/github.com/containerd/fifo/LICENSE new file mode 100644 index 0000000000..261eeb9e9f --- /dev/null +++ b/vendor/github.com/containerd/fifo/LICENSE @@ -0,0 +1,201 @@ + Apache License + Version 2.0, January 2004 + http://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + APPENDIX: How to apply the Apache License to your work. + + To apply the Apache License to your work, attach the following + boilerplate notice, with the fields enclosed by brackets "[]" + replaced with your own identifying information. (Don't include + the brackets!) The text should be enclosed in the appropriate + comment syntax for the file format. We also recommend that a + file or class name and description of purpose be included on the + same "printed page" as the copyright notice for easier + identification within third-party archives. + + Copyright [yyyy] [name of copyright owner] + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. diff --git a/vendor/github.com/containerd/fifo/fifo.go b/vendor/github.com/containerd/fifo/fifo.go new file mode 100644 index 0000000000..e79813da7d --- /dev/null +++ b/vendor/github.com/containerd/fifo/fifo.go @@ -0,0 +1,236 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package fifo + +import ( + "io" + "os" + "runtime" + "sync" + "syscall" + + "github.com/pkg/errors" + "golang.org/x/net/context" +) + +type fifo struct { + flag int + opened chan struct{} + closed chan struct{} + closing chan struct{} + err error + file *os.File + closingOnce sync.Once // close has been called + closedOnce sync.Once // fifo is closed + handle *handle +} + +var leakCheckWg *sync.WaitGroup + +// OpenFifo opens a fifo. Returns io.ReadWriteCloser. +// Context can be used to cancel this function until open(2) has not returned. +// Accepted flags: +// - syscall.O_CREAT - create new fifo if one doesn't exist +// - syscall.O_RDONLY - open fifo only from reader side +// - syscall.O_WRONLY - open fifo only from writer side +// - syscall.O_RDWR - open fifo from both sides, never block on syscall level +// - syscall.O_NONBLOCK - return io.ReadWriteCloser even if other side of the +// fifo isn't open. read/write will be connected after the actual fifo is +// open or after fifo is closed. +func OpenFifo(ctx context.Context, fn string, flag int, perm os.FileMode) (io.ReadWriteCloser, error) { + if _, err := os.Stat(fn); err != nil { + if os.IsNotExist(err) && flag&syscall.O_CREAT != 0 { + if err := mkfifo(fn, uint32(perm&os.ModePerm)); err != nil && !os.IsExist(err) { + return nil, errors.Wrapf(err, "error creating fifo %v", fn) + } + } else { + return nil, err + } + } + + block := flag&syscall.O_NONBLOCK == 0 || flag&syscall.O_RDWR != 0 + + flag &= ^syscall.O_CREAT + flag &= ^syscall.O_NONBLOCK + + h, err := getHandle(fn) + if err != nil { + return nil, err + } + + f := &fifo{ + handle: h, + flag: flag, + opened: make(chan struct{}), + closed: make(chan struct{}), + closing: make(chan struct{}), + } + + wg := leakCheckWg + if wg != nil { + wg.Add(2) + } + + go func() { + if wg != nil { + defer wg.Done() + } + select { + case <-ctx.Done(): + select { + case <-f.opened: + default: + f.Close() + } + case <-f.opened: + case <-f.closed: + } + }() + go func() { + if wg != nil { + defer wg.Done() + } + var file *os.File + fn, err := h.Path() + if err == nil { + file, err = os.OpenFile(fn, flag, 0) + } + select { + case <-f.closing: + if err == nil { + select { + case <-ctx.Done(): + err = ctx.Err() + default: + err = errors.Errorf("fifo %v was closed before opening", h.Name()) + } + if file != nil { + file.Close() + } + } + default: + } + if err != nil { + f.closedOnce.Do(func() { + f.err = err + close(f.closed) + }) + return + } + f.file = file + close(f.opened) + }() + if block { + select { + case <-f.opened: + case <-f.closed: + return nil, f.err + } + } + return f, nil +} + +// Read from a fifo to a byte array. +func (f *fifo) Read(b []byte) (int, error) { + if f.flag&syscall.O_WRONLY > 0 { + return 0, errors.New("reading from write-only fifo") + } + select { + case <-f.opened: + return f.file.Read(b) + default: + } + select { + case <-f.opened: + return f.file.Read(b) + case <-f.closed: + return 0, errors.New("reading from a closed fifo") + } +} + +// Write from byte array to a fifo. +func (f *fifo) Write(b []byte) (int, error) { + if f.flag&(syscall.O_WRONLY|syscall.O_RDWR) == 0 { + return 0, errors.New("writing to read-only fifo") + } + select { + case <-f.opened: + return f.file.Write(b) + default: + } + select { + case <-f.opened: + return f.file.Write(b) + case <-f.closed: + return 0, errors.New("writing to a closed fifo") + } +} + +// Close the fifo. Next reads/writes will error. This method can also be used +// before open(2) has returned and fifo was never opened. +func (f *fifo) Close() (retErr error) { + for { + select { + case <-f.closed: + f.handle.Close() + return + default: + select { + case <-f.opened: + f.closedOnce.Do(func() { + retErr = f.file.Close() + f.err = retErr + close(f.closed) + }) + default: + if f.flag&syscall.O_RDWR != 0 { + runtime.Gosched() + break + } + f.closingOnce.Do(func() { + close(f.closing) + }) + reverseMode := syscall.O_WRONLY + if f.flag&syscall.O_WRONLY > 0 { + reverseMode = syscall.O_RDONLY + } + fn, err := f.handle.Path() + // if Close() is called concurrently(shouldn't) it may cause error + // because handle is closed + select { + case <-f.closed: + default: + if err != nil { + // Path has become invalid. We will leak a goroutine. + // This case should not happen in linux. + f.closedOnce.Do(func() { + f.err = err + close(f.closed) + }) + <-f.closed + break + } + f, err := os.OpenFile(fn, reverseMode|syscall.O_NONBLOCK, 0) + if err == nil { + f.Close() + } + runtime.Gosched() + } + } + } + } +} diff --git a/vendor/github.com/containerd/fifo/handle_linux.go b/vendor/github.com/containerd/fifo/handle_linux.go new file mode 100644 index 0000000000..6ac89b6a4d --- /dev/null +++ b/vendor/github.com/containerd/fifo/handle_linux.go @@ -0,0 +1,97 @@ +// +build linux + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package fifo + +import ( + "fmt" + "os" + "sync" + "syscall" + + "github.com/pkg/errors" +) + +const O_PATH = 010000000 + +type handle struct { + f *os.File + fd uintptr + dev uint64 + ino uint64 + closeOnce sync.Once + name string +} + +func getHandle(fn string) (*handle, error) { + f, err := os.OpenFile(fn, O_PATH, 0) + if err != nil { + return nil, errors.Wrapf(err, "failed to open %v with O_PATH", fn) + } + + var ( + stat syscall.Stat_t + fd = f.Fd() + ) + if err := syscall.Fstat(int(fd), &stat); err != nil { + f.Close() + return nil, errors.Wrapf(err, "failed to stat handle %v", fd) + } + + h := &handle{ + f: f, + name: fn, + dev: uint64(stat.Dev), + ino: stat.Ino, + fd: fd, + } + + // check /proc just in case + if _, err := os.Stat(h.procPath()); err != nil { + f.Close() + return nil, errors.Wrapf(err, "couldn't stat %v", h.procPath()) + } + + return h, nil +} + +func (h *handle) procPath() string { + return fmt.Sprintf("/proc/self/fd/%d", h.fd) +} + +func (h *handle) Name() string { + return h.name +} + +func (h *handle) Path() (string, error) { + var stat syscall.Stat_t + if err := syscall.Stat(h.procPath(), &stat); err != nil { + return "", errors.Wrapf(err, "path %v could not be statted", h.procPath()) + } + if uint64(stat.Dev) != h.dev || stat.Ino != h.ino { + return "", errors.Errorf("failed to verify handle %v/%v %v/%v", stat.Dev, h.dev, stat.Ino, h.ino) + } + return h.procPath(), nil +} + +func (h *handle) Close() error { + h.closeOnce.Do(func() { + h.f.Close() + }) + return nil +} diff --git a/vendor/github.com/containerd/fifo/handle_nolinux.go b/vendor/github.com/containerd/fifo/handle_nolinux.go new file mode 100644 index 0000000000..4f2a282b2b --- /dev/null +++ b/vendor/github.com/containerd/fifo/handle_nolinux.go @@ -0,0 +1,65 @@ +// +build !linux + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package fifo + +import ( + "syscall" + + "github.com/pkg/errors" +) + +type handle struct { + fn string + dev uint64 + ino uint64 +} + +func getHandle(fn string) (*handle, error) { + var stat syscall.Stat_t + if err := syscall.Stat(fn, &stat); err != nil { + return nil, errors.Wrapf(err, "failed to stat %v", fn) + } + + h := &handle{ + fn: fn, + dev: uint64(stat.Dev), + ino: uint64(stat.Ino), + } + + return h, nil +} + +func (h *handle) Path() (string, error) { + var stat syscall.Stat_t + if err := syscall.Stat(h.fn, &stat); err != nil { + return "", errors.Wrapf(err, "path %v could not be statted", h.fn) + } + if uint64(stat.Dev) != h.dev || uint64(stat.Ino) != h.ino { + return "", errors.Errorf("failed to verify handle %v/%v %v/%v for %v", stat.Dev, h.dev, stat.Ino, h.ino, h.fn) + } + return h.fn, nil +} + +func (h *handle) Name() string { + return h.fn +} + +func (h *handle) Close() error { + return nil +} diff --git a/vendor/github.com/containerd/fifo/mkfifo_nosolaris.go b/vendor/github.com/containerd/fifo/mkfifo_nosolaris.go new file mode 100644 index 0000000000..2799a06d10 --- /dev/null +++ b/vendor/github.com/containerd/fifo/mkfifo_nosolaris.go @@ -0,0 +1,25 @@ +// +build !solaris + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package fifo + +import "syscall" + +func mkfifo(path string, mode uint32) (err error) { + return syscall.Mkfifo(path, mode) +} diff --git a/vendor/github.com/containerd/fifo/mkfifo_solaris.go b/vendor/github.com/containerd/fifo/mkfifo_solaris.go new file mode 100644 index 0000000000..1ecd722ae2 --- /dev/null +++ b/vendor/github.com/containerd/fifo/mkfifo_solaris.go @@ -0,0 +1,27 @@ +// +build solaris + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package fifo + +import ( + "golang.org/x/sys/unix" +) + +func mkfifo(path string, mode uint32) (err error) { + return unix.Mkfifo(path, mode) +} diff --git a/vendor/github.com/containerd/go-runc/LICENSE b/vendor/github.com/containerd/go-runc/LICENSE new file mode 100644 index 0000000000..261eeb9e9f --- /dev/null +++ b/vendor/github.com/containerd/go-runc/LICENSE @@ -0,0 +1,201 @@ + Apache License + Version 2.0, January 2004 + http://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + APPENDIX: How to apply the Apache License to your work. + + To apply the Apache License to your work, attach the following + boilerplate notice, with the fields enclosed by brackets "[]" + replaced with your own identifying information. (Don't include + the brackets!) The text should be enclosed in the appropriate + comment syntax for the file format. We also recommend that a + file or class name and description of purpose be included on the + same "printed page" as the copyright notice for easier + identification within third-party archives. + + Copyright [yyyy] [name of copyright owner] + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. diff --git a/vendor/github.com/containerd/go-runc/command_linux.go b/vendor/github.com/containerd/go-runc/command_linux.go new file mode 100644 index 0000000000..71b52f9de4 --- /dev/null +++ b/vendor/github.com/containerd/go-runc/command_linux.go @@ -0,0 +1,41 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package runc + +import ( + "context" + "os" + "os/exec" + "syscall" +) + +func (r *Runc) command(context context.Context, args ...string) *exec.Cmd { + command := r.Command + if command == "" { + command = DefaultCommand + } + cmd := exec.CommandContext(context, command, append(r.args(), args...)...) + cmd.SysProcAttr = &syscall.SysProcAttr{ + Setpgid: r.Setpgid, + } + cmd.Env = os.Environ() + if r.PdeathSignal != 0 { + cmd.SysProcAttr.Pdeathsig = r.PdeathSignal + } + + return cmd +} diff --git a/vendor/github.com/containerd/go-runc/command_other.go b/vendor/github.com/containerd/go-runc/command_other.go new file mode 100644 index 0000000000..b8fd4b8660 --- /dev/null +++ b/vendor/github.com/containerd/go-runc/command_other.go @@ -0,0 +1,35 @@ +// +build !linux + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package runc + +import ( + "context" + "os" + "os/exec" +) + +func (r *Runc) command(context context.Context, args ...string) *exec.Cmd { + command := r.Command + if command == "" { + command = DefaultCommand + } + cmd := exec.CommandContext(context, command, append(r.args(), args...)...) + cmd.Env = os.Environ() + return cmd +} diff --git a/vendor/github.com/containerd/go-runc/console.go b/vendor/github.com/containerd/go-runc/console.go new file mode 100644 index 0000000000..ff223e4276 --- /dev/null +++ b/vendor/github.com/containerd/go-runc/console.go @@ -0,0 +1,165 @@ +// +build !windows + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package runc + +import ( + "fmt" + "io/ioutil" + "net" + "os" + "path/filepath" + + "github.com/containerd/console" + "golang.org/x/sys/unix" +) + +// NewConsoleSocket creates a new unix socket at the provided path to accept a +// pty master created by runc for use by the container +func NewConsoleSocket(path string) (*Socket, error) { + abs, err := filepath.Abs(path) + if err != nil { + return nil, err + } + addr, err := net.ResolveUnixAddr("unix", abs) + if err != nil { + return nil, err + } + l, err := net.ListenUnix("unix", addr) + if err != nil { + return nil, err + } + return &Socket{ + l: l, + }, nil +} + +// NewTempConsoleSocket returns a temp console socket for use with a container +// On Close(), the socket is deleted +func NewTempConsoleSocket() (*Socket, error) { + runtimeDir := os.Getenv("XDG_RUNTIME_DIR") + dir, err := ioutil.TempDir(runtimeDir, "pty") + if err != nil { + return nil, err + } + abs, err := filepath.Abs(filepath.Join(dir, "pty.sock")) + if err != nil { + return nil, err + } + addr, err := net.ResolveUnixAddr("unix", abs) + if err != nil { + return nil, err + } + l, err := net.ListenUnix("unix", addr) + if err != nil { + return nil, err + } + if runtimeDir != "" { + if err := os.Chmod(abs, 0755|os.ModeSticky); err != nil { + return nil, err + } + } + return &Socket{ + l: l, + rmdir: true, + }, nil +} + +// Socket is a unix socket that accepts the pty master created by runc +type Socket struct { + rmdir bool + l *net.UnixListener +} + +// Path returns the path to the unix socket on disk +func (c *Socket) Path() string { + return c.l.Addr().String() +} + +// recvFd waits for a file descriptor to be sent over the given AF_UNIX +// socket. The file name of the remote file descriptor will be recreated +// locally (it is sent as non-auxiliary data in the same payload). +func recvFd(socket *net.UnixConn) (*os.File, error) { + const MaxNameLen = 4096 + var oobSpace = unix.CmsgSpace(4) + + name := make([]byte, MaxNameLen) + oob := make([]byte, oobSpace) + + n, oobn, _, _, err := socket.ReadMsgUnix(name, oob) + if err != nil { + return nil, err + } + + if n >= MaxNameLen || oobn != oobSpace { + return nil, fmt.Errorf("recvfd: incorrect number of bytes read (n=%d oobn=%d)", n, oobn) + } + + // Truncate. + name = name[:n] + oob = oob[:oobn] + + scms, err := unix.ParseSocketControlMessage(oob) + if err != nil { + return nil, err + } + if len(scms) != 1 { + return nil, fmt.Errorf("recvfd: number of SCMs is not 1: %d", len(scms)) + } + scm := scms[0] + + fds, err := unix.ParseUnixRights(&scm) + if err != nil { + return nil, err + } + if len(fds) != 1 { + return nil, fmt.Errorf("recvfd: number of fds is not 1: %d", len(fds)) + } + fd := uintptr(fds[0]) + + return os.NewFile(fd, string(name)), nil +} + +// ReceiveMaster blocks until the socket receives the pty master +func (c *Socket) ReceiveMaster() (console.Console, error) { + conn, err := c.l.Accept() + if err != nil { + return nil, err + } + defer conn.Close() + uc, ok := conn.(*net.UnixConn) + if !ok { + return nil, fmt.Errorf("received connection which was not a unix socket") + } + f, err := recvFd(uc) + if err != nil { + return nil, err + } + return console.ConsoleFromFile(f) +} + +// Close closes the unix socket +func (c *Socket) Close() error { + err := c.l.Close() + if c.rmdir { + if rerr := os.RemoveAll(filepath.Dir(c.Path())); err == nil { + err = rerr + } + } + return err +} diff --git a/vendor/github.com/containerd/go-runc/container.go b/vendor/github.com/containerd/go-runc/container.go new file mode 100644 index 0000000000..107381a551 --- /dev/null +++ b/vendor/github.com/containerd/go-runc/container.go @@ -0,0 +1,30 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package runc + +import "time" + +// Container hold information for a runc container +type Container struct { + ID string `json:"id"` + Pid int `json:"pid"` + Status string `json:"status"` + Bundle string `json:"bundle"` + Rootfs string `json:"rootfs"` + Created time.Time `json:"created"` + Annotations map[string]string `json:"annotations"` +} diff --git a/vendor/github.com/containerd/go-runc/events.go b/vendor/github.com/containerd/go-runc/events.go new file mode 100644 index 0000000000..d610aeb34e --- /dev/null +++ b/vendor/github.com/containerd/go-runc/events.go @@ -0,0 +1,100 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package runc + +type Event struct { + // Type are the event type generated by runc + // If the type is "error" then check the Err field on the event for + // the actual error + Type string `json:"type"` + ID string `json:"id"` + Stats *Stats `json:"data,omitempty"` + // Err has a read error if we were unable to decode the event from runc + Err error `json:"-"` +} + +type Stats struct { + Cpu Cpu `json:"cpu"` + Memory Memory `json:"memory"` + Pids Pids `json:"pids"` + Blkio Blkio `json:"blkio"` + Hugetlb map[string]Hugetlb `json:"hugetlb"` +} + +type Hugetlb struct { + Usage uint64 `json:"usage,omitempty"` + Max uint64 `json:"max,omitempty"` + Failcnt uint64 `json:"failcnt"` +} + +type BlkioEntry struct { + Major uint64 `json:"major,omitempty"` + Minor uint64 `json:"minor,omitempty"` + Op string `json:"op,omitempty"` + Value uint64 `json:"value,omitempty"` +} + +type Blkio struct { + IoServiceBytesRecursive []BlkioEntry `json:"ioServiceBytesRecursive,omitempty"` + IoServicedRecursive []BlkioEntry `json:"ioServicedRecursive,omitempty"` + IoQueuedRecursive []BlkioEntry `json:"ioQueueRecursive,omitempty"` + IoServiceTimeRecursive []BlkioEntry `json:"ioServiceTimeRecursive,omitempty"` + IoWaitTimeRecursive []BlkioEntry `json:"ioWaitTimeRecursive,omitempty"` + IoMergedRecursive []BlkioEntry `json:"ioMergedRecursive,omitempty"` + IoTimeRecursive []BlkioEntry `json:"ioTimeRecursive,omitempty"` + SectorsRecursive []BlkioEntry `json:"sectorsRecursive,omitempty"` +} + +type Pids struct { + Current uint64 `json:"current,omitempty"` + Limit uint64 `json:"limit,omitempty"` +} + +type Throttling struct { + Periods uint64 `json:"periods,omitempty"` + ThrottledPeriods uint64 `json:"throttledPeriods,omitempty"` + ThrottledTime uint64 `json:"throttledTime,omitempty"` +} + +type CpuUsage struct { + // Units: nanoseconds. + Total uint64 `json:"total,omitempty"` + Percpu []uint64 `json:"percpu,omitempty"` + Kernel uint64 `json:"kernel"` + User uint64 `json:"user"` +} + +type Cpu struct { + Usage CpuUsage `json:"usage,omitempty"` + Throttling Throttling `json:"throttling,omitempty"` +} + +type MemoryEntry struct { + Limit uint64 `json:"limit"` + Usage uint64 `json:"usage,omitempty"` + Max uint64 `json:"max,omitempty"` + Failcnt uint64 `json:"failcnt"` +} + +type Memory struct { + Cache uint64 `json:"cache,omitempty"` + Usage MemoryEntry `json:"usage,omitempty"` + Swap MemoryEntry `json:"swap,omitempty"` + Kernel MemoryEntry `json:"kernel,omitempty"` + KernelTCP MemoryEntry `json:"kernelTCP,omitempty"` + Raw map[string]uint64 `json:"raw,omitempty"` +} diff --git a/vendor/github.com/containerd/go-runc/io.go b/vendor/github.com/containerd/go-runc/io.go new file mode 100644 index 0000000000..6cf0410c9d --- /dev/null +++ b/vendor/github.com/containerd/go-runc/io.go @@ -0,0 +1,218 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package runc + +import ( + "io" + "os" + "os/exec" +) + +type IO interface { + io.Closer + Stdin() io.WriteCloser + Stdout() io.ReadCloser + Stderr() io.ReadCloser + Set(*exec.Cmd) +} + +type StartCloser interface { + CloseAfterStart() error +} + +// IOOpt sets I/O creation options +type IOOpt func(*IOOption) + +// IOOption holds I/O creation options +type IOOption struct { + OpenStdin bool + OpenStdout bool + OpenStderr bool +} + +func defaultIOOption() *IOOption { + return &IOOption{ + OpenStdin: true, + OpenStdout: true, + OpenStderr: true, + } +} + +func newPipe() (*pipe, error) { + r, w, err := os.Pipe() + if err != nil { + return nil, err + } + return &pipe{ + r: r, + w: w, + }, nil +} + +type pipe struct { + r *os.File + w *os.File +} + +func (p *pipe) Close() error { + err := p.w.Close() + if rerr := p.r.Close(); err == nil { + err = rerr + } + return err +} + +type pipeIO struct { + in *pipe + out *pipe + err *pipe +} + +func (i *pipeIO) Stdin() io.WriteCloser { + if i.in == nil { + return nil + } + return i.in.w +} + +func (i *pipeIO) Stdout() io.ReadCloser { + if i.out == nil { + return nil + } + return i.out.r +} + +func (i *pipeIO) Stderr() io.ReadCloser { + if i.err == nil { + return nil + } + return i.err.r +} + +func (i *pipeIO) Close() error { + var err error + for _, v := range []*pipe{ + i.in, + i.out, + i.err, + } { + if v != nil { + if cerr := v.Close(); err == nil { + err = cerr + } + } + } + return err +} + +func (i *pipeIO) CloseAfterStart() error { + for _, f := range []*pipe{ + i.out, + i.err, + } { + if f != nil { + f.w.Close() + } + } + return nil +} + +// Set sets the io to the exec.Cmd +func (i *pipeIO) Set(cmd *exec.Cmd) { + if i.in != nil { + cmd.Stdin = i.in.r + } + if i.out != nil { + cmd.Stdout = i.out.w + } + if i.err != nil { + cmd.Stderr = i.err.w + } +} + +func NewSTDIO() (IO, error) { + return &stdio{}, nil +} + +type stdio struct { +} + +func (s *stdio) Close() error { + return nil +} + +func (s *stdio) Set(cmd *exec.Cmd) { + cmd.Stdin = os.Stdin + cmd.Stdout = os.Stdout + cmd.Stderr = os.Stderr +} + +func (s *stdio) Stdin() io.WriteCloser { + return os.Stdin +} + +func (s *stdio) Stdout() io.ReadCloser { + return os.Stdout +} + +func (s *stdio) Stderr() io.ReadCloser { + return os.Stderr +} + +// NewNullIO returns IO setup for /dev/null use with runc +func NewNullIO() (IO, error) { + f, err := os.Open(os.DevNull) + if err != nil { + return nil, err + } + return &nullIO{ + devNull: f, + }, nil +} + +type nullIO struct { + devNull *os.File +} + +func (n *nullIO) Close() error { + // this should be closed after start but if not + // make sure we close the file but don't return the error + n.devNull.Close() + return nil +} + +func (n *nullIO) Stdin() io.WriteCloser { + return nil +} + +func (n *nullIO) Stdout() io.ReadCloser { + return nil +} + +func (n *nullIO) Stderr() io.ReadCloser { + return nil +} + +func (n *nullIO) Set(c *exec.Cmd) { + // don't set STDIN here + c.Stdout = n.devNull + c.Stderr = n.devNull +} + +func (n *nullIO) CloseAfterStart() error { + return n.devNull.Close() +} diff --git a/vendor/github.com/containerd/go-runc/io_unix.go b/vendor/github.com/containerd/go-runc/io_unix.go new file mode 100644 index 0000000000..567cd072e5 --- /dev/null +++ b/vendor/github.com/containerd/go-runc/io_unix.go @@ -0,0 +1,76 @@ +// +build !windows + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package runc + +import ( + "github.com/pkg/errors" + "golang.org/x/sys/unix" +) + +// NewPipeIO creates pipe pairs to be used with runc +func NewPipeIO(uid, gid int, opts ...IOOpt) (i IO, err error) { + option := defaultIOOption() + for _, o := range opts { + o(option) + } + var ( + pipes []*pipe + stdin, stdout, stderr *pipe + ) + // cleanup in case of an error + defer func() { + if err != nil { + for _, p := range pipes { + p.Close() + } + } + }() + if option.OpenStdin { + if stdin, err = newPipe(); err != nil { + return nil, err + } + pipes = append(pipes, stdin) + if err = unix.Fchown(int(stdin.r.Fd()), uid, gid); err != nil { + return nil, errors.Wrap(err, "failed to chown stdin") + } + } + if option.OpenStdout { + if stdout, err = newPipe(); err != nil { + return nil, err + } + pipes = append(pipes, stdout) + if err = unix.Fchown(int(stdout.w.Fd()), uid, gid); err != nil { + return nil, errors.Wrap(err, "failed to chown stdout") + } + } + if option.OpenStderr { + if stderr, err = newPipe(); err != nil { + return nil, err + } + pipes = append(pipes, stderr) + if err = unix.Fchown(int(stderr.w.Fd()), uid, gid); err != nil { + return nil, errors.Wrap(err, "failed to chown stderr") + } + } + return &pipeIO{ + in: stdin, + out: stdout, + err: stderr, + }, nil +} diff --git a/vendor/github.com/containerd/go-runc/io_windows.go b/vendor/github.com/containerd/go-runc/io_windows.go new file mode 100644 index 0000000000..fc56ac4f30 --- /dev/null +++ b/vendor/github.com/containerd/go-runc/io_windows.go @@ -0,0 +1,62 @@ +// +build windows + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package runc + +// NewPipeIO creates pipe pairs to be used with runc +func NewPipeIO(opts ...IOOpt) (i IO, err error) { + option := defaultIOOption() + for _, o := range opts { + o(option) + } + var ( + pipes []*pipe + stdin, stdout, stderr *pipe + ) + // cleanup in case of an error + defer func() { + if err != nil { + for _, p := range pipes { + p.Close() + } + } + }() + if option.OpenStdin { + if stdin, err = newPipe(); err != nil { + return nil, err + } + pipes = append(pipes, stdin) + } + if option.OpenStdout { + if stdout, err = newPipe(); err != nil { + return nil, err + } + pipes = append(pipes, stdout) + } + if option.OpenStderr { + if stderr, err = newPipe(); err != nil { + return nil, err + } + pipes = append(pipes, stderr) + } + return &pipeIO{ + in: stdin, + out: stdout, + err: stderr, + }, nil +} diff --git a/vendor/github.com/containerd/go-runc/monitor.go b/vendor/github.com/containerd/go-runc/monitor.go new file mode 100644 index 0000000000..ff06a3fca9 --- /dev/null +++ b/vendor/github.com/containerd/go-runc/monitor.go @@ -0,0 +1,76 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package runc + +import ( + "os/exec" + "syscall" + "time" +) + +var Monitor ProcessMonitor = &defaultMonitor{} + +type Exit struct { + Timestamp time.Time + Pid int + Status int +} + +// ProcessMonitor is an interface for process monitoring +// +// It allows daemons using go-runc to have a SIGCHLD handler +// to handle exits without introducing races between the handler +// and go's exec.Cmd +// These methods should match the methods exposed by exec.Cmd to provide +// a consistent experience for the caller +type ProcessMonitor interface { + Start(*exec.Cmd) (chan Exit, error) + Wait(*exec.Cmd, chan Exit) (int, error) +} + +type defaultMonitor struct { +} + +func (m *defaultMonitor) Start(c *exec.Cmd) (chan Exit, error) { + if err := c.Start(); err != nil { + return nil, err + } + ec := make(chan Exit, 1) + go func() { + var status int + if err := c.Wait(); err != nil { + status = 255 + if exitErr, ok := err.(*exec.ExitError); ok { + if ws, ok := exitErr.Sys().(syscall.WaitStatus); ok { + status = ws.ExitStatus() + } + } + } + ec <- Exit{ + Timestamp: time.Now(), + Pid: c.Process.Pid, + Status: status, + } + close(ec) + }() + return ec, nil +} + +func (m *defaultMonitor) Wait(c *exec.Cmd, ec chan Exit) (int, error) { + e := <-ec + return e.Status, nil +} diff --git a/vendor/github.com/containerd/go-runc/runc.go b/vendor/github.com/containerd/go-runc/runc.go new file mode 100644 index 0000000000..96262afab3 --- /dev/null +++ b/vendor/github.com/containerd/go-runc/runc.go @@ -0,0 +1,707 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package runc + +import ( + "context" + "encoding/json" + "errors" + "fmt" + "io" + "io/ioutil" + "os" + "os/exec" + "path/filepath" + "strconv" + "strings" + "syscall" + "time" + + specs "github.com/opencontainers/runtime-spec/specs-go" +) + +// Format is the type of log formatting options avaliable +type Format string + +// TopBody represents the structured data of the full ps output +type TopResults struct { + // Processes running in the container, where each is process is an array of values corresponding to the headers + Processes [][]string `json:"Processes"` + + // Headers are the names of the columns + Headers []string `json:"Headers"` +} + +const ( + none Format = "" + JSON Format = "json" + Text Format = "text" + // DefaultCommand is the default command for Runc + DefaultCommand = "runc" +) + +// Runc is the client to the runc cli +type Runc struct { + //If command is empty, DefaultCommand is used + Command string + Root string + Debug bool + Log string + LogFormat Format + PdeathSignal syscall.Signal + Setpgid bool + Criu string + SystemdCgroup bool + Rootless *bool // nil stands for "auto" +} + +// List returns all containers created inside the provided runc root directory +func (r *Runc) List(context context.Context) ([]*Container, error) { + data, err := cmdOutput(r.command(context, "list", "--format=json"), false) + if err != nil { + return nil, err + } + var out []*Container + if err := json.Unmarshal(data, &out); err != nil { + return nil, err + } + return out, nil +} + +// State returns the state for the container provided by id +func (r *Runc) State(context context.Context, id string) (*Container, error) { + data, err := cmdOutput(r.command(context, "state", id), true) + if err != nil { + return nil, fmt.Errorf("%s: %s", err, data) + } + var c Container + if err := json.Unmarshal(data, &c); err != nil { + return nil, err + } + return &c, nil +} + +type ConsoleSocket interface { + Path() string +} + +type CreateOpts struct { + IO + // PidFile is a path to where a pid file should be created + PidFile string + ConsoleSocket ConsoleSocket + Detach bool + NoPivot bool + NoNewKeyring bool + ExtraFiles []*os.File +} + +func (o *CreateOpts) args() (out []string, err error) { + if o.PidFile != "" { + abs, err := filepath.Abs(o.PidFile) + if err != nil { + return nil, err + } + out = append(out, "--pid-file", abs) + } + if o.ConsoleSocket != nil { + out = append(out, "--console-socket", o.ConsoleSocket.Path()) + } + if o.NoPivot { + out = append(out, "--no-pivot") + } + if o.NoNewKeyring { + out = append(out, "--no-new-keyring") + } + if o.Detach { + out = append(out, "--detach") + } + if o.ExtraFiles != nil { + out = append(out, "--preserve-fds", strconv.Itoa(len(o.ExtraFiles))) + } + return out, nil +} + +// Create creates a new container and returns its pid if it was created successfully +func (r *Runc) Create(context context.Context, id, bundle string, opts *CreateOpts) error { + args := []string{"create", "--bundle", bundle} + if opts != nil { + oargs, err := opts.args() + if err != nil { + return err + } + args = append(args, oargs...) + } + cmd := r.command(context, append(args, id)...) + if opts != nil && opts.IO != nil { + opts.Set(cmd) + } + cmd.ExtraFiles = opts.ExtraFiles + + if cmd.Stdout == nil && cmd.Stderr == nil { + data, err := cmdOutput(cmd, true) + if err != nil { + return fmt.Errorf("%s: %s", err, data) + } + return nil + } + ec, err := Monitor.Start(cmd) + if err != nil { + return err + } + if opts != nil && opts.IO != nil { + if c, ok := opts.IO.(StartCloser); ok { + if err := c.CloseAfterStart(); err != nil { + return err + } + } + } + status, err := Monitor.Wait(cmd, ec) + if err == nil && status != 0 { + err = fmt.Errorf("%s did not terminate sucessfully", cmd.Args[0]) + } + return err +} + +// Start will start an already created container +func (r *Runc) Start(context context.Context, id string) error { + return r.runOrError(r.command(context, "start", id)) +} + +type ExecOpts struct { + IO + PidFile string + ConsoleSocket ConsoleSocket + Detach bool +} + +func (o *ExecOpts) args() (out []string, err error) { + if o.ConsoleSocket != nil { + out = append(out, "--console-socket", o.ConsoleSocket.Path()) + } + if o.Detach { + out = append(out, "--detach") + } + if o.PidFile != "" { + abs, err := filepath.Abs(o.PidFile) + if err != nil { + return nil, err + } + out = append(out, "--pid-file", abs) + } + return out, nil +} + +// Exec executres and additional process inside the container based on a full +// OCI Process specification +func (r *Runc) Exec(context context.Context, id string, spec specs.Process, opts *ExecOpts) error { + f, err := ioutil.TempFile(os.Getenv("XDG_RUNTIME_DIR"), "runc-process") + if err != nil { + return err + } + defer os.Remove(f.Name()) + err = json.NewEncoder(f).Encode(spec) + f.Close() + if err != nil { + return err + } + args := []string{"exec", "--process", f.Name()} + if opts != nil { + oargs, err := opts.args() + if err != nil { + return err + } + args = append(args, oargs...) + } + cmd := r.command(context, append(args, id)...) + if opts != nil && opts.IO != nil { + opts.Set(cmd) + } + if cmd.Stdout == nil && cmd.Stderr == nil { + data, err := cmdOutput(cmd, true) + if err != nil { + return fmt.Errorf("%s: %s", err, data) + } + return nil + } + ec, err := Monitor.Start(cmd) + if err != nil { + return err + } + if opts != nil && opts.IO != nil { + if c, ok := opts.IO.(StartCloser); ok { + if err := c.CloseAfterStart(); err != nil { + return err + } + } + } + status, err := Monitor.Wait(cmd, ec) + if err == nil && status != 0 { + err = fmt.Errorf("%s did not terminate sucessfully", cmd.Args[0]) + } + return err +} + +// Run runs the create, start, delete lifecycle of the container +// and returns its exit status after it has exited +func (r *Runc) Run(context context.Context, id, bundle string, opts *CreateOpts) (int, error) { + args := []string{"run", "--bundle", bundle} + if opts != nil { + oargs, err := opts.args() + if err != nil { + return -1, err + } + args = append(args, oargs...) + } + cmd := r.command(context, append(args, id)...) + if opts != nil && opts.IO != nil { + opts.Set(cmd) + } + ec, err := Monitor.Start(cmd) + if err != nil { + return -1, err + } + return Monitor.Wait(cmd, ec) +} + +type DeleteOpts struct { + Force bool +} + +func (o *DeleteOpts) args() (out []string) { + if o.Force { + out = append(out, "--force") + } + return out +} + +// Delete deletes the container +func (r *Runc) Delete(context context.Context, id string, opts *DeleteOpts) error { + args := []string{"delete"} + if opts != nil { + args = append(args, opts.args()...) + } + return r.runOrError(r.command(context, append(args, id)...)) +} + +// KillOpts specifies options for killing a container and its processes +type KillOpts struct { + All bool +} + +func (o *KillOpts) args() (out []string) { + if o.All { + out = append(out, "--all") + } + return out +} + +// Kill sends the specified signal to the container +func (r *Runc) Kill(context context.Context, id string, sig int, opts *KillOpts) error { + args := []string{ + "kill", + } + if opts != nil { + args = append(args, opts.args()...) + } + return r.runOrError(r.command(context, append(args, id, strconv.Itoa(sig))...)) +} + +// Stats return the stats for a container like cpu, memory, and io +func (r *Runc) Stats(context context.Context, id string) (*Stats, error) { + cmd := r.command(context, "events", "--stats", id) + rd, err := cmd.StdoutPipe() + if err != nil { + return nil, err + } + ec, err := Monitor.Start(cmd) + if err != nil { + return nil, err + } + defer func() { + rd.Close() + Monitor.Wait(cmd, ec) + }() + var e Event + if err := json.NewDecoder(rd).Decode(&e); err != nil { + return nil, err + } + return e.Stats, nil +} + +// Events returns an event stream from runc for a container with stats and OOM notifications +func (r *Runc) Events(context context.Context, id string, interval time.Duration) (chan *Event, error) { + cmd := r.command(context, "events", fmt.Sprintf("--interval=%ds", int(interval.Seconds())), id) + rd, err := cmd.StdoutPipe() + if err != nil { + return nil, err + } + ec, err := Monitor.Start(cmd) + if err != nil { + rd.Close() + return nil, err + } + var ( + dec = json.NewDecoder(rd) + c = make(chan *Event, 128) + ) + go func() { + defer func() { + close(c) + rd.Close() + Monitor.Wait(cmd, ec) + }() + for { + var e Event + if err := dec.Decode(&e); err != nil { + if err == io.EOF { + return + } + e = Event{ + Type: "error", + Err: err, + } + } + c <- &e + } + }() + return c, nil +} + +// Pause the container with the provided id +func (r *Runc) Pause(context context.Context, id string) error { + return r.runOrError(r.command(context, "pause", id)) +} + +// Resume the container with the provided id +func (r *Runc) Resume(context context.Context, id string) error { + return r.runOrError(r.command(context, "resume", id)) +} + +// Ps lists all the processes inside the container returning their pids +func (r *Runc) Ps(context context.Context, id string) ([]int, error) { + data, err := cmdOutput(r.command(context, "ps", "--format", "json", id), true) + if err != nil { + return nil, fmt.Errorf("%s: %s", err, data) + } + var pids []int + if err := json.Unmarshal(data, &pids); err != nil { + return nil, err + } + return pids, nil +} + +// Top lists all the processes inside the container returning the full ps data +func (r *Runc) Top(context context.Context, id string, psOptions string) (*TopResults, error) { + data, err := cmdOutput(r.command(context, "ps", "--format", "table", id, psOptions), true) + if err != nil { + return nil, fmt.Errorf("%s: %s", err, data) + } + + topResults, err := ParsePSOutput(data) + if err != nil { + return nil, fmt.Errorf("%s: ", err) + } + return topResults, nil +} + +type CheckpointOpts struct { + // ImagePath is the path for saving the criu image file + ImagePath string + // WorkDir is the working directory for criu + WorkDir string + // ParentPath is the path for previous image files from a pre-dump + ParentPath string + // AllowOpenTCP allows open tcp connections to be checkpointed + AllowOpenTCP bool + // AllowExternalUnixSockets allows external unix sockets to be checkpointed + AllowExternalUnixSockets bool + // AllowTerminal allows the terminal(pty) to be checkpointed with a container + AllowTerminal bool + // CriuPageServer is the address:port for the criu page server + CriuPageServer string + // FileLocks handle file locks held by the container + FileLocks bool + // Cgroups is the cgroup mode for how to handle the checkpoint of a container's cgroups + Cgroups CgroupMode + // EmptyNamespaces creates a namespace for the container but does not save its properties + // Provide the namespaces you wish to be checkpointed without their settings on restore + EmptyNamespaces []string +} + +type CgroupMode string + +const ( + Soft CgroupMode = "soft" + Full CgroupMode = "full" + Strict CgroupMode = "strict" +) + +func (o *CheckpointOpts) args() (out []string) { + if o.ImagePath != "" { + out = append(out, "--image-path", o.ImagePath) + } + if o.WorkDir != "" { + out = append(out, "--work-path", o.WorkDir) + } + if o.ParentPath != "" { + out = append(out, "--parent-path", o.ParentPath) + } + if o.AllowOpenTCP { + out = append(out, "--tcp-established") + } + if o.AllowExternalUnixSockets { + out = append(out, "--ext-unix-sk") + } + if o.AllowTerminal { + out = append(out, "--shell-job") + } + if o.CriuPageServer != "" { + out = append(out, "--page-server", o.CriuPageServer) + } + if o.FileLocks { + out = append(out, "--file-locks") + } + if string(o.Cgroups) != "" { + out = append(out, "--manage-cgroups-mode", string(o.Cgroups)) + } + for _, ns := range o.EmptyNamespaces { + out = append(out, "--empty-ns", ns) + } + return out +} + +type CheckpointAction func([]string) []string + +// LeaveRunning keeps the container running after the checkpoint has been completed +func LeaveRunning(args []string) []string { + return append(args, "--leave-running") +} + +// PreDump allows a pre-dump of the checkpoint to be made and completed later +func PreDump(args []string) []string { + return append(args, "--pre-dump") +} + +// Checkpoint allows you to checkpoint a container using criu +func (r *Runc) Checkpoint(context context.Context, id string, opts *CheckpointOpts, actions ...CheckpointAction) error { + args := []string{"checkpoint"} + if opts != nil { + args = append(args, opts.args()...) + } + for _, a := range actions { + args = a(args) + } + return r.runOrError(r.command(context, append(args, id)...)) +} + +type RestoreOpts struct { + CheckpointOpts + IO + + Detach bool + PidFile string + NoSubreaper bool + NoPivot bool + ConsoleSocket ConsoleSocket +} + +func (o *RestoreOpts) args() ([]string, error) { + out := o.CheckpointOpts.args() + if o.Detach { + out = append(out, "--detach") + } + if o.PidFile != "" { + abs, err := filepath.Abs(o.PidFile) + if err != nil { + return nil, err + } + out = append(out, "--pid-file", abs) + } + if o.ConsoleSocket != nil { + out = append(out, "--console-socket", o.ConsoleSocket.Path()) + } + if o.NoPivot { + out = append(out, "--no-pivot") + } + if o.NoSubreaper { + out = append(out, "-no-subreaper") + } + return out, nil +} + +// Restore restores a container with the provide id from an existing checkpoint +func (r *Runc) Restore(context context.Context, id, bundle string, opts *RestoreOpts) (int, error) { + args := []string{"restore"} + if opts != nil { + oargs, err := opts.args() + if err != nil { + return -1, err + } + args = append(args, oargs...) + } + args = append(args, "--bundle", bundle) + cmd := r.command(context, append(args, id)...) + if opts != nil && opts.IO != nil { + opts.Set(cmd) + } + ec, err := Monitor.Start(cmd) + if err != nil { + return -1, err + } + if opts != nil && opts.IO != nil { + if c, ok := opts.IO.(StartCloser); ok { + if err := c.CloseAfterStart(); err != nil { + return -1, err + } + } + } + return Monitor.Wait(cmd, ec) +} + +// Update updates the current container with the provided resource spec +func (r *Runc) Update(context context.Context, id string, resources *specs.LinuxResources) error { + buf := getBuf() + defer putBuf(buf) + + if err := json.NewEncoder(buf).Encode(resources); err != nil { + return err + } + args := []string{"update", "--resources", "-", id} + cmd := r.command(context, args...) + cmd.Stdin = buf + return r.runOrError(cmd) +} + +var ErrParseRuncVersion = errors.New("unable to parse runc version") + +type Version struct { + Runc string + Commit string + Spec string +} + +// Version returns the runc and runtime-spec versions +func (r *Runc) Version(context context.Context) (Version, error) { + data, err := cmdOutput(r.command(context, "--version"), false) + if err != nil { + return Version{}, err + } + return parseVersion(data) +} + +func parseVersion(data []byte) (Version, error) { + var v Version + parts := strings.Split(strings.TrimSpace(string(data)), "\n") + if len(parts) != 3 { + return v, nil + } + for i, p := range []struct { + dest *string + split string + }{ + { + dest: &v.Runc, + split: "version ", + }, + { + dest: &v.Commit, + split: ": ", + }, + { + dest: &v.Spec, + split: ": ", + }, + } { + p2 := strings.Split(parts[i], p.split) + if len(p2) != 2 { + return v, fmt.Errorf("unable to parse version line %q", parts[i]) + } + *p.dest = p2[1] + } + return v, nil +} + +func (r *Runc) args() (out []string) { + if r.Root != "" { + out = append(out, "--root", r.Root) + } + if r.Debug { + out = append(out, "--debug") + } + if r.Log != "" { + out = append(out, "--log", r.Log) + } + if r.LogFormat != none { + out = append(out, "--log-format", string(r.LogFormat)) + } + if r.Criu != "" { + out = append(out, "--criu", r.Criu) + } + if r.SystemdCgroup { + out = append(out, "--systemd-cgroup") + } + if r.Rootless != nil { + // nil stands for "auto" (differs from explicit "false") + out = append(out, "--rootless="+strconv.FormatBool(*r.Rootless)) + } + return out +} + +// runOrError will run the provided command. If an error is +// encountered and neither Stdout or Stderr was set the error and the +// stderr of the command will be returned in the format of : +// +func (r *Runc) runOrError(cmd *exec.Cmd) error { + if cmd.Stdout != nil || cmd.Stderr != nil { + ec, err := Monitor.Start(cmd) + if err != nil { + return err + } + status, err := Monitor.Wait(cmd, ec) + if err == nil && status != 0 { + err = fmt.Errorf("%s did not terminate sucessfully", cmd.Args[0]) + } + return err + } + data, err := cmdOutput(cmd, true) + if err != nil { + return fmt.Errorf("%s: %s", err, data) + } + return nil +} + +func cmdOutput(cmd *exec.Cmd, combined bool) ([]byte, error) { + b := getBuf() + defer putBuf(b) + + cmd.Stdout = b + if combined { + cmd.Stderr = b + } + ec, err := Monitor.Start(cmd) + if err != nil { + return nil, err + } + + status, err := Monitor.Wait(cmd, ec) + if err == nil && status != 0 { + err = fmt.Errorf("%s did not terminate sucessfully", cmd.Args[0]) + } + + return b.Bytes(), err +} diff --git a/vendor/github.com/containerd/go-runc/utils.go b/vendor/github.com/containerd/go-runc/utils.go new file mode 100644 index 0000000000..69ad6ead75 --- /dev/null +++ b/vendor/github.com/containerd/go-runc/utils.go @@ -0,0 +1,107 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package runc + +import ( + "bytes" + "io/ioutil" + "strconv" + "strings" + "sync" + "syscall" +) + +// ReadPidFile reads the pid file at the provided path and returns +// the pid or an error if the read and conversion is unsuccessful +func ReadPidFile(path string) (int, error) { + data, err := ioutil.ReadFile(path) + if err != nil { + return -1, err + } + return strconv.Atoi(string(data)) +} + +const exitSignalOffset = 128 + +// exitStatus returns the correct exit status for a process based on if it +// was signaled or exited cleanly +func exitStatus(status syscall.WaitStatus) int { + if status.Signaled() { + return exitSignalOffset + int(status.Signal()) + } + return status.ExitStatus() +} + +var bytesBufferPool = sync.Pool{ + New: func() interface{} { + return bytes.NewBuffer(nil) + }, +} + +func getBuf() *bytes.Buffer { + return bytesBufferPool.Get().(*bytes.Buffer) +} + +func putBuf(b *bytes.Buffer) { + b.Reset() + bytesBufferPool.Put(b) +} + +// fieldsASCII is similar to strings.Fields but only allows ASCII whitespaces +func fieldsASCII(s string) []string { + fn := func(r rune) bool { + switch r { + case '\t', '\n', '\f', '\r', ' ': + return true + } + return false + } + return strings.FieldsFunc(s, fn) +} + +// ParsePSOutput parses the runtime's ps raw output and returns a TopResults +func ParsePSOutput(output []byte) (*TopResults, error) { + topResults := &TopResults{} + + lines := strings.Split(string(output), "\n") + topResults.Headers = fieldsASCII(lines[0]) + + pidIndex := -1 + for i, name := range topResults.Headers { + if name == "PID" { + pidIndex = i + } + } + + for _, line := range lines[1:] { + if len(line) == 0 { + continue + } + + fields := fieldsASCII(line) + + if fields[pidIndex] == "-" { + continue + } + + process := fields[:len(topResults.Headers)-1] + process = append(process, strings.Join(fields[len(topResults.Headers)-1:], " ")) + topResults.Processes = append(topResults.Processes, process) + + } + return topResults, nil +} diff --git a/vendor/github.com/containerd/ttrpc/LICENSE b/vendor/github.com/containerd/ttrpc/LICENSE new file mode 100644 index 0000000000..261eeb9e9f --- /dev/null +++ b/vendor/github.com/containerd/ttrpc/LICENSE @@ -0,0 +1,201 @@ + Apache License + Version 2.0, January 2004 + http://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + APPENDIX: How to apply the Apache License to your work. + + To apply the Apache License to your work, attach the following + boilerplate notice, with the fields enclosed by brackets "[]" + replaced with your own identifying information. (Don't include + the brackets!) The text should be enclosed in the appropriate + comment syntax for the file format. We also recommend that a + file or class name and description of purpose be included on the + same "printed page" as the copyright notice for easier + identification within third-party archives. + + Copyright [yyyy] [name of copyright owner] + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. diff --git a/vendor/github.com/containerd/ttrpc/channel.go b/vendor/github.com/containerd/ttrpc/channel.go new file mode 100644 index 0000000000..22f5496b4b --- /dev/null +++ b/vendor/github.com/containerd/ttrpc/channel.go @@ -0,0 +1,154 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package ttrpc + +import ( + "bufio" + "context" + "encoding/binary" + "io" + "net" + "sync" + + "github.com/pkg/errors" + "google.golang.org/grpc/codes" + "google.golang.org/grpc/status" +) + +const ( + messageHeaderLength = 10 + messageLengthMax = 4 << 20 +) + +type messageType uint8 + +const ( + messageTypeRequest messageType = 0x1 + messageTypeResponse messageType = 0x2 +) + +// messageHeader represents the fixed-length message header of 10 bytes sent +// with every request. +type messageHeader struct { + Length uint32 // length excluding this header. b[:4] + StreamID uint32 // identifies which request stream message is a part of. b[4:8] + Type messageType // message type b[8] + Flags uint8 // reserved b[9] +} + +func readMessageHeader(p []byte, r io.Reader) (messageHeader, error) { + _, err := io.ReadFull(r, p[:messageHeaderLength]) + if err != nil { + return messageHeader{}, err + } + + return messageHeader{ + Length: binary.BigEndian.Uint32(p[:4]), + StreamID: binary.BigEndian.Uint32(p[4:8]), + Type: messageType(p[8]), + Flags: p[9], + }, nil +} + +func writeMessageHeader(w io.Writer, p []byte, mh messageHeader) error { + binary.BigEndian.PutUint32(p[:4], mh.Length) + binary.BigEndian.PutUint32(p[4:8], mh.StreamID) + p[8] = byte(mh.Type) + p[9] = mh.Flags + + _, err := w.Write(p[:]) + return err +} + +var buffers sync.Pool + +type channel struct { + conn net.Conn + bw *bufio.Writer + br *bufio.Reader + hrbuf [messageHeaderLength]byte // avoid alloc when reading header + hwbuf [messageHeaderLength]byte +} + +func newChannel(conn net.Conn) *channel { + return &channel{ + conn: conn, + bw: bufio.NewWriter(conn), + br: bufio.NewReader(conn), + } +} + +// recv a message from the channel. The returned buffer contains the message. +// +// If a valid grpc status is returned, the message header +// returned will be valid and caller should send that along to +// the correct consumer. The bytes on the underlying channel +// will be discarded. +func (ch *channel) recv(ctx context.Context) (messageHeader, []byte, error) { + mh, err := readMessageHeader(ch.hrbuf[:], ch.br) + if err != nil { + return messageHeader{}, nil, err + } + + if mh.Length > uint32(messageLengthMax) { + if _, err := ch.br.Discard(int(mh.Length)); err != nil { + return mh, nil, errors.Wrapf(err, "failed to discard after receiving oversized message") + } + + return mh, nil, status.Errorf(codes.ResourceExhausted, "message length %v exceed maximum message size of %v", mh.Length, messageLengthMax) + } + + p := ch.getmbuf(int(mh.Length)) + if _, err := io.ReadFull(ch.br, p); err != nil { + return messageHeader{}, nil, errors.Wrapf(err, "failed reading message") + } + + return mh, p, nil +} + +func (ch *channel) send(ctx context.Context, streamID uint32, t messageType, p []byte) error { + if err := writeMessageHeader(ch.bw, ch.hwbuf[:], messageHeader{Length: uint32(len(p)), StreamID: streamID, Type: t}); err != nil { + return err + } + + _, err := ch.bw.Write(p) + if err != nil { + return err + } + + return ch.bw.Flush() +} + +func (ch *channel) getmbuf(size int) []byte { + // we can't use the standard New method on pool because we want to allocate + // based on size. + b, ok := buffers.Get().(*[]byte) + if !ok || cap(*b) < size { + // TODO(stevvooe): It may be better to allocate these in fixed length + // buckets to reduce fragmentation but its not clear that would help + // with performance. An ilogb approach or similar would work well. + bb := make([]byte, size) + b = &bb + } else { + *b = (*b)[:size] + } + return *b +} + +func (ch *channel) putmbuf(p []byte) { + buffers.Put(&p) +} diff --git a/vendor/github.com/containerd/ttrpc/client.go b/vendor/github.com/containerd/ttrpc/client.go new file mode 100644 index 0000000000..e40592dd74 --- /dev/null +++ b/vendor/github.com/containerd/ttrpc/client.go @@ -0,0 +1,284 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package ttrpc + +import ( + "context" + "io" + "net" + "os" + "strings" + "sync" + "syscall" + + "github.com/gogo/protobuf/proto" + "github.com/pkg/errors" + "github.com/sirupsen/logrus" + "google.golang.org/grpc/status" +) + +// ErrClosed is returned by client methods when the underlying connection is +// closed. +var ErrClosed = errors.New("ttrpc: closed") + +type Client struct { + codec codec + conn net.Conn + channel *channel + calls chan *callRequest + + closed chan struct{} + closeOnce sync.Once + closeFunc func() + done chan struct{} + err error +} + +func NewClient(conn net.Conn) *Client { + c := &Client{ + codec: codec{}, + conn: conn, + channel: newChannel(conn), + calls: make(chan *callRequest), + closed: make(chan struct{}), + done: make(chan struct{}), + closeFunc: func() {}, + } + + go c.run() + return c +} + +type callRequest struct { + ctx context.Context + req *Request + resp *Response // response will be written back here + errs chan error // error written here on completion +} + +func (c *Client) Call(ctx context.Context, service, method string, req, resp interface{}) error { + payload, err := c.codec.Marshal(req) + if err != nil { + return err + } + + var ( + creq = &Request{ + Service: service, + Method: method, + Payload: payload, + } + + cresp = &Response{} + ) + + if err := c.dispatch(ctx, creq, cresp); err != nil { + return err + } + + if err := c.codec.Unmarshal(cresp.Payload, resp); err != nil { + return err + } + + if cresp.Status == nil { + return errors.New("no status provided on response") + } + + return status.ErrorProto(cresp.Status) +} + +func (c *Client) dispatch(ctx context.Context, req *Request, resp *Response) error { + errs := make(chan error, 1) + call := &callRequest{ + req: req, + resp: resp, + errs: errs, + } + + select { + case <-ctx.Done(): + return ctx.Err() + case c.calls <- call: + case <-c.done: + return c.err + } + + select { + case <-ctx.Done(): + return ctx.Err() + case err := <-errs: + return filterCloseErr(err) + case <-c.done: + return c.err + } +} + +func (c *Client) Close() error { + c.closeOnce.Do(func() { + close(c.closed) + }) + + return nil +} + +// OnClose allows a close func to be called when the server is closed +func (c *Client) OnClose(closer func()) { + c.closeFunc = closer +} + +type message struct { + messageHeader + p []byte + err error +} + +func (c *Client) run() { + var ( + streamID uint32 = 1 + waiters = make(map[uint32]*callRequest) + calls = c.calls + incoming = make(chan *message) + shutdown = make(chan struct{}) + shutdownErr error + ) + + go func() { + defer close(shutdown) + + // start one more goroutine to recv messages without blocking. + for { + mh, p, err := c.channel.recv(context.TODO()) + if err != nil { + _, ok := status.FromError(err) + if !ok { + // treat all errors that are not an rpc status as terminal. + // all others poison the connection. + shutdownErr = err + return + } + } + select { + case incoming <- &message{ + messageHeader: mh, + p: p[:mh.Length], + err: err, + }: + case <-c.done: + return + } + } + }() + + defer c.conn.Close() + defer close(c.done) + defer c.closeFunc() + + for { + select { + case call := <-calls: + if err := c.send(call.ctx, streamID, messageTypeRequest, call.req); err != nil { + call.errs <- err + continue + } + + waiters[streamID] = call + streamID += 2 // enforce odd client initiated request ids + case msg := <-incoming: + call, ok := waiters[msg.StreamID] + if !ok { + logrus.Errorf("ttrpc: received message for unknown channel %v", msg.StreamID) + continue + } + + call.errs <- c.recv(call.resp, msg) + delete(waiters, msg.StreamID) + case <-shutdown: + if shutdownErr != nil { + shutdownErr = filterCloseErr(shutdownErr) + } else { + shutdownErr = ErrClosed + } + + shutdownErr = errors.Wrapf(shutdownErr, "ttrpc: client shutting down") + + c.err = shutdownErr + for _, waiter := range waiters { + waiter.errs <- shutdownErr + } + c.Close() + return + case <-c.closed: + if c.err == nil { + c.err = ErrClosed + } + // broadcast the shutdown error to the remaining waiters. + for _, waiter := range waiters { + waiter.errs <- c.err + } + return + } + } +} + +func (c *Client) send(ctx context.Context, streamID uint32, mtype messageType, msg interface{}) error { + p, err := c.codec.Marshal(msg) + if err != nil { + return err + } + + return c.channel.send(ctx, streamID, mtype, p) +} + +func (c *Client) recv(resp *Response, msg *message) error { + if msg.err != nil { + return msg.err + } + + if msg.Type != messageTypeResponse { + return errors.New("unkown message type received") + } + + defer c.channel.putmbuf(msg.p) + return proto.Unmarshal(msg.p, resp) +} + +// filterCloseErr rewrites EOF and EPIPE errors to ErrClosed. Use when +// returning from call or handling errors from main read loop. +// +// This purposely ignores errors with a wrapped cause. +func filterCloseErr(err error) error { + if err == nil { + return nil + } + + if err == io.EOF { + return ErrClosed + } + + if strings.Contains(err.Error(), "use of closed network connection") { + return ErrClosed + } + + // if we have an epipe on a write, we cast to errclosed + if oerr, ok := err.(*net.OpError); ok && oerr.Op == "write" { + if serr, ok := oerr.Err.(*os.SyscallError); ok && serr.Err == syscall.EPIPE { + return ErrClosed + } + } + + return err +} diff --git a/vendor/github.com/containerd/ttrpc/codec.go b/vendor/github.com/containerd/ttrpc/codec.go new file mode 100644 index 0000000000..b4aac2fac0 --- /dev/null +++ b/vendor/github.com/containerd/ttrpc/codec.go @@ -0,0 +1,42 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package ttrpc + +import ( + "github.com/gogo/protobuf/proto" + "github.com/pkg/errors" +) + +type codec struct{} + +func (c codec) Marshal(msg interface{}) ([]byte, error) { + switch v := msg.(type) { + case proto.Message: + return proto.Marshal(v) + default: + return nil, errors.Errorf("ttrpc: cannot marshal unknown type: %T", msg) + } +} + +func (c codec) Unmarshal(p []byte, msg interface{}) error { + switch v := msg.(type) { + case proto.Message: + return proto.Unmarshal(p, v) + default: + return errors.Errorf("ttrpc: cannot unmarshal into unknown type: %T", msg) + } +} diff --git a/vendor/github.com/containerd/ttrpc/config.go b/vendor/github.com/containerd/ttrpc/config.go new file mode 100644 index 0000000000..019b7a09dd --- /dev/null +++ b/vendor/github.com/containerd/ttrpc/config.go @@ -0,0 +1,39 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package ttrpc + +import "github.com/pkg/errors" + +type serverConfig struct { + handshaker Handshaker +} + +type ServerOpt func(*serverConfig) error + +// WithServerHandshaker can be passed to NewServer to ensure that the +// handshaker is called before every connection attempt. +// +// Only one handshaker is allowed per server. +func WithServerHandshaker(handshaker Handshaker) ServerOpt { + return func(c *serverConfig) error { + if c.handshaker != nil { + return errors.New("only one handshaker allowed per server") + } + c.handshaker = handshaker + return nil + } +} diff --git a/vendor/github.com/containerd/ttrpc/handshake.go b/vendor/github.com/containerd/ttrpc/handshake.go new file mode 100644 index 0000000000..a424b67a49 --- /dev/null +++ b/vendor/github.com/containerd/ttrpc/handshake.go @@ -0,0 +1,50 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package ttrpc + +import ( + "context" + "net" +) + +// Handshaker defines the interface for connection handshakes performed on the +// server or client when first connecting. +type Handshaker interface { + // Handshake should confirm or decorate a connection that may be incoming + // to a server or outgoing from a client. + // + // If this returns without an error, the caller should use the connection + // in place of the original connection. + // + // The second return value can contain credential specific data, such as + // unix socket credentials or TLS information. + // + // While we currently only have implementations on the server-side, this + // interface should be sufficient to implement similar handshakes on the + // client-side. + Handshake(ctx context.Context, conn net.Conn) (net.Conn, interface{}, error) +} + +type handshakerFunc func(ctx context.Context, conn net.Conn) (net.Conn, interface{}, error) + +func (fn handshakerFunc) Handshake(ctx context.Context, conn net.Conn) (net.Conn, interface{}, error) { + return fn(ctx, conn) +} + +func noopHandshake(ctx context.Context, conn net.Conn) (net.Conn, interface{}, error) { + return conn, nil, nil +} diff --git a/vendor/github.com/containerd/ttrpc/server.go b/vendor/github.com/containerd/ttrpc/server.go new file mode 100644 index 0000000000..263cb4583b --- /dev/null +++ b/vendor/github.com/containerd/ttrpc/server.go @@ -0,0 +1,456 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package ttrpc + +import ( + "context" + "io" + "math/rand" + "net" + "sync" + "sync/atomic" + "time" + + "github.com/pkg/errors" + "github.com/sirupsen/logrus" + "google.golang.org/grpc/codes" + "google.golang.org/grpc/status" +) + +var ( + ErrServerClosed = errors.New("ttrpc: server closed") +) + +type Server struct { + config *serverConfig + services *serviceSet + codec codec + + mu sync.Mutex + listeners map[net.Listener]struct{} + connections map[*serverConn]struct{} // all connections to current state + done chan struct{} // marks point at which we stop serving requests +} + +func NewServer(opts ...ServerOpt) (*Server, error) { + config := &serverConfig{} + for _, opt := range opts { + if err := opt(config); err != nil { + return nil, err + } + } + + return &Server{ + config: config, + services: newServiceSet(), + done: make(chan struct{}), + listeners: make(map[net.Listener]struct{}), + connections: make(map[*serverConn]struct{}), + }, nil +} + +func (s *Server) Register(name string, methods map[string]Method) { + s.services.register(name, methods) +} + +func (s *Server) Serve(ctx context.Context, l net.Listener) error { + s.addListener(l) + defer s.closeListener(l) + + var ( + backoff time.Duration + handshaker = s.config.handshaker + ) + + if handshaker == nil { + handshaker = handshakerFunc(noopHandshake) + } + + for { + conn, err := l.Accept() + if err != nil { + select { + case <-s.done: + return ErrServerClosed + default: + } + + if terr, ok := err.(interface { + Temporary() bool + }); ok && terr.Temporary() { + if backoff == 0 { + backoff = time.Millisecond + } else { + backoff *= 2 + } + + if max := time.Second; backoff > max { + backoff = max + } + + sleep := time.Duration(rand.Int63n(int64(backoff))) + logrus.WithError(err).Errorf("ttrpc: failed accept; backoff %v", sleep) + time.Sleep(sleep) + continue + } + + return err + } + + backoff = 0 + + approved, handshake, err := handshaker.Handshake(ctx, conn) + if err != nil { + logrus.WithError(err).Errorf("ttrpc: refusing connection after handshake") + conn.Close() + continue + } + + sc := s.newConn(approved, handshake) + go sc.run(ctx) + } +} + +func (s *Server) Shutdown(ctx context.Context) error { + s.mu.Lock() + select { + case <-s.done: + default: + // protected by mutex + close(s.done) + } + lnerr := s.closeListeners() + s.mu.Unlock() + + ticker := time.NewTicker(200 * time.Millisecond) + defer ticker.Stop() + for { + if s.closeIdleConns() { + return lnerr + } + select { + case <-ctx.Done(): + return ctx.Err() + case <-ticker.C: + } + } +} + +// Close the server without waiting for active connections. +func (s *Server) Close() error { + s.mu.Lock() + defer s.mu.Unlock() + + select { + case <-s.done: + default: + // protected by mutex + close(s.done) + } + + err := s.closeListeners() + for c := range s.connections { + c.close() + delete(s.connections, c) + } + + return err +} + +func (s *Server) addListener(l net.Listener) { + s.mu.Lock() + defer s.mu.Unlock() + s.listeners[l] = struct{}{} +} + +func (s *Server) closeListener(l net.Listener) error { + s.mu.Lock() + defer s.mu.Unlock() + + return s.closeListenerLocked(l) +} + +func (s *Server) closeListenerLocked(l net.Listener) error { + defer delete(s.listeners, l) + return l.Close() +} + +func (s *Server) closeListeners() error { + var err error + for l := range s.listeners { + if cerr := s.closeListenerLocked(l); cerr != nil && err == nil { + err = cerr + } + } + return err +} + +func (s *Server) addConnection(c *serverConn) { + s.mu.Lock() + defer s.mu.Unlock() + + s.connections[c] = struct{}{} +} + +func (s *Server) closeIdleConns() bool { + s.mu.Lock() + defer s.mu.Unlock() + quiescent := true + for c := range s.connections { + st, ok := c.getState() + if !ok || st != connStateIdle { + quiescent = false + continue + } + c.close() + delete(s.connections, c) + } + return quiescent +} + +type connState int + +const ( + connStateActive = iota + 1 // outstanding requests + connStateIdle // no requests + connStateClosed // closed connection +) + +func (cs connState) String() string { + switch cs { + case connStateActive: + return "active" + case connStateIdle: + return "idle" + case connStateClosed: + return "closed" + default: + return "unknown" + } +} + +func (s *Server) newConn(conn net.Conn, handshake interface{}) *serverConn { + c := &serverConn{ + server: s, + conn: conn, + handshake: handshake, + shutdown: make(chan struct{}), + } + c.setState(connStateIdle) + s.addConnection(c) + return c +} + +type serverConn struct { + server *Server + conn net.Conn + handshake interface{} // data from handshake, not used for now + state atomic.Value + + shutdownOnce sync.Once + shutdown chan struct{} // forced shutdown, used by close +} + +func (c *serverConn) getState() (connState, bool) { + cs, ok := c.state.Load().(connState) + return cs, ok +} + +func (c *serverConn) setState(newstate connState) { + c.state.Store(newstate) +} + +func (c *serverConn) close() error { + c.shutdownOnce.Do(func() { + close(c.shutdown) + }) + + return nil +} + +func (c *serverConn) run(sctx context.Context) { + type ( + request struct { + id uint32 + req *Request + } + + response struct { + id uint32 + resp *Response + } + ) + + var ( + ch = newChannel(c.conn) + ctx, cancel = context.WithCancel(sctx) + active int + state connState = connStateIdle + responses = make(chan response) + requests = make(chan request) + recvErr = make(chan error, 1) + shutdown = c.shutdown + done = make(chan struct{}) + ) + + defer c.conn.Close() + defer cancel() + defer close(done) + + go func(recvErr chan error) { + defer close(recvErr) + sendImmediate := func(id uint32, st *status.Status) bool { + select { + case responses <- response{ + // even though we've had an invalid stream id, we send it + // back on the same stream id so the client knows which + // stream id was bad. + id: id, + resp: &Response{ + Status: st.Proto(), + }, + }: + return true + case <-c.shutdown: + return false + case <-done: + return false + } + } + + for { + select { + case <-c.shutdown: + return + case <-done: + return + default: // proceed + } + + mh, p, err := ch.recv(ctx) + if err != nil { + status, ok := status.FromError(err) + if !ok { + recvErr <- err + return + } + + // in this case, we send an error for that particular message + // when the status is defined. + if !sendImmediate(mh.StreamID, status) { + return + } + + continue + } + + if mh.Type != messageTypeRequest { + // we must ignore this for future compat. + continue + } + + var req Request + if err := c.server.codec.Unmarshal(p, &req); err != nil { + ch.putmbuf(p) + if !sendImmediate(mh.StreamID, status.Newf(codes.InvalidArgument, "unmarshal request error: %v", err)) { + return + } + continue + } + ch.putmbuf(p) + + if mh.StreamID%2 != 1 { + // enforce odd client initiated identifiers. + if !sendImmediate(mh.StreamID, status.Newf(codes.InvalidArgument, "StreamID must be odd for client initiated streams")) { + return + } + continue + } + + // Forward the request to the main loop. We don't wait on s.done + // because we have already accepted the client request. + select { + case requests <- request{ + id: mh.StreamID, + req: &req, + }: + case <-done: + return + } + } + }(recvErr) + + for { + newstate := state + switch { + case active > 0: + newstate = connStateActive + shutdown = nil + case active == 0: + newstate = connStateIdle + shutdown = c.shutdown // only enable this branch in idle mode + } + + if newstate != state { + c.setState(newstate) + state = newstate + } + + select { + case request := <-requests: + active++ + go func(id uint32) { + p, status := c.server.services.call(ctx, request.req.Service, request.req.Method, request.req.Payload) + resp := &Response{ + Status: status.Proto(), + Payload: p, + } + + select { + case responses <- response{ + id: id, + resp: resp, + }: + case <-done: + } + }(request.id) + case response := <-responses: + p, err := c.server.codec.Marshal(response.resp) + if err != nil { + logrus.WithError(err).Error("failed marshaling response") + return + } + + if err := ch.send(ctx, response.id, messageTypeResponse, p); err != nil { + logrus.WithError(err).Error("failed sending message on channel") + return + } + + active-- + case err := <-recvErr: + // TODO(stevvooe): Not wildly clear what we should do in this + // branch. Basically, it means that we are no longer receiving + // requests due to a terminal error. + recvErr = nil // connection is now "closing" + if err != nil && err != io.EOF { + logrus.WithError(err).Error("error receiving message") + } + case <-shutdown: + return + } + } +} diff --git a/vendor/github.com/containerd/ttrpc/services.go b/vendor/github.com/containerd/ttrpc/services.go new file mode 100644 index 0000000000..e909638259 --- /dev/null +++ b/vendor/github.com/containerd/ttrpc/services.go @@ -0,0 +1,150 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package ttrpc + +import ( + "context" + "io" + "os" + "path" + + "github.com/gogo/protobuf/proto" + "github.com/pkg/errors" + "google.golang.org/grpc/codes" + "google.golang.org/grpc/status" +) + +type Method func(ctx context.Context, unmarshal func(interface{}) error) (interface{}, error) + +type ServiceDesc struct { + Methods map[string]Method + + // TODO(stevvooe): Add stream support. +} + +type serviceSet struct { + services map[string]ServiceDesc +} + +func newServiceSet() *serviceSet { + return &serviceSet{ + services: make(map[string]ServiceDesc), + } +} + +func (s *serviceSet) register(name string, methods map[string]Method) { + if _, ok := s.services[name]; ok { + panic(errors.Errorf("duplicate service %v registered", name)) + } + + s.services[name] = ServiceDesc{ + Methods: methods, + } +} + +func (s *serviceSet) call(ctx context.Context, serviceName, methodName string, p []byte) ([]byte, *status.Status) { + p, err := s.dispatch(ctx, serviceName, methodName, p) + st, ok := status.FromError(err) + if !ok { + st = status.New(convertCode(err), err.Error()) + } + + return p, st +} + +func (s *serviceSet) dispatch(ctx context.Context, serviceName, methodName string, p []byte) ([]byte, error) { + method, err := s.resolve(serviceName, methodName) + if err != nil { + return nil, err + } + + unmarshal := func(obj interface{}) error { + switch v := obj.(type) { + case proto.Message: + if err := proto.Unmarshal(p, v); err != nil { + return status.Errorf(codes.Internal, "ttrpc: error unmarshaling payload: %v", err.Error()) + } + default: + return status.Errorf(codes.Internal, "ttrpc: error unsupported request type: %T", v) + } + return nil + } + + resp, err := method(ctx, unmarshal) + if err != nil { + return nil, err + } + + switch v := resp.(type) { + case proto.Message: + r, err := proto.Marshal(v) + if err != nil { + return nil, status.Errorf(codes.Internal, "ttrpc: error marshaling payload: %v", err.Error()) + } + + return r, nil + default: + return nil, status.Errorf(codes.Internal, "ttrpc: error unsupported response type: %T", v) + } +} + +func (s *serviceSet) resolve(service, method string) (Method, error) { + srv, ok := s.services[service] + if !ok { + return nil, status.Errorf(codes.NotFound, "service %v", service) + } + + mthd, ok := srv.Methods[method] + if !ok { + return nil, status.Errorf(codes.NotFound, "method %v", method) + } + + return mthd, nil +} + +// convertCode maps stdlib go errors into grpc space. +// +// This is ripped from the grpc-go code base. +func convertCode(err error) codes.Code { + switch err { + case nil: + return codes.OK + case io.EOF: + return codes.OutOfRange + case io.ErrClosedPipe, io.ErrNoProgress, io.ErrShortBuffer, io.ErrShortWrite, io.ErrUnexpectedEOF: + return codes.FailedPrecondition + case os.ErrInvalid: + return codes.InvalidArgument + case context.Canceled: + return codes.Canceled + case context.DeadlineExceeded: + return codes.DeadlineExceeded + } + switch { + case os.IsExist(err): + return codes.AlreadyExists + case os.IsNotExist(err): + return codes.NotFound + case os.IsPermission(err): + return codes.PermissionDenied + } + return codes.Unknown +} + +func fullPath(service, method string) string { + return "/" + path.Join("/", service, method) +} diff --git a/vendor/github.com/containerd/ttrpc/types.go b/vendor/github.com/containerd/ttrpc/types.go new file mode 100644 index 0000000000..1f7969e5cf --- /dev/null +++ b/vendor/github.com/containerd/ttrpc/types.go @@ -0,0 +1,42 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package ttrpc + +import ( + "fmt" + + spb "google.golang.org/genproto/googleapis/rpc/status" +) + +type Request struct { + Service string `protobuf:"bytes,1,opt,name=service,proto3"` + Method string `protobuf:"bytes,2,opt,name=method,proto3"` + Payload []byte `protobuf:"bytes,3,opt,name=payload,proto3"` +} + +func (r *Request) Reset() { *r = Request{} } +func (r *Request) String() string { return fmt.Sprintf("%+#v", r) } +func (r *Request) ProtoMessage() {} + +type Response struct { + Status *spb.Status `protobuf:"bytes,1,opt,name=status,proto3"` + Payload []byte `protobuf:"bytes,2,opt,name=payload,proto3"` +} + +func (r *Response) Reset() { *r = Response{} } +func (r *Response) String() string { return fmt.Sprintf("%+#v", r) } +func (r *Response) ProtoMessage() {} diff --git a/vendor/github.com/containerd/ttrpc/unixcreds_linux.go b/vendor/github.com/containerd/ttrpc/unixcreds_linux.go new file mode 100644 index 0000000000..a471bd365c --- /dev/null +++ b/vendor/github.com/containerd/ttrpc/unixcreds_linux.go @@ -0,0 +1,108 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package ttrpc + +import ( + "context" + "net" + "os" + "syscall" + + "github.com/pkg/errors" + "golang.org/x/sys/unix" +) + +type UnixCredentialsFunc func(*unix.Ucred) error + +func (fn UnixCredentialsFunc) Handshake(ctx context.Context, conn net.Conn) (net.Conn, interface{}, error) { + uc, err := requireUnixSocket(conn) + if err != nil { + return nil, nil, errors.Wrap(err, "ttrpc.UnixCredentialsFunc: require unix socket") + } + + rs, err := uc.SyscallConn() + if err != nil { + return nil, nil, errors.Wrap(err, "ttrpc.UnixCredentialsFunc: (net.UnixConn).SyscallConn failed") + } + var ( + ucred *unix.Ucred + ucredErr error + ) + if err := rs.Control(func(fd uintptr) { + ucred, ucredErr = unix.GetsockoptUcred(int(fd), unix.SOL_SOCKET, unix.SO_PEERCRED) + }); err != nil { + return nil, nil, errors.Wrapf(err, "ttrpc.UnixCredentialsFunc: (*syscall.RawConn).Control failed") + } + + if ucredErr != nil { + return nil, nil, errors.Wrapf(err, "ttrpc.UnixCredentialsFunc: failed to retrieve socket peer credentials") + } + + if err := fn(ucred); err != nil { + return nil, nil, errors.Wrapf(err, "ttrpc.UnixCredentialsFunc: credential check failed") + } + + return uc, ucred, nil +} + +// UnixSocketRequireUidGid requires specific *effective* UID/GID, rather than the real UID/GID. +// +// For example, if a daemon binary is owned by the root (UID 0) with SUID bit but running as an +// unprivileged user (UID 1001), the effective UID becomes 0, and the real UID becomes 1001. +// So calling this function with uid=0 allows a connection from effective UID 0 but rejects +// a connection from effective UID 1001. +// +// See socket(7), SO_PEERCRED: "The returned credentials are those that were in effect at the time of the call to connect(2) or socketpair(2)." +func UnixSocketRequireUidGid(uid, gid int) UnixCredentialsFunc { + return func(ucred *unix.Ucred) error { + return requireUidGid(ucred, uid, gid) + } +} + +func UnixSocketRequireRoot() UnixCredentialsFunc { + return UnixSocketRequireUidGid(0, 0) +} + +// UnixSocketRequireSameUser resolves the current effective unix user and returns a +// UnixCredentialsFunc that will validate incoming unix connections against the +// current credentials. +// +// This is useful when using abstract sockets that are accessible by all users. +func UnixSocketRequireSameUser() UnixCredentialsFunc { + euid, egid := os.Geteuid(), os.Getegid() + return UnixSocketRequireUidGid(euid, egid) +} + +func requireRoot(ucred *unix.Ucred) error { + return requireUidGid(ucred, 0, 0) +} + +func requireUidGid(ucred *unix.Ucred, uid, gid int) error { + if (uid != -1 && uint32(uid) != ucred.Uid) || (gid != -1 && uint32(gid) != ucred.Gid) { + return errors.Wrap(syscall.EPERM, "ttrpc: invalid credentials") + } + return nil +} + +func requireUnixSocket(conn net.Conn) (*net.UnixConn, error) { + uc, ok := conn.(*net.UnixConn) + if !ok { + return nil, errors.New("a unix socket connection is required") + } + + return uc, nil +} diff --git a/vendor/github.com/containerd/typeurl/LICENSE b/vendor/github.com/containerd/typeurl/LICENSE new file mode 100644 index 0000000000..584149b6ee --- /dev/null +++ b/vendor/github.com/containerd/typeurl/LICENSE @@ -0,0 +1,191 @@ + + Apache License + Version 2.0, January 2004 + https://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + Copyright The containerd Authors + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + https://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. diff --git a/vendor/github.com/containerd/typeurl/types.go b/vendor/github.com/containerd/typeurl/types.go new file mode 100644 index 0000000000..153c488d0a --- /dev/null +++ b/vendor/github.com/containerd/typeurl/types.go @@ -0,0 +1,158 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package typeurl + +import ( + "encoding/json" + "path" + "reflect" + "sync" + + "github.com/gogo/protobuf/proto" + "github.com/gogo/protobuf/types" + "github.com/pkg/errors" +) + +var ( + mu sync.Mutex + registry = make(map[reflect.Type]string) +) + +var ErrNotFound = errors.New("not found") + +// Register a type with the base url of the type +func Register(v interface{}, args ...string) { + var ( + t = tryDereference(v) + p = path.Join(args...) + ) + mu.Lock() + defer mu.Unlock() + if et, ok := registry[t]; ok { + if et != p { + panic(errors.Errorf("type registred with alternate path %q != %q", et, p)) + } + return + } + registry[t] = p +} + +// TypeURL returns the type url for a registred type +func TypeURL(v interface{}) (string, error) { + mu.Lock() + u, ok := registry[tryDereference(v)] + mu.Unlock() + if !ok { + // fallback to the proto registry if it is a proto message + pb, ok := v.(proto.Message) + if !ok { + return "", errors.Wrapf(ErrNotFound, "type %s", reflect.TypeOf(v)) + } + return proto.MessageName(pb), nil + } + return u, nil +} + +// Is returns true if the type of the Any is the same as v +func Is(any *types.Any, v interface{}) bool { + // call to check that v is a pointer + tryDereference(v) + url, err := TypeURL(v) + if err != nil { + return false + } + return any.TypeUrl == url +} + +// MarshalAny marshals the value v into an any with the correct TypeUrl +func MarshalAny(v interface{}) (*types.Any, error) { + var marshal func(v interface{}) ([]byte, error) + switch t := v.(type) { + case *types.Any: + // avoid reserializing the type if we have an any. + return t, nil + case proto.Message: + marshal = func(v interface{}) ([]byte, error) { + return proto.Marshal(t) + } + default: + marshal = json.Marshal + } + + url, err := TypeURL(v) + if err != nil { + return nil, err + } + + data, err := marshal(v) + if err != nil { + return nil, err + } + return &types.Any{ + TypeUrl: url, + Value: data, + }, nil +} + +// UnmarshalAny unmarshals the any type into a concrete type +func UnmarshalAny(any *types.Any) (interface{}, error) { + t, err := getTypeByUrl(any.TypeUrl) + if err != nil { + return nil, err + } + v := reflect.New(t.t).Interface() + if t.isProto { + err = proto.Unmarshal(any.Value, v.(proto.Message)) + } else { + err = json.Unmarshal(any.Value, v) + } + return v, err +} + +type urlType struct { + t reflect.Type + isProto bool +} + +func getTypeByUrl(url string) (urlType, error) { + for t, u := range registry { + if u == url { + return urlType{ + t: t, + }, nil + } + } + // fallback to proto registry + t := proto.MessageType(url) + if t != nil { + return urlType{ + // get the underlying Elem because proto returns a pointer to the type + t: t.Elem(), + isProto: true, + }, nil + } + return urlType{}, errors.Wrapf(ErrNotFound, "type with url %s", url) +} + +func tryDereference(v interface{}) reflect.Type { + t := reflect.TypeOf(v) + if t.Kind() == reflect.Ptr { + // require check of pointer but dereference to register + return t.Elem() + } + panic("v is not a pointer to a type") +} diff --git a/vendor/github.com/opencontainers/go-digest/LICENSE.code b/vendor/github.com/opencontainers/go-digest/LICENSE.code new file mode 100644 index 0000000000..0ea3ff81e3 --- /dev/null +++ b/vendor/github.com/opencontainers/go-digest/LICENSE.code @@ -0,0 +1,191 @@ + + Apache License + Version 2.0, January 2004 + https://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + Copyright 2016 Docker, Inc. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + https://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. diff --git a/vendor/github.com/opencontainers/go-digest/LICENSE.docs b/vendor/github.com/opencontainers/go-digest/LICENSE.docs new file mode 100644 index 0000000000..e26cd4fc8e --- /dev/null +++ b/vendor/github.com/opencontainers/go-digest/LICENSE.docs @@ -0,0 +1,425 @@ +Attribution-ShareAlike 4.0 International + +======================================================================= + +Creative Commons Corporation ("Creative Commons") is not a law firm and +does not provide legal services or legal advice. Distribution of +Creative Commons public licenses does not create a lawyer-client or +other relationship. Creative Commons makes its licenses and related +information available on an "as-is" basis. Creative Commons gives no +warranties regarding its licenses, any material licensed under their +terms and conditions, or any related information. Creative Commons +disclaims all liability for damages resulting from their use to the +fullest extent possible. + +Using Creative Commons Public Licenses + +Creative Commons public licenses provide a standard set of terms and +conditions that creators and other rights holders may use to share +original works of authorship and other material subject to copyright +and certain other rights specified in the public license below. The +following considerations are for informational purposes only, are not +exhaustive, and do not form part of our licenses. + + Considerations for licensors: Our public licenses are + intended for use by those authorized to give the public + permission to use material in ways otherwise restricted by + copyright and certain other rights. Our licenses are + irrevocable. Licensors should read and understand the terms + and conditions of the license they choose before applying it. + Licensors should also secure all rights necessary before + applying our licenses so that the public can reuse the + material as expected. Licensors should clearly mark any + material not subject to the license. This includes other CC- + licensed material, or material used under an exception or + limitation to copyright. More considerations for licensors: + wiki.creativecommons.org/Considerations_for_licensors + + Considerations for the public: By using one of our public + licenses, a licensor grants the public permission to use the + licensed material under specified terms and conditions. If + the licensor's permission is not necessary for any reason--for + example, because of any applicable exception or limitation to + copyright--then that use is not regulated by the license. Our + licenses grant only permissions under copyright and certain + other rights that a licensor has authority to grant. Use of + the licensed material may still be restricted for other + reasons, including because others have copyright or other + rights in the material. A licensor may make special requests, + such as asking that all changes be marked or described. + Although not required by our licenses, you are encouraged to + respect those requests where reasonable. More_considerations + for the public: + wiki.creativecommons.org/Considerations_for_licensees + +======================================================================= + +Creative Commons Attribution-ShareAlike 4.0 International Public +License + +By exercising the Licensed Rights (defined below), You accept and agree +to be bound by the terms and conditions of this Creative Commons +Attribution-ShareAlike 4.0 International Public License ("Public +License"). To the extent this Public License may be interpreted as a +contract, You are granted the Licensed Rights in consideration of Your +acceptance of these terms and conditions, and the Licensor grants You +such rights in consideration of benefits the Licensor receives from +making the Licensed Material available under these terms and +conditions. + + +Section 1 -- Definitions. + + a. Adapted Material means material subject to Copyright and Similar + Rights that is derived from or based upon the Licensed Material + and in which the Licensed Material is translated, altered, + arranged, transformed, or otherwise modified in a manner requiring + permission under the Copyright and Similar Rights held by the + Licensor. For purposes of this Public License, where the Licensed + Material is a musical work, performance, or sound recording, + Adapted Material is always produced where the Licensed Material is + synched in timed relation with a moving image. + + b. Adapter's License means the license You apply to Your Copyright + and Similar Rights in Your contributions to Adapted Material in + accordance with the terms and conditions of this Public License. + + c. BY-SA Compatible License means a license listed at + creativecommons.org/compatiblelicenses, approved by Creative + Commons as essentially the equivalent of this Public License. + + d. Copyright and Similar Rights means copyright and/or similar rights + closely related to copyright including, without limitation, + performance, broadcast, sound recording, and Sui Generis Database + Rights, without regard to how the rights are labeled or + categorized. For purposes of this Public License, the rights + specified in Section 2(b)(1)-(2) are not Copyright and Similar + Rights. + + e. Effective Technological Measures means those measures that, in the + absence of proper authority, may not be circumvented under laws + fulfilling obligations under Article 11 of the WIPO Copyright + Treaty adopted on December 20, 1996, and/or similar international + agreements. + + f. Exceptions and Limitations means fair use, fair dealing, and/or + any other exception or limitation to Copyright and Similar Rights + that applies to Your use of the Licensed Material. + + g. License Elements means the license attributes listed in the name + of a Creative Commons Public License. The License Elements of this + Public License are Attribution and ShareAlike. + + h. Licensed Material means the artistic or literary work, database, + or other material to which the Licensor applied this Public + License. + + i. Licensed Rights means the rights granted to You subject to the + terms and conditions of this Public License, which are limited to + all Copyright and Similar Rights that apply to Your use of the + Licensed Material and that the Licensor has authority to license. + + j. Licensor means the individual(s) or entity(ies) granting rights + under this Public License. + + k. Share means to provide material to the public by any means or + process that requires permission under the Licensed Rights, such + as reproduction, public display, public performance, distribution, + dissemination, communication, or importation, and to make material + available to the public including in ways that members of the + public may access the material from a place and at a time + individually chosen by them. + + l. Sui Generis Database Rights means rights other than copyright + resulting from Directive 96/9/EC of the European Parliament and of + the Council of 11 March 1996 on the legal protection of databases, + as amended and/or succeeded, as well as other essentially + equivalent rights anywhere in the world. + + m. You means the individual or entity exercising the Licensed Rights + under this Public License. Your has a corresponding meaning. + + +Section 2 -- Scope. + + a. License grant. + + 1. Subject to the terms and conditions of this Public License, + the Licensor hereby grants You a worldwide, royalty-free, + non-sublicensable, non-exclusive, irrevocable license to + exercise the Licensed Rights in the Licensed Material to: + + a. reproduce and Share the Licensed Material, in whole or + in part; and + + b. produce, reproduce, and Share Adapted Material. + + 2. Exceptions and Limitations. For the avoidance of doubt, where + Exceptions and Limitations apply to Your use, this Public + License does not apply, and You do not need to comply with + its terms and conditions. + + 3. Term. The term of this Public License is specified in Section + 6(a). + + 4. Media and formats; technical modifications allowed. The + Licensor authorizes You to exercise the Licensed Rights in + all media and formats whether now known or hereafter created, + and to make technical modifications necessary to do so. The + Licensor waives and/or agrees not to assert any right or + authority to forbid You from making technical modifications + necessary to exercise the Licensed Rights, including + technical modifications necessary to circumvent Effective + Technological Measures. For purposes of this Public License, + simply making modifications authorized by this Section 2(a) + (4) never produces Adapted Material. + + 5. Downstream recipients. + + a. Offer from the Licensor -- Licensed Material. Every + recipient of the Licensed Material automatically + receives an offer from the Licensor to exercise the + Licensed Rights under the terms and conditions of this + Public License. + + b. Additional offer from the Licensor -- Adapted Material. + Every recipient of Adapted Material from You + automatically receives an offer from the Licensor to + exercise the Licensed Rights in the Adapted Material + under the conditions of the Adapter's License You apply. + + c. No downstream restrictions. You may not offer or impose + any additional or different terms or conditions on, or + apply any Effective Technological Measures to, the + Licensed Material if doing so restricts exercise of the + Licensed Rights by any recipient of the Licensed + Material. + + 6. No endorsement. Nothing in this Public License constitutes or + may be construed as permission to assert or imply that You + are, or that Your use of the Licensed Material is, connected + with, or sponsored, endorsed, or granted official status by, + the Licensor or others designated to receive attribution as + provided in Section 3(a)(1)(A)(i). + + b. Other rights. + + 1. Moral rights, such as the right of integrity, are not + licensed under this Public License, nor are publicity, + privacy, and/or other similar personality rights; however, to + the extent possible, the Licensor waives and/or agrees not to + assert any such rights held by the Licensor to the limited + extent necessary to allow You to exercise the Licensed + Rights, but not otherwise. + + 2. Patent and trademark rights are not licensed under this + Public License. + + 3. To the extent possible, the Licensor waives any right to + collect royalties from You for the exercise of the Licensed + Rights, whether directly or through a collecting society + under any voluntary or waivable statutory or compulsory + licensing scheme. In all other cases the Licensor expressly + reserves any right to collect such royalties. + + +Section 3 -- License Conditions. + +Your exercise of the Licensed Rights is expressly made subject to the +following conditions. + + a. Attribution. + + 1. If You Share the Licensed Material (including in modified + form), You must: + + a. retain the following if it is supplied by the Licensor + with the Licensed Material: + + i. identification of the creator(s) of the Licensed + Material and any others designated to receive + attribution, in any reasonable manner requested by + the Licensor (including by pseudonym if + designated); + + ii. a copyright notice; + + iii. a notice that refers to this Public License; + + iv. a notice that refers to the disclaimer of + warranties; + + v. a URI or hyperlink to the Licensed Material to the + extent reasonably practicable; + + b. indicate if You modified the Licensed Material and + retain an indication of any previous modifications; and + + c. indicate the Licensed Material is licensed under this + Public License, and include the text of, or the URI or + hyperlink to, this Public License. + + 2. You may satisfy the conditions in Section 3(a)(1) in any + reasonable manner based on the medium, means, and context in + which You Share the Licensed Material. For example, it may be + reasonable to satisfy the conditions by providing a URI or + hyperlink to a resource that includes the required + information. + + 3. If requested by the Licensor, You must remove any of the + information required by Section 3(a)(1)(A) to the extent + reasonably practicable. + + b. ShareAlike. + + In addition to the conditions in Section 3(a), if You Share + Adapted Material You produce, the following conditions also apply. + + 1. The Adapter's License You apply must be a Creative Commons + license with the same License Elements, this version or + later, or a BY-SA Compatible License. + + 2. You must include the text of, or the URI or hyperlink to, the + Adapter's License You apply. You may satisfy this condition + in any reasonable manner based on the medium, means, and + context in which You Share Adapted Material. + + 3. You may not offer or impose any additional or different terms + or conditions on, or apply any Effective Technological + Measures to, Adapted Material that restrict exercise of the + rights granted under the Adapter's License You apply. + + +Section 4 -- Sui Generis Database Rights. + +Where the Licensed Rights include Sui Generis Database Rights that +apply to Your use of the Licensed Material: + + a. for the avoidance of doubt, Section 2(a)(1) grants You the right + to extract, reuse, reproduce, and Share all or a substantial + portion of the contents of the database; + + b. if You include all or a substantial portion of the database + contents in a database in which You have Sui Generis Database + Rights, then the database in which You have Sui Generis Database + Rights (but not its individual contents) is Adapted Material, + + including for purposes of Section 3(b); and + c. You must comply with the conditions in Section 3(a) if You Share + all or a substantial portion of the contents of the database. + +For the avoidance of doubt, this Section 4 supplements and does not +replace Your obligations under this Public License where the Licensed +Rights include other Copyright and Similar Rights. + + +Section 5 -- Disclaimer of Warranties and Limitation of Liability. + + a. UNLESS OTHERWISE SEPARATELY UNDERTAKEN BY THE LICENSOR, TO THE + EXTENT POSSIBLE, THE LICENSOR OFFERS THE LICENSED MATERIAL AS-IS + AND AS-AVAILABLE, AND MAKES NO REPRESENTATIONS OR WARRANTIES OF + ANY KIND CONCERNING THE LICENSED MATERIAL, WHETHER EXPRESS, + IMPLIED, STATUTORY, OR OTHER. THIS INCLUDES, WITHOUT LIMITATION, + WARRANTIES OF TITLE, MERCHANTABILITY, FITNESS FOR A PARTICULAR + PURPOSE, NON-INFRINGEMENT, ABSENCE OF LATENT OR OTHER DEFECTS, + ACCURACY, OR THE PRESENCE OR ABSENCE OF ERRORS, WHETHER OR NOT + KNOWN OR DISCOVERABLE. WHERE DISCLAIMERS OF WARRANTIES ARE NOT + ALLOWED IN FULL OR IN PART, THIS DISCLAIMER MAY NOT APPLY TO YOU. + + b. TO THE EXTENT POSSIBLE, IN NO EVENT WILL THE LICENSOR BE LIABLE + TO YOU ON ANY LEGAL THEORY (INCLUDING, WITHOUT LIMITATION, + NEGLIGENCE) OR OTHERWISE FOR ANY DIRECT, SPECIAL, INDIRECT, + INCIDENTAL, CONSEQUENTIAL, PUNITIVE, EXEMPLARY, OR OTHER LOSSES, + COSTS, EXPENSES, OR DAMAGES ARISING OUT OF THIS PUBLIC LICENSE OR + USE OF THE LICENSED MATERIAL, EVEN IF THE LICENSOR HAS BEEN + ADVISED OF THE POSSIBILITY OF SUCH LOSSES, COSTS, EXPENSES, OR + DAMAGES. WHERE A LIMITATION OF LIABILITY IS NOT ALLOWED IN FULL OR + IN PART, THIS LIMITATION MAY NOT APPLY TO YOU. + + c. The disclaimer of warranties and limitation of liability provided + above shall be interpreted in a manner that, to the extent + possible, most closely approximates an absolute disclaimer and + waiver of all liability. + + +Section 6 -- Term and Termination. + + a. This Public License applies for the term of the Copyright and + Similar Rights licensed here. However, if You fail to comply with + this Public License, then Your rights under this Public License + terminate automatically. + + b. Where Your right to use the Licensed Material has terminated under + Section 6(a), it reinstates: + + 1. automatically as of the date the violation is cured, provided + it is cured within 30 days of Your discovery of the + violation; or + + 2. upon express reinstatement by the Licensor. + + For the avoidance of doubt, this Section 6(b) does not affect any + right the Licensor may have to seek remedies for Your violations + of this Public License. + + c. For the avoidance of doubt, the Licensor may also offer the + Licensed Material under separate terms or conditions or stop + distributing the Licensed Material at any time; however, doing so + will not terminate this Public License. + + d. Sections 1, 5, 6, 7, and 8 survive termination of this Public + License. + + +Section 7 -- Other Terms and Conditions. + + a. The Licensor shall not be bound by any additional or different + terms or conditions communicated by You unless expressly agreed. + + b. Any arrangements, understandings, or agreements regarding the + Licensed Material not stated herein are separate from and + independent of the terms and conditions of this Public License. + + +Section 8 -- Interpretation. + + a. For the avoidance of doubt, this Public License does not, and + shall not be interpreted to, reduce, limit, restrict, or impose + conditions on any use of the Licensed Material that could lawfully + be made without permission under this Public License. + + b. To the extent possible, if any provision of this Public License is + deemed unenforceable, it shall be automatically reformed to the + minimum extent necessary to make it enforceable. If the provision + cannot be reformed, it shall be severed from this Public License + without affecting the enforceability of the remaining terms and + conditions. + + c. No term or condition of this Public License will be waived and no + failure to comply consented to unless expressly agreed to by the + Licensor. + + d. Nothing in this Public License constitutes or may be interpreted + as a limitation upon, or waiver of, any privileges and immunities + that apply to the Licensor or You, including from the legal + processes of any jurisdiction or authority. + + +======================================================================= + +Creative Commons is not a party to its public licenses. +Notwithstanding, Creative Commons may elect to apply one of its public +licenses to material it publishes and in those instances will be +considered the "Licensor." Except for the limited purpose of indicating +that material is shared under a Creative Commons public license or as +otherwise permitted by the Creative Commons policies published at +creativecommons.org/policies, Creative Commons does not authorize the +use of the trademark "Creative Commons" or any other trademark or logo +of Creative Commons without its prior written consent including, +without limitation, in connection with any unauthorized modifications +to any of its public licenses or any other arrangements, +understandings, or agreements concerning use of licensed material. For +the avoidance of doubt, this paragraph does not form part of the public +licenses. + +Creative Commons may be contacted at creativecommons.org. diff --git a/vendor/github.com/opencontainers/go-digest/algorithm.go b/vendor/github.com/opencontainers/go-digest/algorithm.go new file mode 100644 index 0000000000..8813bd26f1 --- /dev/null +++ b/vendor/github.com/opencontainers/go-digest/algorithm.go @@ -0,0 +1,192 @@ +// Copyright 2017 Docker, Inc. +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// https://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package digest + +import ( + "crypto" + "fmt" + "hash" + "io" + "regexp" +) + +// Algorithm identifies and implementation of a digester by an identifier. +// Note the that this defines both the hash algorithm used and the string +// encoding. +type Algorithm string + +// supported digest types +const ( + SHA256 Algorithm = "sha256" // sha256 with hex encoding (lower case only) + SHA384 Algorithm = "sha384" // sha384 with hex encoding (lower case only) + SHA512 Algorithm = "sha512" // sha512 with hex encoding (lower case only) + + // Canonical is the primary digest algorithm used with the distribution + // project. Other digests may be used but this one is the primary storage + // digest. + Canonical = SHA256 +) + +var ( + // TODO(stevvooe): Follow the pattern of the standard crypto package for + // registration of digests. Effectively, we are a registerable set and + // common symbol access. + + // algorithms maps values to hash.Hash implementations. Other algorithms + // may be available but they cannot be calculated by the digest package. + algorithms = map[Algorithm]crypto.Hash{ + SHA256: crypto.SHA256, + SHA384: crypto.SHA384, + SHA512: crypto.SHA512, + } + + // anchoredEncodedRegexps contains anchored regular expressions for hex-encoded digests. + // Note that /A-F/ disallowed. + anchoredEncodedRegexps = map[Algorithm]*regexp.Regexp{ + SHA256: regexp.MustCompile(`^[a-f0-9]{64}$`), + SHA384: regexp.MustCompile(`^[a-f0-9]{96}$`), + SHA512: regexp.MustCompile(`^[a-f0-9]{128}$`), + } +) + +// Available returns true if the digest type is available for use. If this +// returns false, Digester and Hash will return nil. +func (a Algorithm) Available() bool { + h, ok := algorithms[a] + if !ok { + return false + } + + // check availability of the hash, as well + return h.Available() +} + +func (a Algorithm) String() string { + return string(a) +} + +// Size returns number of bytes returned by the hash. +func (a Algorithm) Size() int { + h, ok := algorithms[a] + if !ok { + return 0 + } + return h.Size() +} + +// Set implemented to allow use of Algorithm as a command line flag. +func (a *Algorithm) Set(value string) error { + if value == "" { + *a = Canonical + } else { + // just do a type conversion, support is queried with Available. + *a = Algorithm(value) + } + + if !a.Available() { + return ErrDigestUnsupported + } + + return nil +} + +// Digester returns a new digester for the specified algorithm. If the algorithm +// does not have a digester implementation, nil will be returned. This can be +// checked by calling Available before calling Digester. +func (a Algorithm) Digester() Digester { + return &digester{ + alg: a, + hash: a.Hash(), + } +} + +// Hash returns a new hash as used by the algorithm. If not available, the +// method will panic. Check Algorithm.Available() before calling. +func (a Algorithm) Hash() hash.Hash { + if !a.Available() { + // Empty algorithm string is invalid + if a == "" { + panic(fmt.Sprintf("empty digest algorithm, validate before calling Algorithm.Hash()")) + } + + // NOTE(stevvooe): A missing hash is usually a programming error that + // must be resolved at compile time. We don't import in the digest + // package to allow users to choose their hash implementation (such as + // when using stevvooe/resumable or a hardware accelerated package). + // + // Applications that may want to resolve the hash at runtime should + // call Algorithm.Available before call Algorithm.Hash(). + panic(fmt.Sprintf("%v not available (make sure it is imported)", a)) + } + + return algorithms[a].New() +} + +// Encode encodes the raw bytes of a digest, typically from a hash.Hash, into +// the encoded portion of the digest. +func (a Algorithm) Encode(d []byte) string { + // TODO(stevvooe): Currently, all algorithms use a hex encoding. When we + // add support for back registration, we can modify this accordingly. + return fmt.Sprintf("%x", d) +} + +// FromReader returns the digest of the reader using the algorithm. +func (a Algorithm) FromReader(rd io.Reader) (Digest, error) { + digester := a.Digester() + + if _, err := io.Copy(digester.Hash(), rd); err != nil { + return "", err + } + + return digester.Digest(), nil +} + +// FromBytes digests the input and returns a Digest. +func (a Algorithm) FromBytes(p []byte) Digest { + digester := a.Digester() + + if _, err := digester.Hash().Write(p); err != nil { + // Writes to a Hash should never fail. None of the existing + // hash implementations in the stdlib or hashes vendored + // here can return errors from Write. Having a panic in this + // condition instead of having FromBytes return an error value + // avoids unnecessary error handling paths in all callers. + panic("write to hash function returned error: " + err.Error()) + } + + return digester.Digest() +} + +// FromString digests the string input and returns a Digest. +func (a Algorithm) FromString(s string) Digest { + return a.FromBytes([]byte(s)) +} + +// Validate validates the encoded portion string +func (a Algorithm) Validate(encoded string) error { + r, ok := anchoredEncodedRegexps[a] + if !ok { + return ErrDigestUnsupported + } + // Digests much always be hex-encoded, ensuring that their hex portion will + // always be size*2 + if a.Size()*2 != len(encoded) { + return ErrDigestInvalidLength + } + if r.MatchString(encoded) { + return nil + } + return ErrDigestInvalidFormat +} diff --git a/vendor/github.com/opencontainers/go-digest/digest.go b/vendor/github.com/opencontainers/go-digest/digest.go new file mode 100644 index 0000000000..ad398cba2f --- /dev/null +++ b/vendor/github.com/opencontainers/go-digest/digest.go @@ -0,0 +1,156 @@ +// Copyright 2017 Docker, Inc. +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// https://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package digest + +import ( + "fmt" + "hash" + "io" + "regexp" + "strings" +) + +// Digest allows simple protection of hex formatted digest strings, prefixed +// by their algorithm. Strings of type Digest have some guarantee of being in +// the correct format and it provides quick access to the components of a +// digest string. +// +// The following is an example of the contents of Digest types: +// +// sha256:7173b809ca12ec5dee4506cd86be934c4596dd234ee82c0662eac04a8c2c71dc +// +// This allows to abstract the digest behind this type and work only in those +// terms. +type Digest string + +// NewDigest returns a Digest from alg and a hash.Hash object. +func NewDigest(alg Algorithm, h hash.Hash) Digest { + return NewDigestFromBytes(alg, h.Sum(nil)) +} + +// NewDigestFromBytes returns a new digest from the byte contents of p. +// Typically, this can come from hash.Hash.Sum(...) or xxx.SumXXX(...) +// functions. This is also useful for rebuilding digests from binary +// serializations. +func NewDigestFromBytes(alg Algorithm, p []byte) Digest { + return NewDigestFromEncoded(alg, alg.Encode(p)) +} + +// NewDigestFromHex is deprecated. Please use NewDigestFromEncoded. +func NewDigestFromHex(alg, hex string) Digest { + return NewDigestFromEncoded(Algorithm(alg), hex) +} + +// NewDigestFromEncoded returns a Digest from alg and the encoded digest. +func NewDigestFromEncoded(alg Algorithm, encoded string) Digest { + return Digest(fmt.Sprintf("%s:%s", alg, encoded)) +} + +// DigestRegexp matches valid digest types. +var DigestRegexp = regexp.MustCompile(`[a-z0-9]+(?:[.+_-][a-z0-9]+)*:[a-zA-Z0-9=_-]+`) + +// DigestRegexpAnchored matches valid digest types, anchored to the start and end of the match. +var DigestRegexpAnchored = regexp.MustCompile(`^` + DigestRegexp.String() + `$`) + +var ( + // ErrDigestInvalidFormat returned when digest format invalid. + ErrDigestInvalidFormat = fmt.Errorf("invalid checksum digest format") + + // ErrDigestInvalidLength returned when digest has invalid length. + ErrDigestInvalidLength = fmt.Errorf("invalid checksum digest length") + + // ErrDigestUnsupported returned when the digest algorithm is unsupported. + ErrDigestUnsupported = fmt.Errorf("unsupported digest algorithm") +) + +// Parse parses s and returns the validated digest object. An error will +// be returned if the format is invalid. +func Parse(s string) (Digest, error) { + d := Digest(s) + return d, d.Validate() +} + +// FromReader consumes the content of rd until io.EOF, returning canonical digest. +func FromReader(rd io.Reader) (Digest, error) { + return Canonical.FromReader(rd) +} + +// FromBytes digests the input and returns a Digest. +func FromBytes(p []byte) Digest { + return Canonical.FromBytes(p) +} + +// FromString digests the input and returns a Digest. +func FromString(s string) Digest { + return Canonical.FromString(s) +} + +// Validate checks that the contents of d is a valid digest, returning an +// error if not. +func (d Digest) Validate() error { + s := string(d) + i := strings.Index(s, ":") + if i <= 0 || i+1 == len(s) { + return ErrDigestInvalidFormat + } + algorithm, encoded := Algorithm(s[:i]), s[i+1:] + if !algorithm.Available() { + if !DigestRegexpAnchored.MatchString(s) { + return ErrDigestInvalidFormat + } + return ErrDigestUnsupported + } + return algorithm.Validate(encoded) +} + +// Algorithm returns the algorithm portion of the digest. This will panic if +// the underlying digest is not in a valid format. +func (d Digest) Algorithm() Algorithm { + return Algorithm(d[:d.sepIndex()]) +} + +// Verifier returns a writer object that can be used to verify a stream of +// content against the digest. If the digest is invalid, the method will panic. +func (d Digest) Verifier() Verifier { + return hashVerifier{ + hash: d.Algorithm().Hash(), + digest: d, + } +} + +// Encoded returns the encoded portion of the digest. This will panic if the +// underlying digest is not in a valid format. +func (d Digest) Encoded() string { + return string(d[d.sepIndex()+1:]) +} + +// Hex is deprecated. Please use Digest.Encoded. +func (d Digest) Hex() string { + return d.Encoded() +} + +func (d Digest) String() string { + return string(d) +} + +func (d Digest) sepIndex() int { + i := strings.Index(string(d), ":") + + if i < 0 { + panic(fmt.Sprintf("no ':' separator in digest %q", d)) + } + + return i +} diff --git a/vendor/github.com/opencontainers/go-digest/digester.go b/vendor/github.com/opencontainers/go-digest/digester.go new file mode 100644 index 0000000000..36fa2728ef --- /dev/null +++ b/vendor/github.com/opencontainers/go-digest/digester.go @@ -0,0 +1,39 @@ +// Copyright 2017 Docker, Inc. +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// https://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package digest + +import "hash" + +// Digester calculates the digest of written data. Writes should go directly +// to the return value of Hash, while calling Digest will return the current +// value of the digest. +type Digester interface { + Hash() hash.Hash // provides direct access to underlying hash instance. + Digest() Digest +} + +// digester provides a simple digester definition that embeds a hasher. +type digester struct { + alg Algorithm + hash hash.Hash +} + +func (d *digester) Hash() hash.Hash { + return d.hash +} + +func (d *digester) Digest() Digest { + return NewDigest(d.alg, d.hash) +} diff --git a/vendor/github.com/opencontainers/go-digest/doc.go b/vendor/github.com/opencontainers/go-digest/doc.go new file mode 100644 index 0000000000..491ea1ef1f --- /dev/null +++ b/vendor/github.com/opencontainers/go-digest/doc.go @@ -0,0 +1,56 @@ +// Copyright 2017 Docker, Inc. +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// https://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// Package digest provides a generalized type to opaquely represent message +// digests and their operations within the registry. The Digest type is +// designed to serve as a flexible identifier in a content-addressable system. +// More importantly, it provides tools and wrappers to work with +// hash.Hash-based digests with little effort. +// +// Basics +// +// The format of a digest is simply a string with two parts, dubbed the +// "algorithm" and the "digest", separated by a colon: +// +// : +// +// An example of a sha256 digest representation follows: +// +// sha256:7173b809ca12ec5dee4506cd86be934c4596dd234ee82c0662eac04a8c2c71dc +// +// In this case, the string "sha256" is the algorithm and the hex bytes are +// the "digest". +// +// Because the Digest type is simply a string, once a valid Digest is +// obtained, comparisons are cheap, quick and simple to express with the +// standard equality operator. +// +// Verification +// +// The main benefit of using the Digest type is simple verification against a +// given digest. The Verifier interface, modeled after the stdlib hash.Hash +// interface, provides a common write sink for digest verification. After +// writing is complete, calling the Verifier.Verified method will indicate +// whether or not the stream of bytes matches the target digest. +// +// Missing Features +// +// In addition to the above, we intend to add the following features to this +// package: +// +// 1. A Digester type that supports write sink digest calculation. +// +// 2. Suspend and resume of ongoing digest calculations to support efficient digest verification in the registry. +// +package digest diff --git a/vendor/github.com/opencontainers/go-digest/verifiers.go b/vendor/github.com/opencontainers/go-digest/verifiers.go new file mode 100644 index 0000000000..32125e9187 --- /dev/null +++ b/vendor/github.com/opencontainers/go-digest/verifiers.go @@ -0,0 +1,45 @@ +// Copyright 2017 Docker, Inc. +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// https://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package digest + +import ( + "hash" + "io" +) + +// Verifier presents a general verification interface to be used with message +// digests and other byte stream verifications. Users instantiate a Verifier +// from one of the various methods, write the data under test to it then check +// the result with the Verified method. +type Verifier interface { + io.Writer + + // Verified will return true if the content written to Verifier matches + // the digest. + Verified() bool +} + +type hashVerifier struct { + digest Digest + hash hash.Hash +} + +func (hv hashVerifier) Write(p []byte) (n int, err error) { + return hv.hash.Write(p) +} + +func (hv hashVerifier) Verified() bool { + return hv.digest == NewDigest(hv.digest.Algorithm(), hv.hash) +} diff --git a/vendor/github.com/opencontainers/runc/libcontainer/system/linux.go b/vendor/github.com/opencontainers/runc/libcontainer/system/linux.go new file mode 100644 index 0000000000..4837085a7f --- /dev/null +++ b/vendor/github.com/opencontainers/runc/libcontainer/system/linux.go @@ -0,0 +1,136 @@ +// +build linux + +package system + +import ( + "bufio" + "fmt" + "os" + "os/exec" + "syscall" // only for exec + "unsafe" + + "golang.org/x/sys/unix" +) + +// If arg2 is nonzero, set the "child subreaper" attribute of the +// calling process; if arg2 is zero, unset the attribute. When a +// process is marked as a child subreaper, all of the children +// that it creates, and their descendants, will be marked as +// having a subreaper. In effect, a subreaper fulfills the role +// of init(1) for its descendant processes. Upon termination of +// a process that is orphaned (i.e., its immediate parent has +// already terminated) and marked as having a subreaper, the +// nearest still living ancestor subreaper will receive a SIGCHLD +// signal and be able to wait(2) on the process to discover its +// termination status. +const PR_SET_CHILD_SUBREAPER = 36 + +type ParentDeathSignal int + +func (p ParentDeathSignal) Restore() error { + if p == 0 { + return nil + } + current, err := GetParentDeathSignal() + if err != nil { + return err + } + if p == current { + return nil + } + return p.Set() +} + +func (p ParentDeathSignal) Set() error { + return SetParentDeathSignal(uintptr(p)) +} + +func Execv(cmd string, args []string, env []string) error { + name, err := exec.LookPath(cmd) + if err != nil { + return err + } + + return syscall.Exec(name, args, env) +} + +func Prlimit(pid, resource int, limit unix.Rlimit) error { + _, _, err := unix.RawSyscall6(unix.SYS_PRLIMIT64, uintptr(pid), uintptr(resource), uintptr(unsafe.Pointer(&limit)), uintptr(unsafe.Pointer(&limit)), 0, 0) + if err != 0 { + return err + } + return nil +} + +func SetParentDeathSignal(sig uintptr) error { + if err := unix.Prctl(unix.PR_SET_PDEATHSIG, sig, 0, 0, 0); err != nil { + return err + } + return nil +} + +func GetParentDeathSignal() (ParentDeathSignal, error) { + var sig int + if err := unix.Prctl(unix.PR_GET_PDEATHSIG, uintptr(unsafe.Pointer(&sig)), 0, 0, 0); err != nil { + return -1, err + } + return ParentDeathSignal(sig), nil +} + +func SetKeepCaps() error { + if err := unix.Prctl(unix.PR_SET_KEEPCAPS, 1, 0, 0, 0); err != nil { + return err + } + + return nil +} + +func ClearKeepCaps() error { + if err := unix.Prctl(unix.PR_SET_KEEPCAPS, 0, 0, 0, 0); err != nil { + return err + } + + return nil +} + +func Setctty() error { + if err := unix.IoctlSetInt(0, unix.TIOCSCTTY, 0); err != nil { + return err + } + return nil +} + +// RunningInUserNS detects whether we are currently running in a user namespace. +// Copied from github.com/lxc/lxd/shared/util.go +func RunningInUserNS() bool { + file, err := os.Open("/proc/self/uid_map") + if err != nil { + // This kernel-provided file only exists if user namespaces are supported + return false + } + defer file.Close() + + buf := bufio.NewReader(file) + l, _, err := buf.ReadLine() + if err != nil { + return false + } + + line := string(l) + var a, b, c int64 + fmt.Sscanf(line, "%d %d %d", &a, &b, &c) + /* + * We assume we are in the initial user namespace if we have a full + * range - 4294967295 uids starting at uid 0. + */ + if a == 0 && b == 0 && c == 4294967295 { + return false + } + return true +} + +// SetSubreaper sets the value i as the subreaper setting for the calling process +func SetSubreaper(i int) error { + return unix.Prctl(PR_SET_CHILD_SUBREAPER, uintptr(i), 0, 0, 0) +} diff --git a/vendor/github.com/opencontainers/runc/libcontainer/system/proc.go b/vendor/github.com/opencontainers/runc/libcontainer/system/proc.go new file mode 100644 index 0000000000..79232a4371 --- /dev/null +++ b/vendor/github.com/opencontainers/runc/libcontainer/system/proc.go @@ -0,0 +1,113 @@ +package system + +import ( + "fmt" + "io/ioutil" + "path/filepath" + "strconv" + "strings" +) + +// State is the status of a process. +type State rune + +const ( // Only values for Linux 3.14 and later are listed here + Dead State = 'X' + DiskSleep State = 'D' + Running State = 'R' + Sleeping State = 'S' + Stopped State = 'T' + TracingStop State = 't' + Zombie State = 'Z' +) + +// String forms of the state from proc(5)'s documentation for +// /proc/[pid]/status' "State" field. +func (s State) String() string { + switch s { + case Dead: + return "dead" + case DiskSleep: + return "disk sleep" + case Running: + return "running" + case Sleeping: + return "sleeping" + case Stopped: + return "stopped" + case TracingStop: + return "tracing stop" + case Zombie: + return "zombie" + default: + return fmt.Sprintf("unknown (%c)", s) + } +} + +// Stat_t represents the information from /proc/[pid]/stat, as +// described in proc(5) with names based on the /proc/[pid]/status +// fields. +type Stat_t struct { + // PID is the process ID. + PID uint + + // Name is the command run by the process. + Name string + + // State is the state of the process. + State State + + // StartTime is the number of clock ticks after system boot (since + // Linux 2.6). + StartTime uint64 +} + +// Stat returns a Stat_t instance for the specified process. +func Stat(pid int) (stat Stat_t, err error) { + bytes, err := ioutil.ReadFile(filepath.Join("/proc", strconv.Itoa(pid), "stat")) + if err != nil { + return stat, err + } + return parseStat(string(bytes)) +} + +// GetProcessStartTime is deprecated. Use Stat(pid) and +// Stat_t.StartTime instead. +func GetProcessStartTime(pid int) (string, error) { + stat, err := Stat(pid) + if err != nil { + return "", err + } + return fmt.Sprintf("%d", stat.StartTime), nil +} + +func parseStat(data string) (stat Stat_t, err error) { + // From proc(5), field 2 could contain space and is inside `(` and `)`. + // The following is an example: + // 89653 (gunicorn: maste) S 89630 89653 89653 0 -1 4194560 29689 28896 0 3 146 32 76 19 20 0 1 0 2971844 52965376 3920 18446744073709551615 1 1 0 0 0 0 0 16781312 137447943 0 0 0 17 1 0 0 0 0 0 0 0 0 0 0 0 0 0 + i := strings.LastIndex(data, ")") + if i <= 2 || i >= len(data)-1 { + return stat, fmt.Errorf("invalid stat data: %q", data) + } + + parts := strings.SplitN(data[:i], "(", 2) + if len(parts) != 2 { + return stat, fmt.Errorf("invalid stat data: %q", data) + } + + stat.Name = parts[1] + _, err = fmt.Sscanf(parts[0], "%d", &stat.PID) + if err != nil { + return stat, err + } + + // parts indexes should be offset by 3 from the field number given + // proc(5), because parts is zero-indexed and we've removed fields + // one (PID) and two (Name) in the paren-split. + parts = strings.Split(data[i+2:], " ") + var state int + fmt.Sscanf(parts[3-3], "%c", &state) + stat.State = State(state) + fmt.Sscanf(parts[22-3], "%d", &stat.StartTime) + return stat, nil +} diff --git a/vendor/github.com/opencontainers/runc/libcontainer/system/syscall_linux_386.go b/vendor/github.com/opencontainers/runc/libcontainer/system/syscall_linux_386.go new file mode 100644 index 0000000000..3f7235ed15 --- /dev/null +++ b/vendor/github.com/opencontainers/runc/libcontainer/system/syscall_linux_386.go @@ -0,0 +1,25 @@ +// +build linux,386 + +package system + +import ( + "golang.org/x/sys/unix" +) + +// Setuid sets the uid of the calling thread to the specified uid. +func Setuid(uid int) (err error) { + _, _, e1 := unix.RawSyscall(unix.SYS_SETUID32, uintptr(uid), 0, 0) + if e1 != 0 { + err = e1 + } + return +} + +// Setgid sets the gid of the calling thread to the specified gid. +func Setgid(gid int) (err error) { + _, _, e1 := unix.RawSyscall(unix.SYS_SETGID32, uintptr(gid), 0, 0) + if e1 != 0 { + err = e1 + } + return +} diff --git a/vendor/github.com/opencontainers/runc/libcontainer/system/syscall_linux_64.go b/vendor/github.com/opencontainers/runc/libcontainer/system/syscall_linux_64.go new file mode 100644 index 0000000000..d7891a2ffa --- /dev/null +++ b/vendor/github.com/opencontainers/runc/libcontainer/system/syscall_linux_64.go @@ -0,0 +1,25 @@ +// +build linux,arm64 linux,amd64 linux,ppc linux,ppc64 linux,ppc64le linux,s390x + +package system + +import ( + "golang.org/x/sys/unix" +) + +// Setuid sets the uid of the calling thread to the specified uid. +func Setuid(uid int) (err error) { + _, _, e1 := unix.RawSyscall(unix.SYS_SETUID, uintptr(uid), 0, 0) + if e1 != 0 { + err = e1 + } + return +} + +// Setgid sets the gid of the calling thread to the specified gid. +func Setgid(gid int) (err error) { + _, _, e1 := unix.RawSyscall(unix.SYS_SETGID, uintptr(gid), 0, 0) + if e1 != 0 { + err = e1 + } + return +} diff --git a/vendor/github.com/opencontainers/runc/libcontainer/system/syscall_linux_arm.go b/vendor/github.com/opencontainers/runc/libcontainer/system/syscall_linux_arm.go new file mode 100644 index 0000000000..31ff3deb13 --- /dev/null +++ b/vendor/github.com/opencontainers/runc/libcontainer/system/syscall_linux_arm.go @@ -0,0 +1,25 @@ +// +build linux,arm + +package system + +import ( + "golang.org/x/sys/unix" +) + +// Setuid sets the uid of the calling thread to the specified uid. +func Setuid(uid int) (err error) { + _, _, e1 := unix.RawSyscall(unix.SYS_SETUID32, uintptr(uid), 0, 0) + if e1 != 0 { + err = e1 + } + return +} + +// Setgid sets the gid of the calling thread to the specified gid. +func Setgid(gid int) (err error) { + _, _, e1 := unix.RawSyscall(unix.SYS_SETGID32, uintptr(gid), 0, 0) + if e1 != 0 { + err = e1 + } + return +} diff --git a/vendor/github.com/opencontainers/runc/libcontainer/system/sysconfig.go b/vendor/github.com/opencontainers/runc/libcontainer/system/sysconfig.go new file mode 100644 index 0000000000..b3a07cba3e --- /dev/null +++ b/vendor/github.com/opencontainers/runc/libcontainer/system/sysconfig.go @@ -0,0 +1,12 @@ +// +build cgo,linux cgo,freebsd + +package system + +/* +#include +*/ +import "C" + +func GetClockTicks() int { + return int(C.sysconf(C._SC_CLK_TCK)) +} diff --git a/vendor/github.com/opencontainers/runc/libcontainer/system/sysconfig_notcgo.go b/vendor/github.com/opencontainers/runc/libcontainer/system/sysconfig_notcgo.go new file mode 100644 index 0000000000..d93b5d5fdf --- /dev/null +++ b/vendor/github.com/opencontainers/runc/libcontainer/system/sysconfig_notcgo.go @@ -0,0 +1,15 @@ +// +build !cgo windows + +package system + +func GetClockTicks() int { + // TODO figure out a better alternative for platforms where we're missing cgo + // + // TODO Windows. This could be implemented using Win32 QueryPerformanceFrequency(). + // https://msdn.microsoft.com/en-us/library/windows/desktop/ms644905(v=vs.85).aspx + // + // An example of its usage can be found here. + // https://msdn.microsoft.com/en-us/library/windows/desktop/dn553408(v=vs.85).aspx + + return 100 +} diff --git a/vendor/github.com/opencontainers/runc/libcontainer/system/unsupported.go b/vendor/github.com/opencontainers/runc/libcontainer/system/unsupported.go new file mode 100644 index 0000000000..e7cfd62b29 --- /dev/null +++ b/vendor/github.com/opencontainers/runc/libcontainer/system/unsupported.go @@ -0,0 +1,9 @@ +// +build !linux + +package system + +// RunningInUserNS is a stub for non-Linux systems +// Always returns false +func RunningInUserNS() bool { + return false +} diff --git a/vendor/github.com/opencontainers/runc/libcontainer/system/xattrs_linux.go b/vendor/github.com/opencontainers/runc/libcontainer/system/xattrs_linux.go new file mode 100644 index 0000000000..a6823fc99b --- /dev/null +++ b/vendor/github.com/opencontainers/runc/libcontainer/system/xattrs_linux.go @@ -0,0 +1,35 @@ +package system + +import "golang.org/x/sys/unix" + +// Returns a []byte slice if the xattr is set and nil otherwise +// Requires path and its attribute as arguments +func Lgetxattr(path string, attr string) ([]byte, error) { + var sz int + // Start with a 128 length byte array + dest := make([]byte, 128) + sz, errno := unix.Lgetxattr(path, attr, dest) + + switch { + case errno == unix.ENODATA: + return nil, errno + case errno == unix.ENOTSUP: + return nil, errno + case errno == unix.ERANGE: + // 128 byte array might just not be good enough, + // A dummy buffer is used to get the real size + // of the xattrs on disk + sz, errno = unix.Lgetxattr(path, attr, []byte{}) + if errno != nil { + return nil, errno + } + dest = make([]byte, sz) + sz, errno = unix.Lgetxattr(path, attr, dest) + if errno != nil { + return nil, errno + } + case errno != nil: + return nil, errno + } + return dest[:sz], nil +}