From c3b4a588c9ad4dc5ec0a29b6ea1ee269558b11d9 Mon Sep 17 00:00:00 2001 From: Petr Fedchenkov Date: Tue, 13 Dec 2022 22:04:29 +0300 Subject: [PATCH] Fix handling of platform flag (#3880) * Update of buildkit to the last version Commit contains the version of buildkit from output of `go list -m -json github.com/moby/buildkit@c0ac5e8b9b51603c5a93795fcf1373d6d44d3a85`: go get -u github.com/moby/buildkit@v0.11.0-rc1.0.20221213132957-c0ac5e8b9b51 go mod tidy go mod vendor Signed-off-by: Petr Fedchenkov * Fix handling of platform flag In case of 'FROM --platform' defined I can see 'ERROR: no match for platform in manifest: not found'. The problem was fixed on buildkit side Signed-off-by: Petr Fedchenkov Signed-off-by: Petr Fedchenkov --- src/cmd/linuxkit/go.mod | 70 +- src/cmd/linuxkit/go.sum | 131 +- src/cmd/linuxkit/pkg_build.go | 6 +- .../Microsoft/go-winio/backuptar/noop.go | 4 + .../Microsoft/go-winio/backuptar/strconv.go | 68 + .../Microsoft/go-winio/backuptar/tar.go | 517 ++ .../pkg/security/grantvmgroupaccess.go | 160 + .../go-winio/pkg/security/syscall_windows.go | 7 + .../go-winio/pkg/security/zsyscall_windows.go | 70 + .../github.com/Microsoft/go-winio/vhd/vhd.go | 350 + .../Microsoft/go-winio/vhd/zvhd_windows.go | 106 + .../Microsoft/hcsshim/.gitattributes | 1 + .../github.com/Microsoft/hcsshim/.gitignore | 38 + .../Microsoft/hcsshim/.golangci.yml | 99 + .../github.com/Microsoft/hcsshim/CODEOWNERS | 1 + .../github.com/Microsoft/hcsshim/LICENSE | 21 + .../github.com/Microsoft/hcsshim/Makefile | 87 + .../Microsoft/hcsshim/Protobuild.toml | 49 + .../github.com/Microsoft/hcsshim/README.md | 120 + .../hcsshim/computestorage/attach.go | 38 + .../hcsshim/computestorage/destroy.go | 26 + .../hcsshim/computestorage/detach.go | 26 + .../hcsshim/computestorage/export.go | 46 + .../hcsshim/computestorage/format.go | 26 + .../hcsshim/computestorage/helpers.go | 193 + .../hcsshim/computestorage/import.go | 41 + .../hcsshim/computestorage/initialize.go | 38 + .../Microsoft/hcsshim/computestorage/mount.go | 27 + .../Microsoft/hcsshim/computestorage/setup.go | 74 + .../hcsshim/computestorage/storage.go | 50 + .../computestorage/zsyscall_windows.go | 319 + .../github.com/Microsoft/hcsshim/container.go | 223 + .../github.com/Microsoft/hcsshim/errors.go | 245 + .../Microsoft/hcsshim/functional_tests.ps1 | 12 + .../github.com/Microsoft/hcsshim/hcsshim.go | 28 + .../Microsoft/hcsshim/hnsendpoint.go | 118 + .../Microsoft/hcsshim/hnsglobals.go | 16 + .../Microsoft/hcsshim/hnsnetwork.go | 36 + .../github.com/Microsoft/hcsshim/hnspolicy.go | 60 + .../Microsoft/hcsshim/hnspolicylist.go | 47 + .../Microsoft/hcsshim/hnssupport.go | 13 + .../github.com/Microsoft/hcsshim/interface.go | 114 + .../Microsoft/hcsshim/internal/cow/cow.go | 91 + .../hcsshim/internal/hcs/callback.go | 161 + .../Microsoft/hcsshim/internal/hcs/errors.go | 343 + .../Microsoft/hcsshim/internal/hcs/process.go | 557 ++ .../hcsshim/internal/hcs/schema1/schema1.go | 250 + .../internal/hcs/schema2/attachment.go | 36 + .../hcsshim/internal/hcs/schema2/battery.go | 13 + .../hcs/schema2/cache_query_stats_response.go | 18 + .../hcsshim/internal/hcs/schema2/chipset.go | 27 + .../internal/hcs/schema2/close_handle.go | 14 + .../hcsshim/internal/hcs/schema2/com_port.go | 17 + .../internal/hcs/schema2/compute_system.go | 26 + .../internal/hcs/schema2/configuration.go | 72 + .../internal/hcs/schema2/console_size.go | 16 + .../hcsshim/internal/hcs/schema2/container.go | 36 + ...r_credential_guard_add_instance_request.go | 16 + ...edential_guard_hv_socket_service_config.go | 15 + .../container_credential_guard_instance.go | 16 + ...ainer_credential_guard_modify_operation.go | 17 + ...iner_credential_guard_operation_request.go | 15 + ...redential_guard_remove_instance_request.go | 14 + .../container_credential_guard_state.go | 25 + .../container_credential_guard_system_info.go | 14 + .../schema2/container_memory_information.go | 25 + .../hcsshim/internal/hcs/schema2/cpu_group.go | 15 + .../hcs/schema2/cpu_group_affinity.go | 15 + .../internal/hcs/schema2/cpu_group_config.go | 18 + .../hcs/schema2/cpu_group_configurations.go | 15 + .../hcs/schema2/cpu_group_operations.go | 18 + .../hcs/schema2/cpu_group_property.go | 15 + .../hcs/schema2/create_group_operation.go | 17 + .../hcs/schema2/delete_group_operation.go | 15 + .../hcsshim/internal/hcs/schema2/device.go | 27 + .../hcsshim/internal/hcs/schema2/devices.go | 46 + .../hcs/schema2/enhanced_mode_video.go | 14 + .../hcs/schema2/flexible_io_device.go | 18 + .../internal/hcs/schema2/guest_connection.go | 19 + .../hcs/schema2/guest_connection_info.go | 21 + .../hcs/schema2/guest_crash_reporting.go | 14 + .../hcsshim/internal/hcs/schema2/guest_os.go | 14 + .../internal/hcs/schema2/guest_state.go | 22 + .../schema2/host_processor_modify_request.go | 16 + .../internal/hcs/schema2/hosted_system.go | 16 + .../hcsshim/internal/hcs/schema2/hv_socket.go | 16 + .../internal/hcs/schema2/hv_socket_2.go | 15 + .../internal/hcs/schema2/hv_socket_address.go | 17 + .../hcs/schema2/hv_socket_service_config.go | 28 + .../hcs/schema2/hv_socket_system_config.go | 22 + .../hcs/schema2/interrupt_moderation_mode.go | 42 + .../internal/hcs/schema2/iov_settings.go | 22 + .../hcsshim/internal/hcs/schema2/keyboard.go | 13 + .../hcsshim/internal/hcs/schema2/layer.go | 21 + .../hcs/schema2/linux_kernel_direct.go | 18 + .../internal/hcs/schema2/logical_processor.go | 18 + .../internal/hcs/schema2/mapped_directory.go | 20 + .../internal/hcs/schema2/mapped_pipe.go | 18 + .../hcsshim/internal/hcs/schema2/memory.go | 14 + .../hcsshim/internal/hcs/schema2/memory_2.go | 49 + .../hcs/schema2/memory_information_for_vm.go | 18 + .../internal/hcs/schema2/memory_stats.go | 19 + .../model_container_definition_device.go | 14 + .../hcs/schema2/model_device_category.go | 15 + .../hcs/schema2/model_device_extension.go | 15 + .../hcs/schema2/model_device_instance.go | 17 + .../hcs/schema2/model_device_namespace.go | 16 + .../hcs/schema2/model_interface_class.go | 16 + .../internal/hcs/schema2/model_namespace.go | 15 + .../hcs/schema2/model_object_directory.go | 18 + .../hcs/schema2/model_object_namespace.go | 16 + .../hcs/schema2/model_object_symlink.go | 18 + .../hcs/schema2/modification_request.go | 15 + .../hcs/schema2/modify_setting_request.go | 20 + .../hcsshim/internal/hcs/schema2/mouse.go | 13 + .../internal/hcs/schema2/network_adapter.go | 17 + .../internal/hcs/schema2/networking.go | 23 + .../hcs/schema2/pause_notification.go | 15 + .../internal/hcs/schema2/pause_options.go | 17 + .../hcsshim/internal/hcs/schema2/plan9.go | 14 + .../internal/hcs/schema2/plan9_share.go | 34 + .../internal/hcs/schema2/process_details.go | 33 + .../hcs/schema2/process_modify_request.go | 19 + .../hcs/schema2/process_parameters.go | 46 + .../internal/hcs/schema2/process_status.go | 21 + .../hcsshim/internal/hcs/schema2/processor.go | 18 + .../internal/hcs/schema2/processor_2.go | 23 + .../internal/hcs/schema2/processor_stats.go | 19 + .../hcs/schema2/processor_topology.go | 15 + .../internal/hcs/schema2/properties.go | 54 + .../internal/hcs/schema2/property_query.go | 15 + .../internal/hcs/schema2/property_type.go | 26 + .../hcs/schema2/rdp_connection_options.go | 16 + .../internal/hcs/schema2/registry_changes.go | 16 + .../internal/hcs/schema2/registry_key.go | 18 + .../internal/hcs/schema2/registry_value.go | 30 + .../internal/hcs/schema2/restore_state.go | 19 + .../internal/hcs/schema2/save_options.go | 19 + .../hcsshim/internal/hcs/schema2/scsi.go | 16 + .../hcs/schema2/service_properties.go | 18 + .../schema2/shared_memory_configuration.go | 14 + .../hcs/schema2/shared_memory_region.go | 22 + .../hcs/schema2/shared_memory_region_info.go | 16 + .../internal/hcs/schema2/silo_properties.go | 17 + .../internal/hcs/schema2/statistics.go | 29 + .../hcsshim/internal/hcs/schema2/storage.go | 21 + .../internal/hcs/schema2/storage_qo_s.go | 16 + .../internal/hcs/schema2/storage_stats.go | 21 + .../hcsshim/internal/hcs/schema2/topology.go | 16 + .../hcsshim/internal/hcs/schema2/uefi.go | 20 + .../internal/hcs/schema2/uefi_boot_entry.go | 22 + .../hcsshim/internal/hcs/schema2/version.go | 16 + .../internal/hcs/schema2/video_monitor.go | 18 + .../internal/hcs/schema2/virtual_machine.go | 32 + .../internal/hcs/schema2/virtual_node_info.go | 20 + .../hcs/schema2/virtual_p_mem_controller.go | 20 + .../hcs/schema2/virtual_p_mem_device.go | 18 + .../hcs/schema2/virtual_p_mem_mapping.go | 15 + .../hcs/schema2/virtual_pci_device.go | 16 + .../hcs/schema2/virtual_pci_function.go | 18 + .../internal/hcs/schema2/virtual_smb.go | 16 + .../internal/hcs/schema2/virtual_smb_share.go | 20 + .../hcs/schema2/virtual_smb_share_options.go | 62 + .../hcsshim/internal/hcs/schema2/vm_memory.go | 26 + .../hcs/schema2/vm_processor_limits.go | 22 + .../hcs/schema2/windows_crash_reporting.go | 16 + .../Microsoft/hcsshim/internal/hcs/service.go | 49 + .../Microsoft/hcsshim/internal/hcs/system.go | 807 ++ .../Microsoft/hcsshim/internal/hcs/utils.go | 62 + .../hcsshim/internal/hcs/waithelper.go | 68 + .../hcsshim/internal/hcserror/hcserror.go | 47 + .../Microsoft/hcsshim/internal/hns/hns.go | 23 + .../hcsshim/internal/hns/hnsendpoint.go | 338 + .../hcsshim/internal/hns/hnsfuncs.go | 49 + .../hcsshim/internal/hns/hnsglobals.go | 28 + .../hcsshim/internal/hns/hnsnetwork.go | 141 + .../hcsshim/internal/hns/hnspolicy.go | 110 + .../hcsshim/internal/hns/hnspolicylist.go | 201 + .../hcsshim/internal/hns/hnssupport.go | 49 + .../hcsshim/internal/hns/namespace.go | 111 + .../hcsshim/internal/hns/zsyscall_windows.go | 76 + .../hcsshim/internal/interop/interop.go | 23 + .../internal/interop/zsyscall_windows.go | 48 + .../hcsshim/internal/jobobject/iocp.go | 111 + .../hcsshim/internal/jobobject/jobobject.go | 538 ++ .../hcsshim/internal/jobobject/limits.go | 315 + .../Microsoft/hcsshim/internal/log/g.go | 23 + .../hcsshim/internal/logfields/fields.go | 32 + .../hcsshim/internal/longpath/longpath.go | 24 + .../hcsshim/internal/mergemaps/merge.go | 52 + .../Microsoft/hcsshim/internal/oc/exporter.go | 43 + .../Microsoft/hcsshim/internal/oc/span.go | 17 + .../Microsoft/hcsshim/internal/queue/mq.go | 92 + .../hcsshim/internal/safefile/safeopen.go | 375 + .../hcsshim/internal/timeout/timeout.go | 74 + .../hcsshim/internal/vmcompute/vmcompute.go | 610 ++ .../internal/vmcompute/zsyscall_windows.go | 581 ++ .../hcsshim/internal/wclayer/activatelayer.go | 27 + .../hcsshim/internal/wclayer/baselayer.go | 182 + .../hcsshim/internal/wclayer/createlayer.go | 27 + .../internal/wclayer/createscratchlayer.go | 34 + .../internal/wclayer/deactivatelayer.go | 24 + .../hcsshim/internal/wclayer/destroylayer.go | 25 + .../internal/wclayer/expandscratchsize.go | 140 + .../hcsshim/internal/wclayer/exportlayer.go | 94 + .../internal/wclayer/getlayermountpath.go | 50 + .../internal/wclayer/getsharedbaseimages.go | 29 + .../hcsshim/internal/wclayer/grantvmaccess.go | 26 + .../hcsshim/internal/wclayer/importlayer.go | 166 + .../hcsshim/internal/wclayer/layerexists.go | 28 + .../hcsshim/internal/wclayer/layerid.go | 22 + .../hcsshim/internal/wclayer/layerutils.go | 97 + .../hcsshim/internal/wclayer/legacy.go | 811 ++ .../hcsshim/internal/wclayer/nametoguid.go | 29 + .../hcsshim/internal/wclayer/preparelayer.go | 44 + .../hcsshim/internal/wclayer/processimage.go | 41 + .../internal/wclayer/unpreparelayer.go | 25 + .../hcsshim/internal/wclayer/wclayer.go | 35 + .../internal/wclayer/zsyscall_windows.go | 569 ++ .../hcsshim/internal/winapi/console.go | 44 + .../hcsshim/internal/winapi/devices.go | 13 + .../hcsshim/internal/winapi/errors.go | 15 + .../hcsshim/internal/winapi/filesystem.go | 110 + .../hcsshim/internal/winapi/jobobject.go | 218 + .../hcsshim/internal/winapi/logon.go | 30 + .../hcsshim/internal/winapi/memory.go | 4 + .../Microsoft/hcsshim/internal/winapi/net.go | 3 + .../Microsoft/hcsshim/internal/winapi/path.go | 11 + .../hcsshim/internal/winapi/process.go | 65 + .../hcsshim/internal/winapi/processor.go | 7 + .../hcsshim/internal/winapi/system.go | 53 + .../hcsshim/internal/winapi/thread.go | 12 + .../hcsshim/internal/winapi/utils.go | 80 + .../hcsshim/internal/winapi/winapi.go | 5 + .../internal/winapi/zsyscall_windows.go | 354 + .../github.com/Microsoft/hcsshim/layer.go | 107 + .../hcsshim/osversion/osversion_windows.go | 50 + .../hcsshim/osversion/windowsbuilds.go | 50 + .../hcsshim/pkg/ociwclayer/export.go | 88 + .../hcsshim/pkg/ociwclayer/import.go | 148 + .../github.com/Microsoft/hcsshim/process.go | 98 + .../Microsoft/hcsshim/zsyscall_windows.go | 54 + .../github.com/containerd/cgroups/LICENSE | 201 + .../containerd/cgroups/stats/v1/doc.go | 17 + .../containerd/cgroups/stats/v1/metrics.pb.go | 6125 +++++++++++++ .../cgroups/stats/v1/metrics.pb.txt | 790 ++ .../containerd/cgroups/stats/v1/metrics.proto | 158 + .../containerd/containerd/archive/tar.go | 787 ++ .../containerd/archive/tar_freebsd.go | 46 + .../containerd/archive/tar_mostunix.go | 56 + .../containerd/containerd/archive/tar_opts.go | 85 + .../containerd/archive/tar_opts_linux.go | 57 + .../containerd/archive/tar_opts_windows.go | 70 + .../containerd/containerd/archive/tar_unix.go | 208 + .../containerd/archive/tar_windows.go | 122 + .../containerd/containerd/archive/time.go | 54 + .../containerd/archive/time_unix.go | 39 + .../containerd/archive/time_windows.go | 42 + .../containerd/containerd/content/helpers.go | 68 +- .../containerd/content/local/store.go | 1 - .../containerd/containerd/filters/filter.go | 1 - .../containerd/containerd/filters/parser.go | 1 - .../containerd/containerd/filters/quote.go | 8 +- .../containerd/images/converter/converter.go | 126 + .../containerd/images/converter/default.go | 453 + .../containerd/containerd/leases/lease.go | 9 +- .../containerd/containerd/namespaces/store.go | 2 - .../containerd/pkg/userns/userns_linux.go | 62 + .../pkg/userns/userns_unsupported.go | 26 + .../containerd/platforms/platforms.go | 38 +- .../containerd/remotes/docker/pusher.go | 157 +- .../containerd/remotes/docker/resolver.go | 15 + .../containerd/containerd/remotes/handlers.go | 4 +- .../containerd/containerd/sys/epoll.go | 34 + .../containerd/containerd/sys/fds.go | 35 + .../containerd/containerd/sys/filesys_unix.go | 32 + .../containerd/sys/filesys_windows.go | 345 + .../containerd/containerd/sys/oom_linux.go | 82 + .../containerd/sys/oom_unsupported.go | 49 + .../containerd/containerd/sys/socket_unix.go | 81 + .../containerd/sys/socket_windows.go | 30 + .../containerd/sys/userns_deprecated.go | 23 + .../containerd/containerd/version/version.go | 2 +- .../containerd/continuity/fs/copy.go | 195 + .../continuity/fs/copy_irregular_freebsd.go | 36 + .../continuity/fs/copy_irregular_unix.go | 40 + .../containerd/continuity/fs/copy_linux.go | 145 + .../containerd/continuity/fs/copy_unix.go | 106 + .../containerd/continuity/fs/copy_windows.go | 90 + .../containerd/continuity/fs/diff.go | 325 + .../containerd/continuity/fs/diff_unix.go | 75 + .../containerd/continuity/fs/diff_windows.go | 48 + .../containerd/continuity/fs/dtype_linux.go | 104 + .../github.com/containerd/continuity/fs/du.go | 38 + .../containerd/continuity/fs/du_unix.go | 119 + .../containerd/continuity/fs/du_windows.go | 83 + .../containerd/continuity/fs/hardlink.go | 43 + .../containerd/continuity/fs/hardlink_unix.go | 34 + .../continuity/fs/hardlink_windows.go | 23 + .../containerd/continuity/fs/path.go | 310 + .../containerd/continuity/fs/stat_atim.go | 45 + .../continuity/fs/stat_darwinbsd.go | 45 + .../containerd/continuity/fs/time.go | 29 + .../containerd/continuity/fs/utimesnanoat.go | 33 + .../github.com/containerd/fifo/.gitattributes | 1 + .../github.com/containerd/fifo/.gitignore | 2 + .../github.com/containerd/fifo/.golangci.yml | 20 + .../vendor/github.com/containerd/fifo/LICENSE | 201 + .../github.com/containerd/fifo/Makefile | 24 + .../github.com/containerd/fifo/errors.go | 28 + .../vendor/github.com/containerd/fifo/fifo.go | 258 + .../containerd/fifo/handle_linux.go | 100 + .../containerd/fifo/handle_nolinux.go | 65 + .../vendor/github.com/containerd/fifo/raw.go | 114 + .../github.com/containerd/fifo/readme.md | 46 + .../github.com/containerd/fifo/utils.go | 35 + .../containerd/nydus-snapshotter/LICENSE | 202 + .../pkg/converter/constant.go | 27 + .../pkg/converter/convert_unix.go | 839 ++ .../pkg/converter/convert_windows.go | 51 + .../pkg/converter/tool/builder.go | 217 + .../nydus-snapshotter/pkg/converter/types.go | 84 + .../nydus-snapshotter/pkg/converter/utils.go | 204 + .../nydus-snapshotter/pkg/errdefs/errors.go | 53 + .../stargz-snapshotter/estargz/build.go | 48 +- .../stargz-snapshotter/estargz/estargz.go | 224 +- .../stargz-snapshotter/estargz/gzip.go | 2 +- .../stargz-snapshotter/estargz/testutil.go | 627 +- .../stargz-snapshotter/estargz/types.go | 31 +- .../vendor/github.com/docker/cli/AUTHORS | 101 +- .../docker/cli/cli/config/config.go | 20 +- .../docker/cli/cli/config/configfile/file.go | 77 +- .../cli/cli/config/configfile/file_unix.go | 2 +- .../cli/config/credentials/native_store.go | 2 +- .../cli/connhelper/commandconn/commandconn.go | 18 +- .../credentials/credentials.go | 8 +- .../credentials/version.go | 16 +- .../vendor/github.com/go-logr/logr/README.md | 4 + .../github.com/go-logr/logr/funcr/funcr.go | 36 +- .../vendor/github.com/go-logr/logr/logr.go | 9 + .../vendor/github.com/gofrs/flock/.travis.yml | 4 +- .../github.com/gofrs/flock/appveyor.yml | 2 +- .../vendor/github.com/gofrs/flock/flock.go | 11 +- .../github.com/gofrs/flock/flock_aix.go | 281 + .../github.com/gofrs/flock/flock_unix.go | 2 +- .../github.com/google/go-cmp/cmp/compare.go | 64 +- .../google/go-cmp/cmp/internal/diff/diff.go | 44 +- .../google/go-cmp/cmp/internal/value/zero.go | 48 - .../github.com/google/go-cmp/cmp/options.go | 10 +- .../github.com/google/go-cmp/cmp/path.go | 20 +- .../google/go-cmp/cmp/report_compare.go | 10 +- .../google/go-cmp/cmp/report_reflect.go | 11 +- .../google/go-cmp/cmp/report_slices.go | 25 +- .../google/go-cmp/cmp/report_text.go | 1 + .../in-toto/in-toto-golang/in_toto/keylib.go | 4 +- .../in-toto/in-toto-golang/in_toto/model.go | 103 +- .../slsa_provenance/v0.2/provenance.go | 66 + .../in-toto/in-toto-golang/pkg/ssl/verify.go | 71 - .../github.com/klauspost/compress/README.md | 31 +- .../klauspost/compress/flate/deflate.go | 9 +- .../klauspost/compress/flate/dict_decoder.go | 24 +- .../klauspost/compress/flate/fast_encoder.go | 59 +- .../compress/flate/huffman_bit_writer.go | 20 +- .../klauspost/compress/flate/huffman_code.go | 15 +- .../klauspost/compress/flate/level1.go | 27 +- .../klauspost/compress/flate/level2.go | 35 +- .../klauspost/compress/flate/level3.go | 41 +- .../klauspost/compress/flate/level4.go | 11 +- .../klauspost/compress/flate/level5.go | 28 +- .../klauspost/compress/flate/level6.go | 30 +- .../klauspost/compress/huff0/decompress.go | 36 +- .../compress/huff0/decompress_amd64.go | 4 + .../compress/huff0/decompress_amd64.s | 1 - .../compress/huff0/decompress_generic.go | 18 +- .../compress/internal/snapref/encode_other.go | 6 +- .../klauspost/compress/zstd/README.md | 2 + .../klauspost/compress/zstd/blockdec.go | 5 +- .../klauspost/compress/zstd/bytebuf.go | 3 +- .../klauspost/compress/zstd/decoder.go | 44 +- .../compress/zstd/decoder_options.go | 44 +- .../klauspost/compress/zstd/enc_best.go | 1 + .../klauspost/compress/zstd/enc_better.go | 23 +- .../klauspost/compress/zstd/enc_dfast.go | 7 +- .../klauspost/compress/zstd/enc_fast.go | 8 +- .../klauspost/compress/zstd/framedec.go | 36 +- .../compress/zstd/fse_decoder_amd64.go | 3 +- .../compress/zstd/fse_decoder_amd64.s | 1 - .../klauspost/compress/zstd/history.go | 25 +- .../klauspost/compress/zstd/seqdec.go | 22 +- .../klauspost/compress/zstd/seqdec_amd64.go | 17 +- .../klauspost/compress/zstd/seqdec_amd64.s | 1 - .../klauspost/compress/zstd/seqdec_generic.go | 4 +- .../github.com/mitchellh/go-ps/Vagrantfile | 86 +- .../api/services/control/control.pb.go | 2918 ++++++- .../api/services/control/control.proto | 57 + .../github.com/moby/buildkit/client/build.go | 2 - .../github.com/moby/buildkit/client/client.go | 4 +- .../moby/buildkit/client/diskusage.go | 2 +- .../github.com/moby/buildkit/client/info.go | 2 +- .../moby/buildkit/client/llb/exec.go | 13 +- .../moby/buildkit/client/llb/source.go | 4 +- .../github.com/moby/buildkit/client/prune.go | 2 +- .../github.com/moby/buildkit/client/solve.go | 229 +- .../moby/buildkit/client/workers.go | 2 +- .../exporter/containerimage/exptypes/parse.go | 56 + .../buildkit/frontend/attestations/parse.go | 19 +- .../{attest => attestations/sbom}/sbom.go | 51 +- .../frontend/dockerfile/builder/build.go | 209 +- .../dockerfile/dockerfile2llb/convert.go | 203 +- .../dockerfile/dockerfile2llb/directives.go | 55 - .../dockerfile/dockerignore/dockerignore.go | 5 +- .../frontend/dockerfile/instructions/bflag.go | 24 +- .../dockerfile/instructions/commands.go | 199 +- .../dockerfile/instructions/errors_unix.go | 4 +- .../dockerfile/instructions/errors_windows.go | 4 +- .../frontend/dockerfile/instructions/parse.go | 23 +- .../frontend/dockerfile/parser/directives.go | 171 + .../dockerfile/parser/line_parsers.go | 7 +- .../frontend/dockerfile/parser/parser.go | 69 +- .../buildkit/frontend/dockerfile/shell/lex.go | 2 +- .../moby/buildkit/frontend/frontend.go | 2 + .../frontend/gateway/client/attestation.go | 19 +- .../frontend/gateway/client/client.go | 4 + .../frontend/gateway/grpcclient/client.go | 20 +- .../frontend/gateway/pb/gateway.pb.go | 557 +- .../frontend/gateway/pb/gateway.proto | 9 +- .../moby/buildkit/identity/randomid.go | 5 +- .../buildkit/session/filesync/filesync.go | 28 +- .../moby/buildkit/solver/cachekey.go | 5 +- .../github.com/moby/buildkit/solver/edge.go | 10 +- .../moby/buildkit/solver/exporter.go | 15 +- .../github.com/moby/buildkit/solver/jobs.go | 79 +- .../moby/buildkit/solver/pb/caps.go | 1 + .../moby/buildkit/solver/pb/generate.go | 2 +- .../moby/buildkit/solver/pb/ops.pb.go | 381 +- .../moby/buildkit/solver/pb/ops.proto | 1 + .../moby/buildkit/solver/progress.go | 17 + .../buildkit/solver/result/attestation.go | 51 +- .../moby/buildkit/solver/result/result.go | 110 +- .../github.com/moby/buildkit/solver/types.go | 23 +- .../util/appdefaults/appdefaults_unix.go | 8 +- .../util/appdefaults/appdefaults_windows.go | 6 +- .../buildkit/util/compression/compression.go | 136 +- .../moby/buildkit/util/compression/estargz.go | 256 + .../moby/buildkit/util/compression/gzip.go | 69 + .../moby/buildkit/util/compression/nydus.go | 141 + .../moby/buildkit/util/compression/parse.go | 12 + .../buildkit/util/compression/uncompressed.go | 61 + .../moby/buildkit/util/compression/zstd.go | 80 + .../buildkit/util/grpcerrors/grpcerrors.go | 17 +- .../moby/buildkit/util/imageutil/schema1.go | 2 +- .../moby/buildkit/util/iohelper/helper.go | 63 + .../buildkit/util/progress/multireader.go | 55 +- .../util/progress/progressui/colors.go | 10 +- .../moby/buildkit/util/sshutil/keyscan.go | 3 +- .../moby/buildkit/util/stack/stack.go | 8 +- .../moby/buildkit/util/stack/stack.pb.go | 317 +- .../moby/buildkit/util/system/atime_unix.go | 21 + .../buildkit/util/system/atime_windows.go | 17 + .../moby/buildkit/util/system/path_windows.go | 7 +- .../util/tracing/otlptracegrpc/client.go | 13 +- .../util/tracing/otlptracegrpc/connection.go | 4 +- .../util/tracing/otlptracegrpc/errors.go | 7 + .../image-spec/identity/chainid.go | 67 + .../image-spec/identity/helpers.go | 40 + .../client_golang/prometheus/collector.go | 6 +- .../client_golang/prometheus/counter.go | 13 +- .../client_golang/prometheus/desc.go | 5 +- .../client_golang/prometheus/doc.go | 93 +- .../client_golang/prometheus/gauge.go | 6 +- .../client_golang/prometheus/get_pid.go | 26 + .../prometheus/get_pid_gopherjs.go | 23 + .../client_golang/prometheus/go_collector.go | 12 +- .../prometheus/go_collector_latest.go | 249 +- .../client_golang/prometheus/histogram.go | 978 ++- .../prometheus/internal/almost_equal.go | 60 + .../prometheus/internal/difflib.go | 654 ++ .../internal/go_collector_options.go | 32 + .../prometheus/internal/go_runtime_metrics.go | 4 +- .../prometheus/internal/metric.go | 28 +- .../client_golang/prometheus/labels.go | 9 +- .../client_golang/prometheus/metric.go | 112 +- .../client_golang/prometheus/num_threads.go | 25 + .../prometheus/num_threads_gopherjs.go | 22 + .../client_golang/prometheus/observer.go | 2 +- .../prometheus/process_collector.go | 10 +- .../prometheus/process_collector_js.go | 26 + .../prometheus/process_collector_other.go | 4 +- .../prometheus/promhttp/delegator.go | 18 +- .../client_golang/prometheus/promhttp/http.go | 20 +- .../prometheus/promhttp/instrument_client.go | 40 +- .../prometheus/promhttp/instrument_server.go | 123 +- .../prometheus/promhttp/option.go | 39 +- .../client_golang/prometheus/registry.go | 152 +- .../client_golang/prometheus/summary.go | 9 +- .../client_golang/prometheus/timer.go | 11 +- .../client_golang/prometheus/value.go | 47 +- .../client_golang/prometheus/vec.go | 88 +- .../client_golang/prometheus/wrap.go | 4 +- .../prometheus/client_model/go/metrics.pb.go | 333 +- .../prometheus/common/expfmt/fuzz.go | 1 + .../common/expfmt/openmetrics_create.go | 4 +- .../prometheus/common/model/time.go | 2 +- .../github.com/prometheus/procfs/.gitignore | 3 +- .../prometheus/procfs/.golangci.yml | 10 +- .../prometheus/procfs/CODE_OF_CONDUCT.md | 4 +- .../prometheus/procfs/CONTRIBUTING.md | 4 +- .../github.com/prometheus/procfs/Makefile | 10 +- .../prometheus/procfs/Makefile.common | 89 +- .../github.com/prometheus/procfs/SECURITY.md | 2 +- .../github.com/prometheus/procfs/arp.go | 45 +- .../github.com/prometheus/procfs/cpuinfo.go | 5 +- .../prometheus/procfs/cpuinfo_armx.go | 1 + .../prometheus/procfs/cpuinfo_mipsx.go | 1 + .../prometheus/procfs/cpuinfo_others.go | 4 +- .../prometheus/procfs/cpuinfo_ppcx.go | 1 + .../prometheus/procfs/cpuinfo_riscvx.go | 1 + .../prometheus/procfs/cpuinfo_s390x.go | 1 + .../prometheus/procfs/cpuinfo_x86.go | 1 + .../prometheus/procfs/fixtures.ttar | 7673 ----------------- .../prometheus/procfs/internal/fs/fs.go | 2 +- .../prometheus/procfs/internal/util/parse.go | 6 +- .../procfs/internal/util/readfile.go | 11 +- .../procfs/internal/util/sysreadfile.go | 8 +- .../internal/util/sysreadfile_compat.go | 3 +- .../github.com/prometheus/procfs/ipvs.go | 3 +- .../prometheus/procfs/kernel_random.go | 1 + .../github.com/prometheus/procfs/loadavg.go | 2 +- .../github.com/prometheus/procfs/mdstat.go | 10 +- .../prometheus/procfs/net_conntrackstat.go | 12 +- .../github.com/prometheus/procfs/net_dev.go | 8 +- .../prometheus/procfs/net_ip_socket.go | 2 +- .../prometheus/procfs/net_protocols.go | 4 +- .../prometheus/procfs/net_softnet.go | 8 +- .../procfs/{xfrm.go => net_xfrm.go} | 9 +- .../github.com/prometheus/procfs/netstat.go | 8 +- .../github.com/prometheus/procfs/proc.go | 10 +- .../prometheus/procfs/proc_cgroup.go | 6 +- .../prometheus/procfs/proc_cgroups.go | 98 + .../prometheus/procfs/proc_environ.go | 2 +- .../prometheus/procfs/proc_fdinfo.go | 3 +- .../prometheus/procfs/proc_limits.go | 2 +- .../github.com/prometheus/procfs/proc_maps.go | 12 +- .../prometheus/procfs/proc_netstat.go | 440 + .../github.com/prometheus/procfs/proc_psi.go | 14 +- .../prometheus/procfs/proc_smaps.go | 23 +- .../github.com/prometheus/procfs/proc_snmp.go | 353 + .../prometheus/procfs/proc_snmp6.go | 381 + .../github.com/prometheus/procfs/proc_stat.go | 11 +- .../prometheus/procfs/proc_status.go | 32 +- .../github.com/prometheus/procfs/proc_sys.go | 51 + .../github.com/prometheus/procfs/schedstat.go | 6 +- .../github.com/prometheus/procfs/slab.go | 2 +- .../github.com/prometheus/procfs/softirqs.go | 160 + .../github.com/prometheus/procfs/stat.go | 10 +- .../vendor/github.com/prometheus/procfs/vm.go | 6 +- .../github.com/prometheus/procfs/zoneinfo.go | 5 +- .../go-securesystemslib/LICENSE | 21 + .../cjson}/canonicaljson.go | 2 +- .../go-securesystemslib/dsse}/sign.go | 61 +- .../go-securesystemslib/dsse/verify.go | 146 + .../github.com/shibumi/go-pathspec/.gitignore | 3 + .../github.com/sirupsen/logrus/README.md | 4 +- .../github.com/sirupsen/logrus/buffer_pool.go | 9 - .../github.com/sirupsen/logrus/entry.go | 21 +- .../github.com/sirupsen/logrus/logger.go | 13 + .../testify/assert/assertion_compare.go | 24 +- .../testify/assert/assertion_format.go | 10 + .../testify/assert/assertion_forward.go | 20 + .../stretchr/testify/assert/assertions.go | 78 +- .../stretchr/testify/require/require.go | 26 + .../testify/require/require_forward.go | 20 + .../tonistiigi/fsutil/diskwriter.go | 40 +- .../x/crypto/pkcs12/internal/rc2/rc2.go | 53 +- .../golang.org/x/crypto/ssh/messages.go | 2 +- .../golang.org/x/net/http2/headermap.go | 18 + .../golang.org/x/net/http2/hpack/encode.go | 5 + .../x/net/http2/hpack/static_table.go | 188 + .../golang.org/x/net/http2/hpack/tables.go | 78 +- .../vendor/golang.org/x/net/http2/server.go | 236 +- .../golang.org/x/net/http2/transport.go | 113 +- .../golang.org/x/sync/errgroup/errgroup.go | 4 +- .../golang.org/x/sys/execabs/execabs_go119.go | 8 +- .../golang.org/x/sys/unix/sockcmsg_unix.go | 14 + .../golang.org/x/sys/unix/syscall_linux.go | 1 + .../x/sys/windows/syscall_windows.go | 1 + .../x/sys/windows/zsyscall_windows.go | 7 + .../vendor/golang.org/x/term/terminal.go | 1 - .../golang.org/x/text/unicode/bidi/trieval.go | 12 - .../linuxkit/vendor/golang.org/x/time/AUTHORS | 3 - .../vendor/golang.org/x/time/CONTRIBUTORS | 3 - .../vendor/golang.org/x/time/rate/rate.go | 117 +- .../grpc/balancer/balancer.go | 55 +- .../grpc/balancer/base/balancer.go | 4 + .../grpc/balancer/conn_state_evaluator.go | 70 + .../grpc/balancer/roundrobin/roundrobin.go | 16 +- .../google.golang.org/grpc/clientconn.go | 7 +- .../google.golang.org/grpc/dialoptions.go | 49 +- .../health/grpc_health_v1/health_grpc.pb.go | 17 + .../balancer/gracefulswitch/gracefulswitch.go | 2 + .../grpc/internal/binarylog/binarylog.go | 24 +- .../grpc/internal/binarylog/env_config.go | 2 +- .../grpc/internal/binarylog/method_logger.go | 19 +- .../grpc/internal/envconfig/observability.go | 36 + .../grpc/internal/envconfig/xds.go | 8 +- .../grpc/internal/grpcrand/grpcrand.go | 7 + .../grpc/internal/grpcutil/method.go | 5 + .../grpc/internal/internal.go | 64 + .../grpc/internal/resolver/unix/unix.go | 5 +- .../grpc/internal/transport/controlbuf.go | 4 +- .../grpc/internal/transport/handler_server.go | 22 +- .../grpc/internal/transport/http2_client.go | 102 +- .../grpc/internal/transport/http2_server.go | 68 +- .../grpc/internal/transport/http_util.go | 34 +- .../grpc/internal/transport/transport.go | 6 +- .../grpc/metadata/metadata.go | 55 +- .../google.golang.org/grpc/regenerate.sh | 7 +- .../google.golang.org/grpc/resolver/map.go | 55 +- .../vendor/google.golang.org/grpc/server.go | 245 +- .../google.golang.org/grpc/service_config.go | 7 +- .../vendor/google.golang.org/grpc/stream.go | 207 +- .../vendor/google.golang.org/grpc/version.go | 2 +- .../vendor/google.golang.org/grpc/vet.sh | 1 - .../vendor/google.golang.org/protobuf/AUTHORS | 3 - .../google.golang.org/protobuf/CONTRIBUTORS | 3 - .../protobuf/encoding/protojson/decode.go | 174 +- .../protobuf/encoding/protojson/encode.go | 51 +- .../encoding/protojson/well_known_types.go | 76 +- .../protobuf/encoding/prototext/decode.go | 116 +- .../protobuf/encoding/prototext/encode.go | 39 +- .../protobuf/encoding/protowire/wire.go | 4 + .../protobuf/internal/descfmt/stringer.go | 66 +- .../internal/encoding/defval/default.go | 78 +- .../encoding/messageset/messageset.go | 7 +- .../protobuf/internal/encoding/tag/tag.go | 96 +- .../protobuf/internal/encoding/text/decode.go | 30 +- .../internal/encoding/text/decode_number.go | 6 +- .../protobuf/internal/encoding/text/doc.go | 4 +- .../protobuf/internal/filedesc/build.go | 19 +- .../protobuf/internal/filedesc/desc.go | 378 +- .../protobuf/internal/filedesc/desc_init.go | 36 +- .../protobuf/internal/filedesc/desc_lazy.go | 80 +- .../protobuf/internal/filedesc/desc_list.go | 167 +- .../protobuf/internal/filedesc/placeholder.go | 136 +- .../protobuf/internal/filetype/build.go | 87 +- .../protobuf/internal/impl/api_export.go | 42 +- .../protobuf/internal/impl/checkinit.go | 12 +- .../protobuf/internal/impl/codec_extension.go | 36 +- .../protobuf/internal/impl/codec_field.go | 90 +- .../protobuf/internal/impl/codec_map.go | 20 +- .../protobuf/internal/impl/codec_message.go | 30 +- .../protobuf/internal/impl/codec_tables.go | 290 +- .../protobuf/internal/impl/convert.go | 228 +- .../protobuf/internal/impl/convert_list.go | 42 +- .../protobuf/internal/impl/convert_map.go | 32 +- .../protobuf/internal/impl/decode.go | 21 +- .../protobuf/internal/impl/enum.go | 10 +- .../protobuf/internal/impl/extension.go | 26 +- .../protobuf/internal/impl/legacy_enum.go | 57 +- .../protobuf/internal/impl/legacy_export.go | 18 +- .../internal/impl/legacy_extension.go | 100 +- .../protobuf/internal/impl/legacy_message.go | 122 +- .../protobuf/internal/impl/merge.go | 32 +- .../protobuf/internal/impl/message.go | 41 +- .../protobuf/internal/impl/message_reflect.go | 74 +- .../internal/impl/message_reflect_field.go | 118 +- .../protobuf/internal/impl/validate.go | 50 +- .../protobuf/internal/impl/weak.go | 16 +- .../protobuf/internal/order/order.go | 16 +- .../protobuf/internal/order/range.go | 22 +- .../protobuf/internal/strs/strings_unsafe.go | 6 +- .../protobuf/internal/version/version.go | 54 +- .../protobuf/proto/decode.go | 3 +- .../google.golang.org/protobuf/proto/doc.go | 21 +- .../protobuf/proto/encode.go | 5 +- .../google.golang.org/protobuf/proto/equal.go | 50 +- .../reflect/protodesc/desc_resolve.go | 6 +- .../protobuf/reflect/protoreflect/proto.go | 30 +- .../protobuf/reflect/protoreflect/source.go | 1 + .../protobuf/reflect/protoreflect/type.go | 1 + .../reflect/protoreflect/value_union.go | 2 + .../reflect/protoregistry/registry.go | 2 + .../protobuf/runtime/protoimpl/version.go | 8 +- .../types/known/fieldmaskpb/field_mask.pb.go | 2 +- src/cmd/linuxkit/vendor/modules.txt | 132 +- .../build1/Dockerfile | 4 + .../build1/build.yml | 4 + .../build1/foo | 1 + .../build2/Dockerfile | 9 + .../build2/build.yml | 4 + .../042_chained_builds_with_platform/test.sh | 19 + 691 files changed, 47628 insertions(+), 13134 deletions(-) create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/go-winio/backuptar/noop.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/go-winio/backuptar/strconv.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/go-winio/backuptar/tar.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/go-winio/pkg/security/grantvmgroupaccess.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/go-winio/pkg/security/syscall_windows.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/go-winio/pkg/security/zsyscall_windows.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/go-winio/vhd/vhd.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/go-winio/vhd/zvhd_windows.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/.gitattributes create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/.gitignore create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/.golangci.yml create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/CODEOWNERS create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/LICENSE create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/Makefile create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/Protobuild.toml create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/README.md create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/attach.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/destroy.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/detach.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/export.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/format.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/helpers.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/import.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/initialize.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/mount.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/setup.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/storage.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/zsyscall_windows.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/container.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/errors.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/functional_tests.ps1 create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/hcsshim.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/hnsglobals.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/hnsnetwork.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/hnspolicy.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/hnspolicylist.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/hnssupport.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/interface.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema1/schema1.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/attachment.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/battery.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/cache_query_stats_response.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/chipset.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/close_handle.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/com_port.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/compute_system.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/configuration.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/console_size.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/container.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/container_credential_guard_add_instance_request.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/container_credential_guard_hv_socket_service_config.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/container_credential_guard_instance.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/container_credential_guard_modify_operation.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/container_credential_guard_operation_request.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/container_credential_guard_remove_instance_request.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/container_credential_guard_state.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/container_credential_guard_system_info.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/container_memory_information.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/cpu_group.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/cpu_group_affinity.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/cpu_group_config.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/cpu_group_configurations.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/cpu_group_operations.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/cpu_group_property.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/create_group_operation.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/delete_group_operation.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/device.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/devices.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/enhanced_mode_video.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/flexible_io_device.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/guest_connection.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/guest_connection_info.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/guest_crash_reporting.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/guest_os.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/guest_state.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/host_processor_modify_request.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/hosted_system.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/hv_socket.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/hv_socket_2.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/hv_socket_address.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/hv_socket_service_config.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/hv_socket_system_config.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/interrupt_moderation_mode.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/iov_settings.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/keyboard.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/layer.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/linux_kernel_direct.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/logical_processor.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/mapped_directory.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/mapped_pipe.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/memory.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/memory_2.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/memory_information_for_vm.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/memory_stats.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_container_definition_device.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_device_category.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_device_extension.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_device_instance.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_device_namespace.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_interface_class.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_namespace.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_object_directory.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_object_namespace.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_object_symlink.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/modification_request.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/modify_setting_request.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/mouse.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/network_adapter.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/networking.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/pause_notification.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/pause_options.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/plan9.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/plan9_share.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/process_details.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/process_modify_request.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/process_parameters.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/process_status.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/processor.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/processor_2.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/processor_stats.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/processor_topology.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/properties.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/property_query.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/property_type.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/rdp_connection_options.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/registry_changes.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/registry_key.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/registry_value.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/restore_state.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/save_options.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/scsi.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/service_properties.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/shared_memory_configuration.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/shared_memory_region.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/shared_memory_region_info.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/silo_properties.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/statistics.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/storage.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/storage_qo_s.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/storage_stats.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/topology.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/uefi.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/uefi_boot_entry.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/version.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/video_monitor.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_machine.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_node_info.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_p_mem_controller.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_p_mem_device.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_p_mem_mapping.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_pci_device.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_pci_function.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_smb.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_smb_share.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_smb_share_options.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/vm_memory.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/vm_processor_limits.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/windows_crash_reporting.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/service.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/utils.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcserror/hcserror.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hns/hns.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsglobals.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicylist.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hns/hnssupport.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hns/namespace.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hns/zsyscall_windows.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/interop/zsyscall_windows.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/jobobject/iocp.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/jobobject/jobobject.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/jobobject/limits.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/log/g.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/logfields/fields.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/longpath/longpath.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/mergemaps/merge.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/oc/exporter.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/oc/span.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/queue/mq.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/safefile/safeopen.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/timeout/timeout.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/zsyscall_windows.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/activatelayer.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/baselayer.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createlayer.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createscratchlayer.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/deactivatelayer.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/destroylayer.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/exportlayer.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getlayermountpath.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getsharedbaseimages.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/grantvmaccess.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/importlayer.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerexists.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/legacy.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/preparelayer.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/processimage.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/unpreparelayer.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/console.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/devices.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/errors.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/filesystem.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/jobobject.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/logon.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/memory.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/net.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/path.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/process.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/processor.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/system.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/thread.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/utils.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/winapi.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/zsyscall_windows.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/layer.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/osversion/osversion_windows.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/osversion/windowsbuilds.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/pkg/ociwclayer/export.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/pkg/ociwclayer/import.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/process.go create mode 100644 src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/zsyscall_windows.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/cgroups/LICENSE create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/cgroups/stats/v1/doc.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/cgroups/stats/v1/metrics.pb.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/cgroups/stats/v1/metrics.pb.txt create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/cgroups/stats/v1/metrics.proto create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/containerd/archive/tar.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/containerd/archive/tar_freebsd.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/containerd/archive/tar_mostunix.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/containerd/archive/tar_opts.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/containerd/archive/tar_opts_linux.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/containerd/archive/tar_opts_windows.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/containerd/archive/tar_unix.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/containerd/archive/tar_windows.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/containerd/archive/time.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/containerd/archive/time_unix.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/containerd/archive/time_windows.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/containerd/images/converter/converter.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/containerd/images/converter/default.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/containerd/pkg/userns/userns_linux.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/containerd/pkg/userns/userns_unsupported.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/containerd/sys/epoll.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/containerd/sys/fds.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/containerd/sys/filesys_unix.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/containerd/sys/filesys_windows.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/containerd/sys/oom_linux.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/containerd/sys/oom_unsupported.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/containerd/sys/socket_unix.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/containerd/sys/socket_windows.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/containerd/sys/userns_deprecated.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/copy.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/copy_irregular_freebsd.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/copy_irregular_unix.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/copy_linux.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/copy_unix.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/copy_windows.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/diff.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/diff_unix.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/diff_windows.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/dtype_linux.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/du.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/du_unix.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/du_windows.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/hardlink.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/hardlink_unix.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/hardlink_windows.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/path.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/stat_atim.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/stat_darwinbsd.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/time.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/utimesnanoat.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/fifo/.gitattributes create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/fifo/.gitignore create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/fifo/.golangci.yml create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/fifo/LICENSE create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/fifo/Makefile create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/fifo/errors.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/fifo/fifo.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/fifo/handle_linux.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/fifo/handle_nolinux.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/fifo/raw.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/fifo/readme.md create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/fifo/utils.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/nydus-snapshotter/LICENSE create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/nydus-snapshotter/pkg/converter/constant.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/nydus-snapshotter/pkg/converter/convert_unix.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/nydus-snapshotter/pkg/converter/convert_windows.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/nydus-snapshotter/pkg/converter/tool/builder.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/nydus-snapshotter/pkg/converter/types.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/nydus-snapshotter/pkg/converter/utils.go create mode 100644 src/cmd/linuxkit/vendor/github.com/containerd/nydus-snapshotter/pkg/errdefs/errors.go create mode 100644 src/cmd/linuxkit/vendor/github.com/gofrs/flock/flock_aix.go delete mode 100644 src/cmd/linuxkit/vendor/github.com/google/go-cmp/cmp/internal/value/zero.go create mode 100644 src/cmd/linuxkit/vendor/github.com/in-toto/in-toto-golang/in_toto/slsa_provenance/v0.2/provenance.go delete mode 100644 src/cmd/linuxkit/vendor/github.com/in-toto/in-toto-golang/pkg/ssl/verify.go create mode 100644 src/cmd/linuxkit/vendor/github.com/moby/buildkit/exporter/containerimage/exptypes/parse.go rename src/cmd/linuxkit/vendor/github.com/moby/buildkit/frontend/{attest => attestations/sbom}/sbom.go (67%) delete mode 100644 src/cmd/linuxkit/vendor/github.com/moby/buildkit/frontend/dockerfile/dockerfile2llb/directives.go create mode 100644 src/cmd/linuxkit/vendor/github.com/moby/buildkit/frontend/dockerfile/parser/directives.go create mode 100644 src/cmd/linuxkit/vendor/github.com/moby/buildkit/util/compression/estargz.go create mode 100644 src/cmd/linuxkit/vendor/github.com/moby/buildkit/util/compression/gzip.go create mode 100644 src/cmd/linuxkit/vendor/github.com/moby/buildkit/util/compression/nydus.go create mode 100644 src/cmd/linuxkit/vendor/github.com/moby/buildkit/util/compression/parse.go create mode 100644 src/cmd/linuxkit/vendor/github.com/moby/buildkit/util/compression/uncompressed.go create mode 100644 src/cmd/linuxkit/vendor/github.com/moby/buildkit/util/compression/zstd.go create mode 100644 src/cmd/linuxkit/vendor/github.com/moby/buildkit/util/iohelper/helper.go create mode 100644 src/cmd/linuxkit/vendor/github.com/moby/buildkit/util/system/atime_unix.go create mode 100644 src/cmd/linuxkit/vendor/github.com/moby/buildkit/util/system/atime_windows.go create mode 100644 src/cmd/linuxkit/vendor/github.com/moby/buildkit/util/tracing/otlptracegrpc/errors.go create mode 100644 src/cmd/linuxkit/vendor/github.com/opencontainers/image-spec/identity/chainid.go create mode 100644 src/cmd/linuxkit/vendor/github.com/opencontainers/image-spec/identity/helpers.go create mode 100644 src/cmd/linuxkit/vendor/github.com/prometheus/client_golang/prometheus/get_pid.go create mode 100644 src/cmd/linuxkit/vendor/github.com/prometheus/client_golang/prometheus/get_pid_gopherjs.go create mode 100644 src/cmd/linuxkit/vendor/github.com/prometheus/client_golang/prometheus/internal/almost_equal.go create mode 100644 src/cmd/linuxkit/vendor/github.com/prometheus/client_golang/prometheus/internal/difflib.go create mode 100644 src/cmd/linuxkit/vendor/github.com/prometheus/client_golang/prometheus/internal/go_collector_options.go create mode 100644 src/cmd/linuxkit/vendor/github.com/prometheus/client_golang/prometheus/num_threads.go create mode 100644 src/cmd/linuxkit/vendor/github.com/prometheus/client_golang/prometheus/num_threads_gopherjs.go create mode 100644 src/cmd/linuxkit/vendor/github.com/prometheus/client_golang/prometheus/process_collector_js.go delete mode 100644 src/cmd/linuxkit/vendor/github.com/prometheus/procfs/fixtures.ttar rename src/cmd/linuxkit/vendor/github.com/prometheus/procfs/{xfrm.go => net_xfrm.go} (96%) create mode 100644 src/cmd/linuxkit/vendor/github.com/prometheus/procfs/proc_cgroups.go create mode 100644 src/cmd/linuxkit/vendor/github.com/prometheus/procfs/proc_netstat.go create mode 100644 src/cmd/linuxkit/vendor/github.com/prometheus/procfs/proc_snmp.go create mode 100644 src/cmd/linuxkit/vendor/github.com/prometheus/procfs/proc_snmp6.go create mode 100644 src/cmd/linuxkit/vendor/github.com/prometheus/procfs/proc_sys.go create mode 100644 src/cmd/linuxkit/vendor/github.com/prometheus/procfs/softirqs.go create mode 100644 src/cmd/linuxkit/vendor/github.com/secure-systems-lab/go-securesystemslib/LICENSE rename src/cmd/linuxkit/vendor/github.com/{in-toto/in-toto-golang/in_toto => secure-systems-lab/go-securesystemslib/cjson}/canonicaljson.go (99%) rename src/cmd/linuxkit/vendor/github.com/{in-toto/in-toto-golang/pkg/ssl => secure-systems-lab/go-securesystemslib/dsse}/sign.go (70%) create mode 100644 src/cmd/linuxkit/vendor/github.com/secure-systems-lab/go-securesystemslib/dsse/verify.go create mode 100644 src/cmd/linuxkit/vendor/golang.org/x/net/http2/hpack/static_table.go delete mode 100644 src/cmd/linuxkit/vendor/golang.org/x/time/AUTHORS delete mode 100644 src/cmd/linuxkit/vendor/golang.org/x/time/CONTRIBUTORS create mode 100644 src/cmd/linuxkit/vendor/google.golang.org/grpc/balancer/conn_state_evaluator.go create mode 100644 src/cmd/linuxkit/vendor/google.golang.org/grpc/internal/envconfig/observability.go delete mode 100644 src/cmd/linuxkit/vendor/google.golang.org/protobuf/AUTHORS delete mode 100644 src/cmd/linuxkit/vendor/google.golang.org/protobuf/CONTRIBUTORS create mode 100644 test/cases/000_build/042_chained_builds_with_platform/build1/Dockerfile create mode 100644 test/cases/000_build/042_chained_builds_with_platform/build1/build.yml create mode 100644 test/cases/000_build/042_chained_builds_with_platform/build1/foo create mode 100644 test/cases/000_build/042_chained_builds_with_platform/build2/Dockerfile create mode 100644 test/cases/000_build/042_chained_builds_with_platform/build2/build.yml create mode 100644 test/cases/000_build/042_chained_builds_with_platform/test.sh diff --git a/src/cmd/linuxkit/go.mod b/src/cmd/linuxkit/go.mod index 4200fb19a..bc505fc04 100644 --- a/src/cmd/linuxkit/go.mod +++ b/src/cmd/linuxkit/go.mod @@ -11,10 +11,10 @@ require ( github.com/Microsoft/go-winio v0.5.2 github.com/ScaleFT/sshkeys v0.0.0-20181112160850-82451a803681 github.com/aws/aws-sdk-go v1.44.82 - github.com/containerd/containerd v1.6.8 + github.com/containerd/containerd v1.6.11 github.com/docker/buildx v0.8.2 - github.com/docker/cli v20.10.17+incompatible - github.com/docker/docker v20.10.18+incompatible + github.com/docker/cli v23.0.0-beta.1+incompatible + github.com/docker/docker v23.0.0-beta.1+incompatible github.com/docker/go-units v0.5.0 github.com/estesp/manifest-tool/v2 v2.0.6-0.20220728154431-89d791ab7966 github.com/google/go-containerregistry v0.6.1-0.20211105150418-5c9c442d5d68 @@ -23,7 +23,7 @@ require ( github.com/gophercloud/utils v0.0.0-20181029231510-34f5991525d1 github.com/hashicorp/go-version v1.2.0 github.com/klauspost/pgzip v1.2.5 - github.com/moby/buildkit v0.10.1-0.20221020001917-4410c828d67c + github.com/moby/buildkit v0.11.0-rc1.0.20221213132957-c0ac5e8b9b51 github.com/moby/hyperkit v0.0.0-20180416161519-d65b09c1c28a //github.com/moby/moby v20.10.3-0.20220728162118-71cb54cec41e+incompatible // indirect github.com/moby/term v0.0.0-20210619224110-3f7ff695adc6 @@ -37,21 +37,23 @@ require ( github.com/radu-matei/azure-vhd-utils v0.0.0-20170531165126-e52754d5569d github.com/rn/iso9660wrap v0.0.0-20171120145750-baf8d62ad315 github.com/scaleway/scaleway-sdk-go v1.0.0-beta.6 - github.com/sirupsen/logrus v1.8.1 - github.com/stretchr/testify v1.7.2 + github.com/sirupsen/logrus v1.9.0 + github.com/stretchr/testify v1.8.0 github.com/surma/gocpio v1.0.2-0.20160926205914-fcb68777e7dc github.com/vmware/govmomi v0.20.3 github.com/xeipuuv/gojsonschema v1.2.0 - golang.org/x/crypto v0.1.0 - golang.org/x/net v0.1.0 + golang.org/x/crypto v0.2.0 + golang.org/x/net v0.4.0 golang.org/x/oauth2 v0.1.0 - golang.org/x/sync v0.0.0-20220722155255-886fb9371eb4 - golang.org/x/sys v0.1.0 - golang.org/x/term v0.1.0 + golang.org/x/sync v0.1.0 + golang.org/x/sys v0.3.0 + golang.org/x/term v0.3.0 google.golang.org/api v0.84.0 gopkg.in/yaml.v2 v2.4.0 ) +require github.com/Code-Hex/vz/v3 v3.0.0 + require ( cloud.google.com/go/compute v1.7.0 // indirect github.com/Azure/go-autorest v14.2.1-0.20210115164004-c0fe8b0fea3d+incompatible // indirect @@ -59,32 +61,35 @@ require ( github.com/Azure/go-autorest/autorest/validation v0.3.1 // indirect github.com/Azure/go-autorest/logger v0.2.1 // indirect github.com/Azure/go-autorest/tracing v0.6.0 // indirect - github.com/Code-Hex/vz/v3 v3.0.0 // indirect + github.com/Microsoft/hcsshim v0.9.5 // indirect github.com/agext/levenshtein v1.2.3 // indirect github.com/beorn7/perks v1.0.1 // indirect github.com/cespare/xxhash/v2 v2.1.2 // indirect + github.com/containerd/cgroups v1.0.4 // indirect github.com/containerd/console v1.0.3 // indirect github.com/containerd/continuity v0.3.0 // indirect - github.com/containerd/stargz-snapshotter/estargz v0.12.0 // indirect + github.com/containerd/fifo v1.0.0 // indirect + github.com/containerd/nydus-snapshotter v0.3.1 // indirect + github.com/containerd/stargz-snapshotter/estargz v0.13.0 // indirect github.com/containerd/ttrpc v1.1.0 // indirect github.com/containerd/typeurl v1.0.2 // indirect github.com/creack/goselect v0.0.0-20180501195510-58854f77ee8d // indirect github.com/davecgh/go-spew v1.1.1 // indirect github.com/dchest/bcrypt_pbkdf v0.0.0-20150205184540-83f37f9c154a // indirect github.com/docker/distribution v2.8.1+incompatible // indirect - github.com/docker/docker-credential-helpers v0.6.4 // indirect + github.com/docker/docker-credential-helpers v0.7.0 // indirect github.com/docker/go-connections v0.4.1-0.20190612165340-fd1b1942c4d5 // indirect github.com/docker/go-metrics v0.0.1 // indirect github.com/felixge/httpsnoop v1.0.2 // indirect - github.com/go-logr/logr v1.2.2 // indirect + github.com/go-logr/logr v1.2.3 // indirect github.com/go-logr/stdr v1.2.2 // indirect - github.com/gofrs/flock v0.7.3 // indirect + github.com/gofrs/flock v0.8.1 // indirect github.com/gogo/googleapis v1.4.1 // indirect github.com/gogo/protobuf v1.3.2 // indirect github.com/golang-jwt/jwt/v4 v4.4.2 // indirect github.com/golang/groupcache v0.0.0-20210331224755-41bb18bfe9da // indirect github.com/golang/protobuf v1.5.2 // indirect - github.com/google/go-cmp v0.5.8 // indirect + github.com/google/go-cmp v0.5.9 // indirect github.com/google/shlex v0.0.0-20191202100458-e7afc7fbc510 // indirect github.com/googleapis/enterprise-certificate-proxy v0.0.0-20220520183353-fd19c99a87aa // indirect github.com/googleapis/gax-go/v2 v2.4.0 // indirect @@ -92,11 +97,11 @@ require ( github.com/gorilla/websocket v1.4.2 // indirect github.com/grpc-ecosystem/go-grpc-middleware v1.3.0 // indirect github.com/grpc-ecosystem/grpc-gateway v1.16.0 // indirect - github.com/in-toto/in-toto-golang v0.3.3 // indirect + github.com/in-toto/in-toto-golang v0.3.4-0.20220709202702-fa494aaa0add // indirect github.com/jmespath/go-jmespath v0.4.0 // indirect - github.com/klauspost/compress v1.15.9 // indirect + github.com/klauspost/compress v1.15.12 // indirect github.com/linuxkit/virtsock v0.0.0-20201010232012-f8cee7dfc7a3 // indirect - github.com/matttproud/golang_protobuf_extensions v1.0.2 // indirect + github.com/matttproud/golang_protobuf_extensions v1.0.4 // indirect github.com/mitchellh/go-ps v0.0.0-20190716172923-621e5597135b // indirect github.com/moby/locker v1.0.1 // indirect github.com/moby/patternmatcher v0.5.0 // indirect @@ -106,14 +111,13 @@ require ( github.com/phayes/freeport v0.0.0-20220201140144-74d24b5ae9f5 // indirect github.com/pkg/errors v0.9.1 // indirect github.com/pmezard/go-difflib v1.0.0 // indirect - github.com/prometheus/client_golang v1.12.2 // indirect - github.com/prometheus/client_model v0.2.0 // indirect - github.com/prometheus/common v0.32.1 // indirect - github.com/prometheus/procfs v0.7.3 // indirect - github.com/rs/xid v1.3.0 // indirect - github.com/shibumi/go-pathspec v1.2.0 // indirect - github.com/spf13/cobra v1.4.0 // indirect - github.com/tonistiigi/fsutil v0.0.0-20220930225714-4638ad635be5 // indirect + github.com/prometheus/client_golang v1.14.0 // indirect + github.com/prometheus/client_model v0.3.0 // indirect + github.com/prometheus/common v0.37.0 // indirect + github.com/prometheus/procfs v0.8.0 // indirect + github.com/secure-systems-lab/go-securesystemslib v0.4.0 // indirect + github.com/shibumi/go-pathspec v1.3.0 // indirect + github.com/tonistiigi/fsutil v0.0.0-20221114235510-0127568185cf // indirect github.com/tonistiigi/units v0.0.0-20180711220420-6950e57a87ea // indirect github.com/tonistiigi/vt100 v0.0.0-20210615222946-8066bb97264f // indirect github.com/vbatts/tar-split v0.11.2 // indirect @@ -131,12 +135,12 @@ require ( go.opentelemetry.io/otel/trace v1.4.1 // indirect go.opentelemetry.io/proto/otlp v0.12.0 // indirect golang.org/x/mod v0.6.0 // indirect - golang.org/x/text v0.4.0 // indirect - golang.org/x/time v0.0.0-20220210224613-90d013bbcef8 // indirect + golang.org/x/text v0.5.0 // indirect + golang.org/x/time v0.1.0 // indirect google.golang.org/appengine v1.6.7 // indirect - google.golang.org/genproto v0.0.0-20220616135557-88e70c0c3a90 // indirect - google.golang.org/grpc v1.47.0 // indirect - google.golang.org/protobuf v1.28.0 // indirect + google.golang.org/genproto v0.0.0-20220706185917-7780775163c4 // indirect + google.golang.org/grpc v1.50.1 // indirect + google.golang.org/protobuf v1.28.1 // indirect gopkg.in/yaml.v3 v3.0.1 // indirect oras.land/oras-go v1.2.0 // indirect ) diff --git a/src/cmd/linuxkit/go.sum b/src/cmd/linuxkit/go.sum index ff60d37cd..d8acff3d9 100644 --- a/src/cmd/linuxkit/go.sum +++ b/src/cmd/linuxkit/go.sum @@ -147,8 +147,6 @@ github.com/Azure/go-autorest/tracing v0.6.0 h1:TYi4+3m5t6K48TGI9AUdb+IzbnSxvnvUM github.com/Azure/go-autorest/tracing v0.6.0/go.mod h1:+vhtPC754Xsa23ID7GlGsrdKBpUA79WCAKPPZVC2DeU= github.com/BurntSushi/toml v0.3.1/go.mod h1:xHWCNGjB5oqiDr8zfno3MHue2Ht5sIBksp03qcyfWMU= github.com/BurntSushi/xgb v0.0.0-20160522181843-27f122750802/go.mod h1:IVnqGOEym/WlBOVXweHU+Q+/VP0lqqI8lqeDx9IjBqo= -github.com/Code-Hex/vz v0.0.4 h1:1rM8ijE+znlrOeYIer441cSwpYq2rk57Fd3dRpxUDUA= -github.com/Code-Hex/vz v0.0.4/go.mod h1:UeHKXSv3hP7BzU6IaVE/a7VHSHUHpqbS3oVko4O5UYI= github.com/Code-Hex/vz/v3 v3.0.0 h1:UuYAZz8NF8n+R4MLfn/lpUlepgzZ8BlhKtioQ+q9LXk= github.com/Code-Hex/vz/v3 v3.0.0/go.mod h1:+xPQOXVzNaZ4OeIIhlJFumtbFhsvRfqKwX7wuZS4dFA= github.com/Djarvur/go-err113 v0.0.0-20200410182137-af658d038157/go.mod h1:4UJr5HIiMZrwgkSPdsjy2uOQExX/WEILpIrO9UPGuXs= @@ -184,7 +182,8 @@ github.com/Microsoft/hcsshim v0.8.20/go.mod h1:+w2gRZ5ReXQhFOrvSQeNfhrYB/dg3oDwT github.com/Microsoft/hcsshim v0.8.21/go.mod h1:+w2gRZ5ReXQhFOrvSQeNfhrYB/dg3oDwTOcER2fw4I4= github.com/Microsoft/hcsshim v0.8.23/go.mod h1:4zegtUJth7lAvFyc6cH2gGQ5B3OFQim01nnU2M8jKDg= github.com/Microsoft/hcsshim v0.9.2/go.mod h1:7pLA8lDk46WKDWlVsENo92gC0XFa8rbKfyFRBqxEbCc= -github.com/Microsoft/hcsshim v0.9.4 h1:mnUj0ivWy6UzbB1uLFqKR6F+ZyiDc7j4iGgHTpO+5+I= +github.com/Microsoft/hcsshim v0.9.5 h1:AbV+VPfTrIVffukazHcpxmz/sRiE6YaMDzHWR9BXZHo= +github.com/Microsoft/hcsshim v0.9.5/go.mod h1:7pLA8lDk46WKDWlVsENo92gC0XFa8rbKfyFRBqxEbCc= github.com/Microsoft/hcsshim/test v0.0.0-20200826032352-301c83a30e7c/go.mod h1:30A5igQ91GEmhYJF8TaRP79pMBOYynRsyOByfVV0dU4= github.com/Microsoft/hcsshim/test v0.0.0-20201218223536-d3e5debf77da/go.mod h1:5hlzMzRKMLyo42nCZ9oml8AdTlq/0cvIaBv6tK1RehU= github.com/Microsoft/hcsshim/test v0.0.0-20210227013316-43a75bb4edd3/go.mod h1:mw7qgWloBUl75W/gVH3cQszUg1+gUITj7D6NY7ywVnY= @@ -340,8 +339,9 @@ github.com/containerd/cgroups v0.0.0-20200710171044-318312a37340/go.mod h1:s5q4S github.com/containerd/cgroups v0.0.0-20200824123100-0b889c03f102/go.mod h1:s5q4SojHctfxANBDvMeIaIovkq29IP48TKAxnhYRxvo= github.com/containerd/cgroups v0.0.0-20210114181951-8a68de567b68/go.mod h1:ZJeTFisyysqgcCdecO57Dj79RfL0LNeGiFUqLYQRYLE= github.com/containerd/cgroups v1.0.1/go.mod h1:0SJrPIenamHDcZhEcJMNBB85rHcUsw4f25ZfBiPYRkU= -github.com/containerd/cgroups v1.0.3 h1:ADZftAkglvCiD44c77s5YmMqaP2pzVCFZvBmAlBdAP4= github.com/containerd/cgroups v1.0.3/go.mod h1:/ofk34relqNjSGyqPrmEULrO4Sc8LJhvJmWbUCUKqj8= +github.com/containerd/cgroups v1.0.4 h1:jN/mbWBEaz+T1pi5OFtnkQ+8qnmEbAr1Oo1FRm5B0dA= +github.com/containerd/cgroups v1.0.4/go.mod h1:nLNQtsF7Sl2HxNebu77i1R0oDlhiTG+kO4JTrUzo6IA= github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1/go.mod h1:Tj/on1eG8kiEhd0+fhSDzsPAFESxzBBvdyEgyryXffw= github.com/containerd/console v0.0.0-20181022165439-0650fd9eeb50/go.mod h1:Tj/on1eG8kiEhd0+fhSDzsPAFESxzBBvdyEgyryXffw= github.com/containerd/console v0.0.0-20191206165004-02ecf6a7291e/go.mod h1:8Pf4gM6VEbTNRIT26AyyU7hxdQU3MvAvxVI0sc00XBE= @@ -369,8 +369,8 @@ github.com/containerd/containerd v1.5.1/go.mod h1:0DOxVqwDy2iZvrZp2JUx/E+hS0UNTV github.com/containerd/containerd v1.5.7/go.mod h1:gyvv6+ugqY25TiXxcZC3L5yOeYgEw0QMhscqVp1AR9c= github.com/containerd/containerd v1.5.8/go.mod h1:YdFSv5bTFLpG2HIYmfqDpSYYTDX+mc5qtSuYx1YUb/s= github.com/containerd/containerd v1.6.1/go.mod h1:1nJz5xCZPusx6jJU8Frfct988y0NpumIq9ODB0kLtoE= -github.com/containerd/containerd v1.6.8 h1:h4dOFDwzHmqFEP754PgfgTeVXFnLiRc6kiqC7tplDJs= -github.com/containerd/containerd v1.6.8/go.mod h1:By6p5KqPK0/7/CgO/A6t/Gz+CUYUu2zf1hUaaymVXB0= +github.com/containerd/containerd v1.6.11 h1:uIn0uKrRhETIPyAb0lz6WY2xhYBObUOF1bBi5rqZ5x4= +github.com/containerd/containerd v1.6.11/go.mod h1:K4Bw7gjgh4TnkmQY+py/PYQGp4e7xgnHAeg87VeWb3A= github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y= github.com/containerd/continuity v0.0.0-20190815185530-f2a389ac0a02/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y= github.com/containerd/continuity v0.0.0-20191127005431-f65d91d395eb/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y= @@ -406,13 +406,15 @@ github.com/containerd/imgcrypt v1.1.3/go.mod h1:/TPA1GIDXMzbj01yd8pIbQiLdQxed5ue github.com/containerd/nri v0.0.0-20201007170849-eb1350a75164/go.mod h1:+2wGSDGFYfE5+So4M5syatU0N0f0LbWpuqyMi4/BE8c= github.com/containerd/nri v0.0.0-20210316161719-dbaa18c31c14/go.mod h1:lmxnXF6oMkbqs39FiCt1s0R2HSMhcLel9vNL3m4AaeY= github.com/containerd/nri v0.1.0/go.mod h1:lmxnXF6oMkbqs39FiCt1s0R2HSMhcLel9vNL3m4AaeY= +github.com/containerd/nydus-snapshotter v0.3.1 h1:b8WahTrPkt3XsabjG2o/leN4fw3HWZYr+qxo/Z8Mfzk= +github.com/containerd/nydus-snapshotter v0.3.1/go.mod h1:+8R7NX7vrjlxAgtidnsstwIhpzyTlriYPssTxH++uiM= github.com/containerd/stargz-snapshotter v0.0.0-20201027054423-3a04e4c2c116/go.mod h1:o59b3PCKVAf9jjiKtCc/9hLAd+5p/rfhBfm6aBcTEr4= github.com/containerd/stargz-snapshotter v0.11.2/go.mod h1:HfhsbZ98KIoqA2GLmibTpRwMF/lq3utZ0ElV9ARqU7M= github.com/containerd/stargz-snapshotter/estargz v0.4.1/go.mod h1:x7Q9dg9QYb4+ELgxmo4gBUeJB0tl5dqH1Sdz0nJU1QM= github.com/containerd/stargz-snapshotter/estargz v0.9.0/go.mod h1:aE5PCyhFMwR8sbrErO5eM2GcvkyXTTJremG883D4qF0= github.com/containerd/stargz-snapshotter/estargz v0.11.2/go.mod h1:rjbdAXaytDSIrAy2WAy2kUrJ4ehzDS0eUQLlIb5UCY0= -github.com/containerd/stargz-snapshotter/estargz v0.12.0 h1:idtwRTLjk2erqiYhPWy2L844By8NRFYEwYHcXhoIWPM= -github.com/containerd/stargz-snapshotter/estargz v0.12.0/go.mod h1:AIQ59TewBFJ4GOPEQXujcrJ/EKxh5xXZegW1rkR1P/M= +github.com/containerd/stargz-snapshotter/estargz v0.13.0 h1:fD7AwuVV+B40p0d9qVkH/Au1qhp8hn/HWJHIYjpEcfw= +github.com/containerd/stargz-snapshotter/estargz v0.13.0/go.mod h1:m+9VaGJGlhCnrcEUod8mYumTmRgblwd3rC5UCEh2Yp0= github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de/go.mod h1:PvCDdDGpgqzQIzDW1TphrGLssLDZp2GuS+X5DkEJB8o= github.com/containerd/ttrpc v0.0.0-20190828172938-92c8520ef9f8/go.mod h1:PvCDdDGpgqzQIzDW1TphrGLssLDZp2GuS+X5DkEJB8o= github.com/containerd/ttrpc v0.0.0-20191028202541-4f1b8fe65a5c/go.mod h1:LPm1u0xBw8r8NOKoOdNMeVHSawSsltak+Ihv+etqsE8= @@ -502,8 +504,8 @@ github.com/docker/cli v0.0.0-20191017083524-a8ff7f821017/go.mod h1:JLrzqnKDaYBop github.com/docker/cli v20.10.0-beta1.0.20201029214301-1d20b15adc38+incompatible/go.mod h1:JLrzqnKDaYBop7H2jaqPtU4hHvMKP+vjCwu2uszcLI8= github.com/docker/cli v20.10.9+incompatible/go.mod h1:JLrzqnKDaYBop7H2jaqPtU4hHvMKP+vjCwu2uszcLI8= github.com/docker/cli v20.10.12+incompatible/go.mod h1:JLrzqnKDaYBop7H2jaqPtU4hHvMKP+vjCwu2uszcLI8= -github.com/docker/cli v20.10.17+incompatible h1:eO2KS7ZFeov5UJeaDmIs1NFEDRf32PaqRpvoEkKBy5M= -github.com/docker/cli v20.10.17+incompatible/go.mod h1:JLrzqnKDaYBop7H2jaqPtU4hHvMKP+vjCwu2uszcLI8= +github.com/docker/cli v23.0.0-beta.1+incompatible h1:K9CMaN5nHB1eu2f02PURnJhlPhWuFl0s9mL3kildAtE= +github.com/docker/cli v23.0.0-beta.1+incompatible/go.mod h1:JLrzqnKDaYBop7H2jaqPtU4hHvMKP+vjCwu2uszcLI8= github.com/docker/cli-docs-tool v0.4.0/go.mod h1:rgW5KKdNpLMBIuH4WQ/1RNh38nH+/Ay5jgL4P0ZMPpY= github.com/docker/distribution v0.0.0-20190905152932-14b96e55d84c/go.mod h1:0+TTO4EOBfRPhZXAeF1Vu+W3hHZ8eLp8PgKVZlcvtFY= github.com/docker/distribution v2.6.0-rc.1.0.20180327202408-83389a148052+incompatible/go.mod h1:J2gT2udsDAN96Uj4KfcMRqY0/ypR+oyYUYmja8H+y+w= @@ -513,8 +515,9 @@ github.com/docker/distribution v2.8.0+incompatible/go.mod h1:J2gT2udsDAN96Uj4Kfc github.com/docker/distribution v2.8.1+incompatible h1:Q50tZOPR6T/hjNsyc9g8/syEs6bk8XXApsHjKukMl68= github.com/docker/distribution v2.8.1+incompatible/go.mod h1:J2gT2udsDAN96Uj4KfcMRqY0/ypR+oyYUYmja8H+y+w= github.com/docker/docker-credential-helpers v0.6.3/go.mod h1:WRaJzqw3CTB9bk10avuGsjVBZsD05qeibJ1/TYlvc0Y= -github.com/docker/docker-credential-helpers v0.6.4 h1:axCks+yV+2MR3/kZhAmy07yC56WZ2Pwu/fKWtKuZB0o= github.com/docker/docker-credential-helpers v0.6.4/go.mod h1:ofX3UI0Gz1TteYBjtgs07O36Pyasyp66D2uKT7H8W1c= +github.com/docker/docker-credential-helpers v0.7.0 h1:xtCHsjxogADNZcdv1pKUHXryefjlVRqWqIhk/uXJp0A= +github.com/docker/docker-credential-helpers v0.7.0/go.mod h1:rETQfLdHNT3foU5kuNkFR1R1V12OJRRO5lzt2D1b5X0= github.com/docker/go v1.5.1-1.0.20160303222718-d30aec9fd63c/go.mod h1:CADgU4DSXK5QUlFslkQu2yW2TKzFZcXq/leZfM0UH5Q= github.com/docker/go-connections v0.4.0/go.mod h1:Gbd7IOopHjR8Iph03tsViu4nIes5XhDvyHbTtUxmeec= github.com/docker/go-connections v0.4.1-0.20190612165340-fd1b1942c4d5 h1:2o8D0hdBky229bNnc7a8bAZkeVMpH4qsp2Rmt4g/+Zk= @@ -592,17 +595,20 @@ github.com/go-ini/ini v1.25.4/go.mod h1:ByCAeIL28uOIIG0E3PJtZPDL8WnHpFKFOtgjp+3I github.com/go-kit/kit v0.8.0/go.mod h1:xBxKIO96dXMWWy0MnWVtmwkA9/13aqxPnvrjFYMA2as= github.com/go-kit/kit v0.9.0/go.mod h1:xBxKIO96dXMWWy0MnWVtmwkA9/13aqxPnvrjFYMA2as= github.com/go-kit/log v0.1.0/go.mod h1:zbhenjAZHb184qTLMA9ZjW7ThYL0H2mk7Q6pNt4vbaY= +github.com/go-kit/log v0.2.0/go.mod h1:NwTd00d/i8cPZ3xOwwiv2PO5MOcx78fFErGNcVmBjv0= github.com/go-lintpack/lintpack v0.5.2/go.mod h1:NwZuYi2nUHho8XEIZ6SIxihrnPoqBTDqfpXvXAN0sXM= github.com/go-logfmt/logfmt v0.3.0/go.mod h1:Qt1PoO58o5twSAckw1HlFXLmHsOX5/0LbT9GBnD5lWE= github.com/go-logfmt/logfmt v0.4.0/go.mod h1:3RMwSq7FuexP4Kalkev3ejPJsZTpXXBr9+V4qmtdjCk= github.com/go-logfmt/logfmt v0.5.0/go.mod h1:wCYkCAKZfumFQihp8CzCvQ3paCTfi41vtzG1KdI/P7A= +github.com/go-logfmt/logfmt v0.5.1/go.mod h1:WYhtIu8zTZfxdn5+rREduYbwxfcBr/Vr6KEVveWlfTs= github.com/go-logr/logr v0.1.0/go.mod h1:ixOQHD9gLJUVQQ2ZOR7zLEifBX6tGkNJF4QyIY7sIas= github.com/go-logr/logr v0.2.0/go.mod h1:z6/tIYblkpsD+a4lm/fGIIU9mZ+XfAiaFtq7xTgseGU= github.com/go-logr/logr v0.4.0/go.mod h1:z6/tIYblkpsD+a4lm/fGIIU9mZ+XfAiaFtq7xTgseGU= github.com/go-logr/logr v1.2.0/go.mod h1:jdQByPbusPIv2/zmleS9BjJVeZ6kBagPoEUsqbVz/1A= github.com/go-logr/logr v1.2.1/go.mod h1:jdQByPbusPIv2/zmleS9BjJVeZ6kBagPoEUsqbVz/1A= -github.com/go-logr/logr v1.2.2 h1:ahHml/yUpnlb96Rp8HCvtYVPY8ZYpxq3g7UYchIYwbs= github.com/go-logr/logr v1.2.2/go.mod h1:jdQByPbusPIv2/zmleS9BjJVeZ6kBagPoEUsqbVz/1A= +github.com/go-logr/logr v1.2.3 h1:2DntVwHkVopvECVRSlL5PSo9eG+cAkDCuckLubN+rq0= +github.com/go-logr/logr v1.2.3/go.mod h1:jdQByPbusPIv2/zmleS9BjJVeZ6kBagPoEUsqbVz/1A= github.com/go-logr/stdr v1.2.0/go.mod h1:YkVgnZu1ZjjL7xTxrfm/LLZBfkhTqSR1ydtm6jTKKwI= github.com/go-logr/stdr v1.2.2 h1:hSWxHoqTgW2S2qGc0LTAI563KZ5YKYRhT3MFKZMbjag= github.com/go-logr/stdr v1.2.2/go.mod h1:mMo/vtBO5dYbehREoey6XUKy/eSumjCCveDpRre4VKE= @@ -650,8 +656,9 @@ github.com/godbus/dbus/v5 v5.0.3/go.mod h1:xhWf0FNVPg57R7Z0UbKHbJfkEywrmjJnf7w5x github.com/godbus/dbus/v5 v5.0.4/go.mod h1:xhWf0FNVPg57R7Z0UbKHbJfkEywrmjJnf7w5xrFpKfA= github.com/godbus/dbus/v5 v5.0.6/go.mod h1:xhWf0FNVPg57R7Z0UbKHbJfkEywrmjJnf7w5xrFpKfA= github.com/gofrs/flock v0.0.0-20190320160742-5135e617513b/go.mod h1:F1TvTiK9OcQqauNUHlbJvyl9Qa1QvF/gOUDKA14jxHU= -github.com/gofrs/flock v0.7.3 h1:I0EKY9l8HZCXTMYC4F80vwT6KNypV9uYKP3Alm/hjmQ= github.com/gofrs/flock v0.7.3/go.mod h1:F1TvTiK9OcQqauNUHlbJvyl9Qa1QvF/gOUDKA14jxHU= +github.com/gofrs/flock v0.8.1 h1:+gYjHKf32LDeiEEFhQaotPbLuUXjY5ZqxKgXy7n59aw= +github.com/gofrs/flock v0.8.1/go.mod h1:F1TvTiK9OcQqauNUHlbJvyl9Qa1QvF/gOUDKA14jxHU= github.com/gofrs/uuid v3.3.0+incompatible/go.mod h1:b2aQJv3Z4Fp6yNu3cdSllBxTCLRxnplIgP/c0N/04lM= github.com/gofrs/uuid v4.2.0+incompatible h1:yyYWMnhkhrKwwr8gAOcOCYxOOscHgDS9yZgBrnJfGa0= github.com/gogo/googleapis v1.2.0/go.mod h1:Njal3psf3qN6dwBtQfUmBZh2ybovJ0tlu3o/AC7HYjU= @@ -752,8 +759,9 @@ github.com/google/go-cmp v0.5.4/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/ github.com/google/go-cmp v0.5.5/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE= github.com/google/go-cmp v0.5.6/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE= github.com/google/go-cmp v0.5.7/go.mod h1:n+brtR0CgQNWTVd5ZUFpTBC8YFBDLK/h/bpaJ8/DtOE= -github.com/google/go-cmp v0.5.8 h1:e6P7q2lk1O+qJJb4BtCQXlK8vWEO8V1ZeuEdJNOqZyg= github.com/google/go-cmp v0.5.8/go.mod h1:17dUlkBOakJ0+DkrSSNjCkIjxS6bF9zb3elmeNGIjoY= +github.com/google/go-cmp v0.5.9 h1:O2Tfq5qg4qc4AmwVlvv0oLiVAGB7enBSJ2x2DqQFi38= +github.com/google/go-cmp v0.5.9/go.mod h1:17dUlkBOakJ0+DkrSSNjCkIjxS6bF9zb3elmeNGIjoY= github.com/google/go-containerregistry v0.0.0-20191010200024-a3d713f9b7f8/go.mod h1:KyKXa9ciM8+lgMXwOVsXi7UxGrsf9mM61Mzs+xKUrKE= github.com/google/go-containerregistry v0.1.2/go.mod h1:GPivBPgdAyd2SU+vf6EpsgOtWDuPqjW0hJZt4rNdTZ4= github.com/google/go-containerregistry v0.5.1/go.mod h1:Ct15B4yir3PLOP5jsy0GNeYVaIZs/MK/Jz5any1wFW0= @@ -909,8 +917,8 @@ github.com/imdario/mergo v0.3.9/go.mod h1:2EnlNZ0deacrJVfApfmtdGgDfMuh/nq6Ok1EcJ github.com/imdario/mergo v0.3.10/go.mod h1:jmQim1M+e3UYxmgPu/WyfjB3N3VflVyUjjjwH0dnCYA= github.com/imdario/mergo v0.3.11/go.mod h1:jmQim1M+e3UYxmgPu/WyfjB3N3VflVyUjjjwH0dnCYA= github.com/imdario/mergo v0.3.12/go.mod h1:jmQim1M+e3UYxmgPu/WyfjB3N3VflVyUjjjwH0dnCYA= -github.com/in-toto/in-toto-golang v0.3.3 h1:tkkEBU5i09UEeWKnrp6Rq4fXKAfpVXYMLRO5mDfnb3I= -github.com/in-toto/in-toto-golang v0.3.3/go.mod h1:dbXecHGZSqRubmm5TXtvDSZT5JyaKD7ebVTiC2aMLWY= +github.com/in-toto/in-toto-golang v0.3.4-0.20220709202702-fa494aaa0add h1:DAh7mHiRT7wc6kKepYdCpH16ElPciMPQWJaJ7H3l/ng= +github.com/in-toto/in-toto-golang v0.3.4-0.20220709202702-fa494aaa0add/go.mod h1:DQI8vlV6h6qSY/tCOoYKtxjWrkyiNpJ3WTV/WoBllmQ= github.com/inconshreveable/mousetrap v1.0.0 h1:Z8tu5sraLXCXIcARxBp/8cbvlwVa7Z1NHg9XEKhtSvM= github.com/inconshreveable/mousetrap v1.0.0/go.mod h1:PxqpIevigyE2G7u3NXJIT2ANytuPF1OarO4DADm73n8= github.com/intel/goresctrl v0.2.0/go.mod h1:+CZdzouYFn5EsxgqAQTEzMfwKwuc0fVdMrT9FCCAVRQ= @@ -968,9 +976,8 @@ github.com/klauspost/compress v1.11.3/go.mod h1:aoV0uJVorq1K+umq18yTdKaF57EivdYs github.com/klauspost/compress v1.11.13/go.mod h1:aoV0uJVorq1K+umq18yTdKaF57EivdYsUV+/s2qKfXs= github.com/klauspost/compress v1.13.6/go.mod h1:/3/Vjq9QcHkK5uEr5lBEmyoZ1iFhe47etQ6QUkpK6sk= github.com/klauspost/compress v1.15.0/go.mod h1:/3/Vjq9QcHkK5uEr5lBEmyoZ1iFhe47etQ6QUkpK6sk= -github.com/klauspost/compress v1.15.7/go.mod h1:PhcZ0MbTNciWF3rruxRgKxI5NkcHHrHUDtV4Yw2GlzU= -github.com/klauspost/compress v1.15.9 h1:wKRjX6JRtDdrE9qwa4b/Cip7ACOshUI4smpCQanqjSY= -github.com/klauspost/compress v1.15.9/go.mod h1:PhcZ0MbTNciWF3rruxRgKxI5NkcHHrHUDtV4Yw2GlzU= +github.com/klauspost/compress v1.15.12 h1:YClS/PImqYbn+UILDnqxQCZ3RehC9N318SU3kElDUEM= +github.com/klauspost/compress v1.15.12/go.mod h1:QPwzmACJjUTFsnSHH934V6woptycfrDDJnH7hvFVbGM= github.com/klauspost/cpuid v0.0.0-20180405133222-e7e905edc00e/go.mod h1:Pj4uuM528wm8OyEC2QMXAi2YiTZ96dNQPGgoMS4s3ek= github.com/klauspost/cpuid v1.2.0/go.mod h1:Pj4uuM528wm8OyEC2QMXAi2YiTZ96dNQPGgoMS4s3ek= github.com/klauspost/pgzip v1.2.5 h1:qnWYvvKqedOF2ulHpMG72XQol4ILEJ8k2wwRl/Km8oE= @@ -1033,8 +1040,8 @@ github.com/mattn/go-zglob v0.0.1/go.mod h1:9fxibJccNxU2cnpIKLRRFA7zX7qhkJIQWBb44 github.com/mattn/goveralls v0.0.2/go.mod h1:8d1ZMHsd7fW6IRPKQh46F2WRpyib5/X4FOpevwGNQEw= github.com/matttproud/golang_protobuf_extensions v1.0.1/go.mod h1:D8He9yQNgCq6Z5Ld7szi9bcBfOoFv/3dc6xSMkL2PC0= github.com/matttproud/golang_protobuf_extensions v1.0.2-0.20181231171920-c182affec369/go.mod h1:BSXmuO+STAnVfrANrmjBb36TMTDstsz7MSK+HVaYKv4= -github.com/matttproud/golang_protobuf_extensions v1.0.2 h1:hAHbPm5IJGijwng3PWk09JkG9WeqChjprR5s9bBZ+OM= -github.com/matttproud/golang_protobuf_extensions v1.0.2/go.mod h1:BSXmuO+STAnVfrANrmjBb36TMTDstsz7MSK+HVaYKv4= +github.com/matttproud/golang_protobuf_extensions v1.0.4 h1:mmDVorXM7PCGKw94cs5zkfA9PSy5pEvNWRP0ET0TIVo= +github.com/matttproud/golang_protobuf_extensions v1.0.4/go.mod h1:BSXmuO+STAnVfrANrmjBb36TMTDstsz7MSK+HVaYKv4= github.com/maxbrunsfeld/counterfeiter/v6 v6.2.2/go.mod h1:eD9eIE7cdwcMi9rYluz88Jz2VyhSmden33/aXg4oVIY= github.com/mgutz/ansi v0.0.0-20170206155736-9520e82c474b/go.mod h1:01TrycV0kFyexm33Z7vhZRXopbI8J3TDReVlkTgMUxE= github.com/miekg/dns v1.0.14/go.mod h1:W1PPwlIAgtquWBMBEV9nkV9Cazfe8ScdGz/Lj7v3Nrg= @@ -1059,8 +1066,8 @@ github.com/mitchellh/mapstructure v1.4.3/go.mod h1:bFUtVrKA4DC2yAKiSyO/QUcy7e+RR github.com/mitchellh/osext v0.0.0-20151018003038-5e2d6d41470f/go.mod h1:OkQIRizQZAeMln+1tSwduZz7+Af5oFlKirV/MSYes2A= github.com/moby/buildkit v0.8.1/go.mod h1:/kyU1hKy/aYCuP39GZA9MaKioovHku57N6cqlKZIaiQ= github.com/moby/buildkit v0.10.1-0.20220403220257-10e6f94bf90d/go.mod h1:WvwAZv8aRScHkqc/+X46cRC2CKMKpqcaX+pRvUTtPes= -github.com/moby/buildkit v0.10.1-0.20221020001917-4410c828d67c h1:3PkKnyxPVTc3yeHL5FkvuxgpC3etKNmJ0joofoGi+6E= -github.com/moby/buildkit v0.10.1-0.20221020001917-4410c828d67c/go.mod h1:puBC74FaCtIyLaIp95LzzLutPkKdDIdT+B8itnVVLBs= +github.com/moby/buildkit v0.11.0-rc1.0.20221213132957-c0ac5e8b9b51 h1:JSFjonNJAABHC33y9osJ5YtvMiAJPB4ZMNQnkJE6TRI= +github.com/moby/buildkit v0.11.0-rc1.0.20221213132957-c0ac5e8b9b51/go.mod h1:f3jvilDvcG14z+gzPpA2lcWRwIRyFiNTo5bMwHiYDk0= github.com/moby/hyperkit v0.0.0-20180416161519-d65b09c1c28a h1:hExo7kltIidoitYnXsnqfvkJXG3YEMbHuQbf9nOMvow= github.com/moby/hyperkit v0.0.0-20180416161519-d65b09c1c28a/go.mod h1:zGAVB/FkAf4ozkR8CCuj4LcVuErrNsj9APTDFvhOckw= github.com/moby/locker v1.0.1 h1:fOXqR41zeveg4fFODix+1Ch4mj/gT0NE1XJbp/epuBg= @@ -1186,7 +1193,7 @@ github.com/opentracing/opentracing-go v1.2.0/go.mod h1:GxEUsuufX4nBwe+T+Wl9TAgYr github.com/openzipkin/zipkin-go v0.1.1/go.mod h1:NtoC/o8u3JlF1lSlyPNswIbeQH9bJTmOf0Erfk+hxe8= github.com/openzipkin/zipkin-go v0.1.3/go.mod h1:NtoC/o8u3JlF1lSlyPNswIbeQH9bJTmOf0Erfk+hxe8= github.com/openzipkin/zipkin-go v0.1.6/go.mod h1:QgAqvLzwWbR/WpD4A3cGpPtJrZXNIiJc5AZX7/PBEpw= -github.com/package-url/packageurl-go v0.1.0 h1:efWBc98O/dBZRg1pw2xiDzovnlMjCa9NPnfaiBduh8I= +github.com/package-url/packageurl-go v0.1.1-0.20220428063043-89078438f170 h1:DiLBVp4DAcZlBVBEtJpNWZpZVq0AEeCY7Hqk8URVs4o= github.com/packethost/packngo v0.1.1-0.20171201154433-f1be085ecd6f h1:eJOXAByy+kpuTpq3wyOWYeoo1anPMDp6TsdzBcncuQ4= github.com/packethost/packngo v0.1.1-0.20171201154433-f1be085ecd6f/go.mod h1:otzZQXgoO96RTzDB/Hycg0qZcXZsWJGJRSXbmEIJ+4M= github.com/pascaldekloe/goe v0.0.0-20180627143212-57f6aae5913c/go.mod h1:lzWF7FIEvWOWxwDKqyGYQf6ZUaNfKdP144TG7ZOy1lc= @@ -1225,15 +1232,16 @@ github.com/prometheus/client_golang v1.1.0/go.mod h1:I1FGZT9+L76gKKOs5djB6ezCbFQ github.com/prometheus/client_golang v1.7.1/go.mod h1:PY5Wy2awLA44sXw4AOSfFBetzPP4j5+D6mVACh+pe2M= github.com/prometheus/client_golang v1.11.0/go.mod h1:Z6t4BnS23TR94PD6BsDNk8yVqroYurpAkEiz0P2BEV0= github.com/prometheus/client_golang v1.12.1/go.mod h1:3Z9XVyYiZYEO+YQWt3RD2R3jrbd179Rt297l4aS6nDY= -github.com/prometheus/client_golang v1.12.2 h1:51L9cDoUHVrXx4zWYlcLQIZ+d+VXHgqnYKkIuq4g/34= -github.com/prometheus/client_golang v1.12.2/go.mod h1:3Z9XVyYiZYEO+YQWt3RD2R3jrbd179Rt297l4aS6nDY= +github.com/prometheus/client_golang v1.14.0 h1:nJdhIvne2eSX/XRAFV9PcvFFRbrjbcTUj0VP62TMhnw= +github.com/prometheus/client_golang v1.14.0/go.mod h1:8vpkKitgIVNcqrRBWh1C4TIUQgYNtG/XQE4E/Zae36Y= github.com/prometheus/client_model v0.0.0-20171117100541-99fa1f4be8e5/go.mod h1:MbSGuTsp3dbXC40dX6PRTWyKYBIrTGTE9sqQNg2J8bo= github.com/prometheus/client_model v0.0.0-20180712105110-5c3871d89910/go.mod h1:MbSGuTsp3dbXC40dX6PRTWyKYBIrTGTE9sqQNg2J8bo= github.com/prometheus/client_model v0.0.0-20190115171406-56726106282f/go.mod h1:MbSGuTsp3dbXC40dX6PRTWyKYBIrTGTE9sqQNg2J8bo= github.com/prometheus/client_model v0.0.0-20190129233127-fd36f4220a90/go.mod h1:xMI15A0UPsDsEKsMN9yxemIoYk6Tm2C1GtYGdfGttqA= github.com/prometheus/client_model v0.0.0-20190812154241-14fe0d1b01d4/go.mod h1:xMI15A0UPsDsEKsMN9yxemIoYk6Tm2C1GtYGdfGttqA= -github.com/prometheus/client_model v0.2.0 h1:uq5h0d+GuxiXLJLNABMgp2qUWDPiLvgCzz2dUR+/W/M= github.com/prometheus/client_model v0.2.0/go.mod h1:xMI15A0UPsDsEKsMN9yxemIoYk6Tm2C1GtYGdfGttqA= +github.com/prometheus/client_model v0.3.0 h1:UBgGFHqYdG/TPFD1B1ogZywDqEkwp3fBMvqdiQ7Xew4= +github.com/prometheus/client_model v0.3.0/go.mod h1:LDGWKZIo7rky3hgvBe+caln+Dr3dPggB5dvjtD7w9+w= github.com/prometheus/common v0.0.0-20180110214958-89604d197083/go.mod h1:daVV7qP5qjZbuso7PdcryaAu0sAZbrN9i7WWcTMWvro= github.com/prometheus/common v0.0.0-20180801064454-c7de2306084e/go.mod h1:daVV7qP5qjZbuso7PdcryaAu0sAZbrN9i7WWcTMWvro= github.com/prometheus/common v0.0.0-20181113130724-41aa239b4cce/go.mod h1:daVV7qP5qjZbuso7PdcryaAu0sAZbrN9i7WWcTMWvro= @@ -1244,8 +1252,9 @@ github.com/prometheus/common v0.6.0/go.mod h1:eBmuwkDJBwy6iBfxCBob6t6dR6ENT/y+J+ github.com/prometheus/common v0.10.0/go.mod h1:Tlit/dnDKsSWFlCLTWaA1cyBgKHSMdTB80sz/V91rCo= github.com/prometheus/common v0.26.0/go.mod h1:M7rCNAaPfAosfx8veZJCuw84e35h3Cfd9VFqTh1DIvc= github.com/prometheus/common v0.30.0/go.mod h1:vu+V0TpY+O6vW9J44gczi3Ap/oXXR10b+M/gUGO4Hls= -github.com/prometheus/common v0.32.1 h1:hWIdL3N2HoUx3B8j3YN9mWor0qhY/NlEKZEaXxuIRh4= github.com/prometheus/common v0.32.1/go.mod h1:vu+V0TpY+O6vW9J44gczi3Ap/oXXR10b+M/gUGO4Hls= +github.com/prometheus/common v0.37.0 h1:ccBbHCgIiT9uSoFY0vX8H3zsNR5eLt17/RQLUvn8pXE= +github.com/prometheus/common v0.37.0/go.mod h1:phzohg0JFMnBEFGxTDbfu3QyL5GI8gTQJFhYO5B3mfA= github.com/prometheus/procfs v0.0.0-20180125133057-cb4147076ac7/go.mod h1:c3At6R/oaqEKCNdg8wHV1ftS6bRYblBhIjjI8uT2IGk= github.com/prometheus/procfs v0.0.0-20180725123919-05ee40e3a273/go.mod h1:c3At6R/oaqEKCNdg8wHV1ftS6bRYblBhIjjI8uT2IGk= github.com/prometheus/procfs v0.0.0-20181005140218-185b4288413d/go.mod h1:c3At6R/oaqEKCNdg8wHV1ftS6bRYblBhIjjI8uT2IGk= @@ -1259,8 +1268,9 @@ github.com/prometheus/procfs v0.0.8/go.mod h1:7Qr8sr6344vo1JqZ6HhLceV9o3AJ1Ff+Gx github.com/prometheus/procfs v0.1.3/go.mod h1:lV6e/gmhEcM9IjHGsFOCxxuZ+z1YqCvr4OA4YeYWdaU= github.com/prometheus/procfs v0.2.0/go.mod h1:lV6e/gmhEcM9IjHGsFOCxxuZ+z1YqCvr4OA4YeYWdaU= github.com/prometheus/procfs v0.6.0/go.mod h1:cz+aTbrPOrUb4q7XlbU9ygM+/jj0fzG6c1xBZuNvfVA= -github.com/prometheus/procfs v0.7.3 h1:4jVXhlkAyzOScmCkXBTOLRLTz8EeU+eyjrwB/EPq0VU= github.com/prometheus/procfs v0.7.3/go.mod h1:cz+aTbrPOrUb4q7XlbU9ygM+/jj0fzG6c1xBZuNvfVA= +github.com/prometheus/procfs v0.8.0 h1:ODq8ZFEaYeCaZOJlZZdJA2AbQR98dSHSM1KW/You5mo= +github.com/prometheus/procfs v0.8.0/go.mod h1:z7EfXMXOkbkqb9IINtpCn86r/to3BnA0uaxHdg830/4= github.com/prometheus/tsdb v0.7.1/go.mod h1:qhTCs0VvXwvX/y3TZrWD7rabWM+ijKTux40TwIPHuXU= github.com/quasilyte/go-consistent v0.0.0-20190521200055-c6f3937de18c/go.mod h1:5STLWrekHfjyYwxBRVRXNOSewLJ3PWfDJd1VyTS21fI= github.com/quasilyte/go-ruleguard v0.1.2-0.20200318202121-b00d7a75d3d8/go.mod h1:CGFX09Ci3pq9QZdj86B+VGIdNj4VyCo2iPOGS9esB/k= @@ -1279,7 +1289,6 @@ github.com/rogpeppe/go-charset v0.0.0-20180617210344-2471d30d28b4/go.mod h1:qgYe github.com/rogpeppe/go-internal v1.3.0/go.mod h1:M8bDsm7K2OlrFYOpmOWEs/qY81heoFRclV5y23lUDJ4= github.com/rogpeppe/go-internal v1.5.2/go.mod h1:xXDCJY+GAPziupqXw64V24skbSoqbTEfhy4qGm1nDQc= github.com/rs/xid v1.2.1/go.mod h1:+uKXf+4Djp6Md1KODXJxgGQPKngRmWyn10oCKFzNHOQ= -github.com/rs/xid v1.3.0 h1:6NjYksEUlhurdVehpc7S7dk6DAmcKv8V9gG0FsVN2U4= github.com/rs/xid v1.3.0/go.mod h1:trrq9SKmegXys3aeAKXMUTdJsYXVwGY3RLcfgqegfbg= github.com/rubiojr/go-vhd v0.0.0-20160810183302-0bfd3b39853c/go.mod h1:DM5xW0nvfNNm2uytzsvhI3OnX8uzaRAg8UX/CnDqbto= github.com/russross/blackfriday v1.5.2/go.mod h1:JO/DiYxRf+HjHt06OyowR9PTA263kcR/rfWxYHBV53g= @@ -1300,13 +1309,15 @@ github.com/sclevine/spec v1.2.0/go.mod h1:W4J29eT/Kzv7/b9IWLB055Z+qvVC9vt0Arko24 github.com/sean-/seed v0.0.0-20170313163322-e2103e2c3529/go.mod h1:DxrIzT+xaE7yg65j358z/aeFdxmN0P9QXhEzd20vsDc= github.com/seccomp/libseccomp-golang v0.9.1/go.mod h1:GbW5+tmTXfcxTToHLXlScSlAvWlF4P2Ca7zGrPiEpWo= github.com/seccomp/libseccomp-golang v0.9.2-0.20210429002308-3879420cc921/go.mod h1:JA8cRccbGaA1s33RQf7Y1+q9gHmZX1yB/z9WDN1C6fg= +github.com/secure-systems-lab/go-securesystemslib v0.4.0 h1:b23VGrQhTA8cN2CbBw7/FulN9fTtqYUdS5+Oxzt+DUE= +github.com/secure-systems-lab/go-securesystemslib v0.4.0/go.mod h1:FGBZgq2tXWICsxWQW1msNf49F0Pf2Op5Htayx335Qbs= github.com/securego/gosec v0.0.0-20200103095621-79fbf3af8d83/go.mod h1:vvbZ2Ae7AzSq3/kywjUDxSNq2SJ27RxCz2un0H3ePqE= github.com/securego/gosec v0.0.0-20200401082031-e946c8c39989/go.mod h1:i9l/TNj+yDFh9SZXUTvspXTjbFXgZGP/UvhU1S65A4A= github.com/securego/gosec/v2 v2.3.0/go.mod h1:UzeVyUXbxukhLeHKV3VVqo7HdoQR9MrRfFmZYotn8ME= github.com/sergi/go-diff v1.0.0/go.mod h1:0CfEIISq7TuYL3j771MWULgwwjU+GofnZX9QAmXWZgo= github.com/serialx/hashring v0.0.0-20190422032157-8b2912629002/go.mod h1:/yeG0My1xr/u+HZrFQ1tOQQQQrOawfyMUH13ai5brBc= -github.com/shibumi/go-pathspec v1.2.0 h1:KVKEDHYk7bQolRMs7nfzjT3SBOCgcXFJzccnj9bsGbA= -github.com/shibumi/go-pathspec v1.2.0/go.mod h1:bDxCftD0fST3qXIlHoQ/fChsU4mWMVklXp1yPErQaaY= +github.com/shibumi/go-pathspec v1.3.0 h1:QUyMZhFo0Md5B8zV8x2tesohbb5kfbpTi9rBnKh5dkI= +github.com/shibumi/go-pathspec v1.3.0/go.mod h1:Xutfslp817l2I1cZvgcfeMQJG5QnU2lh5tVaaMCl3jE= github.com/shirou/gopsutil v0.0.0-20190901111213-e4ec7b275ada/go.mod h1:WWnYX4lzhCH5h/3YBfyVA3VbLYjlMZZAQcW9ojMexNc= github.com/shirou/w32 v0.0.0-20160930032740-bb4de0191aa4/go.mod h1:qsXQc7+bwAM3Q1u/4XEfrquwF8Lw7D7y5cD8CuHnfIc= github.com/shurcooL/go v0.0.0-20180423040247-9e1955d9fb6e/go.mod h1:TDJrrUr11Vxrven61rcy3hJMUqaf/CLWYhHNPmT14Lk= @@ -1319,8 +1330,9 @@ github.com/sirupsen/logrus v1.4.1/go.mod h1:ni0Sbl8bgC9z8RoU9G6nDWqqs/fq4eDPysMB github.com/sirupsen/logrus v1.4.2/go.mod h1:tLMulIdttU9McNUspp0xgXVQah82FyeX6MwdIuYE2rE= github.com/sirupsen/logrus v1.6.0/go.mod h1:7uNnSEd1DgxDLC74fIahvMZmmYsHGZGEOFrfsX/uA88= github.com/sirupsen/logrus v1.7.0/go.mod h1:yWOB1SBYBC5VeMP7gHvWumXLIWorT60ONWic61uBYv0= -github.com/sirupsen/logrus v1.8.1 h1:dJKuHgqk1NNQlqoA6BTlM1Wf9DOH3NBjQyu0h9+AZZE= github.com/sirupsen/logrus v1.8.1/go.mod h1:yWOB1SBYBC5VeMP7gHvWumXLIWorT60ONWic61uBYv0= +github.com/sirupsen/logrus v1.9.0 h1:trlNQbNUG3OdDrDil03MCb1H2o9nJ1x4/5LYw7byDE0= +github.com/sirupsen/logrus v1.9.0/go.mod h1:naHLuLoDiP4jHNo9R0sCBMtWGeIprob74mVsIT4qYEQ= github.com/smartystreets/assertions v0.0.0-20180927180507-b2de0cb4f26d/go.mod h1:OnSkiWE9lh6wB0YB77sQom3nweQdgAjqCqsofrRNTgc= github.com/smartystreets/assertions v1.0.0 h1:UVQPSSmc3qtTi+zPPkCXvZX9VvW/xT/NsRvKfwY81a8= github.com/smartystreets/assertions v1.0.0/go.mod h1:kHHU4qYBaI3q23Pp3VPrmWhuIUrLW/7eUrw0BU5VaoM= @@ -1345,8 +1357,7 @@ github.com/spf13/cobra v0.0.5/go.mod h1:3K3wKZymM7VvHMDS9+Akkh4K60UwM26emMESw8tL github.com/spf13/cobra v1.0.0/go.mod h1:/6GTrnGXV9HjY+aR4k0oJ5tcvakLuG6EuKReYlHNrgE= github.com/spf13/cobra v1.1.3/go.mod h1:pGADOWyqRD/YMrPZigI/zbliZ2wVD/23d+is3pSWzOo= github.com/spf13/cobra v1.2.1/go.mod h1:ExllRjgxM/piMAM+3tAZvg8fsklGAf3tPfi+i8t68Nk= -github.com/spf13/cobra v1.4.0 h1:y+wJpx64xcgO1V+RcnwW0LEHxTKRi2ZDPSBjWnrg88Q= -github.com/spf13/cobra v1.4.0/go.mod h1:Wo4iy3BUC+X2Fybo0PDqwJIv3dNRiZLHQymsfxlB84g= +github.com/spf13/cobra v1.5.0 h1:X+jTBEBqF0bHN+9cSMgmfuvv2VHJ9ezmFNf9Y/XstYU= github.com/spf13/jwalterweatherman v1.0.0/go.mod h1:cQK4TGJAtQXfYWX+Ddv3mKDzgVb68N+wFjFa4jdeBTo= github.com/spf13/jwalterweatherman v1.1.0/go.mod h1:aNWZUN0dPAAO/Ljvb5BEdw96iTZ0EXowPYD95IqWIGo= github.com/spf13/pflag v0.0.0-20170130214245-9ff6c6923cff/go.mod h1:DYY7MBk1bdzusC3SYhjObp+wFpr4gzcvqqNjLnInEg4= @@ -1367,6 +1378,7 @@ github.com/stretchr/objx v0.0.0-20180129172003-8a3f7159479f/go.mod h1:HFkY916IF+ github.com/stretchr/objx v0.1.0/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME= github.com/stretchr/objx v0.1.1/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME= github.com/stretchr/objx v0.2.0/go.mod h1:qt09Ya8vawLte6SNmTgCsAVtYtaKzEcn8ATUoHMkEqE= +github.com/stretchr/objx v0.4.0/go.mod h1:YvHI0jy2hoMjB+UWwv71VJQ9isScKT/TqJzVSSt89Yw= github.com/stretchr/testify v0.0.0-20151208002404-e3a8ff8ce365/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXfy6kDkUVs= github.com/stretchr/testify v0.0.0-20180303142811-b89eecf5ca5d/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXfy6kDkUVs= github.com/stretchr/testify v1.2.2/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXfy6kDkUVs= @@ -1375,8 +1387,9 @@ github.com/stretchr/testify v1.4.0/go.mod h1:j7eGeouHqKxXV5pUuKE4zz7dFj8WfuZ+81P github.com/stretchr/testify v1.5.1/go.mod h1:5W2xD1RspED5o8YsWQXVCued0rvSQ+mT+I5cxcmMvtA= github.com/stretchr/testify v1.6.1/go.mod h1:6Fq8oRcR53rry900zMqJjRRixrwX3KX962/h/Wwjteg= github.com/stretchr/testify v1.7.0/go.mod h1:6Fq8oRcR53rry900zMqJjRRixrwX3KX962/h/Wwjteg= -github.com/stretchr/testify v1.7.2 h1:4jaiDzPyXQvSd7D0EjG45355tLlV3VOECpq10pLC+8s= -github.com/stretchr/testify v1.7.2/go.mod h1:R6va5+xMeoiuVRoj+gSkQ7d3FALtqAAGI1FQKckRals= +github.com/stretchr/testify v1.7.1/go.mod h1:6Fq8oRcR53rry900zMqJjRRixrwX3KX962/h/Wwjteg= +github.com/stretchr/testify v1.8.0 h1:pSgiaMZlXftHpm5L7V1+rVB+AZJydKsMxsQBIJw4PKk= +github.com/stretchr/testify v1.8.0/go.mod h1:yNjHg4UonilssWZ8iaSj1OCr/vHnekPRkoO+kdMU+MU= github.com/subosito/gotenv v1.2.0/go.mod h1:N0PQaV/YGNqwC0u51sEeR/aUtSLEXKX9iv69rRypqCw= github.com/surma/gocpio v1.0.2-0.20160926205914-fcb68777e7dc h1:iA3Eg1OVd2o0M4M+0PBsBBssMz98L8CUH7x0xVkuyUA= github.com/surma/gocpio v1.0.2-0.20160926205914-fcb68777e7dc/go.mod h1:zaLNaN+EDnfSnNdWPJJf9OZxWF817w5dt8JNzF9LCVI= @@ -1404,8 +1417,8 @@ github.com/tommy-muehle/go-mnd v1.3.1-0.20200224220436-e6f9a994e8fa/go.mod h1:dS github.com/tonistiigi/fsutil v0.0.0-20201103201449-0834f99b7b85/go.mod h1:a7cilN64dG941IOXfhJhlH0qB92hxJ9A1ewrdUmJ6xo= github.com/tonistiigi/fsutil v0.0.0-20220115021204-b19f7f9cb274/go.mod h1:oPAfvw32vlUJSjyDcQ3Bu0nb2ON2B+G0dtVN/SZNJiA= github.com/tonistiigi/fsutil v0.0.0-20220315205639-9ed612626da3/go.mod h1:oPAfvw32vlUJSjyDcQ3Bu0nb2ON2B+G0dtVN/SZNJiA= -github.com/tonistiigi/fsutil v0.0.0-20220930225714-4638ad635be5 h1:NJ1nZs4j4XcBJKIY5sAwTGp9w5b78Zxr3+r0zXRuKnA= -github.com/tonistiigi/fsutil v0.0.0-20220930225714-4638ad635be5/go.mod h1:F83XRhNblQsKQH9hcKEE45GAOkL9590mtw9KsD0Q4fE= +github.com/tonistiigi/fsutil v0.0.0-20221114235510-0127568185cf h1:2n2v98sRhXEG0Kh7+EvctaNIyOim36Ekp4pGDzbuvO8= +github.com/tonistiigi/fsutil v0.0.0-20221114235510-0127568185cf/go.mod h1:AvLEd1LEIl64G2Jpgwo7aVV5lGH0ePcKl0ygGIHNYl8= github.com/tonistiigi/go-actions-cache v0.0.0-20211202175116-9642704158ff/go.mod h1:qqvyZqkfwkoJuPU/bw61bItaoO0SJ8YSW0vSVRRvsRg= github.com/tonistiigi/go-archvariant v1.0.0/go.mod h1:TxFmO5VS6vMq2kvs3ht04iPXtu2rUT/erOnGFYfk5Ho= github.com/tonistiigi/units v0.0.0-20180711220420-6950e57a87ea h1:SXhTLE6pb6eld/v/cCndK0AMpt1wiVFb/YYmqB3/QG0= @@ -1590,10 +1603,8 @@ golang.org/x/crypto v0.0.0-20210817164053-32db794688a5/go.mod h1:GvvjBRRGRdwPK5y golang.org/x/crypto v0.0.0-20210921155107-089bfa567519/go.mod h1:GvvjBRRGRdwPK5ydBHafDWAxML/pGHZbMvKqRZ5+Abc= golang.org/x/crypto v0.0.0-20211202192323-5770296d904e/go.mod h1:IxCIyHEi3zRg3s0A5j5BB6A9Jmi73HwBIUl50j+osU4= golang.org/x/crypto v0.0.0-20211215153901-e495a2d5b3d3/go.mod h1:IxCIyHEi3zRg3s0A5j5BB6A9Jmi73HwBIUl50j+osU4= -golang.org/x/crypto v0.0.0-20220525230936-793ad666bf5e h1:T8NU3HyQ8ClP4SEE+KbFlg6n0NhuTsN4MyznaarGsZM= -golang.org/x/crypto v0.0.0-20220525230936-793ad666bf5e/go.mod h1:IxCIyHEi3zRg3s0A5j5BB6A9Jmi73HwBIUl50j+osU4= -golang.org/x/crypto v0.1.0 h1:MDRAIl0xIo9Io2xV565hzXHw3zVseKrJKodhohM5CjU= -golang.org/x/crypto v0.1.0/go.mod h1:RecgLatLF4+eUMCP1PoPZQb+cVrJcOPbHkTkbkB9sbw= +golang.org/x/crypto v0.2.0 h1:BRXPfhNivWL5Yq0BGQ39a2sW6t44aODpfxkWjYdzewE= +golang.org/x/crypto v0.2.0/go.mod h1:hebNnKkNXi2UzZN1eVRvBB7co0a+JxK6XbPiWVs/3J4= golang.org/x/exp v0.0.0-20190121172915-509febef88a4/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA= golang.org/x/exp v0.0.0-20190125153040-c74c464bbbf2/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA= golang.org/x/exp v0.0.0-20190306152737-a1d7652674e8/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA= @@ -1709,8 +1720,8 @@ golang.org/x/net v0.0.0-20220325170049-de3da57026de/go.mod h1:CfG3xpIq0wQ8r1q4Su golang.org/x/net v0.0.0-20220412020605-290c469a71a5/go.mod h1:CfG3xpIq0wQ8r1q4Su4UZFWDARRcnwPjda9FqA0JpMk= golang.org/x/net v0.0.0-20220425223048-2871e0cb64e4/go.mod h1:CfG3xpIq0wQ8r1q4Su4UZFWDARRcnwPjda9FqA0JpMk= golang.org/x/net v0.0.0-20220607020251-c690dde0001d/go.mod h1:XRhObCWvk6IyKnWLug+ECip1KBveYUHfp+8e9klMJ9c= -golang.org/x/net v0.1.0 h1:hZ/3BUoy5aId7sCpA/Tc5lt8DkFgdVS2onTpJsZ/fl0= -golang.org/x/net v0.1.0/go.mod h1:Cx3nUiGt4eDBEyega/BKRp+/AlGL8hYe7U9odMt2Cco= +golang.org/x/net v0.4.0 h1:Q5QPcMlvfxFTAPV0+07Xz/MpK9NTXu2VDUuy0FeMfaU= +golang.org/x/net v0.4.0/go.mod h1:MBQ8lrhLObU/6UmLb4fmbmk5OcyYmqtbGd/9yIeKjEE= golang.org/x/oauth2 v0.0.0-20180724155351-3d292e4d0cdc/go.mod h1:N/0e6XlmueqKjAGxoOufVs8QHGRruUQn6yWY3a++T0U= golang.org/x/oauth2 v0.0.0-20180821212333-d2e6202438be/go.mod h1:N/0e6XlmueqKjAGxoOufVs8QHGRruUQn6yWY3a++T0U= golang.org/x/oauth2 v0.0.0-20181017192945-9dcd33a902f4/go.mod h1:N/0e6XlmueqKjAGxoOufVs8QHGRruUQn6yWY3a++T0U= @@ -1753,8 +1764,8 @@ golang.org/x/sync v0.0.0-20201020160332-67f06af15bc9/go.mod h1:RxMgew5VJxzue5/jJ golang.org/x/sync v0.0.0-20201207232520-09787c993a3a/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= golang.org/x/sync v0.0.0-20210220032951-036812b2e83c/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= golang.org/x/sync v0.0.0-20220601150217-0de741cfad7f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= -golang.org/x/sync v0.0.0-20220722155255-886fb9371eb4 h1:uVc8UZUe6tr40fFVnUP5Oj+veunVezqYl9z7DYw9xzw= -golang.org/x/sync v0.0.0-20220722155255-886fb9371eb4/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.1.0 h1:wsuoTGHzEhffawBOhz5CYhcrV4IdKZbEyZjBMuTp12o= +golang.org/x/sync v0.1.0/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= golang.org/x/sys v0.0.0-20170830134202-bb24a47a89ea/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20180823144017-11551d06cbcc/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20180830151530-49385e6e1522/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= @@ -1885,15 +1896,16 @@ golang.org/x/sys v0.0.0-20220502124256-b6088ccd6cba/go.mod h1:oPkhp1MJrh7nUepCBc golang.org/x/sys v0.0.0-20220503163025-988cb79eb6c6/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.0.0-20220520151302-bc2c85ada10a/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.0.0-20220610221304-9f5ed59c137d/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= -golang.org/x/sys v0.1.0 h1:kunALQeHf1/185U1i0GOB/fy1IPRDDpuoOOqRReG57U= -golang.org/x/sys v0.1.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= +golang.org/x/sys v0.0.0-20220715151400-c0bba94af5f8/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= +golang.org/x/sys v0.3.0 h1:w8ZOecv6NaNa/zC8944JTU3vz4u6Lagfk4RPQxv92NQ= +golang.org/x/sys v0.3.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/term v0.0.0-20201117132131-f5c789dd3221/go.mod h1:Nr5EML6q2oocZ2LXRh80K7BxOlk5/8JxuGnuhpl+muw= golang.org/x/term v0.0.0-20201126162022-7de9c90e9dd1/go.mod h1:bj7SfCRtBDWHUb9snDiAeCFNEtKQo2Wmx5Cou7ajbmo= golang.org/x/term v0.0.0-20210220032956-6a3ed077a48d/go.mod h1:bj7SfCRtBDWHUb9snDiAeCFNEtKQo2Wmx5Cou7ajbmo= golang.org/x/term v0.0.0-20210615171337-6886f2dfbf5b/go.mod h1:jbD1KX2456YbFQfuXm/mYQcufACuNUgVhRMnK/tPxf8= golang.org/x/term v0.0.0-20210927222741-03fcf44c2211/go.mod h1:jbD1KX2456YbFQfuXm/mYQcufACuNUgVhRMnK/tPxf8= -golang.org/x/term v0.1.0 h1:g6Z6vPFA9dYBAF7DWcH6sCcOntplXsDKcliusYijMlw= -golang.org/x/term v0.1.0/go.mod h1:jbD1KX2456YbFQfuXm/mYQcufACuNUgVhRMnK/tPxf8= +golang.org/x/term v0.3.0 h1:qoo4akIqOcDME5bhc/NgxUdovd6BSS2uMsVjB56q1xI= +golang.org/x/term v0.3.0/go.mod h1:q750SLmJuPmVoN1blW3UFBPREJfb1KmY3vwxfr+nFDA= golang.org/x/text v0.0.0-20160726164857-2910a502d2bf/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= golang.org/x/text v0.0.0-20170915032832-14c0d48ead0c/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= @@ -1904,8 +1916,8 @@ golang.org/x/text v0.3.4/go.mod h1:5Zoc/QRtKVWzQhOtBMvqHzDpF6irO9z98xDceosuGiQ= golang.org/x/text v0.3.5/go.mod h1:5Zoc/QRtKVWzQhOtBMvqHzDpF6irO9z98xDceosuGiQ= golang.org/x/text v0.3.6/go.mod h1:5Zoc/QRtKVWzQhOtBMvqHzDpF6irO9z98xDceosuGiQ= golang.org/x/text v0.3.7/go.mod h1:u+2+/6zg+i71rQMx5EYifcz6MCKuco9NR6JIITiCfzQ= -golang.org/x/text v0.4.0 h1:BrVqGRd7+k1DiOgtnFvAkoQEWQvBc25ouMJM6429SFg= -golang.org/x/text v0.4.0/go.mod h1:mrYo+phRRbMaCq/xk9113O4dZlRixOauAjOtrjsXDZ8= +golang.org/x/text v0.5.0 h1:OLmvp0KP+FVG99Ct/qFiL/Fhk4zp4QQnZ7b2U+5piUM= +golang.org/x/text v0.5.0/go.mod h1:mrYo+phRRbMaCq/xk9113O4dZlRixOauAjOtrjsXDZ8= golang.org/x/time v0.0.0-20180412165947-fbb02b2291d2/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ= golang.org/x/time v0.0.0-20181108054448-85acf8d2951c/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ= golang.org/x/time v0.0.0-20190308202827-9d24e82272b4/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ= @@ -1914,8 +1926,8 @@ golang.org/x/time v0.0.0-20200416051211-89c76fbcd5d1/go.mod h1:tRJNPiyCQ0inRvYxb golang.org/x/time v0.0.0-20200630173020-3af7569d3a1e/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ= golang.org/x/time v0.0.0-20210220033141-f8bda1e9f3ba/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ= golang.org/x/time v0.0.0-20210723032227-1f47c861a9ac/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ= -golang.org/x/time v0.0.0-20220210224613-90d013bbcef8 h1:vVKdlvoWBphwdxWKrFZEuM0kGgGLxUOYcY4U/2Vjg44= -golang.org/x/time v0.0.0-20220210224613-90d013bbcef8/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ= +golang.org/x/time v0.1.0 h1:xYY+Bajn2a7VBmTM5GikTmnK8ZuX8YgnQCqZpbBNtmA= +golang.org/x/time v0.1.0/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ= golang.org/x/tools v0.0.0-20180221164845-07fd8470d635/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= golang.org/x/tools v0.0.0-20180525024113-a5b4c53f6e8b/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= golang.org/x/tools v0.0.0-20180828015842-6cd1fcedba52/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= @@ -2168,8 +2180,9 @@ google.golang.org/genproto v0.0.0-20220505152158-f39f71e6c8f3/go.mod h1:RAyBrSAP google.golang.org/genproto v0.0.0-20220518221133-4f43b3371335/go.mod h1:RAyBrSAP7Fh3Nc84ghnVLDPuV51xc9agzmm4Ph6i0Q4= google.golang.org/genproto v0.0.0-20220523171625-347a074981d8/go.mod h1:RAyBrSAP7Fh3Nc84ghnVLDPuV51xc9agzmm4Ph6i0Q4= google.golang.org/genproto v0.0.0-20220608133413-ed9918b62aac/go.mod h1:KEWEmljWE5zPzLBa/oHl6DaEt9LmfH6WtH1OHIvleBA= -google.golang.org/genproto v0.0.0-20220616135557-88e70c0c3a90 h1:4SPz2GL2CXJt28MTF8V6Ap/9ZiVbQlJeGSd9qtA7DLs= google.golang.org/genproto v0.0.0-20220616135557-88e70c0c3a90/go.mod h1:KEWEmljWE5zPzLBa/oHl6DaEt9LmfH6WtH1OHIvleBA= +google.golang.org/genproto v0.0.0-20220706185917-7780775163c4 h1:7YDGQC/0sigNGzsEWyb9s72jTxlFdwVEYNJHbfQ+Dtg= +google.golang.org/genproto v0.0.0-20220706185917-7780775163c4/go.mod h1:KEWEmljWE5zPzLBa/oHl6DaEt9LmfH6WtH1OHIvleBA= google.golang.org/grpc v0.0.0-20160317175043-d3ddb4469d5a/go.mod h1:yo6s7OP7yaDglbqo1J04qKzAhqBH6lvTonzMVmEdcZw= google.golang.org/grpc v1.14.0/go.mod h1:yo6s7OP7yaDglbqo1J04qKzAhqBH6lvTonzMVmEdcZw= google.golang.org/grpc v1.16.0/go.mod h1:0JHn/cJsOMiMfNA9+DeHDlAU7KAAB5GDlYFpa9MZMio= @@ -2210,8 +2223,9 @@ google.golang.org/grpc v1.44.0/go.mod h1:k+4IHHFw41K8+bbowsex27ge2rCb65oeWqe4jJ5 google.golang.org/grpc v1.45.0/go.mod h1:lN7owxKUQEqMfSyQikvvk5tf/6zMPsrK+ONuO11+0rQ= google.golang.org/grpc v1.46.0/go.mod h1:vN9eftEi1UMyUsIF80+uQXhHjbXYbm0uXoFCACuMGWk= google.golang.org/grpc v1.46.2/go.mod h1:vN9eftEi1UMyUsIF80+uQXhHjbXYbm0uXoFCACuMGWk= -google.golang.org/grpc v1.47.0 h1:9n77onPX5F3qfFCqjy9dhn8PbNQsIKeVU04J9G7umt8= google.golang.org/grpc v1.47.0/go.mod h1:vN9eftEi1UMyUsIF80+uQXhHjbXYbm0uXoFCACuMGWk= +google.golang.org/grpc v1.50.1 h1:DS/BukOZWp8s6p4Dt/tOaJaTQyPyOoCcrjroHuCeLzY= +google.golang.org/grpc v1.50.1/go.mod h1:ZgQEeidpAuNRZ8iRrlBKXZQP1ghovWIVhdJRyCDK+GI= google.golang.org/grpc/cmd/protoc-gen-go-grpc v1.1.0/go.mod h1:6Kw0yEErY5E/yWrBtf03jp27GLLJujG4z/JK95pnjjw= google.golang.org/protobuf v0.0.0-20200109180630-ec00e32a8dfd/go.mod h1:DFci5gLYBciE7Vtevhsrf46CRTquxDuWsQurQQe4oz8= google.golang.org/protobuf v0.0.0-20200221191635-4d8936d0db64/go.mod h1:kwYJMbMJ01Woi6D6+Kah6886xMZcty6N08ah7+eCXa0= @@ -2226,8 +2240,9 @@ google.golang.org/protobuf v1.25.0/go.mod h1:9JNX74DMeImyA3h4bdi1ymwjUzf21/xIlba google.golang.org/protobuf v1.26.0-rc.1/go.mod h1:jlhhOSvTdKEhbULTjvd4ARK9grFBp09yW+WbY/TyQbw= google.golang.org/protobuf v1.26.0/go.mod h1:9q0QmTI4eRPtz6boOQmLYwt+qCgq0jsYwAQnmE0givc= google.golang.org/protobuf v1.27.1/go.mod h1:9q0QmTI4eRPtz6boOQmLYwt+qCgq0jsYwAQnmE0givc= -google.golang.org/protobuf v1.28.0 h1:w43yiav+6bVFTBQFZX0r7ipe9JQ1QsbMgHwbBziscLw= google.golang.org/protobuf v1.28.0/go.mod h1:HV8QOd/L58Z+nl8r43ehVNZIU/HEI6OcFqwMG9pJV4I= +google.golang.org/protobuf v1.28.1 h1:d0NfwRgPtno5B1Wa6L2DAG+KivqkdutMf1UhdNx175w= +google.golang.org/protobuf v1.28.1/go.mod h1:HV8QOd/L58Z+nl8r43ehVNZIU/HEI6OcFqwMG9pJV4I= gopkg.in/airbrake/gobrake.v2 v2.0.9/go.mod h1:/h5ZAUhDkGaJfjzjKLSjv6zCL6O0LLBxU4K+aSYdM/U= gopkg.in/alecthomas/kingpin.v2 v2.2.6/go.mod h1:FMv+mEhP44yOT+4EoQTLFTRgOQ1FBLkstjWtayDeSgw= gopkg.in/check.v1 v0.0.0-20161208181325-20d25e280405/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0= diff --git a/src/cmd/linuxkit/pkg_build.go b/src/cmd/linuxkit/pkg_build.go index e31efbe54..526acf454 100644 --- a/src/cmd/linuxkit/pkg_build.go +++ b/src/cmd/linuxkit/pkg_build.go @@ -14,10 +14,10 @@ import ( const ( buildersEnvVar = "LINUXKIT_BUILDERS" envVarCacheDir = "LINUXKIT_CACHE" - // this is the most recent manifest pointed to by moby/buildkit:master as of 2022-11-11, with the latest commit - // d3f26c63389c2ad66600ae5c884d6cbde627d6d8. + // this is the most recent manifest pointed to by moby/buildkit:master as of 2022-12-13, with the latest commit + // c0ac5e8b9b51603c5a93795fcf1373d6d44d3a85. // Once there is a normal semver tag later than this, we should switch to it. - defaultBuilderImage = "moby/buildkit@sha256:a44defefec23a24cfc250116c4862e0e47c8d0339cefc4c7ab0ca7f3837618e3" + defaultBuilderImage = "moby/buildkit@sha256:daadc9f6dc5829c9dfa68ef9f4292c2d5b2fddf848046e02e43db53037373dda" ) func pkgBuild(args []string) { diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/go-winio/backuptar/noop.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/go-winio/backuptar/noop.go new file mode 100644 index 000000000..d39eccf02 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/go-winio/backuptar/noop.go @@ -0,0 +1,4 @@ +// +build !windows +// This file only exists to allow go get on non-Windows platforms. + +package backuptar diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/go-winio/backuptar/strconv.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/go-winio/backuptar/strconv.go new file mode 100644 index 000000000..341609663 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/go-winio/backuptar/strconv.go @@ -0,0 +1,68 @@ +package backuptar + +import ( + "archive/tar" + "fmt" + "strconv" + "strings" + "time" +) + +// Functions copied from https://github.com/golang/go/blob/master/src/archive/tar/strconv.go +// as we need to manage the LIBARCHIVE.creationtime PAXRecord manually. +// Idea taken from containerd which did the same thing. + +// parsePAXTime takes a string of the form %d.%d as described in the PAX +// specification. Note that this implementation allows for negative timestamps, +// which is allowed for by the PAX specification, but not always portable. +func parsePAXTime(s string) (time.Time, error) { + const maxNanoSecondDigits = 9 + + // Split string into seconds and sub-seconds parts. + ss, sn := s, "" + if pos := strings.IndexByte(s, '.'); pos >= 0 { + ss, sn = s[:pos], s[pos+1:] + } + + // Parse the seconds. + secs, err := strconv.ParseInt(ss, 10, 64) + if err != nil { + return time.Time{}, tar.ErrHeader + } + if len(sn) == 0 { + return time.Unix(secs, 0), nil // No sub-second values + } + + // Parse the nanoseconds. + if strings.Trim(sn, "0123456789") != "" { + return time.Time{}, tar.ErrHeader + } + if len(sn) < maxNanoSecondDigits { + sn += strings.Repeat("0", maxNanoSecondDigits-len(sn)) // Right pad + } else { + sn = sn[:maxNanoSecondDigits] // Right truncate + } + nsecs, _ := strconv.ParseInt(sn, 10, 64) // Must succeed + if len(ss) > 0 && ss[0] == '-' { + return time.Unix(secs, -1*nsecs), nil // Negative correction + } + return time.Unix(secs, nsecs), nil +} + +// formatPAXTime converts ts into a time of the form %d.%d as described in the +// PAX specification. This function is capable of negative timestamps. +func formatPAXTime(ts time.Time) (s string) { + secs, nsecs := ts.Unix(), ts.Nanosecond() + if nsecs == 0 { + return strconv.FormatInt(secs, 10) + } + + // If seconds is negative, then perform correction. + sign := "" + if secs < 0 { + sign = "-" // Remember sign + secs = -(secs + 1) // Add a second to secs + nsecs = -(nsecs - 1e9) // Take that second away from nsecs + } + return strings.TrimRight(fmt.Sprintf("%s%d.%09d", sign, secs, nsecs), "0") +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/go-winio/backuptar/tar.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/go-winio/backuptar/tar.go new file mode 100644 index 000000000..2342a7fcd --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/go-winio/backuptar/tar.go @@ -0,0 +1,517 @@ +// +build windows + +package backuptar + +import ( + "archive/tar" + "encoding/base64" + "fmt" + "io" + "io/ioutil" + "path/filepath" + "strconv" + "strings" + "syscall" + "time" + + "github.com/Microsoft/go-winio" + "golang.org/x/sys/windows" +) + +const ( + c_ISUID = 04000 // Set uid + c_ISGID = 02000 // Set gid + c_ISVTX = 01000 // Save text (sticky bit) + c_ISDIR = 040000 // Directory + c_ISFIFO = 010000 // FIFO + c_ISREG = 0100000 // Regular file + c_ISLNK = 0120000 // Symbolic link + c_ISBLK = 060000 // Block special file + c_ISCHR = 020000 // Character special file + c_ISSOCK = 0140000 // Socket +) + +const ( + hdrFileAttributes = "MSWINDOWS.fileattr" + hdrSecurityDescriptor = "MSWINDOWS.sd" + hdrRawSecurityDescriptor = "MSWINDOWS.rawsd" + hdrMountPoint = "MSWINDOWS.mountpoint" + hdrEaPrefix = "MSWINDOWS.xattr." + + hdrCreationTime = "LIBARCHIVE.creationtime" +) + +// zeroReader is an io.Reader that always returns 0s. +type zeroReader struct{} + +func (zr zeroReader) Read(b []byte) (int, error) { + for i := range b { + b[i] = 0 + } + return len(b), nil +} + +func copySparse(t *tar.Writer, br *winio.BackupStreamReader) error { + curOffset := int64(0) + for { + bhdr, err := br.Next() + if err == io.EOF { + err = io.ErrUnexpectedEOF + } + if err != nil { + return err + } + if bhdr.Id != winio.BackupSparseBlock { + return fmt.Errorf("unexpected stream %d", bhdr.Id) + } + + // We can't seek backwards, since we have already written that data to the tar.Writer. + if bhdr.Offset < curOffset { + return fmt.Errorf("cannot seek back from %d to %d", curOffset, bhdr.Offset) + } + // archive/tar does not support writing sparse files + // so just write zeroes to catch up to the current offset. + if _, err := io.CopyN(t, zeroReader{}, bhdr.Offset-curOffset); err != nil { + return fmt.Errorf("seek to offset %d: %s", bhdr.Offset, err) + } + if bhdr.Size == 0 { + // A sparse block with size = 0 is used to mark the end of the sparse blocks. + break + } + n, err := io.Copy(t, br) + if err != nil { + return err + } + if n != bhdr.Size { + return fmt.Errorf("copied %d bytes instead of %d at offset %d", n, bhdr.Size, bhdr.Offset) + } + curOffset = bhdr.Offset + n + } + return nil +} + +// BasicInfoHeader creates a tar header from basic file information. +func BasicInfoHeader(name string, size int64, fileInfo *winio.FileBasicInfo) *tar.Header { + hdr := &tar.Header{ + Format: tar.FormatPAX, + Name: filepath.ToSlash(name), + Size: size, + Typeflag: tar.TypeReg, + ModTime: time.Unix(0, fileInfo.LastWriteTime.Nanoseconds()), + ChangeTime: time.Unix(0, fileInfo.ChangeTime.Nanoseconds()), + AccessTime: time.Unix(0, fileInfo.LastAccessTime.Nanoseconds()), + PAXRecords: make(map[string]string), + } + hdr.PAXRecords[hdrFileAttributes] = fmt.Sprintf("%d", fileInfo.FileAttributes) + hdr.PAXRecords[hdrCreationTime] = formatPAXTime(time.Unix(0, fileInfo.CreationTime.Nanoseconds())) + + if (fileInfo.FileAttributes & syscall.FILE_ATTRIBUTE_DIRECTORY) != 0 { + hdr.Mode |= c_ISDIR + hdr.Size = 0 + hdr.Typeflag = tar.TypeDir + } + return hdr +} + +// SecurityDescriptorFromTarHeader reads the SDDL associated with the header of the current file +// from the tar header and returns the security descriptor into a byte slice. +func SecurityDescriptorFromTarHeader(hdr *tar.Header) ([]byte, error) { + // Maintaining old SDDL-based behavior for backward + // compatibility. All new tar headers written by this library + // will have raw binary for the security descriptor. + var sd []byte + var err error + if sddl, ok := hdr.PAXRecords[hdrSecurityDescriptor]; ok { + sd, err = winio.SddlToSecurityDescriptor(sddl) + if err != nil { + return nil, err + } + } + if sdraw, ok := hdr.PAXRecords[hdrRawSecurityDescriptor]; ok { + sd, err = base64.StdEncoding.DecodeString(sdraw) + if err != nil { + return nil, err + } + } + return sd, nil +} + +// ExtendedAttributesFromTarHeader reads the EAs associated with the header of the +// current file from the tar header and returns it as a byte slice. +func ExtendedAttributesFromTarHeader(hdr *tar.Header) ([]byte, error) { + var eas []winio.ExtendedAttribute + var eadata []byte + var err error + for k, v := range hdr.PAXRecords { + if !strings.HasPrefix(k, hdrEaPrefix) { + continue + } + data, err := base64.StdEncoding.DecodeString(v) + if err != nil { + return nil, err + } + eas = append(eas, winio.ExtendedAttribute{ + Name: k[len(hdrEaPrefix):], + Value: data, + }) + } + if len(eas) != 0 { + eadata, err = winio.EncodeExtendedAttributes(eas) + if err != nil { + return nil, err + } + } + return eadata, nil +} + +// EncodeReparsePointFromTarHeader reads the ReparsePoint structure from the tar header +// and encodes it into a byte slice. The file for which this function is called must be a +// symlink. +func EncodeReparsePointFromTarHeader(hdr *tar.Header) []byte { + _, isMountPoint := hdr.PAXRecords[hdrMountPoint] + rp := winio.ReparsePoint{ + Target: filepath.FromSlash(hdr.Linkname), + IsMountPoint: isMountPoint, + } + return winio.EncodeReparsePoint(&rp) +} + +// WriteTarFileFromBackupStream writes a file to a tar writer using data from a Win32 backup stream. +// +// This encodes Win32 metadata as tar pax vendor extensions starting with MSWINDOWS. +// +// The additional Win32 metadata is: +// +// MSWINDOWS.fileattr: The Win32 file attributes, as a decimal value +// +// MSWINDOWS.rawsd: The Win32 security descriptor, in raw binary format +// +// MSWINDOWS.mountpoint: If present, this is a mount point and not a symlink, even though the type is '2' (symlink) +func WriteTarFileFromBackupStream(t *tar.Writer, r io.Reader, name string, size int64, fileInfo *winio.FileBasicInfo) error { + name = filepath.ToSlash(name) + hdr := BasicInfoHeader(name, size, fileInfo) + + // If r can be seeked, then this function is two-pass: pass 1 collects the + // tar header data, and pass 2 copies the data stream. If r cannot be + // seeked, then some header data (in particular EAs) will be silently lost. + var ( + restartPos int64 + err error + ) + sr, readTwice := r.(io.Seeker) + if readTwice { + if restartPos, err = sr.Seek(0, io.SeekCurrent); err != nil { + readTwice = false + } + } + + br := winio.NewBackupStreamReader(r) + var dataHdr *winio.BackupHeader + for dataHdr == nil { + bhdr, err := br.Next() + if err == io.EOF { + break + } + if err != nil { + return err + } + switch bhdr.Id { + case winio.BackupData: + hdr.Mode |= c_ISREG + if !readTwice { + dataHdr = bhdr + } + case winio.BackupSecurity: + sd, err := ioutil.ReadAll(br) + if err != nil { + return err + } + hdr.PAXRecords[hdrRawSecurityDescriptor] = base64.StdEncoding.EncodeToString(sd) + + case winio.BackupReparseData: + hdr.Mode |= c_ISLNK + hdr.Typeflag = tar.TypeSymlink + reparseBuffer, err := ioutil.ReadAll(br) + rp, err := winio.DecodeReparsePoint(reparseBuffer) + if err != nil { + return err + } + if rp.IsMountPoint { + hdr.PAXRecords[hdrMountPoint] = "1" + } + hdr.Linkname = rp.Target + + case winio.BackupEaData: + eab, err := ioutil.ReadAll(br) + if err != nil { + return err + } + eas, err := winio.DecodeExtendedAttributes(eab) + if err != nil { + return err + } + for _, ea := range eas { + // Use base64 encoding for the binary value. Note that there + // is no way to encode the EA's flags, since their use doesn't + // make any sense for persisted EAs. + hdr.PAXRecords[hdrEaPrefix+ea.Name] = base64.StdEncoding.EncodeToString(ea.Value) + } + + case winio.BackupAlternateData, winio.BackupLink, winio.BackupPropertyData, winio.BackupObjectId, winio.BackupTxfsData: + // ignore these streams + default: + return fmt.Errorf("%s: unknown stream ID %d", name, bhdr.Id) + } + } + + err = t.WriteHeader(hdr) + if err != nil { + return err + } + + if readTwice { + // Get back to the data stream. + if _, err = sr.Seek(restartPos, io.SeekStart); err != nil { + return err + } + for dataHdr == nil { + bhdr, err := br.Next() + if err == io.EOF { + break + } + if err != nil { + return err + } + if bhdr.Id == winio.BackupData { + dataHdr = bhdr + } + } + } + + // The logic for copying file contents is fairly complicated due to the need for handling sparse files, + // and the weird ways they are represented by BackupRead. A normal file will always either have a data stream + // with size and content, or no data stream at all (if empty). However, for a sparse file, the content can also + // be represented using a series of sparse block streams following the data stream. Additionally, the way sparse + // files are handled by BackupRead has changed in the OS recently. The specifics of the representation are described + // in the list at the bottom of this block comment. + // + // Sparse files can be represented in four different ways, based on the specifics of the file. + // - Size = 0: + // Previously: BackupRead yields no data stream and no sparse block streams. + // Recently: BackupRead yields a data stream with size = 0. There are no following sparse block streams. + // - Size > 0, no allocated ranges: + // BackupRead yields a data stream with size = 0. Following is a single sparse block stream with + // size = 0 and offset = . + // - Size > 0, one allocated range: + // BackupRead yields a data stream with size = containing the file contents. There are no + // sparse block streams. This is the case if you take a normal file with contents and simply set the + // sparse flag on it. + // - Size > 0, multiple allocated ranges: + // BackupRead yields a data stream with size = 0. Following are sparse block streams for each allocated + // range of the file containing the range contents. Finally there is a sparse block stream with + // size = 0 and offset = . + + if dataHdr != nil { + // A data stream was found. Copy the data. + // We assume that we will either have a data stream size > 0 XOR have sparse block streams. + if dataHdr.Size > 0 || (dataHdr.Attributes&winio.StreamSparseAttributes) == 0 { + if size != dataHdr.Size { + return fmt.Errorf("%s: mismatch between file size %d and header size %d", name, size, dataHdr.Size) + } + if _, err = io.Copy(t, br); err != nil { + return fmt.Errorf("%s: copying contents from data stream: %s", name, err) + } + } else if size > 0 { + // As of a recent OS change, BackupRead now returns a data stream for empty sparse files. + // These files have no sparse block streams, so skip the copySparse call if file size = 0. + if err = copySparse(t, br); err != nil { + return fmt.Errorf("%s: copying contents from sparse block stream: %s", name, err) + } + } + } + + // Look for streams after the data stream. The only ones we handle are alternate data streams. + // Other streams may have metadata that could be serialized, but the tar header has already + // been written. In practice, this means that we don't get EA or TXF metadata. + for { + bhdr, err := br.Next() + if err == io.EOF { + break + } + if err != nil { + return err + } + switch bhdr.Id { + case winio.BackupAlternateData: + altName := bhdr.Name + if strings.HasSuffix(altName, ":$DATA") { + altName = altName[:len(altName)-len(":$DATA")] + } + if (bhdr.Attributes & winio.StreamSparseAttributes) == 0 { + hdr = &tar.Header{ + Format: hdr.Format, + Name: name + altName, + Mode: hdr.Mode, + Typeflag: tar.TypeReg, + Size: bhdr.Size, + ModTime: hdr.ModTime, + AccessTime: hdr.AccessTime, + ChangeTime: hdr.ChangeTime, + } + err = t.WriteHeader(hdr) + if err != nil { + return err + } + _, err = io.Copy(t, br) + if err != nil { + return err + } + + } else { + // Unsupported for now, since the size of the alternate stream is not present + // in the backup stream until after the data has been read. + return fmt.Errorf("%s: tar of sparse alternate data streams is unsupported", name) + } + case winio.BackupEaData, winio.BackupLink, winio.BackupPropertyData, winio.BackupObjectId, winio.BackupTxfsData: + // ignore these streams + default: + return fmt.Errorf("%s: unknown stream ID %d after data", name, bhdr.Id) + } + } + return nil +} + +// FileInfoFromHeader retrieves basic Win32 file information from a tar header, using the additional metadata written by +// WriteTarFileFromBackupStream. +func FileInfoFromHeader(hdr *tar.Header) (name string, size int64, fileInfo *winio.FileBasicInfo, err error) { + name = hdr.Name + if hdr.Typeflag == tar.TypeReg || hdr.Typeflag == tar.TypeRegA { + size = hdr.Size + } + fileInfo = &winio.FileBasicInfo{ + LastAccessTime: windows.NsecToFiletime(hdr.AccessTime.UnixNano()), + LastWriteTime: windows.NsecToFiletime(hdr.ModTime.UnixNano()), + ChangeTime: windows.NsecToFiletime(hdr.ChangeTime.UnixNano()), + // Default to ModTime, we'll pull hdrCreationTime below if present + CreationTime: windows.NsecToFiletime(hdr.ModTime.UnixNano()), + } + if attrStr, ok := hdr.PAXRecords[hdrFileAttributes]; ok { + attr, err := strconv.ParseUint(attrStr, 10, 32) + if err != nil { + return "", 0, nil, err + } + fileInfo.FileAttributes = uint32(attr) + } else { + if hdr.Typeflag == tar.TypeDir { + fileInfo.FileAttributes |= syscall.FILE_ATTRIBUTE_DIRECTORY + } + } + if creationTimeStr, ok := hdr.PAXRecords[hdrCreationTime]; ok { + creationTime, err := parsePAXTime(creationTimeStr) + if err != nil { + return "", 0, nil, err + } + fileInfo.CreationTime = windows.NsecToFiletime(creationTime.UnixNano()) + } + return +} + +// WriteBackupStreamFromTarFile writes a Win32 backup stream from the current tar file. Since this function may process multiple +// tar file entries in order to collect all the alternate data streams for the file, it returns the next +// tar file that was not processed, or io.EOF is there are no more. +func WriteBackupStreamFromTarFile(w io.Writer, t *tar.Reader, hdr *tar.Header) (*tar.Header, error) { + bw := winio.NewBackupStreamWriter(w) + + sd, err := SecurityDescriptorFromTarHeader(hdr) + if err != nil { + return nil, err + } + if len(sd) != 0 { + bhdr := winio.BackupHeader{ + Id: winio.BackupSecurity, + Size: int64(len(sd)), + } + err := bw.WriteHeader(&bhdr) + if err != nil { + return nil, err + } + _, err = bw.Write(sd) + if err != nil { + return nil, err + } + } + + eadata, err := ExtendedAttributesFromTarHeader(hdr) + if err != nil { + return nil, err + } + if len(eadata) != 0 { + bhdr := winio.BackupHeader{ + Id: winio.BackupEaData, + Size: int64(len(eadata)), + } + err = bw.WriteHeader(&bhdr) + if err != nil { + return nil, err + } + _, err = bw.Write(eadata) + if err != nil { + return nil, err + } + } + + if hdr.Typeflag == tar.TypeSymlink { + reparse := EncodeReparsePointFromTarHeader(hdr) + bhdr := winio.BackupHeader{ + Id: winio.BackupReparseData, + Size: int64(len(reparse)), + } + err := bw.WriteHeader(&bhdr) + if err != nil { + return nil, err + } + _, err = bw.Write(reparse) + if err != nil { + return nil, err + } + + } + + if hdr.Typeflag == tar.TypeReg || hdr.Typeflag == tar.TypeRegA { + bhdr := winio.BackupHeader{ + Id: winio.BackupData, + Size: hdr.Size, + } + err := bw.WriteHeader(&bhdr) + if err != nil { + return nil, err + } + _, err = io.Copy(bw, t) + if err != nil { + return nil, err + } + } + // Copy all the alternate data streams and return the next non-ADS header. + for { + ahdr, err := t.Next() + if err != nil { + return nil, err + } + if ahdr.Typeflag != tar.TypeReg || !strings.HasPrefix(ahdr.Name, hdr.Name+":") { + return ahdr, nil + } + bhdr := winio.BackupHeader{ + Id: winio.BackupAlternateData, + Size: ahdr.Size, + Name: ahdr.Name[len(hdr.Name):] + ":$DATA", + } + err = bw.WriteHeader(&bhdr) + if err != nil { + return nil, err + } + _, err = io.Copy(bw, t) + if err != nil { + return nil, err + } + } +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/go-winio/pkg/security/grantvmgroupaccess.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/go-winio/pkg/security/grantvmgroupaccess.go new file mode 100644 index 000000000..602920786 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/go-winio/pkg/security/grantvmgroupaccess.go @@ -0,0 +1,160 @@ +// +build windows + +package security + +import ( + "fmt" + "os" + "syscall" + "unsafe" +) + +type ( + accessMask uint32 + accessMode uint32 + desiredAccess uint32 + inheritMode uint32 + objectType uint32 + shareMode uint32 + securityInformation uint32 + trusteeForm uint32 + trusteeType uint32 + + explicitAccess struct { + accessPermissions accessMask + accessMode accessMode + inheritance inheritMode + trustee trustee + } + + trustee struct { + multipleTrustee *trustee + multipleTrusteeOperation int32 + trusteeForm trusteeForm + trusteeType trusteeType + name uintptr + } +) + +const ( + accessMaskDesiredPermission accessMask = 1 << 31 // GENERIC_READ + + accessModeGrant accessMode = 1 + + desiredAccessReadControl desiredAccess = 0x20000 + desiredAccessWriteDac desiredAccess = 0x40000 + + gvmga = "GrantVmGroupAccess:" + + inheritModeNoInheritance inheritMode = 0x0 + inheritModeSubContainersAndObjectsInherit inheritMode = 0x3 + + objectTypeFileObject objectType = 0x1 + + securityInformationDACL securityInformation = 0x4 + + shareModeRead shareMode = 0x1 + shareModeWrite shareMode = 0x2 + + sidVmGroup = "S-1-5-83-0" + + trusteeFormIsSid trusteeForm = 0 + + trusteeTypeWellKnownGroup trusteeType = 5 +) + +// GrantVMGroupAccess sets the DACL for a specified file or directory to +// include Grant ACE entries for the VM Group SID. This is a golang re- +// implementation of the same function in vmcompute, just not exported in +// RS5. Which kind of sucks. Sucks a lot :/ +func GrantVmGroupAccess(name string) error { + // Stat (to determine if `name` is a directory). + s, err := os.Stat(name) + if err != nil { + return fmt.Errorf("%s os.Stat %s: %w", gvmga, name, err) + } + + // Get a handle to the file/directory. Must defer Close on success. + fd, err := createFile(name, s.IsDir()) + if err != nil { + return err // Already wrapped + } + defer syscall.CloseHandle(fd) + + // Get the current DACL and Security Descriptor. Must defer LocalFree on success. + ot := objectTypeFileObject + si := securityInformationDACL + sd := uintptr(0) + origDACL := uintptr(0) + if err := getSecurityInfo(fd, uint32(ot), uint32(si), nil, nil, &origDACL, nil, &sd); err != nil { + return fmt.Errorf("%s GetSecurityInfo %s: %w", gvmga, name, err) + } + defer syscall.LocalFree((syscall.Handle)(unsafe.Pointer(sd))) + + // Generate a new DACL which is the current DACL with the required ACEs added. + // Must defer LocalFree on success. + newDACL, err := generateDACLWithAcesAdded(name, s.IsDir(), origDACL) + if err != nil { + return err // Already wrapped + } + defer syscall.LocalFree((syscall.Handle)(unsafe.Pointer(newDACL))) + + // And finally use SetSecurityInfo to apply the updated DACL. + if err := setSecurityInfo(fd, uint32(ot), uint32(si), uintptr(0), uintptr(0), newDACL, uintptr(0)); err != nil { + return fmt.Errorf("%s SetSecurityInfo %s: %w", gvmga, name, err) + } + + return nil +} + +// createFile is a helper function to call [Nt]CreateFile to get a handle to +// the file or directory. +func createFile(name string, isDir bool) (syscall.Handle, error) { + namep := syscall.StringToUTF16(name) + da := uint32(desiredAccessReadControl | desiredAccessWriteDac) + sm := uint32(shareModeRead | shareModeWrite) + fa := uint32(syscall.FILE_ATTRIBUTE_NORMAL) + if isDir { + fa = uint32(fa | syscall.FILE_FLAG_BACKUP_SEMANTICS) + } + fd, err := syscall.CreateFile(&namep[0], da, sm, nil, syscall.OPEN_EXISTING, fa, 0) + if err != nil { + return 0, fmt.Errorf("%s syscall.CreateFile %s: %w", gvmga, name, err) + } + return fd, nil +} + +// generateDACLWithAcesAdded generates a new DACL with the two needed ACEs added. +// The caller is responsible for LocalFree of the returned DACL on success. +func generateDACLWithAcesAdded(name string, isDir bool, origDACL uintptr) (uintptr, error) { + // Generate pointers to the SIDs based on the string SIDs + sid, err := syscall.StringToSid(sidVmGroup) + if err != nil { + return 0, fmt.Errorf("%s syscall.StringToSid %s %s: %w", gvmga, name, sidVmGroup, err) + } + + inheritance := inheritModeNoInheritance + if isDir { + inheritance = inheritModeSubContainersAndObjectsInherit + } + + eaArray := []explicitAccess{ + explicitAccess{ + accessPermissions: accessMaskDesiredPermission, + accessMode: accessModeGrant, + inheritance: inheritance, + trustee: trustee{ + trusteeForm: trusteeFormIsSid, + trusteeType: trusteeTypeWellKnownGroup, + name: uintptr(unsafe.Pointer(sid)), + }, + }, + } + + modifiedDACL := uintptr(0) + if err := setEntriesInAcl(uintptr(uint32(1)), uintptr(unsafe.Pointer(&eaArray[0])), origDACL, &modifiedDACL); err != nil { + return 0, fmt.Errorf("%s SetEntriesInAcl %s: %w", gvmga, name, err) + } + + return modifiedDACL, nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/go-winio/pkg/security/syscall_windows.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/go-winio/pkg/security/syscall_windows.go new file mode 100644 index 000000000..d7096716c --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/go-winio/pkg/security/syscall_windows.go @@ -0,0 +1,7 @@ +package security + +//go:generate go run mksyscall_windows.go -output zsyscall_windows.go syscall_windows.go + +//sys getSecurityInfo(handle syscall.Handle, objectType uint32, si uint32, ppsidOwner **uintptr, ppsidGroup **uintptr, ppDacl *uintptr, ppSacl *uintptr, ppSecurityDescriptor *uintptr) (win32err error) = advapi32.GetSecurityInfo +//sys setSecurityInfo(handle syscall.Handle, objectType uint32, si uint32, psidOwner uintptr, psidGroup uintptr, pDacl uintptr, pSacl uintptr) (win32err error) = advapi32.SetSecurityInfo +//sys setEntriesInAcl(count uintptr, pListOfEEs uintptr, oldAcl uintptr, newAcl *uintptr) (win32err error) = advapi32.SetEntriesInAclW diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/go-winio/pkg/security/zsyscall_windows.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/go-winio/pkg/security/zsyscall_windows.go new file mode 100644 index 000000000..4084680e0 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/go-winio/pkg/security/zsyscall_windows.go @@ -0,0 +1,70 @@ +// Code generated by 'go generate'; DO NOT EDIT. + +package security + +import ( + "syscall" + "unsafe" + + "golang.org/x/sys/windows" +) + +var _ unsafe.Pointer + +// Do the interface allocations only once for common +// Errno values. +const ( + errnoERROR_IO_PENDING = 997 +) + +var ( + errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) + errERROR_EINVAL error = syscall.EINVAL +) + +// errnoErr returns common boxed Errno values, to prevent +// allocations at runtime. +func errnoErr(e syscall.Errno) error { + switch e { + case 0: + return errERROR_EINVAL + case errnoERROR_IO_PENDING: + return errERROR_IO_PENDING + } + // TODO: add more here, after collecting data on the common + // error values see on Windows. (perhaps when running + // all.bat?) + return e +} + +var ( + modadvapi32 = windows.NewLazySystemDLL("advapi32.dll") + + procGetSecurityInfo = modadvapi32.NewProc("GetSecurityInfo") + procSetEntriesInAclW = modadvapi32.NewProc("SetEntriesInAclW") + procSetSecurityInfo = modadvapi32.NewProc("SetSecurityInfo") +) + +func getSecurityInfo(handle syscall.Handle, objectType uint32, si uint32, ppsidOwner **uintptr, ppsidGroup **uintptr, ppDacl *uintptr, ppSacl *uintptr, ppSecurityDescriptor *uintptr) (win32err error) { + r0, _, _ := syscall.Syscall9(procGetSecurityInfo.Addr(), 8, uintptr(handle), uintptr(objectType), uintptr(si), uintptr(unsafe.Pointer(ppsidOwner)), uintptr(unsafe.Pointer(ppsidGroup)), uintptr(unsafe.Pointer(ppDacl)), uintptr(unsafe.Pointer(ppSacl)), uintptr(unsafe.Pointer(ppSecurityDescriptor)), 0) + if r0 != 0 { + win32err = syscall.Errno(r0) + } + return +} + +func setEntriesInAcl(count uintptr, pListOfEEs uintptr, oldAcl uintptr, newAcl *uintptr) (win32err error) { + r0, _, _ := syscall.Syscall6(procSetEntriesInAclW.Addr(), 4, uintptr(count), uintptr(pListOfEEs), uintptr(oldAcl), uintptr(unsafe.Pointer(newAcl)), 0, 0) + if r0 != 0 { + win32err = syscall.Errno(r0) + } + return +} + +func setSecurityInfo(handle syscall.Handle, objectType uint32, si uint32, psidOwner uintptr, psidGroup uintptr, pDacl uintptr, pSacl uintptr) (win32err error) { + r0, _, _ := syscall.Syscall9(procSetSecurityInfo.Addr(), 7, uintptr(handle), uintptr(objectType), uintptr(si), uintptr(psidOwner), uintptr(psidGroup), uintptr(pDacl), uintptr(pSacl), 0, 0) + if r0 != 0 { + win32err = syscall.Errno(r0) + } + return +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/go-winio/vhd/vhd.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/go-winio/vhd/vhd.go new file mode 100644 index 000000000..f7f78fc23 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/go-winio/vhd/vhd.go @@ -0,0 +1,350 @@ +//go:build windows +// +build windows + +package vhd + +import ( + "fmt" + "syscall" + + "github.com/Microsoft/go-winio/pkg/guid" + "golang.org/x/sys/windows" +) + +//go:generate go run mksyscall_windows.go -output zvhd_windows.go vhd.go + +//sys createVirtualDisk(virtualStorageType *VirtualStorageType, path string, virtualDiskAccessMask uint32, securityDescriptor *uintptr, createVirtualDiskFlags uint32, providerSpecificFlags uint32, parameters *CreateVirtualDiskParameters, overlapped *syscall.Overlapped, handle *syscall.Handle) (win32err error) = virtdisk.CreateVirtualDisk +//sys openVirtualDisk(virtualStorageType *VirtualStorageType, path string, virtualDiskAccessMask uint32, openVirtualDiskFlags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (win32err error) = virtdisk.OpenVirtualDisk +//sys attachVirtualDisk(handle syscall.Handle, securityDescriptor *uintptr, attachVirtualDiskFlag uint32, providerSpecificFlags uint32, parameters *AttachVirtualDiskParameters, overlapped *syscall.Overlapped) (win32err error) = virtdisk.AttachVirtualDisk +//sys detachVirtualDisk(handle syscall.Handle, detachVirtualDiskFlags uint32, providerSpecificFlags uint32) (win32err error) = virtdisk.DetachVirtualDisk +//sys getVirtualDiskPhysicalPath(handle syscall.Handle, diskPathSizeInBytes *uint32, buffer *uint16) (win32err error) = virtdisk.GetVirtualDiskPhysicalPath + +type ( + CreateVirtualDiskFlag uint32 + VirtualDiskFlag uint32 + AttachVirtualDiskFlag uint32 + DetachVirtualDiskFlag uint32 + VirtualDiskAccessMask uint32 +) + +type VirtualStorageType struct { + DeviceID uint32 + VendorID guid.GUID +} + +type CreateVersion2 struct { + UniqueID guid.GUID + MaximumSize uint64 + BlockSizeInBytes uint32 + SectorSizeInBytes uint32 + PhysicalSectorSizeInByte uint32 + ParentPath *uint16 // string + SourcePath *uint16 // string + OpenFlags uint32 + ParentVirtualStorageType VirtualStorageType + SourceVirtualStorageType VirtualStorageType + ResiliencyGUID guid.GUID +} + +type CreateVirtualDiskParameters struct { + Version uint32 // Must always be set to 2 + Version2 CreateVersion2 +} + +type OpenVersion2 struct { + GetInfoOnly bool + ReadOnly bool + ResiliencyGUID guid.GUID +} + +type OpenVirtualDiskParameters struct { + Version uint32 // Must always be set to 2 + Version2 OpenVersion2 +} + +// The higher level `OpenVersion2` struct uses bools to refer to `GetInfoOnly` and `ReadOnly` for ease of use. However, +// the internal windows structure uses `BOOLS` aka int32s for these types. `openVersion2` is used for translating +// `OpenVersion2` fields to the correct windows internal field types on the `Open____` methods. +type openVersion2 struct { + getInfoOnly int32 + readOnly int32 + resiliencyGUID guid.GUID +} + +type openVirtualDiskParameters struct { + version uint32 + version2 openVersion2 +} + +type AttachVersion2 struct { + RestrictedOffset uint64 + RestrictedLength uint64 +} + +type AttachVirtualDiskParameters struct { + Version uint32 + Version2 AttachVersion2 +} + +const ( + VIRTUAL_STORAGE_TYPE_DEVICE_VHDX = 0x3 + + // Access Mask for opening a VHD + VirtualDiskAccessNone VirtualDiskAccessMask = 0x00000000 + VirtualDiskAccessAttachRO VirtualDiskAccessMask = 0x00010000 + VirtualDiskAccessAttachRW VirtualDiskAccessMask = 0x00020000 + VirtualDiskAccessDetach VirtualDiskAccessMask = 0x00040000 + VirtualDiskAccessGetInfo VirtualDiskAccessMask = 0x00080000 + VirtualDiskAccessCreate VirtualDiskAccessMask = 0x00100000 + VirtualDiskAccessMetaOps VirtualDiskAccessMask = 0x00200000 + VirtualDiskAccessRead VirtualDiskAccessMask = 0x000d0000 + VirtualDiskAccessAll VirtualDiskAccessMask = 0x003f0000 + VirtualDiskAccessWritable VirtualDiskAccessMask = 0x00320000 + + // Flags for creating a VHD + CreateVirtualDiskFlagNone CreateVirtualDiskFlag = 0x0 + CreateVirtualDiskFlagFullPhysicalAllocation CreateVirtualDiskFlag = 0x1 + CreateVirtualDiskFlagPreventWritesToSourceDisk CreateVirtualDiskFlag = 0x2 + CreateVirtualDiskFlagDoNotCopyMetadataFromParent CreateVirtualDiskFlag = 0x4 + CreateVirtualDiskFlagCreateBackingStorage CreateVirtualDiskFlag = 0x8 + CreateVirtualDiskFlagUseChangeTrackingSourceLimit CreateVirtualDiskFlag = 0x10 + CreateVirtualDiskFlagPreserveParentChangeTrackingState CreateVirtualDiskFlag = 0x20 + CreateVirtualDiskFlagVhdSetUseOriginalBackingStorage CreateVirtualDiskFlag = 0x40 + CreateVirtualDiskFlagSparseFile CreateVirtualDiskFlag = 0x80 + CreateVirtualDiskFlagPmemCompatible CreateVirtualDiskFlag = 0x100 + CreateVirtualDiskFlagSupportCompressedVolumes CreateVirtualDiskFlag = 0x200 + + // Flags for opening a VHD + OpenVirtualDiskFlagNone VirtualDiskFlag = 0x00000000 + OpenVirtualDiskFlagNoParents VirtualDiskFlag = 0x00000001 + OpenVirtualDiskFlagBlankFile VirtualDiskFlag = 0x00000002 + OpenVirtualDiskFlagBootDrive VirtualDiskFlag = 0x00000004 + OpenVirtualDiskFlagCachedIO VirtualDiskFlag = 0x00000008 + OpenVirtualDiskFlagCustomDiffChain VirtualDiskFlag = 0x00000010 + OpenVirtualDiskFlagParentCachedIO VirtualDiskFlag = 0x00000020 + OpenVirtualDiskFlagVhdsetFileOnly VirtualDiskFlag = 0x00000040 + OpenVirtualDiskFlagIgnoreRelativeParentLocator VirtualDiskFlag = 0x00000080 + OpenVirtualDiskFlagNoWriteHardening VirtualDiskFlag = 0x00000100 + OpenVirtualDiskFlagSupportCompressedVolumes VirtualDiskFlag = 0x00000200 + + // Flags for attaching a VHD + AttachVirtualDiskFlagNone AttachVirtualDiskFlag = 0x00000000 + AttachVirtualDiskFlagReadOnly AttachVirtualDiskFlag = 0x00000001 + AttachVirtualDiskFlagNoDriveLetter AttachVirtualDiskFlag = 0x00000002 + AttachVirtualDiskFlagPermanentLifetime AttachVirtualDiskFlag = 0x00000004 + AttachVirtualDiskFlagNoLocalHost AttachVirtualDiskFlag = 0x00000008 + AttachVirtualDiskFlagNoSecurityDescriptor AttachVirtualDiskFlag = 0x00000010 + AttachVirtualDiskFlagBypassDefaultEncryptionPolicy AttachVirtualDiskFlag = 0x00000020 + AttachVirtualDiskFlagNonPnp AttachVirtualDiskFlag = 0x00000040 + AttachVirtualDiskFlagRestrictedRange AttachVirtualDiskFlag = 0x00000080 + AttachVirtualDiskFlagSinglePartition AttachVirtualDiskFlag = 0x00000100 + AttachVirtualDiskFlagRegisterVolume AttachVirtualDiskFlag = 0x00000200 + + // Flags for detaching a VHD + DetachVirtualDiskFlagNone DetachVirtualDiskFlag = 0x0 +) + +// CreateVhdx is a helper function to create a simple vhdx file at the given path using +// default values. +func CreateVhdx(path string, maxSizeInGb, blockSizeInMb uint32) error { + params := CreateVirtualDiskParameters{ + Version: 2, + Version2: CreateVersion2{ + MaximumSize: uint64(maxSizeInGb) * 1024 * 1024 * 1024, + BlockSizeInBytes: blockSizeInMb * 1024 * 1024, + }, + } + + handle, err := CreateVirtualDisk(path, VirtualDiskAccessNone, CreateVirtualDiskFlagNone, ¶ms) + if err != nil { + return err + } + + return syscall.CloseHandle(handle) +} + +// DetachVirtualDisk detaches a virtual hard disk by handle. +func DetachVirtualDisk(handle syscall.Handle) (err error) { + if err := detachVirtualDisk(handle, 0, 0); err != nil { + return fmt.Errorf("failed to detach virtual disk: %w", err) + } + return nil +} + +// DetachVhd detaches a vhd found at `path`. +func DetachVhd(path string) error { + handle, err := OpenVirtualDisk( + path, + VirtualDiskAccessNone, + OpenVirtualDiskFlagCachedIO|OpenVirtualDiskFlagIgnoreRelativeParentLocator, + ) + if err != nil { + return err + } + defer syscall.CloseHandle(handle) + return DetachVirtualDisk(handle) +} + +// AttachVirtualDisk attaches a virtual hard disk for use. +func AttachVirtualDisk(handle syscall.Handle, attachVirtualDiskFlag AttachVirtualDiskFlag, parameters *AttachVirtualDiskParameters) (err error) { + // Supports both version 1 and 2 of the attach parameters as version 2 wasn't present in RS5. + if err := attachVirtualDisk( + handle, + nil, + uint32(attachVirtualDiskFlag), + 0, + parameters, + nil, + ); err != nil { + return fmt.Errorf("failed to attach virtual disk: %w", err) + } + return nil +} + +// AttachVhd attaches a virtual hard disk at `path` for use. Attaches using version 2 +// of the ATTACH_VIRTUAL_DISK_PARAMETERS. +func AttachVhd(path string) (err error) { + handle, err := OpenVirtualDisk( + path, + VirtualDiskAccessNone, + OpenVirtualDiskFlagCachedIO|OpenVirtualDiskFlagIgnoreRelativeParentLocator, + ) + if err != nil { + return err + } + + defer syscall.CloseHandle(handle) + params := AttachVirtualDiskParameters{Version: 2} + if err := AttachVirtualDisk( + handle, + AttachVirtualDiskFlagNone, + ¶ms, + ); err != nil { + return fmt.Errorf("failed to attach virtual disk: %w", err) + } + return nil +} + +// OpenVirtualDisk obtains a handle to a VHD opened with supplied access mask and flags. +func OpenVirtualDisk(vhdPath string, virtualDiskAccessMask VirtualDiskAccessMask, openVirtualDiskFlags VirtualDiskFlag) (syscall.Handle, error) { + parameters := OpenVirtualDiskParameters{Version: 2} + handle, err := OpenVirtualDiskWithParameters( + vhdPath, + virtualDiskAccessMask, + openVirtualDiskFlags, + ¶meters, + ) + if err != nil { + return 0, err + } + return handle, nil +} + +// OpenVirtualDiskWithParameters obtains a handle to a VHD opened with supplied access mask, flags and parameters. +func OpenVirtualDiskWithParameters(vhdPath string, virtualDiskAccessMask VirtualDiskAccessMask, openVirtualDiskFlags VirtualDiskFlag, parameters *OpenVirtualDiskParameters) (syscall.Handle, error) { + var ( + handle syscall.Handle + defaultType VirtualStorageType + getInfoOnly int32 + readOnly int32 + ) + if parameters.Version != 2 { + return handle, fmt.Errorf("only version 2 VHDs are supported, found version: %d", parameters.Version) + } + if parameters.Version2.GetInfoOnly { + getInfoOnly = 1 + } + if parameters.Version2.ReadOnly { + readOnly = 1 + } + params := &openVirtualDiskParameters{ + version: parameters.Version, + version2: openVersion2{ + getInfoOnly, + readOnly, + parameters.Version2.ResiliencyGUID, + }, + } + if err := openVirtualDisk( + &defaultType, + vhdPath, + uint32(virtualDiskAccessMask), + uint32(openVirtualDiskFlags), + params, + &handle, + ); err != nil { + return 0, fmt.Errorf("failed to open virtual disk: %w", err) + } + return handle, nil +} + +// CreateVirtualDisk creates a virtual harddisk and returns a handle to the disk. +func CreateVirtualDisk(path string, virtualDiskAccessMask VirtualDiskAccessMask, createVirtualDiskFlags CreateVirtualDiskFlag, parameters *CreateVirtualDiskParameters) (syscall.Handle, error) { + var ( + handle syscall.Handle + defaultType VirtualStorageType + ) + if parameters.Version != 2 { + return handle, fmt.Errorf("only version 2 VHDs are supported, found version: %d", parameters.Version) + } + + if err := createVirtualDisk( + &defaultType, + path, + uint32(virtualDiskAccessMask), + nil, + uint32(createVirtualDiskFlags), + 0, + parameters, + nil, + &handle, + ); err != nil { + return handle, fmt.Errorf("failed to create virtual disk: %w", err) + } + return handle, nil +} + +// GetVirtualDiskPhysicalPath takes a handle to a virtual hard disk and returns the physical +// path of the disk on the machine. This path is in the form \\.\PhysicalDriveX where X is an integer +// that represents the particular enumeration of the physical disk on the caller's system. +func GetVirtualDiskPhysicalPath(handle syscall.Handle) (_ string, err error) { + var ( + diskPathSizeInBytes uint32 = 256 * 2 // max path length 256 wide chars + diskPhysicalPathBuf [256]uint16 + ) + if err := getVirtualDiskPhysicalPath( + handle, + &diskPathSizeInBytes, + &diskPhysicalPathBuf[0], + ); err != nil { + return "", fmt.Errorf("failed to get disk physical path: %w", err) + } + return windows.UTF16ToString(diskPhysicalPathBuf[:]), nil +} + +// CreateDiffVhd is a helper function to create a differencing virtual disk. +func CreateDiffVhd(diffVhdPath, baseVhdPath string, blockSizeInMB uint32) error { + // Setting `ParentPath` is how to signal to create a differencing disk. + createParams := &CreateVirtualDiskParameters{ + Version: 2, + Version2: CreateVersion2{ + ParentPath: windows.StringToUTF16Ptr(baseVhdPath), + BlockSizeInBytes: blockSizeInMB * 1024 * 1024, + OpenFlags: uint32(OpenVirtualDiskFlagCachedIO), + }, + } + + vhdHandle, err := CreateVirtualDisk( + diffVhdPath, + VirtualDiskAccessNone, + CreateVirtualDiskFlagNone, + createParams, + ) + if err != nil { + return fmt.Errorf("failed to create differencing vhd: %w", err) + } + if err := syscall.CloseHandle(vhdHandle); err != nil { + return fmt.Errorf("failed to close differencing vhd handle: %w", err) + } + return nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/go-winio/vhd/zvhd_windows.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/go-winio/vhd/zvhd_windows.go new file mode 100644 index 000000000..1d7498db3 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/go-winio/vhd/zvhd_windows.go @@ -0,0 +1,106 @@ +// Code generated by 'go generate'; DO NOT EDIT. + +package vhd + +import ( + "syscall" + "unsafe" + + "golang.org/x/sys/windows" +) + +var _ unsafe.Pointer + +// Do the interface allocations only once for common +// Errno values. +const ( + errnoERROR_IO_PENDING = 997 +) + +var ( + errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) + errERROR_EINVAL error = syscall.EINVAL +) + +// errnoErr returns common boxed Errno values, to prevent +// allocations at runtime. +func errnoErr(e syscall.Errno) error { + switch e { + case 0: + return errERROR_EINVAL + case errnoERROR_IO_PENDING: + return errERROR_IO_PENDING + } + // TODO: add more here, after collecting data on the common + // error values see on Windows. (perhaps when running + // all.bat?) + return e +} + +var ( + modvirtdisk = windows.NewLazySystemDLL("virtdisk.dll") + + procAttachVirtualDisk = modvirtdisk.NewProc("AttachVirtualDisk") + procCreateVirtualDisk = modvirtdisk.NewProc("CreateVirtualDisk") + procDetachVirtualDisk = modvirtdisk.NewProc("DetachVirtualDisk") + procGetVirtualDiskPhysicalPath = modvirtdisk.NewProc("GetVirtualDiskPhysicalPath") + procOpenVirtualDisk = modvirtdisk.NewProc("OpenVirtualDisk") +) + +func attachVirtualDisk(handle syscall.Handle, securityDescriptor *uintptr, attachVirtualDiskFlag uint32, providerSpecificFlags uint32, parameters *AttachVirtualDiskParameters, overlapped *syscall.Overlapped) (win32err error) { + r0, _, _ := syscall.Syscall6(procAttachVirtualDisk.Addr(), 6, uintptr(handle), uintptr(unsafe.Pointer(securityDescriptor)), uintptr(attachVirtualDiskFlag), uintptr(providerSpecificFlags), uintptr(unsafe.Pointer(parameters)), uintptr(unsafe.Pointer(overlapped))) + if r0 != 0 { + win32err = syscall.Errno(r0) + } + return +} + +func createVirtualDisk(virtualStorageType *VirtualStorageType, path string, virtualDiskAccessMask uint32, securityDescriptor *uintptr, createVirtualDiskFlags uint32, providerSpecificFlags uint32, parameters *CreateVirtualDiskParameters, overlapped *syscall.Overlapped, handle *syscall.Handle) (win32err error) { + var _p0 *uint16 + _p0, win32err = syscall.UTF16PtrFromString(path) + if win32err != nil { + return + } + return _createVirtualDisk(virtualStorageType, _p0, virtualDiskAccessMask, securityDescriptor, createVirtualDiskFlags, providerSpecificFlags, parameters, overlapped, handle) +} + +func _createVirtualDisk(virtualStorageType *VirtualStorageType, path *uint16, virtualDiskAccessMask uint32, securityDescriptor *uintptr, createVirtualDiskFlags uint32, providerSpecificFlags uint32, parameters *CreateVirtualDiskParameters, overlapped *syscall.Overlapped, handle *syscall.Handle) (win32err error) { + r0, _, _ := syscall.Syscall9(procCreateVirtualDisk.Addr(), 9, uintptr(unsafe.Pointer(virtualStorageType)), uintptr(unsafe.Pointer(path)), uintptr(virtualDiskAccessMask), uintptr(unsafe.Pointer(securityDescriptor)), uintptr(createVirtualDiskFlags), uintptr(providerSpecificFlags), uintptr(unsafe.Pointer(parameters)), uintptr(unsafe.Pointer(overlapped)), uintptr(unsafe.Pointer(handle))) + if r0 != 0 { + win32err = syscall.Errno(r0) + } + return +} + +func detachVirtualDisk(handle syscall.Handle, detachVirtualDiskFlags uint32, providerSpecificFlags uint32) (win32err error) { + r0, _, _ := syscall.Syscall(procDetachVirtualDisk.Addr(), 3, uintptr(handle), uintptr(detachVirtualDiskFlags), uintptr(providerSpecificFlags)) + if r0 != 0 { + win32err = syscall.Errno(r0) + } + return +} + +func getVirtualDiskPhysicalPath(handle syscall.Handle, diskPathSizeInBytes *uint32, buffer *uint16) (win32err error) { + r0, _, _ := syscall.Syscall(procGetVirtualDiskPhysicalPath.Addr(), 3, uintptr(handle), uintptr(unsafe.Pointer(diskPathSizeInBytes)), uintptr(unsafe.Pointer(buffer))) + if r0 != 0 { + win32err = syscall.Errno(r0) + } + return +} + +func openVirtualDisk(virtualStorageType *VirtualStorageType, path string, virtualDiskAccessMask uint32, openVirtualDiskFlags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (win32err error) { + var _p0 *uint16 + _p0, win32err = syscall.UTF16PtrFromString(path) + if win32err != nil { + return + } + return _openVirtualDisk(virtualStorageType, _p0, virtualDiskAccessMask, openVirtualDiskFlags, parameters, handle) +} + +func _openVirtualDisk(virtualStorageType *VirtualStorageType, path *uint16, virtualDiskAccessMask uint32, openVirtualDiskFlags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (win32err error) { + r0, _, _ := syscall.Syscall6(procOpenVirtualDisk.Addr(), 6, uintptr(unsafe.Pointer(virtualStorageType)), uintptr(unsafe.Pointer(path)), uintptr(virtualDiskAccessMask), uintptr(openVirtualDiskFlags), uintptr(unsafe.Pointer(parameters)), uintptr(unsafe.Pointer(handle))) + if r0 != 0 { + win32err = syscall.Errno(r0) + } + return +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/.gitattributes b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/.gitattributes new file mode 100644 index 000000000..94f480de9 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/.gitattributes @@ -0,0 +1 @@ +* text=auto eol=lf \ No newline at end of file diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/.gitignore b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/.gitignore new file mode 100644 index 000000000..54ed6f06c --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/.gitignore @@ -0,0 +1,38 @@ +# Binaries for programs and plugins +*.exe +*.dll +*.so +*.dylib + +# Ignore vscode setting files +.vscode/ + +# Test binary, build with `go test -c` +*.test + +# Output of the go coverage tool, specifically when used with LiteIDE +*.out + +# Project-local glide cache, RE: https://github.com/Masterminds/glide/issues/736 +.glide/ + +# Ignore gcs bin directory +service/bin/ +service/pkg/ + +*.img +*.vhd +*.tar.gz + +# Make stuff +.rootfs-done +bin/* +rootfs/* +*.o +/build/ + +deps/* +out/* + +.idea/ +.vscode/ \ No newline at end of file diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/.golangci.yml b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/.golangci.yml new file mode 100644 index 000000000..2400e7f1e --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/.golangci.yml @@ -0,0 +1,99 @@ +run: + timeout: 8m + +linters: + enable: + - stylecheck + +linters-settings: + stylecheck: + # https://staticcheck.io/docs/checks + checks: ["all"] + + +issues: + # This repo has a LOT of generated schema files, operating system bindings, and other things that ST1003 from stylecheck won't like + # (screaming case Windows api constants for example). There's also some structs that we *could* change the initialisms to be Go + # friendly (Id -> ID) but they're exported and it would be a breaking change. This makes it so that most new code, code that isn't + # supposed to be a pretty faithful mapping to an OS call/constants, or non-generated code still checks if we're following idioms, + # while ignoring the things that are just noise or would be more of a hassle than it'd be worth to change. + exclude-rules: + - path: layer.go + linters: + - stylecheck + Text: "ST1003:" + + - path: hcsshim.go + linters: + - stylecheck + Text: "ST1003:" + + - path: internal\\hcs\\schema2\\ + linters: + - stylecheck + Text: "ST1003:" + + - path: internal\\wclayer\\ + linters: + - stylecheck + Text: "ST1003:" + + - path: hcn\\ + linters: + - stylecheck + Text: "ST1003:" + + - path: internal\\hcs\\schema1\\ + linters: + - stylecheck + Text: "ST1003:" + + - path: internal\\hns\\ + linters: + - stylecheck + Text: "ST1003:" + + - path: ext4\\internal\\compactext4\\ + linters: + - stylecheck + Text: "ST1003:" + + - path: ext4\\internal\\format\\ + linters: + - stylecheck + Text: "ST1003:" + + - path: internal\\guestrequest\\ + linters: + - stylecheck + Text: "ST1003:" + + - path: internal\\guest\\prot\\ + linters: + - stylecheck + Text: "ST1003:" + + - path: internal\\windevice\\ + linters: + - stylecheck + Text: "ST1003:" + + - path: internal\\winapi\\ + linters: + - stylecheck + Text: "ST1003:" + + - path: internal\\vmcompute\\ + linters: + - stylecheck + Text: "ST1003:" + + - path: internal\\regstate\\ + linters: + - stylecheck + Text: "ST1003:" + + - path: internal\\hcserror\\ + linters: + - stylecheck + Text: "ST1003:" \ No newline at end of file diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/CODEOWNERS b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/CODEOWNERS new file mode 100644 index 000000000..f4c5a07d1 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/CODEOWNERS @@ -0,0 +1 @@ +* @microsoft/containerplat \ No newline at end of file diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/LICENSE b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/LICENSE new file mode 100644 index 000000000..49d21669a --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/LICENSE @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2015 Microsoft + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. \ No newline at end of file diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/Makefile b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/Makefile new file mode 100644 index 000000000..a8f5516cd --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/Makefile @@ -0,0 +1,87 @@ +BASE:=base.tar.gz + +GO:=go +GO_FLAGS:=-ldflags "-s -w" # strip Go binaries +CGO_ENABLED:=0 +GOMODVENDOR:= + +CFLAGS:=-O2 -Wall +LDFLAGS:=-static -s # strip C binaries + +GO_FLAGS_EXTRA:= +ifeq "$(GOMODVENDOR)" "1" +GO_FLAGS_EXTRA += -mod=vendor +endif +GO_BUILD:=CGO_ENABLED=$(CGO_ENABLED) $(GO) build $(GO_FLAGS) $(GO_FLAGS_EXTRA) + +SRCROOT=$(dir $(abspath $(firstword $(MAKEFILE_LIST)))) + +# The link aliases for gcstools +GCS_TOOLS=\ + generichook + +.PHONY: all always rootfs test + +all: out/initrd.img out/rootfs.tar.gz + +clean: + find -name '*.o' -print0 | xargs -0 -r rm + rm -rf bin deps rootfs out + +test: + cd $(SRCROOT) && go test -v ./internal/guest/... + +out/delta.tar.gz: bin/init bin/vsockexec bin/cmd/gcs bin/cmd/gcstools Makefile + @mkdir -p out + rm -rf rootfs + mkdir -p rootfs/bin/ + cp bin/init rootfs/ + cp bin/vsockexec rootfs/bin/ + cp bin/cmd/gcs rootfs/bin/ + cp bin/cmd/gcstools rootfs/bin/ + for tool in $(GCS_TOOLS); do ln -s gcstools rootfs/bin/$$tool; done + git -C $(SRCROOT) rev-parse HEAD > rootfs/gcs.commit && \ + git -C $(SRCROOT) rev-parse --abbrev-ref HEAD > rootfs/gcs.branch + tar -zcf $@ -C rootfs . + rm -rf rootfs + +out/rootfs.tar.gz: out/initrd.img + rm -rf rootfs-conv + mkdir rootfs-conv + gunzip -c out/initrd.img | (cd rootfs-conv && cpio -imd) + tar -zcf $@ -C rootfs-conv . + rm -rf rootfs-conv + +out/initrd.img: $(BASE) out/delta.tar.gz $(SRCROOT)/hack/catcpio.sh + $(SRCROOT)/hack/catcpio.sh "$(BASE)" out/delta.tar.gz > out/initrd.img.uncompressed + gzip -c out/initrd.img.uncompressed > $@ + rm out/initrd.img.uncompressed + +-include deps/cmd/gcs.gomake +-include deps/cmd/gcstools.gomake + +# Implicit rule for includes that define Go targets. +%.gomake: $(SRCROOT)/Makefile + @mkdir -p $(dir $@) + @/bin/echo $(@:deps/%.gomake=bin/%): $(SRCROOT)/hack/gomakedeps.sh > $@.new + @/bin/echo -e '\t@mkdir -p $$(dir $$@) $(dir $@)' >> $@.new + @/bin/echo -e '\t$$(GO_BUILD) -o $$@.new $$(SRCROOT)/$$(@:bin/%=%)' >> $@.new + @/bin/echo -e '\tGO="$(GO)" $$(SRCROOT)/hack/gomakedeps.sh $$@ $$(SRCROOT)/$$(@:bin/%=%) $$(GO_FLAGS) $$(GO_FLAGS_EXTRA) > $(@:%.gomake=%.godeps).new' >> $@.new + @/bin/echo -e '\tmv $(@:%.gomake=%.godeps).new $(@:%.gomake=%.godeps)' >> $@.new + @/bin/echo -e '\tmv $$@.new $$@' >> $@.new + @/bin/echo -e '-include $(@:%.gomake=%.godeps)' >> $@.new + mv $@.new $@ + +VPATH=$(SRCROOT) + +bin/vsockexec: vsockexec/vsockexec.o vsockexec/vsock.o + @mkdir -p bin + $(CC) $(LDFLAGS) -o $@ $^ + +bin/init: init/init.o vsockexec/vsock.o + @mkdir -p bin + $(CC) $(LDFLAGS) -o $@ $^ + +%.o: %.c + @mkdir -p $(dir $@) + $(CC) $(CFLAGS) $(CPPFLAGS) -c -o $@ $< diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/Protobuild.toml b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/Protobuild.toml new file mode 100644 index 000000000..ee18671aa --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/Protobuild.toml @@ -0,0 +1,49 @@ +version = "unstable" +generator = "gogoctrd" +plugins = ["grpc", "fieldpath"] + +# Control protoc include paths. Below are usually some good defaults, but feel +# free to try it without them if it works for your project. +[includes] + # Include paths that will be added before all others. Typically, you want to + # treat the root of the project as an include, but this may not be necessary. + before = ["./protobuf"] + + # Paths that should be treated as include roots in relation to the vendor + # directory. These will be calculated with the vendor directory nearest the + # target package. + packages = ["github.com/gogo/protobuf"] + + # Paths that will be added untouched to the end of the includes. We use + # `/usr/local/include` to pickup the common install location of protobuf. + # This is the default. + after = ["/usr/local/include"] + +# This section maps protobuf imports to Go packages. These will become +# `-M` directives in the call to the go protobuf generator. +[packages] + "gogoproto/gogo.proto" = "github.com/gogo/protobuf/gogoproto" + "google/protobuf/any.proto" = "github.com/gogo/protobuf/types" + "google/protobuf/empty.proto" = "github.com/gogo/protobuf/types" + "google/protobuf/struct.proto" = "github.com/gogo/protobuf/types" + "google/protobuf/descriptor.proto" = "github.com/gogo/protobuf/protoc-gen-gogo/descriptor" + "google/protobuf/field_mask.proto" = "github.com/gogo/protobuf/types" + "google/protobuf/timestamp.proto" = "github.com/gogo/protobuf/types" + "google/protobuf/duration.proto" = "github.com/gogo/protobuf/types" + "github/containerd/cgroups/stats/v1/metrics.proto" = "github.com/containerd/cgroups/stats/v1" + +[[overrides]] +prefixes = ["github.com/Microsoft/hcsshim/internal/shimdiag"] +plugins = ["ttrpc"] + +[[overrides]] +prefixes = ["github.com/Microsoft/hcsshim/internal/computeagent"] +plugins = ["ttrpc"] + +[[overrides]] +prefixes = ["github.com/Microsoft/hcsshim/internal/ncproxyttrpc"] +plugins = ["ttrpc"] + +[[overrides]] +prefixes = ["github.com/Microsoft/hcsshim/internal/vmservice"] +plugins = ["ttrpc"] \ No newline at end of file diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/README.md b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/README.md new file mode 100644 index 000000000..b8ca926a9 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/README.md @@ -0,0 +1,120 @@ +# hcsshim + +[![Build status](https://github.com/microsoft/hcsshim/actions/workflows/ci.yml/badge.svg?branch=master)](https://github.com/microsoft/hcsshim/actions?query=branch%3Amaster) + +This package contains the Golang interface for using the Windows [Host Compute Service](https://techcommunity.microsoft.com/t5/containers/introducing-the-host-compute-service-hcs/ba-p/382332) (HCS) to launch and manage [Windows Containers](https://docs.microsoft.com/en-us/virtualization/windowscontainers/about/). It also contains other helpers and functions for managing Windows Containers such as the Golang interface for the Host Network Service (HNS), as well as code for the [guest agent](./internal/guest/README.md) (commonly referred to as the GCS or Guest Compute Service in the codebase) used to support running Linux Hyper-V containers. + +It is primarily used in the [Moby](https://github.com/moby/moby) and [Containerd](https://github.com/containerd/containerd) projects, but it can be freely used by other projects as well. + +## Building + +While this repository can be used as a library of sorts to call the HCS apis, there are a couple binaries built out of the repository as well. The main ones being the Linux guest agent, and an implementation of the [runtime v2 containerd shim api](https://github.com/containerd/containerd/blob/master/runtime/v2/README.md). +### Linux Hyper-V Container Guest Agent + +To build the Linux guest agent itself all that's needed is to set your GOOS to "Linux" and build out of ./cmd/gcs. +```powershell +C:\> $env:GOOS="linux" +C:\> go build .\cmd\gcs\ +``` + +or on a Linux machine +```sh +> go build ./cmd/gcs +``` + +If you want it to be packaged inside of a rootfs to boot with alongside all of the other tools then you'll need to provide a rootfs that it can be packaged inside of. An easy way is to export the rootfs of a container. + +```sh +docker pull busybox +docker run --name base_image_container busybox +docker export base_image_container | gzip > base.tar.gz +BASE=./base.tar.gz +make all +``` + +If the build is successful, in the `./out` folder you should see: +```sh +> ls ./out/ +delta.tar.gz initrd.img rootfs.tar.gz +``` + +### Containerd Shim +For info on the Runtime V2 API: https://github.com/containerd/containerd/blob/master/runtime/v2/README.md. + +Contrary to the typical Linux architecture of shim -> runc, the runhcs shim is used both to launch and manage the lifetime of containers. + +```powershell +C:\> $env:GOOS="windows" +C:\> go build .\cmd\containerd-shim-runhcs-v1 +``` + +Then place the binary in the same directory that Containerd is located at in your environment. A default Containerd configuration file can be generated by running: +```powershell +.\containerd.exe config default | Out-File "C:\Program Files\containerd\config.toml" -Encoding ascii +``` + +This config file will already have the shim set as the default runtime for cri interactions. + +To trial using the shim out with ctr.exe: +```powershell +C:\> ctr.exe run --runtime io.containerd.runhcs.v1 --rm mcr.microsoft.com/windows/nanoserver:2004 windows-test cmd /c "echo Hello World!" +``` + +## Contributing + +This project welcomes contributions and suggestions. Most contributions require you to agree to a +Contributor License Agreement (CLA) declaring that you have the right to, and actually do, grant us +the rights to use your contribution. For details, visit https://cla.microsoft.com. + +When you submit a pull request, a CLA-bot will automatically determine whether you need to provide +a CLA and decorate the PR appropriately (e.g., label, comment). Simply follow the instructions +provided by the bot. You will only need to do this once across all repos using our CLA. + +We also require that contributors [sign their commits](https://git-scm.com/docs/git-commit) using `git commit -s` or `git commit --signoff` to +certify they either authored the work themselves or otherwise have permission to use it in this project. Please see https://developercertificate.org/ for +more info, as well as to make sure that you can attest to the rules listed. Our CI uses the [DCO Github app](https://github.com/apps/dco) to ensure +that all commits in a given PR are signed-off. + +### Test Directory (Important to note) + +This project has tried to trim some dependencies from the root Go modules file that would be cumbersome to get transitively included if this +project is being vendored/used as a library. Some of these dependencies were only being used for tests, so the /test directory in this project also has +its own go.mod file where these are now included to get around this issue. Our tests rely on the code in this project to run, so the test Go modules file +has a relative path replace directive to pull in the latest hcsshim code that the tests actually touch from this project +(which is the repo itself on your disk). + +``` +replace ( + github.com/Microsoft/hcsshim => ../ +) +``` + +Because of this, for most code changes you may need to run `go mod vendor` + `go mod tidy` in the /test directory in this repository, as the +CI in this project will check if the files are out of date and will fail if this is true. + + +## Code of Conduct + +This project has adopted the [Microsoft Open Source Code of Conduct](https://opensource.microsoft.com/codeofconduct/). +For more information see the [Code of Conduct FAQ](https://opensource.microsoft.com/codeofconduct/faq/) or +contact [opencode@microsoft.com](mailto:opencode@microsoft.com) with any additional questions or comments. + +## Dependencies + +This project requires Golang 1.9 or newer to build. + +For system requirements to run this project, see the Microsoft docs on [Windows Container requirements](https://docs.microsoft.com/en-us/virtualization/windowscontainers/deploy-containers/system-requirements). + +## Reporting Security Issues + +Security issues and bugs should be reported privately, via email, to the Microsoft Security +Response Center (MSRC) at [secure@microsoft.com](mailto:secure@microsoft.com). You should +receive a response within 24 hours. If for some reason you do not, please follow up via +email to ensure we received your original message. Further information, including the +[MSRC PGP](https://technet.microsoft.com/en-us/security/dn606155) key, can be found in +the [Security TechCenter](https://technet.microsoft.com/en-us/security/default). + +For additional details, see [Report a Computer Security Vulnerability](https://technet.microsoft.com/en-us/security/ff852094.aspx) on Technet + +--------------- +Copyright (c) 2018 Microsoft Corp. All rights reserved. diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/attach.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/attach.go new file mode 100644 index 000000000..7f1f2823d --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/attach.go @@ -0,0 +1,38 @@ +package computestorage + +import ( + "context" + "encoding/json" + + "github.com/Microsoft/hcsshim/internal/oc" + "github.com/pkg/errors" + "go.opencensus.io/trace" +) + +// AttachLayerStorageFilter sets up the layer storage filter on a writable +// container layer. +// +// `layerPath` is a path to a directory the writable layer is mounted. If the +// path does not end in a `\` the platform will append it automatically. +// +// `layerData` is the parent read-only layer data. +func AttachLayerStorageFilter(ctx context.Context, layerPath string, layerData LayerData) (err error) { + title := "hcsshim.AttachLayerStorageFilter" + ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("layerPath", layerPath), + ) + + bytes, err := json.Marshal(layerData) + if err != nil { + return err + } + + err = hcsAttachLayerStorageFilter(layerPath, string(bytes)) + if err != nil { + return errors.Wrap(err, "failed to attach layer storage filter") + } + return nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/destroy.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/destroy.go new file mode 100644 index 000000000..8e28e6c50 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/destroy.go @@ -0,0 +1,26 @@ +package computestorage + +import ( + "context" + + "github.com/Microsoft/hcsshim/internal/oc" + "github.com/pkg/errors" + "go.opencensus.io/trace" +) + +// DestroyLayer deletes a container layer. +// +// `layerPath` is a path to a directory containing the layer to export. +func DestroyLayer(ctx context.Context, layerPath string) (err error) { + title := "hcsshim.DestroyLayer" + ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("layerPath", layerPath)) + + err = hcsDestroyLayer(layerPath) + if err != nil { + return errors.Wrap(err, "failed to destroy layer") + } + return nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/detach.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/detach.go new file mode 100644 index 000000000..435473257 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/detach.go @@ -0,0 +1,26 @@ +package computestorage + +import ( + "context" + + "github.com/Microsoft/hcsshim/internal/oc" + "github.com/pkg/errors" + "go.opencensus.io/trace" +) + +// DetachLayerStorageFilter detaches the layer storage filter on a writable container layer. +// +// `layerPath` is a path to a directory containing the layer to export. +func DetachLayerStorageFilter(ctx context.Context, layerPath string) (err error) { + title := "hcsshim.DetachLayerStorageFilter" + ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("layerPath", layerPath)) + + err = hcsDetachLayerStorageFilter(layerPath) + if err != nil { + return errors.Wrap(err, "failed to detach layer storage filter") + } + return nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/export.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/export.go new file mode 100644 index 000000000..a1b12dd12 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/export.go @@ -0,0 +1,46 @@ +package computestorage + +import ( + "context" + "encoding/json" + + "github.com/Microsoft/hcsshim/internal/oc" + "github.com/pkg/errors" + "go.opencensus.io/trace" +) + +// ExportLayer exports a container layer. +// +// `layerPath` is a path to a directory containing the layer to export. +// +// `exportFolderPath` is a pre-existing folder to export the layer to. +// +// `layerData` is the parent layer data. +// +// `options` are the export options applied to the exported layer. +func ExportLayer(ctx context.Context, layerPath, exportFolderPath string, layerData LayerData, options ExportLayerOptions) (err error) { + title := "hcsshim.ExportLayer" + ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("layerPath", layerPath), + trace.StringAttribute("exportFolderPath", exportFolderPath), + ) + + ldbytes, err := json.Marshal(layerData) + if err != nil { + return err + } + + obytes, err := json.Marshal(options) + if err != nil { + return err + } + + err = hcsExportLayer(layerPath, exportFolderPath, string(ldbytes), string(obytes)) + if err != nil { + return errors.Wrap(err, "failed to export layer") + } + return nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/format.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/format.go new file mode 100644 index 000000000..83c0fa33f --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/format.go @@ -0,0 +1,26 @@ +package computestorage + +import ( + "context" + + "github.com/Microsoft/hcsshim/internal/oc" + "github.com/pkg/errors" + "go.opencensus.io/trace" + "golang.org/x/sys/windows" +) + +// FormatWritableLayerVhd formats a virtual disk for use as a writable container layer. +// +// If the VHD is not mounted it will be temporarily mounted. +func FormatWritableLayerVhd(ctx context.Context, vhdHandle windows.Handle) (err error) { + title := "hcsshim.FormatWritableLayerVhd" + ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + + err = hcsFormatWritableLayerVhd(vhdHandle) + if err != nil { + return errors.Wrap(err, "failed to format writable layer vhd") + } + return nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/helpers.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/helpers.go new file mode 100644 index 000000000..87fee452c --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/helpers.go @@ -0,0 +1,193 @@ +package computestorage + +import ( + "context" + "os" + "path/filepath" + "syscall" + + "github.com/Microsoft/go-winio/pkg/security" + "github.com/Microsoft/go-winio/vhd" + "github.com/pkg/errors" + "golang.org/x/sys/windows" +) + +const defaultVHDXBlockSizeInMB = 1 + +// SetupContainerBaseLayer is a helper to setup a containers scratch. It +// will create and format the vhdx's inside and the size is configurable with the sizeInGB +// parameter. +// +// `layerPath` is the path to the base container layer on disk. +// +// `baseVhdPath` is the path to where the base vhdx for the base layer should be created. +// +// `diffVhdPath` is the path where the differencing disk for the base layer should be created. +// +// `sizeInGB` is the size in gigabytes to make the base vhdx. +func SetupContainerBaseLayer(ctx context.Context, layerPath, baseVhdPath, diffVhdPath string, sizeInGB uint64) (err error) { + var ( + hivesPath = filepath.Join(layerPath, "Hives") + layoutPath = filepath.Join(layerPath, "Layout") + ) + + // We need to remove the hives directory and layout file as `SetupBaseOSLayer` fails if these files + // already exist. `SetupBaseOSLayer` will create these files internally. We also remove the base and + // differencing disks if they exist in case we're asking for a different size. + if _, err := os.Stat(hivesPath); err == nil { + if err := os.RemoveAll(hivesPath); err != nil { + return errors.Wrap(err, "failed to remove prexisting hives directory") + } + } + if _, err := os.Stat(layoutPath); err == nil { + if err := os.RemoveAll(layoutPath); err != nil { + return errors.Wrap(err, "failed to remove prexisting layout file") + } + } + + if _, err := os.Stat(baseVhdPath); err == nil { + if err := os.RemoveAll(baseVhdPath); err != nil { + return errors.Wrap(err, "failed to remove base vhdx path") + } + } + if _, err := os.Stat(diffVhdPath); err == nil { + if err := os.RemoveAll(diffVhdPath); err != nil { + return errors.Wrap(err, "failed to remove differencing vhdx") + } + } + + createParams := &vhd.CreateVirtualDiskParameters{ + Version: 2, + Version2: vhd.CreateVersion2{ + MaximumSize: sizeInGB * 1024 * 1024 * 1024, + BlockSizeInBytes: defaultVHDXBlockSizeInMB * 1024 * 1024, + }, + } + handle, err := vhd.CreateVirtualDisk(baseVhdPath, vhd.VirtualDiskAccessNone, vhd.CreateVirtualDiskFlagNone, createParams) + if err != nil { + return errors.Wrap(err, "failed to create vhdx") + } + + defer func() { + if err != nil { + _ = syscall.CloseHandle(handle) + os.RemoveAll(baseVhdPath) + os.RemoveAll(diffVhdPath) + } + }() + + if err = FormatWritableLayerVhd(ctx, windows.Handle(handle)); err != nil { + return err + } + // Base vhd handle must be closed before calling SetupBaseLayer in case of Container layer + if err = syscall.CloseHandle(handle); err != nil { + return errors.Wrap(err, "failed to close vhdx handle") + } + + options := OsLayerOptions{ + Type: OsLayerTypeContainer, + } + + // SetupBaseOSLayer expects an empty vhd handle for a container layer and will + // error out otherwise. + if err = SetupBaseOSLayer(ctx, layerPath, 0, options); err != nil { + return err + } + // Create the differencing disk that will be what's copied for the final rw layer + // for a container. + if err = vhd.CreateDiffVhd(diffVhdPath, baseVhdPath, defaultVHDXBlockSizeInMB); err != nil { + return errors.Wrap(err, "failed to create differencing disk") + } + + if err = security.GrantVmGroupAccess(baseVhdPath); err != nil { + return errors.Wrapf(err, "failed to grant vm group access to %s", baseVhdPath) + } + if err = security.GrantVmGroupAccess(diffVhdPath); err != nil { + return errors.Wrapf(err, "failed to grant vm group access to %s", diffVhdPath) + } + return nil +} + +// SetupUtilityVMBaseLayer is a helper to setup a UVMs scratch space. It will create and format +// the vhdx inside and the size is configurable by the sizeInGB parameter. +// +// `uvmPath` is the path to the UtilityVM filesystem. +// +// `baseVhdPath` is the path to where the base vhdx for the UVM should be created. +// +// `diffVhdPath` is the path where the differencing disk for the UVM should be created. +// +// `sizeInGB` specifies the size in gigabytes to make the base vhdx. +func SetupUtilityVMBaseLayer(ctx context.Context, uvmPath, baseVhdPath, diffVhdPath string, sizeInGB uint64) (err error) { + // Remove the base and differencing disks if they exist in case we're asking for a different size. + if _, err := os.Stat(baseVhdPath); err == nil { + if err := os.RemoveAll(baseVhdPath); err != nil { + return errors.Wrap(err, "failed to remove base vhdx") + } + } + if _, err := os.Stat(diffVhdPath); err == nil { + if err := os.RemoveAll(diffVhdPath); err != nil { + return errors.Wrap(err, "failed to remove differencing vhdx") + } + } + + // Just create the vhdx for utilityVM layer, no need to format it. + createParams := &vhd.CreateVirtualDiskParameters{ + Version: 2, + Version2: vhd.CreateVersion2{ + MaximumSize: sizeInGB * 1024 * 1024 * 1024, + BlockSizeInBytes: defaultVHDXBlockSizeInMB * 1024 * 1024, + }, + } + handle, err := vhd.CreateVirtualDisk(baseVhdPath, vhd.VirtualDiskAccessNone, vhd.CreateVirtualDiskFlagNone, createParams) + if err != nil { + return errors.Wrap(err, "failed to create vhdx") + } + + defer func() { + if err != nil { + _ = syscall.CloseHandle(handle) + os.RemoveAll(baseVhdPath) + os.RemoveAll(diffVhdPath) + } + }() + + // If it is a UtilityVM layer then the base vhdx must be attached when calling + // `SetupBaseOSLayer` + attachParams := &vhd.AttachVirtualDiskParameters{ + Version: 2, + } + if err := vhd.AttachVirtualDisk(handle, vhd.AttachVirtualDiskFlagNone, attachParams); err != nil { + return errors.Wrapf(err, "failed to attach virtual disk") + } + + options := OsLayerOptions{ + Type: OsLayerTypeVM, + } + if err := SetupBaseOSLayer(ctx, uvmPath, windows.Handle(handle), options); err != nil { + return err + } + + // Detach and close the handle after setting up the layer as we don't need the handle + // for anything else and we no longer need to be attached either. + if err = vhd.DetachVirtualDisk(handle); err != nil { + return errors.Wrap(err, "failed to detach vhdx") + } + if err = syscall.CloseHandle(handle); err != nil { + return errors.Wrap(err, "failed to close vhdx handle") + } + + // Create the differencing disk that will be what's copied for the final rw layer + // for a container. + if err = vhd.CreateDiffVhd(diffVhdPath, baseVhdPath, defaultVHDXBlockSizeInMB); err != nil { + return errors.Wrap(err, "failed to create differencing disk") + } + + if err := security.GrantVmGroupAccess(baseVhdPath); err != nil { + return errors.Wrapf(err, "failed to grant vm group access to %s", baseVhdPath) + } + if err := security.GrantVmGroupAccess(diffVhdPath); err != nil { + return errors.Wrapf(err, "failed to grant vm group access to %s", diffVhdPath) + } + return nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/import.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/import.go new file mode 100644 index 000000000..0c61dab32 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/import.go @@ -0,0 +1,41 @@ +package computestorage + +import ( + "context" + "encoding/json" + + "github.com/Microsoft/hcsshim/internal/oc" + "github.com/pkg/errors" + "go.opencensus.io/trace" +) + +// ImportLayer imports a container layer. +// +// `layerPath` is a path to a directory to import the layer to. If the directory +// does not exist it will be automatically created. +// +// `sourceFolderpath` is a pre-existing folder that contains the layer to +// import. +// +// `layerData` is the parent layer data. +func ImportLayer(ctx context.Context, layerPath, sourceFolderPath string, layerData LayerData) (err error) { + title := "hcsshim.ImportLayer" + ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("layerPath", layerPath), + trace.StringAttribute("sourceFolderPath", sourceFolderPath), + ) + + bytes, err := json.Marshal(layerData) + if err != nil { + return err + } + + err = hcsImportLayer(layerPath, sourceFolderPath, string(bytes)) + if err != nil { + return errors.Wrap(err, "failed to import layer") + } + return nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/initialize.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/initialize.go new file mode 100644 index 000000000..53ed8ea6e --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/initialize.go @@ -0,0 +1,38 @@ +package computestorage + +import ( + "context" + "encoding/json" + + "github.com/Microsoft/hcsshim/internal/oc" + "github.com/pkg/errors" + "go.opencensus.io/trace" +) + +// InitializeWritableLayer initializes a writable layer for a container. +// +// `layerPath` is a path to a directory the layer is mounted. If the +// path does not end in a `\` the platform will append it automatically. +// +// `layerData` is the parent read-only layer data. +func InitializeWritableLayer(ctx context.Context, layerPath string, layerData LayerData) (err error) { + title := "hcsshim.InitializeWritableLayer" + ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("layerPath", layerPath), + ) + + bytes, err := json.Marshal(layerData) + if err != nil { + return err + } + + // Options are not used in the platform as of RS5 + err = hcsInitializeWritableLayer(layerPath, string(bytes), "") + if err != nil { + return errors.Wrap(err, "failed to intitialize container layer") + } + return nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/mount.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/mount.go new file mode 100644 index 000000000..fcdbbef81 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/mount.go @@ -0,0 +1,27 @@ +package computestorage + +import ( + "context" + + "github.com/Microsoft/hcsshim/internal/interop" + "github.com/Microsoft/hcsshim/internal/oc" + "github.com/pkg/errors" + "go.opencensus.io/trace" + "golang.org/x/sys/windows" +) + +// GetLayerVhdMountPath returns the volume path for a virtual disk of a writable container layer. +func GetLayerVhdMountPath(ctx context.Context, vhdHandle windows.Handle) (path string, err error) { + title := "hcsshim.GetLayerVhdMountPath" + ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + + var mountPath *uint16 + err = hcsGetLayerVhdMountPath(vhdHandle, &mountPath) + if err != nil { + return "", errors.Wrap(err, "failed to get vhd mount path") + } + path = interop.ConvertAndFreeCoTaskMemString(mountPath) + return path, nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/setup.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/setup.go new file mode 100644 index 000000000..06aaf841e --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/setup.go @@ -0,0 +1,74 @@ +package computestorage + +import ( + "context" + "encoding/json" + + "github.com/Microsoft/hcsshim/internal/oc" + "github.com/Microsoft/hcsshim/osversion" + "github.com/pkg/errors" + "go.opencensus.io/trace" + "golang.org/x/sys/windows" +) + +// SetupBaseOSLayer sets up a layer that contains a base OS for a container. +// +// `layerPath` is a path to a directory containing the layer. +// +// `vhdHandle` is an empty file handle of `options.Type == OsLayerTypeContainer` +// or else it is a file handle to the 'SystemTemplateBase.vhdx' if `options.Type +// == OsLayerTypeVm`. +// +// `options` are the options applied while processing the layer. +func SetupBaseOSLayer(ctx context.Context, layerPath string, vhdHandle windows.Handle, options OsLayerOptions) (err error) { + title := "hcsshim.SetupBaseOSLayer" + ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("layerPath", layerPath), + ) + + bytes, err := json.Marshal(options) + if err != nil { + return err + } + + err = hcsSetupBaseOSLayer(layerPath, vhdHandle, string(bytes)) + if err != nil { + return errors.Wrap(err, "failed to setup base OS layer") + } + return nil +} + +// SetupBaseOSVolume sets up a volume that contains a base OS for a container. +// +// `layerPath` is a path to a directory containing the layer. +// +// `volumePath` is the path to the volume to be used for setup. +// +// `options` are the options applied while processing the layer. +func SetupBaseOSVolume(ctx context.Context, layerPath, volumePath string, options OsLayerOptions) (err error) { + if osversion.Build() < 19645 { + return errors.New("SetupBaseOSVolume is not present on builds older than 19645") + } + title := "hcsshim.SetupBaseOSVolume" + ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("layerPath", layerPath), + trace.StringAttribute("volumePath", volumePath), + ) + + bytes, err := json.Marshal(options) + if err != nil { + return err + } + + err = hcsSetupBaseOSVolume(layerPath, volumePath, string(bytes)) + if err != nil { + return errors.Wrap(err, "failed to setup base OS layer") + } + return nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/storage.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/storage.go new file mode 100644 index 000000000..95aff9c18 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/storage.go @@ -0,0 +1,50 @@ +// Package computestorage is a wrapper around the HCS storage APIs. These are new storage APIs introduced +// separate from the original graphdriver calls intended to give more freedom around creating +// and managing container layers and scratch spaces. +package computestorage + +import ( + hcsschema "github.com/Microsoft/hcsshim/internal/hcs/schema2" +) + +//go:generate go run ../mksyscall_windows.go -output zsyscall_windows.go storage.go + +//sys hcsImportLayer(layerPath string, sourceFolderPath string, layerData string) (hr error) = computestorage.HcsImportLayer? +//sys hcsExportLayer(layerPath string, exportFolderPath string, layerData string, options string) (hr error) = computestorage.HcsExportLayer? +//sys hcsDestroyLayer(layerPath string) (hr error) = computestorage.HcsDestoryLayer? +//sys hcsSetupBaseOSLayer(layerPath string, handle windows.Handle, options string) (hr error) = computestorage.HcsSetupBaseOSLayer? +//sys hcsInitializeWritableLayer(writableLayerPath string, layerData string, options string) (hr error) = computestorage.HcsInitializeWritableLayer? +//sys hcsAttachLayerStorageFilter(layerPath string, layerData string) (hr error) = computestorage.HcsAttachLayerStorageFilter? +//sys hcsDetachLayerStorageFilter(layerPath string) (hr error) = computestorage.HcsDetachLayerStorageFilter? +//sys hcsFormatWritableLayerVhd(handle windows.Handle) (hr error) = computestorage.HcsFormatWritableLayerVhd? +//sys hcsGetLayerVhdMountPath(vhdHandle windows.Handle, mountPath **uint16) (hr error) = computestorage.HcsGetLayerVhdMountPath? +//sys hcsSetupBaseOSVolume(layerPath string, volumePath string, options string) (hr error) = computestorage.HcsSetupBaseOSVolume? + +// LayerData is the data used to describe parent layer information. +type LayerData struct { + SchemaVersion hcsschema.Version `json:"SchemaVersion,omitempty"` + Layers []hcsschema.Layer `json:"Layers,omitempty"` +} + +// ExportLayerOptions are the set of options that are used with the `computestorage.HcsExportLayer` syscall. +type ExportLayerOptions struct { + IsWritableLayer bool `json:"IsWritableLayer,omitempty"` +} + +// OsLayerType is the type of layer being operated on. +type OsLayerType string + +const ( + // OsLayerTypeContainer is a container layer. + OsLayerTypeContainer OsLayerType = "Container" + // OsLayerTypeVM is a virtual machine layer. + OsLayerTypeVM OsLayerType = "Vm" +) + +// OsLayerOptions are the set of options that are used with the `SetupBaseOSLayer` and +// `SetupBaseOSVolume` calls. +type OsLayerOptions struct { + Type OsLayerType `json:"Type,omitempty"` + DisableCiCacheOptimization bool `json:"DisableCiCacheOptimization,omitempty"` + SkipUpdateBcdForBoot bool `json:"SkipUpdateBcdForBoot,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/zsyscall_windows.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/zsyscall_windows.go new file mode 100644 index 000000000..4f9518067 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/computestorage/zsyscall_windows.go @@ -0,0 +1,319 @@ +// Code generated mksyscall_windows.exe DO NOT EDIT + +package computestorage + +import ( + "syscall" + "unsafe" + + "golang.org/x/sys/windows" +) + +var _ unsafe.Pointer + +// Do the interface allocations only once for common +// Errno values. +const ( + errnoERROR_IO_PENDING = 997 +) + +var ( + errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) +) + +// errnoErr returns common boxed Errno values, to prevent +// allocations at runtime. +func errnoErr(e syscall.Errno) error { + switch e { + case 0: + return nil + case errnoERROR_IO_PENDING: + return errERROR_IO_PENDING + } + // TODO: add more here, after collecting data on the common + // error values see on Windows. (perhaps when running + // all.bat?) + return e +} + +var ( + modcomputestorage = windows.NewLazySystemDLL("computestorage.dll") + + procHcsImportLayer = modcomputestorage.NewProc("HcsImportLayer") + procHcsExportLayer = modcomputestorage.NewProc("HcsExportLayer") + procHcsDestoryLayer = modcomputestorage.NewProc("HcsDestoryLayer") + procHcsSetupBaseOSLayer = modcomputestorage.NewProc("HcsSetupBaseOSLayer") + procHcsInitializeWritableLayer = modcomputestorage.NewProc("HcsInitializeWritableLayer") + procHcsAttachLayerStorageFilter = modcomputestorage.NewProc("HcsAttachLayerStorageFilter") + procHcsDetachLayerStorageFilter = modcomputestorage.NewProc("HcsDetachLayerStorageFilter") + procHcsFormatWritableLayerVhd = modcomputestorage.NewProc("HcsFormatWritableLayerVhd") + procHcsGetLayerVhdMountPath = modcomputestorage.NewProc("HcsGetLayerVhdMountPath") + procHcsSetupBaseOSVolume = modcomputestorage.NewProc("HcsSetupBaseOSVolume") +) + +func hcsImportLayer(layerPath string, sourceFolderPath string, layerData string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(layerPath) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(sourceFolderPath) + if hr != nil { + return + } + var _p2 *uint16 + _p2, hr = syscall.UTF16PtrFromString(layerData) + if hr != nil { + return + } + return _hcsImportLayer(_p0, _p1, _p2) +} + +func _hcsImportLayer(layerPath *uint16, sourceFolderPath *uint16, layerData *uint16) (hr error) { + if hr = procHcsImportLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsImportLayer.Addr(), 3, uintptr(unsafe.Pointer(layerPath)), uintptr(unsafe.Pointer(sourceFolderPath)), uintptr(unsafe.Pointer(layerData))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsExportLayer(layerPath string, exportFolderPath string, layerData string, options string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(layerPath) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(exportFolderPath) + if hr != nil { + return + } + var _p2 *uint16 + _p2, hr = syscall.UTF16PtrFromString(layerData) + if hr != nil { + return + } + var _p3 *uint16 + _p3, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsExportLayer(_p0, _p1, _p2, _p3) +} + +func _hcsExportLayer(layerPath *uint16, exportFolderPath *uint16, layerData *uint16, options *uint16) (hr error) { + if hr = procHcsExportLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsExportLayer.Addr(), 4, uintptr(unsafe.Pointer(layerPath)), uintptr(unsafe.Pointer(exportFolderPath)), uintptr(unsafe.Pointer(layerData)), uintptr(unsafe.Pointer(options)), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsDestroyLayer(layerPath string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(layerPath) + if hr != nil { + return + } + return _hcsDestroyLayer(_p0) +} + +func _hcsDestroyLayer(layerPath *uint16) (hr error) { + if hr = procHcsDestoryLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsDestoryLayer.Addr(), 1, uintptr(unsafe.Pointer(layerPath)), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsSetupBaseOSLayer(layerPath string, handle windows.Handle, options string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(layerPath) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsSetupBaseOSLayer(_p0, handle, _p1) +} + +func _hcsSetupBaseOSLayer(layerPath *uint16, handle windows.Handle, options *uint16) (hr error) { + if hr = procHcsSetupBaseOSLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsSetupBaseOSLayer.Addr(), 3, uintptr(unsafe.Pointer(layerPath)), uintptr(handle), uintptr(unsafe.Pointer(options))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsInitializeWritableLayer(writableLayerPath string, layerData string, options string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(writableLayerPath) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(layerData) + if hr != nil { + return + } + var _p2 *uint16 + _p2, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsInitializeWritableLayer(_p0, _p1, _p2) +} + +func _hcsInitializeWritableLayer(writableLayerPath *uint16, layerData *uint16, options *uint16) (hr error) { + if hr = procHcsInitializeWritableLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsInitializeWritableLayer.Addr(), 3, uintptr(unsafe.Pointer(writableLayerPath)), uintptr(unsafe.Pointer(layerData)), uintptr(unsafe.Pointer(options))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsAttachLayerStorageFilter(layerPath string, layerData string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(layerPath) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(layerData) + if hr != nil { + return + } + return _hcsAttachLayerStorageFilter(_p0, _p1) +} + +func _hcsAttachLayerStorageFilter(layerPath *uint16, layerData *uint16) (hr error) { + if hr = procHcsAttachLayerStorageFilter.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsAttachLayerStorageFilter.Addr(), 2, uintptr(unsafe.Pointer(layerPath)), uintptr(unsafe.Pointer(layerData)), 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsDetachLayerStorageFilter(layerPath string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(layerPath) + if hr != nil { + return + } + return _hcsDetachLayerStorageFilter(_p0) +} + +func _hcsDetachLayerStorageFilter(layerPath *uint16) (hr error) { + if hr = procHcsDetachLayerStorageFilter.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsDetachLayerStorageFilter.Addr(), 1, uintptr(unsafe.Pointer(layerPath)), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsFormatWritableLayerVhd(handle windows.Handle) (hr error) { + if hr = procHcsFormatWritableLayerVhd.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsFormatWritableLayerVhd.Addr(), 1, uintptr(handle), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsGetLayerVhdMountPath(vhdHandle windows.Handle, mountPath **uint16) (hr error) { + if hr = procHcsGetLayerVhdMountPath.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsGetLayerVhdMountPath.Addr(), 2, uintptr(vhdHandle), uintptr(unsafe.Pointer(mountPath)), 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsSetupBaseOSVolume(layerPath string, volumePath string, options string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(layerPath) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(volumePath) + if hr != nil { + return + } + var _p2 *uint16 + _p2, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsSetupBaseOSVolume(_p0, _p1, _p2) +} + +func _hcsSetupBaseOSVolume(layerPath *uint16, volumePath *uint16, options *uint16) (hr error) { + if hr = procHcsSetupBaseOSVolume.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsSetupBaseOSVolume.Addr(), 3, uintptr(unsafe.Pointer(layerPath)), uintptr(unsafe.Pointer(volumePath)), uintptr(unsafe.Pointer(options))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/container.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/container.go new file mode 100644 index 000000000..bfd722898 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/container.go @@ -0,0 +1,223 @@ +package hcsshim + +import ( + "context" + "fmt" + "os" + "sync" + "time" + + "github.com/Microsoft/hcsshim/internal/hcs" + "github.com/Microsoft/hcsshim/internal/hcs/schema1" + "github.com/Microsoft/hcsshim/internal/mergemaps" +) + +// ContainerProperties holds the properties for a container and the processes running in that container +type ContainerProperties = schema1.ContainerProperties + +// MemoryStats holds the memory statistics for a container +type MemoryStats = schema1.MemoryStats + +// ProcessorStats holds the processor statistics for a container +type ProcessorStats = schema1.ProcessorStats + +// StorageStats holds the storage statistics for a container +type StorageStats = schema1.StorageStats + +// NetworkStats holds the network statistics for a container +type NetworkStats = schema1.NetworkStats + +// Statistics is the structure returned by a statistics call on a container +type Statistics = schema1.Statistics + +// ProcessList is the structure of an item returned by a ProcessList call on a container +type ProcessListItem = schema1.ProcessListItem + +// MappedVirtualDiskController is the structure of an item returned by a MappedVirtualDiskList call on a container +type MappedVirtualDiskController = schema1.MappedVirtualDiskController + +// Type of Request Support in ModifySystem +type RequestType = schema1.RequestType + +// Type of Resource Support in ModifySystem +type ResourceType = schema1.ResourceType + +// RequestType const +const ( + Add = schema1.Add + Remove = schema1.Remove + Network = schema1.Network +) + +// ResourceModificationRequestResponse is the structure used to send request to the container to modify the system +// Supported resource types are Network and Request Types are Add/Remove +type ResourceModificationRequestResponse = schema1.ResourceModificationRequestResponse + +type container struct { + system *hcs.System + waitOnce sync.Once + waitErr error + waitCh chan struct{} +} + +// createComputeSystemAdditionalJSON is read from the environment at initialisation +// time. It allows an environment variable to define additional JSON which +// is merged in the CreateComputeSystem call to HCS. +var createContainerAdditionalJSON []byte + +func init() { + createContainerAdditionalJSON = ([]byte)(os.Getenv("HCSSHIM_CREATECONTAINER_ADDITIONALJSON")) +} + +// CreateContainer creates a new container with the given configuration but does not start it. +func CreateContainer(id string, c *ContainerConfig) (Container, error) { + fullConfig, err := mergemaps.MergeJSON(c, createContainerAdditionalJSON) + if err != nil { + return nil, fmt.Errorf("failed to merge additional JSON '%s': %s", createContainerAdditionalJSON, err) + } + + system, err := hcs.CreateComputeSystem(context.Background(), id, fullConfig) + if err != nil { + return nil, err + } + return &container{system: system}, err +} + +// OpenContainer opens an existing container by ID. +func OpenContainer(id string) (Container, error) { + system, err := hcs.OpenComputeSystem(context.Background(), id) + if err != nil { + return nil, err + } + return &container{system: system}, err +} + +// GetContainers gets a list of the containers on the system that match the query +func GetContainers(q ComputeSystemQuery) ([]ContainerProperties, error) { + return hcs.GetComputeSystems(context.Background(), q) +} + +// Start synchronously starts the container. +func (container *container) Start() error { + return convertSystemError(container.system.Start(context.Background()), container) +} + +// Shutdown requests a container shutdown, but it may not actually be shutdown until Wait() succeeds. +func (container *container) Shutdown() error { + err := container.system.Shutdown(context.Background()) + if err != nil { + return convertSystemError(err, container) + } + return &ContainerError{Container: container, Err: ErrVmcomputeOperationPending, Operation: "hcsshim::ComputeSystem::Shutdown"} +} + +// Terminate requests a container terminate, but it may not actually be terminated until Wait() succeeds. +func (container *container) Terminate() error { + err := container.system.Terminate(context.Background()) + if err != nil { + return convertSystemError(err, container) + } + return &ContainerError{Container: container, Err: ErrVmcomputeOperationPending, Operation: "hcsshim::ComputeSystem::Terminate"} +} + +// Waits synchronously waits for the container to shutdown or terminate. +func (container *container) Wait() error { + err := container.system.Wait() + if err == nil { + err = container.system.ExitError() + } + return convertSystemError(err, container) +} + +// WaitTimeout synchronously waits for the container to terminate or the duration to elapse. It +// returns false if timeout occurs. +func (container *container) WaitTimeout(timeout time.Duration) error { + container.waitOnce.Do(func() { + container.waitCh = make(chan struct{}) + go func() { + container.waitErr = container.Wait() + close(container.waitCh) + }() + }) + t := time.NewTimer(timeout) + defer t.Stop() + select { + case <-t.C: + return &ContainerError{Container: container, Err: ErrTimeout, Operation: "hcsshim::ComputeSystem::Wait"} + case <-container.waitCh: + return container.waitErr + } +} + +// Pause pauses the execution of a container. +func (container *container) Pause() error { + return convertSystemError(container.system.Pause(context.Background()), container) +} + +// Resume resumes the execution of a container. +func (container *container) Resume() error { + return convertSystemError(container.system.Resume(context.Background()), container) +} + +// HasPendingUpdates returns true if the container has updates pending to install +func (container *container) HasPendingUpdates() (bool, error) { + return false, nil +} + +// Statistics returns statistics for the container. This is a legacy v1 call +func (container *container) Statistics() (Statistics, error) { + properties, err := container.system.Properties(context.Background(), schema1.PropertyTypeStatistics) + if err != nil { + return Statistics{}, convertSystemError(err, container) + } + + return properties.Statistics, nil +} + +// ProcessList returns an array of ProcessListItems for the container. This is a legacy v1 call +func (container *container) ProcessList() ([]ProcessListItem, error) { + properties, err := container.system.Properties(context.Background(), schema1.PropertyTypeProcessList) + if err != nil { + return nil, convertSystemError(err, container) + } + + return properties.ProcessList, nil +} + +// This is a legacy v1 call +func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskController, error) { + properties, err := container.system.Properties(context.Background(), schema1.PropertyTypeMappedVirtualDisk) + if err != nil { + return nil, convertSystemError(err, container) + } + + return properties.MappedVirtualDiskControllers, nil +} + +// CreateProcess launches a new process within the container. +func (container *container) CreateProcess(c *ProcessConfig) (Process, error) { + p, err := container.system.CreateProcess(context.Background(), c) + if err != nil { + return nil, convertSystemError(err, container) + } + return &process{p: p.(*hcs.Process)}, nil +} + +// OpenProcess gets an interface to an existing process within the container. +func (container *container) OpenProcess(pid int) (Process, error) { + p, err := container.system.OpenProcess(context.Background(), pid) + if err != nil { + return nil, convertSystemError(err, container) + } + return &process{p: p}, nil +} + +// Close cleans up any state associated with the container but does not terminate or wait for it. +func (container *container) Close() error { + return convertSystemError(container.system.Close(), container) +} + +// Modify the System +func (container *container) Modify(config *ResourceModificationRequestResponse) error { + return convertSystemError(container.system.Modify(context.Background(), config), container) +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/errors.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/errors.go new file mode 100644 index 000000000..f367022e7 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/errors.go @@ -0,0 +1,245 @@ +package hcsshim + +import ( + "fmt" + "syscall" + + "github.com/Microsoft/hcsshim/internal/hns" + + "github.com/Microsoft/hcsshim/internal/hcs" + "github.com/Microsoft/hcsshim/internal/hcserror" +) + +var ( + // ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists = hcs.exist + ErrComputeSystemDoesNotExist = hcs.ErrComputeSystemDoesNotExist + + // ErrElementNotFound is an error encountered when the object being referenced does not exist + ErrElementNotFound = hcs.ErrElementNotFound + + // ErrElementNotFound is an error encountered when the object being referenced does not exist + ErrNotSupported = hcs.ErrNotSupported + + // ErrInvalidData is an error encountered when the request being sent to hcs is invalid/unsupported + // decimal -2147024883 / hex 0x8007000d + ErrInvalidData = hcs.ErrInvalidData + + // ErrHandleClose is an error encountered when the handle generating the notification being waited on has been closed + ErrHandleClose = hcs.ErrHandleClose + + // ErrAlreadyClosed is an error encountered when using a handle that has been closed by the Close method + ErrAlreadyClosed = hcs.ErrAlreadyClosed + + // ErrInvalidNotificationType is an error encountered when an invalid notification type is used + ErrInvalidNotificationType = hcs.ErrInvalidNotificationType + + // ErrInvalidProcessState is an error encountered when the process is not in a valid state for the requested operation + ErrInvalidProcessState = hcs.ErrInvalidProcessState + + // ErrTimeout is an error encountered when waiting on a notification times out + ErrTimeout = hcs.ErrTimeout + + // ErrUnexpectedContainerExit is the error encountered when a container exits while waiting for + // a different expected notification + ErrUnexpectedContainerExit = hcs.ErrUnexpectedContainerExit + + // ErrUnexpectedProcessAbort is the error encountered when communication with the compute service + // is lost while waiting for a notification + ErrUnexpectedProcessAbort = hcs.ErrUnexpectedProcessAbort + + // ErrUnexpectedValue is an error encountered when hcs returns an invalid value + ErrUnexpectedValue = hcs.ErrUnexpectedValue + + // ErrVmcomputeAlreadyStopped is an error encountered when a shutdown or terminate request is made on a stopped container + ErrVmcomputeAlreadyStopped = hcs.ErrVmcomputeAlreadyStopped + + // ErrVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously + ErrVmcomputeOperationPending = hcs.ErrVmcomputeOperationPending + + // ErrVmcomputeOperationInvalidState is an error encountered when the compute system is not in a valid state for the requested operation + ErrVmcomputeOperationInvalidState = hcs.ErrVmcomputeOperationInvalidState + + // ErrProcNotFound is an error encountered when a procedure look up fails. + ErrProcNotFound = hcs.ErrProcNotFound + + // ErrVmcomputeOperationAccessIsDenied is an error which can be encountered when enumerating compute systems in RS1/RS2 + // builds when the underlying silo might be in the process of terminating. HCS was fixed in RS3. + ErrVmcomputeOperationAccessIsDenied = hcs.ErrVmcomputeOperationAccessIsDenied + + // ErrVmcomputeInvalidJSON is an error encountered when the compute system does not support/understand the messages sent by management + ErrVmcomputeInvalidJSON = hcs.ErrVmcomputeInvalidJSON + + // ErrVmcomputeUnknownMessage is an error encountered guest compute system doesn't support the message + ErrVmcomputeUnknownMessage = hcs.ErrVmcomputeUnknownMessage + + // ErrNotSupported is an error encountered when hcs doesn't support the request + ErrPlatformNotSupported = hcs.ErrPlatformNotSupported +) + +type EndpointNotFoundError = hns.EndpointNotFoundError +type NetworkNotFoundError = hns.NetworkNotFoundError + +// ProcessError is an error encountered in HCS during an operation on a Process object +type ProcessError struct { + Process *process + Operation string + Err error + Events []hcs.ErrorEvent +} + +// ContainerError is an error encountered in HCS during an operation on a Container object +type ContainerError struct { + Container *container + Operation string + Err error + Events []hcs.ErrorEvent +} + +func (e *ContainerError) Error() string { + if e == nil { + return "" + } + + if e.Container == nil { + return "unexpected nil container for error: " + e.Err.Error() + } + + s := "container " + e.Container.system.ID() + + if e.Operation != "" { + s += " encountered an error during " + e.Operation + } + + switch e.Err.(type) { + case nil: + break + case syscall.Errno: + s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, hcserror.Win32FromError(e.Err)) + default: + s += fmt.Sprintf(": %s", e.Err.Error()) + } + + for _, ev := range e.Events { + s += "\n" + ev.String() + } + + return s +} + +func (e *ProcessError) Error() string { + if e == nil { + return "" + } + + if e.Process == nil { + return "Unexpected nil process for error: " + e.Err.Error() + } + + s := fmt.Sprintf("process %d in container %s", e.Process.p.Pid(), e.Process.p.SystemID()) + if e.Operation != "" { + s += " encountered an error during " + e.Operation + } + + switch e.Err.(type) { + case nil: + break + case syscall.Errno: + s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, hcserror.Win32FromError(e.Err)) + default: + s += fmt.Sprintf(": %s", e.Err.Error()) + } + + for _, ev := range e.Events { + s += "\n" + ev.String() + } + + return s +} + +// IsNotExist checks if an error is caused by the Container or Process not existing. +// Note: Currently, ErrElementNotFound can mean that a Process has either +// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist +// will currently return true when the error is ErrElementNotFound. +func IsNotExist(err error) bool { + if _, ok := err.(EndpointNotFoundError); ok { + return true + } + if _, ok := err.(NetworkNotFoundError); ok { + return true + } + return hcs.IsNotExist(getInnerError(err)) +} + +// IsAlreadyClosed checks if an error is caused by the Container or Process having been +// already closed by a call to the Close() method. +func IsAlreadyClosed(err error) bool { + return hcs.IsAlreadyClosed(getInnerError(err)) +} + +// IsPending returns a boolean indicating whether the error is that +// the requested operation is being completed in the background. +func IsPending(err error) bool { + return hcs.IsPending(getInnerError(err)) +} + +// IsTimeout returns a boolean indicating whether the error is caused by +// a timeout waiting for the operation to complete. +func IsTimeout(err error) bool { + return hcs.IsTimeout(getInnerError(err)) +} + +// IsAlreadyStopped returns a boolean indicating whether the error is caused by +// a Container or Process being already stopped. +// Note: Currently, ErrElementNotFound can mean that a Process has either +// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist +// will currently return true when the error is ErrElementNotFound. +func IsAlreadyStopped(err error) bool { + return hcs.IsAlreadyStopped(getInnerError(err)) +} + +// IsNotSupported returns a boolean indicating whether the error is caused by +// unsupported platform requests +// Note: Currently Unsupported platform requests can be mean either +// ErrVmcomputeInvalidJSON, ErrInvalidData, ErrNotSupported or ErrVmcomputeUnknownMessage +// is thrown from the Platform +func IsNotSupported(err error) bool { + return hcs.IsNotSupported(getInnerError(err)) +} + +// IsOperationInvalidState returns true when err is caused by +// `ErrVmcomputeOperationInvalidState`. +func IsOperationInvalidState(err error) bool { + return hcs.IsOperationInvalidState(getInnerError(err)) +} + +// IsAccessIsDenied returns true when err is caused by +// `ErrVmcomputeOperationAccessIsDenied`. +func IsAccessIsDenied(err error) bool { + return hcs.IsAccessIsDenied(getInnerError(err)) +} + +func getInnerError(err error) error { + switch pe := err.(type) { + case nil: + return nil + case *ContainerError: + err = pe.Err + case *ProcessError: + err = pe.Err + } + return err +} + +func convertSystemError(err error, c *container) error { + if serr, ok := err.(*hcs.SystemError); ok { + return &ContainerError{Container: c, Operation: serr.Op, Err: serr.Err, Events: serr.Events} + } + return err +} + +func convertProcessError(err error, p *process) error { + if perr, ok := err.(*hcs.ProcessError); ok { + return &ProcessError{Process: p, Operation: perr.Op, Err: perr.Err, Events: perr.Events} + } + return err +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/functional_tests.ps1 b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/functional_tests.ps1 new file mode 100644 index 000000000..ce6edbcf3 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/functional_tests.ps1 @@ -0,0 +1,12 @@ +# Requirements so far: +# dockerd running +# - image microsoft/nanoserver (matching host base image) docker load -i c:\baseimages\nanoserver.tar +# - image alpine (linux) docker pull --platform=linux alpine + + +# TODO: Add this a parameter for debugging. ie "functional-tests -debug=$true" +#$env:HCSSHIM_FUNCTIONAL_TESTS_DEBUG="yes please" + +#pushd uvm +go test -v -tags "functional uvmcreate uvmscratch uvmscsi uvmvpmem uvmvsmb uvmp9" ./... +#popd \ No newline at end of file diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/hcsshim.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/hcsshim.go new file mode 100644 index 000000000..ceb3ac85e --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/hcsshim.go @@ -0,0 +1,28 @@ +// Shim for the Host Compute Service (HCS) to manage Windows Server +// containers and Hyper-V containers. + +package hcsshim + +import ( + "syscall" + + "github.com/Microsoft/hcsshim/internal/hcserror" +) + +//go:generate go run mksyscall_windows.go -output zsyscall_windows.go hcsshim.go + +//sys SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) = iphlpapi.SetCurrentThreadCompartmentId + +const ( + // Specific user-visible exit codes + WaitErrExecFailed = 32767 + + ERROR_GEN_FAILURE = hcserror.ERROR_GEN_FAILURE + ERROR_SHUTDOWN_IN_PROGRESS = syscall.Errno(1115) + WSAEINVAL = syscall.Errno(10022) + + // Timeout on wait calls + TimeoutInfinite = 0xFFFFFFFF +) + +type HcsError = hcserror.HcsError diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go new file mode 100644 index 000000000..9e0059447 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go @@ -0,0 +1,118 @@ +package hcsshim + +import ( + "github.com/Microsoft/hcsshim/internal/hns" +) + +// HNSEndpoint represents a network endpoint in HNS +type HNSEndpoint = hns.HNSEndpoint + +// HNSEndpointStats represent the stats for an networkendpoint in HNS +type HNSEndpointStats = hns.EndpointStats + +// Namespace represents a Compartment. +type Namespace = hns.Namespace + +//SystemType represents the type of the system on which actions are done +type SystemType string + +// SystemType const +const ( + ContainerType SystemType = "Container" + VirtualMachineType SystemType = "VirtualMachine" + HostType SystemType = "Host" +) + +// EndpointAttachDetachRequest is the structure used to send request to the container to modify the system +// Supported resource types are Network and Request Types are Add/Remove +type EndpointAttachDetachRequest = hns.EndpointAttachDetachRequest + +// EndpointResquestResponse is object to get the endpoint request response +type EndpointResquestResponse = hns.EndpointResquestResponse + +// HNSEndpointRequest makes a HNS call to modify/query a network endpoint +func HNSEndpointRequest(method, path, request string) (*HNSEndpoint, error) { + return hns.HNSEndpointRequest(method, path, request) +} + +// HNSListEndpointRequest makes a HNS call to query the list of available endpoints +func HNSListEndpointRequest() ([]HNSEndpoint, error) { + return hns.HNSListEndpointRequest() +} + +// HotAttachEndpoint makes a HCS Call to attach the endpoint to the container +func HotAttachEndpoint(containerID string, endpointID string) error { + endpoint, err := GetHNSEndpointByID(endpointID) + if err != nil { + return err + } + isAttached, err := endpoint.IsAttached(containerID) + if isAttached { + return err + } + return modifyNetworkEndpoint(containerID, endpointID, Add) +} + +// HotDetachEndpoint makes a HCS Call to detach the endpoint from the container +func HotDetachEndpoint(containerID string, endpointID string) error { + endpoint, err := GetHNSEndpointByID(endpointID) + if err != nil { + return err + } + isAttached, err := endpoint.IsAttached(containerID) + if !isAttached { + return err + } + return modifyNetworkEndpoint(containerID, endpointID, Remove) +} + +// ModifyContainer corresponding to the container id, by sending a request +func modifyContainer(id string, request *ResourceModificationRequestResponse) error { + container, err := OpenContainer(id) + if err != nil { + if IsNotExist(err) { + return ErrComputeSystemDoesNotExist + } + return getInnerError(err) + } + defer container.Close() + err = container.Modify(request) + if err != nil { + if IsNotSupported(err) { + return ErrPlatformNotSupported + } + return getInnerError(err) + } + + return nil +} + +func modifyNetworkEndpoint(containerID string, endpointID string, request RequestType) error { + requestMessage := &ResourceModificationRequestResponse{ + Resource: Network, + Request: request, + Data: endpointID, + } + err := modifyContainer(containerID, requestMessage) + + if err != nil { + return err + } + + return nil +} + +// GetHNSEndpointByID get the Endpoint by ID +func GetHNSEndpointByID(endpointID string) (*HNSEndpoint, error) { + return hns.GetHNSEndpointByID(endpointID) +} + +// GetHNSEndpointByName gets the endpoint filtered by Name +func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) { + return hns.GetHNSEndpointByName(endpointName) +} + +// GetHNSEndpointStats gets the endpoint stats by ID +func GetHNSEndpointStats(endpointName string) (*HNSEndpointStats, error) { + return hns.GetHNSEndpointStats(endpointName) +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/hnsglobals.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/hnsglobals.go new file mode 100644 index 000000000..2b5381904 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/hnsglobals.go @@ -0,0 +1,16 @@ +package hcsshim + +import ( + "github.com/Microsoft/hcsshim/internal/hns" +) + +type HNSGlobals = hns.HNSGlobals +type HNSVersion = hns.HNSVersion + +var ( + HNSVersion1803 = hns.HNSVersion1803 +) + +func GetHNSGlobals() (*HNSGlobals, error) { + return hns.GetHNSGlobals() +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/hnsnetwork.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/hnsnetwork.go new file mode 100644 index 000000000..f775fa1d0 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/hnsnetwork.go @@ -0,0 +1,36 @@ +package hcsshim + +import ( + "github.com/Microsoft/hcsshim/internal/hns" +) + +// Subnet is assoicated with a network and represents a list +// of subnets available to the network +type Subnet = hns.Subnet + +// MacPool is assoicated with a network and represents a list +// of macaddresses available to the network +type MacPool = hns.MacPool + +// HNSNetwork represents a network in HNS +type HNSNetwork = hns.HNSNetwork + +// HNSNetworkRequest makes a call into HNS to update/query a single network +func HNSNetworkRequest(method, path, request string) (*HNSNetwork, error) { + return hns.HNSNetworkRequest(method, path, request) +} + +// HNSListNetworkRequest makes a HNS call to query the list of available networks +func HNSListNetworkRequest(method, path, request string) ([]HNSNetwork, error) { + return hns.HNSListNetworkRequest(method, path, request) +} + +// GetHNSNetworkByID +func GetHNSNetworkByID(networkID string) (*HNSNetwork, error) { + return hns.GetHNSNetworkByID(networkID) +} + +// GetHNSNetworkName filtered by Name +func GetHNSNetworkByName(networkName string) (*HNSNetwork, error) { + return hns.GetHNSNetworkByName(networkName) +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/hnspolicy.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/hnspolicy.go new file mode 100644 index 000000000..00ab26364 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/hnspolicy.go @@ -0,0 +1,60 @@ +package hcsshim + +import ( + "github.com/Microsoft/hcsshim/internal/hns" +) + +// Type of Request Support in ModifySystem +type PolicyType = hns.PolicyType + +// RequestType const +const ( + Nat = hns.Nat + ACL = hns.ACL + PA = hns.PA + VLAN = hns.VLAN + VSID = hns.VSID + VNet = hns.VNet + L2Driver = hns.L2Driver + Isolation = hns.Isolation + QOS = hns.QOS + OutboundNat = hns.OutboundNat + ExternalLoadBalancer = hns.ExternalLoadBalancer + Route = hns.Route + Proxy = hns.Proxy +) + +type ProxyPolicy = hns.ProxyPolicy + +type NatPolicy = hns.NatPolicy + +type QosPolicy = hns.QosPolicy + +type IsolationPolicy = hns.IsolationPolicy + +type VlanPolicy = hns.VlanPolicy + +type VsidPolicy = hns.VsidPolicy + +type PaPolicy = hns.PaPolicy + +type OutboundNatPolicy = hns.OutboundNatPolicy + +type ActionType = hns.ActionType +type DirectionType = hns.DirectionType +type RuleType = hns.RuleType + +const ( + Allow = hns.Allow + Block = hns.Block + + In = hns.In + Out = hns.Out + + Host = hns.Host + Switch = hns.Switch +) + +type ACLPolicy = hns.ACLPolicy + +type Policy = hns.Policy diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/hnspolicylist.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/hnspolicylist.go new file mode 100644 index 000000000..55aaa4a50 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/hnspolicylist.go @@ -0,0 +1,47 @@ +package hcsshim + +import ( + "github.com/Microsoft/hcsshim/internal/hns" +) + +// RoutePolicy is a structure defining schema for Route based Policy +type RoutePolicy = hns.RoutePolicy + +// ELBPolicy is a structure defining schema for ELB LoadBalancing based Policy +type ELBPolicy = hns.ELBPolicy + +// LBPolicy is a structure defining schema for LoadBalancing based Policy +type LBPolicy = hns.LBPolicy + +// PolicyList is a structure defining schema for Policy list request +type PolicyList = hns.PolicyList + +// HNSPolicyListRequest makes a call into HNS to update/query a single network +func HNSPolicyListRequest(method, path, request string) (*PolicyList, error) { + return hns.HNSPolicyListRequest(method, path, request) +} + +// HNSListPolicyListRequest gets all the policy list +func HNSListPolicyListRequest() ([]PolicyList, error) { + return hns.HNSListPolicyListRequest() +} + +// PolicyListRequest makes a HNS call to modify/query a network policy list +func PolicyListRequest(method, path, request string) (*PolicyList, error) { + return hns.PolicyListRequest(method, path, request) +} + +// GetPolicyListByID get the policy list by ID +func GetPolicyListByID(policyListID string) (*PolicyList, error) { + return hns.GetPolicyListByID(policyListID) +} + +// AddLoadBalancer policy list for the specified endpoints +func AddLoadBalancer(endpoints []HNSEndpoint, isILB bool, sourceVIP, vip string, protocol uint16, internalPort uint16, externalPort uint16) (*PolicyList, error) { + return hns.AddLoadBalancer(endpoints, isILB, sourceVIP, vip, protocol, internalPort, externalPort) +} + +// AddRoute adds route policy list for the specified endpoints +func AddRoute(endpoints []HNSEndpoint, destinationPrefix string, nextHop string, encapEnabled bool) (*PolicyList, error) { + return hns.AddRoute(endpoints, destinationPrefix, nextHop, encapEnabled) +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/hnssupport.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/hnssupport.go new file mode 100644 index 000000000..69405244b --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/hnssupport.go @@ -0,0 +1,13 @@ +package hcsshim + +import ( + "github.com/Microsoft/hcsshim/internal/hns" +) + +type HNSSupportedFeatures = hns.HNSSupportedFeatures + +type HNSAclFeatures = hns.HNSAclFeatures + +func GetHNSSupportedFeatures() HNSSupportedFeatures { + return hns.GetHNSSupportedFeatures() +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/interface.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/interface.go new file mode 100644 index 000000000..300eb5996 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/interface.go @@ -0,0 +1,114 @@ +package hcsshim + +import ( + "io" + "time" + + "github.com/Microsoft/hcsshim/internal/hcs/schema1" +) + +// ProcessConfig is used as both the input of Container.CreateProcess +// and to convert the parameters to JSON for passing onto the HCS +type ProcessConfig = schema1.ProcessConfig + +type Layer = schema1.Layer +type MappedDir = schema1.MappedDir +type MappedPipe = schema1.MappedPipe +type HvRuntime = schema1.HvRuntime +type MappedVirtualDisk = schema1.MappedVirtualDisk + +// AssignedDevice represents a device that has been directly assigned to a container +// +// NOTE: Support added in RS5 +type AssignedDevice = schema1.AssignedDevice + +// ContainerConfig is used as both the input of CreateContainer +// and to convert the parameters to JSON for passing onto the HCS +type ContainerConfig = schema1.ContainerConfig + +type ComputeSystemQuery = schema1.ComputeSystemQuery + +// Container represents a created (but not necessarily running) container. +type Container interface { + // Start synchronously starts the container. + Start() error + + // Shutdown requests a container shutdown, but it may not actually be shutdown until Wait() succeeds. + Shutdown() error + + // Terminate requests a container terminate, but it may not actually be terminated until Wait() succeeds. + Terminate() error + + // Waits synchronously waits for the container to shutdown or terminate. + Wait() error + + // WaitTimeout synchronously waits for the container to terminate or the duration to elapse. It + // returns false if timeout occurs. + WaitTimeout(time.Duration) error + + // Pause pauses the execution of a container. + Pause() error + + // Resume resumes the execution of a container. + Resume() error + + // HasPendingUpdates returns true if the container has updates pending to install. + HasPendingUpdates() (bool, error) + + // Statistics returns statistics for a container. + Statistics() (Statistics, error) + + // ProcessList returns details for the processes in a container. + ProcessList() ([]ProcessListItem, error) + + // MappedVirtualDisks returns virtual disks mapped to a utility VM, indexed by controller + MappedVirtualDisks() (map[int]MappedVirtualDiskController, error) + + // CreateProcess launches a new process within the container. + CreateProcess(c *ProcessConfig) (Process, error) + + // OpenProcess gets an interface to an existing process within the container. + OpenProcess(pid int) (Process, error) + + // Close cleans up any state associated with the container but does not terminate or wait for it. + Close() error + + // Modify the System + Modify(config *ResourceModificationRequestResponse) error +} + +// Process represents a running or exited process. +type Process interface { + // Pid returns the process ID of the process within the container. + Pid() int + + // Kill signals the process to terminate but does not wait for it to finish terminating. + Kill() error + + // Wait waits for the process to exit. + Wait() error + + // WaitTimeout waits for the process to exit or the duration to elapse. It returns + // false if timeout occurs. + WaitTimeout(time.Duration) error + + // ExitCode returns the exit code of the process. The process must have + // already terminated. + ExitCode() (int, error) + + // ResizeConsole resizes the console of the process. + ResizeConsole(width, height uint16) error + + // Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing + // these pipes does not close the underlying pipes; it should be possible to + // call this multiple times to get multiple interfaces. + Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, error) + + // CloseStdin closes the write side of the stdin pipe so that the process is + // notified on the read side that there is no more data in stdin. + CloseStdin() error + + // Close cleans up any state associated with the process but does not kill + // or wait on it. + Close() error +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go new file mode 100644 index 000000000..27a62a723 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go @@ -0,0 +1,91 @@ +package cow + +import ( + "context" + "io" + + "github.com/Microsoft/hcsshim/internal/hcs/schema1" + hcsschema "github.com/Microsoft/hcsshim/internal/hcs/schema2" +) + +// Process is the interface for an OS process running in a container or utility VM. +type Process interface { + // Close releases resources associated with the process and closes the + // writer and readers returned by Stdio. Depending on the implementation, + // this may also terminate the process. + Close() error + // CloseStdin causes the process's stdin handle to receive EOF/EPIPE/whatever + // is appropriate to indicate that no more data is available. + CloseStdin(ctx context.Context) error + // CloseStdout closes the stdout connection to the process. It is used to indicate + // that we are done receiving output on the shim side. + CloseStdout(ctx context.Context) error + // CloseStderr closes the stderr connection to the process. It is used to indicate + // that we are done receiving output on the shim side. + CloseStderr(ctx context.Context) error + // Pid returns the process ID. + Pid() int + // Stdio returns the stdio streams for a process. These may be nil if a stream + // was not requested during CreateProcess. + Stdio() (_ io.Writer, _ io.Reader, _ io.Reader) + // ResizeConsole resizes the virtual terminal associated with the process. + ResizeConsole(ctx context.Context, width, height uint16) error + // Kill sends a SIGKILL or equivalent signal to the process and returns whether + // the signal was delivered. It does not wait for the process to terminate. + Kill(ctx context.Context) (bool, error) + // Signal sends a signal to the process and returns whether the signal was + // delivered. The input is OS specific (either + // guestrequest.SignalProcessOptionsWCOW or + // guestrequest.SignalProcessOptionsLCOW). It does not wait for the process + // to terminate. + Signal(ctx context.Context, options interface{}) (bool, error) + // Wait waits for the process to complete, or for a connection to the process to be + // terminated by some error condition (including calling Close). + Wait() error + // ExitCode returns the exit code of the process. Returns an error if the process is + // not running. + ExitCode() (int, error) +} + +// ProcessHost is the interface for creating processes. +type ProcessHost interface { + // CreateProcess creates a process. The configuration is host specific + // (either hcsschema.ProcessParameters or lcow.ProcessParameters). + CreateProcess(ctx context.Context, config interface{}) (Process, error) + // OS returns the host's operating system, "linux" or "windows". + OS() string + // IsOCI specifies whether this is an OCI-compliant process host. If true, + // then the configuration passed to CreateProcess should have an OCI process + // spec (or nil if this is the initial process in an OCI container). + // Otherwise, it should have the HCS-specific process parameters. + IsOCI() bool +} + +// Container is the interface for container objects, either running on the host or +// in a utility VM. +type Container interface { + ProcessHost + // Close releases the resources associated with the container. Depending on + // the implementation, this may also terminate the container. + Close() error + // ID returns the container ID. + ID() string + // Properties returns the requested container properties targeting a V1 schema container. + Properties(ctx context.Context, types ...schema1.PropertyType) (*schema1.ContainerProperties, error) + // PropertiesV2 returns the requested container properties targeting a V2 schema container. + PropertiesV2(ctx context.Context, types ...hcsschema.PropertyType) (*hcsschema.Properties, error) + // Start starts a container. + Start(ctx context.Context) error + // Shutdown sends a shutdown request to the container (but does not wait for + // the shutdown to complete). + Shutdown(ctx context.Context) error + // Terminate sends a terminate request to the container (but does not wait + // for the terminate to complete). + Terminate(ctx context.Context) error + // Wait waits for the container to terminate, or for the connection to the + // container to be terminated by some error condition (including calling + // Close). + Wait() error + // Modify sends a request to modify container resources + Modify(ctx context.Context, config interface{}) error +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go new file mode 100644 index 000000000..d13772b03 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go @@ -0,0 +1,161 @@ +package hcs + +import ( + "fmt" + "sync" + "syscall" + + "github.com/Microsoft/hcsshim/internal/interop" + "github.com/Microsoft/hcsshim/internal/logfields" + "github.com/Microsoft/hcsshim/internal/vmcompute" + "github.com/sirupsen/logrus" +) + +var ( + nextCallback uintptr + callbackMap = map[uintptr]*notificationWatcherContext{} + callbackMapLock = sync.RWMutex{} + + notificationWatcherCallback = syscall.NewCallback(notificationWatcher) + + // Notifications for HCS_SYSTEM handles + hcsNotificationSystemExited hcsNotification = 0x00000001 + hcsNotificationSystemCreateCompleted hcsNotification = 0x00000002 + hcsNotificationSystemStartCompleted hcsNotification = 0x00000003 + hcsNotificationSystemPauseCompleted hcsNotification = 0x00000004 + hcsNotificationSystemResumeCompleted hcsNotification = 0x00000005 + hcsNotificationSystemCrashReport hcsNotification = 0x00000006 + hcsNotificationSystemSiloJobCreated hcsNotification = 0x00000007 + hcsNotificationSystemSaveCompleted hcsNotification = 0x00000008 + hcsNotificationSystemRdpEnhancedModeStateChanged hcsNotification = 0x00000009 + hcsNotificationSystemShutdownFailed hcsNotification = 0x0000000A + hcsNotificationSystemGetPropertiesCompleted hcsNotification = 0x0000000B + hcsNotificationSystemModifyCompleted hcsNotification = 0x0000000C + hcsNotificationSystemCrashInitiated hcsNotification = 0x0000000D + hcsNotificationSystemGuestConnectionClosed hcsNotification = 0x0000000E + + // Notifications for HCS_PROCESS handles + hcsNotificationProcessExited hcsNotification = 0x00010000 + + // Common notifications + hcsNotificationInvalid hcsNotification = 0x00000000 + hcsNotificationServiceDisconnect hcsNotification = 0x01000000 +) + +type hcsNotification uint32 + +func (hn hcsNotification) String() string { + switch hn { + case hcsNotificationSystemExited: + return "SystemExited" + case hcsNotificationSystemCreateCompleted: + return "SystemCreateCompleted" + case hcsNotificationSystemStartCompleted: + return "SystemStartCompleted" + case hcsNotificationSystemPauseCompleted: + return "SystemPauseCompleted" + case hcsNotificationSystemResumeCompleted: + return "SystemResumeCompleted" + case hcsNotificationSystemCrashReport: + return "SystemCrashReport" + case hcsNotificationSystemSiloJobCreated: + return "SystemSiloJobCreated" + case hcsNotificationSystemSaveCompleted: + return "SystemSaveCompleted" + case hcsNotificationSystemRdpEnhancedModeStateChanged: + return "SystemRdpEnhancedModeStateChanged" + case hcsNotificationSystemShutdownFailed: + return "SystemShutdownFailed" + case hcsNotificationSystemGetPropertiesCompleted: + return "SystemGetPropertiesCompleted" + case hcsNotificationSystemModifyCompleted: + return "SystemModifyCompleted" + case hcsNotificationSystemCrashInitiated: + return "SystemCrashInitiated" + case hcsNotificationSystemGuestConnectionClosed: + return "SystemGuestConnectionClosed" + case hcsNotificationProcessExited: + return "ProcessExited" + case hcsNotificationInvalid: + return "Invalid" + case hcsNotificationServiceDisconnect: + return "ServiceDisconnect" + default: + return fmt.Sprintf("Unknown: %d", hn) + } +} + +type notificationChannel chan error + +type notificationWatcherContext struct { + channels notificationChannels + handle vmcompute.HcsCallback + + systemID string + processID int +} + +type notificationChannels map[hcsNotification]notificationChannel + +func newSystemChannels() notificationChannels { + channels := make(notificationChannels) + for _, notif := range []hcsNotification{ + hcsNotificationServiceDisconnect, + hcsNotificationSystemExited, + hcsNotificationSystemCreateCompleted, + hcsNotificationSystemStartCompleted, + hcsNotificationSystemPauseCompleted, + hcsNotificationSystemResumeCompleted, + hcsNotificationSystemSaveCompleted, + } { + channels[notif] = make(notificationChannel, 1) + } + return channels +} + +func newProcessChannels() notificationChannels { + channels := make(notificationChannels) + for _, notif := range []hcsNotification{ + hcsNotificationServiceDisconnect, + hcsNotificationProcessExited, + } { + channels[notif] = make(notificationChannel, 1) + } + return channels +} + +func closeChannels(channels notificationChannels) { + for _, c := range channels { + close(c) + } +} + +func notificationWatcher(notificationType hcsNotification, callbackNumber uintptr, notificationStatus uintptr, notificationData *uint16) uintptr { + var result error + if int32(notificationStatus) < 0 { + result = interop.Win32FromHresult(notificationStatus) + } + + callbackMapLock.RLock() + context := callbackMap[callbackNumber] + callbackMapLock.RUnlock() + + if context == nil { + return 0 + } + + log := logrus.WithFields(logrus.Fields{ + "notification-type": notificationType.String(), + "system-id": context.systemID, + }) + if context.processID != 0 { + log.Data[logfields.ProcessID] = context.processID + } + log.Debug("HCS notification") + + if channel, ok := context.channels[notificationType]; ok { + channel <- result + } + + return 0 +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go new file mode 100644 index 000000000..295d4b849 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go @@ -0,0 +1,343 @@ +package hcs + +import ( + "context" + "encoding/json" + "errors" + "fmt" + "net" + "syscall" + + "github.com/Microsoft/hcsshim/internal/log" +) + +var ( + // ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists + ErrComputeSystemDoesNotExist = syscall.Errno(0xc037010e) + + // ErrElementNotFound is an error encountered when the object being referenced does not exist + ErrElementNotFound = syscall.Errno(0x490) + + // ErrElementNotFound is an error encountered when the object being referenced does not exist + ErrNotSupported = syscall.Errno(0x32) + + // ErrInvalidData is an error encountered when the request being sent to hcs is invalid/unsupported + // decimal -2147024883 / hex 0x8007000d + ErrInvalidData = syscall.Errno(0xd) + + // ErrHandleClose is an error encountered when the handle generating the notification being waited on has been closed + ErrHandleClose = errors.New("hcsshim: the handle generating this notification has been closed") + + // ErrAlreadyClosed is an error encountered when using a handle that has been closed by the Close method + ErrAlreadyClosed = errors.New("hcsshim: the handle has already been closed") + + // ErrInvalidNotificationType is an error encountered when an invalid notification type is used + ErrInvalidNotificationType = errors.New("hcsshim: invalid notification type") + + // ErrInvalidProcessState is an error encountered when the process is not in a valid state for the requested operation + ErrInvalidProcessState = errors.New("the process is in an invalid state for the attempted operation") + + // ErrTimeout is an error encountered when waiting on a notification times out + ErrTimeout = errors.New("hcsshim: timeout waiting for notification") + + // ErrUnexpectedContainerExit is the error encountered when a container exits while waiting for + // a different expected notification + ErrUnexpectedContainerExit = errors.New("unexpected container exit") + + // ErrUnexpectedProcessAbort is the error encountered when communication with the compute service + // is lost while waiting for a notification + ErrUnexpectedProcessAbort = errors.New("lost communication with compute service") + + // ErrUnexpectedValue is an error encountered when hcs returns an invalid value + ErrUnexpectedValue = errors.New("unexpected value returned from hcs") + + // ErrVmcomputeAlreadyStopped is an error encountered when a shutdown or terminate request is made on a stopped container + ErrVmcomputeAlreadyStopped = syscall.Errno(0xc0370110) + + // ErrVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously + ErrVmcomputeOperationPending = syscall.Errno(0xC0370103) + + // ErrVmcomputeOperationInvalidState is an error encountered when the compute system is not in a valid state for the requested operation + ErrVmcomputeOperationInvalidState = syscall.Errno(0xc0370105) + + // ErrProcNotFound is an error encountered when a procedure look up fails. + ErrProcNotFound = syscall.Errno(0x7f) + + // ErrVmcomputeOperationAccessIsDenied is an error which can be encountered when enumerating compute systems in RS1/RS2 + // builds when the underlying silo might be in the process of terminating. HCS was fixed in RS3. + ErrVmcomputeOperationAccessIsDenied = syscall.Errno(0x5) + + // ErrVmcomputeInvalidJSON is an error encountered when the compute system does not support/understand the messages sent by management + ErrVmcomputeInvalidJSON = syscall.Errno(0xc037010d) + + // ErrVmcomputeUnknownMessage is an error encountered guest compute system doesn't support the message + ErrVmcomputeUnknownMessage = syscall.Errno(0xc037010b) + + // ErrVmcomputeUnexpectedExit is an error encountered when the compute system terminates unexpectedly + ErrVmcomputeUnexpectedExit = syscall.Errno(0xC0370106) + + // ErrNotSupported is an error encountered when hcs doesn't support the request + ErrPlatformNotSupported = errors.New("unsupported platform request") + + // ErrProcessAlreadyStopped is returned by hcs if the process we're trying to kill has already been stopped. + ErrProcessAlreadyStopped = syscall.Errno(0x8037011f) + + // ErrInvalidHandle is an error that can be encountrered when querying the properties of a compute system when the handle to that + // compute system has already been closed. + ErrInvalidHandle = syscall.Errno(0x6) +) + +type ErrorEvent struct { + Message string `json:"Message,omitempty"` // Fully formated error message + StackTrace string `json:"StackTrace,omitempty"` // Stack trace in string form + Provider string `json:"Provider,omitempty"` + EventID uint16 `json:"EventId,omitempty"` + Flags uint32 `json:"Flags,omitempty"` + Source string `json:"Source,omitempty"` + //Data []EventData `json:"Data,omitempty"` // Omit this as HCS doesn't encode this well. It's more confusing to include. It is however logged in debug mode (see processHcsResult function) +} + +type hcsResult struct { + Error int32 + ErrorMessage string + ErrorEvents []ErrorEvent `json:"ErrorEvents,omitempty"` +} + +func (ev *ErrorEvent) String() string { + evs := "[Event Detail: " + ev.Message + if ev.StackTrace != "" { + evs += " Stack Trace: " + ev.StackTrace + } + if ev.Provider != "" { + evs += " Provider: " + ev.Provider + } + if ev.EventID != 0 { + evs = fmt.Sprintf("%s EventID: %d", evs, ev.EventID) + } + if ev.Flags != 0 { + evs = fmt.Sprintf("%s flags: %d", evs, ev.Flags) + } + if ev.Source != "" { + evs += " Source: " + ev.Source + } + evs += "]" + return evs +} + +func processHcsResult(ctx context.Context, resultJSON string) []ErrorEvent { + if resultJSON != "" { + result := &hcsResult{} + if err := json.Unmarshal([]byte(resultJSON), result); err != nil { + log.G(ctx).WithError(err).Warning("Could not unmarshal HCS result") + return nil + } + return result.ErrorEvents + } + return nil +} + +type HcsError struct { + Op string + Err error + Events []ErrorEvent +} + +var _ net.Error = &HcsError{} + +func (e *HcsError) Error() string { + s := e.Op + ": " + e.Err.Error() + for _, ev := range e.Events { + s += "\n" + ev.String() + } + return s +} + +func (e *HcsError) Temporary() bool { + err, ok := e.Err.(net.Error) + return ok && err.Temporary() //nolint:staticcheck +} + +func (e *HcsError) Timeout() bool { + err, ok := e.Err.(net.Error) + return ok && err.Timeout() +} + +// ProcessError is an error encountered in HCS during an operation on a Process object +type ProcessError struct { + SystemID string + Pid int + Op string + Err error + Events []ErrorEvent +} + +var _ net.Error = &ProcessError{} + +// SystemError is an error encountered in HCS during an operation on a Container object +type SystemError struct { + ID string + Op string + Err error + Events []ErrorEvent +} + +var _ net.Error = &SystemError{} + +func (e *SystemError) Error() string { + s := e.Op + " " + e.ID + ": " + e.Err.Error() + for _, ev := range e.Events { + s += "\n" + ev.String() + } + return s +} + +func (e *SystemError) Temporary() bool { + err, ok := e.Err.(net.Error) + return ok && err.Temporary() //nolint:staticcheck +} + +func (e *SystemError) Timeout() bool { + err, ok := e.Err.(net.Error) + return ok && err.Timeout() +} + +func makeSystemError(system *System, op string, err error, events []ErrorEvent) error { + // Don't double wrap errors + if _, ok := err.(*SystemError); ok { + return err + } + return &SystemError{ + ID: system.ID(), + Op: op, + Err: err, + Events: events, + } +} + +func (e *ProcessError) Error() string { + s := fmt.Sprintf("%s %s:%d: %s", e.Op, e.SystemID, e.Pid, e.Err.Error()) + for _, ev := range e.Events { + s += "\n" + ev.String() + } + return s +} + +func (e *ProcessError) Temporary() bool { + err, ok := e.Err.(net.Error) + return ok && err.Temporary() //nolint:staticcheck +} + +func (e *ProcessError) Timeout() bool { + err, ok := e.Err.(net.Error) + return ok && err.Timeout() +} + +func makeProcessError(process *Process, op string, err error, events []ErrorEvent) error { + // Don't double wrap errors + if _, ok := err.(*ProcessError); ok { + return err + } + return &ProcessError{ + Pid: process.Pid(), + SystemID: process.SystemID(), + Op: op, + Err: err, + Events: events, + } +} + +// IsNotExist checks if an error is caused by the Container or Process not existing. +// Note: Currently, ErrElementNotFound can mean that a Process has either +// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist +// will currently return true when the error is ErrElementNotFound. +func IsNotExist(err error) bool { + err = getInnerError(err) + return err == ErrComputeSystemDoesNotExist || + err == ErrElementNotFound +} + +// IsErrorInvalidHandle checks whether the error is the result of an operation carried +// out on a handle that is invalid/closed. This error popped up while trying to query +// stats on a container in the process of being stopped. +func IsErrorInvalidHandle(err error) bool { + err = getInnerError(err) + return err == ErrInvalidHandle +} + +// IsAlreadyClosed checks if an error is caused by the Container or Process having been +// already closed by a call to the Close() method. +func IsAlreadyClosed(err error) bool { + err = getInnerError(err) + return err == ErrAlreadyClosed +} + +// IsPending returns a boolean indicating whether the error is that +// the requested operation is being completed in the background. +func IsPending(err error) bool { + err = getInnerError(err) + return err == ErrVmcomputeOperationPending +} + +// IsTimeout returns a boolean indicating whether the error is caused by +// a timeout waiting for the operation to complete. +func IsTimeout(err error) bool { + if err, ok := err.(net.Error); ok && err.Timeout() { + return true + } + err = getInnerError(err) + return err == ErrTimeout +} + +// IsAlreadyStopped returns a boolean indicating whether the error is caused by +// a Container or Process being already stopped. +// Note: Currently, ErrElementNotFound can mean that a Process has either +// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist +// will currently return true when the error is ErrElementNotFound. +func IsAlreadyStopped(err error) bool { + err = getInnerError(err) + return err == ErrVmcomputeAlreadyStopped || + err == ErrProcessAlreadyStopped || + err == ErrElementNotFound +} + +// IsNotSupported returns a boolean indicating whether the error is caused by +// unsupported platform requests +// Note: Currently Unsupported platform requests can be mean either +// ErrVmcomputeInvalidJSON, ErrInvalidData, ErrNotSupported or ErrVmcomputeUnknownMessage +// is thrown from the Platform +func IsNotSupported(err error) bool { + err = getInnerError(err) + // If Platform doesn't recognize or support the request sent, below errors are seen + return err == ErrVmcomputeInvalidJSON || + err == ErrInvalidData || + err == ErrNotSupported || + err == ErrVmcomputeUnknownMessage +} + +// IsOperationInvalidState returns true when err is caused by +// `ErrVmcomputeOperationInvalidState`. +func IsOperationInvalidState(err error) bool { + err = getInnerError(err) + return err == ErrVmcomputeOperationInvalidState +} + +// IsAccessIsDenied returns true when err is caused by +// `ErrVmcomputeOperationAccessIsDenied`. +func IsAccessIsDenied(err error) bool { + err = getInnerError(err) + return err == ErrVmcomputeOperationAccessIsDenied +} + +func getInnerError(err error) error { + switch pe := err.(type) { + case nil: + return nil + case *HcsError: + err = pe.Err + case *SystemError: + err = pe.Err + case *ProcessError: + err = pe.Err + } + return err +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go new file mode 100644 index 000000000..f4605922a --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go @@ -0,0 +1,557 @@ +package hcs + +import ( + "context" + "encoding/json" + "errors" + "io" + "os" + "sync" + "syscall" + "time" + + "github.com/Microsoft/hcsshim/internal/log" + "github.com/Microsoft/hcsshim/internal/oc" + "github.com/Microsoft/hcsshim/internal/vmcompute" + "go.opencensus.io/trace" +) + +// ContainerError is an error encountered in HCS +type Process struct { + handleLock sync.RWMutex + handle vmcompute.HcsProcess + processID int + system *System + hasCachedStdio bool + stdioLock sync.Mutex + stdin io.WriteCloser + stdout io.ReadCloser + stderr io.ReadCloser + callbackNumber uintptr + killSignalDelivered bool + + closedWaitOnce sync.Once + waitBlock chan struct{} + exitCode int + waitError error +} + +func newProcess(process vmcompute.HcsProcess, processID int, computeSystem *System) *Process { + return &Process{ + handle: process, + processID: processID, + system: computeSystem, + waitBlock: make(chan struct{}), + } +} + +type processModifyRequest struct { + Operation string + ConsoleSize *consoleSize `json:",omitempty"` + CloseHandle *closeHandle `json:",omitempty"` +} + +type consoleSize struct { + Height uint16 + Width uint16 +} + +type closeHandle struct { + Handle string +} + +type processStatus struct { + ProcessID uint32 + Exited bool + ExitCode uint32 + LastWaitResult int32 +} + +const stdIn string = "StdIn" + +const ( + modifyConsoleSize string = "ConsoleSize" + modifyCloseHandle string = "CloseHandle" +) + +// Pid returns the process ID of the process within the container. +func (process *Process) Pid() int { + return process.processID +} + +// SystemID returns the ID of the process's compute system. +func (process *Process) SystemID() string { + return process.system.ID() +} + +func (process *Process) processSignalResult(ctx context.Context, err error) (bool, error) { + switch err { + case nil: + return true, nil + case ErrVmcomputeOperationInvalidState, ErrComputeSystemDoesNotExist, ErrElementNotFound: + select { + case <-process.waitBlock: + // The process exit notification has already arrived. + default: + // The process should be gone, but we have not received the notification. + // After a second, force unblock the process wait to work around a possible + // deadlock in the HCS. + go func() { + time.Sleep(time.Second) + process.closedWaitOnce.Do(func() { + log.G(ctx).WithError(err).Warn("force unblocking process waits") + process.exitCode = -1 + process.waitError = err + close(process.waitBlock) + }) + }() + } + return false, nil + default: + return false, err + } +} + +// Signal signals the process with `options`. +// +// For LCOW `guestrequest.SignalProcessOptionsLCOW`. +// +// For WCOW `guestrequest.SignalProcessOptionsWCOW`. +func (process *Process) Signal(ctx context.Context, options interface{}) (bool, error) { + process.handleLock.RLock() + defer process.handleLock.RUnlock() + + operation := "hcs::Process::Signal" + + if process.handle == 0 { + return false, makeProcessError(process, operation, ErrAlreadyClosed, nil) + } + + optionsb, err := json.Marshal(options) + if err != nil { + return false, err + } + + resultJSON, err := vmcompute.HcsSignalProcess(ctx, process.handle, string(optionsb)) + events := processHcsResult(ctx, resultJSON) + delivered, err := process.processSignalResult(ctx, err) + if err != nil { + err = makeProcessError(process, operation, err, events) + } + return delivered, err +} + +// Kill signals the process to terminate but does not wait for it to finish terminating. +func (process *Process) Kill(ctx context.Context) (bool, error) { + process.handleLock.RLock() + defer process.handleLock.RUnlock() + + operation := "hcs::Process::Kill" + + if process.handle == 0 { + return false, makeProcessError(process, operation, ErrAlreadyClosed, nil) + } + + if process.killSignalDelivered { + // A kill signal has already been sent to this process. Sending a second + // one offers no real benefit, as processes cannot stop themselves from + // being terminated, once a TerminateProcess has been issued. Sending a + // second kill may result in a number of errors (two of which detailed bellow) + // and which we can avoid handling. + return true, nil + } + + resultJSON, err := vmcompute.HcsTerminateProcess(ctx, process.handle) + if err != nil { + // We still need to check these two cases, as processes may still be killed by an + // external actor (human operator, OOM, random script etc). + if errors.Is(err, os.ErrPermission) || IsAlreadyStopped(err) { + // There are two cases where it should be safe to ignore an error returned + // by HcsTerminateProcess. The first one is cause by the fact that + // HcsTerminateProcess ends up calling TerminateProcess in the context + // of a container. According to the TerminateProcess documentation: + // https://docs.microsoft.com/en-us/windows/win32/api/processthreadsapi/nf-processthreadsapi-terminateprocess#remarks + // After a process has terminated, call to TerminateProcess with open + // handles to the process fails with ERROR_ACCESS_DENIED (5) error code. + // It's safe to ignore this error here. HCS should always have permissions + // to kill processes inside any container. So an ERROR_ACCESS_DENIED + // is unlikely to be anything else than what the ending remarks in the + // documentation states. + // + // The second case is generated by hcs itself, if for any reason HcsTerminateProcess + // is called twice in a very short amount of time. In such cases, hcs may return + // HCS_E_PROCESS_ALREADY_STOPPED. + return true, nil + } + } + events := processHcsResult(ctx, resultJSON) + delivered, err := process.processSignalResult(ctx, err) + if err != nil { + err = makeProcessError(process, operation, err, events) + } + + process.killSignalDelivered = delivered + return delivered, err +} + +// waitBackground waits for the process exit notification. Once received sets +// `process.waitError` (if any) and unblocks all `Wait` calls. +// +// This MUST be called exactly once per `process.handle` but `Wait` is safe to +// call multiple times. +func (process *Process) waitBackground() { + operation := "hcs::Process::waitBackground" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + span.AddAttributes( + trace.StringAttribute("cid", process.SystemID()), + trace.Int64Attribute("pid", int64(process.processID))) + + var ( + err error + exitCode = -1 + propertiesJSON string + resultJSON string + ) + + err = waitForNotification(ctx, process.callbackNumber, hcsNotificationProcessExited, nil) + if err != nil { + err = makeProcessError(process, operation, err, nil) + log.G(ctx).WithError(err).Error("failed wait") + } else { + process.handleLock.RLock() + defer process.handleLock.RUnlock() + + // Make sure we didnt race with Close() here + if process.handle != 0 { + propertiesJSON, resultJSON, err = vmcompute.HcsGetProcessProperties(ctx, process.handle) + events := processHcsResult(ctx, resultJSON) + if err != nil { + err = makeProcessError(process, operation, err, events) //nolint:ineffassign + } else { + properties := &processStatus{} + err = json.Unmarshal([]byte(propertiesJSON), properties) + if err != nil { + err = makeProcessError(process, operation, err, nil) //nolint:ineffassign + } else { + if properties.LastWaitResult != 0 { + log.G(ctx).WithField("wait-result", properties.LastWaitResult).Warning("non-zero last wait result") + } else { + exitCode = int(properties.ExitCode) + } + } + } + } + } + log.G(ctx).WithField("exitCode", exitCode).Debug("process exited") + + process.closedWaitOnce.Do(func() { + process.exitCode = exitCode + process.waitError = err + close(process.waitBlock) + }) + oc.SetSpanStatus(span, err) +} + +// Wait waits for the process to exit. If the process has already exited returns +// the pervious error (if any). +func (process *Process) Wait() error { + <-process.waitBlock + return process.waitError +} + +// ResizeConsole resizes the console of the process. +func (process *Process) ResizeConsole(ctx context.Context, width, height uint16) error { + process.handleLock.RLock() + defer process.handleLock.RUnlock() + + operation := "hcs::Process::ResizeConsole" + + if process.handle == 0 { + return makeProcessError(process, operation, ErrAlreadyClosed, nil) + } + + modifyRequest := processModifyRequest{ + Operation: modifyConsoleSize, + ConsoleSize: &consoleSize{ + Height: height, + Width: width, + }, + } + + modifyRequestb, err := json.Marshal(modifyRequest) + if err != nil { + return err + } + + resultJSON, err := vmcompute.HcsModifyProcess(ctx, process.handle, string(modifyRequestb)) + events := processHcsResult(ctx, resultJSON) + if err != nil { + return makeProcessError(process, operation, err, events) + } + + return nil +} + +// ExitCode returns the exit code of the process. The process must have +// already terminated. +func (process *Process) ExitCode() (int, error) { + select { + case <-process.waitBlock: + if process.waitError != nil { + return -1, process.waitError + } + return process.exitCode, nil + default: + return -1, makeProcessError(process, "hcs::Process::ExitCode", ErrInvalidProcessState, nil) + } +} + +// StdioLegacy returns the stdin, stdout, and stderr pipes, respectively. Closing +// these pipes does not close the underlying pipes. Once returned, these pipes +// are the responsibility of the caller to close. +func (process *Process) StdioLegacy() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadCloser, err error) { + operation := "hcs::Process::StdioLegacy" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("cid", process.SystemID()), + trace.Int64Attribute("pid", int64(process.processID))) + + process.handleLock.RLock() + defer process.handleLock.RUnlock() + + if process.handle == 0 { + return nil, nil, nil, makeProcessError(process, operation, ErrAlreadyClosed, nil) + } + + process.stdioLock.Lock() + defer process.stdioLock.Unlock() + if process.hasCachedStdio { + stdin, stdout, stderr := process.stdin, process.stdout, process.stderr + process.stdin, process.stdout, process.stderr = nil, nil, nil + process.hasCachedStdio = false + return stdin, stdout, stderr, nil + } + + processInfo, resultJSON, err := vmcompute.HcsGetProcessInfo(ctx, process.handle) + events := processHcsResult(ctx, resultJSON) + if err != nil { + return nil, nil, nil, makeProcessError(process, operation, err, events) + } + + pipes, err := makeOpenFiles([]syscall.Handle{processInfo.StdInput, processInfo.StdOutput, processInfo.StdError}) + if err != nil { + return nil, nil, nil, makeProcessError(process, operation, err, nil) + } + + return pipes[0], pipes[1], pipes[2], nil +} + +// Stdio returns the stdin, stdout, and stderr pipes, respectively. +// To close them, close the process handle. +func (process *Process) Stdio() (stdin io.Writer, stdout, stderr io.Reader) { + process.stdioLock.Lock() + defer process.stdioLock.Unlock() + return process.stdin, process.stdout, process.stderr +} + +// CloseStdin closes the write side of the stdin pipe so that the process is +// notified on the read side that there is no more data in stdin. +func (process *Process) CloseStdin(ctx context.Context) error { + process.handleLock.RLock() + defer process.handleLock.RUnlock() + + operation := "hcs::Process::CloseStdin" + + if process.handle == 0 { + return makeProcessError(process, operation, ErrAlreadyClosed, nil) + } + + modifyRequest := processModifyRequest{ + Operation: modifyCloseHandle, + CloseHandle: &closeHandle{ + Handle: stdIn, + }, + } + + modifyRequestb, err := json.Marshal(modifyRequest) + if err != nil { + return err + } + + resultJSON, err := vmcompute.HcsModifyProcess(ctx, process.handle, string(modifyRequestb)) + events := processHcsResult(ctx, resultJSON) + if err != nil { + return makeProcessError(process, operation, err, events) + } + + process.stdioLock.Lock() + if process.stdin != nil { + process.stdin.Close() + process.stdin = nil + } + process.stdioLock.Unlock() + + return nil +} + +func (process *Process) CloseStdout(ctx context.Context) (err error) { + ctx, span := trace.StartSpan(ctx, "hcs::Process::CloseStdout") //nolint:ineffassign,staticcheck + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("cid", process.SystemID()), + trace.Int64Attribute("pid", int64(process.processID))) + + process.handleLock.Lock() + defer process.handleLock.Unlock() + + if process.handle == 0 { + return nil + } + + process.stdioLock.Lock() + defer process.stdioLock.Unlock() + if process.stdout != nil { + process.stdout.Close() + process.stdout = nil + } + return nil +} + +func (process *Process) CloseStderr(ctx context.Context) (err error) { + ctx, span := trace.StartSpan(ctx, "hcs::Process::CloseStderr") //nolint:ineffassign,staticcheck + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("cid", process.SystemID()), + trace.Int64Attribute("pid", int64(process.processID))) + + process.handleLock.Lock() + defer process.handleLock.Unlock() + + if process.handle == 0 { + return nil + } + + process.stdioLock.Lock() + defer process.stdioLock.Unlock() + if process.stderr != nil { + process.stderr.Close() + process.stderr = nil + + } + return nil +} + +// Close cleans up any state associated with the process but does not kill +// or wait on it. +func (process *Process) Close() (err error) { + operation := "hcs::Process::Close" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("cid", process.SystemID()), + trace.Int64Attribute("pid", int64(process.processID))) + + process.handleLock.Lock() + defer process.handleLock.Unlock() + + // Don't double free this + if process.handle == 0 { + return nil + } + + process.stdioLock.Lock() + if process.stdin != nil { + process.stdin.Close() + process.stdin = nil + } + if process.stdout != nil { + process.stdout.Close() + process.stdout = nil + } + if process.stderr != nil { + process.stderr.Close() + process.stderr = nil + } + process.stdioLock.Unlock() + + if err = process.unregisterCallback(ctx); err != nil { + return makeProcessError(process, operation, err, nil) + } + + if err = vmcompute.HcsCloseProcess(ctx, process.handle); err != nil { + return makeProcessError(process, operation, err, nil) + } + + process.handle = 0 + process.closedWaitOnce.Do(func() { + process.exitCode = -1 + process.waitError = ErrAlreadyClosed + close(process.waitBlock) + }) + + return nil +} + +func (process *Process) registerCallback(ctx context.Context) error { + callbackContext := ¬ificationWatcherContext{ + channels: newProcessChannels(), + systemID: process.SystemID(), + processID: process.processID, + } + + callbackMapLock.Lock() + callbackNumber := nextCallback + nextCallback++ + callbackMap[callbackNumber] = callbackContext + callbackMapLock.Unlock() + + callbackHandle, err := vmcompute.HcsRegisterProcessCallback(ctx, process.handle, notificationWatcherCallback, callbackNumber) + if err != nil { + return err + } + callbackContext.handle = callbackHandle + process.callbackNumber = callbackNumber + + return nil +} + +func (process *Process) unregisterCallback(ctx context.Context) error { + callbackNumber := process.callbackNumber + + callbackMapLock.RLock() + callbackContext := callbackMap[callbackNumber] + callbackMapLock.RUnlock() + + if callbackContext == nil { + return nil + } + + handle := callbackContext.handle + + if handle == 0 { + return nil + } + + // vmcompute.HcsUnregisterProcessCallback has its own synchronization to + // wait for all callbacks to complete. We must NOT hold the callbackMapLock. + err := vmcompute.HcsUnregisterProcessCallback(ctx, handle) + if err != nil { + return err + } + + closeChannels(callbackContext.channels) + + callbackMapLock.Lock() + delete(callbackMap, callbackNumber) + callbackMapLock.Unlock() + + handle = 0 //nolint:ineffassign + + return nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema1/schema1.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema1/schema1.go new file mode 100644 index 000000000..b621c5593 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema1/schema1.go @@ -0,0 +1,250 @@ +package schema1 + +import ( + "encoding/json" + "time" + + "github.com/Microsoft/go-winio/pkg/guid" + hcsschema "github.com/Microsoft/hcsshim/internal/hcs/schema2" +) + +// ProcessConfig is used as both the input of Container.CreateProcess +// and to convert the parameters to JSON for passing onto the HCS +type ProcessConfig struct { + ApplicationName string `json:",omitempty"` + CommandLine string `json:",omitempty"` + CommandArgs []string `json:",omitempty"` // Used by Linux Containers on Windows + User string `json:",omitempty"` + WorkingDirectory string `json:",omitempty"` + Environment map[string]string `json:",omitempty"` + EmulateConsole bool `json:",omitempty"` + CreateStdInPipe bool `json:",omitempty"` + CreateStdOutPipe bool `json:",omitempty"` + CreateStdErrPipe bool `json:",omitempty"` + ConsoleSize [2]uint `json:",omitempty"` + CreateInUtilityVm bool `json:",omitempty"` // Used by Linux Containers on Windows + OCISpecification *json.RawMessage `json:",omitempty"` // Used by Linux Containers on Windows +} + +type Layer struct { + ID string + Path string +} + +type MappedDir struct { + HostPath string + ContainerPath string + ReadOnly bool + BandwidthMaximum uint64 + IOPSMaximum uint64 + CreateInUtilityVM bool + // LinuxMetadata - Support added in 1803/RS4+. + LinuxMetadata bool `json:",omitempty"` +} + +type MappedPipe struct { + HostPath string + ContainerPipeName string +} + +type HvRuntime struct { + ImagePath string `json:",omitempty"` + SkipTemplate bool `json:",omitempty"` + LinuxInitrdFile string `json:",omitempty"` // File under ImagePath on host containing an initrd image for starting a Linux utility VM + LinuxKernelFile string `json:",omitempty"` // File under ImagePath on host containing a kernel for starting a Linux utility VM + LinuxBootParameters string `json:",omitempty"` // Additional boot parameters for starting a Linux Utility VM in initrd mode + BootSource string `json:",omitempty"` // "Vhd" for Linux Utility VM booting from VHD + WritableBootSource bool `json:",omitempty"` // Linux Utility VM booting from VHD +} + +type MappedVirtualDisk struct { + HostPath string `json:",omitempty"` // Path to VHD on the host + ContainerPath string // Platform-specific mount point path in the container + CreateInUtilityVM bool `json:",omitempty"` + ReadOnly bool `json:",omitempty"` + Cache string `json:",omitempty"` // "" (Unspecified); "Disabled"; "Enabled"; "Private"; "PrivateAllowSharing" + AttachOnly bool `json:",omitempty"` +} + +// AssignedDevice represents a device that has been directly assigned to a container +// +// NOTE: Support added in RS5 +type AssignedDevice struct { + // InterfaceClassGUID of the device to assign to container. + InterfaceClassGUID string `json:"InterfaceClassGuid,omitempty"` +} + +// ContainerConfig is used as both the input of CreateContainer +// and to convert the parameters to JSON for passing onto the HCS +type ContainerConfig struct { + SystemType string // HCS requires this to be hard-coded to "Container" + Name string // Name of the container. We use the docker ID. + Owner string `json:",omitempty"` // The management platform that created this container + VolumePath string `json:",omitempty"` // Windows volume path for scratch space. Used by Windows Server Containers only. Format \\?\\Volume{GUID} + IgnoreFlushesDuringBoot bool `json:",omitempty"` // Optimization hint for container startup in Windows + LayerFolderPath string `json:",omitempty"` // Where the layer folders are located. Used by Windows Server Containers only. Format %root%\windowsfilter\containerID + Layers []Layer // List of storage layers. Required for Windows Server and Hyper-V Containers. Format ID=GUID;Path=%root%\windowsfilter\layerID + Credentials string `json:",omitempty"` // Credentials information + ProcessorCount uint32 `json:",omitempty"` // Number of processors to assign to the container. + ProcessorWeight uint64 `json:",omitempty"` // CPU shares (relative weight to other containers with cpu shares). Range is from 1 to 10000. A value of 0 results in default shares. + ProcessorMaximum int64 `json:",omitempty"` // Specifies the portion of processor cycles that this container can use as a percentage times 100. Range is from 1 to 10000. A value of 0 results in no limit. + StorageIOPSMaximum uint64 `json:",omitempty"` // Maximum Storage IOPS + StorageBandwidthMaximum uint64 `json:",omitempty"` // Maximum Storage Bandwidth in bytes per second + StorageSandboxSize uint64 `json:",omitempty"` // Size in bytes that the container system drive should be expanded to if smaller + MemoryMaximumInMB int64 `json:",omitempty"` // Maximum memory available to the container in Megabytes + HostName string `json:",omitempty"` // Hostname + MappedDirectories []MappedDir `json:",omitempty"` // List of mapped directories (volumes/mounts) + MappedPipes []MappedPipe `json:",omitempty"` // List of mapped Windows named pipes + HvPartition bool // True if it a Hyper-V Container + NetworkSharedContainerName string `json:",omitempty"` // Name (ID) of the container that we will share the network stack with. + EndpointList []string `json:",omitempty"` // List of networking endpoints to be attached to container + HvRuntime *HvRuntime `json:",omitempty"` // Hyper-V container settings. Used by Hyper-V containers only. Format ImagePath=%root%\BaseLayerID\UtilityVM + Servicing bool `json:",omitempty"` // True if this container is for servicing + AllowUnqualifiedDNSQuery bool `json:",omitempty"` // True to allow unqualified DNS name resolution + DNSSearchList string `json:",omitempty"` // Comma seperated list of DNS suffixes to use for name resolution + ContainerType string `json:",omitempty"` // "Linux" for Linux containers on Windows. Omitted otherwise. + TerminateOnLastHandleClosed bool `json:",omitempty"` // Should HCS terminate the container once all handles have been closed + MappedVirtualDisks []MappedVirtualDisk `json:",omitempty"` // Array of virtual disks to mount at start + AssignedDevices []AssignedDevice `json:",omitempty"` // Array of devices to assign. NOTE: Support added in RS5 +} + +type ComputeSystemQuery struct { + IDs []string `json:"Ids,omitempty"` + Types []string `json:",omitempty"` + Names []string `json:",omitempty"` + Owners []string `json:",omitempty"` +} + +type PropertyType string + +const ( + PropertyTypeStatistics PropertyType = "Statistics" // V1 and V2 + PropertyTypeProcessList PropertyType = "ProcessList" // V1 and V2 + PropertyTypeMappedVirtualDisk PropertyType = "MappedVirtualDisk" // Not supported in V2 schema call + PropertyTypeGuestConnection PropertyType = "GuestConnection" // V1 and V2. Nil return from HCS before RS5 +) + +type PropertyQuery struct { + PropertyTypes []PropertyType `json:",omitempty"` +} + +// ContainerProperties holds the properties for a container and the processes running in that container +type ContainerProperties struct { + ID string `json:"Id"` + State string + Name string + SystemType string + RuntimeOSType string `json:"RuntimeOsType,omitempty"` + Owner string + SiloGUID string `json:"SiloGuid,omitempty"` + RuntimeID guid.GUID `json:"RuntimeId,omitempty"` + IsRuntimeTemplate bool `json:",omitempty"` + RuntimeImagePath string `json:",omitempty"` + Stopped bool `json:",omitempty"` + ExitType string `json:",omitempty"` + AreUpdatesPending bool `json:",omitempty"` + ObRoot string `json:",omitempty"` + Statistics Statistics `json:",omitempty"` + ProcessList []ProcessListItem `json:",omitempty"` + MappedVirtualDiskControllers map[int]MappedVirtualDiskController `json:",omitempty"` + GuestConnectionInfo GuestConnectionInfo `json:",omitempty"` +} + +// MemoryStats holds the memory statistics for a container +type MemoryStats struct { + UsageCommitBytes uint64 `json:"MemoryUsageCommitBytes,omitempty"` + UsageCommitPeakBytes uint64 `json:"MemoryUsageCommitPeakBytes,omitempty"` + UsagePrivateWorkingSetBytes uint64 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"` +} + +// ProcessorStats holds the processor statistics for a container +type ProcessorStats struct { + TotalRuntime100ns uint64 `json:",omitempty"` + RuntimeUser100ns uint64 `json:",omitempty"` + RuntimeKernel100ns uint64 `json:",omitempty"` +} + +// StorageStats holds the storage statistics for a container +type StorageStats struct { + ReadCountNormalized uint64 `json:",omitempty"` + ReadSizeBytes uint64 `json:",omitempty"` + WriteCountNormalized uint64 `json:",omitempty"` + WriteSizeBytes uint64 `json:",omitempty"` +} + +// NetworkStats holds the network statistics for a container +type NetworkStats struct { + BytesReceived uint64 `json:",omitempty"` + BytesSent uint64 `json:",omitempty"` + PacketsReceived uint64 `json:",omitempty"` + PacketsSent uint64 `json:",omitempty"` + DroppedPacketsIncoming uint64 `json:",omitempty"` + DroppedPacketsOutgoing uint64 `json:",omitempty"` + EndpointId string `json:",omitempty"` + InstanceId string `json:",omitempty"` +} + +// Statistics is the structure returned by a statistics call on a container +type Statistics struct { + Timestamp time.Time `json:",omitempty"` + ContainerStartTime time.Time `json:",omitempty"` + Uptime100ns uint64 `json:",omitempty"` + Memory MemoryStats `json:",omitempty"` + Processor ProcessorStats `json:",omitempty"` + Storage StorageStats `json:",omitempty"` + Network []NetworkStats `json:",omitempty"` +} + +// ProcessList is the structure of an item returned by a ProcessList call on a container +type ProcessListItem struct { + CreateTimestamp time.Time `json:",omitempty"` + ImageName string `json:",omitempty"` + KernelTime100ns uint64 `json:",omitempty"` + MemoryCommitBytes uint64 `json:",omitempty"` + MemoryWorkingSetPrivateBytes uint64 `json:",omitempty"` + MemoryWorkingSetSharedBytes uint64 `json:",omitempty"` + ProcessId uint32 `json:",omitempty"` + UserTime100ns uint64 `json:",omitempty"` +} + +// MappedVirtualDiskController is the structure of an item returned by a MappedVirtualDiskList call on a container +type MappedVirtualDiskController struct { + MappedVirtualDisks map[int]MappedVirtualDisk `json:",omitempty"` +} + +// GuestDefinedCapabilities is part of the GuestConnectionInfo returned by a GuestConnection call on a utility VM +type GuestDefinedCapabilities struct { + NamespaceAddRequestSupported bool `json:",omitempty"` + SignalProcessSupported bool `json:",omitempty"` + DumpStacksSupported bool `json:",omitempty"` + DeleteContainerStateSupported bool `json:",omitempty"` + UpdateContainerSupported bool `json:",omitempty"` +} + +// GuestConnectionInfo is the structure of an iterm return by a GuestConnection call on a utility VM +type GuestConnectionInfo struct { + SupportedSchemaVersions []hcsschema.Version `json:",omitempty"` + ProtocolVersion uint32 `json:",omitempty"` + GuestDefinedCapabilities GuestDefinedCapabilities `json:",omitempty"` +} + +// Type of Request Support in ModifySystem +type RequestType string + +// Type of Resource Support in ModifySystem +type ResourceType string + +// RequestType const +const ( + Add RequestType = "Add" + Remove RequestType = "Remove" + Network ResourceType = "Network" +) + +// ResourceModificationRequestResponse is the structure used to send request to the container to modify the system +// Supported resource types are Network and Request Types are Add/Remove +type ResourceModificationRequestResponse struct { + Resource ResourceType `json:"ResourceType"` + Data interface{} `json:"Settings"` + Request RequestType `json:"RequestType,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/attachment.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/attachment.go new file mode 100644 index 000000000..70884aad7 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/attachment.go @@ -0,0 +1,36 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Attachment struct { + Type_ string `json:"Type,omitempty"` + + Path string `json:"Path,omitempty"` + + IgnoreFlushes bool `json:"IgnoreFlushes,omitempty"` + + CachingMode string `json:"CachingMode,omitempty"` + + NoWriteHardening bool `json:"NoWriteHardening,omitempty"` + + DisableExpansionOptimization bool `json:"DisableExpansionOptimization,omitempty"` + + IgnoreRelativeLocator bool `json:"IgnoreRelativeLocator,omitempty"` + + CaptureIoAttributionContext bool `json:"CaptureIoAttributionContext,omitempty"` + + ReadOnly bool `json:"ReadOnly,omitempty"` + + SupportCompressedVolumes bool `json:"SupportCompressedVolumes,omitempty"` + + AlwaysAllowSparseFiles bool `json:"AlwaysAllowSparseFiles,omitempty"` + + ExtensibleVirtualDiskType string `json:"ExtensibleVirtualDiskType,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/battery.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/battery.go new file mode 100644 index 000000000..ecbbed4c2 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/battery.go @@ -0,0 +1,13 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Battery struct { +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/cache_query_stats_response.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/cache_query_stats_response.go new file mode 100644 index 000000000..c1ea3953b --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/cache_query_stats_response.go @@ -0,0 +1,18 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type CacheQueryStatsResponse struct { + L3OccupancyBytes int32 `json:"L3OccupancyBytes,omitempty"` + + L3TotalBwBytes int32 `json:"L3TotalBwBytes,omitempty"` + + L3LocalBwBytes int32 `json:"L3LocalBwBytes,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/chipset.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/chipset.go new file mode 100644 index 000000000..ca75277a3 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/chipset.go @@ -0,0 +1,27 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Chipset struct { + Uefi *Uefi `json:"Uefi,omitempty"` + + IsNumLockDisabled bool `json:"IsNumLockDisabled,omitempty"` + + BaseBoardSerialNumber string `json:"BaseBoardSerialNumber,omitempty"` + + ChassisSerialNumber string `json:"ChassisSerialNumber,omitempty"` + + ChassisAssetTag string `json:"ChassisAssetTag,omitempty"` + + UseUtc bool `json:"UseUtc,omitempty"` + + // LinuxKernelDirect - Added in v2.2 Builds >=181117 + LinuxKernelDirect *LinuxKernelDirect `json:"LinuxKernelDirect,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/close_handle.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/close_handle.go new file mode 100644 index 000000000..b4f9c315b --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/close_handle.go @@ -0,0 +1,14 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type CloseHandle struct { + Handle string `json:"Handle,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/com_port.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/com_port.go new file mode 100644 index 000000000..8bf8cab60 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/com_port.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// ComPort specifies the named pipe that will be used for the port, with empty string indicating a disconnected port. +type ComPort struct { + NamedPipe string `json:"NamedPipe,omitempty"` + + OptimizeForDebugger bool `json:"OptimizeForDebugger,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/compute_system.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/compute_system.go new file mode 100644 index 000000000..10cea67e0 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/compute_system.go @@ -0,0 +1,26 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type ComputeSystem struct { + Owner string `json:"Owner,omitempty"` + + SchemaVersion *Version `json:"SchemaVersion,omitempty"` + + HostingSystemId string `json:"HostingSystemId,omitempty"` + + HostedSystem interface{} `json:"HostedSystem,omitempty"` + + Container *Container `json:"Container,omitempty"` + + VirtualMachine *VirtualMachine `json:"VirtualMachine,omitempty"` + + ShouldTerminateOnLastHandleClosed bool `json:"ShouldTerminateOnLastHandleClosed,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/configuration.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/configuration.go new file mode 100644 index 000000000..1d5dfe68a --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/configuration.go @@ -0,0 +1,72 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +import ( + "net/http" +) + +// contextKeys are used to identify the type of value in the context. +// Since these are string, it is possible to get a short description of the +// context key for logging and debugging using key.String(). + +type contextKey string + +func (c contextKey) String() string { + return "auth " + string(c) +} + +var ( + // ContextOAuth2 takes a oauth2.TokenSource as authentication for the request. + ContextOAuth2 = contextKey("token") + + // ContextBasicAuth takes BasicAuth as authentication for the request. + ContextBasicAuth = contextKey("basic") + + // ContextAccessToken takes a string oauth2 access token as authentication for the request. + ContextAccessToken = contextKey("accesstoken") + + // ContextAPIKey takes an APIKey as authentication for the request + ContextAPIKey = contextKey("apikey") +) + +// BasicAuth provides basic http authentication to a request passed via context using ContextBasicAuth +type BasicAuth struct { + UserName string `json:"userName,omitempty"` + Password string `json:"password,omitempty"` +} + +// APIKey provides API key based authentication to a request passed via context using ContextAPIKey +type APIKey struct { + Key string + Prefix string +} + +type Configuration struct { + BasePath string `json:"basePath,omitempty"` + Host string `json:"host,omitempty"` + Scheme string `json:"scheme,omitempty"` + DefaultHeader map[string]string `json:"defaultHeader,omitempty"` + UserAgent string `json:"userAgent,omitempty"` + HTTPClient *http.Client +} + +func NewConfiguration() *Configuration { + cfg := &Configuration{ + BasePath: "https://localhost", + DefaultHeader: make(map[string]string), + UserAgent: "Swagger-Codegen/2.1.0/go", + } + return cfg +} + +func (c *Configuration) AddDefaultHeader(key string, value string) { + c.DefaultHeader[key] = value +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/console_size.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/console_size.go new file mode 100644 index 000000000..68aa04a57 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/console_size.go @@ -0,0 +1,16 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type ConsoleSize struct { + Height int32 `json:"Height,omitempty"` + + Width int32 `json:"Width,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/container.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/container.go new file mode 100644 index 000000000..39a54432c --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/container.go @@ -0,0 +1,36 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Container struct { + GuestOs *GuestOs `json:"GuestOs,omitempty"` + + Storage *Storage `json:"Storage,omitempty"` + + MappedDirectories []MappedDirectory `json:"MappedDirectories,omitempty"` + + MappedPipes []MappedPipe `json:"MappedPipes,omitempty"` + + Memory *Memory `json:"Memory,omitempty"` + + Processor *Processor `json:"Processor,omitempty"` + + Networking *Networking `json:"Networking,omitempty"` + + HvSocket *HvSocket `json:"HvSocket,omitempty"` + + ContainerCredentialGuard *ContainerCredentialGuardState `json:"ContainerCredentialGuard,omitempty"` + + RegistryChanges *RegistryChanges `json:"RegistryChanges,omitempty"` + + AssignedDevices []Device `json:"AssignedDevices,omitempty"` + + AdditionalDeviceNamespace *ContainerDefinitionDevice `json:"AdditionalDeviceNamespace,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/container_credential_guard_add_instance_request.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/container_credential_guard_add_instance_request.go new file mode 100644 index 000000000..495c6ebc8 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/container_credential_guard_add_instance_request.go @@ -0,0 +1,16 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type ContainerCredentialGuardAddInstanceRequest struct { + Id string `json:"Id,omitempty"` + CredentialSpec string `json:"CredentialSpec,omitempty"` + Transport string `json:"Transport,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/container_credential_guard_hv_socket_service_config.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/container_credential_guard_hv_socket_service_config.go new file mode 100644 index 000000000..1ed4c008f --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/container_credential_guard_hv_socket_service_config.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type ContainerCredentialGuardHvSocketServiceConfig struct { + ServiceId string `json:"ServiceId,omitempty"` + ServiceConfig *HvSocketServiceConfig `json:"ServiceConfig,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/container_credential_guard_instance.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/container_credential_guard_instance.go new file mode 100644 index 000000000..d7ebd0fcc --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/container_credential_guard_instance.go @@ -0,0 +1,16 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type ContainerCredentialGuardInstance struct { + Id string `json:"Id,omitempty"` + CredentialGuard *ContainerCredentialGuardState `json:"CredentialGuard,omitempty"` + HvSocketConfig *ContainerCredentialGuardHvSocketServiceConfig `json:"HvSocketConfig,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/container_credential_guard_modify_operation.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/container_credential_guard_modify_operation.go new file mode 100644 index 000000000..71005b090 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/container_credential_guard_modify_operation.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type ContainerCredentialGuardModifyOperation string + +const ( + AddInstance ContainerCredentialGuardModifyOperation = "AddInstance" + RemoveInstance ContainerCredentialGuardModifyOperation = "RemoveInstance" +) diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/container_credential_guard_operation_request.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/container_credential_guard_operation_request.go new file mode 100644 index 000000000..952cda496 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/container_credential_guard_operation_request.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type ContainerCredentialGuardOperationRequest struct { + Operation ContainerCredentialGuardModifyOperation `json:"Operation,omitempty"` + OperationDetails interface{} `json:"OperationDetails,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/container_credential_guard_remove_instance_request.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/container_credential_guard_remove_instance_request.go new file mode 100644 index 000000000..32e5a3bee --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/container_credential_guard_remove_instance_request.go @@ -0,0 +1,14 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type ContainerCredentialGuardRemoveInstanceRequest struct { + Id string `json:"Id,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/container_credential_guard_state.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/container_credential_guard_state.go new file mode 100644 index 000000000..0f8f64437 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/container_credential_guard_state.go @@ -0,0 +1,25 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type ContainerCredentialGuardState struct { + + // Authentication cookie for calls to a Container Credential Guard instance. + Cookie string `json:"Cookie,omitempty"` + + // Name of the RPC endpoint of the Container Credential Guard instance. + RpcEndpoint string `json:"RpcEndpoint,omitempty"` + + // Transport used for the configured Container Credential Guard instance. + Transport string `json:"Transport,omitempty"` + + // Credential spec used for the configured Container Credential Guard instance. + CredentialSpec string `json:"CredentialSpec,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/container_credential_guard_system_info.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/container_credential_guard_system_info.go new file mode 100644 index 000000000..ea306fa21 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/container_credential_guard_system_info.go @@ -0,0 +1,14 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type ContainerCredentialGuardSystemInfo struct { + Instances []ContainerCredentialGuardInstance `json:"Instances,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/container_memory_information.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/container_memory_information.go new file mode 100644 index 000000000..1fd7ca5d5 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/container_memory_information.go @@ -0,0 +1,25 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// memory usage as viewed from within the container +type ContainerMemoryInformation struct { + TotalPhysicalBytes int32 `json:"TotalPhysicalBytes,omitempty"` + + TotalUsage int32 `json:"TotalUsage,omitempty"` + + CommittedBytes int32 `json:"CommittedBytes,omitempty"` + + SharedCommittedBytes int32 `json:"SharedCommittedBytes,omitempty"` + + CommitLimitBytes int32 `json:"CommitLimitBytes,omitempty"` + + PeakCommitmentBytes int32 `json:"PeakCommitmentBytes,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/cpu_group.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/cpu_group.go new file mode 100644 index 000000000..90332a519 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/cpu_group.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// CPU groups allow Hyper-V administrators to better manage and allocate the host's CPU resources across guest virtual machines +type CpuGroup struct { + Id string `json:"Id,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/cpu_group_affinity.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/cpu_group_affinity.go new file mode 100644 index 000000000..8794961bf --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/cpu_group_affinity.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type CpuGroupAffinity struct { + LogicalProcessorCount int32 `json:"LogicalProcessorCount,omitempty"` + LogicalProcessors []int32 `json:"LogicalProcessors,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/cpu_group_config.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/cpu_group_config.go new file mode 100644 index 000000000..0be0475d4 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/cpu_group_config.go @@ -0,0 +1,18 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type CpuGroupConfig struct { + GroupId string `json:"GroupId,omitempty"` + Affinity *CpuGroupAffinity `json:"Affinity,omitempty"` + GroupProperties []CpuGroupProperty `json:"GroupProperties,omitempty"` + // Hypervisor CPU group IDs exposed to clients + HypervisorGroupId uint64 `json:"HypervisorGroupId,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/cpu_group_configurations.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/cpu_group_configurations.go new file mode 100644 index 000000000..3ace0ccc3 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/cpu_group_configurations.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// Structure used to return cpu groups for a Service property query +type CpuGroupConfigurations struct { + CpuGroups []CpuGroupConfig `json:"CpuGroups,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/cpu_group_operations.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/cpu_group_operations.go new file mode 100644 index 000000000..7d8978070 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/cpu_group_operations.go @@ -0,0 +1,18 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type CPUGroupOperation string + +const ( + CreateGroup CPUGroupOperation = "CreateGroup" + DeleteGroup CPUGroupOperation = "DeleteGroup" + SetProperty CPUGroupOperation = "SetProperty" +) diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/cpu_group_property.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/cpu_group_property.go new file mode 100644 index 000000000..bbad6a2c4 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/cpu_group_property.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type CpuGroupProperty struct { + PropertyCode uint32 `json:"PropertyCode,omitempty"` + PropertyValue uint32 `json:"PropertyValue,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/create_group_operation.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/create_group_operation.go new file mode 100644 index 000000000..91a8278fe --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/create_group_operation.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// Create group operation settings +type CreateGroupOperation struct { + GroupId string `json:"GroupId,omitempty"` + LogicalProcessorCount uint32 `json:"LogicalProcessorCount,omitempty"` + LogicalProcessors []uint32 `json:"LogicalProcessors,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/delete_group_operation.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/delete_group_operation.go new file mode 100644 index 000000000..134bd9881 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/delete_group_operation.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// Delete group operation settings +type DeleteGroupOperation struct { + GroupId string `json:"GroupId,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/device.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/device.go new file mode 100644 index 000000000..31c4538af --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/device.go @@ -0,0 +1,27 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type DeviceType string + +const ( + ClassGUID DeviceType = "ClassGuid" + DeviceInstanceID DeviceType = "DeviceInstance" + GPUMirror DeviceType = "GpuMirror" +) + +type Device struct { + // The type of device to assign to the container. + Type DeviceType `json:"Type,omitempty"` + // The interface class guid of the device interfaces to assign to the container. Only used when Type is ClassGuid. + InterfaceClassGuid string `json:"InterfaceClassGuid,omitempty"` + // The location path of the device to assign to the container. Only used when Type is DeviceInstanceID. + LocationPath string `json:"LocationPath,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/devices.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/devices.go new file mode 100644 index 000000000..e985d96d2 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/devices.go @@ -0,0 +1,46 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Devices struct { + ComPorts map[string]ComPort `json:"ComPorts,omitempty"` + + Scsi map[string]Scsi `json:"Scsi,omitempty"` + + VirtualPMem *VirtualPMemController `json:"VirtualPMem,omitempty"` + + NetworkAdapters map[string]NetworkAdapter `json:"NetworkAdapters,omitempty"` + + VideoMonitor *VideoMonitor `json:"VideoMonitor,omitempty"` + + Keyboard *Keyboard `json:"Keyboard,omitempty"` + + Mouse *Mouse `json:"Mouse,omitempty"` + + HvSocket *HvSocket2 `json:"HvSocket,omitempty"` + + EnhancedModeVideo *EnhancedModeVideo `json:"EnhancedModeVideo,omitempty"` + + GuestCrashReporting *GuestCrashReporting `json:"GuestCrashReporting,omitempty"` + + VirtualSmb *VirtualSmb `json:"VirtualSmb,omitempty"` + + Plan9 *Plan9 `json:"Plan9,omitempty"` + + Battery *Battery `json:"Battery,omitempty"` + + FlexibleIov map[string]FlexibleIoDevice `json:"FlexibleIov,omitempty"` + + SharedMemory *SharedMemoryConfiguration `json:"SharedMemory,omitempty"` + + // TODO: This is pre-release support in schema 2.3. Need to add build number + // docs when a public build with this is out. + VirtualPci map[string]VirtualPciDevice `json:",omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/enhanced_mode_video.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/enhanced_mode_video.go new file mode 100644 index 000000000..85450c41e --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/enhanced_mode_video.go @@ -0,0 +1,14 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type EnhancedModeVideo struct { + ConnectionOptions *RdpConnectionOptions `json:"ConnectionOptions,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/flexible_io_device.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/flexible_io_device.go new file mode 100644 index 000000000..fe86cab65 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/flexible_io_device.go @@ -0,0 +1,18 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type FlexibleIoDevice struct { + EmulatorId string `json:"EmulatorId,omitempty"` + + HostingModel string `json:"HostingModel,omitempty"` + + Configuration []string `json:"Configuration,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/guest_connection.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/guest_connection.go new file mode 100644 index 000000000..7db29495b --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/guest_connection.go @@ -0,0 +1,19 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type GuestConnection struct { + + // Use Vsock rather than Hyper-V sockets to communicate with the guest service. + UseVsock bool `json:"UseVsock,omitempty"` + + // Don't disconnect the guest connection when pausing the virtual machine. + UseConnectedSuspend bool `json:"UseConnectedSuspend,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/guest_connection_info.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/guest_connection_info.go new file mode 100644 index 000000000..8a369bab7 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/guest_connection_info.go @@ -0,0 +1,21 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// Information about the guest. +type GuestConnectionInfo struct { + + // Each schema version x.y stands for the range of versions a.b where a==x and b<=y. This list comes from the SupportedSchemaVersions field in GcsCapabilities. + SupportedSchemaVersions []Version `json:"SupportedSchemaVersions,omitempty"` + + ProtocolVersion int32 `json:"ProtocolVersion,omitempty"` + + GuestDefinedCapabilities *interface{} `json:"GuestDefinedCapabilities,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/guest_crash_reporting.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/guest_crash_reporting.go new file mode 100644 index 000000000..af8280048 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/guest_crash_reporting.go @@ -0,0 +1,14 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type GuestCrashReporting struct { + WindowsCrashSettings *WindowsCrashReporting `json:"WindowsCrashSettings,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/guest_os.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/guest_os.go new file mode 100644 index 000000000..8838519a3 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/guest_os.go @@ -0,0 +1,14 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type GuestOs struct { + HostName string `json:"HostName,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/guest_state.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/guest_state.go new file mode 100644 index 000000000..ef1eec886 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/guest_state.go @@ -0,0 +1,22 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type GuestState struct { + + // The path to an existing file uses for persistent guest state storage. An empty string indicates the system should initialize new transient, in-memory guest state. + GuestStateFilePath string `json:"GuestStateFilePath,omitempty"` + + // The path to an existing file for persistent runtime state storage. An empty string indicates the system should initialize new transient, in-memory runtime state. + RuntimeStateFilePath string `json:"RuntimeStateFilePath,omitempty"` + + // If true, the guest state and runtime state files will be used as templates to populate transient, in-memory state instead of using the files as persistent backing store. + ForceTransientState bool `json:"ForceTransientState,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/host_processor_modify_request.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/host_processor_modify_request.go new file mode 100644 index 000000000..2238ce530 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/host_processor_modify_request.go @@ -0,0 +1,16 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// Structure used to request a service processor modification +type HostProcessorModificationRequest struct { + Operation CPUGroupOperation `json:"Operation,omitempty"` + OperationDetails interface{} `json:"OperationDetails,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/hosted_system.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/hosted_system.go new file mode 100644 index 000000000..ea3084bca --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/hosted_system.go @@ -0,0 +1,16 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type HostedSystem struct { + SchemaVersion *Version `json:"SchemaVersion,omitempty"` + + Container *Container `json:"Container,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/hv_socket.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/hv_socket.go new file mode 100644 index 000000000..23b2ee9e7 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/hv_socket.go @@ -0,0 +1,16 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type HvSocket struct { + Config *HvSocketSystemConfig `json:"Config,omitempty"` + + EnablePowerShellDirect bool `json:"EnablePowerShellDirect,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/hv_socket_2.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/hv_socket_2.go new file mode 100644 index 000000000..a017691f0 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/hv_socket_2.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// HvSocket configuration for a VM +type HvSocket2 struct { + HvSocketConfig *HvSocketSystemConfig `json:"HvSocketConfig,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/hv_socket_address.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/hv_socket_address.go new file mode 100644 index 000000000..84c11b93e --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/hv_socket_address.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// This class defines address settings applied to a VM +// by the GCS every time a VM starts or restores. +type HvSocketAddress struct { + LocalAddress string `json:"LocalAddress,omitempty"` + ParentAddress string `json:"ParentAddress,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/hv_socket_service_config.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/hv_socket_service_config.go new file mode 100644 index 000000000..ecd9f7fba --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/hv_socket_service_config.go @@ -0,0 +1,28 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type HvSocketServiceConfig struct { + + // SDDL string that HvSocket will check before allowing a host process to bind to this specific service. If not specified, defaults to the system DefaultBindSecurityDescriptor, defined in HvSocketSystemWpConfig in V1. + BindSecurityDescriptor string `json:"BindSecurityDescriptor,omitempty"` + + // SDDL string that HvSocket will check before allowing a host process to connect to this specific service. If not specified, defaults to the system DefaultConnectSecurityDescriptor, defined in HvSocketSystemWpConfig in V1. + ConnectSecurityDescriptor string `json:"ConnectSecurityDescriptor,omitempty"` + + // If true, HvSocket will process wildcard binds for this service/system combination. Wildcard binds are secured in the registry at SOFTWARE/Microsoft/Windows NT/CurrentVersion/Virtualization/HvSocket/WildcardDescriptors + AllowWildcardBinds bool `json:"AllowWildcardBinds,omitempty"` + + // Disabled controls whether the HvSocket service is accepting connection requests. + // This set to true will make the service refuse all incoming connections as well as cancel + // any connections already established. The service itself will still be active however + // and can be re-enabled at a future time. + Disabled bool `json:"Disabled,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/hv_socket_system_config.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/hv_socket_system_config.go new file mode 100644 index 000000000..69f4f9d39 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/hv_socket_system_config.go @@ -0,0 +1,22 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// This is the HCS Schema version of the HvSocket configuration. The VMWP version is located in Config.Devices.IC in V1. +type HvSocketSystemConfig struct { + + // SDDL string that HvSocket will check before allowing a host process to bind to an unlisted service for this specific container/VM (not wildcard binds). + DefaultBindSecurityDescriptor string `json:"DefaultBindSecurityDescriptor,omitempty"` + + // SDDL string that HvSocket will check before allowing a host process to connect to an unlisted service in the VM/container. + DefaultConnectSecurityDescriptor string `json:"DefaultConnectSecurityDescriptor,omitempty"` + + ServiceTable map[string]HvSocketServiceConfig `json:"ServiceTable,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/interrupt_moderation_mode.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/interrupt_moderation_mode.go new file mode 100644 index 000000000..a614d63bd --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/interrupt_moderation_mode.go @@ -0,0 +1,42 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type InterruptModerationName string + +// The valid interrupt moderation modes for I/O virtualization (IOV) offloading. +const ( + DefaultName InterruptModerationName = "Default" + AdaptiveName InterruptModerationName = "Adaptive" + OffName InterruptModerationName = "Off" + LowName InterruptModerationName = "Low" + MediumName InterruptModerationName = "Medium" + HighName InterruptModerationName = "High" +) + +type InterruptModerationValue uint32 + +const ( + DefaultValue InterruptModerationValue = iota + AdaptiveValue + OffValue + LowValue InterruptModerationValue = 100 + MediumValue InterruptModerationValue = 200 + HighValue InterruptModerationValue = 300 +) + +var InterruptModerationValueToName = map[InterruptModerationValue]InterruptModerationName{ + DefaultValue: DefaultName, + AdaptiveValue: AdaptiveName, + OffValue: OffName, + LowValue: LowName, + MediumValue: MediumName, + HighValue: HighName, +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/iov_settings.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/iov_settings.go new file mode 100644 index 000000000..2a55cc37c --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/iov_settings.go @@ -0,0 +1,22 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type IovSettings struct { + // The weight assigned to this port for I/O virtualization (IOV) offloading. + // Setting this to 0 disables IOV offloading. + OffloadWeight *uint32 `json:"OffloadWeight,omitempty"` + + // The number of queue pairs requested for this port for I/O virtualization (IOV) offloading. + QueuePairsRequested *uint32 `json:"QueuePairsRequested,omitempty"` + + // The interrupt moderation mode for I/O virtualization (IOV) offloading. + InterruptModeration *InterruptModerationName `json:"InterruptModeration,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/keyboard.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/keyboard.go new file mode 100644 index 000000000..3d3fa3b1c --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/keyboard.go @@ -0,0 +1,13 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Keyboard struct { +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/layer.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/layer.go new file mode 100644 index 000000000..176c49d49 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/layer.go @@ -0,0 +1,21 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Layer struct { + Id string `json:"Id,omitempty"` + + Path string `json:"Path,omitempty"` + + PathType string `json:"PathType,omitempty"` + + // Unspecified defaults to Enabled + Cache string `json:"Cache,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/linux_kernel_direct.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/linux_kernel_direct.go new file mode 100644 index 000000000..0ab6c280f --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/linux_kernel_direct.go @@ -0,0 +1,18 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.2 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type LinuxKernelDirect struct { + KernelFilePath string `json:"KernelFilePath,omitempty"` + + InitRdPath string `json:"InitRdPath,omitempty"` + + KernelCmdLine string `json:"KernelCmdLine,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/logical_processor.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/logical_processor.go new file mode 100644 index 000000000..2e3aa5e17 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/logical_processor.go @@ -0,0 +1,18 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type LogicalProcessor struct { + LpIndex uint32 `json:"LpIndex,omitempty"` + NodeNumber uint8 `json:"NodeNumber,omitempty"` + PackageId uint32 `json:"PackageId,omitempty"` + CoreId uint32 `json:"CoreId,omitempty"` + RootVpIndex int32 `json:"RootVpIndex,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/mapped_directory.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/mapped_directory.go new file mode 100644 index 000000000..9b86a4045 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/mapped_directory.go @@ -0,0 +1,20 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type MappedDirectory struct { + HostPath string `json:"HostPath,omitempty"` + + HostPathType string `json:"HostPathType,omitempty"` + + ContainerPath string `json:"ContainerPath,omitempty"` + + ReadOnly bool `json:"ReadOnly,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/mapped_pipe.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/mapped_pipe.go new file mode 100644 index 000000000..208074e9a --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/mapped_pipe.go @@ -0,0 +1,18 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type MappedPipe struct { + ContainerPipeName string `json:"ContainerPipeName,omitempty"` + + HostPath string `json:"HostPath,omitempty"` + + HostPathType string `json:"HostPathType,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/memory.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/memory.go new file mode 100644 index 000000000..30749c672 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/memory.go @@ -0,0 +1,14 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Memory struct { + SizeInMB uint64 `json:"SizeInMB,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/memory_2.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/memory_2.go new file mode 100644 index 000000000..71224c75b --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/memory_2.go @@ -0,0 +1,49 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Memory2 struct { + SizeInMB uint64 `json:"SizeInMB,omitempty"` + + AllowOvercommit bool `json:"AllowOvercommit,omitempty"` + + EnableHotHint bool `json:"EnableHotHint,omitempty"` + + EnableColdHint bool `json:"EnableColdHint,omitempty"` + + EnableEpf bool `json:"EnableEpf,omitempty"` + + // EnableDeferredCommit is private in the schema. If regenerated need to add back. + EnableDeferredCommit bool `json:"EnableDeferredCommit,omitempty"` + + // EnableColdDiscardHint if enabled, then the memory cold discard hint feature is exposed + // to the VM, allowing it to trim non-zeroed pages from the working set (if supported by + // the guest operating system). + EnableColdDiscardHint bool `json:"EnableColdDiscardHint,omitempty"` + + // LowMmioGapInMB is the low MMIO region allocated below 4GB. + // + // TODO: This is pre-release support in schema 2.3. Need to add build number + // docs when a public build with this is out. + LowMMIOGapInMB uint64 `json:"LowMmioGapInMB,omitempty"` + + // HighMmioBaseInMB is the high MMIO region allocated above 4GB (base and + // size). + // + // TODO: This is pre-release support in schema 2.3. Need to add build number + // docs when a public build with this is out. + HighMMIOBaseInMB uint64 `json:"HighMmioBaseInMB,omitempty"` + + // HighMmioGapInMB is the high MMIO region. + // + // TODO: This is pre-release support in schema 2.3. Need to add build number + // docs when a public build with this is out. + HighMMIOGapInMB uint64 `json:"HighMmioGapInMB,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/memory_information_for_vm.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/memory_information_for_vm.go new file mode 100644 index 000000000..811779b04 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/memory_information_for_vm.go @@ -0,0 +1,18 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type MemoryInformationForVm struct { + VirtualNodeCount uint32 `json:"VirtualNodeCount,omitempty"` + + VirtualMachineMemory *VmMemory `json:"VirtualMachineMemory,omitempty"` + + VirtualNodes []VirtualNodeInfo `json:"VirtualNodes,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/memory_stats.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/memory_stats.go new file mode 100644 index 000000000..906ba597f --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/memory_stats.go @@ -0,0 +1,19 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// Memory runtime statistics +type MemoryStats struct { + MemoryUsageCommitBytes uint64 `json:"MemoryUsageCommitBytes,omitempty"` + + MemoryUsageCommitPeakBytes uint64 `json:"MemoryUsageCommitPeakBytes,omitempty"` + + MemoryUsagePrivateWorkingSetBytes uint64 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_container_definition_device.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_container_definition_device.go new file mode 100644 index 000000000..8dbe40b3b --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_container_definition_device.go @@ -0,0 +1,14 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type ContainerDefinitionDevice struct { + DeviceExtension []DeviceExtension `json:"device_extension,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_device_category.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_device_category.go new file mode 100644 index 000000000..8fe89f927 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_device_category.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type DeviceCategory struct { + Name string `json:"name,omitempty"` + InterfaceClass []InterfaceClass `json:"interface_class,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_device_extension.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_device_extension.go new file mode 100644 index 000000000..a62568d89 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_device_extension.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type DeviceExtension struct { + DeviceCategory *DeviceCategory `json:"device_category,omitempty"` + Namespace *DeviceExtensionNamespace `json:"namespace,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_device_instance.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_device_instance.go new file mode 100644 index 000000000..a7410febd --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_device_instance.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type DeviceInstance struct { + Id string `json:"id,omitempty"` + LocationPath string `json:"location_path,omitempty"` + PortName string `json:"port_name,omitempty"` + InterfaceClass []InterfaceClass `json:"interface_class,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_device_namespace.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_device_namespace.go new file mode 100644 index 000000000..355364064 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_device_namespace.go @@ -0,0 +1,16 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type DeviceNamespace struct { + RequiresDriverstore bool `json:"requires_driverstore,omitempty"` + DeviceCategory []DeviceCategory `json:"device_category,omitempty"` + DeviceInstance []DeviceInstance `json:"device_instance,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_interface_class.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_interface_class.go new file mode 100644 index 000000000..7be98b541 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_interface_class.go @@ -0,0 +1,16 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type InterfaceClass struct { + Type_ string `json:"type,omitempty"` + Identifier string `json:"identifier,omitempty"` + Recurse bool `json:"recurse,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_namespace.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_namespace.go new file mode 100644 index 000000000..3ab9cf1ec --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_namespace.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type DeviceExtensionNamespace struct { + Ob *ObjectNamespace `json:"ob,omitempty"` + Device *DeviceNamespace `json:"device,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_object_directory.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_object_directory.go new file mode 100644 index 000000000..d2f51b3b5 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_object_directory.go @@ -0,0 +1,18 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type ObjectDirectory struct { + Name string `json:"name,omitempty"` + Clonesd string `json:"clonesd,omitempty"` + Shadow string `json:"shadow,omitempty"` + Symlink []ObjectSymlink `json:"symlink,omitempty"` + Objdir []ObjectDirectory `json:"objdir,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_object_namespace.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_object_namespace.go new file mode 100644 index 000000000..47dfb55bf --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_object_namespace.go @@ -0,0 +1,16 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type ObjectNamespace struct { + Shadow string `json:"shadow,omitempty"` + Symlink []ObjectSymlink `json:"symlink,omitempty"` + Objdir []ObjectDirectory `json:"objdir,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_object_symlink.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_object_symlink.go new file mode 100644 index 000000000..8867ebe5f --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_object_symlink.go @@ -0,0 +1,18 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type ObjectSymlink struct { + Name string `json:"name,omitempty"` + Path string `json:"path,omitempty"` + Scope string `json:"scope,omitempty"` + Pathtoclone string `json:"pathtoclone,omitempty"` + AccessMask int32 `json:"access_mask,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/modification_request.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/modification_request.go new file mode 100644 index 000000000..1384ed888 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/modification_request.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type ModificationRequest struct { + PropertyType PropertyType `json:"PropertyType,omitempty"` + Settings interface{} `json:"Settings,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/modify_setting_request.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/modify_setting_request.go new file mode 100644 index 000000000..d29455a3e --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/modify_setting_request.go @@ -0,0 +1,20 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type ModifySettingRequest struct { + ResourcePath string `json:"ResourcePath,omitempty"` + + RequestType string `json:"RequestType,omitempty"` + + Settings interface{} `json:"Settings,omitempty"` // NOTE: Swagger generated as *interface{}. Locally updated + + GuestRequest interface{} `json:"GuestRequest,omitempty"` // NOTE: Swagger generated as *interface{}. Locally updated +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/mouse.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/mouse.go new file mode 100644 index 000000000..ccf8b938f --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/mouse.go @@ -0,0 +1,13 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Mouse struct { +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/network_adapter.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/network_adapter.go new file mode 100644 index 000000000..7408abd31 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/network_adapter.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type NetworkAdapter struct { + EndpointId string `json:"EndpointId,omitempty"` + MacAddress string `json:"MacAddress,omitempty"` + // The I/O virtualization (IOV) offloading configuration. + IovSettings *IovSettings `json:"IovSettings,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/networking.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/networking.go new file mode 100644 index 000000000..e5ea187a2 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/networking.go @@ -0,0 +1,23 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Networking struct { + AllowUnqualifiedDnsQuery bool `json:"AllowUnqualifiedDnsQuery,omitempty"` + + DnsSearchList string `json:"DnsSearchList,omitempty"` + + NetworkSharedContainerName string `json:"NetworkSharedContainerName,omitempty"` + + // Guid in windows; string in linux + Namespace string `json:"Namespace,omitempty"` + + NetworkAdapters []string `json:"NetworkAdapters,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/pause_notification.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/pause_notification.go new file mode 100644 index 000000000..d96c9501f --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/pause_notification.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// Notification data that is indicated to components running in the Virtual Machine. +type PauseNotification struct { + Reason string `json:"Reason,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/pause_options.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/pause_options.go new file mode 100644 index 000000000..21707a88e --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/pause_options.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// Options for HcsPauseComputeSystem +type PauseOptions struct { + SuspensionLevel string `json:"SuspensionLevel,omitempty"` + + HostedNotification *PauseNotification `json:"HostedNotification,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/plan9.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/plan9.go new file mode 100644 index 000000000..29d8c8012 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/plan9.go @@ -0,0 +1,14 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Plan9 struct { + Shares []Plan9Share `json:"Shares,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/plan9_share.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/plan9_share.go new file mode 100644 index 000000000..41f8fdea0 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/plan9_share.go @@ -0,0 +1,34 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Plan9Share struct { + Name string `json:"Name,omitempty"` + + // The name by which the guest operation system can access this share, via the aname parameter in the Plan9 protocol. + AccessName string `json:"AccessName,omitempty"` + + Path string `json:"Path,omitempty"` + + Port int32 `json:"Port,omitempty"` + + // Flags are marked private. Until they are exported correctly + // + // ReadOnly 0x00000001 + // LinuxMetadata 0x00000004 + // CaseSensitive 0x00000008 + Flags int32 `json:"Flags,omitempty"` + + ReadOnly bool `json:"ReadOnly,omitempty"` + + UseShareRootIdentity bool `json:"UseShareRootIdentity,omitempty"` + + AllowedFiles []string `json:"AllowedFiles,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/process_details.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/process_details.go new file mode 100644 index 000000000..e9a662dd5 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/process_details.go @@ -0,0 +1,33 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +import ( + "time" +) + +// Information about a process running in a container +type ProcessDetails struct { + ProcessId int32 `json:"ProcessId,omitempty"` + + ImageName string `json:"ImageName,omitempty"` + + CreateTimestamp time.Time `json:"CreateTimestamp,omitempty"` + + UserTime100ns int32 `json:"UserTime100ns,omitempty"` + + KernelTime100ns int32 `json:"KernelTime100ns,omitempty"` + + MemoryCommitBytes int32 `json:"MemoryCommitBytes,omitempty"` + + MemoryWorkingSetPrivateBytes int32 `json:"MemoryWorkingSetPrivateBytes,omitempty"` + + MemoryWorkingSetSharedBytes int32 `json:"MemoryWorkingSetSharedBytes,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/process_modify_request.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/process_modify_request.go new file mode 100644 index 000000000..e4ed095c7 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/process_modify_request.go @@ -0,0 +1,19 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// Passed to HcsRpc_ModifyProcess +type ProcessModifyRequest struct { + Operation string `json:"Operation,omitempty"` + + ConsoleSize *ConsoleSize `json:"ConsoleSize,omitempty"` + + CloseHandle *CloseHandle `json:"CloseHandle,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/process_parameters.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/process_parameters.go new file mode 100644 index 000000000..82b0d0532 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/process_parameters.go @@ -0,0 +1,46 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type ProcessParameters struct { + ApplicationName string `json:"ApplicationName,omitempty"` + + CommandLine string `json:"CommandLine,omitempty"` + + // optional alternative to CommandLine, currently only supported by Linux GCS + CommandArgs []string `json:"CommandArgs,omitempty"` + + User string `json:"User,omitempty"` + + WorkingDirectory string `json:"WorkingDirectory,omitempty"` + + Environment map[string]string `json:"Environment,omitempty"` + + // if set, will run as low-privilege process + RestrictedToken bool `json:"RestrictedToken,omitempty"` + + // if set, ignore StdErrPipe + EmulateConsole bool `json:"EmulateConsole,omitempty"` + + CreateStdInPipe bool `json:"CreateStdInPipe,omitempty"` + + CreateStdOutPipe bool `json:"CreateStdOutPipe,omitempty"` + + CreateStdErrPipe bool `json:"CreateStdErrPipe,omitempty"` + + // height then width + ConsoleSize []int32 `json:"ConsoleSize,omitempty"` + + // if set, find an existing session for the user and create the process in it + UseExistingLogin bool `json:"UseExistingLogin,omitempty"` + + // if set, use the legacy console instead of conhost + UseLegacyConsole bool `json:"UseLegacyConsole,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/process_status.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/process_status.go new file mode 100644 index 000000000..ad9a4fa9a --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/process_status.go @@ -0,0 +1,21 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// Status of a process running in a container +type ProcessStatus struct { + ProcessId int32 `json:"ProcessId,omitempty"` + + Exited bool `json:"Exited,omitempty"` + + ExitCode int32 `json:"ExitCode,omitempty"` + + LastWaitResult int32 `json:"LastWaitResult,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/processor.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/processor.go new file mode 100644 index 000000000..bb24e88da --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/processor.go @@ -0,0 +1,18 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Processor struct { + Count int32 `json:"Count,omitempty"` + + Maximum int32 `json:"Maximum,omitempty"` + + Weight int32 `json:"Weight,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/processor_2.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/processor_2.go new file mode 100644 index 000000000..c64f335ec --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/processor_2.go @@ -0,0 +1,23 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.5 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Processor2 struct { + Count int32 `json:"Count,omitempty"` + + Limit int32 `json:"Limit,omitempty"` + + Weight int32 `json:"Weight,omitempty"` + + ExposeVirtualizationExtensions bool `json:"ExposeVirtualizationExtensions,omitempty"` + + // An optional object that configures the CPU Group to which a Virtual Machine is going to bind to. + CpuGroup *CpuGroup `json:"CpuGroup,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/processor_stats.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/processor_stats.go new file mode 100644 index 000000000..6157e2522 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/processor_stats.go @@ -0,0 +1,19 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// CPU runtime statistics +type ProcessorStats struct { + TotalRuntime100ns uint64 `json:"TotalRuntime100ns,omitempty"` + + RuntimeUser100ns uint64 `json:"RuntimeUser100ns,omitempty"` + + RuntimeKernel100ns uint64 `json:"RuntimeKernel100ns,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/processor_topology.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/processor_topology.go new file mode 100644 index 000000000..885156e77 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/processor_topology.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type ProcessorTopology struct { + LogicalProcessorCount uint32 `json:"LogicalProcessorCount,omitempty"` + LogicalProcessors []LogicalProcessor `json:"LogicalProcessors,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/properties.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/properties.go new file mode 100644 index 000000000..17558cba0 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/properties.go @@ -0,0 +1,54 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +import ( + v1 "github.com/containerd/cgroups/stats/v1" +) + +type Properties struct { + Id string `json:"Id,omitempty"` + + SystemType string `json:"SystemType,omitempty"` + + RuntimeOsType string `json:"RuntimeOsType,omitempty"` + + Name string `json:"Name,omitempty"` + + Owner string `json:"Owner,omitempty"` + + RuntimeId string `json:"RuntimeId,omitempty"` + + RuntimeTemplateId string `json:"RuntimeTemplateId,omitempty"` + + State string `json:"State,omitempty"` + + Stopped bool `json:"Stopped,omitempty"` + + ExitType string `json:"ExitType,omitempty"` + + Memory *MemoryInformationForVm `json:"Memory,omitempty"` + + Statistics *Statistics `json:"Statistics,omitempty"` + + ProcessList []ProcessDetails `json:"ProcessList,omitempty"` + + TerminateOnLastHandleClosed bool `json:"TerminateOnLastHandleClosed,omitempty"` + + HostingSystemId string `json:"HostingSystemId,omitempty"` + + SharedMemoryRegionInfo []SharedMemoryRegionInfo `json:"SharedMemoryRegionInfo,omitempty"` + + GuestConnectionInfo *GuestConnectionInfo `json:"GuestConnectionInfo,omitempty"` + + // Metrics is not part of the API for HCS but this is used for LCOW v2 to + // return the full cgroup metrics from the guest. + Metrics *v1.Metrics `json:"LCOWMetrics,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/property_query.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/property_query.go new file mode 100644 index 000000000..d6d80df13 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/property_query.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// By default the basic properties will be returned. This query provides a way to request specific properties. +type PropertyQuery struct { + PropertyTypes []PropertyType `json:"PropertyTypes,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/property_type.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/property_type.go new file mode 100644 index 000000000..98f2c96ed --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/property_type.go @@ -0,0 +1,26 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type PropertyType string + +const ( + PTMemory PropertyType = "Memory" + PTGuestMemory PropertyType = "GuestMemory" + PTStatistics PropertyType = "Statistics" + PTProcessList PropertyType = "ProcessList" + PTTerminateOnLastHandleClosed PropertyType = "TerminateOnLastHandleClosed" + PTSharedMemoryRegion PropertyType = "SharedMemoryRegion" + PTContainerCredentialGuard PropertyType = "ContainerCredentialGuard" // This field is not generated by swagger. This was added manually. + PTGuestConnection PropertyType = "GuestConnection" + PTICHeartbeatStatus PropertyType = "ICHeartbeatStatus" + PTProcessorTopology PropertyType = "ProcessorTopology" + PTCPUGroup PropertyType = "CpuGroup" +) diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/rdp_connection_options.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/rdp_connection_options.go new file mode 100644 index 000000000..8d5f5c171 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/rdp_connection_options.go @@ -0,0 +1,16 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type RdpConnectionOptions struct { + AccessSids []string `json:"AccessSids,omitempty"` + + NamedPipe string `json:"NamedPipe,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/registry_changes.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/registry_changes.go new file mode 100644 index 000000000..006906f6e --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/registry_changes.go @@ -0,0 +1,16 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type RegistryChanges struct { + AddValues []RegistryValue `json:"AddValues,omitempty"` + + DeleteKeys []RegistryKey `json:"DeleteKeys,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/registry_key.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/registry_key.go new file mode 100644 index 000000000..26fde99c7 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/registry_key.go @@ -0,0 +1,18 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type RegistryKey struct { + Hive string `json:"Hive,omitempty"` + + Name string `json:"Name,omitempty"` + + Volatile bool `json:"Volatile,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/registry_value.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/registry_value.go new file mode 100644 index 000000000..3f203176c --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/registry_value.go @@ -0,0 +1,30 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type RegistryValue struct { + Key *RegistryKey `json:"Key,omitempty"` + + Name string `json:"Name,omitempty"` + + Type_ string `json:"Type,omitempty"` + + // One and only one value type must be set. + StringValue string `json:"StringValue,omitempty"` + + BinaryValue string `json:"BinaryValue,omitempty"` + + DWordValue int32 `json:"DWordValue,omitempty"` + + QWordValue int32 `json:"QWordValue,omitempty"` + + // Only used if RegistryValueType is CustomType The data is in BinaryValue + CustomType int32 `json:"CustomType,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/restore_state.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/restore_state.go new file mode 100644 index 000000000..778ff5873 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/restore_state.go @@ -0,0 +1,19 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type RestoreState struct { + + // The path to the save state file to restore the system from. + SaveStateFilePath string `json:"SaveStateFilePath,omitempty"` + + // The ID of the template system to clone this new system off of. An empty string indicates the system should not be cloned from a template. + TemplateSystemId string `json:"TemplateSystemId,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/save_options.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/save_options.go new file mode 100644 index 000000000..e55fa1d98 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/save_options.go @@ -0,0 +1,19 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type SaveOptions struct { + + // The type of save operation to be performed. + SaveType string `json:"SaveType,omitempty"` + + // The path to the file that will container the saved state. + SaveStateFilePath string `json:"SaveStateFilePath,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/scsi.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/scsi.go new file mode 100644 index 000000000..bf253a470 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/scsi.go @@ -0,0 +1,16 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Scsi struct { + + // Map of attachments, where the key is the integer LUN number on the controller. + Attachments map[string]Attachment `json:"Attachments,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/service_properties.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/service_properties.go new file mode 100644 index 000000000..b8142ca6a --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/service_properties.go @@ -0,0 +1,18 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +import "encoding/json" + +type ServiceProperties struct { + // Changed Properties field to []json.RawMessage from []interface{} to avoid having to + // remarshal sp.Properties[n] and unmarshal into the type(s) we want. + Properties []json.RawMessage `json:"Properties,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/shared_memory_configuration.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/shared_memory_configuration.go new file mode 100644 index 000000000..df9baa921 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/shared_memory_configuration.go @@ -0,0 +1,14 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type SharedMemoryConfiguration struct { + Regions []SharedMemoryRegion `json:"Regions,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/shared_memory_region.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/shared_memory_region.go new file mode 100644 index 000000000..825b71865 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/shared_memory_region.go @@ -0,0 +1,22 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type SharedMemoryRegion struct { + SectionName string `json:"SectionName,omitempty"` + + StartOffset int32 `json:"StartOffset,omitempty"` + + Length int32 `json:"Length,omitempty"` + + AllowGuestWrite bool `json:"AllowGuestWrite,omitempty"` + + HiddenFromGuest bool `json:"HiddenFromGuest,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/shared_memory_region_info.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/shared_memory_region_info.go new file mode 100644 index 000000000..f67b08eb5 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/shared_memory_region_info.go @@ -0,0 +1,16 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type SharedMemoryRegionInfo struct { + SectionName string `json:"SectionName,omitempty"` + + GuestPhysicalAddress int32 `json:"GuestPhysicalAddress,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/silo_properties.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/silo_properties.go new file mode 100644 index 000000000..5eaf6a7f4 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/silo_properties.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// Silo job information +type SiloProperties struct { + Enabled bool `json:"Enabled,omitempty"` + + JobName string `json:"JobName,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/statistics.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/statistics.go new file mode 100644 index 000000000..ba7a6b396 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/statistics.go @@ -0,0 +1,29 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +import ( + "time" +) + +// Runtime statistics for a container +type Statistics struct { + Timestamp time.Time `json:"Timestamp,omitempty"` + + ContainerStartTime time.Time `json:"ContainerStartTime,omitempty"` + + Uptime100ns uint64 `json:"Uptime100ns,omitempty"` + + Processor *ProcessorStats `json:"Processor,omitempty"` + + Memory *MemoryStats `json:"Memory,omitempty"` + + Storage *StorageStats `json:"Storage,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/storage.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/storage.go new file mode 100644 index 000000000..2627af913 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/storage.go @@ -0,0 +1,21 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Storage struct { + + // List of layers that describe the parent hierarchy for a container's storage. These layers combined together, presented as a disposable and/or committable working storage, are used by the container to record all changes done to the parent layers. + Layers []Layer `json:"Layers,omitempty"` + + // Path that points to the scratch space of a container, where parent layers are combined together to present a new disposable and/or committable layer with the changes done during its runtime. + Path string `json:"Path,omitempty"` + + QoS *StorageQoS `json:"QoS,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/storage_qo_s.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/storage_qo_s.go new file mode 100644 index 000000000..9c5e6eb53 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/storage_qo_s.go @@ -0,0 +1,16 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type StorageQoS struct { + IopsMaximum int32 `json:"IopsMaximum,omitempty"` + + BandwidthMaximum int32 `json:"BandwidthMaximum,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/storage_stats.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/storage_stats.go new file mode 100644 index 000000000..4f042ffd9 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/storage_stats.go @@ -0,0 +1,21 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// Storage runtime statistics +type StorageStats struct { + ReadCountNormalized uint64 `json:"ReadCountNormalized,omitempty"` + + ReadSizeBytes uint64 `json:"ReadSizeBytes,omitempty"` + + WriteCountNormalized uint64 `json:"WriteCountNormalized,omitempty"` + + WriteSizeBytes uint64 `json:"WriteSizeBytes,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/topology.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/topology.go new file mode 100644 index 000000000..834869940 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/topology.go @@ -0,0 +1,16 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Topology struct { + Memory *Memory2 `json:"Memory,omitempty"` + + Processor *Processor2 `json:"Processor,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/uefi.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/uefi.go new file mode 100644 index 000000000..0e48ece50 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/uefi.go @@ -0,0 +1,20 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Uefi struct { + EnableDebugger bool `json:"EnableDebugger,omitempty"` + + SecureBootTemplateId string `json:"SecureBootTemplateId,omitempty"` + + BootThis *UefiBootEntry `json:"BootThis,omitempty"` + + Console string `json:"Console,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/uefi_boot_entry.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/uefi_boot_entry.go new file mode 100644 index 000000000..3ab409d82 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/uefi_boot_entry.go @@ -0,0 +1,22 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type UefiBootEntry struct { + DeviceType string `json:"DeviceType,omitempty"` + + DevicePath string `json:"DevicePath,omitempty"` + + DiskNumber int32 `json:"DiskNumber,omitempty"` + + OptionalData string `json:"OptionalData,omitempty"` + + VmbFsRootPath string `json:"VmbFsRootPath,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/version.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/version.go new file mode 100644 index 000000000..2abfccca3 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/version.go @@ -0,0 +1,16 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Version struct { + Major int32 `json:"Major,omitempty"` + + Minor int32 `json:"Minor,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/video_monitor.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/video_monitor.go new file mode 100644 index 000000000..ec5d0fb93 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/video_monitor.go @@ -0,0 +1,18 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type VideoMonitor struct { + HorizontalResolution int32 `json:"HorizontalResolution,omitempty"` + + VerticalResolution int32 `json:"VerticalResolution,omitempty"` + + ConnectionOptions *RdpConnectionOptions `json:"ConnectionOptions,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_machine.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_machine.go new file mode 100644 index 000000000..2d22b1bcb --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_machine.go @@ -0,0 +1,32 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type VirtualMachine struct { + + // StopOnReset is private in the schema. If regenerated need to put back. + StopOnReset bool `json:"StopOnReset,omitempty"` + + Chipset *Chipset `json:"Chipset,omitempty"` + + ComputeTopology *Topology `json:"ComputeTopology,omitempty"` + + Devices *Devices `json:"Devices,omitempty"` + + GuestState *GuestState `json:"GuestState,omitempty"` + + RestoreState *RestoreState `json:"RestoreState,omitempty"` + + RegistryChanges *RegistryChanges `json:"RegistryChanges,omitempty"` + + StorageQoS *StorageQoS `json:"StorageQoS,omitempty"` + + GuestConnection *GuestConnection `json:"GuestConnection,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_node_info.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_node_info.go new file mode 100644 index 000000000..91a3c83d4 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_node_info.go @@ -0,0 +1,20 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type VirtualNodeInfo struct { + VirtualNodeIndex int32 `json:"VirtualNodeIndex,omitempty"` + + PhysicalNodeNumber int32 `json:"PhysicalNodeNumber,omitempty"` + + VirtualProcessorCount int32 `json:"VirtualProcessorCount,omitempty"` + + MemoryUsageInPages int32 `json:"MemoryUsageInPages,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_p_mem_controller.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_p_mem_controller.go new file mode 100644 index 000000000..f5b7f3e38 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_p_mem_controller.go @@ -0,0 +1,20 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type VirtualPMemController struct { + Devices map[string]VirtualPMemDevice `json:"Devices,omitempty"` + + MaximumCount uint32 `json:"MaximumCount,omitempty"` + + MaximumSizeBytes uint64 `json:"MaximumSizeBytes,omitempty"` + + Backing string `json:"Backing,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_p_mem_device.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_p_mem_device.go new file mode 100644 index 000000000..70cf2d90d --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_p_mem_device.go @@ -0,0 +1,18 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type VirtualPMemDevice struct { + HostPath string `json:"HostPath,omitempty"` + + ReadOnly bool `json:"ReadOnly,omitempty"` + + ImageFormat string `json:"ImageFormat,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_p_mem_mapping.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_p_mem_mapping.go new file mode 100644 index 000000000..9ef322f61 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_p_mem_mapping.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type VirtualPMemMapping struct { + HostPath string `json:"HostPath,omitempty"` + ImageFormat string `json:"ImageFormat,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_pci_device.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_pci_device.go new file mode 100644 index 000000000..f5e05903c --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_pci_device.go @@ -0,0 +1,16 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.3 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// TODO: This is pre-release support in schema 2.3. Need to add build number +// docs when a public build with this is out. +type VirtualPciDevice struct { + Functions []VirtualPciFunction `json:",omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_pci_function.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_pci_function.go new file mode 100644 index 000000000..cedb7d18b --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_pci_function.go @@ -0,0 +1,18 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.3 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// TODO: This is pre-release support in schema 2.3. Need to add build number +// docs when a public build with this is out. +type VirtualPciFunction struct { + DeviceInstancePath string `json:",omitempty"` + + VirtualFunction uint16 `json:",omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_smb.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_smb.go new file mode 100644 index 000000000..362df363e --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_smb.go @@ -0,0 +1,16 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type VirtualSmb struct { + Shares []VirtualSmbShare `json:"Shares,omitempty"` + + DirectFileMappingInMB int64 `json:"DirectFileMappingInMB,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_smb_share.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_smb_share.go new file mode 100644 index 000000000..915e9b638 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_smb_share.go @@ -0,0 +1,20 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type VirtualSmbShare struct { + Name string `json:"Name,omitempty"` + + Path string `json:"Path,omitempty"` + + AllowedFiles []string `json:"AllowedFiles,omitempty"` + + Options *VirtualSmbShareOptions `json:"Options,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_smb_share_options.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_smb_share_options.go new file mode 100644 index 000000000..75196bd8c --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_smb_share_options.go @@ -0,0 +1,62 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type VirtualSmbShareOptions struct { + ReadOnly bool `json:"ReadOnly,omitempty"` + + // convert exclusive access to shared read access + ShareRead bool `json:"ShareRead,omitempty"` + + // all opens will use cached I/O + CacheIo bool `json:"CacheIo,omitempty"` + + // disable oplock support + NoOplocks bool `json:"NoOplocks,omitempty"` + + // Acquire the backup privilege when attempting to open + TakeBackupPrivilege bool `json:"TakeBackupPrivilege,omitempty"` + + // Use the identity of the share root when opening + UseShareRootIdentity bool `json:"UseShareRootIdentity,omitempty"` + + // disable Direct Mapping + NoDirectmap bool `json:"NoDirectmap,omitempty"` + + // disable Byterange locks + NoLocks bool `json:"NoLocks,omitempty"` + + // disable Directory CHange Notifications + NoDirnotify bool `json:"NoDirnotify,omitempty"` + + // share is use for VM shared memory + VmSharedMemory bool `json:"VmSharedMemory,omitempty"` + + // allow access only to the files specified in AllowedFiles + RestrictFileAccess bool `json:"RestrictFileAccess,omitempty"` + + // disable all oplocks except Level II + ForceLevelIIOplocks bool `json:"ForceLevelIIOplocks,omitempty"` + + // Allow the host to reparse this base layer + ReparseBaseLayer bool `json:"ReparseBaseLayer,omitempty"` + + // Enable pseudo-oplocks + PseudoOplocks bool `json:"PseudoOplocks,omitempty"` + + // All opens will use non-cached IO + NonCacheIo bool `json:"NonCacheIo,omitempty"` + + // Enable pseudo directory change notifications + PseudoDirnotify bool `json:"PseudoDirnotify,omitempty"` + + // Block directory enumeration, renames, and deletes. + SingleFileMapping bool `json:"SingleFileMapping,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/vm_memory.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/vm_memory.go new file mode 100644 index 000000000..8e1836dd6 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/vm_memory.go @@ -0,0 +1,26 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type VmMemory struct { + AvailableMemory int32 `json:"AvailableMemory,omitempty"` + + AvailableMemoryBuffer int32 `json:"AvailableMemoryBuffer,omitempty"` + + ReservedMemory uint64 `json:"ReservedMemory,omitempty"` + + AssignedMemory uint64 `json:"AssignedMemory,omitempty"` + + SlpActive bool `json:"SlpActive,omitempty"` + + BalancingEnabled bool `json:"BalancingEnabled,omitempty"` + + DmOperationInProgress bool `json:"DmOperationInProgress,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/vm_processor_limits.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/vm_processor_limits.go new file mode 100644 index 000000000..de1b9cf1a --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/vm_processor_limits.go @@ -0,0 +1,22 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// ProcessorLimits is used when modifying processor scheduling limits of a virtual machine. +type ProcessorLimits struct { + // Maximum amount of host CPU resources that the virtual machine can use. + Limit uint64 `json:"Limit,omitempty"` + // Value describing the relative priority of this virtual machine compared to other virtual machines. + Weight uint64 `json:"Weight,omitempty"` + // Minimum amount of host CPU resources that the virtual machine is guaranteed. + Reservation uint64 `json:"Reservation,omitempty"` + // Provides the target maximum CPU frequency, in MHz, for a virtual machine. + MaximumFrequencyMHz uint32 `json:"MaximumFrequencyMHz,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/windows_crash_reporting.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/windows_crash_reporting.go new file mode 100644 index 000000000..8ed7e566d --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/windows_crash_reporting.go @@ -0,0 +1,16 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type WindowsCrashReporting struct { + DumpFileName string `json:"DumpFileName,omitempty"` + + MaxDumpSize int64 `json:"MaxDumpSize,omitempty"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/service.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/service.go new file mode 100644 index 000000000..a634dfc15 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/service.go @@ -0,0 +1,49 @@ +package hcs + +import ( + "context" + "encoding/json" + + hcsschema "github.com/Microsoft/hcsshim/internal/hcs/schema2" + "github.com/Microsoft/hcsshim/internal/vmcompute" +) + +// GetServiceProperties returns properties of the host compute service. +func GetServiceProperties(ctx context.Context, q hcsschema.PropertyQuery) (*hcsschema.ServiceProperties, error) { + operation := "hcs::GetServiceProperties" + + queryb, err := json.Marshal(q) + if err != nil { + return nil, err + } + propertiesJSON, resultJSON, err := vmcompute.HcsGetServiceProperties(ctx, string(queryb)) + events := processHcsResult(ctx, resultJSON) + if err != nil { + return nil, &HcsError{Op: operation, Err: err, Events: events} + } + + if propertiesJSON == "" { + return nil, ErrUnexpectedValue + } + properties := &hcsschema.ServiceProperties{} + if err := json.Unmarshal([]byte(propertiesJSON), properties); err != nil { + return nil, err + } + return properties, nil +} + +// ModifyServiceSettings modifies settings of the host compute service. +func ModifyServiceSettings(ctx context.Context, settings hcsschema.ModificationRequest) error { + operation := "hcs::ModifyServiceSettings" + + settingsJSON, err := json.Marshal(settings) + if err != nil { + return err + } + resultJSON, err := vmcompute.HcsModifyServiceSettings(ctx, string(settingsJSON)) + events := processHcsResult(ctx, resultJSON) + if err != nil { + return &HcsError{Op: operation, Err: err, Events: events} + } + return nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go new file mode 100644 index 000000000..1d45a703b --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go @@ -0,0 +1,807 @@ +package hcs + +import ( + "context" + "encoding/json" + "errors" + "fmt" + "strings" + "sync" + "syscall" + "time" + + "github.com/Microsoft/hcsshim/internal/cow" + "github.com/Microsoft/hcsshim/internal/hcs/schema1" + hcsschema "github.com/Microsoft/hcsshim/internal/hcs/schema2" + "github.com/Microsoft/hcsshim/internal/jobobject" + "github.com/Microsoft/hcsshim/internal/log" + "github.com/Microsoft/hcsshim/internal/logfields" + "github.com/Microsoft/hcsshim/internal/oc" + "github.com/Microsoft/hcsshim/internal/timeout" + "github.com/Microsoft/hcsshim/internal/vmcompute" + "github.com/sirupsen/logrus" + "go.opencensus.io/trace" +) + +type System struct { + handleLock sync.RWMutex + handle vmcompute.HcsSystem + id string + callbackNumber uintptr + + closedWaitOnce sync.Once + waitBlock chan struct{} + waitError error + exitError error + os, typ, owner string + startTime time.Time +} + +func newSystem(id string) *System { + return &System{ + id: id, + waitBlock: make(chan struct{}), + } +} + +// Implementation detail for silo naming, this should NOT be relied upon very heavily. +func siloNameFmt(containerID string) string { + return fmt.Sprintf(`\Container_%s`, containerID) +} + +// CreateComputeSystem creates a new compute system with the given configuration but does not start it. +func CreateComputeSystem(ctx context.Context, id string, hcsDocumentInterface interface{}) (_ *System, err error) { + operation := "hcs::CreateComputeSystem" + + // hcsCreateComputeSystemContext is an async operation. Start the outer span + // here to measure the full create time. + ctx, span := trace.StartSpan(ctx, operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", id)) + + computeSystem := newSystem(id) + + hcsDocumentB, err := json.Marshal(hcsDocumentInterface) + if err != nil { + return nil, err + } + + hcsDocument := string(hcsDocumentB) + + var ( + identity syscall.Handle + resultJSON string + createError error + ) + computeSystem.handle, resultJSON, createError = vmcompute.HcsCreateComputeSystem(ctx, id, hcsDocument, identity) + if createError == nil || IsPending(createError) { + defer func() { + if err != nil { + computeSystem.Close() + } + }() + if err = computeSystem.registerCallback(ctx); err != nil { + // Terminate the compute system if it still exists. We're okay to + // ignore a failure here. + _ = computeSystem.Terminate(ctx) + return nil, makeSystemError(computeSystem, operation, err, nil) + } + } + + events, err := processAsyncHcsResult(ctx, createError, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemCreateCompleted, &timeout.SystemCreate) + if err != nil { + if err == ErrTimeout { + // Terminate the compute system if it still exists. We're okay to + // ignore a failure here. + _ = computeSystem.Terminate(ctx) + } + return nil, makeSystemError(computeSystem, operation, err, events) + } + go computeSystem.waitBackground() + if err = computeSystem.getCachedProperties(ctx); err != nil { + return nil, err + } + return computeSystem, nil +} + +// OpenComputeSystem opens an existing compute system by ID. +func OpenComputeSystem(ctx context.Context, id string) (*System, error) { + operation := "hcs::OpenComputeSystem" + + computeSystem := newSystem(id) + handle, resultJSON, err := vmcompute.HcsOpenComputeSystem(ctx, id) + events := processHcsResult(ctx, resultJSON) + if err != nil { + return nil, makeSystemError(computeSystem, operation, err, events) + } + computeSystem.handle = handle + defer func() { + if err != nil { + computeSystem.Close() + } + }() + if err = computeSystem.registerCallback(ctx); err != nil { + return nil, makeSystemError(computeSystem, operation, err, nil) + } + go computeSystem.waitBackground() + if err = computeSystem.getCachedProperties(ctx); err != nil { + return nil, err + } + return computeSystem, nil +} + +func (computeSystem *System) getCachedProperties(ctx context.Context) error { + props, err := computeSystem.Properties(ctx) + if err != nil { + return err + } + computeSystem.typ = strings.ToLower(props.SystemType) + computeSystem.os = strings.ToLower(props.RuntimeOSType) + computeSystem.owner = strings.ToLower(props.Owner) + if computeSystem.os == "" && computeSystem.typ == "container" { + // Pre-RS5 HCS did not return the OS, but it only supported containers + // that ran Windows. + computeSystem.os = "windows" + } + return nil +} + +// OS returns the operating system of the compute system, "linux" or "windows". +func (computeSystem *System) OS() string { + return computeSystem.os +} + +// IsOCI returns whether processes in the compute system should be created via +// OCI. +func (computeSystem *System) IsOCI() bool { + return computeSystem.os == "linux" && computeSystem.typ == "container" +} + +// GetComputeSystems gets a list of the compute systems on the system that match the query +func GetComputeSystems(ctx context.Context, q schema1.ComputeSystemQuery) ([]schema1.ContainerProperties, error) { + operation := "hcs::GetComputeSystems" + + queryb, err := json.Marshal(q) + if err != nil { + return nil, err + } + + computeSystemsJSON, resultJSON, err := vmcompute.HcsEnumerateComputeSystems(ctx, string(queryb)) + events := processHcsResult(ctx, resultJSON) + if err != nil { + return nil, &HcsError{Op: operation, Err: err, Events: events} + } + + if computeSystemsJSON == "" { + return nil, ErrUnexpectedValue + } + computeSystems := []schema1.ContainerProperties{} + if err = json.Unmarshal([]byte(computeSystemsJSON), &computeSystems); err != nil { + return nil, err + } + + return computeSystems, nil +} + +// Start synchronously starts the computeSystem. +func (computeSystem *System) Start(ctx context.Context) (err error) { + operation := "hcs::System::Start" + + // hcsStartComputeSystemContext is an async operation. Start the outer span + // here to measure the full start time. + ctx, span := trace.StartSpan(ctx, operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + + computeSystem.handleLock.RLock() + defer computeSystem.handleLock.RUnlock() + + if computeSystem.handle == 0 { + return makeSystemError(computeSystem, operation, ErrAlreadyClosed, nil) + } + + resultJSON, err := vmcompute.HcsStartComputeSystem(ctx, computeSystem.handle, "") + events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemStartCompleted, &timeout.SystemStart) + if err != nil { + return makeSystemError(computeSystem, operation, err, events) + } + computeSystem.startTime = time.Now() + return nil +} + +// ID returns the compute system's identifier. +func (computeSystem *System) ID() string { + return computeSystem.id +} + +// Shutdown requests a compute system shutdown. +func (computeSystem *System) Shutdown(ctx context.Context) error { + computeSystem.handleLock.RLock() + defer computeSystem.handleLock.RUnlock() + + operation := "hcs::System::Shutdown" + + if computeSystem.handle == 0 { + return nil + } + + resultJSON, err := vmcompute.HcsShutdownComputeSystem(ctx, computeSystem.handle, "") + events := processHcsResult(ctx, resultJSON) + switch err { + case nil, ErrVmcomputeAlreadyStopped, ErrComputeSystemDoesNotExist, ErrVmcomputeOperationPending: + default: + return makeSystemError(computeSystem, operation, err, events) + } + return nil +} + +// Terminate requests a compute system terminate. +func (computeSystem *System) Terminate(ctx context.Context) error { + computeSystem.handleLock.RLock() + defer computeSystem.handleLock.RUnlock() + + operation := "hcs::System::Terminate" + + if computeSystem.handle == 0 { + return nil + } + + resultJSON, err := vmcompute.HcsTerminateComputeSystem(ctx, computeSystem.handle, "") + events := processHcsResult(ctx, resultJSON) + switch err { + case nil, ErrVmcomputeAlreadyStopped, ErrComputeSystemDoesNotExist, ErrVmcomputeOperationPending: + default: + return makeSystemError(computeSystem, operation, err, events) + } + return nil +} + +// waitBackground waits for the compute system exit notification. Once received +// sets `computeSystem.waitError` (if any) and unblocks all `Wait` calls. +// +// This MUST be called exactly once per `computeSystem.handle` but `Wait` is +// safe to call multiple times. +func (computeSystem *System) waitBackground() { + operation := "hcs::System::waitBackground" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + + err := waitForNotification(ctx, computeSystem.callbackNumber, hcsNotificationSystemExited, nil) + switch err { + case nil: + log.G(ctx).Debug("system exited") + case ErrVmcomputeUnexpectedExit: + log.G(ctx).Debug("unexpected system exit") + computeSystem.exitError = makeSystemError(computeSystem, operation, err, nil) + err = nil + default: + err = makeSystemError(computeSystem, operation, err, nil) + } + computeSystem.closedWaitOnce.Do(func() { + computeSystem.waitError = err + close(computeSystem.waitBlock) + }) + oc.SetSpanStatus(span, err) +} + +// Wait synchronously waits for the compute system to shutdown or terminate. If +// the compute system has already exited returns the previous error (if any). +func (computeSystem *System) Wait() error { + <-computeSystem.waitBlock + return computeSystem.waitError +} + +// ExitError returns an error describing the reason the compute system terminated. +func (computeSystem *System) ExitError() error { + select { + case <-computeSystem.waitBlock: + if computeSystem.waitError != nil { + return computeSystem.waitError + } + return computeSystem.exitError + default: + return errors.New("container not exited") + } +} + +// Properties returns the requested container properties targeting a V1 schema container. +func (computeSystem *System) Properties(ctx context.Context, types ...schema1.PropertyType) (*schema1.ContainerProperties, error) { + computeSystem.handleLock.RLock() + defer computeSystem.handleLock.RUnlock() + + operation := "hcs::System::Properties" + + queryBytes, err := json.Marshal(schema1.PropertyQuery{PropertyTypes: types}) + if err != nil { + return nil, makeSystemError(computeSystem, operation, err, nil) + } + + propertiesJSON, resultJSON, err := vmcompute.HcsGetComputeSystemProperties(ctx, computeSystem.handle, string(queryBytes)) + events := processHcsResult(ctx, resultJSON) + if err != nil { + return nil, makeSystemError(computeSystem, operation, err, events) + } + + if propertiesJSON == "" { + return nil, ErrUnexpectedValue + } + properties := &schema1.ContainerProperties{} + if err := json.Unmarshal([]byte(propertiesJSON), properties); err != nil { + return nil, makeSystemError(computeSystem, operation, err, nil) + } + + return properties, nil +} + +// queryInProc handles querying for container properties without reaching out to HCS. `props` +// will be updated to contain any data returned from the queries present in `types`. If any properties +// failed to be queried they will be tallied up and returned in as the first return value. Failures on +// query are NOT considered errors; the only failure case for this method is if the containers job object +// cannot be opened. +func (computeSystem *System) queryInProc(ctx context.Context, props *hcsschema.Properties, types []hcsschema.PropertyType) ([]hcsschema.PropertyType, error) { + // In the future we can make use of some new functionality in the HCS that allows you + // to pass a job object for HCS to use for the container. Currently, the only way we'll + // be able to open the job/silo is if we're running as SYSTEM. + jobOptions := &jobobject.Options{ + UseNTVariant: true, + Name: siloNameFmt(computeSystem.id), + } + job, err := jobobject.Open(ctx, jobOptions) + if err != nil { + return nil, err + } + defer job.Close() + + var fallbackQueryTypes []hcsschema.PropertyType + for _, propType := range types { + switch propType { + case hcsschema.PTStatistics: + // Handle a bad caller asking for the same type twice. No use in re-querying if this is + // filled in already. + if props.Statistics == nil { + props.Statistics, err = computeSystem.statisticsInProc(job) + if err != nil { + log.G(ctx).WithError(err).Warn("failed to get statistics in-proc") + + fallbackQueryTypes = append(fallbackQueryTypes, propType) + } + } + default: + fallbackQueryTypes = append(fallbackQueryTypes, propType) + } + } + + return fallbackQueryTypes, nil +} + +// statisticsInProc emulates what HCS does to grab statistics for a given container with a small +// change to make grabbing the private working set total much more efficient. +func (computeSystem *System) statisticsInProc(job *jobobject.JobObject) (*hcsschema.Statistics, error) { + // Start timestamp for these stats before we grab them to match HCS + timestamp := time.Now() + + memInfo, err := job.QueryMemoryStats() + if err != nil { + return nil, err + } + + processorInfo, err := job.QueryProcessorStats() + if err != nil { + return nil, err + } + + storageInfo, err := job.QueryStorageStats() + if err != nil { + return nil, err + } + + // This calculates the private working set more efficiently than HCS does. HCS calls NtQuerySystemInformation + // with the class SystemProcessInformation which returns an array containing system information for *every* + // process running on the machine. They then grab the pids that are running in the container and filter down + // the entries in the array to only what's running in that silo and start tallying up the total. This doesn't + // work well as performance should get worse if more processess are running on the machine in general and not + // just in the container. All of the additional information besides the WorkingSetPrivateSize field is ignored + // as well which isn't great and is wasted work to fetch. + // + // HCS only let's you grab statistics in an all or nothing fashion, so we can't just grab the private + // working set ourselves and ask for everything else seperately. The optimization we can make here is + // to open the silo ourselves and do the same queries for the rest of the info, as well as calculating + // the private working set in a more efficient manner by: + // + // 1. Find the pids running in the silo + // 2. Get a process handle for every process (only need PROCESS_QUERY_LIMITED_INFORMATION access) + // 3. Call NtQueryInformationProcess on each process with the class ProcessVmCounters + // 4. Tally up the total using the field PrivateWorkingSetSize in VM_COUNTERS_EX2. + privateWorkingSet, err := job.QueryPrivateWorkingSet() + if err != nil { + return nil, err + } + + return &hcsschema.Statistics{ + Timestamp: timestamp, + ContainerStartTime: computeSystem.startTime, + Uptime100ns: uint64(time.Since(computeSystem.startTime).Nanoseconds()) / 100, + Memory: &hcsschema.MemoryStats{ + MemoryUsageCommitBytes: memInfo.JobMemory, + MemoryUsageCommitPeakBytes: memInfo.PeakJobMemoryUsed, + MemoryUsagePrivateWorkingSetBytes: privateWorkingSet, + }, + Processor: &hcsschema.ProcessorStats{ + RuntimeKernel100ns: uint64(processorInfo.TotalKernelTime), + RuntimeUser100ns: uint64(processorInfo.TotalUserTime), + TotalRuntime100ns: uint64(processorInfo.TotalKernelTime + processorInfo.TotalUserTime), + }, + Storage: &hcsschema.StorageStats{ + ReadCountNormalized: uint64(storageInfo.ReadStats.IoCount), + ReadSizeBytes: storageInfo.ReadStats.TotalSize, + WriteCountNormalized: uint64(storageInfo.WriteStats.IoCount), + WriteSizeBytes: storageInfo.WriteStats.TotalSize, + }, + }, nil +} + +// hcsPropertiesV2Query is a helper to make a HcsGetComputeSystemProperties call using the V2 schema property types. +func (computeSystem *System) hcsPropertiesV2Query(ctx context.Context, types []hcsschema.PropertyType) (*hcsschema.Properties, error) { + operation := "hcs::System::PropertiesV2" + + queryBytes, err := json.Marshal(hcsschema.PropertyQuery{PropertyTypes: types}) + if err != nil { + return nil, makeSystemError(computeSystem, operation, err, nil) + } + + propertiesJSON, resultJSON, err := vmcompute.HcsGetComputeSystemProperties(ctx, computeSystem.handle, string(queryBytes)) + events := processHcsResult(ctx, resultJSON) + if err != nil { + return nil, makeSystemError(computeSystem, operation, err, events) + } + + if propertiesJSON == "" { + return nil, ErrUnexpectedValue + } + props := &hcsschema.Properties{} + if err := json.Unmarshal([]byte(propertiesJSON), props); err != nil { + return nil, makeSystemError(computeSystem, operation, err, nil) + } + + return props, nil +} + +// PropertiesV2 returns the requested compute systems properties targeting a V2 schema compute system. +func (computeSystem *System) PropertiesV2(ctx context.Context, types ...hcsschema.PropertyType) (_ *hcsschema.Properties, err error) { + computeSystem.handleLock.RLock() + defer computeSystem.handleLock.RUnlock() + + // Let HCS tally up the total for VM based queries instead of querying ourselves. + if computeSystem.typ != "container" { + return computeSystem.hcsPropertiesV2Query(ctx, types) + } + + // Define a starter Properties struct with the default fields returned from every + // query. Owner is only returned from Statistics but it's harmless to include. + properties := &hcsschema.Properties{ + Id: computeSystem.id, + SystemType: computeSystem.typ, + RuntimeOsType: computeSystem.os, + Owner: computeSystem.owner, + } + + logEntry := log.G(ctx) + // First lets try and query ourselves without reaching to HCS. If any of the queries fail + // we'll take note and fallback to querying HCS for any of the failed types. + fallbackTypes, err := computeSystem.queryInProc(ctx, properties, types) + if err == nil && len(fallbackTypes) == 0 { + return properties, nil + } else if err != nil { + logEntry.WithError(fmt.Errorf("failed to query compute system properties in-proc: %w", err)) + fallbackTypes = types + } + + logEntry.WithFields(logrus.Fields{ + logfields.ContainerID: computeSystem.id, + "propertyTypes": fallbackTypes, + }).Info("falling back to HCS for property type queries") + + hcsProperties, err := computeSystem.hcsPropertiesV2Query(ctx, fallbackTypes) + if err != nil { + return nil, err + } + + // Now add in anything that we might have successfully queried in process. + if properties.Statistics != nil { + hcsProperties.Statistics = properties.Statistics + hcsProperties.Owner = properties.Owner + } + + // For future support for querying processlist in-proc as well. + if properties.ProcessList != nil { + hcsProperties.ProcessList = properties.ProcessList + } + + return hcsProperties, nil +} + +// Pause pauses the execution of the computeSystem. This feature is not enabled in TP5. +func (computeSystem *System) Pause(ctx context.Context) (err error) { + operation := "hcs::System::Pause" + + // hcsPauseComputeSystemContext is an async peration. Start the outer span + // here to measure the full pause time. + ctx, span := trace.StartSpan(ctx, operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + + computeSystem.handleLock.RLock() + defer computeSystem.handleLock.RUnlock() + + if computeSystem.handle == 0 { + return makeSystemError(computeSystem, operation, ErrAlreadyClosed, nil) + } + + resultJSON, err := vmcompute.HcsPauseComputeSystem(ctx, computeSystem.handle, "") + events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemPauseCompleted, &timeout.SystemPause) + if err != nil { + return makeSystemError(computeSystem, operation, err, events) + } + + return nil +} + +// Resume resumes the execution of the computeSystem. This feature is not enabled in TP5. +func (computeSystem *System) Resume(ctx context.Context) (err error) { + operation := "hcs::System::Resume" + + // hcsResumeComputeSystemContext is an async operation. Start the outer span + // here to measure the full restore time. + ctx, span := trace.StartSpan(ctx, operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + + computeSystem.handleLock.RLock() + defer computeSystem.handleLock.RUnlock() + + if computeSystem.handle == 0 { + return makeSystemError(computeSystem, operation, ErrAlreadyClosed, nil) + } + + resultJSON, err := vmcompute.HcsResumeComputeSystem(ctx, computeSystem.handle, "") + events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemResumeCompleted, &timeout.SystemResume) + if err != nil { + return makeSystemError(computeSystem, operation, err, events) + } + + return nil +} + +// Save the compute system +func (computeSystem *System) Save(ctx context.Context, options interface{}) (err error) { + operation := "hcs::System::Save" + + // hcsSaveComputeSystemContext is an async peration. Start the outer span + // here to measure the full save time. + ctx, span := trace.StartSpan(ctx, operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + + saveOptions, err := json.Marshal(options) + if err != nil { + return err + } + + computeSystem.handleLock.RLock() + defer computeSystem.handleLock.RUnlock() + + if computeSystem.handle == 0 { + return makeSystemError(computeSystem, operation, ErrAlreadyClosed, nil) + } + + result, err := vmcompute.HcsSaveComputeSystem(ctx, computeSystem.handle, string(saveOptions)) + events, err := processAsyncHcsResult(ctx, err, result, computeSystem.callbackNumber, hcsNotificationSystemSaveCompleted, &timeout.SystemSave) + if err != nil { + return makeSystemError(computeSystem, operation, err, events) + } + + return nil +} + +func (computeSystem *System) createProcess(ctx context.Context, operation string, c interface{}) (*Process, *vmcompute.HcsProcessInformation, error) { + computeSystem.handleLock.RLock() + defer computeSystem.handleLock.RUnlock() + + if computeSystem.handle == 0 { + return nil, nil, makeSystemError(computeSystem, operation, ErrAlreadyClosed, nil) + } + + configurationb, err := json.Marshal(c) + if err != nil { + return nil, nil, makeSystemError(computeSystem, operation, err, nil) + } + + configuration := string(configurationb) + processInfo, processHandle, resultJSON, err := vmcompute.HcsCreateProcess(ctx, computeSystem.handle, configuration) + events := processHcsResult(ctx, resultJSON) + if err != nil { + return nil, nil, makeSystemError(computeSystem, operation, err, events) + } + + log.G(ctx).WithField("pid", processInfo.ProcessId).Debug("created process pid") + return newProcess(processHandle, int(processInfo.ProcessId), computeSystem), &processInfo, nil +} + +// CreateProcess launches a new process within the computeSystem. +func (computeSystem *System) CreateProcess(ctx context.Context, c interface{}) (cow.Process, error) { + operation := "hcs::System::CreateProcess" + process, processInfo, err := computeSystem.createProcess(ctx, operation, c) + if err != nil { + return nil, err + } + defer func() { + if err != nil { + process.Close() + } + }() + + pipes, err := makeOpenFiles([]syscall.Handle{processInfo.StdInput, processInfo.StdOutput, processInfo.StdError}) + if err != nil { + return nil, makeSystemError(computeSystem, operation, err, nil) + } + process.stdin = pipes[0] + process.stdout = pipes[1] + process.stderr = pipes[2] + process.hasCachedStdio = true + + if err = process.registerCallback(ctx); err != nil { + return nil, makeSystemError(computeSystem, operation, err, nil) + } + go process.waitBackground() + + return process, nil +} + +// OpenProcess gets an interface to an existing process within the computeSystem. +func (computeSystem *System) OpenProcess(ctx context.Context, pid int) (*Process, error) { + computeSystem.handleLock.RLock() + defer computeSystem.handleLock.RUnlock() + + operation := "hcs::System::OpenProcess" + + if computeSystem.handle == 0 { + return nil, makeSystemError(computeSystem, operation, ErrAlreadyClosed, nil) + } + + processHandle, resultJSON, err := vmcompute.HcsOpenProcess(ctx, computeSystem.handle, uint32(pid)) + events := processHcsResult(ctx, resultJSON) + if err != nil { + return nil, makeSystemError(computeSystem, operation, err, events) + } + + process := newProcess(processHandle, pid, computeSystem) + if err = process.registerCallback(ctx); err != nil { + return nil, makeSystemError(computeSystem, operation, err, nil) + } + go process.waitBackground() + + return process, nil +} + +// Close cleans up any state associated with the compute system but does not terminate or wait for it. +func (computeSystem *System) Close() (err error) { + operation := "hcs::System::Close" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + + computeSystem.handleLock.Lock() + defer computeSystem.handleLock.Unlock() + + // Don't double free this + if computeSystem.handle == 0 { + return nil + } + + if err = computeSystem.unregisterCallback(ctx); err != nil { + return makeSystemError(computeSystem, operation, err, nil) + } + + err = vmcompute.HcsCloseComputeSystem(ctx, computeSystem.handle) + if err != nil { + return makeSystemError(computeSystem, operation, err, nil) + } + + computeSystem.handle = 0 + computeSystem.closedWaitOnce.Do(func() { + computeSystem.waitError = ErrAlreadyClosed + close(computeSystem.waitBlock) + }) + + return nil +} + +func (computeSystem *System) registerCallback(ctx context.Context) error { + callbackContext := ¬ificationWatcherContext{ + channels: newSystemChannels(), + systemID: computeSystem.id, + } + + callbackMapLock.Lock() + callbackNumber := nextCallback + nextCallback++ + callbackMap[callbackNumber] = callbackContext + callbackMapLock.Unlock() + + callbackHandle, err := vmcompute.HcsRegisterComputeSystemCallback(ctx, computeSystem.handle, notificationWatcherCallback, callbackNumber) + if err != nil { + return err + } + callbackContext.handle = callbackHandle + computeSystem.callbackNumber = callbackNumber + + return nil +} + +func (computeSystem *System) unregisterCallback(ctx context.Context) error { + callbackNumber := computeSystem.callbackNumber + + callbackMapLock.RLock() + callbackContext := callbackMap[callbackNumber] + callbackMapLock.RUnlock() + + if callbackContext == nil { + return nil + } + + handle := callbackContext.handle + + if handle == 0 { + return nil + } + + // hcsUnregisterComputeSystemCallback has its own syncronization + // to wait for all callbacks to complete. We must NOT hold the callbackMapLock. + err := vmcompute.HcsUnregisterComputeSystemCallback(ctx, handle) + if err != nil { + return err + } + + closeChannels(callbackContext.channels) + + callbackMapLock.Lock() + delete(callbackMap, callbackNumber) + callbackMapLock.Unlock() + + handle = 0 //nolint:ineffassign + + return nil +} + +// Modify the System by sending a request to HCS +func (computeSystem *System) Modify(ctx context.Context, config interface{}) error { + computeSystem.handleLock.RLock() + defer computeSystem.handleLock.RUnlock() + + operation := "hcs::System::Modify" + + if computeSystem.handle == 0 { + return makeSystemError(computeSystem, operation, ErrAlreadyClosed, nil) + } + + requestBytes, err := json.Marshal(config) + if err != nil { + return err + } + + requestJSON := string(requestBytes) + resultJSON, err := vmcompute.HcsModifyComputeSystem(ctx, computeSystem.handle, requestJSON) + events := processHcsResult(ctx, resultJSON) + if err != nil { + return makeSystemError(computeSystem, operation, err, events) + } + + return nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/utils.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/utils.go new file mode 100644 index 000000000..3342e5bb9 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/utils.go @@ -0,0 +1,62 @@ +package hcs + +import ( + "context" + "io" + "syscall" + + "github.com/Microsoft/go-winio" + diskutil "github.com/Microsoft/go-winio/vhd" + "github.com/Microsoft/hcsshim/computestorage" + "github.com/pkg/errors" + "golang.org/x/sys/windows" +) + +// makeOpenFiles calls winio.MakeOpenFile for each handle in a slice but closes all the handles +// if there is an error. +func makeOpenFiles(hs []syscall.Handle) (_ []io.ReadWriteCloser, err error) { + fs := make([]io.ReadWriteCloser, len(hs)) + for i, h := range hs { + if h != syscall.Handle(0) { + if err == nil { + fs[i], err = winio.MakeOpenFile(h) + } + if err != nil { + syscall.Close(h) + } + } + } + if err != nil { + for _, f := range fs { + if f != nil { + f.Close() + } + } + return nil, err + } + return fs, nil +} + +// CreateNTFSVHD creates a VHD formatted with NTFS of size `sizeGB` at the given `vhdPath`. +func CreateNTFSVHD(ctx context.Context, vhdPath string, sizeGB uint32) (err error) { + if err := diskutil.CreateVhdx(vhdPath, sizeGB, 1); err != nil { + return errors.Wrap(err, "failed to create VHD") + } + + vhd, err := diskutil.OpenVirtualDisk(vhdPath, diskutil.VirtualDiskAccessNone, diskutil.OpenVirtualDiskFlagNone) + if err != nil { + return errors.Wrap(err, "failed to open VHD") + } + defer func() { + err2 := windows.CloseHandle(windows.Handle(vhd)) + if err == nil { + err = errors.Wrap(err2, "failed to close VHD") + } + }() + + if err := computestorage.FormatWritableLayerVhd(ctx, windows.Handle(vhd)); err != nil { + return errors.Wrap(err, "failed to format VHD") + } + + return nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go new file mode 100644 index 000000000..db4e14fdf --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go @@ -0,0 +1,68 @@ +package hcs + +import ( + "context" + "time" + + "github.com/Microsoft/hcsshim/internal/log" +) + +func processAsyncHcsResult(ctx context.Context, err error, resultJSON string, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) ([]ErrorEvent, error) { + events := processHcsResult(ctx, resultJSON) + if IsPending(err) { + return nil, waitForNotification(ctx, callbackNumber, expectedNotification, timeout) + } + + return events, err +} + +func waitForNotification(ctx context.Context, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error { + callbackMapLock.RLock() + if _, ok := callbackMap[callbackNumber]; !ok { + callbackMapLock.RUnlock() + log.G(ctx).WithField("callbackNumber", callbackNumber).Error("failed to waitForNotification: callbackNumber does not exist in callbackMap") + return ErrHandleClose + } + channels := callbackMap[callbackNumber].channels + callbackMapLock.RUnlock() + + expectedChannel := channels[expectedNotification] + if expectedChannel == nil { + log.G(ctx).WithField("type", expectedNotification).Error("unknown notification type in waitForNotification") + return ErrInvalidNotificationType + } + + var c <-chan time.Time + if timeout != nil { + timer := time.NewTimer(*timeout) + c = timer.C + defer timer.Stop() + } + + select { + case err, ok := <-expectedChannel: + if !ok { + return ErrHandleClose + } + return err + case err, ok := <-channels[hcsNotificationSystemExited]: + if !ok { + return ErrHandleClose + } + // If the expected notification is hcsNotificationSystemExited which of the two selects + // chosen is random. Return the raw error if hcsNotificationSystemExited is expected + if channels[hcsNotificationSystemExited] == expectedChannel { + return err + } + return ErrUnexpectedContainerExit + case _, ok := <-channels[hcsNotificationServiceDisconnect]: + if !ok { + return ErrHandleClose + } + // hcsNotificationServiceDisconnect should never be an expected notification + // it does not need the same handling as hcsNotificationSystemExited + return ErrUnexpectedProcessAbort + case <-c: + return ErrTimeout + } +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcserror/hcserror.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcserror/hcserror.go new file mode 100644 index 000000000..921c2c855 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hcserror/hcserror.go @@ -0,0 +1,47 @@ +package hcserror + +import ( + "fmt" + "syscall" +) + +const ERROR_GEN_FAILURE = syscall.Errno(31) + +type HcsError struct { + title string + rest string + Err error +} + +func (e *HcsError) Error() string { + s := e.title + if len(s) > 0 && s[len(s)-1] != ' ' { + s += " " + } + s += fmt.Sprintf("failed in Win32: %s (0x%x)", e.Err, Win32FromError(e.Err)) + if e.rest != "" { + if e.rest[0] != ' ' { + s += " " + } + s += e.rest + } + return s +} + +func New(err error, title, rest string) error { + // Pass through DLL errors directly since they do not originate from HCS. + if _, ok := err.(*syscall.DLLError); ok { + return err + } + return &HcsError{title, rest, err} +} + +func Win32FromError(err error) uint32 { + if herr, ok := err.(*HcsError); ok { + return Win32FromError(herr.Err) + } + if code, ok := err.(syscall.Errno); ok { + return uint32(code) + } + return uint32(ERROR_GEN_FAILURE) +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hns/hns.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hns/hns.go new file mode 100644 index 000000000..b2e475f53 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hns/hns.go @@ -0,0 +1,23 @@ +package hns + +import "fmt" + +//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hns.go + +//sys _hnsCall(method string, path string, object string, response **uint16) (hr error) = vmcompute.HNSCall? + +type EndpointNotFoundError struct { + EndpointName string +} + +func (e EndpointNotFoundError) Error() string { + return fmt.Sprintf("Endpoint %s not found", e.EndpointName) +} + +type NetworkNotFoundError struct { + NetworkName string +} + +func (e NetworkNotFoundError) Error() string { + return fmt.Sprintf("Network %s not found", e.NetworkName) +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go new file mode 100644 index 000000000..7cf954c7b --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go @@ -0,0 +1,338 @@ +package hns + +import ( + "encoding/json" + "net" + "strings" + + "github.com/sirupsen/logrus" +) + +// HNSEndpoint represents a network endpoint in HNS +type HNSEndpoint struct { + Id string `json:"ID,omitempty"` + Name string `json:",omitempty"` + VirtualNetwork string `json:",omitempty"` + VirtualNetworkName string `json:",omitempty"` + Policies []json.RawMessage `json:",omitempty"` + MacAddress string `json:",omitempty"` + IPAddress net.IP `json:",omitempty"` + IPv6Address net.IP `json:",omitempty"` + DNSSuffix string `json:",omitempty"` + DNSServerList string `json:",omitempty"` + DNSDomain string `json:",omitempty"` + GatewayAddress string `json:",omitempty"` + GatewayAddressV6 string `json:",omitempty"` + EnableInternalDNS bool `json:",omitempty"` + DisableICC bool `json:",omitempty"` + PrefixLength uint8 `json:",omitempty"` + IPv6PrefixLength uint8 `json:",omitempty"` + IsRemoteEndpoint bool `json:",omitempty"` + EnableLowMetric bool `json:",omitempty"` + Namespace *Namespace `json:",omitempty"` + EncapOverhead uint16 `json:",omitempty"` + SharedContainers []string `json:",omitempty"` +} + +//SystemType represents the type of the system on which actions are done +type SystemType string + +// SystemType const +const ( + ContainerType SystemType = "Container" + VirtualMachineType SystemType = "VirtualMachine" + HostType SystemType = "Host" +) + +// EndpointAttachDetachRequest is the structure used to send request to the container to modify the system +// Supported resource types are Network and Request Types are Add/Remove +type EndpointAttachDetachRequest struct { + ContainerID string `json:"ContainerId,omitempty"` + SystemType SystemType `json:"SystemType"` + CompartmentID uint16 `json:"CompartmentId,omitempty"` + VirtualNICName string `json:"VirtualNicName,omitempty"` +} + +// EndpointResquestResponse is object to get the endpoint request response +type EndpointResquestResponse struct { + Success bool + Error string +} + +// EndpointStats is the object that has stats for a given endpoint +type EndpointStats struct { + BytesReceived uint64 `json:"BytesReceived"` + BytesSent uint64 `json:"BytesSent"` + DroppedPacketsIncoming uint64 `json:"DroppedPacketsIncoming"` + DroppedPacketsOutgoing uint64 `json:"DroppedPacketsOutgoing"` + EndpointID string `json:"EndpointId"` + InstanceID string `json:"InstanceId"` + PacketsReceived uint64 `json:"PacketsReceived"` + PacketsSent uint64 `json:"PacketsSent"` +} + +// HNSEndpointRequest makes a HNS call to modify/query a network endpoint +func HNSEndpointRequest(method, path, request string) (*HNSEndpoint, error) { + endpoint := &HNSEndpoint{} + err := hnsCall(method, "/endpoints/"+path, request, &endpoint) + if err != nil { + return nil, err + } + + return endpoint, nil +} + +// HNSListEndpointRequest makes a HNS call to query the list of available endpoints +func HNSListEndpointRequest() ([]HNSEndpoint, error) { + var endpoint []HNSEndpoint + err := hnsCall("GET", "/endpoints/", "", &endpoint) + if err != nil { + return nil, err + } + + return endpoint, nil +} + +// hnsEndpointStatsRequest makes a HNS call to query the stats for a given endpoint ID +func hnsEndpointStatsRequest(id string) (*EndpointStats, error) { + var stats EndpointStats + err := hnsCall("GET", "/endpointstats/"+id, "", &stats) + if err != nil { + return nil, err + } + + return &stats, nil +} + +// GetHNSEndpointByID get the Endpoint by ID +func GetHNSEndpointByID(endpointID string) (*HNSEndpoint, error) { + return HNSEndpointRequest("GET", endpointID, "") +} + +// GetHNSEndpointStats get the stats for a n Endpoint by ID +func GetHNSEndpointStats(endpointID string) (*EndpointStats, error) { + return hnsEndpointStatsRequest(endpointID) +} + +// GetHNSEndpointByName gets the endpoint filtered by Name +func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) { + hnsResponse, err := HNSListEndpointRequest() + if err != nil { + return nil, err + } + for _, hnsEndpoint := range hnsResponse { + if hnsEndpoint.Name == endpointName { + return &hnsEndpoint, nil + } + } + return nil, EndpointNotFoundError{EndpointName: endpointName} +} + +type endpointAttachInfo struct { + SharedContainers json.RawMessage `json:",omitempty"` +} + +func (endpoint *HNSEndpoint) IsAttached(vID string) (bool, error) { + attachInfo := endpointAttachInfo{} + err := hnsCall("GET", "/endpoints/"+endpoint.Id, "", &attachInfo) + + // Return false allows us to just return the err + if err != nil { + return false, err + } + + if strings.Contains(strings.ToLower(string(attachInfo.SharedContainers)), strings.ToLower(vID)) { + return true, nil + } + + return false, nil + +} + +// Create Endpoint by sending EndpointRequest to HNS. TODO: Create a separate HNS interface to place all these methods +func (endpoint *HNSEndpoint) Create() (*HNSEndpoint, error) { + operation := "Create" + title := "hcsshim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + + jsonString, err := json.Marshal(endpoint) + if err != nil { + return nil, err + } + return HNSEndpointRequest("POST", "", string(jsonString)) +} + +// Delete Endpoint by sending EndpointRequest to HNS +func (endpoint *HNSEndpoint) Delete() (*HNSEndpoint, error) { + operation := "Delete" + title := "hcsshim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + + return HNSEndpointRequest("DELETE", endpoint.Id, "") +} + +// Update Endpoint +func (endpoint *HNSEndpoint) Update() (*HNSEndpoint, error) { + operation := "Update" + title := "hcsshim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + jsonString, err := json.Marshal(endpoint) + if err != nil { + return nil, err + } + err = hnsCall("POST", "/endpoints/"+endpoint.Id, string(jsonString), &endpoint) + + return endpoint, err +} + +// ApplyACLPolicy applies a set of ACL Policies on the Endpoint +func (endpoint *HNSEndpoint) ApplyACLPolicy(policies ...*ACLPolicy) error { + operation := "ApplyACLPolicy" + title := "hcsshim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + + for _, policy := range policies { + if policy == nil { + continue + } + jsonString, err := json.Marshal(policy) + if err != nil { + return err + } + endpoint.Policies = append(endpoint.Policies, jsonString) + } + + _, err := endpoint.Update() + return err +} + +// ApplyProxyPolicy applies a set of Proxy Policies on the Endpoint +func (endpoint *HNSEndpoint) ApplyProxyPolicy(policies ...*ProxyPolicy) error { + operation := "ApplyProxyPolicy" + title := "hcsshim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + + for _, policy := range policies { + if policy == nil { + continue + } + jsonString, err := json.Marshal(policy) + if err != nil { + return err + } + endpoint.Policies = append(endpoint.Policies, jsonString) + } + + _, err := endpoint.Update() + return err +} + +// ContainerAttach attaches an endpoint to container +func (endpoint *HNSEndpoint) ContainerAttach(containerID string, compartmentID uint16) error { + operation := "ContainerAttach" + title := "hcsshim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + + requestMessage := &EndpointAttachDetachRequest{ + ContainerID: containerID, + CompartmentID: compartmentID, + SystemType: ContainerType, + } + response := &EndpointResquestResponse{} + jsonString, err := json.Marshal(requestMessage) + if err != nil { + return err + } + return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response) +} + +// ContainerDetach detaches an endpoint from container +func (endpoint *HNSEndpoint) ContainerDetach(containerID string) error { + operation := "ContainerDetach" + title := "hcsshim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + + requestMessage := &EndpointAttachDetachRequest{ + ContainerID: containerID, + SystemType: ContainerType, + } + response := &EndpointResquestResponse{} + + jsonString, err := json.Marshal(requestMessage) + if err != nil { + return err + } + return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response) +} + +// HostAttach attaches a nic on the host +func (endpoint *HNSEndpoint) HostAttach(compartmentID uint16) error { + operation := "HostAttach" + title := "hcsshim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + requestMessage := &EndpointAttachDetachRequest{ + CompartmentID: compartmentID, + SystemType: HostType, + } + response := &EndpointResquestResponse{} + + jsonString, err := json.Marshal(requestMessage) + if err != nil { + return err + } + return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response) + +} + +// HostDetach detaches a nic on the host +func (endpoint *HNSEndpoint) HostDetach() error { + operation := "HostDetach" + title := "hcsshim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + requestMessage := &EndpointAttachDetachRequest{ + SystemType: HostType, + } + response := &EndpointResquestResponse{} + + jsonString, err := json.Marshal(requestMessage) + if err != nil { + return err + } + return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response) +} + +// VirtualMachineNICAttach attaches a endpoint to a virtual machine +func (endpoint *HNSEndpoint) VirtualMachineNICAttach(virtualMachineNICName string) error { + operation := "VirtualMachineNicAttach" + title := "hcsshim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + requestMessage := &EndpointAttachDetachRequest{ + VirtualNICName: virtualMachineNICName, + SystemType: VirtualMachineType, + } + response := &EndpointResquestResponse{} + + jsonString, err := json.Marshal(requestMessage) + if err != nil { + return err + } + return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response) +} + +// VirtualMachineNICDetach detaches a endpoint from a virtual machine +func (endpoint *HNSEndpoint) VirtualMachineNICDetach() error { + operation := "VirtualMachineNicDetach" + title := "hcsshim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + + requestMessage := &EndpointAttachDetachRequest{ + SystemType: VirtualMachineType, + } + response := &EndpointResquestResponse{} + + jsonString, err := json.Marshal(requestMessage) + if err != nil { + return err + } + return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response) +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go new file mode 100644 index 000000000..2df4a57f5 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go @@ -0,0 +1,49 @@ +package hns + +import ( + "encoding/json" + "fmt" + + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/Microsoft/hcsshim/internal/interop" + "github.com/sirupsen/logrus" +) + +func hnsCallRawResponse(method, path, request string) (*hnsResponse, error) { + var responseBuffer *uint16 + logrus.Debugf("[%s]=>[%s] Request : %s", method, path, request) + + err := _hnsCall(method, path, request, &responseBuffer) + if err != nil { + return nil, hcserror.New(err, "hnsCall ", "") + } + response := interop.ConvertAndFreeCoTaskMemString(responseBuffer) + + hnsresponse := &hnsResponse{} + if err = json.Unmarshal([]byte(response), &hnsresponse); err != nil { + return nil, err + } + return hnsresponse, nil +} + +func hnsCall(method, path, request string, returnResponse interface{}) error { + hnsresponse, err := hnsCallRawResponse(method, path, request) + if err != nil { + return fmt.Errorf("failed during hnsCallRawResponse: %v", err) + } + if !hnsresponse.Success { + return fmt.Errorf("hns failed with error : %s", hnsresponse.Error) + } + + if len(hnsresponse.Output) == 0 { + return nil + } + + logrus.Debugf("Network Response : %s", hnsresponse.Output) + err = json.Unmarshal(hnsresponse.Output, returnResponse) + if err != nil { + return err + } + + return nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsglobals.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsglobals.go new file mode 100644 index 000000000..a8d8cc56a --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsglobals.go @@ -0,0 +1,28 @@ +package hns + +type HNSGlobals struct { + Version HNSVersion `json:"Version"` +} + +type HNSVersion struct { + Major int `json:"Major"` + Minor int `json:"Minor"` +} + +var ( + HNSVersion1803 = HNSVersion{Major: 7, Minor: 2} +) + +func GetHNSGlobals() (*HNSGlobals, error) { + var version HNSVersion + err := hnsCall("GET", "/globals/version", "", &version) + if err != nil { + return nil, err + } + + globals := &HNSGlobals{ + Version: version, + } + + return globals, nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go new file mode 100644 index 000000000..f12d3ab04 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go @@ -0,0 +1,141 @@ +package hns + +import ( + "encoding/json" + "errors" + "github.com/sirupsen/logrus" + "net" +) + +// Subnet is assoicated with a network and represents a list +// of subnets available to the network +type Subnet struct { + AddressPrefix string `json:",omitempty"` + GatewayAddress string `json:",omitempty"` + Policies []json.RawMessage `json:",omitempty"` +} + +// MacPool is assoicated with a network and represents a list +// of macaddresses available to the network +type MacPool struct { + StartMacAddress string `json:",omitempty"` + EndMacAddress string `json:",omitempty"` +} + +// HNSNetwork represents a network in HNS +type HNSNetwork struct { + Id string `json:"ID,omitempty"` + Name string `json:",omitempty"` + Type string `json:",omitempty"` + NetworkAdapterName string `json:",omitempty"` + SourceMac string `json:",omitempty"` + Policies []json.RawMessage `json:",omitempty"` + MacPools []MacPool `json:",omitempty"` + Subnets []Subnet `json:",omitempty"` + DNSSuffix string `json:",omitempty"` + DNSServerList string `json:",omitempty"` + DNSServerCompartment uint32 `json:",omitempty"` + ManagementIP string `json:",omitempty"` + AutomaticDNS bool `json:",omitempty"` +} + +type hnsResponse struct { + Success bool + Error string + Output json.RawMessage +} + +// HNSNetworkRequest makes a call into HNS to update/query a single network +func HNSNetworkRequest(method, path, request string) (*HNSNetwork, error) { + var network HNSNetwork + err := hnsCall(method, "/networks/"+path, request, &network) + if err != nil { + return nil, err + } + + return &network, nil +} + +// HNSListNetworkRequest makes a HNS call to query the list of available networks +func HNSListNetworkRequest(method, path, request string) ([]HNSNetwork, error) { + var network []HNSNetwork + err := hnsCall(method, "/networks/"+path, request, &network) + if err != nil { + return nil, err + } + + return network, nil +} + +// GetHNSNetworkByID +func GetHNSNetworkByID(networkID string) (*HNSNetwork, error) { + return HNSNetworkRequest("GET", networkID, "") +} + +// GetHNSNetworkName filtered by Name +func GetHNSNetworkByName(networkName string) (*HNSNetwork, error) { + hsnnetworks, err := HNSListNetworkRequest("GET", "", "") + if err != nil { + return nil, err + } + for _, hnsnetwork := range hsnnetworks { + if hnsnetwork.Name == networkName { + return &hnsnetwork, nil + } + } + return nil, NetworkNotFoundError{NetworkName: networkName} +} + +// Create Network by sending NetworkRequest to HNS. +func (network *HNSNetwork) Create() (*HNSNetwork, error) { + operation := "Create" + title := "hcsshim::HNSNetwork::" + operation + logrus.Debugf(title+" id=%s", network.Id) + + for _, subnet := range network.Subnets { + if (subnet.AddressPrefix != "") && (subnet.GatewayAddress == "") { + return nil, errors.New("network create error, subnet has address prefix but no gateway specified") + } + } + + jsonString, err := json.Marshal(network) + if err != nil { + return nil, err + } + return HNSNetworkRequest("POST", "", string(jsonString)) +} + +// Delete Network by sending NetworkRequest to HNS +func (network *HNSNetwork) Delete() (*HNSNetwork, error) { + operation := "Delete" + title := "hcsshim::HNSNetwork::" + operation + logrus.Debugf(title+" id=%s", network.Id) + + return HNSNetworkRequest("DELETE", network.Id, "") +} + +// Creates an endpoint on the Network. +func (network *HNSNetwork) NewEndpoint(ipAddress net.IP, macAddress net.HardwareAddr) *HNSEndpoint { + return &HNSEndpoint{ + VirtualNetwork: network.Id, + IPAddress: ipAddress, + MacAddress: string(macAddress), + } +} + +func (network *HNSNetwork) CreateEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) { + operation := "CreateEndpoint" + title := "hcsshim::HNSNetwork::" + operation + logrus.Debugf(title+" id=%s, endpointId=%s", network.Id, endpoint.Id) + + endpoint.VirtualNetwork = network.Id + return endpoint.Create() +} + +func (network *HNSNetwork) CreateRemoteEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) { + operation := "CreateRemoteEndpoint" + title := "hcsshim::HNSNetwork::" + operation + logrus.Debugf(title+" id=%s", network.Id) + endpoint.IsRemoteEndpoint = true + return network.CreateEndpoint(endpoint) +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go new file mode 100644 index 000000000..84b368218 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go @@ -0,0 +1,110 @@ +package hns + +// Type of Request Support in ModifySystem +type PolicyType string + +// RequestType const +const ( + Nat PolicyType = "NAT" + ACL PolicyType = "ACL" + PA PolicyType = "PA" + VLAN PolicyType = "VLAN" + VSID PolicyType = "VSID" + VNet PolicyType = "VNET" + L2Driver PolicyType = "L2Driver" + Isolation PolicyType = "Isolation" + QOS PolicyType = "QOS" + OutboundNat PolicyType = "OutBoundNAT" + ExternalLoadBalancer PolicyType = "ELB" + Route PolicyType = "ROUTE" + Proxy PolicyType = "PROXY" +) + +type NatPolicy struct { + Type PolicyType `json:"Type"` + Protocol string `json:",omitempty"` + InternalPort uint16 `json:",omitempty"` + ExternalPort uint16 `json:",omitempty"` + ExternalPortReserved bool `json:",omitempty"` +} + +type QosPolicy struct { + Type PolicyType `json:"Type"` + MaximumOutgoingBandwidthInBytes uint64 +} + +type IsolationPolicy struct { + Type PolicyType `json:"Type"` + VLAN uint + VSID uint + InDefaultIsolation bool +} + +type VlanPolicy struct { + Type PolicyType `json:"Type"` + VLAN uint +} + +type VsidPolicy struct { + Type PolicyType `json:"Type"` + VSID uint +} + +type PaPolicy struct { + Type PolicyType `json:"Type"` + PA string `json:"PA"` +} + +type OutboundNatPolicy struct { + Policy + VIP string `json:"VIP,omitempty"` + Exceptions []string `json:"ExceptionList,omitempty"` + Destinations []string `json:",omitempty"` +} + +type ProxyPolicy struct { + Type PolicyType `json:"Type"` + IP string `json:",omitempty"` + Port string `json:",omitempty"` + ExceptionList []string `json:",omitempty"` + Destination string `json:",omitempty"` + OutboundNat bool `json:",omitempty"` +} + +type ActionType string +type DirectionType string +type RuleType string + +const ( + Allow ActionType = "Allow" + Block ActionType = "Block" + + In DirectionType = "In" + Out DirectionType = "Out" + + Host RuleType = "Host" + Switch RuleType = "Switch" +) + +type ACLPolicy struct { + Type PolicyType `json:"Type"` + Id string `json:"Id,omitempty"` + Protocol uint16 `json:",omitempty"` + Protocols string `json:"Protocols,omitempty"` + InternalPort uint16 `json:",omitempty"` + Action ActionType + Direction DirectionType + LocalAddresses string `json:",omitempty"` + RemoteAddresses string `json:",omitempty"` + LocalPorts string `json:"LocalPorts,omitempty"` + LocalPort uint16 `json:",omitempty"` + RemotePorts string `json:"RemotePorts,omitempty"` + RemotePort uint16 `json:",omitempty"` + RuleType RuleType `json:"RuleType,omitempty"` + Priority uint16 `json:",omitempty"` + ServiceName string `json:",omitempty"` +} + +type Policy struct { + Type PolicyType `json:"Type"` +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicylist.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicylist.go new file mode 100644 index 000000000..31322a681 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicylist.go @@ -0,0 +1,201 @@ +package hns + +import ( + "encoding/json" + + "github.com/sirupsen/logrus" +) + +// RoutePolicy is a structure defining schema for Route based Policy +type RoutePolicy struct { + Policy + DestinationPrefix string `json:"DestinationPrefix,omitempty"` + NextHop string `json:"NextHop,omitempty"` + EncapEnabled bool `json:"NeedEncap,omitempty"` +} + +// ELBPolicy is a structure defining schema for ELB LoadBalancing based Policy +type ELBPolicy struct { + LBPolicy + SourceVIP string `json:"SourceVIP,omitempty"` + VIPs []string `json:"VIPs,omitempty"` + ILB bool `json:"ILB,omitempty"` + DSR bool `json:"IsDSR,omitempty"` +} + +// LBPolicy is a structure defining schema for LoadBalancing based Policy +type LBPolicy struct { + Policy + Protocol uint16 `json:"Protocol,omitempty"` + InternalPort uint16 + ExternalPort uint16 +} + +// PolicyList is a structure defining schema for Policy list request +type PolicyList struct { + ID string `json:"ID,omitempty"` + EndpointReferences []string `json:"References,omitempty"` + Policies []json.RawMessage `json:"Policies,omitempty"` +} + +// HNSPolicyListRequest makes a call into HNS to update/query a single network +func HNSPolicyListRequest(method, path, request string) (*PolicyList, error) { + var policy PolicyList + err := hnsCall(method, "/policylists/"+path, request, &policy) + if err != nil { + return nil, err + } + + return &policy, nil +} + +// HNSListPolicyListRequest gets all the policy list +func HNSListPolicyListRequest() ([]PolicyList, error) { + var plist []PolicyList + err := hnsCall("GET", "/policylists/", "", &plist) + if err != nil { + return nil, err + } + + return plist, nil +} + +// PolicyListRequest makes a HNS call to modify/query a network policy list +func PolicyListRequest(method, path, request string) (*PolicyList, error) { + policylist := &PolicyList{} + err := hnsCall(method, "/policylists/"+path, request, &policylist) + if err != nil { + return nil, err + } + + return policylist, nil +} + +// GetPolicyListByID get the policy list by ID +func GetPolicyListByID(policyListID string) (*PolicyList, error) { + return PolicyListRequest("GET", policyListID, "") +} + +// Create PolicyList by sending PolicyListRequest to HNS. +func (policylist *PolicyList) Create() (*PolicyList, error) { + operation := "Create" + title := "hcsshim::PolicyList::" + operation + logrus.Debugf(title+" id=%s", policylist.ID) + jsonString, err := json.Marshal(policylist) + if err != nil { + return nil, err + } + return PolicyListRequest("POST", "", string(jsonString)) +} + +// Delete deletes PolicyList +func (policylist *PolicyList) Delete() (*PolicyList, error) { + operation := "Delete" + title := "hcsshim::PolicyList::" + operation + logrus.Debugf(title+" id=%s", policylist.ID) + + return PolicyListRequest("DELETE", policylist.ID, "") +} + +// AddEndpoint add an endpoint to a Policy List +func (policylist *PolicyList) AddEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) { + operation := "AddEndpoint" + title := "hcsshim::PolicyList::" + operation + logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id) + + _, err := policylist.Delete() + if err != nil { + return nil, err + } + + // Add Endpoint to the Existing List + policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id) + + return policylist.Create() +} + +// RemoveEndpoint removes an endpoint from the Policy List +func (policylist *PolicyList) RemoveEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) { + operation := "RemoveEndpoint" + title := "hcsshim::PolicyList::" + operation + logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id) + + _, err := policylist.Delete() + if err != nil { + return nil, err + } + + elementToRemove := "/endpoints/" + endpoint.Id + + var references []string + + for _, endpointReference := range policylist.EndpointReferences { + if endpointReference == elementToRemove { + continue + } + references = append(references, endpointReference) + } + policylist.EndpointReferences = references + return policylist.Create() +} + +// AddLoadBalancer policy list for the specified endpoints +func AddLoadBalancer(endpoints []HNSEndpoint, isILB bool, sourceVIP, vip string, protocol uint16, internalPort uint16, externalPort uint16) (*PolicyList, error) { + operation := "AddLoadBalancer" + title := "hcsshim::PolicyList::" + operation + logrus.Debugf(title+" endpointId=%v, isILB=%v, sourceVIP=%s, vip=%s, protocol=%v, internalPort=%v, externalPort=%v", endpoints, isILB, sourceVIP, vip, protocol, internalPort, externalPort) + + policylist := &PolicyList{} + + elbPolicy := &ELBPolicy{ + SourceVIP: sourceVIP, + ILB: isILB, + } + + if len(vip) > 0 { + elbPolicy.VIPs = []string{vip} + } + elbPolicy.Type = ExternalLoadBalancer + elbPolicy.Protocol = protocol + elbPolicy.InternalPort = internalPort + elbPolicy.ExternalPort = externalPort + + for _, endpoint := range endpoints { + policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id) + } + + jsonString, err := json.Marshal(elbPolicy) + if err != nil { + return nil, err + } + policylist.Policies = append(policylist.Policies, jsonString) + return policylist.Create() +} + +// AddRoute adds route policy list for the specified endpoints +func AddRoute(endpoints []HNSEndpoint, destinationPrefix string, nextHop string, encapEnabled bool) (*PolicyList, error) { + operation := "AddRoute" + title := "hcsshim::PolicyList::" + operation + logrus.Debugf(title+" destinationPrefix:%s", destinationPrefix) + + policylist := &PolicyList{} + + rPolicy := &RoutePolicy{ + DestinationPrefix: destinationPrefix, + NextHop: nextHop, + EncapEnabled: encapEnabled, + } + rPolicy.Type = Route + + for _, endpoint := range endpoints { + policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id) + } + + jsonString, err := json.Marshal(rPolicy) + if err != nil { + return nil, err + } + + policylist.Policies = append(policylist.Policies, jsonString) + return policylist.Create() +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hns/hnssupport.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hns/hnssupport.go new file mode 100644 index 000000000..d5efba7f2 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hns/hnssupport.go @@ -0,0 +1,49 @@ +package hns + +import ( + "github.com/sirupsen/logrus" +) + +type HNSSupportedFeatures struct { + Acl HNSAclFeatures `json:"ACL"` +} + +type HNSAclFeatures struct { + AclAddressLists bool `json:"AclAddressLists"` + AclNoHostRulePriority bool `json:"AclHostRulePriority"` + AclPortRanges bool `json:"AclPortRanges"` + AclRuleId bool `json:"AclRuleId"` +} + +func GetHNSSupportedFeatures() HNSSupportedFeatures { + var hnsFeatures HNSSupportedFeatures + + globals, err := GetHNSGlobals() + if err != nil { + // Expected on pre-1803 builds, all features will be false/unsupported + logrus.Debugf("Unable to obtain HNS globals: %s", err) + return hnsFeatures + } + + hnsFeatures.Acl = HNSAclFeatures{ + AclAddressLists: isHNSFeatureSupported(globals.Version, HNSVersion1803), + AclNoHostRulePriority: isHNSFeatureSupported(globals.Version, HNSVersion1803), + AclPortRanges: isHNSFeatureSupported(globals.Version, HNSVersion1803), + AclRuleId: isHNSFeatureSupported(globals.Version, HNSVersion1803), + } + + return hnsFeatures +} + +func isHNSFeatureSupported(currentVersion HNSVersion, minVersionSupported HNSVersion) bool { + if currentVersion.Major < minVersionSupported.Major { + return false + } + if currentVersion.Major > minVersionSupported.Major { + return true + } + if currentVersion.Minor < minVersionSupported.Minor { + return false + } + return true +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hns/namespace.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hns/namespace.go new file mode 100644 index 000000000..d3b04eefe --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hns/namespace.go @@ -0,0 +1,111 @@ +package hns + +import ( + "encoding/json" + "fmt" + "os" + "path" + "strings" +) + +type namespaceRequest struct { + IsDefault bool `json:",omitempty"` +} + +type namespaceEndpointRequest struct { + ID string `json:"Id"` +} + +type NamespaceResource struct { + Type string + Data json.RawMessage +} + +type namespaceResourceRequest struct { + Type string + Data interface{} +} + +type Namespace struct { + ID string + IsDefault bool `json:",omitempty"` + ResourceList []NamespaceResource `json:",omitempty"` + CompartmentId uint32 `json:",omitempty"` +} + +func issueNamespaceRequest(id *string, method, subpath string, request interface{}) (*Namespace, error) { + var err error + hnspath := "/namespaces/" + if id != nil { + hnspath = path.Join(hnspath, *id) + } + if subpath != "" { + hnspath = path.Join(hnspath, subpath) + } + var reqJSON []byte + if request != nil { + if reqJSON, err = json.Marshal(request); err != nil { + return nil, err + } + } + var ns Namespace + err = hnsCall(method, hnspath, string(reqJSON), &ns) + if err != nil { + if strings.Contains(err.Error(), "Element not found.") { + return nil, os.ErrNotExist + } + return nil, fmt.Errorf("%s %s: %s", method, hnspath, err) + } + return &ns, err +} + +func CreateNamespace() (string, error) { + req := namespaceRequest{} + ns, err := issueNamespaceRequest(nil, "POST", "", &req) + if err != nil { + return "", err + } + return ns.ID, nil +} + +func RemoveNamespace(id string) error { + _, err := issueNamespaceRequest(&id, "DELETE", "", nil) + return err +} + +func GetNamespaceEndpoints(id string) ([]string, error) { + ns, err := issueNamespaceRequest(&id, "GET", "", nil) + if err != nil { + return nil, err + } + var endpoints []string + for _, rsrc := range ns.ResourceList { + if rsrc.Type == "Endpoint" { + var endpoint namespaceEndpointRequest + err = json.Unmarshal(rsrc.Data, &endpoint) + if err != nil { + return nil, fmt.Errorf("unmarshal endpoint: %s", err) + } + endpoints = append(endpoints, endpoint.ID) + } + } + return endpoints, nil +} + +func AddNamespaceEndpoint(id string, endpointID string) error { + resource := namespaceResourceRequest{ + Type: "Endpoint", + Data: namespaceEndpointRequest{endpointID}, + } + _, err := issueNamespaceRequest(&id, "POST", "addresource", &resource) + return err +} + +func RemoveNamespaceEndpoint(id string, endpointID string) error { + resource := namespaceResourceRequest{ + Type: "Endpoint", + Data: namespaceEndpointRequest{endpointID}, + } + _, err := issueNamespaceRequest(&id, "POST", "removeresource", &resource) + return err +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hns/zsyscall_windows.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hns/zsyscall_windows.go new file mode 100644 index 000000000..204633a48 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/hns/zsyscall_windows.go @@ -0,0 +1,76 @@ +// Code generated mksyscall_windows.exe DO NOT EDIT + +package hns + +import ( + "syscall" + "unsafe" + + "golang.org/x/sys/windows" +) + +var _ unsafe.Pointer + +// Do the interface allocations only once for common +// Errno values. +const ( + errnoERROR_IO_PENDING = 997 +) + +var ( + errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) +) + +// errnoErr returns common boxed Errno values, to prevent +// allocations at runtime. +func errnoErr(e syscall.Errno) error { + switch e { + case 0: + return nil + case errnoERROR_IO_PENDING: + return errERROR_IO_PENDING + } + // TODO: add more here, after collecting data on the common + // error values see on Windows. (perhaps when running + // all.bat?) + return e +} + +var ( + modvmcompute = windows.NewLazySystemDLL("vmcompute.dll") + + procHNSCall = modvmcompute.NewProc("HNSCall") +) + +func _hnsCall(method string, path string, object string, response **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(method) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(path) + if hr != nil { + return + } + var _p2 *uint16 + _p2, hr = syscall.UTF16PtrFromString(object) + if hr != nil { + return + } + return __hnsCall(_p0, _p1, _p2, response) +} + +func __hnsCall(method *uint16, path *uint16, object *uint16, response **uint16) (hr error) { + if hr = procHNSCall.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHNSCall.Addr(), 4, uintptr(unsafe.Pointer(method)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(object)), uintptr(unsafe.Pointer(response)), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go new file mode 100644 index 000000000..922f7c679 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go @@ -0,0 +1,23 @@ +package interop + +import ( + "syscall" + "unsafe" +) + +//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go interop.go + +//sys coTaskMemFree(buffer unsafe.Pointer) = api_ms_win_core_com_l1_1_0.CoTaskMemFree + +func ConvertAndFreeCoTaskMemString(buffer *uint16) string { + str := syscall.UTF16ToString((*[1 << 29]uint16)(unsafe.Pointer(buffer))[:]) + coTaskMemFree(unsafe.Pointer(buffer)) + return str +} + +func Win32FromHresult(hr uintptr) syscall.Errno { + if hr&0x1fff0000 == 0x00070000 { + return syscall.Errno(hr & 0xffff) + } + return syscall.Errno(hr) +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/interop/zsyscall_windows.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/interop/zsyscall_windows.go new file mode 100644 index 000000000..12b0c71c5 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/interop/zsyscall_windows.go @@ -0,0 +1,48 @@ +// Code generated mksyscall_windows.exe DO NOT EDIT + +package interop + +import ( + "syscall" + "unsafe" + + "golang.org/x/sys/windows" +) + +var _ unsafe.Pointer + +// Do the interface allocations only once for common +// Errno values. +const ( + errnoERROR_IO_PENDING = 997 +) + +var ( + errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) +) + +// errnoErr returns common boxed Errno values, to prevent +// allocations at runtime. +func errnoErr(e syscall.Errno) error { + switch e { + case 0: + return nil + case errnoERROR_IO_PENDING: + return errERROR_IO_PENDING + } + // TODO: add more here, after collecting data on the common + // error values see on Windows. (perhaps when running + // all.bat?) + return e +} + +var ( + modapi_ms_win_core_com_l1_1_0 = windows.NewLazySystemDLL("api-ms-win-core-com-l1-1-0.dll") + + procCoTaskMemFree = modapi_ms_win_core_com_l1_1_0.NewProc("CoTaskMemFree") +) + +func coTaskMemFree(buffer unsafe.Pointer) { + syscall.Syscall(procCoTaskMemFree.Addr(), 1, uintptr(buffer), 0, 0) + return +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/jobobject/iocp.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/jobobject/iocp.go new file mode 100644 index 000000000..5d6acd69e --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/jobobject/iocp.go @@ -0,0 +1,111 @@ +package jobobject + +import ( + "context" + "fmt" + "sync" + "unsafe" + + "github.com/Microsoft/hcsshim/internal/log" + "github.com/Microsoft/hcsshim/internal/queue" + "github.com/Microsoft/hcsshim/internal/winapi" + "github.com/sirupsen/logrus" + "golang.org/x/sys/windows" +) + +var ( + ioInitOnce sync.Once + initIOErr error + // Global iocp handle that will be re-used for every job object + ioCompletionPort windows.Handle + // Mapping of job handle to queue to place notifications in. + jobMap sync.Map +) + +// MsgAllProcessesExited is a type representing a message that every process in a job has exited. +type MsgAllProcessesExited struct{} + +// MsgUnimplemented represents a message that we are aware of, but that isn't implemented currently. +// This should not be treated as an error. +type MsgUnimplemented struct{} + +// pollIOCP polls the io completion port forever. +func pollIOCP(ctx context.Context, iocpHandle windows.Handle) { + var ( + overlapped uintptr + code uint32 + key uintptr + ) + + for { + err := windows.GetQueuedCompletionStatus(iocpHandle, &code, &key, (**windows.Overlapped)(unsafe.Pointer(&overlapped)), windows.INFINITE) + if err != nil { + log.G(ctx).WithError(err).Error("failed to poll for job object message") + continue + } + if val, ok := jobMap.Load(key); ok { + msq, ok := val.(*queue.MessageQueue) + if !ok { + log.G(ctx).WithField("value", msq).Warn("encountered non queue type in job map") + continue + } + notification, err := parseMessage(code, overlapped) + if err != nil { + log.G(ctx).WithFields(logrus.Fields{ + "code": code, + "overlapped": overlapped, + }).Warn("failed to parse job object message") + continue + } + if err := msq.Enqueue(notification); err == queue.ErrQueueClosed { + // Write will only return an error when the queue is closed. + // The only time a queue would ever be closed is when we call `Close` on + // the job it belongs to which also removes it from the jobMap, so something + // went wrong here. We can't return as this is reading messages for all jobs + // so just log it and move on. + log.G(ctx).WithFields(logrus.Fields{ + "code": code, + "overlapped": overlapped, + }).Warn("tried to write to a closed queue") + continue + } + } else { + log.G(ctx).Warn("received a message for a job not present in the mapping") + } + } +} + +func parseMessage(code uint32, overlapped uintptr) (interface{}, error) { + // Check code and parse out relevant information related to that notification + // that we care about. For now all we handle is the message that all processes + // in the job have exited. + switch code { + case winapi.JOB_OBJECT_MSG_ACTIVE_PROCESS_ZERO: + return MsgAllProcessesExited{}, nil + // Other messages for completeness and a check to make sure that if we fall + // into the default case that this is a code we don't know how to handle. + case winapi.JOB_OBJECT_MSG_END_OF_JOB_TIME: + case winapi.JOB_OBJECT_MSG_END_OF_PROCESS_TIME: + case winapi.JOB_OBJECT_MSG_ACTIVE_PROCESS_LIMIT: + case winapi.JOB_OBJECT_MSG_NEW_PROCESS: + case winapi.JOB_OBJECT_MSG_EXIT_PROCESS: + case winapi.JOB_OBJECT_MSG_ABNORMAL_EXIT_PROCESS: + case winapi.JOB_OBJECT_MSG_PROCESS_MEMORY_LIMIT: + case winapi.JOB_OBJECT_MSG_JOB_MEMORY_LIMIT: + case winapi.JOB_OBJECT_MSG_NOTIFICATION_LIMIT: + default: + return nil, fmt.Errorf("unknown job notification type: %d", code) + } + return MsgUnimplemented{}, nil +} + +// Assigns an IO completion port to get notified of events for the registered job +// object. +func attachIOCP(job windows.Handle, iocp windows.Handle) error { + info := winapi.JOBOBJECT_ASSOCIATE_COMPLETION_PORT{ + CompletionKey: job, + CompletionPort: iocp, + } + _, err := windows.SetInformationJobObject(job, windows.JobObjectAssociateCompletionPortInformation, uintptr(unsafe.Pointer(&info)), uint32(unsafe.Sizeof(info))) + return err +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/jobobject/jobobject.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/jobobject/jobobject.go new file mode 100644 index 000000000..c9fdd921a --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/jobobject/jobobject.go @@ -0,0 +1,538 @@ +package jobobject + +import ( + "context" + "errors" + "fmt" + "sync" + "unsafe" + + "github.com/Microsoft/hcsshim/internal/queue" + "github.com/Microsoft/hcsshim/internal/winapi" + "golang.org/x/sys/windows" +) + +// This file provides higher level constructs for the win32 job object API. +// Most of the core creation and management functions are already present in "golang.org/x/sys/windows" +// (CreateJobObject, AssignProcessToJobObject, etc.) as well as most of the limit information +// structs and associated limit flags. Whatever is not present from the job object API +// in golang.org/x/sys/windows is located in /internal/winapi. +// +// https://docs.microsoft.com/en-us/windows/win32/procthread/job-objects + +// JobObject is a high level wrapper around a Windows job object. Holds a handle to +// the job, a queue to receive iocp notifications about the lifecycle +// of the job and a mutex for synchronized handle access. +type JobObject struct { + handle windows.Handle + mq *queue.MessageQueue + handleLock sync.RWMutex +} + +// JobLimits represents the resource constraints that can be applied to a job object. +type JobLimits struct { + CPULimit uint32 + CPUWeight uint32 + MemoryLimitInBytes uint64 + MaxIOPS int64 + MaxBandwidth int64 +} + +type CPURateControlType uint32 + +const ( + WeightBased CPURateControlType = iota + RateBased +) + +// Processor resource controls +const ( + cpuLimitMin = 1 + cpuLimitMax = 10000 + cpuWeightMin = 1 + cpuWeightMax = 9 +) + +var ( + ErrAlreadyClosed = errors.New("the handle has already been closed") + ErrNotRegistered = errors.New("job is not registered to receive notifications") +) + +// Options represents the set of configurable options when making or opening a job object. +type Options struct { + // `Name` specifies the name of the job object if a named job object is desired. + Name string + // `Notifications` specifies if the job will be registered to receive notifications. + // Defaults to false. + Notifications bool + // `UseNTVariant` specifies if we should use the `Nt` variant of Open/CreateJobObject. + // Defaults to false. + UseNTVariant bool + // `IOTracking` enables tracking I/O statistics on the job object. More specifically this + // calls SetInformationJobObject with the JobObjectIoAttribution class. + EnableIOTracking bool +} + +// Create creates a job object. +// +// If options.Name is an empty string, the job will not be assigned a name. +// +// If options.Notifications are not enabled `PollNotifications` will return immediately with error `errNotRegistered`. +// +// If `options` is nil, use default option values. +// +// Returns a JobObject structure and an error if there is one. +func Create(ctx context.Context, options *Options) (_ *JobObject, err error) { + if options == nil { + options = &Options{} + } + + var jobName *winapi.UnicodeString + if options.Name != "" { + jobName, err = winapi.NewUnicodeString(options.Name) + if err != nil { + return nil, err + } + } + + var jobHandle windows.Handle + if options.UseNTVariant { + oa := winapi.ObjectAttributes{ + Length: unsafe.Sizeof(winapi.ObjectAttributes{}), + ObjectName: jobName, + Attributes: 0, + } + status := winapi.NtCreateJobObject(&jobHandle, winapi.JOB_OBJECT_ALL_ACCESS, &oa) + if status != 0 { + return nil, winapi.RtlNtStatusToDosError(status) + } + } else { + var jobNameBuf *uint16 + if jobName != nil && jobName.Buffer != nil { + jobNameBuf = jobName.Buffer + } + jobHandle, err = windows.CreateJobObject(nil, jobNameBuf) + if err != nil { + return nil, err + } + } + + defer func() { + if err != nil { + windows.Close(jobHandle) + } + }() + + job := &JobObject{ + handle: jobHandle, + } + + // If the IOCP we'll be using to receive messages for all jobs hasn't been + // created, create it and start polling. + if options.Notifications { + mq, err := setupNotifications(ctx, job) + if err != nil { + return nil, err + } + job.mq = mq + } + + if options.EnableIOTracking { + if err := enableIOTracking(jobHandle); err != nil { + return nil, err + } + } + + return job, nil +} + +// Open opens an existing job object with name provided in `options`. If no name is provided +// return an error since we need to know what job object to open. +// +// If options.Notifications is false `PollNotifications` will return immediately with error `errNotRegistered`. +// +// Returns a JobObject structure and an error if there is one. +func Open(ctx context.Context, options *Options) (_ *JobObject, err error) { + if options == nil || (options != nil && options.Name == "") { + return nil, errors.New("no job object name specified to open") + } + + unicodeJobName, err := winapi.NewUnicodeString(options.Name) + if err != nil { + return nil, err + } + + var jobHandle windows.Handle + if options != nil && options.UseNTVariant { + oa := winapi.ObjectAttributes{ + Length: unsafe.Sizeof(winapi.ObjectAttributes{}), + ObjectName: unicodeJobName, + Attributes: 0, + } + status := winapi.NtOpenJobObject(&jobHandle, winapi.JOB_OBJECT_ALL_ACCESS, &oa) + if status != 0 { + return nil, winapi.RtlNtStatusToDosError(status) + } + } else { + jobHandle, err = winapi.OpenJobObject(winapi.JOB_OBJECT_ALL_ACCESS, false, unicodeJobName.Buffer) + if err != nil { + return nil, err + } + } + + defer func() { + if err != nil { + windows.Close(jobHandle) + } + }() + + job := &JobObject{ + handle: jobHandle, + } + + // If the IOCP we'll be using to receive messages for all jobs hasn't been + // created, create it and start polling. + if options != nil && options.Notifications { + mq, err := setupNotifications(ctx, job) + if err != nil { + return nil, err + } + job.mq = mq + } + + return job, nil +} + +// helper function to setup notifications for creating/opening a job object +func setupNotifications(ctx context.Context, job *JobObject) (*queue.MessageQueue, error) { + job.handleLock.RLock() + defer job.handleLock.RUnlock() + + if job.handle == 0 { + return nil, ErrAlreadyClosed + } + + ioInitOnce.Do(func() { + h, err := windows.CreateIoCompletionPort(windows.InvalidHandle, 0, 0, 0xffffffff) + if err != nil { + initIOErr = err + return + } + ioCompletionPort = h + go pollIOCP(ctx, h) + }) + + if initIOErr != nil { + return nil, initIOErr + } + + mq := queue.NewMessageQueue() + jobMap.Store(uintptr(job.handle), mq) + if err := attachIOCP(job.handle, ioCompletionPort); err != nil { + jobMap.Delete(uintptr(job.handle)) + return nil, fmt.Errorf("failed to attach job to IO completion port: %w", err) + } + return mq, nil +} + +// PollNotification will poll for a job object notification. This call should only be called once +// per job (ideally in a goroutine loop) and will block if there is not a notification ready. +// This call will return immediately with error `ErrNotRegistered` if the job was not registered +// to receive notifications during `Create`. Internally, messages will be queued and there +// is no worry of messages being dropped. +func (job *JobObject) PollNotification() (interface{}, error) { + if job.mq == nil { + return nil, ErrNotRegistered + } + return job.mq.Dequeue() +} + +// UpdateProcThreadAttribute updates the passed in ProcThreadAttributeList to contain what is necessary to +// launch a process in a job at creation time. This can be used to avoid having to call Assign() after a process +// has already started running. +func (job *JobObject) UpdateProcThreadAttribute(attrList *windows.ProcThreadAttributeListContainer) error { + job.handleLock.RLock() + defer job.handleLock.RUnlock() + + if job.handle == 0 { + return ErrAlreadyClosed + } + + if err := attrList.Update( + winapi.PROC_THREAD_ATTRIBUTE_JOB_LIST, + unsafe.Pointer(&job.handle), + unsafe.Sizeof(job.handle), + ); err != nil { + return fmt.Errorf("failed to update proc thread attributes for job object: %w", err) + } + + return nil +} + +// Close closes the job object handle. +func (job *JobObject) Close() error { + job.handleLock.Lock() + defer job.handleLock.Unlock() + + if job.handle == 0 { + return ErrAlreadyClosed + } + + if err := windows.Close(job.handle); err != nil { + return err + } + + if job.mq != nil { + job.mq.Close() + } + // Handles now invalid so if the map entry to receive notifications for this job still + // exists remove it so we can stop receiving notifications. + if _, ok := jobMap.Load(uintptr(job.handle)); ok { + jobMap.Delete(uintptr(job.handle)) + } + + job.handle = 0 + return nil +} + +// Assign assigns a process to the job object. +func (job *JobObject) Assign(pid uint32) error { + job.handleLock.RLock() + defer job.handleLock.RUnlock() + + if job.handle == 0 { + return ErrAlreadyClosed + } + + if pid == 0 { + return errors.New("invalid pid: 0") + } + hProc, err := windows.OpenProcess(winapi.PROCESS_ALL_ACCESS, true, pid) + if err != nil { + return err + } + defer windows.Close(hProc) + return windows.AssignProcessToJobObject(job.handle, hProc) +} + +// Terminate terminates the job, essentially calls TerminateProcess on every process in the +// job. +func (job *JobObject) Terminate(exitCode uint32) error { + job.handleLock.RLock() + defer job.handleLock.RUnlock() + if job.handle == 0 { + return ErrAlreadyClosed + } + return windows.TerminateJobObject(job.handle, exitCode) +} + +// Pids returns all of the process IDs in the job object. +func (job *JobObject) Pids() ([]uint32, error) { + job.handleLock.RLock() + defer job.handleLock.RUnlock() + + if job.handle == 0 { + return nil, ErrAlreadyClosed + } + + info := winapi.JOBOBJECT_BASIC_PROCESS_ID_LIST{} + err := winapi.QueryInformationJobObject( + job.handle, + winapi.JobObjectBasicProcessIdList, + unsafe.Pointer(&info), + uint32(unsafe.Sizeof(info)), + nil, + ) + + // This is either the case where there is only one process or no processes in + // the job. Any other case will result in ERROR_MORE_DATA. Check if info.NumberOfProcessIdsInList + // is 1 and just return this, otherwise return an empty slice. + if err == nil { + if info.NumberOfProcessIdsInList == 1 { + return []uint32{uint32(info.ProcessIdList[0])}, nil + } + // Return empty slice instead of nil to play well with the caller of this. + // Do not return an error if no processes are running inside the job + return []uint32{}, nil + } + + if err != winapi.ERROR_MORE_DATA { + return nil, fmt.Errorf("failed initial query for PIDs in job object: %w", err) + } + + jobBasicProcessIDListSize := unsafe.Sizeof(info) + (unsafe.Sizeof(info.ProcessIdList[0]) * uintptr(info.NumberOfAssignedProcesses-1)) + buf := make([]byte, jobBasicProcessIDListSize) + if err = winapi.QueryInformationJobObject( + job.handle, + winapi.JobObjectBasicProcessIdList, + unsafe.Pointer(&buf[0]), + uint32(len(buf)), + nil, + ); err != nil { + return nil, fmt.Errorf("failed to query for PIDs in job object: %w", err) + } + + bufInfo := (*winapi.JOBOBJECT_BASIC_PROCESS_ID_LIST)(unsafe.Pointer(&buf[0])) + pids := make([]uint32, bufInfo.NumberOfProcessIdsInList) + for i, bufPid := range bufInfo.AllPids() { + pids[i] = uint32(bufPid) + } + return pids, nil +} + +// QueryMemoryStats gets the memory stats for the job object. +func (job *JobObject) QueryMemoryStats() (*winapi.JOBOBJECT_MEMORY_USAGE_INFORMATION, error) { + job.handleLock.RLock() + defer job.handleLock.RUnlock() + + if job.handle == 0 { + return nil, ErrAlreadyClosed + } + + info := winapi.JOBOBJECT_MEMORY_USAGE_INFORMATION{} + if err := winapi.QueryInformationJobObject( + job.handle, + winapi.JobObjectMemoryUsageInformation, + unsafe.Pointer(&info), + uint32(unsafe.Sizeof(info)), + nil, + ); err != nil { + return nil, fmt.Errorf("failed to query for job object memory stats: %w", err) + } + return &info, nil +} + +// QueryProcessorStats gets the processor stats for the job object. +func (job *JobObject) QueryProcessorStats() (*winapi.JOBOBJECT_BASIC_ACCOUNTING_INFORMATION, error) { + job.handleLock.RLock() + defer job.handleLock.RUnlock() + + if job.handle == 0 { + return nil, ErrAlreadyClosed + } + + info := winapi.JOBOBJECT_BASIC_ACCOUNTING_INFORMATION{} + if err := winapi.QueryInformationJobObject( + job.handle, + winapi.JobObjectBasicAccountingInformation, + unsafe.Pointer(&info), + uint32(unsafe.Sizeof(info)), + nil, + ); err != nil { + return nil, fmt.Errorf("failed to query for job object process stats: %w", err) + } + return &info, nil +} + +// QueryStorageStats gets the storage (I/O) stats for the job object. This call will error +// if either `EnableIOTracking` wasn't set to true on creation of the job, or SetIOTracking() +// hasn't been called since creation of the job. +func (job *JobObject) QueryStorageStats() (*winapi.JOBOBJECT_IO_ATTRIBUTION_INFORMATION, error) { + job.handleLock.RLock() + defer job.handleLock.RUnlock() + + if job.handle == 0 { + return nil, ErrAlreadyClosed + } + + info := winapi.JOBOBJECT_IO_ATTRIBUTION_INFORMATION{ + ControlFlags: winapi.JOBOBJECT_IO_ATTRIBUTION_CONTROL_ENABLE, + } + if err := winapi.QueryInformationJobObject( + job.handle, + winapi.JobObjectIoAttribution, + unsafe.Pointer(&info), + uint32(unsafe.Sizeof(info)), + nil, + ); err != nil { + return nil, fmt.Errorf("failed to query for job object storage stats: %w", err) + } + return &info, nil +} + +// QueryPrivateWorkingSet returns the private working set size for the job. This is calculated by adding up the +// private working set for every process running in the job. +func (job *JobObject) QueryPrivateWorkingSet() (uint64, error) { + pids, err := job.Pids() + if err != nil { + return 0, err + } + + openAndQueryWorkingSet := func(pid uint32) (uint64, error) { + h, err := windows.OpenProcess(windows.PROCESS_QUERY_LIMITED_INFORMATION, false, pid) + if err != nil { + // Continue to the next if OpenProcess doesn't return a valid handle (fails). Handles a + // case where one of the pids in the job exited before we open. + return 0, nil + } + defer func() { + _ = windows.Close(h) + }() + // Check if the process is actually running in the job still. There's a small chance + // that the process could have exited and had its pid re-used between grabbing the pids + // in the job and opening the handle to it above. + var inJob int32 + if err := winapi.IsProcessInJob(h, job.handle, &inJob); err != nil { + // This shouldn't fail unless we have incorrect access rights which we control + // here so probably best to error out if this failed. + return 0, err + } + // Don't report stats for this process as it's not running in the job. This shouldn't be + // an error condition though. + if inJob == 0 { + return 0, nil + } + + var vmCounters winapi.VM_COUNTERS_EX2 + status := winapi.NtQueryInformationProcess( + h, + winapi.ProcessVmCounters, + unsafe.Pointer(&vmCounters), + uint32(unsafe.Sizeof(vmCounters)), + nil, + ) + if !winapi.NTSuccess(status) { + return 0, fmt.Errorf("failed to query information for process: %w", winapi.RtlNtStatusToDosError(status)) + } + return uint64(vmCounters.PrivateWorkingSetSize), nil + } + + var jobWorkingSetSize uint64 + for _, pid := range pids { + workingSet, err := openAndQueryWorkingSet(pid) + if err != nil { + return 0, err + } + jobWorkingSetSize += workingSet + } + + return jobWorkingSetSize, nil +} + +// SetIOTracking enables IO tracking for processes in the job object. +// This enables use of the QueryStorageStats method. +func (job *JobObject) SetIOTracking() error { + job.handleLock.RLock() + defer job.handleLock.RUnlock() + + if job.handle == 0 { + return ErrAlreadyClosed + } + + return enableIOTracking(job.handle) +} + +func enableIOTracking(job windows.Handle) error { + info := winapi.JOBOBJECT_IO_ATTRIBUTION_INFORMATION{ + ControlFlags: winapi.JOBOBJECT_IO_ATTRIBUTION_CONTROL_ENABLE, + } + if _, err := windows.SetInformationJobObject( + job, + winapi.JobObjectIoAttribution, + uintptr(unsafe.Pointer(&info)), + uint32(unsafe.Sizeof(info)), + ); err != nil { + return fmt.Errorf("failed to enable IO tracking on job object: %w", err) + } + return nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/jobobject/limits.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/jobobject/limits.go new file mode 100644 index 000000000..4efde292c --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/jobobject/limits.go @@ -0,0 +1,315 @@ +package jobobject + +import ( + "errors" + "fmt" + "unsafe" + + "github.com/Microsoft/hcsshim/internal/winapi" + "golang.org/x/sys/windows" +) + +const ( + memoryLimitMax uint64 = 0xffffffffffffffff +) + +func isFlagSet(flag, controlFlags uint32) bool { + return (flag & controlFlags) == flag +} + +// SetResourceLimits sets resource limits on the job object (cpu, memory, storage). +func (job *JobObject) SetResourceLimits(limits *JobLimits) error { + // Go through and check what limits were specified and apply them to the job. + if limits.MemoryLimitInBytes != 0 { + if err := job.SetMemoryLimit(limits.MemoryLimitInBytes); err != nil { + return fmt.Errorf("failed to set job object memory limit: %w", err) + } + } + + if limits.CPULimit != 0 { + if err := job.SetCPULimit(RateBased, limits.CPULimit); err != nil { + return fmt.Errorf("failed to set job object cpu limit: %w", err) + } + } else if limits.CPUWeight != 0 { + if err := job.SetCPULimit(WeightBased, limits.CPUWeight); err != nil { + return fmt.Errorf("failed to set job object cpu limit: %w", err) + } + } + + if limits.MaxBandwidth != 0 || limits.MaxIOPS != 0 { + if err := job.SetIOLimit(limits.MaxBandwidth, limits.MaxIOPS); err != nil { + return fmt.Errorf("failed to set io limit on job object: %w", err) + } + } + return nil +} + +// SetTerminateOnLastHandleClose sets the job object flag that specifies that the job should terminate +// all processes in the job on the last open handle being closed. +func (job *JobObject) SetTerminateOnLastHandleClose() error { + info, err := job.getExtendedInformation() + if err != nil { + return err + } + info.BasicLimitInformation.LimitFlags |= windows.JOB_OBJECT_LIMIT_KILL_ON_JOB_CLOSE + return job.setExtendedInformation(info) +} + +// SetMemoryLimit sets the memory limit of the job object based on the given `memoryLimitInBytes`. +func (job *JobObject) SetMemoryLimit(memoryLimitInBytes uint64) error { + if memoryLimitInBytes >= memoryLimitMax { + return errors.New("memory limit specified exceeds the max size") + } + + info, err := job.getExtendedInformation() + if err != nil { + return err + } + + info.JobMemoryLimit = uintptr(memoryLimitInBytes) + info.BasicLimitInformation.LimitFlags |= windows.JOB_OBJECT_LIMIT_JOB_MEMORY + return job.setExtendedInformation(info) +} + +// GetMemoryLimit gets the memory limit in bytes of the job object. +func (job *JobObject) GetMemoryLimit() (uint64, error) { + info, err := job.getExtendedInformation() + if err != nil { + return 0, err + } + return uint64(info.JobMemoryLimit), nil +} + +// SetCPULimit sets the CPU limit depending on the specified `CPURateControlType` to +// `rateControlValue` for the job object. +func (job *JobObject) SetCPULimit(rateControlType CPURateControlType, rateControlValue uint32) error { + cpuInfo, err := job.getCPURateControlInformation() + if err != nil { + return err + } + switch rateControlType { + case WeightBased: + if rateControlValue < cpuWeightMin || rateControlValue > cpuWeightMax { + return fmt.Errorf("processor weight value of `%d` is invalid", rateControlValue) + } + cpuInfo.ControlFlags |= winapi.JOB_OBJECT_CPU_RATE_CONTROL_ENABLE | winapi.JOB_OBJECT_CPU_RATE_CONTROL_WEIGHT_BASED + cpuInfo.Value = rateControlValue + case RateBased: + if rateControlValue < cpuLimitMin || rateControlValue > cpuLimitMax { + return fmt.Errorf("processor rate of `%d` is invalid", rateControlValue) + } + cpuInfo.ControlFlags |= winapi.JOB_OBJECT_CPU_RATE_CONTROL_ENABLE | winapi.JOB_OBJECT_CPU_RATE_CONTROL_HARD_CAP + cpuInfo.Value = rateControlValue + default: + return errors.New("invalid job object cpu rate control type") + } + return job.setCPURateControlInfo(cpuInfo) +} + +// GetCPULimit gets the cpu limits for the job object. +// `rateControlType` is used to indicate what type of cpu limit to query for. +func (job *JobObject) GetCPULimit(rateControlType CPURateControlType) (uint32, error) { + info, err := job.getCPURateControlInformation() + if err != nil { + return 0, err + } + + if !isFlagSet(winapi.JOB_OBJECT_CPU_RATE_CONTROL_ENABLE, info.ControlFlags) { + return 0, errors.New("the job does not have cpu rate control enabled") + } + + switch rateControlType { + case WeightBased: + if !isFlagSet(winapi.JOB_OBJECT_CPU_RATE_CONTROL_WEIGHT_BASED, info.ControlFlags) { + return 0, errors.New("cannot get cpu weight for job object without cpu weight option set") + } + case RateBased: + if !isFlagSet(winapi.JOB_OBJECT_CPU_RATE_CONTROL_HARD_CAP, info.ControlFlags) { + return 0, errors.New("cannot get cpu rate hard cap for job object without cpu rate hard cap option set") + } + default: + return 0, errors.New("invalid job object cpu rate control type") + } + return info.Value, nil +} + +// SetCPUAffinity sets the processor affinity for the job object. +// The affinity is passed in as a bitmask. +func (job *JobObject) SetCPUAffinity(affinityBitMask uint64) error { + info, err := job.getExtendedInformation() + if err != nil { + return err + } + info.BasicLimitInformation.LimitFlags |= uint32(windows.JOB_OBJECT_LIMIT_AFFINITY) + info.BasicLimitInformation.Affinity = uintptr(affinityBitMask) + return job.setExtendedInformation(info) +} + +// GetCPUAffinity gets the processor affinity for the job object. +// The returned affinity is a bitmask. +func (job *JobObject) GetCPUAffinity() (uint64, error) { + info, err := job.getExtendedInformation() + if err != nil { + return 0, err + } + return uint64(info.BasicLimitInformation.Affinity), nil +} + +// SetIOLimit sets the IO limits specified on the job object. +func (job *JobObject) SetIOLimit(maxBandwidth, maxIOPS int64) error { + ioInfo, err := job.getIOLimit() + if err != nil { + return err + } + ioInfo.ControlFlags |= winapi.JOB_OBJECT_IO_RATE_CONTROL_ENABLE + if maxBandwidth != 0 { + ioInfo.MaxBandwidth = maxBandwidth + } + if maxIOPS != 0 { + ioInfo.MaxIops = maxIOPS + } + return job.setIORateControlInfo(ioInfo) +} + +// GetIOMaxBandwidthLimit gets the max bandwidth for the job object. +func (job *JobObject) GetIOMaxBandwidthLimit() (int64, error) { + info, err := job.getIOLimit() + if err != nil { + return 0, err + } + return info.MaxBandwidth, nil +} + +// GetIOMaxIopsLimit gets the max iops for the job object. +func (job *JobObject) GetIOMaxIopsLimit() (int64, error) { + info, err := job.getIOLimit() + if err != nil { + return 0, err + } + return info.MaxIops, nil +} + +// Helper function for getting a job object's extended information. +func (job *JobObject) getExtendedInformation() (*windows.JOBOBJECT_EXTENDED_LIMIT_INFORMATION, error) { + job.handleLock.RLock() + defer job.handleLock.RUnlock() + + if job.handle == 0 { + return nil, ErrAlreadyClosed + } + + info := windows.JOBOBJECT_EXTENDED_LIMIT_INFORMATION{} + if err := winapi.QueryInformationJobObject( + job.handle, + windows.JobObjectExtendedLimitInformation, + unsafe.Pointer(&info), + uint32(unsafe.Sizeof(info)), + nil, + ); err != nil { + return nil, fmt.Errorf("query %v returned error: %w", info, err) + } + return &info, nil +} + +// Helper function for getting a job object's CPU rate control information. +func (job *JobObject) getCPURateControlInformation() (*winapi.JOBOBJECT_CPU_RATE_CONTROL_INFORMATION, error) { + job.handleLock.RLock() + defer job.handleLock.RUnlock() + + if job.handle == 0 { + return nil, ErrAlreadyClosed + } + + info := winapi.JOBOBJECT_CPU_RATE_CONTROL_INFORMATION{} + if err := winapi.QueryInformationJobObject( + job.handle, + windows.JobObjectCpuRateControlInformation, + unsafe.Pointer(&info), + uint32(unsafe.Sizeof(info)), + nil, + ); err != nil { + return nil, fmt.Errorf("query %v returned error: %w", info, err) + } + return &info, nil +} + +// Helper function for setting a job object's extended information. +func (job *JobObject) setExtendedInformation(info *windows.JOBOBJECT_EXTENDED_LIMIT_INFORMATION) error { + job.handleLock.RLock() + defer job.handleLock.RUnlock() + + if job.handle == 0 { + return ErrAlreadyClosed + } + + if _, err := windows.SetInformationJobObject( + job.handle, + windows.JobObjectExtendedLimitInformation, + uintptr(unsafe.Pointer(info)), + uint32(unsafe.Sizeof(*info)), + ); err != nil { + return fmt.Errorf("failed to set Extended info %v on job object: %w", info, err) + } + return nil +} + +// Helper function for querying job handle for IO limit information. +func (job *JobObject) getIOLimit() (*winapi.JOBOBJECT_IO_RATE_CONTROL_INFORMATION, error) { + job.handleLock.RLock() + defer job.handleLock.RUnlock() + + if job.handle == 0 { + return nil, ErrAlreadyClosed + } + + ioInfo := &winapi.JOBOBJECT_IO_RATE_CONTROL_INFORMATION{} + var blockCount uint32 = 1 + + if _, err := winapi.QueryIoRateControlInformationJobObject( + job.handle, + nil, + &ioInfo, + &blockCount, + ); err != nil { + return nil, fmt.Errorf("query %v returned error: %w", ioInfo, err) + } + + if !isFlagSet(winapi.JOB_OBJECT_IO_RATE_CONTROL_ENABLE, ioInfo.ControlFlags) { + return nil, fmt.Errorf("query %v cannot get IO limits for job object without IO rate control option set", ioInfo) + } + return ioInfo, nil +} + +// Helper function for setting a job object's IO rate control information. +func (job *JobObject) setIORateControlInfo(ioInfo *winapi.JOBOBJECT_IO_RATE_CONTROL_INFORMATION) error { + job.handleLock.RLock() + defer job.handleLock.RUnlock() + + if job.handle == 0 { + return ErrAlreadyClosed + } + + if _, err := winapi.SetIoRateControlInformationJobObject(job.handle, ioInfo); err != nil { + return fmt.Errorf("failed to set IO limit info %v on job object: %w", ioInfo, err) + } + return nil +} + +// Helper function for setting a job object's CPU rate control information. +func (job *JobObject) setCPURateControlInfo(cpuInfo *winapi.JOBOBJECT_CPU_RATE_CONTROL_INFORMATION) error { + job.handleLock.RLock() + defer job.handleLock.RUnlock() + + if job.handle == 0 { + return ErrAlreadyClosed + } + if _, err := windows.SetInformationJobObject( + job.handle, + windows.JobObjectCpuRateControlInformation, + uintptr(unsafe.Pointer(cpuInfo)), + uint32(unsafe.Sizeof(cpuInfo)), + ); err != nil { + return fmt.Errorf("failed to set cpu limit info %v on job object: %w", cpuInfo, err) + } + return nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/log/g.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/log/g.go new file mode 100644 index 000000000..ba6b1a4a5 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/log/g.go @@ -0,0 +1,23 @@ +package log + +import ( + "context" + + "github.com/sirupsen/logrus" + "go.opencensus.io/trace" +) + +// G returns a `logrus.Entry` with the `TraceID, SpanID` from `ctx` if `ctx` +// contains an OpenCensus `trace.Span`. +func G(ctx context.Context) *logrus.Entry { + span := trace.FromContext(ctx) + if span != nil { + sctx := span.SpanContext() + return logrus.WithFields(logrus.Fields{ + "traceID": sctx.TraceID.String(), + "spanID": sctx.SpanID.String(), + // "parentSpanID": TODO: JTERRY75 - Try to convince OC to export this? + }) + } + return logrus.NewEntry(logrus.StandardLogger()) +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/logfields/fields.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/logfields/fields.go new file mode 100644 index 000000000..cf2c166d9 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/logfields/fields.go @@ -0,0 +1,32 @@ +package logfields + +const ( + // Identifiers + + ContainerID = "cid" + UVMID = "uvm-id" + ProcessID = "pid" + + // Common Misc + + // Timeout represents an operation timeout. + Timeout = "timeout" + JSON = "json" + + // Keys/values + + Field = "field" + OCIAnnotation = "oci-annotation" + Value = "value" + + // Golang type's + + ExpectedType = "expected-type" + Bool = "bool" + Uint32 = "uint32" + Uint64 = "uint64" + + // runhcs + + VMShimOperation = "vmshim-op" +) diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/longpath/longpath.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/longpath/longpath.go new file mode 100644 index 000000000..e5b8b85e0 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/longpath/longpath.go @@ -0,0 +1,24 @@ +package longpath + +import ( + "path/filepath" + "strings" +) + +// LongAbs makes a path absolute and returns it in NT long path form. +func LongAbs(path string) (string, error) { + if strings.HasPrefix(path, `\\?\`) || strings.HasPrefix(path, `\\.\`) { + return path, nil + } + if !filepath.IsAbs(path) { + absPath, err := filepath.Abs(path) + if err != nil { + return "", err + } + path = absPath + } + if strings.HasPrefix(path, `\\`) { + return `\\?\UNC\` + path[2:], nil + } + return `\\?\` + path, nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/mergemaps/merge.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/mergemaps/merge.go new file mode 100644 index 000000000..7e95efb30 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/mergemaps/merge.go @@ -0,0 +1,52 @@ +package mergemaps + +import "encoding/json" + +// Merge recursively merges map `fromMap` into map `ToMap`. Any pre-existing values +// in ToMap are overwritten. Values in fromMap are added to ToMap. +// From http://stackoverflow.com/questions/40491438/merging-two-json-strings-in-golang +func Merge(fromMap, ToMap interface{}) interface{} { + switch fromMap := fromMap.(type) { + case map[string]interface{}: + ToMap, ok := ToMap.(map[string]interface{}) + if !ok { + return fromMap + } + for keyToMap, valueToMap := range ToMap { + if valueFromMap, ok := fromMap[keyToMap]; ok { + fromMap[keyToMap] = Merge(valueFromMap, valueToMap) + } else { + fromMap[keyToMap] = valueToMap + } + } + case nil: + // merge(nil, map[string]interface{...}) -> map[string]interface{...} + ToMap, ok := ToMap.(map[string]interface{}) + if ok { + return ToMap + } + } + return fromMap +} + +// MergeJSON merges the contents of a JSON string into an object representation, +// returning a new object suitable for translating to JSON. +func MergeJSON(object interface{}, additionalJSON []byte) (interface{}, error) { + if len(additionalJSON) == 0 { + return object, nil + } + objectJSON, err := json.Marshal(object) + if err != nil { + return nil, err + } + var objectMap, newMap map[string]interface{} + err = json.Unmarshal(objectJSON, &objectMap) + if err != nil { + return nil, err + } + err = json.Unmarshal(additionalJSON, &newMap) + if err != nil { + return nil, err + } + return Merge(newMap, objectMap), nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/oc/exporter.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/oc/exporter.go new file mode 100644 index 000000000..f428bdaf7 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/oc/exporter.go @@ -0,0 +1,43 @@ +package oc + +import ( + "github.com/sirupsen/logrus" + "go.opencensus.io/trace" +) + +var _ = (trace.Exporter)(&LogrusExporter{}) + +// LogrusExporter is an OpenCensus `trace.Exporter` that exports +// `trace.SpanData` to logrus output. +type LogrusExporter struct { +} + +// ExportSpan exports `s` based on the the following rules: +// +// 1. All output will contain `s.Attributes`, `s.TraceID`, `s.SpanID`, +// `s.ParentSpanID` for correlation +// +// 2. Any calls to .Annotate will not be supported. +// +// 3. The span itself will be written at `logrus.InfoLevel` unless +// `s.Status.Code != 0` in which case it will be written at `logrus.ErrorLevel` +// providing `s.Status.Message` as the error value. +func (le *LogrusExporter) ExportSpan(s *trace.SpanData) { + // Combine all span annotations with traceID, spanID, parentSpanID + baseEntry := logrus.WithFields(logrus.Fields(s.Attributes)) + baseEntry.Data["traceID"] = s.TraceID.String() + baseEntry.Data["spanID"] = s.SpanID.String() + baseEntry.Data["parentSpanID"] = s.ParentSpanID.String() + baseEntry.Data["startTime"] = s.StartTime + baseEntry.Data["endTime"] = s.EndTime + baseEntry.Data["duration"] = s.EndTime.Sub(s.StartTime).String() + baseEntry.Data["name"] = s.Name + baseEntry.Time = s.StartTime + + level := logrus.InfoLevel + if s.Status.Code != 0 { + level = logrus.ErrorLevel + baseEntry.Data[logrus.ErrorKey] = s.Status.Message + } + baseEntry.Log(level, "Span") +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/oc/span.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/oc/span.go new file mode 100644 index 000000000..fee4765cb --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/oc/span.go @@ -0,0 +1,17 @@ +package oc + +import ( + "go.opencensus.io/trace" +) + +// SetSpanStatus sets `span.SetStatus` to the proper status depending on `err`. If +// `err` is `nil` assumes `trace.StatusCodeOk`. +func SetSpanStatus(span *trace.Span, err error) { + status := trace.Status{} + if err != nil { + // TODO: JTERRY75 - Handle errors in a non-generic way + status.Code = trace.StatusCodeUnknown + status.Message = err.Error() + } + span.SetStatus(status) +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/queue/mq.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/queue/mq.go new file mode 100644 index 000000000..4eb9bb9f1 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/queue/mq.go @@ -0,0 +1,92 @@ +package queue + +import ( + "errors" + "sync" +) + +var ErrQueueClosed = errors.New("the queue is closed for reading and writing") + +// MessageQueue represents a threadsafe message queue to be used to retrieve or +// write messages to. +type MessageQueue struct { + m *sync.RWMutex + c *sync.Cond + messages []interface{} + closed bool +} + +// NewMessageQueue returns a new MessageQueue. +func NewMessageQueue() *MessageQueue { + m := &sync.RWMutex{} + return &MessageQueue{ + m: m, + c: sync.NewCond(m), + messages: []interface{}{}, + } +} + +// Enqueue writes `msg` to the queue. +func (mq *MessageQueue) Enqueue(msg interface{}) error { + mq.m.Lock() + defer mq.m.Unlock() + + if mq.closed { + return ErrQueueClosed + } + mq.messages = append(mq.messages, msg) + // Signal a waiter that there is now a value available in the queue. + mq.c.Signal() + return nil +} + +// Dequeue will read a value from the queue and remove it. If the queue +// is empty, this will block until the queue is closed or a value gets enqueued. +func (mq *MessageQueue) Dequeue() (interface{}, error) { + mq.m.Lock() + defer mq.m.Unlock() + + for !mq.closed && mq.size() == 0 { + mq.c.Wait() + } + + // We got woken up, check if it's because the queue got closed. + if mq.closed { + return nil, ErrQueueClosed + } + + val := mq.messages[0] + mq.messages[0] = nil + mq.messages = mq.messages[1:] + return val, nil +} + +// Size returns the size of the queue. +func (mq *MessageQueue) Size() int { + mq.m.RLock() + defer mq.m.RUnlock() + return mq.size() +} + +// Nonexported size check to check if the queue is empty inside already locked functions. +func (mq *MessageQueue) size() int { + return len(mq.messages) +} + +// Close closes the queue for future writes or reads. Any attempts to read or write from the +// queue after close will return ErrQueueClosed. This is safe to call multiple times. +func (mq *MessageQueue) Close() { + mq.m.Lock() + defer mq.m.Unlock() + + // Already closed, noop + if mq.closed { + return + } + + mq.messages = nil + mq.closed = true + // If there's anybody currently waiting on a value from Dequeue, we need to + // broadcast so the read(s) can return ErrQueueClosed. + mq.c.Broadcast() +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/safefile/safeopen.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/safefile/safeopen.go new file mode 100644 index 000000000..66b8d7e03 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/safefile/safeopen.go @@ -0,0 +1,375 @@ +package safefile + +import ( + "errors" + "io" + "os" + "path/filepath" + "strings" + "syscall" + "unicode/utf16" + "unsafe" + + "github.com/Microsoft/hcsshim/internal/longpath" + "github.com/Microsoft/hcsshim/internal/winapi" + + winio "github.com/Microsoft/go-winio" +) + +func OpenRoot(path string) (*os.File, error) { + longpath, err := longpath.LongAbs(path) + if err != nil { + return nil, err + } + return winio.OpenForBackup(longpath, syscall.GENERIC_READ, syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, syscall.OPEN_EXISTING) +} + +func cleanGoStringRelativePath(path string) (string, error) { + path = filepath.Clean(path) + if strings.Contains(path, ":") { + // Since alternate data streams must follow the file they + // are attached to, finding one here (out of order) is invalid. + return "", errors.New("path contains invalid character `:`") + } + fspath := filepath.FromSlash(path) + if len(fspath) > 0 && fspath[0] == '\\' { + return "", errors.New("expected relative path") + } + return fspath, nil +} + +func ntRelativePath(path string) ([]uint16, error) { + fspath, err := cleanGoStringRelativePath(path) + if err != nil { + return nil, err + } + + path16 := utf16.Encode(([]rune)(fspath)) + if len(path16) > 32767 { + return nil, syscall.ENAMETOOLONG + } + + return path16, nil +} + +// openRelativeInternal opens a relative path from the given root, failing if +// any of the intermediate path components are reparse points. +func openRelativeInternal(path string, root *os.File, accessMask uint32, shareFlags uint32, createDisposition uint32, flags uint32) (*os.File, error) { + var ( + h uintptr + iosb winapi.IOStatusBlock + oa winapi.ObjectAttributes + ) + + cleanRelativePath, err := cleanGoStringRelativePath(path) + if err != nil { + return nil, err + } + + if root == nil || root.Fd() == 0 { + return nil, errors.New("missing root directory") + } + + pathUnicode, err := winapi.NewUnicodeString(cleanRelativePath) + if err != nil { + return nil, err + } + + oa.Length = unsafe.Sizeof(oa) + oa.ObjectName = pathUnicode + oa.RootDirectory = uintptr(root.Fd()) + oa.Attributes = winapi.OBJ_DONT_REPARSE + status := winapi.NtCreateFile( + &h, + accessMask|syscall.SYNCHRONIZE, + &oa, + &iosb, + nil, + 0, + shareFlags, + createDisposition, + winapi.FILE_OPEN_FOR_BACKUP_INTENT|winapi.FILE_SYNCHRONOUS_IO_NONALERT|flags, + nil, + 0, + ) + if status != 0 { + return nil, winapi.RtlNtStatusToDosError(status) + } + + fullPath, err := longpath.LongAbs(filepath.Join(root.Name(), path)) + if err != nil { + syscall.Close(syscall.Handle(h)) + return nil, err + } + + return os.NewFile(h, fullPath), nil +} + +// OpenRelative opens a relative path from the given root, failing if +// any of the intermediate path components are reparse points. +func OpenRelative(path string, root *os.File, accessMask uint32, shareFlags uint32, createDisposition uint32, flags uint32) (*os.File, error) { + f, err := openRelativeInternal(path, root, accessMask, shareFlags, createDisposition, flags) + if err != nil { + err = &os.PathError{Op: "open", Path: filepath.Join(root.Name(), path), Err: err} + } + return f, err +} + +// LinkRelative creates a hard link from oldname to newname (relative to oldroot +// and newroot), failing if any of the intermediate path components are reparse +// points. +func LinkRelative(oldname string, oldroot *os.File, newname string, newroot *os.File) error { + // Open the old file. + oldf, err := openRelativeInternal( + oldname, + oldroot, + syscall.FILE_WRITE_ATTRIBUTES, + syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, + winapi.FILE_OPEN, + 0, + ) + if err != nil { + return &os.LinkError{Op: "link", Old: filepath.Join(oldroot.Name(), oldname), New: filepath.Join(newroot.Name(), newname), Err: err} + } + defer oldf.Close() + + // Open the parent of the new file. + var parent *os.File + parentPath := filepath.Dir(newname) + if parentPath != "." { + parent, err = openRelativeInternal( + parentPath, + newroot, + syscall.GENERIC_READ, + syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, + winapi.FILE_OPEN, + winapi.FILE_DIRECTORY_FILE) + if err != nil { + return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(newroot.Name(), newname), Err: err} + } + defer parent.Close() + + fi, err := winio.GetFileBasicInfo(parent) + if err != nil { + return err + } + if (fi.FileAttributes & syscall.FILE_ATTRIBUTE_REPARSE_POINT) != 0 { + return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(newroot.Name(), newname), Err: winapi.RtlNtStatusToDosError(winapi.STATUS_REPARSE_POINT_ENCOUNTERED)} + } + + } else { + parent = newroot + } + + // Issue an NT call to create the link. This will be safe because NT will + // not open any more directories to create the link, so it cannot walk any + // more reparse points. + newbase := filepath.Base(newname) + newbase16, err := ntRelativePath(newbase) + if err != nil { + return err + } + + size := int(unsafe.Offsetof(winapi.FileLinkInformation{}.FileName)) + len(newbase16)*2 + linkinfoBuffer := winapi.LocalAlloc(0, size) + defer winapi.LocalFree(linkinfoBuffer) + + linkinfo := (*winapi.FileLinkInformation)(unsafe.Pointer(linkinfoBuffer)) + linkinfo.RootDirectory = parent.Fd() + linkinfo.FileNameLength = uint32(len(newbase16) * 2) + copy(winapi.Uint16BufferToSlice(&linkinfo.FileName[0], len(newbase16)), newbase16) + + var iosb winapi.IOStatusBlock + status := winapi.NtSetInformationFile( + oldf.Fd(), + &iosb, + linkinfoBuffer, + uint32(size), + winapi.FileLinkInformationClass, + ) + if status != 0 { + return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(parent.Name(), newbase), Err: winapi.RtlNtStatusToDosError(status)} + } + + return nil +} + +// deleteOnClose marks a file to be deleted when the handle is closed. +func deleteOnClose(f *os.File) error { + disposition := winapi.FileDispositionInformationEx{Flags: winapi.FILE_DISPOSITION_DELETE} + var iosb winapi.IOStatusBlock + status := winapi.NtSetInformationFile( + f.Fd(), + &iosb, + uintptr(unsafe.Pointer(&disposition)), + uint32(unsafe.Sizeof(disposition)), + winapi.FileDispositionInformationExClass, + ) + if status != 0 { + return winapi.RtlNtStatusToDosError(status) + } + return nil +} + +// clearReadOnly clears the readonly attribute on a file. +func clearReadOnly(f *os.File) error { + bi, err := winio.GetFileBasicInfo(f) + if err != nil { + return err + } + if bi.FileAttributes&syscall.FILE_ATTRIBUTE_READONLY == 0 { + return nil + } + sbi := winio.FileBasicInfo{ + FileAttributes: bi.FileAttributes &^ syscall.FILE_ATTRIBUTE_READONLY, + } + if sbi.FileAttributes == 0 { + sbi.FileAttributes = syscall.FILE_ATTRIBUTE_NORMAL + } + return winio.SetFileBasicInfo(f, &sbi) +} + +// RemoveRelative removes a file or directory relative to a root, failing if any +// intermediate path components are reparse points. +func RemoveRelative(path string, root *os.File) error { + f, err := openRelativeInternal( + path, + root, + winapi.FILE_READ_ATTRIBUTES|winapi.FILE_WRITE_ATTRIBUTES|winapi.DELETE, + syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, + winapi.FILE_OPEN, + winapi.FILE_OPEN_REPARSE_POINT) + if err == nil { + defer f.Close() + err = deleteOnClose(f) + if err == syscall.ERROR_ACCESS_DENIED { + // Maybe the file is marked readonly. Clear the bit and retry. + _ = clearReadOnly(f) + err = deleteOnClose(f) + } + } + if err != nil { + return &os.PathError{Op: "remove", Path: filepath.Join(root.Name(), path), Err: err} + } + return nil +} + +// RemoveAllRelative removes a directory tree relative to a root, failing if any +// intermediate path components are reparse points. +func RemoveAllRelative(path string, root *os.File) error { + fi, err := LstatRelative(path, root) + if err != nil { + if os.IsNotExist(err) { + return nil + } + return err + } + fileAttributes := fi.Sys().(*syscall.Win32FileAttributeData).FileAttributes + if fileAttributes&syscall.FILE_ATTRIBUTE_DIRECTORY == 0 || fileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT != 0 { + // If this is a reparse point, it can't have children. Simple remove will do. + err := RemoveRelative(path, root) + if err == nil || os.IsNotExist(err) { + return nil + } + return err + } + + // It is necessary to use os.Open as Readdirnames does not work with + // OpenRelative. This is safe because the above lstatrelative fails + // if the target is outside the root, and we know this is not a + // symlink from the above FILE_ATTRIBUTE_REPARSE_POINT check. + fd, err := os.Open(filepath.Join(root.Name(), path)) + if err != nil { + if os.IsNotExist(err) { + // Race. It was deleted between the Lstat and Open. + // Return nil per RemoveAll's docs. + return nil + } + return err + } + + // Remove contents & return first error. + for { + names, err1 := fd.Readdirnames(100) + for _, name := range names { + err1 := RemoveAllRelative(path+string(os.PathSeparator)+name, root) + if err == nil { + err = err1 + } + } + if err1 == io.EOF { + break + } + // If Readdirnames returned an error, use it. + if err == nil { + err = err1 + } + if len(names) == 0 { + break + } + } + fd.Close() + + // Remove directory. + err1 := RemoveRelative(path, root) + if err1 == nil || os.IsNotExist(err1) { + return nil + } + if err == nil { + err = err1 + } + return err +} + +// MkdirRelative creates a directory relative to a root, failing if any +// intermediate path components are reparse points. +func MkdirRelative(path string, root *os.File) error { + f, err := openRelativeInternal( + path, + root, + 0, + syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, + winapi.FILE_CREATE, + winapi.FILE_DIRECTORY_FILE) + if err == nil { + f.Close() + } else { + err = &os.PathError{Op: "mkdir", Path: filepath.Join(root.Name(), path), Err: err} + } + return err +} + +// LstatRelative performs a stat operation on a file relative to a root, failing +// if any intermediate path components are reparse points. +func LstatRelative(path string, root *os.File) (os.FileInfo, error) { + f, err := openRelativeInternal( + path, + root, + winapi.FILE_READ_ATTRIBUTES, + syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, + winapi.FILE_OPEN, + winapi.FILE_OPEN_REPARSE_POINT) + if err != nil { + return nil, &os.PathError{Op: "stat", Path: filepath.Join(root.Name(), path), Err: err} + } + defer f.Close() + return f.Stat() +} + +// EnsureNotReparsePointRelative validates that a given file (relative to a +// root) and all intermediate path components are not a reparse points. +func EnsureNotReparsePointRelative(path string, root *os.File) error { + // Perform an open with OBJ_DONT_REPARSE but without specifying FILE_OPEN_REPARSE_POINT. + f, err := OpenRelative( + path, + root, + 0, + syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, + winapi.FILE_OPEN, + 0) + if err != nil { + return err + } + f.Close() + return nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/timeout/timeout.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/timeout/timeout.go new file mode 100644 index 000000000..eaf39fa51 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/timeout/timeout.go @@ -0,0 +1,74 @@ +package timeout + +import ( + "os" + "strconv" + "time" +) + +var ( + // defaultTimeout is the timeout for most operations that is not overridden. + defaultTimeout = 4 * time.Minute + + // defaultTimeoutTestdRetry is the retry loop timeout for testd to respond + // for a disk to come online in LCOW. + defaultTimeoutTestdRetry = 5 * time.Second +) + +// External variables for HCSShim consumers to use. +var ( + // SystemCreate is the timeout for creating a compute system + SystemCreate time.Duration = defaultTimeout + + // SystemStart is the timeout for starting a compute system + SystemStart time.Duration = defaultTimeout + + // SystemPause is the timeout for pausing a compute system + SystemPause time.Duration = defaultTimeout + + // SystemResume is the timeout for resuming a compute system + SystemResume time.Duration = defaultTimeout + + // SystemSave is the timeout for saving a compute system + SystemSave time.Duration = defaultTimeout + + // SyscallWatcher is the timeout before warning of a potential stuck platform syscall. + SyscallWatcher time.Duration = defaultTimeout + + // Tar2VHD is the timeout for the tar2vhd operation to complete + Tar2VHD time.Duration = defaultTimeout + + // ExternalCommandToStart is the timeout for external commands to start + ExternalCommandToStart = defaultTimeout + + // ExternalCommandToComplete is the timeout for external commands to complete. + // Generally this means copying data from their stdio pipes. + ExternalCommandToComplete = defaultTimeout + + // TestDRetryLoop is the timeout for testd retry loop when onlining a SCSI disk in LCOW + TestDRetryLoop = defaultTimeoutTestdRetry +) + +func init() { + SystemCreate = durationFromEnvironment("HCSSHIM_TIMEOUT_SYSTEMCREATE", SystemCreate) + SystemStart = durationFromEnvironment("HCSSHIM_TIMEOUT_SYSTEMSTART", SystemStart) + SystemPause = durationFromEnvironment("HCSSHIM_TIMEOUT_SYSTEMPAUSE", SystemPause) + SystemResume = durationFromEnvironment("HCSSHIM_TIMEOUT_SYSTEMRESUME", SystemResume) + SystemSave = durationFromEnvironment("HCSSHIM_TIMEOUT_SYSTEMSAVE", SystemSave) + SyscallWatcher = durationFromEnvironment("HCSSHIM_TIMEOUT_SYSCALLWATCHER", SyscallWatcher) + Tar2VHD = durationFromEnvironment("HCSSHIM_TIMEOUT_TAR2VHD", Tar2VHD) + ExternalCommandToStart = durationFromEnvironment("HCSSHIM_TIMEOUT_EXTERNALCOMMANDSTART", ExternalCommandToStart) + ExternalCommandToComplete = durationFromEnvironment("HCSSHIM_TIMEOUT_EXTERNALCOMMANDCOMPLETE", ExternalCommandToComplete) + TestDRetryLoop = durationFromEnvironment("HCSSHIM_TIMEOUT_TESTDRETRYLOOP", TestDRetryLoop) +} + +func durationFromEnvironment(env string, defaultValue time.Duration) time.Duration { + envTimeout := os.Getenv(env) + if len(envTimeout) > 0 { + e, err := strconv.Atoi(envTimeout) + if err == nil && e > 0 { + return time.Second * time.Duration(e) + } + } + return defaultValue +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go new file mode 100644 index 000000000..e7f114b67 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go @@ -0,0 +1,610 @@ +package vmcompute + +import ( + gcontext "context" + "syscall" + "time" + + "github.com/Microsoft/hcsshim/internal/interop" + "github.com/Microsoft/hcsshim/internal/log" + "github.com/Microsoft/hcsshim/internal/logfields" + "github.com/Microsoft/hcsshim/internal/oc" + "github.com/Microsoft/hcsshim/internal/timeout" + "go.opencensus.io/trace" +) + +//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go vmcompute.go + +//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems? +//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem? +//sys hcsOpenComputeSystem(id string, computeSystem *HcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem? +//sys hcsCloseComputeSystem(computeSystem HcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem? +//sys hcsStartComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem? +//sys hcsShutdownComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem? +//sys hcsTerminateComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem? +//sys hcsPauseComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem? +//sys hcsResumeComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem? +//sys hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties? +//sys hcsModifyComputeSystem(computeSystem HcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem? +//sys hcsModifyServiceSettings(settings string, result **uint16) (hr error) = vmcompute.HcsModifyServiceSettings? +//sys hcsRegisterComputeSystemCallback(computeSystem HcsSystem, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback? +//sys hcsUnregisterComputeSystemCallback(callbackHandle HcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback? +//sys hcsSaveComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsSaveComputeSystem? + +//sys hcsCreateProcess(computeSystem HcsSystem, processParameters string, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess? +//sys hcsOpenProcess(computeSystem HcsSystem, pid uint32, process *HcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess? +//sys hcsCloseProcess(process HcsProcess) (hr error) = vmcompute.HcsCloseProcess? +//sys hcsTerminateProcess(process HcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess? +//sys hcsSignalProcess(process HcsProcess, options string, result **uint16) (hr error) = vmcompute.HcsSignalProcess? +//sys hcsGetProcessInfo(process HcsProcess, processInformation *HcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo? +//sys hcsGetProcessProperties(process HcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties? +//sys hcsModifyProcess(process HcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess? +//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties? +//sys hcsRegisterProcessCallback(process HcsProcess, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback? +//sys hcsUnregisterProcessCallback(callbackHandle HcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback? + +// errVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously +const errVmcomputeOperationPending = syscall.Errno(0xC0370103) + +// HcsSystem is the handle associated with a created compute system. +type HcsSystem syscall.Handle + +// HcsProcess is the handle associated with a created process in a compute +// system. +type HcsProcess syscall.Handle + +// HcsCallback is the handle associated with the function to call when events +// occur. +type HcsCallback syscall.Handle + +// HcsProcessInformation is the structure used when creating or getting process +// info. +type HcsProcessInformation struct { + // ProcessId is the pid of the created process. + ProcessId uint32 + reserved uint32 //nolint:structcheck + // StdInput is the handle associated with the stdin of the process. + StdInput syscall.Handle + // StdOutput is the handle associated with the stdout of the process. + StdOutput syscall.Handle + // StdError is the handle associated with the stderr of the process. + StdError syscall.Handle +} + +func execute(ctx gcontext.Context, timeout time.Duration, f func() error) error { + if timeout > 0 { + var cancel gcontext.CancelFunc + ctx, cancel = gcontext.WithTimeout(ctx, timeout) + defer cancel() + } + + done := make(chan error, 1) + go func() { + done <- f() + }() + select { + case <-ctx.Done(): + if ctx.Err() == gcontext.DeadlineExceeded { + log.G(ctx).WithField(logfields.Timeout, timeout). + Warning("Syscall did not complete within operation timeout. This may indicate a platform issue. If it appears to be making no forward progress, obtain the stacks and see if there is a syscall stuck in the platform API for a significant length of time.") + } + return ctx.Err() + case err := <-done: + return err + } +} + +func HcsEnumerateComputeSystems(ctx gcontext.Context, query string) (computeSystems, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsEnumerateComputeSystems") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("query", query)) + + return computeSystems, result, execute(ctx, timeout.SyscallWatcher, func() error { + var ( + computeSystemsp *uint16 + resultp *uint16 + ) + err := hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp) + if computeSystemsp != nil { + computeSystems = interop.ConvertAndFreeCoTaskMemString(computeSystemsp) + } + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsCreateComputeSystem(ctx gcontext.Context, id string, configuration string, identity syscall.Handle) (computeSystem HcsSystem, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsCreateComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes( + trace.StringAttribute("id", id), + trace.StringAttribute("configuration", configuration)) + + return computeSystem, result, execute(ctx, timeout.SystemCreate, func() error { + var resultp *uint16 + err := hcsCreateComputeSystem(id, configuration, identity, &computeSystem, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsOpenComputeSystem(ctx gcontext.Context, id string) (computeSystem HcsSystem, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsOpenComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + + return computeSystem, result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsOpenComputeSystem(id, &computeSystem, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsCloseComputeSystem(ctx gcontext.Context, computeSystem HcsSystem) (hr error) { + ctx, span := trace.StartSpan(ctx, "HcsCloseComputeSystem") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return execute(ctx, timeout.SyscallWatcher, func() error { + return hcsCloseComputeSystem(computeSystem) + }) +} + +func HcsStartComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsStartComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SystemStart, func() error { + var resultp *uint16 + err := hcsStartComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsShutdownComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsShutdownComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsShutdownComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsTerminateComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsTerminateComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsTerminateComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsPauseComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsPauseComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SystemPause, func() error { + var resultp *uint16 + err := hcsPauseComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsResumeComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsResumeComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SystemResume, func() error { + var resultp *uint16 + err := hcsResumeComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsGetComputeSystemProperties(ctx gcontext.Context, computeSystem HcsSystem, propertyQuery string) (properties, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsGetComputeSystemProperties") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("propertyQuery", propertyQuery)) + + return properties, result, execute(ctx, timeout.SyscallWatcher, func() error { + var ( + propertiesp *uint16 + resultp *uint16 + ) + err := hcsGetComputeSystemProperties(computeSystem, propertyQuery, &propertiesp, &resultp) + if propertiesp != nil { + properties = interop.ConvertAndFreeCoTaskMemString(propertiesp) + } + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsModifyComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, configuration string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsModifyComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("configuration", configuration)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsModifyComputeSystem(computeSystem, configuration, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsModifyServiceSettings(ctx gcontext.Context, settings string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsModifyServiceSettings") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("settings", settings)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsModifyServiceSettings(settings, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsRegisterComputeSystemCallback(ctx gcontext.Context, computeSystem HcsSystem, callback uintptr, context uintptr) (callbackHandle HcsCallback, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsRegisterComputeSystemCallback") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return callbackHandle, execute(ctx, timeout.SyscallWatcher, func() error { + return hcsRegisterComputeSystemCallback(computeSystem, callback, context, &callbackHandle) + }) +} + +func HcsUnregisterComputeSystemCallback(ctx gcontext.Context, callbackHandle HcsCallback) (hr error) { + ctx, span := trace.StartSpan(ctx, "HcsUnregisterComputeSystemCallback") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return execute(ctx, timeout.SyscallWatcher, func() error { + return hcsUnregisterComputeSystemCallback(callbackHandle) + }) +} + +func HcsCreateProcess(ctx gcontext.Context, computeSystem HcsSystem, processParameters string) (processInformation HcsProcessInformation, process HcsProcess, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsCreateProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("processParameters", processParameters)) + + return processInformation, process, result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsCreateProcess(computeSystem, processParameters, &processInformation, &process, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsOpenProcess(ctx gcontext.Context, computeSystem HcsSystem, pid uint32) (process HcsProcess, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsOpenProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.Int64Attribute("pid", int64(pid))) + + return process, result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsOpenProcess(computeSystem, pid, &process, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsCloseProcess(ctx gcontext.Context, process HcsProcess) (hr error) { + ctx, span := trace.StartSpan(ctx, "HcsCloseProcess") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return execute(ctx, timeout.SyscallWatcher, func() error { + return hcsCloseProcess(process) + }) +} + +func HcsTerminateProcess(ctx gcontext.Context, process HcsProcess) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsTerminateProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsTerminateProcess(process, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsSignalProcess(ctx gcontext.Context, process HcsProcess, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsSignalProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsSignalProcess(process, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsGetProcessInfo(ctx gcontext.Context, process HcsProcess) (processInformation HcsProcessInformation, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsGetProcessInfo") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + + return processInformation, result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsGetProcessInfo(process, &processInformation, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsGetProcessProperties(ctx gcontext.Context, process HcsProcess) (processProperties, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsGetProcessProperties") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + + return processProperties, result, execute(ctx, timeout.SyscallWatcher, func() error { + var ( + processPropertiesp *uint16 + resultp *uint16 + ) + err := hcsGetProcessProperties(process, &processPropertiesp, &resultp) + if processPropertiesp != nil { + processProperties = interop.ConvertAndFreeCoTaskMemString(processPropertiesp) + } + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsModifyProcess(ctx gcontext.Context, process HcsProcess, settings string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsModifyProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("settings", settings)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsModifyProcess(process, settings, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsGetServiceProperties(ctx gcontext.Context, propertyQuery string) (properties, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsGetServiceProperties") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("propertyQuery", propertyQuery)) + + return properties, result, execute(ctx, timeout.SyscallWatcher, func() error { + var ( + propertiesp *uint16 + resultp *uint16 + ) + err := hcsGetServiceProperties(propertyQuery, &propertiesp, &resultp) + if propertiesp != nil { + properties = interop.ConvertAndFreeCoTaskMemString(propertiesp) + } + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsRegisterProcessCallback(ctx gcontext.Context, process HcsProcess, callback uintptr, context uintptr) (callbackHandle HcsCallback, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsRegisterProcessCallback") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return callbackHandle, execute(ctx, timeout.SyscallWatcher, func() error { + return hcsRegisterProcessCallback(process, callback, context, &callbackHandle) + }) +} + +func HcsUnregisterProcessCallback(ctx gcontext.Context, callbackHandle HcsCallback) (hr error) { + ctx, span := trace.StartSpan(ctx, "HcsUnregisterProcessCallback") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return execute(ctx, timeout.SyscallWatcher, func() error { + return hcsUnregisterProcessCallback(callbackHandle) + }) +} + +func HcsSaveComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsSaveComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsSaveComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/zsyscall_windows.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/zsyscall_windows.go new file mode 100644 index 000000000..cae55058d --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/zsyscall_windows.go @@ -0,0 +1,581 @@ +// Code generated mksyscall_windows.exe DO NOT EDIT + +package vmcompute + +import ( + "syscall" + "unsafe" + + "golang.org/x/sys/windows" +) + +var _ unsafe.Pointer + +// Do the interface allocations only once for common +// Errno values. +const ( + errnoERROR_IO_PENDING = 997 +) + +var ( + errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) +) + +// errnoErr returns common boxed Errno values, to prevent +// allocations at runtime. +func errnoErr(e syscall.Errno) error { + switch e { + case 0: + return nil + case errnoERROR_IO_PENDING: + return errERROR_IO_PENDING + } + // TODO: add more here, after collecting data on the common + // error values see on Windows. (perhaps when running + // all.bat?) + return e +} + +var ( + modvmcompute = windows.NewLazySystemDLL("vmcompute.dll") + + procHcsEnumerateComputeSystems = modvmcompute.NewProc("HcsEnumerateComputeSystems") + procHcsCreateComputeSystem = modvmcompute.NewProc("HcsCreateComputeSystem") + procHcsOpenComputeSystem = modvmcompute.NewProc("HcsOpenComputeSystem") + procHcsCloseComputeSystem = modvmcompute.NewProc("HcsCloseComputeSystem") + procHcsStartComputeSystem = modvmcompute.NewProc("HcsStartComputeSystem") + procHcsShutdownComputeSystem = modvmcompute.NewProc("HcsShutdownComputeSystem") + procHcsTerminateComputeSystem = modvmcompute.NewProc("HcsTerminateComputeSystem") + procHcsPauseComputeSystem = modvmcompute.NewProc("HcsPauseComputeSystem") + procHcsResumeComputeSystem = modvmcompute.NewProc("HcsResumeComputeSystem") + procHcsGetComputeSystemProperties = modvmcompute.NewProc("HcsGetComputeSystemProperties") + procHcsModifyComputeSystem = modvmcompute.NewProc("HcsModifyComputeSystem") + procHcsModifyServiceSettings = modvmcompute.NewProc("HcsModifyServiceSettings") + procHcsRegisterComputeSystemCallback = modvmcompute.NewProc("HcsRegisterComputeSystemCallback") + procHcsUnregisterComputeSystemCallback = modvmcompute.NewProc("HcsUnregisterComputeSystemCallback") + procHcsSaveComputeSystem = modvmcompute.NewProc("HcsSaveComputeSystem") + procHcsCreateProcess = modvmcompute.NewProc("HcsCreateProcess") + procHcsOpenProcess = modvmcompute.NewProc("HcsOpenProcess") + procHcsCloseProcess = modvmcompute.NewProc("HcsCloseProcess") + procHcsTerminateProcess = modvmcompute.NewProc("HcsTerminateProcess") + procHcsSignalProcess = modvmcompute.NewProc("HcsSignalProcess") + procHcsGetProcessInfo = modvmcompute.NewProc("HcsGetProcessInfo") + procHcsGetProcessProperties = modvmcompute.NewProc("HcsGetProcessProperties") + procHcsModifyProcess = modvmcompute.NewProc("HcsModifyProcess") + procHcsGetServiceProperties = modvmcompute.NewProc("HcsGetServiceProperties") + procHcsRegisterProcessCallback = modvmcompute.NewProc("HcsRegisterProcessCallback") + procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback") +) + +func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(query) + if hr != nil { + return + } + return _hcsEnumerateComputeSystems(_p0, computeSystems, result) +} + +func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result **uint16) (hr error) { + if hr = procHcsEnumerateComputeSystems.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsEnumerateComputeSystems.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(computeSystems)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(configuration) + if hr != nil { + return + } + return _hcsCreateComputeSystem(_p0, _p1, identity, computeSystem, result) +} + +func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) { + if hr = procHcsCreateComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsCreateComputeSystem.Addr(), 5, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(configuration)), uintptr(identity), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)), 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsOpenComputeSystem(id string, computeSystem *HcsSystem, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _hcsOpenComputeSystem(_p0, computeSystem, result) +} + +func _hcsOpenComputeSystem(id *uint16, computeSystem *HcsSystem, result **uint16) (hr error) { + if hr = procHcsOpenComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsOpenComputeSystem.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsCloseComputeSystem(computeSystem HcsSystem) (hr error) { + if hr = procHcsCloseComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsCloseComputeSystem.Addr(), 1, uintptr(computeSystem), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsStartComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsStartComputeSystem(computeSystem, _p0, result) +} + +func _hcsStartComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { + if hr = procHcsStartComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsStartComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsShutdownComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsShutdownComputeSystem(computeSystem, _p0, result) +} + +func _hcsShutdownComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { + if hr = procHcsShutdownComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsShutdownComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsTerminateComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsTerminateComputeSystem(computeSystem, _p0, result) +} + +func _hcsTerminateComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { + if hr = procHcsTerminateComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsTerminateComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsPauseComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsPauseComputeSystem(computeSystem, _p0, result) +} + +func _hcsPauseComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { + if hr = procHcsPauseComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsPauseComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsResumeComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsResumeComputeSystem(computeSystem, _p0, result) +} + +func _hcsResumeComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { + if hr = procHcsResumeComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsResumeComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(propertyQuery) + if hr != nil { + return + } + return _hcsGetComputeSystemProperties(computeSystem, _p0, properties, result) +} + +func _hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { + if hr = procHcsGetComputeSystemProperties.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsGetComputeSystemProperties.Addr(), 4, uintptr(computeSystem), uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsModifyComputeSystem(computeSystem HcsSystem, configuration string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(configuration) + if hr != nil { + return + } + return _hcsModifyComputeSystem(computeSystem, _p0, result) +} + +func _hcsModifyComputeSystem(computeSystem HcsSystem, configuration *uint16, result **uint16) (hr error) { + if hr = procHcsModifyComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsModifyComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(configuration)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsModifyServiceSettings(settings string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(settings) + if hr != nil { + return + } + return _hcsModifyServiceSettings(_p0, result) +} + +func _hcsModifyServiceSettings(settings *uint16, result **uint16) (hr error) { + if hr = procHcsModifyServiceSettings.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsModifyServiceSettings.Addr(), 2, uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result)), 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsRegisterComputeSystemCallback(computeSystem HcsSystem, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) { + if hr = procHcsRegisterComputeSystemCallback.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsRegisterComputeSystemCallback.Addr(), 4, uintptr(computeSystem), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsUnregisterComputeSystemCallback(callbackHandle HcsCallback) (hr error) { + if hr = procHcsUnregisterComputeSystemCallback.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsUnregisterComputeSystemCallback.Addr(), 1, uintptr(callbackHandle), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsSaveComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsSaveComputeSystem(computeSystem, _p0, result) +} + +func _hcsSaveComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { + if hr = procHcsSaveComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsSaveComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsCreateProcess(computeSystem HcsSystem, processParameters string, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(processParameters) + if hr != nil { + return + } + return _hcsCreateProcess(computeSystem, _p0, processInformation, process, result) +} + +func _hcsCreateProcess(computeSystem HcsSystem, processParameters *uint16, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) { + if hr = procHcsCreateProcess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsCreateProcess.Addr(), 5, uintptr(computeSystem), uintptr(unsafe.Pointer(processParameters)), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsOpenProcess(computeSystem HcsSystem, pid uint32, process *HcsProcess, result **uint16) (hr error) { + if hr = procHcsOpenProcess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsOpenProcess.Addr(), 4, uintptr(computeSystem), uintptr(pid), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsCloseProcess(process HcsProcess) (hr error) { + if hr = procHcsCloseProcess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsCloseProcess.Addr(), 1, uintptr(process), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsTerminateProcess(process HcsProcess, result **uint16) (hr error) { + if hr = procHcsTerminateProcess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 2, uintptr(process), uintptr(unsafe.Pointer(result)), 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsSignalProcess(process HcsProcess, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsSignalProcess(process, _p0, result) +} + +func _hcsSignalProcess(process HcsProcess, options *uint16, result **uint16) (hr error) { + if hr = procHcsSignalProcess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsSignalProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsGetProcessInfo(process HcsProcess, processInformation *HcsProcessInformation, result **uint16) (hr error) { + if hr = procHcsGetProcessInfo.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsGetProcessInfo.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsGetProcessProperties(process HcsProcess, processProperties **uint16, result **uint16) (hr error) { + if hr = procHcsGetProcessProperties.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsGetProcessProperties.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processProperties)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsModifyProcess(process HcsProcess, settings string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(settings) + if hr != nil { + return + } + return _hcsModifyProcess(process, _p0, result) +} + +func _hcsModifyProcess(process HcsProcess, settings *uint16, result **uint16) (hr error) { + if hr = procHcsModifyProcess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsModifyProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(propertyQuery) + if hr != nil { + return + } + return _hcsGetServiceProperties(_p0, properties, result) +} + +func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { + if hr = procHcsGetServiceProperties.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsGetServiceProperties.Addr(), 3, uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsRegisterProcessCallback(process HcsProcess, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) { + if hr = procHcsRegisterProcessCallback.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsRegisterProcessCallback.Addr(), 4, uintptr(process), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsUnregisterProcessCallback(callbackHandle HcsCallback) (hr error) { + if hr = procHcsUnregisterProcessCallback.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsUnregisterProcessCallback.Addr(), 1, uintptr(callbackHandle), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/activatelayer.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/activatelayer.go new file mode 100644 index 000000000..5debe974d --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/activatelayer.go @@ -0,0 +1,27 @@ +package wclayer + +import ( + "context" + + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/Microsoft/hcsshim/internal/oc" + "go.opencensus.io/trace" +) + +// ActivateLayer will find the layer with the given id and mount it's filesystem. +// For a read/write layer, the mounted filesystem will appear as a volume on the +// host, while a read-only layer is generally expected to be a no-op. +// An activated layer must later be deactivated via DeactivateLayer. +func ActivateLayer(ctx context.Context, path string) (err error) { + title := "hcsshim::ActivateLayer" + ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("path", path)) + + err = activateLayer(&stdDriverInfo, path) + if err != nil { + return hcserror.New(err, title, "") + } + return nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/baselayer.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/baselayer.go new file mode 100644 index 000000000..3ec708d1e --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/baselayer.go @@ -0,0 +1,182 @@ +package wclayer + +import ( + "context" + "errors" + "os" + "path/filepath" + "syscall" + + "github.com/Microsoft/go-winio" + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/Microsoft/hcsshim/internal/oc" + "github.com/Microsoft/hcsshim/internal/safefile" + "github.com/Microsoft/hcsshim/internal/winapi" + "go.opencensus.io/trace" +) + +type baseLayerWriter struct { + ctx context.Context + s *trace.Span + + root *os.File + f *os.File + bw *winio.BackupFileWriter + err error + hasUtilityVM bool + dirInfo []dirInfo +} + +type dirInfo struct { + path string + fileInfo winio.FileBasicInfo +} + +// reapplyDirectoryTimes reapplies directory modification, creation, etc. times +// after processing of the directory tree has completed. The times are expected +// to be ordered such that parent directories come before child directories. +func reapplyDirectoryTimes(root *os.File, dis []dirInfo) error { + for i := range dis { + di := &dis[len(dis)-i-1] // reverse order: process child directories first + f, err := safefile.OpenRelative(di.path, root, syscall.GENERIC_READ|syscall.GENERIC_WRITE, syscall.FILE_SHARE_READ, winapi.FILE_OPEN, winapi.FILE_DIRECTORY_FILE|syscall.FILE_FLAG_OPEN_REPARSE_POINT) + if err != nil { + return err + } + + err = winio.SetFileBasicInfo(f, &di.fileInfo) + f.Close() + if err != nil { + return err + } + + } + return nil +} + +func (w *baseLayerWriter) closeCurrentFile() error { + if w.f != nil { + err := w.bw.Close() + err2 := w.f.Close() + w.f = nil + w.bw = nil + if err != nil { + return err + } + if err2 != nil { + return err2 + } + } + return nil +} + +func (w *baseLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) (err error) { + defer func() { + if err != nil { + w.err = err + } + }() + + err = w.closeCurrentFile() + if err != nil { + return err + } + + if filepath.ToSlash(name) == `UtilityVM/Files` { + w.hasUtilityVM = true + } + + var f *os.File + defer func() { + if f != nil { + f.Close() + } + }() + + extraFlags := uint32(0) + if fileInfo.FileAttributes&syscall.FILE_ATTRIBUTE_DIRECTORY != 0 { + extraFlags |= winapi.FILE_DIRECTORY_FILE + w.dirInfo = append(w.dirInfo, dirInfo{name, *fileInfo}) + } + + mode := uint32(syscall.GENERIC_READ | syscall.GENERIC_WRITE | winio.WRITE_DAC | winio.WRITE_OWNER | winio.ACCESS_SYSTEM_SECURITY) + f, err = safefile.OpenRelative(name, w.root, mode, syscall.FILE_SHARE_READ, winapi.FILE_CREATE, extraFlags) + if err != nil { + return hcserror.New(err, "Failed to safefile.OpenRelative", name) + } + + err = winio.SetFileBasicInfo(f, fileInfo) + if err != nil { + return hcserror.New(err, "Failed to SetFileBasicInfo", name) + } + + w.f = f + w.bw = winio.NewBackupFileWriter(f, true) + f = nil + return nil +} + +func (w *baseLayerWriter) AddLink(name string, target string) (err error) { + defer func() { + if err != nil { + w.err = err + } + }() + + err = w.closeCurrentFile() + if err != nil { + return err + } + + return safefile.LinkRelative(target, w.root, name, w.root) +} + +func (w *baseLayerWriter) Remove(name string) error { + return errors.New("base layer cannot have tombstones") +} + +func (w *baseLayerWriter) Write(b []byte) (int, error) { + n, err := w.bw.Write(b) + if err != nil { + w.err = err + } + return n, err +} + +func (w *baseLayerWriter) Close() (err error) { + defer w.s.End() + defer func() { oc.SetSpanStatus(w.s, err) }() + defer func() { + w.root.Close() + w.root = nil + }() + + err = w.closeCurrentFile() + if err != nil { + return err + } + if w.err == nil { + // Restore the file times of all the directories, since they may have + // been modified by creating child directories. + err = reapplyDirectoryTimes(w.root, w.dirInfo) + if err != nil { + return err + } + + err = ProcessBaseLayer(w.ctx, w.root.Name()) + if err != nil { + return err + } + + if w.hasUtilityVM { + err := safefile.EnsureNotReparsePointRelative("UtilityVM", w.root) + if err != nil { + return err + } + err = ProcessUtilityVMImage(w.ctx, filepath.Join(w.root.Name(), "UtilityVM")) + if err != nil { + return err + } + } + } + return w.err +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createlayer.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createlayer.go new file mode 100644 index 000000000..480aee872 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createlayer.go @@ -0,0 +1,27 @@ +package wclayer + +import ( + "context" + + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/Microsoft/hcsshim/internal/oc" + "go.opencensus.io/trace" +) + +// CreateLayer creates a new, empty, read-only layer on the filesystem based on +// the parent layer provided. +func CreateLayer(ctx context.Context, path, parent string) (err error) { + title := "hcsshim::CreateLayer" + ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("path", path), + trace.StringAttribute("parent", parent)) + + err = createLayer(&stdDriverInfo, path, parent) + if err != nil { + return hcserror.New(err, title, "") + } + return nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createscratchlayer.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createscratchlayer.go new file mode 100644 index 000000000..131aa94f1 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createscratchlayer.go @@ -0,0 +1,34 @@ +package wclayer + +import ( + "context" + "strings" + + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/Microsoft/hcsshim/internal/oc" + "go.opencensus.io/trace" +) + +// CreateScratchLayer creates and populates new read-write layer for use by a container. +// This requires the full list of paths to all parent layers up to the base +func CreateScratchLayer(ctx context.Context, path string, parentLayerPaths []string) (err error) { + title := "hcsshim::CreateScratchLayer" + ctx, span := trace.StartSpan(ctx, title) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("path", path), + trace.StringAttribute("parentLayerPaths", strings.Join(parentLayerPaths, ", "))) + + // Generate layer descriptors + layers, err := layerPathsToDescriptors(ctx, parentLayerPaths) + if err != nil { + return err + } + + err = createSandboxLayer(&stdDriverInfo, path, 0, layers) + if err != nil { + return hcserror.New(err, title, "") + } + return nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/deactivatelayer.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/deactivatelayer.go new file mode 100644 index 000000000..d5bf2f5bd --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/deactivatelayer.go @@ -0,0 +1,24 @@ +package wclayer + +import ( + "context" + + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/Microsoft/hcsshim/internal/oc" + "go.opencensus.io/trace" +) + +// DeactivateLayer will dismount a layer that was mounted via ActivateLayer. +func DeactivateLayer(ctx context.Context, path string) (err error) { + title := "hcsshim::DeactivateLayer" + ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("path", path)) + + err = deactivateLayer(&stdDriverInfo, path) + if err != nil { + return hcserror.New(err, title+"- failed", "") + } + return nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/destroylayer.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/destroylayer.go new file mode 100644 index 000000000..424467ac3 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/destroylayer.go @@ -0,0 +1,25 @@ +package wclayer + +import ( + "context" + + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/Microsoft/hcsshim/internal/oc" + "go.opencensus.io/trace" +) + +// DestroyLayer will remove the on-disk files representing the layer with the given +// path, including that layer's containing folder, if any. +func DestroyLayer(ctx context.Context, path string) (err error) { + title := "hcsshim::DestroyLayer" + ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("path", path)) + + err = destroyLayer(&stdDriverInfo, path) + if err != nil { + return hcserror.New(err, title, "") + } + return nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go new file mode 100644 index 000000000..035c9041e --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go @@ -0,0 +1,140 @@ +package wclayer + +import ( + "context" + "os" + "path/filepath" + "syscall" + "unsafe" + + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/Microsoft/hcsshim/internal/oc" + "github.com/Microsoft/hcsshim/osversion" + "go.opencensus.io/trace" +) + +// ExpandScratchSize expands the size of a layer to at least size bytes. +func ExpandScratchSize(ctx context.Context, path string, size uint64) (err error) { + title := "hcsshim::ExpandScratchSize" + ctx, span := trace.StartSpan(ctx, title) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("path", path), + trace.Int64Attribute("size", int64(size))) + + err = expandSandboxSize(&stdDriverInfo, path, size) + if err != nil { + return hcserror.New(err, title, "") + } + + // Manually expand the volume now in order to work around bugs in 19H1 and + // prerelease versions of Vb. Remove once this is fixed in Windows. + if build := osversion.Build(); build >= osversion.V19H1 && build < 19020 { + err = expandSandboxVolume(ctx, path) + if err != nil { + return err + } + } + return nil +} + +type virtualStorageType struct { + DeviceID uint32 + VendorID [16]byte +} + +type openVersion2 struct { + GetInfoOnly int32 // bool but 4-byte aligned + ReadOnly int32 // bool but 4-byte aligned + ResiliencyGUID [16]byte // GUID +} + +type openVirtualDiskParameters struct { + Version uint32 // Must always be set to 2 + Version2 openVersion2 +} + +func attachVhd(path string) (syscall.Handle, error) { + var ( + defaultType virtualStorageType + handle syscall.Handle + ) + parameters := openVirtualDiskParameters{Version: 2} + err := openVirtualDisk( + &defaultType, + path, + 0, + 0, + ¶meters, + &handle) + if err != nil { + return 0, &os.PathError{Op: "OpenVirtualDisk", Path: path, Err: err} + } + err = attachVirtualDisk(handle, 0, 0, 0, 0, 0) + if err != nil { + syscall.Close(handle) + return 0, &os.PathError{Op: "AttachVirtualDisk", Path: path, Err: err} + } + return handle, nil +} + +func expandSandboxVolume(ctx context.Context, path string) error { + // Mount the sandbox VHD temporarily. + vhdPath := filepath.Join(path, "sandbox.vhdx") + vhd, err := attachVhd(vhdPath) + if err != nil { + return &os.PathError{Op: "OpenVirtualDisk", Path: vhdPath, Err: err} + } + defer syscall.Close(vhd) + + // Open the volume. + volumePath, err := GetLayerMountPath(ctx, path) + if err != nil { + return err + } + if volumePath[len(volumePath)-1] == '\\' { + volumePath = volumePath[:len(volumePath)-1] + } + volume, err := os.OpenFile(volumePath, os.O_RDWR, 0) + if err != nil { + return err + } + defer volume.Close() + + // Get the volume's underlying partition size in NTFS clusters. + var ( + partitionSize int64 + bytes uint32 + ) + const _IOCTL_DISK_GET_LENGTH_INFO = 0x0007405C + err = syscall.DeviceIoControl(syscall.Handle(volume.Fd()), _IOCTL_DISK_GET_LENGTH_INFO, nil, 0, (*byte)(unsafe.Pointer(&partitionSize)), 8, &bytes, nil) + if err != nil { + return &os.PathError{Op: "IOCTL_DISK_GET_LENGTH_INFO", Path: volume.Name(), Err: err} + } + const ( + clusterSize = 4096 + sectorSize = 512 + ) + targetClusters := partitionSize / clusterSize + + // Get the volume's current size in NTFS clusters. + var volumeSize int64 + err = getDiskFreeSpaceEx(volume.Name()+"\\", nil, &volumeSize, nil) + if err != nil { + return &os.PathError{Op: "GetDiskFreeSpaceEx", Path: volume.Name(), Err: err} + } + volumeClusters := volumeSize / clusterSize + + // Only resize the volume if there is space to grow, otherwise this will + // fail with invalid parameter. NTFS reserves one cluster. + if volumeClusters+1 < targetClusters { + targetSectors := targetClusters * (clusterSize / sectorSize) + const _FSCTL_EXTEND_VOLUME = 0x000900F0 + err = syscall.DeviceIoControl(syscall.Handle(volume.Fd()), _FSCTL_EXTEND_VOLUME, (*byte)(unsafe.Pointer(&targetSectors)), 8, nil, 0, &bytes, nil) + if err != nil { + return &os.PathError{Op: "FSCTL_EXTEND_VOLUME", Path: volume.Name(), Err: err} + } + } + return nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/exportlayer.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/exportlayer.go new file mode 100644 index 000000000..97b27eb7d --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/exportlayer.go @@ -0,0 +1,94 @@ +package wclayer + +import ( + "context" + "io/ioutil" + "os" + "strings" + + "github.com/Microsoft/go-winio" + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/Microsoft/hcsshim/internal/oc" + "go.opencensus.io/trace" +) + +// ExportLayer will create a folder at exportFolderPath and fill that folder with +// the transport format version of the layer identified by layerId. This transport +// format includes any metadata required for later importing the layer (using +// ImportLayer), and requires the full list of parent layer paths in order to +// perform the export. +func ExportLayer(ctx context.Context, path string, exportFolderPath string, parentLayerPaths []string) (err error) { + title := "hcsshim::ExportLayer" + ctx, span := trace.StartSpan(ctx, title) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("path", path), + trace.StringAttribute("exportFolderPath", exportFolderPath), + trace.StringAttribute("parentLayerPaths", strings.Join(parentLayerPaths, ", "))) + + // Generate layer descriptors + layers, err := layerPathsToDescriptors(ctx, parentLayerPaths) + if err != nil { + return err + } + + err = exportLayer(&stdDriverInfo, path, exportFolderPath, layers) + if err != nil { + return hcserror.New(err, title, "") + } + return nil +} + +type LayerReader interface { + Next() (string, int64, *winio.FileBasicInfo, error) + Read(b []byte) (int, error) + Close() error +} + +// NewLayerReader returns a new layer reader for reading the contents of an on-disk layer. +// The caller must have taken the SeBackupPrivilege privilege +// to call this and any methods on the resulting LayerReader. +func NewLayerReader(ctx context.Context, path string, parentLayerPaths []string) (_ LayerReader, err error) { + ctx, span := trace.StartSpan(ctx, "hcsshim::NewLayerReader") + defer func() { + if err != nil { + oc.SetSpanStatus(span, err) + span.End() + } + }() + span.AddAttributes( + trace.StringAttribute("path", path), + trace.StringAttribute("parentLayerPaths", strings.Join(parentLayerPaths, ", "))) + + exportPath, err := ioutil.TempDir("", "hcs") + if err != nil { + return nil, err + } + err = ExportLayer(ctx, path, exportPath, parentLayerPaths) + if err != nil { + os.RemoveAll(exportPath) + return nil, err + } + return &legacyLayerReaderWrapper{ + ctx: ctx, + s: span, + legacyLayerReader: newLegacyLayerReader(exportPath), + }, nil +} + +type legacyLayerReaderWrapper struct { + ctx context.Context + s *trace.Span + + *legacyLayerReader +} + +func (r *legacyLayerReaderWrapper) Close() (err error) { + defer r.s.End() + defer func() { oc.SetSpanStatus(r.s, err) }() + + err = r.legacyLayerReader.Close() + os.RemoveAll(r.root) + return err +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getlayermountpath.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getlayermountpath.go new file mode 100644 index 000000000..8d213f587 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getlayermountpath.go @@ -0,0 +1,50 @@ +package wclayer + +import ( + "context" + "syscall" + + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/Microsoft/hcsshim/internal/log" + "github.com/Microsoft/hcsshim/internal/oc" + "go.opencensus.io/trace" +) + +// GetLayerMountPath will look for a mounted layer with the given path and return +// the path at which that layer can be accessed. This path may be a volume path +// if the layer is a mounted read-write layer, otherwise it is expected to be the +// folder path at which the layer is stored. +func GetLayerMountPath(ctx context.Context, path string) (_ string, err error) { + title := "hcsshim::GetLayerMountPath" + ctx, span := trace.StartSpan(ctx, title) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("path", path)) + + var mountPathLength uintptr = 0 + + // Call the procedure itself. + log.G(ctx).Debug("Calling proc (1)") + err = getLayerMountPath(&stdDriverInfo, path, &mountPathLength, nil) + if err != nil { + return "", hcserror.New(err, title, "(first call)") + } + + // Allocate a mount path of the returned length. + if mountPathLength == 0 { + return "", nil + } + mountPathp := make([]uint16, mountPathLength) + mountPathp[0] = 0 + + // Call the procedure again + log.G(ctx).Debug("Calling proc (2)") + err = getLayerMountPath(&stdDriverInfo, path, &mountPathLength, &mountPathp[0]) + if err != nil { + return "", hcserror.New(err, title, "(second call)") + } + + mountPath := syscall.UTF16ToString(mountPathp[0:]) + span.AddAttributes(trace.StringAttribute("mountPath", mountPath)) + return mountPath, nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getsharedbaseimages.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getsharedbaseimages.go new file mode 100644 index 000000000..ae1fff840 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getsharedbaseimages.go @@ -0,0 +1,29 @@ +package wclayer + +import ( + "context" + + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/Microsoft/hcsshim/internal/interop" + "github.com/Microsoft/hcsshim/internal/oc" + "go.opencensus.io/trace" +) + +// GetSharedBaseImages will enumerate the images stored in the common central +// image store and return descriptive info about those images for the purpose +// of registering them with the graphdriver, graph, and tagstore. +func GetSharedBaseImages(ctx context.Context) (_ string, err error) { + title := "hcsshim::GetSharedBaseImages" + ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + + var buffer *uint16 + err = getBaseImages(&buffer) + if err != nil { + return "", hcserror.New(err, title, "") + } + imageData := interop.ConvertAndFreeCoTaskMemString(buffer) + span.AddAttributes(trace.StringAttribute("imageData", imageData)) + return imageData, nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/grantvmaccess.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/grantvmaccess.go new file mode 100644 index 000000000..4b282fef9 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/grantvmaccess.go @@ -0,0 +1,26 @@ +package wclayer + +import ( + "context" + + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/Microsoft/hcsshim/internal/oc" + "go.opencensus.io/trace" +) + +// GrantVmAccess adds access to a file for a given VM +func GrantVmAccess(ctx context.Context, vmid string, filepath string) (err error) { + title := "hcsshim::GrantVmAccess" + ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("vm-id", vmid), + trace.StringAttribute("path", filepath)) + + err = grantVmAccess(vmid, filepath) + if err != nil { + return hcserror.New(err, title, "") + } + return nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/importlayer.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/importlayer.go new file mode 100644 index 000000000..687550f0b --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/importlayer.go @@ -0,0 +1,166 @@ +package wclayer + +import ( + "context" + "io/ioutil" + "os" + "path/filepath" + "strings" + + "github.com/Microsoft/go-winio" + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/Microsoft/hcsshim/internal/oc" + "github.com/Microsoft/hcsshim/internal/safefile" + "go.opencensus.io/trace" +) + +// ImportLayer will take the contents of the folder at importFolderPath and import +// that into a layer with the id layerId. Note that in order to correctly populate +// the layer and interperet the transport format, all parent layers must already +// be present on the system at the paths provided in parentLayerPaths. +func ImportLayer(ctx context.Context, path string, importFolderPath string, parentLayerPaths []string) (err error) { + title := "hcsshim::ImportLayer" + ctx, span := trace.StartSpan(ctx, title) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("path", path), + trace.StringAttribute("importFolderPath", importFolderPath), + trace.StringAttribute("parentLayerPaths", strings.Join(parentLayerPaths, ", "))) + + // Generate layer descriptors + layers, err := layerPathsToDescriptors(ctx, parentLayerPaths) + if err != nil { + return err + } + + err = importLayer(&stdDriverInfo, path, importFolderPath, layers) + if err != nil { + return hcserror.New(err, title, "") + } + return nil +} + +// LayerWriter is an interface that supports writing a new container image layer. +type LayerWriter interface { + // Add adds a file to the layer with given metadata. + Add(name string, fileInfo *winio.FileBasicInfo) error + // AddLink adds a hard link to the layer. The target must already have been added. + AddLink(name string, target string) error + // Remove removes a file that was present in a parent layer from the layer. + Remove(name string) error + // Write writes data to the current file. The data must be in the format of a Win32 + // backup stream. + Write(b []byte) (int, error) + // Close finishes the layer writing process and releases any resources. + Close() error +} + +type legacyLayerWriterWrapper struct { + ctx context.Context + s *trace.Span + + *legacyLayerWriter + path string + parentLayerPaths []string +} + +func (r *legacyLayerWriterWrapper) Close() (err error) { + defer r.s.End() + defer func() { oc.SetSpanStatus(r.s, err) }() + defer os.RemoveAll(r.root.Name()) + defer r.legacyLayerWriter.CloseRoots() + + err = r.legacyLayerWriter.Close() + if err != nil { + return err + } + + if err = ImportLayer(r.ctx, r.destRoot.Name(), r.path, r.parentLayerPaths); err != nil { + return err + } + for _, name := range r.Tombstones { + if err = safefile.RemoveRelative(name, r.destRoot); err != nil && !os.IsNotExist(err) { + return err + } + } + // Add any hard links that were collected. + for _, lnk := range r.PendingLinks { + if err = safefile.RemoveRelative(lnk.Path, r.destRoot); err != nil && !os.IsNotExist(err) { + return err + } + if err = safefile.LinkRelative(lnk.Target, lnk.TargetRoot, lnk.Path, r.destRoot); err != nil { + return err + } + } + + // The reapplyDirectoryTimes must be called AFTER we are done with Tombstone + // deletion and hard link creation. This is because Tombstone deletion and hard link + // creation updates the directory last write timestamps so that will change the + // timestamps added by the `Add` call. Some container applications depend on the + // correctness of these timestamps and so we should change the timestamps back to + // the original value (i.e the value provided in the Add call) after this + // processing is done. + err = reapplyDirectoryTimes(r.destRoot, r.changedDi) + if err != nil { + return err + } + + // Prepare the utility VM for use if one is present in the layer. + if r.HasUtilityVM { + err := safefile.EnsureNotReparsePointRelative("UtilityVM", r.destRoot) + if err != nil { + return err + } + err = ProcessUtilityVMImage(r.ctx, filepath.Join(r.destRoot.Name(), "UtilityVM")) + if err != nil { + return err + } + } + return nil +} + +// NewLayerWriter returns a new layer writer for creating a layer on disk. +// The caller must have taken the SeBackupPrivilege and SeRestorePrivilege privileges +// to call this and any methods on the resulting LayerWriter. +func NewLayerWriter(ctx context.Context, path string, parentLayerPaths []string) (_ LayerWriter, err error) { + ctx, span := trace.StartSpan(ctx, "hcsshim::NewLayerWriter") + defer func() { + if err != nil { + oc.SetSpanStatus(span, err) + span.End() + } + }() + span.AddAttributes( + trace.StringAttribute("path", path), + trace.StringAttribute("parentLayerPaths", strings.Join(parentLayerPaths, ", "))) + + if len(parentLayerPaths) == 0 { + // This is a base layer. It gets imported differently. + f, err := safefile.OpenRoot(path) + if err != nil { + return nil, err + } + return &baseLayerWriter{ + ctx: ctx, + s: span, + root: f, + }, nil + } + + importPath, err := ioutil.TempDir("", "hcs") + if err != nil { + return nil, err + } + w, err := newLegacyLayerWriter(importPath, parentLayerPaths, path) + if err != nil { + return nil, err + } + return &legacyLayerWriterWrapper{ + ctx: ctx, + s: span, + legacyLayerWriter: w, + path: importPath, + parentLayerPaths: parentLayerPaths, + }, nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerexists.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerexists.go new file mode 100644 index 000000000..01e672339 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerexists.go @@ -0,0 +1,28 @@ +package wclayer + +import ( + "context" + + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/Microsoft/hcsshim/internal/oc" + "go.opencensus.io/trace" +) + +// LayerExists will return true if a layer with the given id exists and is known +// to the system. +func LayerExists(ctx context.Context, path string) (_ bool, err error) { + title := "hcsshim::LayerExists" + ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("path", path)) + + // Call the procedure itself. + var exists uint32 + err = layerExists(&stdDriverInfo, path, &exists) + if err != nil { + return false, hcserror.New(err, title, "") + } + span.AddAttributes(trace.BoolAttribute("layer-exists", exists != 0)) + return exists != 0, nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go new file mode 100644 index 000000000..0ce34a30f --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go @@ -0,0 +1,22 @@ +package wclayer + +import ( + "context" + "path/filepath" + + "github.com/Microsoft/go-winio/pkg/guid" + "github.com/Microsoft/hcsshim/internal/oc" + "go.opencensus.io/trace" +) + +// LayerID returns the layer ID of a layer on disk. +func LayerID(ctx context.Context, path string) (_ guid.GUID, err error) { + title := "hcsshim::LayerID" + ctx, span := trace.StartSpan(ctx, title) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("path", path)) + + _, file := filepath.Split(path) + return NameToGuid(ctx, file) +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go new file mode 100644 index 000000000..1ec893c6a --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go @@ -0,0 +1,97 @@ +package wclayer + +// This file contains utility functions to support storage (graph) related +// functionality. + +import ( + "context" + "syscall" + + "github.com/Microsoft/go-winio/pkg/guid" + "github.com/sirupsen/logrus" +) + +/* To pass into syscall, we need a struct matching the following: +enum GraphDriverType +{ + DiffDriver, + FilterDriver +}; + +struct DriverInfo { + GraphDriverType Flavour; + LPCWSTR HomeDir; +}; +*/ + +type driverInfo struct { + Flavour int + HomeDirp *uint16 +} + +var ( + utf16EmptyString uint16 + stdDriverInfo = driverInfo{1, &utf16EmptyString} +) + +/* To pass into syscall, we need a struct matching the following: +typedef struct _WC_LAYER_DESCRIPTOR { + + // + // The ID of the layer + // + + GUID LayerId; + + // + // Additional flags + // + + union { + struct { + ULONG Reserved : 31; + ULONG Dirty : 1; // Created from sandbox as a result of snapshot + }; + ULONG Value; + } Flags; + + // + // Path to the layer root directory, null-terminated + // + + PCWSTR Path; + +} WC_LAYER_DESCRIPTOR, *PWC_LAYER_DESCRIPTOR; +*/ +type WC_LAYER_DESCRIPTOR struct { + LayerId guid.GUID + Flags uint32 + Pathp *uint16 +} + +func layerPathsToDescriptors(ctx context.Context, parentLayerPaths []string) ([]WC_LAYER_DESCRIPTOR, error) { + // Array of descriptors that gets constructed. + var layers []WC_LAYER_DESCRIPTOR + + for i := 0; i < len(parentLayerPaths); i++ { + g, err := LayerID(ctx, parentLayerPaths[i]) + if err != nil { + logrus.WithError(err).Debug("Failed to convert name to guid") + return nil, err + } + + p, err := syscall.UTF16PtrFromString(parentLayerPaths[i]) + if err != nil { + logrus.WithError(err).Debug("Failed conversion of parentLayerPath to pointer") + return nil, err + } + + layers = append(layers, WC_LAYER_DESCRIPTOR{ + LayerId: g, + Flags: 0, + Pathp: p, + }) + } + + return layers, nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/legacy.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/legacy.go new file mode 100644 index 000000000..b7f3064f2 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/legacy.go @@ -0,0 +1,811 @@ +package wclayer + +import ( + "bufio" + "encoding/binary" + "errors" + "fmt" + "io" + "io/ioutil" + "os" + "path/filepath" + "strings" + "syscall" + + "github.com/Microsoft/go-winio" + "github.com/Microsoft/hcsshim/internal/longpath" + "github.com/Microsoft/hcsshim/internal/safefile" + "github.com/Microsoft/hcsshim/internal/winapi" +) + +var errorIterationCanceled = errors.New("") + +var mutatedUtilityVMFiles = map[string]bool{ + `EFI\Microsoft\Boot\BCD`: true, + `EFI\Microsoft\Boot\BCD.LOG`: true, + `EFI\Microsoft\Boot\BCD.LOG1`: true, + `EFI\Microsoft\Boot\BCD.LOG2`: true, +} + +const ( + filesPath = `Files` + hivesPath = `Hives` + utilityVMPath = `UtilityVM` + utilityVMFilesPath = `UtilityVM\Files` +) + +func openFileOrDir(path string, mode uint32, createDisposition uint32) (file *os.File, err error) { + return winio.OpenForBackup(path, mode, syscall.FILE_SHARE_READ, createDisposition) +} + +func hasPathPrefix(p, prefix string) bool { + return strings.HasPrefix(p, prefix) && len(p) > len(prefix) && p[len(prefix)] == '\\' +} + +type fileEntry struct { + path string + fi os.FileInfo + err error +} + +type legacyLayerReader struct { + root string + result chan *fileEntry + proceed chan bool + currentFile *os.File + backupReader *winio.BackupFileReader +} + +// newLegacyLayerReader returns a new LayerReader that can read the Windows +// container layer transport format from disk. +func newLegacyLayerReader(root string) *legacyLayerReader { + r := &legacyLayerReader{ + root: root, + result: make(chan *fileEntry), + proceed: make(chan bool), + } + go r.walk() + return r +} + +func readTombstones(path string) (map[string]([]string), error) { + tf, err := os.Open(filepath.Join(path, "tombstones.txt")) + if err != nil { + return nil, err + } + defer tf.Close() + s := bufio.NewScanner(tf) + if !s.Scan() || s.Text() != "\xef\xbb\xbfVersion 1.0" { + return nil, errors.New("invalid tombstones file") + } + + ts := make(map[string]([]string)) + for s.Scan() { + t := filepath.Join(filesPath, s.Text()[1:]) // skip leading `\` + dir := filepath.Dir(t) + ts[dir] = append(ts[dir], t) + } + if err = s.Err(); err != nil { + return nil, err + } + + return ts, nil +} + +func (r *legacyLayerReader) walkUntilCancelled() error { + root, err := longpath.LongAbs(r.root) + if err != nil { + return err + } + + r.root = root + ts, err := readTombstones(r.root) + if err != nil { + return err + } + + err = filepath.Walk(r.root, func(path string, info os.FileInfo, err error) error { + if err != nil { + return err + } + + // Indirect fix for https://github.com/moby/moby/issues/32838#issuecomment-343610048. + // Handle failure from what may be a golang bug in the conversion of + // UTF16 to UTF8 in files which are left in the recycle bin. Os.Lstat + // which is called by filepath.Walk will fail when a filename contains + // unicode characters. Skip the recycle bin regardless which is goodness. + if strings.EqualFold(path, filepath.Join(r.root, `Files\$Recycle.Bin`)) && info.IsDir() { + return filepath.SkipDir + } + + if path == r.root || path == filepath.Join(r.root, "tombstones.txt") || strings.HasSuffix(path, ".$wcidirs$") { + return nil + } + + r.result <- &fileEntry{path, info, nil} + if !<-r.proceed { + return errorIterationCanceled + } + + // List all the tombstones. + if info.IsDir() { + relPath, err := filepath.Rel(r.root, path) + if err != nil { + return err + } + if dts, ok := ts[relPath]; ok { + for _, t := range dts { + r.result <- &fileEntry{filepath.Join(r.root, t), nil, nil} + if !<-r.proceed { + return errorIterationCanceled + } + } + } + } + return nil + }) + if err == errorIterationCanceled { + return nil + } + if err == nil { + return io.EOF + } + return err +} + +func (r *legacyLayerReader) walk() { + defer close(r.result) + if !<-r.proceed { + return + } + + err := r.walkUntilCancelled() + if err != nil { + for { + r.result <- &fileEntry{err: err} + if !<-r.proceed { + return + } + } + } +} + +func (r *legacyLayerReader) reset() { + if r.backupReader != nil { + r.backupReader.Close() + r.backupReader = nil + } + if r.currentFile != nil { + r.currentFile.Close() + r.currentFile = nil + } +} + +func findBackupStreamSize(r io.Reader) (int64, error) { + br := winio.NewBackupStreamReader(r) + for { + hdr, err := br.Next() + if err != nil { + if err == io.EOF { + err = nil + } + return 0, err + } + if hdr.Id == winio.BackupData { + return hdr.Size, nil + } + } +} + +func (r *legacyLayerReader) Next() (path string, size int64, fileInfo *winio.FileBasicInfo, err error) { + r.reset() + r.proceed <- true + fe := <-r.result + if fe == nil { + err = errors.New("LegacyLayerReader closed") + return + } + if fe.err != nil { + err = fe.err + return + } + + path, err = filepath.Rel(r.root, fe.path) + if err != nil { + return + } + + if fe.fi == nil { + // This is a tombstone. Return a nil fileInfo. + return + } + + if fe.fi.IsDir() && hasPathPrefix(path, filesPath) { + fe.path += ".$wcidirs$" + } + + f, err := openFileOrDir(fe.path, syscall.GENERIC_READ, syscall.OPEN_EXISTING) + if err != nil { + return + } + defer func() { + if f != nil { + f.Close() + } + }() + + fileInfo, err = winio.GetFileBasicInfo(f) + if err != nil { + return + } + + if !hasPathPrefix(path, filesPath) { + size = fe.fi.Size() + r.backupReader = winio.NewBackupFileReader(f, false) + if path == hivesPath || path == filesPath { + // The Hives directory has a non-deterministic file time because of the + // nature of the import process. Use the times from System_Delta. + var g *os.File + g, err = os.Open(filepath.Join(r.root, hivesPath, `System_Delta`)) + if err != nil { + return + } + attr := fileInfo.FileAttributes + fileInfo, err = winio.GetFileBasicInfo(g) + g.Close() + if err != nil { + return + } + fileInfo.FileAttributes = attr + } + + // The creation time and access time get reset for files outside of the Files path. + fileInfo.CreationTime = fileInfo.LastWriteTime + fileInfo.LastAccessTime = fileInfo.LastWriteTime + + } else { + // The file attributes are written before the backup stream. + var attr uint32 + err = binary.Read(f, binary.LittleEndian, &attr) + if err != nil { + return + } + fileInfo.FileAttributes = attr + beginning := int64(4) + + // Find the accurate file size. + if !fe.fi.IsDir() { + size, err = findBackupStreamSize(f) + if err != nil { + err = &os.PathError{Op: "findBackupStreamSize", Path: fe.path, Err: err} + return + } + } + + // Return back to the beginning of the backup stream. + _, err = f.Seek(beginning, 0) + if err != nil { + return + } + } + + r.currentFile = f + f = nil + return +} + +func (r *legacyLayerReader) Read(b []byte) (int, error) { + if r.backupReader == nil { + if r.currentFile == nil { + return 0, io.EOF + } + return r.currentFile.Read(b) + } + return r.backupReader.Read(b) +} + +func (r *legacyLayerReader) Seek(offset int64, whence int) (int64, error) { + if r.backupReader == nil { + if r.currentFile == nil { + return 0, errors.New("no current file") + } + return r.currentFile.Seek(offset, whence) + } + return 0, errors.New("seek not supported on this stream") +} + +func (r *legacyLayerReader) Close() error { + r.proceed <- false + <-r.result + r.reset() + return nil +} + +type pendingLink struct { + Path, Target string + TargetRoot *os.File +} + +type pendingDir struct { + Path string + Root *os.File +} + +type legacyLayerWriter struct { + root *os.File + destRoot *os.File + parentRoots []*os.File + currentFile *os.File + bufWriter *bufio.Writer + currentFileName string + currentFileRoot *os.File + backupWriter *winio.BackupFileWriter + Tombstones []string + HasUtilityVM bool + changedDi []dirInfo + addedFiles map[string]bool + PendingLinks []pendingLink + pendingDirs []pendingDir + currentIsDir bool +} + +// newLegacyLayerWriter returns a LayerWriter that can write the contaler layer +// transport format to disk. +func newLegacyLayerWriter(root string, parentRoots []string, destRoot string) (w *legacyLayerWriter, err error) { + w = &legacyLayerWriter{ + addedFiles: make(map[string]bool), + } + defer func() { + if err != nil { + w.CloseRoots() + w = nil + } + }() + w.root, err = safefile.OpenRoot(root) + if err != nil { + return + } + w.destRoot, err = safefile.OpenRoot(destRoot) + if err != nil { + return + } + for _, r := range parentRoots { + f, err := safefile.OpenRoot(r) + if err != nil { + return w, err + } + w.parentRoots = append(w.parentRoots, f) + } + w.bufWriter = bufio.NewWriterSize(ioutil.Discard, 65536) + return +} + +func (w *legacyLayerWriter) CloseRoots() { + if w.root != nil { + w.root.Close() + w.root = nil + } + if w.destRoot != nil { + w.destRoot.Close() + w.destRoot = nil + } + for i := range w.parentRoots { + _ = w.parentRoots[i].Close() + } + w.parentRoots = nil +} + +func (w *legacyLayerWriter) initUtilityVM() error { + if !w.HasUtilityVM { + err := safefile.MkdirRelative(utilityVMPath, w.destRoot) + if err != nil { + return err + } + // Server 2016 does not support multiple layers for the utility VM, so + // clone the utility VM from the parent layer into this layer. Use hard + // links to avoid unnecessary copying, since most of the files are + // immutable. + err = cloneTree(w.parentRoots[0], w.destRoot, utilityVMFilesPath, mutatedUtilityVMFiles) + if err != nil { + return fmt.Errorf("cloning the parent utility VM image failed: %s", err) + } + w.HasUtilityVM = true + } + return nil +} + +func (w *legacyLayerWriter) reset() error { + err := w.bufWriter.Flush() + if err != nil { + return err + } + w.bufWriter.Reset(ioutil.Discard) + if w.currentIsDir { + r := w.currentFile + br := winio.NewBackupStreamReader(r) + // Seek to the beginning of the backup stream, skipping the fileattrs + if _, err := r.Seek(4, io.SeekStart); err != nil { + return err + } + + for { + bhdr, err := br.Next() + if err == io.EOF { + // end of backupstream data + break + } + if err != nil { + return err + } + switch bhdr.Id { + case winio.BackupReparseData: + // The current file is a `.$wcidirs$` metadata file that + // describes a directory reparse point. Delete the placeholder + // directory to prevent future files being added into the + // destination of the reparse point during the ImportLayer call + if err := safefile.RemoveRelative(w.currentFileName, w.currentFileRoot); err != nil { + return err + } + w.pendingDirs = append(w.pendingDirs, pendingDir{Path: w.currentFileName, Root: w.currentFileRoot}) + default: + // ignore all other stream types, as we only care about directory reparse points + } + } + w.currentIsDir = false + } + if w.backupWriter != nil { + w.backupWriter.Close() + w.backupWriter = nil + } + if w.currentFile != nil { + w.currentFile.Close() + w.currentFile = nil + w.currentFileName = "" + w.currentFileRoot = nil + } + return nil +} + +// copyFileWithMetadata copies a file using the backup/restore APIs in order to preserve metadata +func copyFileWithMetadata(srcRoot, destRoot *os.File, subPath string, isDir bool) (fileInfo *winio.FileBasicInfo, err error) { + src, err := safefile.OpenRelative( + subPath, + srcRoot, + syscall.GENERIC_READ|winio.ACCESS_SYSTEM_SECURITY, + syscall.FILE_SHARE_READ, + winapi.FILE_OPEN, + winapi.FILE_OPEN_REPARSE_POINT) + if err != nil { + return nil, err + } + defer src.Close() + srcr := winio.NewBackupFileReader(src, true) + defer srcr.Close() + + fileInfo, err = winio.GetFileBasicInfo(src) + if err != nil { + return nil, err + } + + extraFlags := uint32(0) + if isDir { + extraFlags |= winapi.FILE_DIRECTORY_FILE + } + dest, err := safefile.OpenRelative( + subPath, + destRoot, + syscall.GENERIC_READ|syscall.GENERIC_WRITE|winio.WRITE_DAC|winio.WRITE_OWNER|winio.ACCESS_SYSTEM_SECURITY, + syscall.FILE_SHARE_READ, + winapi.FILE_CREATE, + extraFlags) + if err != nil { + return nil, err + } + defer dest.Close() + + err = winio.SetFileBasicInfo(dest, fileInfo) + if err != nil { + return nil, err + } + + destw := winio.NewBackupFileWriter(dest, true) + defer func() { + cerr := destw.Close() + if err == nil { + err = cerr + } + }() + + _, err = io.Copy(destw, srcr) + if err != nil { + return nil, err + } + + return fileInfo, nil +} + +// cloneTree clones a directory tree using hard links. It skips hard links for +// the file names in the provided map and just copies those files. +func cloneTree(srcRoot *os.File, destRoot *os.File, subPath string, mutatedFiles map[string]bool) error { + var di []dirInfo + err := safefile.EnsureNotReparsePointRelative(subPath, srcRoot) + if err != nil { + return err + } + err = filepath.Walk(filepath.Join(srcRoot.Name(), subPath), func(srcFilePath string, info os.FileInfo, err error) error { + if err != nil { + return err + } + + relPath, err := filepath.Rel(srcRoot.Name(), srcFilePath) + if err != nil { + return err + } + + fileAttributes := info.Sys().(*syscall.Win32FileAttributeData).FileAttributes + // Directories, reparse points, and files that will be mutated during + // utility VM import must be copied. All other files can be hard linked. + isReparsePoint := fileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT != 0 + // In go1.9, FileInfo.IsDir() returns false if the directory is also a symlink. + // See: https://github.com/golang/go/commit/1989921aef60c83e6f9127a8448fb5ede10e9acc + // Fixes the problem by checking syscall.FILE_ATTRIBUTE_DIRECTORY directly + isDir := fileAttributes&syscall.FILE_ATTRIBUTE_DIRECTORY != 0 + + if isDir || isReparsePoint || mutatedFiles[relPath] { + fi, err := copyFileWithMetadata(srcRoot, destRoot, relPath, isDir) + if err != nil { + return err + } + if isDir { + di = append(di, dirInfo{path: relPath, fileInfo: *fi}) + } + } else { + err = safefile.LinkRelative(relPath, srcRoot, relPath, destRoot) + if err != nil { + return err + } + } + + return nil + }) + if err != nil { + return err + } + + return reapplyDirectoryTimes(destRoot, di) +} + +func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) error { + if err := w.reset(); err != nil { + return err + } + + if name == utilityVMPath { + return w.initUtilityVM() + } + + if (fileInfo.FileAttributes & syscall.FILE_ATTRIBUTE_DIRECTORY) != 0 { + w.changedDi = append(w.changedDi, dirInfo{path: name, fileInfo: *fileInfo}) + } + + name = filepath.Clean(name) + if hasPathPrefix(name, utilityVMPath) { + if !w.HasUtilityVM { + return errors.New("missing UtilityVM directory") + } + if !hasPathPrefix(name, utilityVMFilesPath) && name != utilityVMFilesPath { + return errors.New("invalid UtilityVM layer") + } + createDisposition := uint32(winapi.FILE_OPEN) + if (fileInfo.FileAttributes & syscall.FILE_ATTRIBUTE_DIRECTORY) != 0 { + st, err := safefile.LstatRelative(name, w.destRoot) + if err != nil && !os.IsNotExist(err) { + return err + } + if st != nil { + // Delete the existing file/directory if it is not the same type as this directory. + existingAttr := st.Sys().(*syscall.Win32FileAttributeData).FileAttributes + if (uint32(fileInfo.FileAttributes)^existingAttr)&(syscall.FILE_ATTRIBUTE_DIRECTORY|syscall.FILE_ATTRIBUTE_REPARSE_POINT) != 0 { + if err = safefile.RemoveAllRelative(name, w.destRoot); err != nil { + return err + } + st = nil + } + } + if st == nil { + if err = safefile.MkdirRelative(name, w.destRoot); err != nil { + return err + } + } + } else { + // Overwrite any existing hard link. + err := safefile.RemoveRelative(name, w.destRoot) + if err != nil && !os.IsNotExist(err) { + return err + } + createDisposition = winapi.FILE_CREATE + } + + f, err := safefile.OpenRelative( + name, + w.destRoot, + syscall.GENERIC_READ|syscall.GENERIC_WRITE|winio.WRITE_DAC|winio.WRITE_OWNER|winio.ACCESS_SYSTEM_SECURITY, + syscall.FILE_SHARE_READ, + createDisposition, + winapi.FILE_OPEN_REPARSE_POINT, + ) + if err != nil { + return err + } + defer func() { + if f != nil { + f.Close() + _ = safefile.RemoveRelative(name, w.destRoot) + } + }() + + err = winio.SetFileBasicInfo(f, fileInfo) + if err != nil { + return err + } + + w.backupWriter = winio.NewBackupFileWriter(f, true) + w.bufWriter.Reset(w.backupWriter) + w.currentFile = f + w.currentFileName = name + w.currentFileRoot = w.destRoot + w.addedFiles[name] = true + f = nil + return nil + } + + fname := name + if (fileInfo.FileAttributes & syscall.FILE_ATTRIBUTE_DIRECTORY) != 0 { + err := safefile.MkdirRelative(name, w.root) + if err != nil { + return err + } + fname += ".$wcidirs$" + w.currentIsDir = true + } + + f, err := safefile.OpenRelative(fname, w.root, syscall.GENERIC_READ|syscall.GENERIC_WRITE, syscall.FILE_SHARE_READ, winapi.FILE_CREATE, 0) + if err != nil { + return err + } + defer func() { + if f != nil { + f.Close() + _ = safefile.RemoveRelative(fname, w.root) + } + }() + + strippedFi := *fileInfo + strippedFi.FileAttributes = 0 + err = winio.SetFileBasicInfo(f, &strippedFi) + if err != nil { + return err + } + + if hasPathPrefix(name, hivesPath) { + w.backupWriter = winio.NewBackupFileWriter(f, false) + w.bufWriter.Reset(w.backupWriter) + } else { + w.bufWriter.Reset(f) + // The file attributes are written before the stream. + err = binary.Write(w.bufWriter, binary.LittleEndian, uint32(fileInfo.FileAttributes)) + if err != nil { + w.bufWriter.Reset(ioutil.Discard) + return err + } + } + + w.currentFile = f + w.currentFileName = name + w.currentFileRoot = w.root + w.addedFiles[name] = true + f = nil + return nil +} + +func (w *legacyLayerWriter) AddLink(name string, target string) error { + if err := w.reset(); err != nil { + return err + } + + target = filepath.Clean(target) + var roots []*os.File + if hasPathPrefix(target, filesPath) { + // Look for cross-layer hard link targets in the parent layers, since + // nothing is in the destination path yet. + roots = w.parentRoots + } else if hasPathPrefix(target, utilityVMFilesPath) { + // Since the utility VM is fully cloned into the destination path + // already, look for cross-layer hard link targets directly in the + // destination path. + roots = []*os.File{w.destRoot} + } + + if roots == nil || (!hasPathPrefix(name, filesPath) && !hasPathPrefix(name, utilityVMFilesPath)) { + return errors.New("invalid hard link in layer") + } + + // Find to try the target of the link in a previously added file. If that + // fails, search in parent layers. + var selectedRoot *os.File + if _, ok := w.addedFiles[target]; ok { + selectedRoot = w.destRoot + } else { + for _, r := range roots { + if _, err := safefile.LstatRelative(target, r); err != nil { + if !os.IsNotExist(err) { + return err + } + } else { + selectedRoot = r + break + } + } + if selectedRoot == nil { + return fmt.Errorf("failed to find link target for '%s' -> '%s'", name, target) + } + } + + // The link can't be written until after the ImportLayer call. + w.PendingLinks = append(w.PendingLinks, pendingLink{ + Path: name, + Target: target, + TargetRoot: selectedRoot, + }) + w.addedFiles[name] = true + return nil +} + +func (w *legacyLayerWriter) Remove(name string) error { + name = filepath.Clean(name) + if hasPathPrefix(name, filesPath) { + w.Tombstones = append(w.Tombstones, name) + } else if hasPathPrefix(name, utilityVMFilesPath) { + err := w.initUtilityVM() + if err != nil { + return err + } + // Make sure the path exists; os.RemoveAll will not fail if the file is + // already gone, and this needs to be a fatal error for diagnostics + // purposes. + if _, err := safefile.LstatRelative(name, w.destRoot); err != nil { + return err + } + err = safefile.RemoveAllRelative(name, w.destRoot) + if err != nil { + return err + } + } else { + return fmt.Errorf("invalid tombstone %s", name) + } + + return nil +} + +func (w *legacyLayerWriter) Write(b []byte) (int, error) { + if w.backupWriter == nil && w.currentFile == nil { + return 0, errors.New("closed") + } + return w.bufWriter.Write(b) +} + +func (w *legacyLayerWriter) Close() error { + if err := w.reset(); err != nil { + return err + } + if err := safefile.RemoveRelative("tombstones.txt", w.root); err != nil && !os.IsNotExist(err) { + return err + } + for _, pd := range w.pendingDirs { + err := safefile.MkdirRelative(pd.Path, pd.Root) + if err != nil { + return err + } + } + return nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go new file mode 100644 index 000000000..09950297c --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go @@ -0,0 +1,29 @@ +package wclayer + +import ( + "context" + + "github.com/Microsoft/go-winio/pkg/guid" + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/Microsoft/hcsshim/internal/oc" + "go.opencensus.io/trace" +) + +// NameToGuid converts the given string into a GUID using the algorithm in the +// Host Compute Service, ensuring GUIDs generated with the same string are common +// across all clients. +func NameToGuid(ctx context.Context, name string) (_ guid.GUID, err error) { + title := "hcsshim::NameToGuid" + ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("objectName", name)) + + var id guid.GUID + err = nameToGuid(name, &id) + if err != nil { + return guid.GUID{}, hcserror.New(err, title, "") + } + span.AddAttributes(trace.StringAttribute("guid", id.String())) + return id, nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/preparelayer.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/preparelayer.go new file mode 100644 index 000000000..90129faef --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/preparelayer.go @@ -0,0 +1,44 @@ +package wclayer + +import ( + "context" + "strings" + "sync" + + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/Microsoft/hcsshim/internal/oc" + "go.opencensus.io/trace" +) + +var prepareLayerLock sync.Mutex + +// PrepareLayer finds a mounted read-write layer matching path and enables the +// the filesystem filter for use on that layer. This requires the paths to all +// parent layers, and is necessary in order to view or interact with the layer +// as an actual filesystem (reading and writing files, creating directories, etc). +// Disabling the filter must be done via UnprepareLayer. +func PrepareLayer(ctx context.Context, path string, parentLayerPaths []string) (err error) { + title := "hcsshim::PrepareLayer" + ctx, span := trace.StartSpan(ctx, title) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("path", path), + trace.StringAttribute("parentLayerPaths", strings.Join(parentLayerPaths, ", "))) + + // Generate layer descriptors + layers, err := layerPathsToDescriptors(ctx, parentLayerPaths) + if err != nil { + return err + } + + // This lock is a temporary workaround for a Windows bug. Only allowing one + // call to prepareLayer at a time vastly reduces the chance of a timeout. + prepareLayerLock.Lock() + defer prepareLayerLock.Unlock() + err = prepareLayer(&stdDriverInfo, path, layers) + if err != nil { + return hcserror.New(err, title, "") + } + return nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/processimage.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/processimage.go new file mode 100644 index 000000000..30bcdff5f --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/processimage.go @@ -0,0 +1,41 @@ +package wclayer + +import ( + "context" + "os" + + "github.com/Microsoft/hcsshim/internal/oc" + "go.opencensus.io/trace" +) + +// ProcessBaseLayer post-processes a base layer that has had its files extracted. +// The files should have been extracted to \Files. +func ProcessBaseLayer(ctx context.Context, path string) (err error) { + title := "hcsshim::ProcessBaseLayer" + ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("path", path)) + + err = processBaseImage(path) + if err != nil { + return &os.PathError{Op: title, Path: path, Err: err} + } + return nil +} + +// ProcessUtilityVMImage post-processes a utility VM image that has had its files extracted. +// The files should have been extracted to \Files. +func ProcessUtilityVMImage(ctx context.Context, path string) (err error) { + title := "hcsshim::ProcessUtilityVMImage" + ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("path", path)) + + err = processUtilityImage(path) + if err != nil { + return &os.PathError{Op: title, Path: path, Err: err} + } + return nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/unpreparelayer.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/unpreparelayer.go new file mode 100644 index 000000000..71b130c52 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/unpreparelayer.go @@ -0,0 +1,25 @@ +package wclayer + +import ( + "context" + + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/Microsoft/hcsshim/internal/oc" + "go.opencensus.io/trace" +) + +// UnprepareLayer disables the filesystem filter for the read-write layer with +// the given id. +func UnprepareLayer(ctx context.Context, path string) (err error) { + title := "hcsshim::UnprepareLayer" + ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("path", path)) + + err = unprepareLayer(&stdDriverInfo, path) + if err != nil { + return hcserror.New(err, title, "") + } + return nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go new file mode 100644 index 000000000..9b1e06d50 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go @@ -0,0 +1,35 @@ +// Package wclayer provides bindings to HCS's legacy layer management API and +// provides a higher level interface around these calls for container layer +// management. +package wclayer + +import "github.com/Microsoft/go-winio/pkg/guid" + +//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go wclayer.go + +//sys activateLayer(info *driverInfo, id string) (hr error) = vmcompute.ActivateLayer? +//sys copyLayer(info *driverInfo, srcId string, dstId string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.CopyLayer? +//sys createLayer(info *driverInfo, id string, parent string) (hr error) = vmcompute.CreateLayer? +//sys createSandboxLayer(info *driverInfo, id string, parent uintptr, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.CreateSandboxLayer? +//sys expandSandboxSize(info *driverInfo, id string, size uint64) (hr error) = vmcompute.ExpandSandboxSize? +//sys deactivateLayer(info *driverInfo, id string) (hr error) = vmcompute.DeactivateLayer? +//sys destroyLayer(info *driverInfo, id string) (hr error) = vmcompute.DestroyLayer? +//sys exportLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.ExportLayer? +//sys getLayerMountPath(info *driverInfo, id string, length *uintptr, buffer *uint16) (hr error) = vmcompute.GetLayerMountPath? +//sys getBaseImages(buffer **uint16) (hr error) = vmcompute.GetBaseImages? +//sys importLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.ImportLayer? +//sys layerExists(info *driverInfo, id string, exists *uint32) (hr error) = vmcompute.LayerExists? +//sys nameToGuid(name string, guid *_guid) (hr error) = vmcompute.NameToGuid? +//sys prepareLayer(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.PrepareLayer? +//sys unprepareLayer(info *driverInfo, id string) (hr error) = vmcompute.UnprepareLayer? +//sys processBaseImage(path string) (hr error) = vmcompute.ProcessBaseImage? +//sys processUtilityImage(path string) (hr error) = vmcompute.ProcessUtilityImage? + +//sys grantVmAccess(vmid string, filepath string) (hr error) = vmcompute.GrantVmAccess? + +//sys openVirtualDisk(virtualStorageType *virtualStorageType, path string, virtualDiskAccessMask uint32, flags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (err error) [failretval != 0] = virtdisk.OpenVirtualDisk +//sys attachVirtualDisk(handle syscall.Handle, sd uintptr, flags uint32, providerFlags uint32, params uintptr, overlapped uintptr) (err error) [failretval != 0] = virtdisk.AttachVirtualDisk + +//sys getDiskFreeSpaceEx(directoryName string, freeBytesAvailableToCaller *int64, totalNumberOfBytes *int64, totalNumberOfFreeBytes *int64) (err error) = GetDiskFreeSpaceExW + +type _guid = guid.GUID diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go new file mode 100644 index 000000000..67f917f07 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go @@ -0,0 +1,569 @@ +// Code generated mksyscall_windows.exe DO NOT EDIT + +package wclayer + +import ( + "syscall" + "unsafe" + + "golang.org/x/sys/windows" +) + +var _ unsafe.Pointer + +// Do the interface allocations only once for common +// Errno values. +const ( + errnoERROR_IO_PENDING = 997 +) + +var ( + errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) +) + +// errnoErr returns common boxed Errno values, to prevent +// allocations at runtime. +func errnoErr(e syscall.Errno) error { + switch e { + case 0: + return nil + case errnoERROR_IO_PENDING: + return errERROR_IO_PENDING + } + // TODO: add more here, after collecting data on the common + // error values see on Windows. (perhaps when running + // all.bat?) + return e +} + +var ( + modvmcompute = windows.NewLazySystemDLL("vmcompute.dll") + modvirtdisk = windows.NewLazySystemDLL("virtdisk.dll") + modkernel32 = windows.NewLazySystemDLL("kernel32.dll") + + procActivateLayer = modvmcompute.NewProc("ActivateLayer") + procCopyLayer = modvmcompute.NewProc("CopyLayer") + procCreateLayer = modvmcompute.NewProc("CreateLayer") + procCreateSandboxLayer = modvmcompute.NewProc("CreateSandboxLayer") + procExpandSandboxSize = modvmcompute.NewProc("ExpandSandboxSize") + procDeactivateLayer = modvmcompute.NewProc("DeactivateLayer") + procDestroyLayer = modvmcompute.NewProc("DestroyLayer") + procExportLayer = modvmcompute.NewProc("ExportLayer") + procGetLayerMountPath = modvmcompute.NewProc("GetLayerMountPath") + procGetBaseImages = modvmcompute.NewProc("GetBaseImages") + procImportLayer = modvmcompute.NewProc("ImportLayer") + procLayerExists = modvmcompute.NewProc("LayerExists") + procNameToGuid = modvmcompute.NewProc("NameToGuid") + procPrepareLayer = modvmcompute.NewProc("PrepareLayer") + procUnprepareLayer = modvmcompute.NewProc("UnprepareLayer") + procProcessBaseImage = modvmcompute.NewProc("ProcessBaseImage") + procProcessUtilityImage = modvmcompute.NewProc("ProcessUtilityImage") + procGrantVmAccess = modvmcompute.NewProc("GrantVmAccess") + procOpenVirtualDisk = modvirtdisk.NewProc("OpenVirtualDisk") + procAttachVirtualDisk = modvirtdisk.NewProc("AttachVirtualDisk") + procGetDiskFreeSpaceExW = modkernel32.NewProc("GetDiskFreeSpaceExW") +) + +func activateLayer(info *driverInfo, id string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _activateLayer(info, _p0) +} + +func _activateLayer(info *driverInfo, id *uint16) (hr error) { + if hr = procActivateLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procActivateLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func copyLayer(info *driverInfo, srcId string, dstId string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(srcId) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(dstId) + if hr != nil { + return + } + return _copyLayer(info, _p0, _p1, descriptors) +} + +func _copyLayer(info *driverInfo, srcId *uint16, dstId *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p2 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p2 = &descriptors[0] + } + if hr = procCopyLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procCopyLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(srcId)), uintptr(unsafe.Pointer(dstId)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func createLayer(info *driverInfo, id string, parent string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(parent) + if hr != nil { + return + } + return _createLayer(info, _p0, _p1) +} + +func _createLayer(info *driverInfo, id *uint16, parent *uint16) (hr error) { + if hr = procCreateLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procCreateLayer.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(parent))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func createSandboxLayer(info *driverInfo, id string, parent uintptr, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _createSandboxLayer(info, _p0, parent, descriptors) +} + +func _createSandboxLayer(info *driverInfo, id *uint16, parent uintptr, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p1 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p1 = &descriptors[0] + } + if hr = procCreateSandboxLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procCreateSandboxLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(parent), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func expandSandboxSize(info *driverInfo, id string, size uint64) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _expandSandboxSize(info, _p0, size) +} + +func _expandSandboxSize(info *driverInfo, id *uint16, size uint64) (hr error) { + if hr = procExpandSandboxSize.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procExpandSandboxSize.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(size)) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func deactivateLayer(info *driverInfo, id string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _deactivateLayer(info, _p0) +} + +func _deactivateLayer(info *driverInfo, id *uint16) (hr error) { + if hr = procDeactivateLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procDeactivateLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func destroyLayer(info *driverInfo, id string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _destroyLayer(info, _p0) +} + +func _destroyLayer(info *driverInfo, id *uint16) (hr error) { + if hr = procDestroyLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procDestroyLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func exportLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(path) + if hr != nil { + return + } + return _exportLayer(info, _p0, _p1, descriptors) +} + +func _exportLayer(info *driverInfo, id *uint16, path *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p2 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p2 = &descriptors[0] + } + if hr = procExportLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procExportLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func getLayerMountPath(info *driverInfo, id string, length *uintptr, buffer *uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _getLayerMountPath(info, _p0, length, buffer) +} + +func _getLayerMountPath(info *driverInfo, id *uint16, length *uintptr, buffer *uint16) (hr error) { + if hr = procGetLayerMountPath.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procGetLayerMountPath.Addr(), 4, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(length)), uintptr(unsafe.Pointer(buffer)), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func getBaseImages(buffer **uint16) (hr error) { + if hr = procGetBaseImages.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procGetBaseImages.Addr(), 1, uintptr(unsafe.Pointer(buffer)), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func importLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(path) + if hr != nil { + return + } + return _importLayer(info, _p0, _p1, descriptors) +} + +func _importLayer(info *driverInfo, id *uint16, path *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p2 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p2 = &descriptors[0] + } + if hr = procImportLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procImportLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func layerExists(info *driverInfo, id string, exists *uint32) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _layerExists(info, _p0, exists) +} + +func _layerExists(info *driverInfo, id *uint16, exists *uint32) (hr error) { + if hr = procLayerExists.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procLayerExists.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(exists))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func nameToGuid(name string, guid *_guid) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(name) + if hr != nil { + return + } + return _nameToGuid(_p0, guid) +} + +func _nameToGuid(name *uint16, guid *_guid) (hr error) { + if hr = procNameToGuid.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procNameToGuid.Addr(), 2, uintptr(unsafe.Pointer(name)), uintptr(unsafe.Pointer(guid)), 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func prepareLayer(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _prepareLayer(info, _p0, descriptors) +} + +func _prepareLayer(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p1 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p1 = &descriptors[0] + } + if hr = procPrepareLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procPrepareLayer.Addr(), 4, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func unprepareLayer(info *driverInfo, id string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _unprepareLayer(info, _p0) +} + +func _unprepareLayer(info *driverInfo, id *uint16) (hr error) { + if hr = procUnprepareLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procUnprepareLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func processBaseImage(path string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(path) + if hr != nil { + return + } + return _processBaseImage(_p0) +} + +func _processBaseImage(path *uint16) (hr error) { + if hr = procProcessBaseImage.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procProcessBaseImage.Addr(), 1, uintptr(unsafe.Pointer(path)), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func processUtilityImage(path string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(path) + if hr != nil { + return + } + return _processUtilityImage(_p0) +} + +func _processUtilityImage(path *uint16) (hr error) { + if hr = procProcessUtilityImage.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procProcessUtilityImage.Addr(), 1, uintptr(unsafe.Pointer(path)), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func grantVmAccess(vmid string, filepath string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(vmid) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(filepath) + if hr != nil { + return + } + return _grantVmAccess(_p0, _p1) +} + +func _grantVmAccess(vmid *uint16, filepath *uint16) (hr error) { + if hr = procGrantVmAccess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procGrantVmAccess.Addr(), 2, uintptr(unsafe.Pointer(vmid)), uintptr(unsafe.Pointer(filepath)), 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func openVirtualDisk(virtualStorageType *virtualStorageType, path string, virtualDiskAccessMask uint32, flags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (err error) { + var _p0 *uint16 + _p0, err = syscall.UTF16PtrFromString(path) + if err != nil { + return + } + return _openVirtualDisk(virtualStorageType, _p0, virtualDiskAccessMask, flags, parameters, handle) +} + +func _openVirtualDisk(virtualStorageType *virtualStorageType, path *uint16, virtualDiskAccessMask uint32, flags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (err error) { + r1, _, e1 := syscall.Syscall6(procOpenVirtualDisk.Addr(), 6, uintptr(unsafe.Pointer(virtualStorageType)), uintptr(unsafe.Pointer(path)), uintptr(virtualDiskAccessMask), uintptr(flags), uintptr(unsafe.Pointer(parameters)), uintptr(unsafe.Pointer(handle))) + if r1 != 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func attachVirtualDisk(handle syscall.Handle, sd uintptr, flags uint32, providerFlags uint32, params uintptr, overlapped uintptr) (err error) { + r1, _, e1 := syscall.Syscall6(procAttachVirtualDisk.Addr(), 6, uintptr(handle), uintptr(sd), uintptr(flags), uintptr(providerFlags), uintptr(params), uintptr(overlapped)) + if r1 != 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func getDiskFreeSpaceEx(directoryName string, freeBytesAvailableToCaller *int64, totalNumberOfBytes *int64, totalNumberOfFreeBytes *int64) (err error) { + var _p0 *uint16 + _p0, err = syscall.UTF16PtrFromString(directoryName) + if err != nil { + return + } + return _getDiskFreeSpaceEx(_p0, freeBytesAvailableToCaller, totalNumberOfBytes, totalNumberOfFreeBytes) +} + +func _getDiskFreeSpaceEx(directoryName *uint16, freeBytesAvailableToCaller *int64, totalNumberOfBytes *int64, totalNumberOfFreeBytes *int64) (err error) { + r1, _, e1 := syscall.Syscall6(procGetDiskFreeSpaceExW.Addr(), 4, uintptr(unsafe.Pointer(directoryName)), uintptr(unsafe.Pointer(freeBytesAvailableToCaller)), uintptr(unsafe.Pointer(totalNumberOfBytes)), uintptr(unsafe.Pointer(totalNumberOfFreeBytes)), 0, 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/console.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/console.go new file mode 100644 index 000000000..def952541 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/console.go @@ -0,0 +1,44 @@ +package winapi + +import ( + "unsafe" + + "golang.org/x/sys/windows" +) + +const PSEUDOCONSOLE_INHERIT_CURSOR = 0x1 + +// CreatePseudoConsole creates a windows pseudo console. +func CreatePseudoConsole(size windows.Coord, hInput windows.Handle, hOutput windows.Handle, dwFlags uint32, hpcon *windows.Handle) error { + // We need this wrapper as the function takes a COORD struct and not a pointer to one, so we need to cast to something beforehand. + return createPseudoConsole(*((*uint32)(unsafe.Pointer(&size))), hInput, hOutput, 0, hpcon) +} + +// ResizePseudoConsole resizes the internal buffers of the pseudo console to the width and height specified in `size`. +func ResizePseudoConsole(hpcon windows.Handle, size windows.Coord) error { + // We need this wrapper as the function takes a COORD struct and not a pointer to one, so we need to cast to something beforehand. + return resizePseudoConsole(hpcon, *((*uint32)(unsafe.Pointer(&size)))) +} + +// HRESULT WINAPI CreatePseudoConsole( +// _In_ COORD size, +// _In_ HANDLE hInput, +// _In_ HANDLE hOutput, +// _In_ DWORD dwFlags, +// _Out_ HPCON* phPC +// ); +// +//sys createPseudoConsole(size uint32, hInput windows.Handle, hOutput windows.Handle, dwFlags uint32, hpcon *windows.Handle) (hr error) = kernel32.CreatePseudoConsole + +// void WINAPI ClosePseudoConsole( +// _In_ HPCON hPC +// ); +// +//sys ClosePseudoConsole(hpc windows.Handle) = kernel32.ClosePseudoConsole + +// HRESULT WINAPI ResizePseudoConsole( +// _In_ HPCON hPC , +// _In_ COORD size +// ); +// +//sys resizePseudoConsole(hPc windows.Handle, size uint32) (hr error) = kernel32.ResizePseudoConsole diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/devices.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/devices.go new file mode 100644 index 000000000..df28ea242 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/devices.go @@ -0,0 +1,13 @@ +package winapi + +import "github.com/Microsoft/go-winio/pkg/guid" + +//sys CMGetDeviceIDListSize(pulLen *uint32, pszFilter *byte, uFlags uint32) (hr error) = cfgmgr32.CM_Get_Device_ID_List_SizeA +//sys CMGetDeviceIDList(pszFilter *byte, buffer *byte, bufferLen uint32, uFlags uint32) (hr error)= cfgmgr32.CM_Get_Device_ID_ListA +//sys CMLocateDevNode(pdnDevInst *uint32, pDeviceID string, uFlags uint32) (hr error) = cfgmgr32.CM_Locate_DevNodeW +//sys CMGetDevNodeProperty(dnDevInst uint32, propertyKey *DevPropKey, propertyType *uint32, propertyBuffer *uint16, propertyBufferSize *uint32, uFlags uint32) (hr error) = cfgmgr32.CM_Get_DevNode_PropertyW + +type DevPropKey struct { + Fmtid guid.GUID + Pid uint32 +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/errors.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/errors.go new file mode 100644 index 000000000..4e80ef68c --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/errors.go @@ -0,0 +1,15 @@ +package winapi + +import "syscall" + +//sys RtlNtStatusToDosError(status uint32) (winerr error) = ntdll.RtlNtStatusToDosError + +const ( + STATUS_REPARSE_POINT_ENCOUNTERED = 0xC000050B + ERROR_NO_MORE_ITEMS = 0x103 + ERROR_MORE_DATA syscall.Errno = 234 +) + +func NTSuccess(status uint32) bool { + return status == 0 +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/filesystem.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/filesystem.go new file mode 100644 index 000000000..7ce52afd5 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/filesystem.go @@ -0,0 +1,110 @@ +package winapi + +//sys NtCreateFile(handle *uintptr, accessMask uint32, oa *ObjectAttributes, iosb *IOStatusBlock, allocationSize *uint64, fileAttributes uint32, shareAccess uint32, createDisposition uint32, createOptions uint32, eaBuffer *byte, eaLength uint32) (status uint32) = ntdll.NtCreateFile +//sys NtSetInformationFile(handle uintptr, iosb *IOStatusBlock, information uintptr, length uint32, class uint32) (status uint32) = ntdll.NtSetInformationFile + +//sys NtOpenDirectoryObject(handle *uintptr, accessMask uint32, oa *ObjectAttributes) (status uint32) = ntdll.NtOpenDirectoryObject +//sys NtQueryDirectoryObject(handle uintptr, buffer *byte, length uint32, singleEntry bool, restartScan bool, context *uint32, returnLength *uint32)(status uint32) = ntdll.NtQueryDirectoryObject + +const ( + FileLinkInformationClass = 11 + FileDispositionInformationExClass = 64 + + FILE_READ_ATTRIBUTES = 0x0080 + FILE_WRITE_ATTRIBUTES = 0x0100 + DELETE = 0x10000 + + FILE_OPEN = 1 + FILE_CREATE = 2 + + FILE_LIST_DIRECTORY = 0x00000001 + FILE_DIRECTORY_FILE = 0x00000001 + FILE_SYNCHRONOUS_IO_NONALERT = 0x00000020 + FILE_OPEN_FOR_BACKUP_INTENT = 0x00004000 + FILE_OPEN_REPARSE_POINT = 0x00200000 + + FILE_DISPOSITION_DELETE = 0x00000001 + + OBJ_DONT_REPARSE = 0x1000 + + STATUS_MORE_ENTRIES = 0x105 + STATUS_NO_MORE_ENTRIES = 0x8000001a +) + +// Select entries from FILE_INFO_BY_HANDLE_CLASS. +// +// C declaration: +// typedef enum _FILE_INFO_BY_HANDLE_CLASS { +// FileBasicInfo, +// FileStandardInfo, +// FileNameInfo, +// FileRenameInfo, +// FileDispositionInfo, +// FileAllocationInfo, +// FileEndOfFileInfo, +// FileStreamInfo, +// FileCompressionInfo, +// FileAttributeTagInfo, +// FileIdBothDirectoryInfo, +// FileIdBothDirectoryRestartInfo, +// FileIoPriorityHintInfo, +// FileRemoteProtocolInfo, +// FileFullDirectoryInfo, +// FileFullDirectoryRestartInfo, +// FileStorageInfo, +// FileAlignmentInfo, +// FileIdInfo, +// FileIdExtdDirectoryInfo, +// FileIdExtdDirectoryRestartInfo, +// FileDispositionInfoEx, +// FileRenameInfoEx, +// FileCaseSensitiveInfo, +// FileNormalizedNameInfo, +// MaximumFileInfoByHandleClass +// } FILE_INFO_BY_HANDLE_CLASS, *PFILE_INFO_BY_HANDLE_CLASS; +// +// Documentation: https://docs.microsoft.com/en-us/windows/win32/api/minwinbase/ne-minwinbase-file_info_by_handle_class +const ( + FileIdInfo = 18 +) + +type FileDispositionInformationEx struct { + Flags uintptr +} + +type IOStatusBlock struct { + Status, Information uintptr +} + +type ObjectAttributes struct { + Length uintptr + RootDirectory uintptr + ObjectName *UnicodeString + Attributes uintptr + SecurityDescriptor uintptr + SecurityQoS uintptr +} + +type ObjectDirectoryInformation struct { + Name UnicodeString + TypeName UnicodeString +} + +type FileLinkInformation struct { + ReplaceIfExists bool + RootDirectory uintptr + FileNameLength uint32 + FileName [1]uint16 +} + +// C declaration: +// typedef struct _FILE_ID_INFO { +// ULONGLONG VolumeSerialNumber; +// FILE_ID_128 FileId; +// } FILE_ID_INFO, *PFILE_ID_INFO; +// +// Documentation: https://docs.microsoft.com/en-us/windows/win32/api/winbase/ns-winbase-file_id_info +type FILE_ID_INFO struct { + VolumeSerialNumber uint64 + FileID [16]byte +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/jobobject.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/jobobject.go new file mode 100644 index 000000000..7eb13f8f0 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/jobobject.go @@ -0,0 +1,218 @@ +package winapi + +import ( + "unsafe" + + "golang.org/x/sys/windows" +) + +// Messages that can be received from an assigned io completion port. +// https://docs.microsoft.com/en-us/windows/win32/api/winnt/ns-winnt-jobobject_associate_completion_port +const ( + JOB_OBJECT_MSG_END_OF_JOB_TIME uint32 = 1 + JOB_OBJECT_MSG_END_OF_PROCESS_TIME uint32 = 2 + JOB_OBJECT_MSG_ACTIVE_PROCESS_LIMIT uint32 = 3 + JOB_OBJECT_MSG_ACTIVE_PROCESS_ZERO uint32 = 4 + JOB_OBJECT_MSG_NEW_PROCESS uint32 = 6 + JOB_OBJECT_MSG_EXIT_PROCESS uint32 = 7 + JOB_OBJECT_MSG_ABNORMAL_EXIT_PROCESS uint32 = 8 + JOB_OBJECT_MSG_PROCESS_MEMORY_LIMIT uint32 = 9 + JOB_OBJECT_MSG_JOB_MEMORY_LIMIT uint32 = 10 + JOB_OBJECT_MSG_NOTIFICATION_LIMIT uint32 = 11 +) + +// Access rights for creating or opening job objects. +// +// https://docs.microsoft.com/en-us/windows/win32/procthread/job-object-security-and-access-rights +const ( + JOB_OBJECT_QUERY = 0x0004 + JOB_OBJECT_ALL_ACCESS = 0x1F001F +) + +// IO limit flags +// +// https://docs.microsoft.com/en-us/windows/win32/api/jobapi2/ns-jobapi2-jobobject_io_rate_control_information +const JOB_OBJECT_IO_RATE_CONTROL_ENABLE = 0x1 + +const JOBOBJECT_IO_ATTRIBUTION_CONTROL_ENABLE uint32 = 0x1 + +// https://docs.microsoft.com/en-us/windows/win32/api/winnt/ns-winnt-jobobject_cpu_rate_control_information +const ( + JOB_OBJECT_CPU_RATE_CONTROL_ENABLE uint32 = 1 << iota + JOB_OBJECT_CPU_RATE_CONTROL_WEIGHT_BASED + JOB_OBJECT_CPU_RATE_CONTROL_HARD_CAP + JOB_OBJECT_CPU_RATE_CONTROL_NOTIFY + JOB_OBJECT_CPU_RATE_CONTROL_MIN_MAX_RATE +) + +// JobObjectInformationClass values. Used for a call to QueryInformationJobObject +// +// https://docs.microsoft.com/en-us/windows/win32/api/jobapi2/nf-jobapi2-queryinformationjobobject +const ( + JobObjectBasicAccountingInformation uint32 = 1 + JobObjectBasicProcessIdList uint32 = 3 + JobObjectBasicAndIoAccountingInformation uint32 = 8 + JobObjectLimitViolationInformation uint32 = 13 + JobObjectMemoryUsageInformation uint32 = 28 + JobObjectNotificationLimitInformation2 uint32 = 33 + JobObjectIoAttribution uint32 = 42 +) + +// https://docs.microsoft.com/en-us/windows/win32/api/winnt/ns-winnt-jobobject_basic_limit_information +type JOBOBJECT_BASIC_LIMIT_INFORMATION struct { + PerProcessUserTimeLimit int64 + PerJobUserTimeLimit int64 + LimitFlags uint32 + MinimumWorkingSetSize uintptr + MaximumWorkingSetSize uintptr + ActiveProcessLimit uint32 + Affinity uintptr + PriorityClass uint32 + SchedulingClass uint32 +} + +// https://docs.microsoft.com/en-us/windows/win32/api/winnt/ns-winnt-jobobject_cpu_rate_control_information +type JOBOBJECT_CPU_RATE_CONTROL_INFORMATION struct { + ControlFlags uint32 + Value uint32 +} + +// https://docs.microsoft.com/en-us/windows/win32/api/jobapi2/ns-jobapi2-jobobject_io_rate_control_information +type JOBOBJECT_IO_RATE_CONTROL_INFORMATION struct { + MaxIops int64 + MaxBandwidth int64 + ReservationIops int64 + BaseIOSize uint32 + VolumeName string + ControlFlags uint32 +} + +// https://docs.microsoft.com/en-us/windows/win32/api/winnt/ns-winnt-jobobject_basic_process_id_list +type JOBOBJECT_BASIC_PROCESS_ID_LIST struct { + NumberOfAssignedProcesses uint32 + NumberOfProcessIdsInList uint32 + ProcessIdList [1]uintptr +} + +// AllPids returns all the process Ids in the job object. +func (p *JOBOBJECT_BASIC_PROCESS_ID_LIST) AllPids() []uintptr { + return (*[(1 << 27) - 1]uintptr)(unsafe.Pointer(&p.ProcessIdList[0]))[:p.NumberOfProcessIdsInList:p.NumberOfProcessIdsInList] +} + +// https://docs.microsoft.com/en-us/windows/win32/api/winnt/ns-winnt-jobobject_basic_accounting_information +type JOBOBJECT_BASIC_ACCOUNTING_INFORMATION struct { + TotalUserTime int64 + TotalKernelTime int64 + ThisPeriodTotalUserTime int64 + ThisPeriodTotalKernelTime int64 + TotalPageFaultCount uint32 + TotalProcesses uint32 + ActiveProcesses uint32 + TotalTerminateProcesses uint32 +} + +//https://docs.microsoft.com/en-us/windows/win32/api/winnt/ns-winnt-jobobject_basic_and_io_accounting_information +type JOBOBJECT_BASIC_AND_IO_ACCOUNTING_INFORMATION struct { + BasicInfo JOBOBJECT_BASIC_ACCOUNTING_INFORMATION + IoInfo windows.IO_COUNTERS +} + +// typedef struct _JOBOBJECT_MEMORY_USAGE_INFORMATION { +// ULONG64 JobMemory; +// ULONG64 PeakJobMemoryUsed; +// } JOBOBJECT_MEMORY_USAGE_INFORMATION, *PJOBOBJECT_MEMORY_USAGE_INFORMATION; +// +type JOBOBJECT_MEMORY_USAGE_INFORMATION struct { + JobMemory uint64 + PeakJobMemoryUsed uint64 +} + +// typedef struct _JOBOBJECT_IO_ATTRIBUTION_STATS { +// ULONG_PTR IoCount; +// ULONGLONG TotalNonOverlappedQueueTime; +// ULONGLONG TotalNonOverlappedServiceTime; +// ULONGLONG TotalSize; +// } JOBOBJECT_IO_ATTRIBUTION_STATS, *PJOBOBJECT_IO_ATTRIBUTION_STATS; +// +type JOBOBJECT_IO_ATTRIBUTION_STATS struct { + IoCount uintptr + TotalNonOverlappedQueueTime uint64 + TotalNonOverlappedServiceTime uint64 + TotalSize uint64 +} + +// typedef struct _JOBOBJECT_IO_ATTRIBUTION_INFORMATION { +// ULONG ControlFlags; +// JOBOBJECT_IO_ATTRIBUTION_STATS ReadStats; +// JOBOBJECT_IO_ATTRIBUTION_STATS WriteStats; +// } JOBOBJECT_IO_ATTRIBUTION_INFORMATION, *PJOBOBJECT_IO_ATTRIBUTION_INFORMATION; +// +type JOBOBJECT_IO_ATTRIBUTION_INFORMATION struct { + ControlFlags uint32 + ReadStats JOBOBJECT_IO_ATTRIBUTION_STATS + WriteStats JOBOBJECT_IO_ATTRIBUTION_STATS +} + +// https://docs.microsoft.com/en-us/windows/win32/api/winnt/ns-winnt-jobobject_associate_completion_port +type JOBOBJECT_ASSOCIATE_COMPLETION_PORT struct { + CompletionKey windows.Handle + CompletionPort windows.Handle +} + +// BOOL IsProcessInJob( +// HANDLE ProcessHandle, +// HANDLE JobHandle, +// PBOOL Result +// ); +// +//sys IsProcessInJob(procHandle windows.Handle, jobHandle windows.Handle, result *int32) (err error) = kernel32.IsProcessInJob + +// BOOL QueryInformationJobObject( +// HANDLE hJob, +// JOBOBJECTINFOCLASS JobObjectInformationClass, +// LPVOID lpJobObjectInformation, +// DWORD cbJobObjectInformationLength, +// LPDWORD lpReturnLength +// ); +// +//sys QueryInformationJobObject(jobHandle windows.Handle, infoClass uint32, jobObjectInfo unsafe.Pointer, jobObjectInformationLength uint32, lpReturnLength *uint32) (err error) = kernel32.QueryInformationJobObject + +// HANDLE OpenJobObjectW( +// DWORD dwDesiredAccess, +// BOOL bInheritHandle, +// LPCWSTR lpName +// ); +// +//sys OpenJobObject(desiredAccess uint32, inheritHandle bool, lpName *uint16) (handle windows.Handle, err error) = kernel32.OpenJobObjectW + +// DWORD SetIoRateControlInformationJobObject( +// HANDLE hJob, +// JOBOBJECT_IO_RATE_CONTROL_INFORMATION *IoRateControlInfo +// ); +// +//sys SetIoRateControlInformationJobObject(jobHandle windows.Handle, ioRateControlInfo *JOBOBJECT_IO_RATE_CONTROL_INFORMATION) (ret uint32, err error) = kernel32.SetIoRateControlInformationJobObject + +// DWORD QueryIoRateControlInformationJobObject( +// HANDLE hJob, +// PCWSTR VolumeName, +// JOBOBJECT_IO_RATE_CONTROL_INFORMATION **InfoBlocks, +// ULONG *InfoBlockCount +// ); +//sys QueryIoRateControlInformationJobObject(jobHandle windows.Handle, volumeName *uint16, ioRateControlInfo **JOBOBJECT_IO_RATE_CONTROL_INFORMATION, infoBlockCount *uint32) (ret uint32, err error) = kernel32.QueryIoRateControlInformationJobObject + +// NTSTATUS +// NtOpenJobObject ( +// _Out_ PHANDLE JobHandle, +// _In_ ACCESS_MASK DesiredAccess, +// _In_ POBJECT_ATTRIBUTES ObjectAttributes +// ); +//sys NtOpenJobObject(jobHandle *windows.Handle, desiredAccess uint32, objAttributes *ObjectAttributes) (status uint32) = ntdll.NtOpenJobObject + +// NTSTATUS +// NTAPI +// NtCreateJobObject ( +// _Out_ PHANDLE JobHandle, +// _In_ ACCESS_MASK DesiredAccess, +// _In_opt_ POBJECT_ATTRIBUTES ObjectAttributes +// ); +//sys NtCreateJobObject(jobHandle *windows.Handle, desiredAccess uint32, objAttributes *ObjectAttributes) (status uint32) = ntdll.NtCreateJobObject diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/logon.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/logon.go new file mode 100644 index 000000000..b6e7cfd46 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/logon.go @@ -0,0 +1,30 @@ +package winapi + +// BOOL LogonUserA( +// LPCWSTR lpszUsername, +// LPCWSTR lpszDomain, +// LPCWSTR lpszPassword, +// DWORD dwLogonType, +// DWORD dwLogonProvider, +// PHANDLE phToken +// ); +// +//sys LogonUser(username *uint16, domain *uint16, password *uint16, logonType uint32, logonProvider uint32, token *windows.Token) (err error) = advapi32.LogonUserW + +// Logon types +const ( + LOGON32_LOGON_INTERACTIVE uint32 = 2 + LOGON32_LOGON_NETWORK uint32 = 3 + LOGON32_LOGON_BATCH uint32 = 4 + LOGON32_LOGON_SERVICE uint32 = 5 + LOGON32_LOGON_UNLOCK uint32 = 7 + LOGON32_LOGON_NETWORK_CLEARTEXT uint32 = 8 + LOGON32_LOGON_NEW_CREDENTIALS uint32 = 9 +) + +// Logon providers +const ( + LOGON32_PROVIDER_DEFAULT uint32 = 0 + LOGON32_PROVIDER_WINNT40 uint32 = 2 + LOGON32_PROVIDER_WINNT50 uint32 = 3 +) diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/memory.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/memory.go new file mode 100644 index 000000000..53f62948c --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/memory.go @@ -0,0 +1,4 @@ +package winapi + +//sys LocalAlloc(flags uint32, size int) (ptr uintptr) = kernel32.LocalAlloc +//sys LocalFree(ptr uintptr) = kernel32.LocalFree diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/net.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/net.go new file mode 100644 index 000000000..f37910024 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/net.go @@ -0,0 +1,3 @@ +package winapi + +//sys SetJobCompartmentId(handle windows.Handle, compartmentId uint32) (win32Err error) = iphlpapi.SetJobCompartmentId diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/path.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/path.go new file mode 100644 index 000000000..908920e87 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/path.go @@ -0,0 +1,11 @@ +package winapi + +// DWORD SearchPathW( +// LPCWSTR lpPath, +// LPCWSTR lpFileName, +// LPCWSTR lpExtension, +// DWORD nBufferLength, +// LPWSTR lpBuffer, +// LPWSTR *lpFilePart +// ); +//sys SearchPath(lpPath *uint16, lpFileName *uint16, lpExtension *uint16, nBufferLength uint32, lpBuffer *uint16, lpFilePath *uint16) (size uint32, err error) = kernel32.SearchPathW diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/process.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/process.go new file mode 100644 index 000000000..222529f43 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/process.go @@ -0,0 +1,65 @@ +package winapi + +const PROCESS_ALL_ACCESS uint32 = 2097151 + +const ( + PROC_THREAD_ATTRIBUTE_PSEUDOCONSOLE = 0x20016 + PROC_THREAD_ATTRIBUTE_JOB_LIST = 0x2000D +) + +// ProcessVmCounters corresponds to the _VM_COUNTERS_EX and _VM_COUNTERS_EX2 structures. +const ProcessVmCounters = 3 + +// __kernel_entry NTSTATUS NtQueryInformationProcess( +// [in] HANDLE ProcessHandle, +// [in] PROCESSINFOCLASS ProcessInformationClass, +// [out] PVOID ProcessInformation, +// [in] ULONG ProcessInformationLength, +// [out, optional] PULONG ReturnLength +// ); +// +//sys NtQueryInformationProcess(processHandle windows.Handle, processInfoClass uint32, processInfo unsafe.Pointer, processInfoLength uint32, returnLength *uint32) (status uint32) = ntdll.NtQueryInformationProcess + +// typedef struct _VM_COUNTERS_EX +// { +// SIZE_T PeakVirtualSize; +// SIZE_T VirtualSize; +// ULONG PageFaultCount; +// SIZE_T PeakWorkingSetSize; +// SIZE_T WorkingSetSize; +// SIZE_T QuotaPeakPagedPoolUsage; +// SIZE_T QuotaPagedPoolUsage; +// SIZE_T QuotaPeakNonPagedPoolUsage; +// SIZE_T QuotaNonPagedPoolUsage; +// SIZE_T PagefileUsage; +// SIZE_T PeakPagefileUsage; +// SIZE_T PrivateUsage; +// } VM_COUNTERS_EX, *PVM_COUNTERS_EX; +// +type VM_COUNTERS_EX struct { + PeakVirtualSize uintptr + VirtualSize uintptr + PageFaultCount uint32 + PeakWorkingSetSize uintptr + WorkingSetSize uintptr + QuotaPeakPagedPoolUsage uintptr + QuotaPagedPoolUsage uintptr + QuotaPeakNonPagedPoolUsage uintptr + QuotaNonPagedPoolUsage uintptr + PagefileUsage uintptr + PeakPagefileUsage uintptr + PrivateUsage uintptr +} + +// typedef struct _VM_COUNTERS_EX2 +// { +// VM_COUNTERS_EX CountersEx; +// SIZE_T PrivateWorkingSetSize; +// SIZE_T SharedCommitUsage; +// } VM_COUNTERS_EX2, *PVM_COUNTERS_EX2; +// +type VM_COUNTERS_EX2 struct { + CountersEx VM_COUNTERS_EX + PrivateWorkingSetSize uintptr + SharedCommitUsage uintptr +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/processor.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/processor.go new file mode 100644 index 000000000..ce79ac2cd --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/processor.go @@ -0,0 +1,7 @@ +package winapi + +// Get count from all processor groups. +// https://docs.microsoft.com/en-us/windows/win32/procthread/processor-groups +const ALL_PROCESSOR_GROUPS = 0xFFFF + +//sys GetActiveProcessorCount(groupNumber uint16) (amount uint32) = kernel32.GetActiveProcessorCount diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/system.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/system.go new file mode 100644 index 000000000..78fe01a4b --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/system.go @@ -0,0 +1,53 @@ +package winapi + +import "golang.org/x/sys/windows" + +const SystemProcessInformation = 5 + +const STATUS_INFO_LENGTH_MISMATCH = 0xC0000004 + +// __kernel_entry NTSTATUS NtQuerySystemInformation( +// SYSTEM_INFORMATION_CLASS SystemInformationClass, +// PVOID SystemInformation, +// ULONG SystemInformationLength, +// PULONG ReturnLength +// ); +// +//sys NtQuerySystemInformation(systemInfoClass int, systemInformation unsafe.Pointer, systemInfoLength uint32, returnLength *uint32) (status uint32) = ntdll.NtQuerySystemInformation + +type SYSTEM_PROCESS_INFORMATION struct { + NextEntryOffset uint32 // ULONG + NumberOfThreads uint32 // ULONG + WorkingSetPrivateSize int64 // LARGE_INTEGER + HardFaultCount uint32 // ULONG + NumberOfThreadsHighWatermark uint32 // ULONG + CycleTime uint64 // ULONGLONG + CreateTime int64 // LARGE_INTEGER + UserTime int64 // LARGE_INTEGER + KernelTime int64 // LARGE_INTEGER + ImageName UnicodeString // UNICODE_STRING + BasePriority int32 // KPRIORITY + UniqueProcessID windows.Handle // HANDLE + InheritedFromUniqueProcessID windows.Handle // HANDLE + HandleCount uint32 // ULONG + SessionID uint32 // ULONG + UniqueProcessKey *uint32 // ULONG_PTR + PeakVirtualSize uintptr // SIZE_T + VirtualSize uintptr // SIZE_T + PageFaultCount uint32 // ULONG + PeakWorkingSetSize uintptr // SIZE_T + WorkingSetSize uintptr // SIZE_T + QuotaPeakPagedPoolUsage uintptr // SIZE_T + QuotaPagedPoolUsage uintptr // SIZE_T + QuotaPeakNonPagedPoolUsage uintptr // SIZE_T + QuotaNonPagedPoolUsage uintptr // SIZE_T + PagefileUsage uintptr // SIZE_T + PeakPagefileUsage uintptr // SIZE_T + PrivatePageCount uintptr // SIZE_T + ReadOperationCount int64 // LARGE_INTEGER + WriteOperationCount int64 // LARGE_INTEGER + OtherOperationCount int64 // LARGE_INTEGER + ReadTransferCount int64 // LARGE_INTEGER + WriteTransferCount int64 // LARGE_INTEGER + OtherTransferCount int64 // LARGE_INTEGER +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/thread.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/thread.go new file mode 100644 index 000000000..4724713e3 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/thread.go @@ -0,0 +1,12 @@ +package winapi + +// HANDLE CreateRemoteThread( +// HANDLE hProcess, +// LPSECURITY_ATTRIBUTES lpThreadAttributes, +// SIZE_T dwStackSize, +// LPTHREAD_START_ROUTINE lpStartAddress, +// LPVOID lpParameter, +// DWORD dwCreationFlags, +// LPDWORD lpThreadId +// ); +//sys CreateRemoteThread(process windows.Handle, sa *windows.SecurityAttributes, stackSize uint32, startAddr uintptr, parameter uintptr, creationFlags uint32, threadID *uint32) (handle windows.Handle, err error) = kernel32.CreateRemoteThread diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/utils.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/utils.go new file mode 100644 index 000000000..859b753c2 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/utils.go @@ -0,0 +1,80 @@ +package winapi + +import ( + "errors" + "reflect" + "syscall" + "unsafe" + + "golang.org/x/sys/windows" +) + +// Uint16BufferToSlice wraps a uint16 pointer-and-length into a slice +// for easier interop with Go APIs +func Uint16BufferToSlice(buffer *uint16, bufferLength int) (result []uint16) { + hdr := (*reflect.SliceHeader)(unsafe.Pointer(&result)) + hdr.Data = uintptr(unsafe.Pointer(buffer)) + hdr.Cap = bufferLength + hdr.Len = bufferLength + + return +} + +// UnicodeString corresponds to UNICODE_STRING win32 struct defined here +// https://docs.microsoft.com/en-us/windows/win32/api/ntdef/ns-ntdef-_unicode_string +type UnicodeString struct { + Length uint16 + MaximumLength uint16 + Buffer *uint16 +} + +// NTSTRSAFE_UNICODE_STRING_MAX_CCH is a constant defined in ntstrsafe.h. This value +// denotes the maximum number of wide chars a path can have. +const NTSTRSAFE_UNICODE_STRING_MAX_CCH = 32767 + +//String converts a UnicodeString to a golang string +func (uni UnicodeString) String() string { + // UnicodeString is not guaranteed to be null terminated, therefore + // use the UnicodeString's Length field + return windows.UTF16ToString(Uint16BufferToSlice(uni.Buffer, int(uni.Length/2))) +} + +// NewUnicodeString allocates a new UnicodeString and copies `s` into +// the buffer of the new UnicodeString. +func NewUnicodeString(s string) (*UnicodeString, error) { + buf, err := windows.UTF16FromString(s) + if err != nil { + return nil, err + } + + if len(buf) > NTSTRSAFE_UNICODE_STRING_MAX_CCH { + return nil, syscall.ENAMETOOLONG + } + + uni := &UnicodeString{ + // The length is in bytes and should not include the trailing null character. + Length: uint16((len(buf) - 1) * 2), + MaximumLength: uint16((len(buf) - 1) * 2), + Buffer: &buf[0], + } + return uni, nil +} + +// ConvertStringSetToSlice is a helper function used to convert the contents of +// `buf` into a string slice. `buf` contains a set of null terminated strings +// with an additional null at the end to indicate the end of the set. +func ConvertStringSetToSlice(buf []byte) ([]string, error) { + var results []string + prev := 0 + for i := range buf { + if buf[i] == 0 { + if prev == i { + // found two null characters in a row, return result + return results, nil + } + results = append(results, string(buf[prev:i])) + prev = i + 1 + } + } + return nil, errors.New("string set malformed: missing null terminator at end of buffer") +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/winapi.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/winapi.go new file mode 100644 index 000000000..d2cc9d9fb --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/winapi.go @@ -0,0 +1,5 @@ +// Package winapi contains various low-level bindings to Windows APIs. It can +// be thought of as an extension to golang.org/x/sys/windows. +package winapi + +//go:generate go run ..\..\mksyscall_windows.go -output zsyscall_windows.go user.go console.go system.go net.go path.go thread.go jobobject.go logon.go memory.go process.go processor.go devices.go filesystem.go errors.go diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/zsyscall_windows.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/zsyscall_windows.go new file mode 100644 index 000000000..1f16cf0b8 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/internal/winapi/zsyscall_windows.go @@ -0,0 +1,354 @@ +// Code generated mksyscall_windows.exe DO NOT EDIT + +package winapi + +import ( + "syscall" + "unsafe" + + "golang.org/x/sys/windows" +) + +var _ unsafe.Pointer + +// Do the interface allocations only once for common +// Errno values. +const ( + errnoERROR_IO_PENDING = 997 +) + +var ( + errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) +) + +// errnoErr returns common boxed Errno values, to prevent +// allocations at runtime. +func errnoErr(e syscall.Errno) error { + switch e { + case 0: + return nil + case errnoERROR_IO_PENDING: + return errERROR_IO_PENDING + } + // TODO: add more here, after collecting data on the common + // error values see on Windows. (perhaps when running + // all.bat?) + return e +} + +var ( + modkernel32 = windows.NewLazySystemDLL("kernel32.dll") + modntdll = windows.NewLazySystemDLL("ntdll.dll") + modiphlpapi = windows.NewLazySystemDLL("iphlpapi.dll") + modadvapi32 = windows.NewLazySystemDLL("advapi32.dll") + modcfgmgr32 = windows.NewLazySystemDLL("cfgmgr32.dll") + + procCreatePseudoConsole = modkernel32.NewProc("CreatePseudoConsole") + procClosePseudoConsole = modkernel32.NewProc("ClosePseudoConsole") + procResizePseudoConsole = modkernel32.NewProc("ResizePseudoConsole") + procNtQuerySystemInformation = modntdll.NewProc("NtQuerySystemInformation") + procSetJobCompartmentId = modiphlpapi.NewProc("SetJobCompartmentId") + procSearchPathW = modkernel32.NewProc("SearchPathW") + procCreateRemoteThread = modkernel32.NewProc("CreateRemoteThread") + procIsProcessInJob = modkernel32.NewProc("IsProcessInJob") + procQueryInformationJobObject = modkernel32.NewProc("QueryInformationJobObject") + procOpenJobObjectW = modkernel32.NewProc("OpenJobObjectW") + procSetIoRateControlInformationJobObject = modkernel32.NewProc("SetIoRateControlInformationJobObject") + procQueryIoRateControlInformationJobObject = modkernel32.NewProc("QueryIoRateControlInformationJobObject") + procNtOpenJobObject = modntdll.NewProc("NtOpenJobObject") + procNtCreateJobObject = modntdll.NewProc("NtCreateJobObject") + procLogonUserW = modadvapi32.NewProc("LogonUserW") + procLocalAlloc = modkernel32.NewProc("LocalAlloc") + procLocalFree = modkernel32.NewProc("LocalFree") + procNtQueryInformationProcess = modntdll.NewProc("NtQueryInformationProcess") + procGetActiveProcessorCount = modkernel32.NewProc("GetActiveProcessorCount") + procCM_Get_Device_ID_List_SizeA = modcfgmgr32.NewProc("CM_Get_Device_ID_List_SizeA") + procCM_Get_Device_ID_ListA = modcfgmgr32.NewProc("CM_Get_Device_ID_ListA") + procCM_Locate_DevNodeW = modcfgmgr32.NewProc("CM_Locate_DevNodeW") + procCM_Get_DevNode_PropertyW = modcfgmgr32.NewProc("CM_Get_DevNode_PropertyW") + procNtCreateFile = modntdll.NewProc("NtCreateFile") + procNtSetInformationFile = modntdll.NewProc("NtSetInformationFile") + procNtOpenDirectoryObject = modntdll.NewProc("NtOpenDirectoryObject") + procNtQueryDirectoryObject = modntdll.NewProc("NtQueryDirectoryObject") + procRtlNtStatusToDosError = modntdll.NewProc("RtlNtStatusToDosError") +) + +func createPseudoConsole(size uint32, hInput windows.Handle, hOutput windows.Handle, dwFlags uint32, hpcon *windows.Handle) (hr error) { + r0, _, _ := syscall.Syscall6(procCreatePseudoConsole.Addr(), 5, uintptr(size), uintptr(hInput), uintptr(hOutput), uintptr(dwFlags), uintptr(unsafe.Pointer(hpcon)), 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func ClosePseudoConsole(hpc windows.Handle) { + syscall.Syscall(procClosePseudoConsole.Addr(), 1, uintptr(hpc), 0, 0) + return +} + +func resizePseudoConsole(hPc windows.Handle, size uint32) (hr error) { + r0, _, _ := syscall.Syscall(procResizePseudoConsole.Addr(), 2, uintptr(hPc), uintptr(size), 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func NtQuerySystemInformation(systemInfoClass int, systemInformation unsafe.Pointer, systemInfoLength uint32, returnLength *uint32) (status uint32) { + r0, _, _ := syscall.Syscall6(procNtQuerySystemInformation.Addr(), 4, uintptr(systemInfoClass), uintptr(systemInformation), uintptr(systemInfoLength), uintptr(unsafe.Pointer(returnLength)), 0, 0) + status = uint32(r0) + return +} + +func SetJobCompartmentId(handle windows.Handle, compartmentId uint32) (win32Err error) { + r0, _, _ := syscall.Syscall(procSetJobCompartmentId.Addr(), 2, uintptr(handle), uintptr(compartmentId), 0) + if r0 != 0 { + win32Err = syscall.Errno(r0) + } + return +} + +func SearchPath(lpPath *uint16, lpFileName *uint16, lpExtension *uint16, nBufferLength uint32, lpBuffer *uint16, lpFilePath *uint16) (size uint32, err error) { + r0, _, e1 := syscall.Syscall6(procSearchPathW.Addr(), 6, uintptr(unsafe.Pointer(lpPath)), uintptr(unsafe.Pointer(lpFileName)), uintptr(unsafe.Pointer(lpExtension)), uintptr(nBufferLength), uintptr(unsafe.Pointer(lpBuffer)), uintptr(unsafe.Pointer(lpFilePath))) + size = uint32(r0) + if size == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func CreateRemoteThread(process windows.Handle, sa *windows.SecurityAttributes, stackSize uint32, startAddr uintptr, parameter uintptr, creationFlags uint32, threadID *uint32) (handle windows.Handle, err error) { + r0, _, e1 := syscall.Syscall9(procCreateRemoteThread.Addr(), 7, uintptr(process), uintptr(unsafe.Pointer(sa)), uintptr(stackSize), uintptr(startAddr), uintptr(parameter), uintptr(creationFlags), uintptr(unsafe.Pointer(threadID)), 0, 0) + handle = windows.Handle(r0) + if handle == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func IsProcessInJob(procHandle windows.Handle, jobHandle windows.Handle, result *int32) (err error) { + r1, _, e1 := syscall.Syscall(procIsProcessInJob.Addr(), 3, uintptr(procHandle), uintptr(jobHandle), uintptr(unsafe.Pointer(result))) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func QueryInformationJobObject(jobHandle windows.Handle, infoClass uint32, jobObjectInfo unsafe.Pointer, jobObjectInformationLength uint32, lpReturnLength *uint32) (err error) { + r1, _, e1 := syscall.Syscall6(procQueryInformationJobObject.Addr(), 5, uintptr(jobHandle), uintptr(infoClass), uintptr(jobObjectInfo), uintptr(jobObjectInformationLength), uintptr(unsafe.Pointer(lpReturnLength)), 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func OpenJobObject(desiredAccess uint32, inheritHandle bool, lpName *uint16) (handle windows.Handle, err error) { + var _p0 uint32 + if inheritHandle { + _p0 = 1 + } else { + _p0 = 0 + } + r0, _, e1 := syscall.Syscall(procOpenJobObjectW.Addr(), 3, uintptr(desiredAccess), uintptr(_p0), uintptr(unsafe.Pointer(lpName))) + handle = windows.Handle(r0) + if handle == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func SetIoRateControlInformationJobObject(jobHandle windows.Handle, ioRateControlInfo *JOBOBJECT_IO_RATE_CONTROL_INFORMATION) (ret uint32, err error) { + r0, _, e1 := syscall.Syscall(procSetIoRateControlInformationJobObject.Addr(), 2, uintptr(jobHandle), uintptr(unsafe.Pointer(ioRateControlInfo)), 0) + ret = uint32(r0) + if ret == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func QueryIoRateControlInformationJobObject(jobHandle windows.Handle, volumeName *uint16, ioRateControlInfo **JOBOBJECT_IO_RATE_CONTROL_INFORMATION, infoBlockCount *uint32) (ret uint32, err error) { + r0, _, e1 := syscall.Syscall6(procQueryIoRateControlInformationJobObject.Addr(), 4, uintptr(jobHandle), uintptr(unsafe.Pointer(volumeName)), uintptr(unsafe.Pointer(ioRateControlInfo)), uintptr(unsafe.Pointer(infoBlockCount)), 0, 0) + ret = uint32(r0) + if ret == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func NtOpenJobObject(jobHandle *windows.Handle, desiredAccess uint32, objAttributes *ObjectAttributes) (status uint32) { + r0, _, _ := syscall.Syscall(procNtOpenJobObject.Addr(), 3, uintptr(unsafe.Pointer(jobHandle)), uintptr(desiredAccess), uintptr(unsafe.Pointer(objAttributes))) + status = uint32(r0) + return +} + +func NtCreateJobObject(jobHandle *windows.Handle, desiredAccess uint32, objAttributes *ObjectAttributes) (status uint32) { + r0, _, _ := syscall.Syscall(procNtCreateJobObject.Addr(), 3, uintptr(unsafe.Pointer(jobHandle)), uintptr(desiredAccess), uintptr(unsafe.Pointer(objAttributes))) + status = uint32(r0) + return +} + +func LogonUser(username *uint16, domain *uint16, password *uint16, logonType uint32, logonProvider uint32, token *windows.Token) (err error) { + r1, _, e1 := syscall.Syscall6(procLogonUserW.Addr(), 6, uintptr(unsafe.Pointer(username)), uintptr(unsafe.Pointer(domain)), uintptr(unsafe.Pointer(password)), uintptr(logonType), uintptr(logonProvider), uintptr(unsafe.Pointer(token))) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func LocalAlloc(flags uint32, size int) (ptr uintptr) { + r0, _, _ := syscall.Syscall(procLocalAlloc.Addr(), 2, uintptr(flags), uintptr(size), 0) + ptr = uintptr(r0) + return +} + +func LocalFree(ptr uintptr) { + syscall.Syscall(procLocalFree.Addr(), 1, uintptr(ptr), 0, 0) + return +} + +func NtQueryInformationProcess(processHandle windows.Handle, processInfoClass uint32, processInfo unsafe.Pointer, processInfoLength uint32, returnLength *uint32) (status uint32) { + r0, _, _ := syscall.Syscall6(procNtQueryInformationProcess.Addr(), 5, uintptr(processHandle), uintptr(processInfoClass), uintptr(processInfo), uintptr(processInfoLength), uintptr(unsafe.Pointer(returnLength)), 0) + status = uint32(r0) + return +} + +func GetActiveProcessorCount(groupNumber uint16) (amount uint32) { + r0, _, _ := syscall.Syscall(procGetActiveProcessorCount.Addr(), 1, uintptr(groupNumber), 0, 0) + amount = uint32(r0) + return +} + +func CMGetDeviceIDListSize(pulLen *uint32, pszFilter *byte, uFlags uint32) (hr error) { + r0, _, _ := syscall.Syscall(procCM_Get_Device_ID_List_SizeA.Addr(), 3, uintptr(unsafe.Pointer(pulLen)), uintptr(unsafe.Pointer(pszFilter)), uintptr(uFlags)) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func CMGetDeviceIDList(pszFilter *byte, buffer *byte, bufferLen uint32, uFlags uint32) (hr error) { + r0, _, _ := syscall.Syscall6(procCM_Get_Device_ID_ListA.Addr(), 4, uintptr(unsafe.Pointer(pszFilter)), uintptr(unsafe.Pointer(buffer)), uintptr(bufferLen), uintptr(uFlags), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func CMLocateDevNode(pdnDevInst *uint32, pDeviceID string, uFlags uint32) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(pDeviceID) + if hr != nil { + return + } + return _CMLocateDevNode(pdnDevInst, _p0, uFlags) +} + +func _CMLocateDevNode(pdnDevInst *uint32, pDeviceID *uint16, uFlags uint32) (hr error) { + r0, _, _ := syscall.Syscall(procCM_Locate_DevNodeW.Addr(), 3, uintptr(unsafe.Pointer(pdnDevInst)), uintptr(unsafe.Pointer(pDeviceID)), uintptr(uFlags)) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func CMGetDevNodeProperty(dnDevInst uint32, propertyKey *DevPropKey, propertyType *uint32, propertyBuffer *uint16, propertyBufferSize *uint32, uFlags uint32) (hr error) { + r0, _, _ := syscall.Syscall6(procCM_Get_DevNode_PropertyW.Addr(), 6, uintptr(dnDevInst), uintptr(unsafe.Pointer(propertyKey)), uintptr(unsafe.Pointer(propertyType)), uintptr(unsafe.Pointer(propertyBuffer)), uintptr(unsafe.Pointer(propertyBufferSize)), uintptr(uFlags)) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func NtCreateFile(handle *uintptr, accessMask uint32, oa *ObjectAttributes, iosb *IOStatusBlock, allocationSize *uint64, fileAttributes uint32, shareAccess uint32, createDisposition uint32, createOptions uint32, eaBuffer *byte, eaLength uint32) (status uint32) { + r0, _, _ := syscall.Syscall12(procNtCreateFile.Addr(), 11, uintptr(unsafe.Pointer(handle)), uintptr(accessMask), uintptr(unsafe.Pointer(oa)), uintptr(unsafe.Pointer(iosb)), uintptr(unsafe.Pointer(allocationSize)), uintptr(fileAttributes), uintptr(shareAccess), uintptr(createDisposition), uintptr(createOptions), uintptr(unsafe.Pointer(eaBuffer)), uintptr(eaLength), 0) + status = uint32(r0) + return +} + +func NtSetInformationFile(handle uintptr, iosb *IOStatusBlock, information uintptr, length uint32, class uint32) (status uint32) { + r0, _, _ := syscall.Syscall6(procNtSetInformationFile.Addr(), 5, uintptr(handle), uintptr(unsafe.Pointer(iosb)), uintptr(information), uintptr(length), uintptr(class), 0) + status = uint32(r0) + return +} + +func NtOpenDirectoryObject(handle *uintptr, accessMask uint32, oa *ObjectAttributes) (status uint32) { + r0, _, _ := syscall.Syscall(procNtOpenDirectoryObject.Addr(), 3, uintptr(unsafe.Pointer(handle)), uintptr(accessMask), uintptr(unsafe.Pointer(oa))) + status = uint32(r0) + return +} + +func NtQueryDirectoryObject(handle uintptr, buffer *byte, length uint32, singleEntry bool, restartScan bool, context *uint32, returnLength *uint32) (status uint32) { + var _p0 uint32 + if singleEntry { + _p0 = 1 + } else { + _p0 = 0 + } + var _p1 uint32 + if restartScan { + _p1 = 1 + } else { + _p1 = 0 + } + r0, _, _ := syscall.Syscall9(procNtQueryDirectoryObject.Addr(), 7, uintptr(handle), uintptr(unsafe.Pointer(buffer)), uintptr(length), uintptr(_p0), uintptr(_p1), uintptr(unsafe.Pointer(context)), uintptr(unsafe.Pointer(returnLength)), 0, 0) + status = uint32(r0) + return +} + +func RtlNtStatusToDosError(status uint32) (winerr error) { + r0, _, _ := syscall.Syscall(procRtlNtStatusToDosError.Addr(), 1, uintptr(status), 0, 0) + if r0 != 0 { + winerr = syscall.Errno(r0) + } + return +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/layer.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/layer.go new file mode 100644 index 000000000..891616370 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/layer.go @@ -0,0 +1,107 @@ +package hcsshim + +import ( + "context" + "crypto/sha1" + "path/filepath" + + "github.com/Microsoft/go-winio/pkg/guid" + "github.com/Microsoft/hcsshim/internal/wclayer" +) + +func layerPath(info *DriverInfo, id string) string { + return filepath.Join(info.HomeDir, id) +} + +func ActivateLayer(info DriverInfo, id string) error { + return wclayer.ActivateLayer(context.Background(), layerPath(&info, id)) +} +func CreateLayer(info DriverInfo, id, parent string) error { + return wclayer.CreateLayer(context.Background(), layerPath(&info, id), parent) +} + +// New clients should use CreateScratchLayer instead. Kept in to preserve API compatibility. +func CreateSandboxLayer(info DriverInfo, layerId, parentId string, parentLayerPaths []string) error { + return wclayer.CreateScratchLayer(context.Background(), layerPath(&info, layerId), parentLayerPaths) +} +func CreateScratchLayer(info DriverInfo, layerId, parentId string, parentLayerPaths []string) error { + return wclayer.CreateScratchLayer(context.Background(), layerPath(&info, layerId), parentLayerPaths) +} +func DeactivateLayer(info DriverInfo, id string) error { + return wclayer.DeactivateLayer(context.Background(), layerPath(&info, id)) +} +func DestroyLayer(info DriverInfo, id string) error { + return wclayer.DestroyLayer(context.Background(), layerPath(&info, id)) +} + +// New clients should use ExpandScratchSize instead. Kept in to preserve API compatibility. +func ExpandSandboxSize(info DriverInfo, layerId string, size uint64) error { + return wclayer.ExpandScratchSize(context.Background(), layerPath(&info, layerId), size) +} +func ExpandScratchSize(info DriverInfo, layerId string, size uint64) error { + return wclayer.ExpandScratchSize(context.Background(), layerPath(&info, layerId), size) +} +func ExportLayer(info DriverInfo, layerId string, exportFolderPath string, parentLayerPaths []string) error { + return wclayer.ExportLayer(context.Background(), layerPath(&info, layerId), exportFolderPath, parentLayerPaths) +} +func GetLayerMountPath(info DriverInfo, id string) (string, error) { + return wclayer.GetLayerMountPath(context.Background(), layerPath(&info, id)) +} +func GetSharedBaseImages() (imageData string, err error) { + return wclayer.GetSharedBaseImages(context.Background()) +} +func ImportLayer(info DriverInfo, layerID string, importFolderPath string, parentLayerPaths []string) error { + return wclayer.ImportLayer(context.Background(), layerPath(&info, layerID), importFolderPath, parentLayerPaths) +} +func LayerExists(info DriverInfo, id string) (bool, error) { + return wclayer.LayerExists(context.Background(), layerPath(&info, id)) +} +func PrepareLayer(info DriverInfo, layerId string, parentLayerPaths []string) error { + return wclayer.PrepareLayer(context.Background(), layerPath(&info, layerId), parentLayerPaths) +} +func ProcessBaseLayer(path string) error { + return wclayer.ProcessBaseLayer(context.Background(), path) +} +func ProcessUtilityVMImage(path string) error { + return wclayer.ProcessUtilityVMImage(context.Background(), path) +} +func UnprepareLayer(info DriverInfo, layerId string) error { + return wclayer.UnprepareLayer(context.Background(), layerPath(&info, layerId)) +} + +type DriverInfo struct { + Flavour int + HomeDir string +} + +type GUID [16]byte + +func NameToGuid(name string) (id GUID, err error) { + g, err := wclayer.NameToGuid(context.Background(), name) + return g.ToWindowsArray(), err +} + +func NewGUID(source string) *GUID { + h := sha1.Sum([]byte(source)) + var g GUID + copy(g[0:], h[0:16]) + return &g +} + +func (g *GUID) ToString() string { + return guid.FromWindowsArray(*g).String() +} + +type LayerReader = wclayer.LayerReader + +func NewLayerReader(info DriverInfo, layerID string, parentLayerPaths []string) (LayerReader, error) { + return wclayer.NewLayerReader(context.Background(), layerPath(&info, layerID), parentLayerPaths) +} + +type LayerWriter = wclayer.LayerWriter + +func NewLayerWriter(info DriverInfo, layerID string, parentLayerPaths []string) (LayerWriter, error) { + return wclayer.NewLayerWriter(context.Background(), layerPath(&info, layerID), parentLayerPaths) +} + +type WC_LAYER_DESCRIPTOR = wclayer.WC_LAYER_DESCRIPTOR diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/osversion/osversion_windows.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/osversion/osversion_windows.go new file mode 100644 index 000000000..3ab3bcd89 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/osversion/osversion_windows.go @@ -0,0 +1,50 @@ +package osversion + +import ( + "fmt" + "sync" + + "golang.org/x/sys/windows" +) + +// OSVersion is a wrapper for Windows version information +// https://msdn.microsoft.com/en-us/library/windows/desktop/ms724439(v=vs.85).aspx +type OSVersion struct { + Version uint32 + MajorVersion uint8 + MinorVersion uint8 + Build uint16 +} + +var ( + osv OSVersion + once sync.Once +) + +// Get gets the operating system version on Windows. +// The calling application must be manifested to get the correct version information. +func Get() OSVersion { + once.Do(func() { + var err error + osv = OSVersion{} + osv.Version, err = windows.GetVersion() + if err != nil { + // GetVersion never fails. + panic(err) + } + osv.MajorVersion = uint8(osv.Version & 0xFF) + osv.MinorVersion = uint8(osv.Version >> 8 & 0xFF) + osv.Build = uint16(osv.Version >> 16) + }) + return osv +} + +// Build gets the build-number on Windows +// The calling application must be manifested to get the correct version information. +func Build() uint16 { + return Get().Build +} + +func (osv OSVersion) ToString() string { + return fmt.Sprintf("%d.%d.%d", osv.MajorVersion, osv.MinorVersion, osv.Build) +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/osversion/windowsbuilds.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/osversion/windowsbuilds.go new file mode 100644 index 000000000..75dce5d82 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/osversion/windowsbuilds.go @@ -0,0 +1,50 @@ +package osversion + +const ( + // RS1 (version 1607, codename "Redstone 1") corresponds to Windows Server + // 2016 (ltsc2016) and Windows 10 (Anniversary Update). + RS1 = 14393 + + // RS2 (version 1703, codename "Redstone 2") was a client-only update, and + // corresponds to Windows 10 (Creators Update). + RS2 = 15063 + + // RS3 (version 1709, codename "Redstone 3") corresponds to Windows Server + // 1709 (Semi-Annual Channel (SAC)), and Windows 10 (Fall Creators Update). + RS3 = 16299 + + // RS4 (version 1803, codename "Redstone 4") corresponds to Windows Server + // 1803 (Semi-Annual Channel (SAC)), and Windows 10 (April 2018 Update). + RS4 = 17134 + + // RS5 (version 1809, codename "Redstone 5") corresponds to Windows Server + // 2019 (ltsc2019), and Windows 10 (October 2018 Update). + RS5 = 17763 + + // V19H1 (version 1903) corresponds to Windows Server 1903 (semi-annual + // channel). + V19H1 = 18362 + + // V19H2 (version 1909) corresponds to Windows Server 1909 (semi-annual + // channel). + V19H2 = 18363 + + // V20H1 (version 2004) corresponds to Windows Server 2004 (semi-annual + // channel). + V20H1 = 19041 + + // V20H2 corresponds to Windows Server 20H2 (semi-annual channel). + V20H2 = 19042 + + // V21H1 corresponds to Windows Server 21H1 (semi-annual channel). + V21H1 = 19043 + + // V21H2Win10 corresponds to Windows 10 (November 2021 Update). + V21H2Win10 = 19044 + + // V21H2Server corresponds to Windows Server 2022 (ltsc2022). + V21H2Server = 20348 + + // V21H2Win11 corresponds to Windows 11 (original release). + V21H2Win11 = 22000 +) diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/pkg/ociwclayer/export.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/pkg/ociwclayer/export.go new file mode 100644 index 000000000..e3f1be333 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/pkg/ociwclayer/export.go @@ -0,0 +1,88 @@ +// Package ociwclayer provides functions for importing and exporting Windows +// container layers from and to their OCI tar representation. +package ociwclayer + +import ( + "archive/tar" + "context" + "io" + "path/filepath" + + "github.com/Microsoft/go-winio/backuptar" + "github.com/Microsoft/hcsshim" +) + +var driverInfo = hcsshim.DriverInfo{} + +// ExportLayerToTar writes an OCI layer tar stream from the provided on-disk layer. +// The caller must specify the parent layers, if any, ordered from lowest to +// highest layer. +// +// The layer will be mounted for this process, so the caller should ensure that +// it is not currently mounted. +func ExportLayerToTar(ctx context.Context, w io.Writer, path string, parentLayerPaths []string) error { + err := hcsshim.ActivateLayer(driverInfo, path) + if err != nil { + return err + } + defer func() { + _ = hcsshim.DeactivateLayer(driverInfo, path) + }() + + // Prepare and unprepare the layer to ensure that it has been initialized. + err = hcsshim.PrepareLayer(driverInfo, path, parentLayerPaths) + if err != nil { + return err + } + err = hcsshim.UnprepareLayer(driverInfo, path) + if err != nil { + return err + } + + r, err := hcsshim.NewLayerReader(driverInfo, path, parentLayerPaths) + if err != nil { + return err + } + + err = writeTarFromLayer(ctx, r, w) + cerr := r.Close() + if err != nil { + return err + } + return cerr +} + +func writeTarFromLayer(ctx context.Context, r hcsshim.LayerReader, w io.Writer) error { + t := tar.NewWriter(w) + for { + select { + case <-ctx.Done(): + return ctx.Err() + default: + } + + name, size, fileInfo, err := r.Next() + if err == io.EOF { + break + } + if err != nil { + return err + } + if fileInfo == nil { + // Write a whiteout file. + hdr := &tar.Header{ + Name: filepath.ToSlash(filepath.Join(filepath.Dir(name), whiteoutPrefix+filepath.Base(name))), + } + err := t.WriteHeader(hdr) + if err != nil { + return err + } + } else { + err = backuptar.WriteTarFileFromBackupStream(t, r, name, size, fileInfo) + if err != nil { + return err + } + } + } + return t.Close() +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/pkg/ociwclayer/import.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/pkg/ociwclayer/import.go new file mode 100644 index 000000000..e74a6b594 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/pkg/ociwclayer/import.go @@ -0,0 +1,148 @@ +package ociwclayer + +import ( + "archive/tar" + "bufio" + "context" + "io" + "os" + "path" + "path/filepath" + "strings" + + winio "github.com/Microsoft/go-winio" + "github.com/Microsoft/go-winio/backuptar" + "github.com/Microsoft/hcsshim" +) + +const whiteoutPrefix = ".wh." + +var ( + // mutatedFiles is a list of files that are mutated by the import process + // and must be backed up and restored. + mutatedFiles = map[string]string{ + "UtilityVM/Files/EFI/Microsoft/Boot/BCD": "bcd.bak", + "UtilityVM/Files/EFI/Microsoft/Boot/BCD.LOG": "bcd.log.bak", + "UtilityVM/Files/EFI/Microsoft/Boot/BCD.LOG1": "bcd.log1.bak", + "UtilityVM/Files/EFI/Microsoft/Boot/BCD.LOG2": "bcd.log2.bak", + } +) + +// ImportLayerFromTar reads a layer from an OCI layer tar stream and extracts it to the +// specified path. The caller must specify the parent layers, if any, ordered +// from lowest to highest layer. +// +// The caller must ensure that the thread or process has acquired backup and +// restore privileges. +// +// This function returns the total size of the layer's files, in bytes. +func ImportLayerFromTar(ctx context.Context, r io.Reader, path string, parentLayerPaths []string) (int64, error) { + err := os.MkdirAll(path, 0) + if err != nil { + return 0, err + } + w, err := hcsshim.NewLayerWriter(hcsshim.DriverInfo{}, path, parentLayerPaths) + if err != nil { + return 0, err + } + n, err := writeLayerFromTar(ctx, r, w, path) + cerr := w.Close() + if err != nil { + return 0, err + } + if cerr != nil { + return 0, cerr + } + return n, nil +} + +func writeLayerFromTar(ctx context.Context, r io.Reader, w hcsshim.LayerWriter, root string) (int64, error) { + t := tar.NewReader(r) + hdr, err := t.Next() + totalSize := int64(0) + buf := bufio.NewWriter(nil) + for err == nil { + select { + case <-ctx.Done(): + return 0, ctx.Err() + default: + } + + base := path.Base(hdr.Name) + if strings.HasPrefix(base, whiteoutPrefix) { + name := path.Join(path.Dir(hdr.Name), base[len(whiteoutPrefix):]) + err = w.Remove(filepath.FromSlash(name)) + if err != nil { + return 0, err + } + hdr, err = t.Next() + } else if hdr.Typeflag == tar.TypeLink { + err = w.AddLink(filepath.FromSlash(hdr.Name), filepath.FromSlash(hdr.Linkname)) + if err != nil { + return 0, err + } + hdr, err = t.Next() + } else { + var ( + name string + size int64 + fileInfo *winio.FileBasicInfo + ) + name, size, fileInfo, err = backuptar.FileInfoFromHeader(hdr) + if err != nil { + return 0, err + } + err = w.Add(filepath.FromSlash(name), fileInfo) + if err != nil { + return 0, err + } + hdr, err = writeBackupStreamFromTarAndSaveMutatedFiles(buf, w, t, hdr, root) + totalSize += size + } + } + if err != io.EOF { + return 0, err + } + return totalSize, nil +} + +// writeBackupStreamFromTarAndSaveMutatedFiles reads data from a tar stream and +// writes it to a backup stream, and also saves any files that will be mutated +// by the import layer process to a backup location. +func writeBackupStreamFromTarAndSaveMutatedFiles(buf *bufio.Writer, w io.Writer, t *tar.Reader, hdr *tar.Header, root string) (nextHdr *tar.Header, err error) { + var bcdBackup *os.File + var bcdBackupWriter *winio.BackupFileWriter + if backupPath, ok := mutatedFiles[hdr.Name]; ok { + bcdBackup, err = os.Create(filepath.Join(root, backupPath)) + if err != nil { + return nil, err + } + defer func() { + cerr := bcdBackup.Close() + if err == nil { + err = cerr + } + }() + + bcdBackupWriter = winio.NewBackupFileWriter(bcdBackup, false) + defer func() { + cerr := bcdBackupWriter.Close() + if err == nil { + err = cerr + } + }() + + buf.Reset(io.MultiWriter(w, bcdBackupWriter)) + } else { + buf.Reset(w) + } + + defer func() { + ferr := buf.Flush() + if err == nil { + err = ferr + } + }() + + return backuptar.WriteBackupStreamFromTarFile(buf, t, hdr) +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/process.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/process.go new file mode 100644 index 000000000..3362c6833 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/process.go @@ -0,0 +1,98 @@ +package hcsshim + +import ( + "context" + "io" + "sync" + "time" + + "github.com/Microsoft/hcsshim/internal/hcs" +) + +// ContainerError is an error encountered in HCS +type process struct { + p *hcs.Process + waitOnce sync.Once + waitCh chan struct{} + waitErr error +} + +// Pid returns the process ID of the process within the container. +func (process *process) Pid() int { + return process.p.Pid() +} + +// Kill signals the process to terminate but does not wait for it to finish terminating. +func (process *process) Kill() error { + found, err := process.p.Kill(context.Background()) + if err != nil { + return convertProcessError(err, process) + } + if !found { + return &ProcessError{Process: process, Err: ErrElementNotFound, Operation: "hcsshim::Process::Kill"} + } + return nil +} + +// Wait waits for the process to exit. +func (process *process) Wait() error { + return convertProcessError(process.p.Wait(), process) +} + +// WaitTimeout waits for the process to exit or the duration to elapse. It returns +// false if timeout occurs. +func (process *process) WaitTimeout(timeout time.Duration) error { + process.waitOnce.Do(func() { + process.waitCh = make(chan struct{}) + go func() { + process.waitErr = process.Wait() + close(process.waitCh) + }() + }) + t := time.NewTimer(timeout) + defer t.Stop() + select { + case <-t.C: + return &ProcessError{Process: process, Err: ErrTimeout, Operation: "hcsshim::Process::Wait"} + case <-process.waitCh: + return process.waitErr + } +} + +// ExitCode returns the exit code of the process. The process must have +// already terminated. +func (process *process) ExitCode() (int, error) { + code, err := process.p.ExitCode() + if err != nil { + err = convertProcessError(err, process) + } + return code, err +} + +// ResizeConsole resizes the console of the process. +func (process *process) ResizeConsole(width, height uint16) error { + return convertProcessError(process.p.ResizeConsole(context.Background(), width, height), process) +} + +// Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing +// these pipes does not close the underlying pipes; it should be possible to +// call this multiple times to get multiple interfaces. +func (process *process) Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, error) { + stdin, stdout, stderr, err := process.p.StdioLegacy() + if err != nil { + err = convertProcessError(err, process) + } + return stdin, stdout, stderr, err +} + +// CloseStdin closes the write side of the stdin pipe so that the process is +// notified on the read side that there is no more data in stdin. +func (process *process) CloseStdin() error { + return convertProcessError(process.p.CloseStdin(context.Background()), process) +} + +// Close cleans up any state associated with the process but does not kill +// or wait on it. +func (process *process) Close() error { + return convertProcessError(process.p.Close(), process) +} diff --git a/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/zsyscall_windows.go b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/zsyscall_windows.go new file mode 100644 index 000000000..8bed84857 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/Microsoft/hcsshim/zsyscall_windows.go @@ -0,0 +1,54 @@ +// Code generated mksyscall_windows.exe DO NOT EDIT + +package hcsshim + +import ( + "syscall" + "unsafe" + + "golang.org/x/sys/windows" +) + +var _ unsafe.Pointer + +// Do the interface allocations only once for common +// Errno values. +const ( + errnoERROR_IO_PENDING = 997 +) + +var ( + errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) +) + +// errnoErr returns common boxed Errno values, to prevent +// allocations at runtime. +func errnoErr(e syscall.Errno) error { + switch e { + case 0: + return nil + case errnoERROR_IO_PENDING: + return errERROR_IO_PENDING + } + // TODO: add more here, after collecting data on the common + // error values see on Windows. (perhaps when running + // all.bat?) + return e +} + +var ( + modiphlpapi = windows.NewLazySystemDLL("iphlpapi.dll") + + procSetCurrentThreadCompartmentId = modiphlpapi.NewProc("SetCurrentThreadCompartmentId") +) + +func SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) { + r0, _, _ := syscall.Syscall(procSetCurrentThreadCompartmentId.Addr(), 1, uintptr(compartmentId), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/cgroups/LICENSE b/src/cmd/linuxkit/vendor/github.com/containerd/cgroups/LICENSE new file mode 100644 index 000000000..261eeb9e9 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/cgroups/LICENSE @@ -0,0 +1,201 @@ + Apache License + Version 2.0, January 2004 + http://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + APPENDIX: How to apply the Apache License to your work. + + To apply the Apache License to your work, attach the following + boilerplate notice, with the fields enclosed by brackets "[]" + replaced with your own identifying information. (Don't include + the brackets!) The text should be enclosed in the appropriate + comment syntax for the file format. We also recommend that a + file or class name and description of purpose be included on the + same "printed page" as the copyright notice for easier + identification within third-party archives. + + Copyright [yyyy] [name of copyright owner] + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/cgroups/stats/v1/doc.go b/src/cmd/linuxkit/vendor/github.com/containerd/cgroups/stats/v1/doc.go new file mode 100644 index 000000000..23f3cdd4b --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/cgroups/stats/v1/doc.go @@ -0,0 +1,17 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package v1 diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/cgroups/stats/v1/metrics.pb.go b/src/cmd/linuxkit/vendor/github.com/containerd/cgroups/stats/v1/metrics.pb.go new file mode 100644 index 000000000..6d2d41770 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/cgroups/stats/v1/metrics.pb.go @@ -0,0 +1,6125 @@ +// Code generated by protoc-gen-gogo. DO NOT EDIT. +// source: github.com/containerd/cgroups/stats/v1/metrics.proto + +package v1 + +import ( + fmt "fmt" + _ "github.com/gogo/protobuf/gogoproto" + proto "github.com/gogo/protobuf/proto" + io "io" + math "math" + math_bits "math/bits" + reflect "reflect" + strings "strings" +) + +// Reference imports to suppress errors if they are not otherwise used. +var _ = proto.Marshal +var _ = fmt.Errorf +var _ = math.Inf + +// This is a compile-time assertion to ensure that this generated file +// is compatible with the proto package it is being compiled against. +// A compilation error at this line likely means your copy of the +// proto package needs to be updated. +const _ = proto.GoGoProtoPackageIsVersion3 // please upgrade the proto package + +type Metrics struct { + Hugetlb []*HugetlbStat `protobuf:"bytes,1,rep,name=hugetlb,proto3" json:"hugetlb,omitempty"` + Pids *PidsStat `protobuf:"bytes,2,opt,name=pids,proto3" json:"pids,omitempty"` + CPU *CPUStat `protobuf:"bytes,3,opt,name=cpu,proto3" json:"cpu,omitempty"` + Memory *MemoryStat `protobuf:"bytes,4,opt,name=memory,proto3" json:"memory,omitempty"` + Blkio *BlkIOStat `protobuf:"bytes,5,opt,name=blkio,proto3" json:"blkio,omitempty"` + Rdma *RdmaStat `protobuf:"bytes,6,opt,name=rdma,proto3" json:"rdma,omitempty"` + Network []*NetworkStat `protobuf:"bytes,7,rep,name=network,proto3" json:"network,omitempty"` + CgroupStats *CgroupStats `protobuf:"bytes,8,opt,name=cgroup_stats,json=cgroupStats,proto3" json:"cgroup_stats,omitempty"` + MemoryOomControl *MemoryOomControl `protobuf:"bytes,9,opt,name=memory_oom_control,json=memoryOomControl,proto3" json:"memory_oom_control,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *Metrics) Reset() { *m = Metrics{} } +func (*Metrics) ProtoMessage() {} +func (*Metrics) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{0} +} +func (m *Metrics) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *Metrics) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_Metrics.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalToSizedBuffer(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *Metrics) XXX_Merge(src proto.Message) { + xxx_messageInfo_Metrics.Merge(m, src) +} +func (m *Metrics) XXX_Size() int { + return m.Size() +} +func (m *Metrics) XXX_DiscardUnknown() { + xxx_messageInfo_Metrics.DiscardUnknown(m) +} + +var xxx_messageInfo_Metrics proto.InternalMessageInfo + +type HugetlbStat struct { + Usage uint64 `protobuf:"varint,1,opt,name=usage,proto3" json:"usage,omitempty"` + Max uint64 `protobuf:"varint,2,opt,name=max,proto3" json:"max,omitempty"` + Failcnt uint64 `protobuf:"varint,3,opt,name=failcnt,proto3" json:"failcnt,omitempty"` + Pagesize string `protobuf:"bytes,4,opt,name=pagesize,proto3" json:"pagesize,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *HugetlbStat) Reset() { *m = HugetlbStat{} } +func (*HugetlbStat) ProtoMessage() {} +func (*HugetlbStat) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{1} +} +func (m *HugetlbStat) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *HugetlbStat) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_HugetlbStat.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalToSizedBuffer(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *HugetlbStat) XXX_Merge(src proto.Message) { + xxx_messageInfo_HugetlbStat.Merge(m, src) +} +func (m *HugetlbStat) XXX_Size() int { + return m.Size() +} +func (m *HugetlbStat) XXX_DiscardUnknown() { + xxx_messageInfo_HugetlbStat.DiscardUnknown(m) +} + +var xxx_messageInfo_HugetlbStat proto.InternalMessageInfo + +type PidsStat struct { + Current uint64 `protobuf:"varint,1,opt,name=current,proto3" json:"current,omitempty"` + Limit uint64 `protobuf:"varint,2,opt,name=limit,proto3" json:"limit,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *PidsStat) Reset() { *m = PidsStat{} } +func (*PidsStat) ProtoMessage() {} +func (*PidsStat) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{2} +} +func (m *PidsStat) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *PidsStat) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_PidsStat.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalToSizedBuffer(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *PidsStat) XXX_Merge(src proto.Message) { + xxx_messageInfo_PidsStat.Merge(m, src) +} +func (m *PidsStat) XXX_Size() int { + return m.Size() +} +func (m *PidsStat) XXX_DiscardUnknown() { + xxx_messageInfo_PidsStat.DiscardUnknown(m) +} + +var xxx_messageInfo_PidsStat proto.InternalMessageInfo + +type CPUStat struct { + Usage *CPUUsage `protobuf:"bytes,1,opt,name=usage,proto3" json:"usage,omitempty"` + Throttling *Throttle `protobuf:"bytes,2,opt,name=throttling,proto3" json:"throttling,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *CPUStat) Reset() { *m = CPUStat{} } +func (*CPUStat) ProtoMessage() {} +func (*CPUStat) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{3} +} +func (m *CPUStat) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *CPUStat) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_CPUStat.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalToSizedBuffer(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *CPUStat) XXX_Merge(src proto.Message) { + xxx_messageInfo_CPUStat.Merge(m, src) +} +func (m *CPUStat) XXX_Size() int { + return m.Size() +} +func (m *CPUStat) XXX_DiscardUnknown() { + xxx_messageInfo_CPUStat.DiscardUnknown(m) +} + +var xxx_messageInfo_CPUStat proto.InternalMessageInfo + +type CPUUsage struct { + // values in nanoseconds + Total uint64 `protobuf:"varint,1,opt,name=total,proto3" json:"total,omitempty"` + Kernel uint64 `protobuf:"varint,2,opt,name=kernel,proto3" json:"kernel,omitempty"` + User uint64 `protobuf:"varint,3,opt,name=user,proto3" json:"user,omitempty"` + PerCPU []uint64 `protobuf:"varint,4,rep,packed,name=per_cpu,json=perCpu,proto3" json:"per_cpu,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *CPUUsage) Reset() { *m = CPUUsage{} } +func (*CPUUsage) ProtoMessage() {} +func (*CPUUsage) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{4} +} +func (m *CPUUsage) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *CPUUsage) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_CPUUsage.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalToSizedBuffer(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *CPUUsage) XXX_Merge(src proto.Message) { + xxx_messageInfo_CPUUsage.Merge(m, src) +} +func (m *CPUUsage) XXX_Size() int { + return m.Size() +} +func (m *CPUUsage) XXX_DiscardUnknown() { + xxx_messageInfo_CPUUsage.DiscardUnknown(m) +} + +var xxx_messageInfo_CPUUsage proto.InternalMessageInfo + +type Throttle struct { + Periods uint64 `protobuf:"varint,1,opt,name=periods,proto3" json:"periods,omitempty"` + ThrottledPeriods uint64 `protobuf:"varint,2,opt,name=throttled_periods,json=throttledPeriods,proto3" json:"throttled_periods,omitempty"` + ThrottledTime uint64 `protobuf:"varint,3,opt,name=throttled_time,json=throttledTime,proto3" json:"throttled_time,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *Throttle) Reset() { *m = Throttle{} } +func (*Throttle) ProtoMessage() {} +func (*Throttle) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{5} +} +func (m *Throttle) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *Throttle) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_Throttle.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalToSizedBuffer(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *Throttle) XXX_Merge(src proto.Message) { + xxx_messageInfo_Throttle.Merge(m, src) +} +func (m *Throttle) XXX_Size() int { + return m.Size() +} +func (m *Throttle) XXX_DiscardUnknown() { + xxx_messageInfo_Throttle.DiscardUnknown(m) +} + +var xxx_messageInfo_Throttle proto.InternalMessageInfo + +type MemoryStat struct { + Cache uint64 `protobuf:"varint,1,opt,name=cache,proto3" json:"cache,omitempty"` + RSS uint64 `protobuf:"varint,2,opt,name=rss,proto3" json:"rss,omitempty"` + RSSHuge uint64 `protobuf:"varint,3,opt,name=rss_huge,json=rssHuge,proto3" json:"rss_huge,omitempty"` + MappedFile uint64 `protobuf:"varint,4,opt,name=mapped_file,json=mappedFile,proto3" json:"mapped_file,omitempty"` + Dirty uint64 `protobuf:"varint,5,opt,name=dirty,proto3" json:"dirty,omitempty"` + Writeback uint64 `protobuf:"varint,6,opt,name=writeback,proto3" json:"writeback,omitempty"` + PgPgIn uint64 `protobuf:"varint,7,opt,name=pg_pg_in,json=pgPgIn,proto3" json:"pg_pg_in,omitempty"` + PgPgOut uint64 `protobuf:"varint,8,opt,name=pg_pg_out,json=pgPgOut,proto3" json:"pg_pg_out,omitempty"` + PgFault uint64 `protobuf:"varint,9,opt,name=pg_fault,json=pgFault,proto3" json:"pg_fault,omitempty"` + PgMajFault uint64 `protobuf:"varint,10,opt,name=pg_maj_fault,json=pgMajFault,proto3" json:"pg_maj_fault,omitempty"` + InactiveAnon uint64 `protobuf:"varint,11,opt,name=inactive_anon,json=inactiveAnon,proto3" json:"inactive_anon,omitempty"` + ActiveAnon uint64 `protobuf:"varint,12,opt,name=active_anon,json=activeAnon,proto3" json:"active_anon,omitempty"` + InactiveFile uint64 `protobuf:"varint,13,opt,name=inactive_file,json=inactiveFile,proto3" json:"inactive_file,omitempty"` + ActiveFile uint64 `protobuf:"varint,14,opt,name=active_file,json=activeFile,proto3" json:"active_file,omitempty"` + Unevictable uint64 `protobuf:"varint,15,opt,name=unevictable,proto3" json:"unevictable,omitempty"` + HierarchicalMemoryLimit uint64 `protobuf:"varint,16,opt,name=hierarchical_memory_limit,json=hierarchicalMemoryLimit,proto3" json:"hierarchical_memory_limit,omitempty"` + HierarchicalSwapLimit uint64 `protobuf:"varint,17,opt,name=hierarchical_swap_limit,json=hierarchicalSwapLimit,proto3" json:"hierarchical_swap_limit,omitempty"` + TotalCache uint64 `protobuf:"varint,18,opt,name=total_cache,json=totalCache,proto3" json:"total_cache,omitempty"` + TotalRSS uint64 `protobuf:"varint,19,opt,name=total_rss,json=totalRss,proto3" json:"total_rss,omitempty"` + TotalRSSHuge uint64 `protobuf:"varint,20,opt,name=total_rss_huge,json=totalRssHuge,proto3" json:"total_rss_huge,omitempty"` + TotalMappedFile uint64 `protobuf:"varint,21,opt,name=total_mapped_file,json=totalMappedFile,proto3" json:"total_mapped_file,omitempty"` + TotalDirty uint64 `protobuf:"varint,22,opt,name=total_dirty,json=totalDirty,proto3" json:"total_dirty,omitempty"` + TotalWriteback uint64 `protobuf:"varint,23,opt,name=total_writeback,json=totalWriteback,proto3" json:"total_writeback,omitempty"` + TotalPgPgIn uint64 `protobuf:"varint,24,opt,name=total_pg_pg_in,json=totalPgPgIn,proto3" json:"total_pg_pg_in,omitempty"` + TotalPgPgOut uint64 `protobuf:"varint,25,opt,name=total_pg_pg_out,json=totalPgPgOut,proto3" json:"total_pg_pg_out,omitempty"` + TotalPgFault uint64 `protobuf:"varint,26,opt,name=total_pg_fault,json=totalPgFault,proto3" json:"total_pg_fault,omitempty"` + TotalPgMajFault uint64 `protobuf:"varint,27,opt,name=total_pg_maj_fault,json=totalPgMajFault,proto3" json:"total_pg_maj_fault,omitempty"` + TotalInactiveAnon uint64 `protobuf:"varint,28,opt,name=total_inactive_anon,json=totalInactiveAnon,proto3" json:"total_inactive_anon,omitempty"` + TotalActiveAnon uint64 `protobuf:"varint,29,opt,name=total_active_anon,json=totalActiveAnon,proto3" json:"total_active_anon,omitempty"` + TotalInactiveFile uint64 `protobuf:"varint,30,opt,name=total_inactive_file,json=totalInactiveFile,proto3" json:"total_inactive_file,omitempty"` + TotalActiveFile uint64 `protobuf:"varint,31,opt,name=total_active_file,json=totalActiveFile,proto3" json:"total_active_file,omitempty"` + TotalUnevictable uint64 `protobuf:"varint,32,opt,name=total_unevictable,json=totalUnevictable,proto3" json:"total_unevictable,omitempty"` + Usage *MemoryEntry `protobuf:"bytes,33,opt,name=usage,proto3" json:"usage,omitempty"` + Swap *MemoryEntry `protobuf:"bytes,34,opt,name=swap,proto3" json:"swap,omitempty"` + Kernel *MemoryEntry `protobuf:"bytes,35,opt,name=kernel,proto3" json:"kernel,omitempty"` + KernelTCP *MemoryEntry `protobuf:"bytes,36,opt,name=kernel_tcp,json=kernelTcp,proto3" json:"kernel_tcp,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *MemoryStat) Reset() { *m = MemoryStat{} } +func (*MemoryStat) ProtoMessage() {} +func (*MemoryStat) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{6} +} +func (m *MemoryStat) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *MemoryStat) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_MemoryStat.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalToSizedBuffer(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *MemoryStat) XXX_Merge(src proto.Message) { + xxx_messageInfo_MemoryStat.Merge(m, src) +} +func (m *MemoryStat) XXX_Size() int { + return m.Size() +} +func (m *MemoryStat) XXX_DiscardUnknown() { + xxx_messageInfo_MemoryStat.DiscardUnknown(m) +} + +var xxx_messageInfo_MemoryStat proto.InternalMessageInfo + +type MemoryEntry struct { + Limit uint64 `protobuf:"varint,1,opt,name=limit,proto3" json:"limit,omitempty"` + Usage uint64 `protobuf:"varint,2,opt,name=usage,proto3" json:"usage,omitempty"` + Max uint64 `protobuf:"varint,3,opt,name=max,proto3" json:"max,omitempty"` + Failcnt uint64 `protobuf:"varint,4,opt,name=failcnt,proto3" json:"failcnt,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *MemoryEntry) Reset() { *m = MemoryEntry{} } +func (*MemoryEntry) ProtoMessage() {} +func (*MemoryEntry) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{7} +} +func (m *MemoryEntry) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *MemoryEntry) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_MemoryEntry.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalToSizedBuffer(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *MemoryEntry) XXX_Merge(src proto.Message) { + xxx_messageInfo_MemoryEntry.Merge(m, src) +} +func (m *MemoryEntry) XXX_Size() int { + return m.Size() +} +func (m *MemoryEntry) XXX_DiscardUnknown() { + xxx_messageInfo_MemoryEntry.DiscardUnknown(m) +} + +var xxx_messageInfo_MemoryEntry proto.InternalMessageInfo + +type MemoryOomControl struct { + OomKillDisable uint64 `protobuf:"varint,1,opt,name=oom_kill_disable,json=oomKillDisable,proto3" json:"oom_kill_disable,omitempty"` + UnderOom uint64 `protobuf:"varint,2,opt,name=under_oom,json=underOom,proto3" json:"under_oom,omitempty"` + OomKill uint64 `protobuf:"varint,3,opt,name=oom_kill,json=oomKill,proto3" json:"oom_kill,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *MemoryOomControl) Reset() { *m = MemoryOomControl{} } +func (*MemoryOomControl) ProtoMessage() {} +func (*MemoryOomControl) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{8} +} +func (m *MemoryOomControl) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *MemoryOomControl) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_MemoryOomControl.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalToSizedBuffer(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *MemoryOomControl) XXX_Merge(src proto.Message) { + xxx_messageInfo_MemoryOomControl.Merge(m, src) +} +func (m *MemoryOomControl) XXX_Size() int { + return m.Size() +} +func (m *MemoryOomControl) XXX_DiscardUnknown() { + xxx_messageInfo_MemoryOomControl.DiscardUnknown(m) +} + +var xxx_messageInfo_MemoryOomControl proto.InternalMessageInfo + +type BlkIOStat struct { + IoServiceBytesRecursive []*BlkIOEntry `protobuf:"bytes,1,rep,name=io_service_bytes_recursive,json=ioServiceBytesRecursive,proto3" json:"io_service_bytes_recursive,omitempty"` + IoServicedRecursive []*BlkIOEntry `protobuf:"bytes,2,rep,name=io_serviced_recursive,json=ioServicedRecursive,proto3" json:"io_serviced_recursive,omitempty"` + IoQueuedRecursive []*BlkIOEntry `protobuf:"bytes,3,rep,name=io_queued_recursive,json=ioQueuedRecursive,proto3" json:"io_queued_recursive,omitempty"` + IoServiceTimeRecursive []*BlkIOEntry `protobuf:"bytes,4,rep,name=io_service_time_recursive,json=ioServiceTimeRecursive,proto3" json:"io_service_time_recursive,omitempty"` + IoWaitTimeRecursive []*BlkIOEntry `protobuf:"bytes,5,rep,name=io_wait_time_recursive,json=ioWaitTimeRecursive,proto3" json:"io_wait_time_recursive,omitempty"` + IoMergedRecursive []*BlkIOEntry `protobuf:"bytes,6,rep,name=io_merged_recursive,json=ioMergedRecursive,proto3" json:"io_merged_recursive,omitempty"` + IoTimeRecursive []*BlkIOEntry `protobuf:"bytes,7,rep,name=io_time_recursive,json=ioTimeRecursive,proto3" json:"io_time_recursive,omitempty"` + SectorsRecursive []*BlkIOEntry `protobuf:"bytes,8,rep,name=sectors_recursive,json=sectorsRecursive,proto3" json:"sectors_recursive,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *BlkIOStat) Reset() { *m = BlkIOStat{} } +func (*BlkIOStat) ProtoMessage() {} +func (*BlkIOStat) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{9} +} +func (m *BlkIOStat) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *BlkIOStat) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_BlkIOStat.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalToSizedBuffer(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *BlkIOStat) XXX_Merge(src proto.Message) { + xxx_messageInfo_BlkIOStat.Merge(m, src) +} +func (m *BlkIOStat) XXX_Size() int { + return m.Size() +} +func (m *BlkIOStat) XXX_DiscardUnknown() { + xxx_messageInfo_BlkIOStat.DiscardUnknown(m) +} + +var xxx_messageInfo_BlkIOStat proto.InternalMessageInfo + +type BlkIOEntry struct { + Op string `protobuf:"bytes,1,opt,name=op,proto3" json:"op,omitempty"` + Device string `protobuf:"bytes,2,opt,name=device,proto3" json:"device,omitempty"` + Major uint64 `protobuf:"varint,3,opt,name=major,proto3" json:"major,omitempty"` + Minor uint64 `protobuf:"varint,4,opt,name=minor,proto3" json:"minor,omitempty"` + Value uint64 `protobuf:"varint,5,opt,name=value,proto3" json:"value,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *BlkIOEntry) Reset() { *m = BlkIOEntry{} } +func (*BlkIOEntry) ProtoMessage() {} +func (*BlkIOEntry) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{10} +} +func (m *BlkIOEntry) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *BlkIOEntry) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_BlkIOEntry.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalToSizedBuffer(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *BlkIOEntry) XXX_Merge(src proto.Message) { + xxx_messageInfo_BlkIOEntry.Merge(m, src) +} +func (m *BlkIOEntry) XXX_Size() int { + return m.Size() +} +func (m *BlkIOEntry) XXX_DiscardUnknown() { + xxx_messageInfo_BlkIOEntry.DiscardUnknown(m) +} + +var xxx_messageInfo_BlkIOEntry proto.InternalMessageInfo + +type RdmaStat struct { + Current []*RdmaEntry `protobuf:"bytes,1,rep,name=current,proto3" json:"current,omitempty"` + Limit []*RdmaEntry `protobuf:"bytes,2,rep,name=limit,proto3" json:"limit,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *RdmaStat) Reset() { *m = RdmaStat{} } +func (*RdmaStat) ProtoMessage() {} +func (*RdmaStat) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{11} +} +func (m *RdmaStat) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *RdmaStat) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_RdmaStat.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalToSizedBuffer(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *RdmaStat) XXX_Merge(src proto.Message) { + xxx_messageInfo_RdmaStat.Merge(m, src) +} +func (m *RdmaStat) XXX_Size() int { + return m.Size() +} +func (m *RdmaStat) XXX_DiscardUnknown() { + xxx_messageInfo_RdmaStat.DiscardUnknown(m) +} + +var xxx_messageInfo_RdmaStat proto.InternalMessageInfo + +type RdmaEntry struct { + Device string `protobuf:"bytes,1,opt,name=device,proto3" json:"device,omitempty"` + HcaHandles uint32 `protobuf:"varint,2,opt,name=hca_handles,json=hcaHandles,proto3" json:"hca_handles,omitempty"` + HcaObjects uint32 `protobuf:"varint,3,opt,name=hca_objects,json=hcaObjects,proto3" json:"hca_objects,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *RdmaEntry) Reset() { *m = RdmaEntry{} } +func (*RdmaEntry) ProtoMessage() {} +func (*RdmaEntry) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{12} +} +func (m *RdmaEntry) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *RdmaEntry) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_RdmaEntry.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalToSizedBuffer(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *RdmaEntry) XXX_Merge(src proto.Message) { + xxx_messageInfo_RdmaEntry.Merge(m, src) +} +func (m *RdmaEntry) XXX_Size() int { + return m.Size() +} +func (m *RdmaEntry) XXX_DiscardUnknown() { + xxx_messageInfo_RdmaEntry.DiscardUnknown(m) +} + +var xxx_messageInfo_RdmaEntry proto.InternalMessageInfo + +type NetworkStat struct { + Name string `protobuf:"bytes,1,opt,name=name,proto3" json:"name,omitempty"` + RxBytes uint64 `protobuf:"varint,2,opt,name=rx_bytes,json=rxBytes,proto3" json:"rx_bytes,omitempty"` + RxPackets uint64 `protobuf:"varint,3,opt,name=rx_packets,json=rxPackets,proto3" json:"rx_packets,omitempty"` + RxErrors uint64 `protobuf:"varint,4,opt,name=rx_errors,json=rxErrors,proto3" json:"rx_errors,omitempty"` + RxDropped uint64 `protobuf:"varint,5,opt,name=rx_dropped,json=rxDropped,proto3" json:"rx_dropped,omitempty"` + TxBytes uint64 `protobuf:"varint,6,opt,name=tx_bytes,json=txBytes,proto3" json:"tx_bytes,omitempty"` + TxPackets uint64 `protobuf:"varint,7,opt,name=tx_packets,json=txPackets,proto3" json:"tx_packets,omitempty"` + TxErrors uint64 `protobuf:"varint,8,opt,name=tx_errors,json=txErrors,proto3" json:"tx_errors,omitempty"` + TxDropped uint64 `protobuf:"varint,9,opt,name=tx_dropped,json=txDropped,proto3" json:"tx_dropped,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *NetworkStat) Reset() { *m = NetworkStat{} } +func (*NetworkStat) ProtoMessage() {} +func (*NetworkStat) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{13} +} +func (m *NetworkStat) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *NetworkStat) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_NetworkStat.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalToSizedBuffer(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *NetworkStat) XXX_Merge(src proto.Message) { + xxx_messageInfo_NetworkStat.Merge(m, src) +} +func (m *NetworkStat) XXX_Size() int { + return m.Size() +} +func (m *NetworkStat) XXX_DiscardUnknown() { + xxx_messageInfo_NetworkStat.DiscardUnknown(m) +} + +var xxx_messageInfo_NetworkStat proto.InternalMessageInfo + +// CgroupStats exports per-cgroup statistics. +type CgroupStats struct { + // number of tasks sleeping + NrSleeping uint64 `protobuf:"varint,1,opt,name=nr_sleeping,json=nrSleeping,proto3" json:"nr_sleeping,omitempty"` + // number of tasks running + NrRunning uint64 `protobuf:"varint,2,opt,name=nr_running,json=nrRunning,proto3" json:"nr_running,omitempty"` + // number of tasks in stopped state + NrStopped uint64 `protobuf:"varint,3,opt,name=nr_stopped,json=nrStopped,proto3" json:"nr_stopped,omitempty"` + // number of tasks in uninterruptible state + NrUninterruptible uint64 `protobuf:"varint,4,opt,name=nr_uninterruptible,json=nrUninterruptible,proto3" json:"nr_uninterruptible,omitempty"` + // number of tasks waiting on IO + NrIoWait uint64 `protobuf:"varint,5,opt,name=nr_io_wait,json=nrIoWait,proto3" json:"nr_io_wait,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *CgroupStats) Reset() { *m = CgroupStats{} } +func (*CgroupStats) ProtoMessage() {} +func (*CgroupStats) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{14} +} +func (m *CgroupStats) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *CgroupStats) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_CgroupStats.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalToSizedBuffer(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *CgroupStats) XXX_Merge(src proto.Message) { + xxx_messageInfo_CgroupStats.Merge(m, src) +} +func (m *CgroupStats) XXX_Size() int { + return m.Size() +} +func (m *CgroupStats) XXX_DiscardUnknown() { + xxx_messageInfo_CgroupStats.DiscardUnknown(m) +} + +var xxx_messageInfo_CgroupStats proto.InternalMessageInfo + +func init() { + proto.RegisterType((*Metrics)(nil), "io.containerd.cgroups.v1.Metrics") + proto.RegisterType((*HugetlbStat)(nil), "io.containerd.cgroups.v1.HugetlbStat") + proto.RegisterType((*PidsStat)(nil), "io.containerd.cgroups.v1.PidsStat") + proto.RegisterType((*CPUStat)(nil), "io.containerd.cgroups.v1.CPUStat") + proto.RegisterType((*CPUUsage)(nil), "io.containerd.cgroups.v1.CPUUsage") + proto.RegisterType((*Throttle)(nil), "io.containerd.cgroups.v1.Throttle") + proto.RegisterType((*MemoryStat)(nil), "io.containerd.cgroups.v1.MemoryStat") + proto.RegisterType((*MemoryEntry)(nil), "io.containerd.cgroups.v1.MemoryEntry") + proto.RegisterType((*MemoryOomControl)(nil), "io.containerd.cgroups.v1.MemoryOomControl") + proto.RegisterType((*BlkIOStat)(nil), "io.containerd.cgroups.v1.BlkIOStat") + proto.RegisterType((*BlkIOEntry)(nil), "io.containerd.cgroups.v1.BlkIOEntry") + proto.RegisterType((*RdmaStat)(nil), "io.containerd.cgroups.v1.RdmaStat") + proto.RegisterType((*RdmaEntry)(nil), "io.containerd.cgroups.v1.RdmaEntry") + proto.RegisterType((*NetworkStat)(nil), "io.containerd.cgroups.v1.NetworkStat") + proto.RegisterType((*CgroupStats)(nil), "io.containerd.cgroups.v1.CgroupStats") +} + +func init() { + proto.RegisterFile("github.com/containerd/cgroups/stats/v1/metrics.proto", fileDescriptor_a17b2d87c332bfaa) +} + +var fileDescriptor_a17b2d87c332bfaa = []byte{ + // 1749 bytes of a gzipped FileDescriptorProto + 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0x94, 0x58, 0xcd, 0x72, 0xe3, 0xc6, + 0x11, 0x36, 0x45, 0x48, 0x24, 0x9a, 0x92, 0x56, 0x9a, 0xfd, 0x83, 0xe4, 0xb5, 0x28, 0x53, 0xbb, + 0x89, 0xe2, 0xad, 0x48, 0x65, 0x27, 0xb5, 0x95, 0x75, 0xec, 0x4a, 0x59, 0x5a, 0xbb, 0x76, 0xcb, + 0x51, 0x44, 0x83, 0x52, 0xd9, 0x39, 0xa1, 0x40, 0x70, 0x16, 0x9c, 0x15, 0x80, 0x81, 0x07, 0x03, + 0x89, 0xca, 0x29, 0x87, 0x54, 0xe5, 0x94, 0x07, 0xca, 0x1b, 0xf8, 0x98, 0x4b, 0x52, 0xc9, 0x45, + 0x15, 0xf3, 0x49, 0x52, 0x33, 0x3d, 0xf8, 0xa1, 0xbc, 0x5a, 0x85, 0x37, 0x76, 0xcf, 0xd7, 0x5f, + 0xf7, 0x34, 0xbe, 0x19, 0x34, 0x08, 0xbf, 0x0e, 0x99, 0x1c, 0xe7, 0xc3, 0xbd, 0x80, 0xc7, 0xfb, + 0x01, 0x4f, 0xa4, 0xcf, 0x12, 0x2a, 0x46, 0xfb, 0x41, 0x28, 0x78, 0x9e, 0x66, 0xfb, 0x99, 0xf4, + 0x65, 0xb6, 0x7f, 0xfe, 0xf1, 0x7e, 0x4c, 0xa5, 0x60, 0x41, 0xb6, 0x97, 0x0a, 0x2e, 0x39, 0x71, + 0x18, 0xdf, 0xab, 0xd0, 0x7b, 0x06, 0xbd, 0x77, 0xfe, 0xf1, 0xe6, 0xbd, 0x90, 0x87, 0x5c, 0x83, + 0xf6, 0xd5, 0x2f, 0xc4, 0xf7, 0xfe, 0x65, 0x41, 0xeb, 0x08, 0x19, 0xc8, 0xef, 0xa0, 0x35, 0xce, + 0x43, 0x2a, 0xa3, 0xa1, 0xd3, 0xd8, 0x6e, 0xee, 0x76, 0x3e, 0x79, 0xb2, 0x77, 0x13, 0xdb, 0xde, + 0x4b, 0x04, 0x0e, 0xa4, 0x2f, 0xdd, 0x22, 0x8a, 0x3c, 0x03, 0x2b, 0x65, 0xa3, 0xcc, 0x59, 0xd8, + 0x6e, 0xec, 0x76, 0x3e, 0xe9, 0xdd, 0x1c, 0xdd, 0x67, 0xa3, 0x4c, 0x87, 0x6a, 0x3c, 0xf9, 0x0c, + 0x9a, 0x41, 0x9a, 0x3b, 0x4d, 0x1d, 0xf6, 0xe1, 0xcd, 0x61, 0x87, 0xfd, 0x53, 0x15, 0x75, 0xd0, + 0x9a, 0x5e, 0x75, 0x9b, 0x87, 0xfd, 0x53, 0x57, 0x85, 0x91, 0xcf, 0x60, 0x29, 0xa6, 0x31, 0x17, + 0x97, 0x8e, 0xa5, 0x09, 0x1e, 0xdf, 0x4c, 0x70, 0xa4, 0x71, 0x3a, 0xb3, 0x89, 0x21, 0xcf, 0x61, + 0x71, 0x18, 0x9d, 0x31, 0xee, 0x2c, 0xea, 0xe0, 0x9d, 0x9b, 0x83, 0x0f, 0xa2, 0xb3, 0x57, 0xc7, + 0x3a, 0x16, 0x23, 0xd4, 0x76, 0xc5, 0x28, 0xf6, 0x9d, 0xa5, 0xdb, 0xb6, 0xeb, 0x8e, 0x62, 0x1f, + 0xb7, 0xab, 0xf0, 0xaa, 0xcf, 0x09, 0x95, 0x17, 0x5c, 0x9c, 0x39, 0xad, 0xdb, 0xfa, 0xfc, 0x07, + 0x04, 0x62, 0x9f, 0x4d, 0x14, 0x79, 0x09, 0xcb, 0x08, 0xf1, 0xb4, 0x0a, 0x9c, 0xb6, 0x2e, 0xe0, + 0x1d, 0x2c, 0x87, 0xfa, 0xa7, 0x22, 0xc9, 0xdc, 0x4e, 0x50, 0x19, 0xe4, 0x3b, 0x20, 0xd8, 0x07, + 0x8f, 0xf3, 0xd8, 0x53, 0xc1, 0x82, 0x47, 0x8e, 0xad, 0xf9, 0x3e, 0xba, 0xad, 0x8f, 0xc7, 0x3c, + 0x3e, 0xc4, 0x08, 0x77, 0x2d, 0xbe, 0xe6, 0xe9, 0x9d, 0x41, 0xa7, 0xa6, 0x11, 0x72, 0x0f, 0x16, + 0xf3, 0xcc, 0x0f, 0xa9, 0xd3, 0xd8, 0x6e, 0xec, 0x5a, 0x2e, 0x1a, 0x64, 0x0d, 0x9a, 0xb1, 0x3f, + 0xd1, 0x7a, 0xb1, 0x5c, 0xf5, 0x93, 0x38, 0xd0, 0x7a, 0xed, 0xb3, 0x28, 0x48, 0xa4, 0x96, 0x83, + 0xe5, 0x16, 0x26, 0xd9, 0x84, 0x76, 0xea, 0x87, 0x34, 0x63, 0x7f, 0xa2, 0xfa, 0x41, 0xdb, 0x6e, + 0x69, 0xf7, 0x3e, 0x85, 0x76, 0x21, 0x29, 0xc5, 0x10, 0xe4, 0x42, 0xd0, 0x44, 0x9a, 0x5c, 0x85, + 0xa9, 0x6a, 0x88, 0x58, 0xcc, 0xa4, 0xc9, 0x87, 0x46, 0xef, 0xaf, 0x0d, 0x68, 0x19, 0x61, 0x91, + 0xdf, 0xd4, 0xab, 0x7c, 0xe7, 0x23, 0x3d, 0xec, 0x9f, 0x9e, 0x2a, 0x64, 0xb1, 0x93, 0x03, 0x00, + 0x39, 0x16, 0x5c, 0xca, 0x88, 0x25, 0xe1, 0xed, 0x07, 0xe0, 0x04, 0xb1, 0xd4, 0xad, 0x45, 0xf5, + 0xbe, 0x87, 0x76, 0x41, 0xab, 0x6a, 0x95, 0x5c, 0xfa, 0x51, 0xd1, 0x2f, 0x6d, 0x90, 0x07, 0xb0, + 0x74, 0x46, 0x45, 0x42, 0x23, 0xb3, 0x05, 0x63, 0x11, 0x02, 0x56, 0x9e, 0x51, 0x61, 0x5a, 0xa6, + 0x7f, 0x93, 0x1d, 0x68, 0xa5, 0x54, 0x78, 0xea, 0x60, 0x59, 0xdb, 0xcd, 0x5d, 0xeb, 0x00, 0xa6, + 0x57, 0xdd, 0xa5, 0x3e, 0x15, 0xea, 0xe0, 0x2c, 0xa5, 0x54, 0x1c, 0xa6, 0x79, 0x6f, 0x02, 0xed, + 0xa2, 0x14, 0xd5, 0xb8, 0x94, 0x0a, 0xc6, 0x47, 0x59, 0xd1, 0x38, 0x63, 0x92, 0xa7, 0xb0, 0x6e, + 0xca, 0xa4, 0x23, 0xaf, 0xc0, 0x60, 0x05, 0x6b, 0xe5, 0x42, 0xdf, 0x80, 0x9f, 0xc0, 0x6a, 0x05, + 0x96, 0x2c, 0xa6, 0xa6, 0xaa, 0x95, 0xd2, 0x7b, 0xc2, 0x62, 0xda, 0xfb, 0x4f, 0x07, 0xa0, 0x3a, + 0x8e, 0x6a, 0xbf, 0x81, 0x1f, 0x8c, 0x4b, 0x7d, 0x68, 0x83, 0x6c, 0x40, 0x53, 0x64, 0x26, 0x15, + 0x9e, 0x7a, 0x77, 0x30, 0x70, 0x95, 0x8f, 0xfc, 0x0c, 0xda, 0x22, 0xcb, 0x3c, 0x75, 0xf5, 0x60, + 0x82, 0x83, 0xce, 0xf4, 0xaa, 0xdb, 0x72, 0x07, 0x03, 0x25, 0x3b, 0xb7, 0x25, 0xb2, 0x4c, 0xfd, + 0x20, 0x5d, 0xe8, 0xc4, 0x7e, 0x9a, 0xd2, 0x91, 0xf7, 0x9a, 0x45, 0xa8, 0x1c, 0xcb, 0x05, 0x74, + 0x7d, 0xc5, 0x22, 0xdd, 0xe9, 0x11, 0x13, 0xf2, 0x52, 0x5f, 0x00, 0x96, 0x8b, 0x06, 0x79, 0x04, + 0xf6, 0x85, 0x60, 0x92, 0x0e, 0xfd, 0xe0, 0x4c, 0x1f, 0x70, 0xcb, 0xad, 0x1c, 0xc4, 0x81, 0x76, + 0x1a, 0x7a, 0x69, 0xe8, 0xb1, 0xc4, 0x69, 0xe1, 0x93, 0x48, 0xc3, 0x7e, 0xf8, 0x2a, 0x21, 0x9b, + 0x60, 0xe3, 0x0a, 0xcf, 0xa5, 0x3e, 0x97, 0xaa, 0x8d, 0x61, 0x3f, 0x3c, 0xce, 0x25, 0xd9, 0xd0, + 0x51, 0xaf, 0xfd, 0x3c, 0x92, 0xfa, 0x88, 0xe9, 0xa5, 0xaf, 0x94, 0x49, 0xb6, 0x61, 0x39, 0x0d, + 0xbd, 0xd8, 0x7f, 0x63, 0x96, 0x01, 0xcb, 0x4c, 0xc3, 0x23, 0xff, 0x0d, 0x22, 0x76, 0x60, 0x85, + 0x25, 0x7e, 0x20, 0xd9, 0x39, 0xf5, 0xfc, 0x84, 0x27, 0x4e, 0x47, 0x43, 0x96, 0x0b, 0xe7, 0x17, + 0x09, 0x4f, 0xd4, 0x66, 0xeb, 0x90, 0x65, 0x64, 0xa9, 0x01, 0xea, 0x2c, 0xba, 0x1f, 0x2b, 0xb3, + 0x2c, 0xba, 0x23, 0x15, 0x8b, 0x86, 0xac, 0xd6, 0x59, 0x34, 0x60, 0x1b, 0x3a, 0x79, 0x42, 0xcf, + 0x59, 0x20, 0xfd, 0x61, 0x44, 0x9d, 0x3b, 0x1a, 0x50, 0x77, 0x91, 0x4f, 0x61, 0x63, 0xcc, 0xa8, + 0xf0, 0x45, 0x30, 0x66, 0x81, 0x1f, 0x79, 0xe6, 0x92, 0xc1, 0xe3, 0xb7, 0xa6, 0xf1, 0x0f, 0xeb, + 0x00, 0x54, 0xc2, 0xef, 0xd5, 0x32, 0x79, 0x06, 0x33, 0x4b, 0x5e, 0x76, 0xe1, 0xa7, 0x26, 0x72, + 0x5d, 0x47, 0xde, 0xaf, 0x2f, 0x0f, 0x2e, 0xfc, 0x14, 0xe3, 0xba, 0xd0, 0xd1, 0xa7, 0xc4, 0x43, + 0x21, 0x11, 0x2c, 0x5b, 0xbb, 0x0e, 0xb5, 0x9a, 0x7e, 0x01, 0x36, 0x02, 0x94, 0xa6, 0xee, 0x6a, + 0xcd, 0x2c, 0x4f, 0xaf, 0xba, 0xed, 0x13, 0xe5, 0x54, 0xc2, 0x6a, 0xeb, 0x65, 0x37, 0xcb, 0xc8, + 0x33, 0x58, 0x2d, 0xa1, 0xa8, 0xb1, 0x7b, 0x1a, 0xbf, 0x36, 0xbd, 0xea, 0x2e, 0x17, 0x78, 0x2d, + 0xb4, 0xe5, 0x22, 0x46, 0xab, 0xed, 0x23, 0x58, 0xc7, 0xb8, 0xba, 0xe6, 0xee, 0xeb, 0x4a, 0xee, + 0xe8, 0x85, 0xa3, 0x4a, 0x78, 0x65, 0xbd, 0x28, 0xbf, 0x07, 0xb5, 0x7a, 0x5f, 0x68, 0x0d, 0xfe, + 0x1c, 0x30, 0xc6, 0xab, 0x94, 0xf8, 0x50, 0x83, 0xb0, 0xb6, 0x6f, 0x4b, 0x39, 0xee, 0x14, 0xd5, + 0x96, 0xa2, 0x74, 0xf0, 0x91, 0x68, 0x6f, 0x1f, 0x95, 0xf9, 0xa4, 0x60, 0xab, 0xf4, 0xb9, 0x81, + 0x0f, 0xbf, 0x44, 0x29, 0x91, 0x3e, 0xae, 0x71, 0xa1, 0x16, 0x37, 0x67, 0x50, 0xa8, 0xc6, 0xa7, + 0x40, 0x4a, 0x54, 0xa5, 0xda, 0xf7, 0x6b, 0x1b, 0xed, 0x57, 0xd2, 0xdd, 0x83, 0xbb, 0x08, 0x9e, + 0x15, 0xf0, 0x23, 0x8d, 0xc6, 0x7e, 0xbd, 0xaa, 0xab, 0xb8, 0x6c, 0x62, 0x1d, 0xfd, 0x41, 0x8d, + 0xfb, 0x8b, 0x0a, 0xfb, 0x53, 0x6e, 0xdd, 0xf2, 0xad, 0xb7, 0x70, 0xeb, 0xa6, 0x5f, 0xe7, 0xd6, + 0xe8, 0xee, 0x4f, 0xb8, 0x35, 0xf6, 0x69, 0x81, 0xad, 0x8b, 0x7d, 0xdb, 0x5c, 0x7b, 0x6a, 0xe1, + 0xb4, 0xa6, 0xf8, 0xdf, 0x16, 0xaf, 0x8e, 0x0f, 0x6f, 0x7b, 0x19, 0xa3, 0xd6, 0xbf, 0x4c, 0xa4, + 0xb8, 0x2c, 0xde, 0x1e, 0xcf, 0xc1, 0x52, 0x2a, 0x77, 0x7a, 0xf3, 0xc4, 0xea, 0x10, 0xf2, 0x79, + 0xf9, 0x4a, 0xd8, 0x99, 0x27, 0xb8, 0x78, 0x73, 0x0c, 0x00, 0xf0, 0x97, 0x27, 0x83, 0xd4, 0x79, + 0x3c, 0x07, 0xc5, 0xc1, 0xca, 0xf4, 0xaa, 0x6b, 0x7f, 0xad, 0x83, 0x4f, 0x0e, 0xfb, 0xae, 0x8d, + 0x3c, 0x27, 0x41, 0xda, 0xa3, 0xd0, 0xa9, 0x01, 0xab, 0xf7, 0x6e, 0xa3, 0xf6, 0xde, 0xad, 0x26, + 0x82, 0x85, 0xb7, 0x4c, 0x04, 0xcd, 0xb7, 0x4e, 0x04, 0xd6, 0xcc, 0x44, 0xd0, 0x93, 0xb0, 0x76, + 0x7d, 0x10, 0x21, 0xbb, 0xb0, 0xa6, 0x26, 0x99, 0x33, 0x16, 0xa9, 0x73, 0x95, 0xe9, 0x47, 0x86, + 0x69, 0x57, 0x39, 0x8f, 0xbf, 0x66, 0x51, 0xf4, 0x02, 0xbd, 0xe4, 0x7d, 0xb0, 0xf3, 0x64, 0x44, + 0x85, 0x9a, 0x7c, 0x4c, 0x0d, 0x6d, 0xed, 0x38, 0xe6, 0xb1, 0xba, 0xaa, 0x0b, 0x9a, 0x62, 0x0e, + 0x31, 0xe1, 0xbd, 0x7f, 0x2e, 0x82, 0x5d, 0x8e, 0x82, 0xc4, 0x87, 0x4d, 0xc6, 0xbd, 0x8c, 0x8a, + 0x73, 0x16, 0x50, 0x6f, 0x78, 0x29, 0x69, 0xe6, 0x09, 0x1a, 0xe4, 0x22, 0x63, 0xe7, 0xd4, 0x8c, + 0xd1, 0x8f, 0x6f, 0x99, 0x29, 0xf1, 0x89, 0x3c, 0x64, 0x7c, 0x80, 0x34, 0x07, 0x8a, 0xc5, 0x2d, + 0x48, 0xc8, 0x77, 0x70, 0xbf, 0x4a, 0x31, 0xaa, 0xb1, 0x2f, 0xcc, 0xc1, 0x7e, 0xb7, 0x64, 0x1f, + 0x55, 0xcc, 0x27, 0x70, 0x97, 0x71, 0xef, 0xfb, 0x9c, 0xe6, 0x33, 0xbc, 0xcd, 0x39, 0x78, 0xd7, + 0x19, 0xff, 0x46, 0xc7, 0x57, 0xac, 0x1e, 0x6c, 0xd4, 0x5a, 0xa2, 0x26, 0x80, 0x1a, 0xb7, 0x35, + 0x07, 0xf7, 0x83, 0xb2, 0x66, 0x35, 0x31, 0x54, 0x09, 0xfe, 0x08, 0x0f, 0x18, 0xf7, 0x2e, 0x7c, + 0x26, 0xaf, 0xb3, 0x2f, 0xce, 0xd7, 0x91, 0x6f, 0x7d, 0x26, 0x67, 0xa9, 0xb1, 0x23, 0x31, 0x15, + 0xe1, 0x4c, 0x47, 0x96, 0xe6, 0xeb, 0xc8, 0x91, 0x8e, 0xaf, 0x58, 0xfb, 0xb0, 0xce, 0xf8, 0xf5, + 0x5a, 0x5b, 0x73, 0x70, 0xde, 0x61, 0x7c, 0xb6, 0xce, 0x6f, 0x60, 0x3d, 0xa3, 0x81, 0xe4, 0xa2, + 0xae, 0xb6, 0xf6, 0x1c, 0x8c, 0x6b, 0x26, 0xbc, 0xa4, 0xec, 0x9d, 0x03, 0x54, 0xeb, 0x64, 0x15, + 0x16, 0x78, 0xaa, 0x4f, 0x8e, 0xed, 0x2e, 0xf0, 0x54, 0x4d, 0x9e, 0x23, 0x75, 0xd9, 0xe1, 0x71, + 0xb5, 0x5d, 0x63, 0xa9, 0x53, 0x1c, 0xfb, 0x6f, 0x78, 0x31, 0x7a, 0xa2, 0xa1, 0xbd, 0x2c, 0xe1, + 0xc2, 0x9c, 0x58, 0x34, 0x94, 0xf7, 0xdc, 0x8f, 0x72, 0x5a, 0x4c, 0x5a, 0xda, 0xe8, 0xfd, 0xa5, + 0x01, 0xed, 0xe2, 0x03, 0x89, 0x7c, 0x5e, 0x1f, 0xde, 0x9b, 0xef, 0xfe, 0x1e, 0x53, 0x41, 0xb8, + 0x99, 0x72, 0xc2, 0x7f, 0x5e, 0x4d, 0xf8, 0xff, 0x77, 0xb0, 0xf9, 0x0c, 0xa0, 0x60, 0x97, 0xbe, + 0xda, 0x6e, 0x1b, 0x33, 0xbb, 0xed, 0x42, 0x67, 0x1c, 0xf8, 0xde, 0xd8, 0x4f, 0x46, 0x11, 0xc5, + 0xb9, 0x74, 0xc5, 0x85, 0x71, 0xe0, 0xbf, 0x44, 0x4f, 0x01, 0xe0, 0xc3, 0x37, 0x34, 0x90, 0x99, + 0x6e, 0x0a, 0x02, 0x8e, 0xd1, 0xd3, 0xfb, 0xdb, 0x02, 0x74, 0x6a, 0xdf, 0x74, 0x6a, 0x72, 0x4f, + 0xfc, 0xb8, 0xc8, 0xa3, 0x7f, 0xab, 0xcb, 0x47, 0x4c, 0xf0, 0x2e, 0x31, 0x17, 0x53, 0x4b, 0x4c, + 0xf4, 0xa5, 0x40, 0x3e, 0x00, 0x10, 0x13, 0x2f, 0xf5, 0x83, 0x33, 0x6a, 0xe8, 0x2d, 0xd7, 0x16, + 0x93, 0x3e, 0x3a, 0xd4, 0x9d, 0x26, 0x26, 0x1e, 0x15, 0x82, 0x8b, 0xcc, 0xf4, 0xbe, 0x2d, 0x26, + 0x5f, 0x6a, 0xdb, 0xc4, 0x8e, 0x04, 0x57, 0x13, 0x88, 0x79, 0x06, 0xb6, 0x98, 0xbc, 0x40, 0x87, + 0xca, 0x2a, 0x8b, 0xac, 0x38, 0xf0, 0xb6, 0x64, 0x95, 0x55, 0x56, 0x59, 0x71, 0xe0, 0xb5, 0x65, + 0x3d, 0xab, 0x2c, 0xb3, 0xe2, 0xcc, 0xdb, 0x96, 0xb5, 0xac, 0xb2, 0xca, 0x6a, 0x17, 0xb1, 0x26, + 0x6b, 0xef, 0xef, 0x0d, 0xe8, 0xd4, 0xbe, 0x4e, 0x55, 0x03, 0x13, 0xe1, 0x65, 0x11, 0xa5, 0xa9, + 0xfa, 0x90, 0xc2, 0xab, 0x1b, 0x12, 0x31, 0x30, 0x1e, 0xc5, 0x97, 0x08, 0x4f, 0xe4, 0x49, 0x52, + 0x7c, 0x68, 0x59, 0xae, 0x9d, 0x08, 0x17, 0x1d, 0x66, 0x39, 0x93, 0x98, 0xae, 0x59, 0x2c, 0x0f, + 0xd0, 0x41, 0x7e, 0x09, 0x24, 0x11, 0x5e, 0x9e, 0xb0, 0x44, 0x52, 0x21, 0xf2, 0x54, 0xb2, 0x61, + 0xf9, 0x51, 0xb0, 0x9e, 0x88, 0xd3, 0xd9, 0x05, 0xf2, 0x48, 0xb3, 0x99, 0xcb, 0xc6, 0xb4, 0xac, + 0x9d, 0x88, 0x57, 0xfa, 0xe6, 0x38, 0x70, 0x7e, 0xf8, 0x71, 0xeb, 0xbd, 0x7f, 0xff, 0xb8, 0xf5, + 0xde, 0x9f, 0xa7, 0x5b, 0x8d, 0x1f, 0xa6, 0x5b, 0x8d, 0x7f, 0x4c, 0xb7, 0x1a, 0xff, 0x9d, 0x6e, + 0x35, 0x86, 0x4b, 0xfa, 0xcf, 0x95, 0x5f, 0xfd, 0x2f, 0x00, 0x00, 0xff, 0xff, 0xc4, 0x4e, 0x24, + 0x22, 0xc4, 0x11, 0x00, 0x00, +} + +func (m *Metrics) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalToSizedBuffer(dAtA[:size]) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *Metrics) MarshalTo(dAtA []byte) (int, error) { + size := m.Size() + return m.MarshalToSizedBuffer(dAtA[:size]) +} + +func (m *Metrics) MarshalToSizedBuffer(dAtA []byte) (int, error) { + i := len(dAtA) + _ = i + var l int + _ = l + if m.XXX_unrecognized != nil { + i -= len(m.XXX_unrecognized) + copy(dAtA[i:], m.XXX_unrecognized) + } + if m.MemoryOomControl != nil { + { + size, err := m.MemoryOomControl.MarshalToSizedBuffer(dAtA[:i]) + if err != nil { + return 0, err + } + i -= size + i = encodeVarintMetrics(dAtA, i, uint64(size)) + } + i-- + dAtA[i] = 0x4a + } + if m.CgroupStats != nil { + { + size, err := m.CgroupStats.MarshalToSizedBuffer(dAtA[:i]) + if err != nil { + return 0, err + } + i -= size + i = encodeVarintMetrics(dAtA, i, uint64(size)) + } + i-- + dAtA[i] = 0x42 + } + if len(m.Network) > 0 { + for iNdEx := len(m.Network) - 1; iNdEx >= 0; iNdEx-- { + { + size, err := m.Network[iNdEx].MarshalToSizedBuffer(dAtA[:i]) + if err != nil { + return 0, err + } + i -= size + i = encodeVarintMetrics(dAtA, i, uint64(size)) + } + i-- + dAtA[i] = 0x3a + } + } + if m.Rdma != nil { + { + size, err := m.Rdma.MarshalToSizedBuffer(dAtA[:i]) + if err != nil { + return 0, err + } + i -= size + i = encodeVarintMetrics(dAtA, i, uint64(size)) + } + i-- + dAtA[i] = 0x32 + } + if m.Blkio != nil { + { + size, err := m.Blkio.MarshalToSizedBuffer(dAtA[:i]) + if err != nil { + return 0, err + } + i -= size + i = encodeVarintMetrics(dAtA, i, uint64(size)) + } + i-- + dAtA[i] = 0x2a + } + if m.Memory != nil { + { + size, err := m.Memory.MarshalToSizedBuffer(dAtA[:i]) + if err != nil { + return 0, err + } + i -= size + i = encodeVarintMetrics(dAtA, i, uint64(size)) + } + i-- + dAtA[i] = 0x22 + } + if m.CPU != nil { + { + size, err := m.CPU.MarshalToSizedBuffer(dAtA[:i]) + if err != nil { + return 0, err + } + i -= size + i = encodeVarintMetrics(dAtA, i, uint64(size)) + } + i-- + dAtA[i] = 0x1a + } + if m.Pids != nil { + { + size, err := m.Pids.MarshalToSizedBuffer(dAtA[:i]) + if err != nil { + return 0, err + } + i -= size + i = encodeVarintMetrics(dAtA, i, uint64(size)) + } + i-- + dAtA[i] = 0x12 + } + if len(m.Hugetlb) > 0 { + for iNdEx := len(m.Hugetlb) - 1; iNdEx >= 0; iNdEx-- { + { + size, err := m.Hugetlb[iNdEx].MarshalToSizedBuffer(dAtA[:i]) + if err != nil { + return 0, err + } + i -= size + i = encodeVarintMetrics(dAtA, i, uint64(size)) + } + i-- + dAtA[i] = 0xa + } + } + return len(dAtA) - i, nil +} + +func (m *HugetlbStat) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalToSizedBuffer(dAtA[:size]) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *HugetlbStat) MarshalTo(dAtA []byte) (int, error) { + size := m.Size() + return m.MarshalToSizedBuffer(dAtA[:size]) +} + +func (m *HugetlbStat) MarshalToSizedBuffer(dAtA []byte) (int, error) { + i := len(dAtA) + _ = i + var l int + _ = l + if m.XXX_unrecognized != nil { + i -= len(m.XXX_unrecognized) + copy(dAtA[i:], m.XXX_unrecognized) + } + if len(m.Pagesize) > 0 { + i -= len(m.Pagesize) + copy(dAtA[i:], m.Pagesize) + i = encodeVarintMetrics(dAtA, i, uint64(len(m.Pagesize))) + i-- + dAtA[i] = 0x22 + } + if m.Failcnt != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.Failcnt)) + i-- + dAtA[i] = 0x18 + } + if m.Max != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.Max)) + i-- + dAtA[i] = 0x10 + } + if m.Usage != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.Usage)) + i-- + dAtA[i] = 0x8 + } + return len(dAtA) - i, nil +} + +func (m *PidsStat) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalToSizedBuffer(dAtA[:size]) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *PidsStat) MarshalTo(dAtA []byte) (int, error) { + size := m.Size() + return m.MarshalToSizedBuffer(dAtA[:size]) +} + +func (m *PidsStat) MarshalToSizedBuffer(dAtA []byte) (int, error) { + i := len(dAtA) + _ = i + var l int + _ = l + if m.XXX_unrecognized != nil { + i -= len(m.XXX_unrecognized) + copy(dAtA[i:], m.XXX_unrecognized) + } + if m.Limit != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.Limit)) + i-- + dAtA[i] = 0x10 + } + if m.Current != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.Current)) + i-- + dAtA[i] = 0x8 + } + return len(dAtA) - i, nil +} + +func (m *CPUStat) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalToSizedBuffer(dAtA[:size]) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *CPUStat) MarshalTo(dAtA []byte) (int, error) { + size := m.Size() + return m.MarshalToSizedBuffer(dAtA[:size]) +} + +func (m *CPUStat) MarshalToSizedBuffer(dAtA []byte) (int, error) { + i := len(dAtA) + _ = i + var l int + _ = l + if m.XXX_unrecognized != nil { + i -= len(m.XXX_unrecognized) + copy(dAtA[i:], m.XXX_unrecognized) + } + if m.Throttling != nil { + { + size, err := m.Throttling.MarshalToSizedBuffer(dAtA[:i]) + if err != nil { + return 0, err + } + i -= size + i = encodeVarintMetrics(dAtA, i, uint64(size)) + } + i-- + dAtA[i] = 0x12 + } + if m.Usage != nil { + { + size, err := m.Usage.MarshalToSizedBuffer(dAtA[:i]) + if err != nil { + return 0, err + } + i -= size + i = encodeVarintMetrics(dAtA, i, uint64(size)) + } + i-- + dAtA[i] = 0xa + } + return len(dAtA) - i, nil +} + +func (m *CPUUsage) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalToSizedBuffer(dAtA[:size]) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *CPUUsage) MarshalTo(dAtA []byte) (int, error) { + size := m.Size() + return m.MarshalToSizedBuffer(dAtA[:size]) +} + +func (m *CPUUsage) MarshalToSizedBuffer(dAtA []byte) (int, error) { + i := len(dAtA) + _ = i + var l int + _ = l + if m.XXX_unrecognized != nil { + i -= len(m.XXX_unrecognized) + copy(dAtA[i:], m.XXX_unrecognized) + } + if len(m.PerCPU) > 0 { + dAtA11 := make([]byte, len(m.PerCPU)*10) + var j10 int + for _, num := range m.PerCPU { + for num >= 1<<7 { + dAtA11[j10] = uint8(uint64(num)&0x7f | 0x80) + num >>= 7 + j10++ + } + dAtA11[j10] = uint8(num) + j10++ + } + i -= j10 + copy(dAtA[i:], dAtA11[:j10]) + i = encodeVarintMetrics(dAtA, i, uint64(j10)) + i-- + dAtA[i] = 0x22 + } + if m.User != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.User)) + i-- + dAtA[i] = 0x18 + } + if m.Kernel != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.Kernel)) + i-- + dAtA[i] = 0x10 + } + if m.Total != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.Total)) + i-- + dAtA[i] = 0x8 + } + return len(dAtA) - i, nil +} + +func (m *Throttle) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalToSizedBuffer(dAtA[:size]) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *Throttle) MarshalTo(dAtA []byte) (int, error) { + size := m.Size() + return m.MarshalToSizedBuffer(dAtA[:size]) +} + +func (m *Throttle) MarshalToSizedBuffer(dAtA []byte) (int, error) { + i := len(dAtA) + _ = i + var l int + _ = l + if m.XXX_unrecognized != nil { + i -= len(m.XXX_unrecognized) + copy(dAtA[i:], m.XXX_unrecognized) + } + if m.ThrottledTime != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.ThrottledTime)) + i-- + dAtA[i] = 0x18 + } + if m.ThrottledPeriods != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.ThrottledPeriods)) + i-- + dAtA[i] = 0x10 + } + if m.Periods != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.Periods)) + i-- + dAtA[i] = 0x8 + } + return len(dAtA) - i, nil +} + +func (m *MemoryStat) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalToSizedBuffer(dAtA[:size]) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *MemoryStat) MarshalTo(dAtA []byte) (int, error) { + size := m.Size() + return m.MarshalToSizedBuffer(dAtA[:size]) +} + +func (m *MemoryStat) MarshalToSizedBuffer(dAtA []byte) (int, error) { + i := len(dAtA) + _ = i + var l int + _ = l + if m.XXX_unrecognized != nil { + i -= len(m.XXX_unrecognized) + copy(dAtA[i:], m.XXX_unrecognized) + } + if m.KernelTCP != nil { + { + size, err := m.KernelTCP.MarshalToSizedBuffer(dAtA[:i]) + if err != nil { + return 0, err + } + i -= size + i = encodeVarintMetrics(dAtA, i, uint64(size)) + } + i-- + dAtA[i] = 0x2 + i-- + dAtA[i] = 0xa2 + } + if m.Kernel != nil { + { + size, err := m.Kernel.MarshalToSizedBuffer(dAtA[:i]) + if err != nil { + return 0, err + } + i -= size + i = encodeVarintMetrics(dAtA, i, uint64(size)) + } + i-- + dAtA[i] = 0x2 + i-- + dAtA[i] = 0x9a + } + if m.Swap != nil { + { + size, err := m.Swap.MarshalToSizedBuffer(dAtA[:i]) + if err != nil { + return 0, err + } + i -= size + i = encodeVarintMetrics(dAtA, i, uint64(size)) + } + i-- + dAtA[i] = 0x2 + i-- + dAtA[i] = 0x92 + } + if m.Usage != nil { + { + size, err := m.Usage.MarshalToSizedBuffer(dAtA[:i]) + if err != nil { + return 0, err + } + i -= size + i = encodeVarintMetrics(dAtA, i, uint64(size)) + } + i-- + dAtA[i] = 0x2 + i-- + dAtA[i] = 0x8a + } + if m.TotalUnevictable != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalUnevictable)) + i-- + dAtA[i] = 0x2 + i-- + dAtA[i] = 0x80 + } + if m.TotalActiveFile != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalActiveFile)) + i-- + dAtA[i] = 0x1 + i-- + dAtA[i] = 0xf8 + } + if m.TotalInactiveFile != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalInactiveFile)) + i-- + dAtA[i] = 0x1 + i-- + dAtA[i] = 0xf0 + } + if m.TotalActiveAnon != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalActiveAnon)) + i-- + dAtA[i] = 0x1 + i-- + dAtA[i] = 0xe8 + } + if m.TotalInactiveAnon != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalInactiveAnon)) + i-- + dAtA[i] = 0x1 + i-- + dAtA[i] = 0xe0 + } + if m.TotalPgMajFault != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalPgMajFault)) + i-- + dAtA[i] = 0x1 + i-- + dAtA[i] = 0xd8 + } + if m.TotalPgFault != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalPgFault)) + i-- + dAtA[i] = 0x1 + i-- + dAtA[i] = 0xd0 + } + if m.TotalPgPgOut != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalPgPgOut)) + i-- + dAtA[i] = 0x1 + i-- + dAtA[i] = 0xc8 + } + if m.TotalPgPgIn != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalPgPgIn)) + i-- + dAtA[i] = 0x1 + i-- + dAtA[i] = 0xc0 + } + if m.TotalWriteback != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalWriteback)) + i-- + dAtA[i] = 0x1 + i-- + dAtA[i] = 0xb8 + } + if m.TotalDirty != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalDirty)) + i-- + dAtA[i] = 0x1 + i-- + dAtA[i] = 0xb0 + } + if m.TotalMappedFile != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalMappedFile)) + i-- + dAtA[i] = 0x1 + i-- + dAtA[i] = 0xa8 + } + if m.TotalRSSHuge != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalRSSHuge)) + i-- + dAtA[i] = 0x1 + i-- + dAtA[i] = 0xa0 + } + if m.TotalRSS != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalRSS)) + i-- + dAtA[i] = 0x1 + i-- + dAtA[i] = 0x98 + } + if m.TotalCache != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalCache)) + i-- + dAtA[i] = 0x1 + i-- + dAtA[i] = 0x90 + } + if m.HierarchicalSwapLimit != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.HierarchicalSwapLimit)) + i-- + dAtA[i] = 0x1 + i-- + dAtA[i] = 0x88 + } + if m.HierarchicalMemoryLimit != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.HierarchicalMemoryLimit)) + i-- + dAtA[i] = 0x1 + i-- + dAtA[i] = 0x80 + } + if m.Unevictable != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.Unevictable)) + i-- + dAtA[i] = 0x78 + } + if m.ActiveFile != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.ActiveFile)) + i-- + dAtA[i] = 0x70 + } + if m.InactiveFile != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.InactiveFile)) + i-- + dAtA[i] = 0x68 + } + if m.ActiveAnon != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.ActiveAnon)) + i-- + dAtA[i] = 0x60 + } + if m.InactiveAnon != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.InactiveAnon)) + i-- + dAtA[i] = 0x58 + } + if m.PgMajFault != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.PgMajFault)) + i-- + dAtA[i] = 0x50 + } + if m.PgFault != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.PgFault)) + i-- + dAtA[i] = 0x48 + } + if m.PgPgOut != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.PgPgOut)) + i-- + dAtA[i] = 0x40 + } + if m.PgPgIn != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.PgPgIn)) + i-- + dAtA[i] = 0x38 + } + if m.Writeback != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.Writeback)) + i-- + dAtA[i] = 0x30 + } + if m.Dirty != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.Dirty)) + i-- + dAtA[i] = 0x28 + } + if m.MappedFile != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.MappedFile)) + i-- + dAtA[i] = 0x20 + } + if m.RSSHuge != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.RSSHuge)) + i-- + dAtA[i] = 0x18 + } + if m.RSS != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.RSS)) + i-- + dAtA[i] = 0x10 + } + if m.Cache != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.Cache)) + i-- + dAtA[i] = 0x8 + } + return len(dAtA) - i, nil +} + +func (m *MemoryEntry) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalToSizedBuffer(dAtA[:size]) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *MemoryEntry) MarshalTo(dAtA []byte) (int, error) { + size := m.Size() + return m.MarshalToSizedBuffer(dAtA[:size]) +} + +func (m *MemoryEntry) MarshalToSizedBuffer(dAtA []byte) (int, error) { + i := len(dAtA) + _ = i + var l int + _ = l + if m.XXX_unrecognized != nil { + i -= len(m.XXX_unrecognized) + copy(dAtA[i:], m.XXX_unrecognized) + } + if m.Failcnt != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.Failcnt)) + i-- + dAtA[i] = 0x20 + } + if m.Max != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.Max)) + i-- + dAtA[i] = 0x18 + } + if m.Usage != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.Usage)) + i-- + dAtA[i] = 0x10 + } + if m.Limit != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.Limit)) + i-- + dAtA[i] = 0x8 + } + return len(dAtA) - i, nil +} + +func (m *MemoryOomControl) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalToSizedBuffer(dAtA[:size]) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *MemoryOomControl) MarshalTo(dAtA []byte) (int, error) { + size := m.Size() + return m.MarshalToSizedBuffer(dAtA[:size]) +} + +func (m *MemoryOomControl) MarshalToSizedBuffer(dAtA []byte) (int, error) { + i := len(dAtA) + _ = i + var l int + _ = l + if m.XXX_unrecognized != nil { + i -= len(m.XXX_unrecognized) + copy(dAtA[i:], m.XXX_unrecognized) + } + if m.OomKill != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.OomKill)) + i-- + dAtA[i] = 0x18 + } + if m.UnderOom != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.UnderOom)) + i-- + dAtA[i] = 0x10 + } + if m.OomKillDisable != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.OomKillDisable)) + i-- + dAtA[i] = 0x8 + } + return len(dAtA) - i, nil +} + +func (m *BlkIOStat) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalToSizedBuffer(dAtA[:size]) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *BlkIOStat) MarshalTo(dAtA []byte) (int, error) { + size := m.Size() + return m.MarshalToSizedBuffer(dAtA[:size]) +} + +func (m *BlkIOStat) MarshalToSizedBuffer(dAtA []byte) (int, error) { + i := len(dAtA) + _ = i + var l int + _ = l + if m.XXX_unrecognized != nil { + i -= len(m.XXX_unrecognized) + copy(dAtA[i:], m.XXX_unrecognized) + } + if len(m.SectorsRecursive) > 0 { + for iNdEx := len(m.SectorsRecursive) - 1; iNdEx >= 0; iNdEx-- { + { + size, err := m.SectorsRecursive[iNdEx].MarshalToSizedBuffer(dAtA[:i]) + if err != nil { + return 0, err + } + i -= size + i = encodeVarintMetrics(dAtA, i, uint64(size)) + } + i-- + dAtA[i] = 0x42 + } + } + if len(m.IoTimeRecursive) > 0 { + for iNdEx := len(m.IoTimeRecursive) - 1; iNdEx >= 0; iNdEx-- { + { + size, err := m.IoTimeRecursive[iNdEx].MarshalToSizedBuffer(dAtA[:i]) + if err != nil { + return 0, err + } + i -= size + i = encodeVarintMetrics(dAtA, i, uint64(size)) + } + i-- + dAtA[i] = 0x3a + } + } + if len(m.IoMergedRecursive) > 0 { + for iNdEx := len(m.IoMergedRecursive) - 1; iNdEx >= 0; iNdEx-- { + { + size, err := m.IoMergedRecursive[iNdEx].MarshalToSizedBuffer(dAtA[:i]) + if err != nil { + return 0, err + } + i -= size + i = encodeVarintMetrics(dAtA, i, uint64(size)) + } + i-- + dAtA[i] = 0x32 + } + } + if len(m.IoWaitTimeRecursive) > 0 { + for iNdEx := len(m.IoWaitTimeRecursive) - 1; iNdEx >= 0; iNdEx-- { + { + size, err := m.IoWaitTimeRecursive[iNdEx].MarshalToSizedBuffer(dAtA[:i]) + if err != nil { + return 0, err + } + i -= size + i = encodeVarintMetrics(dAtA, i, uint64(size)) + } + i-- + dAtA[i] = 0x2a + } + } + if len(m.IoServiceTimeRecursive) > 0 { + for iNdEx := len(m.IoServiceTimeRecursive) - 1; iNdEx >= 0; iNdEx-- { + { + size, err := m.IoServiceTimeRecursive[iNdEx].MarshalToSizedBuffer(dAtA[:i]) + if err != nil { + return 0, err + } + i -= size + i = encodeVarintMetrics(dAtA, i, uint64(size)) + } + i-- + dAtA[i] = 0x22 + } + } + if len(m.IoQueuedRecursive) > 0 { + for iNdEx := len(m.IoQueuedRecursive) - 1; iNdEx >= 0; iNdEx-- { + { + size, err := m.IoQueuedRecursive[iNdEx].MarshalToSizedBuffer(dAtA[:i]) + if err != nil { + return 0, err + } + i -= size + i = encodeVarintMetrics(dAtA, i, uint64(size)) + } + i-- + dAtA[i] = 0x1a + } + } + if len(m.IoServicedRecursive) > 0 { + for iNdEx := len(m.IoServicedRecursive) - 1; iNdEx >= 0; iNdEx-- { + { + size, err := m.IoServicedRecursive[iNdEx].MarshalToSizedBuffer(dAtA[:i]) + if err != nil { + return 0, err + } + i -= size + i = encodeVarintMetrics(dAtA, i, uint64(size)) + } + i-- + dAtA[i] = 0x12 + } + } + if len(m.IoServiceBytesRecursive) > 0 { + for iNdEx := len(m.IoServiceBytesRecursive) - 1; iNdEx >= 0; iNdEx-- { + { + size, err := m.IoServiceBytesRecursive[iNdEx].MarshalToSizedBuffer(dAtA[:i]) + if err != nil { + return 0, err + } + i -= size + i = encodeVarintMetrics(dAtA, i, uint64(size)) + } + i-- + dAtA[i] = 0xa + } + } + return len(dAtA) - i, nil +} + +func (m *BlkIOEntry) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalToSizedBuffer(dAtA[:size]) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *BlkIOEntry) MarshalTo(dAtA []byte) (int, error) { + size := m.Size() + return m.MarshalToSizedBuffer(dAtA[:size]) +} + +func (m *BlkIOEntry) MarshalToSizedBuffer(dAtA []byte) (int, error) { + i := len(dAtA) + _ = i + var l int + _ = l + if m.XXX_unrecognized != nil { + i -= len(m.XXX_unrecognized) + copy(dAtA[i:], m.XXX_unrecognized) + } + if m.Value != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.Value)) + i-- + dAtA[i] = 0x28 + } + if m.Minor != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.Minor)) + i-- + dAtA[i] = 0x20 + } + if m.Major != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.Major)) + i-- + dAtA[i] = 0x18 + } + if len(m.Device) > 0 { + i -= len(m.Device) + copy(dAtA[i:], m.Device) + i = encodeVarintMetrics(dAtA, i, uint64(len(m.Device))) + i-- + dAtA[i] = 0x12 + } + if len(m.Op) > 0 { + i -= len(m.Op) + copy(dAtA[i:], m.Op) + i = encodeVarintMetrics(dAtA, i, uint64(len(m.Op))) + i-- + dAtA[i] = 0xa + } + return len(dAtA) - i, nil +} + +func (m *RdmaStat) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalToSizedBuffer(dAtA[:size]) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *RdmaStat) MarshalTo(dAtA []byte) (int, error) { + size := m.Size() + return m.MarshalToSizedBuffer(dAtA[:size]) +} + +func (m *RdmaStat) MarshalToSizedBuffer(dAtA []byte) (int, error) { + i := len(dAtA) + _ = i + var l int + _ = l + if m.XXX_unrecognized != nil { + i -= len(m.XXX_unrecognized) + copy(dAtA[i:], m.XXX_unrecognized) + } + if len(m.Limit) > 0 { + for iNdEx := len(m.Limit) - 1; iNdEx >= 0; iNdEx-- { + { + size, err := m.Limit[iNdEx].MarshalToSizedBuffer(dAtA[:i]) + if err != nil { + return 0, err + } + i -= size + i = encodeVarintMetrics(dAtA, i, uint64(size)) + } + i-- + dAtA[i] = 0x12 + } + } + if len(m.Current) > 0 { + for iNdEx := len(m.Current) - 1; iNdEx >= 0; iNdEx-- { + { + size, err := m.Current[iNdEx].MarshalToSizedBuffer(dAtA[:i]) + if err != nil { + return 0, err + } + i -= size + i = encodeVarintMetrics(dAtA, i, uint64(size)) + } + i-- + dAtA[i] = 0xa + } + } + return len(dAtA) - i, nil +} + +func (m *RdmaEntry) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalToSizedBuffer(dAtA[:size]) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *RdmaEntry) MarshalTo(dAtA []byte) (int, error) { + size := m.Size() + return m.MarshalToSizedBuffer(dAtA[:size]) +} + +func (m *RdmaEntry) MarshalToSizedBuffer(dAtA []byte) (int, error) { + i := len(dAtA) + _ = i + var l int + _ = l + if m.XXX_unrecognized != nil { + i -= len(m.XXX_unrecognized) + copy(dAtA[i:], m.XXX_unrecognized) + } + if m.HcaObjects != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.HcaObjects)) + i-- + dAtA[i] = 0x18 + } + if m.HcaHandles != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.HcaHandles)) + i-- + dAtA[i] = 0x10 + } + if len(m.Device) > 0 { + i -= len(m.Device) + copy(dAtA[i:], m.Device) + i = encodeVarintMetrics(dAtA, i, uint64(len(m.Device))) + i-- + dAtA[i] = 0xa + } + return len(dAtA) - i, nil +} + +func (m *NetworkStat) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalToSizedBuffer(dAtA[:size]) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *NetworkStat) MarshalTo(dAtA []byte) (int, error) { + size := m.Size() + return m.MarshalToSizedBuffer(dAtA[:size]) +} + +func (m *NetworkStat) MarshalToSizedBuffer(dAtA []byte) (int, error) { + i := len(dAtA) + _ = i + var l int + _ = l + if m.XXX_unrecognized != nil { + i -= len(m.XXX_unrecognized) + copy(dAtA[i:], m.XXX_unrecognized) + } + if m.TxDropped != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.TxDropped)) + i-- + dAtA[i] = 0x48 + } + if m.TxErrors != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.TxErrors)) + i-- + dAtA[i] = 0x40 + } + if m.TxPackets != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.TxPackets)) + i-- + dAtA[i] = 0x38 + } + if m.TxBytes != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.TxBytes)) + i-- + dAtA[i] = 0x30 + } + if m.RxDropped != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.RxDropped)) + i-- + dAtA[i] = 0x28 + } + if m.RxErrors != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.RxErrors)) + i-- + dAtA[i] = 0x20 + } + if m.RxPackets != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.RxPackets)) + i-- + dAtA[i] = 0x18 + } + if m.RxBytes != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.RxBytes)) + i-- + dAtA[i] = 0x10 + } + if len(m.Name) > 0 { + i -= len(m.Name) + copy(dAtA[i:], m.Name) + i = encodeVarintMetrics(dAtA, i, uint64(len(m.Name))) + i-- + dAtA[i] = 0xa + } + return len(dAtA) - i, nil +} + +func (m *CgroupStats) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalToSizedBuffer(dAtA[:size]) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *CgroupStats) MarshalTo(dAtA []byte) (int, error) { + size := m.Size() + return m.MarshalToSizedBuffer(dAtA[:size]) +} + +func (m *CgroupStats) MarshalToSizedBuffer(dAtA []byte) (int, error) { + i := len(dAtA) + _ = i + var l int + _ = l + if m.XXX_unrecognized != nil { + i -= len(m.XXX_unrecognized) + copy(dAtA[i:], m.XXX_unrecognized) + } + if m.NrIoWait != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.NrIoWait)) + i-- + dAtA[i] = 0x28 + } + if m.NrUninterruptible != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.NrUninterruptible)) + i-- + dAtA[i] = 0x20 + } + if m.NrStopped != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.NrStopped)) + i-- + dAtA[i] = 0x18 + } + if m.NrRunning != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.NrRunning)) + i-- + dAtA[i] = 0x10 + } + if m.NrSleeping != 0 { + i = encodeVarintMetrics(dAtA, i, uint64(m.NrSleeping)) + i-- + dAtA[i] = 0x8 + } + return len(dAtA) - i, nil +} + +func encodeVarintMetrics(dAtA []byte, offset int, v uint64) int { + offset -= sovMetrics(v) + base := offset + for v >= 1<<7 { + dAtA[offset] = uint8(v&0x7f | 0x80) + v >>= 7 + offset++ + } + dAtA[offset] = uint8(v) + return base +} +func (m *Metrics) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if len(m.Hugetlb) > 0 { + for _, e := range m.Hugetlb { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if m.Pids != nil { + l = m.Pids.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + if m.CPU != nil { + l = m.CPU.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + if m.Memory != nil { + l = m.Memory.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + if m.Blkio != nil { + l = m.Blkio.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + if m.Rdma != nil { + l = m.Rdma.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + if len(m.Network) > 0 { + for _, e := range m.Network { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if m.CgroupStats != nil { + l = m.CgroupStats.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + if m.MemoryOomControl != nil { + l = m.MemoryOomControl.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *HugetlbStat) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.Usage != 0 { + n += 1 + sovMetrics(uint64(m.Usage)) + } + if m.Max != 0 { + n += 1 + sovMetrics(uint64(m.Max)) + } + if m.Failcnt != 0 { + n += 1 + sovMetrics(uint64(m.Failcnt)) + } + l = len(m.Pagesize) + if l > 0 { + n += 1 + l + sovMetrics(uint64(l)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *PidsStat) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.Current != 0 { + n += 1 + sovMetrics(uint64(m.Current)) + } + if m.Limit != 0 { + n += 1 + sovMetrics(uint64(m.Limit)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *CPUStat) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.Usage != nil { + l = m.Usage.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + if m.Throttling != nil { + l = m.Throttling.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *CPUUsage) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.Total != 0 { + n += 1 + sovMetrics(uint64(m.Total)) + } + if m.Kernel != 0 { + n += 1 + sovMetrics(uint64(m.Kernel)) + } + if m.User != 0 { + n += 1 + sovMetrics(uint64(m.User)) + } + if len(m.PerCPU) > 0 { + l = 0 + for _, e := range m.PerCPU { + l += sovMetrics(uint64(e)) + } + n += 1 + sovMetrics(uint64(l)) + l + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *Throttle) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.Periods != 0 { + n += 1 + sovMetrics(uint64(m.Periods)) + } + if m.ThrottledPeriods != 0 { + n += 1 + sovMetrics(uint64(m.ThrottledPeriods)) + } + if m.ThrottledTime != 0 { + n += 1 + sovMetrics(uint64(m.ThrottledTime)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *MemoryStat) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.Cache != 0 { + n += 1 + sovMetrics(uint64(m.Cache)) + } + if m.RSS != 0 { + n += 1 + sovMetrics(uint64(m.RSS)) + } + if m.RSSHuge != 0 { + n += 1 + sovMetrics(uint64(m.RSSHuge)) + } + if m.MappedFile != 0 { + n += 1 + sovMetrics(uint64(m.MappedFile)) + } + if m.Dirty != 0 { + n += 1 + sovMetrics(uint64(m.Dirty)) + } + if m.Writeback != 0 { + n += 1 + sovMetrics(uint64(m.Writeback)) + } + if m.PgPgIn != 0 { + n += 1 + sovMetrics(uint64(m.PgPgIn)) + } + if m.PgPgOut != 0 { + n += 1 + sovMetrics(uint64(m.PgPgOut)) + } + if m.PgFault != 0 { + n += 1 + sovMetrics(uint64(m.PgFault)) + } + if m.PgMajFault != 0 { + n += 1 + sovMetrics(uint64(m.PgMajFault)) + } + if m.InactiveAnon != 0 { + n += 1 + sovMetrics(uint64(m.InactiveAnon)) + } + if m.ActiveAnon != 0 { + n += 1 + sovMetrics(uint64(m.ActiveAnon)) + } + if m.InactiveFile != 0 { + n += 1 + sovMetrics(uint64(m.InactiveFile)) + } + if m.ActiveFile != 0 { + n += 1 + sovMetrics(uint64(m.ActiveFile)) + } + if m.Unevictable != 0 { + n += 1 + sovMetrics(uint64(m.Unevictable)) + } + if m.HierarchicalMemoryLimit != 0 { + n += 2 + sovMetrics(uint64(m.HierarchicalMemoryLimit)) + } + if m.HierarchicalSwapLimit != 0 { + n += 2 + sovMetrics(uint64(m.HierarchicalSwapLimit)) + } + if m.TotalCache != 0 { + n += 2 + sovMetrics(uint64(m.TotalCache)) + } + if m.TotalRSS != 0 { + n += 2 + sovMetrics(uint64(m.TotalRSS)) + } + if m.TotalRSSHuge != 0 { + n += 2 + sovMetrics(uint64(m.TotalRSSHuge)) + } + if m.TotalMappedFile != 0 { + n += 2 + sovMetrics(uint64(m.TotalMappedFile)) + } + if m.TotalDirty != 0 { + n += 2 + sovMetrics(uint64(m.TotalDirty)) + } + if m.TotalWriteback != 0 { + n += 2 + sovMetrics(uint64(m.TotalWriteback)) + } + if m.TotalPgPgIn != 0 { + n += 2 + sovMetrics(uint64(m.TotalPgPgIn)) + } + if m.TotalPgPgOut != 0 { + n += 2 + sovMetrics(uint64(m.TotalPgPgOut)) + } + if m.TotalPgFault != 0 { + n += 2 + sovMetrics(uint64(m.TotalPgFault)) + } + if m.TotalPgMajFault != 0 { + n += 2 + sovMetrics(uint64(m.TotalPgMajFault)) + } + if m.TotalInactiveAnon != 0 { + n += 2 + sovMetrics(uint64(m.TotalInactiveAnon)) + } + if m.TotalActiveAnon != 0 { + n += 2 + sovMetrics(uint64(m.TotalActiveAnon)) + } + if m.TotalInactiveFile != 0 { + n += 2 + sovMetrics(uint64(m.TotalInactiveFile)) + } + if m.TotalActiveFile != 0 { + n += 2 + sovMetrics(uint64(m.TotalActiveFile)) + } + if m.TotalUnevictable != 0 { + n += 2 + sovMetrics(uint64(m.TotalUnevictable)) + } + if m.Usage != nil { + l = m.Usage.Size() + n += 2 + l + sovMetrics(uint64(l)) + } + if m.Swap != nil { + l = m.Swap.Size() + n += 2 + l + sovMetrics(uint64(l)) + } + if m.Kernel != nil { + l = m.Kernel.Size() + n += 2 + l + sovMetrics(uint64(l)) + } + if m.KernelTCP != nil { + l = m.KernelTCP.Size() + n += 2 + l + sovMetrics(uint64(l)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *MemoryEntry) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.Limit != 0 { + n += 1 + sovMetrics(uint64(m.Limit)) + } + if m.Usage != 0 { + n += 1 + sovMetrics(uint64(m.Usage)) + } + if m.Max != 0 { + n += 1 + sovMetrics(uint64(m.Max)) + } + if m.Failcnt != 0 { + n += 1 + sovMetrics(uint64(m.Failcnt)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *MemoryOomControl) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.OomKillDisable != 0 { + n += 1 + sovMetrics(uint64(m.OomKillDisable)) + } + if m.UnderOom != 0 { + n += 1 + sovMetrics(uint64(m.UnderOom)) + } + if m.OomKill != 0 { + n += 1 + sovMetrics(uint64(m.OomKill)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *BlkIOStat) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if len(m.IoServiceBytesRecursive) > 0 { + for _, e := range m.IoServiceBytesRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.IoServicedRecursive) > 0 { + for _, e := range m.IoServicedRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.IoQueuedRecursive) > 0 { + for _, e := range m.IoQueuedRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.IoServiceTimeRecursive) > 0 { + for _, e := range m.IoServiceTimeRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.IoWaitTimeRecursive) > 0 { + for _, e := range m.IoWaitTimeRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.IoMergedRecursive) > 0 { + for _, e := range m.IoMergedRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.IoTimeRecursive) > 0 { + for _, e := range m.IoTimeRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.SectorsRecursive) > 0 { + for _, e := range m.SectorsRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *BlkIOEntry) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + l = len(m.Op) + if l > 0 { + n += 1 + l + sovMetrics(uint64(l)) + } + l = len(m.Device) + if l > 0 { + n += 1 + l + sovMetrics(uint64(l)) + } + if m.Major != 0 { + n += 1 + sovMetrics(uint64(m.Major)) + } + if m.Minor != 0 { + n += 1 + sovMetrics(uint64(m.Minor)) + } + if m.Value != 0 { + n += 1 + sovMetrics(uint64(m.Value)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *RdmaStat) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if len(m.Current) > 0 { + for _, e := range m.Current { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.Limit) > 0 { + for _, e := range m.Limit { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *RdmaEntry) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + l = len(m.Device) + if l > 0 { + n += 1 + l + sovMetrics(uint64(l)) + } + if m.HcaHandles != 0 { + n += 1 + sovMetrics(uint64(m.HcaHandles)) + } + if m.HcaObjects != 0 { + n += 1 + sovMetrics(uint64(m.HcaObjects)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *NetworkStat) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + l = len(m.Name) + if l > 0 { + n += 1 + l + sovMetrics(uint64(l)) + } + if m.RxBytes != 0 { + n += 1 + sovMetrics(uint64(m.RxBytes)) + } + if m.RxPackets != 0 { + n += 1 + sovMetrics(uint64(m.RxPackets)) + } + if m.RxErrors != 0 { + n += 1 + sovMetrics(uint64(m.RxErrors)) + } + if m.RxDropped != 0 { + n += 1 + sovMetrics(uint64(m.RxDropped)) + } + if m.TxBytes != 0 { + n += 1 + sovMetrics(uint64(m.TxBytes)) + } + if m.TxPackets != 0 { + n += 1 + sovMetrics(uint64(m.TxPackets)) + } + if m.TxErrors != 0 { + n += 1 + sovMetrics(uint64(m.TxErrors)) + } + if m.TxDropped != 0 { + n += 1 + sovMetrics(uint64(m.TxDropped)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *CgroupStats) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.NrSleeping != 0 { + n += 1 + sovMetrics(uint64(m.NrSleeping)) + } + if m.NrRunning != 0 { + n += 1 + sovMetrics(uint64(m.NrRunning)) + } + if m.NrStopped != 0 { + n += 1 + sovMetrics(uint64(m.NrStopped)) + } + if m.NrUninterruptible != 0 { + n += 1 + sovMetrics(uint64(m.NrUninterruptible)) + } + if m.NrIoWait != 0 { + n += 1 + sovMetrics(uint64(m.NrIoWait)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func sovMetrics(x uint64) (n int) { + return (math_bits.Len64(x|1) + 6) / 7 +} +func sozMetrics(x uint64) (n int) { + return sovMetrics(uint64((x << 1) ^ uint64((int64(x) >> 63)))) +} +func (this *Metrics) String() string { + if this == nil { + return "nil" + } + repeatedStringForHugetlb := "[]*HugetlbStat{" + for _, f := range this.Hugetlb { + repeatedStringForHugetlb += strings.Replace(f.String(), "HugetlbStat", "HugetlbStat", 1) + "," + } + repeatedStringForHugetlb += "}" + repeatedStringForNetwork := "[]*NetworkStat{" + for _, f := range this.Network { + repeatedStringForNetwork += strings.Replace(f.String(), "NetworkStat", "NetworkStat", 1) + "," + } + repeatedStringForNetwork += "}" + s := strings.Join([]string{`&Metrics{`, + `Hugetlb:` + repeatedStringForHugetlb + `,`, + `Pids:` + strings.Replace(this.Pids.String(), "PidsStat", "PidsStat", 1) + `,`, + `CPU:` + strings.Replace(this.CPU.String(), "CPUStat", "CPUStat", 1) + `,`, + `Memory:` + strings.Replace(this.Memory.String(), "MemoryStat", "MemoryStat", 1) + `,`, + `Blkio:` + strings.Replace(this.Blkio.String(), "BlkIOStat", "BlkIOStat", 1) + `,`, + `Rdma:` + strings.Replace(this.Rdma.String(), "RdmaStat", "RdmaStat", 1) + `,`, + `Network:` + repeatedStringForNetwork + `,`, + `CgroupStats:` + strings.Replace(this.CgroupStats.String(), "CgroupStats", "CgroupStats", 1) + `,`, + `MemoryOomControl:` + strings.Replace(this.MemoryOomControl.String(), "MemoryOomControl", "MemoryOomControl", 1) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *HugetlbStat) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&HugetlbStat{`, + `Usage:` + fmt.Sprintf("%v", this.Usage) + `,`, + `Max:` + fmt.Sprintf("%v", this.Max) + `,`, + `Failcnt:` + fmt.Sprintf("%v", this.Failcnt) + `,`, + `Pagesize:` + fmt.Sprintf("%v", this.Pagesize) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *PidsStat) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&PidsStat{`, + `Current:` + fmt.Sprintf("%v", this.Current) + `,`, + `Limit:` + fmt.Sprintf("%v", this.Limit) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *CPUStat) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&CPUStat{`, + `Usage:` + strings.Replace(this.Usage.String(), "CPUUsage", "CPUUsage", 1) + `,`, + `Throttling:` + strings.Replace(this.Throttling.String(), "Throttle", "Throttle", 1) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *CPUUsage) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&CPUUsage{`, + `Total:` + fmt.Sprintf("%v", this.Total) + `,`, + `Kernel:` + fmt.Sprintf("%v", this.Kernel) + `,`, + `User:` + fmt.Sprintf("%v", this.User) + `,`, + `PerCPU:` + fmt.Sprintf("%v", this.PerCPU) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *Throttle) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&Throttle{`, + `Periods:` + fmt.Sprintf("%v", this.Periods) + `,`, + `ThrottledPeriods:` + fmt.Sprintf("%v", this.ThrottledPeriods) + `,`, + `ThrottledTime:` + fmt.Sprintf("%v", this.ThrottledTime) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *MemoryStat) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&MemoryStat{`, + `Cache:` + fmt.Sprintf("%v", this.Cache) + `,`, + `RSS:` + fmt.Sprintf("%v", this.RSS) + `,`, + `RSSHuge:` + fmt.Sprintf("%v", this.RSSHuge) + `,`, + `MappedFile:` + fmt.Sprintf("%v", this.MappedFile) + `,`, + `Dirty:` + fmt.Sprintf("%v", this.Dirty) + `,`, + `Writeback:` + fmt.Sprintf("%v", this.Writeback) + `,`, + `PgPgIn:` + fmt.Sprintf("%v", this.PgPgIn) + `,`, + `PgPgOut:` + fmt.Sprintf("%v", this.PgPgOut) + `,`, + `PgFault:` + fmt.Sprintf("%v", this.PgFault) + `,`, + `PgMajFault:` + fmt.Sprintf("%v", this.PgMajFault) + `,`, + `InactiveAnon:` + fmt.Sprintf("%v", this.InactiveAnon) + `,`, + `ActiveAnon:` + fmt.Sprintf("%v", this.ActiveAnon) + `,`, + `InactiveFile:` + fmt.Sprintf("%v", this.InactiveFile) + `,`, + `ActiveFile:` + fmt.Sprintf("%v", this.ActiveFile) + `,`, + `Unevictable:` + fmt.Sprintf("%v", this.Unevictable) + `,`, + `HierarchicalMemoryLimit:` + fmt.Sprintf("%v", this.HierarchicalMemoryLimit) + `,`, + `HierarchicalSwapLimit:` + fmt.Sprintf("%v", this.HierarchicalSwapLimit) + `,`, + `TotalCache:` + fmt.Sprintf("%v", this.TotalCache) + `,`, + `TotalRSS:` + fmt.Sprintf("%v", this.TotalRSS) + `,`, + `TotalRSSHuge:` + fmt.Sprintf("%v", this.TotalRSSHuge) + `,`, + `TotalMappedFile:` + fmt.Sprintf("%v", this.TotalMappedFile) + `,`, + `TotalDirty:` + fmt.Sprintf("%v", this.TotalDirty) + `,`, + `TotalWriteback:` + fmt.Sprintf("%v", this.TotalWriteback) + `,`, + `TotalPgPgIn:` + fmt.Sprintf("%v", this.TotalPgPgIn) + `,`, + `TotalPgPgOut:` + fmt.Sprintf("%v", this.TotalPgPgOut) + `,`, + `TotalPgFault:` + fmt.Sprintf("%v", this.TotalPgFault) + `,`, + `TotalPgMajFault:` + fmt.Sprintf("%v", this.TotalPgMajFault) + `,`, + `TotalInactiveAnon:` + fmt.Sprintf("%v", this.TotalInactiveAnon) + `,`, + `TotalActiveAnon:` + fmt.Sprintf("%v", this.TotalActiveAnon) + `,`, + `TotalInactiveFile:` + fmt.Sprintf("%v", this.TotalInactiveFile) + `,`, + `TotalActiveFile:` + fmt.Sprintf("%v", this.TotalActiveFile) + `,`, + `TotalUnevictable:` + fmt.Sprintf("%v", this.TotalUnevictable) + `,`, + `Usage:` + strings.Replace(this.Usage.String(), "MemoryEntry", "MemoryEntry", 1) + `,`, + `Swap:` + strings.Replace(this.Swap.String(), "MemoryEntry", "MemoryEntry", 1) + `,`, + `Kernel:` + strings.Replace(this.Kernel.String(), "MemoryEntry", "MemoryEntry", 1) + `,`, + `KernelTCP:` + strings.Replace(this.KernelTCP.String(), "MemoryEntry", "MemoryEntry", 1) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *MemoryEntry) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&MemoryEntry{`, + `Limit:` + fmt.Sprintf("%v", this.Limit) + `,`, + `Usage:` + fmt.Sprintf("%v", this.Usage) + `,`, + `Max:` + fmt.Sprintf("%v", this.Max) + `,`, + `Failcnt:` + fmt.Sprintf("%v", this.Failcnt) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *MemoryOomControl) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&MemoryOomControl{`, + `OomKillDisable:` + fmt.Sprintf("%v", this.OomKillDisable) + `,`, + `UnderOom:` + fmt.Sprintf("%v", this.UnderOom) + `,`, + `OomKill:` + fmt.Sprintf("%v", this.OomKill) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *BlkIOStat) String() string { + if this == nil { + return "nil" + } + repeatedStringForIoServiceBytesRecursive := "[]*BlkIOEntry{" + for _, f := range this.IoServiceBytesRecursive { + repeatedStringForIoServiceBytesRecursive += strings.Replace(f.String(), "BlkIOEntry", "BlkIOEntry", 1) + "," + } + repeatedStringForIoServiceBytesRecursive += "}" + repeatedStringForIoServicedRecursive := "[]*BlkIOEntry{" + for _, f := range this.IoServicedRecursive { + repeatedStringForIoServicedRecursive += strings.Replace(f.String(), "BlkIOEntry", "BlkIOEntry", 1) + "," + } + repeatedStringForIoServicedRecursive += "}" + repeatedStringForIoQueuedRecursive := "[]*BlkIOEntry{" + for _, f := range this.IoQueuedRecursive { + repeatedStringForIoQueuedRecursive += strings.Replace(f.String(), "BlkIOEntry", "BlkIOEntry", 1) + "," + } + repeatedStringForIoQueuedRecursive += "}" + repeatedStringForIoServiceTimeRecursive := "[]*BlkIOEntry{" + for _, f := range this.IoServiceTimeRecursive { + repeatedStringForIoServiceTimeRecursive += strings.Replace(f.String(), "BlkIOEntry", "BlkIOEntry", 1) + "," + } + repeatedStringForIoServiceTimeRecursive += "}" + repeatedStringForIoWaitTimeRecursive := "[]*BlkIOEntry{" + for _, f := range this.IoWaitTimeRecursive { + repeatedStringForIoWaitTimeRecursive += strings.Replace(f.String(), "BlkIOEntry", "BlkIOEntry", 1) + "," + } + repeatedStringForIoWaitTimeRecursive += "}" + repeatedStringForIoMergedRecursive := "[]*BlkIOEntry{" + for _, f := range this.IoMergedRecursive { + repeatedStringForIoMergedRecursive += strings.Replace(f.String(), "BlkIOEntry", "BlkIOEntry", 1) + "," + } + repeatedStringForIoMergedRecursive += "}" + repeatedStringForIoTimeRecursive := "[]*BlkIOEntry{" + for _, f := range this.IoTimeRecursive { + repeatedStringForIoTimeRecursive += strings.Replace(f.String(), "BlkIOEntry", "BlkIOEntry", 1) + "," + } + repeatedStringForIoTimeRecursive += "}" + repeatedStringForSectorsRecursive := "[]*BlkIOEntry{" + for _, f := range this.SectorsRecursive { + repeatedStringForSectorsRecursive += strings.Replace(f.String(), "BlkIOEntry", "BlkIOEntry", 1) + "," + } + repeatedStringForSectorsRecursive += "}" + s := strings.Join([]string{`&BlkIOStat{`, + `IoServiceBytesRecursive:` + repeatedStringForIoServiceBytesRecursive + `,`, + `IoServicedRecursive:` + repeatedStringForIoServicedRecursive + `,`, + `IoQueuedRecursive:` + repeatedStringForIoQueuedRecursive + `,`, + `IoServiceTimeRecursive:` + repeatedStringForIoServiceTimeRecursive + `,`, + `IoWaitTimeRecursive:` + repeatedStringForIoWaitTimeRecursive + `,`, + `IoMergedRecursive:` + repeatedStringForIoMergedRecursive + `,`, + `IoTimeRecursive:` + repeatedStringForIoTimeRecursive + `,`, + `SectorsRecursive:` + repeatedStringForSectorsRecursive + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *BlkIOEntry) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&BlkIOEntry{`, + `Op:` + fmt.Sprintf("%v", this.Op) + `,`, + `Device:` + fmt.Sprintf("%v", this.Device) + `,`, + `Major:` + fmt.Sprintf("%v", this.Major) + `,`, + `Minor:` + fmt.Sprintf("%v", this.Minor) + `,`, + `Value:` + fmt.Sprintf("%v", this.Value) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *RdmaStat) String() string { + if this == nil { + return "nil" + } + repeatedStringForCurrent := "[]*RdmaEntry{" + for _, f := range this.Current { + repeatedStringForCurrent += strings.Replace(f.String(), "RdmaEntry", "RdmaEntry", 1) + "," + } + repeatedStringForCurrent += "}" + repeatedStringForLimit := "[]*RdmaEntry{" + for _, f := range this.Limit { + repeatedStringForLimit += strings.Replace(f.String(), "RdmaEntry", "RdmaEntry", 1) + "," + } + repeatedStringForLimit += "}" + s := strings.Join([]string{`&RdmaStat{`, + `Current:` + repeatedStringForCurrent + `,`, + `Limit:` + repeatedStringForLimit + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *RdmaEntry) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&RdmaEntry{`, + `Device:` + fmt.Sprintf("%v", this.Device) + `,`, + `HcaHandles:` + fmt.Sprintf("%v", this.HcaHandles) + `,`, + `HcaObjects:` + fmt.Sprintf("%v", this.HcaObjects) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *NetworkStat) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&NetworkStat{`, + `Name:` + fmt.Sprintf("%v", this.Name) + `,`, + `RxBytes:` + fmt.Sprintf("%v", this.RxBytes) + `,`, + `RxPackets:` + fmt.Sprintf("%v", this.RxPackets) + `,`, + `RxErrors:` + fmt.Sprintf("%v", this.RxErrors) + `,`, + `RxDropped:` + fmt.Sprintf("%v", this.RxDropped) + `,`, + `TxBytes:` + fmt.Sprintf("%v", this.TxBytes) + `,`, + `TxPackets:` + fmt.Sprintf("%v", this.TxPackets) + `,`, + `TxErrors:` + fmt.Sprintf("%v", this.TxErrors) + `,`, + `TxDropped:` + fmt.Sprintf("%v", this.TxDropped) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *CgroupStats) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&CgroupStats{`, + `NrSleeping:` + fmt.Sprintf("%v", this.NrSleeping) + `,`, + `NrRunning:` + fmt.Sprintf("%v", this.NrRunning) + `,`, + `NrStopped:` + fmt.Sprintf("%v", this.NrStopped) + `,`, + `NrUninterruptible:` + fmt.Sprintf("%v", this.NrUninterruptible) + `,`, + `NrIoWait:` + fmt.Sprintf("%v", this.NrIoWait) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func valueToStringMetrics(v interface{}) string { + rv := reflect.ValueOf(v) + if rv.IsNil() { + return "nil" + } + pv := reflect.Indirect(rv).Interface() + return fmt.Sprintf("*%v", pv) +} +func (m *Metrics) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: Metrics: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: Metrics: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Hugetlb", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Hugetlb = append(m.Hugetlb, &HugetlbStat{}) + if err := m.Hugetlb[len(m.Hugetlb)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Pids", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Pids == nil { + m.Pids = &PidsStat{} + } + if err := m.Pids.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 3: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field CPU", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.CPU == nil { + m.CPU = &CPUStat{} + } + if err := m.CPU.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 4: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Memory", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Memory == nil { + m.Memory = &MemoryStat{} + } + if err := m.Memory.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 5: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Blkio", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Blkio == nil { + m.Blkio = &BlkIOStat{} + } + if err := m.Blkio.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 6: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Rdma", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Rdma == nil { + m.Rdma = &RdmaStat{} + } + if err := m.Rdma.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 7: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Network", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Network = append(m.Network, &NetworkStat{}) + if err := m.Network[len(m.Network)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 8: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field CgroupStats", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.CgroupStats == nil { + m.CgroupStats = &CgroupStats{} + } + if err := m.CgroupStats.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 9: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field MemoryOomControl", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.MemoryOomControl == nil { + m.MemoryOomControl = &MemoryOomControl{} + } + if err := m.MemoryOomControl.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if (skippy < 0) || (iNdEx+skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *HugetlbStat) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: HugetlbStat: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: HugetlbStat: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Usage", wireType) + } + m.Usage = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Usage |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Max", wireType) + } + m.Max = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Max |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Failcnt", wireType) + } + m.Failcnt = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Failcnt |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 4: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Pagesize", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Pagesize = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if (skippy < 0) || (iNdEx+skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *PidsStat) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: PidsStat: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: PidsStat: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Current", wireType) + } + m.Current = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Current |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Limit", wireType) + } + m.Limit = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Limit |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if (skippy < 0) || (iNdEx+skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *CPUStat) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: CPUStat: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: CPUStat: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Usage", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Usage == nil { + m.Usage = &CPUUsage{} + } + if err := m.Usage.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Throttling", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Throttling == nil { + m.Throttling = &Throttle{} + } + if err := m.Throttling.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if (skippy < 0) || (iNdEx+skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *CPUUsage) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: CPUUsage: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: CPUUsage: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Total", wireType) + } + m.Total = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Total |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Kernel", wireType) + } + m.Kernel = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Kernel |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field User", wireType) + } + m.User = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.User |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 4: + if wireType == 0 { + var v uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + v |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + m.PerCPU = append(m.PerCPU, v) + } else if wireType == 2 { + var packedLen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + packedLen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if packedLen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + packedLen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + var elementCount int + var count int + for _, integer := range dAtA[iNdEx:postIndex] { + if integer < 128 { + count++ + } + } + elementCount = count + if elementCount != 0 && len(m.PerCPU) == 0 { + m.PerCPU = make([]uint64, 0, elementCount) + } + for iNdEx < postIndex { + var v uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + v |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + m.PerCPU = append(m.PerCPU, v) + } + } else { + return fmt.Errorf("proto: wrong wireType = %d for field PerCPU", wireType) + } + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if (skippy < 0) || (iNdEx+skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *Throttle) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: Throttle: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: Throttle: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Periods", wireType) + } + m.Periods = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Periods |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field ThrottledPeriods", wireType) + } + m.ThrottledPeriods = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.ThrottledPeriods |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field ThrottledTime", wireType) + } + m.ThrottledTime = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.ThrottledTime |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if (skippy < 0) || (iNdEx+skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *MemoryStat) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: MemoryStat: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: MemoryStat: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Cache", wireType) + } + m.Cache = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Cache |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field RSS", wireType) + } + m.RSS = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.RSS |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field RSSHuge", wireType) + } + m.RSSHuge = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.RSSHuge |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 4: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field MappedFile", wireType) + } + m.MappedFile = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.MappedFile |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 5: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Dirty", wireType) + } + m.Dirty = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Dirty |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 6: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Writeback", wireType) + } + m.Writeback = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Writeback |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 7: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field PgPgIn", wireType) + } + m.PgPgIn = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.PgPgIn |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 8: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field PgPgOut", wireType) + } + m.PgPgOut = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.PgPgOut |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 9: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field PgFault", wireType) + } + m.PgFault = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.PgFault |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 10: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field PgMajFault", wireType) + } + m.PgMajFault = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.PgMajFault |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 11: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field InactiveAnon", wireType) + } + m.InactiveAnon = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.InactiveAnon |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 12: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field ActiveAnon", wireType) + } + m.ActiveAnon = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.ActiveAnon |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 13: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field InactiveFile", wireType) + } + m.InactiveFile = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.InactiveFile |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 14: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field ActiveFile", wireType) + } + m.ActiveFile = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.ActiveFile |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 15: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Unevictable", wireType) + } + m.Unevictable = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Unevictable |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 16: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field HierarchicalMemoryLimit", wireType) + } + m.HierarchicalMemoryLimit = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.HierarchicalMemoryLimit |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 17: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field HierarchicalSwapLimit", wireType) + } + m.HierarchicalSwapLimit = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.HierarchicalSwapLimit |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 18: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalCache", wireType) + } + m.TotalCache = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalCache |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 19: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalRSS", wireType) + } + m.TotalRSS = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalRSS |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 20: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalRSSHuge", wireType) + } + m.TotalRSSHuge = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalRSSHuge |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 21: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalMappedFile", wireType) + } + m.TotalMappedFile = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalMappedFile |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 22: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalDirty", wireType) + } + m.TotalDirty = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalDirty |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 23: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalWriteback", wireType) + } + m.TotalWriteback = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalWriteback |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 24: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalPgPgIn", wireType) + } + m.TotalPgPgIn = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalPgPgIn |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 25: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalPgPgOut", wireType) + } + m.TotalPgPgOut = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalPgPgOut |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 26: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalPgFault", wireType) + } + m.TotalPgFault = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalPgFault |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 27: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalPgMajFault", wireType) + } + m.TotalPgMajFault = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalPgMajFault |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 28: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalInactiveAnon", wireType) + } + m.TotalInactiveAnon = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalInactiveAnon |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 29: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalActiveAnon", wireType) + } + m.TotalActiveAnon = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalActiveAnon |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 30: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalInactiveFile", wireType) + } + m.TotalInactiveFile = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalInactiveFile |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 31: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalActiveFile", wireType) + } + m.TotalActiveFile = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalActiveFile |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 32: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalUnevictable", wireType) + } + m.TotalUnevictable = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalUnevictable |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 33: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Usage", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Usage == nil { + m.Usage = &MemoryEntry{} + } + if err := m.Usage.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 34: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Swap", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Swap == nil { + m.Swap = &MemoryEntry{} + } + if err := m.Swap.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 35: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Kernel", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Kernel == nil { + m.Kernel = &MemoryEntry{} + } + if err := m.Kernel.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 36: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field KernelTCP", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.KernelTCP == nil { + m.KernelTCP = &MemoryEntry{} + } + if err := m.KernelTCP.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if (skippy < 0) || (iNdEx+skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *MemoryEntry) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: MemoryEntry: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: MemoryEntry: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Limit", wireType) + } + m.Limit = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Limit |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Usage", wireType) + } + m.Usage = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Usage |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Max", wireType) + } + m.Max = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Max |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 4: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Failcnt", wireType) + } + m.Failcnt = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Failcnt |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if (skippy < 0) || (iNdEx+skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *MemoryOomControl) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: MemoryOomControl: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: MemoryOomControl: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field OomKillDisable", wireType) + } + m.OomKillDisable = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.OomKillDisable |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field UnderOom", wireType) + } + m.UnderOom = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.UnderOom |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field OomKill", wireType) + } + m.OomKill = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.OomKill |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if (skippy < 0) || (iNdEx+skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *BlkIOStat) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: BlkIOStat: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: BlkIOStat: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field IoServiceBytesRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.IoServiceBytesRecursive = append(m.IoServiceBytesRecursive, &BlkIOEntry{}) + if err := m.IoServiceBytesRecursive[len(m.IoServiceBytesRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field IoServicedRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.IoServicedRecursive = append(m.IoServicedRecursive, &BlkIOEntry{}) + if err := m.IoServicedRecursive[len(m.IoServicedRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 3: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field IoQueuedRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.IoQueuedRecursive = append(m.IoQueuedRecursive, &BlkIOEntry{}) + if err := m.IoQueuedRecursive[len(m.IoQueuedRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 4: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field IoServiceTimeRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.IoServiceTimeRecursive = append(m.IoServiceTimeRecursive, &BlkIOEntry{}) + if err := m.IoServiceTimeRecursive[len(m.IoServiceTimeRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 5: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field IoWaitTimeRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.IoWaitTimeRecursive = append(m.IoWaitTimeRecursive, &BlkIOEntry{}) + if err := m.IoWaitTimeRecursive[len(m.IoWaitTimeRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 6: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field IoMergedRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.IoMergedRecursive = append(m.IoMergedRecursive, &BlkIOEntry{}) + if err := m.IoMergedRecursive[len(m.IoMergedRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 7: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field IoTimeRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.IoTimeRecursive = append(m.IoTimeRecursive, &BlkIOEntry{}) + if err := m.IoTimeRecursive[len(m.IoTimeRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 8: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field SectorsRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.SectorsRecursive = append(m.SectorsRecursive, &BlkIOEntry{}) + if err := m.SectorsRecursive[len(m.SectorsRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if (skippy < 0) || (iNdEx+skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *BlkIOEntry) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: BlkIOEntry: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: BlkIOEntry: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Op", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Op = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Device", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Device = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Major", wireType) + } + m.Major = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Major |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 4: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Minor", wireType) + } + m.Minor = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Minor |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 5: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Value", wireType) + } + m.Value = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Value |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if (skippy < 0) || (iNdEx+skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *RdmaStat) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: RdmaStat: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: RdmaStat: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Current", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Current = append(m.Current, &RdmaEntry{}) + if err := m.Current[len(m.Current)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Limit", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Limit = append(m.Limit, &RdmaEntry{}) + if err := m.Limit[len(m.Limit)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if (skippy < 0) || (iNdEx+skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *RdmaEntry) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: RdmaEntry: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: RdmaEntry: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Device", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Device = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field HcaHandles", wireType) + } + m.HcaHandles = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.HcaHandles |= uint32(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field HcaObjects", wireType) + } + m.HcaObjects = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.HcaObjects |= uint32(b&0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if (skippy < 0) || (iNdEx+skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *NetworkStat) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: NetworkStat: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: NetworkStat: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Name", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Name = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field RxBytes", wireType) + } + m.RxBytes = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.RxBytes |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field RxPackets", wireType) + } + m.RxPackets = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.RxPackets |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 4: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field RxErrors", wireType) + } + m.RxErrors = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.RxErrors |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 5: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field RxDropped", wireType) + } + m.RxDropped = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.RxDropped |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 6: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TxBytes", wireType) + } + m.TxBytes = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TxBytes |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 7: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TxPackets", wireType) + } + m.TxPackets = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TxPackets |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 8: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TxErrors", wireType) + } + m.TxErrors = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TxErrors |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 9: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TxDropped", wireType) + } + m.TxDropped = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TxDropped |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if (skippy < 0) || (iNdEx+skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *CgroupStats) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: CgroupStats: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: CgroupStats: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field NrSleeping", wireType) + } + m.NrSleeping = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.NrSleeping |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field NrRunning", wireType) + } + m.NrRunning = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.NrRunning |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field NrStopped", wireType) + } + m.NrStopped = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.NrStopped |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 4: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field NrUninterruptible", wireType) + } + m.NrUninterruptible = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.NrUninterruptible |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 5: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field NrIoWait", wireType) + } + m.NrIoWait = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.NrIoWait |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if (skippy < 0) || (iNdEx+skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func skipMetrics(dAtA []byte) (n int, err error) { + l := len(dAtA) + iNdEx := 0 + depth := 0 + for iNdEx < l { + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowMetrics + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + wireType := int(wire & 0x7) + switch wireType { + case 0: + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowMetrics + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + iNdEx++ + if dAtA[iNdEx-1] < 0x80 { + break + } + } + case 1: + iNdEx += 8 + case 2: + var length int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowMetrics + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + length |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + if length < 0 { + return 0, ErrInvalidLengthMetrics + } + iNdEx += length + case 3: + depth++ + case 4: + if depth == 0 { + return 0, ErrUnexpectedEndOfGroupMetrics + } + depth-- + case 5: + iNdEx += 4 + default: + return 0, fmt.Errorf("proto: illegal wireType %d", wireType) + } + if iNdEx < 0 { + return 0, ErrInvalidLengthMetrics + } + if depth == 0 { + return iNdEx, nil + } + } + return 0, io.ErrUnexpectedEOF +} + +var ( + ErrInvalidLengthMetrics = fmt.Errorf("proto: negative length found during unmarshaling") + ErrIntOverflowMetrics = fmt.Errorf("proto: integer overflow") + ErrUnexpectedEndOfGroupMetrics = fmt.Errorf("proto: unexpected end of group") +) diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/cgroups/stats/v1/metrics.pb.txt b/src/cmd/linuxkit/vendor/github.com/containerd/cgroups/stats/v1/metrics.pb.txt new file mode 100644 index 000000000..e476cea64 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/cgroups/stats/v1/metrics.pb.txt @@ -0,0 +1,790 @@ +file { + name: "github.com/containerd/cgroups/stats/v1/metrics.proto" + package: "io.containerd.cgroups.v1" + dependency: "gogoproto/gogo.proto" + message_type { + name: "Metrics" + field { + name: "hugetlb" + number: 1 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.HugetlbStat" + json_name: "hugetlb" + } + field { + name: "pids" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.PidsStat" + json_name: "pids" + } + field { + name: "cpu" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.CPUStat" + options { + 65004: "CPU" + } + json_name: "cpu" + } + field { + name: "memory" + number: 4 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.MemoryStat" + json_name: "memory" + } + field { + name: "blkio" + number: 5 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOStat" + json_name: "blkio" + } + field { + name: "rdma" + number: 6 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.RdmaStat" + json_name: "rdma" + } + field { + name: "network" + number: 7 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.NetworkStat" + json_name: "network" + } + field { + name: "cgroup_stats" + number: 8 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.CgroupStats" + json_name: "cgroupStats" + } + field { + name: "memory_oom_control" + number: 9 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.MemoryOomControl" + json_name: "memoryOomControl" + } + } + message_type { + name: "HugetlbStat" + field { + name: "usage" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "usage" + } + field { + name: "max" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "max" + } + field { + name: "failcnt" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "failcnt" + } + field { + name: "pagesize" + number: 4 + label: LABEL_OPTIONAL + type: TYPE_STRING + json_name: "pagesize" + } + } + message_type { + name: "PidsStat" + field { + name: "current" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "current" + } + field { + name: "limit" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "limit" + } + } + message_type { + name: "CPUStat" + field { + name: "usage" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.CPUUsage" + json_name: "usage" + } + field { + name: "throttling" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.Throttle" + json_name: "throttling" + } + } + message_type { + name: "CPUUsage" + field { + name: "total" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "total" + } + field { + name: "kernel" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "kernel" + } + field { + name: "user" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "user" + } + field { + name: "per_cpu" + number: 4 + label: LABEL_REPEATED + type: TYPE_UINT64 + options { + 65004: "PerCPU" + } + json_name: "perCpu" + } + } + message_type { + name: "Throttle" + field { + name: "periods" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "periods" + } + field { + name: "throttled_periods" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "throttledPeriods" + } + field { + name: "throttled_time" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "throttledTime" + } + } + message_type { + name: "MemoryStat" + field { + name: "cache" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "cache" + } + field { + name: "rss" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + options { + 65004: "RSS" + } + json_name: "rss" + } + field { + name: "rss_huge" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + options { + 65004: "RSSHuge" + } + json_name: "rssHuge" + } + field { + name: "mapped_file" + number: 4 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "mappedFile" + } + field { + name: "dirty" + number: 5 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "dirty" + } + field { + name: "writeback" + number: 6 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "writeback" + } + field { + name: "pg_pg_in" + number: 7 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "pgPgIn" + } + field { + name: "pg_pg_out" + number: 8 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "pgPgOut" + } + field { + name: "pg_fault" + number: 9 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "pgFault" + } + field { + name: "pg_maj_fault" + number: 10 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "pgMajFault" + } + field { + name: "inactive_anon" + number: 11 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "inactiveAnon" + } + field { + name: "active_anon" + number: 12 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "activeAnon" + } + field { + name: "inactive_file" + number: 13 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "inactiveFile" + } + field { + name: "active_file" + number: 14 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "activeFile" + } + field { + name: "unevictable" + number: 15 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "unevictable" + } + field { + name: "hierarchical_memory_limit" + number: 16 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "hierarchicalMemoryLimit" + } + field { + name: "hierarchical_swap_limit" + number: 17 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "hierarchicalSwapLimit" + } + field { + name: "total_cache" + number: 18 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalCache" + } + field { + name: "total_rss" + number: 19 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + options { + 65004: "TotalRSS" + } + json_name: "totalRss" + } + field { + name: "total_rss_huge" + number: 20 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + options { + 65004: "TotalRSSHuge" + } + json_name: "totalRssHuge" + } + field { + name: "total_mapped_file" + number: 21 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalMappedFile" + } + field { + name: "total_dirty" + number: 22 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalDirty" + } + field { + name: "total_writeback" + number: 23 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalWriteback" + } + field { + name: "total_pg_pg_in" + number: 24 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalPgPgIn" + } + field { + name: "total_pg_pg_out" + number: 25 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalPgPgOut" + } + field { + name: "total_pg_fault" + number: 26 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalPgFault" + } + field { + name: "total_pg_maj_fault" + number: 27 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalPgMajFault" + } + field { + name: "total_inactive_anon" + number: 28 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalInactiveAnon" + } + field { + name: "total_active_anon" + number: 29 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalActiveAnon" + } + field { + name: "total_inactive_file" + number: 30 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalInactiveFile" + } + field { + name: "total_active_file" + number: 31 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalActiveFile" + } + field { + name: "total_unevictable" + number: 32 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalUnevictable" + } + field { + name: "usage" + number: 33 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.MemoryEntry" + json_name: "usage" + } + field { + name: "swap" + number: 34 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.MemoryEntry" + json_name: "swap" + } + field { + name: "kernel" + number: 35 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.MemoryEntry" + json_name: "kernel" + } + field { + name: "kernel_tcp" + number: 36 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.MemoryEntry" + options { + 65004: "KernelTCP" + } + json_name: "kernelTcp" + } + } + message_type { + name: "MemoryEntry" + field { + name: "limit" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "limit" + } + field { + name: "usage" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "usage" + } + field { + name: "max" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "max" + } + field { + name: "failcnt" + number: 4 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "failcnt" + } + } + message_type { + name: "MemoryOomControl" + field { + name: "oom_kill_disable" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "oomKillDisable" + } + field { + name: "under_oom" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "underOom" + } + field { + name: "oom_kill" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "oomKill" + } + } + message_type { + name: "BlkIOStat" + field { + name: "io_service_bytes_recursive" + number: 1 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "ioServiceBytesRecursive" + } + field { + name: "io_serviced_recursive" + number: 2 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "ioServicedRecursive" + } + field { + name: "io_queued_recursive" + number: 3 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "ioQueuedRecursive" + } + field { + name: "io_service_time_recursive" + number: 4 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "ioServiceTimeRecursive" + } + field { + name: "io_wait_time_recursive" + number: 5 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "ioWaitTimeRecursive" + } + field { + name: "io_merged_recursive" + number: 6 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "ioMergedRecursive" + } + field { + name: "io_time_recursive" + number: 7 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "ioTimeRecursive" + } + field { + name: "sectors_recursive" + number: 8 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "sectorsRecursive" + } + } + message_type { + name: "BlkIOEntry" + field { + name: "op" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_STRING + json_name: "op" + } + field { + name: "device" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_STRING + json_name: "device" + } + field { + name: "major" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "major" + } + field { + name: "minor" + number: 4 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "minor" + } + field { + name: "value" + number: 5 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "value" + } + } + message_type { + name: "RdmaStat" + field { + name: "current" + number: 1 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.RdmaEntry" + json_name: "current" + } + field { + name: "limit" + number: 2 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.RdmaEntry" + json_name: "limit" + } + } + message_type { + name: "RdmaEntry" + field { + name: "device" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_STRING + json_name: "device" + } + field { + name: "hca_handles" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT32 + json_name: "hcaHandles" + } + field { + name: "hca_objects" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT32 + json_name: "hcaObjects" + } + } + message_type { + name: "NetworkStat" + field { + name: "name" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_STRING + json_name: "name" + } + field { + name: "rx_bytes" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "rxBytes" + } + field { + name: "rx_packets" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "rxPackets" + } + field { + name: "rx_errors" + number: 4 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "rxErrors" + } + field { + name: "rx_dropped" + number: 5 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "rxDropped" + } + field { + name: "tx_bytes" + number: 6 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "txBytes" + } + field { + name: "tx_packets" + number: 7 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "txPackets" + } + field { + name: "tx_errors" + number: 8 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "txErrors" + } + field { + name: "tx_dropped" + number: 9 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "txDropped" + } + } + message_type { + name: "CgroupStats" + field { + name: "nr_sleeping" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "nrSleeping" + } + field { + name: "nr_running" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "nrRunning" + } + field { + name: "nr_stopped" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "nrStopped" + } + field { + name: "nr_uninterruptible" + number: 4 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "nrUninterruptible" + } + field { + name: "nr_io_wait" + number: 5 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "nrIoWait" + } + } + syntax: "proto3" +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/cgroups/stats/v1/metrics.proto b/src/cmd/linuxkit/vendor/github.com/containerd/cgroups/stats/v1/metrics.proto new file mode 100644 index 000000000..b3f6cc37d --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/cgroups/stats/v1/metrics.proto @@ -0,0 +1,158 @@ +syntax = "proto3"; + +package io.containerd.cgroups.v1; + +import "gogoproto/gogo.proto"; + +message Metrics { + repeated HugetlbStat hugetlb = 1; + PidsStat pids = 2; + CPUStat cpu = 3 [(gogoproto.customname) = "CPU"]; + MemoryStat memory = 4; + BlkIOStat blkio = 5; + RdmaStat rdma = 6; + repeated NetworkStat network = 7; + CgroupStats cgroup_stats = 8; + MemoryOomControl memory_oom_control = 9; +} + +message HugetlbStat { + uint64 usage = 1; + uint64 max = 2; + uint64 failcnt = 3; + string pagesize = 4; +} + +message PidsStat { + uint64 current = 1; + uint64 limit = 2; +} + +message CPUStat { + CPUUsage usage = 1; + Throttle throttling = 2; +} + +message CPUUsage { + // values in nanoseconds + uint64 total = 1; + uint64 kernel = 2; + uint64 user = 3; + repeated uint64 per_cpu = 4 [(gogoproto.customname) = "PerCPU"]; + +} + +message Throttle { + uint64 periods = 1; + uint64 throttled_periods = 2; + uint64 throttled_time = 3; +} + +message MemoryStat { + uint64 cache = 1; + uint64 rss = 2 [(gogoproto.customname) = "RSS"]; + uint64 rss_huge = 3 [(gogoproto.customname) = "RSSHuge"]; + uint64 mapped_file = 4; + uint64 dirty = 5; + uint64 writeback = 6; + uint64 pg_pg_in = 7; + uint64 pg_pg_out = 8; + uint64 pg_fault = 9; + uint64 pg_maj_fault = 10; + uint64 inactive_anon = 11; + uint64 active_anon = 12; + uint64 inactive_file = 13; + uint64 active_file = 14; + uint64 unevictable = 15; + uint64 hierarchical_memory_limit = 16; + uint64 hierarchical_swap_limit = 17; + uint64 total_cache = 18; + uint64 total_rss = 19 [(gogoproto.customname) = "TotalRSS"]; + uint64 total_rss_huge = 20 [(gogoproto.customname) = "TotalRSSHuge"]; + uint64 total_mapped_file = 21; + uint64 total_dirty = 22; + uint64 total_writeback = 23; + uint64 total_pg_pg_in = 24; + uint64 total_pg_pg_out = 25; + uint64 total_pg_fault = 26; + uint64 total_pg_maj_fault = 27; + uint64 total_inactive_anon = 28; + uint64 total_active_anon = 29; + uint64 total_inactive_file = 30; + uint64 total_active_file = 31; + uint64 total_unevictable = 32; + MemoryEntry usage = 33; + MemoryEntry swap = 34; + MemoryEntry kernel = 35; + MemoryEntry kernel_tcp = 36 [(gogoproto.customname) = "KernelTCP"]; + +} + +message MemoryEntry { + uint64 limit = 1; + uint64 usage = 2; + uint64 max = 3; + uint64 failcnt = 4; +} + +message MemoryOomControl { + uint64 oom_kill_disable = 1; + uint64 under_oom = 2; + uint64 oom_kill = 3; +} + +message BlkIOStat { + repeated BlkIOEntry io_service_bytes_recursive = 1; + repeated BlkIOEntry io_serviced_recursive = 2; + repeated BlkIOEntry io_queued_recursive = 3; + repeated BlkIOEntry io_service_time_recursive = 4; + repeated BlkIOEntry io_wait_time_recursive = 5; + repeated BlkIOEntry io_merged_recursive = 6; + repeated BlkIOEntry io_time_recursive = 7; + repeated BlkIOEntry sectors_recursive = 8; +} + +message BlkIOEntry { + string op = 1; + string device = 2; + uint64 major = 3; + uint64 minor = 4; + uint64 value = 5; +} + +message RdmaStat { + repeated RdmaEntry current = 1; + repeated RdmaEntry limit = 2; +} + +message RdmaEntry { + string device = 1; + uint32 hca_handles = 2; + uint32 hca_objects = 3; +} + +message NetworkStat { + string name = 1; + uint64 rx_bytes = 2; + uint64 rx_packets = 3; + uint64 rx_errors = 4; + uint64 rx_dropped = 5; + uint64 tx_bytes = 6; + uint64 tx_packets = 7; + uint64 tx_errors = 8; + uint64 tx_dropped = 9; +} + +// CgroupStats exports per-cgroup statistics. +message CgroupStats { + // number of tasks sleeping + uint64 nr_sleeping = 1; + // number of tasks running + uint64 nr_running = 2; + // number of tasks in stopped state + uint64 nr_stopped = 3; + // number of tasks in uninterruptible state + uint64 nr_uninterruptible = 4; + // number of tasks waiting on IO + uint64 nr_io_wait = 5; +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/archive/tar.go b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/archive/tar.go new file mode 100644 index 000000000..44b794953 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/archive/tar.go @@ -0,0 +1,787 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package archive + +import ( + "archive/tar" + "context" + "errors" + "fmt" + "io" + "os" + "path/filepath" + "runtime" + "strings" + "sync" + "syscall" + "time" + + "github.com/containerd/containerd/log" + "github.com/containerd/containerd/pkg/userns" + "github.com/containerd/continuity/fs" +) + +var bufPool = &sync.Pool{ + New: func() interface{} { + buffer := make([]byte, 32*1024) + return &buffer + }, +} + +var errInvalidArchive = errors.New("invalid archive") + +// Diff returns a tar stream of the computed filesystem +// difference between the provided directories. +// +// Produces a tar using OCI style file markers for deletions. Deleted +// files will be prepended with the prefix ".wh.". This style is +// based off AUFS whiteouts. +// See https://github.com/opencontainers/image-spec/blob/main/layer.md +func Diff(ctx context.Context, a, b string) io.ReadCloser { + r, w := io.Pipe() + + go func() { + err := WriteDiff(ctx, w, a, b) + if err != nil { + log.G(ctx).WithError(err).Debugf("write diff failed") + } + if err = w.CloseWithError(err); err != nil { + log.G(ctx).WithError(err).Debugf("closing tar pipe failed") + } + }() + + return r +} + +// WriteDiff writes a tar stream of the computed difference between the +// provided paths. +// +// Produces a tar using OCI style file markers for deletions. Deleted +// files will be prepended with the prefix ".wh.". This style is +// based off AUFS whiteouts. +// See https://github.com/opencontainers/image-spec/blob/main/layer.md +func WriteDiff(ctx context.Context, w io.Writer, a, b string, opts ...WriteDiffOpt) error { + var options WriteDiffOptions + for _, opt := range opts { + if err := opt(&options); err != nil { + return fmt.Errorf("failed to apply option: %w", err) + } + } + if options.writeDiffFunc == nil { + options.writeDiffFunc = writeDiffNaive + } + + return options.writeDiffFunc(ctx, w, a, b, options) +} + +// writeDiffNaive writes a tar stream of the computed difference between the +// provided directories on disk. +// +// Produces a tar using OCI style file markers for deletions. Deleted +// files will be prepended with the prefix ".wh.". This style is +// based off AUFS whiteouts. +// See https://github.com/opencontainers/image-spec/blob/main/layer.md +func writeDiffNaive(ctx context.Context, w io.Writer, a, b string, _ WriteDiffOptions) error { + cw := NewChangeWriter(w, b) + err := fs.Changes(ctx, a, b, cw.HandleChange) + if err != nil { + return fmt.Errorf("failed to create diff tar stream: %w", err) + } + return cw.Close() +} + +const ( + // whiteoutPrefix prefix means file is a whiteout. If this is followed by a + // filename this means that file has been removed from the base layer. + // See https://github.com/opencontainers/image-spec/blob/main/layer.md#whiteouts + whiteoutPrefix = ".wh." + + // whiteoutMetaPrefix prefix means whiteout has a special meaning and is not + // for removing an actual file. Normally these files are excluded from exported + // archives. + whiteoutMetaPrefix = whiteoutPrefix + whiteoutPrefix + + // whiteoutOpaqueDir file means directory has been made opaque - meaning + // readdir calls to this directory do not follow to lower layers. + whiteoutOpaqueDir = whiteoutMetaPrefix + ".opq" + + paxSchilyXattr = "SCHILY.xattr." + + userXattrPrefix = "user." +) + +// Apply applies a tar stream of an OCI style diff tar. +// See https://github.com/opencontainers/image-spec/blob/main/layer.md#applying-changesets +func Apply(ctx context.Context, root string, r io.Reader, opts ...ApplyOpt) (int64, error) { + root = filepath.Clean(root) + + var options ApplyOptions + for _, opt := range opts { + if err := opt(&options); err != nil { + return 0, fmt.Errorf("failed to apply option: %w", err) + } + } + if options.Filter == nil { + options.Filter = all + } + if options.applyFunc == nil { + options.applyFunc = applyNaive + } + + return options.applyFunc(ctx, root, r, options) +} + +// applyNaive applies a tar stream of an OCI style diff tar to a directory +// applying each file as either a whole file or whiteout. +// See https://github.com/opencontainers/image-spec/blob/main/layer.md#applying-changesets +func applyNaive(ctx context.Context, root string, r io.Reader, options ApplyOptions) (size int64, err error) { + var ( + dirs []*tar.Header + + tr = tar.NewReader(r) + + // Used for handling opaque directory markers which + // may occur out of order + unpackedPaths = make(map[string]struct{}) + + convertWhiteout = options.ConvertWhiteout + ) + + if convertWhiteout == nil { + // handle whiteouts by removing the target files + convertWhiteout = func(hdr *tar.Header, path string) (bool, error) { + base := filepath.Base(path) + dir := filepath.Dir(path) + if base == whiteoutOpaqueDir { + _, err := os.Lstat(dir) + if err != nil { + return false, err + } + err = filepath.Walk(dir, func(path string, info os.FileInfo, err error) error { + if err != nil { + if os.IsNotExist(err) { + err = nil // parent was deleted + } + return err + } + if path == dir { + return nil + } + if _, exists := unpackedPaths[path]; !exists { + err := os.RemoveAll(path) + return err + } + return nil + }) + return false, err + } + + if strings.HasPrefix(base, whiteoutPrefix) { + originalBase := base[len(whiteoutPrefix):] + originalPath := filepath.Join(dir, originalBase) + + return false, os.RemoveAll(originalPath) + } + + return true, nil + } + } + + // Iterate through the files in the archive. + for { + select { + case <-ctx.Done(): + return 0, ctx.Err() + default: + } + + hdr, err := tr.Next() + if err == io.EOF { + // end of tar archive + break + } + if err != nil { + return 0, err + } + + size += hdr.Size + + // Normalize name, for safety and for a simple is-root check + hdr.Name = filepath.Clean(hdr.Name) + + accept, err := options.Filter(hdr) + if err != nil { + return 0, err + } + if !accept { + continue + } + + if skipFile(hdr) { + log.G(ctx).Warnf("file %q ignored: archive may not be supported on system", hdr.Name) + continue + } + + // Split name and resolve symlinks for root directory. + ppath, base := filepath.Split(hdr.Name) + ppath, err = fs.RootPath(root, ppath) + if err != nil { + return 0, fmt.Errorf("failed to get root path: %w", err) + } + + // Join to root before joining to parent path to ensure relative links are + // already resolved based on the root before adding to parent. + path := filepath.Join(ppath, filepath.Join("/", base)) + if path == root { + log.G(ctx).Debugf("file %q ignored: resolved to root", hdr.Name) + continue + } + + // If file is not directly under root, ensure parent directory + // exists or is created. + if ppath != root { + parentPath := ppath + if base == "" { + parentPath = filepath.Dir(path) + } + if err := mkparent(ctx, parentPath, root, options.Parents); err != nil { + return 0, err + } + } + + // Naive whiteout convert function which handles whiteout files by + // removing the target files. + if err := validateWhiteout(path); err != nil { + return 0, err + } + writeFile, err := convertWhiteout(hdr, path) + if err != nil { + return 0, fmt.Errorf("failed to convert whiteout file %q: %w", hdr.Name, err) + } + if !writeFile { + continue + } + // If path exits we almost always just want to remove and replace it. + // The only exception is when it is a directory *and* the file from + // the layer is also a directory. Then we want to merge them (i.e. + // just apply the metadata from the layer). + if fi, err := os.Lstat(path); err == nil { + if !(fi.IsDir() && hdr.Typeflag == tar.TypeDir) { + if err := os.RemoveAll(path); err != nil { + return 0, err + } + } + } + + srcData := io.Reader(tr) + srcHdr := hdr + + if err := createTarFile(ctx, path, root, srcHdr, srcData); err != nil { + return 0, err + } + + // Directory mtimes must be handled at the end to avoid further + // file creation in them to modify the directory mtime + if hdr.Typeflag == tar.TypeDir { + dirs = append(dirs, hdr) + } + unpackedPaths[path] = struct{}{} + } + + for _, hdr := range dirs { + path, err := fs.RootPath(root, hdr.Name) + if err != nil { + return 0, err + } + if err := chtimes(path, boundTime(latestTime(hdr.AccessTime, hdr.ModTime)), boundTime(hdr.ModTime)); err != nil { + return 0, err + } + } + + return size, nil +} + +func createTarFile(ctx context.Context, path, extractDir string, hdr *tar.Header, reader io.Reader) error { + // hdr.Mode is in linux format, which we can use for syscalls, + // but for os.Foo() calls we need the mode converted to os.FileMode, + // so use hdrInfo.Mode() (they differ for e.g. setuid bits) + hdrInfo := hdr.FileInfo() + + switch hdr.Typeflag { + case tar.TypeDir: + // Create directory unless it exists as a directory already. + // In that case we just want to merge the two + if fi, err := os.Lstat(path); !(err == nil && fi.IsDir()) { + if err := mkdir(path, hdrInfo.Mode()); err != nil { + return err + } + } + + case tar.TypeReg, tar.TypeRegA: + file, err := openFile(path, os.O_WRONLY|os.O_CREATE|os.O_TRUNC, hdrInfo.Mode()) + if err != nil { + return err + } + + _, err = copyBuffered(ctx, file, reader) + if err1 := file.Close(); err == nil { + err = err1 + } + if err != nil { + return err + } + + case tar.TypeBlock, tar.TypeChar: + // Handle this is an OS-specific way + if err := handleTarTypeBlockCharFifo(hdr, path); err != nil { + return err + } + + case tar.TypeFifo: + // Handle this is an OS-specific way + if err := handleTarTypeBlockCharFifo(hdr, path); err != nil { + return err + } + + case tar.TypeLink: + targetPath, err := hardlinkRootPath(extractDir, hdr.Linkname) + if err != nil { + return err + } + + if err := os.Link(targetPath, path); err != nil { + return err + } + + case tar.TypeSymlink: + if err := os.Symlink(hdr.Linkname, path); err != nil { + return err + } + + case tar.TypeXGlobalHeader: + log.G(ctx).Debug("PAX Global Extended Headers found and ignored") + return nil + + default: + return fmt.Errorf("unhandled tar header type %d", hdr.Typeflag) + } + + // Lchown is not supported on Windows. + if runtime.GOOS != "windows" { + if err := os.Lchown(path, hdr.Uid, hdr.Gid); err != nil { + err = fmt.Errorf("failed to Lchown %q for UID %d, GID %d: %w", path, hdr.Uid, hdr.Gid, err) + if errors.Is(err, syscall.EINVAL) && userns.RunningInUserNS() { + err = fmt.Errorf("%w (Hint: try increasing the number of subordinate IDs in /etc/subuid and /etc/subgid)", err) + } + return err + } + } + + for key, value := range hdr.PAXRecords { + if strings.HasPrefix(key, paxSchilyXattr) { + key = key[len(paxSchilyXattr):] + if err := setxattr(path, key, value); err != nil { + if errors.Is(err, syscall.EPERM) && strings.HasPrefix(key, userXattrPrefix) { + // In the user.* namespace, only regular files and directories can have extended attributes. + // See https://man7.org/linux/man-pages/man7/xattr.7.html for details. + if fi, err := os.Lstat(path); err == nil && (!fi.Mode().IsRegular() && !fi.Mode().IsDir()) { + log.G(ctx).WithError(err).Warnf("ignored xattr %s in archive", key) + continue + } + } + if errors.Is(err, syscall.ENOTSUP) { + log.G(ctx).WithError(err).Warnf("ignored xattr %s in archive", key) + continue + } + return fmt.Errorf("failed to setxattr %q for key %q: %w", path, key, err) + } + } + } + + // call lchmod after lchown since lchown can modify the file mode + if err := lchmod(path, hdrInfo.Mode()); err != nil { + return err + } + + return chtimes(path, boundTime(latestTime(hdr.AccessTime, hdr.ModTime)), boundTime(hdr.ModTime)) +} + +func mkparent(ctx context.Context, path, root string, parents []string) error { + if dir, err := os.Lstat(path); err == nil { + if dir.IsDir() { + return nil + } + return &os.PathError{ + Op: "mkparent", + Path: path, + Err: syscall.ENOTDIR, + } + } else if !os.IsNotExist(err) { + return err + } + + i := len(path) + for i > len(root) && !os.IsPathSeparator(path[i-1]) { + i-- + } + + if i > len(root)+1 { + if err := mkparent(ctx, path[:i-1], root, parents); err != nil { + return err + } + } + + if err := mkdir(path, 0755); err != nil { + // Check that still doesn't exist + dir, err1 := os.Lstat(path) + if err1 == nil && dir.IsDir() { + return nil + } + return err + } + + for _, p := range parents { + ppath, err := fs.RootPath(p, path[len(root):]) + if err != nil { + return err + } + + dir, err := os.Lstat(ppath) + if err == nil { + if !dir.IsDir() { + // Replaced, do not copy attributes + break + } + if err := copyDirInfo(dir, path); err != nil { + return err + } + return copyUpXAttrs(path, ppath) + } else if !os.IsNotExist(err) { + return err + } + } + + log.G(ctx).Debugf("parent directory %q not found: default permissions(0755) used", path) + + return nil +} + +// ChangeWriter provides tar stream from filesystem change information. +// The privided tar stream is styled as an OCI layer. Change information +// (add/modify/delete/unmodified) for each file needs to be passed to this +// writer through HandleChange method. +// +// This should be used combining with continuity's diff computing functionality +// (e.g. `fs.Change` of github.com/containerd/continuity/fs). +// +// See also https://github.com/opencontainers/image-spec/blob/main/layer.md for details +// about OCI layers +type ChangeWriter struct { + tw *tar.Writer + source string + whiteoutT time.Time + inodeSrc map[uint64]string + inodeRefs map[uint64][]string + addedDirs map[string]struct{} +} + +// NewChangeWriter returns ChangeWriter that writes tar stream of the source directory +// to the privided writer. Change information (add/modify/delete/unmodified) for each +// file needs to be passed through HandleChange method. +func NewChangeWriter(w io.Writer, source string) *ChangeWriter { + return &ChangeWriter{ + tw: tar.NewWriter(w), + source: source, + whiteoutT: time.Now(), + inodeSrc: map[uint64]string{}, + inodeRefs: map[uint64][]string{}, + addedDirs: map[string]struct{}{}, + } +} + +// HandleChange receives filesystem change information and reflect that information to +// the result tar stream. This function implements `fs.ChangeFunc` of continuity +// (github.com/containerd/continuity/fs) and should be used with that package. +func (cw *ChangeWriter) HandleChange(k fs.ChangeKind, p string, f os.FileInfo, err error) error { + if err != nil { + return err + } + if k == fs.ChangeKindDelete { + whiteOutDir := filepath.Dir(p) + whiteOutBase := filepath.Base(p) + whiteOut := filepath.Join(whiteOutDir, whiteoutPrefix+whiteOutBase) + hdr := &tar.Header{ + Typeflag: tar.TypeReg, + Name: whiteOut[1:], + Size: 0, + ModTime: cw.whiteoutT, + AccessTime: cw.whiteoutT, + ChangeTime: cw.whiteoutT, + } + if err := cw.includeParents(hdr); err != nil { + return err + } + if err := cw.tw.WriteHeader(hdr); err != nil { + return fmt.Errorf("failed to write whiteout header: %w", err) + } + } else { + var ( + link string + err error + source = filepath.Join(cw.source, p) + ) + + switch { + case f.Mode()&os.ModeSocket != 0: + return nil // ignore sockets + case f.Mode()&os.ModeSymlink != 0: + if link, err = os.Readlink(source); err != nil { + return err + } + } + + hdr, err := tar.FileInfoHeader(f, link) + if err != nil { + return err + } + + hdr.Mode = int64(chmodTarEntry(os.FileMode(hdr.Mode))) + + // truncate timestamp for compatibility. without PAX stdlib rounds timestamps instead + hdr.Format = tar.FormatPAX + hdr.ModTime = hdr.ModTime.Truncate(time.Second) + hdr.AccessTime = time.Time{} + hdr.ChangeTime = time.Time{} + + name := p + if strings.HasPrefix(name, string(filepath.Separator)) { + name, err = filepath.Rel(string(filepath.Separator), name) + if err != nil { + return fmt.Errorf("failed to make path relative: %w", err) + } + } + name, err = tarName(name) + if err != nil { + return fmt.Errorf("cannot canonicalize path: %w", err) + } + // suffix with '/' for directories + if f.IsDir() && !strings.HasSuffix(name, "/") { + name += "/" + } + hdr.Name = name + + if err := setHeaderForSpecialDevice(hdr, name, f); err != nil { + return fmt.Errorf("failed to set device headers: %w", err) + } + + // additionalLinks stores file names which must be linked to + // this file when this file is added + var additionalLinks []string + inode, isHardlink := fs.GetLinkInfo(f) + if isHardlink { + // If the inode has a source, always link to it + if source, ok := cw.inodeSrc[inode]; ok { + hdr.Typeflag = tar.TypeLink + hdr.Linkname = source + hdr.Size = 0 + } else { + if k == fs.ChangeKindUnmodified { + cw.inodeRefs[inode] = append(cw.inodeRefs[inode], name) + return nil + } + cw.inodeSrc[inode] = name + additionalLinks = cw.inodeRefs[inode] + delete(cw.inodeRefs, inode) + } + } else if k == fs.ChangeKindUnmodified { + // Nothing to write to diff + return nil + } + + if capability, err := getxattr(source, "security.capability"); err != nil { + return fmt.Errorf("failed to get capabilities xattr: %w", err) + } else if len(capability) > 0 { + if hdr.PAXRecords == nil { + hdr.PAXRecords = map[string]string{} + } + hdr.PAXRecords[paxSchilyXattr+"security.capability"] = string(capability) + } + + if err := cw.includeParents(hdr); err != nil { + return err + } + if err := cw.tw.WriteHeader(hdr); err != nil { + return fmt.Errorf("failed to write file header: %w", err) + } + + if hdr.Typeflag == tar.TypeReg && hdr.Size > 0 { + file, err := open(source) + if err != nil { + return fmt.Errorf("failed to open path: %v: %w", source, err) + } + defer file.Close() + + n, err := copyBuffered(context.TODO(), cw.tw, file) + if err != nil { + return fmt.Errorf("failed to copy: %w", err) + } + if n != hdr.Size { + return errors.New("short write copying file") + } + } + + if additionalLinks != nil { + source = hdr.Name + for _, extra := range additionalLinks { + hdr.Name = extra + hdr.Typeflag = tar.TypeLink + hdr.Linkname = source + hdr.Size = 0 + + if err := cw.includeParents(hdr); err != nil { + return err + } + if err := cw.tw.WriteHeader(hdr); err != nil { + return fmt.Errorf("failed to write file header: %w", err) + } + } + } + } + return nil +} + +// Close closes this writer. +func (cw *ChangeWriter) Close() error { + if err := cw.tw.Close(); err != nil { + return fmt.Errorf("failed to close tar writer: %w", err) + } + return nil +} + +func (cw *ChangeWriter) includeParents(hdr *tar.Header) error { + if cw.addedDirs == nil { + return nil + } + name := strings.TrimRight(hdr.Name, "/") + fname := filepath.Join(cw.source, name) + parent := filepath.Dir(name) + pname := filepath.Join(cw.source, parent) + + // Do not include root directory as parent + if fname != cw.source && pname != cw.source { + _, ok := cw.addedDirs[parent] + if !ok { + cw.addedDirs[parent] = struct{}{} + fi, err := os.Stat(pname) + if err != nil { + return err + } + if err := cw.HandleChange(fs.ChangeKindModify, parent, fi, nil); err != nil { + return err + } + } + } + if hdr.Typeflag == tar.TypeDir { + cw.addedDirs[name] = struct{}{} + } + return nil +} + +func copyBuffered(ctx context.Context, dst io.Writer, src io.Reader) (written int64, err error) { + buf := bufPool.Get().(*[]byte) + defer bufPool.Put(buf) + + for { + select { + case <-ctx.Done(): + err = ctx.Err() + return + default: + } + + nr, er := src.Read(*buf) + if nr > 0 { + nw, ew := dst.Write((*buf)[0:nr]) + if nw > 0 { + written += int64(nw) + } + if ew != nil { + err = ew + break + } + if nr != nw { + err = io.ErrShortWrite + break + } + } + if er != nil { + if er != io.EOF { + err = er + } + break + } + } + return written, err + +} + +// hardlinkRootPath returns target linkname, evaluating and bounding any +// symlink to the parent directory. +// +// NOTE: Allow hardlink to the softlink, not the real one. For example, +// +// touch /tmp/zzz +// ln -s /tmp/zzz /tmp/xxx +// ln /tmp/xxx /tmp/yyy +// +// /tmp/yyy should be softlink which be same of /tmp/xxx, not /tmp/zzz. +func hardlinkRootPath(root, linkname string) (string, error) { + ppath, base := filepath.Split(linkname) + ppath, err := fs.RootPath(root, ppath) + if err != nil { + return "", err + } + + targetPath := filepath.Join(ppath, base) + if !strings.HasPrefix(targetPath, root) { + targetPath = root + } + return targetPath, nil +} + +func validateWhiteout(path string) error { + base := filepath.Base(path) + dir := filepath.Dir(path) + + if base == whiteoutOpaqueDir { + return nil + } + + if strings.HasPrefix(base, whiteoutPrefix) { + originalBase := base[len(whiteoutPrefix):] + originalPath := filepath.Join(dir, originalBase) + + // Ensure originalPath is under dir + if dir[len(dir)-1] != filepath.Separator { + dir += string(filepath.Separator) + } + if !strings.HasPrefix(originalPath, dir) { + return fmt.Errorf("invalid whiteout name: %v: %w", base, errInvalidArchive) + } + } + return nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/archive/tar_freebsd.go b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/archive/tar_freebsd.go new file mode 100644 index 000000000..fb5abff0e --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/archive/tar_freebsd.go @@ -0,0 +1,46 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package archive + +import ( + "os" + + "golang.org/x/sys/unix" +) + +// mknod wraps unix.Mknod. FreeBSD's unix.Mknod signature is different from +// other Unix and Unix-like operating systems. +func mknod(path string, mode uint32, dev uint64) error { + return unix.Mknod(path, mode, dev) +} + +// lsetxattrCreate wraps unix.Lsetxattr with FreeBSD-specific flags and errors +func lsetxattrCreate(link string, attr string, data []byte) error { + err := unix.Lsetxattr(link, attr, data, 0) + if err == unix.ENOTSUP || err == unix.EEXIST { + return nil + } + return err +} + +func lchmod(path string, mode os.FileMode) error { + err := unix.Fchmodat(unix.AT_FDCWD, path, uint32(mode), unix.AT_SYMLINK_NOFOLLOW) + if err != nil { + err = &os.PathError{Op: "lchmod", Path: path, Err: err} + } + return err +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/archive/tar_mostunix.go b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/archive/tar_mostunix.go new file mode 100644 index 000000000..d2d970356 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/archive/tar_mostunix.go @@ -0,0 +1,56 @@ +//go:build !windows && !freebsd +// +build !windows,!freebsd + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package archive + +import ( + "os" + + "golang.org/x/sys/unix" +) + +// mknod wraps Unix.Mknod and casts dev to int +func mknod(path string, mode uint32, dev uint64) error { + return unix.Mknod(path, mode, int(dev)) +} + +// lsetxattrCreate wraps unix.Lsetxattr, passes the unix.XATTR_CREATE flag on +// supported operating systems,and ignores appropriate errors +func lsetxattrCreate(link string, attr string, data []byte) error { + err := unix.Lsetxattr(link, attr, data, unix.XATTR_CREATE) + if err == unix.ENOTSUP || err == unix.ENODATA || err == unix.EEXIST { + return nil + } + return err +} + +// lchmod checks for symlink and changes the mode if not a symlink +func lchmod(path string, mode os.FileMode) error { + fi, err := os.Lstat(path) + if err != nil { + return err + } + + if fi.Mode()&os.ModeSymlink == 0 { + if err := os.Chmod(path, mode); err != nil { + return err + } + } + return nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/archive/tar_opts.go b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/archive/tar_opts.go new file mode 100644 index 000000000..58985555a --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/archive/tar_opts.go @@ -0,0 +1,85 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package archive + +import ( + "archive/tar" + "context" + "io" +) + +// ApplyOptions provides additional options for an Apply operation +type ApplyOptions struct { + Filter Filter // Filter tar headers + ConvertWhiteout ConvertWhiteout // Convert whiteout files + Parents []string // Parent directories to handle inherited attributes without CoW + + applyFunc func(context.Context, string, io.Reader, ApplyOptions) (int64, error) +} + +// ApplyOpt allows setting mutable archive apply properties on creation +type ApplyOpt func(options *ApplyOptions) error + +// Filter specific files from the archive +type Filter func(*tar.Header) (bool, error) + +// ConvertWhiteout converts whiteout files from the archive +type ConvertWhiteout func(*tar.Header, string) (bool, error) + +// all allows all files +func all(_ *tar.Header) (bool, error) { + return true, nil +} + +// WithFilter uses the filter to select which files are to be extracted. +func WithFilter(f Filter) ApplyOpt { + return func(options *ApplyOptions) error { + options.Filter = f + return nil + } +} + +// WithConvertWhiteout uses the convert function to convert the whiteout files. +func WithConvertWhiteout(c ConvertWhiteout) ApplyOpt { + return func(options *ApplyOptions) error { + options.ConvertWhiteout = c + return nil + } +} + +// WithParents provides parent directories for resolving inherited attributes +// directory from the filesystem. +// Inherited attributes are searched from first to last, making the first +// element in the list the most immediate parent directory. +// NOTE: When applying to a filesystem which supports CoW, file attributes +// should be inherited by the filesystem. +func WithParents(p []string) ApplyOpt { + return func(options *ApplyOptions) error { + options.Parents = p + return nil + } +} + +// WriteDiffOptions provides additional options for a WriteDiff operation +type WriteDiffOptions struct { + ParentLayers []string // Windows needs the full list of parent layers + + writeDiffFunc func(context.Context, io.Writer, string, string, WriteDiffOptions) error +} + +// WriteDiffOpt allows setting mutable archive write properties on creation +type WriteDiffOpt func(options *WriteDiffOptions) error diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/archive/tar_opts_linux.go b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/archive/tar_opts_linux.go new file mode 100644 index 000000000..f88d826e4 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/archive/tar_opts_linux.go @@ -0,0 +1,57 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package archive + +import ( + "archive/tar" + "os" + "path/filepath" + "strings" + + "golang.org/x/sys/unix" +) + +// AufsConvertWhiteout converts whiteout files for aufs. +func AufsConvertWhiteout(_ *tar.Header, _ string) (bool, error) { + return true, nil +} + +// OverlayConvertWhiteout converts whiteout files for overlay. +func OverlayConvertWhiteout(hdr *tar.Header, path string) (bool, error) { + base := filepath.Base(path) + dir := filepath.Dir(path) + + // if a directory is marked as opaque, we need to translate that to overlay + if base == whiteoutOpaqueDir { + // don't write the file itself + return false, unix.Setxattr(dir, "trusted.overlay.opaque", []byte{'y'}, 0) + } + + // if a file was deleted and we are using overlay, we need to create a character device + if strings.HasPrefix(base, whiteoutPrefix) { + originalBase := base[len(whiteoutPrefix):] + originalPath := filepath.Join(dir, originalBase) + + if err := unix.Mknod(originalPath, unix.S_IFCHR, 0); err != nil { + return false, err + } + // don't write the file itself + return false, os.Chown(originalPath, hdr.Uid, hdr.Gid) + } + + return true, nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/archive/tar_opts_windows.go b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/archive/tar_opts_windows.go new file mode 100644 index 000000000..0ba3cd082 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/archive/tar_opts_windows.go @@ -0,0 +1,70 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package archive + +import ( + "context" + "io" + + "github.com/Microsoft/hcsshim/pkg/ociwclayer" +) + +// applyWindowsLayer applies a tar stream of an OCI style diff tar of a Windows layer +// See https://github.com/opencontainers/image-spec/blob/main/layer.md#applying-changesets +func applyWindowsLayer(ctx context.Context, root string, r io.Reader, options ApplyOptions) (size int64, err error) { + return ociwclayer.ImportLayerFromTar(ctx, r, root, options.Parents) +} + +// AsWindowsContainerLayer indicates that the tar stream to apply is that of +// a Windows Container Layer. The caller must be holding SeBackupPrivilege and +// SeRestorePrivilege. +func AsWindowsContainerLayer() ApplyOpt { + return func(options *ApplyOptions) error { + options.applyFunc = applyWindowsLayer + return nil + } +} + +// writeDiffWindowsLayers writes a tar stream of the computed difference between the +// provided Windows layers +// +// Produces a tar using OCI style file markers for deletions. Deleted +// files will be prepended with the prefix ".wh.". This style is +// based off AUFS whiteouts. +// See https://github.com/opencontainers/image-spec/blob/main/layer.md +func writeDiffWindowsLayers(ctx context.Context, w io.Writer, _, layer string, options WriteDiffOptions) error { + return ociwclayer.ExportLayerToTar(ctx, w, layer, options.ParentLayers) +} + +// AsWindowsContainerLayerPair indicates that the paths to diff are a pair of +// Windows Container Layers. The caller must be holding SeBackupPrivilege. +func AsWindowsContainerLayerPair() WriteDiffOpt { + return func(options *WriteDiffOptions) error { + options.writeDiffFunc = writeDiffWindowsLayers + return nil + } +} + +// WithParentLayers provides the Windows Container Layers that are the parents +// of the target (right-hand, "upper") layer, if any. The source (left-hand, "lower") +// layer passed to WriteDiff should be "" in this case. +func WithParentLayers(p []string) WriteDiffOpt { + return func(options *WriteDiffOptions) error { + options.ParentLayers = p + return nil + } +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/archive/tar_unix.go b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/archive/tar_unix.go new file mode 100644 index 000000000..854afcf0a --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/archive/tar_unix.go @@ -0,0 +1,208 @@ +//go:build !windows +// +build !windows + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package archive + +import ( + "archive/tar" + "errors" + "fmt" + "os" + "runtime" + "strings" + "syscall" + + "github.com/containerd/containerd/pkg/userns" + "github.com/containerd/continuity/fs" + "github.com/containerd/continuity/sysx" + "golang.org/x/sys/unix" +) + +func tarName(p string) (string, error) { + return p, nil +} + +func chmodTarEntry(perm os.FileMode) os.FileMode { + return perm +} + +func setHeaderForSpecialDevice(hdr *tar.Header, name string, fi os.FileInfo) error { + // Devmajor and Devminor are only needed for special devices. + + // In FreeBSD, RDev for regular files is -1 (unless overridden by FS): + // https://cgit.freebsd.org/src/tree/sys/kern/vfs_default.c?h=stable/13#n1531 + // (NODEV is -1: https://cgit.freebsd.org/src/tree/sys/sys/param.h?h=stable/13#n241). + + // ZFS in particular does not override the default: + // https://cgit.freebsd.org/src/tree/sys/contrib/openzfs/module/os/freebsd/zfs/zfs_vnops_os.c?h=stable/13#n2027 + + // Since `Stat_t.Rdev` is uint64, the cast turns -1 into (2^64 - 1). + // Such large values cannot be encoded in a tar header. + if runtime.GOOS == "freebsd" && hdr.Typeflag != tar.TypeBlock && hdr.Typeflag != tar.TypeChar { + return nil + } + s, ok := fi.Sys().(*syscall.Stat_t) + if !ok { + return errors.New("unsupported stat type") + } + + // Rdev is int32 on darwin/bsd, int64 on linux/solaris + rdev := uint64(s.Rdev) //nolint:unconvert + + // Currently go does not fill in the major/minors + if s.Mode&syscall.S_IFBLK != 0 || + s.Mode&syscall.S_IFCHR != 0 { + hdr.Devmajor = int64(unix.Major(rdev)) + hdr.Devminor = int64(unix.Minor(rdev)) + } + + return nil +} + +func open(p string) (*os.File, error) { + return os.Open(p) +} + +func openFile(name string, flag int, perm os.FileMode) (*os.File, error) { + f, err := os.OpenFile(name, flag, perm) + if err != nil { + return nil, err + } + // Call chmod to avoid permission mask + if err := os.Chmod(name, perm); err != nil { + f.Close() + return nil, err + } + return f, err +} + +func mkdir(path string, perm os.FileMode) error { + if err := os.Mkdir(path, perm); err != nil { + return err + } + // Only final created directory gets explicit permission + // call to avoid permission mask + return os.Chmod(path, perm) +} + +func skipFile(hdr *tar.Header) bool { + switch hdr.Typeflag { + case tar.TypeBlock, tar.TypeChar: + // cannot create a device if running in user namespace + return userns.RunningInUserNS() + default: + return false + } +} + +// handleTarTypeBlockCharFifo is an OS-specific helper function used by +// createTarFile to handle the following types of header: Block; Char; Fifo. +// This function must not be called for Block and Char when running in userns. +// (skipFile() should return true for them.) +func handleTarTypeBlockCharFifo(hdr *tar.Header, path string) error { + mode := uint32(hdr.Mode & 07777) + switch hdr.Typeflag { + case tar.TypeBlock: + mode |= unix.S_IFBLK + case tar.TypeChar: + mode |= unix.S_IFCHR + case tar.TypeFifo: + mode |= unix.S_IFIFO + } + + return mknod(path, mode, unix.Mkdev(uint32(hdr.Devmajor), uint32(hdr.Devminor))) +} + +func getxattr(path, attr string) ([]byte, error) { + b, err := sysx.LGetxattr(path, attr) + if err == unix.ENOTSUP || err == sysx.ENODATA { + return nil, nil + } + return b, err +} + +func setxattr(path, key, value string) error { + // Do not set trusted attributes + if strings.HasPrefix(key, "trusted.") { + return fmt.Errorf("admin attributes from archive not supported: %w", unix.ENOTSUP) + } + return unix.Lsetxattr(path, key, []byte(value), 0) +} + +func copyDirInfo(fi os.FileInfo, path string) error { + st := fi.Sys().(*syscall.Stat_t) + if err := os.Lchown(path, int(st.Uid), int(st.Gid)); err != nil { + if os.IsPermission(err) { + // Normally if uid/gid are the same this would be a no-op, but some + // filesystems may still return EPERM... for instance NFS does this. + // In such a case, this is not an error. + if dstStat, err2 := os.Lstat(path); err2 == nil { + st2 := dstStat.Sys().(*syscall.Stat_t) + if st.Uid == st2.Uid && st.Gid == st2.Gid { + err = nil + } + } + } + if err != nil { + return fmt.Errorf("failed to chown %s: %w", path, err) + } + } + + if err := os.Chmod(path, fi.Mode()); err != nil { + return fmt.Errorf("failed to chmod %s: %w", path, err) + } + + timespec := []unix.Timespec{ + unix.NsecToTimespec(syscall.TimespecToNsec(fs.StatAtime(st))), + unix.NsecToTimespec(syscall.TimespecToNsec(fs.StatMtime(st))), + } + if err := unix.UtimesNanoAt(unix.AT_FDCWD, path, timespec, unix.AT_SYMLINK_NOFOLLOW); err != nil { + return fmt.Errorf("failed to utime %s: %w", path, err) + } + + return nil +} + +func copyUpXAttrs(dst, src string) error { + xattrKeys, err := sysx.LListxattr(src) + if err != nil { + if err == unix.ENOTSUP || err == sysx.ENODATA { + return nil + } + return fmt.Errorf("failed to list xattrs on %s: %w", src, err) + } + for _, xattr := range xattrKeys { + // Do not copy up trusted attributes + if strings.HasPrefix(xattr, "trusted.") { + continue + } + data, err := sysx.LGetxattr(src, xattr) + if err != nil { + if err == unix.ENOTSUP || err == sysx.ENODATA { + continue + } + return fmt.Errorf("failed to get xattr %q on %s: %w", xattr, src, err) + } + if err := lsetxattrCreate(dst, xattr, data); err != nil { + return fmt.Errorf("failed to set xattr %q on %s: %w", xattr, dst, err) + } + } + + return nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/archive/tar_windows.go b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/archive/tar_windows.go new file mode 100644 index 000000000..4b71c1e30 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/archive/tar_windows.go @@ -0,0 +1,122 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package archive + +import ( + "archive/tar" + "errors" + "fmt" + "os" + "strings" + + "github.com/containerd/containerd/sys" +) + +// tarName returns platform-specific filepath +// to canonical posix-style path for tar archival. p is relative +// path. +func tarName(p string) (string, error) { + // windows: convert windows style relative path with backslashes + // into forward slashes. Since windows does not allow '/' or '\' + // in file names, it is mostly safe to replace however we must + // check just in case + if strings.Contains(p, "/") { + return "", fmt.Errorf("windows path contains forward slash: %s", p) + } + + return strings.Replace(p, string(os.PathSeparator), "/", -1), nil +} + +// chmodTarEntry is used to adjust the file permissions used in tar header based +// on the platform the archival is done. +func chmodTarEntry(perm os.FileMode) os.FileMode { + perm &= 0755 + // Add the x bit: make everything +x from windows + perm |= 0111 + + return perm +} + +func setHeaderForSpecialDevice(*tar.Header, string, os.FileInfo) error { + // do nothing. no notion of Rdev, Inode, Nlink in stat on Windows + return nil +} + +func open(p string) (*os.File, error) { + // We use sys.OpenSequential to ensure we use sequential file + // access on Windows to avoid depleting the standby list. + return sys.OpenSequential(p) +} + +func openFile(name string, flag int, perm os.FileMode) (*os.File, error) { + // Source is regular file. We use sys.OpenFileSequential to use sequential + // file access to avoid depleting the standby list on Windows. + return sys.OpenFileSequential(name, flag, perm) +} + +func mkdir(path string, perm os.FileMode) error { + return os.Mkdir(path, perm) +} + +func skipFile(hdr *tar.Header) bool { + // Windows does not support filenames with colons in them. Ignore + // these files. This is not a problem though (although it might + // appear that it is). Let's suppose a client is running docker pull. + // The daemon it points to is Windows. Would it make sense for the + // client to be doing a docker pull Ubuntu for example (which has files + // with colons in the name under /usr/share/man/man3)? No, absolutely + // not as it would really only make sense that they were pulling a + // Windows image. However, for development, it is necessary to be able + // to pull Linux images which are in the repository. + // + // TODO Windows. Once the registry is aware of what images are Windows- + // specific or Linux-specific, this warning should be changed to an error + // to cater for the situation where someone does manage to upload a Linux + // image but have it tagged as Windows inadvertently. + return strings.Contains(hdr.Name, ":") +} + +// handleTarTypeBlockCharFifo is an OS-specific helper function used by +// createTarFile to handle the following types of header: Block; Char; Fifo +func handleTarTypeBlockCharFifo(hdr *tar.Header, path string) error { + return nil +} + +func lchmod(path string, mode os.FileMode) error { + return nil +} + +func getxattr(path, attr string) ([]byte, error) { + return nil, nil +} + +func setxattr(path, key, value string) error { + // Return not support error, do not wrap underlying not supported + // since xattrs should not exist in windows diff archives + return errors.New("xattrs not supported on Windows") +} + +func copyDirInfo(fi os.FileInfo, path string) error { + if err := os.Chmod(path, fi.Mode()); err != nil { + return fmt.Errorf("failed to chmod %s: %w", path, err) + } + return nil +} + +func copyUpXAttrs(dst, src string) error { + return nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/archive/time.go b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/archive/time.go new file mode 100644 index 000000000..16651a4d0 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/archive/time.go @@ -0,0 +1,54 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package archive + +import ( + "syscall" + "time" + "unsafe" +) + +var ( + minTime = time.Unix(0, 0) + maxTime time.Time +) + +func init() { + if unsafe.Sizeof(syscall.Timespec{}.Nsec) == 8 { + // This is a 64 bit timespec + // os.Chtimes limits time to the following + maxTime = time.Unix(0, 1<<63-1) + } else { + // This is a 32 bit timespec + maxTime = time.Unix(1<<31-1, 0) + } +} + +func boundTime(t time.Time) time.Time { + if t.Before(minTime) || t.After(maxTime) { + return minTime + } + + return t +} + +func latestTime(t1, t2 time.Time) time.Time { + if t1.Before(t2) { + return t2 + } + return t1 +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/archive/time_unix.go b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/archive/time_unix.go new file mode 100644 index 000000000..043e37453 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/archive/time_unix.go @@ -0,0 +1,39 @@ +//go:build !windows +// +build !windows + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package archive + +import ( + "fmt" + "time" + + "golang.org/x/sys/unix" +) + +func chtimes(path string, atime, mtime time.Time) error { + var utimes [2]unix.Timespec + utimes[0] = unix.NsecToTimespec(atime.UnixNano()) + utimes[1] = unix.NsecToTimespec(mtime.UnixNano()) + + if err := unix.UtimesNanoAt(unix.AT_FDCWD, path, utimes[0:], unix.AT_SYMLINK_NOFOLLOW); err != nil { + return fmt.Errorf("failed call to UtimesNanoAt for %s: %w", path, err) + } + + return nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/archive/time_windows.go b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/archive/time_windows.go new file mode 100644 index 000000000..71f397821 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/archive/time_windows.go @@ -0,0 +1,42 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package archive + +import ( + "time" + + "golang.org/x/sys/windows" +) + +// chtimes will set the create time on a file using the given modtime. +// This requires calling SetFileTime and explicitly including the create time. +func chtimes(path string, atime, mtime time.Time) error { + ctimespec := windows.NsecToTimespec(mtime.UnixNano()) + pathp, e := windows.UTF16PtrFromString(path) + if e != nil { + return e + } + h, e := windows.CreateFile(pathp, + windows.FILE_WRITE_ATTRIBUTES, windows.FILE_SHARE_WRITE, nil, + windows.OPEN_EXISTING, windows.FILE_FLAG_BACKUP_SEMANTICS, 0) + if e != nil { + return e + } + defer windows.Close(h) + c := windows.NsecToFiletime(windows.TimespecToNsec(ctimespec)) + return windows.SetFileTime(h, &c, nil, nil) +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/content/helpers.go b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/content/helpers.go index 3ec1ffce0..723c31391 100644 --- a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/content/helpers.go +++ b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/content/helpers.go @@ -26,10 +26,16 @@ import ( "time" "github.com/containerd/containerd/errdefs" + "github.com/containerd/containerd/log" "github.com/opencontainers/go-digest" ocispec "github.com/opencontainers/image-spec/specs-go/v1" ) +// maxResets is the no.of times the Copy() method can tolerate a reset of the body +const maxResets = 5 + +var ErrReset = errors.New("writer has been reset") + var bufPool = sync.Pool{ New: func() interface{} { buffer := make([]byte, 1<<20) @@ -80,7 +86,7 @@ func WriteBlob(ctx context.Context, cs Ingester, ref string, r io.Reader, desc o return fmt.Errorf("failed to open writer: %w", err) } - return nil // all ready present + return nil // already present } defer cw.Close() @@ -131,35 +137,63 @@ func OpenWriter(ctx context.Context, cs Ingester, opts ...WriterOpt) (Writer, er // the size or digest is unknown, these values may be empty. // // Copy is buffered, so no need to wrap reader in buffered io. -func Copy(ctx context.Context, cw Writer, r io.Reader, size int64, expected digest.Digest, opts ...Opt) error { +func Copy(ctx context.Context, cw Writer, or io.Reader, size int64, expected digest.Digest, opts ...Opt) error { ws, err := cw.Status() if err != nil { return fmt.Errorf("failed to get status: %w", err) } - + r := or if ws.Offset > 0 { - r, err = seekReader(r, ws.Offset, size) + r, err = seekReader(or, ws.Offset, size) if err != nil { return fmt.Errorf("unable to resume write to %v: %w", ws.Ref, err) } } - copied, err := copyWithBuffer(cw, r) - if err != nil { - return fmt.Errorf("failed to copy: %w", err) - } - if size != 0 && copied < size-ws.Offset { - // Short writes would return its own error, this indicates a read failure - return fmt.Errorf("failed to read expected number of bytes: %w", io.ErrUnexpectedEOF) - } - - if err := cw.Commit(ctx, size, expected, opts...); err != nil { - if !errdefs.IsAlreadyExists(err) { - return fmt.Errorf("failed commit on ref %q: %w", ws.Ref, err) + for i := 0; i < maxResets; i++ { + if i >= 1 { + log.G(ctx).WithField("digest", expected).Debugf("retrying copy due to reset") } + copied, err := copyWithBuffer(cw, r) + if errors.Is(err, ErrReset) { + ws, err := cw.Status() + if err != nil { + return fmt.Errorf("failed to get status: %w", err) + } + r, err = seekReader(or, ws.Offset, size) + if err != nil { + return fmt.Errorf("unable to resume write to %v: %w", ws.Ref, err) + } + continue + } + if err != nil { + return fmt.Errorf("failed to copy: %w", err) + } + if size != 0 && copied < size-ws.Offset { + // Short writes would return its own error, this indicates a read failure + return fmt.Errorf("failed to read expected number of bytes: %w", io.ErrUnexpectedEOF) + } + if err := cw.Commit(ctx, size, expected, opts...); err != nil { + if errors.Is(err, ErrReset) { + ws, err := cw.Status() + if err != nil { + return fmt.Errorf("failed to get status: %w", err) + } + r, err = seekReader(or, ws.Offset, size) + if err != nil { + return fmt.Errorf("unable to resume write to %v: %w", ws.Ref, err) + } + continue + } + if !errdefs.IsAlreadyExists(err) { + return fmt.Errorf("failed commit on ref %q: %w", ws.Ref, err) + } + } + return nil } - return nil + log.G(ctx).WithField("digest", expected).Errorf("failed to copy after %d retries", maxResets) + return fmt.Errorf("failed to copy after %d retries", maxResets) } // CopyReaderAt copies to a writer from a given reader at for the given diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/content/local/store.go b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/content/local/store.go index 457bbcd0e..f41a92d04 100644 --- a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/content/local/store.go +++ b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/content/local/store.go @@ -643,7 +643,6 @@ func (s *store) ingestRoot(ref string) string { // - root: entire ingest directory // - ref: name of the starting ref, must be unique // - data: file where data is written -// func (s *store) ingestPaths(ref string) (string, string, string) { var ( fp = s.ingestRoot(ref) diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/filters/filter.go b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/filters/filter.go index cf09d8d9e..e13f2625c 100644 --- a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/filters/filter.go +++ b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/filters/filter.go @@ -65,7 +65,6 @@ // ``` // name==foo,labels.bar // ``` -// package filters import ( diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/filters/parser.go b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/filters/parser.go index 49182d7b7..32767909b 100644 --- a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/filters/parser.go +++ b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/filters/parser.go @@ -45,7 +45,6 @@ field := quoted | [A-Za-z] [A-Za-z0-9_]+ operator := "==" | "!=" | "~=" value := quoted | [^\s,]+ quoted := - */ func Parse(s string) (Filter, error) { // special case empty to match all diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/filters/quote.go b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/filters/quote.go index b76aab9b4..5c800ef84 100644 --- a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/filters/quote.go +++ b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/filters/quote.go @@ -31,10 +31,10 @@ var errQuoteSyntax = errors.New("quote syntax error") // or character literal represented by the string s. // It returns four values: // -// 1) value, the decoded Unicode code point or byte value; -// 2) multibyte, a boolean indicating whether the decoded character requires a multibyte UTF-8 representation; -// 3) tail, the remainder of the string after the character; and -// 4) an error that will be nil if the character is syntactically valid. +// 1. value, the decoded Unicode code point or byte value; +// 2. multibyte, a boolean indicating whether the decoded character requires a multibyte UTF-8 representation; +// 3. tail, the remainder of the string after the character; and +// 4. an error that will be nil if the character is syntactically valid. // // The second argument, quote, specifies the type of literal being parsed // and therefore which escaped quote character is permitted. diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/images/converter/converter.go b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/images/converter/converter.go new file mode 100644 index 000000000..441e0169e --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/images/converter/converter.go @@ -0,0 +1,126 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +// Package converter provides image converter +package converter + +import ( + "context" + + "github.com/containerd/containerd/content" + "github.com/containerd/containerd/images" + "github.com/containerd/containerd/leases" + "github.com/containerd/containerd/platforms" +) + +type convertOpts struct { + layerConvertFunc ConvertFunc + docker2oci bool + indexConvertFunc ConvertFunc + platformMC platforms.MatchComparer +} + +// Opt is an option for Convert() +type Opt func(*convertOpts) error + +// WithLayerConvertFunc specifies the function that converts layers. +func WithLayerConvertFunc(fn ConvertFunc) Opt { + return func(copts *convertOpts) error { + copts.layerConvertFunc = fn + return nil + } +} + +// WithDockerToOCI converts Docker media types into OCI ones. +func WithDockerToOCI(v bool) Opt { + return func(copts *convertOpts) error { + copts.docker2oci = true + return nil + } +} + +// WithPlatform specifies the platform. +// Defaults to all platforms. +func WithPlatform(p platforms.MatchComparer) Opt { + return func(copts *convertOpts) error { + copts.platformMC = p + return nil + } +} + +// WithIndexConvertFunc specifies the function that converts manifests and index (manifest lists). +// Defaults to DefaultIndexConvertFunc. +func WithIndexConvertFunc(fn ConvertFunc) Opt { + return func(copts *convertOpts) error { + copts.indexConvertFunc = fn + return nil + } +} + +// Client is implemented by *containerd.Client . +type Client interface { + WithLease(ctx context.Context, opts ...leases.Opt) (context.Context, func(context.Context) error, error) + ContentStore() content.Store + ImageService() images.Store +} + +// Convert converts an image. +func Convert(ctx context.Context, client Client, dstRef, srcRef string, opts ...Opt) (*images.Image, error) { + var copts convertOpts + for _, o := range opts { + if err := o(&copts); err != nil { + return nil, err + } + } + if copts.platformMC == nil { + copts.platformMC = platforms.All + } + if copts.indexConvertFunc == nil { + copts.indexConvertFunc = DefaultIndexConvertFunc(copts.layerConvertFunc, copts.docker2oci, copts.platformMC) + } + + ctx, done, err := client.WithLease(ctx) + if err != nil { + return nil, err + } + defer done(ctx) + + cs := client.ContentStore() + is := client.ImageService() + srcImg, err := is.Get(ctx, srcRef) + if err != nil { + return nil, err + } + + dstDesc, err := copts.indexConvertFunc(ctx, cs, srcImg.Target) + if err != nil { + return nil, err + } + + dstImg := srcImg + dstImg.Name = dstRef + if dstDesc != nil { + dstImg.Target = *dstDesc + } + var res images.Image + if dstRef != srcRef { + _ = is.Delete(ctx, dstRef) + res, err = is.Create(ctx, dstImg) + } else { + res, err = is.Update(ctx, dstImg) + } + return &res, err +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/images/converter/default.go b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/images/converter/default.go new file mode 100644 index 000000000..f4e944bc5 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/images/converter/default.go @@ -0,0 +1,453 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package converter + +import ( + "bytes" + "context" + "encoding/json" + "fmt" + "strings" + "sync" + + "github.com/containerd/containerd/content" + "github.com/containerd/containerd/images" + "github.com/containerd/containerd/platforms" + "github.com/opencontainers/go-digest" + ocispec "github.com/opencontainers/image-spec/specs-go/v1" + "github.com/sirupsen/logrus" + "golang.org/x/sync/errgroup" +) + +// ConvertFunc returns a converted content descriptor. +// When the content was not converted, ConvertFunc returns nil. +type ConvertFunc func(ctx context.Context, cs content.Store, desc ocispec.Descriptor) (*ocispec.Descriptor, error) + +// DefaultIndexConvertFunc is the default convert func used by Convert. +func DefaultIndexConvertFunc(layerConvertFunc ConvertFunc, docker2oci bool, platformMC platforms.MatchComparer) ConvertFunc { + c := &defaultConverter{ + layerConvertFunc: layerConvertFunc, + docker2oci: docker2oci, + platformMC: platformMC, + diffIDMap: make(map[digest.Digest]digest.Digest), + } + return c.convert +} + +// ConvertHookFunc is a callback function called during conversion of a blob. +// orgDesc is the target descriptor to convert. newDesc is passed if conversion happens. +type ConvertHookFunc func(ctx context.Context, cs content.Store, orgDesc ocispec.Descriptor, newDesc *ocispec.Descriptor) (*ocispec.Descriptor, error) + +// ConvertHooks is a configuration for hook callbacks called during blob conversion. +type ConvertHooks struct { + // PostConvertHook is a callback function called for each blob after conversion is done. + PostConvertHook ConvertHookFunc +} + +// IndexConvertFuncWithHook is the convert func used by Convert with hook functions support. +func IndexConvertFuncWithHook(layerConvertFunc ConvertFunc, docker2oci bool, platformMC platforms.MatchComparer, hooks ConvertHooks) ConvertFunc { + c := &defaultConverter{ + layerConvertFunc: layerConvertFunc, + docker2oci: docker2oci, + platformMC: platformMC, + diffIDMap: make(map[digest.Digest]digest.Digest), + hooks: hooks, + } + return c.convert +} + +type defaultConverter struct { + layerConvertFunc ConvertFunc + docker2oci bool + platformMC platforms.MatchComparer + diffIDMap map[digest.Digest]digest.Digest // key: old diffID, value: new diffID + diffIDMapMu sync.RWMutex + hooks ConvertHooks +} + +// convert dispatches desc.MediaType and calls c.convert{Layer,Manifest,Index,Config}. +// +// Also converts media type if c.docker2oci is set. +func (c *defaultConverter) convert(ctx context.Context, cs content.Store, desc ocispec.Descriptor) (*ocispec.Descriptor, error) { + var ( + newDesc *ocispec.Descriptor + err error + ) + if images.IsLayerType(desc.MediaType) { + newDesc, err = c.convertLayer(ctx, cs, desc) + } else if images.IsManifestType(desc.MediaType) { + newDesc, err = c.convertManifest(ctx, cs, desc) + } else if images.IsIndexType(desc.MediaType) { + newDesc, err = c.convertIndex(ctx, cs, desc) + } else if images.IsConfigType(desc.MediaType) { + newDesc, err = c.convertConfig(ctx, cs, desc) + } + if err != nil { + return nil, err + } + + if c.hooks.PostConvertHook != nil { + if newDescPost, err := c.hooks.PostConvertHook(ctx, cs, desc, newDesc); err != nil { + return nil, err + } else if newDescPost != nil { + newDesc = newDescPost + } + } + + if images.IsDockerType(desc.MediaType) { + if c.docker2oci { + if newDesc == nil { + newDesc = copyDesc(desc) + } + newDesc.MediaType = ConvertDockerMediaTypeToOCI(newDesc.MediaType) + } else if (newDesc == nil && len(desc.Annotations) != 0) || (newDesc != nil && len(newDesc.Annotations) != 0) { + // Annotations is supported only on OCI manifest. + // We need to remove annotations for Docker media types. + if newDesc == nil { + newDesc = copyDesc(desc) + } + newDesc.Annotations = nil + } + } + logrus.WithField("old", desc).WithField("new", newDesc).Debugf("converted") + return newDesc, nil +} + +func copyDesc(desc ocispec.Descriptor) *ocispec.Descriptor { + descCopy := desc + return &descCopy +} + +// convertLayer converts image image layers if c.layerConvertFunc is set. +// +// c.layerConvertFunc can be nil, e.g., for converting Docker media types to OCI ones. +func (c *defaultConverter) convertLayer(ctx context.Context, cs content.Store, desc ocispec.Descriptor) (*ocispec.Descriptor, error) { + if c.layerConvertFunc != nil { + return c.layerConvertFunc(ctx, cs, desc) + } + return nil, nil +} + +// convertManifest converts image manifests. +// +// - converts `.mediaType` if the target format is OCI +// - records diff ID changes in c.diffIDMap +func (c *defaultConverter) convertManifest(ctx context.Context, cs content.Store, desc ocispec.Descriptor) (*ocispec.Descriptor, error) { + var ( + manifest ocispec.Manifest + modified bool + ) + labels, err := readJSON(ctx, cs, &manifest, desc) + if err != nil { + return nil, err + } + if labels == nil { + labels = make(map[string]string) + } + if images.IsDockerType(manifest.MediaType) && c.docker2oci { + manifest.MediaType = ConvertDockerMediaTypeToOCI(manifest.MediaType) + modified = true + } + var mu sync.Mutex + eg, ctx2 := errgroup.WithContext(ctx) + for i, l := range manifest.Layers { + i := i + l := l + oldDiffID, err := images.GetDiffID(ctx, cs, l) + if err != nil { + return nil, err + } + eg.Go(func() error { + newL, err := c.convert(ctx2, cs, l) + if err != nil { + return err + } + if newL != nil { + mu.Lock() + // update GC labels + ClearGCLabels(labels, l.Digest) + labelKey := fmt.Sprintf("containerd.io/gc.ref.content.l.%d", i) + labels[labelKey] = newL.Digest.String() + manifest.Layers[i] = *newL + modified = true + mu.Unlock() + + // diffID changes if the tar entries were modified. + // diffID stays same if only the compression type was changed. + // When diffID changed, add a map entry so that we can update image config. + newDiffID, err := images.GetDiffID(ctx, cs, *newL) + if err != nil { + return err + } + if newDiffID != oldDiffID { + c.diffIDMapMu.Lock() + c.diffIDMap[oldDiffID] = newDiffID + c.diffIDMapMu.Unlock() + } + } + return nil + }) + } + if err := eg.Wait(); err != nil { + return nil, err + } + + newConfig, err := c.convert(ctx, cs, manifest.Config) + if err != nil { + return nil, err + } + if newConfig != nil { + ClearGCLabels(labels, manifest.Config.Digest) + labels["containerd.io/gc.ref.content.config"] = newConfig.Digest.String() + manifest.Config = *newConfig + modified = true + } + + if modified { + return writeJSON(ctx, cs, &manifest, desc, labels) + } + return nil, nil +} + +// convertIndex converts image index. +// +// - converts `.mediaType` if the target format is OCI +// - clears manifest entries that do not match c.platformMC +func (c *defaultConverter) convertIndex(ctx context.Context, cs content.Store, desc ocispec.Descriptor) (*ocispec.Descriptor, error) { + var ( + index ocispec.Index + modified bool + ) + labels, err := readJSON(ctx, cs, &index, desc) + if err != nil { + return nil, err + } + if labels == nil { + labels = make(map[string]string) + } + if images.IsDockerType(index.MediaType) && c.docker2oci { + index.MediaType = ConvertDockerMediaTypeToOCI(index.MediaType) + modified = true + } + + newManifests := make([]ocispec.Descriptor, len(index.Manifests)) + newManifestsToBeRemoved := make(map[int]struct{}) // slice index + var mu sync.Mutex + eg, ctx2 := errgroup.WithContext(ctx) + for i, mani := range index.Manifests { + i := i + mani := mani + labelKey := fmt.Sprintf("containerd.io/gc.ref.content.m.%d", i) + eg.Go(func() error { + if mani.Platform != nil && !c.platformMC.Match(*mani.Platform) { + mu.Lock() + ClearGCLabels(labels, mani.Digest) + newManifestsToBeRemoved[i] = struct{}{} + modified = true + mu.Unlock() + return nil + } + newMani, err := c.convert(ctx2, cs, mani) + if err != nil { + return err + } + mu.Lock() + if newMani != nil { + ClearGCLabels(labels, mani.Digest) + labels[labelKey] = newMani.Digest.String() + // NOTE: for keeping manifest order, we specify `i` index explicitly + newManifests[i] = *newMani + modified = true + } else { + newManifests[i] = mani + } + mu.Unlock() + return nil + }) + } + if err := eg.Wait(); err != nil { + return nil, err + } + if modified { + var newManifestsClean []ocispec.Descriptor + for i, m := range newManifests { + if _, ok := newManifestsToBeRemoved[i]; !ok { + newManifestsClean = append(newManifestsClean, m) + } + } + index.Manifests = newManifestsClean + return writeJSON(ctx, cs, &index, desc, labels) + } + return nil, nil +} + +// convertConfig converts image config contents. +// +// - updates `.rootfs.diff_ids` using c.diffIDMap . +// +// - clears legacy `.config.Image` and `.container_config.Image` fields if `.rootfs.diff_ids` was updated. +func (c *defaultConverter) convertConfig(ctx context.Context, cs content.Store, desc ocispec.Descriptor) (*ocispec.Descriptor, error) { + var ( + cfg DualConfig + cfgAsOCI ocispec.Image // read only, used for parsing cfg + modified bool + ) + + labels, err := readJSON(ctx, cs, &cfg, desc) + if err != nil { + return nil, err + } + if labels == nil { + labels = make(map[string]string) + } + if _, err := readJSON(ctx, cs, &cfgAsOCI, desc); err != nil { + return nil, err + } + + if rootfs := cfgAsOCI.RootFS; rootfs.Type == "layers" { + rootfsModified := false + c.diffIDMapMu.RLock() + for i, oldDiffID := range rootfs.DiffIDs { + if newDiffID, ok := c.diffIDMap[oldDiffID]; ok && newDiffID != oldDiffID { + rootfs.DiffIDs[i] = newDiffID + rootfsModified = true + } + } + c.diffIDMapMu.RUnlock() + if rootfsModified { + rootfsB, err := json.Marshal(rootfs) + if err != nil { + return nil, err + } + cfg["rootfs"] = (*json.RawMessage)(&rootfsB) + modified = true + } + } + + if modified { + // cfg may have dummy value for legacy `.config.Image` and `.container_config.Image` + // We should clear the ID if we changed the diff IDs. + if _, err := clearDockerV1DummyID(cfg); err != nil { + return nil, err + } + return writeJSON(ctx, cs, &cfg, desc, labels) + } + return nil, nil +} + +// clearDockerV1DummyID clears the dummy values for legacy `.config.Image` and `.container_config.Image`. +// Returns true if the cfg was modified. +func clearDockerV1DummyID(cfg DualConfig) (bool, error) { + var modified bool + f := func(k string) error { + if configX, ok := cfg[k]; ok && configX != nil { + var configField map[string]*json.RawMessage + if err := json.Unmarshal(*configX, &configField); err != nil { + return err + } + delete(configField, "Image") + b, err := json.Marshal(configField) + if err != nil { + return err + } + cfg[k] = (*json.RawMessage)(&b) + modified = true + } + return nil + } + if err := f("config"); err != nil { + return modified, err + } + if err := f("container_config"); err != nil { + return modified, err + } + return modified, nil +} + +// DualConfig covers Docker config (v1.0, v1.1, v1.2) and OCI config. +// Unmarshalled as map[string]*json.RawMessage to retain unknown fields on remarshalling. +type DualConfig map[string]*json.RawMessage + +func readJSON(ctx context.Context, cs content.Store, x interface{}, desc ocispec.Descriptor) (map[string]string, error) { + info, err := cs.Info(ctx, desc.Digest) + if err != nil { + return nil, err + } + labels := info.Labels + b, err := content.ReadBlob(ctx, cs, desc) + if err != nil { + return nil, err + } + if err := json.Unmarshal(b, x); err != nil { + return nil, err + } + return labels, nil +} + +func writeJSON(ctx context.Context, cs content.Store, x interface{}, oldDesc ocispec.Descriptor, labels map[string]string) (*ocispec.Descriptor, error) { + b, err := json.Marshal(x) + if err != nil { + return nil, err + } + dgst := digest.SHA256.FromBytes(b) + ref := fmt.Sprintf("converter-write-json-%s", dgst.String()) + w, err := content.OpenWriter(ctx, cs, content.WithRef(ref)) + if err != nil { + return nil, err + } + if err := content.Copy(ctx, w, bytes.NewReader(b), int64(len(b)), dgst, content.WithLabels(labels)); err != nil { + return nil, err + } + if err := w.Close(); err != nil { + return nil, err + } + newDesc := oldDesc + newDesc.Size = int64(len(b)) + newDesc.Digest = dgst + return &newDesc, nil +} + +// ConvertDockerMediaTypeToOCI converts a media type string +func ConvertDockerMediaTypeToOCI(mt string) string { + switch mt { + case images.MediaTypeDockerSchema2ManifestList: + return ocispec.MediaTypeImageIndex + case images.MediaTypeDockerSchema2Manifest: + return ocispec.MediaTypeImageManifest + case images.MediaTypeDockerSchema2LayerGzip: + return ocispec.MediaTypeImageLayerGzip + case images.MediaTypeDockerSchema2LayerForeignGzip: + return ocispec.MediaTypeImageLayerNonDistributableGzip + case images.MediaTypeDockerSchema2Layer: + return ocispec.MediaTypeImageLayer + case images.MediaTypeDockerSchema2LayerForeign: + return ocispec.MediaTypeImageLayerNonDistributable + case images.MediaTypeDockerSchema2Config: + return ocispec.MediaTypeImageConfig + default: + return mt + } +} + +// ClearGCLabels clears GC labels for the given digest. +func ClearGCLabels(labels map[string]string, dgst digest.Digest) { + for k, v := range labels { + if v == dgst.String() && strings.HasPrefix(k, "containerd.io/gc.ref.content") { + delete(labels, k) + } + } +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/leases/lease.go b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/leases/lease.go index 058d06559..fc0ca3491 100644 --- a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/leases/lease.go +++ b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/leases/lease.go @@ -65,10 +65,15 @@ func SynchronousDelete(ctx context.Context, o *DeleteOptions) error { return nil } -// WithLabels sets labels on a lease +// WithLabels merges labels on a lease func WithLabels(labels map[string]string) Opt { return func(l *Lease) error { - l.Labels = labels + if l.Labels == nil { + l.Labels = map[string]string{} + } + for k, v := range labels { + l.Labels[k] = v + } return nil } } diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/namespaces/store.go b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/namespaces/store.go index 5936772cb..a1b2571bb 100644 --- a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/namespaces/store.go +++ b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/namespaces/store.go @@ -24,8 +24,6 @@ import "context" // oriented. A namespace is really just a name and a set of labels. Objects // that belong to a namespace are returned when the namespace is assigned to a // given context. -// -// type Store interface { Create(ctx context.Context, namespace string, labels map[string]string) error Labels(ctx context.Context, namespace string) (map[string]string, error) diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/pkg/userns/userns_linux.go b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/pkg/userns/userns_linux.go new file mode 100644 index 000000000..6656465ef --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/pkg/userns/userns_linux.go @@ -0,0 +1,62 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package userns + +import ( + "bufio" + "fmt" + "os" + "sync" +) + +var ( + inUserNS bool + nsOnce sync.Once +) + +// RunningInUserNS detects whether we are currently running in a user namespace. +// Originally copied from github.com/lxc/lxd/shared/util.go +func RunningInUserNS() bool { + nsOnce.Do(func() { + file, err := os.Open("/proc/self/uid_map") + if err != nil { + // This kernel-provided file only exists if user namespaces are supported + return + } + defer file.Close() + + buf := bufio.NewReader(file) + l, _, err := buf.ReadLine() + if err != nil { + return + } + + line := string(l) + var a, b, c int64 + fmt.Sscanf(line, "%d %d %d", &a, &b, &c) + + /* + * We assume we are in the initial user namespace if we have a full + * range - 4294967295 uids starting at uid 0. + */ + if a == 0 && b == 0 && c == 4294967295 { + return + } + inUserNS = true + }) + return inUserNS +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/pkg/userns/userns_unsupported.go b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/pkg/userns/userns_unsupported.go new file mode 100644 index 000000000..4f8d7dd2d --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/pkg/userns/userns_unsupported.go @@ -0,0 +1,26 @@ +//go:build !linux +// +build !linux + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package userns + +// RunningInUserNS is a stub for non-Linux systems +// Always returns false +func RunningInUserNS() bool { + return false +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/platforms/platforms.go b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/platforms/platforms.go index 8f955d036..234309941 100644 --- a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/platforms/platforms.go +++ b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/platforms/platforms.go @@ -27,40 +27,40 @@ // The vast majority of use cases should simply use the match function with // user input. The first step is to parse a specifier into a matcher: // -// m, err := Parse("linux") -// if err != nil { ... } +// m, err := Parse("linux") +// if err != nil { ... } // // Once you have a matcher, use it to match against the platform declared by a // component, typically from an image or runtime. Since extracting an images // platform is a little more involved, we'll use an example against the // platform default: // -// if ok := m.Match(Default()); !ok { /* doesn't match */ } +// if ok := m.Match(Default()); !ok { /* doesn't match */ } // // This can be composed in loops for resolving runtimes or used as a filter for // fetch and select images. // // More details of the specifier syntax and platform spec follow. // -// Declaring Platform Support +// # Declaring Platform Support // // Components that have strict platform requirements should use the OCI // platform specification to declare their support. Typically, this will be // images and runtimes that should make these declaring which platform they // support specifically. This looks roughly as follows: // -// type Platform struct { -// Architecture string -// OS string -// Variant string -// } +// type Platform struct { +// Architecture string +// OS string +// Variant string +// } // // Most images and runtimes should at least set Architecture and OS, according // to their GOARCH and GOOS values, respectively (follow the OCI image // specification when in doubt). ARM should set variant under certain // discussions, which are outlined below. // -// Platform Specifiers +// # Platform Specifiers // // While the OCI platform specifications provide a tool for components to // specify structured information, user input typically doesn't need the full @@ -77,7 +77,7 @@ // where the architecture may be known but a runtime may support images from // different operating systems. // -// Normalization +// # Normalization // // Because not all users are familiar with the way the Go runtime represents // platforms, several normalizations have been provided to make this package @@ -85,17 +85,17 @@ // // The following are performed for architectures: // -// Value Normalized -// aarch64 arm64 -// armhf arm -// armel arm/v6 -// i386 386 -// x86_64 amd64 -// x86-64 amd64 +// Value Normalized +// aarch64 arm64 +// armhf arm +// armel arm/v6 +// i386 386 +// x86_64 amd64 +// x86-64 amd64 // // We also normalize the operating system `macos` to `darwin`. // -// ARM Support +// # ARM Support // // To qualify ARM architecture, the Variant field is used to qualify the arm // version. The most common arm version, v7, is represented without the variant diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/remotes/docker/pusher.go b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/remotes/docker/pusher.go index c786ad215..56d60efe9 100644 --- a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/remotes/docker/pusher.go +++ b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/remotes/docker/pusher.go @@ -24,6 +24,7 @@ import ( "net/http" "net/url" "strings" + "sync" "time" "github.com/containerd/containerd/content" @@ -261,27 +262,20 @@ func (p dockerPusher) push(ctx context.Context, desc ocispec.Descriptor, ref str // TODO: Support chunked upload - pr, pw := io.Pipe() - respC := make(chan response, 1) - body := io.NopCloser(pr) + pushw := newPushWriter(p.dockerBase, ref, desc.Digest, p.tracker, isManifest) req.body = func() (io.ReadCloser, error) { - if body == nil { - return nil, errors.New("cannot reuse body, request must be retried") - } - // Only use the body once since pipe cannot be seeked - ob := body - body = nil - return ob, nil + pr, pw := io.Pipe() + pushw.setPipe(pw) + return io.NopCloser(pr), nil } req.size = desc.Size go func() { - defer close(respC) resp, err := req.doWithRetries(ctx, nil) if err != nil { - respC <- response{err: err} - pr.CloseWithError(err) + pushw.setError(err) + pushw.Close() return } @@ -290,20 +284,13 @@ func (p dockerPusher) push(ctx context.Context, desc ocispec.Descriptor, ref str default: err := remoteserrors.NewUnexpectedStatusErr(resp) log.G(ctx).WithField("resp", resp).WithField("body", string(err.(remoteserrors.ErrUnexpectedStatus).Body)).Debug("unexpected response") - pr.CloseWithError(err) + pushw.setError(err) + pushw.Close() } - respC <- response{Response: resp} + pushw.setResponse(resp) }() - return &pushWriter{ - base: p.dockerBase, - ref: ref, - pipe: pw, - responseC: respC, - isManifest: isManifest, - expected: desc.Digest, - tracker: p.tracker, - }, nil + return pushw, nil } func getManifestPath(object string, dgst digest.Digest) []string { @@ -325,28 +312,81 @@ func getManifestPath(object string, dgst digest.Digest) []string { return []string{"manifests", object} } -type response struct { - *http.Response - err error -} - type pushWriter struct { base *dockerBase ref string - pipe *io.PipeWriter - responseC <-chan response + pipe *io.PipeWriter + + pipeC chan *io.PipeWriter + respC chan *http.Response + closeOnce sync.Once + errC chan error + isManifest bool expected digest.Digest tracker StatusTracker } +func newPushWriter(db *dockerBase, ref string, expected digest.Digest, tracker StatusTracker, isManifest bool) *pushWriter { + // Initialize and create response + return &pushWriter{ + base: db, + ref: ref, + expected: expected, + tracker: tracker, + pipeC: make(chan *io.PipeWriter, 1), + respC: make(chan *http.Response, 1), + errC: make(chan error, 1), + isManifest: isManifest, + } +} + +func (pw *pushWriter) setPipe(p *io.PipeWriter) { + pw.pipeC <- p +} + +func (pw *pushWriter) setError(err error) { + pw.errC <- err +} +func (pw *pushWriter) setResponse(resp *http.Response) { + pw.respC <- resp +} + func (pw *pushWriter) Write(p []byte) (n int, err error) { status, err := pw.tracker.GetStatus(pw.ref) if err != nil { return n, err } + + if pw.pipe == nil { + p, ok := <-pw.pipeC + if !ok { + return 0, io.ErrClosedPipe + } + pw.pipe = p + } else { + select { + case p, ok := <-pw.pipeC: + if !ok { + return 0, io.ErrClosedPipe + } + pw.pipe.CloseWithError(content.ErrReset) + pw.pipe = p + + // If content has already been written, the bytes + // cannot be written and the caller must reset + if status.Offset > 0 { + status.Offset = 0 + status.UpdatedAt = time.Now() + pw.tracker.SetStatus(pw.ref, status) + return 0, content.ErrReset + } + default: + } + } + n, err = pw.pipe.Write(p) status.Offset += int64(n) status.UpdatedAt = time.Now() @@ -355,13 +395,21 @@ func (pw *pushWriter) Write(p []byte) (n int, err error) { } func (pw *pushWriter) Close() error { - status, err := pw.tracker.GetStatus(pw.ref) - if err == nil && !status.Committed { - // Closing an incomplete writer. Record this as an error so that following write can retry it. - status.ErrClosed = errors.New("closed incomplete writer") - pw.tracker.SetStatus(pw.ref, status) + // Ensure pipeC is closed but handle `Close()` being + // called multiple times without panicking + pw.closeOnce.Do(func() { + close(pw.pipeC) + }) + if pw.pipe != nil { + status, err := pw.tracker.GetStatus(pw.ref) + if err == nil && !status.Committed { + // Closing an incomplete writer. Record this as an error so that following write can retry it. + status.ErrClosed = errors.New("closed incomplete writer") + pw.tracker.SetStatus(pw.ref, status) + } + return pw.pipe.Close() } - return pw.pipe.Close() + return nil } func (pw *pushWriter) Status() (content.Status, error) { @@ -388,18 +436,43 @@ func (pw *pushWriter) Commit(ctx context.Context, size int64, expected digest.Di return err } // TODO: timeout waiting for response - resp := <-pw.responseC - if resp.err != nil { - return resp.err + var resp *http.Response + select { + case err := <-pw.errC: + if err != nil { + return err + } + case resp = <-pw.respC: + defer resp.Body.Close() + case p, ok := <-pw.pipeC: + // check whether the pipe has changed in the commit, because sometimes Write + // can complete successfully, but the pipe may have changed. In that case, the + // content needs to be reset. + if !ok { + return io.ErrClosedPipe + } + pw.pipe.CloseWithError(content.ErrReset) + pw.pipe = p + status, err := pw.tracker.GetStatus(pw.ref) + if err != nil { + return err + } + // If content has already been written, the bytes + // cannot be written again and the caller must reset + if status.Offset > 0 { + status.Offset = 0 + status.UpdatedAt = time.Now() + pw.tracker.SetStatus(pw.ref, status) + return content.ErrReset + } } - defer resp.Response.Body.Close() // 201 is specified return status, some registries return // 200, 202 or 204. switch resp.StatusCode { case http.StatusOK, http.StatusCreated, http.StatusNoContent, http.StatusAccepted: default: - return remoteserrors.NewUnexpectedStatusErr(resp.Response) + return remoteserrors.NewUnexpectedStatusErr(resp) } status, err := pw.tracker.GetStatus(pw.ref) diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/remotes/docker/resolver.go b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/remotes/docker/resolver.go index 9bbbc2622..709fa028d 100644 --- a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/remotes/docker/resolver.go +++ b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/remotes/docker/resolver.go @@ -21,6 +21,7 @@ import ( "errors" "fmt" "io" + "net" "net/http" "net/url" "path" @@ -667,3 +668,17 @@ func responseFields(resp *http.Response) logrus.Fields { return logrus.Fields(fields) } + +// IsLocalhost checks if the registry host is local. +func IsLocalhost(host string) bool { + if h, _, err := net.SplitHostPort(host); err == nil { + host = h + } + + if host == "localhost" { + return true + } + + ip := net.ParseIP(host) + return ip.IsLoopback() +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/remotes/handlers.go b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/remotes/handlers.go index 8bcafb22a..4d91ed2e5 100644 --- a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/remotes/handlers.go +++ b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/remotes/handlers.go @@ -257,8 +257,8 @@ func PushContent(ctx context.Context, pusher Pusher, desc ocispec.Descriptor, st // An example of this kind of content would be a Windows base layer, which is not supposed to be redistributed. // // This is based on the media type of the content: -// - application/vnd.oci.image.layer.nondistributable -// - application/vnd.docker.image.rootfs.foreign +// - application/vnd.oci.image.layer.nondistributable +// - application/vnd.docker.image.rootfs.foreign func SkipNonDistributableBlobs(f images.HandlerFunc) images.HandlerFunc { return func(ctx context.Context, desc ocispec.Descriptor) ([]ocispec.Descriptor, error) { if images.IsNonDistributable(desc.MediaType) { diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/sys/epoll.go b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/sys/epoll.go new file mode 100644 index 000000000..73a57013f --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/sys/epoll.go @@ -0,0 +1,34 @@ +//go:build linux +// +build linux + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package sys + +import "golang.org/x/sys/unix" + +// EpollCreate1 is an alias for unix.EpollCreate1 +// Deprecated: use golang.org/x/sys/unix.EpollCreate1 +var EpollCreate1 = unix.EpollCreate1 + +// EpollCtl is an alias for unix.EpollCtl +// Deprecated: use golang.org/x/sys/unix.EpollCtl +var EpollCtl = unix.EpollCtl + +// EpollWait is an alias for unix.EpollWait +// Deprecated: use golang.org/x/sys/unix.EpollWait +var EpollWait = unix.EpollWait diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/sys/fds.go b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/sys/fds.go new file mode 100644 index 000000000..a71a9cd7e --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/sys/fds.go @@ -0,0 +1,35 @@ +//go:build !windows && !darwin +// +build !windows,!darwin + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package sys + +import ( + "os" + "path/filepath" + "strconv" +) + +// GetOpenFds returns the number of open fds for the process provided by pid +func GetOpenFds(pid int) (int, error) { + dirs, err := os.ReadDir(filepath.Join("/proc", strconv.Itoa(pid), "fd")) + if err != nil { + return -1, err + } + return len(dirs), nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/sys/filesys_unix.go b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/sys/filesys_unix.go new file mode 100644 index 000000000..805a7a736 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/sys/filesys_unix.go @@ -0,0 +1,32 @@ +//go:build !windows +// +build !windows + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package sys + +import "os" + +// ForceRemoveAll on unix is just a wrapper for os.RemoveAll +func ForceRemoveAll(path string) error { + return os.RemoveAll(path) +} + +// MkdirAllWithACL is a wrapper for os.MkdirAll on Unix systems. +func MkdirAllWithACL(path string, perm os.FileMode) error { + return os.MkdirAll(path, perm) +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/sys/filesys_windows.go b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/sys/filesys_windows.go new file mode 100644 index 000000000..87ebacc20 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/sys/filesys_windows.go @@ -0,0 +1,345 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package sys + +import ( + "fmt" + "os" + "path/filepath" + "regexp" + "sort" + "strconv" + "strings" + "syscall" + "unsafe" + + "github.com/Microsoft/hcsshim" + "golang.org/x/sys/windows" +) + +const ( + // SddlAdministratorsLocalSystem is local administrators plus NT AUTHORITY\System + SddlAdministratorsLocalSystem = "D:P(A;OICI;GA;;;BA)(A;OICI;GA;;;SY)" +) + +// MkdirAllWithACL is a wrapper for MkdirAll that creates a directory +// ACL'd for Builtin Administrators and Local System. +func MkdirAllWithACL(path string, perm os.FileMode) error { + return mkdirall(path, true) +} + +// MkdirAll implementation that is volume path aware for Windows. It can be used +// as a drop-in replacement for os.MkdirAll() +func MkdirAll(path string, _ os.FileMode) error { + return mkdirall(path, false) +} + +// mkdirall is a custom version of os.MkdirAll modified for use on Windows +// so that it is both volume path aware, and can create a directory with +// a DACL. +func mkdirall(path string, adminAndLocalSystem bool) error { + if re := regexp.MustCompile(`^\\\\\?\\Volume{[a-z0-9-]+}$`); re.MatchString(path) { + return nil + } + + // The rest of this method is largely copied from os.MkdirAll and should be kept + // as-is to ensure compatibility. + + // Fast path: if we can tell whether path is a directory or file, stop with success or error. + dir, err := os.Stat(path) + if err == nil { + if dir.IsDir() { + return nil + } + return &os.PathError{ + Op: "mkdir", + Path: path, + Err: syscall.ENOTDIR, + } + } + + // Slow path: make sure parent exists and then call Mkdir for path. + i := len(path) + for i > 0 && os.IsPathSeparator(path[i-1]) { // Skip trailing path separator. + i-- + } + + j := i + for j > 0 && !os.IsPathSeparator(path[j-1]) { // Scan backward over element. + j-- + } + + if j > 1 { + // Create parent + err = mkdirall(path[0:j-1], adminAndLocalSystem) + if err != nil { + return err + } + } + + // Parent now exists; invoke os.Mkdir or mkdirWithACL and use its result. + if adminAndLocalSystem { + err = mkdirWithACL(path) + } else { + err = os.Mkdir(path, 0) + } + + if err != nil { + // Handle arguments like "foo/." by + // double-checking that directory doesn't exist. + dir, err1 := os.Lstat(path) + if err1 == nil && dir.IsDir() { + return nil + } + return err + } + return nil +} + +// mkdirWithACL creates a new directory. If there is an error, it will be of +// type *PathError. . +// +// This is a modified and combined version of os.Mkdir and windows.Mkdir +// in golang to cater for creating a directory am ACL permitting full +// access, with inheritance, to any subfolder/file for Built-in Administrators +// and Local System. +func mkdirWithACL(name string) error { + sa := windows.SecurityAttributes{Length: 0} + sd, err := windows.SecurityDescriptorFromString(SddlAdministratorsLocalSystem) + if err != nil { + return &os.PathError{Op: "mkdir", Path: name, Err: err} + } + sa.Length = uint32(unsafe.Sizeof(sa)) + sa.InheritHandle = 1 + sa.SecurityDescriptor = sd + + namep, err := windows.UTF16PtrFromString(name) + if err != nil { + return &os.PathError{Op: "mkdir", Path: name, Err: err} + } + + e := windows.CreateDirectory(namep, &sa) + if e != nil { + return &os.PathError{Op: "mkdir", Path: name, Err: e} + } + return nil +} + +// IsAbs is a platform-specific wrapper for filepath.IsAbs. On Windows, +// golang filepath.IsAbs does not consider a path \windows\system32 as absolute +// as it doesn't start with a drive-letter/colon combination. However, in +// docker we need to verify things such as WORKDIR /windows/system32 in +// a Dockerfile (which gets translated to \windows\system32 when being processed +// by the daemon. This SHOULD be treated as absolute from a docker processing +// perspective. +func IsAbs(path string) bool { + if !filepath.IsAbs(path) { + if !strings.HasPrefix(path, string(os.PathSeparator)) { + return false + } + } + return true +} + +// The origin of the functions below here are the golang OS and windows packages, +// slightly modified to only cope with files, not directories due to the +// specific use case. +// +// The alteration is to allow a file on Windows to be opened with +// FILE_FLAG_SEQUENTIAL_SCAN (particular for docker load), to avoid eating +// the standby list, particularly when accessing large files such as layer.tar. + +// CreateSequential creates the named file with mode 0666 (before umask), truncating +// it if it already exists. If successful, methods on the returned +// File can be used for I/O; the associated file descriptor has mode +// O_RDWR. +// If there is an error, it will be of type *PathError. +func CreateSequential(name string) (*os.File, error) { + return OpenFileSequential(name, os.O_RDWR|os.O_CREATE|os.O_TRUNC, 0) +} + +// OpenSequential opens the named file for reading. If successful, methods on +// the returned file can be used for reading; the associated file +// descriptor has mode O_RDONLY. +// If there is an error, it will be of type *PathError. +func OpenSequential(name string) (*os.File, error) { + return OpenFileSequential(name, os.O_RDONLY, 0) +} + +// OpenFileSequential is the generalized open call; most users will use Open +// or Create instead. +// If there is an error, it will be of type *PathError. +func OpenFileSequential(name string, flag int, _ os.FileMode) (*os.File, error) { + if name == "" { + return nil, &os.PathError{Op: "open", Path: name, Err: syscall.ENOENT} + } + r, errf := windowsOpenFileSequential(name, flag, 0) + if errf == nil { + return r, nil + } + return nil, &os.PathError{Op: "open", Path: name, Err: errf} +} + +func windowsOpenFileSequential(name string, flag int, _ os.FileMode) (file *os.File, err error) { + r, e := windowsOpenSequential(name, flag|windows.O_CLOEXEC, 0) + if e != nil { + return nil, e + } + return os.NewFile(uintptr(r), name), nil +} + +func makeInheritSa() *windows.SecurityAttributes { + var sa windows.SecurityAttributes + sa.Length = uint32(unsafe.Sizeof(sa)) + sa.InheritHandle = 1 + return &sa +} + +func windowsOpenSequential(path string, mode int, _ uint32) (fd windows.Handle, err error) { + if len(path) == 0 { + return windows.InvalidHandle, windows.ERROR_FILE_NOT_FOUND + } + pathp, err := windows.UTF16PtrFromString(path) + if err != nil { + return windows.InvalidHandle, err + } + var access uint32 + switch mode & (windows.O_RDONLY | windows.O_WRONLY | windows.O_RDWR) { + case windows.O_RDONLY: + access = windows.GENERIC_READ + case windows.O_WRONLY: + access = windows.GENERIC_WRITE + case windows.O_RDWR: + access = windows.GENERIC_READ | windows.GENERIC_WRITE + } + if mode&windows.O_CREAT != 0 { + access |= windows.GENERIC_WRITE + } + if mode&windows.O_APPEND != 0 { + access &^= windows.GENERIC_WRITE + access |= windows.FILE_APPEND_DATA + } + sharemode := uint32(windows.FILE_SHARE_READ | windows.FILE_SHARE_WRITE) + var sa *windows.SecurityAttributes + if mode&windows.O_CLOEXEC == 0 { + sa = makeInheritSa() + } + var createmode uint32 + switch { + case mode&(windows.O_CREAT|windows.O_EXCL) == (windows.O_CREAT | windows.O_EXCL): + createmode = windows.CREATE_NEW + case mode&(windows.O_CREAT|windows.O_TRUNC) == (windows.O_CREAT | windows.O_TRUNC): + createmode = windows.CREATE_ALWAYS + case mode&windows.O_CREAT == windows.O_CREAT: + createmode = windows.OPEN_ALWAYS + case mode&windows.O_TRUNC == windows.O_TRUNC: + createmode = windows.TRUNCATE_EXISTING + default: + createmode = windows.OPEN_EXISTING + } + // Use FILE_FLAG_SEQUENTIAL_SCAN rather than FILE_ATTRIBUTE_NORMAL as implemented in golang. + // https://msdn.microsoft.com/en-us/library/windows/desktop/aa363858(v=vs.85).aspx + const fileFlagSequentialScan = 0x08000000 // FILE_FLAG_SEQUENTIAL_SCAN + h, e := windows.CreateFile(pathp, access, sharemode, sa, createmode, fileFlagSequentialScan, 0) + return h, e +} + +// ForceRemoveAll is the same as os.RemoveAll, but is aware of io.containerd.snapshotter.v1.windows +// and uses hcsshim to unmount and delete container layers contained therein, in the correct order, +// when passed a containerd root data directory (i.e. the `--root` directory for containerd). +func ForceRemoveAll(path string) error { + // snapshots/windows/windows.go init() + const snapshotPlugin = "io.containerd.snapshotter.v1" + "." + "windows" + // snapshots/windows/windows.go NewSnapshotter() + snapshotDir := filepath.Join(path, snapshotPlugin, "snapshots") + if stat, err := os.Stat(snapshotDir); err == nil && stat.IsDir() { + if err := cleanupWCOWLayers(snapshotDir); err != nil { + return fmt.Errorf("failed to cleanup WCOW layers in %s: %w", snapshotDir, err) + } + } + + return os.RemoveAll(path) +} + +func cleanupWCOWLayers(root string) error { + // See snapshots/windows/windows.go getSnapshotDir() + var layerNums []int + var rmLayerNums []int + if err := filepath.Walk(root, func(path string, info os.FileInfo, err error) error { + if path != root && info.IsDir() { + name := filepath.Base(path) + if strings.HasPrefix(name, "rm-") { + layerNum, err := strconv.Atoi(strings.TrimPrefix(name, "rm-")) + if err != nil { + return err + } + rmLayerNums = append(rmLayerNums, layerNum) + } else { + layerNum, err := strconv.Atoi(name) + if err != nil { + return err + } + layerNums = append(layerNums, layerNum) + } + return filepath.SkipDir + } + + return nil + }); err != nil { + return err + } + + sort.Sort(sort.Reverse(sort.IntSlice(rmLayerNums))) + for _, rmLayerNum := range rmLayerNums { + if err := cleanupWCOWLayer(filepath.Join(root, "rm-"+strconv.Itoa(rmLayerNum))); err != nil { + return err + } + } + + sort.Sort(sort.Reverse(sort.IntSlice(layerNums))) + for _, layerNum := range layerNums { + if err := cleanupWCOWLayer(filepath.Join(root, strconv.Itoa(layerNum))); err != nil { + return err + } + } + + return nil +} + +func cleanupWCOWLayer(layerPath string) error { + info := hcsshim.DriverInfo{ + HomeDir: filepath.Dir(layerPath), + } + + // ERROR_DEV_NOT_EXIST is returned if the layer is not currently prepared or activated. + // ERROR_FLT_INSTANCE_NOT_FOUND is returned if the layer is currently activated but not prepared. + if err := hcsshim.UnprepareLayer(info, filepath.Base(layerPath)); err != nil { + if hcserror, ok := err.(*hcsshim.HcsError); !ok || (hcserror.Err != windows.ERROR_DEV_NOT_EXIST && hcserror.Err != syscall.Errno(windows.ERROR_FLT_INSTANCE_NOT_FOUND)) { + return fmt.Errorf("failed to unprepare %s: %w", layerPath, err) + } + } + + if err := hcsshim.DeactivateLayer(info, filepath.Base(layerPath)); err != nil { + return fmt.Errorf("failed to deactivate %s: %w", layerPath, err) + } + + if err := hcsshim.DestroyLayer(info, filepath.Base(layerPath)); err != nil { + return fmt.Errorf("failed to destroy %s: %w", layerPath, err) + } + + return nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/sys/oom_linux.go b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/sys/oom_linux.go new file mode 100644 index 000000000..bb2a3eafb --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/sys/oom_linux.go @@ -0,0 +1,82 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package sys + +import ( + "fmt" + "os" + "strconv" + "strings" + + "github.com/containerd/containerd/pkg/userns" + "golang.org/x/sys/unix" +) + +const ( + // OOMScoreAdjMin is from OOM_SCORE_ADJ_MIN https://github.com/torvalds/linux/blob/v5.10/include/uapi/linux/oom.h#L9 + OOMScoreAdjMin = -1000 + // OOMScoreAdjMax is from OOM_SCORE_ADJ_MAX https://github.com/torvalds/linux/blob/v5.10/include/uapi/linux/oom.h#L10 + OOMScoreAdjMax = 1000 +) + +// AdjustOOMScore sets the oom score for the provided pid. If the provided score +// is out of range (-1000 - 1000), it is clipped to the min/max value. +func AdjustOOMScore(pid, score int) error { + if score > OOMScoreAdjMax { + score = OOMScoreAdjMax + } else if score < OOMScoreAdjMin { + score = OOMScoreAdjMin + } + return SetOOMScore(pid, score) +} + +// SetOOMScore sets the oom score for the provided pid +func SetOOMScore(pid, score int) error { + if score > OOMScoreAdjMax || score < OOMScoreAdjMin { + return fmt.Errorf("value out of range (%d): OOM score must be between %d and %d", score, OOMScoreAdjMin, OOMScoreAdjMax) + } + path := fmt.Sprintf("/proc/%d/oom_score_adj", pid) + f, err := os.OpenFile(path, os.O_WRONLY, 0) + if err != nil { + return err + } + defer f.Close() + if _, err = f.WriteString(strconv.Itoa(score)); err != nil { + if os.IsPermission(err) && (!runningPrivileged() || userns.RunningInUserNS()) { + return nil + } + return err + } + return nil +} + +// GetOOMScoreAdj gets the oom score for a process. It returns 0 (zero) if either +// no oom score is set, or a sore is set to 0. +func GetOOMScoreAdj(pid int) (int, error) { + path := fmt.Sprintf("/proc/%d/oom_score_adj", pid) + data, err := os.ReadFile(path) + if err != nil { + return 0, err + } + return strconv.Atoi(strings.TrimSpace(string(data))) +} + +// runningPrivileged returns true if the effective user ID of the +// calling process is 0 +func runningPrivileged() bool { + return unix.Geteuid() == 0 +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/sys/oom_unsupported.go b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/sys/oom_unsupported.go new file mode 100644 index 000000000..fa0db5a10 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/sys/oom_unsupported.go @@ -0,0 +1,49 @@ +//go:build !linux +// +build !linux + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package sys + +const ( + // OOMScoreMaxKillable is not implemented on non Linux + OOMScoreMaxKillable = 0 + // OOMScoreAdjMax is not implemented on non Linux + OOMScoreAdjMax = 0 +) + +// AdjustOOMScore sets the oom score for the provided pid. If the provided score +// is out of range (-1000 - 1000), it is clipped to the min/max value. +// +// Not implemented on Windows +func AdjustOOMScore(pid, score int) error { + return nil +} + +// SetOOMScore sets the oom score for the process +// +// Not implemented on Windows +func SetOOMScore(pid, score int) error { + return nil +} + +// GetOOMScoreAdj gets the oom score for a process +// +// Not implemented on Windows +func GetOOMScoreAdj(pid int) (int, error) { + return 0, nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/sys/socket_unix.go b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/sys/socket_unix.go new file mode 100644 index 000000000..367e19cad --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/sys/socket_unix.go @@ -0,0 +1,81 @@ +//go:build !windows +// +build !windows + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package sys + +import ( + "fmt" + "net" + "os" + "path/filepath" + + "golang.org/x/sys/unix" +) + +// CreateUnixSocket creates a unix socket and returns the listener +func CreateUnixSocket(path string) (net.Listener, error) { + // BSDs have a 104 limit + if len(path) > 104 { + return nil, fmt.Errorf("%q: unix socket path too long (> 104)", path) + } + if err := os.MkdirAll(filepath.Dir(path), 0660); err != nil { + return nil, err + } + if err := unix.Unlink(path); err != nil && !os.IsNotExist(err) { + return nil, err + } + return net.Listen("unix", path) +} + +// GetLocalListener returns a listener out of a unix socket. +func GetLocalListener(path string, uid, gid int) (net.Listener, error) { + // Ensure parent directory is created + if err := mkdirAs(filepath.Dir(path), uid, gid); err != nil { + return nil, err + } + + l, err := CreateUnixSocket(path) + if err != nil { + return l, err + } + + if err := os.Chmod(path, 0660); err != nil { + l.Close() + return nil, err + } + + if err := os.Chown(path, uid, gid); err != nil { + l.Close() + return nil, err + } + + return l, nil +} + +func mkdirAs(path string, uid, gid int) error { + if _, err := os.Stat(path); !os.IsNotExist(err) { + return err + } + + if err := os.MkdirAll(path, 0770); err != nil { + return err + } + + return os.Chown(path, uid, gid) +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/sys/socket_windows.go b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/sys/socket_windows.go new file mode 100644 index 000000000..1ae12bc51 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/sys/socket_windows.go @@ -0,0 +1,30 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package sys + +import ( + "net" + + "github.com/Microsoft/go-winio" +) + +// GetLocalListener returns a Listernet out of a named pipe. +// `path` must be of the form of `\\.\pipe\` +// (see https://msdn.microsoft.com/en-us/library/windows/desktop/aa365150) +func GetLocalListener(path string, uid, gid int) (net.Listener, error) { + return winio.ListenPipe(path, nil) +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/sys/userns_deprecated.go b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/sys/userns_deprecated.go new file mode 100644 index 000000000..53acf5547 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/sys/userns_deprecated.go @@ -0,0 +1,23 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package sys + +import "github.com/containerd/containerd/pkg/userns" + +// RunningInUserNS detects whether we are currently running in a user namespace. +// Deprecated: use github.com/containerd/containerd/pkg/userns.RunningInUserNS instead. +var RunningInUserNS = userns.RunningInUserNS diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/version/version.go b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/version/version.go index a4156cb7a..476c6c4b2 100644 --- a/src/cmd/linuxkit/vendor/github.com/containerd/containerd/version/version.go +++ b/src/cmd/linuxkit/vendor/github.com/containerd/containerd/version/version.go @@ -23,7 +23,7 @@ var ( Package = "github.com/containerd/containerd" // Version holds the complete version number. Filled in at linking time. - Version = "1.6.8+unknown" + Version = "1.6.11+unknown" // Revision is filled with the VCS (e.g. git) revision being used to build // the program at linking time. diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/copy.go b/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/copy.go new file mode 100644 index 000000000..6982a761b --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/copy.go @@ -0,0 +1,195 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package fs + +import ( + "fmt" + "io/ioutil" + "os" + "path/filepath" + "sync" + + "github.com/sirupsen/logrus" +) + +var bufferPool = &sync.Pool{ + New: func() interface{} { + buffer := make([]byte, 32*1024) + return &buffer + }, +} + +// XAttrErrorHandler transform a non-nil xattr error. +// Return nil to ignore an error. +// xattrKey can be empty for listxattr operation. +type XAttrErrorHandler func(dst, src, xattrKey string, err error) error + +type copyDirOpts struct { + xeh XAttrErrorHandler + // xex contains a set of xattrs to exclude when copying + xex map[string]struct{} +} + +type CopyDirOpt func(*copyDirOpts) error + +// WithXAttrErrorHandler allows specifying XAttrErrorHandler +// If nil XAttrErrorHandler is specified (default), CopyDir stops +// on a non-nil xattr error. +func WithXAttrErrorHandler(xeh XAttrErrorHandler) CopyDirOpt { + return func(o *copyDirOpts) error { + o.xeh = xeh + return nil + } +} + +// WithAllowXAttrErrors allows ignoring xattr errors. +func WithAllowXAttrErrors() CopyDirOpt { + xeh := func(dst, src, xattrKey string, err error) error { + return nil + } + return WithXAttrErrorHandler(xeh) +} + +// WithXAttrExclude allows for exclusion of specified xattr during CopyDir operation. +func WithXAttrExclude(keys ...string) CopyDirOpt { + return func(o *copyDirOpts) error { + if o.xex == nil { + o.xex = make(map[string]struct{}, len(keys)) + } + for _, key := range keys { + o.xex[key] = struct{}{} + } + return nil + } +} + +// CopyDir copies the directory from src to dst. +// Most efficient copy of files is attempted. +func CopyDir(dst, src string, opts ...CopyDirOpt) error { + var o copyDirOpts + for _, opt := range opts { + if err := opt(&o); err != nil { + return err + } + } + inodes := map[uint64]string{} + return copyDirectory(dst, src, inodes, &o) +} + +func copyDirectory(dst, src string, inodes map[uint64]string, o *copyDirOpts) error { + stat, err := os.Stat(src) + if err != nil { + return fmt.Errorf("failed to stat %s: %w", src, err) + } + if !stat.IsDir() { + return fmt.Errorf("source %s is not directory", src) + } + + if st, err := os.Stat(dst); err != nil { + if err := os.Mkdir(dst, stat.Mode()); err != nil { + return fmt.Errorf("failed to mkdir %s: %w", dst, err) + } + } else if !st.IsDir() { + return fmt.Errorf("cannot copy to non-directory: %s", dst) + } else { + if err := os.Chmod(dst, stat.Mode()); err != nil { + return fmt.Errorf("failed to chmod on %s: %w", dst, err) + } + } + + fis, err := ioutil.ReadDir(src) + if err != nil { + return fmt.Errorf("failed to read %s: %w", src, err) + } + + if err := copyFileInfo(stat, src, dst); err != nil { + return fmt.Errorf("failed to copy file info for %s: %w", dst, err) + } + + if err := copyXAttrs(dst, src, o.xex, o.xeh); err != nil { + return fmt.Errorf("failed to copy xattrs: %w", err) + } + + for _, fi := range fis { + source := filepath.Join(src, fi.Name()) + target := filepath.Join(dst, fi.Name()) + + switch { + case fi.IsDir(): + if err := copyDirectory(target, source, inodes, o); err != nil { + return err + } + continue + case (fi.Mode() & os.ModeType) == 0: + link, err := getLinkSource(target, fi, inodes) + if err != nil { + return fmt.Errorf("failed to get hardlink: %w", err) + } + if link != "" { + if err := os.Link(link, target); err != nil { + return fmt.Errorf("failed to create hard link: %w", err) + } + } else if err := CopyFile(target, source); err != nil { + return fmt.Errorf("failed to copy files: %w", err) + } + case (fi.Mode() & os.ModeSymlink) == os.ModeSymlink: + link, err := os.Readlink(source) + if err != nil { + return fmt.Errorf("failed to read link: %s: %w", source, err) + } + if err := os.Symlink(link, target); err != nil { + return fmt.Errorf("failed to create symlink: %s: %w", target, err) + } + case (fi.Mode() & os.ModeDevice) == os.ModeDevice, + (fi.Mode() & os.ModeNamedPipe) == os.ModeNamedPipe, + (fi.Mode() & os.ModeSocket) == os.ModeSocket: + if err := copyIrregular(target, fi); err != nil { + return fmt.Errorf("failed to create irregular file: %w", err) + } + default: + logrus.Warnf("unsupported mode: %s: %s", source, fi.Mode()) + continue + } + + if err := copyFileInfo(fi, source, target); err != nil { + return fmt.Errorf("failed to copy file info: %w", err) + } + + if err := copyXAttrs(target, source, o.xex, o.xeh); err != nil { + return fmt.Errorf("failed to copy xattrs: %w", err) + } + } + + return nil +} + +// CopyFile copies the source file to the target. +// The most efficient means of copying is used for the platform. +func CopyFile(target, source string) error { + src, err := os.Open(source) + if err != nil { + return fmt.Errorf("failed to open source %s: %w", source, err) + } + defer src.Close() + tgt, err := os.Create(target) + if err != nil { + return fmt.Errorf("failed to open target %s: %w", target, err) + } + defer tgt.Close() + + return copyFileContent(tgt, src) +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/copy_irregular_freebsd.go b/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/copy_irregular_freebsd.go new file mode 100644 index 000000000..cfe9d8020 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/copy_irregular_freebsd.go @@ -0,0 +1,36 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package fs + +import ( + "fmt" + "os" + "syscall" +) + +// copyIrregular covers devices, pipes, and sockets +func copyIrregular(dst string, fi os.FileInfo) error { + st, ok := fi.Sys().(*syscall.Stat_t) // not *unix.Stat_t + if !ok { + return fmt.Errorf("unsupported stat type: %s: %v", dst, fi.Mode()) + } + var rDev uint64 // uint64 on FreeBSD, int on other unixen + if fi.Mode()&os.ModeDevice == os.ModeDevice { + rDev = st.Rdev + } + return syscall.Mknod(dst, uint32(st.Mode), rDev) +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/copy_irregular_unix.go b/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/copy_irregular_unix.go new file mode 100644 index 000000000..99fc8a965 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/copy_irregular_unix.go @@ -0,0 +1,40 @@ +//go:build !windows && !freebsd +// +build !windows,!freebsd + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package fs + +import ( + "fmt" + "os" + "syscall" +) + +// copyIrregular covers devices, pipes, and sockets +func copyIrregular(dst string, fi os.FileInfo) error { + st, ok := fi.Sys().(*syscall.Stat_t) // not *unix.Stat_t + if !ok { + return fmt.Errorf("unsupported stat type: %s: %v", dst, fi.Mode()) + } + var rDev int + if fi.Mode()&os.ModeDevice == os.ModeDevice { + rDev = int(st.Rdev) + } + //nolint:unconvert + return syscall.Mknod(dst, uint32(st.Mode), rDev) +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/copy_linux.go b/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/copy_linux.go new file mode 100644 index 000000000..1906e5e01 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/copy_linux.go @@ -0,0 +1,145 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package fs + +import ( + "fmt" + "io" + "os" + "syscall" + + "github.com/containerd/continuity/sysx" + "golang.org/x/sys/unix" +) + +func copyFileInfo(fi os.FileInfo, src, name string) error { + st := fi.Sys().(*syscall.Stat_t) + if err := os.Lchown(name, int(st.Uid), int(st.Gid)); err != nil { + if os.IsPermission(err) { + // Normally if uid/gid are the same this would be a no-op, but some + // filesystems may still return EPERM... for instance NFS does this. + // In such a case, this is not an error. + if dstStat, err2 := os.Lstat(name); err2 == nil { + st2 := dstStat.Sys().(*syscall.Stat_t) + if st.Uid == st2.Uid && st.Gid == st2.Gid { + err = nil + } + } + } + if err != nil { + return fmt.Errorf("failed to chown %s: %w", name, err) + } + } + + if (fi.Mode() & os.ModeSymlink) != os.ModeSymlink { + if err := os.Chmod(name, fi.Mode()); err != nil { + return fmt.Errorf("failed to chmod %s: %w", name, err) + } + } + + timespec := []unix.Timespec{ + unix.NsecToTimespec(syscall.TimespecToNsec(StatAtime(st))), + unix.NsecToTimespec(syscall.TimespecToNsec(StatMtime(st))), + } + if err := unix.UtimesNanoAt(unix.AT_FDCWD, name, timespec, unix.AT_SYMLINK_NOFOLLOW); err != nil { + return fmt.Errorf("failed to utime %s: %w", name, err) + } + + return nil +} + +const maxSSizeT = int64(^uint(0) >> 1) + +func copyFileContent(dst, src *os.File) error { + st, err := src.Stat() + if err != nil { + return fmt.Errorf("unable to stat source: %w", err) + } + + size := st.Size() + first := true + srcFd := int(src.Fd()) + dstFd := int(dst.Fd()) + + for size > 0 { + // Ensure that we are never trying to copy more than SSIZE_MAX at a + // time and at the same time avoids overflows when the file is larger + // than 4GB on 32-bit systems. + var copySize int + if size > maxSSizeT { + copySize = int(maxSSizeT) + } else { + copySize = int(size) + } + n, err := unix.CopyFileRange(srcFd, nil, dstFd, nil, copySize, 0) + if err != nil { + if (err != unix.ENOSYS && err != unix.EXDEV) || !first { + return fmt.Errorf("copy file range failed: %w", err) + } + + buf := bufferPool.Get().(*[]byte) + _, err = io.CopyBuffer(dst, src, *buf) + bufferPool.Put(buf) + if err != nil { + return fmt.Errorf("userspace copy failed: %w", err) + } + return nil + } + + first = false + size -= int64(n) + } + + return nil +} + +func copyXAttrs(dst, src string, excludes map[string]struct{}, errorHandler XAttrErrorHandler) error { + xattrKeys, err := sysx.LListxattr(src) + if err != nil { + e := fmt.Errorf("failed to list xattrs on %s: %w", src, err) + if errorHandler != nil { + e = errorHandler(dst, src, "", e) + } + return e + } + for _, xattr := range xattrKeys { + if _, exclude := excludes[xattr]; exclude { + continue + } + data, err := sysx.LGetxattr(src, xattr) + if err != nil { + e := fmt.Errorf("failed to get xattr %q on %s: %w", xattr, src, err) + if errorHandler != nil { + if e = errorHandler(dst, src, xattr, e); e == nil { + continue + } + } + return e + } + if err := sysx.LSetxattr(dst, xattr, data, 0); err != nil { + e := fmt.Errorf("failed to set xattr %q on %s: %w", xattr, dst, err) + if errorHandler != nil { + if e = errorHandler(dst, src, xattr, e); e == nil { + continue + } + } + return e + } + } + + return nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/copy_unix.go b/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/copy_unix.go new file mode 100644 index 000000000..0e68ba9ec --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/copy_unix.go @@ -0,0 +1,106 @@ +//go:build darwin || freebsd || openbsd || netbsd || solaris +// +build darwin freebsd openbsd netbsd solaris + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package fs + +import ( + "fmt" + "io" + "os" + "syscall" + + "github.com/containerd/continuity/sysx" +) + +func copyFileInfo(fi os.FileInfo, src, name string) error { + st := fi.Sys().(*syscall.Stat_t) + if err := os.Lchown(name, int(st.Uid), int(st.Gid)); err != nil { + if os.IsPermission(err) { + // Normally if uid/gid are the same this would be a no-op, but some + // filesystems may still return EPERM... for instance NFS does this. + // In such a case, this is not an error. + if dstStat, err2 := os.Lstat(name); err2 == nil { + st2 := dstStat.Sys().(*syscall.Stat_t) + if st.Uid == st2.Uid && st.Gid == st2.Gid { + err = nil + } + } + } + if err != nil { + return fmt.Errorf("failed to chown %s: %w", name, err) + } + } + + if (fi.Mode() & os.ModeSymlink) != os.ModeSymlink { + if err := os.Chmod(name, fi.Mode()); err != nil { + return fmt.Errorf("failed to chmod %s: %w", name, err) + } + } + + if err := utimesNano(name, StatAtime(st), StatMtime(st)); err != nil { + return fmt.Errorf("failed to utime %s: %w", name, err) + } + + return nil +} + +func copyFileContent(dst, src *os.File) error { + buf := bufferPool.Get().(*[]byte) + _, err := io.CopyBuffer(dst, src, *buf) + bufferPool.Put(buf) + + return err +} + +func copyXAttrs(dst, src string, excludes map[string]struct{}, errorHandler XAttrErrorHandler) error { + xattrKeys, err := sysx.LListxattr(src) + if err != nil { + e := fmt.Errorf("failed to list xattrs on %s: %w", src, err) + if errorHandler != nil { + e = errorHandler(dst, src, "", e) + } + return e + } + for _, xattr := range xattrKeys { + if _, exclude := excludes[xattr]; exclude { + continue + } + data, err := sysx.LGetxattr(src, xattr) + if err != nil { + e := fmt.Errorf("failed to get xattr %q on %s: %w", xattr, src, err) + if errorHandler != nil { + if e = errorHandler(dst, src, xattr, e); e == nil { + continue + } + } + return e + } + if err := sysx.LSetxattr(dst, xattr, data, 0); err != nil { + e := fmt.Errorf("failed to set xattr %q on %s: %w", xattr, dst, err) + if errorHandler != nil { + if e = errorHandler(dst, src, xattr, e); e == nil { + continue + } + } + return e + } + } + + return nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/copy_windows.go b/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/copy_windows.go new file mode 100644 index 000000000..4dad9441d --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/copy_windows.go @@ -0,0 +1,90 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package fs + +import ( + "errors" + "fmt" + "io" + "os" + + winio "github.com/Microsoft/go-winio" + "golang.org/x/sys/windows" +) + +const ( + seTakeOwnershipPrivilege = "SeTakeOwnershipPrivilege" +) + +func copyFileInfo(fi os.FileInfo, src, name string) error { + if err := os.Chmod(name, fi.Mode()); err != nil { + return fmt.Errorf("failed to chmod %s: %w", name, err) + } + + // Copy file ownership and ACL + // We need SeRestorePrivilege and SeTakeOwnershipPrivilege in order + // to restore security info on a file, especially if we're trying to + // apply security info which includes SIDs not necessarily present on + // the host. + privileges := []string{winio.SeRestorePrivilege, seTakeOwnershipPrivilege} + if err := winio.EnableProcessPrivileges(privileges); err != nil { + return err + } + defer winio.DisableProcessPrivileges(privileges) + + secInfo, err := windows.GetNamedSecurityInfo( + src, windows.SE_FILE_OBJECT, + windows.OWNER_SECURITY_INFORMATION|windows.DACL_SECURITY_INFORMATION) + + if err != nil { + return err + } + + dacl, _, err := secInfo.DACL() + if err != nil { + return err + } + + sid, _, err := secInfo.Owner() + if err != nil { + return err + } + + if err := windows.SetNamedSecurityInfo( + name, windows.SE_FILE_OBJECT, + windows.OWNER_SECURITY_INFORMATION|windows.DACL_SECURITY_INFORMATION, + sid, nil, dacl, nil); err != nil { + + return err + } + return nil +} + +func copyFileContent(dst, src *os.File) error { + buf := bufferPool.Get().(*[]byte) + _, err := io.CopyBuffer(dst, src, *buf) + bufferPool.Put(buf) + return err +} + +func copyXAttrs(dst, src string, excludes map[string]struct{}, errorHandler XAttrErrorHandler) error { + return nil +} + +func copyIrregular(dst string, fi os.FileInfo) error { + return errors.New("irregular copy not supported") +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/diff.go b/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/diff.go new file mode 100644 index 000000000..3cd4eee6f --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/diff.go @@ -0,0 +1,325 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package fs + +import ( + "context" + "os" + "path/filepath" + "strings" + + "github.com/sirupsen/logrus" + "golang.org/x/sync/errgroup" +) + +// ChangeKind is the type of modification that +// a change is making. +type ChangeKind int + +const ( + // ChangeKindUnmodified represents an unmodified + // file + ChangeKindUnmodified = iota + + // ChangeKindAdd represents an addition of + // a file + ChangeKindAdd + + // ChangeKindModify represents a change to + // an existing file + ChangeKindModify + + // ChangeKindDelete represents a delete of + // a file + ChangeKindDelete +) + +func (k ChangeKind) String() string { + switch k { + case ChangeKindUnmodified: + return "unmodified" + case ChangeKindAdd: + return "add" + case ChangeKindModify: + return "modify" + case ChangeKindDelete: + return "delete" + default: + return "" + } +} + +// Change represents single change between a diff and its parent. +type Change struct { + Kind ChangeKind + Path string +} + +// ChangeFunc is the type of function called for each change +// computed during a directory changes calculation. +type ChangeFunc func(ChangeKind, string, os.FileInfo, error) error + +// Changes computes changes between two directories calling the +// given change function for each computed change. The first +// directory is intended to the base directory and second +// directory the changed directory. +// +// The change callback is called by the order of path names and +// should be appliable in that order. +// Due to this apply ordering, the following is true +// - Removed directory trees only create a single change for the root +// directory removed. Remaining changes are implied. +// - A directory which is modified to become a file will not have +// delete entries for sub-path items, their removal is implied +// by the removal of the parent directory. +// +// Opaque directories will not be treated specially and each file +// removed from the base directory will show up as a removal. +// +// File content comparisons will be done on files which have timestamps +// which may have been truncated. If either of the files being compared +// has a zero value nanosecond value, each byte will be compared for +// differences. If 2 files have the same seconds value but different +// nanosecond values where one of those values is zero, the files will +// be considered unchanged if the content is the same. This behavior +// is to account for timestamp truncation during archiving. +func Changes(ctx context.Context, a, b string, changeFn ChangeFunc) error { + if a == "" { + logrus.Debugf("Using single walk diff for %s", b) + return addDirChanges(ctx, changeFn, b) + } else if diffOptions := detectDirDiff(b, a); diffOptions != nil { + logrus.Debugf("Using single walk diff for %s from %s", diffOptions.diffDir, a) + return diffDirChanges(ctx, changeFn, a, diffOptions) + } + + logrus.Debugf("Using double walk diff for %s from %s", b, a) + return doubleWalkDiff(ctx, changeFn, a, b) +} + +func addDirChanges(ctx context.Context, changeFn ChangeFunc, root string) error { + return filepath.Walk(root, func(path string, f os.FileInfo, err error) error { + if err != nil { + return err + } + + // Rebase path + path, err = filepath.Rel(root, path) + if err != nil { + return err + } + + path = filepath.Join(string(os.PathSeparator), path) + + // Skip root + if path == string(os.PathSeparator) { + return nil + } + + return changeFn(ChangeKindAdd, path, f, nil) + }) +} + +// diffDirOptions is used when the diff can be directly calculated from +// a diff directory to its base, without walking both trees. +type diffDirOptions struct { + diffDir string + skipChange func(string) (bool, error) + deleteChange func(string, string, os.FileInfo) (string, error) +} + +// diffDirChanges walks the diff directory and compares changes against the base. +func diffDirChanges(ctx context.Context, changeFn ChangeFunc, base string, o *diffDirOptions) error { + changedDirs := make(map[string]struct{}) + return filepath.Walk(o.diffDir, func(path string, f os.FileInfo, err error) error { + if err != nil { + return err + } + + // Rebase path + path, err = filepath.Rel(o.diffDir, path) + if err != nil { + return err + } + + path = filepath.Join(string(os.PathSeparator), path) + + // Skip root + if path == string(os.PathSeparator) { + return nil + } + + // TODO: handle opaqueness, start new double walker at this + // location to get deletes, and skip tree in single walker + + if o.skipChange != nil { + if skip, err := o.skipChange(path); skip { + return err + } + } + + var kind ChangeKind + + deletedFile, err := o.deleteChange(o.diffDir, path, f) + if err != nil { + return err + } + + // Find out what kind of modification happened + if deletedFile != "" { + path = deletedFile + kind = ChangeKindDelete + f = nil + } else { + // Otherwise, the file was added + kind = ChangeKindAdd + + // ...Unless it already existed in a base, in which case, it's a modification + stat, err := os.Stat(filepath.Join(base, path)) + if err != nil && !os.IsNotExist(err) { + return err + } + if err == nil { + // The file existed in the base, so that's a modification + + // However, if it's a directory, maybe it wasn't actually modified. + // If you modify /foo/bar/baz, then /foo will be part of the changed files only because it's the parent of bar + if stat.IsDir() && f.IsDir() { + if f.Size() == stat.Size() && f.Mode() == stat.Mode() && sameFsTime(f.ModTime(), stat.ModTime()) { + // Both directories are the same, don't record the change + return nil + } + } + kind = ChangeKindModify + } + } + + // If /foo/bar/file.txt is modified, then /foo/bar must be part of the changed files. + // This block is here to ensure the change is recorded even if the + // modify time, mode and size of the parent directory in the rw and ro layers are all equal. + // Check https://github.com/docker/docker/pull/13590 for details. + if f.IsDir() { + changedDirs[path] = struct{}{} + } + if kind == ChangeKindAdd || kind == ChangeKindDelete { + parent := filepath.Dir(path) + if _, ok := changedDirs[parent]; !ok && parent != "/" { + pi, err := os.Stat(filepath.Join(o.diffDir, parent)) + if err := changeFn(ChangeKindModify, parent, pi, err); err != nil { + return err + } + changedDirs[parent] = struct{}{} + } + } + + return changeFn(kind, path, f, nil) + }) +} + +// doubleWalkDiff walks both directories to create a diff +func doubleWalkDiff(ctx context.Context, changeFn ChangeFunc, a, b string) (err error) { + g, ctx := errgroup.WithContext(ctx) + + var ( + c1 = make(chan *currentPath) + c2 = make(chan *currentPath) + + f1, f2 *currentPath + rmdir string + ) + g.Go(func() error { + defer close(c1) + return pathWalk(ctx, a, c1) + }) + g.Go(func() error { + defer close(c2) + return pathWalk(ctx, b, c2) + }) + g.Go(func() error { + for c1 != nil || c2 != nil { + if f1 == nil && c1 != nil { + f1, err = nextPath(ctx, c1) + if err != nil { + return err + } + if f1 == nil { + c1 = nil + } + } + + if f2 == nil && c2 != nil { + f2, err = nextPath(ctx, c2) + if err != nil { + return err + } + if f2 == nil { + c2 = nil + } + } + if f1 == nil && f2 == nil { + continue + } + + var f os.FileInfo + k, p := pathChange(f1, f2) + switch k { + case ChangeKindAdd: + if rmdir != "" { + rmdir = "" + } + f = f2.f + f2 = nil + case ChangeKindDelete: + // Check if this file is already removed by being + // under of a removed directory + if rmdir != "" && strings.HasPrefix(f1.path, rmdir) { + f1 = nil + continue + } else if f1.f.IsDir() { + rmdir = f1.path + string(os.PathSeparator) + } else if rmdir != "" { + rmdir = "" + } + f1 = nil + case ChangeKindModify: + same, err := sameFile(f1, f2) + if err != nil { + return err + } + if f1.f.IsDir() && !f2.f.IsDir() { + rmdir = f1.path + string(os.PathSeparator) + } else if rmdir != "" { + rmdir = "" + } + f = f2.f + f1 = nil + f2 = nil + if same { + if !isLinked(f) { + continue + } + k = ChangeKindUnmodified + } + } + if err := changeFn(k, p, f, nil); err != nil { + return err + } + } + return nil + }) + + return g.Wait() +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/diff_unix.go b/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/diff_unix.go new file mode 100644 index 000000000..5de9b6b48 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/diff_unix.go @@ -0,0 +1,75 @@ +//go:build !windows +// +build !windows + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package fs + +import ( + "bytes" + "fmt" + "os" + "syscall" + + "github.com/containerd/continuity/sysx" +) + +// detectDirDiff returns diff dir options if a directory could +// be found in the mount info for upper which is the direct +// diff with the provided lower directory +func detectDirDiff(upper, lower string) *diffDirOptions { + // TODO: get mount options for upper + // TODO: detect AUFS + // TODO: detect overlay + return nil +} + +// compareSysStat returns whether the stats are equivalent, +// whether the files are considered the same file, and +// an error +func compareSysStat(s1, s2 interface{}) (bool, error) { + ls1, ok := s1.(*syscall.Stat_t) + if !ok { + return false, nil + } + ls2, ok := s2.(*syscall.Stat_t) + if !ok { + return false, nil + } + + return ls1.Mode == ls2.Mode && ls1.Uid == ls2.Uid && ls1.Gid == ls2.Gid && ls1.Rdev == ls2.Rdev, nil +} + +func compareCapabilities(p1, p2 string) (bool, error) { + c1, err := sysx.LGetxattr(p1, "security.capability") + if err != nil && err != sysx.ENODATA { + return false, fmt.Errorf("failed to get xattr for %s: %w", p1, err) + } + c2, err := sysx.LGetxattr(p2, "security.capability") + if err != nil && err != sysx.ENODATA { + return false, fmt.Errorf("failed to get xattr for %s: %w", p2, err) + } + return bytes.Equal(c1, c2), nil +} + +func isLinked(f os.FileInfo) bool { + s, ok := f.Sys().(*syscall.Stat_t) + if !ok { + return false + } + return !f.IsDir() && s.Nlink > 1 +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/diff_windows.go b/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/diff_windows.go new file mode 100644 index 000000000..4bfa72d3a --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/diff_windows.go @@ -0,0 +1,48 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package fs + +import ( + "os" + + "golang.org/x/sys/windows" +) + +func detectDirDiff(upper, lower string) *diffDirOptions { + return nil +} + +func compareSysStat(s1, s2 interface{}) (bool, error) { + f1, ok := s1.(windows.Win32FileAttributeData) + if !ok { + return false, nil + } + f2, ok := s2.(windows.Win32FileAttributeData) + if !ok { + return false, nil + } + return f1.FileAttributes == f2.FileAttributes, nil +} + +func compareCapabilities(p1, p2 string) (bool, error) { + // TODO: Use windows equivalent + return true, nil +} + +func isLinked(os.FileInfo) bool { + return false +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/dtype_linux.go b/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/dtype_linux.go new file mode 100644 index 000000000..a8eab1db8 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/dtype_linux.go @@ -0,0 +1,104 @@ +//go:build linux +// +build linux + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package fs + +import ( + "fmt" + "io/ioutil" + "os" + "syscall" + "unsafe" +) + +func locateDummyIfEmpty(path string) (string, error) { + children, err := ioutil.ReadDir(path) + if err != nil { + return "", err + } + if len(children) != 0 { + return "", nil + } + dummyFile, err := os.CreateTemp(path, "fsutils-dummy") + if err != nil { + return "", err + } + name := dummyFile.Name() + err = dummyFile.Close() + return name, err +} + +// SupportsDType returns whether the filesystem mounted on path supports d_type +func SupportsDType(path string) (bool, error) { + // locate dummy so that we have at least one dirent + dummy, err := locateDummyIfEmpty(path) + if err != nil { + return false, err + } + if dummy != "" { + defer os.Remove(dummy) + } + + visited := 0 + supportsDType := true + fn := func(ent *syscall.Dirent) bool { + visited++ + if ent.Type == syscall.DT_UNKNOWN { + supportsDType = false + // stop iteration + return true + } + // continue iteration + return false + } + if err = iterateReadDir(path, fn); err != nil { + return false, err + } + if visited == 0 { + return false, fmt.Errorf("did not hit any dirent during iteration %s", path) + } + return supportsDType, nil +} + +func iterateReadDir(path string, fn func(*syscall.Dirent) bool) error { + d, err := os.Open(path) + if err != nil { + return err + } + defer d.Close() + fd := int(d.Fd()) + buf := make([]byte, 4096) + for { + nbytes, err := syscall.ReadDirent(fd, buf) + if err != nil { + return err + } + if nbytes == 0 { + break + } + for off := 0; off < nbytes; { + ent := (*syscall.Dirent)(unsafe.Pointer(&buf[off])) + if stop := fn(ent); stop { + return nil + } + off += int(ent.Reclen) + } + } + return nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/du.go b/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/du.go new file mode 100644 index 000000000..fccc985dc --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/du.go @@ -0,0 +1,38 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package fs + +import "context" + +// Usage of disk information +type Usage struct { + Inodes int64 + Size int64 +} + +// DiskUsage counts the number of inodes and disk usage for the resources under +// path. +func DiskUsage(ctx context.Context, roots ...string) (Usage, error) { + return diskUsage(ctx, roots...) +} + +// DiffUsage counts the numbers of inodes and disk usage in the +// diff between the 2 directories. The first path is intended +// as the base directory and the second as the changed directory. +func DiffUsage(ctx context.Context, a, b string) (Usage, error) { + return diffUsage(ctx, a, b) +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/du_unix.go b/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/du_unix.go new file mode 100644 index 000000000..bf33c42d7 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/du_unix.go @@ -0,0 +1,119 @@ +//go:build !windows +// +build !windows + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package fs + +import ( + "context" + "os" + "path/filepath" + "syscall" +) + +// blocksUnitSize is the unit used by `st_blocks` in `stat` in bytes. +// See https://man7.org/linux/man-pages/man2/stat.2.html +// st_blocks +// This field indicates the number of blocks allocated to the +// file, in 512-byte units. (This may be smaller than +// st_size/512 when the file has holes.) +const blocksUnitSize = 512 + +type inode struct { + // TODO(stevvooe): Can probably reduce memory usage by not tracking + // device, but we can leave this right for now. + dev, ino uint64 +} + +func newInode(stat *syscall.Stat_t) inode { + return inode{ + dev: uint64(stat.Dev), //nolint: unconvert // dev is uint32 on darwin/bsd, uint64 on linux/solaris/freebsd + ino: uint64(stat.Ino), //nolint: unconvert // ino is uint32 on bsd, uint64 on darwin/linux/solaris/freebsd + } +} + +func diskUsage(ctx context.Context, roots ...string) (Usage, error) { + + var ( + size int64 + inodes = map[inode]struct{}{} // expensive! + ) + + for _, root := range roots { + if err := filepath.Walk(root, func(path string, fi os.FileInfo, err error) error { + if err != nil { + return err + } + + select { + case <-ctx.Done(): + return ctx.Err() + default: + } + + stat := fi.Sys().(*syscall.Stat_t) + inoKey := newInode(stat) + if _, ok := inodes[inoKey]; !ok { + inodes[inoKey] = struct{}{} + size += stat.Blocks * blocksUnitSize + } + + return nil + }); err != nil { + return Usage{}, err + } + } + + return Usage{ + Inodes: int64(len(inodes)), + Size: size, + }, nil +} + +func diffUsage(ctx context.Context, a, b string) (Usage, error) { + var ( + size int64 + inodes = map[inode]struct{}{} // expensive! + ) + + if err := Changes(ctx, a, b, func(kind ChangeKind, _ string, fi os.FileInfo, err error) error { + if err != nil { + return err + } + + if kind == ChangeKindAdd || kind == ChangeKindModify { + stat := fi.Sys().(*syscall.Stat_t) + inoKey := newInode(stat) + if _, ok := inodes[inoKey]; !ok { + inodes[inoKey] = struct{}{} + size += stat.Blocks * blocksUnitSize + } + + return nil + + } + return nil + }); err != nil { + return Usage{}, err + } + + return Usage{ + Inodes: int64(len(inodes)), + Size: size, + }, nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/du_windows.go b/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/du_windows.go new file mode 100644 index 000000000..08fb28333 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/du_windows.go @@ -0,0 +1,83 @@ +//go:build windows +// +build windows + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package fs + +import ( + "context" + "os" + "path/filepath" +) + +func diskUsage(ctx context.Context, roots ...string) (Usage, error) { + var ( + size int64 + ) + + // TODO(stevvooe): Support inodes (or equivalent) for windows. + + for _, root := range roots { + if err := filepath.Walk(root, func(path string, fi os.FileInfo, err error) error { + if err != nil { + return err + } + + select { + case <-ctx.Done(): + return ctx.Err() + default: + } + + size += fi.Size() + return nil + }); err != nil { + return Usage{}, err + } + } + + return Usage{ + Size: size, + }, nil +} + +func diffUsage(ctx context.Context, a, b string) (Usage, error) { + var ( + size int64 + ) + + if err := Changes(ctx, a, b, func(kind ChangeKind, _ string, fi os.FileInfo, err error) error { + if err != nil { + return err + } + + if kind == ChangeKindAdd || kind == ChangeKindModify { + size += fi.Size() + + return nil + + } + return nil + }); err != nil { + return Usage{}, err + } + + return Usage{ + Size: size, + }, nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/hardlink.go b/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/hardlink.go new file mode 100644 index 000000000..762aa45e6 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/hardlink.go @@ -0,0 +1,43 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package fs + +import "os" + +// GetLinkInfo returns an identifier representing the node a hardlink is pointing +// to. If the file is not hard linked then 0 will be returned. +func GetLinkInfo(fi os.FileInfo) (uint64, bool) { + return getLinkInfo(fi) +} + +// getLinkSource returns a path for the given name and +// file info to its link source in the provided inode +// map. If the given file name is not in the map and +// has other links, it is added to the inode map +// to be a source for other link locations. +func getLinkSource(name string, fi os.FileInfo, inodes map[uint64]string) (string, error) { + inode, isHardlink := getLinkInfo(fi) + if !isHardlink { + return "", nil + } + + path, ok := inodes[inode] + if !ok { + inodes[inode] = name + } + return path, nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/hardlink_unix.go b/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/hardlink_unix.go new file mode 100644 index 000000000..cce8902f3 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/hardlink_unix.go @@ -0,0 +1,34 @@ +//go:build !windows +// +build !windows + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package fs + +import ( + "os" + "syscall" +) + +func getLinkInfo(fi os.FileInfo) (uint64, bool) { + s, ok := fi.Sys().(*syscall.Stat_t) + if !ok { + return 0, false + } + + return uint64(s.Ino), !fi.IsDir() && s.Nlink > 1 //nolint: unconvert // ino is uint32 on bsd, uint64 on darwin/linux/solaris +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/hardlink_windows.go b/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/hardlink_windows.go new file mode 100644 index 000000000..748554714 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/hardlink_windows.go @@ -0,0 +1,23 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package fs + +import "os" + +func getLinkInfo(fi os.FileInfo) (uint64, bool) { + return 0, false +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/path.go b/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/path.go new file mode 100644 index 000000000..97313e2b8 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/path.go @@ -0,0 +1,310 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package fs + +import ( + "bytes" + "context" + "errors" + "io" + "os" + "path/filepath" +) + +var ( + errTooManyLinks = errors.New("too many links") +) + +type currentPath struct { + path string + f os.FileInfo + fullPath string +} + +func pathChange(lower, upper *currentPath) (ChangeKind, string) { + if lower == nil { + if upper == nil { + panic("cannot compare nil paths") + } + return ChangeKindAdd, upper.path + } + if upper == nil { + return ChangeKindDelete, lower.path + } + + switch i := directoryCompare(lower.path, upper.path); { + case i < 0: + // File in lower that is not in upper + return ChangeKindDelete, lower.path + case i > 0: + // File in upper that is not in lower + return ChangeKindAdd, upper.path + default: + return ChangeKindModify, upper.path + } +} + +func directoryCompare(a, b string) int { + l := len(a) + if len(b) < l { + l = len(b) + } + for i := 0; i < l; i++ { + c1, c2 := a[i], b[i] + if c1 == filepath.Separator { + c1 = byte(0) + } + if c2 == filepath.Separator { + c2 = byte(0) + } + if c1 < c2 { + return -1 + } + if c1 > c2 { + return +1 + } + } + if len(a) < len(b) { + return -1 + } + if len(a) > len(b) { + return +1 + } + return 0 +} + +func sameFile(f1, f2 *currentPath) (bool, error) { + if os.SameFile(f1.f, f2.f) { + return true, nil + } + + equalStat, err := compareSysStat(f1.f.Sys(), f2.f.Sys()) + if err != nil || !equalStat { + return equalStat, err + } + + if eq, err := compareCapabilities(f1.fullPath, f2.fullPath); err != nil || !eq { + return eq, err + } + + // If not a directory also check size, modtime, and content + if !f1.f.IsDir() { + if f1.f.Size() != f2.f.Size() { + return false, nil + } + t1 := f1.f.ModTime() + t2 := f2.f.ModTime() + + if t1.Unix() != t2.Unix() { + return false, nil + } + + // If the timestamp may have been truncated in both of the + // files, check content of file to determine difference + if t1.Nanosecond() == 0 && t2.Nanosecond() == 0 { + if (f1.f.Mode() & os.ModeSymlink) == os.ModeSymlink { + return compareSymlinkTarget(f1.fullPath, f2.fullPath) + } + if f1.f.Size() == 0 { // if file sizes are zero length, the files are the same by definition + return true, nil + } + return compareFileContent(f1.fullPath, f2.fullPath) + } else if t1.Nanosecond() != t2.Nanosecond() { + return false, nil + } + } + + return true, nil +} + +func compareSymlinkTarget(p1, p2 string) (bool, error) { + t1, err := os.Readlink(p1) + if err != nil { + return false, err + } + t2, err := os.Readlink(p2) + if err != nil { + return false, err + } + return t1 == t2, nil +} + +const compareChuckSize = 32 * 1024 + +// compareFileContent compares the content of 2 same sized files +// by comparing each byte. +func compareFileContent(p1, p2 string) (bool, error) { + f1, err := os.Open(p1) + if err != nil { + return false, err + } + defer f1.Close() + f2, err := os.Open(p2) + if err != nil { + return false, err + } + defer f2.Close() + + b1 := make([]byte, compareChuckSize) + b2 := make([]byte, compareChuckSize) + for { + n1, err1 := f1.Read(b1) + if err1 != nil && err1 != io.EOF { + return false, err1 + } + n2, err2 := f2.Read(b2) + if err2 != nil && err2 != io.EOF { + return false, err2 + } + if n1 != n2 || !bytes.Equal(b1[:n1], b2[:n2]) { + return false, nil + } + if err1 == io.EOF && err2 == io.EOF { + return true, nil + } + } +} + +func pathWalk(ctx context.Context, root string, pathC chan<- *currentPath) error { + return filepath.Walk(root, func(path string, f os.FileInfo, err error) error { + if err != nil { + return err + } + + // Rebase path + path, err = filepath.Rel(root, path) + if err != nil { + return err + } + + path = filepath.Join(string(os.PathSeparator), path) + + // Skip root + if path == string(os.PathSeparator) { + return nil + } + + p := ¤tPath{ + path: path, + f: f, + fullPath: filepath.Join(root, path), + } + + select { + case <-ctx.Done(): + return ctx.Err() + case pathC <- p: + return nil + } + }) +} + +func nextPath(ctx context.Context, pathC <-chan *currentPath) (*currentPath, error) { + select { + case <-ctx.Done(): + return nil, ctx.Err() + case p := <-pathC: + return p, nil + } +} + +// RootPath joins a path with a root, evaluating and bounding any +// symlink to the root directory. +func RootPath(root, path string) (string, error) { + if path == "" { + return root, nil + } + var linksWalked int // to protect against cycles + for { + i := linksWalked + newpath, err := walkLinks(root, path, &linksWalked) + if err != nil { + return "", err + } + path = newpath + if i == linksWalked { + newpath = filepath.Join("/", newpath) + if path == newpath { + return filepath.Join(root, newpath), nil + } + path = newpath + } + } +} + +func walkLink(root, path string, linksWalked *int) (newpath string, islink bool, err error) { + if *linksWalked > 255 { + return "", false, errTooManyLinks + } + + path = filepath.Join("/", path) + if path == "/" { + return path, false, nil + } + realPath := filepath.Join(root, path) + + fi, err := os.Lstat(realPath) + if err != nil { + // If path does not yet exist, treat as non-symlink + if os.IsNotExist(err) { + return path, false, nil + } + return "", false, err + } + if fi.Mode()&os.ModeSymlink == 0 { + return path, false, nil + } + newpath, err = os.Readlink(realPath) + if err != nil { + return "", false, err + } + *linksWalked++ + return newpath, true, nil +} + +func walkLinks(root, path string, linksWalked *int) (string, error) { + switch dir, file := filepath.Split(path); { + case dir == "": + newpath, _, err := walkLink(root, file, linksWalked) + return newpath, err + case file == "": + if os.IsPathSeparator(dir[len(dir)-1]) { + if dir == "/" { + return dir, nil + } + return walkLinks(root, dir[:len(dir)-1], linksWalked) + } + newpath, _, err := walkLink(root, dir, linksWalked) + return newpath, err + default: + newdir, err := walkLinks(root, dir, linksWalked) + if err != nil { + return "", err + } + newpath, islink, err := walkLink(root, filepath.Join(newdir, file), linksWalked) + if err != nil { + return "", err + } + if !islink { + return newpath, nil + } + if filepath.IsAbs(newpath) { + return newpath, nil + } + return filepath.Join(newdir, newpath), nil + } +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/stat_atim.go b/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/stat_atim.go new file mode 100644 index 000000000..996b9c1ae --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/stat_atim.go @@ -0,0 +1,45 @@ +//go:build linux || openbsd || solaris +// +build linux openbsd solaris + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package fs + +import ( + "syscall" + "time" +) + +// StatAtime returns the Atim +func StatAtime(st *syscall.Stat_t) syscall.Timespec { + return st.Atim +} + +// StatCtime returns the Ctim +func StatCtime(st *syscall.Stat_t) syscall.Timespec { + return st.Ctim +} + +// StatMtime returns the Mtim +func StatMtime(st *syscall.Stat_t) syscall.Timespec { + return st.Mtim +} + +// StatATimeAsTime returns st.Atim as a time.Time +func StatATimeAsTime(st *syscall.Stat_t) time.Time { + return time.Unix(st.Atim.Unix()) +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/stat_darwinbsd.go b/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/stat_darwinbsd.go new file mode 100644 index 000000000..dbdb90ec8 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/stat_darwinbsd.go @@ -0,0 +1,45 @@ +//go:build darwin || freebsd || netbsd +// +build darwin freebsd netbsd + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package fs + +import ( + "syscall" + "time" +) + +// StatAtime returns the access time from a stat struct +func StatAtime(st *syscall.Stat_t) syscall.Timespec { + return st.Atimespec +} + +// StatCtime returns the created time from a stat struct +func StatCtime(st *syscall.Stat_t) syscall.Timespec { + return st.Ctimespec +} + +// StatMtime returns the modified time from a stat struct +func StatMtime(st *syscall.Stat_t) syscall.Timespec { + return st.Mtimespec +} + +// StatATimeAsTime returns the access time as a time.Time +func StatATimeAsTime(st *syscall.Stat_t) time.Time { + return time.Unix(st.Atimespec.Unix()) +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/time.go b/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/time.go new file mode 100644 index 000000000..cde456123 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/time.go @@ -0,0 +1,29 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package fs + +import "time" + +// Gnu tar and the go tar writer don't have sub-second mtime +// precision, which is problematic when we apply changes via tar +// files, we handle this by comparing for exact times, *or* same +// second count and either a or b having exactly 0 nanoseconds +func sameFsTime(a, b time.Time) bool { + return a == b || + (a.Unix() == b.Unix() && + (a.Nanosecond() == 0 || b.Nanosecond() == 0)) +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/utimesnanoat.go b/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/utimesnanoat.go new file mode 100644 index 000000000..5435398d4 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/continuity/fs/utimesnanoat.go @@ -0,0 +1,33 @@ +//go:build !(windows || linux) +// +build !windows,!linux + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package fs + +import ( + "syscall" + + "golang.org/x/sys/unix" +) + +func utimesNano(name string, atime, mtime syscall.Timespec) error { + at := unix.NsecToTimespec(atime.Nano()) + mt := unix.NsecToTimespec(mtime.Nano()) + utimes := [2]unix.Timespec{at, mt} + return unix.UtimesNanoAt(unix.AT_FDCWD, name, utimes[0:], unix.AT_SYMLINK_NOFOLLOW) +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/fifo/.gitattributes b/src/cmd/linuxkit/vendor/github.com/containerd/fifo/.gitattributes new file mode 100644 index 000000000..d207b1802 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/fifo/.gitattributes @@ -0,0 +1 @@ +*.go text eol=lf diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/fifo/.gitignore b/src/cmd/linuxkit/vendor/github.com/containerd/fifo/.gitignore new file mode 100644 index 000000000..7f7bd6ac8 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/fifo/.gitignore @@ -0,0 +1,2 @@ +coverage.txt +vendor/ diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/fifo/.golangci.yml b/src/cmd/linuxkit/vendor/github.com/containerd/fifo/.golangci.yml new file mode 100644 index 000000000..fcba5e885 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/fifo/.golangci.yml @@ -0,0 +1,20 @@ +linters: + enable: + - structcheck + - varcheck + - staticcheck + - unconvert + - gofmt + - goimports + - golint + - ineffassign + - vet + - unused + - misspell + disable: + - errcheck + +run: + timeout: 3m + skip-dirs: + - vendor diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/fifo/LICENSE b/src/cmd/linuxkit/vendor/github.com/containerd/fifo/LICENSE new file mode 100644 index 000000000..261eeb9e9 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/fifo/LICENSE @@ -0,0 +1,201 @@ + Apache License + Version 2.0, January 2004 + http://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + APPENDIX: How to apply the Apache License to your work. + + To apply the Apache License to your work, attach the following + boilerplate notice, with the fields enclosed by brackets "[]" + replaced with your own identifying information. (Don't include + the brackets!) The text should be enclosed in the appropriate + comment syntax for the file format. We also recommend that a + file or class name and description of purpose be included on the + same "printed page" as the copyright notice for easier + identification within third-party archives. + + Copyright [yyyy] [name of copyright owner] + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/fifo/Makefile b/src/cmd/linuxkit/vendor/github.com/containerd/fifo/Makefile new file mode 100644 index 000000000..40c5046a9 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/fifo/Makefile @@ -0,0 +1,24 @@ +# Copyright The containerd Authors. + +# Licensed under the Apache License, Version 2.0 (the "License"); +# you may not use this file except in compliance with the License. +# You may obtain a copy of the License at + +# http://www.apache.org/licenses/LICENSE-2.0 + +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, +# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +# See the License for the specific language governing permissions and +# limitations under the License. + +.PHONY: check test deps + +test: deps + go test -v -race ./... + +deps: + go mod vendor + +check: + GOGC=75 golangci-lint run diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/fifo/errors.go b/src/cmd/linuxkit/vendor/github.com/containerd/fifo/errors.go new file mode 100644 index 000000000..50f73b2dc --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/fifo/errors.go @@ -0,0 +1,28 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package fifo + +import "errors" + +var ( + ErrClosed = errors.New("fifo closed") + ErrCtrlClosed = errors.New("control of closed fifo") + ErrRdFrmWRONLY = errors.New("reading from write-only fifo") + ErrReadClosed = errors.New("reading from a closed fifo") + ErrWrToRDONLY = errors.New("writing to read-only fifo") + ErrWriteClosed = errors.New("writing to a closed fifo") +) diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/fifo/fifo.go b/src/cmd/linuxkit/vendor/github.com/containerd/fifo/fifo.go new file mode 100644 index 000000000..45a9b3840 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/fifo/fifo.go @@ -0,0 +1,258 @@ +// +build !windows + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package fifo + +import ( + "context" + "io" + "os" + "runtime" + "sync" + "syscall" + + "github.com/pkg/errors" + "golang.org/x/sys/unix" +) + +type fifo struct { + flag int + opened chan struct{} + closed chan struct{} + closing chan struct{} + err error + file *os.File + closingOnce sync.Once // close has been called + closedOnce sync.Once // fifo is closed + handle *handle +} + +var leakCheckWg *sync.WaitGroup + +// OpenFifoDup2 is same as OpenFifo, but additionally creates a copy of the FIFO file descriptor with dup2 syscall. +func OpenFifoDup2(ctx context.Context, fn string, flag int, perm os.FileMode, fd int) (io.ReadWriteCloser, error) { + f, err := openFifo(ctx, fn, flag, perm) + if err != nil { + return nil, errors.Wrap(err, "fifo error") + } + + if err := unix.Dup2(int(f.file.Fd()), fd); err != nil { + _ = f.Close() + return nil, errors.Wrap(err, "dup2 error") + } + + return f, nil +} + +// OpenFifo opens a fifo. Returns io.ReadWriteCloser. +// Context can be used to cancel this function until open(2) has not returned. +// Accepted flags: +// - syscall.O_CREAT - create new fifo if one doesn't exist +// - syscall.O_RDONLY - open fifo only from reader side +// - syscall.O_WRONLY - open fifo only from writer side +// - syscall.O_RDWR - open fifo from both sides, never block on syscall level +// - syscall.O_NONBLOCK - return io.ReadWriteCloser even if other side of the +// fifo isn't open. read/write will be connected after the actual fifo is +// open or after fifo is closed. +func OpenFifo(ctx context.Context, fn string, flag int, perm os.FileMode) (io.ReadWriteCloser, error) { + return openFifo(ctx, fn, flag, perm) +} + +func openFifo(ctx context.Context, fn string, flag int, perm os.FileMode) (*fifo, error) { + if _, err := os.Stat(fn); err != nil { + if os.IsNotExist(err) && flag&syscall.O_CREAT != 0 { + if err := syscall.Mkfifo(fn, uint32(perm&os.ModePerm)); err != nil && !os.IsExist(err) { + return nil, errors.Wrapf(err, "error creating fifo %v", fn) + } + } else { + return nil, err + } + } + + block := flag&syscall.O_NONBLOCK == 0 || flag&syscall.O_RDWR != 0 + + flag &= ^syscall.O_CREAT + flag &= ^syscall.O_NONBLOCK + + h, err := getHandle(fn) + if err != nil { + return nil, err + } + + f := &fifo{ + handle: h, + flag: flag, + opened: make(chan struct{}), + closed: make(chan struct{}), + closing: make(chan struct{}), + } + + wg := leakCheckWg + if wg != nil { + wg.Add(2) + } + + go func() { + if wg != nil { + defer wg.Done() + } + select { + case <-ctx.Done(): + select { + case <-f.opened: + default: + f.Close() + } + case <-f.opened: + case <-f.closed: + } + }() + go func() { + if wg != nil { + defer wg.Done() + } + var file *os.File + fn, err := h.Path() + if err == nil { + file, err = os.OpenFile(fn, flag, 0) + } + select { + case <-f.closing: + if err == nil { + select { + case <-ctx.Done(): + err = ctx.Err() + default: + err = errors.Errorf("fifo %v was closed before opening", h.Name()) + } + if file != nil { + file.Close() + } + } + default: + } + if err != nil { + f.closedOnce.Do(func() { + f.err = err + close(f.closed) + }) + return + } + f.file = file + close(f.opened) + }() + if block { + select { + case <-f.opened: + case <-f.closed: + return nil, f.err + } + } + return f, nil +} + +// Read from a fifo to a byte array. +func (f *fifo) Read(b []byte) (int, error) { + if f.flag&syscall.O_WRONLY > 0 { + return 0, ErrRdFrmWRONLY + } + select { + case <-f.opened: + return f.file.Read(b) + default: + } + select { + case <-f.opened: + return f.file.Read(b) + case <-f.closed: + return 0, ErrReadClosed + } +} + +// Write from byte array to a fifo. +func (f *fifo) Write(b []byte) (int, error) { + if f.flag&(syscall.O_WRONLY|syscall.O_RDWR) == 0 { + return 0, ErrWrToRDONLY + } + select { + case <-f.opened: + return f.file.Write(b) + default: + } + select { + case <-f.opened: + return f.file.Write(b) + case <-f.closed: + return 0, ErrWriteClosed + } +} + +// Close the fifo. Next reads/writes will error. This method can also be used +// before open(2) has returned and fifo was never opened. +func (f *fifo) Close() (retErr error) { + for { + select { + case <-f.closed: + f.handle.Close() + return + default: + select { + case <-f.opened: + f.closedOnce.Do(func() { + retErr = f.file.Close() + f.err = retErr + close(f.closed) + }) + default: + if f.flag&syscall.O_RDWR != 0 { + runtime.Gosched() + break + } + f.closingOnce.Do(func() { + close(f.closing) + }) + reverseMode := syscall.O_WRONLY + if f.flag&syscall.O_WRONLY > 0 { + reverseMode = syscall.O_RDONLY + } + fn, err := f.handle.Path() + // if Close() is called concurrently(shouldn't) it may cause error + // because handle is closed + select { + case <-f.closed: + default: + if err != nil { + // Path has become invalid. We will leak a goroutine. + // This case should not happen in linux. + f.closedOnce.Do(func() { + f.err = err + close(f.closed) + }) + <-f.closed + break + } + f, err := os.OpenFile(fn, reverseMode|syscall.O_NONBLOCK, 0) + if err == nil { + f.Close() + } + runtime.Gosched() + } + } + } + } +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/fifo/handle_linux.go b/src/cmd/linuxkit/vendor/github.com/containerd/fifo/handle_linux.go new file mode 100644 index 000000000..0ee2c9fee --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/fifo/handle_linux.go @@ -0,0 +1,100 @@ +// +build linux + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package fifo + +import ( + "fmt" + "os" + "sync" + "syscall" + + "github.com/pkg/errors" +) + +//nolint:golint +const O_PATH = 010000000 + +type handle struct { + f *os.File + fd uintptr + dev uint64 + ino uint64 + closeOnce sync.Once + name string +} + +func getHandle(fn string) (*handle, error) { + f, err := os.OpenFile(fn, O_PATH, 0) + if err != nil { + return nil, errors.Wrapf(err, "failed to open %v with O_PATH", fn) + } + + var ( + stat syscall.Stat_t + fd = f.Fd() + ) + if err := syscall.Fstat(int(fd), &stat); err != nil { + f.Close() + return nil, errors.Wrapf(err, "failed to stat handle %v", fd) + } + + h := &handle{ + f: f, + name: fn, + //nolint:unconvert + dev: uint64(stat.Dev), + ino: stat.Ino, + fd: fd, + } + + // check /proc just in case + if _, err := os.Stat(h.procPath()); err != nil { + f.Close() + return nil, errors.Wrapf(err, "couldn't stat %v", h.procPath()) + } + + return h, nil +} + +func (h *handle) procPath() string { + return fmt.Sprintf("/proc/self/fd/%d", h.fd) +} + +func (h *handle) Name() string { + return h.name +} + +func (h *handle) Path() (string, error) { + var stat syscall.Stat_t + if err := syscall.Stat(h.procPath(), &stat); err != nil { + return "", errors.Wrapf(err, "path %v could not be statted", h.procPath()) + } + //nolint:unconvert + if uint64(stat.Dev) != h.dev || stat.Ino != h.ino { + return "", errors.Errorf("failed to verify handle %v/%v %v/%v", stat.Dev, h.dev, stat.Ino, h.ino) + } + return h.procPath(), nil +} + +func (h *handle) Close() error { + h.closeOnce.Do(func() { + h.f.Close() + }) + return nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/fifo/handle_nolinux.go b/src/cmd/linuxkit/vendor/github.com/containerd/fifo/handle_nolinux.go new file mode 100644 index 000000000..81ca308fe --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/fifo/handle_nolinux.go @@ -0,0 +1,65 @@ +// +build !linux,!windows + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package fifo + +import ( + "syscall" + + "github.com/pkg/errors" +) + +type handle struct { + fn string + dev uint64 + ino uint64 +} + +func getHandle(fn string) (*handle, error) { + var stat syscall.Stat_t + if err := syscall.Stat(fn, &stat); err != nil { + return nil, errors.Wrapf(err, "failed to stat %v", fn) + } + + h := &handle{ + fn: fn, + dev: uint64(stat.Dev), //nolint: unconvert + ino: uint64(stat.Ino), //nolint: unconvert + } + + return h, nil +} + +func (h *handle) Path() (string, error) { + var stat syscall.Stat_t + if err := syscall.Stat(h.fn, &stat); err != nil { + return "", errors.Wrapf(err, "path %v could not be statted", h.fn) + } + if uint64(stat.Dev) != h.dev || uint64(stat.Ino) != h.ino { //nolint: unconvert + return "", errors.Errorf("failed to verify handle %v/%v %v/%v for %v", stat.Dev, h.dev, stat.Ino, h.ino, h.fn) + } + return h.fn, nil +} + +func (h *handle) Name() string { + return h.fn +} + +func (h *handle) Close() error { + return nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/fifo/raw.go b/src/cmd/linuxkit/vendor/github.com/containerd/fifo/raw.go new file mode 100644 index 000000000..cead94ca2 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/fifo/raw.go @@ -0,0 +1,114 @@ +// +build !windows + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package fifo + +import ( + "syscall" +) + +// SyscallConn provides raw access to the fifo's underlying filedescrptor. +// See syscall.Conn for guarantees provided by this interface. +func (f *fifo) SyscallConn() (syscall.RawConn, error) { + // deterministic check for closed + select { + case <-f.closed: + return nil, ErrClosed + default: + } + + select { + case <-f.closed: + return nil, ErrClosed + case <-f.opened: + return f.file.SyscallConn() + default: + } + + // Not opened and not closed, this means open is non-blocking AND it's not open yet + // Use rawConn to deal with non-blocking open. + rc := &rawConn{f: f, ready: make(chan struct{})} + go func() { + select { + case <-f.closed: + return + case <-f.opened: + rc.raw, rc.err = f.file.SyscallConn() + close(rc.ready) + } + }() + + return rc, nil +} + +type rawConn struct { + f *fifo + ready chan struct{} + raw syscall.RawConn + err error +} + +func (r *rawConn) Control(f func(fd uintptr)) error { + select { + case <-r.f.closed: + return ErrCtrlClosed + case <-r.ready: + } + + if r.err != nil { + return r.err + } + + return r.raw.Control(f) +} + +func (r *rawConn) Read(f func(fd uintptr) (done bool)) error { + if r.f.flag&syscall.O_WRONLY > 0 { + return ErrRdFrmWRONLY + } + + select { + case <-r.f.closed: + return ErrReadClosed + case <-r.ready: + } + + if r.err != nil { + return r.err + } + + return r.raw.Read(f) +} + +func (r *rawConn) Write(f func(fd uintptr) (done bool)) error { + if r.f.flag&(syscall.O_WRONLY|syscall.O_RDWR) == 0 { + return ErrWrToRDONLY + } + + select { + case <-r.f.closed: + return ErrWriteClosed + case <-r.ready: + } + + if r.err != nil { + return r.err + } + + return r.raw.Write(f) +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/fifo/readme.md b/src/cmd/linuxkit/vendor/github.com/containerd/fifo/readme.md new file mode 100644 index 000000000..ad4727dfe --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/fifo/readme.md @@ -0,0 +1,46 @@ +### fifo + +[![PkgGoDev](https://pkg.go.dev/badge/github.com/containerd/fifo)](https://pkg.go.dev/github.com/containerd/fifo) +[![Build Status](https://github.com/containerd/fifo/workflows/CI/badge.svg)](https://github.com/containerd/fifo/actions?query=workflow%3ACI) +[![codecov](https://codecov.io/gh/containerd/fifo/branch/master/graph/badge.svg)](https://codecov.io/gh/containerd/fifo) +[![Go Report Card](https://goreportcard.com/badge/github.com/containerd/fifo)](https://goreportcard.com/report/github.com/containerd/fifo) + +Go package for handling fifos in a sane way. + +``` +// OpenFifo opens a fifo. Returns io.ReadWriteCloser. +// Context can be used to cancel this function until open(2) has not returned. +// Accepted flags: +// - syscall.O_CREAT - create new fifo if one doesn't exist +// - syscall.O_RDONLY - open fifo only from reader side +// - syscall.O_WRONLY - open fifo only from writer side +// - syscall.O_RDWR - open fifo from both sides, never block on syscall level +// - syscall.O_NONBLOCK - return io.ReadWriteCloser even if other side of the +// fifo isn't open. read/write will be connected after the actual fifo is +// open or after fifo is closed. +func OpenFifo(ctx context.Context, fn string, flag int, perm os.FileMode) (io.ReadWriteCloser, error) + + +// Read from a fifo to a byte array. +func (f *fifo) Read(b []byte) (int, error) + + +// Write from byte array to a fifo. +func (f *fifo) Write(b []byte) (int, error) + + +// Close the fifo. Next reads/writes will error. This method can also be used +// before open(2) has returned and fifo was never opened. +func (f *fifo) Close() error +``` + +## Project details + +The fifo is a containerd sub-project, licensed under the [Apache 2.0 license](./LICENSE). +As a containerd sub-project, you will find the: + + * [Project governance](https://github.com/containerd/project/blob/master/GOVERNANCE.md), + * [Maintainers](https://github.com/containerd/project/blob/master/MAINTAINERS), + * and [Contributing guidelines](https://github.com/containerd/project/blob/master/CONTRIBUTING.md) + +information in our [`containerd/project`](https://github.com/containerd/project) repository. diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/fifo/utils.go b/src/cmd/linuxkit/vendor/github.com/containerd/fifo/utils.go new file mode 100644 index 000000000..bbdf79015 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/fifo/utils.go @@ -0,0 +1,35 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package fifo + +import "os" + +// IsFifo checks if a file is a (named pipe) fifo +// if the file does not exist then it returns false +func IsFifo(path string) (bool, error) { + stat, err := os.Stat(path) + if err != nil { + if os.IsNotExist(err) { + return false, nil + } + return false, err + } + if stat.Mode()&os.ModeNamedPipe == os.ModeNamedPipe { + return true, nil + } + return false, nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/nydus-snapshotter/LICENSE b/src/cmd/linuxkit/vendor/github.com/containerd/nydus-snapshotter/LICENSE new file mode 100644 index 000000000..d64569567 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/nydus-snapshotter/LICENSE @@ -0,0 +1,202 @@ + + Apache License + Version 2.0, January 2004 + http://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + APPENDIX: How to apply the Apache License to your work. + + To apply the Apache License to your work, attach the following + boilerplate notice, with the fields enclosed by brackets "[]" + replaced with your own identifying information. (Don't include + the brackets!) The text should be enclosed in the appropriate + comment syntax for the file format. We also recommend that a + file or class name and description of purpose be included on the + same "printed page" as the copyright notice for easier + identification within third-party archives. + + Copyright [yyyy] [name of copyright owner] + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/nydus-snapshotter/pkg/converter/constant.go b/src/cmd/linuxkit/vendor/github.com/containerd/nydus-snapshotter/pkg/converter/constant.go new file mode 100644 index 000000000..b7b9f2a2b --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/nydus-snapshotter/pkg/converter/constant.go @@ -0,0 +1,27 @@ +/* + * Copyright (c) 2022. Nydus Developers. All rights reserved. + * + * SPDX-License-Identifier: Apache-2.0 + */ + +package converter + +const ( + ManifestOSFeatureNydus = "nydus.remoteimage.v1" + MediaTypeNydusBlob = "application/vnd.oci.image.layer.nydus.blob.v1" + BootstrapFileNameInLayer = "image/image.boot" + + ManifestNydusCache = "containerd.io/snapshot/nydus-cache" + + LayerAnnotationFSVersion = "containerd.io/snapshot/nydus-fs-version" + LayerAnnotationNydusBlob = "containerd.io/snapshot/nydus-blob" + LayerAnnotationNydusBlobDigest = "containerd.io/snapshot/nydus-blob-digest" + LayerAnnotationNydusBlobSize = "containerd.io/snapshot/nydus-blob-size" + LayerAnnotationNydusBlobIDs = "containerd.io/snapshot/nydus-blob-ids" + LayerAnnotationNydusBootstrap = "containerd.io/snapshot/nydus-bootstrap" + LayerAnnotationNydusSourceChainID = "containerd.io/snapshot/nydus-source-chainid" + + LayerAnnotationNydusReferenceBlobIDs = "containerd.io/snapshot/nydus-reference-blob-ids" + + LayerAnnotationUncompressed = "containerd.io/uncompressed" +) diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/nydus-snapshotter/pkg/converter/convert_unix.go b/src/cmd/linuxkit/vendor/github.com/containerd/nydus-snapshotter/pkg/converter/convert_unix.go new file mode 100644 index 000000000..dc0130aef --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/nydus-snapshotter/pkg/converter/convert_unix.go @@ -0,0 +1,839 @@ +//go:build !windows +// +build !windows + +/* + * Copyright (c) 2022. Nydus Developers. All rights reserved. + * + * SPDX-License-Identifier: Apache-2.0 + */ + +package converter + +import ( + "archive/tar" + "compress/gzip" + "context" + "encoding/json" + "fmt" + "io" + "os" + "path/filepath" + "sync" + "syscall" + + "github.com/containerd/containerd/archive" + "github.com/containerd/containerd/archive/compression" + "github.com/containerd/containerd/content" + "github.com/containerd/containerd/images" + "github.com/containerd/containerd/images/converter" + "github.com/containerd/containerd/labels" + "github.com/containerd/fifo" + "github.com/opencontainers/go-digest" + "github.com/opencontainers/image-spec/identity" + ocispec "github.com/opencontainers/image-spec/specs-go/v1" + "github.com/pkg/errors" + "golang.org/x/sync/errgroup" + + "github.com/containerd/nydus-snapshotter/pkg/converter/tool" + "github.com/containerd/nydus-snapshotter/pkg/errdefs" +) + +const bootstrapNameInTar = "image.boot" +const blobNameInTar = "image.blob" + +const envNydusBuilder = "NYDUS_BUILDER" +const envNydusWorkDir = "NYDUS_WORKDIR" + +const configGCLabelKey = "containerd.io/gc.ref.content.config" + +var bufPool = sync.Pool{ + New: func() interface{} { + buffer := make([]byte, 1<<20) + return &buffer + }, +} + +func getBuilder(specifiedPath string) string { + if specifiedPath != "" { + return specifiedPath + } + + builderPath := os.Getenv(envNydusBuilder) + if builderPath != "" { + return builderPath + } + + return "nydus-image" +} + +func ensureWorkDir(specifiedBasePath string) (string, error) { + var baseWorkDir string + + if specifiedBasePath != "" { + baseWorkDir = specifiedBasePath + } else { + baseWorkDir = os.Getenv(envNydusWorkDir) + } + if baseWorkDir == "" { + baseWorkDir = os.TempDir() + } + + if err := os.MkdirAll(baseWorkDir, 0750); err != nil { + return "", errors.Wrapf(err, "create base directory %s", baseWorkDir) + } + + workDirPath, err := os.MkdirTemp(baseWorkDir, "nydus-converter-") + if err != nil { + return "", errors.Wrap(err, "create work directory") + } + + return workDirPath, nil +} + +// Unpack a OCI formatted tar stream into a directory. +func unpackOciTar(ctx context.Context, dst string, reader io.Reader) error { + ds, err := compression.DecompressStream(reader) + if err != nil { + return errors.Wrap(err, "unpack stream") + } + defer ds.Close() + + if _, err := archive.Apply( + ctx, + dst, + ds, + archive.WithConvertWhiteout(func(hdr *tar.Header, file string) (bool, error) { + // Keep to extract all whiteout files. + return true, nil + }), + ); err != nil { + return errors.Wrap(err, "apply with convert whiteout") + } + + return nil +} + +// Unpack a Nydus formatted tar stream into a directory. +func unpackNydusTar(ctx context.Context, bootDst, blobDst string, ra content.ReaderAt) error { + boot, err := os.OpenFile(bootDst, os.O_CREATE|os.O_WRONLY|os.O_TRUNC, 0644) + if err != nil { + return errors.Wrapf(err, "write to bootstrap %s", bootDst) + } + defer boot.Close() + + if err = unpackBootstrapFromNydusTar(ctx, ra, boot); err != nil { + return errors.Wrap(err, "unpack bootstrap from nydus") + } + + blob, err := os.OpenFile(blobDst, os.O_CREATE|os.O_WRONLY|os.O_TRUNC, 0644) + if err != nil { + return errors.Wrapf(err, "write to blob %s", blobDst) + } + defer blob.Close() + + if err = unpackBlobFromNydusTar(ctx, ra, blob); err != nil { + return errors.Wrap(err, "unpack blob from nydus") + } + + return nil +} + +// Unpack the bootstrap from nydus formatted tar stream (blob + bootstrap). +// The nydus formatted tar stream is a tar-like structure that arranges the +// data as follows: +// +// `blob_data | blob_tar_header | bootstrap_data | bootstrap_tar_header` +func unpackBootstrapFromNydusTar(ctx context.Context, ra content.ReaderAt, target io.Writer) error { + cur := ra.Size() + reader := newSeekReader(ra) + + const headerSize = 512 + + // Seek from tail to head of nydus formatted tar stream to find nydus + // bootstrap data. + for { + if headerSize > cur { + return fmt.Errorf("invalid tar format at pos %d", cur) + } + + // Try to seek to the part of tar header. + var err error + cur, err = reader.Seek(cur-headerSize, io.SeekCurrent) + if err != nil { + return errors.Wrapf(err, "seek to %d for tar header", cur-headerSize) + } + + tr := tar.NewReader(reader) + // Parse tar header. + hdr, err := tr.Next() + if err != nil { + return errors.Wrap(err, "parse tar header") + } + + if hdr.Name == bootstrapNameInTar { + // Try to seek to the part of tar data (bootstrap_data). + if hdr.Size > cur { + return fmt.Errorf("invalid tar format at pos %d", cur) + } + bootstrapOffset := cur - hdr.Size + _, err = reader.Seek(bootstrapOffset, io.SeekStart) + if err != nil { + return errors.Wrap(err, "seek to bootstrap data offset") + } + + // Copy tar data (bootstrap_data) to provided target writer. + if _, err := io.CopyN(target, reader, hdr.Size); err != nil { + return errors.Wrap(err, "copy bootstrap data to reader") + } + + return nil + } + + if cur == hdr.Size { + break + } + } + + return fmt.Errorf("can't find bootstrap in nydus tar") +} + +// Unpack the blob from nydus formatted tar stream (blob + bootstrap). +// The nydus formatted tar stream is a tar-like structure that arranges the +// data as follows: +// +// `blob_data | blob_tar_header | bootstrap_data | bootstrap_tar_header` +func unpackBlobFromNydusTar(ctx context.Context, ra content.ReaderAt, target io.Writer) error { + cur := ra.Size() + reader := newSeekReader(ra) + + const headerSize = 512 + + // Seek from tail to head of nydus formatted tar stream to find nydus + // bootstrap data. + for { + if headerSize > cur { + break + } + + // Try to seek to the part of tar header. + var err error + cur, err = reader.Seek(cur-headerSize, io.SeekStart) + if err != nil { + return errors.Wrapf(err, "seek to %d for tar header", cur-headerSize) + } + + tr := tar.NewReader(reader) + // Parse tar header. + hdr, err := tr.Next() + if err != nil { + return errors.Wrap(err, "parse tar header") + } + + if hdr.Name == bootstrapNameInTar { + if hdr.Size > cur { + return fmt.Errorf("invalid tar format at pos %d", cur) + } + cur, err = reader.Seek(cur-hdr.Size, io.SeekStart) + if err != nil { + return errors.Wrap(err, "seek to bootstrap data offset") + } + } else if hdr.Name == blobNameInTar { + if hdr.Size > cur { + return fmt.Errorf("invalid tar format at pos %d", cur) + } + _, err = reader.Seek(cur-hdr.Size, io.SeekStart) + if err != nil { + return errors.Wrap(err, "seek to blob data offset") + } + if _, err := io.CopyN(target, reader, hdr.Size); err != nil { + return errors.Wrap(err, "copy blob data to reader") + } + return nil + } + } + + return nil +} + +// Pack converts an OCI tar stream to nydus formatted stream with a tar-like +// structure that arranges the data as follows: +// +// `blob_data | blob_tar_header | bootstrap_data | bootstrap_tar_header` +// +// The caller should write OCI tar stream into the returned `io.WriteCloser`, +// then the Pack method will write the nydus formatted stream to `dest` +// provided by the caller. +// +// Important: the caller must check `io.WriteCloser.Close() == nil` to ensure +// the conversion workflow is finished. +func Pack(ctx context.Context, dest io.Writer, opt PackOption) (io.WriteCloser, error) { + workDir, err := ensureWorkDir(opt.WorkDir) + if err != nil { + return nil, errors.Wrap(err, "ensure work directory") + } + defer func() { + if err != nil { + os.RemoveAll(workDir) + } + }() + + sourceDir := filepath.Join(workDir, "source") + if err := os.MkdirAll(sourceDir, 0755); err != nil { + return nil, errors.Wrap(err, "create source directory") + } + + pr, pw := io.Pipe() + + unpackDone := make(chan bool, 1) + go func() { + if err := unpackOciTar(ctx, sourceDir, pr); err != nil { + pr.CloseWithError(errors.Wrapf(err, "unpack to %s", sourceDir)) + close(unpackDone) + return + } + unpackDone <- true + }() + + wc := newWriteCloser(pw, func() error { + defer func() { + os.RemoveAll(workDir) + }() + + // Because PipeWriter#Close is called does not mean that the PipeReader + // has finished reading all the data, and unpack may not be complete yet, + // so we need to wait for that here. + <-unpackDone + + blobPath := filepath.Join(workDir, "blob") + blobFifo, err := fifo.OpenFifo(ctx, blobPath, syscall.O_CREAT|syscall.O_RDONLY|syscall.O_NONBLOCK, 0644) + if err != nil { + return errors.Wrapf(err, "create fifo file") + } + defer blobFifo.Close() + + go func() { + err := tool.Pack(tool.PackOption{ + BuilderPath: getBuilder(opt.BuilderPath), + + BlobPath: blobPath, + FsVersion: opt.FsVersion, + SourcePath: sourceDir, + ChunkDictPath: opt.ChunkDictPath, + PrefetchPatterns: opt.PrefetchPatterns, + Compressor: opt.Compressor, + Timeout: opt.Timeout, + }) + if err != nil { + pw.CloseWithError(errors.Wrapf(err, "convert blob for %s", sourceDir)) + blobFifo.Close() + } + }() + + buffer := bufPool.Get().(*[]byte) + defer bufPool.Put(buffer) + if _, err := io.CopyBuffer(dest, blobFifo, *buffer); err != nil { + return errors.Wrap(err, "pack nydus tar") + } + + return nil + }) + + return wc, nil +} + +// Merge multiple nydus bootstraps (from each layer of image) to a final +// bootstrap. And due to the possibility of enabling the `ChunkDictPath` +// option causes the data deduplication, it will return the actual blob +// digests referenced by the bootstrap. +func Merge(ctx context.Context, layers []Layer, dest io.Writer, opt MergeOption) ([]digest.Digest, error) { + workDir, err := ensureWorkDir(opt.WorkDir) + if err != nil { + return nil, errors.Wrap(err, "ensure work directory") + } + defer os.RemoveAll(workDir) + + eg, ctx := errgroup.WithContext(ctx) + sourceBootstrapPaths := []string{} + for idx := range layers { + sourceBootstrapPaths = append(sourceBootstrapPaths, filepath.Join(workDir, layers[idx].Digest.Hex())) + eg.Go(func(idx int) func() error { + return func() error { + layer := layers[idx] + + // Use the hex hash string of whole tar blob as the bootstrap name. + bootstrap, err := os.Create(filepath.Join(workDir, layer.Digest.Hex())) + if err != nil { + return errors.Wrap(err, "create source bootstrap") + } + defer bootstrap.Close() + + if err := unpackBootstrapFromNydusTar(ctx, layer.ReaderAt, bootstrap); err != nil { + return errors.Wrap(err, "unpack nydus tar") + } + + return nil + } + }(idx)) + } + + if err := eg.Wait(); err != nil { + return nil, errors.Wrap(err, "unpack all bootstraps") + } + + targetBootstrapPath := filepath.Join(workDir, "bootstrap") + + blobDigests, err := tool.Merge(tool.MergeOption{ + BuilderPath: getBuilder(opt.BuilderPath), + + SourceBootstrapPaths: sourceBootstrapPaths, + TargetBootstrapPath: targetBootstrapPath, + ChunkDictPath: opt.ChunkDictPath, + PrefetchPatterns: opt.PrefetchPatterns, + OutputJSONPath: filepath.Join(workDir, "merge-output.json"), + Timeout: opt.Timeout, + }) + if err != nil { + return nil, errors.Wrap(err, "merge bootstrap") + } + + var rc io.ReadCloser + + if opt.WithTar { + rc, err = packToTar(targetBootstrapPath, fmt.Sprintf("image/%s", bootstrapNameInTar), false) + if err != nil { + return nil, errors.Wrap(err, "pack bootstrap to tar") + } + } else { + rc, err = os.Open(targetBootstrapPath) + if err != nil { + return nil, errors.Wrap(err, "open targe bootstrap") + } + } + defer rc.Close() + + buffer := bufPool.Get().(*[]byte) + defer bufPool.Put(buffer) + if _, err = io.CopyBuffer(dest, rc, *buffer); err != nil { + return nil, errors.Wrap(err, "copy merged bootstrap") + } + + return blobDigests, nil +} + +// Unpack converts a nydus blob layer to OCI formatted tar stream. +func Unpack(ctx context.Context, ra content.ReaderAt, dest io.Writer, opt UnpackOption) error { + workDir, err := ensureWorkDir(opt.WorkDir) + if err != nil { + return errors.Wrap(err, "ensure work directory") + } + defer os.RemoveAll(workDir) + + bootPath, blobPath := filepath.Join(workDir, bootstrapNameInTar), filepath.Join(workDir, blobNameInTar) + if err = unpackNydusTar(ctx, bootPath, blobPath, ra); err != nil { + return errors.Wrap(err, "unpack nydus tar") + } + + tarPath := filepath.Join(workDir, "oci.tar") + blobFifo, err := fifo.OpenFifo(ctx, tarPath, syscall.O_CREAT|syscall.O_RDONLY|syscall.O_NONBLOCK, 0644) + if err != nil { + return errors.Wrapf(err, "create fifo file") + } + defer blobFifo.Close() + + unpackErrChan := make(chan error) + go func() { + defer close(unpackErrChan) + err := tool.Unpack(tool.UnpackOption{ + BuilderPath: getBuilder(opt.BuilderPath), + BootstrapPath: bootPath, + BlobPath: blobPath, + TarPath: tarPath, + Timeout: opt.Timeout, + }) + if err != nil { + blobFifo.Close() + unpackErrChan <- err + } + }() + + buffer := bufPool.Get().(*[]byte) + defer bufPool.Put(buffer) + if _, err := io.CopyBuffer(dest, blobFifo, *buffer); err != nil { + if unpackErr := <-unpackErrChan; unpackErr != nil { + return errors.Wrap(unpackErr, "unpack") + } + return errors.Wrap(err, "copy oci tar") + } + + return nil +} + +// IsNydusBlobAndExists returns true when the specified digest of content exists in +// the content store and it's nydus blob format. +func IsNydusBlobAndExists(ctx context.Context, cs content.Store, desc ocispec.Descriptor) bool { + _, err := cs.Info(ctx, desc.Digest) + if err != nil { + return false + } + + return IsNydusBlob(ctx, desc) +} + +// IsNydusBlob returns true when the specified descriptor is nydus blob format. +func IsNydusBlob(ctx context.Context, desc ocispec.Descriptor) bool { + if desc.Annotations == nil { + return false + } + + _, hasAnno := desc.Annotations[LayerAnnotationNydusBlob] + return hasAnno +} + +// LayerConvertFunc returns a function which converts an OCI image layer to +// a nydus blob layer, and set the media type to "application/vnd.oci.image.layer.nydus.blob.v1". +func LayerConvertFunc(opt PackOption) converter.ConvertFunc { + return func(ctx context.Context, cs content.Store, desc ocispec.Descriptor) (*ocispec.Descriptor, error) { + if !images.IsLayerType(desc.MediaType) { + return nil, nil + } + + ra, err := cs.ReaderAt(ctx, desc) + if err != nil { + return nil, errors.Wrap(err, "get source blob reader") + } + defer ra.Close() + rdr := io.NewSectionReader(ra, 0, ra.Size()) + + ref := fmt.Sprintf("convert-nydus-from-%s", desc.Digest) + dst, err := content.OpenWriter(ctx, cs, content.WithRef(ref)) + if err != nil { + return nil, errors.Wrap(err, "open blob writer") + } + defer dst.Close() + + tr, err := compression.DecompressStream(rdr) + if err != nil { + return nil, errors.Wrap(err, "decompress blob stream") + } + + digester := digest.SHA256.Digester() + pr, pw := io.Pipe() + tw, err := Pack(ctx, io.MultiWriter(pw, digester.Hash()), opt) + if err != nil { + return nil, errors.Wrap(err, "pack tar to nydus") + } + + go func() { + defer pw.Close() + buffer := bufPool.Get().(*[]byte) + defer bufPool.Put(buffer) + if _, err := io.CopyBuffer(tw, tr, *buffer); err != nil { + pw.CloseWithError(err) + return + } + if err := tr.Close(); err != nil { + pw.CloseWithError(err) + return + } + if err := tw.Close(); err != nil { + pw.CloseWithError(err) + return + } + }() + + if err := content.Copy(ctx, dst, pr, 0, ""); err != nil { + return nil, errors.Wrap(err, "copy nydus blob to content store") + } + + blobDigest := digester.Digest() + info, err := cs.Info(ctx, blobDigest) + if err != nil { + return nil, errors.Wrapf(err, "get blob info %s", blobDigest) + } + if info.Labels == nil { + info.Labels = map[string]string{} + } + // Write a diff id label of layer in content store for simplifying + // diff id calculation to speed up the conversion. + // See: https://github.com/containerd/containerd/blob/e4fefea5544d259177abb85b64e428702ac49c97/images/diffid.go#L49 + info.Labels[labels.LabelUncompressed] = blobDigest.String() + _, err = cs.Update(ctx, info) + if err != nil { + return nil, errors.Wrap(err, "update layer label") + } + + newDesc := ocispec.Descriptor{ + Digest: blobDigest, + Size: info.Size, + MediaType: MediaTypeNydusBlob, + Annotations: map[string]string{ + // Use `containerd.io/uncompressed` to generate DiffID of + // layer defined in OCI spec. + LayerAnnotationUncompressed: blobDigest.String(), + LayerAnnotationNydusBlob: "true", + }, + } + + if opt.Backend != nil { + blobRa, err := cs.ReaderAt(ctx, newDesc) + if err != nil { + return nil, errors.Wrap(err, "get nydus blob reader") + } + defer blobRa.Close() + + if err := opt.Backend.Push(ctx, blobRa, blobDigest); err != nil { + return nil, errors.Wrap(err, "push to storage backend") + } + } + + return &newDesc, nil + } +} + +// ConvertHookFunc returns a function which will be used as a callback +// called for each blob after conversion is done. The function only hooks +// the index conversion and the manifest conversion. +func ConvertHookFunc(opt MergeOption) converter.ConvertHookFunc { + return func(ctx context.Context, cs content.Store, orgDesc ocispec.Descriptor, newDesc *ocispec.Descriptor) (*ocispec.Descriptor, error) { + switch { + case images.IsIndexType(newDesc.MediaType): + return convertIndex(ctx, cs, orgDesc, newDesc) + case images.IsManifestType(newDesc.MediaType): + return convertManifest(ctx, cs, newDesc, opt) + default: + return newDesc, nil + } + } +} + +// convertIndex modifies the original index by appending "nydus.remoteimage.v1" +// to the Platform.OSFeatures of each modified manifest descriptors. +func convertIndex(ctx context.Context, cs content.Store, orgDesc ocispec.Descriptor, newDesc *ocispec.Descriptor) (*ocispec.Descriptor, error) { + var orgIndex ocispec.Index + if _, err := readJSON(ctx, cs, &orgIndex, orgDesc); err != nil { + return nil, errors.Wrap(err, "read target image index json") + } + // isManifestModified is a function to check whether the manifest is modified. + isManifestModified := func(manifest ocispec.Descriptor) bool { + for _, oldManifest := range orgIndex.Manifests { + if manifest.Digest == oldManifest.Digest { + return false + } + } + return true + } + + var index ocispec.Index + indexLabels, err := readJSON(ctx, cs, &index, *newDesc) + if err != nil { + return nil, errors.Wrap(err, "read index json") + } + for i, manifest := range index.Manifests { + if !isManifestModified(manifest) { + // Skip the manifest which is not modified. + continue + } + manifest.Platform.OSFeatures = append(manifest.Platform.OSFeatures, ManifestOSFeatureNydus) + index.Manifests[i] = manifest + } + // Update image index in content store. + newIndexDesc, err := writeJSON(ctx, cs, index, *newDesc, indexLabels) + if err != nil { + return nil, errors.Wrap(err, "write index json") + } + return newIndexDesc, nil +} + +// convertManifest merges all the nydus blob layers into a +// nydus bootstrap layer, update the image config, +// and modify the image manifest. +func convertManifest(ctx context.Context, cs content.Store, newDesc *ocispec.Descriptor, opt MergeOption) (*ocispec.Descriptor, error) { + var manifest ocispec.Manifest + manifestDesc := *newDesc + manifestLabels, err := readJSON(ctx, cs, &manifest, manifestDesc) + if err != nil { + return nil, errors.Wrap(err, "read manifest json") + } + + // Append bootstrap layer to manifest. + bootstrapDesc, blobDescs, err := MergeLayers(ctx, cs, manifest.Layers, MergeOption{ + BuilderPath: opt.BuilderPath, + WorkDir: opt.WorkDir, + ChunkDictPath: opt.ChunkDictPath, + FsVersion: opt.FsVersion, + WithTar: true, + }) + if err != nil { + return nil, errors.Wrap(err, "merge nydus layers") + } + if opt.Backend != nil { + // Only append nydus bootstrap layer into manifest, and do not put nydus + // blob layer into manifest if blob storage backend is specified. + manifest.Layers = []ocispec.Descriptor{*bootstrapDesc} + } else { + for idx, blobDesc := range blobDescs { + blobGCLabelKey := fmt.Sprintf("containerd.io/gc.ref.content.l.%d", idx) + manifestLabels[blobGCLabelKey] = blobDesc.Digest.String() + } + // Affected by chunk dict, the blob list referenced by final bootstrap + // are from different layers, part of them are from original layers, part + // from chunk dict bootstrap, so we need to rewrite manifest's layers here. + manifest.Layers = append(blobDescs, *bootstrapDesc) + } + + // Update the gc label of bootstrap layer + bootstrapGCLabelKey := fmt.Sprintf("containerd.io/gc.ref.content.l.%d", len(manifest.Layers)-1) + manifestLabels[bootstrapGCLabelKey] = bootstrapDesc.Digest.String() + + // Rewrite diff ids and remove useless annotation. + var config ocispec.Image + configLabels, err := readJSON(ctx, cs, &config, manifest.Config) + if err != nil { + return nil, errors.Wrap(err, "read image config") + } + if opt.Backend != nil { + config.RootFS.DiffIDs = []digest.Digest{digest.Digest(bootstrapDesc.Annotations[LayerAnnotationUncompressed])} + } else { + config.RootFS.DiffIDs = make([]digest.Digest, 0, len(manifest.Layers)) + for i, layer := range manifest.Layers { + config.RootFS.DiffIDs = append(config.RootFS.DiffIDs, digest.Digest(layer.Annotations[LayerAnnotationUncompressed])) + // Remove useless annotation. + delete(manifest.Layers[i].Annotations, LayerAnnotationUncompressed) + } + } + // Update image config in content store. + newConfigDesc, err := writeJSON(ctx, cs, config, manifest.Config, configLabels) + if err != nil { + return nil, errors.Wrap(err, "write image config") + } + manifest.Config = *newConfigDesc + // Update the config gc label + manifestLabels[configGCLabelKey] = newConfigDesc.Digest.String() + + // Update image manifest in content store. + newManifestDesc, err := writeJSON(ctx, cs, manifest, manifestDesc, manifestLabels) + if err != nil { + return nil, errors.Wrap(err, "write manifest") + } + + return newManifestDesc, nil +} + +// MergeLayers merges a list of nydus blob layer into a nydus bootstrap layer. +// The media type of the nydus bootstrap layer is "application/vnd.oci.image.layer.v1.tar+gzip". +func MergeLayers(ctx context.Context, cs content.Store, descs []ocispec.Descriptor, opt MergeOption) (*ocispec.Descriptor, []ocispec.Descriptor, error) { + // Extracts nydus bootstrap from nydus format for each layer. + layers := []Layer{} + + var chainID digest.Digest + for _, blobDesc := range descs { + ra, err := cs.ReaderAt(ctx, blobDesc) + if err != nil { + return nil, nil, errors.Wrapf(err, "get reader for blob %q", blobDesc.Digest) + } + defer ra.Close() + layers = append(layers, Layer{ + Digest: blobDesc.Digest, + ReaderAt: ra, + }) + if chainID == "" { + chainID = identity.ChainID([]digest.Digest{blobDesc.Digest}) + } else { + chainID = identity.ChainID([]digest.Digest{chainID, blobDesc.Digest}) + } + } + + // Merge all nydus bootstraps into a final nydus bootstrap. + pr, pw := io.Pipe() + blobDigestChan := make(chan []digest.Digest, 1) + go func() { + defer pw.Close() + blobDigests, err := Merge(ctx, layers, pw, opt) + if err != nil { + pw.CloseWithError(errors.Wrapf(err, "merge nydus bootstrap")) + } + blobDigestChan <- blobDigests + }() + + // Compress final nydus bootstrap to tar.gz and write into content store. + cw, err := content.OpenWriter(ctx, cs, content.WithRef("nydus-merge-"+chainID.String())) + if err != nil { + return nil, nil, errors.Wrap(err, "open content store writer") + } + defer cw.Close() + + gw := gzip.NewWriter(cw) + uncompressedDgst := digest.SHA256.Digester() + compressed := io.MultiWriter(gw, uncompressedDgst.Hash()) + buffer := bufPool.Get().(*[]byte) + defer bufPool.Put(buffer) + if _, err := io.CopyBuffer(compressed, pr, *buffer); err != nil { + return nil, nil, errors.Wrapf(err, "copy bootstrap targz into content store") + } + if err := gw.Close(); err != nil { + return nil, nil, errors.Wrap(err, "close gzip writer") + } + + compressedDgst := cw.Digest() + if err := cw.Commit(ctx, 0, compressedDgst, content.WithLabels(map[string]string{ + LayerAnnotationUncompressed: uncompressedDgst.Digest().String(), + })); err != nil { + if !errdefs.IsAlreadyExists(err) { + return nil, nil, errors.Wrap(err, "commit to content store") + } + } + if err := cw.Close(); err != nil { + return nil, nil, errors.Wrap(err, "close content store writer") + } + + bootstrapInfo, err := cs.Info(ctx, compressedDgst) + if err != nil { + return nil, nil, errors.Wrap(err, "get info from content store") + } + + blobDigests := <-blobDigestChan + blobDescs := []ocispec.Descriptor{} + blobIDs := []string{} + for _, blobDigest := range blobDigests { + blobInfo, err := cs.Info(ctx, blobDigest) + if err != nil { + return nil, nil, errors.Wrap(err, "get info from content store") + } + blobDesc := ocispec.Descriptor{ + Digest: blobDigest, + Size: blobInfo.Size, + MediaType: MediaTypeNydusBlob, + Annotations: map[string]string{ + LayerAnnotationUncompressed: blobDigest.String(), + LayerAnnotationNydusBlob: "true", + }, + } + blobDescs = append(blobDescs, blobDesc) + blobIDs = append(blobIDs, blobDigest.Hex()) + } + + blobIDsBytes, err := json.Marshal(blobIDs) + if err != nil { + return nil, nil, errors.Wrap(err, "marshal blob ids") + } + + if opt.FsVersion == "" { + opt.FsVersion = "5" + } + + bootstrapDesc := ocispec.Descriptor{ + Digest: compressedDgst, + Size: bootstrapInfo.Size, + MediaType: ocispec.MediaTypeImageLayerGzip, + Annotations: map[string]string{ + LayerAnnotationUncompressed: uncompressedDgst.Digest().String(), + LayerAnnotationFSVersion: opt.FsVersion, + // Use this annotation to identify nydus bootstrap layer. + LayerAnnotationNydusBootstrap: "true", + // Track all blob digests for nydus snapshotter. + LayerAnnotationNydusBlobIDs: string(blobIDsBytes), + }, + } + + return &bootstrapDesc, blobDescs, nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/nydus-snapshotter/pkg/converter/convert_windows.go b/src/cmd/linuxkit/vendor/github.com/containerd/nydus-snapshotter/pkg/converter/convert_windows.go new file mode 100644 index 000000000..12cb53ed5 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/nydus-snapshotter/pkg/converter/convert_windows.go @@ -0,0 +1,51 @@ +//go:build windows +// +build windows + +/* + * Copyright (c) 2022. Nydus Developers. All rights reserved. + * + * SPDX-License-Identifier: Apache-2.0 + */ + +package converter + +import ( + "context" + "io" + + "github.com/containerd/containerd/content" + "github.com/containerd/containerd/images/converter" + ocispec "github.com/opencontainers/image-spec/specs-go/v1" +) + +func Pack(ctx context.Context, dest io.Writer, opt PackOption) (io.WriteCloser, error) { + panic("not implemented") +} + +func Merge(ctx context.Context, layers []Layer, dest io.Writer, opt MergeOption) error { + panic("not implemented") +} + +func Unpack(ctx context.Context, ia content.ReaderAt, dest io.Writer, opt UnpackOption) error { + panic("not implemented") +} + +func IsNydusBlobAndExists(ctx context.Context, cs content.Store, desc ocispec.Descriptor) bool { + panic("not implemented") +} + +func IsNydusBlob(ctx context.Context, desc ocispec.Descriptor) bool { + panic("not implemented") +} + +func LayerConvertFunc(opt PackOption) converter.ConvertFunc { + panic("not implemented") +} + +func ConvertHookFunc(opt MergeOption) converter.ConvertHookFunc { + panic("not implemented") +} + +func MergeLayers(ctx context.Context, cs content.Store, descs []ocispec.Descriptor, opt MergeOption) (*ocispec.Descriptor, error) { + panic("not implemented") +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/nydus-snapshotter/pkg/converter/tool/builder.go b/src/cmd/linuxkit/vendor/github.com/containerd/nydus-snapshotter/pkg/converter/tool/builder.go new file mode 100644 index 000000000..55e98cc09 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/nydus-snapshotter/pkg/converter/tool/builder.go @@ -0,0 +1,217 @@ +/* + * Copyright (c) 2022. Nydus Developers. All rights reserved. + * + * SPDX-License-Identifier: Apache-2.0 + */ + +package tool + +import ( + "context" + "encoding/json" + "fmt" + "io/ioutil" + "os/exec" + "strings" + "time" + + "github.com/containerd/nydus-snapshotter/pkg/errdefs" + "github.com/opencontainers/go-digest" + "github.com/pkg/errors" + "github.com/sirupsen/logrus" +) + +var logger = logrus.WithField("module", "builder") + +type PackOption struct { + BuilderPath string + + BootstrapPath string + BlobPath string + FsVersion string + SourcePath string + ChunkDictPath string + PrefetchPatterns string + Compressor string + Timeout *time.Duration +} + +type MergeOption struct { + BuilderPath string + + SourceBootstrapPaths []string + TargetBootstrapPath string + ChunkDictPath string + PrefetchPatterns string + OutputJSONPath string + Timeout *time.Duration +} + +type UnpackOption struct { + BuilderPath string + BootstrapPath string + BlobPath string + TarPath string + Timeout *time.Duration +} + +type outputJSON struct { + Blobs []string +} + +func Pack(option PackOption) error { + if option.FsVersion == "" { + option.FsVersion = "5" + } + + args := []string{ + "create", + "--log-level", + "warn", + "--prefetch-policy", + "fs", + "--blob", + option.BlobPath, + "--source-type", + "directory", + "--whiteout-spec", + "none", + "--fs-version", + option.FsVersion, + "--inline-bootstrap", + } + if option.ChunkDictPath != "" { + args = append(args, "--chunk-dict", fmt.Sprintf("bootstrap=%s", option.ChunkDictPath)) + } + if option.PrefetchPatterns == "" { + option.PrefetchPatterns = "/" + } + if option.Compressor != "" { + args = append(args, "--compressor", option.Compressor) + } + args = append(args, option.SourcePath) + + ctx := context.Background() + var cancel context.CancelFunc + if option.Timeout != nil { + ctx, cancel = context.WithTimeout(ctx, *option.Timeout) + defer cancel() + } + + logrus.Debugf("\tCommand: %s %s", option.BuilderPath, strings.Join(args[:], " ")) + + cmd := exec.CommandContext(ctx, option.BuilderPath, args...) + cmd.Stdout = logger.Writer() + cmd.Stderr = logger.Writer() + cmd.Stdin = strings.NewReader(option.PrefetchPatterns) + + if err := cmd.Run(); err != nil { + if errdefs.IsSignalKilled(err) && option.Timeout != nil { + logrus.WithError(err).Errorf("fail to run %v %+v, possibly due to timeout %v", option.BuilderPath, args, *option.Timeout) + } else { + logrus.WithError(err).Errorf("fail to run %v %+v", option.BuilderPath, args) + } + return err + } + + return nil +} + +func Merge(option MergeOption) ([]digest.Digest, error) { + args := []string{ + "merge", + "--log-level", + "warn", + "--prefetch-policy", + "fs", + "--output-json", + option.OutputJSONPath, + "--bootstrap", + option.TargetBootstrapPath, + } + if option.ChunkDictPath != "" { + args = append(args, "--chunk-dict", fmt.Sprintf("bootstrap=%s", option.ChunkDictPath)) + } + if option.PrefetchPatterns == "" { + option.PrefetchPatterns = "/" + } + args = append(args, option.SourceBootstrapPaths...) + + ctx := context.Background() + var cancel context.CancelFunc + if option.Timeout != nil { + ctx, cancel = context.WithTimeout(ctx, *option.Timeout) + defer cancel() + } + logrus.Debugf("\tCommand: %s %s", option.BuilderPath, strings.Join(args[:], " ")) + + cmd := exec.CommandContext(ctx, option.BuilderPath, args...) + cmd.Stdout = logger.Writer() + cmd.Stderr = logger.Writer() + cmd.Stdin = strings.NewReader(option.PrefetchPatterns) + + if err := cmd.Run(); err != nil { + if errdefs.IsSignalKilled(err) && option.Timeout != nil { + logrus.WithError(err).Errorf("fail to run %v %+v, possibly due to timeout %v", option.BuilderPath, args, *option.Timeout) + } else { + logrus.WithError(err).Errorf("fail to run %v %+v", option.BuilderPath, args) + } + return nil, errors.Wrap(err, "run merge command") + } + + outputBytes, err := ioutil.ReadFile(option.OutputJSONPath) + if err != nil { + return nil, errors.Wrapf(err, "read file %s", option.OutputJSONPath) + } + var output outputJSON + err = json.Unmarshal(outputBytes, &output) + if err != nil { + return nil, errors.Wrapf(err, "unmarshal output json file %s", option.OutputJSONPath) + } + + blobDigests := []digest.Digest{} + for _, blobID := range output.Blobs { + blobDigests = append(blobDigests, digest.NewDigestFromHex(string(digest.SHA256), blobID)) + } + + return blobDigests, nil +} + +func Unpack(option UnpackOption) error { + args := []string{ + "unpack", + "--log-level", + "warn", + "--bootstrap", + option.BootstrapPath, + "--output", + option.TarPath, + } + if option.BlobPath != "" { + args = append(args, "--blob", option.BlobPath) + } + + ctx := context.Background() + var cancel context.CancelFunc + if option.Timeout != nil { + ctx, cancel = context.WithTimeout(ctx, *option.Timeout) + defer cancel() + } + + logrus.Debugf("\tCommand: %s %s", option.BuilderPath, strings.Join(args[:], " ")) + + cmd := exec.CommandContext(ctx, option.BuilderPath, args...) + cmd.Stdout = logger.Writer() + cmd.Stderr = logger.Writer() + + if err := cmd.Run(); err != nil { + if errdefs.IsSignalKilled(err) && option.Timeout != nil { + logrus.WithError(err).Errorf("fail to run %v %+v, possibly due to timeout %v", option.BuilderPath, args, *option.Timeout) + } else { + logrus.WithError(err).Errorf("fail to run %v %+v", option.BuilderPath, args) + } + return err + } + + return nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/nydus-snapshotter/pkg/converter/types.go b/src/cmd/linuxkit/vendor/github.com/containerd/nydus-snapshotter/pkg/converter/types.go new file mode 100644 index 000000000..9d0590a0c --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/nydus-snapshotter/pkg/converter/types.go @@ -0,0 +1,84 @@ +/* + * Copyright (c) 2022. Nydus Developers. All rights reserved. + * + * SPDX-License-Identifier: Apache-2.0 + */ + +package converter + +import ( + "context" + "time" + + "github.com/containerd/containerd/content" + "github.com/opencontainers/go-digest" +) + +type Layer struct { + // Digest represents the hash of whole tar blob. + Digest digest.Digest + // ReaderAt holds the reader of whole tar blob. + ReaderAt content.ReaderAt +} + +// Backend uploads blobs generated by nydus-image builder to a backend storage such as: +// - oss: A object storage backend, which uses its SDK to upload blob file. +type Backend interface { + // Push pushes specified blob file to remote storage backend. + Push(ctx context.Context, ra content.ReaderAt, blobDigest digest.Digest) error + // Check checks whether a blob exists in remote storage backend, + // blob exists -> return (blobPath, nil) + // blob not exists -> return ("", err) + Check(blobDigest digest.Digest) (string, error) + // Type returns backend type name. + Type() string +} + +type PackOption struct { + // WorkDir is used as the work directory during layer pack. + WorkDir string + // BuilderPath holds the path of `nydus-image` binary tool. + BuilderPath string + // FsVersion specifies nydus RAFS format version, possible + // values: `5`, `6` (EROFS-compatible), default is `5`. + FsVersion string + // ChunkDictPath holds the bootstrap path of chunk dict image. + ChunkDictPath string + // PrefetchPatterns holds file path pattern list want to prefetch. + PrefetchPatterns string + // Compressor specifies nydus blob compression algorithm. + Compressor string + // Backend uploads blobs generated by nydus-image builder to a backend storage. + Backend Backend + // Timeout cancels execution once exceed the specified time. + Timeout *time.Duration +} + +type MergeOption struct { + // WorkDir is used as the work directory during layer merge. + WorkDir string + // BuilderPath holds the path of `nydus-image` binary tool. + BuilderPath string + // FsVersion specifies nydus RAFS format version, possible + // values: `5`, `6` (EROFS-compatible), default is `5`. + FsVersion string + // ChunkDictPath holds the bootstrap path of chunk dict image. + ChunkDictPath string + // PrefetchPatterns holds file path pattern list want to prefetch. + PrefetchPatterns string + // WithTar puts bootstrap into a tar stream (no gzip). + WithTar bool + // Backend uploads blobs generated by nydus-image builder to a backend storage. + Backend Backend + // Timeout cancels execution once exceed the specified time. + Timeout *time.Duration +} + +type UnpackOption struct { + // WorkDir is used as the work directory during layer unpack. + WorkDir string + // BuilderPath holds the path of `nydus-image` binary tool. + BuilderPath string + // Timeout cancels execution once exceed the specified time. + Timeout *time.Duration +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/nydus-snapshotter/pkg/converter/utils.go b/src/cmd/linuxkit/vendor/github.com/containerd/nydus-snapshotter/pkg/converter/utils.go new file mode 100644 index 000000000..849d870b3 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/nydus-snapshotter/pkg/converter/utils.go @@ -0,0 +1,204 @@ +/* + * Copyright (c) 2022. Nydus Developers. All rights reserved. + * + * SPDX-License-Identifier: Apache-2.0 + */ + +package converter + +import ( + "archive/tar" + "bytes" + "compress/gzip" + "context" + "encoding/json" + "fmt" + "io" + "os" + "path/filepath" + + "github.com/containerd/containerd/content" + "github.com/opencontainers/go-digest" + ocispec "github.com/opencontainers/image-spec/specs-go/v1" +) + +type writeCloser struct { + closed bool + io.WriteCloser + action func() error +} + +func (c *writeCloser) Close() error { + if c.closed { + return nil + } + + if err := c.WriteCloser.Close(); err != nil { + return err + } + c.closed = true + + if err := c.action(); err != nil { + return err + } + + return nil +} + +func newWriteCloser(wc io.WriteCloser, action func() error) *writeCloser { + return &writeCloser{ + WriteCloser: wc, + action: action, + } +} + +type seekReader struct { + io.ReaderAt + pos int64 +} + +func (ra *seekReader) Read(p []byte) (int, error) { + n, err := ra.ReaderAt.ReadAt(p, ra.pos) + ra.pos += int64(len(p)) + return n, err +} + +func (ra *seekReader) Seek(offset int64, whence int) (int64, error) { + if whence == io.SeekCurrent { + ra.pos += offset + } else if whence == io.SeekStart { + ra.pos = offset + } else { + return 0, fmt.Errorf("unsupported whence %d", whence) + } + return ra.pos, nil +} + +func newSeekReader(ra io.ReaderAt) *seekReader { + return &seekReader{ + ReaderAt: ra, + pos: 0, + } +} + +// packToTar makes .tar(.gz) stream of file named `name` and return reader. +func packToTar(src string, name string, compress bool) (io.ReadCloser, error) { + fi, err := os.Stat(src) + if err != nil { + return nil, err + } + + dirHdr := &tar.Header{ + Name: filepath.Dir(name), + Mode: 0755, + Typeflag: tar.TypeDir, + } + + hdr := &tar.Header{ + Name: name, + Mode: 0444, + Size: fi.Size(), + } + + reader, writer := io.Pipe() + + go func() { + // Prepare targz writer + var tw *tar.Writer + var gw *gzip.Writer + var err error + var file *os.File + + if compress { + gw = gzip.NewWriter(writer) + tw = tar.NewWriter(gw) + } else { + tw = tar.NewWriter(writer) + } + + defer func() { + err1 := tw.Close() + var err2 error + if gw != nil { + err2 = gw.Close() + } + + var finalErr error + + // Return the first error encountered to the other end and ignore others. + if err != nil { + finalErr = err + } else if err1 != nil { + finalErr = err1 + } else if err2 != nil { + finalErr = err2 + } + + writer.CloseWithError(finalErr) + }() + + file, err = os.Open(src) + if err != nil { + return + } + defer file.Close() + + // Write targz stream + if err = tw.WriteHeader(dirHdr); err != nil { + return + } + + if err = tw.WriteHeader(hdr); err != nil { + return + } + + if _, err = io.Copy(tw, file); err != nil { + return + } + }() + + return reader, nil +} + +// Copied from containerd/containerd project, copyright The containerd Authors. +// https://github.com/containerd/containerd/blob/4902059cb554f4f06a8d06a12134c17117809f4e/images/converter/default.go#L385 +func readJSON(ctx context.Context, cs content.Store, x interface{}, desc ocispec.Descriptor) (map[string]string, error) { + info, err := cs.Info(ctx, desc.Digest) + if err != nil { + return nil, err + } + labels := info.Labels + b, err := content.ReadBlob(ctx, cs, desc) + if err != nil { + return nil, err + } + if err := json.Unmarshal(b, x); err != nil { + return nil, err + } + return labels, nil +} + +// Copied from containerd/containerd project, copyright The containerd Authors. +// https://github.com/containerd/containerd/blob/4902059cb554f4f06a8d06a12134c17117809f4e/images/converter/default.go#L401 +func writeJSON(ctx context.Context, cs content.Store, x interface{}, oldDesc ocispec.Descriptor, labels map[string]string) (*ocispec.Descriptor, error) { + b, err := json.Marshal(x) + if err != nil { + return nil, err + } + dgst := digest.SHA256.FromBytes(b) + ref := fmt.Sprintf("converter-write-json-%s", dgst.String()) + w, err := content.OpenWriter(ctx, cs, content.WithRef(ref)) + if err != nil { + return nil, err + } + if err := content.Copy(ctx, w, bytes.NewReader(b), int64(len(b)), dgst, content.WithLabels(labels)); err != nil { + return nil, err + } + if err := w.Close(); err != nil { + return nil, err + } + newDesc := oldDesc + newDesc.Size = int64(len(b)) + newDesc.Digest = dgst + return &newDesc, nil +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/nydus-snapshotter/pkg/errdefs/errors.go b/src/cmd/linuxkit/vendor/github.com/containerd/nydus-snapshotter/pkg/errdefs/errors.go new file mode 100644 index 000000000..3bdf74cb9 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/containerd/nydus-snapshotter/pkg/errdefs/errors.go @@ -0,0 +1,53 @@ +/* + * Copyright (c) 2020. Ant Group. All rights reserved. + * + * SPDX-License-Identifier: Apache-2.0 + */ + +package errdefs + +import ( + stderrors "errors" + "net" + "strings" + "syscall" + + "github.com/pkg/errors" +) + +const signalKilled = "signal: killed" + +var ( + ErrAlreadyExists = errors.New("already exists") + ErrNotFound = errors.New("not found") +) + +// IsAlreadyExists returns true if the error is due to already exists +func IsAlreadyExists(err error) bool { + return errors.Is(err, ErrAlreadyExists) +} + +// IsNotFound returns true if the error is due to a missing object +func IsNotFound(err error) bool { + return errors.Is(err, ErrNotFound) +} + +// IsSignalKilled returns true if the error is signal killed +func IsSignalKilled(err error) bool { + return strings.Contains(err.Error(), signalKilled) +} + +// IsConnectionClosed returns true if error is due to connection closed +// this is used when snapshotter closed by sig term +func IsConnectionClosed(err error) bool { + switch err := err.(type) { + case *net.OpError: + return err.Err.Error() == "use of closed network connection" + default: + return false + } +} + +func IsErofsMounted(err error) bool { + return stderrors.Is(err, syscall.EBUSY) +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/stargz-snapshotter/estargz/build.go b/src/cmd/linuxkit/vendor/github.com/containerd/stargz-snapshotter/estargz/build.go index 0da3efe4c..b071cea51 100644 --- a/src/cmd/linuxkit/vendor/github.com/containerd/stargz-snapshotter/estargz/build.go +++ b/src/cmd/linuxkit/vendor/github.com/containerd/stargz-snapshotter/estargz/build.go @@ -49,6 +49,7 @@ type options struct { missedPrioritizedFiles *[]string compression Compression ctx context.Context + minChunkSize int } type Option func(o *options) error @@ -63,6 +64,7 @@ func WithChunkSize(chunkSize int) Option { // WithCompressionLevel option specifies the gzip compression level. // The default is gzip.BestCompression. +// This option will be ignored if WithCompression option is used. // See also: https://godoc.org/compress/gzip#pkg-constants func WithCompressionLevel(level int) Option { return func(o *options) error { @@ -113,6 +115,18 @@ func WithContext(ctx context.Context) Option { } } +// WithMinChunkSize option specifies the minimal number of bytes of data +// must be written in one gzip stream. +// By increasing this number, one gzip stream can contain multiple files +// and it hopefully leads to smaller result blob. +// NOTE: This adds a TOC property that old reader doesn't understand. +func WithMinChunkSize(minChunkSize int) Option { + return func(o *options) error { + o.minChunkSize = minChunkSize + return nil + } +} + // Blob is an eStargz blob. type Blob struct { io.ReadCloser @@ -180,7 +194,14 @@ func Build(tarBlob *io.SectionReader, opt ...Option) (_ *Blob, rErr error) { if err != nil { return nil, err } - tarParts := divideEntries(entries, runtime.GOMAXPROCS(0)) + var tarParts [][]*entry + if opts.minChunkSize > 0 { + // Each entry needs to know the size of the current gzip stream so they + // cannot be processed in parallel. + tarParts = [][]*entry{entries} + } else { + tarParts = divideEntries(entries, runtime.GOMAXPROCS(0)) + } writers := make([]*Writer, len(tarParts)) payloads := make([]*os.File, len(tarParts)) var mu sync.Mutex @@ -195,6 +216,13 @@ func Build(tarBlob *io.SectionReader, opt ...Option) (_ *Blob, rErr error) { } sw := NewWriterWithCompressor(esgzFile, opts.compression) sw.ChunkSize = opts.chunkSize + sw.MinChunkSize = opts.minChunkSize + if sw.needsOpenGzEntries == nil { + sw.needsOpenGzEntries = make(map[string]struct{}) + } + for _, f := range []string{PrefetchLandmark, NoPrefetchLandmark} { + sw.needsOpenGzEntries[f] = struct{}{} + } if err := sw.AppendTar(readerFromEntries(parts...)); err != nil { return err } @@ -209,7 +237,7 @@ func Build(tarBlob *io.SectionReader, opt ...Option) (_ *Blob, rErr error) { rErr = err return nil, err } - tocAndFooter, tocDgst, err := closeWithCombine(opts.compressionLevel, writers...) + tocAndFooter, tocDgst, err := closeWithCombine(writers...) if err != nil { rErr = err return nil, err @@ -252,7 +280,7 @@ func Build(tarBlob *io.SectionReader, opt ...Option) (_ *Blob, rErr error) { // Writers doesn't write TOC and footer to the underlying writers so they can be // combined into a single eStargz and tocAndFooter returned by this function can // be appended at the tail of that combined blob. -func closeWithCombine(compressionLevel int, ws ...*Writer) (tocAndFooterR io.Reader, tocDgst digest.Digest, err error) { +func closeWithCombine(ws ...*Writer) (tocAndFooterR io.Reader, tocDgst digest.Digest, err error) { if len(ws) == 0 { return nil, "", fmt.Errorf("at least one writer must be passed") } @@ -395,7 +423,7 @@ func readerFromEntries(entries ...*entry) io.Reader { func importTar(in io.ReaderAt) (*tarFile, error) { tf := &tarFile{} - pw, err := newCountReader(in) + pw, err := newCountReadSeeker(in) if err != nil { return nil, fmt.Errorf("failed to make position watcher: %w", err) } @@ -571,19 +599,19 @@ func (tf *tempFiles) cleanupAll() error { return errorutil.Aggregate(allErr) } -func newCountReader(r io.ReaderAt) (*countReader, error) { +func newCountReadSeeker(r io.ReaderAt) (*countReadSeeker, error) { pos := int64(0) - return &countReader{r: r, cPos: &pos}, nil + return &countReadSeeker{r: r, cPos: &pos}, nil } -type countReader struct { +type countReadSeeker struct { r io.ReaderAt cPos *int64 mu sync.Mutex } -func (cr *countReader) Read(p []byte) (int, error) { +func (cr *countReadSeeker) Read(p []byte) (int, error) { cr.mu.Lock() defer cr.mu.Unlock() @@ -594,7 +622,7 @@ func (cr *countReader) Read(p []byte) (int, error) { return n, err } -func (cr *countReader) Seek(offset int64, whence int) (int64, error) { +func (cr *countReadSeeker) Seek(offset int64, whence int) (int64, error) { cr.mu.Lock() defer cr.mu.Unlock() @@ -615,7 +643,7 @@ func (cr *countReader) Seek(offset int64, whence int) (int64, error) { return offset, nil } -func (cr *countReader) currentPos() int64 { +func (cr *countReadSeeker) currentPos() int64 { cr.mu.Lock() defer cr.mu.Unlock() diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/stargz-snapshotter/estargz/estargz.go b/src/cmd/linuxkit/vendor/github.com/containerd/stargz-snapshotter/estargz/estargz.go index 921e59ec6..f4d554655 100644 --- a/src/cmd/linuxkit/vendor/github.com/containerd/stargz-snapshotter/estargz/estargz.go +++ b/src/cmd/linuxkit/vendor/github.com/containerd/stargz-snapshotter/estargz/estargz.go @@ -150,10 +150,10 @@ func Open(sr *io.SectionReader, opt ...OpenOption) (*Reader, error) { allErr = append(allErr, err) continue } - if tocSize <= 0 { + if tocOffset >= 0 && tocSize <= 0 { tocSize = sr.Size() - tocOffset - fSize } - if tocSize < int64(len(maybeTocBytes)) { + if tocOffset >= 0 && tocSize < int64(len(maybeTocBytes)) { maybeTocBytes = maybeTocBytes[:tocSize] } r, err = parseTOC(d, sr, tocOffset, tocSize, maybeTocBytes, opts) @@ -207,8 +207,16 @@ func (r *Reader) initFields() error { uname := map[int]string{} gname := map[int]string{} var lastRegEnt *TOCEntry - for _, ent := range r.toc.Entries { + var chunkTopIndex int + for i, ent := range r.toc.Entries { ent.Name = cleanEntryName(ent.Name) + switch ent.Type { + case "reg", "chunk": + if ent.Offset != r.toc.Entries[chunkTopIndex].Offset { + chunkTopIndex = i + } + ent.chunkTopIndex = chunkTopIndex + } if ent.Type == "reg" { lastRegEnt = ent } @@ -294,7 +302,7 @@ func (r *Reader) initFields() error { if e.isDataType() { e.nextOffset = lastOffset } - if e.Offset != 0 { + if e.Offset != 0 && e.InnerOffset == 0 { lastOffset = e.Offset } } @@ -488,6 +496,14 @@ func (r *Reader) Lookup(path string) (e *TOCEntry, ok bool) { // // Name must be absolute path or one that is relative to root. func (r *Reader) OpenFile(name string) (*io.SectionReader, error) { + fr, err := r.newFileReader(name) + if err != nil { + return nil, err + } + return io.NewSectionReader(fr, 0, fr.size), nil +} + +func (r *Reader) newFileReader(name string) (*fileReader, error) { name = cleanEntryName(name) ent, ok := r.Lookup(name) if !ok { @@ -505,11 +521,19 @@ func (r *Reader) OpenFile(name string) (*io.SectionReader, error) { Err: errors.New("not a regular file"), } } - fr := &fileReader{ + return &fileReader{ r: r, size: ent.Size, ents: r.getChunks(ent), + }, nil +} + +func (r *Reader) OpenFileWithPreReader(name string, preRead func(*TOCEntry, io.Reader) error) (*io.SectionReader, error) { + fr, err := r.newFileReader(name) + if err != nil { + return nil, err } + fr.preRead = preRead return io.NewSectionReader(fr, 0, fr.size), nil } @@ -521,9 +545,10 @@ func (r *Reader) getChunks(ent *TOCEntry) []*TOCEntry { } type fileReader struct { - r *Reader - size int64 - ents []*TOCEntry // 1 or more reg/chunk entries + r *Reader + size int64 + ents []*TOCEntry // 1 or more reg/chunk entries + preRead func(*TOCEntry, io.Reader) error } func (fr *fileReader) ReadAt(p []byte, off int64) (n int, err error) { @@ -578,10 +603,48 @@ func (fr *fileReader) ReadAt(p []byte, off int64) (n int, err error) { return 0, fmt.Errorf("fileReader.ReadAt.decompressor.Reader: %v", err) } defer dr.Close() - if n, err := io.CopyN(io.Discard, dr, off); n != off || err != nil { - return 0, fmt.Errorf("discard of %d bytes = %v, %v", off, n, err) + + if fr.preRead == nil { + if n, err := io.CopyN(io.Discard, dr, ent.InnerOffset+off); n != ent.InnerOffset+off || err != nil { + return 0, fmt.Errorf("discard of %d bytes != %v, %v", ent.InnerOffset+off, n, err) + } + return io.ReadFull(dr, p) } - return io.ReadFull(dr, p) + + var retN int + var retErr error + var found bool + var nr int64 + for _, e := range fr.r.toc.Entries[ent.chunkTopIndex:] { + if !e.isDataType() { + continue + } + if e.Offset != fr.r.toc.Entries[ent.chunkTopIndex].Offset { + break + } + if in, err := io.CopyN(io.Discard, dr, e.InnerOffset-nr); err != nil || in != e.InnerOffset-nr { + return 0, fmt.Errorf("discard of remaining %d bytes != %v, %v", e.InnerOffset-nr, in, err) + } + nr = e.InnerOffset + if e == ent { + found = true + if n, err := io.CopyN(io.Discard, dr, off); n != off || err != nil { + return 0, fmt.Errorf("discard of offset %d bytes != %v, %v", off, n, err) + } + retN, retErr = io.ReadFull(dr, p) + nr += off + int64(retN) + continue + } + cr := &countReader{r: io.LimitReader(dr, e.ChunkSize)} + if err := fr.preRead(e, cr); err != nil { + return 0, fmt.Errorf("failed to pre read: %w", err) + } + nr += cr.n + } + if !found { + return 0, fmt.Errorf("fileReader.ReadAt: target entry not found") + } + return retN, retErr } // A Writer writes stargz files. @@ -599,11 +662,20 @@ type Writer struct { lastGroupname map[int]string compressor Compressor + uncompressedCounter *countWriteFlusher + // ChunkSize optionally controls the maximum number of bytes // of data of a regular file that can be written in one gzip // stream before a new gzip stream is started. // Zero means to use a default, currently 4 MiB. ChunkSize int + + // MinChunkSize optionally controls the minimum number of bytes + // of data must be written in one gzip stream before a new gzip + // NOTE: This adds a TOC property that stargz snapshotter < v0.13.0 doesn't understand. + MinChunkSize int + + needsOpenGzEntries map[string]struct{} } // currentCompressionWriter writes to the current w.gz field, which can @@ -646,6 +718,9 @@ func Unpack(sr *io.SectionReader, c Decompressor) (io.ReadCloser, error) { if err != nil { return nil, fmt.Errorf("failed to parse footer: %w", err) } + if blobPayloadSize < 0 { + blobPayloadSize = sr.Size() + } return c.Reader(io.LimitReader(sr, blobPayloadSize)) } @@ -672,11 +747,12 @@ func NewWriterWithCompressor(w io.Writer, c Compressor) *Writer { bw := bufio.NewWriter(w) cw := &countWriter{w: bw} return &Writer{ - bw: bw, - cw: cw, - toc: &JTOC{Version: 1}, - diffHash: sha256.New(), - compressor: c, + bw: bw, + cw: cw, + toc: &JTOC{Version: 1}, + diffHash: sha256.New(), + compressor: c, + uncompressedCounter: &countWriteFlusher{}, } } @@ -717,6 +793,20 @@ func (w *Writer) closeGz() error { return nil } +func (w *Writer) flushGz() error { + if w.closed { + return errors.New("flush on closed Writer") + } + if w.gz != nil { + if f, ok := w.gz.(interface { + Flush() error + }); ok { + return f.Flush() + } + } + return nil +} + // nameIfChanged returns name, unless it was the already the value of (*mp)[id], // in which case it returns the empty string. func (w *Writer) nameIfChanged(mp *map[int]string, id int, name string) string { @@ -736,6 +826,9 @@ func (w *Writer) nameIfChanged(mp *map[int]string, id int, name string) string { func (w *Writer) condOpenGz() (err error) { if w.gz == nil { w.gz, err = w.compressor.Writer(w.cw) + if w.gz != nil { + w.gz = w.uncompressedCounter.register(w.gz) + } } return } @@ -784,6 +877,8 @@ func (w *Writer) appendTar(r io.Reader, lossless bool) error { if lossless { tr.RawAccounting = true } + prevOffset := w.cw.n + var prevOffsetUncompressed int64 for { h, err := tr.Next() if err == io.EOF { @@ -883,10 +978,6 @@ func (w *Writer) appendTar(r io.Reader, lossless bool) error { totalSize := ent.Size // save it before we destroy ent tee := io.TeeReader(tr, payloadDigest.Hash()) for written < totalSize { - if err := w.closeGz(); err != nil { - return err - } - chunkSize := int64(w.chunkSize()) remain := totalSize - written if remain < chunkSize { @@ -894,7 +985,23 @@ func (w *Writer) appendTar(r io.Reader, lossless bool) error { } else { ent.ChunkSize = chunkSize } - ent.Offset = w.cw.n + + // We flush the underlying compression writer here to correctly calculate "w.cw.n". + if err := w.flushGz(); err != nil { + return err + } + if w.needsOpenGz(ent) || w.cw.n-prevOffset >= int64(w.MinChunkSize) { + if err := w.closeGz(); err != nil { + return err + } + ent.Offset = w.cw.n + prevOffset = ent.Offset + prevOffsetUncompressed = w.uncompressedCounter.n + } else { + ent.Offset = prevOffset + ent.InnerOffset = w.uncompressedCounter.n - prevOffsetUncompressed + } + ent.ChunkOffset = written chunkDigest := digest.Canonical.Digester() @@ -940,6 +1047,17 @@ func (w *Writer) appendTar(r io.Reader, lossless bool) error { return err } +func (w *Writer) needsOpenGz(ent *TOCEntry) bool { + if ent.Type != "reg" { + return false + } + if w.needsOpenGzEntries == nil { + return false + } + _, ok := w.needsOpenGzEntries[ent.Name] + return ok +} + // DiffID returns the SHA-256 of the uncompressed tar bytes. // It is only valid to call DiffID after Close. func (w *Writer) DiffID() string { @@ -956,6 +1074,28 @@ func maxFooterSize(blobSize int64, decompressors ...Decompressor) (res int64) { } func parseTOC(d Decompressor, sr *io.SectionReader, tocOff, tocSize int64, tocBytes []byte, opts openOpts) (*Reader, error) { + if tocOff < 0 { + // This means that TOC isn't contained in the blob. + // We pass nil reader to ParseTOC and expect that ParseTOC acquire TOC from + // the external location. + start := time.Now() + toc, tocDgst, err := d.ParseTOC(nil) + if err != nil { + return nil, err + } + if opts.telemetry != nil && opts.telemetry.GetTocLatency != nil { + opts.telemetry.GetTocLatency(start) + } + if opts.telemetry != nil && opts.telemetry.DeserializeTocLatency != nil { + opts.telemetry.DeserializeTocLatency(start) + } + return &Reader{ + sr: sr, + toc: toc, + tocDigest: tocDgst, + decompressor: d, + }, nil + } if len(tocBytes) > 0 { start := time.Now() toc, tocDgst, err := d.ParseTOC(bytes.NewReader(tocBytes)) @@ -1021,6 +1161,37 @@ func (cw *countWriter) Write(p []byte) (n int, err error) { return } +type countWriteFlusher struct { + io.WriteCloser + n int64 +} + +func (wc *countWriteFlusher) register(w io.WriteCloser) io.WriteCloser { + wc.WriteCloser = w + return wc +} + +func (wc *countWriteFlusher) Write(p []byte) (n int, err error) { + n, err = wc.WriteCloser.Write(p) + wc.n += int64(n) + return +} + +func (wc *countWriteFlusher) Flush() error { + if f, ok := wc.WriteCloser.(interface { + Flush() error + }); ok { + return f.Flush() + } + return nil +} + +func (wc *countWriteFlusher) Close() error { + err := wc.WriteCloser.Close() + wc.WriteCloser = nil + return err +} + // isGzip reports whether br is positioned right before an upcoming gzip stream. // It does not consume any bytes from br. func isGzip(br *bufio.Reader) bool { @@ -1039,3 +1210,14 @@ func positive(n int64) int64 { } return n } + +type countReader struct { + r io.Reader + n int64 +} + +func (cr *countReader) Read(p []byte) (n int, err error) { + n, err = cr.r.Read(p) + cr.n += int64(n) + return +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/stargz-snapshotter/estargz/gzip.go b/src/cmd/linuxkit/vendor/github.com/containerd/stargz-snapshotter/estargz/gzip.go index 591d7a62e..f24afe32f 100644 --- a/src/cmd/linuxkit/vendor/github.com/containerd/stargz-snapshotter/estargz/gzip.go +++ b/src/cmd/linuxkit/vendor/github.com/containerd/stargz-snapshotter/estargz/gzip.go @@ -60,7 +60,7 @@ type GzipCompressor struct { compressionLevel int } -func (gc *GzipCompressor) Writer(w io.Writer) (io.WriteCloser, error) { +func (gc *GzipCompressor) Writer(w io.Writer) (WriteFlushCloser, error) { return gzip.NewWriterLevel(w, gc.compressionLevel) } diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/stargz-snapshotter/estargz/testutil.go b/src/cmd/linuxkit/vendor/github.com/containerd/stargz-snapshotter/estargz/testutil.go index 37448cae0..0ca6fd75f 100644 --- a/src/cmd/linuxkit/vendor/github.com/containerd/stargz-snapshotter/estargz/testutil.go +++ b/src/cmd/linuxkit/vendor/github.com/containerd/stargz-snapshotter/estargz/testutil.go @@ -31,6 +31,7 @@ import ( "errors" "fmt" "io" + "math/rand" "os" "path/filepath" "reflect" @@ -44,21 +45,27 @@ import ( digest "github.com/opencontainers/go-digest" ) +func init() { + rand.Seed(time.Now().UnixNano()) +} + // TestingController is Compression with some helper methods necessary for testing. type TestingController interface { Compression - CountStreams(*testing.T, []byte) int + TestStreams(t *testing.T, b []byte, streams []int64) DiffIDOf(*testing.T, []byte) string String() string } // CompressionTestSuite tests this pkg with controllers can build valid eStargz blobs and parse them. -func CompressionTestSuite(t *testing.T, controllers ...TestingController) { +func CompressionTestSuite(t *testing.T, controllers ...TestingControllerFactory) { t.Run("testBuild", func(t *testing.T) { t.Parallel(); testBuild(t, controllers...) }) t.Run("testDigestAndVerify", func(t *testing.T) { t.Parallel(); testDigestAndVerify(t, controllers...) }) t.Run("testWriteAndOpen", func(t *testing.T) { t.Parallel(); testWriteAndOpen(t, controllers...) }) } +type TestingControllerFactory func() TestingController + const ( uncompressedType int = iota gzipType @@ -75,11 +82,12 @@ var allowedPrefix = [4]string{"", "./", "/", "../"} // testBuild tests the resulting stargz blob built by this pkg has the same // contents as the normal stargz blob. -func testBuild(t *testing.T, controllers ...TestingController) { +func testBuild(t *testing.T, controllers ...TestingControllerFactory) { tests := []struct { - name string - chunkSize int - in []tarEntry + name string + chunkSize int + minChunkSize []int + in []tarEntry }{ { name: "regfiles and directories", @@ -108,11 +116,14 @@ func testBuild(t *testing.T, controllers ...TestingController) { ), }, { - name: "various files", - chunkSize: 4, + name: "various files", + chunkSize: 4, + minChunkSize: []int{0, 64000}, in: tarOf( file("baz.txt", "bazbazbazbazbazbazbaz"), - file("foo.txt", "a"), + file("foo1.txt", "a"), + file("bar/foo2.txt", "b"), + file("foo3.txt", "c"), symlink("barlink", "test/bar.txt"), dir("test/"), dir("dev/"), @@ -144,99 +155,112 @@ func testBuild(t *testing.T, controllers ...TestingController) { }, } for _, tt := range tests { + if len(tt.minChunkSize) == 0 { + tt.minChunkSize = []int{0} + } for _, srcCompression := range srcCompressions { srcCompression := srcCompression - for _, cl := range controllers { - cl := cl + for _, newCL := range controllers { + newCL := newCL for _, srcTarFormat := range []tar.Format{tar.FormatUSTAR, tar.FormatPAX, tar.FormatGNU} { srcTarFormat := srcTarFormat for _, prefix := range allowedPrefix { prefix := prefix - t.Run(tt.name+"-"+fmt.Sprintf("compression=%v,prefix=%q,src=%d,format=%s", cl, prefix, srcCompression, srcTarFormat), func(t *testing.T) { - tarBlob := buildTar(t, tt.in, prefix, srcTarFormat) - // Test divideEntries() - entries, err := sortEntries(tarBlob, nil, nil) // identical order - if err != nil { - t.Fatalf("failed to parse tar: %v", err) - } - var merged []*entry - for _, part := range divideEntries(entries, 4) { - merged = append(merged, part...) - } - if !reflect.DeepEqual(entries, merged) { - for _, e := range entries { - t.Logf("Original: %v", e.header) + for _, minChunkSize := range tt.minChunkSize { + minChunkSize := minChunkSize + t.Run(tt.name+"-"+fmt.Sprintf("compression=%v,prefix=%q,src=%d,format=%s,minChunkSize=%d", newCL(), prefix, srcCompression, srcTarFormat, minChunkSize), func(t *testing.T) { + tarBlob := buildTar(t, tt.in, prefix, srcTarFormat) + // Test divideEntries() + entries, err := sortEntries(tarBlob, nil, nil) // identical order + if err != nil { + t.Fatalf("failed to parse tar: %v", err) } - for _, e := range merged { - t.Logf("Merged: %v", e.header) + var merged []*entry + for _, part := range divideEntries(entries, 4) { + merged = append(merged, part...) + } + if !reflect.DeepEqual(entries, merged) { + for _, e := range entries { + t.Logf("Original: %v", e.header) + } + for _, e := range merged { + t.Logf("Merged: %v", e.header) + } + t.Errorf("divided entries couldn't be merged") + return } - t.Errorf("divided entries couldn't be merged") - return - } - // Prepare sample data - wantBuf := new(bytes.Buffer) - sw := NewWriterWithCompressor(wantBuf, cl) - sw.ChunkSize = tt.chunkSize - if err := sw.AppendTar(tarBlob); err != nil { - t.Fatalf("failed to append tar to want stargz: %v", err) - } - if _, err := sw.Close(); err != nil { - t.Fatalf("failed to prepare want stargz: %v", err) - } - wantData := wantBuf.Bytes() - want, err := Open(io.NewSectionReader( - bytes.NewReader(wantData), 0, int64(len(wantData))), - WithDecompressors(cl), - ) - if err != nil { - t.Fatalf("failed to parse the want stargz: %v", err) - } + // Prepare sample data + cl1 := newCL() + wantBuf := new(bytes.Buffer) + sw := NewWriterWithCompressor(wantBuf, cl1) + sw.MinChunkSize = minChunkSize + sw.ChunkSize = tt.chunkSize + if err := sw.AppendTar(tarBlob); err != nil { + t.Fatalf("failed to append tar to want stargz: %v", err) + } + if _, err := sw.Close(); err != nil { + t.Fatalf("failed to prepare want stargz: %v", err) + } + wantData := wantBuf.Bytes() + want, err := Open(io.NewSectionReader( + bytes.NewReader(wantData), 0, int64(len(wantData))), + WithDecompressors(cl1), + ) + if err != nil { + t.Fatalf("failed to parse the want stargz: %v", err) + } - // Prepare testing data - rc, err := Build(compressBlob(t, tarBlob, srcCompression), - WithChunkSize(tt.chunkSize), WithCompression(cl)) - if err != nil { - t.Fatalf("failed to build stargz: %v", err) - } - defer rc.Close() - gotBuf := new(bytes.Buffer) - if _, err := io.Copy(gotBuf, rc); err != nil { - t.Fatalf("failed to copy built stargz blob: %v", err) - } - gotData := gotBuf.Bytes() - got, err := Open(io.NewSectionReader( - bytes.NewReader(gotBuf.Bytes()), 0, int64(len(gotData))), - WithDecompressors(cl), - ) - if err != nil { - t.Fatalf("failed to parse the got stargz: %v", err) - } + // Prepare testing data + var opts []Option + if minChunkSize > 0 { + opts = append(opts, WithMinChunkSize(minChunkSize)) + } + cl2 := newCL() + rc, err := Build(compressBlob(t, tarBlob, srcCompression), + append(opts, WithChunkSize(tt.chunkSize), WithCompression(cl2))...) + if err != nil { + t.Fatalf("failed to build stargz: %v", err) + } + defer rc.Close() + gotBuf := new(bytes.Buffer) + if _, err := io.Copy(gotBuf, rc); err != nil { + t.Fatalf("failed to copy built stargz blob: %v", err) + } + gotData := gotBuf.Bytes() + got, err := Open(io.NewSectionReader( + bytes.NewReader(gotBuf.Bytes()), 0, int64(len(gotData))), + WithDecompressors(cl2), + ) + if err != nil { + t.Fatalf("failed to parse the got stargz: %v", err) + } - // Check DiffID is properly calculated - rc.Close() - diffID := rc.DiffID() - wantDiffID := cl.DiffIDOf(t, gotData) - if diffID.String() != wantDiffID { - t.Errorf("DiffID = %q; want %q", diffID, wantDiffID) - } + // Check DiffID is properly calculated + rc.Close() + diffID := rc.DiffID() + wantDiffID := cl2.DiffIDOf(t, gotData) + if diffID.String() != wantDiffID { + t.Errorf("DiffID = %q; want %q", diffID, wantDiffID) + } - // Compare as stargz - if !isSameVersion(t, cl, wantData, gotData) { - t.Errorf("built stargz hasn't same json") - return - } - if !isSameEntries(t, want, got) { - t.Errorf("built stargz isn't same as the original") - return - } + // Compare as stargz + if !isSameVersion(t, cl1, wantData, cl2, gotData) { + t.Errorf("built stargz hasn't same json") + return + } + if !isSameEntries(t, want, got) { + t.Errorf("built stargz isn't same as the original") + return + } - // Compare as tar.gz - if !isSameTarGz(t, cl, wantData, gotData) { - t.Errorf("built stargz isn't same tar.gz") - return - } - }) + // Compare as tar.gz + if !isSameTarGz(t, cl1, wantData, cl2, gotData) { + t.Errorf("built stargz isn't same tar.gz") + return + } + }) + } } } } @@ -244,13 +268,13 @@ func testBuild(t *testing.T, controllers ...TestingController) { } } -func isSameTarGz(t *testing.T, controller TestingController, a, b []byte) bool { - aGz, err := controller.Reader(bytes.NewReader(a)) +func isSameTarGz(t *testing.T, cla TestingController, a []byte, clb TestingController, b []byte) bool { + aGz, err := cla.Reader(bytes.NewReader(a)) if err != nil { t.Fatalf("failed to read A") } defer aGz.Close() - bGz, err := controller.Reader(bytes.NewReader(b)) + bGz, err := clb.Reader(bytes.NewReader(b)) if err != nil { t.Fatalf("failed to read B") } @@ -304,12 +328,12 @@ func isSameTarGz(t *testing.T, controller TestingController, a, b []byte) bool { return true } -func isSameVersion(t *testing.T, controller TestingController, a, b []byte) bool { - aJTOC, _, err := parseStargz(io.NewSectionReader(bytes.NewReader(a), 0, int64(len(a))), controller) +func isSameVersion(t *testing.T, cla TestingController, a []byte, clb TestingController, b []byte) bool { + aJTOC, _, err := parseStargz(io.NewSectionReader(bytes.NewReader(a), 0, int64(len(a))), cla) if err != nil { t.Fatalf("failed to parse A: %v", err) } - bJTOC, _, err := parseStargz(io.NewSectionReader(bytes.NewReader(b), 0, int64(len(b))), controller) + bJTOC, _, err := parseStargz(io.NewSectionReader(bytes.NewReader(b), 0, int64(len(b))), clb) if err != nil { t.Fatalf("failed to parse B: %v", err) } @@ -463,7 +487,7 @@ func equalEntry(a, b *TOCEntry) bool { a.GID == b.GID && a.Uname == b.Uname && a.Gname == b.Gname && - (a.Offset > 0) == (b.Offset > 0) && + (a.Offset >= 0) == (b.Offset >= 0) && (a.NextOffset() > 0) == (b.NextOffset() > 0) && a.DevMajor == b.DevMajor && a.DevMinor == b.DevMinor && @@ -510,14 +534,15 @@ func dumpTOCJSON(t *testing.T, tocJSON *JTOC) string { const chunkSize = 3 // type check func(t *testing.T, sgzData []byte, tocDigest digest.Digest, dgstMap map[string]digest.Digest, compressionLevel int) -type check func(t *testing.T, sgzData []byte, tocDigest digest.Digest, dgstMap map[string]digest.Digest, controller TestingController) +type check func(t *testing.T, sgzData []byte, tocDigest digest.Digest, dgstMap map[string]digest.Digest, controller TestingController, newController TestingControllerFactory) // testDigestAndVerify runs specified checks against sample stargz blobs. -func testDigestAndVerify(t *testing.T, controllers ...TestingController) { +func testDigestAndVerify(t *testing.T, controllers ...TestingControllerFactory) { tests := []struct { - name string - tarInit func(t *testing.T, dgstMap map[string]digest.Digest) (blob []tarEntry) - checks []check + name string + tarInit func(t *testing.T, dgstMap map[string]digest.Digest) (blob []tarEntry) + checks []check + minChunkSize []int }{ { name: "no-regfile", @@ -544,6 +569,7 @@ func testDigestAndVerify(t *testing.T, controllers ...TestingController) { regDigest(t, "test/bar.txt", "bbb", dgstMap), ) }, + minChunkSize: []int{0, 64000}, checks: []check{ checkStargzTOC, checkVerifyTOC, @@ -581,11 +607,14 @@ func testDigestAndVerify(t *testing.T, controllers ...TestingController) { }, }, { - name: "with-non-regfiles", + name: "with-non-regfiles", + minChunkSize: []int{0, 64000}, tarInit: func(t *testing.T, dgstMap map[string]digest.Digest) (blob []tarEntry) { return tarOf( regDigest(t, "baz.txt", "bazbazbazbazbazbazbaz", dgstMap), regDigest(t, "foo.txt", "a", dgstMap), + regDigest(t, "bar/foo2.txt", "b", dgstMap), + regDigest(t, "foo3.txt", "c", dgstMap), symlink("barlink", "test/bar.txt"), dir("test/"), regDigest(t, "test/bar.txt", "testbartestbar", dgstMap), @@ -599,6 +628,8 @@ func testDigestAndVerify(t *testing.T, controllers ...TestingController) { checkVerifyInvalidStargzFail(buildTar(t, tarOf( file("baz.txt", "bazbazbazbazbazbazbaz"), file("foo.txt", "a"), + file("bar/foo2.txt", "b"), + file("foo3.txt", "c"), symlink("barlink", "test/bar.txt"), dir("test/"), file("test/bar.txt", "testbartestbar"), @@ -612,38 +643,45 @@ func testDigestAndVerify(t *testing.T, controllers ...TestingController) { } for _, tt := range tests { + if len(tt.minChunkSize) == 0 { + tt.minChunkSize = []int{0} + } for _, srcCompression := range srcCompressions { srcCompression := srcCompression - for _, cl := range controllers { - cl := cl + for _, newCL := range controllers { + newCL := newCL for _, prefix := range allowedPrefix { prefix := prefix for _, srcTarFormat := range []tar.Format{tar.FormatUSTAR, tar.FormatPAX, tar.FormatGNU} { srcTarFormat := srcTarFormat - t.Run(tt.name+"-"+fmt.Sprintf("compression=%v,prefix=%q,format=%s", cl, prefix, srcTarFormat), func(t *testing.T) { - // Get original tar file and chunk digests - dgstMap := make(map[string]digest.Digest) - tarBlob := buildTar(t, tt.tarInit(t, dgstMap), prefix, srcTarFormat) + for _, minChunkSize := range tt.minChunkSize { + minChunkSize := minChunkSize + t.Run(tt.name+"-"+fmt.Sprintf("compression=%v,prefix=%q,format=%s,minChunkSize=%d", newCL(), prefix, srcTarFormat, minChunkSize), func(t *testing.T) { + // Get original tar file and chunk digests + dgstMap := make(map[string]digest.Digest) + tarBlob := buildTar(t, tt.tarInit(t, dgstMap), prefix, srcTarFormat) - rc, err := Build(compressBlob(t, tarBlob, srcCompression), - WithChunkSize(chunkSize), WithCompression(cl)) - if err != nil { - t.Fatalf("failed to convert stargz: %v", err) - } - tocDigest := rc.TOCDigest() - defer rc.Close() - buf := new(bytes.Buffer) - if _, err := io.Copy(buf, rc); err != nil { - t.Fatalf("failed to copy built stargz blob: %v", err) - } - newStargz := buf.Bytes() - // NoPrefetchLandmark is added during `Bulid`, which is expected behaviour. - dgstMap[chunkID(NoPrefetchLandmark, 0, int64(len([]byte{landmarkContents})))] = digest.FromBytes([]byte{landmarkContents}) + cl := newCL() + rc, err := Build(compressBlob(t, tarBlob, srcCompression), + WithChunkSize(chunkSize), WithCompression(cl)) + if err != nil { + t.Fatalf("failed to convert stargz: %v", err) + } + tocDigest := rc.TOCDigest() + defer rc.Close() + buf := new(bytes.Buffer) + if _, err := io.Copy(buf, rc); err != nil { + t.Fatalf("failed to copy built stargz blob: %v", err) + } + newStargz := buf.Bytes() + // NoPrefetchLandmark is added during `Bulid`, which is expected behaviour. + dgstMap[chunkID(NoPrefetchLandmark, 0, int64(len([]byte{landmarkContents})))] = digest.FromBytes([]byte{landmarkContents}) - for _, check := range tt.checks { - check(t, newStargz, tocDigest, dgstMap, cl) - } - }) + for _, check := range tt.checks { + check(t, newStargz, tocDigest, dgstMap, cl, newCL) + } + }) + } } } } @@ -654,7 +692,7 @@ func testDigestAndVerify(t *testing.T, controllers ...TestingController) { // checkStargzTOC checks the TOC JSON of the passed stargz has the expected // digest and contains valid chunks. It walks all entries in the stargz and // checks all chunk digests stored to the TOC JSON match the actual contents. -func checkStargzTOC(t *testing.T, sgzData []byte, tocDigest digest.Digest, dgstMap map[string]digest.Digest, controller TestingController) { +func checkStargzTOC(t *testing.T, sgzData []byte, tocDigest digest.Digest, dgstMap map[string]digest.Digest, controller TestingController, newController TestingControllerFactory) { sgz, err := Open( io.NewSectionReader(bytes.NewReader(sgzData), 0, int64(len(sgzData))), WithDecompressors(controller), @@ -765,7 +803,7 @@ func checkStargzTOC(t *testing.T, sgzData []byte, tocDigest digest.Digest, dgstM // checkVerifyTOC checks the verification works for the TOC JSON of the passed // stargz. It walks all entries in the stargz and checks the verifications for // all chunks work. -func checkVerifyTOC(t *testing.T, sgzData []byte, tocDigest digest.Digest, dgstMap map[string]digest.Digest, controller TestingController) { +func checkVerifyTOC(t *testing.T, sgzData []byte, tocDigest digest.Digest, dgstMap map[string]digest.Digest, controller TestingController, newController TestingControllerFactory) { sgz, err := Open( io.NewSectionReader(bytes.NewReader(sgzData), 0, int64(len(sgzData))), WithDecompressors(controller), @@ -846,7 +884,7 @@ func checkVerifyTOC(t *testing.T, sgzData []byte, tocDigest digest.Digest, dgstM // checkVerifyInvalidTOCEntryFail checks if misconfigured TOC JSON can be // detected during the verification and the verification returns an error. func checkVerifyInvalidTOCEntryFail(filename string) check { - return func(t *testing.T, sgzData []byte, tocDigest digest.Digest, dgstMap map[string]digest.Digest, controller TestingController) { + return func(t *testing.T, sgzData []byte, tocDigest digest.Digest, dgstMap map[string]digest.Digest, controller TestingController, newController TestingControllerFactory) { funcs := map[string]rewriteFunc{ "lost digest in a entry": func(t *testing.T, toc *JTOC, sgz *io.SectionReader) { var found bool @@ -920,8 +958,9 @@ func checkVerifyInvalidTOCEntryFail(filename string) check { // checkVerifyInvalidStargzFail checks if the verification detects that the // given stargz file doesn't match to the expected digest and returns error. func checkVerifyInvalidStargzFail(invalid *io.SectionReader) check { - return func(t *testing.T, sgzData []byte, tocDigest digest.Digest, dgstMap map[string]digest.Digest, controller TestingController) { - rc, err := Build(invalid, WithChunkSize(chunkSize), WithCompression(controller)) + return func(t *testing.T, sgzData []byte, tocDigest digest.Digest, dgstMap map[string]digest.Digest, controller TestingController, newController TestingControllerFactory) { + cl := newController() + rc, err := Build(invalid, WithChunkSize(chunkSize), WithCompression(cl)) if err != nil { t.Fatalf("failed to convert stargz: %v", err) } @@ -934,7 +973,7 @@ func checkVerifyInvalidStargzFail(invalid *io.SectionReader) check { sgz, err := Open( io.NewSectionReader(bytes.NewReader(mStargz), 0, int64(len(mStargz))), - WithDecompressors(controller), + WithDecompressors(cl), ) if err != nil { t.Fatalf("failed to parse converted stargz: %v", err) @@ -951,7 +990,7 @@ func checkVerifyInvalidStargzFail(invalid *io.SectionReader) check { // checkVerifyBrokenContentFail checks if the verifier detects broken contents // that doesn't match to the expected digest and returns error. func checkVerifyBrokenContentFail(filename string) check { - return func(t *testing.T, sgzData []byte, tocDigest digest.Digest, dgstMap map[string]digest.Digest, controller TestingController) { + return func(t *testing.T, sgzData []byte, tocDigest digest.Digest, dgstMap map[string]digest.Digest, controller TestingController, newController TestingControllerFactory) { // Parse stargz file sgz, err := Open( io.NewSectionReader(bytes.NewReader(sgzData), 0, int64(len(sgzData))), @@ -1070,7 +1109,10 @@ func parseStargz(sgz *io.SectionReader, controller TestingController) (decodedJT } // Decode the TOC JSON - tocReader := io.NewSectionReader(sgz, tocOffset, sgz.Size()-tocOffset-fSize) + var tocReader io.Reader + if tocOffset >= 0 { + tocReader = io.NewSectionReader(sgz, tocOffset, sgz.Size()-tocOffset-fSize) + } decodedJTOC, _, err = controller.ParseTOC(tocReader) if err != nil { return nil, 0, fmt.Errorf("failed to parse TOC: %w", err) @@ -1078,28 +1120,31 @@ func parseStargz(sgz *io.SectionReader, controller TestingController) (decodedJT return decodedJTOC, tocOffset, nil } -func testWriteAndOpen(t *testing.T, controllers ...TestingController) { +func testWriteAndOpen(t *testing.T, controllers ...TestingControllerFactory) { const content = "Some contents" invalidUtf8 := "\xff\xfe\xfd" xAttrFile := xAttr{"foo": "bar", "invalid-utf8": invalidUtf8} sampleOwner := owner{uid: 50, gid: 100} + data64KB := randomContents(64000) + tests := []struct { - name string - chunkSize int - in []tarEntry - want []stargzCheck - wantNumGz int // expected number of streams + name string + chunkSize int + minChunkSize int + in []tarEntry + want []stargzCheck + wantNumGz int // expected number of streams wantNumGzLossLess int // expected number of streams (> 0) in lossless mode if it's different from wantNumGz wantFailOnLossLess bool + wantTOCVersion int // default = 1 }{ { - name: "empty", - in: tarOf(), - wantNumGz: 2, // empty tar + TOC + footer - wantNumGzLossLess: 3, // empty tar + TOC + footer + name: "empty", + in: tarOf(), + wantNumGz: 2, // (empty tar) + TOC + footer want: checks( numTOCEntries(0), ), @@ -1195,7 +1240,7 @@ func testWriteAndOpen(t *testing.T, controllers ...TestingController) { dir("foo/"), file("foo/big.txt", "This "+"is s"+"uch "+"a bi"+"g fi"+"le"), ), - wantNumGz: 9, + wantNumGz: 9, // dir + big.txt(6 chunks) + TOC + footer want: checks( numTOCEntries(7), // 1 for foo dir, 6 for the foo/big.txt file hasDir("foo/"), @@ -1326,23 +1371,108 @@ func testWriteAndOpen(t *testing.T, controllers ...TestingController) { mustSameEntry("foo/foo1", "foolink"), ), }, + { + name: "several_files_in_chunk", + minChunkSize: 8000, + in: tarOf( + dir("foo/"), + file("foo/foo1", data64KB), + file("foo2", "bb"), + file("foo22", "ccc"), + dir("bar/"), + file("bar/bar.txt", "aaa"), + file("foo3", data64KB), + ), + // NOTE: we assume that the compressed "data64KB" is still larger than 8KB + wantNumGz: 4, // dir+foo1, foo2+foo22+dir+bar.txt+foo3, TOC, footer + want: checks( + numTOCEntries(7), // dir, foo1, foo2, foo22, dir, bar.txt, foo3 + hasDir("foo/"), + hasDir("bar/"), + hasFileLen("foo/foo1", len(data64KB)), + hasFileLen("foo2", len("bb")), + hasFileLen("foo22", len("ccc")), + hasFileLen("bar/bar.txt", len("aaa")), + hasFileLen("foo3", len(data64KB)), + hasFileDigest("foo/foo1", digestFor(data64KB)), + hasFileDigest("foo2", digestFor("bb")), + hasFileDigest("foo22", digestFor("ccc")), + hasFileDigest("bar/bar.txt", digestFor("aaa")), + hasFileDigest("foo3", digestFor(data64KB)), + hasFileContentsWithPreRead("foo22", 0, "ccc", chunkInfo{"foo2", "bb"}, chunkInfo{"bar/bar.txt", "aaa"}, chunkInfo{"foo3", data64KB}), + hasFileContentsRange("foo/foo1", 0, data64KB), + hasFileContentsRange("foo2", 0, "bb"), + hasFileContentsRange("foo2", 1, "b"), + hasFileContentsRange("foo22", 0, "ccc"), + hasFileContentsRange("foo22", 1, "cc"), + hasFileContentsRange("foo22", 2, "c"), + hasFileContentsRange("bar/bar.txt", 0, "aaa"), + hasFileContentsRange("bar/bar.txt", 1, "aa"), + hasFileContentsRange("bar/bar.txt", 2, "a"), + hasFileContentsRange("foo3", 0, data64KB), + hasFileContentsRange("foo3", 1, data64KB[1:]), + hasFileContentsRange("foo3", 2, data64KB[2:]), + hasFileContentsRange("foo3", len(data64KB)/2, data64KB[len(data64KB)/2:]), + hasFileContentsRange("foo3", len(data64KB)-1, data64KB[len(data64KB)-1:]), + ), + }, + { + name: "several_files_in_chunk_chunked", + minChunkSize: 8000, + chunkSize: 32000, + in: tarOf( + dir("foo/"), + file("foo/foo1", data64KB), + file("foo2", "bb"), + dir("bar/"), + file("foo3", data64KB), + ), + // NOTE: we assume that the compressed chunk of "data64KB" is still larger than 8KB + wantNumGz: 6, // dir+foo1(1), foo1(2), foo2+dir+foo3(1), foo3(2), TOC, footer + want: checks( + numTOCEntries(7), // dir, foo1(2 chunks), foo2, dir, foo3(2 chunks) + hasDir("foo/"), + hasDir("bar/"), + hasFileLen("foo/foo1", len(data64KB)), + hasFileLen("foo2", len("bb")), + hasFileLen("foo3", len(data64KB)), + hasFileDigest("foo/foo1", digestFor(data64KB)), + hasFileDigest("foo2", digestFor("bb")), + hasFileDigest("foo3", digestFor(data64KB)), + hasFileContentsWithPreRead("foo2", 0, "bb", chunkInfo{"foo3", data64KB[:32000]}), + hasFileContentsRange("foo/foo1", 0, data64KB), + hasFileContentsRange("foo/foo1", 1, data64KB[1:]), + hasFileContentsRange("foo/foo1", 2, data64KB[2:]), + hasFileContentsRange("foo/foo1", len(data64KB)/2, data64KB[len(data64KB)/2:]), + hasFileContentsRange("foo/foo1", len(data64KB)-1, data64KB[len(data64KB)-1:]), + hasFileContentsRange("foo2", 0, "bb"), + hasFileContentsRange("foo2", 1, "b"), + hasFileContentsRange("foo3", 0, data64KB), + hasFileContentsRange("foo3", 1, data64KB[1:]), + hasFileContentsRange("foo3", 2, data64KB[2:]), + hasFileContentsRange("foo3", len(data64KB)/2, data64KB[len(data64KB)/2:]), + hasFileContentsRange("foo3", len(data64KB)-1, data64KB[len(data64KB)-1:]), + ), + }, } for _, tt := range tests { - for _, cl := range controllers { - cl := cl + for _, newCL := range controllers { + newCL := newCL for _, prefix := range allowedPrefix { prefix := prefix for _, srcTarFormat := range []tar.Format{tar.FormatUSTAR, tar.FormatPAX, tar.FormatGNU} { srcTarFormat := srcTarFormat for _, lossless := range []bool{true, false} { - t.Run(tt.name+"-"+fmt.Sprintf("compression=%v,prefix=%q,lossless=%v,format=%s", cl, prefix, lossless, srcTarFormat), func(t *testing.T) { + t.Run(tt.name+"-"+fmt.Sprintf("compression=%v,prefix=%q,lossless=%v,format=%s", newCL(), prefix, lossless, srcTarFormat), func(t *testing.T) { var tr io.Reader = buildTar(t, tt.in, prefix, srcTarFormat) origTarDgstr := digest.Canonical.Digester() tr = io.TeeReader(tr, origTarDgstr.Hash()) var stargzBuf bytes.Buffer - w := NewWriterWithCompressor(&stargzBuf, cl) + cl1 := newCL() + w := NewWriterWithCompressor(&stargzBuf, cl1) w.ChunkSize = tt.chunkSize + w.MinChunkSize = tt.minChunkSize if lossless { err := w.AppendTarLossLess(tr) if tt.wantFailOnLossLess { @@ -1366,7 +1496,7 @@ func testWriteAndOpen(t *testing.T, controllers ...TestingController) { if lossless { // Check if the result blob reserves original tar metadata - rc, err := Unpack(io.NewSectionReader(bytes.NewReader(b), 0, int64(len(b))), cl) + rc, err := Unpack(io.NewSectionReader(bytes.NewReader(b), 0, int64(len(b))), cl1) if err != nil { t.Errorf("failed to decompress blob: %v", err) return @@ -1385,32 +1515,71 @@ func testWriteAndOpen(t *testing.T, controllers ...TestingController) { } diffID := w.DiffID() - wantDiffID := cl.DiffIDOf(t, b) + wantDiffID := cl1.DiffIDOf(t, b) if diffID != wantDiffID { t.Errorf("DiffID = %q; want %q", diffID, wantDiffID) } - got := cl.CountStreams(t, b) - wantNumGz := tt.wantNumGz - if lossless && tt.wantNumGzLossLess > 0 { - wantNumGz = tt.wantNumGzLossLess - } - if got != wantNumGz { - t.Errorf("number of streams = %d; want %d", got, wantNumGz) - } - telemetry, checkCalled := newCalledTelemetry() + sr := io.NewSectionReader(bytes.NewReader(b), 0, int64(len(b))) r, err := Open( - io.NewSectionReader(bytes.NewReader(b), 0, int64(len(b))), - WithDecompressors(cl), + sr, + WithDecompressors(cl1), WithTelemetry(telemetry), ) if err != nil { t.Fatalf("stargz.Open: %v", err) } - if err := checkCalled(); err != nil { + wantTOCVersion := 1 + if tt.wantTOCVersion > 0 { + wantTOCVersion = tt.wantTOCVersion + } + if r.toc.Version != wantTOCVersion { + t.Fatalf("invalid TOC Version %d; wanted %d", r.toc.Version, wantTOCVersion) + } + + footerSize := cl1.FooterSize() + footerOffset := sr.Size() - footerSize + footer := make([]byte, footerSize) + if _, err := sr.ReadAt(footer, footerOffset); err != nil { + t.Errorf("failed to read footer: %v", err) + } + _, tocOffset, _, err := cl1.ParseFooter(footer) + if err != nil { + t.Errorf("failed to parse footer: %v", err) + } + if err := checkCalled(tocOffset >= 0); err != nil { t.Errorf("telemetry failure: %v", err) } + + wantNumGz := tt.wantNumGz + if lossless && tt.wantNumGzLossLess > 0 { + wantNumGz = tt.wantNumGzLossLess + } + streamOffsets := []int64{0} + prevOffset := int64(-1) + streams := 0 + for _, e := range r.toc.Entries { + if e.Offset > prevOffset { + streamOffsets = append(streamOffsets, e.Offset) + prevOffset = e.Offset + streams++ + } + } + streams++ // TOC + if tocOffset >= 0 { + // toc is in the blob + streamOffsets = append(streamOffsets, tocOffset) + } + streams++ // footer + streamOffsets = append(streamOffsets, footerOffset) + if streams != wantNumGz { + t.Errorf("number of streams in TOC = %d; want %d", streams, wantNumGz) + } + + t.Logf("testing streams: %+v", streamOffsets) + cl1.TestStreams(t, b, streamOffsets) + for _, want := range tt.want { want.check(t, r) } @@ -1422,7 +1591,12 @@ func testWriteAndOpen(t *testing.T, controllers ...TestingController) { } } -func newCalledTelemetry() (telemetry *Telemetry, check func() error) { +type chunkInfo struct { + name string + data string +} + +func newCalledTelemetry() (telemetry *Telemetry, check func(needsGetTOC bool) error) { var getFooterLatencyCalled bool var getTocLatencyCalled bool var deserializeTocLatencyCalled bool @@ -1430,13 +1604,15 @@ func newCalledTelemetry() (telemetry *Telemetry, check func() error) { func(time.Time) { getFooterLatencyCalled = true }, func(time.Time) { getTocLatencyCalled = true }, func(time.Time) { deserializeTocLatencyCalled = true }, - }, func() error { + }, func(needsGetTOC bool) error { var allErr []error if !getFooterLatencyCalled { allErr = append(allErr, fmt.Errorf("metrics GetFooterLatency isn't called")) } - if !getTocLatencyCalled { - allErr = append(allErr, fmt.Errorf("metrics GetTocLatency isn't called")) + if needsGetTOC { + if !getTocLatencyCalled { + allErr = append(allErr, fmt.Errorf("metrics GetTocLatency isn't called")) + } } if !deserializeTocLatencyCalled { allErr = append(allErr, fmt.Errorf("metrics DeserializeTocLatency isn't called")) @@ -1573,6 +1749,53 @@ func hasFileDigest(file string, digest string) stargzCheck { }) } +func hasFileContentsWithPreRead(file string, offset int, want string, extra ...chunkInfo) stargzCheck { + return stargzCheckFn(func(t *testing.T, r *Reader) { + extraMap := make(map[string]chunkInfo) + for _, e := range extra { + extraMap[e.name] = e + } + var extraNames []string + for n := range extraMap { + extraNames = append(extraNames, n) + } + f, err := r.OpenFileWithPreReader(file, func(e *TOCEntry, cr io.Reader) error { + t.Logf("On %q: got preread of %q", file, e.Name) + ex, ok := extraMap[e.Name] + if !ok { + t.Fatalf("fail on %q: unexpected entry %q: %+v, %+v", file, e.Name, e, extraNames) + } + got, err := io.ReadAll(cr) + if err != nil { + t.Fatalf("fail on %q: failed to read %q: %v", file, e.Name, err) + } + if ex.data != string(got) { + t.Fatalf("fail on %q: unexpected contents of %q: len=%d; want=%d", file, e.Name, len(got), len(ex.data)) + } + delete(extraMap, e.Name) + return nil + }) + if err != nil { + t.Fatal(err) + } + got := make([]byte, len(want)) + n, err := f.ReadAt(got, int64(offset)) + if err != nil { + t.Fatalf("ReadAt(len %d, offset %d, size %d) = %v, %v", len(got), offset, f.Size(), n, err) + } + if string(got) != want { + t.Fatalf("ReadAt(len %d, offset %d) = %q, want %q", len(got), offset, viewContent(got), viewContent([]byte(want))) + } + if len(extraMap) != 0 { + var exNames []string + for _, ex := range extraMap { + exNames = append(exNames, ex.name) + } + t.Fatalf("fail on %q: some entries aren't read: %+v", file, exNames) + } + }) +} + func hasFileContentsRange(file string, offset int, want string) stargzCheck { return stargzCheckFn(func(t *testing.T, r *Reader) { f, err := r.OpenFile(file) @@ -1585,7 +1808,7 @@ func hasFileContentsRange(file string, offset int, want string) stargzCheck { t.Fatalf("ReadAt(len %d, offset %d) = %v, %v", len(got), offset, n, err) } if string(got) != want { - t.Fatalf("ReadAt(len %d, offset %d) = %q, want %q", len(got), offset, got, want) + t.Fatalf("ReadAt(len %d, offset %d) = %q, want %q", len(got), offset, viewContent(got), viewContent([]byte(want))) } }) } @@ -1797,6 +2020,13 @@ func mustSameEntry(files ...string) stargzCheck { }) } +func viewContent(c []byte) string { + if len(c) < 100 { + return string(c) + } + return string(c[:50]) + "...(omit)..." + string(c[50:100]) +} + func tarOf(s ...tarEntry) []tarEntry { return s } type tarEntry interface { @@ -2056,6 +2286,16 @@ func regDigest(t *testing.T, name string, contentStr string, digestMap map[strin }) } +var runes = []rune("1234567890abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ") + +func randomContents(n int) string { + b := make([]rune, n) + for i := range b { + b[i] = runes[rand.Intn(len(runes))] + } + return string(b) +} + func fileModeToTarMode(mode os.FileMode) (int64, error) { h, err := tar.FileInfoHeader(fileInfoOnlyMode(mode), "") if err != nil { @@ -2073,3 +2313,54 @@ func (f fileInfoOnlyMode) Mode() os.FileMode { return os.FileMode(f) } func (f fileInfoOnlyMode) ModTime() time.Time { return time.Now() } func (f fileInfoOnlyMode) IsDir() bool { return os.FileMode(f).IsDir() } func (f fileInfoOnlyMode) Sys() interface{} { return nil } + +func CheckGzipHasStreams(t *testing.T, b []byte, streams []int64) { + if len(streams) == 0 { + return // nop + } + + wants := map[int64]struct{}{} + for _, s := range streams { + wants[s] = struct{}{} + } + + len0 := len(b) + br := bytes.NewReader(b) + zr := new(gzip.Reader) + t.Logf("got gzip streams:") + numStreams := 0 + for { + zoff := len0 - br.Len() + if err := zr.Reset(br); err != nil { + if err == io.EOF { + return + } + t.Fatalf("countStreams(gzip), Reset: %v", err) + } + zr.Multistream(false) + n, err := io.Copy(io.Discard, zr) + if err != nil { + t.Fatalf("countStreams(gzip), Copy: %v", err) + } + var extra string + if len(zr.Header.Extra) > 0 { + extra = fmt.Sprintf("; extra=%q", zr.Header.Extra) + } + t.Logf(" [%d] at %d in stargz, uncompressed length %d%s", numStreams, zoff, n, extra) + delete(wants, int64(zoff)) + numStreams++ + } +} + +func GzipDiffIDOf(t *testing.T, b []byte) string { + h := sha256.New() + zr, err := gzip.NewReader(bytes.NewReader(b)) + if err != nil { + t.Fatalf("diffIDOf(gzip): %v", err) + } + defer zr.Close() + if _, err := io.Copy(h, zr); err != nil { + t.Fatalf("diffIDOf(gzip).Copy: %v", err) + } + return fmt.Sprintf("sha256:%x", h.Sum(nil)) +} diff --git a/src/cmd/linuxkit/vendor/github.com/containerd/stargz-snapshotter/estargz/types.go b/src/cmd/linuxkit/vendor/github.com/containerd/stargz-snapshotter/estargz/types.go index 3bc74463e..57e0aa614 100644 --- a/src/cmd/linuxkit/vendor/github.com/containerd/stargz-snapshotter/estargz/types.go +++ b/src/cmd/linuxkit/vendor/github.com/containerd/stargz-snapshotter/estargz/types.go @@ -149,6 +149,12 @@ type TOCEntry struct { // ChunkSize. Offset int64 `json:"offset,omitempty"` + // InnerOffset is an optional field indicates uncompressed offset + // of this "reg" or "chunk" payload in a stream starts from Offset. + // This field enables to put multiple "reg" or "chunk" payloads + // in one chunk with having the same Offset but different InnerOffset. + InnerOffset int64 `json:"innerOffset,omitempty"` + nextOffset int64 // the Offset of the next entry with a non-zero Offset // DevMajor is the major device number for "char" and "block" types. @@ -186,6 +192,9 @@ type TOCEntry struct { ChunkDigest string `json:"chunkDigest,omitempty"` children map[string]*TOCEntry + + // chunkTopIndex is index of the entry where Offset starts in the blob. + chunkTopIndex int } // ModTime returns the entry's modification time. @@ -279,7 +288,10 @@ type Compressor interface { // Writer returns WriteCloser to be used for writing a chunk to eStargz. // Everytime a chunk is written, the WriteCloser is closed and Writer is // called again for writing the next chunk. - Writer(w io.Writer) (io.WriteCloser, error) + // + // The returned writer should implement "Flush() error" function that flushes + // any pending compressed data to the underlying writer. + Writer(w io.Writer) (WriteFlushCloser, error) // WriteTOCAndFooter is called to write JTOC to the passed Writer. // diffHash calculates the DiffID (uncompressed sha256 hash) of the blob @@ -303,8 +315,12 @@ type Decompressor interface { // payloadBlobSize is the (compressed) size of the blob payload (i.e. the size between // the top until the TOC JSON). // - // Here, tocSize is optional. If tocSize <= 0, it's by default the size of the range - // from tocOffset until the beginning of the footer (blob size - tocOff - FooterSize). + // If tocOffset < 0, we assume that TOC isn't contained in the blob and pass nil reader + // to ParseTOC. We expect that ParseTOC acquire TOC from the external location and return it. + // + // tocSize is optional. If tocSize <= 0, it's by default the size of the range from tocOffset until the beginning of the + // footer (blob size - tocOff - FooterSize). + // If blobPayloadSize < 0, blobPayloadSize become the blob size. ParseFooter(p []byte) (blobPayloadSize, tocOffset, tocSize int64, err error) // ParseTOC parses TOC from the passed reader. The reader provides the partial contents @@ -313,5 +329,14 @@ type Decompressor interface { // This function returns tocDgst that represents the digest of TOC that will be used // to verify this blob. This must match to the value returned from // Compressor.WriteTOCAndFooter that is used when creating this blob. + // + // If tocOffset returned by ParseFooter is < 0, we assume that TOC isn't contained in the blob. + // Pass nil reader to ParseTOC then we expect that ParseTOC acquire TOC from the external location + // and return it. ParseTOC(r io.Reader) (toc *JTOC, tocDgst digest.Digest, err error) } + +type WriteFlushCloser interface { + io.WriteCloser + Flush() error +} diff --git a/src/cmd/linuxkit/vendor/github.com/docker/cli/AUTHORS b/src/cmd/linuxkit/vendor/github.com/docker/cli/AUTHORS index 8990f85b5..483743c99 100644 --- a/src/cmd/linuxkit/vendor/github.com/docker/cli/AUTHORS +++ b/src/cmd/linuxkit/vendor/github.com/docker/cli/AUTHORS @@ -1,9 +1,10 @@ -# This file lists all individuals having contributed content to the repository. -# For how it is generated, see `scripts/docs/generate-authors.sh`. +# File @generated by scripts/docs/generate-authors.sh. DO NOT EDIT. +# This file lists all contributors to the repository. +# See scripts/docs/generate-authors.sh to make modifications. Aanand Prasad Aaron L. Xu -Aaron Lehmann +Aaron Lehmann Aaron.L.Xu Abdur Rehman Abhinandan Prativadi @@ -24,22 +25,27 @@ Akihiro Suda Akim Demaille Alan Thompson Albert Callarisa +Alberto Roura Albin Kerouanton Aleksa Sarai Aleksander Piotrowski Alessandro Boch +Alex Couture-Beil Alex Mavrogiannis Alex Mayer Alexander Boyd Alexander Larsson -Alexander Morozov +Alexander Morozov Alexander Ryabov Alexandre González +Alexey Igrychev +Alexis Couvreur Alfred Landrum Alicia Lauerman Allen Sun Alvin Deng Amen Belayneh +Amey Shrivastava <72866602+AmeyShrivastava@users.noreply.github.com> Amir Goldstein Amit Krishnan Amit Shukla @@ -48,6 +54,8 @@ Anca Iordache Anda Xu Andrea Luzzardi Andreas Köhler +Andres G. Aragoneses +Andres Leon Rangel Andrew France Andrew Hsu Andrew Macpherson @@ -67,8 +75,9 @@ Antonis Kalipetis Anusha Ragunathan Ao Li Arash Deshmeh -Arko Dasgupta -Arnaud Porterie +Arko Dasgupta +Arnaud Porterie +Arnaud Rebillout Arthur Peka Ashwini Oruganti Azat Khuyiyakhmetov @@ -76,18 +85,23 @@ Bardia Keyoumarsi Barnaby Gray Bastiaan Bakker BastianHofmann +Ben Bodenmiller Ben Bonnefoy Ben Creasy Ben Firshman Benjamin Boudreau +Benjamin Böhmke +Benjamin Nater Benoit Sigoure Bhumika Bayani Bill Wang Bin Liu Bingshen Wang +Bishal Das Boaz Shuster Bogdan Anton Boris Pruessmann +Brad Baker Bradley Cicenas Brandon Mitchell Brandon Philips @@ -96,6 +110,7 @@ Bret Fisher Brian (bex) Exelbierd Brian Goff Brian Wieder +Bruno Sousa Bryan Bess Bryan Boreham Bryan Murphy @@ -114,15 +129,19 @@ Charles Chan Charles Law Charles Smith Charlie Drage +Charlotte Mach ChaYoung You +Chee Hau Lim Chen Chuanliang Chen Hanxiao Chen Mingjie Chen Qiu +Chris Couzens Chris Gavin Chris Gibson Chris McKinnel Chris Snow +Chris Vermilion Chris Weyl Christian Persson Christian Stefanescu @@ -131,6 +150,7 @@ Christophe Vidal Christopher Biscardi Christopher Crone Christopher Jones +Christopher Svensson Christy Norman Chun Chen Clinton Kitson @@ -139,8 +159,10 @@ Colin Hebert Collin Guarino Colm Hally Comical Derskeal <27731088+derskeal@users.noreply.github.com> +Conner Crosby Corey Farrell Corey Quon +Cory Bennet Craig Wilhite Cristian Staretu Daehyeok Mun @@ -170,11 +192,13 @@ Dattatraya Kumbhar Dave Goodchild Dave Henderson Dave Tucker +David Alvarez David Beitey David Calavera David Cramer David Dooling David Gageot +David Karlsson David Lechner David Scott David Sheets @@ -186,7 +210,8 @@ Denis Defreyne Denis Gladkikh Denis Ollier Dennis Docter -Derek McGowan +Derek McGowan +Des Preston Deshi Xiao Dharmit Shah Dhawal Yogesh Bhanushali @@ -196,12 +221,14 @@ Dimitry Andric Ding Fei Diogo Monica Djordje Lukic +Dmitriy Fishman Dmitry Gusev Dmitry Smirnov Dmitry V. Krivenok Dominik Braun Don Kjer Dong Chen +DongGeon Lee Doug Davis Drew Erny Ed Costello @@ -211,12 +238,14 @@ Eli Uriegas Elias Faxö Elliot Luo <956941328@qq.com> Eric Curtin +Eric Engestrom Eric G. Noriega Eric Rosenberg Eric Sage Eric-Olivier Lamey Erica Windisch Erik Hollensbe +Erik Humphrey Erik St. Martin Essam A. Hassan Ethan Haynes @@ -229,8 +258,10 @@ Evelyn Xu Everett Toews Fabio Falci Fabrizio Soppelsa +Felix Geyer Felix Hupfeld Felix Rabe +fezzik1620 Filip Jareš Flavio Crisciani Florian Klein @@ -242,6 +273,7 @@ Frederic Hemberger Frederick F. Kautz IV Frederik Nordahl Jul Sabroe Frieder Bluemle +Gabriel Gore Gabriel Nicolas Avellaneda Gaetan de Villele Gang Qiao @@ -251,13 +283,18 @@ George MacRorie George Xie Gianluca Borello Gildas Cuisinier +Gio d'Amelio +Gleb Stsenov Goksu Toprak Gou Rao +Govind Rai Grant Reaber Greg Pflaum +Gsealy Guilhem Lettron Guillaume J. Charmes Guillaume Le Floch +Guillaume Tardif gwx296173 Günther Jungbluth Hakan Özler @@ -278,6 +315,7 @@ Hugo Gabriel Eyherabide huqun Huu Nguyen Hyzhou Zhy +Iain Samuel McLean Elder Ian Campbell Ian Philpot Ignacio Capurro @@ -287,6 +325,7 @@ Ilya Sotkov Ioan Eugen Stan Isabel Jimenez Ivan Grcic +Ivan Grund Ivan Markin Jacob Atzen Jacob Tomlinson @@ -302,15 +341,18 @@ Jan-Jaap Driessen Jana Radhakrishnan Jared Hocutt Jasmine Hegman +Jason Hall Jason Heiss Jason Plum Jay Kamat +Jean Lecordier Jean Rouge Jean-Christophe Sirot Jean-Pierre Huynh Jeff Lindsay Jeff Nickoloff Jeff Silberman +Jennings Zhang Jeremy Chambers Jeremy Unruh Jeremy Yallop @@ -322,6 +364,7 @@ Jian Zhang Jie Luo Jilles Oldenbeuving Jim Galasyn +Jim Lin Jimmy Leger Jimmy Song jimmyxian @@ -338,6 +381,7 @@ Johannes 'fish' Ziemke John Feminella John Harris John Howard +John Howard John Laswell John Maguire John Mulhausen @@ -347,13 +391,16 @@ John Tims John V. Martinez John Willis Jon Johnson +Jon Zeolla Jonatas Baldin Jonathan Boulle Jonathan Lee Jonathan Lomas Jonathan McCrohan +Jonathan Warriss-Simmons Jonh Wendell Jordan Jennings +Jorge Vallecillo Jose J. Escobar <53836904+jescobar-docker@users.noreply.github.com> Joseph Kern Josh Bodah @@ -383,9 +430,11 @@ Katie McLaughlin Ke Xu Kei Ohmura Keith Hudgins +Kelton Bassingthwaite Ken Cochrane Ken ICHIKAWA Kenfe-Mickaël Laventure +Kevin Alvarez Kevin Burke Kevin Feyrer Kevin Kern @@ -401,6 +450,7 @@ Krasi Georgiev Kris-Mikael Krister Kun Zhang Kunal Kushwaha +Kyle Mitofsky Lachlan Cooper Lai Jiangshan Lars Kellogg-Stedman @@ -410,6 +460,7 @@ Lee Gaines Lei Jitang Lennie Leo Gallucci +Leonid Skorospelov Lewis Daly Li Yi Li Yi @@ -445,6 +496,7 @@ Manjunath A Kumatagi Mansi Nahar mapk0y Marc Bihlmaier +Marc Cornellà Marco Mariani Marco Vedovati Marcus Martins @@ -459,6 +511,7 @@ Mason Fish Mason Malone Mateusz Major Mathieu Champlon +Mathieu Rollet Matt Gucci Matt Robenolt Matteo Orefice @@ -467,11 +520,13 @@ Matthieu Hauglustaine Mauro Porras P Max Shytikov Maxime Petazzoni +Maximillian Fan Xavier Mei ChunTao +Metal <2466052+tedhexaflow@users.noreply.github.com> Micah Zoltu Michael A. Smith Michael Bridgen -Michael Crosby +Michael Crosby Michael Friis Michael Irwin Michael Käufl @@ -487,6 +542,7 @@ Mihai Borobocea Mihuleacc Sergiu Mike Brown Mike Casas +Mike Dalton Mike Danese Mike Dillon Mike Goelzer @@ -503,9 +559,12 @@ Mohini Anne Dsouza Moorthy RS Morgan Bauer Morten Hekkvang +Morten Linderud Moysés Borges +Mozi <29089388+pzhlkj6612@users.noreply.github.com> Mrunal Patel muicoder +Murukesh Mohanan Muthukumar R Máximo Cuadros Mårten Cassel @@ -521,6 +580,7 @@ Nathan LeClaire Nathan McCauley Neil Peterson Nick Adcock +Nick Santos Nico Stapelbroek Nicola Kabar Nicolas Borboën @@ -535,6 +595,8 @@ Noah Treuhaft O.S. Tezer Odin Ugedal ohmystack +OKA Naoya +Oliver Pomeroy Olle Jonsson Olli Janatuinen Oscar Wieman @@ -550,9 +612,12 @@ Paul Lietar Paul Mulders Paul Weaver Pavel Pospisil +Paweł Gronowski +Paweł Pokrywka Paweł Szczekutowicz Peeyush Gupta Per Lundberg +Peter Dave Hello Peter Edge Peter Hsu Peter Jaffe @@ -560,11 +625,13 @@ Peter Kehl Peter Nagy Peter Salvatore Peter Waller -Phil Estes +Phil Estes Philip Alexander Etling Philipp Gillé Philipp Schmied +Phong Tran pidster +Pieter E Smit pixelistik Pratik Karki Prayag Verma @@ -574,6 +641,7 @@ Qiang Huang Qinglan Peng qudongfang Raghavendra K T +Rahul Kadyan Rahul Zoldyck Ravi Shekhar Jethani Ray Tsang @@ -582,6 +650,7 @@ Remy Suen Renaud Gaubert Ricardo N Feliciano Rich Moyse +Richard Chen Zheng <58443436+rchenzheng@users.noreply.github.com> Richard Mathie Richard Scothern Rick Wieman @@ -591,6 +660,7 @@ Rob Gulewich Robert Wallis Robin Naundorf Robin Speekenbrink +Roch Feuillade Rodolfo Ortiz Rogelio Canedo Rohan Verma @@ -609,11 +679,13 @@ Sainath Grandhi Sakeven Jiang Sally O'Malley Sam Neirinck +Sam Thibault Samarth Shah Sambuddha Basu Sami Tabet Samuel Cochran Samuel Karp +Sandro Jäckel Santhosh Manohar Sargun Dhillon Saswat Bhattacharya @@ -643,7 +715,8 @@ Slava Semushin Solomon Hykes Song Gao Spencer Brown -squeegels <1674195+squeegels@users.noreply.github.com> +Spring Lee +squeegels Srini Brahmaroutu Stefan S. Stefan Scherer @@ -654,6 +727,7 @@ Stephen Rust Steve Durrheimer Steve Richards Steven Burgess +Stoica-Marcu Floris-Andrei Subhajit Ghosh Sun Jianbo Sune Keller @@ -665,7 +739,10 @@ Sébastien HOUZÉ T K Sourabh TAGOMORI Satoshi taiji-tech +Takeshi Koenuma +Takuya Noguchi Taylor Jones +Teiva Harsanyi Tejaswini Duggaraju Tengfei Wang Teppei Fukuda @@ -696,6 +773,7 @@ Tom Fotherby Tom Klingenberg Tom Milligan Tom X. Tobin +Tomas Bäckman Tomas Tomecek Tomasz Kopczynski Tomáš Hrčka @@ -711,6 +789,7 @@ Ulrich Bareth Ulysses Souza Umesh Yadav Valentin Lorentz +Vardan Pogosian Venkateswara Reddy Bukkasamudram Veres Lajos Victor Vieux @@ -757,6 +836,7 @@ Yunxiang Huang Zachary Romero Zander Mackie zebrilee +Zeel B Patel Zhang Kun Zhang Wei Zhang Wentao @@ -768,4 +848,5 @@ Zhu Guihua Álex González Álvaro Lázaro Átila Camurça Alves +Александр Менщиков <__Singleton__@hackerdom.ru> 徐俊杰 diff --git a/src/cmd/linuxkit/vendor/github.com/docker/cli/cli/config/config.go b/src/cmd/linuxkit/vendor/github.com/docker/cli/cli/config/config.go index 31ad117d4..b7c05c3f8 100644 --- a/src/cmd/linuxkit/vendor/github.com/docker/cli/cli/config/config.go +++ b/src/cmd/linuxkit/vendor/github.com/docker/cli/cli/config/config.go @@ -19,7 +19,7 @@ const ( // ConfigFileName is the name of config file ConfigFileName = "config.json" configFileDir = ".docker" - oldConfigfile = ".dockercfg" + oldConfigfile = ".dockercfg" // Deprecated: remove once we stop printing deprecation warning contextsDir = "contexts" ) @@ -84,16 +84,6 @@ func Path(p ...string) (string, error) { return path, nil } -// LegacyLoadFromReader is a convenience function that creates a ConfigFile object from -// a non-nested reader -func LegacyLoadFromReader(configData io.Reader) (*configfile.ConfigFile, error) { - configFile := configfile.ConfigFile{ - AuthConfigs: make(map[string]types.AuthConfig), - } - err := configFile.LegacyLoadFromReader(configData) - return &configFile, err -} - // LoadFromReader is a convenience function that creates a ConfigFile object from // a reader func LoadFromReader(configData io.Reader) (*configfile.ConfigFile, error) { @@ -140,12 +130,8 @@ func load(configDir string) (*configfile.ConfigFile, bool, error) { // Can't find latest config file so check for the old one filename = filepath.Join(getHomeDir(), oldConfigfile) - if file, err := os.Open(filename); err == nil { + if _, err := os.Stat(filename); err == nil { printLegacyFileWarning = true - defer file.Close() - if err := configFile.LegacyLoadFromReader(file); err != nil { - return configFile, printLegacyFileWarning, errors.Wrap(err, filename) - } } return configFile, printLegacyFileWarning, nil } @@ -158,7 +144,7 @@ func LoadDefaultConfigFile(stderr io.Writer) *configfile.ConfigFile { fmt.Fprintf(stderr, "WARNING: Error loading config file: %v\n", err) } if printLegacyFileWarning { - _, _ = fmt.Fprintln(stderr, "WARNING: Support for the legacy ~/.dockercfg configuration file and file-format is deprecated and will be removed in an upcoming release") + _, _ = fmt.Fprintln(stderr, "WARNING: Support for the legacy ~/.dockercfg configuration file and file-format has been removed and the configuration file will be ignored") } if !configFile.ContainsAuth() { configFile.CredentialsStore = credentials.DetectDefaultStore(configFile.CredentialsStore) diff --git a/src/cmd/linuxkit/vendor/github.com/docker/cli/cli/config/configfile/file.go b/src/cmd/linuxkit/vendor/github.com/docker/cli/cli/config/configfile/file.go index d6f710817..796b0a0ae 100644 --- a/src/cmd/linuxkit/vendor/github.com/docker/cli/cli/config/configfile/file.go +++ b/src/cmd/linuxkit/vendor/github.com/docker/cli/cli/config/configfile/file.go @@ -3,9 +3,7 @@ package configfile import ( "encoding/base64" "encoding/json" - "fmt" "io" - "io/ioutil" "os" "path/filepath" "strings" @@ -16,13 +14,6 @@ import ( "github.com/sirupsen/logrus" ) -const ( - // This constant is only used for really old config files when the - // URL wasn't saved as part of the config file and it was just - // assumed to be this value. - defaultIndexServer = "https://index.docker.io/v1/" -) - // ConfigFile ~/.docker/config.json file info type ConfigFile struct { AuthConfigs map[string]types.AuthConfig `json:"auths"` @@ -46,8 +37,7 @@ type ConfigFile struct { PruneFilters []string `json:"pruneFilters,omitempty"` Proxies map[string]ProxyConfig `json:"proxies,omitempty"` Experimental string `json:"experimental,omitempty"` - StackOrchestrator string `json:"stackOrchestrator,omitempty"` - Kubernetes *KubernetesConfig `json:"kubernetes,omitempty"` + StackOrchestrator string `json:"stackOrchestrator,omitempty"` // Deprecated: swarm is now the default orchestrator, and this option is ignored. CurrentContext string `json:"currentContext,omitempty"` CLIPluginsExtraDirs []string `json:"cliPluginsExtraDirs,omitempty"` Plugins map[string]map[string]string `json:"plugins,omitempty"` @@ -60,11 +50,7 @@ type ProxyConfig struct { HTTPSProxy string `json:"httpsProxy,omitempty"` NoProxy string `json:"noProxy,omitempty"` FTPProxy string `json:"ftpProxy,omitempty"` -} - -// KubernetesConfig contains Kubernetes orchestrator settings -type KubernetesConfig struct { - AllNamespaces string `json:"allNamespaces,omitempty"` + AllProxy string `json:"allProxy,omitempty"` } // New initializes an empty configuration file for the given filename 'fn' @@ -78,44 +64,6 @@ func New(fn string) *ConfigFile { } } -// LegacyLoadFromReader reads the non-nested configuration data given and sets up the -// auth config information with given directory and populates the receiver object -func (configFile *ConfigFile) LegacyLoadFromReader(configData io.Reader) error { - b, err := ioutil.ReadAll(configData) - if err != nil { - return err - } - - if err := json.Unmarshal(b, &configFile.AuthConfigs); err != nil { - arr := strings.Split(string(b), "\n") - if len(arr) < 2 { - return errors.Errorf("The Auth config file is empty") - } - authConfig := types.AuthConfig{} - origAuth := strings.Split(arr[0], " = ") - if len(origAuth) != 2 { - return errors.Errorf("Invalid Auth config file") - } - authConfig.Username, authConfig.Password, err = decodeAuth(origAuth[1]) - if err != nil { - return err - } - authConfig.ServerAddress = defaultIndexServer - configFile.AuthConfigs[defaultIndexServer] = authConfig - } else { - for k, authConfig := range configFile.AuthConfigs { - authConfig.Username, authConfig.Password, err = decodeAuth(authConfig.Auth) - if err != nil { - return err - } - authConfig.Auth = "" - authConfig.ServerAddress = k - configFile.AuthConfigs[k] = authConfig - } - } - return nil -} - // LoadFromReader reads the configuration data given and sets up the auth config // information with given directory and populates the receiver object func (configFile *ConfigFile) LoadFromReader(configData io.Reader) error { @@ -134,7 +82,7 @@ func (configFile *ConfigFile) LoadFromReader(configData io.Reader) error { ac.ServerAddress = addr configFile.AuthConfigs[addr] = ac } - return checkKubernetesConfiguration(configFile.Kubernetes) + return nil } // ContainsAuth returns whether there is authentication configured @@ -191,10 +139,10 @@ func (configFile *ConfigFile) Save() (retErr error) { } dir := filepath.Dir(configFile.Filename) - if err := os.MkdirAll(dir, 0700); err != nil { + if err := os.MkdirAll(dir, 0o700); err != nil { return err } - temp, err := ioutil.TempFile(dir, filepath.Base(configFile.Filename)) + temp, err := os.CreateTemp(dir, filepath.Base(configFile.Filename)) if err != nil { return err } @@ -244,6 +192,7 @@ func (configFile *ConfigFile) ParseProxyConfig(host string, runOpts map[string]* "HTTPS_PROXY": &config.HTTPSProxy, "NO_PROXY": &config.NoProxy, "FTP_PROXY": &config.FTPProxy, + "ALL_PROXY": &config.AllProxy, } m := runOpts if m == nil { @@ -399,17 +348,3 @@ func (configFile *ConfigFile) SetPluginConfig(pluginname, option, value string) delete(configFile.Plugins, pluginname) } } - -func checkKubernetesConfiguration(kubeConfig *KubernetesConfig) error { - if kubeConfig == nil { - return nil - } - switch kubeConfig.AllNamespaces { - case "": - case "enabled": - case "disabled": - default: - return fmt.Errorf("invalid 'kubernetes.allNamespaces' value, should be 'enabled' or 'disabled': %s", kubeConfig.AllNamespaces) - } - return nil -} diff --git a/src/cmd/linuxkit/vendor/github.com/docker/cli/cli/config/configfile/file_unix.go b/src/cmd/linuxkit/vendor/github.com/docker/cli/cli/config/configfile/file_unix.go index 6af671812..353887547 100644 --- a/src/cmd/linuxkit/vendor/github.com/docker/cli/cli/config/configfile/file_unix.go +++ b/src/cmd/linuxkit/vendor/github.com/docker/cli/cli/config/configfile/file_unix.go @@ -12,7 +12,7 @@ import ( // ignoring any error during the process. func copyFilePermissions(src, dst string) { var ( - mode os.FileMode = 0600 + mode os.FileMode = 0o600 uid, gid int ) diff --git a/src/cmd/linuxkit/vendor/github.com/docker/cli/cli/config/credentials/native_store.go b/src/cmd/linuxkit/vendor/github.com/docker/cli/cli/config/credentials/native_store.go index afe542cc3..f9619b038 100644 --- a/src/cmd/linuxkit/vendor/github.com/docker/cli/cli/config/credentials/native_store.go +++ b/src/cmd/linuxkit/vendor/github.com/docker/cli/cli/config/credentials/native_store.go @@ -7,7 +7,7 @@ import ( ) const ( - remoteCredentialsPrefix = "docker-credential-" + remoteCredentialsPrefix = "docker-credential-" //nolint:gosec // ignore G101: Potential hardcoded credentials tokenUsername = "" ) diff --git a/src/cmd/linuxkit/vendor/github.com/docker/cli/cli/connhelper/commandconn/commandconn.go b/src/cmd/linuxkit/vendor/github.com/docker/cli/cli/connhelper/commandconn/commandconn.go index 128da447b..95b5d6933 100644 --- a/src/cmd/linuxkit/vendor/github.com/docker/cli/cli/connhelper/commandconn/commandconn.go +++ b/src/cmd/linuxkit/vendor/github.com/docker/cli/cli/connhelper/commandconn/commandconn.go @@ -4,13 +4,13 @@ // For example, to provide an http.Client that can connect to a Docker daemon // running in a Docker container ("DIND"): // -// httpClient := &http.Client{ -// Transport: &http.Transport{ -// DialContext: func(ctx context.Context, _network, _addr string) (net.Conn, error) { -// return commandconn.New(ctx, "docker", "exec", "-it", containerID, "docker", "system", "dial-stdio") -// }, -// }, -// } +// httpClient := &http.Client{ +// Transport: &http.Transport{ +// DialContext: func(ctx context.Context, _network, _addr string) (net.Conn, error) { +// return commandconn.New(ctx, "docker", "exec", "-it", containerID, "docker", "system", "dial-stdio") +// }, +// }, +// } package commandconn import ( @@ -236,17 +236,21 @@ func (c *commandConn) Close() error { func (c *commandConn) LocalAddr() net.Addr { return c.localAddr } + func (c *commandConn) RemoteAddr() net.Addr { return c.remoteAddr } + func (c *commandConn) SetDeadline(t time.Time) error { logrus.Debugf("unimplemented call: SetDeadline(%v)", t) return nil } + func (c *commandConn) SetReadDeadline(t time.Time) error { logrus.Debugf("unimplemented call: SetReadDeadline(%v)", t) return nil } + func (c *commandConn) SetWriteDeadline(t time.Time) error { logrus.Debugf("unimplemented call: SetWriteDeadline(%v)", t) return nil diff --git a/src/cmd/linuxkit/vendor/github.com/docker/docker-credential-helpers/credentials/credentials.go b/src/cmd/linuxkit/vendor/github.com/docker/docker-credential-helpers/credentials/credentials.go index da8b594e7..91d9d4bba 100644 --- a/src/cmd/linuxkit/vendor/github.com/docker/docker-credential-helpers/credentials/credentials.go +++ b/src/cmd/linuxkit/vendor/github.com/docker/docker-credential-helpers/credentials/credentials.go @@ -169,8 +169,8 @@ func Erase(helper Helper, reader io.Reader) error { return helper.Delete(serverURL) } -//List returns all the serverURLs of keys in -//the OS store as a list of strings +// List returns all the serverURLs of keys in +// the OS store as a list of strings func List(helper Helper, writer io.Writer) error { accts, err := helper.List() if err != nil { @@ -179,8 +179,8 @@ func List(helper Helper, writer io.Writer) error { return json.NewEncoder(writer).Encode(accts) } -//PrintVersion outputs the current version. +// PrintVersion outputs the current version. func PrintVersion(writer io.Writer) error { - fmt.Fprintln(writer, Version) + fmt.Fprintf(writer, "%s (%s) %s\n", Name, Package, Version) return nil } diff --git a/src/cmd/linuxkit/vendor/github.com/docker/docker-credential-helpers/credentials/version.go b/src/cmd/linuxkit/vendor/github.com/docker/docker-credential-helpers/credentials/version.go index 185e36796..84377c263 100644 --- a/src/cmd/linuxkit/vendor/github.com/docker/docker-credential-helpers/credentials/version.go +++ b/src/cmd/linuxkit/vendor/github.com/docker/docker-credential-helpers/credentials/version.go @@ -1,4 +1,16 @@ package credentials -// Version holds a string describing the current version -const Version = "0.6.4" +var ( + // Name is filled at linking time + Name = "" + + // Package is filled at linking time + Package = "github.com/docker/docker-credential-helpers" + + // Version holds the complete version number. Filled in at linking time. + Version = "v0.0.0+unknown" + + // Revision is filled with the VCS (e.g. git) revision being used to build + // the program at linking time. + Revision = "" +) diff --git a/src/cmd/linuxkit/vendor/github.com/go-logr/logr/README.md b/src/cmd/linuxkit/vendor/github.com/go-logr/logr/README.md index ad825f5f0..ab5931181 100644 --- a/src/cmd/linuxkit/vendor/github.com/go-logr/logr/README.md +++ b/src/cmd/linuxkit/vendor/github.com/go-logr/logr/README.md @@ -105,14 +105,18 @@ with higher verbosity means more (and less important) logs will be generated. There are implementations for the following logging libraries: - **a function** (can bridge to non-structured libraries): [funcr](https://github.com/go-logr/logr/tree/master/funcr) +- **a testing.T** (for use in Go tests, with JSON-like output): [testr](https://github.com/go-logr/logr/tree/master/testr) - **github.com/google/glog**: [glogr](https://github.com/go-logr/glogr) - **k8s.io/klog** (for Kubernetes): [klogr](https://git.k8s.io/klog/klogr) +- **a testing.T** (with klog-like text output): [ktesting](https://git.k8s.io/klog/ktesting) - **go.uber.org/zap**: [zapr](https://github.com/go-logr/zapr) - **log** (the Go standard library logger): [stdr](https://github.com/go-logr/stdr) - **github.com/sirupsen/logrus**: [logrusr](https://github.com/bombsimon/logrusr) - **github.com/wojas/genericr**: [genericr](https://github.com/wojas/genericr) (makes it easy to implement your own backend) - **logfmt** (Heroku style [logging](https://www.brandur.org/logfmt)): [logfmtr](https://github.com/iand/logfmtr) - **github.com/rs/zerolog**: [zerologr](https://github.com/go-logr/zerologr) +- **github.com/go-kit/log**: [gokitlogr](https://github.com/tonglil/gokitlogr) (also compatible with github.com/go-kit/kit/log since v0.12.0) +- **bytes.Buffer** (writing to a buffer): [bufrlogr](https://github.com/tonglil/buflogr) (useful for ensuring values were logged, like during testing) ## FAQ diff --git a/src/cmd/linuxkit/vendor/github.com/go-logr/logr/funcr/funcr.go b/src/cmd/linuxkit/vendor/github.com/go-logr/logr/funcr/funcr.go index b23ab9679..7accdb0c4 100644 --- a/src/cmd/linuxkit/vendor/github.com/go-logr/logr/funcr/funcr.go +++ b/src/cmd/linuxkit/vendor/github.com/go-logr/logr/funcr/funcr.go @@ -351,15 +351,15 @@ func (f Formatter) prettyWithFlags(value interface{}, flags uint32, depth int) s if v, ok := value.(logr.Marshaler); ok { // Replace the value with what the type wants to get logged. // That then gets handled below via reflection. - value = v.MarshalLog() + value = invokeMarshaler(v) } // Handle types that want to format themselves. switch v := value.(type) { case fmt.Stringer: - value = v.String() + value = invokeStringer(v) case error: - value = v.Error() + value = invokeError(v) } // Handling the most common types without reflect is a small perf win. @@ -408,8 +408,9 @@ func (f Formatter) prettyWithFlags(value interface{}, flags uint32, depth int) s if i > 0 { buf.WriteByte(',') } + k, _ := v[i].(string) // sanitize() above means no need to check success // arbitrary keys might need escaping - buf.WriteString(prettyString(v[i].(string))) + buf.WriteString(prettyString(k)) buf.WriteByte(':') buf.WriteString(f.prettyWithFlags(v[i+1], 0, depth+1)) } @@ -596,6 +597,33 @@ func isEmpty(v reflect.Value) bool { return false } +func invokeMarshaler(m logr.Marshaler) (ret interface{}) { + defer func() { + if r := recover(); r != nil { + ret = fmt.Sprintf("", r) + } + }() + return m.MarshalLog() +} + +func invokeStringer(s fmt.Stringer) (ret string) { + defer func() { + if r := recover(); r != nil { + ret = fmt.Sprintf("", r) + } + }() + return s.String() +} + +func invokeError(e error) (ret string) { + defer func() { + if r := recover(); r != nil { + ret = fmt.Sprintf("", r) + } + }() + return e.Error() +} + // Caller represents the original call site for a log line, after considering // logr.Logger.WithCallDepth and logr.Logger.WithCallStackHelper. The File and // Line fields will always be provided, while the Func field is optional. diff --git a/src/cmd/linuxkit/vendor/github.com/go-logr/logr/logr.go b/src/cmd/linuxkit/vendor/github.com/go-logr/logr/logr.go index c05482a20..c3b56b3d2 100644 --- a/src/cmd/linuxkit/vendor/github.com/go-logr/logr/logr.go +++ b/src/cmd/linuxkit/vendor/github.com/go-logr/logr/logr.go @@ -115,6 +115,15 @@ limitations under the License. // may be any Go value, but how the value is formatted is determined by the // LogSink implementation. // +// Logger instances are meant to be passed around by value. Code that receives +// such a value can call its methods without having to check whether the +// instance is ready for use. +// +// Calling methods with the null logger (Logger{}) as instance will crash +// because it has no LogSink. Therefore this null logger should never be passed +// around. For cases where passing a logger is optional, a pointer to Logger +// should be used. +// // Key Naming Conventions // // Keys are not strictly required to conform to any specification or regex, but diff --git a/src/cmd/linuxkit/vendor/github.com/gofrs/flock/.travis.yml b/src/cmd/linuxkit/vendor/github.com/gofrs/flock/.travis.yml index b791a7421..b16d040fa 100644 --- a/src/cmd/linuxkit/vendor/github.com/gofrs/flock/.travis.yml +++ b/src/cmd/linuxkit/vendor/github.com/gofrs/flock/.travis.yml @@ -1,7 +1,7 @@ language: go go: - - 1.10.x - - 1.11.x + - 1.14.x + - 1.15.x script: go test -v -check.vv -race ./... sudo: false notifications: diff --git a/src/cmd/linuxkit/vendor/github.com/gofrs/flock/appveyor.yml b/src/cmd/linuxkit/vendor/github.com/gofrs/flock/appveyor.yml index 6848e94bf..909b4bf7c 100644 --- a/src/cmd/linuxkit/vendor/github.com/gofrs/flock/appveyor.yml +++ b/src/cmd/linuxkit/vendor/github.com/gofrs/flock/appveyor.yml @@ -7,7 +7,7 @@ clone_folder: 'c:\gopath\src\github.com\gofrs\flock' environment: GOPATH: 'c:\gopath' - GOVERSION: '1.11' + GOVERSION: '1.15' init: - git config --global core.autocrlf input diff --git a/src/cmd/linuxkit/vendor/github.com/gofrs/flock/flock.go b/src/cmd/linuxkit/vendor/github.com/gofrs/flock/flock.go index 2fd160337..95c784ca5 100644 --- a/src/cmd/linuxkit/vendor/github.com/gofrs/flock/flock.go +++ b/src/cmd/linuxkit/vendor/github.com/gofrs/flock/flock.go @@ -19,6 +19,7 @@ package flock import ( "context" "os" + "runtime" "sync" "time" ) @@ -116,7 +117,15 @@ func tryCtx(ctx context.Context, fn func() (bool, error), retryDelay time.Durati func (f *Flock) setFh() error { // open a new os.File instance // create it if it doesn't exist, and open the file read-only. - fh, err := os.OpenFile(f.path, os.O_CREATE|os.O_RDONLY, os.FileMode(0600)) + flags := os.O_CREATE + if runtime.GOOS == "aix" { + // AIX cannot preform write-lock (ie exclusive) on a + // read-only file. + flags |= os.O_RDWR + } else { + flags |= os.O_RDONLY + } + fh, err := os.OpenFile(f.path, flags, os.FileMode(0600)) if err != nil { return err } diff --git a/src/cmd/linuxkit/vendor/github.com/gofrs/flock/flock_aix.go b/src/cmd/linuxkit/vendor/github.com/gofrs/flock/flock_aix.go new file mode 100644 index 000000000..7277c1b6b --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/gofrs/flock/flock_aix.go @@ -0,0 +1,281 @@ +// Copyright 2019 Tim Heckman. All rights reserved. Use of this source code is +// governed by the BSD 3-Clause license that can be found in the LICENSE file. + +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// This code implements the filelock API using POSIX 'fcntl' locks, which attach +// to an (inode, process) pair rather than a file descriptor. To avoid unlocking +// files prematurely when the same file is opened through different descriptors, +// we allow only one read-lock at a time. +// +// This code is adapted from the Go package: +// cmd/go/internal/lockedfile/internal/filelock + +//+build aix + +package flock + +import ( + "errors" + "io" + "os" + "sync" + "syscall" + + "golang.org/x/sys/unix" +) + +type lockType int16 + +const ( + readLock lockType = unix.F_RDLCK + writeLock lockType = unix.F_WRLCK +) + +type cmdType int + +const ( + tryLock cmdType = unix.F_SETLK + waitLock cmdType = unix.F_SETLKW +) + +type inode = uint64 + +type inodeLock struct { + owner *Flock + queue []<-chan *Flock +} + +var ( + mu sync.Mutex + inodes = map[*Flock]inode{} + locks = map[inode]inodeLock{} +) + +// Lock is a blocking call to try and take an exclusive file lock. It will wait +// until it is able to obtain the exclusive file lock. It's recommended that +// TryLock() be used over this function. This function may block the ability to +// query the current Locked() or RLocked() status due to a RW-mutex lock. +// +// If we are already exclusive-locked, this function short-circuits and returns +// immediately assuming it can take the mutex lock. +// +// If the *Flock has a shared lock (RLock), this may transparently replace the +// shared lock with an exclusive lock on some UNIX-like operating systems. Be +// careful when using exclusive locks in conjunction with shared locks +// (RLock()), because calling Unlock() may accidentally release the exclusive +// lock that was once a shared lock. +func (f *Flock) Lock() error { + return f.lock(&f.l, writeLock) +} + +// RLock is a blocking call to try and take a shared file lock. It will wait +// until it is able to obtain the shared file lock. It's recommended that +// TryRLock() be used over this function. This function may block the ability to +// query the current Locked() or RLocked() status due to a RW-mutex lock. +// +// If we are already shared-locked, this function short-circuits and returns +// immediately assuming it can take the mutex lock. +func (f *Flock) RLock() error { + return f.lock(&f.r, readLock) +} + +func (f *Flock) lock(locked *bool, flag lockType) error { + f.m.Lock() + defer f.m.Unlock() + + if *locked { + return nil + } + + if f.fh == nil { + if err := f.setFh(); err != nil { + return err + } + defer f.ensureFhState() + } + + if _, err := f.doLock(waitLock, flag, true); err != nil { + return err + } + + *locked = true + return nil +} + +func (f *Flock) doLock(cmd cmdType, lt lockType, blocking bool) (bool, error) { + // POSIX locks apply per inode and process, and the lock for an inode is + // released when *any* descriptor for that inode is closed. So we need to + // synchronize access to each inode internally, and must serialize lock and + // unlock calls that refer to the same inode through different descriptors. + fi, err := f.fh.Stat() + if err != nil { + return false, err + } + ino := inode(fi.Sys().(*syscall.Stat_t).Ino) + + mu.Lock() + if i, dup := inodes[f]; dup && i != ino { + mu.Unlock() + return false, &os.PathError{ + Path: f.Path(), + Err: errors.New("inode for file changed since last Lock or RLock"), + } + } + + inodes[f] = ino + + var wait chan *Flock + l := locks[ino] + if l.owner == f { + // This file already owns the lock, but the call may change its lock type. + } else if l.owner == nil { + // No owner: it's ours now. + l.owner = f + } else if !blocking { + // Already owned: cannot take the lock. + mu.Unlock() + return false, nil + } else { + // Already owned: add a channel to wait on. + wait = make(chan *Flock) + l.queue = append(l.queue, wait) + } + locks[ino] = l + mu.Unlock() + + if wait != nil { + wait <- f + } + + err = setlkw(f.fh.Fd(), cmd, lt) + + if err != nil { + f.doUnlock() + if cmd == tryLock && err == unix.EACCES { + return false, nil + } + return false, err + } + + return true, nil +} + +func (f *Flock) Unlock() error { + f.m.Lock() + defer f.m.Unlock() + + // if we aren't locked or if the lockfile instance is nil + // just return a nil error because we are unlocked + if (!f.l && !f.r) || f.fh == nil { + return nil + } + + if err := f.doUnlock(); err != nil { + return err + } + + f.fh.Close() + + f.l = false + f.r = false + f.fh = nil + + return nil +} + +func (f *Flock) doUnlock() (err error) { + var owner *Flock + mu.Lock() + ino, ok := inodes[f] + if ok { + owner = locks[ino].owner + } + mu.Unlock() + + if owner == f { + err = setlkw(f.fh.Fd(), waitLock, unix.F_UNLCK) + } + + mu.Lock() + l := locks[ino] + if len(l.queue) == 0 { + // No waiters: remove the map entry. + delete(locks, ino) + } else { + // The first waiter is sending us their file now. + // Receive it and update the queue. + l.owner = <-l.queue[0] + l.queue = l.queue[1:] + locks[ino] = l + } + delete(inodes, f) + mu.Unlock() + + return err +} + +// TryLock is the preferred function for taking an exclusive file lock. This +// function takes an RW-mutex lock before it tries to lock the file, so there is +// the possibility that this function may block for a short time if another +// goroutine is trying to take any action. +// +// The actual file lock is non-blocking. If we are unable to get the exclusive +// file lock, the function will return false instead of waiting for the lock. If +// we get the lock, we also set the *Flock instance as being exclusive-locked. +func (f *Flock) TryLock() (bool, error) { + return f.try(&f.l, writeLock) +} + +// TryRLock is the preferred function for taking a shared file lock. This +// function takes an RW-mutex lock before it tries to lock the file, so there is +// the possibility that this function may block for a short time if another +// goroutine is trying to take any action. +// +// The actual file lock is non-blocking. If we are unable to get the shared file +// lock, the function will return false instead of waiting for the lock. If we +// get the lock, we also set the *Flock instance as being share-locked. +func (f *Flock) TryRLock() (bool, error) { + return f.try(&f.r, readLock) +} + +func (f *Flock) try(locked *bool, flag lockType) (bool, error) { + f.m.Lock() + defer f.m.Unlock() + + if *locked { + return true, nil + } + + if f.fh == nil { + if err := f.setFh(); err != nil { + return false, err + } + defer f.ensureFhState() + } + + haslock, err := f.doLock(tryLock, flag, false) + if err != nil { + return false, err + } + + *locked = haslock + return haslock, nil +} + +// setlkw calls FcntlFlock with cmd for the entire file indicated by fd. +func setlkw(fd uintptr, cmd cmdType, lt lockType) error { + for { + err := unix.FcntlFlock(fd, int(cmd), &unix.Flock_t{ + Type: int16(lt), + Whence: io.SeekStart, + Start: 0, + Len: 0, // All bytes. + }) + if err != unix.EINTR { + return err + } + } +} diff --git a/src/cmd/linuxkit/vendor/github.com/gofrs/flock/flock_unix.go b/src/cmd/linuxkit/vendor/github.com/gofrs/flock/flock_unix.go index 366a60ca6..c315a3e29 100644 --- a/src/cmd/linuxkit/vendor/github.com/gofrs/flock/flock_unix.go +++ b/src/cmd/linuxkit/vendor/github.com/gofrs/flock/flock_unix.go @@ -2,7 +2,7 @@ // Use of this source code is governed by the BSD 3-Clause // license that can be found in the LICENSE file. -// +build !windows +// +build !aix,!windows package flock diff --git a/src/cmd/linuxkit/vendor/github.com/google/go-cmp/cmp/compare.go b/src/cmd/linuxkit/vendor/github.com/google/go-cmp/cmp/compare.go index fd2b3a42b..087320da7 100644 --- a/src/cmd/linuxkit/vendor/github.com/google/go-cmp/cmp/compare.go +++ b/src/cmd/linuxkit/vendor/github.com/google/go-cmp/cmp/compare.go @@ -13,21 +13,21 @@ // // The primary features of cmp are: // -// • When the default behavior of equality does not suit the needs of the test, -// custom equality functions can override the equality operation. -// For example, an equality function may report floats as equal so long as they -// are within some tolerance of each other. +// - When the default behavior of equality does not suit the test's needs, +// custom equality functions can override the equality operation. +// For example, an equality function may report floats as equal so long as +// they are within some tolerance of each other. // -// • Types that have an Equal method may use that method to determine equality. -// This allows package authors to determine the equality operation for the types -// that they define. +// - Types with an Equal method may use that method to determine equality. +// This allows package authors to determine the equality operation +// for the types that they define. // -// • If no custom equality functions are used and no Equal method is defined, -// equality is determined by recursively comparing the primitive kinds on both -// values, much like reflect.DeepEqual. Unlike reflect.DeepEqual, unexported -// fields are not compared by default; they result in panics unless suppressed -// by using an Ignore option (see cmpopts.IgnoreUnexported) or explicitly -// compared using the Exporter option. +// - If no custom equality functions are used and no Equal method is defined, +// equality is determined by recursively comparing the primitive kinds on +// both values, much like reflect.DeepEqual. Unlike reflect.DeepEqual, +// unexported fields are not compared by default; they result in panics +// unless suppressed by using an Ignore option (see cmpopts.IgnoreUnexported) +// or explicitly compared using the Exporter option. package cmp import ( @@ -45,25 +45,25 @@ import ( // Equal reports whether x and y are equal by recursively applying the // following rules in the given order to x and y and all of their sub-values: // -// • Let S be the set of all Ignore, Transformer, and Comparer options that -// remain after applying all path filters, value filters, and type filters. -// If at least one Ignore exists in S, then the comparison is ignored. -// If the number of Transformer and Comparer options in S is greater than one, -// then Equal panics because it is ambiguous which option to use. -// If S contains a single Transformer, then use that to transform the current -// values and recursively call Equal on the output values. -// If S contains a single Comparer, then use that to compare the current values. -// Otherwise, evaluation proceeds to the next rule. +// - Let S be the set of all Ignore, Transformer, and Comparer options that +// remain after applying all path filters, value filters, and type filters. +// If at least one Ignore exists in S, then the comparison is ignored. +// If the number of Transformer and Comparer options in S is non-zero, +// then Equal panics because it is ambiguous which option to use. +// If S contains a single Transformer, then use that to transform +// the current values and recursively call Equal on the output values. +// If S contains a single Comparer, then use that to compare the current values. +// Otherwise, evaluation proceeds to the next rule. // -// • If the values have an Equal method of the form "(T) Equal(T) bool" or -// "(T) Equal(I) bool" where T is assignable to I, then use the result of -// x.Equal(y) even if x or y is nil. Otherwise, no such method exists and -// evaluation proceeds to the next rule. +// - If the values have an Equal method of the form "(T) Equal(T) bool" or +// "(T) Equal(I) bool" where T is assignable to I, then use the result of +// x.Equal(y) even if x or y is nil. Otherwise, no such method exists and +// evaluation proceeds to the next rule. // -// • Lastly, try to compare x and y based on their basic kinds. -// Simple kinds like booleans, integers, floats, complex numbers, strings, and -// channels are compared using the equivalent of the == operator in Go. -// Functions are only equal if they are both nil, otherwise they are unequal. +// - Lastly, try to compare x and y based on their basic kinds. +// Simple kinds like booleans, integers, floats, complex numbers, strings, +// and channels are compared using the equivalent of the == operator in Go. +// Functions are only equal if they are both nil, otherwise they are unequal. // // Structs are equal if recursively calling Equal on all fields report equal. // If a struct contains unexported fields, Equal panics unless an Ignore option @@ -144,7 +144,7 @@ func rootStep(x, y interface{}) PathStep { // so that they have the same parent type. var t reflect.Type if !vx.IsValid() || !vy.IsValid() || vx.Type() != vy.Type() { - t = reflect.TypeOf((*interface{})(nil)).Elem() + t = anyType if vx.IsValid() { vvx := reflect.New(t).Elem() vvx.Set(vx) @@ -639,7 +639,9 @@ type dynChecker struct{ curr, next int } // Next increments the state and reports whether a check should be performed. // // Checks occur every Nth function call, where N is a triangular number: +// // 0 1 3 6 10 15 21 28 36 45 55 66 78 91 105 120 136 153 171 190 ... +// // See https://en.wikipedia.org/wiki/Triangular_number // // This sequence ensures that the cost of checks drops significantly as diff --git a/src/cmd/linuxkit/vendor/github.com/google/go-cmp/cmp/internal/diff/diff.go b/src/cmd/linuxkit/vendor/github.com/google/go-cmp/cmp/internal/diff/diff.go index bc196b16c..a248e5436 100644 --- a/src/cmd/linuxkit/vendor/github.com/google/go-cmp/cmp/internal/diff/diff.go +++ b/src/cmd/linuxkit/vendor/github.com/google/go-cmp/cmp/internal/diff/diff.go @@ -127,9 +127,9 @@ var randBool = rand.New(rand.NewSource(time.Now().Unix())).Intn(2) == 0 // This function returns an edit-script, which is a sequence of operations // needed to convert one list into the other. The following invariants for // the edit-script are maintained: -// • eq == (es.Dist()==0) -// • nx == es.LenX() -// • ny == es.LenY() +// - eq == (es.Dist()==0) +// - nx == es.LenX() +// - ny == es.LenY() // // This algorithm is not guaranteed to be an optimal solution (i.e., one that // produces an edit-script with a minimal Levenshtein distance). This algorithm @@ -169,12 +169,13 @@ func Difference(nx, ny int, f EqualFunc) (es EditScript) { // A diagonal edge is equivalent to a matching symbol between both X and Y. // Invariants: - // • 0 ≤ fwdPath.X ≤ (fwdFrontier.X, revFrontier.X) ≤ revPath.X ≤ nx - // • 0 ≤ fwdPath.Y ≤ (fwdFrontier.Y, revFrontier.Y) ≤ revPath.Y ≤ ny + // - 0 ≤ fwdPath.X ≤ (fwdFrontier.X, revFrontier.X) ≤ revPath.X ≤ nx + // - 0 ≤ fwdPath.Y ≤ (fwdFrontier.Y, revFrontier.Y) ≤ revPath.Y ≤ ny // // In general: - // • fwdFrontier.X < revFrontier.X - // • fwdFrontier.Y < revFrontier.Y + // - fwdFrontier.X < revFrontier.X + // - fwdFrontier.Y < revFrontier.Y + // // Unless, it is time for the algorithm to terminate. fwdPath := path{+1, point{0, 0}, make(EditScript, 0, (nx+ny)/2)} revPath := path{-1, point{nx, ny}, make(EditScript, 0)} @@ -195,19 +196,21 @@ func Difference(nx, ny int, f EqualFunc) (es EditScript) { // computing sub-optimal edit-scripts between two lists. // // The algorithm is approximately as follows: - // • Searching for differences switches back-and-forth between - // a search that starts at the beginning (the top-left corner), and - // a search that starts at the end (the bottom-right corner). The goal of - // the search is connect with the search from the opposite corner. - // • As we search, we build a path in a greedy manner, where the first - // match seen is added to the path (this is sub-optimal, but provides a - // decent result in practice). When matches are found, we try the next pair - // of symbols in the lists and follow all matches as far as possible. - // • When searching for matches, we search along a diagonal going through - // through the "frontier" point. If no matches are found, we advance the - // frontier towards the opposite corner. - // • This algorithm terminates when either the X coordinates or the - // Y coordinates of the forward and reverse frontier points ever intersect. + // - Searching for differences switches back-and-forth between + // a search that starts at the beginning (the top-left corner), and + // a search that starts at the end (the bottom-right corner). + // The goal of the search is connect with the search + // from the opposite corner. + // - As we search, we build a path in a greedy manner, + // where the first match seen is added to the path (this is sub-optimal, + // but provides a decent result in practice). When matches are found, + // we try the next pair of symbols in the lists and follow all matches + // as far as possible. + // - When searching for matches, we search along a diagonal going through + // through the "frontier" point. If no matches are found, + // we advance the frontier towards the opposite corner. + // - This algorithm terminates when either the X coordinates or the + // Y coordinates of the forward and reverse frontier points ever intersect. // This algorithm is correct even if searching only in the forward direction // or in the reverse direction. We do both because it is commonly observed @@ -389,6 +392,7 @@ type point struct{ X, Y int } func (p *point) add(dx, dy int) { p.X += dx; p.Y += dy } // zigzag maps a consecutive sequence of integers to a zig-zag sequence. +// // [0 1 2 3 4 5 ...] => [0 -1 +1 -2 +2 ...] func zigzag(x int) int { if x&1 != 0 { diff --git a/src/cmd/linuxkit/vendor/github.com/google/go-cmp/cmp/internal/value/zero.go b/src/cmd/linuxkit/vendor/github.com/google/go-cmp/cmp/internal/value/zero.go deleted file mode 100644 index 9147a2997..000000000 --- a/src/cmd/linuxkit/vendor/github.com/google/go-cmp/cmp/internal/value/zero.go +++ /dev/null @@ -1,48 +0,0 @@ -// Copyright 2017, The Go Authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the LICENSE file. - -package value - -import ( - "math" - "reflect" -) - -// IsZero reports whether v is the zero value. -// This does not rely on Interface and so can be used on unexported fields. -func IsZero(v reflect.Value) bool { - switch v.Kind() { - case reflect.Bool: - return v.Bool() == false - case reflect.Int, reflect.Int8, reflect.Int16, reflect.Int32, reflect.Int64: - return v.Int() == 0 - case reflect.Uint, reflect.Uint8, reflect.Uint16, reflect.Uint32, reflect.Uint64, reflect.Uintptr: - return v.Uint() == 0 - case reflect.Float32, reflect.Float64: - return math.Float64bits(v.Float()) == 0 - case reflect.Complex64, reflect.Complex128: - return math.Float64bits(real(v.Complex())) == 0 && math.Float64bits(imag(v.Complex())) == 0 - case reflect.String: - return v.String() == "" - case reflect.UnsafePointer: - return v.Pointer() == 0 - case reflect.Chan, reflect.Func, reflect.Interface, reflect.Ptr, reflect.Map, reflect.Slice: - return v.IsNil() - case reflect.Array: - for i := 0; i < v.Len(); i++ { - if !IsZero(v.Index(i)) { - return false - } - } - return true - case reflect.Struct: - for i := 0; i < v.NumField(); i++ { - if !IsZero(v.Field(i)) { - return false - } - } - return true - } - return false -} diff --git a/src/cmd/linuxkit/vendor/github.com/google/go-cmp/cmp/options.go b/src/cmd/linuxkit/vendor/github.com/google/go-cmp/cmp/options.go index e57b9eb53..1f9ca9c48 100644 --- a/src/cmd/linuxkit/vendor/github.com/google/go-cmp/cmp/options.go +++ b/src/cmd/linuxkit/vendor/github.com/google/go-cmp/cmp/options.go @@ -33,6 +33,7 @@ type Option interface { } // applicableOption represents the following types: +// // Fundamental: ignore | validator | *comparer | *transformer // Grouping: Options type applicableOption interface { @@ -43,6 +44,7 @@ type applicableOption interface { } // coreOption represents the following types: +// // Fundamental: ignore | validator | *comparer | *transformer // Filters: *pathFilter | *valuesFilter type coreOption interface { @@ -336,9 +338,9 @@ func (tr transformer) String() string { // both implement T. // // The equality function must be: -// • Symmetric: equal(x, y) == equal(y, x) -// • Deterministic: equal(x, y) == equal(x, y) -// • Pure: equal(x, y) does not modify x or y +// - Symmetric: equal(x, y) == equal(y, x) +// - Deterministic: equal(x, y) == equal(x, y) +// - Pure: equal(x, y) does not modify x or y func Comparer(f interface{}) Option { v := reflect.ValueOf(f) if !function.IsType(v.Type(), function.Equal) || v.IsNil() { @@ -430,7 +432,7 @@ func AllowUnexported(types ...interface{}) Option { } // Result represents the comparison result for a single node and -// is provided by cmp when calling Result (see Reporter). +// is provided by cmp when calling Report (see Reporter). type Result struct { _ [0]func() // Make Result incomparable flags resultFlags diff --git a/src/cmd/linuxkit/vendor/github.com/google/go-cmp/cmp/path.go b/src/cmd/linuxkit/vendor/github.com/google/go-cmp/cmp/path.go index c71003463..a0a588502 100644 --- a/src/cmd/linuxkit/vendor/github.com/google/go-cmp/cmp/path.go +++ b/src/cmd/linuxkit/vendor/github.com/google/go-cmp/cmp/path.go @@ -41,13 +41,13 @@ type PathStep interface { // The type of each valid value is guaranteed to be identical to Type. // // In some cases, one or both may be invalid or have restrictions: - // • For StructField, both are not interface-able if the current field - // is unexported and the struct type is not explicitly permitted by - // an Exporter to traverse unexported fields. - // • For SliceIndex, one may be invalid if an element is missing from - // either the x or y slice. - // • For MapIndex, one may be invalid if an entry is missing from - // either the x or y map. + // - For StructField, both are not interface-able if the current field + // is unexported and the struct type is not explicitly permitted by + // an Exporter to traverse unexported fields. + // - For SliceIndex, one may be invalid if an element is missing from + // either the x or y slice. + // - For MapIndex, one may be invalid if an entry is missing from + // either the x or y map. // // The provided values must not be mutated. Values() (vx, vy reflect.Value) @@ -94,6 +94,7 @@ func (pa Path) Index(i int) PathStep { // The simplified path only contains struct field accesses. // // For example: +// // MyMap.MySlices.MyField func (pa Path) String() string { var ss []string @@ -108,6 +109,7 @@ func (pa Path) String() string { // GoString returns the path to a specific node using Go syntax. // // For example: +// // (*root.MyMap["key"].(*mypkg.MyStruct).MySlices)[2][3].MyField func (pa Path) GoString() string { var ssPre, ssPost []string @@ -159,7 +161,7 @@ func (ps pathStep) String() string { if ps.typ == nil { return "" } - s := ps.typ.String() + s := value.TypeString(ps.typ, false) if s == "" || strings.ContainsAny(s, "{}\n") { return "root" // Type too simple or complex to print } @@ -282,7 +284,7 @@ type typeAssertion struct { func (ta TypeAssertion) Type() reflect.Type { return ta.typ } func (ta TypeAssertion) Values() (vx, vy reflect.Value) { return ta.vx, ta.vy } -func (ta TypeAssertion) String() string { return fmt.Sprintf(".(%v)", ta.typ) } +func (ta TypeAssertion) String() string { return fmt.Sprintf(".(%v)", value.TypeString(ta.typ, false)) } // Transform is a transformation from the parent type to the current type. type Transform struct{ *transform } diff --git a/src/cmd/linuxkit/vendor/github.com/google/go-cmp/cmp/report_compare.go b/src/cmd/linuxkit/vendor/github.com/google/go-cmp/cmp/report_compare.go index 1ef65ac1d..2050bf6b4 100644 --- a/src/cmd/linuxkit/vendor/github.com/google/go-cmp/cmp/report_compare.go +++ b/src/cmd/linuxkit/vendor/github.com/google/go-cmp/cmp/report_compare.go @@ -7,8 +7,6 @@ package cmp import ( "fmt" "reflect" - - "github.com/google/go-cmp/cmp/internal/value" ) // numContextRecords is the number of surrounding equal records to print. @@ -117,7 +115,7 @@ func (opts formatOptions) FormatDiff(v *valueNode, ptrs *pointerReferences) (out // For leaf nodes, format the value based on the reflect.Values alone. // As a special case, treat equal []byte as a leaf nodes. - isBytes := v.Type.Kind() == reflect.Slice && v.Type.Elem() == reflect.TypeOf(byte(0)) + isBytes := v.Type.Kind() == reflect.Slice && v.Type.Elem() == byteType isEqualBytes := isBytes && v.NumDiff+v.NumIgnored+v.NumTransformed == 0 if v.MaxDepth == 0 || isEqualBytes { switch opts.DiffMode { @@ -248,11 +246,11 @@ func (opts formatOptions) formatDiffList(recs []reportRecord, k reflect.Kind, pt var isZero bool switch opts.DiffMode { case diffIdentical: - isZero = value.IsZero(r.Value.ValueX) || value.IsZero(r.Value.ValueY) + isZero = r.Value.ValueX.IsZero() || r.Value.ValueY.IsZero() case diffRemoved: - isZero = value.IsZero(r.Value.ValueX) + isZero = r.Value.ValueX.IsZero() case diffInserted: - isZero = value.IsZero(r.Value.ValueY) + isZero = r.Value.ValueY.IsZero() } if isZero { continue diff --git a/src/cmd/linuxkit/vendor/github.com/google/go-cmp/cmp/report_reflect.go b/src/cmd/linuxkit/vendor/github.com/google/go-cmp/cmp/report_reflect.go index 287b89358..2ab41fad3 100644 --- a/src/cmd/linuxkit/vendor/github.com/google/go-cmp/cmp/report_reflect.go +++ b/src/cmd/linuxkit/vendor/github.com/google/go-cmp/cmp/report_reflect.go @@ -16,6 +16,13 @@ import ( "github.com/google/go-cmp/cmp/internal/value" ) +var ( + anyType = reflect.TypeOf((*interface{})(nil)).Elem() + stringType = reflect.TypeOf((*string)(nil)).Elem() + bytesType = reflect.TypeOf((*[]byte)(nil)).Elem() + byteType = reflect.TypeOf((*byte)(nil)).Elem() +) + type formatValueOptions struct { // AvoidStringer controls whether to avoid calling custom stringer // methods like error.Error or fmt.Stringer.String. @@ -184,7 +191,7 @@ func (opts formatOptions) FormatValue(v reflect.Value, parentKind reflect.Kind, } for i := 0; i < v.NumField(); i++ { vv := v.Field(i) - if value.IsZero(vv) { + if vv.IsZero() { continue // Elide fields with zero values } if len(list) == maxLen { @@ -205,7 +212,7 @@ func (opts formatOptions) FormatValue(v reflect.Value, parentKind reflect.Kind, } // Check whether this is a []byte of text data. - if t.Elem() == reflect.TypeOf(byte(0)) { + if t.Elem() == byteType { b := v.Bytes() isPrintSpace := func(r rune) bool { return unicode.IsPrint(r) || unicode.IsSpace(r) } if len(b) > 0 && utf8.Valid(b) && len(bytes.TrimFunc(b, isPrintSpace)) == 0 { diff --git a/src/cmd/linuxkit/vendor/github.com/google/go-cmp/cmp/report_slices.go b/src/cmd/linuxkit/vendor/github.com/google/go-cmp/cmp/report_slices.go index 68b5c1ae1..23e444f62 100644 --- a/src/cmd/linuxkit/vendor/github.com/google/go-cmp/cmp/report_slices.go +++ b/src/cmd/linuxkit/vendor/github.com/google/go-cmp/cmp/report_slices.go @@ -104,7 +104,7 @@ func (opts formatOptions) FormatDiffSlice(v *valueNode) textNode { case t.Kind() == reflect.String: sx, sy = vx.String(), vy.String() isString = true - case t.Kind() == reflect.Slice && t.Elem() == reflect.TypeOf(byte(0)): + case t.Kind() == reflect.Slice && t.Elem() == byteType: sx, sy = string(vx.Bytes()), string(vy.Bytes()) isString = true case t.Kind() == reflect.Array: @@ -147,7 +147,10 @@ func (opts formatOptions) FormatDiffSlice(v *valueNode) textNode { }) efficiencyLines := float64(esLines.Dist()) / float64(len(esLines)) efficiencyBytes := float64(esBytes.Dist()) / float64(len(esBytes)) - isPureLinedText = efficiencyLines < 4*efficiencyBytes + quotedLength := len(strconv.Quote(sx + sy)) + unquotedLength := len(sx) + len(sy) + escapeExpansionRatio := float64(quotedLength) / float64(unquotedLength) + isPureLinedText = efficiencyLines < 4*efficiencyBytes || escapeExpansionRatio > 1.1 } } @@ -171,12 +174,13 @@ func (opts formatOptions) FormatDiffSlice(v *valueNode) textNode { // differences in a string literal. This format is more readable, // but has edge-cases where differences are visually indistinguishable. // This format is avoided under the following conditions: - // • A line starts with `"""` - // • A line starts with "..." - // • A line contains non-printable characters - // • Adjacent different lines differ only by whitespace + // - A line starts with `"""` + // - A line starts with "..." + // - A line contains non-printable characters + // - Adjacent different lines differ only by whitespace // // For example: + // // """ // ... // 3 identical lines // foo @@ -231,7 +235,7 @@ func (opts formatOptions) FormatDiffSlice(v *valueNode) textNode { var out textNode = &textWrap{Prefix: "(", Value: list2, Suffix: ")"} switch t.Kind() { case reflect.String: - if t != reflect.TypeOf(string("")) { + if t != stringType { out = opts.FormatType(t, out) } case reflect.Slice: @@ -326,12 +330,12 @@ func (opts formatOptions) FormatDiffSlice(v *valueNode) textNode { switch t.Kind() { case reflect.String: out = &textWrap{Prefix: "strings.Join(", Value: out, Suffix: fmt.Sprintf(", %q)", delim)} - if t != reflect.TypeOf(string("")) { + if t != stringType { out = opts.FormatType(t, out) } case reflect.Slice: out = &textWrap{Prefix: "bytes.Join(", Value: out, Suffix: fmt.Sprintf(", %q)", delim)} - if t != reflect.TypeOf([]byte(nil)) { + if t != bytesType { out = opts.FormatType(t, out) } } @@ -446,7 +450,6 @@ func (opts formatOptions) formatDiffSlice( // {NumIdentical: 3}, // {NumInserted: 1}, // ] -// func coalesceAdjacentEdits(name string, es diff.EditScript) (groups []diffStats) { var prevMode byte lastStats := func(mode byte) *diffStats { @@ -503,7 +506,6 @@ func coalesceAdjacentEdits(name string, es diff.EditScript) (groups []diffStats) // {NumIdentical: 8, NumRemoved: 12, NumInserted: 3}, // {NumIdentical: 63}, // ] -// func coalesceInterveningIdentical(groups []diffStats, windowSize int) []diffStats { groups, groupsOrig := groups[:0], groups for i, ds := range groupsOrig { @@ -548,7 +550,6 @@ func coalesceInterveningIdentical(groups []diffStats, windowSize int) []diffStat // {NumRemoved: 9}, // {NumIdentical: 64}, // incremented by 10 // ] -// func cleanupSurroundingIdentical(groups []diffStats, eq func(i, j int) bool) []diffStats { var ix, iy int // indexes into sequence x and y for i, ds := range groups { diff --git a/src/cmd/linuxkit/vendor/github.com/google/go-cmp/cmp/report_text.go b/src/cmd/linuxkit/vendor/github.com/google/go-cmp/cmp/report_text.go index 0fd46d7ff..388fcf571 100644 --- a/src/cmd/linuxkit/vendor/github.com/google/go-cmp/cmp/report_text.go +++ b/src/cmd/linuxkit/vendor/github.com/google/go-cmp/cmp/report_text.go @@ -393,6 +393,7 @@ func (s diffStats) Append(ds diffStats) diffStats { // String prints a humanly-readable summary of coalesced records. // // Example: +// // diffStats{Name: "Field", NumIgnored: 5}.String() => "5 ignored fields" func (s diffStats) String() string { var ss []string diff --git a/src/cmd/linuxkit/vendor/github.com/in-toto/in-toto-golang/in_toto/keylib.go b/src/cmd/linuxkit/vendor/github.com/in-toto/in-toto-golang/in_toto/keylib.go index 15d098acd..8811d32d9 100644 --- a/src/cmd/linuxkit/vendor/github.com/in-toto/in-toto-golang/in_toto/keylib.go +++ b/src/cmd/linuxkit/vendor/github.com/in-toto/in-toto-golang/in_toto/keylib.go @@ -16,6 +16,8 @@ import ( "io/ioutil" "os" "strings" + + "github.com/secure-systems-lab/go-securesystemslib/cjson" ) // ErrFailedPEMParsing gets returned when PKCS1, PKCS8 or PKIX key parsing fails @@ -106,7 +108,7 @@ func (k *Key) generateKeyID() error { "public": k.KeyVal.Public, }, } - keyCanonical, err := EncodeCanonical(keyToBeHashed) + keyCanonical, err := cjson.EncodeCanonical(keyToBeHashed) if err != nil { return err } diff --git a/src/cmd/linuxkit/vendor/github.com/in-toto/in-toto-golang/in_toto/model.go b/src/cmd/linuxkit/vendor/github.com/in-toto/in-toto-golang/in_toto/model.go index 82c1e0904..25e12c033 100644 --- a/src/cmd/linuxkit/vendor/github.com/in-toto/in-toto-golang/in_toto/model.go +++ b/src/cmd/linuxkit/vendor/github.com/in-toto/in-toto-golang/in_toto/model.go @@ -15,7 +15,10 @@ import ( "strings" "time" - "github.com/in-toto/in-toto-golang/pkg/ssl" + slsa "github.com/in-toto/in-toto-golang/in_toto/slsa_provenance/v0.2" + + "github.com/secure-systems-lab/go-securesystemslib/cjson" + "github.com/secure-systems-lab/go-securesystemslib/dsse" ) /* @@ -76,10 +79,10 @@ const ( // The SPDX mandates 'spdxVersion' field, so predicate type can omit // version. PredicateSPDX = "https://spdx.dev/Document" + // PredicateCycloneDX represents a CycloneDX SBOM + PredicateCycloneDX = "https://cyclonedx.org/schema" // PredicateLinkV1 represents an in-toto 0.9 link. PredicateLinkV1 = "https://in-toto.io/Link/v1" - // PredicateSLSAProvenanceV01 represents a build provenance for an artifact. - PredicateSLSAProvenanceV01 = "https://slsa.dev/provenance/v0.1" ) // ErrInvalidPayloadType indicates that the envelope used an unkown payload type @@ -873,7 +876,7 @@ Signed field of the Metablock on which it was called. If canonicalization fails the first return value is nil and the second return value is the error. */ func (mb *Metablock) GetSignableRepresentation() ([]byte, error) { - return EncodeCanonical(mb.Signed) + return cjson.EncodeCanonical(mb.Signed) } /* @@ -959,16 +962,10 @@ func (mb *Metablock) Sign(key Key) error { return nil } -/* -DigestSet contains a set of digests. It is represented as a map from -algorithm name to lowercase hex-encoded value. -*/ -type DigestSet map[string]string - // Subject describes the set of software artifacts the statement applies to. type Subject struct { - Name string `json:"name"` - Digest DigestSet `json:"digest"` + Name string `json:"name"` + Digest slsa.DigestSet `json:"digest"` } // StatementHeader defines the common fields for all statements @@ -988,59 +985,10 @@ type Statement struct { Predicate interface{} `json:"predicate"` } -// ProvenanceBuilder idenfifies the entity that executed the build steps. -type ProvenanceBuilder struct { - ID string `json:"id"` -} - -// ProvenanceRecipe describes the actions performed by the builder. -type ProvenanceRecipe struct { - Type string `json:"type"` - // DefinedInMaterial can be sent as the null pointer to indicate that - // the value is not present. - DefinedInMaterial *int `json:"definedInMaterial,omitempty"` - EntryPoint string `json:"entryPoint"` - Arguments interface{} `json:"arguments,omitempty"` - Environment interface{} `json:"environment,omitempty"` -} - -// ProvenanceComplete indicates wheter the claims in build/recipe are complete. -// For in depth information refer to the specifictaion: -// https://github.com/in-toto/attestation/blob/v0.1.0/spec/predicates/provenance.md -type ProvenanceComplete struct { - Arguments bool `json:"arguments"` - Environment bool `json:"environment"` - Materials bool `json:"materials"` -} - -// ProvenanceMetadata contains metadata for the built artifact. -type ProvenanceMetadata struct { - // Use pointer to make sure that the abscense of a time is not - // encoded as the Epoch time. - BuildStartedOn *time.Time `json:"buildStartedOn,omitempty"` - BuildFinishedOn *time.Time `json:"buildFinishedOn,omitempty"` - Completeness ProvenanceComplete `json:"completeness"` - Reproducible bool `json:"reproducible"` -} - -// ProvenanceMaterial defines the materials used to build an artifact. -type ProvenanceMaterial struct { - URI string `json:"uri"` - Digest DigestSet `json:"digest,omitempty"` -} - -// ProvenancePredicate is the provenance predicate definition. -type ProvenancePredicate struct { - Builder ProvenanceBuilder `json:"builder"` - Recipe ProvenanceRecipe `json:"recipe"` - Metadata *ProvenanceMetadata `json:"metadata,omitempty"` - Materials []ProvenanceMaterial `json:"materials,omitempty"` -} - // ProvenanceStatement is the definition for an entire provenance statement. type ProvenanceStatement struct { StatementHeader - Predicate ProvenancePredicate `json:"predicate"` + Predicate slsa.ProvenancePredicate `json:"predicate"` } // LinkStatement is the definition for an entire link statement. @@ -1051,7 +999,7 @@ type LinkStatement struct { /* SPDXStatement is the definition for an entire SPDX statement. -Currently not implemented. Some tooling exists here: +This is currently not implemented. Some tooling exists here: https://github.com/spdx/tools-golang, but this software is still in early state. This struct is the same as the generic Statement struct but is added for @@ -1063,35 +1011,46 @@ type SPDXStatement struct { } /* -SSLSigner provides signature generation and validation based on the SSL +CycloneDXStatement defines a cyclonedx sbom in the predicate. It is not +currently serialized just as its SPDX counterpart. It is an empty +interface, like the generic Statement. +*/ +type CycloneDXStatement struct { + StatementHeader + Predicate interface{} `json:"predicate"` +} + +/* +DSSESigner provides signature generation and validation based on the SSL Signing Spec: https://github.com/secure-systems-lab/signing-spec as describe by: https://github.com/MarkLodato/ITE/tree/media-type/ITE/5 It wraps the generic SSL envelope signer and enforces the correct payload type both during signature generation and validation. */ -type SSLSigner struct { - signer *ssl.EnvelopeSigner +type DSSESigner struct { + signer *dsse.EnvelopeSigner } -func NewSSLSigner(p ...ssl.SignVerifier) (*SSLSigner, error) { - es, err := ssl.NewEnvelopeSigner(p...) +func NewDSSESigner(p ...dsse.SignVerifier) (*DSSESigner, error) { + es, err := dsse.NewEnvelopeSigner(p...) if err != nil { return nil, err } - return &SSLSigner{ + return &DSSESigner{ signer: es, }, nil } -func (s *SSLSigner) SignPayload(body []byte) (*ssl.Envelope, error) { +func (s *DSSESigner) SignPayload(body []byte) (*dsse.Envelope, error) { return s.signer.SignPayload(PayloadType, body) } -func (s *SSLSigner) Verify(e *ssl.Envelope) error { +func (s *DSSESigner) Verify(e *dsse.Envelope) error { if e.PayloadType != PayloadType { return ErrInvalidPayloadType } - return s.signer.Verify(e) + _, err := s.signer.Verify(e) + return err } diff --git a/src/cmd/linuxkit/vendor/github.com/in-toto/in-toto-golang/in_toto/slsa_provenance/v0.2/provenance.go b/src/cmd/linuxkit/vendor/github.com/in-toto/in-toto-golang/in_toto/slsa_provenance/v0.2/provenance.go new file mode 100644 index 000000000..1cecf3a49 --- /dev/null +++ b/src/cmd/linuxkit/vendor/github.com/in-toto/in-toto-golang/in_toto/slsa_provenance/v0.2/provenance.go @@ -0,0 +1,66 @@ +package v02 + +import "time" + +const ( + // PredicateSLSAProvenance represents a build provenance for an artifact. + PredicateSLSAProvenance = "https://slsa.dev/provenance/v0.2" +) + +// ProvenancePredicate is the provenance predicate definition. +type ProvenancePredicate struct { + Builder ProvenanceBuilder `json:"builder"` + BuildType string `json:"buildType"` + Invocation ProvenanceInvocation `json:"invocation,omitempty"` + BuildConfig interface{} `json:"buildConfig,omitempty"` + Metadata *ProvenanceMetadata `json:"metadata,omitempty"` + Materials []ProvenanceMaterial `json:"materials,omitempty"` +} + +// ProvenanceBuilder idenfifies the entity that executed the build steps. +type ProvenanceBuilder struct { + ID string `json:"id"` +} + +// ProvenanceInvocation identifies the event that kicked off the build. +type ProvenanceInvocation struct { + ConfigSource ConfigSource `json:"configSource,omitempty"` + Parameters interface{} `json:"parameters,omitempty"` + Environment interface{} `json:"environment,omitempty"` +} + +type ConfigSource struct { + URI string `json:"uri,omitempty"` + Digest DigestSet `json:"digest,omitempty"` + EntryPoint string `json:"entryPoint,omitempty"` +} + +// ProvenanceMetadata contains metadata for the built artifact. +type ProvenanceMetadata struct { + BuildInvocationID string `json:"buildInvocationID,omitempty"` + // Use pointer to make sure that the abscense of a time is not + // encoded as the Epoch time. + BuildStartedOn *time.Time `json:"buildStartedOn,omitempty"` + BuildFinishedOn *time.Time `json:"buildFinishedOn,omitempty"` + Completeness ProvenanceComplete `json:"completeness"` + Reproducible bool `json:"reproducible"` +} + +// ProvenanceMaterial defines the materials used to build an artifact. +type ProvenanceMaterial struct { + URI string `json:"uri,omitempty"` + Digest DigestSet `json:"digest,omitempty"` +} + +// ProvenanceComplete indicates wheter the claims in build/recipe are complete. +// For in depth information refer to the specifictaion: +// https://github.com/in-toto/attestation/blob/v0.1.0/spec/predicates/provenance.md +type ProvenanceComplete struct { + Parameters bool `json:"parameters"` + Environment bool `json:"environment"` + Materials bool `json:"materials"` +} + +// DigestSet contains a set of digests. It is represented as a map from +// algorithm name to lowercase hex-encoded value. +type DigestSet map[string]string diff --git a/src/cmd/linuxkit/vendor/github.com/in-toto/in-toto-golang/pkg/ssl/verify.go b/src/cmd/linuxkit/vendor/github.com/in-toto/in-toto-golang/pkg/ssl/verify.go deleted file mode 100644 index 426968deb..000000000 --- a/src/cmd/linuxkit/vendor/github.com/in-toto/in-toto-golang/pkg/ssl/verify.go +++ /dev/null @@ -1,71 +0,0 @@ -/* -Package ssl implements the Secure Systems Lab signing-spec (sometimes -abbreviated SSL Siging spec. -https://github.com/secure-systems-lab/signing-spec -*/ -package ssl - -/* -Verifier verifies a complete message against a signature and key. -If the message was hashed prior to signature generation, the verifier -must perform the same steps. -If the key is not recognized ErrUnknownKey shall be returned. -*/ -type Verifier interface { - Verify(keyID string, data, sig []byte) error -} - -type EnvelopeVerifier struct { - providers []Verifier -} - -func (ev *EnvelopeVerifier) Verify(e *Envelope) error { - if len(e.Signatures) == 0 { - return ErrNoSignature - } - - // Decode payload (i.e serialized body) - body, err := b64Decode(e.Payload) - if err != nil { - return err - } - // Generate PAE(payloadtype, serialized body) - paeEnc := PAE(e.PayloadType, string(body)) - - // If *any* signature is found to be incorrect, the entire verification - // step fails even if *some* signatures are correct. - verified := false - for _, s := range e.Signatures { - sig, err := b64Decode(s.Sig) - if err != nil { - return err - } - - // Loop over the providers. If a provider recognizes the key, we exit - // the loop and use the result. - for _, v := range ev.providers { - err := v.Verify(s.KeyID, paeEnc, sig) - if err != nil { - if err == ErrUnknownKey { - continue - } - return err - } - - verified = true - break - } - } - if !verified { - return ErrUnknownKey - } - - return nil -} - -func NewEnvelopeVerifier(p ...Verifier) EnvelopeVerifier { - ev := EnvelopeVerifier{ - providers: p, - } - return ev -} diff --git a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/README.md b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/README.md index ad5c63a82..9ec000ffa 100644 --- a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/README.md +++ b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/README.md @@ -17,6 +17,30 @@ This package provides various compression algorithms. # changelog +* Sept 26, 2022 (v1.15.11) + + * flate: Improve level 1-3 compression https://github.com/klauspost/compress/pull/678 + * zstd: Improve "best" compression by @nightwolfz in https://github.com/klauspost/compress/pull/677 + * zstd: Fix+reduce decompression allocations https://github.com/klauspost/compress/pull/668 + * zstd: Fix non-effective noescape tag https://github.com/klauspost/compress/pull/667 + +* Sept 16, 2022 (v1.15.10) + + * zstd: Add [WithDecodeAllCapLimit](https://pkg.go.dev/github.com/klauspost/compress@v1.15.10/zstd#WithDecodeAllCapLimit) https://github.com/klauspost/compress/pull/649 + * Add Go 1.19 - deprecate Go 1.16 https://github.com/klauspost/compress/pull/651 + * flate: Improve level 5+6 compression https://github.com/klauspost/compress/pull/656 + * zstd: Improve "better" compresssion https://github.com/klauspost/compress/pull/657 + * s2: Improve "best" compression https://github.com/klauspost/compress/pull/658 + * s2: Improve "better" compression. https://github.com/klauspost/compress/pull/635 + * s2: Slightly faster non-assembly decompression https://github.com/klauspost/compress/pull/646 + * Use arrays for constant size copies https://github.com/klauspost/compress/pull/659 + +* July 21, 2022 (v1.15.9) + + * zstd: Fix decoder crash on amd64 (no BMI) on invalid input https://github.com/klauspost/compress/pull/645 + * zstd: Disable decoder extended memory copies (amd64) due to possible crashes https://github.com/klauspost/compress/pull/644 + * zstd: Allow single segments up to "max decoded size" by @klauspost in https://github.com/klauspost/compress/pull/643 + * July 13, 2022 (v1.15.8) * gzip: fix stack exhaustion bug in Reader.Read https://github.com/klauspost/compress/pull/641 @@ -91,15 +115,15 @@ This package provides various compression algorithms. * gzhttp: Add zstd to transport by @klauspost in [#400](https://github.com/klauspost/compress/pull/400) * gzhttp: Make content-type optional by @klauspost in [#510](https://github.com/klauspost/compress/pull/510) -
- See Details Both compression and decompression now supports "synchronous" stream operations. This means that whenever "concurrency" is set to 1, they will operate without spawning goroutines. Stream decompression is now faster on asynchronous, since the goroutine allocation much more effectively splits the workload. On typical streams this will typically use 2 cores fully for decompression. When a stream has finished decoding no goroutines will be left over, so decoders can now safely be pooled and still be garbage collected. While the release has been extensively tested, it is recommended to testing when upgrading. -
+
+ See changes to v1.14.x + * Feb 22, 2022 (v1.14.4) * flate: Fix rare huffman only (-2) corruption. [#503](https://github.com/klauspost/compress/pull/503) * zip: Update deprecated CreateHeaderRaw to correctly call CreateRaw by @saracen in [#502](https://github.com/klauspost/compress/pull/502) @@ -125,6 +149,7 @@ While the release has been extensively tested, it is recommended to testing when * zstd: Performance improvement in [#420]( https://github.com/klauspost/compress/pull/420) [#456](https://github.com/klauspost/compress/pull/456) [#437](https://github.com/klauspost/compress/pull/437) [#467](https://github.com/klauspost/compress/pull/467) [#468](https://github.com/klauspost/compress/pull/468) * zstd: add arm64 xxhash assembly in [#464](https://github.com/klauspost/compress/pull/464) * Add garbled for binaries for s2 in [#445](https://github.com/klauspost/compress/pull/445) +
See changes to v1.13.x diff --git a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/flate/deflate.go b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/flate/deflate.go index f8435998e..07265dded 100644 --- a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/flate/deflate.go +++ b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/flate/deflate.go @@ -131,7 +131,8 @@ func (d *compressor) fillDeflate(b []byte) int { s := d.state if s.index >= 2*windowSize-(minMatchLength+maxMatchLength) { // shift the window by windowSize - copy(d.window[:], d.window[windowSize:2*windowSize]) + //copy(d.window[:], d.window[windowSize:2*windowSize]) + *(*[windowSize]byte)(d.window) = *(*[windowSize]byte)(d.window[windowSize:]) s.index -= windowSize d.windowEnd -= windowSize if d.blockStart >= windowSize { @@ -373,6 +374,12 @@ func hash4(b []byte) uint32 { return hash4u(binary.LittleEndian.Uint32(b), hashBits) } +// hash4 returns the hash of u to fit in a hash table with h bits. +// Preferably h should be a constant and should always be <32. +func hash4u(u uint32, h uint8) uint32 { + return (u * prime4bytes) >> (32 - h) +} + // bulkHash4 will compute hashes using the same // algorithm as hash4 func bulkHash4(b []byte, dst []uint32) { diff --git a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/flate/dict_decoder.go b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/flate/dict_decoder.go index 71c75a065..bb36351a5 100644 --- a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/flate/dict_decoder.go +++ b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/flate/dict_decoder.go @@ -7,19 +7,19 @@ package flate // dictDecoder implements the LZ77 sliding dictionary as used in decompression. // LZ77 decompresses data through sequences of two forms of commands: // -// * Literal insertions: Runs of one or more symbols are inserted into the data -// stream as is. This is accomplished through the writeByte method for a -// single symbol, or combinations of writeSlice/writeMark for multiple symbols. -// Any valid stream must start with a literal insertion if no preset dictionary -// is used. +// - Literal insertions: Runs of one or more symbols are inserted into the data +// stream as is. This is accomplished through the writeByte method for a +// single symbol, or combinations of writeSlice/writeMark for multiple symbols. +// Any valid stream must start with a literal insertion if no preset dictionary +// is used. // -// * Backward copies: Runs of one or more symbols are copied from previously -// emitted data. Backward copies come as the tuple (dist, length) where dist -// determines how far back in the stream to copy from and length determines how -// many bytes to copy. Note that it is valid for the length to be greater than -// the distance. Since LZ77 uses forward copies, that situation is used to -// perform a form of run-length encoding on repeated runs of symbols. -// The writeCopy and tryWriteCopy are used to implement this command. +// - Backward copies: Runs of one or more symbols are copied from previously +// emitted data. Backward copies come as the tuple (dist, length) where dist +// determines how far back in the stream to copy from and length determines how +// many bytes to copy. Note that it is valid for the length to be greater than +// the distance. Since LZ77 uses forward copies, that situation is used to +// perform a form of run-length encoding on repeated runs of symbols. +// The writeCopy and tryWriteCopy are used to implement this command. // // For performance reasons, this implementation performs little to no sanity // checks about the arguments. As such, the invariants documented for each diff --git a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/flate/fast_encoder.go b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/flate/fast_encoder.go index f781aaa62..24caf5f70 100644 --- a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/flate/fast_encoder.go +++ b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/flate/fast_encoder.go @@ -58,17 +58,6 @@ const ( prime8bytes = 0xcf1bbcdcb7a56463 ) -func load32(b []byte, i int) uint32 { - // Help the compiler eliminate bounds checks on the read so it can be done in a single read. - b = b[i:] - b = b[:4] - return uint32(b[0]) | uint32(b[1])<<8 | uint32(b[2])<<16 | uint32(b[3])<<24 -} - -func load64(b []byte, i int) uint64 { - return binary.LittleEndian.Uint64(b[i:]) -} - func load3232(b []byte, i int32) uint32 { return binary.LittleEndian.Uint32(b[i:]) } @@ -77,10 +66,6 @@ func load6432(b []byte, i int32) uint64 { return binary.LittleEndian.Uint64(b[i:]) } -func hash(u uint32) uint32 { - return (u * 0x1e35a7bd) >> tableShift -} - type tableEntry struct { offset int32 } @@ -104,7 +89,8 @@ func (e *fastGen) addBlock(src []byte) int32 { } // Move down offset := int32(len(e.hist)) - maxMatchOffset - copy(e.hist[0:maxMatchOffset], e.hist[offset:]) + // copy(e.hist[0:maxMatchOffset], e.hist[offset:]) + *(*[maxMatchOffset]byte)(e.hist) = *(*[maxMatchOffset]byte)(e.hist[offset:]) e.cur += offset e.hist = e.hist[:maxMatchOffset] } @@ -114,39 +100,36 @@ func (e *fastGen) addBlock(src []byte) int32 { return s } -// hash4 returns the hash of u to fit in a hash table with h bits. -// Preferably h should be a constant and should always be <32. -func hash4u(u uint32, h uint8) uint32 { - return (u * prime4bytes) >> (32 - h) -} - type tableEntryPrev struct { Cur tableEntry Prev tableEntry } -// hash4x64 returns the hash of the lowest 4 bytes of u to fit in a hash table with h bits. -// Preferably h should be a constant and should always be <32. -func hash4x64(u uint64, h uint8) uint32 { - return (uint32(u) * prime4bytes) >> ((32 - h) & reg8SizeMask32) -} - // hash7 returns the hash of the lowest 7 bytes of u to fit in a hash table with h bits. // Preferably h should be a constant and should always be <64. func hash7(u uint64, h uint8) uint32 { return uint32(((u << (64 - 56)) * prime7bytes) >> ((64 - h) & reg8SizeMask64)) } -// hash8 returns the hash of u to fit in a hash table with h bits. -// Preferably h should be a constant and should always be <64. -func hash8(u uint64, h uint8) uint32 { - return uint32((u * prime8bytes) >> ((64 - h) & reg8SizeMask64)) -} - -// hash6 returns the hash of the lowest 6 bytes of u to fit in a hash table with h bits. -// Preferably h should be a constant and should always be <64. -func hash6(u uint64, h uint8) uint32 { - return uint32(((u << (64 - 48)) * prime6bytes) >> ((64 - h) & reg8SizeMask64)) +// hashLen returns a hash of the lowest mls bytes of with length output bits. +// mls must be >=3 and <=8. Any other value will return hash for 4 bytes. +// length should always be < 32. +// Preferably length and mls should be a constant for inlining. +func hashLen(u uint64, length, mls uint8) uint32 { + switch mls { + case 3: + return (uint32(u<<8) * prime3bytes) >> (32 - length) + case 5: + return uint32(((u << (64 - 40)) * prime5bytes) >> (64 - length)) + case 6: + return uint32(((u << (64 - 48)) * prime6bytes) >> (64 - length)) + case 7: + return uint32(((u << (64 - 56)) * prime7bytes) >> (64 - length)) + case 8: + return uint32((u * prime8bytes) >> (64 - length)) + default: + return (uint32(u) * prime4bytes) >> (32 - length) + } } // matchlen will return the match length between offsets and t in src. diff --git a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/flate/huffman_bit_writer.go b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/flate/huffman_bit_writer.go index 40ef45c2f..89a5dd89f 100644 --- a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/flate/huffman_bit_writer.go +++ b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/flate/huffman_bit_writer.go @@ -265,9 +265,9 @@ func (w *huffmanBitWriter) writeBytes(bytes []byte) { // Codes 0-15 are single byte codes. Codes 16-18 are followed by additional // information. Code badCode is an end marker // -// numLiterals The number of literals in literalEncoding -// numOffsets The number of offsets in offsetEncoding -// litenc, offenc The literal and offset encoder to use +// numLiterals The number of literals in literalEncoding +// numOffsets The number of offsets in offsetEncoding +// litenc, offenc The literal and offset encoder to use func (w *huffmanBitWriter) generateCodegen(numLiterals int, numOffsets int, litEnc, offEnc *huffmanEncoder) { for i := range w.codegenFreq { w.codegenFreq[i] = 0 @@ -460,9 +460,9 @@ func (w *huffmanBitWriter) writeOutBits() { // Write the header of a dynamic Huffman block to the output stream. // -// numLiterals The number of literals specified in codegen -// numOffsets The number of offsets specified in codegen -// numCodegens The number of codegens used in codegen +// numLiterals The number of literals specified in codegen +// numOffsets The number of offsets specified in codegen +// numCodegens The number of codegens used in codegen func (w *huffmanBitWriter) writeDynamicHeader(numLiterals int, numOffsets int, numCodegens int, isEof bool) { if w.err != nil { return @@ -790,9 +790,11 @@ func (w *huffmanBitWriter) fillTokens() { // and offsetEncoding. // The number of literal and offset tokens is returned. func (w *huffmanBitWriter) indexTokens(t *tokens, filled bool) (numLiterals, numOffsets int) { - copy(w.literalFreq[:], t.litHist[:]) - copy(w.literalFreq[256:], t.extraHist[:]) - copy(w.offsetFreq[:], t.offHist[:offsetCodeCount]) + //copy(w.literalFreq[:], t.litHist[:]) + *(*[256]uint16)(w.literalFreq[:]) = t.litHist + //copy(w.literalFreq[256:], t.extraHist[:]) + *(*[32]uint16)(w.literalFreq[256:]) = t.extraHist + w.offsetFreq = t.offHist if t.n == 0 { return diff --git a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/flate/huffman_code.go b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/flate/huffman_code.go index 5ac144f28..be7b58b47 100644 --- a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/flate/huffman_code.go +++ b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/flate/huffman_code.go @@ -168,13 +168,18 @@ func (h *huffmanEncoder) canReuseBits(freq []uint16) int { // The cases of 0, 1, and 2 literals are handled by special case code. // // list An array of the literals with non-zero frequencies -// and their associated frequencies. The array is in order of increasing -// frequency, and has as its last element a special element with frequency -// MaxInt32 +// +// and their associated frequencies. The array is in order of increasing +// frequency, and has as its last element a special element with frequency +// MaxInt32 +// // maxBits The maximum number of bits that should be used to encode any literal. -// Must be less than 16. +// +// Must be less than 16. +// // return An integer array in which array[i] indicates the number of literals -// that should be encoded in i bits. +// +// that should be encoded in i bits. func (h *huffmanEncoder) bitCounts(list []literalNode, maxBits int32) []int32 { if maxBits >= maxBitsLimit { panic("flate: maxBits too large") diff --git a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/flate/level1.go b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/flate/level1.go index 0f14f8d63..703b9a89a 100644 --- a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/flate/level1.go +++ b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/flate/level1.go @@ -19,6 +19,7 @@ func (e *fastEncL1) Encode(dst *tokens, src []byte) { const ( inputMargin = 12 - 1 minNonLiteralBlockSize = 1 + 1 + inputMargin + hashBytes = 5 ) if debugDeflate && e.cur < 0 { panic(fmt.Sprint("e.cur < 0: ", e.cur)) @@ -68,7 +69,7 @@ func (e *fastEncL1) Encode(dst *tokens, src []byte) { sLimit := int32(len(src) - inputMargin) // nextEmit is where in src the next emitLiteral should start from. - cv := load3232(src, s) + cv := load6432(src, s) for { const skipLog = 5 @@ -77,7 +78,7 @@ func (e *fastEncL1) Encode(dst *tokens, src []byte) { nextS := s var candidate tableEntry for { - nextHash := hash(cv) + nextHash := hashLen(cv, tableBits, hashBytes) candidate = e.table[nextHash] nextS = s + doEvery + (s-nextEmit)>>skipLog if nextS > sLimit { @@ -86,16 +87,16 @@ func (e *fastEncL1) Encode(dst *tokens, src []byte) { now := load6432(src, nextS) e.table[nextHash] = tableEntry{offset: s + e.cur} - nextHash = hash(uint32(now)) + nextHash = hashLen(now, tableBits, hashBytes) offset := s - (candidate.offset - e.cur) - if offset < maxMatchOffset && cv == load3232(src, candidate.offset-e.cur) { + if offset < maxMatchOffset && uint32(cv) == load3232(src, candidate.offset-e.cur) { e.table[nextHash] = tableEntry{offset: nextS + e.cur} break } // Do one right away... - cv = uint32(now) + cv = now s = nextS nextS++ candidate = e.table[nextHash] @@ -103,11 +104,11 @@ func (e *fastEncL1) Encode(dst *tokens, src []byte) { e.table[nextHash] = tableEntry{offset: s + e.cur} offset = s - (candidate.offset - e.cur) - if offset < maxMatchOffset && cv == load3232(src, candidate.offset-e.cur) { + if offset < maxMatchOffset && uint32(cv) == load3232(src, candidate.offset-e.cur) { e.table[nextHash] = tableEntry{offset: nextS + e.cur} break } - cv = uint32(now) + cv = now s = nextS } @@ -198,9 +199,9 @@ func (e *fastEncL1) Encode(dst *tokens, src []byte) { } if s >= sLimit { // Index first pair after match end. - if int(s+l+4) < len(src) { - cv := load3232(src, s) - e.table[hash(cv)] = tableEntry{offset: s + e.cur} + if int(s+l+8) < len(src) { + cv := load6432(src, s) + e.table[hashLen(cv, tableBits, hashBytes)] = tableEntry{offset: s + e.cur} } goto emitRemainder } @@ -213,16 +214,16 @@ func (e *fastEncL1) Encode(dst *tokens, src []byte) { // three load32 calls. x := load6432(src, s-2) o := e.cur + s - 2 - prevHash := hash(uint32(x)) + prevHash := hashLen(x, tableBits, hashBytes) e.table[prevHash] = tableEntry{offset: o} x >>= 16 - currHash := hash(uint32(x)) + currHash := hashLen(x, tableBits, hashBytes) candidate = e.table[currHash] e.table[currHash] = tableEntry{offset: o + 2} offset := s - (candidate.offset - e.cur) if offset > maxMatchOffset || uint32(x) != load3232(src, candidate.offset-e.cur) { - cv = uint32(x >> 8) + cv = x >> 8 s++ break } diff --git a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/flate/level2.go b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/flate/level2.go index 8603fbd55..876dfbe30 100644 --- a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/flate/level2.go +++ b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/flate/level2.go @@ -16,6 +16,7 @@ func (e *fastEncL2) Encode(dst *tokens, src []byte) { const ( inputMargin = 12 - 1 minNonLiteralBlockSize = 1 + 1 + inputMargin + hashBytes = 5 ) if debugDeflate && e.cur < 0 { @@ -66,7 +67,7 @@ func (e *fastEncL2) Encode(dst *tokens, src []byte) { sLimit := int32(len(src) - inputMargin) // nextEmit is where in src the next emitLiteral should start from. - cv := load3232(src, s) + cv := load6432(src, s) for { // When should we start skipping if we haven't found matches in a long while. const skipLog = 5 @@ -75,7 +76,7 @@ func (e *fastEncL2) Encode(dst *tokens, src []byte) { nextS := s var candidate tableEntry for { - nextHash := hash4u(cv, bTableBits) + nextHash := hashLen(cv, bTableBits, hashBytes) s = nextS nextS = s + doEvery + (s-nextEmit)>>skipLog if nextS > sLimit { @@ -84,16 +85,16 @@ func (e *fastEncL2) Encode(dst *tokens, src []byte) { candidate = e.table[nextHash] now := load6432(src, nextS) e.table[nextHash] = tableEntry{offset: s + e.cur} - nextHash = hash4u(uint32(now), bTableBits) + nextHash = hashLen(now, bTableBits, hashBytes) offset := s - (candidate.offset - e.cur) - if offset < maxMatchOffset && cv == load3232(src, candidate.offset-e.cur) { + if offset < maxMatchOffset && uint32(cv) == load3232(src, candidate.offset-e.cur) { e.table[nextHash] = tableEntry{offset: nextS + e.cur} break } // Do one right away... - cv = uint32(now) + cv = now s = nextS nextS++ candidate = e.table[nextHash] @@ -101,10 +102,10 @@ func (e *fastEncL2) Encode(dst *tokens, src []byte) { e.table[nextHash] = tableEntry{offset: s + e.cur} offset = s - (candidate.offset - e.cur) - if offset < maxMatchOffset && cv == load3232(src, candidate.offset-e.cur) { + if offset < maxMatchOffset && uint32(cv) == load3232(src, candidate.offset-e.cur) { break } - cv = uint32(now) + cv = now } // A 4-byte match has been found. We'll later see if more than 4 bytes @@ -154,9 +155,9 @@ func (e *fastEncL2) Encode(dst *tokens, src []byte) { if s >= sLimit { // Index first pair after match end. - if int(s+l+4) < len(src) { - cv := load3232(src, s) - e.table[hash4u(cv, bTableBits)] = tableEntry{offset: s + e.cur} + if int(s+l+8) < len(src) { + cv := load6432(src, s) + e.table[hashLen(cv, bTableBits, hashBytes)] = tableEntry{offset: s + e.cur} } goto emitRemainder } @@ -164,15 +165,15 @@ func (e *fastEncL2) Encode(dst *tokens, src []byte) { // Store every second hash in-between, but offset by 1. for i := s - l + 2; i < s-5; i += 7 { x := load6432(src, i) - nextHash := hash4u(uint32(x), bTableBits) + nextHash := hashLen(x, bTableBits, hashBytes) e.table[nextHash] = tableEntry{offset: e.cur + i} // Skip one x >>= 16 - nextHash = hash4u(uint32(x), bTableBits) + nextHash = hashLen(x, bTableBits, hashBytes) e.table[nextHash] = tableEntry{offset: e.cur + i + 2} // Skip one x >>= 16 - nextHash = hash4u(uint32(x), bTableBits) + nextHash = hashLen(x, bTableBits, hashBytes) e.table[nextHash] = tableEntry{offset: e.cur + i + 4} } @@ -184,17 +185,17 @@ func (e *fastEncL2) Encode(dst *tokens, src []byte) { // three load32 calls. x := load6432(src, s-2) o := e.cur + s - 2 - prevHash := hash4u(uint32(x), bTableBits) - prevHash2 := hash4u(uint32(x>>8), bTableBits) + prevHash := hashLen(x, bTableBits, hashBytes) + prevHash2 := hashLen(x>>8, bTableBits, hashBytes) e.table[prevHash] = tableEntry{offset: o} e.table[prevHash2] = tableEntry{offset: o + 1} - currHash := hash4u(uint32(x>>16), bTableBits) + currHash := hashLen(x>>16, bTableBits, hashBytes) candidate = e.table[currHash] e.table[currHash] = tableEntry{offset: o + 2} offset := s - (candidate.offset - e.cur) if offset > maxMatchOffset || uint32(x>>16) != load3232(src, candidate.offset-e.cur) { - cv = uint32(x >> 24) + cv = x >> 24 s++ break } diff --git a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/flate/level3.go b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/flate/level3.go index 039639f89..7aa2b72a1 100644 --- a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/flate/level3.go +++ b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/flate/level3.go @@ -11,10 +11,11 @@ type fastEncL3 struct { // Encode uses a similar algorithm to level 2, will check up to two candidates. func (e *fastEncL3) Encode(dst *tokens, src []byte) { const ( - inputMargin = 8 - 1 + inputMargin = 12 - 1 minNonLiteralBlockSize = 1 + 1 + inputMargin tableBits = 16 tableSize = 1 << tableBits + hashBytes = 5 ) if debugDeflate && e.cur < 0 { @@ -69,20 +70,20 @@ func (e *fastEncL3) Encode(dst *tokens, src []byte) { sLimit := int32(len(src) - inputMargin) // nextEmit is where in src the next emitLiteral should start from. - cv := load3232(src, s) + cv := load6432(src, s) for { - const skipLog = 6 + const skipLog = 7 nextS := s var candidate tableEntry for { - nextHash := hash4u(cv, tableBits) + nextHash := hashLen(cv, tableBits, hashBytes) s = nextS nextS = s + 1 + (s-nextEmit)>>skipLog if nextS > sLimit { goto emitRemainder } candidates := e.table[nextHash] - now := load3232(src, nextS) + now := load6432(src, nextS) // Safe offset distance until s + 4... minOffset := e.cur + s - (maxMatchOffset - 4) @@ -96,8 +97,8 @@ func (e *fastEncL3) Encode(dst *tokens, src []byte) { continue } - if cv == load3232(src, candidate.offset-e.cur) { - if candidates.Prev.offset < minOffset || cv != load3232(src, candidates.Prev.offset-e.cur) { + if uint32(cv) == load3232(src, candidate.offset-e.cur) { + if candidates.Prev.offset < minOffset || uint32(cv) != load3232(src, candidates.Prev.offset-e.cur) { break } // Both match and are valid, pick longest. @@ -112,7 +113,7 @@ func (e *fastEncL3) Encode(dst *tokens, src []byte) { // We only check if value mismatches. // Offset will always be invalid in other cases. candidate = candidates.Prev - if candidate.offset > minOffset && cv == load3232(src, candidate.offset-e.cur) { + if candidate.offset > minOffset && uint32(cv) == load3232(src, candidate.offset-e.cur) { break } } @@ -164,9 +165,9 @@ func (e *fastEncL3) Encode(dst *tokens, src []byte) { if s >= sLimit { t += l // Index first pair after match end. - if int(t+4) < len(src) && t > 0 { - cv := load3232(src, t) - nextHash := hash4u(cv, tableBits) + if int(t+8) < len(src) && t > 0 { + cv = load6432(src, t) + nextHash := hashLen(cv, tableBits, hashBytes) e.table[nextHash] = tableEntryPrev{ Prev: e.table[nextHash].Cur, Cur: tableEntry{offset: e.cur + t}, @@ -176,8 +177,8 @@ func (e *fastEncL3) Encode(dst *tokens, src []byte) { } // Store every 5th hash in-between. - for i := s - l + 2; i < s-5; i += 5 { - nextHash := hash4u(load3232(src, i), tableBits) + for i := s - l + 2; i < s-5; i += 6 { + nextHash := hashLen(load6432(src, i), tableBits, hashBytes) e.table[nextHash] = tableEntryPrev{ Prev: e.table[nextHash].Cur, Cur: tableEntry{offset: e.cur + i}} @@ -185,23 +186,23 @@ func (e *fastEncL3) Encode(dst *tokens, src []byte) { // We could immediately start working at s now, but to improve // compression we first update the hash table at s-2 to s. x := load6432(src, s-2) - prevHash := hash4u(uint32(x), tableBits) + prevHash := hashLen(x, tableBits, hashBytes) e.table[prevHash] = tableEntryPrev{ Prev: e.table[prevHash].Cur, Cur: tableEntry{offset: e.cur + s - 2}, } x >>= 8 - prevHash = hash4u(uint32(x), tableBits) + prevHash = hashLen(x, tableBits, hashBytes) e.table[prevHash] = tableEntryPrev{ Prev: e.table[prevHash].Cur, Cur: tableEntry{offset: e.cur + s - 1}, } x >>= 8 - currHash := hash4u(uint32(x), tableBits) + currHash := hashLen(x, tableBits, hashBytes) candidates := e.table[currHash] - cv = uint32(x) + cv = x e.table[currHash] = tableEntryPrev{ Prev: candidates.Cur, Cur: tableEntry{offset: s + e.cur}, @@ -212,17 +213,17 @@ func (e *fastEncL3) Encode(dst *tokens, src []byte) { minOffset := e.cur + s - (maxMatchOffset - 4) if candidate.offset > minOffset { - if cv == load3232(src, candidate.offset-e.cur) { + if uint32(cv) == load3232(src, candidate.offset-e.cur) { // Found a match... continue } candidate = candidates.Prev - if candidate.offset > minOffset && cv == load3232(src, candidate.offset-e.cur) { + if candidate.offset > minOffset && uint32(cv) == load3232(src, candidate.offset-e.cur) { // Match at prev... continue } } - cv = uint32(x >> 8) + cv = x >> 8 s++ break } diff --git a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/flate/level4.go b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/flate/level4.go index 1cbffa1ae..23c08b325 100644 --- a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/flate/level4.go +++ b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/flate/level4.go @@ -12,6 +12,7 @@ func (e *fastEncL4) Encode(dst *tokens, src []byte) { const ( inputMargin = 12 - 1 minNonLiteralBlockSize = 1 + 1 + inputMargin + hashShortBytes = 4 ) if debugDeflate && e.cur < 0 { panic(fmt.Sprint("e.cur < 0: ", e.cur)) @@ -80,7 +81,7 @@ func (e *fastEncL4) Encode(dst *tokens, src []byte) { nextS := s var t int32 for { - nextHashS := hash4x64(cv, tableBits) + nextHashS := hashLen(cv, tableBits, hashShortBytes) nextHashL := hash7(cv, tableBits) s = nextS @@ -168,7 +169,7 @@ func (e *fastEncL4) Encode(dst *tokens, src []byte) { // Index first pair after match end. if int(s+8) < len(src) { cv := load6432(src, s) - e.table[hash4x64(cv, tableBits)] = tableEntry{offset: s + e.cur} + e.table[hashLen(cv, tableBits, hashShortBytes)] = tableEntry{offset: s + e.cur} e.bTable[hash7(cv, tableBits)] = tableEntry{offset: s + e.cur} } goto emitRemainder @@ -183,7 +184,7 @@ func (e *fastEncL4) Encode(dst *tokens, src []byte) { t2 := tableEntry{offset: t.offset + 1} e.bTable[hash7(cv, tableBits)] = t e.bTable[hash7(cv>>8, tableBits)] = t2 - e.table[hash4u(uint32(cv>>8), tableBits)] = t2 + e.table[hashLen(cv>>8, tableBits, hashShortBytes)] = t2 i += 3 for ; i < s-1; i += 3 { @@ -192,7 +193,7 @@ func (e *fastEncL4) Encode(dst *tokens, src []byte) { t2 := tableEntry{offset: t.offset + 1} e.bTable[hash7(cv, tableBits)] = t e.bTable[hash7(cv>>8, tableBits)] = t2 - e.table[hash4u(uint32(cv>>8), tableBits)] = t2 + e.table[hashLen(cv>>8, tableBits, hashShortBytes)] = t2 } } } @@ -201,7 +202,7 @@ func (e *fastEncL4) Encode(dst *tokens, src []byte) { // compression we first update the hash table at s-1 and at s. x := load6432(src, s-1) o := e.cur + s - 1 - prevHashS := hash4x64(x, tableBits) + prevHashS := hashLen(x, tableBits, hashShortBytes) prevHashL := hash7(x, tableBits) e.table[prevHashS] = tableEntry{offset: o} e.bTable[prevHashL] = tableEntry{offset: o} diff --git a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/flate/level5.go b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/flate/level5.go index 4b97576bd..83ef50ba4 100644 --- a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/flate/level5.go +++ b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/flate/level5.go @@ -12,6 +12,7 @@ func (e *fastEncL5) Encode(dst *tokens, src []byte) { const ( inputMargin = 12 - 1 minNonLiteralBlockSize = 1 + 1 + inputMargin + hashShortBytes = 4 ) if debugDeflate && e.cur < 0 { panic(fmt.Sprint("e.cur < 0: ", e.cur)) @@ -88,7 +89,7 @@ func (e *fastEncL5) Encode(dst *tokens, src []byte) { var l int32 var t int32 for { - nextHashS := hash4x64(cv, tableBits) + nextHashS := hashLen(cv, tableBits, hashShortBytes) nextHashL := hash7(cv, tableBits) s = nextS @@ -105,7 +106,7 @@ func (e *fastEncL5) Encode(dst *tokens, src []byte) { eLong := &e.bTable[nextHashL] eLong.Cur, eLong.Prev = entry, eLong.Cur - nextHashS = hash4x64(next, tableBits) + nextHashS = hashLen(next, tableBits, hashShortBytes) nextHashL = hash7(next, tableBits) t = lCandidate.Cur.offset - e.cur @@ -191,14 +192,21 @@ func (e *fastEncL5) Encode(dst *tokens, src []byte) { // Try to locate a better match by checking the end of best match... if sAt := s + l; l < 30 && sAt < sLimit { + // Allow some bytes at the beginning to mismatch. + // Sweet spot is 2/3 bytes depending on input. + // 3 is only a little better when it is but sometimes a lot worse. + // The skipped bytes are tested in Extend backwards, + // and still picked up as part of the match if they do. + const skipBeginning = 2 eLong := e.bTable[hash7(load6432(src, sAt), tableBits)].Cur.offset - // Test current - t2 := eLong - e.cur - l - off := s - t2 + t2 := eLong - e.cur - l + skipBeginning + s2 := s + skipBeginning + off := s2 - t2 if t2 >= 0 && off < maxMatchOffset && off > 0 { - if l2 := e.matchlenLong(s, t2, src); l2 > l { + if l2 := e.matchlenLong(s2, t2, src); l2 > l { t = t2 l = l2 + s = s2 } } } @@ -250,7 +258,7 @@ func (e *fastEncL5) Encode(dst *tokens, src []byte) { if i < s-1 { cv := load6432(src, i) t := tableEntry{offset: i + e.cur} - e.table[hash4x64(cv, tableBits)] = t + e.table[hashLen(cv, tableBits, hashShortBytes)] = t eLong := &e.bTable[hash7(cv, tableBits)] eLong.Cur, eLong.Prev = t, eLong.Cur @@ -263,7 +271,7 @@ func (e *fastEncL5) Encode(dst *tokens, src []byte) { // We only have enough bits for a short entry at i+2 cv >>= 8 t = tableEntry{offset: t.offset + 1} - e.table[hash4x64(cv, tableBits)] = t + e.table[hashLen(cv, tableBits, hashShortBytes)] = t // Skip one - otherwise we risk hitting 's' i += 4 @@ -273,7 +281,7 @@ func (e *fastEncL5) Encode(dst *tokens, src []byte) { t2 := tableEntry{offset: t.offset + 1} eLong := &e.bTable[hash7(cv, tableBits)] eLong.Cur, eLong.Prev = t, eLong.Cur - e.table[hash4u(uint32(cv>>8), tableBits)] = t2 + e.table[hashLen(cv>>8, tableBits, hashShortBytes)] = t2 } } } @@ -282,7 +290,7 @@ func (e *fastEncL5) Encode(dst *tokens, src []byte) { // compression we first update the hash table at s-1 and at s. x := load6432(src, s-1) o := e.cur + s - 1 - prevHashS := hash4x64(x, tableBits) + prevHashS := hashLen(x, tableBits, hashShortBytes) prevHashL := hash7(x, tableBits) e.table[prevHashS] = tableEntry{offset: o} eLong := &e.bTable[prevHashL] diff --git a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/flate/level6.go b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/flate/level6.go index 62888edf3..f1e9d98fa 100644 --- a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/flate/level6.go +++ b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/flate/level6.go @@ -12,6 +12,7 @@ func (e *fastEncL6) Encode(dst *tokens, src []byte) { const ( inputMargin = 12 - 1 minNonLiteralBlockSize = 1 + 1 + inputMargin + hashShortBytes = 4 ) if debugDeflate && e.cur < 0 { panic(fmt.Sprint("e.cur < 0: ", e.cur)) @@ -90,7 +91,7 @@ func (e *fastEncL6) Encode(dst *tokens, src []byte) { var l int32 var t int32 for { - nextHashS := hash4x64(cv, tableBits) + nextHashS := hashLen(cv, tableBits, hashShortBytes) nextHashL := hash7(cv, tableBits) s = nextS nextS = s + doEvery + (s-nextEmit)>>skipLog @@ -107,7 +108,7 @@ func (e *fastEncL6) Encode(dst *tokens, src []byte) { eLong.Cur, eLong.Prev = entry, eLong.Cur // Calculate hashes of 'next' - nextHashS = hash4x64(next, tableBits) + nextHashS = hashLen(next, tableBits, hashShortBytes) nextHashL = hash7(next, tableBits) t = lCandidate.Cur.offset - e.cur @@ -213,24 +214,33 @@ func (e *fastEncL6) Encode(dst *tokens, src []byte) { // Try to locate a better match by checking the end-of-match... if sAt := s + l; sAt < sLimit { + // Allow some bytes at the beginning to mismatch. + // Sweet spot is 2/3 bytes depending on input. + // 3 is only a little better when it is but sometimes a lot worse. + // The skipped bytes are tested in Extend backwards, + // and still picked up as part of the match if they do. + const skipBeginning = 2 eLong := &e.bTable[hash7(load6432(src, sAt), tableBits)] // Test current - t2 := eLong.Cur.offset - e.cur - l - off := s - t2 + t2 := eLong.Cur.offset - e.cur - l + skipBeginning + s2 := s + skipBeginning + off := s2 - t2 if off < maxMatchOffset { if off > 0 && t2 >= 0 { - if l2 := e.matchlenLong(s, t2, src); l2 > l { + if l2 := e.matchlenLong(s2, t2, src); l2 > l { t = t2 l = l2 + s = s2 } } // Test next: - t2 = eLong.Prev.offset - e.cur - l - off := s - t2 + t2 = eLong.Prev.offset - e.cur - l + skipBeginning + off := s2 - t2 if off > 0 && off < maxMatchOffset && t2 >= 0 { - if l2 := e.matchlenLong(s, t2, src); l2 > l { + if l2 := e.matchlenLong(s2, t2, src); l2 > l { t = t2 l = l2 + s = s2 } } } @@ -277,7 +287,7 @@ func (e *fastEncL6) Encode(dst *tokens, src []byte) { // Index after match end. for i := nextS + 1; i < int32(len(src))-8; i += 2 { cv := load6432(src, i) - e.table[hash4x64(cv, tableBits)] = tableEntry{offset: i + e.cur} + e.table[hashLen(cv, tableBits, hashShortBytes)] = tableEntry{offset: i + e.cur} eLong := &e.bTable[hash7(cv, tableBits)] eLong.Cur, eLong.Prev = tableEntry{offset: i + e.cur}, eLong.Cur } @@ -292,7 +302,7 @@ func (e *fastEncL6) Encode(dst *tokens, src []byte) { t2 := tableEntry{offset: t.offset + 1} eLong := &e.bTable[hash7(cv, tableBits)] eLong2 := &e.bTable[hash7(cv>>8, tableBits)] - e.table[hash4x64(cv, tableBits)] = t + e.table[hashLen(cv, tableBits, hashShortBytes)] = t eLong.Cur, eLong.Prev = t, eLong.Cur eLong2.Cur, eLong2.Prev = t2, eLong2.Cur } diff --git a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/huff0/decompress.go b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/huff0/decompress.go index c0c48bd70..42a237eac 100644 --- a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/huff0/decompress.go +++ b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/huff0/decompress.go @@ -763,17 +763,20 @@ func (d *Decoder) decompress4X8bit(dst, src []byte) ([]byte, error) { d.bufs.Put(buf) return nil, errors.New("corruption detected: stream overrun 1") } - copy(out, buf[0][:]) - copy(out[dstEvery:], buf[1][:]) - copy(out[dstEvery*2:], buf[2][:]) - copy(out[dstEvery*3:], buf[3][:]) - out = out[bufoff:] - decoded += bufoff * 4 // There must at least be 3 buffers left. - if len(out) < dstEvery*3 { + if len(out)-bufoff < dstEvery*3 { d.bufs.Put(buf) return nil, errors.New("corruption detected: stream overrun 2") } + //copy(out, buf[0][:]) + //copy(out[dstEvery:], buf[1][:]) + //copy(out[dstEvery*2:], buf[2][:]) + *(*[bufoff]byte)(out) = buf[0] + *(*[bufoff]byte)(out[dstEvery:]) = buf[1] + *(*[bufoff]byte)(out[dstEvery*2:]) = buf[2] + *(*[bufoff]byte)(out[dstEvery*3:]) = buf[3] + out = out[bufoff:] + decoded += bufoff * 4 } } if off > 0 { @@ -997,17 +1000,22 @@ func (d *Decoder) decompress4X8bitExactly(dst, src []byte) ([]byte, error) { d.bufs.Put(buf) return nil, errors.New("corruption detected: stream overrun 1") } - copy(out, buf[0][:]) - copy(out[dstEvery:], buf[1][:]) - copy(out[dstEvery*2:], buf[2][:]) - copy(out[dstEvery*3:], buf[3][:]) - out = out[bufoff:] - decoded += bufoff * 4 // There must at least be 3 buffers left. - if len(out) < dstEvery*3 { + if len(out)-bufoff < dstEvery*3 { d.bufs.Put(buf) return nil, errors.New("corruption detected: stream overrun 2") } + + //copy(out, buf[0][:]) + //copy(out[dstEvery:], buf[1][:]) + //copy(out[dstEvery*2:], buf[2][:]) + // copy(out[dstEvery*3:], buf[3][:]) + *(*[bufoff]byte)(out) = buf[0] + *(*[bufoff]byte)(out[dstEvery:]) = buf[1] + *(*[bufoff]byte)(out[dstEvery*2:]) = buf[2] + *(*[bufoff]byte)(out[dstEvery*3:]) = buf[3] + out = out[bufoff:] + decoded += bufoff * 4 } } if off > 0 { diff --git a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/huff0/decompress_amd64.go b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/huff0/decompress_amd64.go index 9f3e9f79e..ba7e8e6b0 100644 --- a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/huff0/decompress_amd64.go +++ b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/huff0/decompress_amd64.go @@ -14,12 +14,14 @@ import ( // decompress4x_main_loop_x86 is an x86 assembler implementation // of Decompress4X when tablelog > 8. +// //go:noescape func decompress4x_main_loop_amd64(ctx *decompress4xContext) // decompress4x_8b_loop_x86 is an x86 assembler implementation // of Decompress4X when tablelog <= 8 which decodes 4 entries // per loop. +// //go:noescape func decompress4x_8b_main_loop_amd64(ctx *decompress4xContext) @@ -145,11 +147,13 @@ func (d *Decoder) Decompress4X(dst, src []byte) ([]byte, error) { // decompress4x_main_loop_x86 is an x86 assembler implementation // of Decompress1X when tablelog > 8. +// //go:noescape func decompress1x_main_loop_amd64(ctx *decompress1xContext) // decompress4x_main_loop_x86 is an x86 with BMI2 assembler implementation // of Decompress1X when tablelog > 8. +// //go:noescape func decompress1x_main_loop_bmi2(ctx *decompress1xContext) diff --git a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/huff0/decompress_amd64.s b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/huff0/decompress_amd64.s index dd1a5aecd..8d2187a2c 100644 --- a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/huff0/decompress_amd64.s +++ b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/huff0/decompress_amd64.s @@ -1,7 +1,6 @@ // Code generated by command: go run gen.go -out ../decompress_amd64.s -pkg=huff0. DO NOT EDIT. //go:build amd64 && !appengine && !noasm && gc -// +build amd64,!appengine,!noasm,gc // func decompress4x_main_loop_amd64(ctx *decompress4xContext) TEXT ·decompress4x_main_loop_amd64(SB), $0-8 diff --git a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/huff0/decompress_generic.go b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/huff0/decompress_generic.go index 4f6f37cb2..908c17de6 100644 --- a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/huff0/decompress_generic.go +++ b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/huff0/decompress_generic.go @@ -122,17 +122,21 @@ func (d *Decoder) Decompress4X(dst, src []byte) ([]byte, error) { d.bufs.Put(buf) return nil, errors.New("corruption detected: stream overrun 1") } - copy(out, buf[0][:]) - copy(out[dstEvery:], buf[1][:]) - copy(out[dstEvery*2:], buf[2][:]) - copy(out[dstEvery*3:], buf[3][:]) - out = out[bufoff:] - decoded += bufoff * 4 // There must at least be 3 buffers left. - if len(out) < dstEvery*3 { + if len(out)-bufoff < dstEvery*3 { d.bufs.Put(buf) return nil, errors.New("corruption detected: stream overrun 2") } + //copy(out, buf[0][:]) + //copy(out[dstEvery:], buf[1][:]) + //copy(out[dstEvery*2:], buf[2][:]) + //copy(out[dstEvery*3:], buf[3][:]) + *(*[bufoff]byte)(out) = buf[0] + *(*[bufoff]byte)(out[dstEvery:]) = buf[1] + *(*[bufoff]byte)(out[dstEvery*2:]) = buf[2] + *(*[bufoff]byte)(out[dstEvery*3:]) = buf[3] + out = out[bufoff:] + decoded += bufoff * 4 } } if off > 0 { diff --git a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/internal/snapref/encode_other.go b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/internal/snapref/encode_other.go index 511bba65d..298c4f8e9 100644 --- a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/internal/snapref/encode_other.go +++ b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/internal/snapref/encode_other.go @@ -18,6 +18,7 @@ func load64(b []byte, i int) uint64 { // emitLiteral writes a literal chunk and returns the number of bytes written. // // It assumes that: +// // dst is long enough to hold the encoded bytes // 1 <= len(lit) && len(lit) <= 65536 func emitLiteral(dst, lit []byte) int { @@ -42,6 +43,7 @@ func emitLiteral(dst, lit []byte) int { // emitCopy writes a copy chunk and returns the number of bytes written. // // It assumes that: +// // dst is long enough to hold the encoded bytes // 1 <= offset && offset <= 65535 // 4 <= length && length <= 65535 @@ -89,6 +91,7 @@ func emitCopy(dst []byte, offset, length int) int { // src[i:i+k-j] and src[j:k] have the same contents. // // It assumes that: +// // 0 <= i && i < j && j <= len(src) func extendMatch(src []byte, i, j int) int { for ; j < len(src) && src[i] == src[j]; i, j = i+1, j+1 { @@ -105,8 +108,9 @@ func hash(u, shift uint32) uint32 { // been written. // // It also assumes that: +// // len(dst) >= MaxEncodedLen(len(src)) && -// minNonLiteralBlockSize <= len(src) && len(src) <= maxBlockSize +// minNonLiteralBlockSize <= len(src) && len(src) <= maxBlockSize func encodeBlock(dst, src []byte) (d int) { // Initialize the hash table. Its size ranges from 1<<8 to 1<<14 inclusive. // The table element type is uint16, as s < sLimit and sLimit < len(src) diff --git a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/README.md b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/README.md index beb7fa872..65b38abed 100644 --- a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/README.md +++ b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/README.md @@ -12,6 +12,8 @@ The `zstd` package is provided as open source software using a Go standard licen Currently the package is heavily optimized for 64 bit processors and will be significantly slower on 32 bit processors. +For seekable zstd streams, see [this excellent package](https://github.com/SaveTheRbtz/zstd-seekable-format-go). + ## Installation Install using `go get -u github.com/klauspost/compress`. The package is located in `github.com/klauspost/compress/zstd`. diff --git a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/blockdec.go b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/blockdec.go index 7eed729be..da814715d 100644 --- a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/blockdec.go +++ b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/blockdec.go @@ -10,7 +10,6 @@ import ( "errors" "fmt" "io" - "io/ioutil" "os" "path/filepath" "sync" @@ -233,7 +232,7 @@ func (b *blockDec) decodeBuf(hist *history) error { if b.lowMem { b.dst = make([]byte, b.RLESize) } else { - b.dst = make([]byte, maxBlockSize) + b.dst = make([]byte, maxCompressedBlockSize) } } b.dst = b.dst[:b.RLESize] @@ -651,7 +650,7 @@ func (b *blockDec) prepareSequences(in []byte, hist *history) (err error) { fatalErr(binary.Write(&buf, binary.LittleEndian, hist.decoders.matchLengths.fse)) fatalErr(binary.Write(&buf, binary.LittleEndian, hist.decoders.offsets.fse)) buf.Write(in) - ioutil.WriteFile(filepath.Join("testdata", "seqs", fn), buf.Bytes(), os.ModePerm) + os.WriteFile(filepath.Join("testdata", "seqs", fn), buf.Bytes(), os.ModePerm) } return nil diff --git a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/bytebuf.go b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/bytebuf.go index 2ad02070d..176788f25 100644 --- a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/bytebuf.go +++ b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/bytebuf.go @@ -7,7 +7,6 @@ package zstd import ( "fmt" "io" - "io/ioutil" ) type byteBuffer interface { @@ -124,7 +123,7 @@ func (r *readerWrapper) readByte() (byte, error) { } func (r *readerWrapper) skipN(n int64) error { - n2, err := io.CopyN(ioutil.Discard, r.r, n) + n2, err := io.CopyN(io.Discard, r.r, n) if n2 != n { err = io.ErrUnexpectedEOF } diff --git a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/decoder.go b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/decoder.go index d212f4737..74d645f7c 100644 --- a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/decoder.go +++ b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/decoder.go @@ -35,6 +35,7 @@ type Decoder struct { br readerWrapper enabled bool inFrame bool + dstBuf []byte } frame *frameDec @@ -187,21 +188,23 @@ func (d *Decoder) Reset(r io.Reader) error { } // If bytes buffer and < 5MB, do sync decoding anyway. - if bb, ok := r.(byter); ok && bb.Len() < 5<<20 { + if bb, ok := r.(byter); ok && bb.Len() < d.o.decodeBufsBelow && !d.o.limitToCap { bb2 := bb if debugDecoder { println("*bytes.Buffer detected, doing sync decode, len:", bb.Len()) } b := bb2.Bytes() var dst []byte - if cap(d.current.b) > 0 { - dst = d.current.b + if cap(d.syncStream.dstBuf) > 0 { + dst = d.syncStream.dstBuf[:0] } - dst, err := d.DecodeAll(b, dst[:0]) + dst, err := d.DecodeAll(b, dst) if err == nil { err = io.EOF } + // Save output buffer + d.syncStream.dstBuf = dst d.current.b = dst d.current.err = err d.current.flushed = true @@ -216,6 +219,7 @@ func (d *Decoder) Reset(r io.Reader) error { d.current.err = nil d.current.flushed = false d.current.d = nil + d.syncStream.dstBuf = nil // Ensure no-one else is still running... d.streamWg.Wait() @@ -312,6 +316,7 @@ func (d *Decoder) DecodeAll(input, dst []byte) ([]byte, error) { // Grab a block decoder and frame decoder. block := <-d.decoders frame := block.localFrame + initialSize := len(dst) defer func() { if debugDecoder { printf("re-adding decoder: %p", block) @@ -354,7 +359,16 @@ func (d *Decoder) DecodeAll(input, dst []byte) ([]byte, error) { return dst, ErrWindowSizeExceeded } if frame.FrameContentSize != fcsUnknown { - if frame.FrameContentSize > d.o.maxDecodedSize-uint64(len(dst)) { + if frame.FrameContentSize > d.o.maxDecodedSize-uint64(len(dst)-initialSize) { + if debugDecoder { + println("decoder size exceeded; fcs:", frame.FrameContentSize, "> mcs:", d.o.maxDecodedSize-uint64(len(dst)-initialSize), "len:", len(dst)) + } + return dst, ErrDecoderSizeExceeded + } + if d.o.limitToCap && frame.FrameContentSize > uint64(cap(dst)-len(dst)) { + if debugDecoder { + println("decoder size exceeded; fcs:", frame.FrameContentSize, "> (cap-len)", cap(dst)-len(dst)) + } return dst, ErrDecoderSizeExceeded } if cap(dst)-len(dst) < int(frame.FrameContentSize) { @@ -364,7 +378,7 @@ func (d *Decoder) DecodeAll(input, dst []byte) ([]byte, error) { } } - if cap(dst) == 0 { + if cap(dst) == 0 && !d.o.limitToCap { // Allocate len(input) * 2 by default if nothing is provided // and we didn't get frame content size. size := len(input) * 2 @@ -382,6 +396,9 @@ func (d *Decoder) DecodeAll(input, dst []byte) ([]byte, error) { if err != nil { return dst, err } + if uint64(len(dst)-initialSize) > d.o.maxDecodedSize { + return dst, ErrDecoderSizeExceeded + } if len(frame.bBuf) == 0 { if debugDecoder { println("frame dbuf empty") @@ -667,6 +684,7 @@ func (d *Decoder) startStreamDecoder(ctx context.Context, r io.Reader, output ch if debugDecoder { println("Async 1: new history, recent:", block.async.newHist.recentOffsets) } + hist.reset() hist.decoders = block.async.newHist.decoders hist.recentOffsets = block.async.newHist.recentOffsets hist.windowSize = block.async.newHist.windowSize @@ -698,6 +716,7 @@ func (d *Decoder) startStreamDecoder(ctx context.Context, r io.Reader, output ch seqExecute <- block } close(seqExecute) + hist.reset() }() var wg sync.WaitGroup @@ -721,6 +740,7 @@ func (d *Decoder) startStreamDecoder(ctx context.Context, r io.Reader, output ch if debugDecoder { println("Async 2: new history") } + hist.reset() hist.windowSize = block.async.newHist.windowSize hist.allocFrameBuffer = block.async.newHist.allocFrameBuffer if block.async.newHist.dict != nil { @@ -750,7 +770,7 @@ func (d *Decoder) startStreamDecoder(ctx context.Context, r io.Reader, output ch if block.lowMem { block.dst = make([]byte, block.RLESize) } else { - block.dst = make([]byte, maxBlockSize) + block.dst = make([]byte, maxCompressedBlockSize) } } block.dst = block.dst[:block.RLESize] @@ -802,13 +822,14 @@ func (d *Decoder) startStreamDecoder(ctx context.Context, r io.Reader, output ch if debugDecoder { println("decoder goroutines finished") } + hist.reset() }() + var hist history decodeStream: for { - var hist history var hasErr bool - + hist.reset() decodeBlock := func(block *blockDec) { if hasErr { if block != nil { @@ -852,6 +873,10 @@ decodeStream: } } if err == nil && d.frame.WindowSize > d.o.maxWindowSize { + if debugDecoder { + println("decoder size exceeded, fws:", d.frame.WindowSize, "> mws:", d.o.maxWindowSize) + } + err = ErrDecoderSizeExceeded } if err != nil { @@ -920,5 +945,6 @@ decodeStream: } close(seqDecode) wg.Wait() + hist.reset() d.frame.history.b = frameHistCache } diff --git a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/decoder_options.go b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/decoder_options.go index c70e6fa0f..f42448e69 100644 --- a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/decoder_options.go +++ b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/decoder_options.go @@ -14,20 +14,23 @@ type DOption func(*decoderOptions) error // options retains accumulated state of multiple options. type decoderOptions struct { - lowMem bool - concurrent int - maxDecodedSize uint64 - maxWindowSize uint64 - dicts []dict - ignoreChecksum bool + lowMem bool + concurrent int + maxDecodedSize uint64 + maxWindowSize uint64 + dicts []dict + ignoreChecksum bool + limitToCap bool + decodeBufsBelow int } func (o *decoderOptions) setDefault() { *o = decoderOptions{ // use less ram: true for now, but may change. - lowMem: true, - concurrent: runtime.GOMAXPROCS(0), - maxWindowSize: MaxWindowSize, + lowMem: true, + concurrent: runtime.GOMAXPROCS(0), + maxWindowSize: MaxWindowSize, + decodeBufsBelow: 128 << 10, } if o.concurrent > 4 { o.concurrent = 4 @@ -114,6 +117,29 @@ func WithDecoderMaxWindow(size uint64) DOption { } } +// WithDecodeAllCapLimit will limit DecodeAll to decoding cap(dst)-len(dst) bytes, +// or any size set in WithDecoderMaxMemory. +// This can be used to limit decoding to a specific maximum output size. +// Disabled by default. +func WithDecodeAllCapLimit(b bool) DOption { + return func(o *decoderOptions) error { + o.limitToCap = b + return nil + } +} + +// WithDecodeBuffersBelow will fully decode readers that have a +// `Bytes() []byte` and `Len() int` interface similar to bytes.Buffer. +// This typically uses less allocations but will have the full decompressed object in memory. +// Note that DecodeAllCapLimit will disable this, as well as giving a size of 0 or less. +// Default is 128KiB. +func WithDecodeBuffersBelow(size int) DOption { + return func(o *decoderOptions) error { + o.decodeBufsBelow = size + return nil + } +} + // IgnoreChecksum allows to forcibly ignore checksum checking. func IgnoreChecksum(b bool) DOption { return func(o *decoderOptions) error { diff --git a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/enc_best.go b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/enc_best.go index 96028ecd8..dbbb88d92 100644 --- a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/enc_best.go +++ b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/enc_best.go @@ -32,6 +32,7 @@ type match struct { length int32 rep int32 est int32 + _ [12]byte // Aligned size to cache line: 4+4+4+4+4 bytes + 12 bytes padding = 32 bytes } const highScore = 25000 diff --git a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/enc_better.go b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/enc_better.go index c769f6941..d70e3fd3d 100644 --- a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/enc_better.go +++ b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/enc_better.go @@ -416,15 +416,23 @@ encodeLoop: // Try to find a better match by searching for a long match at the end of the current best match if s+matched < sLimit { + // Allow some bytes at the beginning to mismatch. + // Sweet spot is around 3 bytes, but depends on input. + // The skipped bytes are tested in Extend backwards, + // and still picked up as part of the match if they do. + const skipBeginning = 3 + nextHashL := hashLen(load6432(src, s+matched), betterLongTableBits, betterLongLen) - cv := load3232(src, s) + s2 := s + skipBeginning + cv := load3232(src, s2) candidateL := e.longTable[nextHashL] - coffsetL := candidateL.offset - e.cur - matched - if coffsetL >= 0 && coffsetL < s && s-coffsetL < e.maxMatchOff && cv == load3232(src, coffsetL) { + coffsetL := candidateL.offset - e.cur - matched + skipBeginning + if coffsetL >= 0 && coffsetL < s2 && s2-coffsetL < e.maxMatchOff && cv == load3232(src, coffsetL) { // Found a long match, at least 4 bytes. - matchedNext := e.matchlen(s+4, coffsetL+4, src) + 4 + matchedNext := e.matchlen(s2+4, coffsetL+4, src) + 4 if matchedNext > matched { t = coffsetL + s = s2 matched = matchedNext if debugMatches { println("long match at end-of-match") @@ -434,12 +442,13 @@ encodeLoop: // Check prev long... if true { - coffsetL = candidateL.prev - e.cur - matched - if coffsetL >= 0 && coffsetL < s && s-coffsetL < e.maxMatchOff && cv == load3232(src, coffsetL) { + coffsetL = candidateL.prev - e.cur - matched + skipBeginning + if coffsetL >= 0 && coffsetL < s2 && s2-coffsetL < e.maxMatchOff && cv == load3232(src, coffsetL) { // Found a long match, at least 4 bytes. - matchedNext := e.matchlen(s+4, coffsetL+4, src) + 4 + matchedNext := e.matchlen(s2+4, coffsetL+4, src) + 4 if matchedNext > matched { t = coffsetL + s = s2 matched = matchedNext if debugMatches { println("prev long match at end-of-match") diff --git a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/enc_dfast.go b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/enc_dfast.go index 7ff0c64fa..1f4a9a245 100644 --- a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/enc_dfast.go +++ b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/enc_dfast.go @@ -1103,7 +1103,8 @@ func (e *doubleFastEncoderDict) Reset(d *dict, singleBlock bool) { } if allDirty || dirtyShardCnt > dLongTableShardCnt/2 { - copy(e.longTable[:], e.dictLongTable) + //copy(e.longTable[:], e.dictLongTable) + e.longTable = *(*[dFastLongTableSize]tableEntry)(e.dictLongTable) for i := range e.longTableShardDirty { e.longTableShardDirty[i] = false } @@ -1114,7 +1115,9 @@ func (e *doubleFastEncoderDict) Reset(d *dict, singleBlock bool) { continue } - copy(e.longTable[i*dLongTableShardSize:(i+1)*dLongTableShardSize], e.dictLongTable[i*dLongTableShardSize:(i+1)*dLongTableShardSize]) + // copy(e.longTable[i*dLongTableShardSize:(i+1)*dLongTableShardSize], e.dictLongTable[i*dLongTableShardSize:(i+1)*dLongTableShardSize]) + *(*[dLongTableShardSize]tableEntry)(e.longTable[i*dLongTableShardSize:]) = *(*[dLongTableShardSize]tableEntry)(e.dictLongTable[i*dLongTableShardSize:]) + e.longTableShardDirty[i] = false } } diff --git a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/enc_fast.go b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/enc_fast.go index f51ab529a..202636db0 100644 --- a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/enc_fast.go +++ b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/enc_fast.go @@ -304,7 +304,7 @@ func (e *fastEncoder) EncodeNoHist(blk *blockEnc, src []byte) { minNonLiteralBlockSize = 1 + 1 + inputMargin ) if debugEncoder { - if len(src) > maxBlockSize { + if len(src) > maxCompressedBlockSize { panic("src too big") } } @@ -871,7 +871,8 @@ func (e *fastEncoderDict) Reset(d *dict, singleBlock bool) { const shardCnt = tableShardCnt const shardSize = tableShardSize if e.allDirty || dirtyShardCnt > shardCnt*4/6 { - copy(e.table[:], e.dictTable) + //copy(e.table[:], e.dictTable) + e.table = *(*[tableSize]tableEntry)(e.dictTable) for i := range e.tableShardDirty { e.tableShardDirty[i] = false } @@ -883,7 +884,8 @@ func (e *fastEncoderDict) Reset(d *dict, singleBlock bool) { continue } - copy(e.table[i*shardSize:(i+1)*shardSize], e.dictTable[i*shardSize:(i+1)*shardSize]) + //copy(e.table[i*shardSize:(i+1)*shardSize], e.dictTable[i*shardSize:(i+1)*shardSize]) + *(*[shardSize]tableEntry)(e.table[i*shardSize:]) = *(*[shardSize]tableEntry)(e.dictTable[i*shardSize:]) e.tableShardDirty[i] = false } e.allDirty = false diff --git a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/framedec.go b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/framedec.go index 9568a4ba3..2c0affcd8 100644 --- a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/framedec.go +++ b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/framedec.go @@ -261,11 +261,16 @@ func (d *frameDec) reset(br byteBuffer) error { } d.history.windowSize = int(d.WindowSize) if !d.o.lowMem || d.history.windowSize < maxBlockSize { - // Alloc 2x window size if not low-mem, or very small window size. + // Alloc 2x window size if not low-mem, or window size below 2MB. d.history.allocFrameBuffer = d.history.windowSize * 2 } else { - // Alloc with one additional block - d.history.allocFrameBuffer = d.history.windowSize + maxBlockSize + if d.o.lowMem { + // Alloc with 1MB extra. + d.history.allocFrameBuffer = d.history.windowSize + maxBlockSize/2 + } else { + // Alloc with 2MB extra. + d.history.allocFrameBuffer = d.history.windowSize + maxBlockSize + } } if debugDecoder { @@ -343,7 +348,7 @@ func (d *frameDec) consumeCRC() error { return nil } -// runDecoder will create a sync decoder that will decode a block of data. +// runDecoder will run the decoder for the remainder of the frame. func (d *frameDec) runDecoder(dst []byte, dec *blockDec) ([]byte, error) { saved := d.history.b @@ -353,12 +358,23 @@ func (d *frameDec) runDecoder(dst []byte, dec *blockDec) ([]byte, error) { // Store input length, so we only check new data. crcStart := len(dst) d.history.decoders.maxSyncLen = 0 + if d.o.limitToCap { + d.history.decoders.maxSyncLen = uint64(cap(dst) - len(dst)) + } if d.FrameContentSize != fcsUnknown { - d.history.decoders.maxSyncLen = d.FrameContentSize + uint64(len(dst)) + if !d.o.limitToCap || d.FrameContentSize+uint64(len(dst)) < d.history.decoders.maxSyncLen { + d.history.decoders.maxSyncLen = d.FrameContentSize + uint64(len(dst)) + } if d.history.decoders.maxSyncLen > d.o.maxDecodedSize { + if debugDecoder { + println("maxSyncLen:", d.history.decoders.maxSyncLen, "> maxDecodedSize:", d.o.maxDecodedSize) + } return dst, ErrDecoderSizeExceeded } - if uint64(cap(dst)) < d.history.decoders.maxSyncLen { + if debugDecoder { + println("maxSyncLen:", d.history.decoders.maxSyncLen) + } + if !d.o.limitToCap && uint64(cap(dst)) < d.history.decoders.maxSyncLen { // Alloc for output dst2 := make([]byte, len(dst), d.history.decoders.maxSyncLen+compressedBlockOverAlloc) copy(dst2, dst) @@ -378,7 +394,13 @@ func (d *frameDec) runDecoder(dst []byte, dec *blockDec) ([]byte, error) { if err != nil { break } - if uint64(len(d.history.b)) > d.o.maxDecodedSize { + if uint64(len(d.history.b)-crcStart) > d.o.maxDecodedSize { + println("runDecoder: maxDecodedSize exceeded", uint64(len(d.history.b)-crcStart), ">", d.o.maxDecodedSize) + err = ErrDecoderSizeExceeded + break + } + if d.o.limitToCap && len(d.history.b) > cap(dst) { + println("runDecoder: cap exceeded", uint64(len(d.history.b)), ">", cap(dst)) err = ErrDecoderSizeExceeded break } diff --git a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/fse_decoder_amd64.go b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/fse_decoder_amd64.go index c881d28d8..d04a829b0 100644 --- a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/fse_decoder_amd64.go +++ b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/fse_decoder_amd64.go @@ -21,7 +21,8 @@ type buildDtableAsmContext struct { // buildDtable_asm is an x86 assembly implementation of fseDecoder.buildDtable. // Function returns non-zero exit code on error. -// go:noescape +// +//go:noescape func buildDtable_asm(s *fseDecoder, ctx *buildDtableAsmContext) int // please keep in sync with _generate/gen_fse.go diff --git a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/fse_decoder_amd64.s b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/fse_decoder_amd64.s index da32b4420..bcde39869 100644 --- a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/fse_decoder_amd64.s +++ b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/fse_decoder_amd64.s @@ -1,7 +1,6 @@ // Code generated by command: go run gen_fse.go -out ../fse_decoder_amd64.s -pkg=zstd. DO NOT EDIT. //go:build !appengine && !noasm && gc && !noasm -// +build !appengine,!noasm,gc,!noasm // func buildDtable_asm(s *fseDecoder, ctx *buildDtableAsmContext) int TEXT ·buildDtable_asm(SB), $0-24 diff --git a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/history.go b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/history.go index 28b40153c..09164856d 100644 --- a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/history.go +++ b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/history.go @@ -37,26 +37,23 @@ func (h *history) reset() { h.ignoreBuffer = 0 h.error = false h.recentOffsets = [3]int{1, 4, 8} - if f := h.decoders.litLengths.fse; f != nil && !f.preDefined { - fseDecoderPool.Put(f) - } - if f := h.decoders.offsets.fse; f != nil && !f.preDefined { - fseDecoderPool.Put(f) - } - if f := h.decoders.matchLengths.fse; f != nil && !f.preDefined { - fseDecoderPool.Put(f) - } + h.decoders.freeDecoders() h.decoders = sequenceDecs{br: h.decoders.br} - if h.huffTree != nil { - if h.dict == nil || h.dict.litEnc != h.huffTree { - huffDecoderPool.Put(h.huffTree) - } - } + h.freeHuffDecoder() h.huffTree = nil h.dict = nil //printf("history created: %+v (l: %d, c: %d)", *h, len(h.b), cap(h.b)) } +func (h *history) freeHuffDecoder() { + if h.huffTree != nil { + if h.dict == nil || h.dict.litEnc != h.huffTree { + huffDecoderPool.Put(h.huffTree) + h.huffTree = nil + } + } +} + func (h *history) setDict(dict *dict) { if dict == nil { return diff --git a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/seqdec.go b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/seqdec.go index df0447203..f833d1541 100644 --- a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/seqdec.go +++ b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/seqdec.go @@ -99,6 +99,21 @@ func (s *sequenceDecs) initialize(br *bitReader, hist *history, out []byte) erro return nil } +func (s *sequenceDecs) freeDecoders() { + if f := s.litLengths.fse; f != nil && !f.preDefined { + fseDecoderPool.Put(f) + s.litLengths.fse = nil + } + if f := s.offsets.fse; f != nil && !f.preDefined { + fseDecoderPool.Put(f) + s.offsets.fse = nil + } + if f := s.matchLengths.fse; f != nil && !f.preDefined { + fseDecoderPool.Put(f) + s.matchLengths.fse = nil + } +} + // execute will execute the decoded sequence with the provided history. // The sequence must be evaluated before being sent. func (s *sequenceDecs) execute(seqs []seqVals, hist []byte) error { @@ -299,7 +314,10 @@ func (s *sequenceDecs) decodeSync(hist []byte) error { } size := ll + ml + len(out) if size-startSize > maxBlockSize { - return fmt.Errorf("output (%d) bigger than max block size (%d)", size-startSize, maxBlockSize) + if size-startSize == 424242 { + panic("here") + } + return fmt.Errorf("output bigger than max block size (%d)", maxBlockSize) } if size > cap(out) { // Not enough size, which can happen under high volume block streaming conditions @@ -411,7 +429,7 @@ func (s *sequenceDecs) decodeSync(hist []byte) error { // Check if space for literals if size := len(s.literals) + len(s.out) - startSize; size > maxBlockSize { - return fmt.Errorf("output (%d) bigger than max block size (%d)", size, maxBlockSize) + return fmt.Errorf("output bigger than max block size (%d)", maxBlockSize) } // Add final literals diff --git a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/seqdec_amd64.go b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/seqdec_amd64.go index 7598c1018..191384adf 100644 --- a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/seqdec_amd64.go +++ b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/seqdec_amd64.go @@ -32,18 +32,22 @@ type decodeSyncAsmContext struct { // sequenceDecs_decodeSync_amd64 implements the main loop of sequenceDecs.decodeSync in x86 asm. // // Please refer to seqdec_generic.go for the reference implementation. +// //go:noescape func sequenceDecs_decodeSync_amd64(s *sequenceDecs, br *bitReader, ctx *decodeSyncAsmContext) int // sequenceDecs_decodeSync_bmi2 implements the main loop of sequenceDecs.decodeSync in x86 asm with BMI2 extensions. +// //go:noescape func sequenceDecs_decodeSync_bmi2(s *sequenceDecs, br *bitReader, ctx *decodeSyncAsmContext) int // sequenceDecs_decodeSync_safe_amd64 does the same as above, but does not write more than output buffer. +// //go:noescape func sequenceDecs_decodeSync_safe_amd64(s *sequenceDecs, br *bitReader, ctx *decodeSyncAsmContext) int // sequenceDecs_decodeSync_safe_bmi2 does the same as above, but does not write more than output buffer. +// //go:noescape func sequenceDecs_decodeSync_safe_bmi2(s *sequenceDecs, br *bitReader, ctx *decodeSyncAsmContext) int @@ -135,7 +139,7 @@ func (s *sequenceDecs) decodeSyncSimple(hist []byte) (bool, error) { if debugDecoder { println("msl:", s.maxSyncLen, "cap", cap(s.out), "bef:", startSize, "sz:", size-startSize, "mbs:", maxBlockSize, "outsz:", cap(s.out)-startSize) } - return true, fmt.Errorf("output (%d) bigger than max block size (%d)", size-startSize, maxBlockSize) + return true, fmt.Errorf("output bigger than max block size (%d)", maxBlockSize) default: return true, fmt.Errorf("sequenceDecs_decode returned erronous code %d", errCode) @@ -143,7 +147,8 @@ func (s *sequenceDecs) decodeSyncSimple(hist []byte) (bool, error) { s.seqSize += ctx.litRemain if s.seqSize > maxBlockSize { - return true, fmt.Errorf("output (%d) bigger than max block size (%d)", s.seqSize, maxBlockSize) + return true, fmt.Errorf("output bigger than max block size (%d)", maxBlockSize) + } err := br.close() if err != nil { @@ -201,20 +206,24 @@ const errorNotEnoughSpace = 5 // sequenceDecs_decode implements the main loop of sequenceDecs in x86 asm. // // Please refer to seqdec_generic.go for the reference implementation. +// //go:noescape func sequenceDecs_decode_amd64(s *sequenceDecs, br *bitReader, ctx *decodeAsmContext) int // sequenceDecs_decode implements the main loop of sequenceDecs in x86 asm. // // Please refer to seqdec_generic.go for the reference implementation. +// //go:noescape func sequenceDecs_decode_56_amd64(s *sequenceDecs, br *bitReader, ctx *decodeAsmContext) int // sequenceDecs_decode implements the main loop of sequenceDecs in x86 asm with BMI2 extensions. +// //go:noescape func sequenceDecs_decode_bmi2(s *sequenceDecs, br *bitReader, ctx *decodeAsmContext) int // sequenceDecs_decode implements the main loop of sequenceDecs in x86 asm with BMI2 extensions. +// //go:noescape func sequenceDecs_decode_56_bmi2(s *sequenceDecs, br *bitReader, ctx *decodeAsmContext) int @@ -281,7 +290,7 @@ func (s *sequenceDecs) decode(seqs []seqVals) error { s.seqSize += ctx.litRemain if s.seqSize > maxBlockSize { - return fmt.Errorf("output (%d) bigger than max block size (%d)", s.seqSize, maxBlockSize) + return fmt.Errorf("output bigger than max block size (%d)", maxBlockSize) } err := br.close() if err != nil { @@ -308,10 +317,12 @@ type executeAsmContext struct { // Returns false if a match offset is too big. // // Please refer to seqdec_generic.go for the reference implementation. +// //go:noescape func sequenceDecs_executeSimple_amd64(ctx *executeAsmContext) bool // Same as above, but with safe memcopies +// //go:noescape func sequenceDecs_executeSimple_safe_amd64(ctx *executeAsmContext) bool diff --git a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/seqdec_amd64.s b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/seqdec_amd64.s index 27e76774c..52e5703c2 100644 --- a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/seqdec_amd64.s +++ b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/seqdec_amd64.s @@ -1,7 +1,6 @@ // Code generated by command: go run gen.go -out ../seqdec_amd64.s -pkg=zstd. DO NOT EDIT. //go:build !appengine && !noasm && gc && !noasm -// +build !appengine,!noasm,gc,!noasm // func sequenceDecs_decode_amd64(s *sequenceDecs, br *bitReader, ctx *decodeAsmContext) int // Requires: CMOV diff --git a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/seqdec_generic.go b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/seqdec_generic.go index c3452bc3a..ac2a80d29 100644 --- a/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/seqdec_generic.go +++ b/src/cmd/linuxkit/vendor/github.com/klauspost/compress/zstd/seqdec_generic.go @@ -111,7 +111,7 @@ func (s *sequenceDecs) decode(seqs []seqVals) error { } s.seqSize += ll + ml if s.seqSize > maxBlockSize { - return fmt.Errorf("output (%d) bigger than max block size (%d)", s.seqSize, maxBlockSize) + return fmt.Errorf("output bigger than max block size (%d)", maxBlockSize) } litRemain -= ll if litRemain < 0 { @@ -149,7 +149,7 @@ func (s *sequenceDecs) decode(seqs []seqVals) error { } s.seqSize += litRemain if s.seqSize > maxBlockSize { - return fmt.Errorf("output (%d) bigger than max block size (%d)", s.seqSize, maxBlockSize) + return fmt.Errorf("output bigger than max block size (%d)", maxBlockSize) } err := br.close() if err != nil { diff --git a/src/cmd/linuxkit/vendor/github.com/mitchellh/go-ps/Vagrantfile b/src/cmd/linuxkit/vendor/github.com/mitchellh/go-ps/Vagrantfile index 61662ab1e..9c93a8e80 100644 --- a/src/cmd/linuxkit/vendor/github.com/mitchellh/go-ps/Vagrantfile +++ b/src/cmd/linuxkit/vendor/github.com/mitchellh/go-ps/Vagrantfile @@ -1,43 +1,43 @@ -# -*- mode: ruby -*- -# vi: set ft=ruby : - -# Vagrantfile API/syntax version. Don't touch unless you know what you're doing! -VAGRANTFILE_API_VERSION = "2" - -Vagrant.configure(VAGRANTFILE_API_VERSION) do |config| - config.vm.box = "chef/ubuntu-12.04" - - config.vm.provision "shell", inline: $script - - ["vmware_fusion", "vmware_workstation"].each do |p| - config.vm.provider "p" do |v| - v.vmx["memsize"] = "1024" - v.vmx["numvcpus"] = "2" - v.vmx["cpuid.coresPerSocket"] = "1" - end - end -end - -$script = <