Bump github.com/containers/buildah from 1.11.4 to 1.11.5

Bumps [github.com/containers/buildah](https://github.com/containers/buildah) from 1.11.4 to 1.11.5.
- [Release notes](https://github.com/containers/buildah/releases)
- [Changelog](https://github.com/containers/buildah/blob/master/CHANGELOG.md)
- [Commits](https://github.com/containers/buildah/compare/v1.11.4...v1.11.5)

Signed-off-by: dependabot-preview[bot] <support@dependabot.com>
Signed-off-by: Daniel J Walsh <dwalsh@redhat.com>
Signed-off-by: Valentin Rothberg <rothberg@redhat.com>
This commit is contained in:
dependabot-preview[bot]
2019-11-13 09:20:48 +00:00
committed by Valentin Rothberg
parent 23d9383a36
commit 5f3219a854
305 changed files with 24930 additions and 9503 deletions

View File

@@ -0,0 +1,565 @@
package vmcompute
import (
gcontext "context"
"syscall"
"time"
"github.com/Microsoft/hcsshim/internal/interop"
"github.com/Microsoft/hcsshim/internal/log"
"github.com/Microsoft/hcsshim/internal/logfields"
"github.com/Microsoft/hcsshim/internal/oc"
"github.com/Microsoft/hcsshim/internal/timeout"
"go.opencensus.io/trace"
)
//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go vmcompute.go
//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems?
//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem?
//sys hcsOpenComputeSystem(id string, computeSystem *HcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem?
//sys hcsCloseComputeSystem(computeSystem HcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem?
//sys hcsStartComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem?
//sys hcsShutdownComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem?
//sys hcsTerminateComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem?
//sys hcsPauseComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem?
//sys hcsResumeComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem?
//sys hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties?
//sys hcsModifyComputeSystem(computeSystem HcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem?
//sys hcsRegisterComputeSystemCallback(computeSystem HcsSystem, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback?
//sys hcsUnregisterComputeSystemCallback(callbackHandle HcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback?
//sys hcsCreateProcess(computeSystem HcsSystem, processParameters string, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess?
//sys hcsOpenProcess(computeSystem HcsSystem, pid uint32, process *HcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess?
//sys hcsCloseProcess(process HcsProcess) (hr error) = vmcompute.HcsCloseProcess?
//sys hcsTerminateProcess(process HcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess?
//sys hcsSignalProcess(process HcsProcess, options string, result **uint16) (hr error) = vmcompute.HcsSignalProcess?
//sys hcsGetProcessInfo(process HcsProcess, processInformation *HcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo?
//sys hcsGetProcessProperties(process HcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties?
//sys hcsModifyProcess(process HcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess?
//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties?
//sys hcsRegisterProcessCallback(process HcsProcess, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback?
//sys hcsUnregisterProcessCallback(callbackHandle HcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback?
// errVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously
const errVmcomputeOperationPending = syscall.Errno(0xC0370103)
// HcsSystem is the handle associated with a created compute system.
type HcsSystem syscall.Handle
// HcsProcess is the handle associated with a created process in a compute
// system.
type HcsProcess syscall.Handle
// HcsCallback is the handle associated with the function to call when events
// occur.
type HcsCallback syscall.Handle
// HcsProcessInformation is the structure used when creating or getting process
// info.
type HcsProcessInformation struct {
// ProcessId is the pid of the created process.
ProcessId uint32
reserved uint32
// StdInput is the handle associated with the stdin of the process.
StdInput syscall.Handle
// StdOutput is the handle associated with the stdout of the process.
StdOutput syscall.Handle
// StdError is the handle associated with the stderr of the process.
StdError syscall.Handle
}
func execute(ctx gcontext.Context, timeout time.Duration, f func() error) error {
if timeout > 0 {
var cancel gcontext.CancelFunc
ctx, cancel = gcontext.WithTimeout(ctx, timeout)
defer cancel()
}
done := make(chan error, 1)
go func() {
done <- f()
}()
select {
case <-ctx.Done():
if ctx.Err() == gcontext.DeadlineExceeded {
log.G(ctx).WithField(logfields.Timeout, timeout).
Warning("Syscall did not complete within operation timeout. This may indicate a platform issue. If it appears to be making no forward progress, obtain the stacks and see if there is a syscall stuck in the platform API for a significant length of time.")
}
return ctx.Err()
case err := <-done:
return err
}
}
func HcsEnumerateComputeSystems(ctx gcontext.Context, query string) (computeSystems, result string, hr error) {
ctx, span := trace.StartSpan(ctx, "HcsEnumerateComputeSystems")
defer span.End()
defer func() {
if result != "" {
span.AddAttributes(trace.StringAttribute("result", result))
}
oc.SetSpanStatus(span, hr)
}()
span.AddAttributes(trace.StringAttribute("query", query))
return computeSystems, result, execute(ctx, timeout.SyscallWatcher, func() error {
var (
computeSystemsp *uint16
resultp *uint16
)
err := hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp)
if computeSystemsp != nil {
computeSystems = interop.ConvertAndFreeCoTaskMemString(computeSystemsp)
}
if resultp != nil {
result = interop.ConvertAndFreeCoTaskMemString(resultp)
}
return err
})
}
func HcsCreateComputeSystem(ctx gcontext.Context, id string, configuration string, identity syscall.Handle) (computeSystem HcsSystem, result string, hr error) {
ctx, span := trace.StartSpan(ctx, "HcsCreateComputeSystem")
defer span.End()
defer func() {
if result != "" {
span.AddAttributes(trace.StringAttribute("result", result))
}
if hr != errVmcomputeOperationPending {
oc.SetSpanStatus(span, hr)
}
}()
span.AddAttributes(
trace.StringAttribute("id", id),
trace.StringAttribute("configuration", configuration))
return computeSystem, result, execute(ctx, timeout.SystemCreate, func() error {
var resultp *uint16
err := hcsCreateComputeSystem(id, configuration, identity, &computeSystem, &resultp)
if resultp != nil {
result = interop.ConvertAndFreeCoTaskMemString(resultp)
}
return err
})
}
func HcsOpenComputeSystem(ctx gcontext.Context, id string) (computeSystem HcsSystem, result string, hr error) {
ctx, span := trace.StartSpan(ctx, "HcsOpenComputeSystem")
defer span.End()
defer func() {
if result != "" {
span.AddAttributes(trace.StringAttribute("result", result))
}
oc.SetSpanStatus(span, hr)
}()
return computeSystem, result, execute(ctx, timeout.SyscallWatcher, func() error {
var resultp *uint16
err := hcsOpenComputeSystem(id, &computeSystem, &resultp)
if resultp != nil {
result = interop.ConvertAndFreeCoTaskMemString(resultp)
}
return err
})
}
func HcsCloseComputeSystem(ctx gcontext.Context, computeSystem HcsSystem) (hr error) {
ctx, span := trace.StartSpan(ctx, "HcsCloseComputeSystem")
defer span.End()
defer func() { oc.SetSpanStatus(span, hr) }()
return execute(ctx, timeout.SyscallWatcher, func() error {
return hcsCloseComputeSystem(computeSystem)
})
}
func HcsStartComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) {
ctx, span := trace.StartSpan(ctx, "HcsStartComputeSystem")
defer span.End()
defer func() {
if result != "" {
span.AddAttributes(trace.StringAttribute("result", result))
}
if hr != errVmcomputeOperationPending {
oc.SetSpanStatus(span, hr)
}
}()
span.AddAttributes(trace.StringAttribute("options", options))
return result, execute(ctx, timeout.SystemStart, func() error {
var resultp *uint16
err := hcsStartComputeSystem(computeSystem, options, &resultp)
if resultp != nil {
result = interop.ConvertAndFreeCoTaskMemString(resultp)
}
return err
})
}
func HcsShutdownComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) {
ctx, span := trace.StartSpan(ctx, "HcsShutdownComputeSystem")
defer span.End()
defer func() {
if result != "" {
span.AddAttributes(trace.StringAttribute("result", result))
}
if hr != errVmcomputeOperationPending {
oc.SetSpanStatus(span, hr)
}
}()
span.AddAttributes(trace.StringAttribute("options", options))
return result, execute(ctx, timeout.SyscallWatcher, func() error {
var resultp *uint16
err := hcsShutdownComputeSystem(computeSystem, options, &resultp)
if resultp != nil {
result = interop.ConvertAndFreeCoTaskMemString(resultp)
}
return err
})
}
func HcsTerminateComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) {
ctx, span := trace.StartSpan(ctx, "HcsTerminateComputeSystem")
defer span.End()
defer func() {
if result != "" {
span.AddAttributes(trace.StringAttribute("result", result))
}
if hr != errVmcomputeOperationPending {
oc.SetSpanStatus(span, hr)
}
}()
span.AddAttributes(trace.StringAttribute("options", options))
return result, execute(ctx, timeout.SyscallWatcher, func() error {
var resultp *uint16
err := hcsTerminateComputeSystem(computeSystem, options, &resultp)
if resultp != nil {
result = interop.ConvertAndFreeCoTaskMemString(resultp)
}
return err
})
}
func HcsPauseComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) {
ctx, span := trace.StartSpan(ctx, "HcsPauseComputeSystem")
defer span.End()
defer func() {
if result != "" {
span.AddAttributes(trace.StringAttribute("result", result))
}
if hr != errVmcomputeOperationPending {
oc.SetSpanStatus(span, hr)
}
}()
span.AddAttributes(trace.StringAttribute("options", options))
return result, execute(ctx, timeout.SystemPause, func() error {
var resultp *uint16
err := hcsPauseComputeSystem(computeSystem, options, &resultp)
if resultp != nil {
result = interop.ConvertAndFreeCoTaskMemString(resultp)
}
return err
})
}
func HcsResumeComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) {
ctx, span := trace.StartSpan(ctx, "HcsResumeComputeSystem")
defer span.End()
defer func() {
if result != "" {
span.AddAttributes(trace.StringAttribute("result", result))
}
if hr != errVmcomputeOperationPending {
oc.SetSpanStatus(span, hr)
}
}()
span.AddAttributes(trace.StringAttribute("options", options))
return result, execute(ctx, timeout.SystemResume, func() error {
var resultp *uint16
err := hcsResumeComputeSystem(computeSystem, options, &resultp)
if resultp != nil {
result = interop.ConvertAndFreeCoTaskMemString(resultp)
}
return err
})
}
func HcsGetComputeSystemProperties(ctx gcontext.Context, computeSystem HcsSystem, propertyQuery string) (properties, result string, hr error) {
ctx, span := trace.StartSpan(ctx, "HcsGetComputeSystemProperties")
defer span.End()
defer func() {
if result != "" {
span.AddAttributes(trace.StringAttribute("result", result))
}
oc.SetSpanStatus(span, hr)
}()
span.AddAttributes(trace.StringAttribute("propertyQuery", propertyQuery))
return properties, result, execute(ctx, timeout.SyscallWatcher, func() error {
var (
propertiesp *uint16
resultp *uint16
)
err := hcsGetComputeSystemProperties(computeSystem, propertyQuery, &propertiesp, &resultp)
if propertiesp != nil {
properties = interop.ConvertAndFreeCoTaskMemString(propertiesp)
}
if resultp != nil {
result = interop.ConvertAndFreeCoTaskMemString(resultp)
}
return err
})
}
func HcsModifyComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, configuration string) (result string, hr error) {
ctx, span := trace.StartSpan(ctx, "HcsModifyComputeSystem")
defer span.End()
defer func() {
if result != "" {
span.AddAttributes(trace.StringAttribute("result", result))
}
oc.SetSpanStatus(span, hr)
}()
span.AddAttributes(trace.StringAttribute("configuration", configuration))
return result, execute(ctx, timeout.SyscallWatcher, func() error {
var resultp *uint16
err := hcsModifyComputeSystem(computeSystem, configuration, &resultp)
if resultp != nil {
result = interop.ConvertAndFreeCoTaskMemString(resultp)
}
return err
})
}
func HcsRegisterComputeSystemCallback(ctx gcontext.Context, computeSystem HcsSystem, callback uintptr, context uintptr) (callbackHandle HcsCallback, hr error) {
ctx, span := trace.StartSpan(ctx, "HcsRegisterComputeSystemCallback")
defer span.End()
defer func() { oc.SetSpanStatus(span, hr) }()
return callbackHandle, execute(ctx, timeout.SyscallWatcher, func() error {
return hcsRegisterComputeSystemCallback(computeSystem, callback, context, &callbackHandle)
})
}
func HcsUnregisterComputeSystemCallback(ctx gcontext.Context, callbackHandle HcsCallback) (hr error) {
ctx, span := trace.StartSpan(ctx, "HcsUnregisterComputeSystemCallback")
defer span.End()
defer func() { oc.SetSpanStatus(span, hr) }()
return execute(ctx, timeout.SyscallWatcher, func() error {
return hcsUnregisterComputeSystemCallback(callbackHandle)
})
}
func HcsCreateProcess(ctx gcontext.Context, computeSystem HcsSystem, processParameters string) (processInformation HcsProcessInformation, process HcsProcess, result string, hr error) {
ctx, span := trace.StartSpan(ctx, "HcsCreateProcess")
defer span.End()
defer func() {
if result != "" {
span.AddAttributes(trace.StringAttribute("result", result))
}
oc.SetSpanStatus(span, hr)
}()
span.AddAttributes(trace.StringAttribute("processParameters", processParameters))
return processInformation, process, result, execute(ctx, timeout.SyscallWatcher, func() error {
var resultp *uint16
err := hcsCreateProcess(computeSystem, processParameters, &processInformation, &process, &resultp)
if resultp != nil {
result = interop.ConvertAndFreeCoTaskMemString(resultp)
}
return err
})
}
func HcsOpenProcess(ctx gcontext.Context, computeSystem HcsSystem, pid uint32) (process HcsProcess, result string, hr error) {
ctx, span := trace.StartSpan(ctx, "HcsOpenProcess")
defer span.End()
defer func() {
if result != "" {
span.AddAttributes(trace.StringAttribute("result", result))
}
oc.SetSpanStatus(span, hr)
}()
span.AddAttributes(trace.Int64Attribute("pid", int64(pid)))
return process, result, execute(ctx, timeout.SyscallWatcher, func() error {
var resultp *uint16
err := hcsOpenProcess(computeSystem, pid, &process, &resultp)
if resultp != nil {
result = interop.ConvertAndFreeCoTaskMemString(resultp)
}
return err
})
}
func HcsCloseProcess(ctx gcontext.Context, process HcsProcess) (hr error) {
ctx, span := trace.StartSpan(ctx, "HcsCloseProcess")
defer span.End()
defer func() { oc.SetSpanStatus(span, hr) }()
return execute(ctx, timeout.SyscallWatcher, func() error {
return hcsCloseProcess(process)
})
}
func HcsTerminateProcess(ctx gcontext.Context, process HcsProcess) (result string, hr error) {
ctx, span := trace.StartSpan(ctx, "HcsTerminateProcess")
defer span.End()
defer func() {
if result != "" {
span.AddAttributes(trace.StringAttribute("result", result))
}
oc.SetSpanStatus(span, hr)
}()
return result, execute(ctx, timeout.SyscallWatcher, func() error {
var resultp *uint16
err := hcsTerminateProcess(process, &resultp)
if resultp != nil {
result = interop.ConvertAndFreeCoTaskMemString(resultp)
}
return err
})
}
func HcsSignalProcess(ctx gcontext.Context, process HcsProcess, options string) (result string, hr error) {
ctx, span := trace.StartSpan(ctx, "HcsSignalProcess")
defer span.End()
defer func() {
if result != "" {
span.AddAttributes(trace.StringAttribute("result", result))
}
oc.SetSpanStatus(span, hr)
}()
span.AddAttributes(trace.StringAttribute("options", options))
return result, execute(ctx, timeout.SyscallWatcher, func() error {
var resultp *uint16
err := hcsSignalProcess(process, options, &resultp)
if resultp != nil {
result = interop.ConvertAndFreeCoTaskMemString(resultp)
}
return err
})
}
func HcsGetProcessInfo(ctx gcontext.Context, process HcsProcess) (processInformation HcsProcessInformation, result string, hr error) {
ctx, span := trace.StartSpan(ctx, "HcsGetProcessInfo")
defer span.End()
defer func() {
if result != "" {
span.AddAttributes(trace.StringAttribute("result", result))
}
oc.SetSpanStatus(span, hr)
}()
return processInformation, result, execute(ctx, timeout.SyscallWatcher, func() error {
var resultp *uint16
err := hcsGetProcessInfo(process, &processInformation, &resultp)
if resultp != nil {
result = interop.ConvertAndFreeCoTaskMemString(resultp)
}
return err
})
}
func HcsGetProcessProperties(ctx gcontext.Context, process HcsProcess) (processProperties, result string, hr error) {
ctx, span := trace.StartSpan(ctx, "HcsGetProcessProperties")
defer span.End()
defer func() {
if result != "" {
span.AddAttributes(trace.StringAttribute("result", result))
}
oc.SetSpanStatus(span, hr)
}()
return processProperties, result, execute(ctx, timeout.SyscallWatcher, func() error {
var (
processPropertiesp *uint16
resultp *uint16
)
err := hcsGetProcessProperties(process, &processPropertiesp, &resultp)
if processPropertiesp != nil {
processProperties = interop.ConvertAndFreeCoTaskMemString(processPropertiesp)
}
if resultp != nil {
result = interop.ConvertAndFreeCoTaskMemString(resultp)
}
return err
})
}
func HcsModifyProcess(ctx gcontext.Context, process HcsProcess, settings string) (result string, hr error) {
ctx, span := trace.StartSpan(ctx, "HcsModifyProcess")
defer span.End()
defer func() {
if result != "" {
span.AddAttributes(trace.StringAttribute("result", result))
}
oc.SetSpanStatus(span, hr)
}()
span.AddAttributes(trace.StringAttribute("settings", settings))
return result, execute(ctx, timeout.SyscallWatcher, func() error {
var resultp *uint16
err := hcsModifyProcess(process, settings, &resultp)
if resultp != nil {
result = interop.ConvertAndFreeCoTaskMemString(resultp)
}
return err
})
}
func HcsGetServiceProperties(ctx gcontext.Context, propertyQuery string) (properties, result string, hr error) {
ctx, span := trace.StartSpan(ctx, "HcsGetServiceProperties")
defer span.End()
defer func() {
if result != "" {
span.AddAttributes(trace.StringAttribute("result", result))
}
oc.SetSpanStatus(span, hr)
}()
span.AddAttributes(trace.StringAttribute("propertyQuery", propertyQuery))
return properties, result, execute(ctx, timeout.SyscallWatcher, func() error {
var (
propertiesp *uint16
resultp *uint16
)
err := hcsGetServiceProperties(propertyQuery, &propertiesp, &resultp)
if propertiesp != nil {
properties = interop.ConvertAndFreeCoTaskMemString(propertiesp)
}
if resultp != nil {
result = interop.ConvertAndFreeCoTaskMemString(resultp)
}
return err
})
}
func HcsRegisterProcessCallback(ctx gcontext.Context, process HcsProcess, callback uintptr, context uintptr) (callbackHandle HcsCallback, hr error) {
ctx, span := trace.StartSpan(ctx, "HcsRegisterProcessCallback")
defer span.End()
defer func() { oc.SetSpanStatus(span, hr) }()
return callbackHandle, execute(ctx, timeout.SyscallWatcher, func() error {
return hcsRegisterProcessCallback(process, callback, context, &callbackHandle)
})
}
func HcsUnregisterProcessCallback(ctx gcontext.Context, callbackHandle HcsCallback) (hr error) {
ctx, span := trace.StartSpan(ctx, "HcsUnregisterProcessCallback")
defer span.End()
defer func() { oc.SetSpanStatus(span, hr) }()
return execute(ctx, timeout.SyscallWatcher, func() error {
return hcsUnregisterProcessCallback(callbackHandle)
})
}

View File

@@ -0,0 +1,533 @@
// Code generated mksyscall_windows.exe DO NOT EDIT
package vmcompute
import (
"syscall"
"unsafe"
"golang.org/x/sys/windows"
)
var _ unsafe.Pointer
// Do the interface allocations only once for common
// Errno values.
const (
errnoERROR_IO_PENDING = 997
)
var (
errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
)
// errnoErr returns common boxed Errno values, to prevent
// allocations at runtime.
func errnoErr(e syscall.Errno) error {
switch e {
case 0:
return nil
case errnoERROR_IO_PENDING:
return errERROR_IO_PENDING
}
// TODO: add more here, after collecting data on the common
// error values see on Windows. (perhaps when running
// all.bat?)
return e
}
var (
modvmcompute = windows.NewLazySystemDLL("vmcompute.dll")
procHcsEnumerateComputeSystems = modvmcompute.NewProc("HcsEnumerateComputeSystems")
procHcsCreateComputeSystem = modvmcompute.NewProc("HcsCreateComputeSystem")
procHcsOpenComputeSystem = modvmcompute.NewProc("HcsOpenComputeSystem")
procHcsCloseComputeSystem = modvmcompute.NewProc("HcsCloseComputeSystem")
procHcsStartComputeSystem = modvmcompute.NewProc("HcsStartComputeSystem")
procHcsShutdownComputeSystem = modvmcompute.NewProc("HcsShutdownComputeSystem")
procHcsTerminateComputeSystem = modvmcompute.NewProc("HcsTerminateComputeSystem")
procHcsPauseComputeSystem = modvmcompute.NewProc("HcsPauseComputeSystem")
procHcsResumeComputeSystem = modvmcompute.NewProc("HcsResumeComputeSystem")
procHcsGetComputeSystemProperties = modvmcompute.NewProc("HcsGetComputeSystemProperties")
procHcsModifyComputeSystem = modvmcompute.NewProc("HcsModifyComputeSystem")
procHcsRegisterComputeSystemCallback = modvmcompute.NewProc("HcsRegisterComputeSystemCallback")
procHcsUnregisterComputeSystemCallback = modvmcompute.NewProc("HcsUnregisterComputeSystemCallback")
procHcsCreateProcess = modvmcompute.NewProc("HcsCreateProcess")
procHcsOpenProcess = modvmcompute.NewProc("HcsOpenProcess")
procHcsCloseProcess = modvmcompute.NewProc("HcsCloseProcess")
procHcsTerminateProcess = modvmcompute.NewProc("HcsTerminateProcess")
procHcsSignalProcess = modvmcompute.NewProc("HcsSignalProcess")
procHcsGetProcessInfo = modvmcompute.NewProc("HcsGetProcessInfo")
procHcsGetProcessProperties = modvmcompute.NewProc("HcsGetProcessProperties")
procHcsModifyProcess = modvmcompute.NewProc("HcsModifyProcess")
procHcsGetServiceProperties = modvmcompute.NewProc("HcsGetServiceProperties")
procHcsRegisterProcessCallback = modvmcompute.NewProc("HcsRegisterProcessCallback")
procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback")
)
func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(query)
if hr != nil {
return
}
return _hcsEnumerateComputeSystems(_p0, computeSystems, result)
}
func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result **uint16) (hr error) {
if hr = procHcsEnumerateComputeSystems.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsEnumerateComputeSystems.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(computeSystems)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
if r0&0x1fff0000 == 0x00070000 {
r0 &= 0xffff
}
hr = syscall.Errno(r0)
}
return
}
func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
var _p1 *uint16
_p1, hr = syscall.UTF16PtrFromString(configuration)
if hr != nil {
return
}
return _hcsCreateComputeSystem(_p0, _p1, identity, computeSystem, result)
}
func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) {
if hr = procHcsCreateComputeSystem.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procHcsCreateComputeSystem.Addr(), 5, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(configuration)), uintptr(identity), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)), 0)
if int32(r0) < 0 {
if r0&0x1fff0000 == 0x00070000 {
r0 &= 0xffff
}
hr = syscall.Errno(r0)
}
return
}
func hcsOpenComputeSystem(id string, computeSystem *HcsSystem, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
return _hcsOpenComputeSystem(_p0, computeSystem, result)
}
func _hcsOpenComputeSystem(id *uint16, computeSystem *HcsSystem, result **uint16) (hr error) {
if hr = procHcsOpenComputeSystem.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsOpenComputeSystem.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
if r0&0x1fff0000 == 0x00070000 {
r0 &= 0xffff
}
hr = syscall.Errno(r0)
}
return
}
func hcsCloseComputeSystem(computeSystem HcsSystem) (hr error) {
if hr = procHcsCloseComputeSystem.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsCloseComputeSystem.Addr(), 1, uintptr(computeSystem), 0, 0)
if int32(r0) < 0 {
if r0&0x1fff0000 == 0x00070000 {
r0 &= 0xffff
}
hr = syscall.Errno(r0)
}
return
}
func hcsStartComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(options)
if hr != nil {
return
}
return _hcsStartComputeSystem(computeSystem, _p0, result)
}
func _hcsStartComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) {
if hr = procHcsStartComputeSystem.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsStartComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
if r0&0x1fff0000 == 0x00070000 {
r0 &= 0xffff
}
hr = syscall.Errno(r0)
}
return
}
func hcsShutdownComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(options)
if hr != nil {
return
}
return _hcsShutdownComputeSystem(computeSystem, _p0, result)
}
func _hcsShutdownComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) {
if hr = procHcsShutdownComputeSystem.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsShutdownComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
if r0&0x1fff0000 == 0x00070000 {
r0 &= 0xffff
}
hr = syscall.Errno(r0)
}
return
}
func hcsTerminateComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(options)
if hr != nil {
return
}
return _hcsTerminateComputeSystem(computeSystem, _p0, result)
}
func _hcsTerminateComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) {
if hr = procHcsTerminateComputeSystem.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsTerminateComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
if r0&0x1fff0000 == 0x00070000 {
r0 &= 0xffff
}
hr = syscall.Errno(r0)
}
return
}
func hcsPauseComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(options)
if hr != nil {
return
}
return _hcsPauseComputeSystem(computeSystem, _p0, result)
}
func _hcsPauseComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) {
if hr = procHcsPauseComputeSystem.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsPauseComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
if r0&0x1fff0000 == 0x00070000 {
r0 &= 0xffff
}
hr = syscall.Errno(r0)
}
return
}
func hcsResumeComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(options)
if hr != nil {
return
}
return _hcsResumeComputeSystem(computeSystem, _p0, result)
}
func _hcsResumeComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) {
if hr = procHcsResumeComputeSystem.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsResumeComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
if r0&0x1fff0000 == 0x00070000 {
r0 &= 0xffff
}
hr = syscall.Errno(r0)
}
return
}
func hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(propertyQuery)
if hr != nil {
return
}
return _hcsGetComputeSystemProperties(computeSystem, _p0, properties, result)
}
func _hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) {
if hr = procHcsGetComputeSystemProperties.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procHcsGetComputeSystemProperties.Addr(), 4, uintptr(computeSystem), uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0)
if int32(r0) < 0 {
if r0&0x1fff0000 == 0x00070000 {
r0 &= 0xffff
}
hr = syscall.Errno(r0)
}
return
}
func hcsModifyComputeSystem(computeSystem HcsSystem, configuration string, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(configuration)
if hr != nil {
return
}
return _hcsModifyComputeSystem(computeSystem, _p0, result)
}
func _hcsModifyComputeSystem(computeSystem HcsSystem, configuration *uint16, result **uint16) (hr error) {
if hr = procHcsModifyComputeSystem.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsModifyComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(configuration)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
if r0&0x1fff0000 == 0x00070000 {
r0 &= 0xffff
}
hr = syscall.Errno(r0)
}
return
}
func hcsRegisterComputeSystemCallback(computeSystem HcsSystem, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) {
if hr = procHcsRegisterComputeSystemCallback.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procHcsRegisterComputeSystemCallback.Addr(), 4, uintptr(computeSystem), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0)
if int32(r0) < 0 {
if r0&0x1fff0000 == 0x00070000 {
r0 &= 0xffff
}
hr = syscall.Errno(r0)
}
return
}
func hcsUnregisterComputeSystemCallback(callbackHandle HcsCallback) (hr error) {
if hr = procHcsUnregisterComputeSystemCallback.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsUnregisterComputeSystemCallback.Addr(), 1, uintptr(callbackHandle), 0, 0)
if int32(r0) < 0 {
if r0&0x1fff0000 == 0x00070000 {
r0 &= 0xffff
}
hr = syscall.Errno(r0)
}
return
}
func hcsCreateProcess(computeSystem HcsSystem, processParameters string, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(processParameters)
if hr != nil {
return
}
return _hcsCreateProcess(computeSystem, _p0, processInformation, process, result)
}
func _hcsCreateProcess(computeSystem HcsSystem, processParameters *uint16, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) {
if hr = procHcsCreateProcess.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procHcsCreateProcess.Addr(), 5, uintptr(computeSystem), uintptr(unsafe.Pointer(processParameters)), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0)
if int32(r0) < 0 {
if r0&0x1fff0000 == 0x00070000 {
r0 &= 0xffff
}
hr = syscall.Errno(r0)
}
return
}
func hcsOpenProcess(computeSystem HcsSystem, pid uint32, process *HcsProcess, result **uint16) (hr error) {
if hr = procHcsOpenProcess.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procHcsOpenProcess.Addr(), 4, uintptr(computeSystem), uintptr(pid), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0, 0)
if int32(r0) < 0 {
if r0&0x1fff0000 == 0x00070000 {
r0 &= 0xffff
}
hr = syscall.Errno(r0)
}
return
}
func hcsCloseProcess(process HcsProcess) (hr error) {
if hr = procHcsCloseProcess.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsCloseProcess.Addr(), 1, uintptr(process), 0, 0)
if int32(r0) < 0 {
if r0&0x1fff0000 == 0x00070000 {
r0 &= 0xffff
}
hr = syscall.Errno(r0)
}
return
}
func hcsTerminateProcess(process HcsProcess, result **uint16) (hr error) {
if hr = procHcsTerminateProcess.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 2, uintptr(process), uintptr(unsafe.Pointer(result)), 0)
if int32(r0) < 0 {
if r0&0x1fff0000 == 0x00070000 {
r0 &= 0xffff
}
hr = syscall.Errno(r0)
}
return
}
func hcsSignalProcess(process HcsProcess, options string, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(options)
if hr != nil {
return
}
return _hcsSignalProcess(process, _p0, result)
}
func _hcsSignalProcess(process HcsProcess, options *uint16, result **uint16) (hr error) {
if hr = procHcsSignalProcess.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsSignalProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
if r0&0x1fff0000 == 0x00070000 {
r0 &= 0xffff
}
hr = syscall.Errno(r0)
}
return
}
func hcsGetProcessInfo(process HcsProcess, processInformation *HcsProcessInformation, result **uint16) (hr error) {
if hr = procHcsGetProcessInfo.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsGetProcessInfo.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
if r0&0x1fff0000 == 0x00070000 {
r0 &= 0xffff
}
hr = syscall.Errno(r0)
}
return
}
func hcsGetProcessProperties(process HcsProcess, processProperties **uint16, result **uint16) (hr error) {
if hr = procHcsGetProcessProperties.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsGetProcessProperties.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processProperties)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
if r0&0x1fff0000 == 0x00070000 {
r0 &= 0xffff
}
hr = syscall.Errno(r0)
}
return
}
func hcsModifyProcess(process HcsProcess, settings string, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(settings)
if hr != nil {
return
}
return _hcsModifyProcess(process, _p0, result)
}
func _hcsModifyProcess(process HcsProcess, settings *uint16, result **uint16) (hr error) {
if hr = procHcsModifyProcess.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsModifyProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
if r0&0x1fff0000 == 0x00070000 {
r0 &= 0xffff
}
hr = syscall.Errno(r0)
}
return
}
func hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(propertyQuery)
if hr != nil {
return
}
return _hcsGetServiceProperties(_p0, properties, result)
}
func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result **uint16) (hr error) {
if hr = procHcsGetServiceProperties.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsGetServiceProperties.Addr(), 3, uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
if r0&0x1fff0000 == 0x00070000 {
r0 &= 0xffff
}
hr = syscall.Errno(r0)
}
return
}
func hcsRegisterProcessCallback(process HcsProcess, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) {
if hr = procHcsRegisterProcessCallback.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procHcsRegisterProcessCallback.Addr(), 4, uintptr(process), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0)
if int32(r0) < 0 {
if r0&0x1fff0000 == 0x00070000 {
r0 &= 0xffff
}
hr = syscall.Errno(r0)
}
return
}
func hcsUnregisterProcessCallback(callbackHandle HcsCallback) (hr error) {
if hr = procHcsUnregisterProcessCallback.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsUnregisterProcessCallback.Addr(), 1, uintptr(callbackHandle), 0, 0)
if int32(r0) < 0 {
if r0&0x1fff0000 == 0x00070000 {
r0 &= 0xffff
}
hr = syscall.Errno(r0)
}
return
}