From a14f0abb5c195b4e75529815a80fa1912946b2c3 Mon Sep 17 00:00:00 2001 From: Ettore Di Giacinto Date: Sat, 18 Apr 2020 11:42:34 +0200 Subject: [PATCH] Update vendor --- vendor/github.com/Microsoft/go-winio/file.go | 18 +- vendor/github.com/Microsoft/go-winio/go.mod | 9 + vendor/github.com/Microsoft/go-winio/go.sum | 18 + .../github.com/Microsoft/go-winio/hvsock.go | 305 + vendor/github.com/Microsoft/go-winio/pipe.go | 256 +- .../Microsoft/go-winio/pkg/guid/guid.go | 235 + .../github.com/Microsoft/go-winio/syscall.go | 2 +- .../Microsoft/go-winio/zsyscall_windows.go | 88 +- .../Microsoft/hcsshim/Protobuild.toml | 54 + .../github.com/Microsoft/hcsshim/appveyor.yml | 20 +- .../github.com/Microsoft/hcsshim/container.go | 75 +- vendor/github.com/Microsoft/hcsshim/go.mod | 37 + vendor/github.com/Microsoft/hcsshim/go.sum | 131 + .../Microsoft/hcsshim/hnsendpoint.go | 10 + .../Microsoft/hcsshim/internal/cow/cow.go | 83 + .../hcsshim/internal/guestrequest/types.go | 100 - .../Microsoft/hcsshim/internal/guid/guid.go | 69 - .../hcsshim/internal/hcs/callback.go | 102 +- .../Microsoft/hcsshim/internal/hcs/errors.go | 75 +- .../Microsoft/hcsshim/internal/hcs/hcs.go | 48 - .../Microsoft/hcsshim/internal/hcs/log.go | 20 - .../Microsoft/hcsshim/internal/hcs/process.go | 441 +- .../Microsoft/hcsshim/internal/hcs/system.go | 647 +- .../hcsshim/internal/hcs/waithelper.go | 18 +- .../Microsoft/hcsshim/internal/hcs/watcher.go | 41 - .../hcsshim/internal/hns/hnsendpoint.go | 22 + .../hcsshim/internal/hns/hnsfuncs.go | 15 +- .../hcsshim/internal/hns/hnsnetwork.go | 10 +- .../hcsshim/internal/hns/hnspolicy.go | 5 +- .../hcsshim/internal/interop/interop.go | 4 - .../Microsoft/hcsshim/internal/log/g.go | 23 + .../Microsoft/hcsshim/internal/oc/exporter.go | 43 + .../Microsoft/hcsshim/internal/oc/span.go | 17 + .../hcsshim/internal/schema1/schema1.go | 9 +- .../hcsshim/internal/schema2/attachment.go | 1 - .../schema2/cache_query_stats_response.go | 1 - .../hcsshim/internal/schema2/close_handle.go | 1 - .../hcsshim/internal/schema2/com_port.go | 1 - .../internal/schema2/compute_system.go | 3 +- .../hcsshim/internal/schema2/configuration.go | 32 +- .../hcsshim/internal/schema2/console_size.go | 1 - .../hcsshim/internal/schema2/container.go | 1 - .../schema2/container_memory_information.go | 1 - .../hcsshim/internal/schema2/devices.go | 1 - .../internal/schema2/enhanced_mode_video.go | 1 - .../internal/schema2/flexible_io_device.go | 1 - .../internal/schema2/guest_crash_reporting.go | 1 - .../hcsshim/internal/schema2/guest_os.go | 1 - .../hcsshim/internal/schema2/hosted_system.go | 1 - .../hcsshim/internal/schema2/hv_socket.go | 1 - .../hcsshim/internal/schema2/hv_socket_2.go | 1 - .../hcsshim/internal/schema2/layer.go | 1 - .../internal/schema2/mapped_directory.go | 1 - .../hcsshim/internal/schema2/mapped_pipe.go | 1 - .../hcsshim/internal/schema2/memory.go | 1 - .../hcsshim/internal/schema2/memory_2.go | 5 + .../schema2/memory_information_for_vm.go | 3 +- .../hcsshim/internal/schema2/memory_stats.go | 7 +- .../internal/schema2/network_adapter.go | 1 - .../hcsshim/internal/schema2/networking.go | 1 - .../internal/schema2/pause_notification.go | 1 - .../hcsshim/internal/schema2/pause_options.go | 1 - .../hcsshim/internal/schema2/plan9.go | 1 - .../hcsshim/internal/schema2/plan9_share.go | 3 +- .../internal/schema2/process_details.go | 1 - .../schema2/process_modify_request.go | 1 - .../internal/schema2/process_parameters.go | 1 - .../internal/schema2/process_status.go | 1 - .../hcsshim/internal/schema2/processor.go | 1 - .../hcsshim/internal/schema2/processor_2.go | 1 - .../internal/schema2/processor_stats.go | 7 +- .../hcsshim/internal/schema2/properties.go | 9 +- .../internal/schema2/property_query.go | 5 +- .../hcsshim/internal/schema2/property_type.go | 23 + .../schema2/rdp_connection_options.go | 1 - .../internal/schema2/registry_changes.go | 1 - .../hcsshim/internal/schema2/registry_key.go | 1 - .../internal/schema2/registry_value.go | 1 - .../schema2/shared_memory_configuration.go | 1 - .../internal/schema2/shared_memory_region.go | 1 - .../schema2/shared_memory_region_info.go | 1 - .../internal/schema2/silo_properties.go | 1 - .../hcsshim/internal/schema2/statistics.go | 3 +- .../hcsshim/internal/schema2/storage_qo_s.go | 1 - .../hcsshim/internal/schema2/storage_stats.go | 9 +- .../hcsshim/internal/schema2/topology.go | 1 - .../hcsshim/internal/schema2/uefi.go | 1 - .../internal/schema2/uefi_boot_entry.go | 1 - .../hcsshim/internal/schema2/version.go | 1 - .../hcsshim/internal/schema2/video_monitor.go | 1 - .../internal/schema2/virtual_node_info.go | 1 - .../internal/schema2/virtual_p_mem_device.go | 1 - .../hcsshim/internal/schema2/virtual_smb.go | 1 - .../internal/schema2/virtual_smb_share.go | 1 - .../schema2/virtual_smb_share_options.go | 1 - .../hcsshim/internal/schema2/vm_memory.go | 5 +- .../schema2/windows_crash_reporting.go | 1 - .../hcsshim/internal/vmcompute/vmcompute.go | 565 ++ .../{hcs => vmcompute}/zsyscall_windows.go | 88 +- .../internal/wclayer/expandscratchsize.go | 115 + .../hcsshim/internal/wclayer/layerid.go | 2 +- .../hcsshim/internal/wclayer/layerutils.go | 2 +- .../hcsshim/internal/wclayer/nametoguid.go | 2 +- .../hcsshim/internal/wclayer/wclayer.go | 7 +- .../internal/wclayer/zsyscall_windows.go | 59 + vendor/github.com/Microsoft/hcsshim/layer.go | 6 +- .../Microsoft/hcsshim/mksyscall_windows.go | 943 --- .../hcsshim/osversion/osversion_windows.go | 57 + .../hcsshim/osversion/windowsbuilds.go | 27 + .../github.com/Microsoft/hcsshim/process.go | 38 +- .../github.com/Microsoft/hcsshim/vendor.conf | 21 - vendor/github.com/Nvveen/Gotty/LICENSE | 26 - vendor/github.com/Nvveen/Gotty/README | 5 - vendor/github.com/Nvveen/Gotty/TODO | 3 - vendor/github.com/Nvveen/Gotty/attributes.go | 514 -- vendor/github.com/Nvveen/Gotty/gotty.go | 238 - vendor/github.com/Nvveen/Gotty/parser.go | 362 -- vendor/github.com/Nvveen/Gotty/types.go | 23 - .../libnetwork => containerd/cgroups}/LICENSE | 7 +- .../stats/v1/doc.go} | 9 +- .../containerd/cgroups/stats/v1/metrics.pb.go | 5368 +++++++++++++++++ .../cgroups/stats/v1/metrics.pb.txt | 712 +++ .../containerd/cgroups/stats/v1/metrics.proto | 136 + .../containerd/containerd/archive/tar.go | 261 +- .../containerd/containerd/archive/tar_opts.go | 38 +- .../containerd/archive/tar_opts_linux.go | 59 + .../containerd/archive/tar_opts_windows.go | 18 +- .../containerd/containerd/archive/tar_unix.go | 77 +- .../containerd/archive/tar_windows.go | 31 +- .../containerd/archive/time_darwin.go | 30 - .../containerd/archive/time_unix.go | 4 +- .../containerd/containerd/errdefs/errors.go | 93 + .../containerd/containerd/errdefs/grpc.go | 147 + .../containerd/containerd/log/context.go | 2 +- .../containerd/containerd/sys/filesys_unix.go | 5 + .../containerd/sys/filesys_windows.go | 10 +- .../containerd/containerd/sys/oom_unix.go | 12 + .../containerd/containerd/sys/oom_windows.go | 7 + .../containerd/continuity/fs/copy.go | 6 +- .../containerd/continuity/fs/copy_linux.go | 5 +- .../containerd/continuity/fs/copy_unix.go | 2 +- .../containerd/continuity/fs/path.go | 33 +- .../fs/{stat_bsd.go => stat_darwinfreebsd.go} | 0 .../{stat_linux.go => stat_linuxopenbsd.go} | 2 + .../continuity/pathdriver/path_driver.go | 101 - .../containerd/continuity/sysx/nodata_unix.go | 2 +- .../containerd/continuity/sysx/xattr.go | 72 +- .../github.com/docker/distribution/Dockerfile | 2 +- .../registry/api/errcode/errors.go | 267 + .../registry/api/errcode/handler.go | 40 + .../registry/api/errcode/register.go | 138 + vendor/github.com/docker/docker/AUTHORS | 181 +- vendor/github.com/docker/docker/LICENSE | 2 +- vendor/github.com/docker/docker/NOTICE | 2 +- .../docker/docker/api/types/auth.go | 22 - .../docker/docker/api/types/client.go | 406 -- .../docker/docker/api/types/configs.go | 64 - .../docker/api/types/container/config.go | 2 +- .../api/types/container/container_changes.go | 5 +- .../api/types/container/container_create.go | 5 +- .../api/types/container/container_top.go | 5 +- .../api/types/container/container_update.go | 5 +- .../api/types/container/container_wait.go | 5 +- .../docker/api/types/container/host_config.go | 44 +- .../docker/docker/api/types/error_response.go | 13 - .../docker/docker/api/types/filters/parse.go | 78 +- .../docker/api/types/graph_driver_data.go | 17 - .../docker/docker/api/types/id_response.go | 13 - .../api/types/image_delete_response_item.go | 15 - .../docker/docker/api/types/image_summary.go | 49 - .../docker/docker/api/types/mount/mount.go | 3 +- .../docker/api/types/network/network.go | 15 +- .../docker/docker/api/types/plugin.go | 203 - .../docker/docker/api/types/plugin_device.go | 25 - .../docker/docker/api/types/plugin_env.go | 25 - .../docker/api/types/plugin_interface_type.go | 21 - .../docker/docker/api/types/plugin_mount.go | 37 - .../docker/api/types/plugin_responses.go | 71 - .../docker/docker/api/types/port.go | 23 - .../docker/api/types/registry/registry.go | 2 +- .../docker/docker/api/types/seccomp.go | 93 - .../api/types/service_update_response.go | 12 - .../docker/docker/api/types/stats.go | 181 - .../docker/docker/api/types/swarm/config.go | 7 +- .../docker/api/types/swarm/container.go | 14 +- .../api/types/swarm/runtime/plugin.pb.go | 110 +- .../api/types/swarm/runtime/plugin.proto | 1 + .../docker/docker/api/types/swarm/service.go | 82 +- .../docker/docker/api/types/swarm/swarm.go | 4 + .../docker/docker/api/types/swarm/task.go | 7 + .../docker/docker/api/types/types.go | 605 -- .../docker/docker/api/types/volume.go | 69 - .../github.com/docker/docker/errdefs/defs.go | 5 - .../docker/docker/errdefs/helpers.go | 67 +- .../docker/docker/errdefs/http_helpers.go | 191 + vendor/github.com/docker/docker/errdefs/is.go | 7 - .../docker/docker/opts/address_pools.go | 84 - vendor/github.com/docker/docker/opts/env.go | 48 - vendor/github.com/docker/docker/opts/hosts.go | 165 - .../docker/docker/opts/hosts_unix.go | 8 - .../docker/docker/opts/hosts_windows.go | 4 - vendor/github.com/docker/docker/opts/ip.go | 47 - vendor/github.com/docker/docker/opts/opts.go | 337 -- .../docker/docker/opts/opts_unix.go | 6 - .../docker/docker/opts/opts_windows.go | 56 - .../docker/docker/opts/quotedstring.go | 37 - .../github.com/docker/docker/opts/runtime.go | 79 - .../github.com/docker/docker/opts/ulimit.go | 81 - .../docker/docker/pkg/archive/archive.go | 47 +- .../docker/pkg/archive/archive_linux.go | 178 +- .../docker/pkg/archive/archive_other.go | 2 +- .../docker/docker/pkg/archive/archive_unix.go | 3 +- .../docker/pkg/archive/archive_windows.go | 2 +- .../docker/docker/pkg/archive/changes.go | 12 +- .../docker/docker/pkg/archive/changes_unix.go | 8 +- .../docker/pkg/archive/changes_windows.go | 8 +- .../docker/docker/pkg/archive/copy.go | 8 + .../docker/docker/pkg/archive/diff.go | 16 +- .../docker/pkg/archive/example_changes.go | 97 - .../docker/docker/pkg/fileutils/fileutils.go | 2 +- .../docker/pkg/homedir/homedir_linux.go | 98 +- .../docker/pkg/homedir/homedir_others.go | 22 +- .../docker/docker/pkg/homedir/homedir_unix.go | 12 +- .../docker/docker/pkg/idtools/idtools.go | 3 - .../docker/docker/pkg/idtools/idtools_unix.go | 2 +- .../docker/pkg/idtools/idtools_windows.go | 2 +- .../docker/docker/pkg/idtools/utils_unix.go | 4 +- .../docker/docker/pkg/ioutils/bytespipe.go | 3 +- .../docker/pkg}/jsonmessage/jsonmessage.go | 124 +- .../docker/docker/pkg/mount/mount.go | 141 - .../docker/docker/pkg/pools/pools.go | 10 +- .../docker/docker/pkg/system/args_windows.go | 16 + .../docker/docker/pkg/system/chtimes_unix.go | 6 +- .../docker/pkg/system/chtimes_windows.go | 4 +- .../system/{filesys.go => filesys_unix.go} | 6 +- .../docker/pkg/system/filesys_windows.go | 24 +- .../docker/docker/pkg/system/init_unix.go | 5 + .../docker/docker/pkg/system/init_windows.go | 38 +- .../docker/docker/pkg/system/lstat_unix.go | 3 +- .../docker/docker/pkg/system/meminfo_linux.go | 8 +- .../docker/docker/pkg/system/path.go | 10 +- .../docker/docker/pkg/system/path_unix.go | 10 + .../docker/docker/pkg/system/path_windows.go | 27 + .../docker/docker/pkg/system/process_unix.go | 20 + .../docker/pkg/system/process_windows.go | 2 +- .../github.com/docker/docker/pkg/system/rm.go | 10 +- .../docker/docker/pkg/system/stat_linux.go | 3 +- .../docker/docker/pkg/system/stat_solaris.go | 13 - .../docker/docker/pkg/system/stat_unix.go | 3 +- .../docker/docker/pkg/system/syscall_unix.go | 6 - .../docker/pkg/system/syscall_windows.go | 125 +- .../docker/docker/pkg/system/utimes_linux.go | 25 - .../{utimes_freebsd.go => utimes_unix.go} | 14 +- .../docker/docker/pkg/system/xattrs_linux.go | 18 +- .../docker/docker/pkg/term/ascii.go | 66 + .../docker/docker/pkg/term/proxy.go | 88 + .../github.com/docker/docker/pkg/term/tc.go | 20 + .../github.com/docker/docker/pkg/term/term.go | 124 + .../docker/docker/pkg/term/term_windows.go | 221 + .../docker/docker/pkg/term/termios_bsd.go | 42 + .../docker/docker/pkg/term/termios_linux.go | 39 + .../docker/pkg/term/windows/ansi_reader.go | 263 + .../docker/pkg/term/windows/ansi_writer.go | 64 + .../docker/docker/pkg/term/windows/console.go | 35 + .../docker/docker/pkg/term/windows/windows.go | 34 + .../docker/docker/pkg/term/winsize.go | 20 + .../docker/libnetwork/ipamutils/utils.go | 96 - .../fsouza/go-dockerclient/.gitattributes | 1 + .../fsouza/go-dockerclient/.gitignore | 2 - .../fsouza/go-dockerclient/.golangci.yaml | 30 + .../fsouza/go-dockerclient/.travis.yml | 30 - .../github.com/fsouza/go-dockerclient/AUTHORS | 6 + .../fsouza/go-dockerclient/Gopkg.toml | 28 - .../github.com/fsouza/go-dockerclient/LICENSE | 2 +- .../fsouza/go-dockerclient/Makefile | 25 +- .../{README.markdown => README.md} | 70 +- .../fsouza/go-dockerclient/appveyor.yml | 21 - .../github.com/fsouza/go-dockerclient/auth.go | 74 +- .../fsouza/go-dockerclient/client.go | 149 +- .../fsouza/go-dockerclient/client_unix.go | 9 +- .../fsouza/go-dockerclient/client_windows.go | 14 +- .../fsouza/go-dockerclient/container.go | 142 +- .../fsouza/go-dockerclient/distribution.go | 3 +- .../fsouza/go-dockerclient/event.go | 8 +- .../github.com/fsouza/go-dockerclient/exec.go | 25 +- .../github.com/fsouza/go-dockerclient/go.mod | 51 +- .../github.com/fsouza/go-dockerclient/go.sum | 201 +- .../fsouza/go-dockerclient/image.go | 144 +- .../internal/archive/archive.go | 505 -- .../internal/archive/archive_linux.go | 104 - .../internal/archive/archive_other.go | 11 - .../internal/archive/archive_unix.go | 77 - .../internal/archive/archive_windows.go | 71 - .../internal/archive/changes_unix.go | 16 - .../internal/archive/changes_windows.go | 11 - .../go-dockerclient/internal/archive/copy.go | 29 - .../internal/archive/whiteouts.go | 27 - .../go-dockerclient/internal/term/term.go | 13 - .../go-dockerclient/internal/term/winsize.go | 16 - .../internal/term/winsize_windows.go | 22 - .../github.com/fsouza/go-dockerclient/misc.go | 45 +- .../fsouza/go-dockerclient/network.go | 28 +- .../fsouza/go-dockerclient/plugin.go | 106 +- .../fsouza/go-dockerclient/swarm.go | 10 +- .../fsouza/go-dockerclient/swarm_configs.go | 10 +- .../fsouza/go-dockerclient/swarm_node.go | 8 +- .../fsouza/go-dockerclient/swarm_secrets.go | 10 +- .../fsouza/go-dockerclient/swarm_service.go | 15 +- .../fsouza/go-dockerclient/swarm_task.go | 4 +- .../fsouza/go-dockerclient/system.go | 3 +- .../github.com/fsouza/go-dockerclient/tar.go | 12 +- .../github.com/fsouza/go-dockerclient/tls.go | 5 +- .../fsouza/go-dockerclient/volume.go | 10 +- .../gogo/protobuf/gogoproto/Makefile | 37 + .../github.com/gogo/protobuf/gogoproto/doc.go | 169 + .../gogo/protobuf/gogoproto/gogo.pb.go | 874 +++ .../gogo/protobuf/gogoproto/gogo.pb.golden | 45 + .../gogo/protobuf/gogoproto/gogo.proto | 144 + .../gogo/protobuf/gogoproto/helper.go | 415 ++ .../github.com/gogo/protobuf/proto/encode.go | 2 + .../gogo/protobuf/proto/extensions.go | 1 + .../gogo/protobuf/proto/extensions_gogo.go | 21 + vendor/github.com/gogo/protobuf/proto/lib.go | 18 +- .../gogo/protobuf/proto/properties.go | 71 +- .../gogo/protobuf/proto/table_marshal.go | 17 +- .../gogo/protobuf/proto/table_merge.go | 19 + .../gogo/protobuf/proto/table_unmarshal.go | 22 +- vendor/github.com/gogo/protobuf/proto/text.go | 6 +- .../protoc-gen-gogo/descriptor/Makefile | 36 + .../protoc-gen-gogo/descriptor/descriptor.go | 118 + .../descriptor/descriptor.pb.go | 2865 +++++++++ .../descriptor/descriptor_gostring.gen.go | 752 +++ .../protoc-gen-gogo/descriptor/helper.go | 390 ++ .../github.com/golang/protobuf/ptypes/any.go | 141 + .../golang/protobuf/ptypes/any/any.pb.go | 200 + .../golang/protobuf/ptypes/any/any.proto | 154 + .../github.com/golang/protobuf/ptypes/doc.go | 35 + .../golang/protobuf/ptypes/duration.go | 102 + .../protobuf/ptypes/duration/duration.pb.go | 161 + .../protobuf/ptypes/duration/duration.proto | 117 + .../golang/protobuf/ptypes/timestamp.go | 132 + .../protobuf/ptypes/timestamp/timestamp.pb.go | 179 + .../protobuf/ptypes/timestamp/timestamp.proto | 135 + .../github.com/hashicorp/golang-lru/LICENSE | 362 ++ .../hashicorp/golang-lru/simplelru/lru.go | 161 + .../golang-lru/simplelru/lru_interface.go | 36 + .../klauspost/compress/flate/gen.go | 265 - .../github.com/klauspost/cpuid/private-gen.go | 476 -- vendor/github.com/moby/sys/mount/LICENSE | 202 + .../docker/pkg => moby/sys}/mount/flags.go | 14 +- .../pkg => moby/sys}/mount/flags_freebsd.go | 3 +- .../pkg => moby/sys}/mount/flags_linux.go | 2 +- .../sys}/mount/flags_unsupported.go | 3 +- vendor/github.com/moby/sys/mount/go.mod | 8 + vendor/github.com/moby/sys/mount/go.sum | 4 + vendor/github.com/moby/sys/mount/mount.go | 98 + .../pkg => moby/sys}/mount/mounter_freebsd.go | 19 +- .../pkg => moby/sys}/mount/mounter_linux.go | 32 +- .../sys}/mount/mounter_unsupported.go | 6 +- .../sys}/mount/sharedsubtree_linux.go | 42 +- .../github.com/moby/sys/mount/unmount_unix.go | 22 + .../moby/sys/mount/unmount_unsupported.go | 7 + vendor/github.com/moby/sys/mountinfo/LICENSE | 202 + vendor/github.com/moby/sys/mountinfo/go.mod | 3 + .../mount => moby/sys/mountinfo}/mountinfo.go | 19 +- .../moby/sys/mountinfo/mountinfo_filters.go | 56 + .../sys/mountinfo}/mountinfo_freebsd.go | 9 +- .../sys/mountinfo}/mountinfo_linux.go | 108 +- .../sys/mountinfo}/mountinfo_unsupported.go | 2 +- .../sys/mountinfo}/mountinfo_windows.go | 2 +- vendor/github.com/morikuni/aec/LICENSE | 21 + vendor/github.com/morikuni/aec/README.md | 178 + vendor/github.com/morikuni/aec/aec.go | 137 + vendor/github.com/morikuni/aec/ansi.go | 59 + vendor/github.com/morikuni/aec/builder.go | 388 ++ vendor/github.com/morikuni/aec/sample.gif | Bin 0 -> 12548 bytes vendor/github.com/morikuni/aec/sgr.go | 202 + vendor/github.com/urfave/cli/build.go | 164 - vendor/go.opencensus.io/.gitignore | 9 + vendor/go.opencensus.io/.travis.yml | 17 + vendor/go.opencensus.io/AUTHORS | 1 + vendor/go.opencensus.io/CONTRIBUTING.md | 63 + vendor/go.opencensus.io/Gopkg.lock | 231 + vendor/go.opencensus.io/Gopkg.toml | 36 + vendor/go.opencensus.io/LICENSE | 202 + vendor/go.opencensus.io/Makefile | 96 + vendor/go.opencensus.io/README.md | 263 + vendor/go.opencensus.io/appveyor.yml | 25 + vendor/go.opencensus.io/go.mod | 12 + vendor/go.opencensus.io/go.sum | 61 + vendor/go.opencensus.io/internal/internal.go | 37 + vendor/go.opencensus.io/internal/sanitize.go | 50 + .../internal/traceinternals.go | 53 + vendor/go.opencensus.io/opencensus.go | 21 + vendor/go.opencensus.io/trace/basetypes.go | 119 + vendor/go.opencensus.io/trace/config.go | 86 + vendor/go.opencensus.io/trace/doc.go | 53 + vendor/go.opencensus.io/trace/evictedqueue.go | 38 + vendor/go.opencensus.io/trace/export.go | 97 + .../trace/internal/internal.go | 22 + vendor/go.opencensus.io/trace/lrumap.go | 37 + vendor/go.opencensus.io/trace/sampling.go | 75 + vendor/go.opencensus.io/trace/spanbucket.go | 130 + vendor/go.opencensus.io/trace/spanstore.go | 306 + vendor/go.opencensus.io/trace/status_codes.go | 37 + vendor/go.opencensus.io/trace/trace.go | 598 ++ vendor/go.opencensus.io/trace/trace_go11.go | 32 + .../go.opencensus.io/trace/trace_nongo11.go | 25 + .../trace/tracestate/tracestate.go | 147 + .../x/crypto/ssh/terminal/terminal.go | 17 +- .../x/crypto/ssh/terminal/util_windows.go | 4 +- vendor/golang.org/x/net/html/atom/gen.go | 712 --- .../golang.org/x/sys/unix/asm_linux_riscv64.s | 7 - vendor/golang.org/x/sys/unix/mkasm_darwin.go | 78 - vendor/golang.org/x/sys/unix/mkerrors.sh | 2 +- vendor/golang.org/x/sys/unix/mkpost.go | 127 - vendor/golang.org/x/sys/unix/mksyscall.go | 402 -- .../x/sys/unix/mksyscall_aix_ppc.go | 415 -- .../x/sys/unix/mksyscall_aix_ppc64.go | 614 -- .../x/sys/unix/mksyscall_solaris.go | 335 - .../golang.org/x/sys/unix/mksysctl_openbsd.go | 355 -- vendor/golang.org/x/sys/unix/mksysnum.go | 190 - vendor/golang.org/x/sys/unix/syscall_bsd.go | 17 + .../golang.org/x/sys/unix/syscall_darwin.go | 17 - .../golang.org/x/sys/unix/syscall_freebsd.go | 6 - .../x/sys/unix/syscall_freebsd_386.go | 6 + .../x/sys/unix/syscall_freebsd_amd64.go | 6 + .../x/sys/unix/syscall_freebsd_arm.go | 6 + .../x/sys/unix/syscall_freebsd_arm64.go | 6 + vendor/golang.org/x/sys/unix/syscall_linux.go | 28 +- .../x/sys/unix/syscall_linux_386.go | 4 +- .../x/sys/unix/syscall_linux_amd64.go | 4 +- .../x/sys/unix/syscall_linux_arm.go | 4 +- .../x/sys/unix/syscall_linux_arm64.go | 4 +- .../x/sys/unix/syscall_linux_mips64x.go | 8 +- .../x/sys/unix/syscall_linux_mipsx.go | 4 +- .../x/sys/unix/syscall_linux_ppc64x.go | 4 +- .../x/sys/unix/syscall_linux_riscv64.go | 4 +- .../x/sys/unix/syscall_linux_s390x.go | 4 +- .../x/sys/unix/syscall_linux_sparc64.go | 4 +- .../golang.org/x/sys/unix/syscall_netbsd.go | 21 +- .../golang.org/x/sys/unix/syscall_openbsd.go | 27 +- vendor/golang.org/x/sys/unix/types_aix.go | 237 - vendor/golang.org/x/sys/unix/types_darwin.go | 283 - .../golang.org/x/sys/unix/types_dragonfly.go | 263 - vendor/golang.org/x/sys/unix/types_freebsd.go | 400 -- vendor/golang.org/x/sys/unix/types_netbsd.go | 300 - vendor/golang.org/x/sys/unix/types_openbsd.go | 283 - vendor/golang.org/x/sys/unix/types_solaris.go | 266 - .../x/sys/unix/zerrors_linux_386.go | 46 +- .../x/sys/unix/zerrors_linux_amd64.go | 46 +- .../x/sys/unix/zerrors_linux_arm.go | 46 +- .../x/sys/unix/zerrors_linux_arm64.go | 46 +- .../x/sys/unix/zerrors_linux_mips.go | 46 +- .../x/sys/unix/zerrors_linux_mips64.go | 46 +- .../x/sys/unix/zerrors_linux_mips64le.go | 46 +- .../x/sys/unix/zerrors_linux_mipsle.go | 46 +- .../x/sys/unix/zerrors_linux_ppc64.go | 47 +- .../x/sys/unix/zerrors_linux_ppc64le.go | 47 +- .../x/sys/unix/zerrors_linux_riscv64.go | 46 +- .../x/sys/unix/zerrors_linux_s390x.go | 46 +- .../x/sys/unix/zerrors_linux_sparc64.go | 47 +- .../x/sys/unix/zsyscall_linux_386.go | 14 +- .../x/sys/unix/zsyscall_linux_amd64.go | 14 +- .../x/sys/unix/zsyscall_linux_arm.go | 14 +- .../x/sys/unix/zsyscall_linux_arm64.go | 14 +- .../x/sys/unix/zsyscall_linux_mips.go | 14 +- .../x/sys/unix/zsyscall_linux_mips64.go | 14 +- .../x/sys/unix/zsyscall_linux_mips64le.go | 14 +- .../x/sys/unix/zsyscall_linux_mipsle.go | 14 +- .../x/sys/unix/zsyscall_linux_ppc64.go | 14 +- .../x/sys/unix/zsyscall_linux_ppc64le.go | 14 +- .../x/sys/unix/zsyscall_linux_riscv64.go | 14 +- .../x/sys/unix/zsyscall_linux_s390x.go | 14 +- .../x/sys/unix/zsyscall_linux_sparc64.go | 14 +- .../x/sys/unix/zsyscall_netbsd_386.go | 32 +- .../x/sys/unix/zsyscall_netbsd_amd64.go | 32 +- .../x/sys/unix/zsyscall_netbsd_arm.go | 32 +- .../x/sys/unix/zsyscall_netbsd_arm64.go | 32 +- .../x/sys/unix/zsyscall_openbsd_386.go | 4 +- .../x/sys/unix/zsyscall_openbsd_amd64.go | 4 +- .../x/sys/unix/zsyscall_openbsd_arm.go | 4 +- .../x/sys/unix/zsyscall_openbsd_arm64.go | 4 +- .../x/sys/unix/zsysnum_linux_arm64.go | 1 + .../x/sys/unix/ztypes_dragonfly_amd64.go | 10 + .../x/sys/unix/ztypes_freebsd_386.go | 12 +- .../x/sys/unix/ztypes_freebsd_amd64.go | 12 +- .../x/sys/unix/ztypes_freebsd_arm.go | 12 +- .../x/sys/unix/ztypes_freebsd_arm64.go | 12 +- .../golang.org/x/sys/unix/ztypes_linux_386.go | 14 +- .../x/sys/unix/ztypes_linux_amd64.go | 14 +- .../golang.org/x/sys/unix/ztypes_linux_arm.go | 14 +- .../x/sys/unix/ztypes_linux_arm64.go | 14 +- .../x/sys/unix/ztypes_linux_mips.go | 14 +- .../x/sys/unix/ztypes_linux_mips64.go | 14 +- .../x/sys/unix/ztypes_linux_mips64le.go | 14 +- .../x/sys/unix/ztypes_linux_mipsle.go | 14 +- .../x/sys/unix/ztypes_linux_ppc64.go | 14 +- .../x/sys/unix/ztypes_linux_ppc64le.go | 14 +- .../x/sys/unix/ztypes_linux_riscv64.go | 14 +- .../x/sys/unix/ztypes_linux_s390x.go | 14 +- .../x/sys/unix/ztypes_linux_sparc64.go | 14 +- .../x/sys/unix/ztypes_solaris_amd64.go | 7 + .../golang.org/x/sys/windows/types_windows.go | 19 +- .../x/text/encoding/charmap/maketables.go | 556 -- .../x/text/encoding/htmlindex/gen.go | 173 - .../text/encoding/internal/identifier/gen.go | 142 - .../x/text/encoding/japanese/maketables.go | 161 - .../x/text/encoding/korean/maketables.go | 143 - .../encoding/simplifiedchinese/maketables.go | 161 - .../encoding/traditionalchinese/maketables.go | 140 - .../x/text/internal/language/compact/gen.go | 64 - .../internal/language/compact/gen_index.go | 113 - .../internal/language/compact/gen_parents.go | 54 - .../x/text/internal/language/gen.go | 1520 ----- .../x/text/internal/language/gen_common.go | 20 - vendor/golang.org/x/text/language/gen.go | 305 - .../x/text/unicode/norm/maketables.go | 986 --- .../golang.org/x/text/unicode/norm/triegen.go | 117 - .../x/tools/go/gcexportdata/main.go | 99 - vendor/google.golang.org/genproto/LICENSE | 202 + .../googleapis/rpc/status/status.pb.go | 163 + vendor/google.golang.org/grpc/AUTHORS | 1 + vendor/google.golang.org/grpc/LICENSE | 202 + .../grpc/codes/code_string.go | 62 + vendor/google.golang.org/grpc/codes/codes.go | 198 + .../grpc/connectivity/connectivity.go | 73 + .../google.golang.org/grpc/grpclog/grpclog.go | 126 + .../google.golang.org/grpc/grpclog/logger.go | 85 + .../grpc/grpclog/loggerv2.go | 195 + .../grpc/internal/internal.go | 72 + .../google.golang.org/grpc/status/status.go | 228 + vendor/modules.txt | 236 +- 533 files changed, 28836 insertions(+), 20391 deletions(-) create mode 100644 vendor/github.com/Microsoft/go-winio/go.mod create mode 100644 vendor/github.com/Microsoft/go-winio/go.sum create mode 100644 vendor/github.com/Microsoft/go-winio/hvsock.go create mode 100644 vendor/github.com/Microsoft/go-winio/pkg/guid/guid.go create mode 100644 vendor/github.com/Microsoft/hcsshim/Protobuild.toml create mode 100644 vendor/github.com/Microsoft/hcsshim/go.mod create mode 100644 vendor/github.com/Microsoft/hcsshim/go.sum create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go delete mode 100644 vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go delete mode 100644 vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go delete mode 100644 vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go delete mode 100644 vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go delete mode 100644 vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/log/g.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/oc/exporter.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/oc/span.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/property_type.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go rename vendor/github.com/Microsoft/hcsshim/internal/{hcs => vmcompute}/zsyscall_windows.go (81%) delete mode 100644 vendor/github.com/Microsoft/hcsshim/mksyscall_windows.go create mode 100644 vendor/github.com/Microsoft/hcsshim/osversion/osversion_windows.go create mode 100644 vendor/github.com/Microsoft/hcsshim/osversion/windowsbuilds.go delete mode 100644 vendor/github.com/Microsoft/hcsshim/vendor.conf delete mode 100644 vendor/github.com/Nvveen/Gotty/LICENSE delete mode 100644 vendor/github.com/Nvveen/Gotty/README delete mode 100644 vendor/github.com/Nvveen/Gotty/TODO delete mode 100644 vendor/github.com/Nvveen/Gotty/attributes.go delete mode 100644 vendor/github.com/Nvveen/Gotty/gotty.go delete mode 100644 vendor/github.com/Nvveen/Gotty/parser.go delete mode 100644 vendor/github.com/Nvveen/Gotty/types.go rename vendor/github.com/{docker/libnetwork => containerd/cgroups}/LICENSE (99%) rename vendor/github.com/containerd/{containerd/archive/tar_opts_unix.go => cgroups/stats/v1/doc.go} (77%) create mode 100644 vendor/github.com/containerd/cgroups/stats/v1/metrics.pb.go create mode 100644 vendor/github.com/containerd/cgroups/stats/v1/metrics.pb.txt create mode 100644 vendor/github.com/containerd/cgroups/stats/v1/metrics.proto create mode 100644 vendor/github.com/containerd/containerd/archive/tar_opts_linux.go delete mode 100644 vendor/github.com/containerd/containerd/archive/time_darwin.go create mode 100644 vendor/github.com/containerd/containerd/errdefs/errors.go create mode 100644 vendor/github.com/containerd/containerd/errdefs/grpc.go rename vendor/github.com/containerd/continuity/fs/{stat_bsd.go => stat_darwinfreebsd.go} (100%) rename vendor/github.com/containerd/continuity/fs/{stat_linux.go => stat_linuxopenbsd.go} (97%) delete mode 100644 vendor/github.com/containerd/continuity/pathdriver/path_driver.go create mode 100644 vendor/github.com/docker/distribution/registry/api/errcode/errors.go create mode 100644 vendor/github.com/docker/distribution/registry/api/errcode/handler.go create mode 100644 vendor/github.com/docker/distribution/registry/api/errcode/register.go delete mode 100644 vendor/github.com/docker/docker/api/types/auth.go delete mode 100644 vendor/github.com/docker/docker/api/types/client.go delete mode 100644 vendor/github.com/docker/docker/api/types/configs.go delete mode 100644 vendor/github.com/docker/docker/api/types/error_response.go delete mode 100644 vendor/github.com/docker/docker/api/types/graph_driver_data.go delete mode 100644 vendor/github.com/docker/docker/api/types/id_response.go delete mode 100644 vendor/github.com/docker/docker/api/types/image_delete_response_item.go delete mode 100644 vendor/github.com/docker/docker/api/types/image_summary.go delete mode 100644 vendor/github.com/docker/docker/api/types/plugin.go delete mode 100644 vendor/github.com/docker/docker/api/types/plugin_device.go delete mode 100644 vendor/github.com/docker/docker/api/types/plugin_env.go delete mode 100644 vendor/github.com/docker/docker/api/types/plugin_interface_type.go delete mode 100644 vendor/github.com/docker/docker/api/types/plugin_mount.go delete mode 100644 vendor/github.com/docker/docker/api/types/plugin_responses.go delete mode 100644 vendor/github.com/docker/docker/api/types/port.go delete mode 100644 vendor/github.com/docker/docker/api/types/seccomp.go delete mode 100644 vendor/github.com/docker/docker/api/types/service_update_response.go delete mode 100644 vendor/github.com/docker/docker/api/types/stats.go delete mode 100644 vendor/github.com/docker/docker/api/types/types.go delete mode 100644 vendor/github.com/docker/docker/api/types/volume.go create mode 100644 vendor/github.com/docker/docker/errdefs/http_helpers.go delete mode 100644 vendor/github.com/docker/docker/opts/address_pools.go delete mode 100644 vendor/github.com/docker/docker/opts/env.go delete mode 100644 vendor/github.com/docker/docker/opts/hosts.go delete mode 100644 vendor/github.com/docker/docker/opts/hosts_unix.go delete mode 100644 vendor/github.com/docker/docker/opts/hosts_windows.go delete mode 100644 vendor/github.com/docker/docker/opts/ip.go delete mode 100644 vendor/github.com/docker/docker/opts/opts.go delete mode 100644 vendor/github.com/docker/docker/opts/opts_unix.go delete mode 100644 vendor/github.com/docker/docker/opts/opts_windows.go delete mode 100644 vendor/github.com/docker/docker/opts/quotedstring.go delete mode 100644 vendor/github.com/docker/docker/opts/runtime.go delete mode 100644 vendor/github.com/docker/docker/opts/ulimit.go delete mode 100644 vendor/github.com/docker/docker/pkg/archive/example_changes.go rename vendor/github.com/{fsouza/go-dockerclient/internal => docker/docker/pkg}/jsonmessage/jsonmessage.go (70%) delete mode 100644 vendor/github.com/docker/docker/pkg/mount/mount.go create mode 100644 vendor/github.com/docker/docker/pkg/system/args_windows.go rename vendor/github.com/docker/docker/pkg/system/{filesys.go => filesys_unix.go} (93%) create mode 100644 vendor/github.com/docker/docker/pkg/system/path_unix.go create mode 100644 vendor/github.com/docker/docker/pkg/system/path_windows.go delete mode 100644 vendor/github.com/docker/docker/pkg/system/stat_solaris.go delete mode 100644 vendor/github.com/docker/docker/pkg/system/utimes_linux.go rename vendor/github.com/docker/docker/pkg/system/{utimes_freebsd.go => utimes_unix.go} (58%) create mode 100644 vendor/github.com/docker/docker/pkg/term/ascii.go create mode 100644 vendor/github.com/docker/docker/pkg/term/proxy.go create mode 100644 vendor/github.com/docker/docker/pkg/term/tc.go create mode 100644 vendor/github.com/docker/docker/pkg/term/term.go create mode 100644 vendor/github.com/docker/docker/pkg/term/term_windows.go create mode 100644 vendor/github.com/docker/docker/pkg/term/termios_bsd.go create mode 100644 vendor/github.com/docker/docker/pkg/term/termios_linux.go create mode 100644 vendor/github.com/docker/docker/pkg/term/windows/ansi_reader.go create mode 100644 vendor/github.com/docker/docker/pkg/term/windows/ansi_writer.go create mode 100644 vendor/github.com/docker/docker/pkg/term/windows/console.go create mode 100644 vendor/github.com/docker/docker/pkg/term/windows/windows.go create mode 100644 vendor/github.com/docker/docker/pkg/term/winsize.go delete mode 100644 vendor/github.com/docker/libnetwork/ipamutils/utils.go create mode 100644 vendor/github.com/fsouza/go-dockerclient/.gitattributes create mode 100644 vendor/github.com/fsouza/go-dockerclient/.golangci.yaml delete mode 100644 vendor/github.com/fsouza/go-dockerclient/.travis.yml delete mode 100644 vendor/github.com/fsouza/go-dockerclient/Gopkg.toml rename vendor/github.com/fsouza/go-dockerclient/{README.markdown => README.md} (53%) delete mode 100644 vendor/github.com/fsouza/go-dockerclient/appveyor.yml delete mode 100644 vendor/github.com/fsouza/go-dockerclient/internal/archive/archive.go delete mode 100644 vendor/github.com/fsouza/go-dockerclient/internal/archive/archive_linux.go delete mode 100644 vendor/github.com/fsouza/go-dockerclient/internal/archive/archive_other.go delete mode 100644 vendor/github.com/fsouza/go-dockerclient/internal/archive/archive_unix.go delete mode 100644 vendor/github.com/fsouza/go-dockerclient/internal/archive/archive_windows.go delete mode 100644 vendor/github.com/fsouza/go-dockerclient/internal/archive/changes_unix.go delete mode 100644 vendor/github.com/fsouza/go-dockerclient/internal/archive/changes_windows.go delete mode 100644 vendor/github.com/fsouza/go-dockerclient/internal/archive/copy.go delete mode 100644 vendor/github.com/fsouza/go-dockerclient/internal/archive/whiteouts.go delete mode 100644 vendor/github.com/fsouza/go-dockerclient/internal/term/term.go delete mode 100644 vendor/github.com/fsouza/go-dockerclient/internal/term/winsize.go delete mode 100644 vendor/github.com/fsouza/go-dockerclient/internal/term/winsize_windows.go create mode 100644 vendor/github.com/gogo/protobuf/gogoproto/Makefile create mode 100644 vendor/github.com/gogo/protobuf/gogoproto/doc.go create mode 100644 vendor/github.com/gogo/protobuf/gogoproto/gogo.pb.go create mode 100644 vendor/github.com/gogo/protobuf/gogoproto/gogo.pb.golden create mode 100644 vendor/github.com/gogo/protobuf/gogoproto/gogo.proto create mode 100644 vendor/github.com/gogo/protobuf/gogoproto/helper.go create mode 100644 vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/Makefile create mode 100644 vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor.go create mode 100644 vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor.pb.go create mode 100644 vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor_gostring.gen.go create mode 100644 vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/helper.go create mode 100644 vendor/github.com/golang/protobuf/ptypes/any.go create mode 100644 vendor/github.com/golang/protobuf/ptypes/any/any.pb.go create mode 100644 vendor/github.com/golang/protobuf/ptypes/any/any.proto create mode 100644 vendor/github.com/golang/protobuf/ptypes/doc.go create mode 100644 vendor/github.com/golang/protobuf/ptypes/duration.go create mode 100644 vendor/github.com/golang/protobuf/ptypes/duration/duration.pb.go create mode 100644 vendor/github.com/golang/protobuf/ptypes/duration/duration.proto create mode 100644 vendor/github.com/golang/protobuf/ptypes/timestamp.go create mode 100644 vendor/github.com/golang/protobuf/ptypes/timestamp/timestamp.pb.go create mode 100644 vendor/github.com/golang/protobuf/ptypes/timestamp/timestamp.proto create mode 100644 vendor/github.com/hashicorp/golang-lru/LICENSE create mode 100644 vendor/github.com/hashicorp/golang-lru/simplelru/lru.go create mode 100644 vendor/github.com/hashicorp/golang-lru/simplelru/lru_interface.go delete mode 100644 vendor/github.com/klauspost/compress/flate/gen.go delete mode 100644 vendor/github.com/klauspost/cpuid/private-gen.go create mode 100644 vendor/github.com/moby/sys/mount/LICENSE rename vendor/github.com/{docker/docker/pkg => moby/sys}/mount/flags.go (89%) rename vendor/github.com/{docker/docker/pkg => moby/sys}/mount/flags_freebsd.go (92%) rename vendor/github.com/{docker/docker/pkg => moby/sys}/mount/flags_linux.go (97%) rename vendor/github.com/{docker/docker/pkg => moby/sys}/mount/flags_unsupported.go (85%) create mode 100644 vendor/github.com/moby/sys/mount/go.mod create mode 100644 vendor/github.com/moby/sys/mount/go.sum create mode 100644 vendor/github.com/moby/sys/mount/mount.go rename vendor/github.com/{docker/docker/pkg => moby/sys}/mount/mounter_freebsd.go (78%) rename vendor/github.com/{docker/docker/pkg => moby/sys}/mount/mounter_linux.go (74%) rename vendor/github.com/{docker/docker/pkg => moby/sys}/mount/mounter_unsupported.go (51%) rename vendor/github.com/{docker/docker/pkg => moby/sys}/mount/sharedsubtree_linux.go (65%) create mode 100644 vendor/github.com/moby/sys/mount/unmount_unix.go create mode 100644 vendor/github.com/moby/sys/mount/unmount_unsupported.go create mode 100644 vendor/github.com/moby/sys/mountinfo/LICENSE create mode 100644 vendor/github.com/moby/sys/mountinfo/go.mod rename vendor/github.com/{docker/docker/pkg/mount => moby/sys/mountinfo}/mountinfo.go (66%) create mode 100644 vendor/github.com/moby/sys/mountinfo/mountinfo_filters.go rename vendor/github.com/{docker/docker/pkg/mount => moby/sys/mountinfo}/mountinfo_freebsd.go (84%) rename vendor/github.com/{docker/docker/pkg/mount => moby/sys/mountinfo}/mountinfo_linux.go (59%) rename vendor/github.com/{docker/docker/pkg/mount => moby/sys/mountinfo}/mountinfo_unsupported.go (79%) rename vendor/github.com/{docker/docker/pkg/mount => moby/sys/mountinfo}/mountinfo_windows.go (62%) create mode 100644 vendor/github.com/morikuni/aec/LICENSE create mode 100644 vendor/github.com/morikuni/aec/README.md create mode 100644 vendor/github.com/morikuni/aec/aec.go create mode 100644 vendor/github.com/morikuni/aec/ansi.go create mode 100644 vendor/github.com/morikuni/aec/builder.go create mode 100644 vendor/github.com/morikuni/aec/sample.gif create mode 100644 vendor/github.com/morikuni/aec/sgr.go delete mode 100644 vendor/github.com/urfave/cli/build.go create mode 100644 vendor/go.opencensus.io/.gitignore create mode 100644 vendor/go.opencensus.io/.travis.yml create mode 100644 vendor/go.opencensus.io/AUTHORS create mode 100644 vendor/go.opencensus.io/CONTRIBUTING.md create mode 100644 vendor/go.opencensus.io/Gopkg.lock create mode 100644 vendor/go.opencensus.io/Gopkg.toml create mode 100644 vendor/go.opencensus.io/LICENSE create mode 100644 vendor/go.opencensus.io/Makefile create mode 100644 vendor/go.opencensus.io/README.md create mode 100644 vendor/go.opencensus.io/appveyor.yml create mode 100644 vendor/go.opencensus.io/go.mod create mode 100644 vendor/go.opencensus.io/go.sum create mode 100644 vendor/go.opencensus.io/internal/internal.go create mode 100644 vendor/go.opencensus.io/internal/sanitize.go create mode 100644 vendor/go.opencensus.io/internal/traceinternals.go create mode 100644 vendor/go.opencensus.io/opencensus.go create mode 100644 vendor/go.opencensus.io/trace/basetypes.go create mode 100644 vendor/go.opencensus.io/trace/config.go create mode 100644 vendor/go.opencensus.io/trace/doc.go create mode 100644 vendor/go.opencensus.io/trace/evictedqueue.go create mode 100644 vendor/go.opencensus.io/trace/export.go create mode 100644 vendor/go.opencensus.io/trace/internal/internal.go create mode 100644 vendor/go.opencensus.io/trace/lrumap.go create mode 100644 vendor/go.opencensus.io/trace/sampling.go create mode 100644 vendor/go.opencensus.io/trace/spanbucket.go create mode 100644 vendor/go.opencensus.io/trace/spanstore.go create mode 100644 vendor/go.opencensus.io/trace/status_codes.go create mode 100644 vendor/go.opencensus.io/trace/trace.go create mode 100644 vendor/go.opencensus.io/trace/trace_go11.go create mode 100644 vendor/go.opencensus.io/trace/trace_nongo11.go create mode 100644 vendor/go.opencensus.io/trace/tracestate/tracestate.go delete mode 100644 vendor/golang.org/x/net/html/atom/gen.go delete mode 100644 vendor/golang.org/x/sys/unix/mkasm_darwin.go delete mode 100644 vendor/golang.org/x/sys/unix/mkpost.go delete mode 100644 vendor/golang.org/x/sys/unix/mksyscall.go delete mode 100644 vendor/golang.org/x/sys/unix/mksyscall_aix_ppc.go delete mode 100644 vendor/golang.org/x/sys/unix/mksyscall_aix_ppc64.go delete mode 100644 vendor/golang.org/x/sys/unix/mksyscall_solaris.go delete mode 100644 vendor/golang.org/x/sys/unix/mksysctl_openbsd.go delete mode 100644 vendor/golang.org/x/sys/unix/mksysnum.go delete mode 100644 vendor/golang.org/x/sys/unix/types_aix.go delete mode 100644 vendor/golang.org/x/sys/unix/types_darwin.go delete mode 100644 vendor/golang.org/x/sys/unix/types_dragonfly.go delete mode 100644 vendor/golang.org/x/sys/unix/types_freebsd.go delete mode 100644 vendor/golang.org/x/sys/unix/types_netbsd.go delete mode 100644 vendor/golang.org/x/sys/unix/types_openbsd.go delete mode 100644 vendor/golang.org/x/sys/unix/types_solaris.go delete mode 100644 vendor/golang.org/x/text/encoding/charmap/maketables.go delete mode 100644 vendor/golang.org/x/text/encoding/htmlindex/gen.go delete mode 100644 vendor/golang.org/x/text/encoding/internal/identifier/gen.go delete mode 100644 vendor/golang.org/x/text/encoding/japanese/maketables.go delete mode 100644 vendor/golang.org/x/text/encoding/korean/maketables.go delete mode 100644 vendor/golang.org/x/text/encoding/simplifiedchinese/maketables.go delete mode 100644 vendor/golang.org/x/text/encoding/traditionalchinese/maketables.go delete mode 100644 vendor/golang.org/x/text/internal/language/compact/gen.go delete mode 100644 vendor/golang.org/x/text/internal/language/compact/gen_index.go delete mode 100644 vendor/golang.org/x/text/internal/language/compact/gen_parents.go delete mode 100644 vendor/golang.org/x/text/internal/language/gen.go delete mode 100644 vendor/golang.org/x/text/internal/language/gen_common.go delete mode 100644 vendor/golang.org/x/text/language/gen.go delete mode 100644 vendor/golang.org/x/text/unicode/norm/maketables.go delete mode 100644 vendor/golang.org/x/text/unicode/norm/triegen.go delete mode 100644 vendor/golang.org/x/tools/go/gcexportdata/main.go create mode 100644 vendor/google.golang.org/genproto/LICENSE create mode 100644 vendor/google.golang.org/genproto/googleapis/rpc/status/status.pb.go create mode 100644 vendor/google.golang.org/grpc/AUTHORS create mode 100644 vendor/google.golang.org/grpc/LICENSE create mode 100644 vendor/google.golang.org/grpc/codes/code_string.go create mode 100644 vendor/google.golang.org/grpc/codes/codes.go create mode 100644 vendor/google.golang.org/grpc/connectivity/connectivity.go create mode 100644 vendor/google.golang.org/grpc/grpclog/grpclog.go create mode 100644 vendor/google.golang.org/grpc/grpclog/logger.go create mode 100644 vendor/google.golang.org/grpc/grpclog/loggerv2.go create mode 100644 vendor/google.golang.org/grpc/internal/internal.go create mode 100644 vendor/google.golang.org/grpc/status/status.go diff --git a/vendor/github.com/Microsoft/go-winio/file.go b/vendor/github.com/Microsoft/go-winio/file.go index 4334ff1c..0385e410 100644 --- a/vendor/github.com/Microsoft/go-winio/file.go +++ b/vendor/github.com/Microsoft/go-winio/file.go @@ -16,6 +16,7 @@ import ( //sys createIoCompletionPort(file syscall.Handle, port syscall.Handle, key uintptr, threadCount uint32) (newport syscall.Handle, err error) = CreateIoCompletionPort //sys getQueuedCompletionStatus(port syscall.Handle, bytes *uint32, key *uintptr, o **ioOperation, timeout uint32) (err error) = GetQueuedCompletionStatus //sys setFileCompletionNotificationModes(h syscall.Handle, flags uint8) (err error) = SetFileCompletionNotificationModes +//sys wsaGetOverlappedResult(h syscall.Handle, o *syscall.Overlapped, bytes *uint32, wait bool, flags *uint32) (err error) = ws2_32.WSAGetOverlappedResult type atomicBool int32 @@ -79,6 +80,7 @@ type win32File struct { wg sync.WaitGroup wgLock sync.RWMutex closing atomicBool + socket bool readDeadline deadlineHandler writeDeadline deadlineHandler } @@ -109,7 +111,13 @@ func makeWin32File(h syscall.Handle) (*win32File, error) { } func MakeOpenFile(h syscall.Handle) (io.ReadWriteCloser, error) { - return makeWin32File(h) + // If we return the result of makeWin32File directly, it can result in an + // interface-wrapped nil, rather than a nil interface value. + f, err := makeWin32File(h) + if err != nil { + return nil, err + } + return f, nil } // closeHandle closes the resources associated with a Win32 handle @@ -190,6 +198,10 @@ func (f *win32File) asyncIo(c *ioOperation, d *deadlineHandler, bytes uint32, er if f.closing.isSet() { err = ErrFileClosed } + } else if err != nil && f.socket { + // err is from Win32. Query the overlapped structure to get the winsock error. + var bytes, flags uint32 + err = wsaGetOverlappedResult(f.handle, &c.o, &bytes, false, &flags) } case <-timeout: cancelIoEx(f.handle, &c.o) @@ -265,6 +277,10 @@ func (f *win32File) Flush() error { return syscall.FlushFileBuffers(f.handle) } +func (f *win32File) Fd() uintptr { + return uintptr(f.handle) +} + func (d *deadlineHandler) set(deadline time.Time) error { d.setLock.Lock() defer d.setLock.Unlock() diff --git a/vendor/github.com/Microsoft/go-winio/go.mod b/vendor/github.com/Microsoft/go-winio/go.mod new file mode 100644 index 00000000..50b9d6e2 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/go.mod @@ -0,0 +1,9 @@ +module github.com/Microsoft/go-winio + +go 1.12 + +require ( + github.com/pkg/errors v0.8.1 + github.com/sirupsen/logrus v1.4.1 + golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 +) diff --git a/vendor/github.com/Microsoft/go-winio/go.sum b/vendor/github.com/Microsoft/go-winio/go.sum new file mode 100644 index 00000000..209aa8cf --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/go.sum @@ -0,0 +1,18 @@ +github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c= +github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38= +github.com/konsorten/go-windows-terminal-sequences v1.0.1 h1:mweAR1A6xJ3oS2pRaGiHgQ4OO8tzTaLawm8vnODuwDk= +github.com/konsorten/go-windows-terminal-sequences v1.0.1/go.mod h1:T0+1ngSBFLxvqU3pZ+m/2kptfBszLMUkC4ZK/EgS/cQ= +github.com/pkg/errors v0.8.1 h1:iURUrRGxPUNPdy5/HRSm+Yj6okJ6UtLINN0Q9M4+h3I= +github.com/pkg/errors v0.8.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0= +github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM= +github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4= +github.com/sirupsen/logrus v1.4.1 h1:GL2rEmy6nsikmW0r8opw9JIRScdMF5hA8cOYLH7In1k= +github.com/sirupsen/logrus v1.4.1/go.mod h1:ni0Sbl8bgC9z8RoU9G6nDWqqs/fq4eDPysMBDgk/93Q= +github.com/stretchr/objx v0.1.1/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME= +github.com/stretchr/testify v1.2.2 h1:bSDNvY7ZPG5RlJ8otE/7V6gMiyenm9RtJ7IUVIAoJ1w= +github.com/stretchr/testify v1.2.2/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXfy6kDkUVs= +golang.org/x/sys v0.0.0-20180905080454-ebe1bf3edb33/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20190507160741-ecd444e8653b h1:ag/x1USPSsqHud38I9BAC88qdNLDHHtQ4mlgQIZPPNA= +golang.org/x/sys v0.0.0-20190507160741-ecd444e8653b/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 h1:7TYNF4UdlohbFwpNH04CoPMp1cHUZgO1Ebq5r2hIjfo= +golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= diff --git a/vendor/github.com/Microsoft/go-winio/hvsock.go b/vendor/github.com/Microsoft/go-winio/hvsock.go new file mode 100644 index 00000000..dbfe790e --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/hvsock.go @@ -0,0 +1,305 @@ +package winio + +import ( + "fmt" + "io" + "net" + "os" + "syscall" + "time" + "unsafe" + + "github.com/Microsoft/go-winio/pkg/guid" +) + +//sys bind(s syscall.Handle, name unsafe.Pointer, namelen int32) (err error) [failretval==socketError] = ws2_32.bind + +const ( + afHvSock = 34 // AF_HYPERV + + socketError = ^uintptr(0) +) + +// An HvsockAddr is an address for a AF_HYPERV socket. +type HvsockAddr struct { + VMID guid.GUID + ServiceID guid.GUID +} + +type rawHvsockAddr struct { + Family uint16 + _ uint16 + VMID guid.GUID + ServiceID guid.GUID +} + +// Network returns the address's network name, "hvsock". +func (addr *HvsockAddr) Network() string { + return "hvsock" +} + +func (addr *HvsockAddr) String() string { + return fmt.Sprintf("%s:%s", &addr.VMID, &addr.ServiceID) +} + +// VsockServiceID returns an hvsock service ID corresponding to the specified AF_VSOCK port. +func VsockServiceID(port uint32) guid.GUID { + g, _ := guid.FromString("00000000-facb-11e6-bd58-64006a7986d3") + g.Data1 = port + return g +} + +func (addr *HvsockAddr) raw() rawHvsockAddr { + return rawHvsockAddr{ + Family: afHvSock, + VMID: addr.VMID, + ServiceID: addr.ServiceID, + } +} + +func (addr *HvsockAddr) fromRaw(raw *rawHvsockAddr) { + addr.VMID = raw.VMID + addr.ServiceID = raw.ServiceID +} + +// HvsockListener is a socket listener for the AF_HYPERV address family. +type HvsockListener struct { + sock *win32File + addr HvsockAddr +} + +// HvsockConn is a connected socket of the AF_HYPERV address family. +type HvsockConn struct { + sock *win32File + local, remote HvsockAddr +} + +func newHvSocket() (*win32File, error) { + fd, err := syscall.Socket(afHvSock, syscall.SOCK_STREAM, 1) + if err != nil { + return nil, os.NewSyscallError("socket", err) + } + f, err := makeWin32File(fd) + if err != nil { + syscall.Close(fd) + return nil, err + } + f.socket = true + return f, nil +} + +// ListenHvsock listens for connections on the specified hvsock address. +func ListenHvsock(addr *HvsockAddr) (_ *HvsockListener, err error) { + l := &HvsockListener{addr: *addr} + sock, err := newHvSocket() + if err != nil { + return nil, l.opErr("listen", err) + } + sa := addr.raw() + err = bind(sock.handle, unsafe.Pointer(&sa), int32(unsafe.Sizeof(sa))) + if err != nil { + return nil, l.opErr("listen", os.NewSyscallError("socket", err)) + } + err = syscall.Listen(sock.handle, 16) + if err != nil { + return nil, l.opErr("listen", os.NewSyscallError("listen", err)) + } + return &HvsockListener{sock: sock, addr: *addr}, nil +} + +func (l *HvsockListener) opErr(op string, err error) error { + return &net.OpError{Op: op, Net: "hvsock", Addr: &l.addr, Err: err} +} + +// Addr returns the listener's network address. +func (l *HvsockListener) Addr() net.Addr { + return &l.addr +} + +// Accept waits for the next connection and returns it. +func (l *HvsockListener) Accept() (_ net.Conn, err error) { + sock, err := newHvSocket() + if err != nil { + return nil, l.opErr("accept", err) + } + defer func() { + if sock != nil { + sock.Close() + } + }() + c, err := l.sock.prepareIo() + if err != nil { + return nil, l.opErr("accept", err) + } + defer l.sock.wg.Done() + + // AcceptEx, per documentation, requires an extra 16 bytes per address. + const addrlen = uint32(16 + unsafe.Sizeof(rawHvsockAddr{})) + var addrbuf [addrlen * 2]byte + + var bytes uint32 + err = syscall.AcceptEx(l.sock.handle, sock.handle, &addrbuf[0], 0, addrlen, addrlen, &bytes, &c.o) + _, err = l.sock.asyncIo(c, nil, bytes, err) + if err != nil { + return nil, l.opErr("accept", os.NewSyscallError("acceptex", err)) + } + conn := &HvsockConn{ + sock: sock, + } + conn.local.fromRaw((*rawHvsockAddr)(unsafe.Pointer(&addrbuf[0]))) + conn.remote.fromRaw((*rawHvsockAddr)(unsafe.Pointer(&addrbuf[addrlen]))) + sock = nil + return conn, nil +} + +// Close closes the listener, causing any pending Accept calls to fail. +func (l *HvsockListener) Close() error { + return l.sock.Close() +} + +/* Need to finish ConnectEx handling +func DialHvsock(ctx context.Context, addr *HvsockAddr) (*HvsockConn, error) { + sock, err := newHvSocket() + if err != nil { + return nil, err + } + defer func() { + if sock != nil { + sock.Close() + } + }() + c, err := sock.prepareIo() + if err != nil { + return nil, err + } + defer sock.wg.Done() + var bytes uint32 + err = windows.ConnectEx(windows.Handle(sock.handle), sa, nil, 0, &bytes, &c.o) + _, err = sock.asyncIo(ctx, c, nil, bytes, err) + if err != nil { + return nil, err + } + conn := &HvsockConn{ + sock: sock, + remote: *addr, + } + sock = nil + return conn, nil +} +*/ + +func (conn *HvsockConn) opErr(op string, err error) error { + return &net.OpError{Op: op, Net: "hvsock", Source: &conn.local, Addr: &conn.remote, Err: err} +} + +func (conn *HvsockConn) Read(b []byte) (int, error) { + c, err := conn.sock.prepareIo() + if err != nil { + return 0, conn.opErr("read", err) + } + defer conn.sock.wg.Done() + buf := syscall.WSABuf{Buf: &b[0], Len: uint32(len(b))} + var flags, bytes uint32 + err = syscall.WSARecv(conn.sock.handle, &buf, 1, &bytes, &flags, &c.o, nil) + n, err := conn.sock.asyncIo(c, &conn.sock.readDeadline, bytes, err) + if err != nil { + if _, ok := err.(syscall.Errno); ok { + err = os.NewSyscallError("wsarecv", err) + } + return 0, conn.opErr("read", err) + } else if n == 0 { + err = io.EOF + } + return n, err +} + +func (conn *HvsockConn) Write(b []byte) (int, error) { + t := 0 + for len(b) != 0 { + n, err := conn.write(b) + if err != nil { + return t + n, err + } + t += n + b = b[n:] + } + return t, nil +} + +func (conn *HvsockConn) write(b []byte) (int, error) { + c, err := conn.sock.prepareIo() + if err != nil { + return 0, conn.opErr("write", err) + } + defer conn.sock.wg.Done() + buf := syscall.WSABuf{Buf: &b[0], Len: uint32(len(b))} + var bytes uint32 + err = syscall.WSASend(conn.sock.handle, &buf, 1, &bytes, 0, &c.o, nil) + n, err := conn.sock.asyncIo(c, &conn.sock.writeDeadline, bytes, err) + if err != nil { + if _, ok := err.(syscall.Errno); ok { + err = os.NewSyscallError("wsasend", err) + } + return 0, conn.opErr("write", err) + } + return n, err +} + +// Close closes the socket connection, failing any pending read or write calls. +func (conn *HvsockConn) Close() error { + return conn.sock.Close() +} + +func (conn *HvsockConn) shutdown(how int) error { + err := syscall.Shutdown(conn.sock.handle, syscall.SHUT_RD) + if err != nil { + return os.NewSyscallError("shutdown", err) + } + return nil +} + +// CloseRead shuts down the read end of the socket. +func (conn *HvsockConn) CloseRead() error { + err := conn.shutdown(syscall.SHUT_RD) + if err != nil { + return conn.opErr("close", err) + } + return nil +} + +// CloseWrite shuts down the write end of the socket, notifying the other endpoint that +// no more data will be written. +func (conn *HvsockConn) CloseWrite() error { + err := conn.shutdown(syscall.SHUT_WR) + if err != nil { + return conn.opErr("close", err) + } + return nil +} + +// LocalAddr returns the local address of the connection. +func (conn *HvsockConn) LocalAddr() net.Addr { + return &conn.local +} + +// RemoteAddr returns the remote address of the connection. +func (conn *HvsockConn) RemoteAddr() net.Addr { + return &conn.remote +} + +// SetDeadline implements the net.Conn SetDeadline method. +func (conn *HvsockConn) SetDeadline(t time.Time) error { + conn.SetReadDeadline(t) + conn.SetWriteDeadline(t) + return nil +} + +// SetReadDeadline implements the net.Conn SetReadDeadline method. +func (conn *HvsockConn) SetReadDeadline(t time.Time) error { + return conn.sock.SetReadDeadline(t) +} + +// SetWriteDeadline implements the net.Conn SetWriteDeadline method. +func (conn *HvsockConn) SetWriteDeadline(t time.Time) error { + return conn.sock.SetWriteDeadline(t) +} diff --git a/vendor/github.com/Microsoft/go-winio/pipe.go b/vendor/github.com/Microsoft/go-winio/pipe.go index d99eedb6..ff96dff1 100644 --- a/vendor/github.com/Microsoft/go-winio/pipe.go +++ b/vendor/github.com/Microsoft/go-winio/pipe.go @@ -3,10 +3,13 @@ package winio import ( + "context" "errors" + "fmt" "io" "net" "os" + "runtime" "syscall" "time" "unsafe" @@ -18,6 +21,48 @@ import ( //sys getNamedPipeInfo(pipe syscall.Handle, flags *uint32, outSize *uint32, inSize *uint32, maxInstances *uint32) (err error) = GetNamedPipeInfo //sys getNamedPipeHandleState(pipe syscall.Handle, state *uint32, curInstances *uint32, maxCollectionCount *uint32, collectDataTimeout *uint32, userName *uint16, maxUserNameSize uint32) (err error) = GetNamedPipeHandleStateW //sys localAlloc(uFlags uint32, length uint32) (ptr uintptr) = LocalAlloc +//sys ntCreateNamedPipeFile(pipe *syscall.Handle, access uint32, oa *objectAttributes, iosb *ioStatusBlock, share uint32, disposition uint32, options uint32, typ uint32, readMode uint32, completionMode uint32, maxInstances uint32, inboundQuota uint32, outputQuota uint32, timeout *int64) (status ntstatus) = ntdll.NtCreateNamedPipeFile +//sys rtlNtStatusToDosError(status ntstatus) (winerr error) = ntdll.RtlNtStatusToDosErrorNoTeb +//sys rtlDosPathNameToNtPathName(name *uint16, ntName *unicodeString, filePart uintptr, reserved uintptr) (status ntstatus) = ntdll.RtlDosPathNameToNtPathName_U +//sys rtlDefaultNpAcl(dacl *uintptr) (status ntstatus) = ntdll.RtlDefaultNpAcl + +type ioStatusBlock struct { + Status, Information uintptr +} + +type objectAttributes struct { + Length uintptr + RootDirectory uintptr + ObjectName *unicodeString + Attributes uintptr + SecurityDescriptor *securityDescriptor + SecurityQoS uintptr +} + +type unicodeString struct { + Length uint16 + MaximumLength uint16 + Buffer uintptr +} + +type securityDescriptor struct { + Revision byte + Sbz1 byte + Control uint16 + Owner uintptr + Group uintptr + Sacl uintptr + Dacl uintptr +} + +type ntstatus int32 + +func (status ntstatus) Err() error { + if status >= 0 { + return nil + } + return rtlNtStatusToDosError(status) +} const ( cERROR_PIPE_BUSY = syscall.Errno(231) @@ -25,21 +70,20 @@ const ( cERROR_PIPE_CONNECTED = syscall.Errno(535) cERROR_SEM_TIMEOUT = syscall.Errno(121) - cPIPE_ACCESS_DUPLEX = 0x3 - cFILE_FLAG_FIRST_PIPE_INSTANCE = 0x80000 - cSECURITY_SQOS_PRESENT = 0x100000 - cSECURITY_ANONYMOUS = 0 - - cPIPE_REJECT_REMOTE_CLIENTS = 0x8 - - cPIPE_UNLIMITED_INSTANCES = 255 - - cNMPWAIT_USE_DEFAULT_WAIT = 0 - cNMPWAIT_NOWAIT = 1 + cSECURITY_SQOS_PRESENT = 0x100000 + cSECURITY_ANONYMOUS = 0 cPIPE_TYPE_MESSAGE = 4 cPIPE_READMODE_MESSAGE = 2 + + cFILE_OPEN = 1 + cFILE_CREATE = 2 + + cFILE_PIPE_MESSAGE_TYPE = 1 + cFILE_PIPE_REJECT_REMOTE_CLIENTS = 2 + + cSE_DACL_PRESENT = 4 ) var ( @@ -137,33 +181,60 @@ func (s pipeAddress) String() string { return string(s) } +// tryDialPipe attempts to dial the pipe at `path` until `ctx` cancellation or timeout. +func tryDialPipe(ctx context.Context, path *string, access uint32) (syscall.Handle, error) { + for { + + select { + case <-ctx.Done(): + return syscall.Handle(0), ctx.Err() + default: + h, err := createFile(*path, access, 0, nil, syscall.OPEN_EXISTING, syscall.FILE_FLAG_OVERLAPPED|cSECURITY_SQOS_PRESENT|cSECURITY_ANONYMOUS, 0) + if err == nil { + return h, nil + } + if err != cERROR_PIPE_BUSY { + return h, &os.PathError{Err: err, Op: "open", Path: *path} + } + // Wait 10 msec and try again. This is a rather simplistic + // view, as we always try each 10 milliseconds. + time.Sleep(10 * time.Millisecond) + } + } +} + // DialPipe connects to a named pipe by path, timing out if the connection // takes longer than the specified duration. If timeout is nil, then we use -// a default timeout of 5 seconds. (We do not use WaitNamedPipe.) +// a default timeout of 2 seconds. (We do not use WaitNamedPipe.) func DialPipe(path string, timeout *time.Duration) (net.Conn, error) { var absTimeout time.Time if timeout != nil { absTimeout = time.Now().Add(*timeout) } else { - absTimeout = time.Now().Add(time.Second * 2) + absTimeout = time.Now().Add(2 * time.Second) } + ctx, _ := context.WithDeadline(context.Background(), absTimeout) + conn, err := DialPipeContext(ctx, path) + if err == context.DeadlineExceeded { + return nil, ErrTimeout + } + return conn, err +} + +// DialPipeContext attempts to connect to a named pipe by `path` until `ctx` +// cancellation or timeout. +func DialPipeContext(ctx context.Context, path string) (net.Conn, error) { + return DialPipeAccess(ctx, path, syscall.GENERIC_READ|syscall.GENERIC_WRITE) +} + +// DialPipeAccess attempts to connect to a named pipe by `path` with `access` until `ctx` +// cancellation or timeout. +func DialPipeAccess(ctx context.Context, path string, access uint32) (net.Conn, error) { var err error var h syscall.Handle - for { - h, err = createFile(path, syscall.GENERIC_READ|syscall.GENERIC_WRITE, 0, nil, syscall.OPEN_EXISTING, syscall.FILE_FLAG_OVERLAPPED|cSECURITY_SQOS_PRESENT|cSECURITY_ANONYMOUS, 0) - if err != cERROR_PIPE_BUSY { - break - } - if time.Now().After(absTimeout) { - return nil, ErrTimeout - } - - // Wait 10 msec and try again. This is a rather simplistic - // view, as we always try each 10 milliseconds. - time.Sleep(time.Millisecond * 10) - } + h, err = tryDialPipe(ctx, &path, access) if err != nil { - return nil, &os.PathError{Op: "open", Path: path, Err: err} + return nil, err } var flags uint32 @@ -194,43 +265,87 @@ type acceptResponse struct { } type win32PipeListener struct { - firstHandle syscall.Handle - path string - securityDescriptor []byte - config PipeConfig - acceptCh chan (chan acceptResponse) - closeCh chan int - doneCh chan int + firstHandle syscall.Handle + path string + config PipeConfig + acceptCh chan (chan acceptResponse) + closeCh chan int + doneCh chan int } -func makeServerPipeHandle(path string, securityDescriptor []byte, c *PipeConfig, first bool) (syscall.Handle, error) { - var flags uint32 = cPIPE_ACCESS_DUPLEX | syscall.FILE_FLAG_OVERLAPPED - if first { - flags |= cFILE_FLAG_FIRST_PIPE_INSTANCE - } - - var mode uint32 = cPIPE_REJECT_REMOTE_CLIENTS - if c.MessageMode { - mode |= cPIPE_TYPE_MESSAGE - } - - sa := &syscall.SecurityAttributes{} - sa.Length = uint32(unsafe.Sizeof(*sa)) - if securityDescriptor != nil { - len := uint32(len(securityDescriptor)) - sa.SecurityDescriptor = localAlloc(0, len) - defer localFree(sa.SecurityDescriptor) - copy((*[0xffff]byte)(unsafe.Pointer(sa.SecurityDescriptor))[:], securityDescriptor) - } - h, err := createNamedPipe(path, flags, mode, cPIPE_UNLIMITED_INSTANCES, uint32(c.OutputBufferSize), uint32(c.InputBufferSize), 0, sa) +func makeServerPipeHandle(path string, sd []byte, c *PipeConfig, first bool) (syscall.Handle, error) { + path16, err := syscall.UTF16FromString(path) if err != nil { return 0, &os.PathError{Op: "open", Path: path, Err: err} } + + var oa objectAttributes + oa.Length = unsafe.Sizeof(oa) + + var ntPath unicodeString + if err := rtlDosPathNameToNtPathName(&path16[0], &ntPath, 0, 0).Err(); err != nil { + return 0, &os.PathError{Op: "open", Path: path, Err: err} + } + defer localFree(ntPath.Buffer) + oa.ObjectName = &ntPath + + // The security descriptor is only needed for the first pipe. + if first { + if sd != nil { + len := uint32(len(sd)) + sdb := localAlloc(0, len) + defer localFree(sdb) + copy((*[0xffff]byte)(unsafe.Pointer(sdb))[:], sd) + oa.SecurityDescriptor = (*securityDescriptor)(unsafe.Pointer(sdb)) + } else { + // Construct the default named pipe security descriptor. + var dacl uintptr + if err := rtlDefaultNpAcl(&dacl).Err(); err != nil { + return 0, fmt.Errorf("getting default named pipe ACL: %s", err) + } + defer localFree(dacl) + + sdb := &securityDescriptor{ + Revision: 1, + Control: cSE_DACL_PRESENT, + Dacl: dacl, + } + oa.SecurityDescriptor = sdb + } + } + + typ := uint32(cFILE_PIPE_REJECT_REMOTE_CLIENTS) + if c.MessageMode { + typ |= cFILE_PIPE_MESSAGE_TYPE + } + + disposition := uint32(cFILE_OPEN) + access := uint32(syscall.GENERIC_READ | syscall.GENERIC_WRITE | syscall.SYNCHRONIZE) + if first { + disposition = cFILE_CREATE + // By not asking for read or write access, the named pipe file system + // will put this pipe into an initially disconnected state, blocking + // client connections until the next call with first == false. + access = syscall.SYNCHRONIZE + } + + timeout := int64(-50 * 10000) // 50ms + + var ( + h syscall.Handle + iosb ioStatusBlock + ) + err = ntCreateNamedPipeFile(&h, access, &oa, &iosb, syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE, disposition, 0, typ, 0, 0, 0xffffffff, uint32(c.InputBufferSize), uint32(c.OutputBufferSize), &timeout).Err() + if err != nil { + return 0, &os.PathError{Op: "open", Path: path, Err: err} + } + + runtime.KeepAlive(ntPath) return h, nil } func (l *win32PipeListener) makeServerPipe() (*win32File, error) { - h, err := makeServerPipeHandle(l.path, l.securityDescriptor, &l.config, false) + h, err := makeServerPipeHandle(l.path, nil, &l.config, false) if err != nil { return nil, err } @@ -341,32 +456,13 @@ func ListenPipe(path string, c *PipeConfig) (net.Listener, error) { if err != nil { return nil, err } - // Create a client handle and connect it. This results in the pipe - // instance always existing, so that clients see ERROR_PIPE_BUSY - // rather than ERROR_FILE_NOT_FOUND. This ties the first instance - // up so that no other instances can be used. This would have been - // cleaner if the Win32 API matched CreateFile with ConnectNamedPipe - // instead of CreateNamedPipe. (Apparently created named pipes are - // considered to be in listening state regardless of whether any - // active calls to ConnectNamedPipe are outstanding.) - h2, err := createFile(path, 0, 0, nil, syscall.OPEN_EXISTING, cSECURITY_SQOS_PRESENT|cSECURITY_ANONYMOUS, 0) - if err != nil { - syscall.Close(h) - return nil, err - } - // Close the client handle. The server side of the instance will - // still be busy, leading to ERROR_PIPE_BUSY instead of - // ERROR_NOT_FOUND, as long as we don't close the server handle, - // or disconnect the client with DisconnectNamedPipe. - syscall.Close(h2) l := &win32PipeListener{ - firstHandle: h, - path: path, - securityDescriptor: sd, - config: *c, - acceptCh: make(chan (chan acceptResponse)), - closeCh: make(chan int), - doneCh: make(chan int), + firstHandle: h, + path: path, + config: *c, + acceptCh: make(chan (chan acceptResponse)), + closeCh: make(chan int), + doneCh: make(chan int), } go l.listenerRoutine() return l, nil diff --git a/vendor/github.com/Microsoft/go-winio/pkg/guid/guid.go b/vendor/github.com/Microsoft/go-winio/pkg/guid/guid.go new file mode 100644 index 00000000..58640657 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/pkg/guid/guid.go @@ -0,0 +1,235 @@ +// Package guid provides a GUID type. The backing structure for a GUID is +// identical to that used by the golang.org/x/sys/windows GUID type. +// There are two main binary encodings used for a GUID, the big-endian encoding, +// and the Windows (mixed-endian) encoding. See here for details: +// https://en.wikipedia.org/wiki/Universally_unique_identifier#Encoding +package guid + +import ( + "crypto/rand" + "crypto/sha1" + "encoding" + "encoding/binary" + "fmt" + "strconv" + + "golang.org/x/sys/windows" +) + +// Variant specifies which GUID variant (or "type") of the GUID. It determines +// how the entirety of the rest of the GUID is interpreted. +type Variant uint8 + +// The variants specified by RFC 4122. +const ( + // VariantUnknown specifies a GUID variant which does not conform to one of + // the variant encodings specified in RFC 4122. + VariantUnknown Variant = iota + VariantNCS + VariantRFC4122 + VariantMicrosoft + VariantFuture +) + +// Version specifies how the bits in the GUID were generated. For instance, a +// version 4 GUID is randomly generated, and a version 5 is generated from the +// hash of an input string. +type Version uint8 + +var _ = (encoding.TextMarshaler)(GUID{}) +var _ = (encoding.TextUnmarshaler)(&GUID{}) + +// GUID represents a GUID/UUID. It has the same structure as +// golang.org/x/sys/windows.GUID so that it can be used with functions expecting +// that type. It is defined as its own type so that stringification and +// marshaling can be supported. The representation matches that used by native +// Windows code. +type GUID windows.GUID + +// NewV4 returns a new version 4 (pseudorandom) GUID, as defined by RFC 4122. +func NewV4() (GUID, error) { + var b [16]byte + if _, err := rand.Read(b[:]); err != nil { + return GUID{}, err + } + + g := FromArray(b) + g.setVersion(4) // Version 4 means randomly generated. + g.setVariant(VariantRFC4122) + + return g, nil +} + +// NewV5 returns a new version 5 (generated from a string via SHA-1 hashing) +// GUID, as defined by RFC 4122. The RFC is unclear on the encoding of the name, +// and the sample code treats it as a series of bytes, so we do the same here. +// +// Some implementations, such as those found on Windows, treat the name as a +// big-endian UTF16 stream of bytes. If that is desired, the string can be +// encoded as such before being passed to this function. +func NewV5(namespace GUID, name []byte) (GUID, error) { + b := sha1.New() + namespaceBytes := namespace.ToArray() + b.Write(namespaceBytes[:]) + b.Write(name) + + a := [16]byte{} + copy(a[:], b.Sum(nil)) + + g := FromArray(a) + g.setVersion(5) // Version 5 means generated from a string. + g.setVariant(VariantRFC4122) + + return g, nil +} + +func fromArray(b [16]byte, order binary.ByteOrder) GUID { + var g GUID + g.Data1 = order.Uint32(b[0:4]) + g.Data2 = order.Uint16(b[4:6]) + g.Data3 = order.Uint16(b[6:8]) + copy(g.Data4[:], b[8:16]) + return g +} + +func (g GUID) toArray(order binary.ByteOrder) [16]byte { + b := [16]byte{} + order.PutUint32(b[0:4], g.Data1) + order.PutUint16(b[4:6], g.Data2) + order.PutUint16(b[6:8], g.Data3) + copy(b[8:16], g.Data4[:]) + return b +} + +// FromArray constructs a GUID from a big-endian encoding array of 16 bytes. +func FromArray(b [16]byte) GUID { + return fromArray(b, binary.BigEndian) +} + +// ToArray returns an array of 16 bytes representing the GUID in big-endian +// encoding. +func (g GUID) ToArray() [16]byte { + return g.toArray(binary.BigEndian) +} + +// FromWindowsArray constructs a GUID from a Windows encoding array of bytes. +func FromWindowsArray(b [16]byte) GUID { + return fromArray(b, binary.LittleEndian) +} + +// ToWindowsArray returns an array of 16 bytes representing the GUID in Windows +// encoding. +func (g GUID) ToWindowsArray() [16]byte { + return g.toArray(binary.LittleEndian) +} + +func (g GUID) String() string { + return fmt.Sprintf( + "%08x-%04x-%04x-%04x-%012x", + g.Data1, + g.Data2, + g.Data3, + g.Data4[:2], + g.Data4[2:]) +} + +// FromString parses a string containing a GUID and returns the GUID. The only +// format currently supported is the `xxxxxxxx-xxxx-xxxx-xxxx-xxxxxxxxxxxx` +// format. +func FromString(s string) (GUID, error) { + if len(s) != 36 { + return GUID{}, fmt.Errorf("invalid GUID %q", s) + } + if s[8] != '-' || s[13] != '-' || s[18] != '-' || s[23] != '-' { + return GUID{}, fmt.Errorf("invalid GUID %q", s) + } + + var g GUID + + data1, err := strconv.ParseUint(s[0:8], 16, 32) + if err != nil { + return GUID{}, fmt.Errorf("invalid GUID %q", s) + } + g.Data1 = uint32(data1) + + data2, err := strconv.ParseUint(s[9:13], 16, 16) + if err != nil { + return GUID{}, fmt.Errorf("invalid GUID %q", s) + } + g.Data2 = uint16(data2) + + data3, err := strconv.ParseUint(s[14:18], 16, 16) + if err != nil { + return GUID{}, fmt.Errorf("invalid GUID %q", s) + } + g.Data3 = uint16(data3) + + for i, x := range []int{19, 21, 24, 26, 28, 30, 32, 34} { + v, err := strconv.ParseUint(s[x:x+2], 16, 8) + if err != nil { + return GUID{}, fmt.Errorf("invalid GUID %q", s) + } + g.Data4[i] = uint8(v) + } + + return g, nil +} + +func (g *GUID) setVariant(v Variant) { + d := g.Data4[0] + switch v { + case VariantNCS: + d = (d & 0x7f) + case VariantRFC4122: + d = (d & 0x3f) | 0x80 + case VariantMicrosoft: + d = (d & 0x1f) | 0xc0 + case VariantFuture: + d = (d & 0x0f) | 0xe0 + case VariantUnknown: + fallthrough + default: + panic(fmt.Sprintf("invalid variant: %d", v)) + } + g.Data4[0] = d +} + +// Variant returns the GUID variant, as defined in RFC 4122. +func (g GUID) Variant() Variant { + b := g.Data4[0] + if b&0x80 == 0 { + return VariantNCS + } else if b&0xc0 == 0x80 { + return VariantRFC4122 + } else if b&0xe0 == 0xc0 { + return VariantMicrosoft + } else if b&0xe0 == 0xe0 { + return VariantFuture + } + return VariantUnknown +} + +func (g *GUID) setVersion(v Version) { + g.Data3 = (g.Data3 & 0x0fff) | (uint16(v) << 12) +} + +// Version returns the GUID version, as defined in RFC 4122. +func (g GUID) Version() Version { + return Version((g.Data3 & 0xF000) >> 12) +} + +// MarshalText returns the textual representation of the GUID. +func (g GUID) MarshalText() ([]byte, error) { + return []byte(g.String()), nil +} + +// UnmarshalText takes the textual representation of a GUID, and unmarhals it +// into this GUID. +func (g *GUID) UnmarshalText(text []byte) error { + g2, err := FromString(string(text)) + if err != nil { + return err + } + *g = g2 + return nil +} diff --git a/vendor/github.com/Microsoft/go-winio/syscall.go b/vendor/github.com/Microsoft/go-winio/syscall.go index 20d64cf4..5cb52bc7 100644 --- a/vendor/github.com/Microsoft/go-winio/syscall.go +++ b/vendor/github.com/Microsoft/go-winio/syscall.go @@ -1,3 +1,3 @@ package winio -//go:generate go run $GOROOT/src/syscall/mksyscall_windows.go -output zsyscall_windows.go file.go pipe.go sd.go fileinfo.go privilege.go backup.go +//go:generate go run $GOROOT/src/syscall/mksyscall_windows.go -output zsyscall_windows.go file.go pipe.go sd.go fileinfo.go privilege.go backup.go hvsock.go diff --git a/vendor/github.com/Microsoft/go-winio/zsyscall_windows.go b/vendor/github.com/Microsoft/go-winio/zsyscall_windows.go index 3f527639..e26b01fa 100644 --- a/vendor/github.com/Microsoft/go-winio/zsyscall_windows.go +++ b/vendor/github.com/Microsoft/go-winio/zsyscall_windows.go @@ -1,4 +1,4 @@ -// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT +// Code generated by 'go generate'; DO NOT EDIT. package winio @@ -38,19 +38,25 @@ func errnoErr(e syscall.Errno) error { var ( modkernel32 = windows.NewLazySystemDLL("kernel32.dll") + modws2_32 = windows.NewLazySystemDLL("ws2_32.dll") + modntdll = windows.NewLazySystemDLL("ntdll.dll") modadvapi32 = windows.NewLazySystemDLL("advapi32.dll") procCancelIoEx = modkernel32.NewProc("CancelIoEx") procCreateIoCompletionPort = modkernel32.NewProc("CreateIoCompletionPort") procGetQueuedCompletionStatus = modkernel32.NewProc("GetQueuedCompletionStatus") procSetFileCompletionNotificationModes = modkernel32.NewProc("SetFileCompletionNotificationModes") + procWSAGetOverlappedResult = modws2_32.NewProc("WSAGetOverlappedResult") procConnectNamedPipe = modkernel32.NewProc("ConnectNamedPipe") procCreateNamedPipeW = modkernel32.NewProc("CreateNamedPipeW") procCreateFileW = modkernel32.NewProc("CreateFileW") - procWaitNamedPipeW = modkernel32.NewProc("WaitNamedPipeW") procGetNamedPipeInfo = modkernel32.NewProc("GetNamedPipeInfo") procGetNamedPipeHandleStateW = modkernel32.NewProc("GetNamedPipeHandleStateW") procLocalAlloc = modkernel32.NewProc("LocalAlloc") + procNtCreateNamedPipeFile = modntdll.NewProc("NtCreateNamedPipeFile") + procRtlNtStatusToDosErrorNoTeb = modntdll.NewProc("RtlNtStatusToDosErrorNoTeb") + procRtlDosPathNameToNtPathName_U = modntdll.NewProc("RtlDosPathNameToNtPathName_U") + procRtlDefaultNpAcl = modntdll.NewProc("RtlDefaultNpAcl") procLookupAccountNameW = modadvapi32.NewProc("LookupAccountNameW") procConvertSidToStringSidW = modadvapi32.NewProc("ConvertSidToStringSidW") procConvertStringSecurityDescriptorToSecurityDescriptorW = modadvapi32.NewProc("ConvertStringSecurityDescriptorToSecurityDescriptorW") @@ -69,6 +75,7 @@ var ( procLookupPrivilegeDisplayNameW = modadvapi32.NewProc("LookupPrivilegeDisplayNameW") procBackupRead = modkernel32.NewProc("BackupRead") procBackupWrite = modkernel32.NewProc("BackupWrite") + procbind = modws2_32.NewProc("bind") ) func cancelIoEx(file syscall.Handle, o *syscall.Overlapped) (err error) { @@ -120,6 +127,24 @@ func setFileCompletionNotificationModes(h syscall.Handle, flags uint8) (err erro return } +func wsaGetOverlappedResult(h syscall.Handle, o *syscall.Overlapped, bytes *uint32, wait bool, flags *uint32) (err error) { + var _p0 uint32 + if wait { + _p0 = 1 + } else { + _p0 = 0 + } + r1, _, e1 := syscall.Syscall6(procWSAGetOverlappedResult.Addr(), 5, uintptr(h), uintptr(unsafe.Pointer(o)), uintptr(unsafe.Pointer(bytes)), uintptr(_p0), uintptr(unsafe.Pointer(flags)), 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + func connectNamedPipe(pipe syscall.Handle, o *syscall.Overlapped) (err error) { r1, _, e1 := syscall.Syscall(procConnectNamedPipe.Addr(), 2, uintptr(pipe), uintptr(unsafe.Pointer(o)), 0) if r1 == 0 { @@ -176,27 +201,6 @@ func _createFile(name *uint16, access uint32, mode uint32, sa *syscall.SecurityA return } -func waitNamedPipe(name string, timeout uint32) (err error) { - var _p0 *uint16 - _p0, err = syscall.UTF16PtrFromString(name) - if err != nil { - return - } - return _waitNamedPipe(_p0, timeout) -} - -func _waitNamedPipe(name *uint16, timeout uint32) (err error) { - r1, _, e1 := syscall.Syscall(procWaitNamedPipeW.Addr(), 2, uintptr(unsafe.Pointer(name)), uintptr(timeout), 0) - if r1 == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } - } - return -} - func getNamedPipeInfo(pipe syscall.Handle, flags *uint32, outSize *uint32, inSize *uint32, maxInstances *uint32) (err error) { r1, _, e1 := syscall.Syscall6(procGetNamedPipeInfo.Addr(), 5, uintptr(pipe), uintptr(unsafe.Pointer(flags)), uintptr(unsafe.Pointer(outSize)), uintptr(unsafe.Pointer(inSize)), uintptr(unsafe.Pointer(maxInstances)), 0) if r1 == 0 { @@ -227,6 +231,32 @@ func localAlloc(uFlags uint32, length uint32) (ptr uintptr) { return } +func ntCreateNamedPipeFile(pipe *syscall.Handle, access uint32, oa *objectAttributes, iosb *ioStatusBlock, share uint32, disposition uint32, options uint32, typ uint32, readMode uint32, completionMode uint32, maxInstances uint32, inboundQuota uint32, outputQuota uint32, timeout *int64) (status ntstatus) { + r0, _, _ := syscall.Syscall15(procNtCreateNamedPipeFile.Addr(), 14, uintptr(unsafe.Pointer(pipe)), uintptr(access), uintptr(unsafe.Pointer(oa)), uintptr(unsafe.Pointer(iosb)), uintptr(share), uintptr(disposition), uintptr(options), uintptr(typ), uintptr(readMode), uintptr(completionMode), uintptr(maxInstances), uintptr(inboundQuota), uintptr(outputQuota), uintptr(unsafe.Pointer(timeout)), 0) + status = ntstatus(r0) + return +} + +func rtlNtStatusToDosError(status ntstatus) (winerr error) { + r0, _, _ := syscall.Syscall(procRtlNtStatusToDosErrorNoTeb.Addr(), 1, uintptr(status), 0, 0) + if r0 != 0 { + winerr = syscall.Errno(r0) + } + return +} + +func rtlDosPathNameToNtPathName(name *uint16, ntName *unicodeString, filePart uintptr, reserved uintptr) (status ntstatus) { + r0, _, _ := syscall.Syscall6(procRtlDosPathNameToNtPathName_U.Addr(), 4, uintptr(unsafe.Pointer(name)), uintptr(unsafe.Pointer(ntName)), uintptr(filePart), uintptr(reserved), 0, 0) + status = ntstatus(r0) + return +} + +func rtlDefaultNpAcl(dacl *uintptr) (status ntstatus) { + r0, _, _ := syscall.Syscall(procRtlDefaultNpAcl.Addr(), 1, uintptr(unsafe.Pointer(dacl)), 0, 0) + status = ntstatus(r0) + return +} + func lookupAccountName(systemName *uint16, accountName string, sid *byte, sidSize *uint32, refDomain *uint16, refDomainSize *uint32, sidNameUse *uint32) (err error) { var _p0 *uint16 _p0, err = syscall.UTF16PtrFromString(accountName) @@ -518,3 +548,15 @@ func backupWrite(h syscall.Handle, b []byte, bytesWritten *uint32, abort bool, p } return } + +func bind(s syscall.Handle, name unsafe.Pointer, namelen int32) (err error) { + r1, _, e1 := syscall.Syscall(procbind.Addr(), 3, uintptr(s), uintptr(name), uintptr(namelen)) + if r1 == socketError { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} diff --git a/vendor/github.com/Microsoft/hcsshim/Protobuild.toml b/vendor/github.com/Microsoft/hcsshim/Protobuild.toml new file mode 100644 index 00000000..47d7650f --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/Protobuild.toml @@ -0,0 +1,54 @@ +version = "unstable" +generator = "gogoctrd" +plugins = ["grpc", "fieldpath"] + +# Control protoc include paths. Below are usually some good defaults, but feel +# free to try it without them if it works for your project. +[includes] + # Include paths that will be added before all others. Typically, you want to + # treat the root of the project as an include, but this may not be necessary. + before = ["./protobuf"] + + # Paths that should be treated as include roots in relation to the vendor + # directory. These will be calculated with the vendor directory nearest the + # target package. + packages = ["github.com/gogo/protobuf"] + + # Paths that will be added untouched to the end of the includes. We use + # `/usr/local/include` to pickup the common install location of protobuf. + # This is the default. + after = ["/usr/local/include"] + +# This section maps protobuf imports to Go packages. These will become +# `-M` directives in the call to the go protobuf generator. +[packages] + "gogoproto/gogo.proto" = "github.com/gogo/protobuf/gogoproto" + "google/protobuf/any.proto" = "github.com/gogo/protobuf/types" + "google/protobuf/empty.proto" = "github.com/gogo/protobuf/types" + "google/protobuf/descriptor.proto" = "github.com/gogo/protobuf/protoc-gen-gogo/descriptor" + "google/protobuf/field_mask.proto" = "github.com/gogo/protobuf/types" + "google/protobuf/timestamp.proto" = "github.com/gogo/protobuf/types" + "google/protobuf/duration.proto" = "github.com/gogo/protobuf/types" + "github/containerd/cgroups/stats/v1/metrics.proto" = "github.com/containerd/cgroups/stats/v1" + +[[overrides]] +prefixes = ["github.com/Microsoft/hcsshim/internal/shimdiag"] +plugins = ["ttrpc"] + +# Lock down runhcs config + +[[descriptors]] +prefix = "github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options" +target = "cmd/containerd-shim-runhcs-v1/options/next.pb.txt" +ignore_files = [ + "google/protobuf/descriptor.proto", + "gogoproto/gogo.proto" +] + +[[descriptors]] +prefix = "github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/stats" +target = "cmd/containerd-shim-runhcs-v1/stats/next.pb.txt" +ignore_files = [ + "google/protobuf/descriptor.proto", + "gogoproto/gogo.proto" +] \ No newline at end of file diff --git a/vendor/github.com/Microsoft/hcsshim/appveyor.yml b/vendor/github.com/Microsoft/hcsshim/appveyor.yml index a8ec5a59..661bc406 100644 --- a/vendor/github.com/Microsoft/hcsshim/appveyor.yml +++ b/vendor/github.com/Microsoft/hcsshim/appveyor.yml @@ -8,22 +8,34 @@ environment: GOPATH: c:\gopath PATH: C:\mingw-w64\x86_64-7.2.0-posix-seh-rt_v5-rev1\mingw64\bin;%GOPATH%\bin;C:\gometalinter-2.0.12-windows-amd64;%PATH% -stack: go 1.11 +stack: go 1.13.4 build_script: - appveyor DownloadFile https://github.com/alecthomas/gometalinter/releases/download/v2.0.12/gometalinter-2.0.12-windows-amd64.zip - 7z x gometalinter-2.0.12-windows-amd64.zip -y -oC:\ > NUL - gometalinter.exe --config .gometalinter.json ./... - - go build ./cmd/wclayer + - go build ./cmd/containerd-shim-runhcs-v1 - go build ./cmd/runhcs - go build ./cmd/tar2ext4 + - go build ./cmd/wclayer + - go build ./internal/tools/grantvmgroupaccess + - go build ./internal/tools/uvmboot + - go build ./internal/tools/zapdir - go test -v ./... -tags admin + - go test -c ./test/containerd-shim-runhcs-v1/ -tags functional + - go test -c ./test/cri-containerd/ -tags functional - go test -c ./test/functional/ -tags functional - - go test -c ./test/runhcs/ -tags integration + - go test -c ./test/runhcs/ -tags functional artifacts: - - path: 'wclayer.exe' + - path: 'containerd-shim-runhcs-v1.exe' - path: 'runhcs.exe' - path: 'tar2ext4.exe' + - path: 'wclayer.exe' + - path: 'grantvmgroupaccess.exe' + - path: 'uvmboot.exe' + - path: 'zapdir.exe' + - path: 'containerd-shim-runhcs-v1.test.exe' + - path: 'cri-containerd.test.exe' - path: 'functional.test.exe' - path: 'runhcs.test.exe' \ No newline at end of file diff --git a/vendor/github.com/Microsoft/hcsshim/container.go b/vendor/github.com/Microsoft/hcsshim/container.go index e142c315..7205a62c 100644 --- a/vendor/github.com/Microsoft/hcsshim/container.go +++ b/vendor/github.com/Microsoft/hcsshim/container.go @@ -1,8 +1,10 @@ package hcsshim import ( + "context" "fmt" "os" + "sync" "time" "github.com/Microsoft/hcsshim/internal/hcs" @@ -52,7 +54,10 @@ const ( type ResourceModificationRequestResponse = schema1.ResourceModificationRequestResponse type container struct { - system *hcs.System + system *hcs.System + waitOnce sync.Once + waitErr error + waitCh chan struct{} } // createComputeSystemAdditionalJSON is read from the environment at initialisation @@ -71,61 +76,87 @@ func CreateContainer(id string, c *ContainerConfig) (Container, error) { return nil, fmt.Errorf("failed to merge additional JSON '%s': %s", createContainerAdditionalJSON, err) } - system, err := hcs.CreateComputeSystem(id, fullConfig) + system, err := hcs.CreateComputeSystem(context.Background(), id, fullConfig) if err != nil { return nil, err } - return &container{system}, err + return &container{system: system}, err } // OpenContainer opens an existing container by ID. func OpenContainer(id string) (Container, error) { - system, err := hcs.OpenComputeSystem(id) + system, err := hcs.OpenComputeSystem(context.Background(), id) if err != nil { return nil, err } - return &container{system}, err + return &container{system: system}, err } // GetContainers gets a list of the containers on the system that match the query func GetContainers(q ComputeSystemQuery) ([]ContainerProperties, error) { - return hcs.GetComputeSystems(q) + return hcs.GetComputeSystems(context.Background(), q) } // Start synchronously starts the container. func (container *container) Start() error { - return convertSystemError(container.system.Start(), container) + return convertSystemError(container.system.Start(context.Background()), container) } // Shutdown requests a container shutdown, but it may not actually be shutdown until Wait() succeeds. func (container *container) Shutdown() error { - return convertSystemError(container.system.Shutdown(), container) + err := container.system.Shutdown(context.Background()) + if err != nil { + return convertSystemError(err, container) + } + return &ContainerError{Container: container, Err: ErrVmcomputeOperationPending, Operation: "hcsshim::ComputeSystem::Shutdown"} } // Terminate requests a container terminate, but it may not actually be terminated until Wait() succeeds. func (container *container) Terminate() error { - return convertSystemError(container.system.Terminate(), container) + err := container.system.Terminate(context.Background()) + if err != nil { + return convertSystemError(err, container) + } + return &ContainerError{Container: container, Err: ErrVmcomputeOperationPending, Operation: "hcsshim::ComputeSystem::Terminate"} } // Waits synchronously waits for the container to shutdown or terminate. func (container *container) Wait() error { - return convertSystemError(container.system.Wait(), container) + err := container.system.Wait() + if err == nil { + err = container.system.ExitError() + } + return convertSystemError(err, container) } // WaitTimeout synchronously waits for the container to terminate or the duration to elapse. It // returns false if timeout occurs. -func (container *container) WaitTimeout(t time.Duration) error { - return convertSystemError(container.system.WaitTimeout(t), container) +func (container *container) WaitTimeout(timeout time.Duration) error { + container.waitOnce.Do(func() { + container.waitCh = make(chan struct{}) + go func() { + container.waitErr = container.Wait() + close(container.waitCh) + }() + }) + t := time.NewTimer(timeout) + defer t.Stop() + select { + case <-t.C: + return &ContainerError{Container: container, Err: ErrTimeout, Operation: "hcsshim::ComputeSystem::Wait"} + case <-container.waitCh: + return container.waitErr + } } // Pause pauses the execution of a container. func (container *container) Pause() error { - return convertSystemError(container.system.Pause(), container) + return convertSystemError(container.system.Pause(context.Background()), container) } // Resume resumes the execution of a container. func (container *container) Resume() error { - return convertSystemError(container.system.Resume(), container) + return convertSystemError(container.system.Resume(context.Background()), container) } // HasPendingUpdates returns true if the container has updates pending to install @@ -135,7 +166,7 @@ func (container *container) HasPendingUpdates() (bool, error) { // Statistics returns statistics for the container. This is a legacy v1 call func (container *container) Statistics() (Statistics, error) { - properties, err := container.system.Properties(schema1.PropertyTypeStatistics) + properties, err := container.system.Properties(context.Background(), schema1.PropertyTypeStatistics) if err != nil { return Statistics{}, convertSystemError(err, container) } @@ -145,7 +176,7 @@ func (container *container) Statistics() (Statistics, error) { // ProcessList returns an array of ProcessListItems for the container. This is a legacy v1 call func (container *container) ProcessList() ([]ProcessListItem, error) { - properties, err := container.system.Properties(schema1.PropertyTypeProcessList) + properties, err := container.system.Properties(context.Background(), schema1.PropertyTypeProcessList) if err != nil { return nil, convertSystemError(err, container) } @@ -155,7 +186,7 @@ func (container *container) ProcessList() ([]ProcessListItem, error) { // This is a legacy v1 call func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskController, error) { - properties, err := container.system.Properties(schema1.PropertyTypeMappedVirtualDisk) + properties, err := container.system.Properties(context.Background(), schema1.PropertyTypeMappedVirtualDisk) if err != nil { return nil, convertSystemError(err, container) } @@ -165,20 +196,20 @@ func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskContr // CreateProcess launches a new process within the container. func (container *container) CreateProcess(c *ProcessConfig) (Process, error) { - p, err := container.system.CreateProcess(c) + p, err := container.system.CreateProcess(context.Background(), c) if err != nil { return nil, convertSystemError(err, container) } - return &process{p}, nil + return &process{p: p.(*hcs.Process)}, nil } // OpenProcess gets an interface to an existing process within the container. func (container *container) OpenProcess(pid int) (Process, error) { - p, err := container.system.OpenProcess(pid) + p, err := container.system.OpenProcess(context.Background(), pid) if err != nil { return nil, convertSystemError(err, container) } - return &process{p}, nil + return &process{p: p}, nil } // Close cleans up any state associated with the container but does not terminate or wait for it. @@ -188,5 +219,5 @@ func (container *container) Close() error { // Modify the System func (container *container) Modify(config *ResourceModificationRequestResponse) error { - return convertSystemError(container.system.Modify(config), container) + return convertSystemError(container.system.Modify(context.Background(), config), container) } diff --git a/vendor/github.com/Microsoft/hcsshim/go.mod b/vendor/github.com/Microsoft/hcsshim/go.mod new file mode 100644 index 00000000..72d253da --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/go.mod @@ -0,0 +1,37 @@ +module github.com/Microsoft/hcsshim + +go 1.13 + +require ( + github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5 + github.com/blang/semver v3.1.0+incompatible // indirect + github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f + github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1 + github.com/containerd/containerd v1.3.0-beta.2.0.20190828155532-0293cbd26c69 + github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc // indirect + github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448 // indirect + github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3 + github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de + github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd + github.com/gogo/protobuf v1.2.1 + github.com/hashicorp/errwrap v0.0.0-20141028054710-7554cd9344ce // indirect + github.com/hashicorp/go-multierror v0.0.0-20161216184304-ed905158d874 // indirect + github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2 // indirect + github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f // indirect + github.com/opencontainers/runtime-spec v0.1.2-0.20190507144316-5b71a03e2700 + github.com/opencontainers/runtime-tools v0.0.0-20181011054405-1d69bd0f9c39 + github.com/pkg/errors v0.8.1 + github.com/prometheus/procfs v0.0.5 // indirect + github.com/sirupsen/logrus v1.4.1 + github.com/syndtr/gocapability v0.0.0-20170704070218-db04d3cc01c8 // indirect + github.com/urfave/cli v0.0.0-20171014202726-7bc6a0acffa5 + github.com/xeipuuv/gojsonpointer v0.0.0-20180127040702-4e3ac2762d5f // indirect + github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415 // indirect + github.com/xeipuuv/gojsonschema v0.0.0-20180618132009-1d523034197f // indirect + go.opencensus.io v0.22.0 + golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6 + golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 + google.golang.org/grpc v1.20.1 + gotest.tools v2.2.0+incompatible // indirect + k8s.io/kubernetes v1.13.0 +) diff --git a/vendor/github.com/Microsoft/hcsshim/go.sum b/vendor/github.com/Microsoft/hcsshim/go.sum new file mode 100644 index 00000000..578b78e8 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/go.sum @@ -0,0 +1,131 @@ +cloud.google.com/go v0.26.0/go.mod h1:aQUYkXzVsufM+DwF1aE+0xfcU+56JwCaLick0ClmMTw= +github.com/BurntSushi/toml v0.3.1/go.mod h1:xHWCNGjB5oqiDr8zfno3MHue2Ht5sIBksp03qcyfWMU= +github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5 h1:ygIc8M6trr62pF5DucadTWGdEB4mEyvzi0e2nbcmcyA= +github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5/go.mod h1:tTuCMEN+UleMWgg9dVx4Hu52b1bJo+59jBh3ajtinzw= +github.com/blang/semver v3.1.0+incompatible h1:7hqmJYuaEK3qwVjWubYiht3j93YI0WQBuysxHIfUriU= +github.com/blang/semver v3.1.0+incompatible/go.mod h1:kRBLl5iJ+tD4TcOOxsy/0fnwebNt5EWlYSAyrTnjyyk= +github.com/client9/misspell v0.3.4/go.mod h1:qj6jICC3Q7zFZvVWo7KLAzC3yx5G7kyvSDkc90ppPyw= +github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f h1:tSNMc+rJDfmYntojat8lljbt1mgKNpTxUZJsSzJ9Y1s= +github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f/go.mod h1:OApqhQ4XNSNC13gXIwDjhOQxjWa/NxkwZXJ1EvqT0ko= +github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1 h1:uict5mhHFTzKLUCufdSLym7z/J0CbBJT59lYbP9wtbg= +github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1/go.mod h1:Tj/on1eG8kiEhd0+fhSDzsPAFESxzBBvdyEgyryXffw= +github.com/containerd/containerd v1.3.0-beta.2.0.20190828155532-0293cbd26c69 h1:rG1clvJbgsUcmb50J82YUJhUMopWNtZvyMZjb+4fqGw= +github.com/containerd/containerd v1.3.0-beta.2.0.20190828155532-0293cbd26c69/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= +github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc h1:TP+534wVlf61smEIq1nwLLAjQVEK2EADoW3CX9AuT+8= +github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y= +github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448 h1:PUD50EuOMkXVcpBIA/R95d56duJR9VxhwncsFbNnxW4= +github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448/go.mod h1:ODA38xgv3Kuk8dQz2ZQXpnv/UZZUHUCL7pnLehbXgQI= +github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3 h1:esQOJREg8nw8aXj6uCN5dfW5cKUBiEJ/+nni1Q/D/sw= +github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3/go.mod h1:IV7qH3hrUgRmyYrtgEeGWJfWbgcHL9CSRruz2Vqcph0= +github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de h1:dlfGmNcE3jDAecLqwKPMNX6nk2qh1c1Vg1/YTzpOOF4= +github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de/go.mod h1:PvCDdDGpgqzQIzDW1TphrGLssLDZp2GuS+X5DkEJB8o= +github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd h1:JNn81o/xG+8NEo3bC/vx9pbi/g2WI8mtP2/nXzu297Y= +github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd/go.mod h1:Cm3kwCdlkCfMSHURc+r6fwoGH6/F1hH3S4sg0rLFWPc= +github.com/coreos/go-systemd v0.0.0-20190321100706-95778dfbb74e h1:Wf6HqHfScWJN9/ZjdUKyjop4mf3Qdd+1TvvltAvM3m8= +github.com/coreos/go-systemd v0.0.0-20190321100706-95778dfbb74e/go.mod h1:F5haX7vjVVG0kc13fIWeqUViNPyEJxv/OmvnBo0Yme4= +github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c= +github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38= +github.com/docker/go-units v0.4.0 h1:3uh0PgVws3nIA0Q+MwDC8yjEPf9zjRfZZWXZYDct3Tw= +github.com/docker/go-units v0.4.0/go.mod h1:fgPhTUdO+D/Jk86RDLlptpiXQzgHJF7gydDDbaIK4Dk= +github.com/godbus/dbus v0.0.0-20190422162347-ade71ed3457e h1:BWhy2j3IXJhjCbC68FptL43tDKIq8FladmaTs3Xs7Z8= +github.com/godbus/dbus v0.0.0-20190422162347-ade71ed3457e/go.mod h1:bBOAhwG1umN6/6ZUMtDFBMQR8jRg9O75tm9K00oMsK4= +github.com/gogo/protobuf v1.2.1 h1:/s5zKNz0uPFCZ5hddgPdo2TK2TVrUNMn0OOX8/aZMTE= +github.com/gogo/protobuf v1.2.1/go.mod h1:hp+jE20tsWTFYpLwKvXlhS1hjn+gTNwPg2I6zVXpSg4= +github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b h1:VKtxabqXZkF25pY9ekfRL6a582T4P37/31XEstQ5p58= +github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b/go.mod h1:SBH7ygxi8pfUlaOkMMuAQtPIUF8ecWP5IEl/CR7VP2Q= +github.com/golang/mock v1.1.1/go.mod h1:oTYuIxOrZwtPieC+H1uAHpcLFnEyAGVDL/k47Jfbm0A= +github.com/golang/protobuf v1.2.0 h1:P3YflyNX/ehuJFLhxviNdFxQPkGK5cDcApsge1SqnvM= +github.com/golang/protobuf v1.2.0/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= +github.com/golang/protobuf v1.3.1 h1:YF8+flBXS5eO826T4nzqPrxfhQThhXl0YzfuUPu4SBg= +github.com/golang/protobuf v1.3.1/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= +github.com/google/go-cmp v0.3.0 h1:crn/baboCvb5fXaQ0IJ1SGTsTVrWpDsCWC8EGETZijY= +github.com/google/go-cmp v0.3.0/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU= +github.com/hashicorp/errwrap v0.0.0-20141028054710-7554cd9344ce h1:prjrVgOk2Yg6w+PflHoszQNLTUh4kaByUcEWM/9uin4= +github.com/hashicorp/errwrap v0.0.0-20141028054710-7554cd9344ce/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4= +github.com/hashicorp/go-multierror v0.0.0-20161216184304-ed905158d874 h1:cAv7ZbSmyb1wjn6T4TIiyFCkpcfgpbcNNC3bM2srLaI= +github.com/hashicorp/go-multierror v0.0.0-20161216184304-ed905158d874/go.mod h1:JMRHfdO9jKNzS/+BTlxCjKNQHg/jZAft8U7LloJvN7I= +github.com/hashicorp/golang-lru v0.5.1 h1:0hERBMJE1eitiLkihrMvRVBYAkpHzc/J3QdDN+dAcgU= +github.com/hashicorp/golang-lru v0.5.1/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8= +github.com/kisielk/errcheck v1.1.0/go.mod h1:EZBBE59ingxPouuu3KfxchcWSUPOHkagtvWXihfKN4Q= +github.com/kisielk/gotool v1.0.0/go.mod h1:XhKaO+MFFWcvkIS/tQcRk01m1F5IRFswLeQ+oQHNcck= +github.com/konsorten/go-windows-terminal-sequences v1.0.1 h1:mweAR1A6xJ3oS2pRaGiHgQ4OO8tzTaLawm8vnODuwDk= +github.com/konsorten/go-windows-terminal-sequences v1.0.1/go.mod h1:T0+1ngSBFLxvqU3pZ+m/2kptfBszLMUkC4ZK/EgS/cQ= +github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2 h1:QhPf3A2AZW3tTGvHPg0TA+CR3oHbVLlXUhlghqISp1I= +github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s= +github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f h1:a969LJ4IQFwRHYqonHtUDMSh9i54WcKggeEkQ3fZMl4= +github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U= +github.com/opencontainers/runtime-spec v0.1.2-0.20190507144316-5b71a03e2700 h1:eNUVfm/RFLIi1G7flU5/ZRTHvd4kcVuzfRnL6OFlzCI= +github.com/opencontainers/runtime-spec v0.1.2-0.20190507144316-5b71a03e2700/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0= +github.com/opencontainers/runtime-tools v0.0.0-20181011054405-1d69bd0f9c39 h1:H7DMc6FAjgwZZi8BRqjrAAHWoqEr5e5L6pS4V0ezet4= +github.com/opencontainers/runtime-tools v0.0.0-20181011054405-1d69bd0f9c39/go.mod h1:r3f7wjNzSs2extwzU3Y+6pKfobzPh+kKFJ3ofN+3nfs= +github.com/pkg/errors v0.8.1 h1:iURUrRGxPUNPdy5/HRSm+Yj6okJ6UtLINN0Q9M4+h3I= +github.com/pkg/errors v0.8.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0= +github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM= +github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4= +github.com/prometheus/procfs v0.0.5 h1:3+auTFlqw+ZaQYJARz6ArODtkaIwtvBTx3N2NehQlL8= +github.com/prometheus/procfs v0.0.5/go.mod h1:4A/X28fw3Fc593LaREMrKMqOKvUAntwMDaekg4FpcdQ= +github.com/sirupsen/logrus v1.4.1 h1:GL2rEmy6nsikmW0r8opw9JIRScdMF5hA8cOYLH7In1k= +github.com/sirupsen/logrus v1.4.1/go.mod h1:ni0Sbl8bgC9z8RoU9G6nDWqqs/fq4eDPysMBDgk/93Q= +github.com/stretchr/objx v0.1.1/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME= +github.com/stretchr/testify v1.2.2 h1:bSDNvY7ZPG5RlJ8otE/7V6gMiyenm9RtJ7IUVIAoJ1w= +github.com/stretchr/testify v1.2.2/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXfy6kDkUVs= +github.com/syndtr/gocapability v0.0.0-20170704070218-db04d3cc01c8 h1:zLV6q4e8Jv9EHjNg/iHfzwDkCve6Ua5jCygptrtXHvI= +github.com/syndtr/gocapability v0.0.0-20170704070218-db04d3cc01c8/go.mod h1:hkRG7XYTFWNJGYcbNJQlaLq0fg1yr4J4t/NcTQtrfww= +github.com/urfave/cli v0.0.0-20171014202726-7bc6a0acffa5 h1:MCfT24H3f//U5+UCrZp1/riVO3B50BovxtDiNn0XKkk= +github.com/urfave/cli v0.0.0-20171014202726-7bc6a0acffa5/go.mod h1:70zkFmudgCuE/ngEzBv17Jvp/497gISqfk5gWijbERA= +github.com/xeipuuv/gojsonpointer v0.0.0-20180127040702-4e3ac2762d5f h1:J9EGpcZtP0E/raorCMxlFGSTBrsSlaDGf3jU/qvAE2c= +github.com/xeipuuv/gojsonpointer v0.0.0-20180127040702-4e3ac2762d5f/go.mod h1:N2zxlSyiKSe5eX1tZViRH5QA0qijqEDrYZiPEAiq3wU= +github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415 h1:EzJWgHovont7NscjpAxXsDA8S8BMYve8Y5+7cuRE7R0= +github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415/go.mod h1:GwrjFmJcFw6At/Gs6z4yjiIwzuJ1/+UwLxMQDVQXShQ= +github.com/xeipuuv/gojsonschema v0.0.0-20180618132009-1d523034197f h1:mvXjJIHRZyhNuGassLTcXTwjiWq7NmjdavZsUnmFybQ= +github.com/xeipuuv/gojsonschema v0.0.0-20180618132009-1d523034197f/go.mod h1:5yf86TLmAcydyeJq5YvxkGPE2fm/u4myDekKRoLuqhs= +go.opencensus.io v0.22.0 h1:C9hSCOW830chIVkdja34wa6Ky+IzWllkUinR+BtRZd4= +go.opencensus.io v0.22.0/go.mod h1:+kGneAE2xo2IficOXnaByMWTGM9T73dGwxeWcUqIpI8= +golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACkg1iLfiJU5Ep61QUkGW8qpdssI0+w= +golang.org/x/exp v0.0.0-20190121172915-509febef88a4/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA= +golang.org/x/lint v0.0.0-20181026193005-c67002cb31c3/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE= +golang.org/x/lint v0.0.0-20190227174305-5b3e6a55c961/go.mod h1:wehouNa3lNwaWXcvxsM5YxQ5yQlVC4a0KAMCusXpPoU= +golang.org/x/lint v0.0.0-20190313153728-d0100b6bd8b3/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc= +golang.org/x/net v0.0.0-20180724234803-3673e40ba225/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20180826012351-8a410e7b638d/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20190213061140-3a22650c66bd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20190311183353-d8887717615a h1:oWX7TPOiFAMXLq8o0ikBYfCJVlRHBcsciT5bXOrH628= +golang.org/x/net v0.0.0-20190311183353-d8887717615a/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= +golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09 h1:KaQtG+aDELoNmXYas3TVkGNYRuq8JQ1aa7LJt8EXVyo= +golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= +golang.org/x/oauth2 v0.0.0-20180821212333-d2e6202438be/go.mod h1:N/0e6XlmueqKjAGxoOufVs8QHGRruUQn6yWY3a++T0U= +golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20181108010431-42b317875d0f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20181221193216-37e7f081c4d4/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6 h1:bjcUS9ztw9kFmmIxJInhon/0Is3p+EHBKNgquIzo1OI= +golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sys v0.0.0-20180830151530-49385e6e1522/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20180905080454-ebe1bf3edb33/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190514135907-3a4b5fb9f71f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 h1:7TYNF4UdlohbFwpNH04CoPMp1cHUZgO1Ebq5r2hIjfo= +golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/text v0.3.0 h1:g61tztE5qeGQ89tm6NTjjM9VPIm088od1l6aSorWRWg= +golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= +golang.org/x/text v0.3.2 h1:tW2bmiBqwgJj/UpqtC8EpXEZVYOwU0yG4iWbprSVAcs= +golang.org/x/text v0.3.2/go.mod h1:bEr9sfX3Q8Zfm5fL9x+3itogRgK3+ptLWKqgva+5dAk= +golang.org/x/tools v0.0.0-20180221164845-07fd8470d635/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20190114222345-bf090417da8b/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20190226205152-f727befe758c/go.mod h1:9Yl7xja0Znq3iFh3HoIrodX9oNMXvdceNzlUR8zjMvY= +golang.org/x/tools v0.0.0-20190311212946-11955173bddd/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs= +google.golang.org/appengine v1.1.0/go.mod h1:EbEs0AVv82hx2wNQdGPgUI5lhzA/G0D9YwlJXL52JkM= +google.golang.org/appengine v1.4.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4= +google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8 h1:Nw54tB0rB7hY/N0NQvRW8DG4Yk3Q6T9cu9RcFQDu1tc= +google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8/go.mod h1:JiN7NxoALGmiZfu7CAH4rXhgtRTLTxftemlI0sWmxmc= +google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb h1:i1Ppqkc3WQXikh8bXiwHqAN5Rv3/qDCcRk0/Otx73BY= +google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE= +google.golang.org/grpc v1.19.0/go.mod h1:mqu4LbDTu4XGKhr4mRzUsmM4RtVoemTSY81AxZiDr8c= +google.golang.org/grpc v1.20.1 h1:Hz2g2wirWK7H0qIIhGIqRGTuMwTE8HEKFnDZZ7lm9NU= +google.golang.org/grpc v1.20.1/go.mod h1:10oTOabMzJvdu6/UiuZezV6QK5dSlG84ov/aaiqXj38= +gotest.tools v2.2.0+incompatible h1:VsBPFP1AI068pPrMxtb/S8Zkgf9xEmTLJjfM+P5UIEo= +gotest.tools v2.2.0+incompatible/go.mod h1:DsYFclhRJ6vuDpmuTbkuFWG+y2sxOXAzmJt81HFBacw= +honnef.co/go/tools v0.0.0-20190102054323-c2f93a96b099/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4= +k8s.io/kubernetes v1.13.0 h1:qTfB+u5M92k2fCCCVP2iuhgwwSOv1EkAkvQY1tQODD8= +k8s.io/kubernetes v1.13.0/go.mod h1:ocZa8+6APFNC2tX1DZASIbocyYT5jHzqFVsY5aoB7Jk= diff --git a/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go b/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go index eb013d2c..09b3860a 100644 --- a/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go +++ b/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go @@ -39,11 +39,21 @@ func HNSListEndpointRequest() ([]HNSEndpoint, error) { // HotAttachEndpoint makes a HCS Call to attach the endpoint to the container func HotAttachEndpoint(containerID string, endpointID string) error { + endpoint, err := GetHNSEndpointByID(endpointID) + isAttached, err := endpoint.IsAttached(containerID) + if isAttached { + return err + } return modifyNetworkEndpoint(containerID, endpointID, Add) } // HotDetachEndpoint makes a HCS Call to detach the endpoint from the container func HotDetachEndpoint(containerID string, endpointID string) error { + endpoint, err := GetHNSEndpointByID(endpointID) + isAttached, err := endpoint.IsAttached(containerID) + if !isAttached { + return err + } return modifyNetworkEndpoint(containerID, endpointID, Remove) } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go b/vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go new file mode 100644 index 00000000..8193315f --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go @@ -0,0 +1,83 @@ +package cow + +import ( + "context" + "io" + + "github.com/Microsoft/hcsshim/internal/schema1" + hcsschema "github.com/Microsoft/hcsshim/internal/schema2" +) + +// Process is the interface for an OS process running in a container or utility VM. +type Process interface { + // Close releases resources associated with the process and closes the + // writer and readers returned by Stdio. Depending on the implementation, + // this may also terminate the process. + Close() error + // CloseStdin causes the process's stdin handle to receive EOF/EPIPE/whatever + // is appropriate to indicate that no more data is available. + CloseStdin(ctx context.Context) error + // Pid returns the process ID. + Pid() int + // Stdio returns the stdio streams for a process. These may be nil if a stream + // was not requested during CreateProcess. + Stdio() (_ io.Writer, _ io.Reader, _ io.Reader) + // ResizeConsole resizes the virtual terminal associated with the process. + ResizeConsole(ctx context.Context, width, height uint16) error + // Kill sends a SIGKILL or equivalent signal to the process and returns whether + // the signal was delivered. It does not wait for the process to terminate. + Kill(ctx context.Context) (bool, error) + // Signal sends a signal to the process and returns whether the signal was + // delivered. The input is OS specific (either + // guestrequest.SignalProcessOptionsWCOW or + // guestrequest.SignalProcessOptionsLCOW). It does not wait for the process + // to terminate. + Signal(ctx context.Context, options interface{}) (bool, error) + // Wait waits for the process to complete, or for a connection to the process to be + // terminated by some error condition (including calling Close). + Wait() error + // ExitCode returns the exit code of the process. Returns an error if the process is + // not running. + ExitCode() (int, error) +} + +// ProcessHost is the interface for creating processes. +type ProcessHost interface { + // CreateProcess creates a process. The configuration is host specific + // (either hcsschema.ProcessParameters or lcow.ProcessParameters). + CreateProcess(ctx context.Context, config interface{}) (Process, error) + // OS returns the host's operating system, "linux" or "windows". + OS() string + // IsOCI specifies whether this is an OCI-compliant process host. If true, + // then the configuration passed to CreateProcess should have an OCI process + // spec (or nil if this is the initial process in an OCI container). + // Otherwise, it should have the HCS-specific process parameters. + IsOCI() bool +} + +// Container is the interface for container objects, either running on the host or +// in a utility VM. +type Container interface { + ProcessHost + // Close releases the resources associated with the container. Depending on + // the implementation, this may also terminate the container. + Close() error + // ID returns the container ID. + ID() string + // Properties returns the requested container properties targeting a V1 schema container. + Properties(ctx context.Context, types ...schema1.PropertyType) (*schema1.ContainerProperties, error) + // PropertiesV2 returns the requested container properties targeting a V2 schema container. + PropertiesV2(ctx context.Context, types ...hcsschema.PropertyType) (*hcsschema.Properties, error) + // Start starts a container. + Start(ctx context.Context) error + // Shutdown sends a shutdown request to the container (but does not wait for + // the shutdown to complete). + Shutdown(ctx context.Context) error + // Terminate sends a terminate request to the container (but does not wait + // for the terminate to complete). + Terminate(ctx context.Context) error + // Wait waits for the container to terminate, or for the connection to the + // container to be terminated by some error condition (including calling + // Close). + Wait() error +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go b/vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go deleted file mode 100644 index 5d3d0dfe..00000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go +++ /dev/null @@ -1,100 +0,0 @@ -package guestrequest - -import ( - "github.com/Microsoft/hcsshim/internal/schema2" -) - -// Arguably, many of these (at least CombinedLayers) should have been generated -// by swagger. -// -// This will also change package name due to an inbound breaking change. - -// This class is used by a modify request to add or remove a combined layers -// structure in the guest. For windows, the GCS applies a filter in ContainerRootPath -// using the specified layers as the parent content. Ignores property ScratchPath -// since the container path is already the scratch path. For linux, the GCS unions -// the specified layers and ScratchPath together, placing the resulting union -// filesystem at ContainerRootPath. -type CombinedLayers struct { - ContainerRootPath string `json:"ContainerRootPath,omitempty"` - Layers []hcsschema.Layer `json:"Layers,omitempty"` - ScratchPath string `json:"ScratchPath,omitempty"` -} - -// Defines the schema for hosted settings passed to GCS and/or OpenGCS - -// SCSI. Scratch space for remote file-system commands, or R/W layer for containers -type LCOWMappedVirtualDisk struct { - MountPath string `json:"MountPath,omitempty"` // /tmp/scratch for an LCOW utility VM being used as a service VM - Lun uint8 `json:"Lun,omitempty"` - Controller uint8 `json:"Controller,omitempty"` - ReadOnly bool `json:"ReadOnly,omitempty"` -} - -type WCOWMappedVirtualDisk struct { - ContainerPath string `json:"ContainerPath,omitempty"` - Lun int32 `json:"Lun,omitempty"` -} - -type LCOWMappedDirectory struct { - MountPath string `json:"MountPath,omitempty"` - Port int32 `json:"Port,omitempty"` - ShareName string `json:"ShareName,omitempty"` // If empty not using ANames (not currently supported) - ReadOnly bool `json:"ReadOnly,omitempty"` -} - -// Read-only layers over VPMem -type LCOWMappedVPMemDevice struct { - DeviceNumber uint32 `json:"DeviceNumber,omitempty"` - MountPath string `json:"MountPath,omitempty"` // /tmp/pN -} - -type LCOWNetworkAdapter struct { - NamespaceID string `json:",omitempty"` - ID string `json:",omitempty"` - MacAddress string `json:",omitempty"` - IPAddress string `json:",omitempty"` - PrefixLength uint8 `json:",omitempty"` - GatewayAddress string `json:",omitempty"` - DNSSuffix string `json:",omitempty"` - DNSServerList string `json:",omitempty"` - EnableLowMetric bool `json:",omitempty"` - EncapOverhead uint16 `json:",omitempty"` -} - -type ResourceType string - -const ( - // These are constants for v2 schema modify guest requests. - ResourceTypeMappedDirectory ResourceType = "MappedDirectory" - ResourceTypeMappedVirtualDisk ResourceType = "MappedVirtualDisk" - ResourceTypeNetwork ResourceType = "Network" - ResourceTypeNetworkNamespace ResourceType = "NetworkNamespace" - ResourceTypeCombinedLayers ResourceType = "CombinedLayers" - ResourceTypeVPMemDevice ResourceType = "VPMemDevice" -) - -// GuestRequest is for modify commands passed to the guest. -type GuestRequest struct { - RequestType string `json:"RequestType,omitempty"` - ResourceType ResourceType `json:"ResourceType,omitempty"` - Settings interface{} `json:"Settings,omitempty"` -} - -type NetworkModifyRequest struct { - AdapterId string `json:"AdapterId,omitempty"` - RequestType string `json:"RequestType,omitempty"` - Settings interface{} `json:"Settings,omitempty"` -} - -type RS4NetworkModifyRequest struct { - AdapterInstanceId string `json:"AdapterInstanceId,omitempty"` - RequestType string `json:"RequestType,omitempty"` - Settings interface{} `json:"Settings,omitempty"` -} - -// SignalProcessOptions is the options passed to either WCOW or LCOW -// to signal a given process. -type SignalProcessOptions struct { - Signal int `json:,omitempty` -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go b/vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go deleted file mode 100644 index e9e45c03..00000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go +++ /dev/null @@ -1,69 +0,0 @@ -package guid - -import ( - "crypto/rand" - "encoding/json" - "fmt" - "io" - "strconv" - "strings" -) - -var _ = (json.Marshaler)(&GUID{}) -var _ = (json.Unmarshaler)(&GUID{}) - -type GUID [16]byte - -func New() GUID { - g := GUID{} - _, err := io.ReadFull(rand.Reader, g[:]) - if err != nil { - panic(err) - } - return g -} - -func (g GUID) String() string { - return fmt.Sprintf("%02x%02x%02x%02x-%02x%02x-%02x%02x-%02x-%02x", g[3], g[2], g[1], g[0], g[5], g[4], g[7], g[6], g[8:10], g[10:]) -} - -func FromString(s string) GUID { - if len(s) != 36 { - panic(fmt.Sprintf("invalid GUID length: %d", len(s))) - } - if s[8] != '-' || s[13] != '-' || s[18] != '-' || s[23] != '-' { - panic("invalid GUID format") - } - indexOrder := [16]int{ - 0, 2, 4, 6, - 9, 11, - 14, 16, - 19, 21, - 24, 26, 28, 30, 32, 34, - } - byteOrder := [16]int{ - 3, 2, 1, 0, - 5, 4, - 7, 6, - 8, 9, - 10, 11, 12, 13, 14, 15, - } - var g GUID - for i, x := range indexOrder { - b, err := strconv.ParseInt(s[x:x+2], 16, 16) - if err != nil { - panic(err) - } - g[byteOrder[i]] = byte(b) - } - return g -} - -func (g GUID) MarshalJSON() ([]byte, error) { - return json.Marshal(g.String()) -} - -func (g *GUID) UnmarshalJSON(data []byte) error { - *g = FromString(strings.Trim(string(data), "\"")) - return nil -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go index f9a922a4..62ba8175 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go @@ -1,10 +1,13 @@ package hcs import ( + "fmt" "sync" "syscall" "github.com/Microsoft/hcsshim/internal/interop" + "github.com/Microsoft/hcsshim/internal/logfields" + "github.com/Microsoft/hcsshim/internal/vmcompute" "github.com/sirupsen/logrus" ) @@ -40,35 +43,83 @@ var ( ) type hcsNotification uint32 + +func (hn hcsNotification) String() string { + switch hn { + case hcsNotificationSystemExited: + return "SystemExited" + case hcsNotificationSystemCreateCompleted: + return "SystemCreateCompleted" + case hcsNotificationSystemStartCompleted: + return "SystemStartCompleted" + case hcsNotificationSystemPauseCompleted: + return "SystemPauseCompleted" + case hcsNotificationSystemResumeCompleted: + return "SystemResumeCompleted" + case hcsNotificationSystemCrashReport: + return "SystemCrashReport" + case hcsNotificationSystemSiloJobCreated: + return "SystemSiloJobCreated" + case hcsNotificationSystemSaveCompleted: + return "SystemSaveCompleted" + case hcsNotificationSystemRdpEnhancedModeStateChanged: + return "SystemRdpEnhancedModeStateChanged" + case hcsNotificationSystemShutdownFailed: + return "SystemShutdownFailed" + case hcsNotificationSystemGetPropertiesCompleted: + return "SystemGetPropertiesCompleted" + case hcsNotificationSystemModifyCompleted: + return "SystemModifyCompleted" + case hcsNotificationSystemCrashInitiated: + return "SystemCrashInitiated" + case hcsNotificationSystemGuestConnectionClosed: + return "SystemGuestConnectionClosed" + case hcsNotificationProcessExited: + return "ProcessExited" + case hcsNotificationInvalid: + return "Invalid" + case hcsNotificationServiceDisconnect: + return "ServiceDisconnect" + default: + return fmt.Sprintf("Unknown: %d", hn) + } +} + type notificationChannel chan error type notifcationWatcherContext struct { channels notificationChannels - handle hcsCallback + handle vmcompute.HcsCallback + + systemID string + processID int } type notificationChannels map[hcsNotification]notificationChannel -func newChannels() notificationChannels { +func newSystemChannels() notificationChannels { channels := make(notificationChannels) + for _, notif := range []hcsNotification{ + hcsNotificationServiceDisconnect, + hcsNotificationSystemExited, + hcsNotificationSystemCreateCompleted, + hcsNotificationSystemStartCompleted, + hcsNotificationSystemPauseCompleted, + hcsNotificationSystemResumeCompleted, + } { + channels[notif] = make(notificationChannel, 1) + } + return channels +} - channels[hcsNotificationSystemExited] = make(notificationChannel, 1) - channels[hcsNotificationSystemCreateCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemStartCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemPauseCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemResumeCompleted] = make(notificationChannel, 1) - channels[hcsNotificationProcessExited] = make(notificationChannel, 1) - channels[hcsNotificationServiceDisconnect] = make(notificationChannel, 1) - channels[hcsNotificationSystemCrashReport] = make(notificationChannel, 1) - channels[hcsNotificationSystemSiloJobCreated] = make(notificationChannel, 1) - channels[hcsNotificationSystemSaveCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemRdpEnhancedModeStateChanged] = make(notificationChannel, 1) - channels[hcsNotificationSystemShutdownFailed] = make(notificationChannel, 1) - channels[hcsNotificationSystemGetPropertiesCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemModifyCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemCrashInitiated] = make(notificationChannel, 1) - channels[hcsNotificationSystemGuestConnectionClosed] = make(notificationChannel, 1) - +func newProcessChannels() notificationChannels { + channels := make(notificationChannels) + for _, notif := range []hcsNotification{ + hcsNotificationServiceDisconnect, + hcsNotificationProcessExited, + } { + channels[notif] = make(notificationChannel, 1) + } return channels } @@ -92,12 +143,17 @@ func notificationWatcher(notificationType hcsNotification, callbackNumber uintpt return 0 } + log := logrus.WithFields(logrus.Fields{ + "notification-type": notificationType.String(), + "system-id": context.systemID, + }) + if context.processID != 0 { + log.Data[logfields.ProcessID] = context.processID + } + log.Debug("HCS notification") + if channel, ok := context.channels[notificationType]; ok { channel <- result - } else { - logrus.WithFields(logrus.Fields{ - "notification-type": notificationType, - }).Warn("Received a callback of an unsupported type") } return 0 diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go index 079b5653..9a4705a4 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go @@ -1,14 +1,14 @@ package hcs import ( + "context" "encoding/json" "errors" "fmt" + "net" "syscall" - "github.com/Microsoft/hcsshim/internal/interop" - "github.com/Microsoft/hcsshim/internal/logfields" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/log" ) var ( @@ -117,17 +117,11 @@ func (ev *ErrorEvent) String() string { return evs } -func processHcsResult(resultp *uint16) []ErrorEvent { - if resultp != nil { - resultj := interop.ConvertAndFreeCoTaskMemString(resultp) - logrus.WithField(logfields.JSON, resultj). - Debug("HCS Result") +func processHcsResult(ctx context.Context, resultJSON string) []ErrorEvent { + if resultJSON != "" { result := &hcsResult{} - if err := json.Unmarshal([]byte(resultj), result); err != nil { - logrus.WithFields(logrus.Fields{ - logfields.JSON: resultj, - logrus.ErrorKey: err, - }).Warning("Could not unmarshal HCS result") + if err := json.Unmarshal([]byte(resultJSON), result); err != nil { + log.G(ctx).WithError(err).Warning("Could not unmarshal HCS result") return nil } return result.ErrorEvents @@ -141,6 +135,8 @@ type HcsError struct { Events []ErrorEvent } +var _ net.Error = &HcsError{} + func (e *HcsError) Error() string { s := e.Op + ": " + e.Err.Error() for _, ev := range e.Events { @@ -149,6 +145,16 @@ func (e *HcsError) Error() string { return s } +func (e *HcsError) Temporary() bool { + err, ok := e.Err.(net.Error) + return ok && err.Temporary() +} + +func (e *HcsError) Timeout() bool { + err, ok := e.Err.(net.Error) + return ok && err.Timeout() +} + // ProcessError is an error encountered in HCS during an operation on a Process object type ProcessError struct { SystemID string @@ -158,6 +164,8 @@ type ProcessError struct { Events []ErrorEvent } +var _ net.Error = &ProcessError{} + // SystemError is an error encountered in HCS during an operation on a Container object type SystemError struct { ID string @@ -167,6 +175,8 @@ type SystemError struct { Events []ErrorEvent } +var _ net.Error = &SystemError{} + func (e *SystemError) Error() string { s := e.Op + " " + e.ID + ": " + e.Err.Error() for _, ev := range e.Events { @@ -178,6 +188,16 @@ func (e *SystemError) Error() string { return s } +func (e *SystemError) Temporary() bool { + err, ok := e.Err.(net.Error) + return ok && err.Temporary() +} + +func (e *SystemError) Timeout() bool { + err, ok := e.Err.(net.Error) + return ok && err.Timeout() +} + func makeSystemError(system *System, op string, extra string, err error, events []ErrorEvent) error { // Don't double wrap errors if _, ok := err.(*SystemError); ok { @@ -200,6 +220,16 @@ func (e *ProcessError) Error() string { return s } +func (e *ProcessError) Temporary() bool { + err, ok := e.Err.(net.Error) + return ok && err.Temporary() +} + +func (e *ProcessError) Timeout() bool { + err, ok := e.Err.(net.Error) + return ok && err.Timeout() +} + func makeProcessError(process *Process, op string, err error, events []ErrorEvent) error { // Don't double wrap errors if _, ok := err.(*ProcessError); ok { @@ -242,6 +272,9 @@ func IsPending(err error) bool { // IsTimeout returns a boolean indicating whether the error is caused by // a timeout waiting for the operation to complete. func IsTimeout(err error) bool { + if err, ok := err.(net.Error); ok && err.Timeout() { + return true + } err = getInnerError(err) return err == ErrTimeout } @@ -272,6 +305,13 @@ func IsNotSupported(err error) bool { err == ErrVmcomputeUnknownMessage } +// IsOperationInvalidState returns true when err is caused by +// `ErrVmcomputeOperationInvalidState`. +func IsOperationInvalidState(err error) bool { + err = getInnerError(err) + return err == ErrVmcomputeOperationInvalidState +} + func getInnerError(err error) error { switch pe := err.(type) { case nil: @@ -285,3 +325,12 @@ func getInnerError(err error) error { } return err } + +func getOperationLogResult(err error) (string, error) { + switch err { + case nil: + return "Success", nil + default: + return "Error", err + } +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go deleted file mode 100644 index b0d49cbc..00000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go +++ /dev/null @@ -1,48 +0,0 @@ -// Shim for the Host Compute Service (HCS) to manage Windows Server -// containers and Hyper-V containers. - -package hcs - -import ( - "syscall" -) - -//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hcs.go - -//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems? -//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem? -//sys hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem? -//sys hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem? -//sys hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem? -//sys hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem? -//sys hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem? -//sys hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem? -//sys hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem? -//sys hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties? -//sys hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem? -//sys hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback? -//sys hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback? - -//sys hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess? -//sys hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess? -//sys hcsCloseProcess(process hcsProcess) (hr error) = vmcompute.HcsCloseProcess? -//sys hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess? -//sys hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) = vmcompute.HcsTerminateProcess? -//sys hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo? -//sys hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties? -//sys hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess? -//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties? -//sys hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback? -//sys hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback? - -type hcsSystem syscall.Handle -type hcsProcess syscall.Handle -type hcsCallback syscall.Handle - -type hcsProcessInformation struct { - ProcessId uint32 - Reserved uint32 - StdInput syscall.Handle - StdOutput syscall.Handle - StdError syscall.Handle -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go deleted file mode 100644 index 6d03b17a..00000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go +++ /dev/null @@ -1,20 +0,0 @@ -package hcs - -import "github.com/sirupsen/logrus" - -func logOperationBegin(ctx logrus.Fields, msg string) { - logrus.WithFields(ctx).Debug(msg) -} - -func logOperationEnd(ctx logrus.Fields, msg string, err error) { - // Copy the log and fields first. - log := logrus.WithFields(ctx) - if err == nil { - log.Debug(msg) - } else { - // Edit only the copied field data to avoid race conditions on the - // write. - log.Data[logrus.ErrorKey] = err - log.Error(msg) - } -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go index 41e20bbf..2ad978f2 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go @@ -1,48 +1,47 @@ package hcs import ( + "context" "encoding/json" "io" "sync" "syscall" "time" - "github.com/Microsoft/hcsshim/internal/guestrequest" - "github.com/Microsoft/hcsshim/internal/interop" - "github.com/Microsoft/hcsshim/internal/logfields" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/log" + "github.com/Microsoft/hcsshim/internal/oc" + "github.com/Microsoft/hcsshim/internal/vmcompute" + "go.opencensus.io/trace" ) // ContainerError is an error encountered in HCS type Process struct { handleLock sync.RWMutex - handle hcsProcess + handle vmcompute.HcsProcess processID int system *System - cachedPipes *cachedPipes + hasCachedStdio bool + stdioLock sync.Mutex + stdin io.WriteCloser + stdout io.ReadCloser + stderr io.ReadCloser callbackNumber uintptr - logctx logrus.Fields + closedWaitOnce sync.Once + waitBlock chan struct{} + exitCode int + waitError error } -func newProcess(process hcsProcess, processID int, computeSystem *System) *Process { +func newProcess(process vmcompute.HcsProcess, processID int, computeSystem *System) *Process { return &Process{ handle: process, processID: processID, system: computeSystem, - logctx: logrus.Fields{ - logfields.ContainerID: computeSystem.ID(), - logfields.ProcessID: processID, - }, + waitBlock: make(chan struct{}), } } -type cachedPipes struct { - stdIn syscall.Handle - stdOut syscall.Handle - stdErr syscall.Handle -} - type processModifyRequest struct { Operation string ConsoleSize *consoleSize `json:",omitempty"` @@ -58,7 +57,7 @@ type closeHandle struct { Handle string } -type ProcessStatus struct { +type processStatus struct { ProcessID uint32 Exited bool ExitCode uint32 @@ -86,120 +85,153 @@ func (process *Process) SystemID() string { return process.system.ID() } -func (process *Process) logOperationBegin(operation string) { - logOperationBegin( - process.logctx, - operation+" - Begin Operation") -} - -func (process *Process) logOperationEnd(operation string, err error) { - var result string - if err == nil { - result = "Success" - } else { - result = "Error" +func (process *Process) processSignalResult(ctx context.Context, err error) (bool, error) { + switch err { + case nil: + return true, nil + case ErrVmcomputeOperationInvalidState, ErrComputeSystemDoesNotExist, ErrElementNotFound: + select { + case <-process.waitBlock: + // The process exit notification has already arrived. + default: + // The process should be gone, but we have not received the notification. + // After a second, force unblock the process wait to work around a possible + // deadlock in the HCS. + go func() { + time.Sleep(time.Second) + process.closedWaitOnce.Do(func() { + log.G(ctx).WithError(err).Warn("force unblocking process waits") + process.exitCode = -1 + process.waitError = err + close(process.waitBlock) + }) + }() + } + return false, nil + default: + return false, err } - - logOperationEnd( - process.logctx, - operation+" - End Operation - "+result, - err) } // Signal signals the process with `options`. -func (process *Process) Signal(options guestrequest.SignalProcessOptions) (err error) { +// +// For LCOW `guestrequest.SignalProcessOptionsLCOW`. +// +// For WCOW `guestrequest.SignalProcessOptionsWCOW`. +func (process *Process) Signal(ctx context.Context, options interface{}) (bool, error) { process.handleLock.RLock() defer process.handleLock.RUnlock() operation := "hcsshim::Process::Signal" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() if process.handle == 0 { - return makeProcessError(process, operation, ErrAlreadyClosed, nil) + return false, makeProcessError(process, operation, ErrAlreadyClosed, nil) } optionsb, err := json.Marshal(options) if err != nil { - return err + return false, err } - optionsStr := string(optionsb) - - var resultp *uint16 - syscallWatcher(process.logctx, func() { - err = hcsSignalProcess(process.handle, optionsStr, &resultp) - }) - events := processHcsResult(resultp) + resultJSON, err := vmcompute.HcsSignalProcess(ctx, process.handle, string(optionsb)) + events := processHcsResult(ctx, resultJSON) + delivered, err := process.processSignalResult(ctx, err) if err != nil { - return makeProcessError(process, operation, err, events) + err = makeProcessError(process, operation, err, events) } - - return nil + return delivered, err } // Kill signals the process to terminate but does not wait for it to finish terminating. -func (process *Process) Kill() (err error) { +func (process *Process) Kill(ctx context.Context) (bool, error) { process.handleLock.RLock() defer process.handleLock.RUnlock() operation := "hcsshim::Process::Kill" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() if process.handle == 0 { - return makeProcessError(process, operation, ErrAlreadyClosed, nil) + return false, makeProcessError(process, operation, ErrAlreadyClosed, nil) } - var resultp *uint16 - syscallWatcher(process.logctx, func() { - err = hcsTerminateProcess(process.handle, &resultp) + resultJSON, err := vmcompute.HcsTerminateProcess(ctx, process.handle) + events := processHcsResult(ctx, resultJSON) + delivered, err := process.processSignalResult(ctx, err) + if err != nil { + err = makeProcessError(process, operation, err, events) + } + return delivered, err +} + +// waitBackground waits for the process exit notification. Once received sets +// `process.waitError` (if any) and unblocks all `Wait` calls. +// +// This MUST be called exactly once per `process.handle` but `Wait` is safe to +// call multiple times. +func (process *Process) waitBackground() { + operation := "hcsshim::Process::waitBackground" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + span.AddAttributes( + trace.StringAttribute("cid", process.SystemID()), + trace.Int64Attribute("pid", int64(process.processID))) + + var ( + err error + exitCode = -1 + ) + + err = waitForNotification(ctx, process.callbackNumber, hcsNotificationProcessExited, nil) + if err != nil { + err = makeProcessError(process, operation, err, nil) + log.G(ctx).WithError(err).Error("failed wait") + } else { + process.handleLock.RLock() + defer process.handleLock.RUnlock() + + // Make sure we didnt race with Close() here + if process.handle != 0 { + propertiesJSON, resultJSON, err := vmcompute.HcsGetProcessProperties(ctx, process.handle) + events := processHcsResult(ctx, resultJSON) + if err != nil { + err = makeProcessError(process, operation, err, events) + } else { + properties := &processStatus{} + err = json.Unmarshal([]byte(propertiesJSON), properties) + if err != nil { + err = makeProcessError(process, operation, err, nil) + } else { + if properties.LastWaitResult != 0 { + log.G(ctx).WithField("wait-result", properties.LastWaitResult).Warning("non-zero last wait result") + } else { + exitCode = int(properties.ExitCode) + } + } + } + } + } + log.G(ctx).WithField("exitCode", exitCode).Debug("process exited") + + process.closedWaitOnce.Do(func() { + process.exitCode = exitCode + process.waitError = err + close(process.waitBlock) }) - events := processHcsResult(resultp) - if err != nil { - return makeProcessError(process, operation, err, events) - } - - return nil + oc.SetSpanStatus(span, err) } -// Wait waits for the process to exit. -func (process *Process) Wait() (err error) { - operation := "hcsshim::Process::Wait" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - - err = waitForNotification(process.callbackNumber, hcsNotificationProcessExited, nil) - if err != nil { - return makeProcessError(process, operation, err, nil) - } - - return nil -} - -// WaitTimeout waits for the process to exit or the duration to elapse. It returns -// false if timeout occurs. -func (process *Process) WaitTimeout(timeout time.Duration) (err error) { - operation := "hcssshim::Process::WaitTimeout" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - - err = waitForNotification(process.callbackNumber, hcsNotificationProcessExited, &timeout) - if err != nil { - return makeProcessError(process, operation, err, nil) - } - - return nil +// Wait waits for the process to exit. If the process has already exited returns +// the pervious error (if any). +func (process *Process) Wait() error { + <-process.waitBlock + return process.waitError } // ResizeConsole resizes the console of the process. -func (process *Process) ResizeConsole(width, height uint16) (err error) { +func (process *Process) ResizeConsole(ctx context.Context, width, height uint16) error { process.handleLock.RLock() defer process.handleLock.RUnlock() operation := "hcsshim::Process::ResizeConsole" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() if process.handle == 0 { return makeProcessError(process, operation, ErrAlreadyClosed, nil) @@ -218,11 +250,8 @@ func (process *Process) ResizeConsole(width, height uint16) (err error) { return err } - modifyRequestStr := string(modifyRequestb) - - var resultp *uint16 - err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp) - events := processHcsResult(resultp) + resultJSON, err := vmcompute.HcsModifyProcess(ctx, process.handle, string(modifyRequestb)) + events := processHcsResult(ctx, resultJSON) if err != nil { return makeProcessError(process, operation, err, events) } @@ -230,104 +259,55 @@ func (process *Process) ResizeConsole(width, height uint16) (err error) { return nil } -func (process *Process) Properties() (_ *ProcessStatus, err error) { - process.handleLock.RLock() - defer process.handleLock.RUnlock() - - operation := "hcsshim::Process::Properties" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - - if process.handle == 0 { - return nil, makeProcessError(process, operation, ErrAlreadyClosed, nil) - } - - var ( - resultp *uint16 - propertiesp *uint16 - ) - syscallWatcher(process.logctx, func() { - err = hcsGetProcessProperties(process.handle, &propertiesp, &resultp) - }) - events := processHcsResult(resultp) - if err != nil { - return nil, makeProcessError(process, operation, err, events) - } - - if propertiesp == nil { - return nil, ErrUnexpectedValue - } - propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp) - - properties := &ProcessStatus{} - if err := json.Unmarshal(propertiesRaw, properties); err != nil { - return nil, makeProcessError(process, operation, err, nil) - } - - return properties, nil -} - // ExitCode returns the exit code of the process. The process must have // already terminated. -func (process *Process) ExitCode() (_ int, err error) { - operation := "hcsshim::Process::ExitCode" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - - properties, err := process.Properties() - if err != nil { - return 0, makeProcessError(process, operation, err, nil) +func (process *Process) ExitCode() (int, error) { + select { + case <-process.waitBlock: + if process.waitError != nil { + return -1, process.waitError + } + return process.exitCode, nil + default: + return -1, makeProcessError(process, "hcsshim::Process::ExitCode", ErrInvalidProcessState, nil) } - - if properties.Exited == false { - return 0, makeProcessError(process, operation, ErrInvalidProcessState, nil) - } - - if properties.LastWaitResult != 0 { - return 0, makeProcessError(process, operation, syscall.Errno(properties.LastWaitResult), nil) - } - - return int(properties.ExitCode), nil } -// Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing -// these pipes does not close the underlying pipes; it should be possible to -// call this multiple times to get multiple interfaces. -func (process *Process) Stdio() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadCloser, err error) { +// StdioLegacy returns the stdin, stdout, and stderr pipes, respectively. Closing +// these pipes does not close the underlying pipes. Once returned, these pipes +// are the responsibility of the caller to close. +func (process *Process) StdioLegacy() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadCloser, err error) { + operation := "hcsshim::Process::StdioLegacy" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("cid", process.SystemID()), + trace.Int64Attribute("pid", int64(process.processID))) + process.handleLock.RLock() defer process.handleLock.RUnlock() - operation := "hcsshim::Process::Stdio" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - if process.handle == 0 { return nil, nil, nil, makeProcessError(process, operation, ErrAlreadyClosed, nil) } - var stdIn, stdOut, stdErr syscall.Handle - - if process.cachedPipes == nil { - var ( - processInfo hcsProcessInformation - resultp *uint16 - ) - err = hcsGetProcessInfo(process.handle, &processInfo, &resultp) - events := processHcsResult(resultp) - if err != nil { - return nil, nil, nil, makeProcessError(process, operation, err, events) - } - - stdIn, stdOut, stdErr = processInfo.StdInput, processInfo.StdOutput, processInfo.StdError - } else { - // Use cached pipes - stdIn, stdOut, stdErr = process.cachedPipes.stdIn, process.cachedPipes.stdOut, process.cachedPipes.stdErr - - // Invalidate the cache - process.cachedPipes = nil + process.stdioLock.Lock() + defer process.stdioLock.Unlock() + if process.hasCachedStdio { + stdin, stdout, stderr := process.stdin, process.stdout, process.stderr + process.stdin, process.stdout, process.stderr = nil, nil, nil + process.hasCachedStdio = false + return stdin, stdout, stderr, nil } - pipes, err := makeOpenFiles([]syscall.Handle{stdIn, stdOut, stdErr}) + processInfo, resultJSON, err := vmcompute.HcsGetProcessInfo(ctx, process.handle) + events := processHcsResult(ctx, resultJSON) + if err != nil { + return nil, nil, nil, makeProcessError(process, operation, err, events) + } + + pipes, err := makeOpenFiles([]syscall.Handle{processInfo.StdInput, processInfo.StdOutput, processInfo.StdError}) if err != nil { return nil, nil, nil, makeProcessError(process, operation, err, nil) } @@ -335,15 +315,21 @@ func (process *Process) Stdio() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadClo return pipes[0], pipes[1], pipes[2], nil } +// Stdio returns the stdin, stdout, and stderr pipes, respectively. +// To close them, close the process handle. +func (process *Process) Stdio() (stdin io.Writer, stdout, stderr io.Reader) { + process.stdioLock.Lock() + defer process.stdioLock.Unlock() + return process.stdin, process.stdout, process.stderr +} + // CloseStdin closes the write side of the stdin pipe so that the process is // notified on the read side that there is no more data in stdin. -func (process *Process) CloseStdin() (err error) { +func (process *Process) CloseStdin(ctx context.Context) error { process.handleLock.RLock() defer process.handleLock.RUnlock() operation := "hcsshim::Process::CloseStdin" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() if process.handle == 0 { return makeProcessError(process, operation, ErrAlreadyClosed, nil) @@ -361,96 +347,125 @@ func (process *Process) CloseStdin() (err error) { return err } - modifyRequestStr := string(modifyRequestb) - - var resultp *uint16 - err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp) - events := processHcsResult(resultp) + resultJSON, err := vmcompute.HcsModifyProcess(ctx, process.handle, string(modifyRequestb)) + events := processHcsResult(ctx, resultJSON) if err != nil { return makeProcessError(process, operation, err, events) } + process.stdioLock.Lock() + if process.stdin != nil { + process.stdin.Close() + process.stdin = nil + } + process.stdioLock.Unlock() + return nil } // Close cleans up any state associated with the process but does not kill // or wait on it. func (process *Process) Close() (err error) { + operation := "hcsshim::Process::Close" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("cid", process.SystemID()), + trace.Int64Attribute("pid", int64(process.processID))) + process.handleLock.Lock() defer process.handleLock.Unlock() - operation := "hcsshim::Process::Close" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - // Don't double free this if process.handle == 0 { return nil } - if err = process.unregisterCallback(); err != nil { + process.stdioLock.Lock() + if process.stdin != nil { + process.stdin.Close() + process.stdin = nil + } + if process.stdout != nil { + process.stdout.Close() + process.stdout = nil + } + if process.stderr != nil { + process.stderr.Close() + process.stderr = nil + } + process.stdioLock.Unlock() + + if err = process.unregisterCallback(ctx); err != nil { return makeProcessError(process, operation, err, nil) } - if err = hcsCloseProcess(process.handle); err != nil { + if err = vmcompute.HcsCloseProcess(ctx, process.handle); err != nil { return makeProcessError(process, operation, err, nil) } process.handle = 0 + process.closedWaitOnce.Do(func() { + process.exitCode = -1 + process.waitError = ErrAlreadyClosed + close(process.waitBlock) + }) return nil } -func (process *Process) registerCallback() error { - context := ¬ifcationWatcherContext{ - channels: newChannels(), +func (process *Process) registerCallback(ctx context.Context) error { + callbackContext := ¬ifcationWatcherContext{ + channels: newProcessChannels(), + systemID: process.SystemID(), + processID: process.processID, } callbackMapLock.Lock() callbackNumber := nextCallback nextCallback++ - callbackMap[callbackNumber] = context + callbackMap[callbackNumber] = callbackContext callbackMapLock.Unlock() - var callbackHandle hcsCallback - err := hcsRegisterProcessCallback(process.handle, notificationWatcherCallback, callbackNumber, &callbackHandle) + callbackHandle, err := vmcompute.HcsRegisterProcessCallback(ctx, process.handle, notificationWatcherCallback, callbackNumber) if err != nil { return err } - context.handle = callbackHandle + callbackContext.handle = callbackHandle process.callbackNumber = callbackNumber return nil } -func (process *Process) unregisterCallback() error { +func (process *Process) unregisterCallback(ctx context.Context) error { callbackNumber := process.callbackNumber callbackMapLock.RLock() - context := callbackMap[callbackNumber] + callbackContext := callbackMap[callbackNumber] callbackMapLock.RUnlock() - if context == nil { + if callbackContext == nil { return nil } - handle := context.handle + handle := callbackContext.handle if handle == 0 { return nil } - // hcsUnregisterProcessCallback has its own syncronization - // to wait for all callbacks to complete. We must NOT hold the callbackMapLock. - err := hcsUnregisterProcessCallback(handle) + // vmcompute.HcsUnregisterProcessCallback has its own synchronization to + // wait for all callbacks to complete. We must NOT hold the callbackMapLock. + err := vmcompute.HcsUnregisterProcessCallback(ctx, handle) if err != nil { return err } - closeChannels(context.channels) + closeChannels(callbackContext.channels) callbackMapLock.Lock() - callbackMap[callbackNumber] = nil + delete(callbackMap, callbackNumber) callbackMapLock.Unlock() handle = 0 diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go index 20b24252..6300a797 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go @@ -1,18 +1,24 @@ package hcs import ( + "context" "encoding/json" + "errors" "os" "strconv" + "strings" "sync" "syscall" "time" - "github.com/Microsoft/hcsshim/internal/interop" - "github.com/Microsoft/hcsshim/internal/logfields" + "github.com/Microsoft/hcsshim/internal/cow" + "github.com/Microsoft/hcsshim/internal/log" + "github.com/Microsoft/hcsshim/internal/oc" "github.com/Microsoft/hcsshim/internal/schema1" + hcsschema "github.com/Microsoft/hcsshim/internal/schema2" "github.com/Microsoft/hcsshim/internal/timeout" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/vmcompute" + "go.opencensus.io/trace" ) // currentContainerStarts is used to limit the number of concurrent container @@ -38,49 +44,37 @@ func init() { type System struct { handleLock sync.RWMutex - handle hcsSystem + handle vmcompute.HcsSystem id string callbackNumber uintptr - logctx logrus.Fields + closedWaitOnce sync.Once + waitBlock chan struct{} + waitError error + exitError error + + os, typ string } func newSystem(id string) *System { return &System{ - id: id, - logctx: logrus.Fields{ - logfields.ContainerID: id, - }, + id: id, + waitBlock: make(chan struct{}), } } -func (computeSystem *System) logOperationBegin(operation string) { - logOperationBegin( - computeSystem.logctx, - operation+" - Begin Operation") -} - -func (computeSystem *System) logOperationEnd(operation string, err error) { - var result string - if err == nil { - result = "Success" - } else { - result = "Error" - } - - logOperationEnd( - computeSystem.logctx, - operation+" - End Operation - "+result, - err) -} - // CreateComputeSystem creates a new compute system with the given configuration but does not start it. -func CreateComputeSystem(id string, hcsDocumentInterface interface{}) (_ *System, err error) { +func CreateComputeSystem(ctx context.Context, id string, hcsDocumentInterface interface{}) (_ *System, err error) { operation := "hcsshim::CreateComputeSystem" + // hcsCreateComputeSystemContext is an async operation. Start the outer span + // here to measure the full create time. + ctx, span := trace.StartSpan(ctx, operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", id)) + computeSystem := newSystem(id) - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() hcsDocumentB, err := json.Marshal(hcsDocumentInterface) if err != nil { @@ -89,126 +83,114 @@ func CreateComputeSystem(id string, hcsDocumentInterface interface{}) (_ *System hcsDocument := string(hcsDocumentB) - logrus.WithFields(computeSystem.logctx). - WithField(logfields.JSON, hcsDocument). - Debug("HCS ComputeSystem Document") - var ( - resultp *uint16 identity syscall.Handle + resultJSON string createError error ) - syscallWatcher(computeSystem.logctx, func() { - createError = hcsCreateComputeSystem(id, hcsDocument, identity, &computeSystem.handle, &resultp) - }) - + computeSystem.handle, resultJSON, createError = vmcompute.HcsCreateComputeSystem(ctx, id, hcsDocument, identity) if createError == nil || IsPending(createError) { - if err = computeSystem.registerCallback(); err != nil { + defer func() { + if err != nil { + computeSystem.Close() + } + }() + if err = computeSystem.registerCallback(ctx); err != nil { // Terminate the compute system if it still exists. We're okay to // ignore a failure here. - computeSystem.Terminate() + computeSystem.Terminate(ctx) return nil, makeSystemError(computeSystem, operation, "", err, nil) } } - events, err := processAsyncHcsResult(createError, resultp, computeSystem.callbackNumber, hcsNotificationSystemCreateCompleted, &timeout.SystemCreate) + events, err := processAsyncHcsResult(ctx, createError, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemCreateCompleted, &timeout.SystemCreate) if err != nil { if err == ErrTimeout { // Terminate the compute system if it still exists. We're okay to // ignore a failure here. - computeSystem.Terminate() + computeSystem.Terminate(ctx) } return nil, makeSystemError(computeSystem, operation, hcsDocument, err, events) } - + go computeSystem.waitBackground() + if err = computeSystem.getCachedProperties(ctx); err != nil { + return nil, err + } return computeSystem, nil } // OpenComputeSystem opens an existing compute system by ID. -func OpenComputeSystem(id string) (_ *System, err error) { +func OpenComputeSystem(ctx context.Context, id string) (*System, error) { operation := "hcsshim::OpenComputeSystem" computeSystem := newSystem(id) - computeSystem.logOperationBegin(operation) - defer func() { - if IsNotExist(err) { - computeSystem.logOperationEnd(operation, nil) - } else { - computeSystem.logOperationEnd(operation, err) - } - }() - - var ( - handle hcsSystem - resultp *uint16 - ) - err = hcsOpenComputeSystem(id, &handle, &resultp) - events := processHcsResult(resultp) + handle, resultJSON, err := vmcompute.HcsOpenComputeSystem(ctx, id) + events := processHcsResult(ctx, resultJSON) if err != nil { return nil, makeSystemError(computeSystem, operation, "", err, events) } - computeSystem.handle = handle - - if err = computeSystem.registerCallback(); err != nil { + defer func() { + if err != nil { + computeSystem.Close() + } + }() + if err = computeSystem.registerCallback(ctx); err != nil { return nil, makeSystemError(computeSystem, operation, "", err, nil) } - + go computeSystem.waitBackground() + if err = computeSystem.getCachedProperties(ctx); err != nil { + return nil, err + } return computeSystem, nil } +func (computeSystem *System) getCachedProperties(ctx context.Context) error { + props, err := computeSystem.Properties(ctx) + if err != nil { + return err + } + computeSystem.typ = strings.ToLower(props.SystemType) + computeSystem.os = strings.ToLower(props.RuntimeOSType) + if computeSystem.os == "" && computeSystem.typ == "container" { + // Pre-RS5 HCS did not return the OS, but it only supported containers + // that ran Windows. + computeSystem.os = "windows" + } + return nil +} + +// OS returns the operating system of the compute system, "linux" or "windows". +func (computeSystem *System) OS() string { + return computeSystem.os +} + +// IsOCI returns whether processes in the compute system should be created via +// OCI. +func (computeSystem *System) IsOCI() bool { + return computeSystem.os == "linux" && computeSystem.typ == "container" +} + // GetComputeSystems gets a list of the compute systems on the system that match the query -func GetComputeSystems(q schema1.ComputeSystemQuery) (_ []schema1.ContainerProperties, err error) { +func GetComputeSystems(ctx context.Context, q schema1.ComputeSystemQuery) ([]schema1.ContainerProperties, error) { operation := "hcsshim::GetComputeSystems" - fields := logrus.Fields{} - logOperationBegin( - fields, - operation+" - Begin Operation") - - defer func() { - var result string - if err == nil { - result = "Success" - } else { - result = "Error" - } - - logOperationEnd( - fields, - operation+" - End Operation - "+result, - err) - }() queryb, err := json.Marshal(q) if err != nil { return nil, err } - query := string(queryb) - - logrus.WithFields(fields). - WithField(logfields.JSON, query). - Debug("HCS ComputeSystem Query") - - var ( - resultp *uint16 - computeSystemsp *uint16 - ) - - syscallWatcher(fields, func() { - err = hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp) - }) - events := processHcsResult(resultp) + computeSystemsJSON, resultJSON, err := vmcompute.HcsEnumerateComputeSystems(ctx, string(queryb)) + events := processHcsResult(ctx, resultJSON) if err != nil { return nil, &HcsError{Op: operation, Err: err, Events: events} } - if computeSystemsp == nil { + if computeSystemsJSON == "" { return nil, ErrUnexpectedValue } - computeSystemsRaw := interop.ConvertAndFreeCoTaskMemBytes(computeSystemsp) computeSystems := []schema1.ContainerProperties{} - if err = json.Unmarshal(computeSystemsRaw, &computeSystems); err != nil { + if err = json.Unmarshal([]byte(computeSystemsJSON), &computeSystems); err != nil { return nil, err } @@ -216,16 +198,21 @@ func GetComputeSystems(q schema1.ComputeSystemQuery) (_ []schema1.ContainerPrope } // Start synchronously starts the computeSystem. -func (computeSystem *System) Start() (err error) { +func (computeSystem *System) Start(ctx context.Context) (err error) { + operation := "hcsshim::System::Start" + + // hcsStartComputeSystemContext is an async operation. Start the outer span + // here to measure the full start time. + ctx, span := trace.StartSpan(ctx, operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Start" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Start", "", ErrAlreadyClosed, nil) + return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } // This is a very simple backoff-retry loop to limit the number @@ -254,13 +241,10 @@ func (computeSystem *System) Start() (err error) { }() } - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsStartComputeSystem(computeSystem.handle, "", &resultp) - }) - events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemStartCompleted, &timeout.SystemStart) + resultJSON, err := vmcompute.HcsStartComputeSystem(ctx, computeSystem.handle, "") + events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemStartCompleted, &timeout.SystemStart) if err != nil { - return makeSystemError(computeSystem, "Start", "", err, events) + return makeSystemError(computeSystem, operation, "", err, events) } return nil @@ -271,360 +255,357 @@ func (computeSystem *System) ID() string { return computeSystem.id } -// Shutdown requests a compute system shutdown, if IsPending() on the error returned is true, -// it may not actually be shut down until Wait() succeeds. -func (computeSystem *System) Shutdown() (err error) { +// Shutdown requests a compute system shutdown. +func (computeSystem *System) Shutdown(ctx context.Context) error { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Shutdown" - computeSystem.logOperationBegin(operation) - defer func() { - if IsAlreadyStopped(err) { - computeSystem.logOperationEnd(operation, nil) - } else { - computeSystem.logOperationEnd(operation, err) - } - }() + operation := "hcsshim::System::Shutdown" if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Shutdown", "", ErrAlreadyClosed, nil) + return nil } - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsShutdownComputeSystem(computeSystem.handle, "", &resultp) - }) - events := processHcsResult(resultp) - if err != nil { - return makeSystemError(computeSystem, "Shutdown", "", err, events) + resultJSON, err := vmcompute.HcsShutdownComputeSystem(ctx, computeSystem.handle, "") + events := processHcsResult(ctx, resultJSON) + switch err { + case nil, ErrVmcomputeAlreadyStopped, ErrComputeSystemDoesNotExist, ErrVmcomputeOperationPending: + default: + return makeSystemError(computeSystem, operation, "", err, events) } - return nil } -// Terminate requests a compute system terminate, if IsPending() on the error returned is true, -// it may not actually be shut down until Wait() succeeds. -func (computeSystem *System) Terminate() (err error) { +// Terminate requests a compute system terminate. +func (computeSystem *System) Terminate(ctx context.Context) error { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Terminate" - computeSystem.logOperationBegin(operation) - defer func() { - if IsPending(err) { - computeSystem.logOperationEnd(operation, nil) - } else { - computeSystem.logOperationEnd(operation, err) - } - }() + operation := "hcsshim::System::Terminate" if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Terminate", "", ErrAlreadyClosed, nil) + return nil } - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsTerminateComputeSystem(computeSystem.handle, "", &resultp) + resultJSON, err := vmcompute.HcsTerminateComputeSystem(ctx, computeSystem.handle, "") + events := processHcsResult(ctx, resultJSON) + switch err { + case nil, ErrVmcomputeAlreadyStopped, ErrComputeSystemDoesNotExist, ErrVmcomputeOperationPending: + default: + return makeSystemError(computeSystem, operation, "", err, events) + } + return nil +} + +// waitBackground waits for the compute system exit notification. Once received +// sets `computeSystem.waitError` (if any) and unblocks all `Wait` calls. +// +// This MUST be called exactly once per `computeSystem.handle` but `Wait` is +// safe to call multiple times. +func (computeSystem *System) waitBackground() { + operation := "hcsshim::System::waitBackground" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + + err := waitForNotification(ctx, computeSystem.callbackNumber, hcsNotificationSystemExited, nil) + switch err { + case nil: + log.G(ctx).Debug("system exited") + case ErrVmcomputeUnexpectedExit: + log.G(ctx).Debug("unexpected system exit") + computeSystem.exitError = makeSystemError(computeSystem, operation, "", err, nil) + err = nil + default: + err = makeSystemError(computeSystem, operation, "", err, nil) + } + computeSystem.closedWaitOnce.Do(func() { + computeSystem.waitError = err + close(computeSystem.waitBlock) }) - events := processHcsResult(resultp) - if err != nil && err != ErrVmcomputeAlreadyStopped { - return makeSystemError(computeSystem, "Terminate", "", err, events) - } - - return nil + oc.SetSpanStatus(span, err) } -// Wait synchronously waits for the compute system to shutdown or terminate. -func (computeSystem *System) Wait() (err error) { - operation := "hcsshim::ComputeSystem::Wait" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - - err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, nil) - if err != nil { - return makeSystemError(computeSystem, "Wait", "", err, nil) - } - - return nil +// Wait synchronously waits for the compute system to shutdown or terminate. If +// the compute system has already exited returns the previous error (if any). +func (computeSystem *System) Wait() error { + <-computeSystem.waitBlock + return computeSystem.waitError } -// WaitExpectedError synchronously waits for the compute system to shutdown or -// terminate, and ignores the passed error if it occurs. -func (computeSystem *System) WaitExpectedError(expected error) (err error) { - operation := "hcsshim::ComputeSystem::WaitExpectedError" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - - err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, nil) - if err != nil && getInnerError(err) != expected { - return makeSystemError(computeSystem, "WaitExpectedError", "", err, nil) +// ExitError returns an error describing the reason the compute system terminated. +func (computeSystem *System) ExitError() error { + select { + case <-computeSystem.waitBlock: + if computeSystem.waitError != nil { + return computeSystem.waitError + } + return computeSystem.exitError + default: + return errors.New("container not exited") } - - return nil } -// WaitTimeout synchronously waits for the compute system to terminate or the duration to elapse. -// If the timeout expires, IsTimeout(err) == true -func (computeSystem *System) WaitTimeout(timeout time.Duration) (err error) { - operation := "hcsshim::ComputeSystem::WaitTimeout" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - - err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, &timeout) - if err != nil { - return makeSystemError(computeSystem, "WaitTimeout", "", err, nil) - } - - return nil -} - -func (computeSystem *System) Properties(types ...schema1.PropertyType) (_ *schema1.ContainerProperties, err error) { +// Properties returns the requested container properties targeting a V1 schema container. +func (computeSystem *System) Properties(ctx context.Context, types ...schema1.PropertyType) (*schema1.ContainerProperties, error) { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Properties" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() + operation := "hcsshim::System::Properties" - queryj, err := json.Marshal(schema1.PropertyQuery{types}) + queryBytes, err := json.Marshal(schema1.PropertyQuery{PropertyTypes: types}) if err != nil { - return nil, makeSystemError(computeSystem, "Properties", "", err, nil) + return nil, makeSystemError(computeSystem, operation, "", err, nil) } - logrus.WithFields(computeSystem.logctx). - WithField(logfields.JSON, queryj). - Debug("HCS ComputeSystem Properties Query") - - var resultp, propertiesp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsGetComputeSystemProperties(computeSystem.handle, string(queryj), &propertiesp, &resultp) - }) - events := processHcsResult(resultp) + propertiesJSON, resultJSON, err := vmcompute.HcsGetComputeSystemProperties(ctx, computeSystem.handle, string(queryBytes)) + events := processHcsResult(ctx, resultJSON) if err != nil { - return nil, makeSystemError(computeSystem, "Properties", "", err, events) + return nil, makeSystemError(computeSystem, operation, "", err, events) } - if propertiesp == nil { + if propertiesJSON == "" { return nil, ErrUnexpectedValue } - propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp) properties := &schema1.ContainerProperties{} - if err := json.Unmarshal(propertiesRaw, properties); err != nil { - return nil, makeSystemError(computeSystem, "Properties", "", err, nil) + if err := json.Unmarshal([]byte(propertiesJSON), properties); err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) + } + + return properties, nil +} + +// PropertiesV2 returns the requested container properties targeting a V2 schema container. +func (computeSystem *System) PropertiesV2(ctx context.Context, types ...hcsschema.PropertyType) (*hcsschema.Properties, error) { + computeSystem.handleLock.RLock() + defer computeSystem.handleLock.RUnlock() + + operation := "hcsshim::System::PropertiesV2" + + queryBytes, err := json.Marshal(hcsschema.PropertyQuery{PropertyTypes: types}) + if err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) + } + + propertiesJSON, resultJSON, err := vmcompute.HcsGetComputeSystemProperties(ctx, computeSystem.handle, string(queryBytes)) + events := processHcsResult(ctx, resultJSON) + if err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, events) + } + + if propertiesJSON == "" { + return nil, ErrUnexpectedValue + } + properties := &hcsschema.Properties{} + if err := json.Unmarshal([]byte(propertiesJSON), properties); err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) } return properties, nil } // Pause pauses the execution of the computeSystem. This feature is not enabled in TP5. -func (computeSystem *System) Pause() (err error) { +func (computeSystem *System) Pause(ctx context.Context) (err error) { + operation := "hcsshim::System::Pause" + + // hcsPauseComputeSystemContext is an async peration. Start the outer span + // here to measure the full pause time. + ctx, span := trace.StartSpan(ctx, operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Pause" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Pause", "", ErrAlreadyClosed, nil) + return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsPauseComputeSystem(computeSystem.handle, "", &resultp) - }) - events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemPauseCompleted, &timeout.SystemPause) + resultJSON, err := vmcompute.HcsPauseComputeSystem(ctx, computeSystem.handle, "") + events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemPauseCompleted, &timeout.SystemPause) if err != nil { - return makeSystemError(computeSystem, "Pause", "", err, events) + return makeSystemError(computeSystem, operation, "", err, events) } return nil } // Resume resumes the execution of the computeSystem. This feature is not enabled in TP5. -func (computeSystem *System) Resume() (err error) { +func (computeSystem *System) Resume(ctx context.Context) (err error) { + operation := "hcsshim::System::Resume" + + // hcsResumeComputeSystemContext is an async operation. Start the outer span + // here to measure the full restore time. + ctx, span := trace.StartSpan(ctx, operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Resume" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Resume", "", ErrAlreadyClosed, nil) + return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsResumeComputeSystem(computeSystem.handle, "", &resultp) - }) - events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemResumeCompleted, &timeout.SystemResume) + resultJSON, err := vmcompute.HcsResumeComputeSystem(ctx, computeSystem.handle, "") + events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemResumeCompleted, &timeout.SystemResume) if err != nil { - return makeSystemError(computeSystem, "Resume", "", err, events) + return makeSystemError(computeSystem, operation, "", err, events) } return nil } -// CreateProcess launches a new process within the computeSystem. -func (computeSystem *System) CreateProcess(c interface{}) (_ *Process, err error) { +func (computeSystem *System) createProcess(ctx context.Context, operation string, c interface{}) (*Process, *vmcompute.HcsProcessInformation, error) { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::CreateProcess" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - - var ( - processInfo hcsProcessInformation - processHandle hcsProcess - resultp *uint16 - ) - if computeSystem.handle == 0 { - return nil, makeSystemError(computeSystem, "CreateProcess", "", ErrAlreadyClosed, nil) + return nil, nil, makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } configurationb, err := json.Marshal(c) if err != nil { - return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil) + return nil, nil, makeSystemError(computeSystem, operation, "", err, nil) } configuration := string(configurationb) - - logrus.WithFields(computeSystem.logctx). - WithField(logfields.JSON, configuration). - Debug("HCS ComputeSystem Process Document") - - syscallWatcher(computeSystem.logctx, func() { - err = hcsCreateProcess(computeSystem.handle, configuration, &processInfo, &processHandle, &resultp) - }) - events := processHcsResult(resultp) + processInfo, processHandle, resultJSON, err := vmcompute.HcsCreateProcess(ctx, computeSystem.handle, configuration) + events := processHcsResult(ctx, resultJSON) if err != nil { - return nil, makeSystemError(computeSystem, "CreateProcess", configuration, err, events) + return nil, nil, makeSystemError(computeSystem, operation, configuration, err, events) } - logrus.WithFields(computeSystem.logctx). - WithField(logfields.ProcessID, processInfo.ProcessId). - Debug("HCS ComputeSystem CreateProcess PID") + log.G(ctx).WithField("pid", processInfo.ProcessId).Debug("created process pid") + return newProcess(processHandle, int(processInfo.ProcessId), computeSystem), &processInfo, nil +} - process := newProcess(processHandle, int(processInfo.ProcessId), computeSystem) - process.cachedPipes = &cachedPipes{ - stdIn: processInfo.StdInput, - stdOut: processInfo.StdOutput, - stdErr: processInfo.StdError, +// CreateProcess launches a new process within the computeSystem. +func (computeSystem *System) CreateProcess(ctx context.Context, c interface{}) (cow.Process, error) { + operation := "hcsshim::System::CreateProcess" + process, processInfo, err := computeSystem.createProcess(ctx, operation, c) + if err != nil { + return nil, err } + defer func() { + if err != nil { + process.Close() + } + }() - if err = process.registerCallback(); err != nil { - return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil) + pipes, err := makeOpenFiles([]syscall.Handle{processInfo.StdInput, processInfo.StdOutput, processInfo.StdError}) + if err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) } + process.stdin = pipes[0] + process.stdout = pipes[1] + process.stderr = pipes[2] + process.hasCachedStdio = true + + if err = process.registerCallback(ctx); err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) + } + go process.waitBackground() return process, nil } // OpenProcess gets an interface to an existing process within the computeSystem. -func (computeSystem *System) OpenProcess(pid int) (_ *Process, err error) { +func (computeSystem *System) OpenProcess(ctx context.Context, pid int) (*Process, error) { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - // Add PID for the context of this operation - computeSystem.logctx[logfields.ProcessID] = pid - defer delete(computeSystem.logctx, logfields.ProcessID) - - operation := "hcsshim::ComputeSystem::OpenProcess" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - - var ( - processHandle hcsProcess - resultp *uint16 - ) + operation := "hcsshim::System::OpenProcess" if computeSystem.handle == 0 { - return nil, makeSystemError(computeSystem, "OpenProcess", "", ErrAlreadyClosed, nil) + return nil, makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } - syscallWatcher(computeSystem.logctx, func() { - err = hcsOpenProcess(computeSystem.handle, uint32(pid), &processHandle, &resultp) - }) - events := processHcsResult(resultp) + processHandle, resultJSON, err := vmcompute.HcsOpenProcess(ctx, computeSystem.handle, uint32(pid)) + events := processHcsResult(ctx, resultJSON) if err != nil { - return nil, makeSystemError(computeSystem, "OpenProcess", "", err, events) + return nil, makeSystemError(computeSystem, operation, "", err, events) } process := newProcess(processHandle, pid, computeSystem) - if err = process.registerCallback(); err != nil { - return nil, makeSystemError(computeSystem, "OpenProcess", "", err, nil) + if err = process.registerCallback(ctx); err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) } + go process.waitBackground() return process, nil } // Close cleans up any state associated with the compute system but does not terminate or wait for it. func (computeSystem *System) Close() (err error) { + operation := "hcsshim::System::Close" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + computeSystem.handleLock.Lock() defer computeSystem.handleLock.Unlock() - operation := "hcsshim::ComputeSystem::Close" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - // Don't double free this if computeSystem.handle == 0 { return nil } - if err = computeSystem.unregisterCallback(); err != nil { - return makeSystemError(computeSystem, "Close", "", err, nil) + if err = computeSystem.unregisterCallback(ctx); err != nil { + return makeSystemError(computeSystem, operation, "", err, nil) } - syscallWatcher(computeSystem.logctx, func() { - err = hcsCloseComputeSystem(computeSystem.handle) - }) + err = vmcompute.HcsCloseComputeSystem(ctx, computeSystem.handle) if err != nil { - return makeSystemError(computeSystem, "Close", "", err, nil) + return makeSystemError(computeSystem, operation, "", err, nil) } computeSystem.handle = 0 + computeSystem.closedWaitOnce.Do(func() { + computeSystem.waitError = ErrAlreadyClosed + close(computeSystem.waitBlock) + }) return nil } -func (computeSystem *System) registerCallback() error { - context := ¬ifcationWatcherContext{ - channels: newChannels(), +func (computeSystem *System) registerCallback(ctx context.Context) error { + callbackContext := ¬ifcationWatcherContext{ + channels: newSystemChannels(), + systemID: computeSystem.id, } callbackMapLock.Lock() callbackNumber := nextCallback nextCallback++ - callbackMap[callbackNumber] = context + callbackMap[callbackNumber] = callbackContext callbackMapLock.Unlock() - var callbackHandle hcsCallback - err := hcsRegisterComputeSystemCallback(computeSystem.handle, notificationWatcherCallback, callbackNumber, &callbackHandle) + callbackHandle, err := vmcompute.HcsRegisterComputeSystemCallback(ctx, computeSystem.handle, notificationWatcherCallback, callbackNumber) if err != nil { return err } - context.handle = callbackHandle + callbackContext.handle = callbackHandle computeSystem.callbackNumber = callbackNumber return nil } -func (computeSystem *System) unregisterCallback() error { +func (computeSystem *System) unregisterCallback(ctx context.Context) error { callbackNumber := computeSystem.callbackNumber callbackMapLock.RLock() - context := callbackMap[callbackNumber] + callbackContext := callbackMap[callbackNumber] callbackMapLock.RUnlock() - if context == nil { + if callbackContext == nil { return nil } - handle := context.handle + handle := callbackContext.handle if handle == 0 { return nil @@ -632,15 +613,15 @@ func (computeSystem *System) unregisterCallback() error { // hcsUnregisterComputeSystemCallback has its own syncronization // to wait for all callbacks to complete. We must NOT hold the callbackMapLock. - err := hcsUnregisterComputeSystemCallback(handle) + err := vmcompute.HcsUnregisterComputeSystemCallback(ctx, handle) if err != nil { return err } - closeChannels(context.channels) + closeChannels(callbackContext.channels) callbackMapLock.Lock() - callbackMap[callbackNumber] = nil + delete(callbackMap, callbackNumber) callbackMapLock.Unlock() handle = 0 @@ -649,36 +630,26 @@ func (computeSystem *System) unregisterCallback() error { } // Modify the System by sending a request to HCS -func (computeSystem *System) Modify(config interface{}) (err error) { +func (computeSystem *System) Modify(ctx context.Context, config interface{}) error { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Modify" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() + operation := "hcsshim::System::Modify" if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Modify", "", ErrAlreadyClosed, nil) + return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } - requestJSON, err := json.Marshal(config) + requestBytes, err := json.Marshal(config) if err != nil { return err } - requestString := string(requestJSON) - - logrus.WithFields(computeSystem.logctx). - WithField(logfields.JSON, requestString). - Debug("HCS ComputeSystem Modify Document") - - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsModifyComputeSystem(computeSystem.handle, requestString, &resultp) - }) - events := processHcsResult(resultp) + requestJSON := string(requestBytes) + resultJSON, err := vmcompute.HcsModifyComputeSystem(ctx, computeSystem.handle, requestJSON) + events := processHcsResult(ctx, resultJSON) if err != nil { - return makeSystemError(computeSystem, "Modify", requestString, err, events) + return makeSystemError(computeSystem, operation, requestJSON, err, events) } return nil diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go index 91e212c5..f07f532c 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go @@ -1,28 +1,34 @@ package hcs import ( + "context" "time" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/log" ) -func processAsyncHcsResult(err error, resultp *uint16, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) ([]ErrorEvent, error) { - events := processHcsResult(resultp) +func processAsyncHcsResult(ctx context.Context, err error, resultJSON string, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) ([]ErrorEvent, error) { + events := processHcsResult(ctx, resultJSON) if IsPending(err) { - return nil, waitForNotification(callbackNumber, expectedNotification, timeout) + return nil, waitForNotification(ctx, callbackNumber, expectedNotification, timeout) } return events, err } -func waitForNotification(callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error { +func waitForNotification(ctx context.Context, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error { callbackMapLock.RLock() + if _, ok := callbackMap[callbackNumber]; !ok { + callbackMapLock.RUnlock() + log.G(ctx).WithField("callbackNumber", callbackNumber).Error("failed to waitForNotification: callbackNumber does not exist in callbackMap") + return ErrHandleClose + } channels := callbackMap[callbackNumber].channels callbackMapLock.RUnlock() expectedChannel := channels[expectedNotification] if expectedChannel == nil { - logrus.Errorf("unknown notification type in waitForNotification %x", expectedNotification) + log.G(ctx).WithField("type", expectedNotification).Error("unknown notification type in waitForNotification") return ErrInvalidNotificationType } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go deleted file mode 100644 index f85ed318..00000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go +++ /dev/null @@ -1,41 +0,0 @@ -package hcs - -import ( - "context" - - "github.com/Microsoft/hcsshim/internal/logfields" - "github.com/Microsoft/hcsshim/internal/timeout" - "github.com/sirupsen/logrus" -) - -// syscallWatcher is used as a very simple goroutine around calls into -// the platform. In some cases, we have seen HCS APIs not returning due to -// various bugs, and the goroutine making the syscall ends up not returning, -// prior to its async callback. By spinning up a syscallWatcher, it allows -// us to at least log a warning if a syscall doesn't complete in a reasonable -// amount of time. -// -// Usage is: -// -// syscallWatcher(logContext, func() { -// err = (args...) -// }) -// - -func syscallWatcher(logContext logrus.Fields, syscallLambda func()) { - ctx, cancel := context.WithTimeout(context.Background(), timeout.SyscallWatcher) - defer cancel() - go watchFunc(ctx, logContext) - syscallLambda() -} - -func watchFunc(ctx context.Context, logContext logrus.Fields) { - select { - case <-ctx.Done(): - if ctx.Err() != context.Canceled { - logrus.WithFields(logContext). - WithField(logfields.Timeout, timeout.SyscallWatcher). - Warning("Syscall did not complete within operation timeout. This may indicate a platform issue. If it appears to be making no forward progress, obtain the stacks and see if there is a syscall stuck in the platform API for a significant length of time.") - } - } -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go index 59ec7004..6a1c41e1 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go @@ -3,6 +3,7 @@ package hns import ( "encoding/json" "net" + "strings" "github.com/sirupsen/logrus" ) @@ -94,6 +95,27 @@ func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) { return nil, EndpointNotFoundError{EndpointName: endpointName} } +type endpointAttachInfo struct { + SharedContainers json.RawMessage `json:",omitempty"` +} + +func (endpoint *HNSEndpoint) IsAttached(vID string) (bool, error) { + attachInfo := endpointAttachInfo{} + err := hnsCall("GET", "/endpoints/"+endpoint.Id, "", &attachInfo) + + // Return false allows us to just return the err + if err != nil { + return false, err + } + + if strings.Contains(strings.ToLower(string(attachInfo.SharedContainers)), strings.ToLower(vID)) { + return true, nil + } + + return false, nil + +} + // Create Endpoint by sending EndpointRequest to HNS. TODO: Create a separate HNS interface to place all these methods func (endpoint *HNSEndpoint) Create() (*HNSEndpoint, error) { operation := "Create" diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go index 969d1b26..2df4a57f 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go @@ -9,23 +9,30 @@ import ( "github.com/sirupsen/logrus" ) -func hnsCall(method, path, request string, returnResponse interface{}) error { +func hnsCallRawResponse(method, path, request string) (*hnsResponse, error) { var responseBuffer *uint16 logrus.Debugf("[%s]=>[%s] Request : %s", method, path, request) err := _hnsCall(method, path, request, &responseBuffer) if err != nil { - return hcserror.New(err, "hnsCall ", "") + return nil, hcserror.New(err, "hnsCall ", "") } response := interop.ConvertAndFreeCoTaskMemString(responseBuffer) hnsresponse := &hnsResponse{} if err = json.Unmarshal([]byte(response), &hnsresponse); err != nil { - return err + return nil, err } + return hnsresponse, nil +} +func hnsCall(method, path, request string, returnResponse interface{}) error { + hnsresponse, err := hnsCallRawResponse(method, path, request) + if err != nil { + return fmt.Errorf("failed during hnsCallRawResponse: %v", err) + } if !hnsresponse.Success { - return fmt.Errorf("HNS failed with error : %s", hnsresponse.Error) + return fmt.Errorf("hns failed with error : %s", hnsresponse.Error) } if len(hnsresponse.Output) == 0 { diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go index 7e859de9..b7ae96fd 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go @@ -2,9 +2,9 @@ package hns import ( "encoding/json" - "net" - + "errors" "github.com/sirupsen/logrus" + "net" ) // Subnet is assoicated with a network and represents a list @@ -98,6 +98,12 @@ func (network *HNSNetwork) Create() (*HNSNetwork, error) { title := "hcsshim::HNSNetwork::" + operation logrus.Debugf(title+" id=%s", network.Id) + for _, subnet := range network.Subnets { + if (subnet.AddressPrefix != "") && (subnet.GatewayAddress == "") { + return nil, errors.New("network create error, subnet has address prefix but no gateway specified") + } + } + jsonString, err := json.Marshal(network) if err != nil { return nil, err diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go index 2318a4fc..61da242e 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go @@ -55,8 +55,9 @@ type PaPolicy struct { type OutboundNatPolicy struct { Policy - VIP string `json:"VIP,omitempty"` - Exceptions []string `json:"ExceptionList,omitempty"` + VIP string `json:"VIP,omitempty"` + Exceptions []string `json:"ExceptionList,omitempty"` + Destinations []string `json:",omitempty"` } type ActionType string diff --git a/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go b/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go index 2f6ec029..922f7c67 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go @@ -15,10 +15,6 @@ func ConvertAndFreeCoTaskMemString(buffer *uint16) string { return str } -func ConvertAndFreeCoTaskMemBytes(buffer *uint16) []byte { - return []byte(ConvertAndFreeCoTaskMemString(buffer)) -} - func Win32FromHresult(hr uintptr) syscall.Errno { if hr&0x1fff0000 == 0x00070000 { return syscall.Errno(hr & 0xffff) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/log/g.go b/vendor/github.com/Microsoft/hcsshim/internal/log/g.go new file mode 100644 index 00000000..ba6b1a4a --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/log/g.go @@ -0,0 +1,23 @@ +package log + +import ( + "context" + + "github.com/sirupsen/logrus" + "go.opencensus.io/trace" +) + +// G returns a `logrus.Entry` with the `TraceID, SpanID` from `ctx` if `ctx` +// contains an OpenCensus `trace.Span`. +func G(ctx context.Context) *logrus.Entry { + span := trace.FromContext(ctx) + if span != nil { + sctx := span.SpanContext() + return logrus.WithFields(logrus.Fields{ + "traceID": sctx.TraceID.String(), + "spanID": sctx.SpanID.String(), + // "parentSpanID": TODO: JTERRY75 - Try to convince OC to export this? + }) + } + return logrus.NewEntry(logrus.StandardLogger()) +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/oc/exporter.go b/vendor/github.com/Microsoft/hcsshim/internal/oc/exporter.go new file mode 100644 index 00000000..f428bdaf --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/oc/exporter.go @@ -0,0 +1,43 @@ +package oc + +import ( + "github.com/sirupsen/logrus" + "go.opencensus.io/trace" +) + +var _ = (trace.Exporter)(&LogrusExporter{}) + +// LogrusExporter is an OpenCensus `trace.Exporter` that exports +// `trace.SpanData` to logrus output. +type LogrusExporter struct { +} + +// ExportSpan exports `s` based on the the following rules: +// +// 1. All output will contain `s.Attributes`, `s.TraceID`, `s.SpanID`, +// `s.ParentSpanID` for correlation +// +// 2. Any calls to .Annotate will not be supported. +// +// 3. The span itself will be written at `logrus.InfoLevel` unless +// `s.Status.Code != 0` in which case it will be written at `logrus.ErrorLevel` +// providing `s.Status.Message` as the error value. +func (le *LogrusExporter) ExportSpan(s *trace.SpanData) { + // Combine all span annotations with traceID, spanID, parentSpanID + baseEntry := logrus.WithFields(logrus.Fields(s.Attributes)) + baseEntry.Data["traceID"] = s.TraceID.String() + baseEntry.Data["spanID"] = s.SpanID.String() + baseEntry.Data["parentSpanID"] = s.ParentSpanID.String() + baseEntry.Data["startTime"] = s.StartTime + baseEntry.Data["endTime"] = s.EndTime + baseEntry.Data["duration"] = s.EndTime.Sub(s.StartTime).String() + baseEntry.Data["name"] = s.Name + baseEntry.Time = s.StartTime + + level := logrus.InfoLevel + if s.Status.Code != 0 { + level = logrus.ErrorLevel + baseEntry.Data[logrus.ErrorKey] = s.Status.Message + } + baseEntry.Log(level, "Span") +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/oc/span.go b/vendor/github.com/Microsoft/hcsshim/internal/oc/span.go new file mode 100644 index 00000000..fee4765c --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/oc/span.go @@ -0,0 +1,17 @@ +package oc + +import ( + "go.opencensus.io/trace" +) + +// SetSpanStatus sets `span.SetStatus` to the proper status depending on `err`. If +// `err` is `nil` assumes `trace.StatusCodeOk`. +func SetSpanStatus(span *trace.Span, err error) { + status := trace.Status{} + if err != nil { + // TODO: JTERRY75 - Handle errors in a non-generic way + status.Code = trace.StatusCodeUnknown + status.Message = err.Error() + } + span.SetStatus(status) +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go b/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go index 995433ac..fb23617f 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go @@ -4,7 +4,8 @@ import ( "encoding/json" "time" - "github.com/Microsoft/hcsshim/internal/schema2" + "github.com/Microsoft/go-winio/pkg/guid" + hcsschema "github.com/Microsoft/hcsshim/internal/schema2" ) // ProcessConfig is used as both the input of Container.CreateProcess @@ -62,7 +63,7 @@ type MappedVirtualDisk struct { CreateInUtilityVM bool `json:",omitempty"` ReadOnly bool `json:",omitempty"` Cache string `json:",omitempty"` // "" (Unspecified); "Disabled"; "Enabled"; "Private"; "PrivateAllowSharing" - AttachOnly bool `json:",omitempty:` + AttachOnly bool `json:",omitempty"` } // AssignedDevice represents a device that has been directly assigned to a container @@ -133,9 +134,10 @@ type ContainerProperties struct { State string Name string SystemType string + RuntimeOSType string `json:"RuntimeOsType,omitempty"` Owner string SiloGUID string `json:"SiloGuid,omitempty"` - RuntimeID string `json:"RuntimeId,omitempty"` + RuntimeID guid.GUID `json:"RuntimeId,omitempty"` IsRuntimeTemplate bool `json:",omitempty"` RuntimeImagePath string `json:",omitempty"` Stopped bool `json:",omitempty"` @@ -214,6 +216,7 @@ type MappedVirtualDiskController struct { type GuestDefinedCapabilities struct { NamespaceAddRequestSupported bool `json:",omitempty"` SignalProcessSupported bool `json:",omitempty"` + DumpStacksSupported bool `json:",omitempty"` } // GuestConnectionInfo is the structure of an iterm return by a GuestConnection call on a utility VM diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go index 09456cbc..bcfeb34d 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go @@ -10,7 +10,6 @@ package hcsschema type Attachment struct { - Type_ string `json:"Type,omitempty"` Path string `json:"Path,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go index 243779ea..c1ea3953 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go @@ -10,7 +10,6 @@ package hcsschema type CacheQueryStatsResponse struct { - L3OccupancyBytes int32 `json:"L3OccupancyBytes,omitempty"` L3TotalBwBytes int32 `json:"L3TotalBwBytes,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go index 88f01707..b4f9c315 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go @@ -10,6 +10,5 @@ package hcsschema type CloseHandle struct { - Handle string `json:"Handle,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go index c665be3d..8bf8cab6 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go @@ -11,7 +11,6 @@ package hcsschema // ComPort specifies the named pipe that will be used for the port, with empty string indicating a disconnected port. type ComPort struct { - NamedPipe string `json:"NamedPipe,omitempty"` OptimizeForDebugger bool `json:"OptimizeForDebugger,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go index 85785d28..10cea67e 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go @@ -10,14 +10,13 @@ package hcsschema type ComputeSystem struct { - Owner string `json:"Owner,omitempty"` SchemaVersion *Version `json:"SchemaVersion,omitempty"` HostingSystemId string `json:"HostingSystemId,omitempty"` - HostedSystem *HostedSystem `json:"HostedSystem,omitempty"` + HostedSystem interface{} `json:"HostedSystem,omitempty"` Container *Container `json:"Container,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go index 1a47db7d..1d5dfe68 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go @@ -25,37 +25,37 @@ func (c contextKey) String() string { var ( // ContextOAuth2 takes a oauth2.TokenSource as authentication for the request. - ContextOAuth2 = contextKey("token") + ContextOAuth2 = contextKey("token") // ContextBasicAuth takes BasicAuth as authentication for the request. - ContextBasicAuth = contextKey("basic") + ContextBasicAuth = contextKey("basic") // ContextAccessToken takes a string oauth2 access token as authentication for the request. - ContextAccessToken = contextKey("accesstoken") + ContextAccessToken = contextKey("accesstoken") // ContextAPIKey takes an APIKey as authentication for the request - ContextAPIKey = contextKey("apikey") + ContextAPIKey = contextKey("apikey") ) -// BasicAuth provides basic http authentication to a request passed via context using ContextBasicAuth +// BasicAuth provides basic http authentication to a request passed via context using ContextBasicAuth type BasicAuth struct { - UserName string `json:"userName,omitempty"` - Password string `json:"password,omitempty"` + UserName string `json:"userName,omitempty"` + Password string `json:"password,omitempty"` } // APIKey provides API key based authentication to a request passed via context using ContextAPIKey type APIKey struct { - Key string - Prefix string + Key string + Prefix string } type Configuration struct { - BasePath string `json:"basePath,omitempty"` - Host string `json:"host,omitempty"` - Scheme string `json:"scheme,omitempty"` - DefaultHeader map[string]string `json:"defaultHeader,omitempty"` - UserAgent string `json:"userAgent,omitempty"` - HTTPClient *http.Client + BasePath string `json:"basePath,omitempty"` + Host string `json:"host,omitempty"` + Scheme string `json:"scheme,omitempty"` + DefaultHeader map[string]string `json:"defaultHeader,omitempty"` + UserAgent string `json:"userAgent,omitempty"` + HTTPClient *http.Client } func NewConfiguration() *Configuration { @@ -69,4 +69,4 @@ func NewConfiguration() *Configuration { func (c *Configuration) AddDefaultHeader(key string, value string) { c.DefaultHeader[key] = value -} \ No newline at end of file +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go index adbe07fe..68aa04a5 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go @@ -10,7 +10,6 @@ package hcsschema type ConsoleSize struct { - Height int32 `json:"Height,omitempty"` Width int32 `json:"Width,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go index 17dce28b..4fb23107 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go @@ -10,7 +10,6 @@ package hcsschema type Container struct { - GuestOs *GuestOs `json:"GuestOs,omitempty"` Storage *Storage `json:"Storage,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go index 754797e2..1fd7ca5d 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go @@ -11,7 +11,6 @@ package hcsschema // memory usage as viewed from within the container type ContainerMemoryInformation struct { - TotalPhysicalBytes int32 `json:"TotalPhysicalBytes,omitempty"` TotalUsage int32 `json:"TotalUsage,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go index b2191c57..781a8840 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go @@ -10,7 +10,6 @@ package hcsschema type Devices struct { - ComPorts map[string]ComPort `json:"ComPorts,omitempty"` Scsi map[string]Scsi `json:"Scsi,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go index 4fe592f7..85450c41 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go @@ -10,6 +10,5 @@ package hcsschema type EnhancedModeVideo struct { - ConnectionOptions *RdpConnectionOptions `json:"ConnectionOptions,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go index 51011afe..fe86cab6 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go @@ -10,7 +10,6 @@ package hcsschema type FlexibleIoDevice struct { - EmulatorId string `json:"EmulatorId,omitempty"` HostingModel string `json:"HostingModel,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go index c5fa7673..af828004 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go @@ -10,6 +10,5 @@ package hcsschema type GuestCrashReporting struct { - WindowsCrashSettings *WindowsCrashReporting `json:"WindowsCrashSettings,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go index c708fc7c..8838519a 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go @@ -10,6 +10,5 @@ package hcsschema type GuestOs struct { - HostName string `json:"HostName,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go index 0797584c..ea3084bc 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go @@ -10,7 +10,6 @@ package hcsschema type HostedSystem struct { - SchemaVersion *Version `json:"SchemaVersion,omitempty"` Container *Container `json:"Container,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go index ef9ffb8d..23b2ee9e 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go @@ -10,7 +10,6 @@ package hcsschema type HvSocket struct { - Config *HvSocketSystemConfig `json:"Config,omitempty"` EnablePowerShellDirect bool `json:"EnablePowerShellDirect,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go index a19ba15c..a017691f 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go @@ -11,6 +11,5 @@ package hcsschema // HvSocket configuration for a VM type HvSocket2 struct { - HvSocketConfig *HvSocketSystemConfig `json:"HvSocketConfig,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go index b63b8ef1..176c49d4 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go @@ -10,7 +10,6 @@ package hcsschema type Layer struct { - Id string `json:"Id,omitempty"` Path string `json:"Path,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go index a823a6d3..9b86a404 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go @@ -10,7 +10,6 @@ package hcsschema type MappedDirectory struct { - HostPath string `json:"HostPath,omitempty"` HostPathType string `json:"HostPathType,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go index 2d1d2604..208074e9 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go @@ -10,7 +10,6 @@ package hcsschema type MappedPipe struct { - ContainerPipeName string `json:"ContainerPipeName,omitempty"` HostPath string `json:"HostPath,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go index e1d135a3..ec93d004 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go @@ -10,6 +10,5 @@ package hcsschema type Memory struct { - SizeInMB int32 `json:"SizeInMB,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_2.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_2.go index 27d0b8c4..b4a36954 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_2.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_2.go @@ -22,4 +22,9 @@ type Memory2 struct { // EnableDeferredCommit is private in the schema. If regenerated need to add back. EnableDeferredCommit bool `json:"EnableDeferredCommit,omitempty"` + + // EnableColdDiscardHint if enabled, then the memory cold discard hint feature is exposed + // to the VM, allowing it to trim non-zeroed pages from the working set (if supported by + // the guest operating system). + EnableColdDiscardHint bool `json:"EnableColdDiscardHint,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go index bdd87dff..811779b0 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go @@ -10,8 +10,7 @@ package hcsschema type MemoryInformationForVm struct { - - VirtualNodeCount int32 `json:"VirtualNodeCount,omitempty"` + VirtualNodeCount uint32 `json:"VirtualNodeCount,omitempty"` VirtualMachineMemory *VmMemory `json:"VirtualMachineMemory,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go index 6214970f..906ba597 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go @@ -11,10 +11,9 @@ package hcsschema // Memory runtime statistics type MemoryStats struct { + MemoryUsageCommitBytes uint64 `json:"MemoryUsageCommitBytes,omitempty"` - MemoryUsageCommitBytes int32 `json:"MemoryUsageCommitBytes,omitempty"` + MemoryUsageCommitPeakBytes uint64 `json:"MemoryUsageCommitPeakBytes,omitempty"` - MemoryUsageCommitPeakBytes int32 `json:"MemoryUsageCommitPeakBytes,omitempty"` - - MemoryUsagePrivateWorkingSetBytes int32 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"` + MemoryUsagePrivateWorkingSetBytes uint64 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go index c586f66c..a9c750b3 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go @@ -10,7 +10,6 @@ package hcsschema type NetworkAdapter struct { - EndpointId string `json:"EndpointId,omitempty"` MacAddress string `json:"MacAddress,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go index 12c47827..e5ea187a 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go @@ -10,7 +10,6 @@ package hcsschema type Networking struct { - AllowUnqualifiedDnsQuery bool `json:"AllowUnqualifiedDnsQuery,omitempty"` DnsSearchList string `json:"DnsSearchList,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go index 1cd70d17..d96c9501 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go @@ -11,6 +11,5 @@ package hcsschema // Notification data that is indicated to components running in the Virtual Machine. type PauseNotification struct { - Reason string `json:"Reason,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go index 780a5cae..21707a88 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go @@ -11,7 +11,6 @@ package hcsschema // Options for HcsPauseComputeSystem type PauseOptions struct { - SuspensionLevel string `json:"SuspensionLevel,omitempty"` HostedNotification *PauseNotification `json:"HostedNotification,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go index 705c677e..29d8c801 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go @@ -10,6 +10,5 @@ package hcsschema type Plan9 struct { - Shares []Plan9Share `json:"Shares,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9_share.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9_share.go index eb171817..41f8fdea 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9_share.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9_share.go @@ -10,7 +10,6 @@ package hcsschema type Plan9Share struct { - Name string `json:"Name,omitempty"` // The name by which the guest operation system can access this share, via the aname parameter in the Plan9 protocol. @@ -30,4 +29,6 @@ type Plan9Share struct { ReadOnly bool `json:"ReadOnly,omitempty"` UseShareRootIdentity bool `json:"UseShareRootIdentity,omitempty"` + + AllowedFiles []string `json:"AllowedFiles,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go index 63e0b7f8..e9a662dd 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go @@ -15,7 +15,6 @@ import ( // Information about a process running in a container type ProcessDetails struct { - ProcessId int32 `json:"ProcessId,omitempty"` ImageName string `json:"ImageName,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go index 29bc2e3d..e4ed095c 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go @@ -11,7 +11,6 @@ package hcsschema // Passed to HcsRpc_ModifyProcess type ProcessModifyRequest struct { - Operation string `json:"Operation,omitempty"` ConsoleSize *ConsoleSize `json:"ConsoleSize,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go index 470c5573..82b0d053 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go @@ -10,7 +10,6 @@ package hcsschema type ProcessParameters struct { - ApplicationName string `json:"ApplicationName,omitempty"` CommandLine string `json:"CommandLine,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go index 20793d15..ad9a4fa9 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go @@ -11,7 +11,6 @@ package hcsschema // Status of a process running in a container type ProcessStatus struct { - ProcessId int32 `json:"ProcessId,omitempty"` Exited bool `json:"Exited,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go index 7a60b024..bb24e88d 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go @@ -10,7 +10,6 @@ package hcsschema type Processor struct { - Count int32 `json:"Count,omitempty"` Maximum int32 `json:"Maximum,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go index 40d3e735..21fe4606 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go @@ -10,7 +10,6 @@ package hcsschema type Processor2 struct { - Count int32 `json:"Count,omitempty"` Limit int32 `json:"Limit,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go index 9d3b77e5..6157e252 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go @@ -11,10 +11,9 @@ package hcsschema // CPU runtime statistics type ProcessorStats struct { + TotalRuntime100ns uint64 `json:"TotalRuntime100ns,omitempty"` - TotalRuntime100ns int32 `json:"TotalRuntime100ns,omitempty"` + RuntimeUser100ns uint64 `json:"RuntimeUser100ns,omitempty"` - RuntimeUser100ns int32 `json:"RuntimeUser100ns,omitempty"` - - RuntimeKernel100ns int32 `json:"RuntimeKernel100ns,omitempty"` + RuntimeKernel100ns uint64 `json:"RuntimeKernel100ns,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go index 6db2a48f..17558cba 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go @@ -9,8 +9,11 @@ package hcsschema -type Properties struct { +import ( + v1 "github.com/containerd/cgroups/stats/v1" +) +type Properties struct { Id string `json:"Id,omitempty"` SystemType string `json:"SystemType,omitempty"` @@ -44,4 +47,8 @@ type Properties struct { SharedMemoryRegionInfo []SharedMemoryRegionInfo `json:"SharedMemoryRegionInfo,omitempty"` GuestConnectionInfo *GuestConnectionInfo `json:"GuestConnectionInfo,omitempty"` + + // Metrics is not part of the API for HCS but this is used for LCOW v2 to + // return the full cgroup metrics from the guest. + Metrics *v1.Metrics `json:"LCOWMetrics,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go index 22b92ffd..d6d80df1 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go @@ -9,8 +9,7 @@ package hcsschema -// By default the basic properties will be returned. This query provides a way to request specific properties. +// By default the basic properties will be returned. This query provides a way to request specific properties. type PropertyQuery struct { - - PropertyTypes []string `json:"PropertyTypes,omitempty"` + PropertyTypes []PropertyType `json:"PropertyTypes,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_type.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_type.go new file mode 100644 index 00000000..f092b737 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_type.go @@ -0,0 +1,23 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type PropertyType string + +const ( + PTMemory PropertyType = "Memory" + PTGuestMemory PropertyType = "GuestMemory" + PTStatistics PropertyType = "Statistics" + PTProcessList PropertyType = "ProcessList" + PTTerminateOnLastHandleClosed PropertyType = "TerminateOnLastHandleClosed" + PTSharedMemoryRegion PropertyType = "SharedMemoryRegion" + PTGuestConnection PropertyType = "GuestConnection" + PTICHeartbeatStatus PropertyType = "ICHeartbeatStatus" +) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go index 97e45312..8d5f5c17 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go @@ -10,7 +10,6 @@ package hcsschema type RdpConnectionOptions struct { - AccessSids []string `json:"AccessSids,omitempty"` NamedPipe string `json:"NamedPipe,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go index fa574ccc..006906f6 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go @@ -10,7 +10,6 @@ package hcsschema type RegistryChanges struct { - AddValues []RegistryValue `json:"AddValues,omitempty"` DeleteKeys []RegistryKey `json:"DeleteKeys,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go index fab03bc6..26fde99c 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go @@ -10,7 +10,6 @@ package hcsschema type RegistryKey struct { - Hive string `json:"Hive,omitempty"` Name string `json:"Name,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go index 1589f484..3f203176 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go @@ -10,7 +10,6 @@ package hcsschema type RegistryValue struct { - Key *RegistryKey `json:"Key,omitempty"` Name string `json:"Name,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go index bd573f6c..df9baa92 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go @@ -10,6 +10,5 @@ package hcsschema type SharedMemoryConfiguration struct { - Regions []SharedMemoryRegion `json:"Regions,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go index a57b2cba..825b7186 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go @@ -10,7 +10,6 @@ package hcsschema type SharedMemoryRegion struct { - SectionName string `json:"SectionName,omitempty"` StartOffset int32 `json:"StartOffset,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go index d9a50cc7..f67b08eb 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go @@ -10,7 +10,6 @@ package hcsschema type SharedMemoryRegionInfo struct { - SectionName string `json:"SectionName,omitempty"` GuestPhysicalAddress int32 `json:"GuestPhysicalAddress,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go index 599c06e8..5eaf6a7f 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go @@ -11,7 +11,6 @@ package hcsschema // Silo job information type SiloProperties struct { - Enabled bool `json:"Enabled,omitempty"` JobName string `json:"JobName,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go index 5cb3ed93..ba7a6b39 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go @@ -15,12 +15,11 @@ import ( // Runtime statistics for a container type Statistics struct { - Timestamp time.Time `json:"Timestamp,omitempty"` ContainerStartTime time.Time `json:"ContainerStartTime,omitempty"` - Uptime100ns int32 `json:"Uptime100ns,omitempty"` + Uptime100ns uint64 `json:"Uptime100ns,omitempty"` Processor *ProcessorStats `json:"Processor,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go index 8c5255df..9c5e6eb5 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go @@ -10,7 +10,6 @@ package hcsschema type StorageQoS struct { - IopsMaximum int32 `json:"IopsMaximum,omitempty"` BandwidthMaximum int32 `json:"BandwidthMaximum,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go index 198ea57d..4f042ffd 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go @@ -11,12 +11,11 @@ package hcsschema // Storage runtime statistics type StorageStats struct { + ReadCountNormalized uint64 `json:"ReadCountNormalized,omitempty"` - ReadCountNormalized int32 `json:"ReadCountNormalized,omitempty"` + ReadSizeBytes uint64 `json:"ReadSizeBytes,omitempty"` - ReadSizeBytes int32 `json:"ReadSizeBytes,omitempty"` + WriteCountNormalized uint64 `json:"WriteCountNormalized,omitempty"` - WriteCountNormalized int32 `json:"WriteCountNormalized,omitempty"` - - WriteSizeBytes int32 `json:"WriteSizeBytes,omitempty"` + WriteSizeBytes uint64 `json:"WriteSizeBytes,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go index af2e3c82..83486994 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go @@ -10,7 +10,6 @@ package hcsschema type Topology struct { - Memory *Memory2 `json:"Memory,omitempty"` Processor *Processor2 `json:"Processor,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go index ba91178f..0e48ece5 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go @@ -10,7 +10,6 @@ package hcsschema type Uefi struct { - EnableDebugger bool `json:"EnableDebugger,omitempty"` SecureBootTemplateId string `json:"SecureBootTemplateId,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go index 6620fb2b..3ab409d8 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go @@ -10,7 +10,6 @@ package hcsschema type UefiBootEntry struct { - DeviceType string `json:"DeviceType,omitempty"` DevicePath string `json:"DevicePath,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go index 62c0e4d1..2abfccca 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go @@ -10,7 +10,6 @@ package hcsschema type Version struct { - Major int32 `json:"Major,omitempty"` Minor int32 `json:"Minor,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go index 0958e560..ec5d0fb9 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go @@ -10,7 +10,6 @@ package hcsschema type VideoMonitor struct { - HorizontalResolution int32 `json:"HorizontalResolution,omitempty"` VerticalResolution int32 `json:"VerticalResolution,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go index 48402d8e..91a3c83d 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go @@ -10,7 +10,6 @@ package hcsschema type VirtualNodeInfo struct { - VirtualNodeIndex int32 `json:"VirtualNodeIndex,omitempty"` PhysicalNodeNumber int32 `json:"PhysicalNodeNumber,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go index 47714444..70cf2d90 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go @@ -10,7 +10,6 @@ package hcsschema type VirtualPMemDevice struct { - HostPath string `json:"HostPath,omitempty"` ReadOnly bool `json:"ReadOnly,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go index 76131b3a..362df363 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go @@ -10,7 +10,6 @@ package hcsschema type VirtualSmb struct { - Shares []VirtualSmbShare `json:"Shares,omitempty"` DirectFileMappingInMB int64 `json:"DirectFileMappingInMB,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go index b50098a4..915e9b63 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go @@ -10,7 +10,6 @@ package hcsschema type VirtualSmbShare struct { - Name string `json:"Name,omitempty"` Path string `json:"Path,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go index c1894279..75196bd8 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go @@ -10,7 +10,6 @@ package hcsschema type VirtualSmbShareOptions struct { - ReadOnly bool `json:"ReadOnly,omitempty"` // convert exclusive access to shared read access diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go index 39f62866..8e1836dd 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go @@ -10,14 +10,13 @@ package hcsschema type VmMemory struct { - AvailableMemory int32 `json:"AvailableMemory,omitempty"` AvailableMemoryBuffer int32 `json:"AvailableMemoryBuffer,omitempty"` - ReservedMemory int32 `json:"ReservedMemory,omitempty"` + ReservedMemory uint64 `json:"ReservedMemory,omitempty"` - AssignedMemory int32 `json:"AssignedMemory,omitempty"` + AssignedMemory uint64 `json:"AssignedMemory,omitempty"` SlpActive bool `json:"SlpActive,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go index cf632bbc..8ed7e566 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go @@ -10,7 +10,6 @@ package hcsschema type WindowsCrashReporting struct { - DumpFileName string `json:"DumpFileName,omitempty"` MaxDumpSize int64 `json:"MaxDumpSize,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go new file mode 100644 index 00000000..7c2a0dc2 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go @@ -0,0 +1,565 @@ +package vmcompute + +import ( + gcontext "context" + "syscall" + "time" + + "github.com/Microsoft/hcsshim/internal/interop" + "github.com/Microsoft/hcsshim/internal/log" + "github.com/Microsoft/hcsshim/internal/logfields" + "github.com/Microsoft/hcsshim/internal/oc" + "github.com/Microsoft/hcsshim/internal/timeout" + "go.opencensus.io/trace" +) + +//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go vmcompute.go + +//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems? +//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem? +//sys hcsOpenComputeSystem(id string, computeSystem *HcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem? +//sys hcsCloseComputeSystem(computeSystem HcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem? +//sys hcsStartComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem? +//sys hcsShutdownComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem? +//sys hcsTerminateComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem? +//sys hcsPauseComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem? +//sys hcsResumeComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem? +//sys hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties? +//sys hcsModifyComputeSystem(computeSystem HcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem? +//sys hcsRegisterComputeSystemCallback(computeSystem HcsSystem, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback? +//sys hcsUnregisterComputeSystemCallback(callbackHandle HcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback? + +//sys hcsCreateProcess(computeSystem HcsSystem, processParameters string, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess? +//sys hcsOpenProcess(computeSystem HcsSystem, pid uint32, process *HcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess? +//sys hcsCloseProcess(process HcsProcess) (hr error) = vmcompute.HcsCloseProcess? +//sys hcsTerminateProcess(process HcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess? +//sys hcsSignalProcess(process HcsProcess, options string, result **uint16) (hr error) = vmcompute.HcsSignalProcess? +//sys hcsGetProcessInfo(process HcsProcess, processInformation *HcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo? +//sys hcsGetProcessProperties(process HcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties? +//sys hcsModifyProcess(process HcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess? +//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties? +//sys hcsRegisterProcessCallback(process HcsProcess, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback? +//sys hcsUnregisterProcessCallback(callbackHandle HcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback? + +// errVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously +const errVmcomputeOperationPending = syscall.Errno(0xC0370103) + +// HcsSystem is the handle associated with a created compute system. +type HcsSystem syscall.Handle + +// HcsProcess is the handle associated with a created process in a compute +// system. +type HcsProcess syscall.Handle + +// HcsCallback is the handle associated with the function to call when events +// occur. +type HcsCallback syscall.Handle + +// HcsProcessInformation is the structure used when creating or getting process +// info. +type HcsProcessInformation struct { + // ProcessId is the pid of the created process. + ProcessId uint32 + reserved uint32 + // StdInput is the handle associated with the stdin of the process. + StdInput syscall.Handle + // StdOutput is the handle associated with the stdout of the process. + StdOutput syscall.Handle + // StdError is the handle associated with the stderr of the process. + StdError syscall.Handle +} + +func execute(ctx gcontext.Context, timeout time.Duration, f func() error) error { + if timeout > 0 { + var cancel gcontext.CancelFunc + ctx, cancel = gcontext.WithTimeout(ctx, timeout) + defer cancel() + } + + done := make(chan error, 1) + go func() { + done <- f() + }() + select { + case <-ctx.Done(): + if ctx.Err() == gcontext.DeadlineExceeded { + log.G(ctx).WithField(logfields.Timeout, timeout). + Warning("Syscall did not complete within operation timeout. This may indicate a platform issue. If it appears to be making no forward progress, obtain the stacks and see if there is a syscall stuck in the platform API for a significant length of time.") + } + return ctx.Err() + case err := <-done: + return err + } +} + +func HcsEnumerateComputeSystems(ctx gcontext.Context, query string) (computeSystems, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsEnumerateComputeSystems") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("query", query)) + + return computeSystems, result, execute(ctx, timeout.SyscallWatcher, func() error { + var ( + computeSystemsp *uint16 + resultp *uint16 + ) + err := hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp) + if computeSystemsp != nil { + computeSystems = interop.ConvertAndFreeCoTaskMemString(computeSystemsp) + } + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsCreateComputeSystem(ctx gcontext.Context, id string, configuration string, identity syscall.Handle) (computeSystem HcsSystem, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsCreateComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes( + trace.StringAttribute("id", id), + trace.StringAttribute("configuration", configuration)) + + return computeSystem, result, execute(ctx, timeout.SystemCreate, func() error { + var resultp *uint16 + err := hcsCreateComputeSystem(id, configuration, identity, &computeSystem, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsOpenComputeSystem(ctx gcontext.Context, id string) (computeSystem HcsSystem, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsOpenComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + + return computeSystem, result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsOpenComputeSystem(id, &computeSystem, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsCloseComputeSystem(ctx gcontext.Context, computeSystem HcsSystem) (hr error) { + ctx, span := trace.StartSpan(ctx, "HcsCloseComputeSystem") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return execute(ctx, timeout.SyscallWatcher, func() error { + return hcsCloseComputeSystem(computeSystem) + }) +} + +func HcsStartComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsStartComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SystemStart, func() error { + var resultp *uint16 + err := hcsStartComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsShutdownComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsShutdownComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsShutdownComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsTerminateComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsTerminateComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsTerminateComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsPauseComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsPauseComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SystemPause, func() error { + var resultp *uint16 + err := hcsPauseComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsResumeComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsResumeComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SystemResume, func() error { + var resultp *uint16 + err := hcsResumeComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsGetComputeSystemProperties(ctx gcontext.Context, computeSystem HcsSystem, propertyQuery string) (properties, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsGetComputeSystemProperties") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("propertyQuery", propertyQuery)) + + return properties, result, execute(ctx, timeout.SyscallWatcher, func() error { + var ( + propertiesp *uint16 + resultp *uint16 + ) + err := hcsGetComputeSystemProperties(computeSystem, propertyQuery, &propertiesp, &resultp) + if propertiesp != nil { + properties = interop.ConvertAndFreeCoTaskMemString(propertiesp) + } + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsModifyComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, configuration string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsModifyComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("configuration", configuration)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsModifyComputeSystem(computeSystem, configuration, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsRegisterComputeSystemCallback(ctx gcontext.Context, computeSystem HcsSystem, callback uintptr, context uintptr) (callbackHandle HcsCallback, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsRegisterComputeSystemCallback") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return callbackHandle, execute(ctx, timeout.SyscallWatcher, func() error { + return hcsRegisterComputeSystemCallback(computeSystem, callback, context, &callbackHandle) + }) +} + +func HcsUnregisterComputeSystemCallback(ctx gcontext.Context, callbackHandle HcsCallback) (hr error) { + ctx, span := trace.StartSpan(ctx, "HcsUnregisterComputeSystemCallback") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return execute(ctx, timeout.SyscallWatcher, func() error { + return hcsUnregisterComputeSystemCallback(callbackHandle) + }) +} + +func HcsCreateProcess(ctx gcontext.Context, computeSystem HcsSystem, processParameters string) (processInformation HcsProcessInformation, process HcsProcess, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsCreateProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("processParameters", processParameters)) + + return processInformation, process, result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsCreateProcess(computeSystem, processParameters, &processInformation, &process, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsOpenProcess(ctx gcontext.Context, computeSystem HcsSystem, pid uint32) (process HcsProcess, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsOpenProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.Int64Attribute("pid", int64(pid))) + + return process, result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsOpenProcess(computeSystem, pid, &process, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsCloseProcess(ctx gcontext.Context, process HcsProcess) (hr error) { + ctx, span := trace.StartSpan(ctx, "HcsCloseProcess") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return execute(ctx, timeout.SyscallWatcher, func() error { + return hcsCloseProcess(process) + }) +} + +func HcsTerminateProcess(ctx gcontext.Context, process HcsProcess) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsTerminateProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsTerminateProcess(process, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsSignalProcess(ctx gcontext.Context, process HcsProcess, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsSignalProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsSignalProcess(process, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsGetProcessInfo(ctx gcontext.Context, process HcsProcess) (processInformation HcsProcessInformation, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsGetProcessInfo") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + + return processInformation, result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsGetProcessInfo(process, &processInformation, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsGetProcessProperties(ctx gcontext.Context, process HcsProcess) (processProperties, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsGetProcessProperties") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + + return processProperties, result, execute(ctx, timeout.SyscallWatcher, func() error { + var ( + processPropertiesp *uint16 + resultp *uint16 + ) + err := hcsGetProcessProperties(process, &processPropertiesp, &resultp) + if processPropertiesp != nil { + processProperties = interop.ConvertAndFreeCoTaskMemString(processPropertiesp) + } + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsModifyProcess(ctx gcontext.Context, process HcsProcess, settings string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsModifyProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("settings", settings)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsModifyProcess(process, settings, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsGetServiceProperties(ctx gcontext.Context, propertyQuery string) (properties, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsGetServiceProperties") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("propertyQuery", propertyQuery)) + + return properties, result, execute(ctx, timeout.SyscallWatcher, func() error { + var ( + propertiesp *uint16 + resultp *uint16 + ) + err := hcsGetServiceProperties(propertyQuery, &propertiesp, &resultp) + if propertiesp != nil { + properties = interop.ConvertAndFreeCoTaskMemString(propertiesp) + } + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsRegisterProcessCallback(ctx gcontext.Context, process HcsProcess, callback uintptr, context uintptr) (callbackHandle HcsCallback, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsRegisterProcessCallback") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return callbackHandle, execute(ctx, timeout.SyscallWatcher, func() error { + return hcsRegisterProcessCallback(process, callback, context, &callbackHandle) + }) +} + +func HcsUnregisterProcessCallback(ctx gcontext.Context, callbackHandle HcsCallback) (hr error) { + ctx, span := trace.StartSpan(ctx, "HcsUnregisterProcessCallback") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return execute(ctx, timeout.SyscallWatcher, func() error { + return hcsUnregisterProcessCallback(callbackHandle) + }) +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/zsyscall_windows.go similarity index 81% rename from vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go rename to vendor/github.com/Microsoft/hcsshim/internal/vmcompute/zsyscall_windows.go index fcd5cdc8..0f2a69f6 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/zsyscall_windows.go @@ -1,6 +1,6 @@ // Code generated mksyscall_windows.exe DO NOT EDIT -package hcs +package vmcompute import ( "syscall" @@ -56,13 +56,13 @@ var ( procHcsOpenProcess = modvmcompute.NewProc("HcsOpenProcess") procHcsCloseProcess = modvmcompute.NewProc("HcsCloseProcess") procHcsTerminateProcess = modvmcompute.NewProc("HcsTerminateProcess") - - procHcsGetProcessInfo = modvmcompute.NewProc("HcsGetProcessInfo") - procHcsGetProcessProperties = modvmcompute.NewProc("HcsGetProcessProperties") - procHcsModifyProcess = modvmcompute.NewProc("HcsModifyProcess") - procHcsGetServiceProperties = modvmcompute.NewProc("HcsGetServiceProperties") - procHcsRegisterProcessCallback = modvmcompute.NewProc("HcsRegisterProcessCallback") - procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback") + procHcsSignalProcess = modvmcompute.NewProc("HcsSignalProcess") + procHcsGetProcessInfo = modvmcompute.NewProc("HcsGetProcessInfo") + procHcsGetProcessProperties = modvmcompute.NewProc("HcsGetProcessProperties") + procHcsModifyProcess = modvmcompute.NewProc("HcsModifyProcess") + procHcsGetServiceProperties = modvmcompute.NewProc("HcsGetServiceProperties") + procHcsRegisterProcessCallback = modvmcompute.NewProc("HcsRegisterProcessCallback") + procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback") ) func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) { @@ -88,7 +88,7 @@ func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result return } -func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) { +func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(id) if hr != nil { @@ -102,7 +102,7 @@ func hcsCreateComputeSystem(id string, configuration string, identity syscall.Ha return _hcsCreateComputeSystem(_p0, _p1, identity, computeSystem, result) } -func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) { +func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) { if hr = procHcsCreateComputeSystem.Find(); hr != nil { return } @@ -116,7 +116,7 @@ func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall return } -func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) { +func hcsOpenComputeSystem(id string, computeSystem *HcsSystem, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(id) if hr != nil { @@ -125,7 +125,7 @@ func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) return _hcsOpenComputeSystem(_p0, computeSystem, result) } -func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16) (hr error) { +func _hcsOpenComputeSystem(id *uint16, computeSystem *HcsSystem, result **uint16) (hr error) { if hr = procHcsOpenComputeSystem.Find(); hr != nil { return } @@ -139,7 +139,7 @@ func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16 return } -func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) { +func hcsCloseComputeSystem(computeSystem HcsSystem) (hr error) { if hr = procHcsCloseComputeSystem.Find(); hr != nil { return } @@ -153,7 +153,7 @@ func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) { return } -func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { +func hcsStartComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -162,7 +162,7 @@ func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uin return _hcsStartComputeSystem(computeSystem, _p0, result) } -func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { +func _hcsStartComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsStartComputeSystem.Find(); hr != nil { return } @@ -176,7 +176,7 @@ func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **u return } -func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { +func hcsShutdownComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -185,7 +185,7 @@ func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result ** return _hcsShutdownComputeSystem(computeSystem, _p0, result) } -func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { +func _hcsShutdownComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsShutdownComputeSystem.Find(); hr != nil { return } @@ -199,7 +199,7 @@ func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result return } -func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { +func hcsTerminateComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -208,7 +208,7 @@ func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result * return _hcsTerminateComputeSystem(computeSystem, _p0, result) } -func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { +func _hcsTerminateComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsTerminateComputeSystem.Find(); hr != nil { return } @@ -222,7 +222,7 @@ func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result return } -func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { +func hcsPauseComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -231,7 +231,7 @@ func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uin return _hcsPauseComputeSystem(computeSystem, _p0, result) } -func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { +func _hcsPauseComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsPauseComputeSystem.Find(); hr != nil { return } @@ -245,7 +245,7 @@ func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **u return } -func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { +func hcsResumeComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -254,7 +254,7 @@ func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **ui return _hcsResumeComputeSystem(computeSystem, _p0, result) } -func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { +func _hcsResumeComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsResumeComputeSystem.Find(); hr != nil { return } @@ -268,7 +268,7 @@ func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result ** return } -func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) { +func hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(propertyQuery) if hr != nil { @@ -277,7 +277,7 @@ func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string return _hcsGetComputeSystemProperties(computeSystem, _p0, properties, result) } -func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { +func _hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { if hr = procHcsGetComputeSystemProperties.Find(); hr != nil { return } @@ -291,7 +291,7 @@ func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint return } -func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) { +func hcsModifyComputeSystem(computeSystem HcsSystem, configuration string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(configuration) if hr != nil { @@ -300,7 +300,7 @@ func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, resul return _hcsModifyComputeSystem(computeSystem, _p0, result) } -func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, result **uint16) (hr error) { +func _hcsModifyComputeSystem(computeSystem HcsSystem, configuration *uint16, result **uint16) (hr error) { if hr = procHcsModifyComputeSystem.Find(); hr != nil { return } @@ -314,7 +314,7 @@ func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, res return } -func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) { +func hcsRegisterComputeSystemCallback(computeSystem HcsSystem, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) { if hr = procHcsRegisterComputeSystemCallback.Find(); hr != nil { return } @@ -328,7 +328,7 @@ func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, return } -func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) { +func hcsUnregisterComputeSystemCallback(callbackHandle HcsCallback) (hr error) { if hr = procHcsUnregisterComputeSystemCallback.Find(); hr != nil { return } @@ -342,7 +342,7 @@ func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) { return } -func hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) { +func hcsCreateProcess(computeSystem HcsSystem, processParameters string, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(processParameters) if hr != nil { @@ -351,7 +351,7 @@ func hcsCreateProcess(computeSystem hcsSystem, processParameters string, process return _hcsCreateProcess(computeSystem, _p0, processInformation, process, result) } -func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) { +func _hcsCreateProcess(computeSystem HcsSystem, processParameters *uint16, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) { if hr = procHcsCreateProcess.Find(); hr != nil { return } @@ -365,7 +365,7 @@ func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, proce return } -func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) { +func hcsOpenProcess(computeSystem HcsSystem, pid uint32, process *HcsProcess, result **uint16) (hr error) { if hr = procHcsOpenProcess.Find(); hr != nil { return } @@ -379,7 +379,7 @@ func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, re return } -func hcsCloseProcess(process hcsProcess) (hr error) { +func hcsCloseProcess(process HcsProcess) (hr error) { if hr = procHcsCloseProcess.Find(); hr != nil { return } @@ -393,7 +393,7 @@ func hcsCloseProcess(process hcsProcess) (hr error) { return } -func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) { +func hcsTerminateProcess(process HcsProcess, result **uint16) (hr error) { if hr = procHcsTerminateProcess.Find(); hr != nil { return } @@ -407,7 +407,7 @@ func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) { return } -func hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) { +func hcsSignalProcess(process HcsProcess, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -416,11 +416,11 @@ func hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr e return _hcsSignalProcess(process, _p0, result) } -func _hcsSignalProcess(process hcsProcess, options *uint16, result **uint16) (hr error) { - if hr = procHcsTerminateProcess.Find(); hr != nil { +func _hcsSignalProcess(process HcsProcess, options *uint16, result **uint16) (hr error) { + if hr = procHcsSignalProcess.Find(); hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + r0, _, _ := syscall.Syscall(procHcsSignalProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -430,7 +430,7 @@ func _hcsSignalProcess(process hcsProcess, options *uint16, result **uint16) (hr return } -func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) { +func hcsGetProcessInfo(process HcsProcess, processInformation *HcsProcessInformation, result **uint16) (hr error) { if hr = procHcsGetProcessInfo.Find(); hr != nil { return } @@ -444,7 +444,7 @@ func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInforma return } -func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) { +func hcsGetProcessProperties(process HcsProcess, processProperties **uint16, result **uint16) (hr error) { if hr = procHcsGetProcessProperties.Find(); hr != nil { return } @@ -458,7 +458,7 @@ func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, res return } -func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) { +func hcsModifyProcess(process HcsProcess, settings string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(settings) if hr != nil { @@ -467,7 +467,7 @@ func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr return _hcsModifyProcess(process, _p0, result) } -func _hcsModifyProcess(process hcsProcess, settings *uint16, result **uint16) (hr error) { +func _hcsModifyProcess(process HcsProcess, settings *uint16, result **uint16) (hr error) { if hr = procHcsModifyProcess.Find(); hr != nil { return } @@ -504,7 +504,7 @@ func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result return } -func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) { +func hcsRegisterProcessCallback(process HcsProcess, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) { if hr = procHcsRegisterProcessCallback.Find(); hr != nil { return } @@ -518,7 +518,7 @@ func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context ui return } -func hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) { +func hcsUnregisterProcessCallback(callbackHandle HcsCallback) (hr error) { if hr = procHcsUnregisterProcessCallback.Find(); hr != nil { return } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go index 651676fb..b3b431e3 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go @@ -1,7 +1,13 @@ package wclayer import ( + "os" + "path/filepath" + "syscall" + "unsafe" + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/Microsoft/hcsshim/osversion" "github.com/sirupsen/logrus" ) @@ -26,5 +32,114 @@ func ExpandScratchSize(path string, size uint64) (err error) { if err != nil { return hcserror.New(err, title+" - failed", "") } + + // Manually expand the volume now in order to work around bugs in 19H1 and + // prerelease versions of Vb. Remove once this is fixed in Windows. + if build := osversion.Get().Build; build >= osversion.V19H1 && build < 19020 { + err = expandSandboxVolume(path) + if err != nil { + return err + } + } + return nil +} + +type virtualStorageType struct { + DeviceID uint32 + VendorID [16]byte +} + +type openVersion2 struct { + GetInfoOnly int32 // bool but 4-byte aligned + ReadOnly int32 // bool but 4-byte aligned + ResiliencyGUID [16]byte // GUID +} + +type openVirtualDiskParameters struct { + Version uint32 // Must always be set to 2 + Version2 openVersion2 +} + +func attachVhd(path string) (syscall.Handle, error) { + var ( + defaultType virtualStorageType + handle syscall.Handle + ) + parameters := openVirtualDiskParameters{Version: 2} + err := openVirtualDisk( + &defaultType, + path, + 0, + 0, + ¶meters, + &handle) + if err != nil { + return 0, &os.PathError{Op: "OpenVirtualDisk", Path: path, Err: err} + } + err = attachVirtualDisk(handle, 0, 0, 0, 0, 0) + if err != nil { + syscall.Close(handle) + return 0, &os.PathError{Op: "AttachVirtualDisk", Path: path, Err: err} + } + return handle, nil +} + +func expandSandboxVolume(path string) error { + // Mount the sandbox VHD temporarily. + vhdPath := filepath.Join(path, "sandbox.vhdx") + vhd, err := attachVhd(vhdPath) + if err != nil { + return &os.PathError{Op: "OpenVirtualDisk", Path: vhdPath, Err: err} + } + defer syscall.Close(vhd) + + // Open the volume. + volumePath, err := GetLayerMountPath(path) + if err != nil { + return err + } + if volumePath[len(volumePath)-1] == '\\' { + volumePath = volumePath[:len(volumePath)-1] + } + volume, err := os.OpenFile(volumePath, os.O_RDWR, 0) + if err != nil { + return err + } + defer volume.Close() + + // Get the volume's underlying partition size in NTFS clusters. + var ( + partitionSize int64 + bytes uint32 + ) + const _IOCTL_DISK_GET_LENGTH_INFO = 0x0007405C + err = syscall.DeviceIoControl(syscall.Handle(volume.Fd()), _IOCTL_DISK_GET_LENGTH_INFO, nil, 0, (*byte)(unsafe.Pointer(&partitionSize)), 8, &bytes, nil) + if err != nil { + return &os.PathError{Op: "IOCTL_DISK_GET_LENGTH_INFO", Path: volume.Name(), Err: err} + } + const ( + clusterSize = 4096 + sectorSize = 512 + ) + targetClusters := partitionSize / clusterSize + + // Get the volume's current size in NTFS clusters. + var volumeSize int64 + err = getDiskFreeSpaceEx(volume.Name()+"\\", nil, &volumeSize, nil) + if err != nil { + return &os.PathError{Op: "GetDiskFreeSpaceEx", Path: volume.Name(), Err: err} + } + volumeClusters := volumeSize / clusterSize + + // Only resize the volume if there is space to grow, otherwise this will + // fail with invalid parameter. NTFS reserves one cluster. + if volumeClusters+1 < targetClusters { + targetSectors := targetClusters * (clusterSize / sectorSize) + const _FSCTL_EXTEND_VOLUME = 0x000900F0 + err = syscall.DeviceIoControl(syscall.Handle(volume.Fd()), _FSCTL_EXTEND_VOLUME, (*byte)(unsafe.Pointer(&targetSectors)), 8, nil, 0, &bytes, nil) + if err != nil { + return &os.PathError{Op: "FSCTL_EXTEND_VOLUME", Path: volume.Name(), Err: err} + } + } return nil } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go index 90df3bed..443596fb 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go @@ -3,7 +3,7 @@ package wclayer import ( "path/filepath" - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" ) // LayerID returns the layer ID of a layer on disk. diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go index 6d0ae8a0..06671309 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go @@ -6,7 +6,7 @@ package wclayer import ( "syscall" - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" "github.com/sirupsen/logrus" ) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go index 45a63cf6..a259c1b8 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go @@ -1,7 +1,7 @@ package wclayer import ( - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" "github.com/Microsoft/hcsshim/internal/hcserror" "github.com/sirupsen/logrus" ) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go index 78f2aacd..dc40bf51 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go @@ -1,6 +1,6 @@ package wclayer -import "github.com/Microsoft/hcsshim/internal/guid" +import "github.com/Microsoft/go-winio/pkg/guid" //go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go wclayer.go @@ -24,4 +24,9 @@ import "github.com/Microsoft/hcsshim/internal/guid" //sys grantVmAccess(vmid string, filepath string) (hr error) = vmcompute.GrantVmAccess? +//sys openVirtualDisk(virtualStorageType *virtualStorageType, path string, virtualDiskAccessMask uint32, flags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (err error) [failretval != 0] = virtdisk.OpenVirtualDisk +//sys attachVirtualDisk(handle syscall.Handle, sd uintptr, flags uint32, providerFlags uint32, params uintptr, overlapped uintptr) (err error) [failretval != 0] = virtdisk.AttachVirtualDisk + +//sys getDiskFreeSpaceEx(directoryName string, freeBytesAvailableToCaller *int64, totalNumberOfBytes *int64, totalNumberOfFreeBytes *int64) (err error) = GetDiskFreeSpaceExW + type _guid = guid.GUID diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go index d853ab25..67f917f0 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go @@ -38,6 +38,8 @@ func errnoErr(e syscall.Errno) error { var ( modvmcompute = windows.NewLazySystemDLL("vmcompute.dll") + modvirtdisk = windows.NewLazySystemDLL("virtdisk.dll") + modkernel32 = windows.NewLazySystemDLL("kernel32.dll") procActivateLayer = modvmcompute.NewProc("ActivateLayer") procCopyLayer = modvmcompute.NewProc("CopyLayer") @@ -57,6 +59,9 @@ var ( procProcessBaseImage = modvmcompute.NewProc("ProcessBaseImage") procProcessUtilityImage = modvmcompute.NewProc("ProcessUtilityImage") procGrantVmAccess = modvmcompute.NewProc("GrantVmAccess") + procOpenVirtualDisk = modvirtdisk.NewProc("OpenVirtualDisk") + procAttachVirtualDisk = modvirtdisk.NewProc("AttachVirtualDisk") + procGetDiskFreeSpaceExW = modkernel32.NewProc("GetDiskFreeSpaceExW") ) func activateLayer(info *driverInfo, id string) (hr error) { @@ -508,3 +513,57 @@ func _grantVmAccess(vmid *uint16, filepath *uint16) (hr error) { } return } + +func openVirtualDisk(virtualStorageType *virtualStorageType, path string, virtualDiskAccessMask uint32, flags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (err error) { + var _p0 *uint16 + _p0, err = syscall.UTF16PtrFromString(path) + if err != nil { + return + } + return _openVirtualDisk(virtualStorageType, _p0, virtualDiskAccessMask, flags, parameters, handle) +} + +func _openVirtualDisk(virtualStorageType *virtualStorageType, path *uint16, virtualDiskAccessMask uint32, flags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (err error) { + r1, _, e1 := syscall.Syscall6(procOpenVirtualDisk.Addr(), 6, uintptr(unsafe.Pointer(virtualStorageType)), uintptr(unsafe.Pointer(path)), uintptr(virtualDiskAccessMask), uintptr(flags), uintptr(unsafe.Pointer(parameters)), uintptr(unsafe.Pointer(handle))) + if r1 != 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func attachVirtualDisk(handle syscall.Handle, sd uintptr, flags uint32, providerFlags uint32, params uintptr, overlapped uintptr) (err error) { + r1, _, e1 := syscall.Syscall6(procAttachVirtualDisk.Addr(), 6, uintptr(handle), uintptr(sd), uintptr(flags), uintptr(providerFlags), uintptr(params), uintptr(overlapped)) + if r1 != 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func getDiskFreeSpaceEx(directoryName string, freeBytesAvailableToCaller *int64, totalNumberOfBytes *int64, totalNumberOfFreeBytes *int64) (err error) { + var _p0 *uint16 + _p0, err = syscall.UTF16PtrFromString(directoryName) + if err != nil { + return + } + return _getDiskFreeSpaceEx(_p0, freeBytesAvailableToCaller, totalNumberOfBytes, totalNumberOfFreeBytes) +} + +func _getDiskFreeSpaceEx(directoryName *uint16, freeBytesAvailableToCaller *int64, totalNumberOfBytes *int64, totalNumberOfFreeBytes *int64) (err error) { + r1, _, e1 := syscall.Syscall6(procGetDiskFreeSpaceExW.Addr(), 4, uintptr(unsafe.Pointer(directoryName)), uintptr(unsafe.Pointer(freeBytesAvailableToCaller)), uintptr(unsafe.Pointer(totalNumberOfBytes)), uintptr(unsafe.Pointer(totalNumberOfFreeBytes)), 0, 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} diff --git a/vendor/github.com/Microsoft/hcsshim/layer.go b/vendor/github.com/Microsoft/hcsshim/layer.go index df0e63bb..f60ba550 100644 --- a/vendor/github.com/Microsoft/hcsshim/layer.go +++ b/vendor/github.com/Microsoft/hcsshim/layer.go @@ -4,7 +4,7 @@ import ( "crypto/sha1" "path/filepath" - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" "github.com/Microsoft/hcsshim/internal/wclayer" ) @@ -77,7 +77,7 @@ type GUID [16]byte func NameToGuid(name string) (id GUID, err error) { g, err := wclayer.NameToGuid(name) - return GUID(g), err + return g.ToWindowsArray(), err } func NewGUID(source string) *GUID { @@ -88,7 +88,7 @@ func NewGUID(source string) *GUID { } func (g *GUID) ToString() string { - return (guid.GUID)(*g).String() + return guid.FromWindowsArray(*g).String() } type LayerReader = wclayer.LayerReader diff --git a/vendor/github.com/Microsoft/hcsshim/mksyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/mksyscall_windows.go deleted file mode 100644 index 7647734d..00000000 --- a/vendor/github.com/Microsoft/hcsshim/mksyscall_windows.go +++ /dev/null @@ -1,943 +0,0 @@ -// Copyright 2013 The Go Authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the LICENSE file. - -// +build ignore - -/* -mksyscall_windows generates windows system call bodies - -It parses all files specified on command line containing function -prototypes (like syscall_windows.go) and prints system call bodies -to standard output. - -The prototypes are marked by lines beginning with "//sys" and read -like func declarations if //sys is replaced by func, but: - -* The parameter lists must give a name for each argument. This - includes return parameters. - -* The parameter lists must give a type for each argument: - the (x, y, z int) shorthand is not allowed. - -* If the return parameter is an error number, it must be named err. - -* If go func name needs to be different from it's winapi dll name, - the winapi name could be specified at the end, after "=" sign, like - //sys LoadLibrary(libname string) (handle uint32, err error) = LoadLibraryA - -* Each function that returns err needs to supply a condition, that - return value of winapi will be tested against to detect failure. - This would set err to windows "last-error", otherwise it will be nil. - The value can be provided at end of //sys declaration, like - //sys LoadLibrary(libname string) (handle uint32, err error) [failretval==-1] = LoadLibraryA - and is [failretval==0] by default. - -Usage: - mksyscall_windows [flags] [path ...] - -The flags are: - -output - Specify output file name (outputs to console if blank). - -trace - Generate print statement after every syscall. -*/ -package main - -import ( - "bufio" - "bytes" - "errors" - "flag" - "fmt" - "go/format" - "go/parser" - "go/token" - "io" - "io/ioutil" - "log" - "os" - "path/filepath" - "runtime" - "sort" - "strconv" - "strings" - "text/template" -) - -var ( - filename = flag.String("output", "", "output file name (standard output if omitted)") - printTraceFlag = flag.Bool("trace", false, "generate print statement after every syscall") - systemDLL = flag.Bool("systemdll", true, "whether all DLLs should be loaded from the Windows system directory") - winio = flag.Bool("winio", false, "import go-winio") -) - -func trim(s string) string { - return strings.Trim(s, " \t") -} - -var packageName string - -func packagename() string { - return packageName -} - -func syscalldot() string { - if packageName == "syscall" { - return "" - } - return "syscall." -} - -// Param is function parameter -type Param struct { - Name string - Type string - fn *Fn - tmpVarIdx int -} - -// tmpVar returns temp variable name that will be used to represent p during syscall. -func (p *Param) tmpVar() string { - if p.tmpVarIdx < 0 { - p.tmpVarIdx = p.fn.curTmpVarIdx - p.fn.curTmpVarIdx++ - } - return fmt.Sprintf("_p%d", p.tmpVarIdx) -} - -// BoolTmpVarCode returns source code for bool temp variable. -func (p *Param) BoolTmpVarCode() string { - const code = `var %s uint32 - if %s { - %s = 1 - } else { - %s = 0 - }` - tmp := p.tmpVar() - return fmt.Sprintf(code, tmp, p.Name, tmp, tmp) -} - -// SliceTmpVarCode returns source code for slice temp variable. -func (p *Param) SliceTmpVarCode() string { - const code = `var %s *%s - if len(%s) > 0 { - %s = &%s[0] - }` - tmp := p.tmpVar() - return fmt.Sprintf(code, tmp, p.Type[2:], p.Name, tmp, p.Name) -} - -// StringTmpVarCode returns source code for string temp variable. -func (p *Param) StringTmpVarCode() string { - errvar := p.fn.Rets.ErrorVarName() - if errvar == "" { - errvar = "_" - } - tmp := p.tmpVar() - const code = `var %s %s - %s, %s = %s(%s)` - s := fmt.Sprintf(code, tmp, p.fn.StrconvType(), tmp, errvar, p.fn.StrconvFunc(), p.Name) - if errvar == "-" { - return s - } - const morecode = ` - if %s != nil { - return - }` - return s + fmt.Sprintf(morecode, errvar) -} - -// TmpVarCode returns source code for temp variable. -func (p *Param) TmpVarCode() string { - switch { - case p.Type == "bool": - return p.BoolTmpVarCode() - case strings.HasPrefix(p.Type, "[]"): - return p.SliceTmpVarCode() - default: - return "" - } -} - -// TmpVarHelperCode returns source code for helper's temp variable. -func (p *Param) TmpVarHelperCode() string { - if p.Type != "string" { - return "" - } - return p.StringTmpVarCode() -} - -// SyscallArgList returns source code fragments representing p parameter -// in syscall. Slices are translated into 2 syscall parameters: pointer to -// the first element and length. -func (p *Param) SyscallArgList() []string { - t := p.HelperType() - var s string - switch { - case t[0] == '*': - s = fmt.Sprintf("unsafe.Pointer(%s)", p.Name) - case t == "bool": - s = p.tmpVar() - case strings.HasPrefix(t, "[]"): - return []string{ - fmt.Sprintf("uintptr(unsafe.Pointer(%s))", p.tmpVar()), - fmt.Sprintf("uintptr(len(%s))", p.Name), - } - default: - s = p.Name - } - return []string{fmt.Sprintf("uintptr(%s)", s)} -} - -// IsError determines if p parameter is used to return error. -func (p *Param) IsError() bool { - return p.Name == "err" && p.Type == "error" -} - -// HelperType returns type of parameter p used in helper function. -func (p *Param) HelperType() string { - if p.Type == "string" { - return p.fn.StrconvType() - } - return p.Type -} - -// join concatenates parameters ps into a string with sep separator. -// Each parameter is converted into string by applying fn to it -// before conversion. -func join(ps []*Param, fn func(*Param) string, sep string) string { - if len(ps) == 0 { - return "" - } - a := make([]string, 0) - for _, p := range ps { - a = append(a, fn(p)) - } - return strings.Join(a, sep) -} - -// Rets describes function return parameters. -type Rets struct { - Name string - Type string - ReturnsError bool - FailCond string -} - -// ErrorVarName returns error variable name for r. -func (r *Rets) ErrorVarName() string { - if r.ReturnsError { - return "err" - } - if r.Type == "error" { - return r.Name - } - return "" -} - -// ToParams converts r into slice of *Param. -func (r *Rets) ToParams() []*Param { - ps := make([]*Param, 0) - if len(r.Name) > 0 { - ps = append(ps, &Param{Name: r.Name, Type: r.Type}) - } - if r.ReturnsError { - ps = append(ps, &Param{Name: "err", Type: "error"}) - } - return ps -} - -// List returns source code of syscall return parameters. -func (r *Rets) List() string { - s := join(r.ToParams(), func(p *Param) string { return p.Name + " " + p.Type }, ", ") - if len(s) > 0 { - s = "(" + s + ")" - } - return s -} - -// PrintList returns source code of trace printing part correspondent -// to syscall return values. -func (r *Rets) PrintList() string { - return join(r.ToParams(), func(p *Param) string { return fmt.Sprintf(`"%s=", %s, `, p.Name, p.Name) }, `", ", `) -} - -// SetReturnValuesCode returns source code that accepts syscall return values. -func (r *Rets) SetReturnValuesCode() string { - if r.Name == "" && !r.ReturnsError { - return "" - } - retvar := "r0" - if r.Name == "" { - retvar = "r1" - } - errvar := "_" - if r.ReturnsError { - errvar = "e1" - } - return fmt.Sprintf("%s, _, %s := ", retvar, errvar) -} - -func (r *Rets) useLongHandleErrorCode(retvar string) string { - const code = `if %s { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = %sEINVAL - } - }` - cond := retvar + " == 0" - if r.FailCond != "" { - cond = strings.Replace(r.FailCond, "failretval", retvar, 1) - } - return fmt.Sprintf(code, cond, syscalldot()) -} - -// SetErrorCode returns source code that sets return parameters. -func (r *Rets) SetErrorCode() string { - const code = `if r0 != 0 { - %s = %sErrno(r0) - }` - const hrCode = `if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - %s = %sErrno(r0) - }` - if r.Name == "" && !r.ReturnsError { - return "" - } - if r.Name == "" { - return r.useLongHandleErrorCode("r1") - } - if r.Type == "error" { - if r.Name == "hr" { - return fmt.Sprintf(hrCode, r.Name, syscalldot()) - } else { - return fmt.Sprintf(code, r.Name, syscalldot()) - } - } - s := "" - switch { - case r.Type[0] == '*': - s = fmt.Sprintf("%s = (%s)(unsafe.Pointer(r0))", r.Name, r.Type) - case r.Type == "bool": - s = fmt.Sprintf("%s = r0 != 0", r.Name) - default: - s = fmt.Sprintf("%s = %s(r0)", r.Name, r.Type) - } - if !r.ReturnsError { - return s - } - return s + "\n\t" + r.useLongHandleErrorCode(r.Name) -} - -// Fn describes syscall function. -type Fn struct { - Name string - Params []*Param - Rets *Rets - PrintTrace bool - confirmproc bool - dllname string - dllfuncname string - src string - // TODO: get rid of this field and just use parameter index instead - curTmpVarIdx int // insure tmp variables have uniq names -} - -// extractParams parses s to extract function parameters. -func extractParams(s string, f *Fn) ([]*Param, error) { - s = trim(s) - if s == "" { - return nil, nil - } - a := strings.Split(s, ",") - ps := make([]*Param, len(a)) - for i := range ps { - s2 := trim(a[i]) - b := strings.Split(s2, " ") - if len(b) != 2 { - b = strings.Split(s2, "\t") - if len(b) != 2 { - return nil, errors.New("Could not extract function parameter from \"" + s2 + "\"") - } - } - ps[i] = &Param{ - Name: trim(b[0]), - Type: trim(b[1]), - fn: f, - tmpVarIdx: -1, - } - } - return ps, nil -} - -// extractSection extracts text out of string s starting after start -// and ending just before end. found return value will indicate success, -// and prefix, body and suffix will contain correspondent parts of string s. -func extractSection(s string, start, end rune) (prefix, body, suffix string, found bool) { - s = trim(s) - if strings.HasPrefix(s, string(start)) { - // no prefix - body = s[1:] - } else { - a := strings.SplitN(s, string(start), 2) - if len(a) != 2 { - return "", "", s, false - } - prefix = a[0] - body = a[1] - } - a := strings.SplitN(body, string(end), 2) - if len(a) != 2 { - return "", "", "", false - } - return prefix, a[0], a[1], true -} - -// newFn parses string s and return created function Fn. -func newFn(s string) (*Fn, error) { - s = trim(s) - f := &Fn{ - Rets: &Rets{}, - src: s, - PrintTrace: *printTraceFlag, - } - // function name and args - prefix, body, s, found := extractSection(s, '(', ')') - if !found || prefix == "" { - return nil, errors.New("Could not extract function name and parameters from \"" + f.src + "\"") - } - f.Name = prefix - var err error - f.Params, err = extractParams(body, f) - if err != nil { - return nil, err - } - // return values - _, body, s, found = extractSection(s, '(', ')') - if found { - r, err := extractParams(body, f) - if err != nil { - return nil, err - } - switch len(r) { - case 0: - case 1: - if r[0].IsError() { - f.Rets.ReturnsError = true - } else { - f.Rets.Name = r[0].Name - f.Rets.Type = r[0].Type - } - case 2: - if !r[1].IsError() { - return nil, errors.New("Only last windows error is allowed as second return value in \"" + f.src + "\"") - } - f.Rets.ReturnsError = true - f.Rets.Name = r[0].Name - f.Rets.Type = r[0].Type - default: - return nil, errors.New("Too many return values in \"" + f.src + "\"") - } - } - // fail condition - _, body, s, found = extractSection(s, '[', ']') - if found { - f.Rets.FailCond = body - } - // dll and dll function names - s = trim(s) - if s == "" { - return f, nil - } - if !strings.HasPrefix(s, "=") { - return nil, errors.New("Could not extract dll name from \"" + f.src + "\"") - } - s = trim(s[1:]) - a := strings.Split(s, ".") - switch len(a) { - case 1: - f.dllfuncname = a[0] - case 2: - f.dllname = a[0] - f.dllfuncname = a[1] - default: - return nil, errors.New("Could not extract dll name from \"" + f.src + "\"") - } - if f.dllfuncname[len(f.dllfuncname)-1] == '?' { - f.confirmproc = true - f.dllfuncname = f.dllfuncname[0 : len(f.dllfuncname)-1] - } - return f, nil -} - -// DLLName returns DLL name for function f. -func (f *Fn) DLLName() string { - if f.dllname == "" { - return "kernel32" - } - return f.dllname -} - -// DLLName returns DLL function name for function f. -func (f *Fn) DLLFuncName() string { - if f.dllfuncname == "" { - return f.Name - } - return f.dllfuncname -} - -func (f *Fn) ConfirmProc() bool { - return f.confirmproc -} - -// ParamList returns source code for function f parameters. -func (f *Fn) ParamList() string { - return join(f.Params, func(p *Param) string { return p.Name + " " + p.Type }, ", ") -} - -// HelperParamList returns source code for helper function f parameters. -func (f *Fn) HelperParamList() string { - return join(f.Params, func(p *Param) string { return p.Name + " " + p.HelperType() }, ", ") -} - -// ParamPrintList returns source code of trace printing part correspondent -// to syscall input parameters. -func (f *Fn) ParamPrintList() string { - return join(f.Params, func(p *Param) string { return fmt.Sprintf(`"%s=", %s, `, p.Name, p.Name) }, `", ", `) -} - -// ParamCount return number of syscall parameters for function f. -func (f *Fn) ParamCount() int { - n := 0 - for _, p := range f.Params { - n += len(p.SyscallArgList()) - } - return n -} - -// SyscallParamCount determines which version of Syscall/Syscall6/Syscall9/... -// to use. It returns parameter count for correspondent SyscallX function. -func (f *Fn) SyscallParamCount() int { - n := f.ParamCount() - switch { - case n <= 3: - return 3 - case n <= 6: - return 6 - case n <= 9: - return 9 - case n <= 12: - return 12 - case n <= 15: - return 15 - default: - panic("too many arguments to system call") - } -} - -// Syscall determines which SyscallX function to use for function f. -func (f *Fn) Syscall() string { - c := f.SyscallParamCount() - if c == 3 { - return syscalldot() + "Syscall" - } - return syscalldot() + "Syscall" + strconv.Itoa(c) -} - -// SyscallParamList returns source code for SyscallX parameters for function f. -func (f *Fn) SyscallParamList() string { - a := make([]string, 0) - for _, p := range f.Params { - a = append(a, p.SyscallArgList()...) - } - for len(a) < f.SyscallParamCount() { - a = append(a, "0") - } - return strings.Join(a, ", ") -} - -// HelperCallParamList returns source code of call into function f helper. -func (f *Fn) HelperCallParamList() string { - a := make([]string, 0, len(f.Params)) - for _, p := range f.Params { - s := p.Name - if p.Type == "string" { - s = p.tmpVar() - } - a = append(a, s) - } - return strings.Join(a, ", ") -} - -// IsUTF16 is true, if f is W (utf16) function. It is false -// for all A (ascii) functions. -func (_ *Fn) IsUTF16() bool { - return true -} - -// StrconvFunc returns name of Go string to OS string function for f. -func (f *Fn) StrconvFunc() string { - if f.IsUTF16() { - return syscalldot() + "UTF16PtrFromString" - } - return syscalldot() + "BytePtrFromString" -} - -// StrconvType returns Go type name used for OS string for f. -func (f *Fn) StrconvType() string { - if f.IsUTF16() { - return "*uint16" - } - return "*byte" -} - -// HasStringParam is true, if f has at least one string parameter. -// Otherwise it is false. -func (f *Fn) HasStringParam() bool { - for _, p := range f.Params { - if p.Type == "string" { - return true - } - } - return false -} - -var uniqDllFuncName = make(map[string]bool) - -// IsNotDuplicate is true if f is not a duplicated function -func (f *Fn) IsNotDuplicate() bool { - funcName := f.DLLFuncName() - if uniqDllFuncName[funcName] == false { - uniqDllFuncName[funcName] = true - return true - } - return false -} - -// HelperName returns name of function f helper. -func (f *Fn) HelperName() string { - if !f.HasStringParam() { - return f.Name - } - return "_" + f.Name -} - -// Source files and functions. -type Source struct { - Funcs []*Fn - Files []string - StdLibImports []string - ExternalImports []string -} - -func (src *Source) Import(pkg string) { - src.StdLibImports = append(src.StdLibImports, pkg) - sort.Strings(src.StdLibImports) -} - -func (src *Source) ExternalImport(pkg string) { - src.ExternalImports = append(src.ExternalImports, pkg) - sort.Strings(src.ExternalImports) -} - -// ParseFiles parses files listed in fs and extracts all syscall -// functions listed in sys comments. It returns source files -// and functions collection *Source if successful. -func ParseFiles(fs []string) (*Source, error) { - src := &Source{ - Funcs: make([]*Fn, 0), - Files: make([]string, 0), - StdLibImports: []string{ - "unsafe", - }, - ExternalImports: make([]string, 0), - } - for _, file := range fs { - if err := src.ParseFile(file); err != nil { - return nil, err - } - } - return src, nil -} - -// DLLs return dll names for a source set src. -func (src *Source) DLLs() []string { - uniq := make(map[string]bool) - r := make([]string, 0) - for _, f := range src.Funcs { - name := f.DLLName() - if _, found := uniq[name]; !found { - uniq[name] = true - r = append(r, name) - } - } - return r -} - -// ParseFile adds additional file path to a source set src. -func (src *Source) ParseFile(path string) error { - file, err := os.Open(path) - if err != nil { - return err - } - defer file.Close() - - s := bufio.NewScanner(file) - for s.Scan() { - t := trim(s.Text()) - if len(t) < 7 { - continue - } - if !strings.HasPrefix(t, "//sys") { - continue - } - t = t[5:] - if !(t[0] == ' ' || t[0] == '\t') { - continue - } - f, err := newFn(t[1:]) - if err != nil { - return err - } - src.Funcs = append(src.Funcs, f) - } - if err := s.Err(); err != nil { - return err - } - src.Files = append(src.Files, path) - - // get package name - fset := token.NewFileSet() - _, err = file.Seek(0, 0) - if err != nil { - return err - } - pkg, err := parser.ParseFile(fset, "", file, parser.PackageClauseOnly) - if err != nil { - return err - } - packageName = pkg.Name.Name - - return nil -} - -// IsStdRepo returns true if src is part of standard library. -func (src *Source) IsStdRepo() (bool, error) { - if len(src.Files) == 0 { - return false, errors.New("no input files provided") - } - abspath, err := filepath.Abs(src.Files[0]) - if err != nil { - return false, err - } - goroot := runtime.GOROOT() - if runtime.GOOS == "windows" { - abspath = strings.ToLower(abspath) - goroot = strings.ToLower(goroot) - } - sep := string(os.PathSeparator) - if !strings.HasSuffix(goroot, sep) { - goroot += sep - } - return strings.HasPrefix(abspath, goroot), nil -} - -// Generate output source file from a source set src. -func (src *Source) Generate(w io.Writer) error { - const ( - pkgStd = iota // any package in std library - pkgXSysWindows // x/sys/windows package - pkgOther - ) - isStdRepo, err := src.IsStdRepo() - if err != nil { - return err - } - var pkgtype int - switch { - case isStdRepo: - pkgtype = pkgStd - case packageName == "windows": - // TODO: this needs better logic than just using package name - pkgtype = pkgXSysWindows - default: - pkgtype = pkgOther - } - if *systemDLL { - switch pkgtype { - case pkgStd: - src.Import("internal/syscall/windows/sysdll") - case pkgXSysWindows: - default: - src.ExternalImport("golang.org/x/sys/windows") - } - } - if *winio { - src.ExternalImport("github.com/Microsoft/go-winio") - } - if packageName != "syscall" { - src.Import("syscall") - } - funcMap := template.FuncMap{ - "packagename": packagename, - "syscalldot": syscalldot, - "newlazydll": func(dll string) string { - arg := "\"" + dll + ".dll\"" - if !*systemDLL { - return syscalldot() + "NewLazyDLL(" + arg + ")" - } - if strings.HasPrefix(dll, "api_") || strings.HasPrefix(dll, "ext_") { - arg = strings.Replace(arg, "_", "-", -1) - } - switch pkgtype { - case pkgStd: - return syscalldot() + "NewLazyDLL(sysdll.Add(" + arg + "))" - case pkgXSysWindows: - return "NewLazySystemDLL(" + arg + ")" - default: - return "windows.NewLazySystemDLL(" + arg + ")" - } - }, - } - t := template.Must(template.New("main").Funcs(funcMap).Parse(srcTemplate)) - err = t.Execute(w, src) - if err != nil { - return errors.New("Failed to execute template: " + err.Error()) - } - return nil -} - -func usage() { - fmt.Fprintf(os.Stderr, "usage: mksyscall_windows [flags] [path ...]\n") - flag.PrintDefaults() - os.Exit(1) -} - -func main() { - flag.Usage = usage - flag.Parse() - if len(flag.Args()) <= 0 { - fmt.Fprintf(os.Stderr, "no files to parse provided\n") - usage() - } - - src, err := ParseFiles(flag.Args()) - if err != nil { - log.Fatal(err) - } - - var buf bytes.Buffer - if err := src.Generate(&buf); err != nil { - log.Fatal(err) - } - - data, err := format.Source(buf.Bytes()) - if err != nil { - log.Fatal(err) - } - if *filename == "" { - _, err = os.Stdout.Write(data) - } else { - err = ioutil.WriteFile(*filename, data, 0644) - } - if err != nil { - log.Fatal(err) - } -} - -// TODO: use println instead to print in the following template -const srcTemplate = ` - -{{define "main"}}// Code generated mksyscall_windows.exe DO NOT EDIT - -package {{packagename}} - -import ( -{{range .StdLibImports}}"{{.}}" -{{end}} - -{{range .ExternalImports}}"{{.}}" -{{end}} -) - -var _ unsafe.Pointer - -// Do the interface allocations only once for common -// Errno values. -const ( - errnoERROR_IO_PENDING = 997 -) - -var ( - errERROR_IO_PENDING error = {{syscalldot}}Errno(errnoERROR_IO_PENDING) -) - -// errnoErr returns common boxed Errno values, to prevent -// allocations at runtime. -func errnoErr(e {{syscalldot}}Errno) error { - switch e { - case 0: - return nil - case errnoERROR_IO_PENDING: - return errERROR_IO_PENDING - } - // TODO: add more here, after collecting data on the common - // error values see on Windows. (perhaps when running - // all.bat?) - return e -} - -var ( -{{template "dlls" .}} -{{template "funcnames" .}}) -{{range .Funcs}}{{if .HasStringParam}}{{template "helperbody" .}}{{end}}{{template "funcbody" .}}{{end}} -{{end}} - -{{/* help functions */}} - -{{define "dlls"}}{{range .DLLs}} mod{{.}} = {{newlazydll .}} -{{end}}{{end}} - -{{define "funcnames"}}{{range .Funcs}}{{if .IsNotDuplicate}} proc{{.DLLFuncName}} = mod{{.DLLName}}.NewProc("{{.DLLFuncName}}"){{end}} -{{end}}{{end}} - -{{define "helperbody"}} -func {{.Name}}({{.ParamList}}) {{template "results" .}}{ -{{template "helpertmpvars" .}} return {{.HelperName}}({{.HelperCallParamList}}) -} -{{end}} - -{{define "funcbody"}} -func {{.HelperName}}({{.HelperParamList}}) {{template "results" .}}{ -{{template "tmpvars" .}} {{template "syscallcheck" .}}{{template "syscall" .}} -{{template "seterror" .}}{{template "printtrace" .}} return -} -{{end}} - -{{define "helpertmpvars"}}{{range .Params}}{{if .TmpVarHelperCode}} {{.TmpVarHelperCode}} -{{end}}{{end}}{{end}} - -{{define "tmpvars"}}{{range .Params}}{{if .TmpVarCode}} {{.TmpVarCode}} -{{end}}{{end}}{{end}} - -{{define "results"}}{{if .Rets.List}}{{.Rets.List}} {{end}}{{end}} - -{{define "syscall"}}{{.Rets.SetReturnValuesCode}}{{.Syscall}}(proc{{.DLLFuncName}}.Addr(), {{.ParamCount}}, {{.SyscallParamList}}){{end}} - -{{define "syscallcheck"}}{{if .ConfirmProc}}if {{.Rets.ErrorVarName}} = proc{{.DLLFuncName}}.Find(); {{.Rets.ErrorVarName}} != nil { - return -} -{{end}}{{end}} - - -{{define "seterror"}}{{if .Rets.SetErrorCode}} {{.Rets.SetErrorCode}} -{{end}}{{end}} - -{{define "printtrace"}}{{if .PrintTrace}} print("SYSCALL: {{.Name}}(", {{.ParamPrintList}}") (", {{.Rets.PrintList}}")\n") -{{end}}{{end}} - -` diff --git a/vendor/github.com/Microsoft/hcsshim/osversion/osversion_windows.go b/vendor/github.com/Microsoft/hcsshim/osversion/osversion_windows.go new file mode 100644 index 00000000..477fe707 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/osversion/osversion_windows.go @@ -0,0 +1,57 @@ +package osversion + +import ( + "fmt" + + "golang.org/x/sys/windows" +) + +// OSVersion is a wrapper for Windows version information +// https://msdn.microsoft.com/en-us/library/windows/desktop/ms724439(v=vs.85).aspx +type OSVersion struct { + Version uint32 + MajorVersion uint8 + MinorVersion uint8 + Build uint16 +} + +// https://msdn.microsoft.com/en-us/library/windows/desktop/ms724833(v=vs.85).aspx +type osVersionInfoEx struct { + OSVersionInfoSize uint32 + MajorVersion uint32 + MinorVersion uint32 + BuildNumber uint32 + PlatformID uint32 + CSDVersion [128]uint16 + ServicePackMajor uint16 + ServicePackMinor uint16 + SuiteMask uint16 + ProductType byte + Reserve byte +} + +// Get gets the operating system version on Windows. +// The calling application must be manifested to get the correct version information. +func Get() OSVersion { + var err error + osv := OSVersion{} + osv.Version, err = windows.GetVersion() + if err != nil { + // GetVersion never fails. + panic(err) + } + osv.MajorVersion = uint8(osv.Version & 0xFF) + osv.MinorVersion = uint8(osv.Version >> 8 & 0xFF) + osv.Build = uint16(osv.Version >> 16) + return osv +} + +// Build gets the build-number on Windows +// The calling application must be manifested to get the correct version information. +func Build() uint16 { + return Get().Build +} + +func (osv OSVersion) ToString() string { + return fmt.Sprintf("%d.%d.%d", osv.MajorVersion, osv.MinorVersion, osv.Build) +} diff --git a/vendor/github.com/Microsoft/hcsshim/osversion/windowsbuilds.go b/vendor/github.com/Microsoft/hcsshim/osversion/windowsbuilds.go new file mode 100644 index 00000000..726d1c8c --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/osversion/windowsbuilds.go @@ -0,0 +1,27 @@ +package osversion + +const ( + // RS1 (version 1607, codename "Redstone 1") corresponds to Windows Server + // 2016 (ltsc2016) and Windows 10 (Anniversary Update). + RS1 = 14393 + + // RS2 (version 1703, codename "Redstone 2") was a client-only update, and + // corresponds to Windows 10 (Creators Update). + RS2 = 15063 + + // RS3 (version 1709, codename "Redstone 3") corresponds to Windows Server + // 1709 (Semi-Annual Channel (SAC)), and Windows 10 (Fall Creators Update). + RS3 = 16299 + + // RS4 (version 1803, codename "Redstone 4") corresponds to Windows Server + // 1803 (Semi-Annual Channel (SAC)), and Windows 10 (April 2018 Update). + RS4 = 17134 + + // RS5 (version 1809, codename "Redstone 5") corresponds to Windows Server + // 2019 (ltsc2019), and Windows 10 (October 2018 Update). + RS5 = 17763 + + // V19H1 (version 1903) corresponds to Windows Server 1903 (semi-annual + // channel). + V19H1 = 18362 +) diff --git a/vendor/github.com/Microsoft/hcsshim/process.go b/vendor/github.com/Microsoft/hcsshim/process.go index ca8acbb7..3362c683 100644 --- a/vendor/github.com/Microsoft/hcsshim/process.go +++ b/vendor/github.com/Microsoft/hcsshim/process.go @@ -1,7 +1,9 @@ package hcsshim import ( + "context" "io" + "sync" "time" "github.com/Microsoft/hcsshim/internal/hcs" @@ -9,7 +11,10 @@ import ( // ContainerError is an error encountered in HCS type process struct { - p *hcs.Process + p *hcs.Process + waitOnce sync.Once + waitCh chan struct{} + waitErr error } // Pid returns the process ID of the process within the container. @@ -19,7 +24,14 @@ func (process *process) Pid() int { // Kill signals the process to terminate but does not wait for it to finish terminating. func (process *process) Kill() error { - return convertProcessError(process.p.Kill(), process) + found, err := process.p.Kill(context.Background()) + if err != nil { + return convertProcessError(err, process) + } + if !found { + return &ProcessError{Process: process, Err: ErrElementNotFound, Operation: "hcsshim::Process::Kill"} + } + return nil } // Wait waits for the process to exit. @@ -30,7 +42,21 @@ func (process *process) Wait() error { // WaitTimeout waits for the process to exit or the duration to elapse. It returns // false if timeout occurs. func (process *process) WaitTimeout(timeout time.Duration) error { - return convertProcessError(process.p.WaitTimeout(timeout), process) + process.waitOnce.Do(func() { + process.waitCh = make(chan struct{}) + go func() { + process.waitErr = process.Wait() + close(process.waitCh) + }() + }) + t := time.NewTimer(timeout) + defer t.Stop() + select { + case <-t.C: + return &ProcessError{Process: process, Err: ErrTimeout, Operation: "hcsshim::Process::Wait"} + case <-process.waitCh: + return process.waitErr + } } // ExitCode returns the exit code of the process. The process must have @@ -45,14 +71,14 @@ func (process *process) ExitCode() (int, error) { // ResizeConsole resizes the console of the process. func (process *process) ResizeConsole(width, height uint16) error { - return convertProcessError(process.p.ResizeConsole(width, height), process) + return convertProcessError(process.p.ResizeConsole(context.Background(), width, height), process) } // Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing // these pipes does not close the underlying pipes; it should be possible to // call this multiple times to get multiple interfaces. func (process *process) Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, error) { - stdin, stdout, stderr, err := process.p.Stdio() + stdin, stdout, stderr, err := process.p.StdioLegacy() if err != nil { err = convertProcessError(err, process) } @@ -62,7 +88,7 @@ func (process *process) Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, e // CloseStdin closes the write side of the stdin pipe so that the process is // notified on the read side that there is no more data in stdin. func (process *process) CloseStdin() error { - return convertProcessError(process.p.CloseStdin(), process) + return convertProcessError(process.p.CloseStdin(context.Background()), process) } // Close cleans up any state associated with the process but does not kill diff --git a/vendor/github.com/Microsoft/hcsshim/vendor.conf b/vendor/github.com/Microsoft/hcsshim/vendor.conf deleted file mode 100644 index 6e0ed156..00000000 --- a/vendor/github.com/Microsoft/hcsshim/vendor.conf +++ /dev/null @@ -1,21 +0,0 @@ -github.com/blang/semver v3.1.0 -github.com/containerd/console c12b1e7919c14469339a5d38f2f8ed9b64a9de23 -github.com/containerd/go-runc 5a6d9f37cfa36b15efba46dc7ea349fa9b7143c3 -github.com/hashicorp/errwrap 7554cd9344cec97297fa6649b055a8c98c2a1e55 -github.com/hashicorp/go-multierror ed905158d87462226a13fe39ddf685ea65f1c11f -github.com/konsorten/go-windows-terminal-sequences v1.0.1 -github.com/linuxkit/virtsock 8e79449dea0735c1c056d814934dd035734cc97c -github.com/Microsoft/go-winio 16cfc975803886a5e47c4257a24c8d8c52e178b2 -github.com/Microsoft/opengcs v0.3.9 -github.com/opencontainers/runtime-spec eba862dc2470385a233c7507392675cbeadf7353 -github.com/opencontainers/runtime-tools 1d69bd0f9c39677d0630e50664fbc3154ae61b88 -github.com/pkg/errors v0.8.1 -github.com/sirupsen/logrus v1.3.0 -github.com/syndtr/gocapability db04d3cc01c8b54962a58ec7e491717d06cfcc16 -github.com/urfave/cli 7bc6a0acffa589f415f88aca16cc1de5ffd66f9c -github.com/xeipuuv/gojsonpointer 4e3ac2762d5f479393488629ee9370b50873b3a6 -github.com/xeipuuv/gojsonreference bd5ef7bd5415a7ac448318e64f11a24cd21e594b -github.com/xeipuuv/gojsonschema 1d523034197ff1f222f6429836dd36a2457a1874 -golang.org/x/crypto ff983b9c42bc9fbf91556e191cc8efb585c16908 -golang.org/x/sync 37e7f081c4d4c64e13b10787722085407fe5d15f -golang.org/x/sys e5ecc2a6747ce8d4af18ed98b3de5ae30eb3a5bb \ No newline at end of file diff --git a/vendor/github.com/Nvveen/Gotty/LICENSE b/vendor/github.com/Nvveen/Gotty/LICENSE deleted file mode 100644 index 0b71c973..00000000 --- a/vendor/github.com/Nvveen/Gotty/LICENSE +++ /dev/null @@ -1,26 +0,0 @@ -Copyright (c) 2012, Neal van Veen (nealvanveen@gmail.com) -All rights reserved. - -Redistribution and use in source and binary forms, with or without -modification, are permitted provided that the following conditions are met: - -1. Redistributions of source code must retain the above copyright notice, this - list of conditions and the following disclaimer. -2. Redistributions in binary form must reproduce the above copyright notice, - this list of conditions and the following disclaimer in the documentation - and/or other materials provided with the distribution. - -THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND -ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED -WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE -DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR -ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES -(INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; -LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND -ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT -(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS -SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. - -The views and conclusions contained in the software and documentation are those -of the authors and should not be interpreted as representing official policies, -either expressed or implied, of the FreeBSD Project. diff --git a/vendor/github.com/Nvveen/Gotty/README b/vendor/github.com/Nvveen/Gotty/README deleted file mode 100644 index a6b0d9a8..00000000 --- a/vendor/github.com/Nvveen/Gotty/README +++ /dev/null @@ -1,5 +0,0 @@ -Gotty is a library written in Go that determines and reads termcap database -files to produce an interface for interacting with the capabilities of a -terminal. -See the godoc documentation or the source code for more information about -function usage. diff --git a/vendor/github.com/Nvveen/Gotty/TODO b/vendor/github.com/Nvveen/Gotty/TODO deleted file mode 100644 index 47046053..00000000 --- a/vendor/github.com/Nvveen/Gotty/TODO +++ /dev/null @@ -1,3 +0,0 @@ -gotty.go:// TODO add more concurrency to name lookup, look for more opportunities. -all:// TODO add more documentation, with function usage in a doc.go file. -all:// TODO add more testing/benchmarking with go test. diff --git a/vendor/github.com/Nvveen/Gotty/attributes.go b/vendor/github.com/Nvveen/Gotty/attributes.go deleted file mode 100644 index a4c005fa..00000000 --- a/vendor/github.com/Nvveen/Gotty/attributes.go +++ /dev/null @@ -1,514 +0,0 @@ -// Copyright 2012 Neal van Veen. All rights reserved. -// Usage of this source code is governed by a BSD-style license that can be -// found in the LICENSE file. - -package gotty - -// Boolean capabilities -var BoolAttr = [...]string{ - "auto_left_margin", "bw", - "auto_right_margin", "am", - "no_esc_ctlc", "xsb", - "ceol_standout_glitch", "xhp", - "eat_newline_glitch", "xenl", - "erase_overstrike", "eo", - "generic_type", "gn", - "hard_copy", "hc", - "has_meta_key", "km", - "has_status_line", "hs", - "insert_null_glitch", "in", - "memory_above", "da", - "memory_below", "db", - "move_insert_mode", "mir", - "move_standout_mode", "msgr", - "over_strike", "os", - "status_line_esc_ok", "eslok", - "dest_tabs_magic_smso", "xt", - "tilde_glitch", "hz", - "transparent_underline", "ul", - "xon_xoff", "nxon", - "needs_xon_xoff", "nxon", - "prtr_silent", "mc5i", - "hard_cursor", "chts", - "non_rev_rmcup", "nrrmc", - "no_pad_char", "npc", - "non_dest_scroll_region", "ndscr", - "can_change", "ccc", - "back_color_erase", "bce", - "hue_lightness_saturation", "hls", - "col_addr_glitch", "xhpa", - "cr_cancels_micro_mode", "crxm", - "has_print_wheel", "daisy", - "row_addr_glitch", "xvpa", - "semi_auto_right_margin", "sam", - "cpi_changes_res", "cpix", - "lpi_changes_res", "lpix", - "backspaces_with_bs", "", - "crt_no_scrolling", "", - "no_correctly_working_cr", "", - "gnu_has_meta_key", "", - "linefeed_is_newline", "", - "has_hardware_tabs", "", - "return_does_clr_eol", "", -} - -// Numerical capabilities -var NumAttr = [...]string{ - "columns", "cols", - "init_tabs", "it", - "lines", "lines", - "lines_of_memory", "lm", - "magic_cookie_glitch", "xmc", - "padding_baud_rate", "pb", - "virtual_terminal", "vt", - "width_status_line", "wsl", - "num_labels", "nlab", - "label_height", "lh", - "label_width", "lw", - "max_attributes", "ma", - "maximum_windows", "wnum", - "max_colors", "colors", - "max_pairs", "pairs", - "no_color_video", "ncv", - "buffer_capacity", "bufsz", - "dot_vert_spacing", "spinv", - "dot_horz_spacing", "spinh", - "max_micro_address", "maddr", - "max_micro_jump", "mjump", - "micro_col_size", "mcs", - "micro_line_size", "mls", - "number_of_pins", "npins", - "output_res_char", "orc", - "output_res_line", "orl", - "output_res_horz_inch", "orhi", - "output_res_vert_inch", "orvi", - "print_rate", "cps", - "wide_char_size", "widcs", - "buttons", "btns", - "bit_image_entwining", "bitwin", - "bit_image_type", "bitype", - "magic_cookie_glitch_ul", "", - "carriage_return_delay", "", - "new_line_delay", "", - "backspace_delay", "", - "horizontal_tab_delay", "", - "number_of_function_keys", "", -} - -// String capabilities -var StrAttr = [...]string{ - "back_tab", "cbt", - "bell", "bel", - "carriage_return", "cr", - "change_scroll_region", "csr", - "clear_all_tabs", "tbc", - "clear_screen", "clear", - "clr_eol", "el", - "clr_eos", "ed", - "column_address", "hpa", - "command_character", "cmdch", - "cursor_address", "cup", - "cursor_down", "cud1", - "cursor_home", "home", - "cursor_invisible", "civis", - "cursor_left", "cub1", - "cursor_mem_address", "mrcup", - "cursor_normal", "cnorm", - "cursor_right", "cuf1", - "cursor_to_ll", "ll", - "cursor_up", "cuu1", - "cursor_visible", "cvvis", - "delete_character", "dch1", - "delete_line", "dl1", - "dis_status_line", "dsl", - "down_half_line", "hd", - "enter_alt_charset_mode", "smacs", - "enter_blink_mode", "blink", - "enter_bold_mode", "bold", - "enter_ca_mode", "smcup", - "enter_delete_mode", "smdc", - "enter_dim_mode", "dim", - "enter_insert_mode", "smir", - "enter_secure_mode", "invis", - "enter_protected_mode", "prot", - "enter_reverse_mode", "rev", - "enter_standout_mode", "smso", - "enter_underline_mode", "smul", - "erase_chars", "ech", - "exit_alt_charset_mode", "rmacs", - "exit_attribute_mode", "sgr0", - "exit_ca_mode", "rmcup", - "exit_delete_mode", "rmdc", - "exit_insert_mode", "rmir", - "exit_standout_mode", "rmso", - "exit_underline_mode", "rmul", - "flash_screen", "flash", - "form_feed", "ff", - "from_status_line", "fsl", - "init_1string", "is1", - "init_2string", "is2", - "init_3string", "is3", - "init_file", "if", - "insert_character", "ich1", - "insert_line", "il1", - "insert_padding", "ip", - "key_backspace", "kbs", - "key_catab", "ktbc", - "key_clear", "kclr", - "key_ctab", "kctab", - "key_dc", "kdch1", - "key_dl", "kdl1", - "key_down", "kcud1", - "key_eic", "krmir", - "key_eol", "kel", - "key_eos", "ked", - "key_f0", "kf0", - "key_f1", "kf1", - "key_f10", "kf10", - "key_f2", "kf2", - "key_f3", "kf3", - "key_f4", "kf4", - "key_f5", "kf5", - "key_f6", "kf6", - "key_f7", "kf7", - "key_f8", "kf8", - "key_f9", "kf9", - "key_home", "khome", - "key_ic", "kich1", - "key_il", "kil1", - "key_left", "kcub1", - "key_ll", "kll", - "key_npage", "knp", - "key_ppage", "kpp", - "key_right", "kcuf1", - "key_sf", "kind", - "key_sr", "kri", - "key_stab", "khts", - "key_up", "kcuu1", - "keypad_local", "rmkx", - "keypad_xmit", "smkx", - "lab_f0", "lf0", - "lab_f1", "lf1", - "lab_f10", "lf10", - "lab_f2", "lf2", - "lab_f3", "lf3", - "lab_f4", "lf4", - "lab_f5", "lf5", - "lab_f6", "lf6", - "lab_f7", "lf7", - "lab_f8", "lf8", - "lab_f9", "lf9", - "meta_off", "rmm", - "meta_on", "smm", - "newline", "_glitch", - "pad_char", "npc", - "parm_dch", "dch", - "parm_delete_line", "dl", - "parm_down_cursor", "cud", - "parm_ich", "ich", - "parm_index", "indn", - "parm_insert_line", "il", - "parm_left_cursor", "cub", - "parm_right_cursor", "cuf", - "parm_rindex", "rin", - "parm_up_cursor", "cuu", - "pkey_key", "pfkey", - "pkey_local", "pfloc", - "pkey_xmit", "pfx", - "print_screen", "mc0", - "prtr_off", "mc4", - "prtr_on", "mc5", - "repeat_char", "rep", - "reset_1string", "rs1", - "reset_2string", "rs2", - "reset_3string", "rs3", - "reset_file", "rf", - "restore_cursor", "rc", - "row_address", "mvpa", - "save_cursor", "row_address", - "scroll_forward", "ind", - "scroll_reverse", "ri", - "set_attributes", "sgr", - "set_tab", "hts", - "set_window", "wind", - "tab", "s_magic_smso", - "to_status_line", "tsl", - "underline_char", "uc", - "up_half_line", "hu", - "init_prog", "iprog", - "key_a1", "ka1", - "key_a3", "ka3", - "key_b2", "kb2", - "key_c1", "kc1", - "key_c3", "kc3", - "prtr_non", "mc5p", - "char_padding", "rmp", - "acs_chars", "acsc", - "plab_norm", "pln", - "key_btab", "kcbt", - "enter_xon_mode", "smxon", - "exit_xon_mode", "rmxon", - "enter_am_mode", "smam", - "exit_am_mode", "rmam", - "xon_character", "xonc", - "xoff_character", "xoffc", - "ena_acs", "enacs", - "label_on", "smln", - "label_off", "rmln", - "key_beg", "kbeg", - "key_cancel", "kcan", - "key_close", "kclo", - "key_command", "kcmd", - "key_copy", "kcpy", - "key_create", "kcrt", - "key_end", "kend", - "key_enter", "kent", - "key_exit", "kext", - "key_find", "kfnd", - "key_help", "khlp", - "key_mark", "kmrk", - "key_message", "kmsg", - "key_move", "kmov", - "key_next", "knxt", - "key_open", "kopn", - "key_options", "kopt", - "key_previous", "kprv", - "key_print", "kprt", - "key_redo", "krdo", - "key_reference", "kref", - "key_refresh", "krfr", - "key_replace", "krpl", - "key_restart", "krst", - "key_resume", "kres", - "key_save", "ksav", - "key_suspend", "kspd", - "key_undo", "kund", - "key_sbeg", "kBEG", - "key_scancel", "kCAN", - "key_scommand", "kCMD", - "key_scopy", "kCPY", - "key_screate", "kCRT", - "key_sdc", "kDC", - "key_sdl", "kDL", - "key_select", "kslt", - "key_send", "kEND", - "key_seol", "kEOL", - "key_sexit", "kEXT", - "key_sfind", "kFND", - "key_shelp", "kHLP", - "key_shome", "kHOM", - "key_sic", "kIC", - "key_sleft", "kLFT", - "key_smessage", "kMSG", - "key_smove", "kMOV", - "key_snext", "kNXT", - "key_soptions", "kOPT", - "key_sprevious", "kPRV", - "key_sprint", "kPRT", - "key_sredo", "kRDO", - "key_sreplace", "kRPL", - "key_sright", "kRIT", - "key_srsume", "kRES", - "key_ssave", "kSAV", - "key_ssuspend", "kSPD", - "key_sundo", "kUND", - "req_for_input", "rfi", - "key_f11", "kf11", - "key_f12", "kf12", - "key_f13", "kf13", - "key_f14", "kf14", - "key_f15", "kf15", - "key_f16", "kf16", - "key_f17", "kf17", - "key_f18", "kf18", - "key_f19", "kf19", - "key_f20", "kf20", - "key_f21", "kf21", - "key_f22", "kf22", - "key_f23", "kf23", - "key_f24", "kf24", - "key_f25", "kf25", - "key_f26", "kf26", - "key_f27", "kf27", - "key_f28", "kf28", - "key_f29", "kf29", - "key_f30", "kf30", - "key_f31", "kf31", - "key_f32", "kf32", - "key_f33", "kf33", - "key_f34", "kf34", - "key_f35", "kf35", - "key_f36", "kf36", - "key_f37", "kf37", - "key_f38", "kf38", - "key_f39", "kf39", - "key_f40", "kf40", - "key_f41", "kf41", - "key_f42", "kf42", - "key_f43", "kf43", - "key_f44", "kf44", - "key_f45", "kf45", - "key_f46", "kf46", - "key_f47", "kf47", - "key_f48", "kf48", - "key_f49", "kf49", - "key_f50", "kf50", - "key_f51", "kf51", - "key_f52", "kf52", - "key_f53", "kf53", - "key_f54", "kf54", - "key_f55", "kf55", - "key_f56", "kf56", - "key_f57", "kf57", - "key_f58", "kf58", - "key_f59", "kf59", - "key_f60", "kf60", - "key_f61", "kf61", - "key_f62", "kf62", - "key_f63", "kf63", - "clr_bol", "el1", - "clear_margins", "mgc", - "set_left_margin", "smgl", - "set_right_margin", "smgr", - "label_format", "fln", - "set_clock", "sclk", - "display_clock", "dclk", - "remove_clock", "rmclk", - "create_window", "cwin", - "goto_window", "wingo", - "hangup", "hup", - "dial_phone", "dial", - "quick_dial", "qdial", - "tone", "tone", - "pulse", "pulse", - "flash_hook", "hook", - "fixed_pause", "pause", - "wait_tone", "wait", - "user0", "u0", - "user1", "u1", - "user2", "u2", - "user3", "u3", - "user4", "u4", - "user5", "u5", - "user6", "u6", - "user7", "u7", - "user8", "u8", - "user9", "u9", - "orig_pair", "op", - "orig_colors", "oc", - "initialize_color", "initc", - "initialize_pair", "initp", - "set_color_pair", "scp", - "set_foreground", "setf", - "set_background", "setb", - "change_char_pitch", "cpi", - "change_line_pitch", "lpi", - "change_res_horz", "chr", - "change_res_vert", "cvr", - "define_char", "defc", - "enter_doublewide_mode", "swidm", - "enter_draft_quality", "sdrfq", - "enter_italics_mode", "sitm", - "enter_leftward_mode", "slm", - "enter_micro_mode", "smicm", - "enter_near_letter_quality", "snlq", - "enter_normal_quality", "snrmq", - "enter_shadow_mode", "sshm", - "enter_subscript_mode", "ssubm", - "enter_superscript_mode", "ssupm", - "enter_upward_mode", "sum", - "exit_doublewide_mode", "rwidm", - "exit_italics_mode", "ritm", - "exit_leftward_mode", "rlm", - "exit_micro_mode", "rmicm", - "exit_shadow_mode", "rshm", - "exit_subscript_mode", "rsubm", - "exit_superscript_mode", "rsupm", - "exit_upward_mode", "rum", - "micro_column_address", "mhpa", - "micro_down", "mcud1", - "micro_left", "mcub1", - "micro_right", "mcuf1", - "micro_row_address", "mvpa", - "micro_up", "mcuu1", - "order_of_pins", "porder", - "parm_down_micro", "mcud", - "parm_left_micro", "mcub", - "parm_right_micro", "mcuf", - "parm_up_micro", "mcuu", - "select_char_set", "scs", - "set_bottom_margin", "smgb", - "set_bottom_margin_parm", "smgbp", - "set_left_margin_parm", "smglp", - "set_right_margin_parm", "smgrp", - "set_top_margin", "smgt", - "set_top_margin_parm", "smgtp", - "start_bit_image", "sbim", - "start_char_set_def", "scsd", - "stop_bit_image", "rbim", - "stop_char_set_def", "rcsd", - "subscript_characters", "subcs", - "superscript_characters", "supcs", - "these_cause_cr", "docr", - "zero_motion", "zerom", - "char_set_names", "csnm", - "key_mouse", "kmous", - "mouse_info", "minfo", - "req_mouse_pos", "reqmp", - "get_mouse", "getm", - "set_a_foreground", "setaf", - "set_a_background", "setab", - "pkey_plab", "pfxl", - "device_type", "devt", - "code_set_init", "csin", - "set0_des_seq", "s0ds", - "set1_des_seq", "s1ds", - "set2_des_seq", "s2ds", - "set3_des_seq", "s3ds", - "set_lr_margin", "smglr", - "set_tb_margin", "smgtb", - "bit_image_repeat", "birep", - "bit_image_newline", "binel", - "bit_image_carriage_return", "bicr", - "color_names", "colornm", - "define_bit_image_region", "defbi", - "end_bit_image_region", "endbi", - "set_color_band", "setcolor", - "set_page_length", "slines", - "display_pc_char", "dispc", - "enter_pc_charset_mode", "smpch", - "exit_pc_charset_mode", "rmpch", - "enter_scancode_mode", "smsc", - "exit_scancode_mode", "rmsc", - "pc_term_options", "pctrm", - "scancode_escape", "scesc", - "alt_scancode_esc", "scesa", - "enter_horizontal_hl_mode", "ehhlm", - "enter_left_hl_mode", "elhlm", - "enter_low_hl_mode", "elohlm", - "enter_right_hl_mode", "erhlm", - "enter_top_hl_mode", "ethlm", - "enter_vertical_hl_mode", "evhlm", - "set_a_attributes", "sgr1", - "set_pglen_inch", "slength", - "termcap_init2", "", - "termcap_reset", "", - "linefeed_if_not_lf", "", - "backspace_if_not_bs", "", - "other_non_function_keys", "", - "arrow_key_map", "", - "acs_ulcorner", "", - "acs_llcorner", "", - "acs_urcorner", "", - "acs_lrcorner", "", - "acs_ltee", "", - "acs_rtee", "", - "acs_btee", "", - "acs_ttee", "", - "acs_hline", "", - "acs_vline", "", - "acs_plus", "", - "memory_lock", "", - "memory_unlock", "", - "box_chars_1", "", -} diff --git a/vendor/github.com/Nvveen/Gotty/gotty.go b/vendor/github.com/Nvveen/Gotty/gotty.go deleted file mode 100644 index 093cbf37..00000000 --- a/vendor/github.com/Nvveen/Gotty/gotty.go +++ /dev/null @@ -1,238 +0,0 @@ -// Copyright 2012 Neal van Veen. All rights reserved. -// Usage of this source code is governed by a BSD-style license that can be -// found in the LICENSE file. - -// Gotty is a Go-package for reading and parsing the terminfo database -package gotty - -// TODO add more concurrency to name lookup, look for more opportunities. - -import ( - "encoding/binary" - "errors" - "fmt" - "os" - "reflect" - "strings" - "sync" -) - -// Open a terminfo file by the name given and construct a TermInfo object. -// If something went wrong reading the terminfo database file, an error is -// returned. -func OpenTermInfo(termName string) (*TermInfo, error) { - var term *TermInfo - var err error - // Find the environment variables - termloc := os.Getenv("TERMINFO") - if len(termloc) == 0 { - // Search like ncurses - locations := []string{os.Getenv("HOME") + "/.terminfo/", "/etc/terminfo/", - "/lib/terminfo/", "/usr/share/terminfo/"} - var path string - for _, str := range locations { - // Construct path - path = str + string(termName[0]) + "/" + termName - // Check if path can be opened - file, _ := os.Open(path) - if file != nil { - // Path can open, fall out and use current path - file.Close() - break - } - } - if len(path) > 0 { - term, err = readTermInfo(path) - } else { - err = errors.New(fmt.Sprintf("No terminfo file(-location) found")) - } - } - return term, err -} - -// Open a terminfo file from the environment variable containing the current -// terminal name and construct a TermInfo object. If something went wrong -// reading the terminfo database file, an error is returned. -func OpenTermInfoEnv() (*TermInfo, error) { - termenv := os.Getenv("TERM") - return OpenTermInfo(termenv) -} - -// Return an attribute by the name attr provided. If none can be found, -// an error is returned. -func (term *TermInfo) GetAttribute(attr string) (stacker, error) { - // Channel to store the main value in. - var value stacker - // Add a blocking WaitGroup - var block sync.WaitGroup - // Keep track of variable being written. - written := false - // Function to put into goroutine. - f := func(ats interface{}) { - var ok bool - var v stacker - // Switch on type of map to use and assign value to it. - switch reflect.TypeOf(ats).Elem().Kind() { - case reflect.Bool: - v, ok = ats.(map[string]bool)[attr] - case reflect.Int16: - v, ok = ats.(map[string]int16)[attr] - case reflect.String: - v, ok = ats.(map[string]string)[attr] - } - // If ok, a value is found, so we can write. - if ok { - value = v - written = true - } - // Goroutine is done - block.Done() - } - block.Add(3) - // Go for all 3 attribute lists. - go f(term.boolAttributes) - go f(term.numAttributes) - go f(term.strAttributes) - // Wait until every goroutine is done. - block.Wait() - // If a value has been written, return it. - if written { - return value, nil - } - // Otherwise, error. - return nil, fmt.Errorf("Erorr finding attribute") -} - -// Return an attribute by the name attr provided. If none can be found, -// an error is returned. A name is first converted to its termcap value. -func (term *TermInfo) GetAttributeName(name string) (stacker, error) { - tc := GetTermcapName(name) - return term.GetAttribute(tc) -} - -// A utility function that finds and returns the termcap equivalent of a -// variable name. -func GetTermcapName(name string) string { - // Termcap name - var tc string - // Blocking group - var wait sync.WaitGroup - // Function to put into a goroutine - f := func(attrs []string) { - // Find the string corresponding to the name - for i, s := range attrs { - if s == name { - tc = attrs[i+1] - } - } - // Goroutine is finished - wait.Done() - } - wait.Add(3) - // Go for all 3 attribute lists - go f(BoolAttr[:]) - go f(NumAttr[:]) - go f(StrAttr[:]) - // Wait until every goroutine is done - wait.Wait() - // Return the termcap name - return tc -} - -// This function takes a path to a terminfo file and reads it in binary -// form to construct the actual TermInfo file. -func readTermInfo(path string) (*TermInfo, error) { - // Open the terminfo file - file, err := os.Open(path) - defer file.Close() - if err != nil { - return nil, err - } - - // magic, nameSize, boolSize, nrSNum, nrOffsetsStr, strSize - // Header is composed of the magic 0432 octal number, size of the name - // section, size of the boolean section, the amount of number values, - // the number of offsets of strings, and the size of the string section. - var header [6]int16 - // Byte array is used to read in byte values - var byteArray []byte - // Short array is used to read in short values - var shArray []int16 - // TermInfo object to store values - var term TermInfo - - // Read in the header - err = binary.Read(file, binary.LittleEndian, &header) - if err != nil { - return nil, err - } - // If magic number isn't there or isn't correct, we have the wrong filetype - if header[0] != 0432 { - return nil, errors.New(fmt.Sprintf("Wrong filetype")) - } - - // Read in the names - byteArray = make([]byte, header[1]) - err = binary.Read(file, binary.LittleEndian, &byteArray) - if err != nil { - return nil, err - } - term.Names = strings.Split(string(byteArray), "|") - - // Read in the booleans - byteArray = make([]byte, header[2]) - err = binary.Read(file, binary.LittleEndian, &byteArray) - if err != nil { - return nil, err - } - term.boolAttributes = make(map[string]bool) - for i, b := range byteArray { - if b == 1 { - term.boolAttributes[BoolAttr[i*2+1]] = true - } - } - // If the number of bytes read is not even, a byte for alignment is added - if len(byteArray)%2 != 0 { - err = binary.Read(file, binary.LittleEndian, make([]byte, 1)) - if err != nil { - return nil, err - } - } - - // Read in shorts - shArray = make([]int16, header[3]) - err = binary.Read(file, binary.LittleEndian, &shArray) - if err != nil { - return nil, err - } - term.numAttributes = make(map[string]int16) - for i, n := range shArray { - if n != 0377 && n > -1 { - term.numAttributes[NumAttr[i*2+1]] = n - } - } - - // Read the offsets into the short array - shArray = make([]int16, header[4]) - err = binary.Read(file, binary.LittleEndian, &shArray) - if err != nil { - return nil, err - } - // Read the actual strings in the byte array - byteArray = make([]byte, header[5]) - err = binary.Read(file, binary.LittleEndian, &byteArray) - if err != nil { - return nil, err - } - term.strAttributes = make(map[string]string) - // We get an offset, and then iterate until the string is null-terminated - for i, offset := range shArray { - if offset > -1 { - r := offset - for ; byteArray[r] != 0; r++ { - } - term.strAttributes[StrAttr[i*2+1]] = string(byteArray[offset:r]) - } - } - return &term, nil -} diff --git a/vendor/github.com/Nvveen/Gotty/parser.go b/vendor/github.com/Nvveen/Gotty/parser.go deleted file mode 100644 index a9d5d23c..00000000 --- a/vendor/github.com/Nvveen/Gotty/parser.go +++ /dev/null @@ -1,362 +0,0 @@ -// Copyright 2012 Neal van Veen. All rights reserved. -// Usage of this source code is governed by a BSD-style license that can be -// found in the LICENSE file. - -package gotty - -import ( - "bytes" - "errors" - "fmt" - "regexp" - "strconv" - "strings" -) - -var exp = [...]string{ - "%%", - "%c", - "%s", - "%p(\\d)", - "%P([A-z])", - "%g([A-z])", - "%'(.)'", - "%{([0-9]+)}", - "%l", - "%\\+|%-|%\\*|%/|%m", - "%&|%\\||%\\^", - "%=|%>|%<", - "%A|%O", - "%!|%~", - "%i", - "%(:[\\ #\\-\\+]{0,4})?(\\d+\\.\\d+|\\d+)?[doxXs]", - "%\\?(.*?);", -} - -var regex *regexp.Regexp -var staticVar map[byte]stacker - -// Parses the attribute that is received with name attr and parameters params. -func (term *TermInfo) Parse(attr string, params ...interface{}) (string, error) { - // Get the attribute name first. - iface, err := term.GetAttribute(attr) - str, ok := iface.(string) - if err != nil { - return "", err - } - if !ok { - return str, errors.New("Only string capabilities can be parsed.") - } - // Construct the hidden parser struct so we can use a recursive stack based - // parser. - ps := &parser{} - // Dynamic variables only exist in this context. - ps.dynamicVar = make(map[byte]stacker, 26) - ps.parameters = make([]stacker, len(params)) - // Convert the parameters to insert them into the parser struct. - for i, x := range params { - ps.parameters[i] = x - } - // Recursively walk and return. - result, err := ps.walk(str) - return result, err -} - -// Parses the attribute that is received with name attr and parameters params. -// Only works on full name of a capability that is given, which it uses to -// search for the termcap name. -func (term *TermInfo) ParseName(attr string, params ...interface{}) (string, error) { - tc := GetTermcapName(attr) - return term.Parse(tc, params) -} - -// Identify each token in a stack based manner and do the actual parsing. -func (ps *parser) walk(attr string) (string, error) { - // We use a buffer to get the modified string. - var buf bytes.Buffer - // Next, find and identify all tokens by their indices and strings. - tokens := regex.FindAllStringSubmatch(attr, -1) - if len(tokens) == 0 { - return attr, nil - } - indices := regex.FindAllStringIndex(attr, -1) - q := 0 // q counts the matches of one token - // Iterate through the string per character. - for i := 0; i < len(attr); i++ { - // If the current position is an identified token, execute the following - // steps. - if q < len(indices) && i >= indices[q][0] && i < indices[q][1] { - // Switch on token. - switch { - case tokens[q][0][:2] == "%%": - // Literal percentage character. - buf.WriteByte('%') - case tokens[q][0][:2] == "%c": - // Pop a character. - c, err := ps.st.pop() - if err != nil { - return buf.String(), err - } - buf.WriteByte(c.(byte)) - case tokens[q][0][:2] == "%s": - // Pop a string. - str, err := ps.st.pop() - if err != nil { - return buf.String(), err - } - if _, ok := str.(string); !ok { - return buf.String(), errors.New("Stack head is not a string") - } - buf.WriteString(str.(string)) - case tokens[q][0][:2] == "%p": - // Push a parameter on the stack. - index, err := strconv.ParseInt(tokens[q][1], 10, 8) - index-- - if err != nil { - return buf.String(), err - } - if int(index) >= len(ps.parameters) { - return buf.String(), errors.New("Parameters index out of bound") - } - ps.st.push(ps.parameters[index]) - case tokens[q][0][:2] == "%P": - // Pop a variable from the stack as a dynamic or static variable. - val, err := ps.st.pop() - if err != nil { - return buf.String(), err - } - index := tokens[q][2] - if len(index) > 1 { - errorStr := fmt.Sprintf("%s is not a valid dynamic variables index", - index) - return buf.String(), errors.New(errorStr) - } - // Specify either dynamic or static. - if index[0] >= 'a' && index[0] <= 'z' { - ps.dynamicVar[index[0]] = val - } else if index[0] >= 'A' && index[0] <= 'Z' { - staticVar[index[0]] = val - } - case tokens[q][0][:2] == "%g": - // Push a variable from the stack as a dynamic or static variable. - index := tokens[q][3] - if len(index) > 1 { - errorStr := fmt.Sprintf("%s is not a valid static variables index", - index) - return buf.String(), errors.New(errorStr) - } - var val stacker - if index[0] >= 'a' && index[0] <= 'z' { - val = ps.dynamicVar[index[0]] - } else if index[0] >= 'A' && index[0] <= 'Z' { - val = staticVar[index[0]] - } - ps.st.push(val) - case tokens[q][0][:2] == "%'": - // Push a character constant. - con := tokens[q][4] - if len(con) > 1 { - errorStr := fmt.Sprintf("%s is not a valid character constant", con) - return buf.String(), errors.New(errorStr) - } - ps.st.push(con[0]) - case tokens[q][0][:2] == "%{": - // Push an integer constant. - con, err := strconv.ParseInt(tokens[q][5], 10, 32) - if err != nil { - return buf.String(), err - } - ps.st.push(con) - case tokens[q][0][:2] == "%l": - // Push the length of the string that is popped from the stack. - popStr, err := ps.st.pop() - if err != nil { - return buf.String(), err - } - if _, ok := popStr.(string); !ok { - errStr := fmt.Sprintf("Stack head is not a string") - return buf.String(), errors.New(errStr) - } - ps.st.push(len(popStr.(string))) - case tokens[q][0][:2] == "%?": - // If-then-else construct. First, the whole string is identified and - // then inside this substring, we can specify which parts to switch on. - ifReg, _ := regexp.Compile("%\\?(.*)%t(.*)%e(.*);|%\\?(.*)%t(.*);") - ifTokens := ifReg.FindStringSubmatch(tokens[q][0]) - var ( - ifStr string - err error - ) - // Parse the if-part to determine if-else. - if len(ifTokens[1]) > 0 { - ifStr, err = ps.walk(ifTokens[1]) - } else { // else - ifStr, err = ps.walk(ifTokens[4]) - } - // Return any errors - if err != nil { - return buf.String(), err - } else if len(ifStr) > 0 { - // Self-defined limitation, not sure if this is correct, but didn't - // seem like it. - return buf.String(), errors.New("If-clause cannot print statements") - } - var thenStr string - // Pop the first value that is set by parsing the if-clause. - choose, err := ps.st.pop() - if err != nil { - return buf.String(), err - } - // Switch to if or else. - if choose.(int) == 0 && len(ifTokens[1]) > 0 { - thenStr, err = ps.walk(ifTokens[3]) - } else if choose.(int) != 0 { - if len(ifTokens[1]) > 0 { - thenStr, err = ps.walk(ifTokens[2]) - } else { - thenStr, err = ps.walk(ifTokens[5]) - } - } - if err != nil { - return buf.String(), err - } - buf.WriteString(thenStr) - case tokens[q][0][len(tokens[q][0])-1] == 'd': // Fallthrough for printing - fallthrough - case tokens[q][0][len(tokens[q][0])-1] == 'o': // digits. - fallthrough - case tokens[q][0][len(tokens[q][0])-1] == 'x': - fallthrough - case tokens[q][0][len(tokens[q][0])-1] == 'X': - fallthrough - case tokens[q][0][len(tokens[q][0])-1] == 's': - token := tokens[q][0] - // Remove the : that comes before a flag. - if token[1] == ':' { - token = token[:1] + token[2:] - } - digit, err := ps.st.pop() - if err != nil { - return buf.String(), err - } - // The rest is determined like the normal formatted prints. - digitStr := fmt.Sprintf(token, digit.(int)) - buf.WriteString(digitStr) - case tokens[q][0][:2] == "%i": - // Increment the parameters by one. - if len(ps.parameters) < 2 { - return buf.String(), errors.New("Not enough parameters to increment.") - } - val1, val2 := ps.parameters[0].(int), ps.parameters[1].(int) - val1++ - val2++ - ps.parameters[0], ps.parameters[1] = val1, val2 - default: - // The rest of the tokens is a special case, where two values are - // popped and then operated on by the token that comes after them. - op1, err := ps.st.pop() - if err != nil { - return buf.String(), err - } - op2, err := ps.st.pop() - if err != nil { - return buf.String(), err - } - var result stacker - switch tokens[q][0][:2] { - case "%+": - // Addition - result = op2.(int) + op1.(int) - case "%-": - // Subtraction - result = op2.(int) - op1.(int) - case "%*": - // Multiplication - result = op2.(int) * op1.(int) - case "%/": - // Division - result = op2.(int) / op1.(int) - case "%m": - // Modulo - result = op2.(int) % op1.(int) - case "%&": - // Bitwise AND - result = op2.(int) & op1.(int) - case "%|": - // Bitwise OR - result = op2.(int) | op1.(int) - case "%^": - // Bitwise XOR - result = op2.(int) ^ op1.(int) - case "%=": - // Equals - result = op2 == op1 - case "%>": - // Greater-than - result = op2.(int) > op1.(int) - case "%<": - // Lesser-than - result = op2.(int) < op1.(int) - case "%A": - // Logical AND - result = op2.(bool) && op1.(bool) - case "%O": - // Logical OR - result = op2.(bool) || op1.(bool) - case "%!": - // Logical complement - result = !op1.(bool) - case "%~": - // Bitwise complement - result = ^(op1.(int)) - } - ps.st.push(result) - } - - i = indices[q][1] - 1 - q++ - } else { - // We are not "inside" a token, so just skip until the end or the next - // token, and add all characters to the buffer. - j := i - if q != len(indices) { - for !(j >= indices[q][0] && j < indices[q][1]) { - j++ - } - } else { - j = len(attr) - } - buf.WriteString(string(attr[i:j])) - i = j - } - } - // Return the buffer as a string. - return buf.String(), nil -} - -// Push a stacker-value onto the stack. -func (st *stack) push(s stacker) { - *st = append(*st, s) -} - -// Pop a stacker-value from the stack. -func (st *stack) pop() (stacker, error) { - if len(*st) == 0 { - return nil, errors.New("Stack is empty.") - } - newStack := make(stack, len(*st)-1) - val := (*st)[len(*st)-1] - copy(newStack, (*st)[:len(*st)-1]) - *st = newStack - return val, nil -} - -// Initialize regexes and the static vars (that don't get changed between -// calls. -func init() { - // Initialize the main regex. - expStr := strings.Join(exp[:], "|") - regex, _ = regexp.Compile(expStr) - // Initialize the static variables. - staticVar = make(map[byte]stacker, 26) -} diff --git a/vendor/github.com/Nvveen/Gotty/types.go b/vendor/github.com/Nvveen/Gotty/types.go deleted file mode 100644 index 9bcc65e9..00000000 --- a/vendor/github.com/Nvveen/Gotty/types.go +++ /dev/null @@ -1,23 +0,0 @@ -// Copyright 2012 Neal van Veen. All rights reserved. -// Usage of this source code is governed by a BSD-style license that can be -// found in the LICENSE file. - -package gotty - -type TermInfo struct { - boolAttributes map[string]bool - numAttributes map[string]int16 - strAttributes map[string]string - // The various names of the TermInfo file. - Names []string -} - -type stacker interface { -} -type stack []stacker - -type parser struct { - st stack - parameters []stacker - dynamicVar map[byte]stacker -} diff --git a/vendor/github.com/docker/libnetwork/LICENSE b/vendor/github.com/containerd/cgroups/LICENSE similarity index 99% rename from vendor/github.com/docker/libnetwork/LICENSE rename to vendor/github.com/containerd/cgroups/LICENSE index e06d2081..261eeb9e 100644 --- a/vendor/github.com/docker/libnetwork/LICENSE +++ b/vendor/github.com/containerd/cgroups/LICENSE @@ -1,4 +1,4 @@ -Apache License + Apache License Version 2.0, January 2004 http://www.apache.org/licenses/ @@ -178,7 +178,7 @@ Apache License APPENDIX: How to apply the Apache License to your work. To apply the Apache License to your work, attach the following - boilerplate notice, with the fields enclosed by brackets "{}" + boilerplate notice, with the fields enclosed by brackets "[]" replaced with your own identifying information. (Don't include the brackets!) The text should be enclosed in the appropriate comment syntax for the file format. We also recommend that a @@ -186,7 +186,7 @@ Apache License same "printed page" as the copyright notice for easier identification within third-party archives. - Copyright {yyyy} {name of copyright owner} + Copyright [yyyy] [name of copyright owner] Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. @@ -199,4 +199,3 @@ Apache License WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the specific language governing permissions and limitations under the License. - diff --git a/vendor/github.com/containerd/containerd/archive/tar_opts_unix.go b/vendor/github.com/containerd/cgroups/stats/v1/doc.go similarity index 77% rename from vendor/github.com/containerd/containerd/archive/tar_opts_unix.go rename to vendor/github.com/containerd/cgroups/stats/v1/doc.go index 17382696..23f3cdd4 100644 --- a/vendor/github.com/containerd/containerd/archive/tar_opts_unix.go +++ b/vendor/github.com/containerd/cgroups/stats/v1/doc.go @@ -1,5 +1,3 @@ -// +build !windows - /* Copyright The containerd Authors. @@ -16,9 +14,4 @@ limitations under the License. */ -package archive - -// ApplyOptions provides additional options for an Apply operation -type ApplyOptions struct { - Filter Filter // Filter tar headers -} +package v1 diff --git a/vendor/github.com/containerd/cgroups/stats/v1/metrics.pb.go b/vendor/github.com/containerd/cgroups/stats/v1/metrics.pb.go new file mode 100644 index 00000000..c7884e8e --- /dev/null +++ b/vendor/github.com/containerd/cgroups/stats/v1/metrics.pb.go @@ -0,0 +1,5368 @@ +// Code generated by protoc-gen-gogo. DO NOT EDIT. +// source: github.com/containerd/cgroups/stats/v1/metrics.proto + +package v1 + +import ( + fmt "fmt" + _ "github.com/gogo/protobuf/gogoproto" + proto "github.com/gogo/protobuf/proto" + io "io" + math "math" + reflect "reflect" + strings "strings" +) + +// Reference imports to suppress errors if they are not otherwise used. +var _ = proto.Marshal +var _ = fmt.Errorf +var _ = math.Inf + +// This is a compile-time assertion to ensure that this generated file +// is compatible with the proto package it is being compiled against. +// A compilation error at this line likely means your copy of the +// proto package needs to be updated. +const _ = proto.GoGoProtoPackageIsVersion2 // please upgrade the proto package + +type Metrics struct { + Hugetlb []*HugetlbStat `protobuf:"bytes,1,rep,name=hugetlb,proto3" json:"hugetlb,omitempty"` + Pids *PidsStat `protobuf:"bytes,2,opt,name=pids,proto3" json:"pids,omitempty"` + CPU *CPUStat `protobuf:"bytes,3,opt,name=cpu,proto3" json:"cpu,omitempty"` + Memory *MemoryStat `protobuf:"bytes,4,opt,name=memory,proto3" json:"memory,omitempty"` + Blkio *BlkIOStat `protobuf:"bytes,5,opt,name=blkio,proto3" json:"blkio,omitempty"` + Rdma *RdmaStat `protobuf:"bytes,6,opt,name=rdma,proto3" json:"rdma,omitempty"` + Network []*NetworkStat `protobuf:"bytes,7,rep,name=network,proto3" json:"network,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *Metrics) Reset() { *m = Metrics{} } +func (*Metrics) ProtoMessage() {} +func (*Metrics) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{0} +} +func (m *Metrics) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *Metrics) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_Metrics.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *Metrics) XXX_Merge(src proto.Message) { + xxx_messageInfo_Metrics.Merge(m, src) +} +func (m *Metrics) XXX_Size() int { + return m.Size() +} +func (m *Metrics) XXX_DiscardUnknown() { + xxx_messageInfo_Metrics.DiscardUnknown(m) +} + +var xxx_messageInfo_Metrics proto.InternalMessageInfo + +type HugetlbStat struct { + Usage uint64 `protobuf:"varint,1,opt,name=usage,proto3" json:"usage,omitempty"` + Max uint64 `protobuf:"varint,2,opt,name=max,proto3" json:"max,omitempty"` + Failcnt uint64 `protobuf:"varint,3,opt,name=failcnt,proto3" json:"failcnt,omitempty"` + Pagesize string `protobuf:"bytes,4,opt,name=pagesize,proto3" json:"pagesize,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *HugetlbStat) Reset() { *m = HugetlbStat{} } +func (*HugetlbStat) ProtoMessage() {} +func (*HugetlbStat) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{1} +} +func (m *HugetlbStat) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *HugetlbStat) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_HugetlbStat.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *HugetlbStat) XXX_Merge(src proto.Message) { + xxx_messageInfo_HugetlbStat.Merge(m, src) +} +func (m *HugetlbStat) XXX_Size() int { + return m.Size() +} +func (m *HugetlbStat) XXX_DiscardUnknown() { + xxx_messageInfo_HugetlbStat.DiscardUnknown(m) +} + +var xxx_messageInfo_HugetlbStat proto.InternalMessageInfo + +type PidsStat struct { + Current uint64 `protobuf:"varint,1,opt,name=current,proto3" json:"current,omitempty"` + Limit uint64 `protobuf:"varint,2,opt,name=limit,proto3" json:"limit,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *PidsStat) Reset() { *m = PidsStat{} } +func (*PidsStat) ProtoMessage() {} +func (*PidsStat) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{2} +} +func (m *PidsStat) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *PidsStat) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_PidsStat.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *PidsStat) XXX_Merge(src proto.Message) { + xxx_messageInfo_PidsStat.Merge(m, src) +} +func (m *PidsStat) XXX_Size() int { + return m.Size() +} +func (m *PidsStat) XXX_DiscardUnknown() { + xxx_messageInfo_PidsStat.DiscardUnknown(m) +} + +var xxx_messageInfo_PidsStat proto.InternalMessageInfo + +type CPUStat struct { + Usage *CPUUsage `protobuf:"bytes,1,opt,name=usage,proto3" json:"usage,omitempty"` + Throttling *Throttle `protobuf:"bytes,2,opt,name=throttling,proto3" json:"throttling,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *CPUStat) Reset() { *m = CPUStat{} } +func (*CPUStat) ProtoMessage() {} +func (*CPUStat) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{3} +} +func (m *CPUStat) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *CPUStat) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_CPUStat.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *CPUStat) XXX_Merge(src proto.Message) { + xxx_messageInfo_CPUStat.Merge(m, src) +} +func (m *CPUStat) XXX_Size() int { + return m.Size() +} +func (m *CPUStat) XXX_DiscardUnknown() { + xxx_messageInfo_CPUStat.DiscardUnknown(m) +} + +var xxx_messageInfo_CPUStat proto.InternalMessageInfo + +type CPUUsage struct { + // values in nanoseconds + Total uint64 `protobuf:"varint,1,opt,name=total,proto3" json:"total,omitempty"` + Kernel uint64 `protobuf:"varint,2,opt,name=kernel,proto3" json:"kernel,omitempty"` + User uint64 `protobuf:"varint,3,opt,name=user,proto3" json:"user,omitempty"` + PerCPU []uint64 `protobuf:"varint,4,rep,packed,name=per_cpu,json=perCpu,proto3" json:"per_cpu,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *CPUUsage) Reset() { *m = CPUUsage{} } +func (*CPUUsage) ProtoMessage() {} +func (*CPUUsage) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{4} +} +func (m *CPUUsage) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *CPUUsage) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_CPUUsage.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *CPUUsage) XXX_Merge(src proto.Message) { + xxx_messageInfo_CPUUsage.Merge(m, src) +} +func (m *CPUUsage) XXX_Size() int { + return m.Size() +} +func (m *CPUUsage) XXX_DiscardUnknown() { + xxx_messageInfo_CPUUsage.DiscardUnknown(m) +} + +var xxx_messageInfo_CPUUsage proto.InternalMessageInfo + +type Throttle struct { + Periods uint64 `protobuf:"varint,1,opt,name=periods,proto3" json:"periods,omitempty"` + ThrottledPeriods uint64 `protobuf:"varint,2,opt,name=throttled_periods,json=throttledPeriods,proto3" json:"throttled_periods,omitempty"` + ThrottledTime uint64 `protobuf:"varint,3,opt,name=throttled_time,json=throttledTime,proto3" json:"throttled_time,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *Throttle) Reset() { *m = Throttle{} } +func (*Throttle) ProtoMessage() {} +func (*Throttle) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{5} +} +func (m *Throttle) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *Throttle) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_Throttle.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *Throttle) XXX_Merge(src proto.Message) { + xxx_messageInfo_Throttle.Merge(m, src) +} +func (m *Throttle) XXX_Size() int { + return m.Size() +} +func (m *Throttle) XXX_DiscardUnknown() { + xxx_messageInfo_Throttle.DiscardUnknown(m) +} + +var xxx_messageInfo_Throttle proto.InternalMessageInfo + +type MemoryStat struct { + Cache uint64 `protobuf:"varint,1,opt,name=cache,proto3" json:"cache,omitempty"` + RSS uint64 `protobuf:"varint,2,opt,name=rss,proto3" json:"rss,omitempty"` + RSSHuge uint64 `protobuf:"varint,3,opt,name=rss_huge,json=rssHuge,proto3" json:"rss_huge,omitempty"` + MappedFile uint64 `protobuf:"varint,4,opt,name=mapped_file,json=mappedFile,proto3" json:"mapped_file,omitempty"` + Dirty uint64 `protobuf:"varint,5,opt,name=dirty,proto3" json:"dirty,omitempty"` + Writeback uint64 `protobuf:"varint,6,opt,name=writeback,proto3" json:"writeback,omitempty"` + PgPgIn uint64 `protobuf:"varint,7,opt,name=pg_pg_in,json=pgPgIn,proto3" json:"pg_pg_in,omitempty"` + PgPgOut uint64 `protobuf:"varint,8,opt,name=pg_pg_out,json=pgPgOut,proto3" json:"pg_pg_out,omitempty"` + PgFault uint64 `protobuf:"varint,9,opt,name=pg_fault,json=pgFault,proto3" json:"pg_fault,omitempty"` + PgMajFault uint64 `protobuf:"varint,10,opt,name=pg_maj_fault,json=pgMajFault,proto3" json:"pg_maj_fault,omitempty"` + InactiveAnon uint64 `protobuf:"varint,11,opt,name=inactive_anon,json=inactiveAnon,proto3" json:"inactive_anon,omitempty"` + ActiveAnon uint64 `protobuf:"varint,12,opt,name=active_anon,json=activeAnon,proto3" json:"active_anon,omitempty"` + InactiveFile uint64 `protobuf:"varint,13,opt,name=inactive_file,json=inactiveFile,proto3" json:"inactive_file,omitempty"` + ActiveFile uint64 `protobuf:"varint,14,opt,name=active_file,json=activeFile,proto3" json:"active_file,omitempty"` + Unevictable uint64 `protobuf:"varint,15,opt,name=unevictable,proto3" json:"unevictable,omitempty"` + HierarchicalMemoryLimit uint64 `protobuf:"varint,16,opt,name=hierarchical_memory_limit,json=hierarchicalMemoryLimit,proto3" json:"hierarchical_memory_limit,omitempty"` + HierarchicalSwapLimit uint64 `protobuf:"varint,17,opt,name=hierarchical_swap_limit,json=hierarchicalSwapLimit,proto3" json:"hierarchical_swap_limit,omitempty"` + TotalCache uint64 `protobuf:"varint,18,opt,name=total_cache,json=totalCache,proto3" json:"total_cache,omitempty"` + TotalRSS uint64 `protobuf:"varint,19,opt,name=total_rss,json=totalRss,proto3" json:"total_rss,omitempty"` + TotalRSSHuge uint64 `protobuf:"varint,20,opt,name=total_rss_huge,json=totalRssHuge,proto3" json:"total_rss_huge,omitempty"` + TotalMappedFile uint64 `protobuf:"varint,21,opt,name=total_mapped_file,json=totalMappedFile,proto3" json:"total_mapped_file,omitempty"` + TotalDirty uint64 `protobuf:"varint,22,opt,name=total_dirty,json=totalDirty,proto3" json:"total_dirty,omitempty"` + TotalWriteback uint64 `protobuf:"varint,23,opt,name=total_writeback,json=totalWriteback,proto3" json:"total_writeback,omitempty"` + TotalPgPgIn uint64 `protobuf:"varint,24,opt,name=total_pg_pg_in,json=totalPgPgIn,proto3" json:"total_pg_pg_in,omitempty"` + TotalPgPgOut uint64 `protobuf:"varint,25,opt,name=total_pg_pg_out,json=totalPgPgOut,proto3" json:"total_pg_pg_out,omitempty"` + TotalPgFault uint64 `protobuf:"varint,26,opt,name=total_pg_fault,json=totalPgFault,proto3" json:"total_pg_fault,omitempty"` + TotalPgMajFault uint64 `protobuf:"varint,27,opt,name=total_pg_maj_fault,json=totalPgMajFault,proto3" json:"total_pg_maj_fault,omitempty"` + TotalInactiveAnon uint64 `protobuf:"varint,28,opt,name=total_inactive_anon,json=totalInactiveAnon,proto3" json:"total_inactive_anon,omitempty"` + TotalActiveAnon uint64 `protobuf:"varint,29,opt,name=total_active_anon,json=totalActiveAnon,proto3" json:"total_active_anon,omitempty"` + TotalInactiveFile uint64 `protobuf:"varint,30,opt,name=total_inactive_file,json=totalInactiveFile,proto3" json:"total_inactive_file,omitempty"` + TotalActiveFile uint64 `protobuf:"varint,31,opt,name=total_active_file,json=totalActiveFile,proto3" json:"total_active_file,omitempty"` + TotalUnevictable uint64 `protobuf:"varint,32,opt,name=total_unevictable,json=totalUnevictable,proto3" json:"total_unevictable,omitempty"` + Usage *MemoryEntry `protobuf:"bytes,33,opt,name=usage,proto3" json:"usage,omitempty"` + Swap *MemoryEntry `protobuf:"bytes,34,opt,name=swap,proto3" json:"swap,omitempty"` + Kernel *MemoryEntry `protobuf:"bytes,35,opt,name=kernel,proto3" json:"kernel,omitempty"` + KernelTCP *MemoryEntry `protobuf:"bytes,36,opt,name=kernel_tcp,json=kernelTcp,proto3" json:"kernel_tcp,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *MemoryStat) Reset() { *m = MemoryStat{} } +func (*MemoryStat) ProtoMessage() {} +func (*MemoryStat) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{6} +} +func (m *MemoryStat) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *MemoryStat) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_MemoryStat.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *MemoryStat) XXX_Merge(src proto.Message) { + xxx_messageInfo_MemoryStat.Merge(m, src) +} +func (m *MemoryStat) XXX_Size() int { + return m.Size() +} +func (m *MemoryStat) XXX_DiscardUnknown() { + xxx_messageInfo_MemoryStat.DiscardUnknown(m) +} + +var xxx_messageInfo_MemoryStat proto.InternalMessageInfo + +type MemoryEntry struct { + Limit uint64 `protobuf:"varint,1,opt,name=limit,proto3" json:"limit,omitempty"` + Usage uint64 `protobuf:"varint,2,opt,name=usage,proto3" json:"usage,omitempty"` + Max uint64 `protobuf:"varint,3,opt,name=max,proto3" json:"max,omitempty"` + Failcnt uint64 `protobuf:"varint,4,opt,name=failcnt,proto3" json:"failcnt,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *MemoryEntry) Reset() { *m = MemoryEntry{} } +func (*MemoryEntry) ProtoMessage() {} +func (*MemoryEntry) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{7} +} +func (m *MemoryEntry) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *MemoryEntry) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_MemoryEntry.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *MemoryEntry) XXX_Merge(src proto.Message) { + xxx_messageInfo_MemoryEntry.Merge(m, src) +} +func (m *MemoryEntry) XXX_Size() int { + return m.Size() +} +func (m *MemoryEntry) XXX_DiscardUnknown() { + xxx_messageInfo_MemoryEntry.DiscardUnknown(m) +} + +var xxx_messageInfo_MemoryEntry proto.InternalMessageInfo + +type BlkIOStat struct { + IoServiceBytesRecursive []*BlkIOEntry `protobuf:"bytes,1,rep,name=io_service_bytes_recursive,json=ioServiceBytesRecursive,proto3" json:"io_service_bytes_recursive,omitempty"` + IoServicedRecursive []*BlkIOEntry `protobuf:"bytes,2,rep,name=io_serviced_recursive,json=ioServicedRecursive,proto3" json:"io_serviced_recursive,omitempty"` + IoQueuedRecursive []*BlkIOEntry `protobuf:"bytes,3,rep,name=io_queued_recursive,json=ioQueuedRecursive,proto3" json:"io_queued_recursive,omitempty"` + IoServiceTimeRecursive []*BlkIOEntry `protobuf:"bytes,4,rep,name=io_service_time_recursive,json=ioServiceTimeRecursive,proto3" json:"io_service_time_recursive,omitempty"` + IoWaitTimeRecursive []*BlkIOEntry `protobuf:"bytes,5,rep,name=io_wait_time_recursive,json=ioWaitTimeRecursive,proto3" json:"io_wait_time_recursive,omitempty"` + IoMergedRecursive []*BlkIOEntry `protobuf:"bytes,6,rep,name=io_merged_recursive,json=ioMergedRecursive,proto3" json:"io_merged_recursive,omitempty"` + IoTimeRecursive []*BlkIOEntry `protobuf:"bytes,7,rep,name=io_time_recursive,json=ioTimeRecursive,proto3" json:"io_time_recursive,omitempty"` + SectorsRecursive []*BlkIOEntry `protobuf:"bytes,8,rep,name=sectors_recursive,json=sectorsRecursive,proto3" json:"sectors_recursive,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *BlkIOStat) Reset() { *m = BlkIOStat{} } +func (*BlkIOStat) ProtoMessage() {} +func (*BlkIOStat) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{8} +} +func (m *BlkIOStat) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *BlkIOStat) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_BlkIOStat.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *BlkIOStat) XXX_Merge(src proto.Message) { + xxx_messageInfo_BlkIOStat.Merge(m, src) +} +func (m *BlkIOStat) XXX_Size() int { + return m.Size() +} +func (m *BlkIOStat) XXX_DiscardUnknown() { + xxx_messageInfo_BlkIOStat.DiscardUnknown(m) +} + +var xxx_messageInfo_BlkIOStat proto.InternalMessageInfo + +type BlkIOEntry struct { + Op string `protobuf:"bytes,1,opt,name=op,proto3" json:"op,omitempty"` + Device string `protobuf:"bytes,2,opt,name=device,proto3" json:"device,omitempty"` + Major uint64 `protobuf:"varint,3,opt,name=major,proto3" json:"major,omitempty"` + Minor uint64 `protobuf:"varint,4,opt,name=minor,proto3" json:"minor,omitempty"` + Value uint64 `protobuf:"varint,5,opt,name=value,proto3" json:"value,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *BlkIOEntry) Reset() { *m = BlkIOEntry{} } +func (*BlkIOEntry) ProtoMessage() {} +func (*BlkIOEntry) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{9} +} +func (m *BlkIOEntry) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *BlkIOEntry) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_BlkIOEntry.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *BlkIOEntry) XXX_Merge(src proto.Message) { + xxx_messageInfo_BlkIOEntry.Merge(m, src) +} +func (m *BlkIOEntry) XXX_Size() int { + return m.Size() +} +func (m *BlkIOEntry) XXX_DiscardUnknown() { + xxx_messageInfo_BlkIOEntry.DiscardUnknown(m) +} + +var xxx_messageInfo_BlkIOEntry proto.InternalMessageInfo + +type RdmaStat struct { + Current []*RdmaEntry `protobuf:"bytes,1,rep,name=current,proto3" json:"current,omitempty"` + Limit []*RdmaEntry `protobuf:"bytes,2,rep,name=limit,proto3" json:"limit,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *RdmaStat) Reset() { *m = RdmaStat{} } +func (*RdmaStat) ProtoMessage() {} +func (*RdmaStat) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{10} +} +func (m *RdmaStat) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *RdmaStat) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_RdmaStat.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *RdmaStat) XXX_Merge(src proto.Message) { + xxx_messageInfo_RdmaStat.Merge(m, src) +} +func (m *RdmaStat) XXX_Size() int { + return m.Size() +} +func (m *RdmaStat) XXX_DiscardUnknown() { + xxx_messageInfo_RdmaStat.DiscardUnknown(m) +} + +var xxx_messageInfo_RdmaStat proto.InternalMessageInfo + +type RdmaEntry struct { + Device string `protobuf:"bytes,1,opt,name=device,proto3" json:"device,omitempty"` + HcaHandles uint32 `protobuf:"varint,2,opt,name=hca_handles,json=hcaHandles,proto3" json:"hca_handles,omitempty"` + HcaObjects uint32 `protobuf:"varint,3,opt,name=hca_objects,json=hcaObjects,proto3" json:"hca_objects,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *RdmaEntry) Reset() { *m = RdmaEntry{} } +func (*RdmaEntry) ProtoMessage() {} +func (*RdmaEntry) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{11} +} +func (m *RdmaEntry) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *RdmaEntry) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_RdmaEntry.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *RdmaEntry) XXX_Merge(src proto.Message) { + xxx_messageInfo_RdmaEntry.Merge(m, src) +} +func (m *RdmaEntry) XXX_Size() int { + return m.Size() +} +func (m *RdmaEntry) XXX_DiscardUnknown() { + xxx_messageInfo_RdmaEntry.DiscardUnknown(m) +} + +var xxx_messageInfo_RdmaEntry proto.InternalMessageInfo + +type NetworkStat struct { + Name string `protobuf:"bytes,1,opt,name=name,proto3" json:"name,omitempty"` + RxBytes uint64 `protobuf:"varint,2,opt,name=rx_bytes,json=rxBytes,proto3" json:"rx_bytes,omitempty"` + RxPackets uint64 `protobuf:"varint,3,opt,name=rx_packets,json=rxPackets,proto3" json:"rx_packets,omitempty"` + RxErrors uint64 `protobuf:"varint,4,opt,name=rx_errors,json=rxErrors,proto3" json:"rx_errors,omitempty"` + RxDropped uint64 `protobuf:"varint,5,opt,name=rx_dropped,json=rxDropped,proto3" json:"rx_dropped,omitempty"` + TxBytes uint64 `protobuf:"varint,6,opt,name=tx_bytes,json=txBytes,proto3" json:"tx_bytes,omitempty"` + TxPackets uint64 `protobuf:"varint,7,opt,name=tx_packets,json=txPackets,proto3" json:"tx_packets,omitempty"` + TxErrors uint64 `protobuf:"varint,8,opt,name=tx_errors,json=txErrors,proto3" json:"tx_errors,omitempty"` + TxDropped uint64 `protobuf:"varint,9,opt,name=tx_dropped,json=txDropped,proto3" json:"tx_dropped,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *NetworkStat) Reset() { *m = NetworkStat{} } +func (*NetworkStat) ProtoMessage() {} +func (*NetworkStat) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{12} +} +func (m *NetworkStat) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *NetworkStat) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_NetworkStat.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *NetworkStat) XXX_Merge(src proto.Message) { + xxx_messageInfo_NetworkStat.Merge(m, src) +} +func (m *NetworkStat) XXX_Size() int { + return m.Size() +} +func (m *NetworkStat) XXX_DiscardUnknown() { + xxx_messageInfo_NetworkStat.DiscardUnknown(m) +} + +var xxx_messageInfo_NetworkStat proto.InternalMessageInfo + +func init() { + proto.RegisterType((*Metrics)(nil), "io.containerd.cgroups.v1.Metrics") + proto.RegisterType((*HugetlbStat)(nil), "io.containerd.cgroups.v1.HugetlbStat") + proto.RegisterType((*PidsStat)(nil), "io.containerd.cgroups.v1.PidsStat") + proto.RegisterType((*CPUStat)(nil), "io.containerd.cgroups.v1.CPUStat") + proto.RegisterType((*CPUUsage)(nil), "io.containerd.cgroups.v1.CPUUsage") + proto.RegisterType((*Throttle)(nil), "io.containerd.cgroups.v1.Throttle") + proto.RegisterType((*MemoryStat)(nil), "io.containerd.cgroups.v1.MemoryStat") + proto.RegisterType((*MemoryEntry)(nil), "io.containerd.cgroups.v1.MemoryEntry") + proto.RegisterType((*BlkIOStat)(nil), "io.containerd.cgroups.v1.BlkIOStat") + proto.RegisterType((*BlkIOEntry)(nil), "io.containerd.cgroups.v1.BlkIOEntry") + proto.RegisterType((*RdmaStat)(nil), "io.containerd.cgroups.v1.RdmaStat") + proto.RegisterType((*RdmaEntry)(nil), "io.containerd.cgroups.v1.RdmaEntry") + proto.RegisterType((*NetworkStat)(nil), "io.containerd.cgroups.v1.NetworkStat") +} + +func init() { + proto.RegisterFile("github.com/containerd/cgroups/stats/v1/metrics.proto", fileDescriptor_a17b2d87c332bfaa) +} + +var fileDescriptor_a17b2d87c332bfaa = []byte{ + // 1558 bytes of a gzipped FileDescriptorProto + 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0x94, 0x57, 0xcf, 0x73, 0x13, 0x39, + 0x16, 0xc6, 0xb1, 0x13, 0xbb, 0x9f, 0x93, 0x90, 0x28, 0x10, 0x3a, 0x01, 0xe2, 0xe0, 0x24, 0xbb, + 0xd9, 0xa5, 0xca, 0x29, 0xd8, 0x2d, 0x6a, 0x61, 0xa1, 0xb6, 0x70, 0x80, 0x82, 0xda, 0xcd, 0x62, + 0xda, 0x49, 0xb1, 0x7b, 0xea, 0x92, 0xdb, 0xa2, 0xad, 0xc4, 0x6e, 0x35, 0x6a, 0xb5, 0xe3, 0xcc, + 0x69, 0x0e, 0x53, 0x35, 0xa7, 0xf9, 0x67, 0xe6, 0xaf, 0xe0, 0x38, 0x97, 0xa9, 0x9a, 0xb9, 0xa4, + 0x06, 0xff, 0x25, 0x53, 0x92, 0xfa, 0x87, 0x0c, 0x84, 0x8c, 0x6f, 0x2d, 0xe9, 0xfb, 0xbe, 0xf7, + 0xf4, 0xfa, 0x53, 0xeb, 0x35, 0xfc, 0xdd, 0xa7, 0xa2, 0x17, 0x77, 0x1a, 0x1e, 0x1b, 0xec, 0x79, + 0x2c, 0x10, 0x98, 0x06, 0x84, 0x77, 0xf7, 0x3c, 0x9f, 0xb3, 0x38, 0x8c, 0xf6, 0x22, 0x81, 0x45, + 0xb4, 0x37, 0xbc, 0xb7, 0x37, 0x20, 0x82, 0x53, 0x2f, 0x6a, 0x84, 0x9c, 0x09, 0x86, 0x6c, 0xca, + 0x1a, 0x39, 0xba, 0x91, 0xa0, 0x1b, 0xc3, 0x7b, 0xeb, 0xd7, 0x7c, 0xe6, 0x33, 0x05, 0xda, 0x93, + 0x4f, 0x1a, 0x5f, 0xff, 0xb1, 0x08, 0xe5, 0x03, 0xad, 0x80, 0xfe, 0x05, 0xe5, 0x5e, 0xec, 0x13, + 0xd1, 0xef, 0xd8, 0x85, 0xcd, 0xe2, 0x6e, 0xf5, 0xfe, 0x4e, 0xe3, 0x22, 0xb5, 0xc6, 0x4b, 0x0d, + 0x6c, 0x0b, 0x2c, 0x9c, 0x94, 0x85, 0x1e, 0x40, 0x29, 0xa4, 0xdd, 0xc8, 0x9e, 0xd9, 0x2c, 0xec, + 0x56, 0xef, 0xd7, 0x2f, 0x66, 0xb7, 0x68, 0x37, 0x52, 0x54, 0x85, 0x47, 0x8f, 0xa1, 0xe8, 0x85, + 0xb1, 0x5d, 0x54, 0xb4, 0x3b, 0x17, 0xd3, 0xf6, 0x5b, 0x47, 0x92, 0xd5, 0x2c, 0x8f, 0xcf, 0x6b, + 0xc5, 0xfd, 0xd6, 0x91, 0x23, 0x69, 0xe8, 0x31, 0xcc, 0x0d, 0xc8, 0x80, 0xf1, 0x33, 0xbb, 0xa4, + 0x04, 0xb6, 0x2f, 0x16, 0x38, 0x50, 0x38, 0x15, 0x39, 0xe1, 0xa0, 0x87, 0x30, 0xdb, 0xe9, 0x9f, + 0x50, 0x66, 0xcf, 0x2a, 0xf2, 0xd6, 0xc5, 0xe4, 0x66, 0xff, 0xe4, 0xd5, 0x6b, 0xc5, 0xd5, 0x0c, + 0xb9, 0x5d, 0xde, 0x1d, 0x60, 0x7b, 0xee, 0xb2, 0xed, 0x3a, 0xdd, 0x01, 0xd6, 0xdb, 0x95, 0x78, + 0x59, 0xe7, 0x80, 0x88, 0x53, 0xc6, 0x4f, 0xec, 0xf2, 0x65, 0x75, 0xfe, 0xaf, 0x06, 0xea, 0x3a, + 0x27, 0xac, 0xfa, 0x09, 0x54, 0x8d, 0xfa, 0xa3, 0x6b, 0x30, 0x1b, 0x47, 0xd8, 0x27, 0x76, 0x61, + 0xb3, 0xb0, 0x5b, 0x72, 0xf4, 0x00, 0x2d, 0x41, 0x71, 0x80, 0x47, 0xea, 0x5d, 0x94, 0x1c, 0xf9, + 0x88, 0x6c, 0x28, 0xbf, 0xc3, 0xb4, 0xef, 0x05, 0x42, 0x95, 0xba, 0xe4, 0xa4, 0x43, 0xb4, 0x0e, + 0x95, 0x10, 0xfb, 0x24, 0xa2, 0xdf, 0x10, 0x55, 0x44, 0xcb, 0xc9, 0xc6, 0xf5, 0x47, 0x50, 0x49, + 0x5f, 0x97, 0x54, 0xf0, 0x62, 0xce, 0x49, 0x20, 0x92, 0x58, 0xe9, 0x50, 0xe6, 0xd0, 0xa7, 0x03, + 0x2a, 0x92, 0x78, 0x7a, 0x50, 0xff, 0xbe, 0x00, 0xe5, 0xe4, 0xa5, 0xa1, 0x7f, 0x98, 0x59, 0x7e, + 0xb5, 0x5c, 0xfb, 0xad, 0xa3, 0x23, 0x89, 0x4c, 0x77, 0xd2, 0x04, 0x10, 0x3d, 0xce, 0x84, 0xe8, + 0xd3, 0xc0, 0xbf, 0xdc, 0x5c, 0x87, 0x1a, 0x4b, 0x1c, 0x83, 0x55, 0x7f, 0x0f, 0x95, 0x54, 0x56, + 0xe6, 0x2a, 0x98, 0xc0, 0xfd, 0xb4, 0x5e, 0x6a, 0x80, 0x56, 0x61, 0xee, 0x84, 0xf0, 0x80, 0xf4, + 0x93, 0x2d, 0x24, 0x23, 0x84, 0xa0, 0x14, 0x47, 0x84, 0x27, 0x25, 0x53, 0xcf, 0x68, 0x0b, 0xca, + 0x21, 0xe1, 0xae, 0x34, 0x6d, 0x69, 0xb3, 0xb8, 0x5b, 0x6a, 0xc2, 0xf8, 0xbc, 0x36, 0xd7, 0x22, + 0x5c, 0x9a, 0x72, 0x2e, 0x24, 0x7c, 0x3f, 0x8c, 0xeb, 0x23, 0xa8, 0xa4, 0xa9, 0xc8, 0xc2, 0x85, + 0x84, 0x53, 0xd6, 0x8d, 0xd2, 0xc2, 0x25, 0x43, 0x74, 0x17, 0x96, 0x93, 0x34, 0x49, 0xd7, 0x4d, + 0x31, 0x3a, 0x83, 0xa5, 0x6c, 0xa1, 0x95, 0x80, 0x77, 0x60, 0x31, 0x07, 0x0b, 0x3a, 0x20, 0x49, + 0x56, 0x0b, 0xd9, 0xec, 0x21, 0x1d, 0x90, 0xfa, 0xaf, 0x55, 0x80, 0xdc, 0xea, 0x72, 0xbf, 0x1e, + 0xf6, 0x7a, 0x99, 0x3f, 0xd4, 0x00, 0xad, 0x41, 0x91, 0x47, 0x49, 0x28, 0x7d, 0xa2, 0x9c, 0x76, + 0xdb, 0x91, 0x73, 0xe8, 0x4f, 0x50, 0xe1, 0x51, 0xe4, 0xca, 0x63, 0xad, 0x03, 0x34, 0xab, 0xe3, + 0xf3, 0x5a, 0xd9, 0x69, 0xb7, 0xa5, 0xed, 0x9c, 0x32, 0x8f, 0x22, 0xf9, 0x80, 0x6a, 0x50, 0x1d, + 0xe0, 0x30, 0x24, 0x5d, 0xf7, 0x1d, 0xed, 0x6b, 0xe7, 0x94, 0x1c, 0xd0, 0x53, 0x2f, 0x68, 0x5f, + 0x55, 0xba, 0x4b, 0xb9, 0x38, 0x53, 0x87, 0xab, 0xe4, 0xe8, 0x01, 0xba, 0x05, 0xd6, 0x29, 0xa7, + 0x82, 0x74, 0xb0, 0x77, 0xa2, 0x0e, 0x4f, 0xc9, 0xc9, 0x27, 0x90, 0x0d, 0x95, 0xd0, 0x77, 0x43, + 0xdf, 0xa5, 0x81, 0x5d, 0xd6, 0x6f, 0x22, 0xf4, 0x5b, 0xfe, 0xab, 0x00, 0xad, 0x83, 0xa5, 0x57, + 0x58, 0x2c, 0xec, 0x4a, 0x52, 0x46, 0xbf, 0xe5, 0xbf, 0x8e, 0x05, 0x5a, 0x53, 0xac, 0x77, 0x38, + 0xee, 0x0b, 0xdb, 0x4a, 0x97, 0x5e, 0xc8, 0x21, 0xda, 0x84, 0xf9, 0xd0, 0x77, 0x07, 0xf8, 0x38, + 0x59, 0x06, 0x9d, 0x66, 0xe8, 0x1f, 0xe0, 0x63, 0x8d, 0xd8, 0x82, 0x05, 0x1a, 0x60, 0x4f, 0xd0, + 0x21, 0x71, 0x71, 0xc0, 0x02, 0xbb, 0xaa, 0x20, 0xf3, 0xe9, 0xe4, 0xd3, 0x80, 0x05, 0x72, 0xb3, + 0x26, 0x64, 0x5e, 0xab, 0x18, 0x00, 0x53, 0x45, 0xd5, 0x63, 0x61, 0x52, 0x45, 0x55, 0x24, 0x57, + 0x51, 0x90, 0x45, 0x53, 0x45, 0x01, 0x36, 0xa1, 0x1a, 0x07, 0x64, 0x48, 0x3d, 0x81, 0x3b, 0x7d, + 0x62, 0x5f, 0x55, 0x00, 0x73, 0x0a, 0x3d, 0x82, 0xb5, 0x1e, 0x25, 0x1c, 0x73, 0xaf, 0x47, 0x3d, + 0xdc, 0x77, 0xf5, 0x87, 0xcc, 0xd5, 0xc7, 0x6f, 0x49, 0xe1, 0x6f, 0x98, 0x00, 0xed, 0x84, 0xff, + 0xc8, 0x65, 0xf4, 0x00, 0x26, 0x96, 0xdc, 0xe8, 0x14, 0x87, 0x09, 0x73, 0x59, 0x31, 0xaf, 0x9b, + 0xcb, 0xed, 0x53, 0x1c, 0x6a, 0x5e, 0x0d, 0xaa, 0xea, 0x94, 0xb8, 0xda, 0x48, 0x48, 0xa7, 0xad, + 0xa6, 0xf6, 0x95, 0x9b, 0xfe, 0x02, 0x96, 0x06, 0x48, 0x4f, 0xad, 0x28, 0xcf, 0xcc, 0x8f, 0xcf, + 0x6b, 0x95, 0x43, 0x39, 0x29, 0x8d, 0x55, 0x51, 0xcb, 0x4e, 0x14, 0xa1, 0x07, 0xb0, 0x98, 0x41, + 0xb5, 0xc7, 0xae, 0x29, 0xfc, 0xd2, 0xf8, 0xbc, 0x36, 0x9f, 0xe2, 0x95, 0xd1, 0xe6, 0x53, 0x8e, + 0x72, 0xdb, 0x5f, 0x61, 0x59, 0xf3, 0x4c, 0xcf, 0x5d, 0x57, 0x99, 0x5c, 0x55, 0x0b, 0x07, 0xb9, + 0xf1, 0xb2, 0x7c, 0xb5, 0xfd, 0x56, 0x8d, 0x7c, 0x9f, 0x29, 0x0f, 0xfe, 0x19, 0x34, 0xc7, 0xcd, + 0x9d, 0x78, 0x43, 0x81, 0x74, 0x6e, 0x6f, 0x33, 0x3b, 0x6e, 0xa5, 0xd9, 0x66, 0xa6, 0xb4, 0xf5, + 0x2b, 0x51, 0xb3, 0x2d, 0xed, 0xcc, 0x9d, 0x54, 0x2d, 0xf7, 0xe7, 0x9a, 0x7e, 0xf9, 0x19, 0x4a, + 0x9a, 0x74, 0xdb, 0xd0, 0xd2, 0x5e, 0x5c, 0x9f, 0x40, 0x69, 0x37, 0xde, 0x05, 0x94, 0xa1, 0x72, + 0xd7, 0xde, 0x34, 0x36, 0xda, 0xca, 0xad, 0xdb, 0x80, 0x15, 0x0d, 0x9e, 0x34, 0xf0, 0x2d, 0x85, + 0xd6, 0xf5, 0x7a, 0x65, 0xba, 0x38, 0x2b, 0xa2, 0x89, 0xbe, 0x6d, 0x68, 0x3f, 0xcd, 0xb1, 0x9f, + 0x6b, 0xab, 0x92, 0x6f, 0x7c, 0x41, 0x5b, 0x15, 0xfd, 0x53, 0x6d, 0x85, 0xae, 0x7d, 0xa6, 0xad, + 0xb0, 0x77, 0x53, 0xac, 0x69, 0xf6, 0xcd, 0xe4, 0xb3, 0x27, 0x17, 0x8e, 0x0c, 0xc7, 0xff, 0x33, + 0xbd, 0x3a, 0xee, 0xa8, 0x6f, 0xff, 0xce, 0x65, 0x17, 0xfc, 0xf3, 0x40, 0xf0, 0xb3, 0xf4, 0xf6, + 0x78, 0x08, 0x25, 0xe9, 0x72, 0xbb, 0x3e, 0x0d, 0x57, 0x51, 0xd0, 0x93, 0xec, 0x4a, 0xd8, 0x9a, + 0x86, 0x9c, 0xde, 0x1c, 0x6d, 0x00, 0xfd, 0xe4, 0x0a, 0x2f, 0xb4, 0xb7, 0xa7, 0x90, 0x68, 0x2e, + 0x8c, 0xcf, 0x6b, 0xd6, 0xbf, 0x15, 0xf9, 0x70, 0xbf, 0xe5, 0x58, 0x5a, 0xe7, 0xd0, 0x0b, 0xeb, + 0x04, 0xaa, 0x06, 0x30, 0xbf, 0x77, 0x0b, 0xc6, 0xbd, 0x9b, 0x77, 0x04, 0x33, 0x5f, 0xe8, 0x08, + 0x8a, 0x5f, 0xec, 0x08, 0x4a, 0x13, 0x1d, 0x41, 0xfd, 0xe7, 0x59, 0xb0, 0xb2, 0x86, 0x07, 0x61, + 0x58, 0xa7, 0xcc, 0x8d, 0x08, 0x1f, 0x52, 0x8f, 0xb8, 0x9d, 0x33, 0x41, 0x22, 0x97, 0x13, 0x2f, + 0xe6, 0x11, 0x1d, 0x92, 0xa4, 0x59, 0xdc, 0xbe, 0xa4, 0x73, 0xd2, 0xb5, 0xb9, 0x41, 0x59, 0x5b, + 0xcb, 0x34, 0xa5, 0x8a, 0x93, 0x8a, 0xa0, 0xff, 0xc1, 0xf5, 0x3c, 0x44, 0xd7, 0x50, 0x9f, 0x99, + 0x42, 0x7d, 0x25, 0x53, 0xef, 0xe6, 0xca, 0x87, 0xb0, 0x42, 0x99, 0xfb, 0x3e, 0x26, 0xf1, 0x84, + 0x6e, 0x71, 0x0a, 0xdd, 0x65, 0xca, 0xde, 0x28, 0x7e, 0xae, 0xea, 0xc2, 0x9a, 0x51, 0x12, 0x79, + 0x17, 0x1b, 0xda, 0xa5, 0x29, 0xb4, 0x57, 0xb3, 0x9c, 0xe5, 0xdd, 0x9d, 0x07, 0xf8, 0x3f, 0xac, + 0x52, 0xe6, 0x9e, 0x62, 0x2a, 0x3e, 0x55, 0x9f, 0x9d, 0xae, 0x22, 0x6f, 0x31, 0x15, 0x93, 0xd2, + 0xba, 0x22, 0x03, 0xc2, 0xfd, 0x89, 0x8a, 0xcc, 0x4d, 0x57, 0x91, 0x03, 0xc5, 0xcf, 0x55, 0x5b, + 0xb0, 0x4c, 0xd9, 0xa7, 0xb9, 0x96, 0xa7, 0xd0, 0xbc, 0x4a, 0xd9, 0x64, 0x9e, 0x6f, 0x60, 0x39, + 0x22, 0x9e, 0x60, 0xdc, 0x74, 0x5b, 0x65, 0x0a, 0xc5, 0xa5, 0x84, 0x9e, 0x49, 0xd6, 0x87, 0x00, + 0xf9, 0x3a, 0x5a, 0x84, 0x19, 0x16, 0xaa, 0xa3, 0x63, 0x39, 0x33, 0x2c, 0x94, 0x3d, 0x60, 0x57, + 0x7e, 0x76, 0xf4, 0xc1, 0xb1, 0x9c, 0x64, 0x24, 0xcf, 0xd3, 0x00, 0x1f, 0xb3, 0xb4, 0x09, 0xd4, + 0x03, 0x35, 0x4b, 0x03, 0xc6, 0x93, 0xb3, 0xa3, 0x07, 0x72, 0x76, 0x88, 0xfb, 0x31, 0x49, 0x7b, + 0x1e, 0x35, 0xa8, 0x7f, 0x57, 0x80, 0x4a, 0xfa, 0x1b, 0x80, 0x9e, 0x98, 0x6d, 0x74, 0xf1, 0xeb, + 0x7f, 0x1d, 0x92, 0xa4, 0x37, 0x93, 0xf5, 0xda, 0x0f, 0xf3, 0x5e, 0xfb, 0x0f, 0x93, 0x93, 0x86, + 0x9c, 0x80, 0x95, 0xcd, 0x19, 0xbb, 0x2d, 0x4c, 0xec, 0xb6, 0x06, 0xd5, 0x9e, 0x87, 0xdd, 0x1e, + 0x0e, 0xba, 0x7d, 0xa2, 0x3b, 0xc4, 0x05, 0x07, 0x7a, 0x1e, 0x7e, 0xa9, 0x67, 0x52, 0x00, 0xeb, + 0x1c, 0x13, 0x4f, 0x44, 0xaa, 0x28, 0x1a, 0xf0, 0x5a, 0xcf, 0xd4, 0x7f, 0x98, 0x81, 0xaa, 0xf1, + 0xe7, 0x22, 0x7b, 0xe8, 0x00, 0x0f, 0xd2, 0x38, 0xea, 0x59, 0x76, 0x6c, 0x7c, 0xa4, 0xbf, 0x25, + 0xc9, 0x67, 0xaa, 0xcc, 0x47, 0xea, 0xa3, 0x80, 0x6e, 0x03, 0xf0, 0x91, 0x1b, 0x62, 0xef, 0x84, + 0x24, 0xf2, 0x25, 0xc7, 0xe2, 0xa3, 0x96, 0x9e, 0x40, 0x37, 0xc1, 0xe2, 0x23, 0x97, 0x70, 0xce, + 0x78, 0x94, 0xd4, 0xbe, 0xc2, 0x47, 0xcf, 0xd5, 0x38, 0xe1, 0x76, 0x39, 0x93, 0xbd, 0x40, 0xf2, + 0x0e, 0x2c, 0x3e, 0x7a, 0xa6, 0x27, 0x64, 0x54, 0x91, 0x46, 0xd5, 0xad, 0x67, 0x59, 0xe4, 0x51, + 0x45, 0x1e, 0x55, 0xb7, 0x9e, 0x96, 0x30, 0xa3, 0x8a, 0x2c, 0xaa, 0xee, 0x3e, 0x2b, 0xc2, 0x88, + 0x2a, 0xf2, 0xa8, 0x56, 0xca, 0x4d, 0xa2, 0x36, 0xed, 0x0f, 0x1f, 0x37, 0xae, 0xfc, 0xf2, 0x71, + 0xe3, 0xca, 0xb7, 0xe3, 0x8d, 0xc2, 0x87, 0xf1, 0x46, 0xe1, 0xa7, 0xf1, 0x46, 0xe1, 0xb7, 0xf1, + 0x46, 0xa1, 0x33, 0xa7, 0x7e, 0xc3, 0xff, 0xf6, 0x7b, 0x00, 0x00, 0x00, 0xff, 0xff, 0x2f, 0xc0, + 0x49, 0x92, 0xee, 0x0f, 0x00, 0x00, +} + +func (m *Metrics) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *Metrics) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.Hugetlb) > 0 { + for _, msg := range m.Hugetlb { + dAtA[i] = 0xa + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if m.Pids != nil { + dAtA[i] = 0x12 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Pids.Size())) + n1, err := m.Pids.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n1 + } + if m.CPU != nil { + dAtA[i] = 0x1a + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.CPU.Size())) + n2, err := m.CPU.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n2 + } + if m.Memory != nil { + dAtA[i] = 0x22 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Memory.Size())) + n3, err := m.Memory.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n3 + } + if m.Blkio != nil { + dAtA[i] = 0x2a + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Blkio.Size())) + n4, err := m.Blkio.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n4 + } + if m.Rdma != nil { + dAtA[i] = 0x32 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Rdma.Size())) + n5, err := m.Rdma.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n5 + } + if len(m.Network) > 0 { + for _, msg := range m.Network { + dAtA[i] = 0x3a + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *HugetlbStat) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *HugetlbStat) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if m.Usage != 0 { + dAtA[i] = 0x8 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Usage)) + } + if m.Max != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Max)) + } + if m.Failcnt != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Failcnt)) + } + if len(m.Pagesize) > 0 { + dAtA[i] = 0x22 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(len(m.Pagesize))) + i += copy(dAtA[i:], m.Pagesize) + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *PidsStat) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *PidsStat) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if m.Current != 0 { + dAtA[i] = 0x8 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Current)) + } + if m.Limit != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Limit)) + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *CPUStat) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *CPUStat) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if m.Usage != nil { + dAtA[i] = 0xa + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Usage.Size())) + n6, err := m.Usage.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n6 + } + if m.Throttling != nil { + dAtA[i] = 0x12 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Throttling.Size())) + n7, err := m.Throttling.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n7 + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *CPUUsage) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *CPUUsage) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if m.Total != 0 { + dAtA[i] = 0x8 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Total)) + } + if m.Kernel != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Kernel)) + } + if m.User != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.User)) + } + if len(m.PerCPU) > 0 { + dAtA9 := make([]byte, len(m.PerCPU)*10) + var j8 int + for _, num := range m.PerCPU { + for num >= 1<<7 { + dAtA9[j8] = uint8(uint64(num)&0x7f | 0x80) + num >>= 7 + j8++ + } + dAtA9[j8] = uint8(num) + j8++ + } + dAtA[i] = 0x22 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(j8)) + i += copy(dAtA[i:], dAtA9[:j8]) + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *Throttle) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *Throttle) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if m.Periods != 0 { + dAtA[i] = 0x8 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Periods)) + } + if m.ThrottledPeriods != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.ThrottledPeriods)) + } + if m.ThrottledTime != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.ThrottledTime)) + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *MemoryStat) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *MemoryStat) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if m.Cache != 0 { + dAtA[i] = 0x8 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Cache)) + } + if m.RSS != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.RSS)) + } + if m.RSSHuge != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.RSSHuge)) + } + if m.MappedFile != 0 { + dAtA[i] = 0x20 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.MappedFile)) + } + if m.Dirty != 0 { + dAtA[i] = 0x28 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Dirty)) + } + if m.Writeback != 0 { + dAtA[i] = 0x30 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Writeback)) + } + if m.PgPgIn != 0 { + dAtA[i] = 0x38 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.PgPgIn)) + } + if m.PgPgOut != 0 { + dAtA[i] = 0x40 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.PgPgOut)) + } + if m.PgFault != 0 { + dAtA[i] = 0x48 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.PgFault)) + } + if m.PgMajFault != 0 { + dAtA[i] = 0x50 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.PgMajFault)) + } + if m.InactiveAnon != 0 { + dAtA[i] = 0x58 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.InactiveAnon)) + } + if m.ActiveAnon != 0 { + dAtA[i] = 0x60 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.ActiveAnon)) + } + if m.InactiveFile != 0 { + dAtA[i] = 0x68 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.InactiveFile)) + } + if m.ActiveFile != 0 { + dAtA[i] = 0x70 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.ActiveFile)) + } + if m.Unevictable != 0 { + dAtA[i] = 0x78 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Unevictable)) + } + if m.HierarchicalMemoryLimit != 0 { + dAtA[i] = 0x80 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.HierarchicalMemoryLimit)) + } + if m.HierarchicalSwapLimit != 0 { + dAtA[i] = 0x88 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.HierarchicalSwapLimit)) + } + if m.TotalCache != 0 { + dAtA[i] = 0x90 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalCache)) + } + if m.TotalRSS != 0 { + dAtA[i] = 0x98 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalRSS)) + } + if m.TotalRSSHuge != 0 { + dAtA[i] = 0xa0 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalRSSHuge)) + } + if m.TotalMappedFile != 0 { + dAtA[i] = 0xa8 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalMappedFile)) + } + if m.TotalDirty != 0 { + dAtA[i] = 0xb0 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalDirty)) + } + if m.TotalWriteback != 0 { + dAtA[i] = 0xb8 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalWriteback)) + } + if m.TotalPgPgIn != 0 { + dAtA[i] = 0xc0 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalPgPgIn)) + } + if m.TotalPgPgOut != 0 { + dAtA[i] = 0xc8 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalPgPgOut)) + } + if m.TotalPgFault != 0 { + dAtA[i] = 0xd0 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalPgFault)) + } + if m.TotalPgMajFault != 0 { + dAtA[i] = 0xd8 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalPgMajFault)) + } + if m.TotalInactiveAnon != 0 { + dAtA[i] = 0xe0 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalInactiveAnon)) + } + if m.TotalActiveAnon != 0 { + dAtA[i] = 0xe8 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalActiveAnon)) + } + if m.TotalInactiveFile != 0 { + dAtA[i] = 0xf0 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalInactiveFile)) + } + if m.TotalActiveFile != 0 { + dAtA[i] = 0xf8 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalActiveFile)) + } + if m.TotalUnevictable != 0 { + dAtA[i] = 0x80 + i++ + dAtA[i] = 0x2 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalUnevictable)) + } + if m.Usage != nil { + dAtA[i] = 0x8a + i++ + dAtA[i] = 0x2 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Usage.Size())) + n10, err := m.Usage.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n10 + } + if m.Swap != nil { + dAtA[i] = 0x92 + i++ + dAtA[i] = 0x2 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Swap.Size())) + n11, err := m.Swap.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n11 + } + if m.Kernel != nil { + dAtA[i] = 0x9a + i++ + dAtA[i] = 0x2 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Kernel.Size())) + n12, err := m.Kernel.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n12 + } + if m.KernelTCP != nil { + dAtA[i] = 0xa2 + i++ + dAtA[i] = 0x2 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.KernelTCP.Size())) + n13, err := m.KernelTCP.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n13 + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *MemoryEntry) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *MemoryEntry) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if m.Limit != 0 { + dAtA[i] = 0x8 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Limit)) + } + if m.Usage != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Usage)) + } + if m.Max != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Max)) + } + if m.Failcnt != 0 { + dAtA[i] = 0x20 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Failcnt)) + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *BlkIOStat) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *BlkIOStat) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.IoServiceBytesRecursive) > 0 { + for _, msg := range m.IoServiceBytesRecursive { + dAtA[i] = 0xa + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if len(m.IoServicedRecursive) > 0 { + for _, msg := range m.IoServicedRecursive { + dAtA[i] = 0x12 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if len(m.IoQueuedRecursive) > 0 { + for _, msg := range m.IoQueuedRecursive { + dAtA[i] = 0x1a + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if len(m.IoServiceTimeRecursive) > 0 { + for _, msg := range m.IoServiceTimeRecursive { + dAtA[i] = 0x22 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if len(m.IoWaitTimeRecursive) > 0 { + for _, msg := range m.IoWaitTimeRecursive { + dAtA[i] = 0x2a + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if len(m.IoMergedRecursive) > 0 { + for _, msg := range m.IoMergedRecursive { + dAtA[i] = 0x32 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if len(m.IoTimeRecursive) > 0 { + for _, msg := range m.IoTimeRecursive { + dAtA[i] = 0x3a + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if len(m.SectorsRecursive) > 0 { + for _, msg := range m.SectorsRecursive { + dAtA[i] = 0x42 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *BlkIOEntry) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *BlkIOEntry) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.Op) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintMetrics(dAtA, i, uint64(len(m.Op))) + i += copy(dAtA[i:], m.Op) + } + if len(m.Device) > 0 { + dAtA[i] = 0x12 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(len(m.Device))) + i += copy(dAtA[i:], m.Device) + } + if m.Major != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Major)) + } + if m.Minor != 0 { + dAtA[i] = 0x20 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Minor)) + } + if m.Value != 0 { + dAtA[i] = 0x28 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Value)) + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *RdmaStat) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *RdmaStat) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.Current) > 0 { + for _, msg := range m.Current { + dAtA[i] = 0xa + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if len(m.Limit) > 0 { + for _, msg := range m.Limit { + dAtA[i] = 0x12 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *RdmaEntry) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *RdmaEntry) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.Device) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintMetrics(dAtA, i, uint64(len(m.Device))) + i += copy(dAtA[i:], m.Device) + } + if m.HcaHandles != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.HcaHandles)) + } + if m.HcaObjects != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.HcaObjects)) + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *NetworkStat) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *NetworkStat) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.Name) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintMetrics(dAtA, i, uint64(len(m.Name))) + i += copy(dAtA[i:], m.Name) + } + if m.RxBytes != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.RxBytes)) + } + if m.RxPackets != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.RxPackets)) + } + if m.RxErrors != 0 { + dAtA[i] = 0x20 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.RxErrors)) + } + if m.RxDropped != 0 { + dAtA[i] = 0x28 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.RxDropped)) + } + if m.TxBytes != 0 { + dAtA[i] = 0x30 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TxBytes)) + } + if m.TxPackets != 0 { + dAtA[i] = 0x38 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TxPackets)) + } + if m.TxErrors != 0 { + dAtA[i] = 0x40 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TxErrors)) + } + if m.TxDropped != 0 { + dAtA[i] = 0x48 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TxDropped)) + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func encodeVarintMetrics(dAtA []byte, offset int, v uint64) int { + for v >= 1<<7 { + dAtA[offset] = uint8(v&0x7f | 0x80) + v >>= 7 + offset++ + } + dAtA[offset] = uint8(v) + return offset + 1 +} +func (m *Metrics) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if len(m.Hugetlb) > 0 { + for _, e := range m.Hugetlb { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if m.Pids != nil { + l = m.Pids.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + if m.CPU != nil { + l = m.CPU.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + if m.Memory != nil { + l = m.Memory.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + if m.Blkio != nil { + l = m.Blkio.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + if m.Rdma != nil { + l = m.Rdma.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + if len(m.Network) > 0 { + for _, e := range m.Network { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *HugetlbStat) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.Usage != 0 { + n += 1 + sovMetrics(uint64(m.Usage)) + } + if m.Max != 0 { + n += 1 + sovMetrics(uint64(m.Max)) + } + if m.Failcnt != 0 { + n += 1 + sovMetrics(uint64(m.Failcnt)) + } + l = len(m.Pagesize) + if l > 0 { + n += 1 + l + sovMetrics(uint64(l)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *PidsStat) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.Current != 0 { + n += 1 + sovMetrics(uint64(m.Current)) + } + if m.Limit != 0 { + n += 1 + sovMetrics(uint64(m.Limit)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *CPUStat) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.Usage != nil { + l = m.Usage.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + if m.Throttling != nil { + l = m.Throttling.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *CPUUsage) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.Total != 0 { + n += 1 + sovMetrics(uint64(m.Total)) + } + if m.Kernel != 0 { + n += 1 + sovMetrics(uint64(m.Kernel)) + } + if m.User != 0 { + n += 1 + sovMetrics(uint64(m.User)) + } + if len(m.PerCPU) > 0 { + l = 0 + for _, e := range m.PerCPU { + l += sovMetrics(uint64(e)) + } + n += 1 + sovMetrics(uint64(l)) + l + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *Throttle) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.Periods != 0 { + n += 1 + sovMetrics(uint64(m.Periods)) + } + if m.ThrottledPeriods != 0 { + n += 1 + sovMetrics(uint64(m.ThrottledPeriods)) + } + if m.ThrottledTime != 0 { + n += 1 + sovMetrics(uint64(m.ThrottledTime)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *MemoryStat) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.Cache != 0 { + n += 1 + sovMetrics(uint64(m.Cache)) + } + if m.RSS != 0 { + n += 1 + sovMetrics(uint64(m.RSS)) + } + if m.RSSHuge != 0 { + n += 1 + sovMetrics(uint64(m.RSSHuge)) + } + if m.MappedFile != 0 { + n += 1 + sovMetrics(uint64(m.MappedFile)) + } + if m.Dirty != 0 { + n += 1 + sovMetrics(uint64(m.Dirty)) + } + if m.Writeback != 0 { + n += 1 + sovMetrics(uint64(m.Writeback)) + } + if m.PgPgIn != 0 { + n += 1 + sovMetrics(uint64(m.PgPgIn)) + } + if m.PgPgOut != 0 { + n += 1 + sovMetrics(uint64(m.PgPgOut)) + } + if m.PgFault != 0 { + n += 1 + sovMetrics(uint64(m.PgFault)) + } + if m.PgMajFault != 0 { + n += 1 + sovMetrics(uint64(m.PgMajFault)) + } + if m.InactiveAnon != 0 { + n += 1 + sovMetrics(uint64(m.InactiveAnon)) + } + if m.ActiveAnon != 0 { + n += 1 + sovMetrics(uint64(m.ActiveAnon)) + } + if m.InactiveFile != 0 { + n += 1 + sovMetrics(uint64(m.InactiveFile)) + } + if m.ActiveFile != 0 { + n += 1 + sovMetrics(uint64(m.ActiveFile)) + } + if m.Unevictable != 0 { + n += 1 + sovMetrics(uint64(m.Unevictable)) + } + if m.HierarchicalMemoryLimit != 0 { + n += 2 + sovMetrics(uint64(m.HierarchicalMemoryLimit)) + } + if m.HierarchicalSwapLimit != 0 { + n += 2 + sovMetrics(uint64(m.HierarchicalSwapLimit)) + } + if m.TotalCache != 0 { + n += 2 + sovMetrics(uint64(m.TotalCache)) + } + if m.TotalRSS != 0 { + n += 2 + sovMetrics(uint64(m.TotalRSS)) + } + if m.TotalRSSHuge != 0 { + n += 2 + sovMetrics(uint64(m.TotalRSSHuge)) + } + if m.TotalMappedFile != 0 { + n += 2 + sovMetrics(uint64(m.TotalMappedFile)) + } + if m.TotalDirty != 0 { + n += 2 + sovMetrics(uint64(m.TotalDirty)) + } + if m.TotalWriteback != 0 { + n += 2 + sovMetrics(uint64(m.TotalWriteback)) + } + if m.TotalPgPgIn != 0 { + n += 2 + sovMetrics(uint64(m.TotalPgPgIn)) + } + if m.TotalPgPgOut != 0 { + n += 2 + sovMetrics(uint64(m.TotalPgPgOut)) + } + if m.TotalPgFault != 0 { + n += 2 + sovMetrics(uint64(m.TotalPgFault)) + } + if m.TotalPgMajFault != 0 { + n += 2 + sovMetrics(uint64(m.TotalPgMajFault)) + } + if m.TotalInactiveAnon != 0 { + n += 2 + sovMetrics(uint64(m.TotalInactiveAnon)) + } + if m.TotalActiveAnon != 0 { + n += 2 + sovMetrics(uint64(m.TotalActiveAnon)) + } + if m.TotalInactiveFile != 0 { + n += 2 + sovMetrics(uint64(m.TotalInactiveFile)) + } + if m.TotalActiveFile != 0 { + n += 2 + sovMetrics(uint64(m.TotalActiveFile)) + } + if m.TotalUnevictable != 0 { + n += 2 + sovMetrics(uint64(m.TotalUnevictable)) + } + if m.Usage != nil { + l = m.Usage.Size() + n += 2 + l + sovMetrics(uint64(l)) + } + if m.Swap != nil { + l = m.Swap.Size() + n += 2 + l + sovMetrics(uint64(l)) + } + if m.Kernel != nil { + l = m.Kernel.Size() + n += 2 + l + sovMetrics(uint64(l)) + } + if m.KernelTCP != nil { + l = m.KernelTCP.Size() + n += 2 + l + sovMetrics(uint64(l)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *MemoryEntry) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.Limit != 0 { + n += 1 + sovMetrics(uint64(m.Limit)) + } + if m.Usage != 0 { + n += 1 + sovMetrics(uint64(m.Usage)) + } + if m.Max != 0 { + n += 1 + sovMetrics(uint64(m.Max)) + } + if m.Failcnt != 0 { + n += 1 + sovMetrics(uint64(m.Failcnt)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *BlkIOStat) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if len(m.IoServiceBytesRecursive) > 0 { + for _, e := range m.IoServiceBytesRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.IoServicedRecursive) > 0 { + for _, e := range m.IoServicedRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.IoQueuedRecursive) > 0 { + for _, e := range m.IoQueuedRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.IoServiceTimeRecursive) > 0 { + for _, e := range m.IoServiceTimeRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.IoWaitTimeRecursive) > 0 { + for _, e := range m.IoWaitTimeRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.IoMergedRecursive) > 0 { + for _, e := range m.IoMergedRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.IoTimeRecursive) > 0 { + for _, e := range m.IoTimeRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.SectorsRecursive) > 0 { + for _, e := range m.SectorsRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *BlkIOEntry) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + l = len(m.Op) + if l > 0 { + n += 1 + l + sovMetrics(uint64(l)) + } + l = len(m.Device) + if l > 0 { + n += 1 + l + sovMetrics(uint64(l)) + } + if m.Major != 0 { + n += 1 + sovMetrics(uint64(m.Major)) + } + if m.Minor != 0 { + n += 1 + sovMetrics(uint64(m.Minor)) + } + if m.Value != 0 { + n += 1 + sovMetrics(uint64(m.Value)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *RdmaStat) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if len(m.Current) > 0 { + for _, e := range m.Current { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.Limit) > 0 { + for _, e := range m.Limit { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *RdmaEntry) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + l = len(m.Device) + if l > 0 { + n += 1 + l + sovMetrics(uint64(l)) + } + if m.HcaHandles != 0 { + n += 1 + sovMetrics(uint64(m.HcaHandles)) + } + if m.HcaObjects != 0 { + n += 1 + sovMetrics(uint64(m.HcaObjects)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *NetworkStat) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + l = len(m.Name) + if l > 0 { + n += 1 + l + sovMetrics(uint64(l)) + } + if m.RxBytes != 0 { + n += 1 + sovMetrics(uint64(m.RxBytes)) + } + if m.RxPackets != 0 { + n += 1 + sovMetrics(uint64(m.RxPackets)) + } + if m.RxErrors != 0 { + n += 1 + sovMetrics(uint64(m.RxErrors)) + } + if m.RxDropped != 0 { + n += 1 + sovMetrics(uint64(m.RxDropped)) + } + if m.TxBytes != 0 { + n += 1 + sovMetrics(uint64(m.TxBytes)) + } + if m.TxPackets != 0 { + n += 1 + sovMetrics(uint64(m.TxPackets)) + } + if m.TxErrors != 0 { + n += 1 + sovMetrics(uint64(m.TxErrors)) + } + if m.TxDropped != 0 { + n += 1 + sovMetrics(uint64(m.TxDropped)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func sovMetrics(x uint64) (n int) { + for { + n++ + x >>= 7 + if x == 0 { + break + } + } + return n +} +func sozMetrics(x uint64) (n int) { + return sovMetrics(uint64((x << 1) ^ uint64((int64(x) >> 63)))) +} +func (this *Metrics) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&Metrics{`, + `Hugetlb:` + strings.Replace(fmt.Sprintf("%v", this.Hugetlb), "HugetlbStat", "HugetlbStat", 1) + `,`, + `Pids:` + strings.Replace(fmt.Sprintf("%v", this.Pids), "PidsStat", "PidsStat", 1) + `,`, + `CPU:` + strings.Replace(fmt.Sprintf("%v", this.CPU), "CPUStat", "CPUStat", 1) + `,`, + `Memory:` + strings.Replace(fmt.Sprintf("%v", this.Memory), "MemoryStat", "MemoryStat", 1) + `,`, + `Blkio:` + strings.Replace(fmt.Sprintf("%v", this.Blkio), "BlkIOStat", "BlkIOStat", 1) + `,`, + `Rdma:` + strings.Replace(fmt.Sprintf("%v", this.Rdma), "RdmaStat", "RdmaStat", 1) + `,`, + `Network:` + strings.Replace(fmt.Sprintf("%v", this.Network), "NetworkStat", "NetworkStat", 1) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *HugetlbStat) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&HugetlbStat{`, + `Usage:` + fmt.Sprintf("%v", this.Usage) + `,`, + `Max:` + fmt.Sprintf("%v", this.Max) + `,`, + `Failcnt:` + fmt.Sprintf("%v", this.Failcnt) + `,`, + `Pagesize:` + fmt.Sprintf("%v", this.Pagesize) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *PidsStat) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&PidsStat{`, + `Current:` + fmt.Sprintf("%v", this.Current) + `,`, + `Limit:` + fmt.Sprintf("%v", this.Limit) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *CPUStat) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&CPUStat{`, + `Usage:` + strings.Replace(fmt.Sprintf("%v", this.Usage), "CPUUsage", "CPUUsage", 1) + `,`, + `Throttling:` + strings.Replace(fmt.Sprintf("%v", this.Throttling), "Throttle", "Throttle", 1) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *CPUUsage) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&CPUUsage{`, + `Total:` + fmt.Sprintf("%v", this.Total) + `,`, + `Kernel:` + fmt.Sprintf("%v", this.Kernel) + `,`, + `User:` + fmt.Sprintf("%v", this.User) + `,`, + `PerCPU:` + fmt.Sprintf("%v", this.PerCPU) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *Throttle) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&Throttle{`, + `Periods:` + fmt.Sprintf("%v", this.Periods) + `,`, + `ThrottledPeriods:` + fmt.Sprintf("%v", this.ThrottledPeriods) + `,`, + `ThrottledTime:` + fmt.Sprintf("%v", this.ThrottledTime) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *MemoryStat) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&MemoryStat{`, + `Cache:` + fmt.Sprintf("%v", this.Cache) + `,`, + `RSS:` + fmt.Sprintf("%v", this.RSS) + `,`, + `RSSHuge:` + fmt.Sprintf("%v", this.RSSHuge) + `,`, + `MappedFile:` + fmt.Sprintf("%v", this.MappedFile) + `,`, + `Dirty:` + fmt.Sprintf("%v", this.Dirty) + `,`, + `Writeback:` + fmt.Sprintf("%v", this.Writeback) + `,`, + `PgPgIn:` + fmt.Sprintf("%v", this.PgPgIn) + `,`, + `PgPgOut:` + fmt.Sprintf("%v", this.PgPgOut) + `,`, + `PgFault:` + fmt.Sprintf("%v", this.PgFault) + `,`, + `PgMajFault:` + fmt.Sprintf("%v", this.PgMajFault) + `,`, + `InactiveAnon:` + fmt.Sprintf("%v", this.InactiveAnon) + `,`, + `ActiveAnon:` + fmt.Sprintf("%v", this.ActiveAnon) + `,`, + `InactiveFile:` + fmt.Sprintf("%v", this.InactiveFile) + `,`, + `ActiveFile:` + fmt.Sprintf("%v", this.ActiveFile) + `,`, + `Unevictable:` + fmt.Sprintf("%v", this.Unevictable) + `,`, + `HierarchicalMemoryLimit:` + fmt.Sprintf("%v", this.HierarchicalMemoryLimit) + `,`, + `HierarchicalSwapLimit:` + fmt.Sprintf("%v", this.HierarchicalSwapLimit) + `,`, + `TotalCache:` + fmt.Sprintf("%v", this.TotalCache) + `,`, + `TotalRSS:` + fmt.Sprintf("%v", this.TotalRSS) + `,`, + `TotalRSSHuge:` + fmt.Sprintf("%v", this.TotalRSSHuge) + `,`, + `TotalMappedFile:` + fmt.Sprintf("%v", this.TotalMappedFile) + `,`, + `TotalDirty:` + fmt.Sprintf("%v", this.TotalDirty) + `,`, + `TotalWriteback:` + fmt.Sprintf("%v", this.TotalWriteback) + `,`, + `TotalPgPgIn:` + fmt.Sprintf("%v", this.TotalPgPgIn) + `,`, + `TotalPgPgOut:` + fmt.Sprintf("%v", this.TotalPgPgOut) + `,`, + `TotalPgFault:` + fmt.Sprintf("%v", this.TotalPgFault) + `,`, + `TotalPgMajFault:` + fmt.Sprintf("%v", this.TotalPgMajFault) + `,`, + `TotalInactiveAnon:` + fmt.Sprintf("%v", this.TotalInactiveAnon) + `,`, + `TotalActiveAnon:` + fmt.Sprintf("%v", this.TotalActiveAnon) + `,`, + `TotalInactiveFile:` + fmt.Sprintf("%v", this.TotalInactiveFile) + `,`, + `TotalActiveFile:` + fmt.Sprintf("%v", this.TotalActiveFile) + `,`, + `TotalUnevictable:` + fmt.Sprintf("%v", this.TotalUnevictable) + `,`, + `Usage:` + strings.Replace(fmt.Sprintf("%v", this.Usage), "MemoryEntry", "MemoryEntry", 1) + `,`, + `Swap:` + strings.Replace(fmt.Sprintf("%v", this.Swap), "MemoryEntry", "MemoryEntry", 1) + `,`, + `Kernel:` + strings.Replace(fmt.Sprintf("%v", this.Kernel), "MemoryEntry", "MemoryEntry", 1) + `,`, + `KernelTCP:` + strings.Replace(fmt.Sprintf("%v", this.KernelTCP), "MemoryEntry", "MemoryEntry", 1) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *MemoryEntry) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&MemoryEntry{`, + `Limit:` + fmt.Sprintf("%v", this.Limit) + `,`, + `Usage:` + fmt.Sprintf("%v", this.Usage) + `,`, + `Max:` + fmt.Sprintf("%v", this.Max) + `,`, + `Failcnt:` + fmt.Sprintf("%v", this.Failcnt) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *BlkIOStat) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&BlkIOStat{`, + `IoServiceBytesRecursive:` + strings.Replace(fmt.Sprintf("%v", this.IoServiceBytesRecursive), "BlkIOEntry", "BlkIOEntry", 1) + `,`, + `IoServicedRecursive:` + strings.Replace(fmt.Sprintf("%v", this.IoServicedRecursive), "BlkIOEntry", "BlkIOEntry", 1) + `,`, + `IoQueuedRecursive:` + strings.Replace(fmt.Sprintf("%v", this.IoQueuedRecursive), "BlkIOEntry", "BlkIOEntry", 1) + `,`, + `IoServiceTimeRecursive:` + strings.Replace(fmt.Sprintf("%v", this.IoServiceTimeRecursive), "BlkIOEntry", "BlkIOEntry", 1) + `,`, + `IoWaitTimeRecursive:` + strings.Replace(fmt.Sprintf("%v", this.IoWaitTimeRecursive), "BlkIOEntry", "BlkIOEntry", 1) + `,`, + `IoMergedRecursive:` + strings.Replace(fmt.Sprintf("%v", this.IoMergedRecursive), "BlkIOEntry", "BlkIOEntry", 1) + `,`, + `IoTimeRecursive:` + strings.Replace(fmt.Sprintf("%v", this.IoTimeRecursive), "BlkIOEntry", "BlkIOEntry", 1) + `,`, + `SectorsRecursive:` + strings.Replace(fmt.Sprintf("%v", this.SectorsRecursive), "BlkIOEntry", "BlkIOEntry", 1) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *BlkIOEntry) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&BlkIOEntry{`, + `Op:` + fmt.Sprintf("%v", this.Op) + `,`, + `Device:` + fmt.Sprintf("%v", this.Device) + `,`, + `Major:` + fmt.Sprintf("%v", this.Major) + `,`, + `Minor:` + fmt.Sprintf("%v", this.Minor) + `,`, + `Value:` + fmt.Sprintf("%v", this.Value) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *RdmaStat) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&RdmaStat{`, + `Current:` + strings.Replace(fmt.Sprintf("%v", this.Current), "RdmaEntry", "RdmaEntry", 1) + `,`, + `Limit:` + strings.Replace(fmt.Sprintf("%v", this.Limit), "RdmaEntry", "RdmaEntry", 1) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *RdmaEntry) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&RdmaEntry{`, + `Device:` + fmt.Sprintf("%v", this.Device) + `,`, + `HcaHandles:` + fmt.Sprintf("%v", this.HcaHandles) + `,`, + `HcaObjects:` + fmt.Sprintf("%v", this.HcaObjects) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *NetworkStat) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&NetworkStat{`, + `Name:` + fmt.Sprintf("%v", this.Name) + `,`, + `RxBytes:` + fmt.Sprintf("%v", this.RxBytes) + `,`, + `RxPackets:` + fmt.Sprintf("%v", this.RxPackets) + `,`, + `RxErrors:` + fmt.Sprintf("%v", this.RxErrors) + `,`, + `RxDropped:` + fmt.Sprintf("%v", this.RxDropped) + `,`, + `TxBytes:` + fmt.Sprintf("%v", this.TxBytes) + `,`, + `TxPackets:` + fmt.Sprintf("%v", this.TxPackets) + `,`, + `TxErrors:` + fmt.Sprintf("%v", this.TxErrors) + `,`, + `TxDropped:` + fmt.Sprintf("%v", this.TxDropped) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func valueToStringMetrics(v interface{}) string { + rv := reflect.ValueOf(v) + if rv.IsNil() { + return "nil" + } + pv := reflect.Indirect(rv).Interface() + return fmt.Sprintf("*%v", pv) +} +func (m *Metrics) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: Metrics: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: Metrics: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Hugetlb", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Hugetlb = append(m.Hugetlb, &HugetlbStat{}) + if err := m.Hugetlb[len(m.Hugetlb)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Pids", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Pids == nil { + m.Pids = &PidsStat{} + } + if err := m.Pids.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 3: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field CPU", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.CPU == nil { + m.CPU = &CPUStat{} + } + if err := m.CPU.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 4: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Memory", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Memory == nil { + m.Memory = &MemoryStat{} + } + if err := m.Memory.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 5: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Blkio", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Blkio == nil { + m.Blkio = &BlkIOStat{} + } + if err := m.Blkio.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 6: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Rdma", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Rdma == nil { + m.Rdma = &RdmaStat{} + } + if err := m.Rdma.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 7: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Network", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Network = append(m.Network, &NetworkStat{}) + if err := m.Network[len(m.Network)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *HugetlbStat) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: HugetlbStat: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: HugetlbStat: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Usage", wireType) + } + m.Usage = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Usage |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Max", wireType) + } + m.Max = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Max |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Failcnt", wireType) + } + m.Failcnt = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Failcnt |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 4: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Pagesize", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Pagesize = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *PidsStat) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: PidsStat: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: PidsStat: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Current", wireType) + } + m.Current = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Current |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Limit", wireType) + } + m.Limit = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Limit |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *CPUStat) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: CPUStat: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: CPUStat: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Usage", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Usage == nil { + m.Usage = &CPUUsage{} + } + if err := m.Usage.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Throttling", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Throttling == nil { + m.Throttling = &Throttle{} + } + if err := m.Throttling.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *CPUUsage) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: CPUUsage: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: CPUUsage: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Total", wireType) + } + m.Total = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Total |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Kernel", wireType) + } + m.Kernel = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Kernel |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field User", wireType) + } + m.User = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.User |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 4: + if wireType == 0 { + var v uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + v |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + m.PerCPU = append(m.PerCPU, v) + } else if wireType == 2 { + var packedLen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + packedLen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if packedLen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + packedLen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + var elementCount int + var count int + for _, integer := range dAtA[iNdEx:postIndex] { + if integer < 128 { + count++ + } + } + elementCount = count + if elementCount != 0 && len(m.PerCPU) == 0 { + m.PerCPU = make([]uint64, 0, elementCount) + } + for iNdEx < postIndex { + var v uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + v |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + m.PerCPU = append(m.PerCPU, v) + } + } else { + return fmt.Errorf("proto: wrong wireType = %d for field PerCPU", wireType) + } + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *Throttle) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: Throttle: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: Throttle: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Periods", wireType) + } + m.Periods = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Periods |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field ThrottledPeriods", wireType) + } + m.ThrottledPeriods = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.ThrottledPeriods |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field ThrottledTime", wireType) + } + m.ThrottledTime = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.ThrottledTime |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *MemoryStat) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: MemoryStat: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: MemoryStat: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Cache", wireType) + } + m.Cache = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Cache |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field RSS", wireType) + } + m.RSS = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.RSS |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field RSSHuge", wireType) + } + m.RSSHuge = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.RSSHuge |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 4: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field MappedFile", wireType) + } + m.MappedFile = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.MappedFile |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 5: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Dirty", wireType) + } + m.Dirty = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Dirty |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 6: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Writeback", wireType) + } + m.Writeback = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Writeback |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 7: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field PgPgIn", wireType) + } + m.PgPgIn = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.PgPgIn |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 8: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field PgPgOut", wireType) + } + m.PgPgOut = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.PgPgOut |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 9: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field PgFault", wireType) + } + m.PgFault = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.PgFault |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 10: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field PgMajFault", wireType) + } + m.PgMajFault = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.PgMajFault |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 11: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field InactiveAnon", wireType) + } + m.InactiveAnon = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.InactiveAnon |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 12: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field ActiveAnon", wireType) + } + m.ActiveAnon = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.ActiveAnon |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 13: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field InactiveFile", wireType) + } + m.InactiveFile = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.InactiveFile |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 14: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field ActiveFile", wireType) + } + m.ActiveFile = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.ActiveFile |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 15: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Unevictable", wireType) + } + m.Unevictable = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Unevictable |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 16: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field HierarchicalMemoryLimit", wireType) + } + m.HierarchicalMemoryLimit = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.HierarchicalMemoryLimit |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 17: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field HierarchicalSwapLimit", wireType) + } + m.HierarchicalSwapLimit = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.HierarchicalSwapLimit |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 18: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalCache", wireType) + } + m.TotalCache = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalCache |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 19: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalRSS", wireType) + } + m.TotalRSS = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalRSS |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 20: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalRSSHuge", wireType) + } + m.TotalRSSHuge = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalRSSHuge |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 21: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalMappedFile", wireType) + } + m.TotalMappedFile = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalMappedFile |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 22: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalDirty", wireType) + } + m.TotalDirty = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalDirty |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 23: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalWriteback", wireType) + } + m.TotalWriteback = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalWriteback |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 24: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalPgPgIn", wireType) + } + m.TotalPgPgIn = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalPgPgIn |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 25: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalPgPgOut", wireType) + } + m.TotalPgPgOut = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalPgPgOut |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 26: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalPgFault", wireType) + } + m.TotalPgFault = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalPgFault |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 27: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalPgMajFault", wireType) + } + m.TotalPgMajFault = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalPgMajFault |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 28: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalInactiveAnon", wireType) + } + m.TotalInactiveAnon = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalInactiveAnon |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 29: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalActiveAnon", wireType) + } + m.TotalActiveAnon = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalActiveAnon |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 30: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalInactiveFile", wireType) + } + m.TotalInactiveFile = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalInactiveFile |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 31: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalActiveFile", wireType) + } + m.TotalActiveFile = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalActiveFile |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 32: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalUnevictable", wireType) + } + m.TotalUnevictable = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalUnevictable |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 33: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Usage", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Usage == nil { + m.Usage = &MemoryEntry{} + } + if err := m.Usage.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 34: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Swap", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Swap == nil { + m.Swap = &MemoryEntry{} + } + if err := m.Swap.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 35: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Kernel", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Kernel == nil { + m.Kernel = &MemoryEntry{} + } + if err := m.Kernel.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 36: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field KernelTCP", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.KernelTCP == nil { + m.KernelTCP = &MemoryEntry{} + } + if err := m.KernelTCP.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *MemoryEntry) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: MemoryEntry: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: MemoryEntry: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Limit", wireType) + } + m.Limit = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Limit |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Usage", wireType) + } + m.Usage = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Usage |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Max", wireType) + } + m.Max = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Max |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 4: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Failcnt", wireType) + } + m.Failcnt = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Failcnt |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *BlkIOStat) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: BlkIOStat: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: BlkIOStat: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field IoServiceBytesRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.IoServiceBytesRecursive = append(m.IoServiceBytesRecursive, &BlkIOEntry{}) + if err := m.IoServiceBytesRecursive[len(m.IoServiceBytesRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field IoServicedRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.IoServicedRecursive = append(m.IoServicedRecursive, &BlkIOEntry{}) + if err := m.IoServicedRecursive[len(m.IoServicedRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 3: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field IoQueuedRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.IoQueuedRecursive = append(m.IoQueuedRecursive, &BlkIOEntry{}) + if err := m.IoQueuedRecursive[len(m.IoQueuedRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 4: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field IoServiceTimeRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.IoServiceTimeRecursive = append(m.IoServiceTimeRecursive, &BlkIOEntry{}) + if err := m.IoServiceTimeRecursive[len(m.IoServiceTimeRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 5: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field IoWaitTimeRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.IoWaitTimeRecursive = append(m.IoWaitTimeRecursive, &BlkIOEntry{}) + if err := m.IoWaitTimeRecursive[len(m.IoWaitTimeRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 6: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field IoMergedRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.IoMergedRecursive = append(m.IoMergedRecursive, &BlkIOEntry{}) + if err := m.IoMergedRecursive[len(m.IoMergedRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 7: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field IoTimeRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.IoTimeRecursive = append(m.IoTimeRecursive, &BlkIOEntry{}) + if err := m.IoTimeRecursive[len(m.IoTimeRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 8: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field SectorsRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.SectorsRecursive = append(m.SectorsRecursive, &BlkIOEntry{}) + if err := m.SectorsRecursive[len(m.SectorsRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *BlkIOEntry) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: BlkIOEntry: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: BlkIOEntry: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Op", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Op = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Device", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Device = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Major", wireType) + } + m.Major = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Major |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 4: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Minor", wireType) + } + m.Minor = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Minor |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 5: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Value", wireType) + } + m.Value = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Value |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *RdmaStat) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: RdmaStat: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: RdmaStat: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Current", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Current = append(m.Current, &RdmaEntry{}) + if err := m.Current[len(m.Current)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Limit", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Limit = append(m.Limit, &RdmaEntry{}) + if err := m.Limit[len(m.Limit)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *RdmaEntry) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: RdmaEntry: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: RdmaEntry: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Device", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Device = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field HcaHandles", wireType) + } + m.HcaHandles = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.HcaHandles |= uint32(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field HcaObjects", wireType) + } + m.HcaObjects = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.HcaObjects |= uint32(b&0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *NetworkStat) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: NetworkStat: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: NetworkStat: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Name", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Name = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field RxBytes", wireType) + } + m.RxBytes = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.RxBytes |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field RxPackets", wireType) + } + m.RxPackets = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.RxPackets |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 4: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field RxErrors", wireType) + } + m.RxErrors = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.RxErrors |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 5: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field RxDropped", wireType) + } + m.RxDropped = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.RxDropped |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 6: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TxBytes", wireType) + } + m.TxBytes = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TxBytes |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 7: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TxPackets", wireType) + } + m.TxPackets = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TxPackets |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 8: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TxErrors", wireType) + } + m.TxErrors = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TxErrors |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 9: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TxDropped", wireType) + } + m.TxDropped = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TxDropped |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func skipMetrics(dAtA []byte) (n int, err error) { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowMetrics + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + wireType := int(wire & 0x7) + switch wireType { + case 0: + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowMetrics + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + iNdEx++ + if dAtA[iNdEx-1] < 0x80 { + break + } + } + return iNdEx, nil + case 1: + iNdEx += 8 + return iNdEx, nil + case 2: + var length int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowMetrics + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + length |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + if length < 0 { + return 0, ErrInvalidLengthMetrics + } + iNdEx += length + if iNdEx < 0 { + return 0, ErrInvalidLengthMetrics + } + return iNdEx, nil + case 3: + for { + var innerWire uint64 + var start int = iNdEx + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowMetrics + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + innerWire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + innerWireType := int(innerWire & 0x7) + if innerWireType == 4 { + break + } + next, err := skipMetrics(dAtA[start:]) + if err != nil { + return 0, err + } + iNdEx = start + next + if iNdEx < 0 { + return 0, ErrInvalidLengthMetrics + } + } + return iNdEx, nil + case 4: + return iNdEx, nil + case 5: + iNdEx += 4 + return iNdEx, nil + default: + return 0, fmt.Errorf("proto: illegal wireType %d", wireType) + } + } + panic("unreachable") +} + +var ( + ErrInvalidLengthMetrics = fmt.Errorf("proto: negative length found during unmarshaling") + ErrIntOverflowMetrics = fmt.Errorf("proto: integer overflow") +) diff --git a/vendor/github.com/containerd/cgroups/stats/v1/metrics.pb.txt b/vendor/github.com/containerd/cgroups/stats/v1/metrics.pb.txt new file mode 100644 index 00000000..7a960c67 --- /dev/null +++ b/vendor/github.com/containerd/cgroups/stats/v1/metrics.pb.txt @@ -0,0 +1,712 @@ +file { + name: "github.com/containerd/cgroups/stats/v1/metrics.proto" + package: "io.containerd.cgroups.v1" + dependency: "gogoproto/gogo.proto" + message_type { + name: "Metrics" + field { + name: "hugetlb" + number: 1 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.HugetlbStat" + json_name: "hugetlb" + } + field { + name: "pids" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.PidsStat" + json_name: "pids" + } + field { + name: "cpu" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.CPUStat" + options { + 65004: "CPU" + } + json_name: "cpu" + } + field { + name: "memory" + number: 4 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.MemoryStat" + json_name: "memory" + } + field { + name: "blkio" + number: 5 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOStat" + json_name: "blkio" + } + field { + name: "rdma" + number: 6 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.RdmaStat" + json_name: "rdma" + } + field { + name: "network" + number: 7 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.NetworkStat" + json_name: "network" + } + } + message_type { + name: "HugetlbStat" + field { + name: "usage" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "usage" + } + field { + name: "max" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "max" + } + field { + name: "failcnt" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "failcnt" + } + field { + name: "pagesize" + number: 4 + label: LABEL_OPTIONAL + type: TYPE_STRING + json_name: "pagesize" + } + } + message_type { + name: "PidsStat" + field { + name: "current" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "current" + } + field { + name: "limit" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "limit" + } + } + message_type { + name: "CPUStat" + field { + name: "usage" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.CPUUsage" + json_name: "usage" + } + field { + name: "throttling" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.Throttle" + json_name: "throttling" + } + } + message_type { + name: "CPUUsage" + field { + name: "total" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "total" + } + field { + name: "kernel" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "kernel" + } + field { + name: "user" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "user" + } + field { + name: "per_cpu" + number: 4 + label: LABEL_REPEATED + type: TYPE_UINT64 + options { + 65004: "PerCPU" + } + json_name: "perCpu" + } + } + message_type { + name: "Throttle" + field { + name: "periods" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "periods" + } + field { + name: "throttled_periods" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "throttledPeriods" + } + field { + name: "throttled_time" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "throttledTime" + } + } + message_type { + name: "MemoryStat" + field { + name: "cache" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "cache" + } + field { + name: "rss" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + options { + 65004: "RSS" + } + json_name: "rss" + } + field { + name: "rss_huge" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + options { + 65004: "RSSHuge" + } + json_name: "rssHuge" + } + field { + name: "mapped_file" + number: 4 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "mappedFile" + } + field { + name: "dirty" + number: 5 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "dirty" + } + field { + name: "writeback" + number: 6 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "writeback" + } + field { + name: "pg_pg_in" + number: 7 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "pgPgIn" + } + field { + name: "pg_pg_out" + number: 8 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "pgPgOut" + } + field { + name: "pg_fault" + number: 9 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "pgFault" + } + field { + name: "pg_maj_fault" + number: 10 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "pgMajFault" + } + field { + name: "inactive_anon" + number: 11 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "inactiveAnon" + } + field { + name: "active_anon" + number: 12 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "activeAnon" + } + field { + name: "inactive_file" + number: 13 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "inactiveFile" + } + field { + name: "active_file" + number: 14 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "activeFile" + } + field { + name: "unevictable" + number: 15 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "unevictable" + } + field { + name: "hierarchical_memory_limit" + number: 16 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "hierarchicalMemoryLimit" + } + field { + name: "hierarchical_swap_limit" + number: 17 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "hierarchicalSwapLimit" + } + field { + name: "total_cache" + number: 18 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalCache" + } + field { + name: "total_rss" + number: 19 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + options { + 65004: "TotalRSS" + } + json_name: "totalRss" + } + field { + name: "total_rss_huge" + number: 20 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + options { + 65004: "TotalRSSHuge" + } + json_name: "totalRssHuge" + } + field { + name: "total_mapped_file" + number: 21 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalMappedFile" + } + field { + name: "total_dirty" + number: 22 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalDirty" + } + field { + name: "total_writeback" + number: 23 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalWriteback" + } + field { + name: "total_pg_pg_in" + number: 24 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalPgPgIn" + } + field { + name: "total_pg_pg_out" + number: 25 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalPgPgOut" + } + field { + name: "total_pg_fault" + number: 26 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalPgFault" + } + field { + name: "total_pg_maj_fault" + number: 27 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalPgMajFault" + } + field { + name: "total_inactive_anon" + number: 28 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalInactiveAnon" + } + field { + name: "total_active_anon" + number: 29 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalActiveAnon" + } + field { + name: "total_inactive_file" + number: 30 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalInactiveFile" + } + field { + name: "total_active_file" + number: 31 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalActiveFile" + } + field { + name: "total_unevictable" + number: 32 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalUnevictable" + } + field { + name: "usage" + number: 33 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.MemoryEntry" + json_name: "usage" + } + field { + name: "swap" + number: 34 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.MemoryEntry" + json_name: "swap" + } + field { + name: "kernel" + number: 35 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.MemoryEntry" + json_name: "kernel" + } + field { + name: "kernel_tcp" + number: 36 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.MemoryEntry" + options { + 65004: "KernelTCP" + } + json_name: "kernelTcp" + } + } + message_type { + name: "MemoryEntry" + field { + name: "limit" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "limit" + } + field { + name: "usage" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "usage" + } + field { + name: "max" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "max" + } + field { + name: "failcnt" + number: 4 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "failcnt" + } + } + message_type { + name: "BlkIOStat" + field { + name: "io_service_bytes_recursive" + number: 1 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "ioServiceBytesRecursive" + } + field { + name: "io_serviced_recursive" + number: 2 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "ioServicedRecursive" + } + field { + name: "io_queued_recursive" + number: 3 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "ioQueuedRecursive" + } + field { + name: "io_service_time_recursive" + number: 4 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "ioServiceTimeRecursive" + } + field { + name: "io_wait_time_recursive" + number: 5 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "ioWaitTimeRecursive" + } + field { + name: "io_merged_recursive" + number: 6 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "ioMergedRecursive" + } + field { + name: "io_time_recursive" + number: 7 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "ioTimeRecursive" + } + field { + name: "sectors_recursive" + number: 8 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "sectorsRecursive" + } + } + message_type { + name: "BlkIOEntry" + field { + name: "op" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_STRING + json_name: "op" + } + field { + name: "device" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_STRING + json_name: "device" + } + field { + name: "major" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "major" + } + field { + name: "minor" + number: 4 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "minor" + } + field { + name: "value" + number: 5 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "value" + } + } + message_type { + name: "RdmaStat" + field { + name: "current" + number: 1 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.RdmaEntry" + json_name: "current" + } + field { + name: "limit" + number: 2 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.RdmaEntry" + json_name: "limit" + } + } + message_type { + name: "RdmaEntry" + field { + name: "device" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_STRING + json_name: "device" + } + field { + name: "hca_handles" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT32 + json_name: "hcaHandles" + } + field { + name: "hca_objects" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT32 + json_name: "hcaObjects" + } + } + message_type { + name: "NetworkStat" + field { + name: "name" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_STRING + json_name: "name" + } + field { + name: "rx_bytes" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "rxBytes" + } + field { + name: "rx_packets" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "rxPackets" + } + field { + name: "rx_errors" + number: 4 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "rxErrors" + } + field { + name: "rx_dropped" + number: 5 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "rxDropped" + } + field { + name: "tx_bytes" + number: 6 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "txBytes" + } + field { + name: "tx_packets" + number: 7 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "txPackets" + } + field { + name: "tx_errors" + number: 8 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "txErrors" + } + field { + name: "tx_dropped" + number: 9 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "txDropped" + } + } + syntax: "proto3" +} diff --git a/vendor/github.com/containerd/cgroups/stats/v1/metrics.proto b/vendor/github.com/containerd/cgroups/stats/v1/metrics.proto new file mode 100644 index 00000000..62b51980 --- /dev/null +++ b/vendor/github.com/containerd/cgroups/stats/v1/metrics.proto @@ -0,0 +1,136 @@ +syntax = "proto3"; + +package io.containerd.cgroups.v1; + +import "gogoproto/gogo.proto"; + +message Metrics { + repeated HugetlbStat hugetlb = 1; + PidsStat pids = 2; + CPUStat cpu = 3 [(gogoproto.customname) = "CPU"]; + MemoryStat memory = 4; + BlkIOStat blkio = 5; + RdmaStat rdma = 6; + repeated NetworkStat network = 7; +} + +message HugetlbStat { + uint64 usage = 1; + uint64 max = 2; + uint64 failcnt = 3; + string pagesize = 4; +} + +message PidsStat { + uint64 current = 1; + uint64 limit = 2; +} + +message CPUStat { + CPUUsage usage = 1; + Throttle throttling = 2; +} + +message CPUUsage { + // values in nanoseconds + uint64 total = 1; + uint64 kernel = 2; + uint64 user = 3; + repeated uint64 per_cpu = 4 [(gogoproto.customname) = "PerCPU"]; + +} + +message Throttle { + uint64 periods = 1; + uint64 throttled_periods = 2; + uint64 throttled_time = 3; +} + +message MemoryStat { + uint64 cache = 1; + uint64 rss = 2 [(gogoproto.customname) = "RSS"]; + uint64 rss_huge = 3 [(gogoproto.customname) = "RSSHuge"]; + uint64 mapped_file = 4; + uint64 dirty = 5; + uint64 writeback = 6; + uint64 pg_pg_in = 7; + uint64 pg_pg_out = 8; + uint64 pg_fault = 9; + uint64 pg_maj_fault = 10; + uint64 inactive_anon = 11; + uint64 active_anon = 12; + uint64 inactive_file = 13; + uint64 active_file = 14; + uint64 unevictable = 15; + uint64 hierarchical_memory_limit = 16; + uint64 hierarchical_swap_limit = 17; + uint64 total_cache = 18; + uint64 total_rss = 19 [(gogoproto.customname) = "TotalRSS"]; + uint64 total_rss_huge = 20 [(gogoproto.customname) = "TotalRSSHuge"]; + uint64 total_mapped_file = 21; + uint64 total_dirty = 22; + uint64 total_writeback = 23; + uint64 total_pg_pg_in = 24; + uint64 total_pg_pg_out = 25; + uint64 total_pg_fault = 26; + uint64 total_pg_maj_fault = 27; + uint64 total_inactive_anon = 28; + uint64 total_active_anon = 29; + uint64 total_inactive_file = 30; + uint64 total_active_file = 31; + uint64 total_unevictable = 32; + MemoryEntry usage = 33; + MemoryEntry swap = 34; + MemoryEntry kernel = 35; + MemoryEntry kernel_tcp = 36 [(gogoproto.customname) = "KernelTCP"]; + +} + +message MemoryEntry { + uint64 limit = 1; + uint64 usage = 2; + uint64 max = 3; + uint64 failcnt = 4; +} + +message BlkIOStat { + repeated BlkIOEntry io_service_bytes_recursive = 1; + repeated BlkIOEntry io_serviced_recursive = 2; + repeated BlkIOEntry io_queued_recursive = 3; + repeated BlkIOEntry io_service_time_recursive = 4; + repeated BlkIOEntry io_wait_time_recursive = 5; + repeated BlkIOEntry io_merged_recursive = 6; + repeated BlkIOEntry io_time_recursive = 7; + repeated BlkIOEntry sectors_recursive = 8; +} + +message BlkIOEntry { + string op = 1; + string device = 2; + uint64 major = 3; + uint64 minor = 4; + uint64 value = 5; +} + +message RdmaStat { + repeated RdmaEntry current = 1; + repeated RdmaEntry limit = 2; +} + +message RdmaEntry { + string device = 1; + uint32 hca_handles = 2; + uint32 hca_objects = 3; +} + +message NetworkStat { + string name = 1; + uint64 rx_bytes = 2; + uint64 rx_packets = 3; + uint64 rx_errors = 4; + uint64 rx_dropped = 5; + uint64 tx_bytes = 6; + uint64 tx_packets = 7; + uint64 tx_errors = 8; + uint64 tx_dropped = 9; +} diff --git a/vendor/github.com/containerd/containerd/archive/tar.go b/vendor/github.com/containerd/containerd/archive/tar.go index 0d9e0e75..7ec46575 100644 --- a/vendor/github.com/containerd/containerd/archive/tar.go +++ b/vendor/github.com/containerd/containerd/archive/tar.go @@ -19,9 +19,7 @@ package archive import ( "archive/tar" "context" - "fmt" "io" - "io/ioutil" "os" "path/filepath" "runtime" @@ -91,11 +89,6 @@ const ( // archives. whiteoutMetaPrefix = whiteoutPrefix + whiteoutPrefix - // whiteoutLinkDir is a directory AUFS uses for storing hardlink links to other - // layers. Normally these should not go into exported archives and all changed - // hardlinks should be copied to the top layer. - whiteoutLinkDir = whiteoutMetaPrefix + "plnk" - // whiteoutOpaqueDir file means directory has been made opaque - meaning // readdir calls to this directory do not follow to lower layers. whiteoutOpaqueDir = whiteoutMetaPrefix + ".opq" @@ -117,11 +110,15 @@ func Apply(ctx context.Context, root string, r io.Reader, opts ...ApplyOpt) (int if options.Filter == nil { options.Filter = all } + if options.applyFunc == nil { + options.applyFunc = applyNaive + } - return apply(ctx, root, tar.NewReader(r), options) + return options.applyFunc(ctx, root, tar.NewReader(r), options) } -// applyNaive applies a tar stream of an OCI style diff tar. +// applyNaive applies a tar stream of an OCI style diff tar to a directory +// applying each file as either a whole file or whiteout. // See https://github.com/opencontainers/image-spec/blob/master/layer.md#applying-changesets func applyNaive(ctx context.Context, root string, tr *tar.Reader, options ApplyOptions) (size int64, err error) { var ( @@ -131,11 +128,49 @@ func applyNaive(ctx context.Context, root string, tr *tar.Reader, options ApplyO // may occur out of order unpackedPaths = make(map[string]struct{}) - // Used for aufs plink directory - aufsTempdir = "" - aufsHardlinks = make(map[string]*tar.Header) + convertWhiteout = options.ConvertWhiteout ) + if convertWhiteout == nil { + // handle whiteouts by removing the target files + convertWhiteout = func(hdr *tar.Header, path string) (bool, error) { + base := filepath.Base(path) + dir := filepath.Dir(path) + if base == whiteoutOpaqueDir { + _, err := os.Lstat(dir) + if err != nil { + return false, err + } + err = filepath.Walk(dir, func(path string, info os.FileInfo, err error) error { + if err != nil { + if os.IsNotExist(err) { + err = nil // parent was deleted + } + return err + } + if path == dir { + return nil + } + if _, exists := unpackedPaths[path]; !exists { + err := os.RemoveAll(path) + return err + } + return nil + }) + return false, err + } + + if strings.HasPrefix(base, whiteoutPrefix) { + originalBase := base[len(whiteoutPrefix):] + originalPath := filepath.Join(dir, originalBase) + + return false, os.RemoveAll(originalPath) + } + + return true, nil + } + } + // Iterate through the files in the archive. for { select { @@ -193,85 +228,21 @@ func applyNaive(ctx context.Context, root string, tr *tar.Reader, options ApplyO if base == "" { parentPath = filepath.Dir(path) } - if _, err := os.Lstat(parentPath); err != nil && os.IsNotExist(err) { - err = mkdirAll(parentPath, 0700) - if err != nil { - return 0, err - } - } - } - - // Skip AUFS metadata dirs - if strings.HasPrefix(hdr.Name, whiteoutMetaPrefix) { - // Regular files inside /.wh..wh.plnk can be used as hardlink targets - // We don't want this directory, but we need the files in them so that - // such hardlinks can be resolved. - if strings.HasPrefix(hdr.Name, whiteoutLinkDir) && hdr.Typeflag == tar.TypeReg { - basename := filepath.Base(hdr.Name) - aufsHardlinks[basename] = hdr - if aufsTempdir == "" { - if aufsTempdir, err = ioutil.TempDir(os.Getenv("XDG_RUNTIME_DIR"), "dockerplnk"); err != nil { - return 0, err - } - defer os.RemoveAll(aufsTempdir) - } - p, err := fs.RootPath(aufsTempdir, basename) - if err != nil { - return 0, err - } - if err := createTarFile(ctx, p, root, hdr, tr); err != nil { - return 0, err - } - } - - if hdr.Name != whiteoutOpaqueDir { - continue - } - } - - if strings.HasPrefix(base, whiteoutPrefix) { - dir := filepath.Dir(path) - if base == whiteoutOpaqueDir { - _, err := os.Lstat(dir) - if err != nil { - return 0, err - } - err = filepath.Walk(dir, func(path string, info os.FileInfo, err error) error { - if err != nil { - if os.IsNotExist(err) { - err = nil // parent was deleted - } - return err - } - if path == dir { - return nil - } - if _, exists := unpackedPaths[path]; !exists { - err := os.RemoveAll(path) - return err - } - return nil - }) - if err != nil { - return 0, err - } - continue - } - - originalBase := base[len(whiteoutPrefix):] - originalPath := filepath.Join(dir, originalBase) - - // Ensure originalPath is under dir - if dir[len(dir)-1] != filepath.Separator { - dir += string(filepath.Separator) - } - if !strings.HasPrefix(originalPath, dir) { - return 0, errors.Wrapf(errInvalidArchive, "invalid whiteout name: %v", base) - } - - if err := os.RemoveAll(originalPath); err != nil { + if err := mkparent(ctx, parentPath, root, options.Parents); err != nil { return 0, err } + } + + // Naive whiteout convert function which handles whiteout files by + // removing the target files. + if err := validateWhiteout(path); err != nil { + return 0, err + } + writeFile, err := convertWhiteout(hdr, path) + if err != nil { + return 0, errors.Wrapf(err, "failed to convert whiteout file %q", hdr.Name) + } + if !writeFile { continue } // If path exits we almost always just want to remove and replace it. @@ -289,26 +260,6 @@ func applyNaive(ctx context.Context, root string, tr *tar.Reader, options ApplyO srcData := io.Reader(tr) srcHdr := hdr - // Hard links into /.wh..wh.plnk don't work, as we don't extract that directory, so - // we manually retarget these into the temporary files we extracted them into - if hdr.Typeflag == tar.TypeLink && strings.HasPrefix(filepath.Clean(hdr.Linkname), whiteoutLinkDir) { - linkBasename := filepath.Base(hdr.Linkname) - srcHdr = aufsHardlinks[linkBasename] - if srcHdr == nil { - return 0, fmt.Errorf("invalid aufs hardlink") - } - p, err := fs.RootPath(aufsTempdir, linkBasename) - if err != nil { - return 0, err - } - tmpFile, err := os.Open(p) - if err != nil { - return 0, err - } - defer tmpFile.Close() - srcData = tmpFile - } - if err := createTarFile(ctx, path, root, srcHdr, srcData); err != nil { return 0, err } @@ -428,6 +379,66 @@ func createTarFile(ctx context.Context, path, extractDir string, hdr *tar.Header return chtimes(path, boundTime(latestTime(hdr.AccessTime, hdr.ModTime)), boundTime(hdr.ModTime)) } +func mkparent(ctx context.Context, path, root string, parents []string) error { + if dir, err := os.Lstat(path); err == nil { + if dir.IsDir() { + return nil + } + return &os.PathError{ + Op: "mkparent", + Path: path, + Err: syscall.ENOTDIR, + } + } else if !os.IsNotExist(err) { + return err + } + + i := len(path) + for i > len(root) && !os.IsPathSeparator(path[i-1]) { + i-- + } + + if i > len(root)+1 { + if err := mkparent(ctx, path[:i-1], root, parents); err != nil { + return err + } + } + + if err := mkdir(path, 0755); err != nil { + // Check that still doesn't exist + dir, err1 := os.Lstat(path) + if err1 == nil && dir.IsDir() { + return nil + } + return err + } + + for _, p := range parents { + ppath, err := fs.RootPath(p, path[len(root):]) + if err != nil { + return err + } + + dir, err := os.Lstat(ppath) + if err == nil { + if !dir.IsDir() { + // Replaced, do not copy attributes + break + } + if err := copyDirInfo(dir, path); err != nil { + return err + } + return copyUpXAttrs(path, ppath) + } else if !os.IsNotExist(err) { + return err + } + } + + log.G(ctx).Debugf("parent directory %q not found: default permissions(0755) used", path) + + return nil +} + type changeWriter struct { tw *tar.Writer source string @@ -493,6 +504,12 @@ func (cw *changeWriter) HandleChange(k fs.ChangeKind, p string, f os.FileInfo, e hdr.Mode = int64(chmodTarEntry(os.FileMode(hdr.Mode))) + // truncate timestamp for compatibility. without PAX stdlib rounds timestamps instead + hdr.Format = tar.FormatPAX + hdr.ModTime = hdr.ModTime.Truncate(time.Second) + hdr.AccessTime = time.Time{} + hdr.ChangeTime = time.Time{} + name := p if strings.HasPrefix(name, string(filepath.Separator)) { name, err = filepath.Rel(string(filepath.Separator), name) @@ -598,6 +615,9 @@ func (cw *changeWriter) Close() error { } func (cw *changeWriter) includeParents(hdr *tar.Header) error { + if cw.addedDirs == nil { + return nil + } name := strings.TrimRight(hdr.Name, "/") fname := filepath.Join(cw.source, name) parent := filepath.Dir(name) @@ -684,3 +704,26 @@ func hardlinkRootPath(root, linkname string) (string, error) { } return targetPath, nil } + +func validateWhiteout(path string) error { + base := filepath.Base(path) + dir := filepath.Dir(path) + + if base == whiteoutOpaqueDir { + return nil + } + + if strings.HasPrefix(base, whiteoutPrefix) { + originalBase := base[len(whiteoutPrefix):] + originalPath := filepath.Join(dir, originalBase) + + // Ensure originalPath is under dir + if dir[len(dir)-1] != filepath.Separator { + dir += string(filepath.Separator) + } + if !strings.HasPrefix(originalPath, dir) { + return errors.Wrapf(errInvalidArchive, "invalid whiteout name: %v", base) + } + } + return nil +} diff --git a/vendor/github.com/containerd/containerd/archive/tar_opts.go b/vendor/github.com/containerd/containerd/archive/tar_opts.go index a08bc102..ca419e11 100644 --- a/vendor/github.com/containerd/containerd/archive/tar_opts.go +++ b/vendor/github.com/containerd/containerd/archive/tar_opts.go @@ -16,7 +16,19 @@ package archive -import "archive/tar" +import ( + "archive/tar" + "context" +) + +// ApplyOptions provides additional options for an Apply operation +type ApplyOptions struct { + Filter Filter // Filter tar headers + ConvertWhiteout ConvertWhiteout // Convert whiteout files + Parents []string // Parent directories to handle inherited attributes without CoW + + applyFunc func(context.Context, string, *tar.Reader, ApplyOptions) (int64, error) +} // ApplyOpt allows setting mutable archive apply properties on creation type ApplyOpt func(options *ApplyOptions) error @@ -24,6 +36,9 @@ type ApplyOpt func(options *ApplyOptions) error // Filter specific files from the archive type Filter func(*tar.Header) (bool, error) +// ConvertWhiteout converts whiteout files from the archive +type ConvertWhiteout func(*tar.Header, string) (bool, error) + // all allows all files func all(_ *tar.Header) (bool, error) { return true, nil @@ -36,3 +51,24 @@ func WithFilter(f Filter) ApplyOpt { return nil } } + +// WithConvertWhiteout uses the convert function to convert the whiteout files. +func WithConvertWhiteout(c ConvertWhiteout) ApplyOpt { + return func(options *ApplyOptions) error { + options.ConvertWhiteout = c + return nil + } +} + +// WithParents provides parent directories for resolving inherited attributes +// directory from the filesystem. +// Inherited attributes are searched from first to last, making the first +// element in the list the most immediate parent directory. +// NOTE: When applying to a filesystem which supports CoW, file attributes +// should be inherited by the filesystem. +func WithParents(p []string) ApplyOpt { + return func(options *ApplyOptions) error { + options.Parents = p + return nil + } +} diff --git a/vendor/github.com/containerd/containerd/archive/tar_opts_linux.go b/vendor/github.com/containerd/containerd/archive/tar_opts_linux.go new file mode 100644 index 00000000..38ef9e9b --- /dev/null +++ b/vendor/github.com/containerd/containerd/archive/tar_opts_linux.go @@ -0,0 +1,59 @@ +// +build linux + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package archive + +import ( + "archive/tar" + "os" + "path/filepath" + "strings" + + "golang.org/x/sys/unix" +) + +// AufsConvertWhiteout converts whiteout files for aufs. +func AufsConvertWhiteout(_ *tar.Header, _ string) (bool, error) { + return true, nil +} + +// OverlayConvertWhiteout converts whiteout files for overlay. +func OverlayConvertWhiteout(hdr *tar.Header, path string) (bool, error) { + base := filepath.Base(path) + dir := filepath.Dir(path) + + // if a directory is marked as opaque, we need to translate that to overlay + if base == whiteoutOpaqueDir { + // don't write the file itself + return false, unix.Setxattr(dir, "trusted.overlay.opaque", []byte{'y'}, 0) + } + + // if a file was deleted and we are using overlay, we need to create a character device + if strings.HasPrefix(base, whiteoutPrefix) { + originalBase := base[len(whiteoutPrefix):] + originalPath := filepath.Join(dir, originalBase) + + if err := unix.Mknod(originalPath, unix.S_IFCHR, 0); err != nil { + return false, err + } + // don't write the file itself + return false, os.Chown(originalPath, hdr.Uid, hdr.Gid) + } + + return true, nil +} diff --git a/vendor/github.com/containerd/containerd/archive/tar_opts_windows.go b/vendor/github.com/containerd/containerd/archive/tar_opts_windows.go index e4b15a16..f472013b 100644 --- a/vendor/github.com/containerd/containerd/archive/tar_opts_windows.go +++ b/vendor/github.com/containerd/containerd/archive/tar_opts_windows.go @@ -18,28 +18,12 @@ package archive -// ApplyOptions provides additional options for an Apply operation -type ApplyOptions struct { - ParentLayerPaths []string // Parent layer paths used for Windows layer apply - IsWindowsContainerLayer bool // True if the tar stream to be applied is a Windows Container Layer - Filter Filter // Filter tar headers -} - -// WithParentLayers adds parent layers to the apply process this is required -// for all Windows layers except the base layer. -func WithParentLayers(parentPaths []string) ApplyOpt { - return func(options *ApplyOptions) error { - options.ParentLayerPaths = parentPaths - return nil - } -} - // AsWindowsContainerLayer indicates that the tar stream to apply is that of // a Windows Container Layer. The caller must be holding SeBackupPrivilege and // SeRestorePrivilege. func AsWindowsContainerLayer() ApplyOpt { return func(options *ApplyOptions) error { - options.IsWindowsContainerLayer = true + options.applyFunc = applyWindowsLayer return nil } } diff --git a/vendor/github.com/containerd/containerd/archive/tar_unix.go b/vendor/github.com/containerd/containerd/archive/tar_unix.go index 022dd6d4..e8721875 100644 --- a/vendor/github.com/containerd/containerd/archive/tar_unix.go +++ b/vendor/github.com/containerd/containerd/archive/tar_unix.go @@ -20,11 +20,12 @@ package archive import ( "archive/tar" - "context" "os" + "strings" "sync" "syscall" + "github.com/containerd/continuity/fs" "github.com/containerd/continuity/sysx" "github.com/opencontainers/runc/libcontainer/system" "github.com/pkg/errors" @@ -74,10 +75,6 @@ func openFile(name string, flag int, perm os.FileMode) (*os.File, error) { return f, err } -func mkdirAll(path string, perm os.FileMode) error { - return os.MkdirAll(path, perm) -} - func mkdir(path string, perm os.FileMode) error { if err := os.Mkdir(path, perm); err != nil { return err @@ -149,11 +146,71 @@ func getxattr(path, attr string) ([]byte, error) { } func setxattr(path, key, value string) error { - return sysx.LSetxattr(path, key, []byte(value), 0) + // Do not set trusted attributes + if strings.HasPrefix(key, "trusted.") { + return errors.Wrap(unix.ENOTSUP, "admin attributes from archive not supported") + } + return unix.Lsetxattr(path, key, []byte(value), 0) } -// apply applies a tar stream of an OCI style diff tar. -// See https://github.com/opencontainers/image-spec/blob/master/layer.md#applying-changesets -func apply(ctx context.Context, root string, tr *tar.Reader, options ApplyOptions) (size int64, err error) { - return applyNaive(ctx, root, tr, options) +func copyDirInfo(fi os.FileInfo, path string) error { + st := fi.Sys().(*syscall.Stat_t) + if err := os.Lchown(path, int(st.Uid), int(st.Gid)); err != nil { + if os.IsPermission(err) { + // Normally if uid/gid are the same this would be a no-op, but some + // filesystems may still return EPERM... for instance NFS does this. + // In such a case, this is not an error. + if dstStat, err2 := os.Lstat(path); err2 == nil { + st2 := dstStat.Sys().(*syscall.Stat_t) + if st.Uid == st2.Uid && st.Gid == st2.Gid { + err = nil + } + } + } + if err != nil { + return errors.Wrapf(err, "failed to chown %s", path) + } + } + + if err := os.Chmod(path, fi.Mode()); err != nil { + return errors.Wrapf(err, "failed to chmod %s", path) + } + + timespec := []unix.Timespec{unix.Timespec(fs.StatAtime(st)), unix.Timespec(fs.StatMtime(st))} + if err := unix.UtimesNanoAt(unix.AT_FDCWD, path, timespec, unix.AT_SYMLINK_NOFOLLOW); err != nil { + return errors.Wrapf(err, "failed to utime %s", path) + } + + return nil +} + +func copyUpXAttrs(dst, src string) error { + xattrKeys, err := sysx.LListxattr(src) + if err != nil { + if err == unix.ENOTSUP || err == sysx.ENODATA { + return nil + } + return errors.Wrapf(err, "failed to list xattrs on %s", src) + } + for _, xattr := range xattrKeys { + // Do not copy up trusted attributes + if strings.HasPrefix(xattr, "trusted.") { + continue + } + data, err := sysx.LGetxattr(src, xattr) + if err != nil { + if err == unix.ENOTSUP || err == sysx.ENODATA { + continue + } + return errors.Wrapf(err, "failed to get xattr %q on %s", xattr, src) + } + if err := unix.Lsetxattr(dst, xattr, data, unix.XATTR_CREATE); err != nil { + if err == unix.ENOTSUP || err == unix.ENODATA || err == unix.EEXIST { + continue + } + return errors.Wrapf(err, "failed to set xattr %q on %s", xattr, dst) + } + } + + return nil } diff --git a/vendor/github.com/containerd/containerd/archive/tar_windows.go b/vendor/github.com/containerd/containerd/archive/tar_windows.go index b97631fc..a5c6da69 100644 --- a/vendor/github.com/containerd/containerd/archive/tar_windows.go +++ b/vendor/github.com/containerd/containerd/archive/tar_windows.go @@ -23,7 +23,6 @@ import ( "bufio" "context" "encoding/base64" - "errors" "fmt" "io" "os" @@ -36,6 +35,7 @@ import ( "github.com/Microsoft/go-winio" "github.com/Microsoft/hcsshim" "github.com/containerd/containerd/sys" + "github.com/pkg/errors" ) const ( @@ -107,10 +107,6 @@ func openFile(name string, flag int, perm os.FileMode) (*os.File, error) { return sys.OpenFileSequential(name, flag, perm) } -func mkdirAll(path string, perm os.FileMode) error { - return sys.MkdirAll(path, perm) -} - func mkdir(path string, perm os.FileMode) error { return os.Mkdir(path, perm) } @@ -153,16 +149,8 @@ func setxattr(path, key, value string) error { return errors.New("xattrs not supported on Windows") } -// apply applies a tar stream of an OCI style diff tar of a Windows layer. -// See https://github.com/opencontainers/image-spec/blob/master/layer.md#applying-changesets -func apply(ctx context.Context, root string, tr *tar.Reader, options ApplyOptions) (size int64, err error) { - if options.IsWindowsContainerLayer { - return applyWindowsLayer(ctx, root, tr, options) - } - return applyNaive(ctx, root, tr, options) -} - -// applyWindowsLayer applies a tar stream of an OCI style diff tar of a Windows layer. +// applyWindowsLayer applies a tar stream of an OCI style diff tar of a Windows +// layer using the hcsshim layer writer and backup streams. // See https://github.com/opencontainers/image-spec/blob/master/layer.md#applying-changesets func applyWindowsLayer(ctx context.Context, root string, tr *tar.Reader, options ApplyOptions) (size int64, err error) { home, id := filepath.Split(root) @@ -170,7 +158,7 @@ func applyWindowsLayer(ctx context.Context, root string, tr *tar.Reader, options HomeDir: home, } - w, err := hcsshim.NewLayerWriter(info, id, options.ParentLayerPaths) + w, err := hcsshim.NewLayerWriter(info, id, options.Parents) if err != nil { return 0, err } @@ -443,3 +431,14 @@ func writeBackupStreamFromTarFile(w io.Writer, t *tar.Reader, hdr *tar.Header) ( } } } + +func copyDirInfo(fi os.FileInfo, path string) error { + if err := os.Chmod(path, fi.Mode()); err != nil { + return errors.Wrapf(err, "failed to chmod %s", path) + } + return nil +} + +func copyUpXAttrs(dst, src string) error { + return nil +} diff --git a/vendor/github.com/containerd/containerd/archive/time_darwin.go b/vendor/github.com/containerd/containerd/archive/time_darwin.go deleted file mode 100644 index 9c2b656b..00000000 --- a/vendor/github.com/containerd/containerd/archive/time_darwin.go +++ /dev/null @@ -1,30 +0,0 @@ -/* - Copyright The containerd Authors. - - Licensed under the Apache License, Version 2.0 (the "License"); - you may not use this file except in compliance with the License. - You may obtain a copy of the License at - - http://www.apache.org/licenses/LICENSE-2.0 - - Unless required by applicable law or agreed to in writing, software - distributed under the License is distributed on an "AS IS" BASIS, - WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. - See the License for the specific language governing permissions and - limitations under the License. -*/ - -package archive - -import ( - "time" - - "github.com/pkg/errors" -) - -// as at MacOS 10.12 there is apparently no way to set timestamps -// with nanosecond precision. We could fall back to utimes/lutimes -// and lose the precision as a temporary workaround. -func chtimes(path string, atime, mtime time.Time) error { - return errors.New("OSX missing UtimesNanoAt") -} diff --git a/vendor/github.com/containerd/containerd/archive/time_unix.go b/vendor/github.com/containerd/containerd/archive/time_unix.go index 53d655be..e05ca719 100644 --- a/vendor/github.com/containerd/containerd/archive/time_unix.go +++ b/vendor/github.com/containerd/containerd/archive/time_unix.go @@ -1,4 +1,4 @@ -// +build freebsd linux openbsd solaris +// +build !windows /* Copyright The containerd Authors. @@ -32,7 +32,7 @@ func chtimes(path string, atime, mtime time.Time) error { utimes[1] = unix.NsecToTimespec(mtime.UnixNano()) if err := unix.UtimesNanoAt(unix.AT_FDCWD, path, utimes[0:], unix.AT_SYMLINK_NOFOLLOW); err != nil { - return errors.Wrap(err, "failed call to UtimesNanoAt") + return errors.Wrapf(err, "failed call to UtimesNanoAt for %s", path) } return nil diff --git a/vendor/github.com/containerd/containerd/errdefs/errors.go b/vendor/github.com/containerd/containerd/errdefs/errors.go new file mode 100644 index 00000000..b5200afc --- /dev/null +++ b/vendor/github.com/containerd/containerd/errdefs/errors.go @@ -0,0 +1,93 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +// Package errdefs defines the common errors used throughout containerd +// packages. +// +// Use with errors.Wrap and error.Wrapf to add context to an error. +// +// To detect an error class, use the IsXXX functions to tell whether an error +// is of a certain type. +// +// The functions ToGRPC and FromGRPC can be used to map server-side and +// client-side errors to the correct types. +package errdefs + +import ( + "context" + + "github.com/pkg/errors" +) + +// Definitions of common error types used throughout containerd. All containerd +// errors returned by most packages will map into one of these errors classes. +// Packages should return errors of these types when they want to instruct a +// client to take a particular action. +// +// For the most part, we just try to provide local grpc errors. Most conditions +// map very well to those defined by grpc. +var ( + ErrUnknown = errors.New("unknown") // used internally to represent a missed mapping. + ErrInvalidArgument = errors.New("invalid argument") + ErrNotFound = errors.New("not found") + ErrAlreadyExists = errors.New("already exists") + ErrFailedPrecondition = errors.New("failed precondition") + ErrUnavailable = errors.New("unavailable") + ErrNotImplemented = errors.New("not implemented") // represents not supported and unimplemented +) + +// IsInvalidArgument returns true if the error is due to an invalid argument +func IsInvalidArgument(err error) bool { + return errors.Cause(err) == ErrInvalidArgument +} + +// IsNotFound returns true if the error is due to a missing object +func IsNotFound(err error) bool { + return errors.Cause(err) == ErrNotFound +} + +// IsAlreadyExists returns true if the error is due to an already existing +// metadata item +func IsAlreadyExists(err error) bool { + return errors.Cause(err) == ErrAlreadyExists +} + +// IsFailedPrecondition returns true if an operation could not proceed to the +// lack of a particular condition +func IsFailedPrecondition(err error) bool { + return errors.Cause(err) == ErrFailedPrecondition +} + +// IsUnavailable returns true if the error is due to a resource being unavailable +func IsUnavailable(err error) bool { + return errors.Cause(err) == ErrUnavailable +} + +// IsNotImplemented returns true if the error is due to not being implemented +func IsNotImplemented(err error) bool { + return errors.Cause(err) == ErrNotImplemented +} + +// IsCanceled returns true if the error is due to `context.Canceled`. +func IsCanceled(err error) bool { + return errors.Cause(err) == context.Canceled +} + +// IsDeadlineExceeded returns true if the error is due to +// `context.DeadlineExceeded`. +func IsDeadlineExceeded(err error) bool { + return errors.Cause(err) == context.DeadlineExceeded +} diff --git a/vendor/github.com/containerd/containerd/errdefs/grpc.go b/vendor/github.com/containerd/containerd/errdefs/grpc.go new file mode 100644 index 00000000..209f63bd --- /dev/null +++ b/vendor/github.com/containerd/containerd/errdefs/grpc.go @@ -0,0 +1,147 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package errdefs + +import ( + "context" + "strings" + + "github.com/pkg/errors" + "google.golang.org/grpc/codes" + "google.golang.org/grpc/status" +) + +// ToGRPC will attempt to map the backend containerd error into a grpc error, +// using the original error message as a description. +// +// Further information may be extracted from certain errors depending on their +// type. +// +// If the error is unmapped, the original error will be returned to be handled +// by the regular grpc error handling stack. +func ToGRPC(err error) error { + if err == nil { + return nil + } + + if isGRPCError(err) { + // error has already been mapped to grpc + return err + } + + switch { + case IsInvalidArgument(err): + return status.Errorf(codes.InvalidArgument, err.Error()) + case IsNotFound(err): + return status.Errorf(codes.NotFound, err.Error()) + case IsAlreadyExists(err): + return status.Errorf(codes.AlreadyExists, err.Error()) + case IsFailedPrecondition(err): + return status.Errorf(codes.FailedPrecondition, err.Error()) + case IsUnavailable(err): + return status.Errorf(codes.Unavailable, err.Error()) + case IsNotImplemented(err): + return status.Errorf(codes.Unimplemented, err.Error()) + case IsCanceled(err): + return status.Errorf(codes.Canceled, err.Error()) + case IsDeadlineExceeded(err): + return status.Errorf(codes.DeadlineExceeded, err.Error()) + } + + return err +} + +// ToGRPCf maps the error to grpc error codes, assembling the formatting string +// and combining it with the target error string. +// +// This is equivalent to errors.ToGRPC(errors.Wrapf(err, format, args...)) +func ToGRPCf(err error, format string, args ...interface{}) error { + return ToGRPC(errors.Wrapf(err, format, args...)) +} + +// FromGRPC returns the underlying error from a grpc service based on the grpc error code +func FromGRPC(err error) error { + if err == nil { + return nil + } + + var cls error // divide these into error classes, becomes the cause + + switch code(err) { + case codes.InvalidArgument: + cls = ErrInvalidArgument + case codes.AlreadyExists: + cls = ErrAlreadyExists + case codes.NotFound: + cls = ErrNotFound + case codes.Unavailable: + cls = ErrUnavailable + case codes.FailedPrecondition: + cls = ErrFailedPrecondition + case codes.Unimplemented: + cls = ErrNotImplemented + case codes.Canceled: + cls = context.Canceled + case codes.DeadlineExceeded: + cls = context.DeadlineExceeded + default: + cls = ErrUnknown + } + + msg := rebaseMessage(cls, err) + if msg != "" { + err = errors.Wrap(cls, msg) + } else { + err = errors.WithStack(cls) + } + + return err +} + +// rebaseMessage removes the repeats for an error at the end of an error +// string. This will happen when taking an error over grpc then remapping it. +// +// Effectively, we just remove the string of cls from the end of err if it +// appears there. +func rebaseMessage(cls error, err error) string { + desc := errDesc(err) + clss := cls.Error() + if desc == clss { + return "" + } + + return strings.TrimSuffix(desc, ": "+clss) +} + +func isGRPCError(err error) bool { + _, ok := status.FromError(err) + return ok +} + +func code(err error) codes.Code { + if s, ok := status.FromError(err); ok { + return s.Code() + } + return codes.Unknown +} + +func errDesc(err error) string { + if s, ok := status.FromError(err); ok { + return s.Message() + } + return err.Error() +} diff --git a/vendor/github.com/containerd/containerd/log/context.go b/vendor/github.com/containerd/containerd/log/context.go index 3fab96b8..31f1a3ac 100644 --- a/vendor/github.com/containerd/containerd/log/context.go +++ b/vendor/github.com/containerd/containerd/log/context.go @@ -30,7 +30,7 @@ var ( // messages. G = GetLogger - // L is an alias for the the standard logger. + // L is an alias for the standard logger. L = logrus.NewEntry(logrus.StandardLogger()) ) diff --git a/vendor/github.com/containerd/containerd/sys/filesys_unix.go b/vendor/github.com/containerd/containerd/sys/filesys_unix.go index 700f44ef..d8329af9 100644 --- a/vendor/github.com/containerd/containerd/sys/filesys_unix.go +++ b/vendor/github.com/containerd/containerd/sys/filesys_unix.go @@ -24,3 +24,8 @@ import "os" func ForceRemoveAll(path string) error { return os.RemoveAll(path) } + +// MkdirAllWithACL is a wrapper for os.MkdirAll on Unix systems. +func MkdirAllWithACL(path string, perm os.FileMode) error { + return os.MkdirAll(path, perm) +} diff --git a/vendor/github.com/containerd/containerd/sys/filesys_windows.go b/vendor/github.com/containerd/containerd/sys/filesys_windows.go index dc880c34..1bdc5317 100644 --- a/vendor/github.com/containerd/containerd/sys/filesys_windows.go +++ b/vendor/github.com/containerd/containerd/sys/filesys_windows.go @@ -30,6 +30,11 @@ import ( "github.com/Microsoft/hcsshim" ) +const ( + // SddlAdministratorsLocalSystem is local administrators plus NT AUTHORITY\System + SddlAdministratorsLocalSystem = "D:P(A;OICI;GA;;;BA)(A;OICI;GA;;;SY)" +) + // MkdirAllWithACL is a wrapper for MkdirAll that creates a directory // ACL'd for Builtin Administrators and Local System. func MkdirAllWithACL(path string, perm os.FileMode) error { @@ -78,7 +83,7 @@ func mkdirall(path string, adminAndLocalSystem bool) error { if j > 1 { // Create parent - err = mkdirall(path[0:j-1], false) + err = mkdirall(path[0:j-1], adminAndLocalSystem) if err != nil { return err } @@ -112,8 +117,7 @@ func mkdirall(path string, adminAndLocalSystem bool) error { // and Local System. func mkdirWithACL(name string) error { sa := syscall.SecurityAttributes{Length: 0} - sddl := "D:P(A;OICI;GA;;;BA)(A;OICI;GA;;;SY)" - sd, err := winio.SddlToSecurityDescriptor(sddl) + sd, err := winio.SddlToSecurityDescriptor(SddlAdministratorsLocalSystem) if err != nil { return &os.PathError{Op: "mkdir", Path: name, Err: err} } diff --git a/vendor/github.com/containerd/containerd/sys/oom_unix.go b/vendor/github.com/containerd/containerd/sys/oom_unix.go index 7192efec..54412e9c 100644 --- a/vendor/github.com/containerd/containerd/sys/oom_unix.go +++ b/vendor/github.com/containerd/containerd/sys/oom_unix.go @@ -20,8 +20,10 @@ package sys import ( "fmt" + "io/ioutil" "os" "strconv" + "strings" "github.com/opencontainers/runc/libcontainer/system" ) @@ -45,3 +47,13 @@ func SetOOMScore(pid, score int) error { } return nil } + +// GetOOMScoreAdj gets the oom score for a process +func GetOOMScoreAdj(pid int) (int, error) { + path := fmt.Sprintf("/proc/%d/oom_score_adj", pid) + data, err := ioutil.ReadFile(path) + if err != nil { + return 0, err + } + return strconv.Atoi(strings.TrimSpace(string(data))) +} diff --git a/vendor/github.com/containerd/containerd/sys/oom_windows.go b/vendor/github.com/containerd/containerd/sys/oom_windows.go index f44bcebd..a917ba63 100644 --- a/vendor/github.com/containerd/containerd/sys/oom_windows.go +++ b/vendor/github.com/containerd/containerd/sys/oom_windows.go @@ -22,3 +22,10 @@ package sys func SetOOMScore(pid, score int) error { return nil } + +// GetOOMScoreAdj gets the oom score for a process +// +// Not implemented on Windows +func GetOOMScoreAdj(pid int) (int, error) { + return 0, nil +} diff --git a/vendor/github.com/containerd/continuity/fs/copy.go b/vendor/github.com/containerd/continuity/fs/copy.go index ad61022a..818bba2c 100644 --- a/vendor/github.com/containerd/continuity/fs/copy.go +++ b/vendor/github.com/containerd/continuity/fs/copy.go @@ -80,7 +80,7 @@ func copyDirectory(dst, src string, inodes map[uint64]string, o *copyDirOpts) er return errors.Wrapf(err, "failed to stat %s", src) } if !stat.IsDir() { - return errors.Errorf("source is not directory") + return errors.Errorf("source %s is not directory", src) } if st, err := os.Stat(dst); err != nil { @@ -104,6 +104,10 @@ func copyDirectory(dst, src string, inodes map[uint64]string, o *copyDirOpts) er return errors.Wrapf(err, "failed to copy file info for %s", dst) } + if err := copyXAttrs(dst, src, o.xeh); err != nil { + return errors.Wrap(err, "failed to copy xattrs") + } + for _, fi := range fis { source := filepath.Join(src, fi.Name()) target := filepath.Join(dst, fi.Name()) diff --git a/vendor/github.com/containerd/continuity/fs/copy_linux.go b/vendor/github.com/containerd/continuity/fs/copy_linux.go index 81c71522..72bae7d4 100644 --- a/vendor/github.com/containerd/continuity/fs/copy_linux.go +++ b/vendor/github.com/containerd/continuity/fs/copy_linux.go @@ -51,7 +51,10 @@ func copyFileInfo(fi os.FileInfo, name string) error { } } - timespec := []unix.Timespec{unix.Timespec(StatAtime(st)), unix.Timespec(StatMtime(st))} + timespec := []unix.Timespec{ + unix.NsecToTimespec(syscall.TimespecToNsec(StatAtime(st))), + unix.NsecToTimespec(syscall.TimespecToNsec(StatMtime(st))), + } if err := unix.UtimesNanoAt(unix.AT_FDCWD, name, timespec, unix.AT_SYMLINK_NOFOLLOW); err != nil { return errors.Wrapf(err, "failed to utime %s", name) } diff --git a/vendor/github.com/containerd/continuity/fs/copy_unix.go b/vendor/github.com/containerd/continuity/fs/copy_unix.go index 73c01a46..a5de8926 100644 --- a/vendor/github.com/containerd/continuity/fs/copy_unix.go +++ b/vendor/github.com/containerd/continuity/fs/copy_unix.go @@ -1,4 +1,4 @@ -// +build solaris darwin freebsd +// +build darwin freebsd openbsd solaris /* Copyright The containerd Authors. diff --git a/vendor/github.com/containerd/continuity/fs/path.go b/vendor/github.com/containerd/continuity/fs/path.go index 99598178..8863caa9 100644 --- a/vendor/github.com/containerd/continuity/fs/path.go +++ b/vendor/github.com/containerd/continuity/fs/path.go @@ -22,7 +22,6 @@ import ( "io" "os" "path/filepath" - "strings" "github.com/pkg/errors" ) @@ -47,9 +46,8 @@ func pathChange(lower, upper *currentPath) (ChangeKind, string) { if upper == nil { return ChangeKindDelete, lower.path } - // TODO: compare by directory - switch i := strings.Compare(lower.path, upper.path); { + switch i := directoryCompare(lower.path, upper.path); { case i < 0: // File in lower that is not in upper return ChangeKindDelete, lower.path @@ -61,6 +59,35 @@ func pathChange(lower, upper *currentPath) (ChangeKind, string) { } } +func directoryCompare(a, b string) int { + l := len(a) + if len(b) < l { + l = len(b) + } + for i := 0; i < l; i++ { + c1, c2 := a[i], b[i] + if c1 == filepath.Separator { + c1 = byte(0) + } + if c2 == filepath.Separator { + c2 = byte(0) + } + if c1 < c2 { + return -1 + } + if c1 > c2 { + return +1 + } + } + if len(a) < len(b) { + return -1 + } + if len(a) > len(b) { + return +1 + } + return 0 +} + func sameFile(f1, f2 *currentPath) (bool, error) { if os.SameFile(f1.f, f2.f) { return true, nil diff --git a/vendor/github.com/containerd/continuity/fs/stat_bsd.go b/vendor/github.com/containerd/continuity/fs/stat_darwinfreebsd.go similarity index 100% rename from vendor/github.com/containerd/continuity/fs/stat_bsd.go rename to vendor/github.com/containerd/continuity/fs/stat_darwinfreebsd.go diff --git a/vendor/github.com/containerd/continuity/fs/stat_linux.go b/vendor/github.com/containerd/continuity/fs/stat_linuxopenbsd.go similarity index 97% rename from vendor/github.com/containerd/continuity/fs/stat_linux.go rename to vendor/github.com/containerd/continuity/fs/stat_linuxopenbsd.go index 4a678dd1..c68df6e5 100644 --- a/vendor/github.com/containerd/continuity/fs/stat_linux.go +++ b/vendor/github.com/containerd/continuity/fs/stat_linuxopenbsd.go @@ -1,3 +1,5 @@ +// +build linux openbsd + /* Copyright The containerd Authors. diff --git a/vendor/github.com/containerd/continuity/pathdriver/path_driver.go b/vendor/github.com/containerd/continuity/pathdriver/path_driver.go deleted file mode 100644 index b0d5a6b5..00000000 --- a/vendor/github.com/containerd/continuity/pathdriver/path_driver.go +++ /dev/null @@ -1,101 +0,0 @@ -/* - Copyright The containerd Authors. - - Licensed under the Apache License, Version 2.0 (the "License"); - you may not use this file except in compliance with the License. - You may obtain a copy of the License at - - http://www.apache.org/licenses/LICENSE-2.0 - - Unless required by applicable law or agreed to in writing, software - distributed under the License is distributed on an "AS IS" BASIS, - WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. - See the License for the specific language governing permissions and - limitations under the License. -*/ - -package pathdriver - -import ( - "path/filepath" -) - -// PathDriver provides all of the path manipulation functions in a common -// interface. The context should call these and never use the `filepath` -// package or any other package to manipulate paths. -type PathDriver interface { - Join(paths ...string) string - IsAbs(path string) bool - Rel(base, target string) (string, error) - Base(path string) string - Dir(path string) string - Clean(path string) string - Split(path string) (dir, file string) - Separator() byte - Abs(path string) (string, error) - Walk(string, filepath.WalkFunc) error - FromSlash(path string) string - ToSlash(path string) string - Match(pattern, name string) (matched bool, err error) -} - -// pathDriver is a simple default implementation calls the filepath package. -type pathDriver struct{} - -// LocalPathDriver is the exported pathDriver struct for convenience. -var LocalPathDriver PathDriver = &pathDriver{} - -func (*pathDriver) Join(paths ...string) string { - return filepath.Join(paths...) -} - -func (*pathDriver) IsAbs(path string) bool { - return filepath.IsAbs(path) -} - -func (*pathDriver) Rel(base, target string) (string, error) { - return filepath.Rel(base, target) -} - -func (*pathDriver) Base(path string) string { - return filepath.Base(path) -} - -func (*pathDriver) Dir(path string) string { - return filepath.Dir(path) -} - -func (*pathDriver) Clean(path string) string { - return filepath.Clean(path) -} - -func (*pathDriver) Split(path string) (dir, file string) { - return filepath.Split(path) -} - -func (*pathDriver) Separator() byte { - return filepath.Separator -} - -func (*pathDriver) Abs(path string) (string, error) { - return filepath.Abs(path) -} - -// Note that filepath.Walk calls os.Stat, so if the context wants to -// to call Driver.Stat() for Walk, they need to create a new struct that -// overrides this method. -func (*pathDriver) Walk(root string, walkFn filepath.WalkFunc) error { - return filepath.Walk(root, walkFn) -} - -func (*pathDriver) FromSlash(path string) string { - return filepath.FromSlash(path) -} - -func (*pathDriver) ToSlash(path string) string { - return filepath.ToSlash(path) -} - -func (*pathDriver) Match(pattern, name string) (bool, error) { - return filepath.Match(pattern, name) -} diff --git a/vendor/github.com/containerd/continuity/sysx/nodata_unix.go b/vendor/github.com/containerd/continuity/sysx/nodata_unix.go index b26f5b3d..de4b3d50 100644 --- a/vendor/github.com/containerd/continuity/sysx/nodata_unix.go +++ b/vendor/github.com/containerd/continuity/sysx/nodata_unix.go @@ -1,4 +1,4 @@ -// +build darwin freebsd +// +build darwin freebsd openbsd /* Copyright The containerd Authors. diff --git a/vendor/github.com/containerd/continuity/sysx/xattr.go b/vendor/github.com/containerd/continuity/sysx/xattr.go index 9e4326dc..db6fe70f 100644 --- a/vendor/github.com/containerd/continuity/sysx/xattr.go +++ b/vendor/github.com/containerd/continuity/sysx/xattr.go @@ -20,7 +20,6 @@ package sysx import ( "bytes" - "syscall" "golang.org/x/sys/unix" ) @@ -66,60 +65,53 @@ func LGetxattr(path, attr string) ([]byte, error) { return getxattrAll(path, attr, unix.Lgetxattr) } -const defaultXattrBufferSize = 5 +const defaultXattrBufferSize = 128 type listxattrFunc func(path string, dest []byte) (int, error) func listxattrAll(path string, listFunc listxattrFunc) ([]string, error) { - var p []byte // nil on first execution - - for { - n, err := listFunc(path, p) // first call gets buffer size. + buf := make([]byte, defaultXattrBufferSize) + n, err := listFunc(path, buf) + for err == unix.ERANGE { + // Buffer too small, use zero-sized buffer to get the actual size + n, err = listFunc(path, []byte{}) if err != nil { return nil, err } - - if n > len(p) { - p = make([]byte, n) - continue - } - - p = p[:n] - - ps := bytes.Split(bytes.TrimSuffix(p, []byte{0}), []byte{0}) - var entries []string - for _, p := range ps { - s := string(p) - if s != "" { - entries = append(entries, s) - } - } - - return entries, nil + buf = make([]byte, n) + n, err = listFunc(path, buf) } + if err != nil { + return nil, err + } + + ps := bytes.Split(bytes.TrimSuffix(buf[:n], []byte{0}), []byte{0}) + var entries []string + for _, p := range ps { + if len(p) > 0 { + entries = append(entries, string(p)) + } + } + + return entries, nil } type getxattrFunc func(string, string, []byte) (int, error) func getxattrAll(path, attr string, getFunc getxattrFunc) ([]byte, error) { - p := make([]byte, defaultXattrBufferSize) - for { - n, err := getFunc(path, attr, p) + buf := make([]byte, defaultXattrBufferSize) + n, err := getFunc(path, attr, buf) + for err == unix.ERANGE { + // Buffer too small, use zero-sized buffer to get the actual size + n, err = getFunc(path, attr, []byte{}) if err != nil { - if errno, ok := err.(syscall.Errno); ok && errno == syscall.ERANGE { - p = make([]byte, len(p)*2) // this can't be ideal. - continue // try again! - } - return nil, err } - - // realloc to correct size and repeat - if n > len(p) { - p = make([]byte, n) - continue - } - - return p[:n], nil + buf = make([]byte, n) + n, err = getFunc(path, attr, buf) } + if err != nil { + return nil, err + } + return buf[:n], nil } diff --git a/vendor/github.com/docker/distribution/Dockerfile b/vendor/github.com/docker/distribution/Dockerfile index 612e62ce..9537817c 100644 --- a/vendor/github.com/docker/distribution/Dockerfile +++ b/vendor/github.com/docker/distribution/Dockerfile @@ -1,7 +1,7 @@ FROM golang:1.11-alpine AS build ENV DISTRIBUTION_DIR /go/src/github.com/docker/distribution -ENV DOCKER_BUILDTAGS include_oss include_gcs +ENV BUILDTAGS include_oss include_gcs ARG GOOS=linux ARG GOARCH=amd64 diff --git a/vendor/github.com/docker/distribution/registry/api/errcode/errors.go b/vendor/github.com/docker/distribution/registry/api/errcode/errors.go new file mode 100644 index 00000000..6d9bb4b6 --- /dev/null +++ b/vendor/github.com/docker/distribution/registry/api/errcode/errors.go @@ -0,0 +1,267 @@ +package errcode + +import ( + "encoding/json" + "fmt" + "strings" +) + +// ErrorCoder is the base interface for ErrorCode and Error allowing +// users of each to just call ErrorCode to get the real ID of each +type ErrorCoder interface { + ErrorCode() ErrorCode +} + +// ErrorCode represents the error type. The errors are serialized via strings +// and the integer format may change and should *never* be exported. +type ErrorCode int + +var _ error = ErrorCode(0) + +// ErrorCode just returns itself +func (ec ErrorCode) ErrorCode() ErrorCode { + return ec +} + +// Error returns the ID/Value +func (ec ErrorCode) Error() string { + // NOTE(stevvooe): Cannot use message here since it may have unpopulated args. + return strings.ToLower(strings.Replace(ec.String(), "_", " ", -1)) +} + +// Descriptor returns the descriptor for the error code. +func (ec ErrorCode) Descriptor() ErrorDescriptor { + d, ok := errorCodeToDescriptors[ec] + + if !ok { + return ErrorCodeUnknown.Descriptor() + } + + return d +} + +// String returns the canonical identifier for this error code. +func (ec ErrorCode) String() string { + return ec.Descriptor().Value +} + +// Message returned the human-readable error message for this error code. +func (ec ErrorCode) Message() string { + return ec.Descriptor().Message +} + +// MarshalText encodes the receiver into UTF-8-encoded text and returns the +// result. +func (ec ErrorCode) MarshalText() (text []byte, err error) { + return []byte(ec.String()), nil +} + +// UnmarshalText decodes the form generated by MarshalText. +func (ec *ErrorCode) UnmarshalText(text []byte) error { + desc, ok := idToDescriptors[string(text)] + + if !ok { + desc = ErrorCodeUnknown.Descriptor() + } + + *ec = desc.Code + + return nil +} + +// WithMessage creates a new Error struct based on the passed-in info and +// overrides the Message property. +func (ec ErrorCode) WithMessage(message string) Error { + return Error{ + Code: ec, + Message: message, + } +} + +// WithDetail creates a new Error struct based on the passed-in info and +// set the Detail property appropriately +func (ec ErrorCode) WithDetail(detail interface{}) Error { + return Error{ + Code: ec, + Message: ec.Message(), + }.WithDetail(detail) +} + +// WithArgs creates a new Error struct and sets the Args slice +func (ec ErrorCode) WithArgs(args ...interface{}) Error { + return Error{ + Code: ec, + Message: ec.Message(), + }.WithArgs(args...) +} + +// Error provides a wrapper around ErrorCode with extra Details provided. +type Error struct { + Code ErrorCode `json:"code"` + Message string `json:"message"` + Detail interface{} `json:"detail,omitempty"` + + // TODO(duglin): See if we need an "args" property so we can do the + // variable substitution right before showing the message to the user +} + +var _ error = Error{} + +// ErrorCode returns the ID/Value of this Error +func (e Error) ErrorCode() ErrorCode { + return e.Code +} + +// Error returns a human readable representation of the error. +func (e Error) Error() string { + return fmt.Sprintf("%s: %s", e.Code.Error(), e.Message) +} + +// WithDetail will return a new Error, based on the current one, but with +// some Detail info added +func (e Error) WithDetail(detail interface{}) Error { + return Error{ + Code: e.Code, + Message: e.Message, + Detail: detail, + } +} + +// WithArgs uses the passed-in list of interface{} as the substitution +// variables in the Error's Message string, but returns a new Error +func (e Error) WithArgs(args ...interface{}) Error { + return Error{ + Code: e.Code, + Message: fmt.Sprintf(e.Code.Message(), args...), + Detail: e.Detail, + } +} + +// ErrorDescriptor provides relevant information about a given error code. +type ErrorDescriptor struct { + // Code is the error code that this descriptor describes. + Code ErrorCode + + // Value provides a unique, string key, often captilized with + // underscores, to identify the error code. This value is used as the + // keyed value when serializing api errors. + Value string + + // Message is a short, human readable decription of the error condition + // included in API responses. + Message string + + // Description provides a complete account of the errors purpose, suitable + // for use in documentation. + Description string + + // HTTPStatusCode provides the http status code that is associated with + // this error condition. + HTTPStatusCode int +} + +// ParseErrorCode returns the value by the string error code. +// `ErrorCodeUnknown` will be returned if the error is not known. +func ParseErrorCode(value string) ErrorCode { + ed, ok := idToDescriptors[value] + if ok { + return ed.Code + } + + return ErrorCodeUnknown +} + +// Errors provides the envelope for multiple errors and a few sugar methods +// for use within the application. +type Errors []error + +var _ error = Errors{} + +func (errs Errors) Error() string { + switch len(errs) { + case 0: + return "" + case 1: + return errs[0].Error() + default: + msg := "errors:\n" + for _, err := range errs { + msg += err.Error() + "\n" + } + return msg + } +} + +// Len returns the current number of errors. +func (errs Errors) Len() int { + return len(errs) +} + +// MarshalJSON converts slice of error, ErrorCode or Error into a +// slice of Error - then serializes +func (errs Errors) MarshalJSON() ([]byte, error) { + var tmpErrs struct { + Errors []Error `json:"errors,omitempty"` + } + + for _, daErr := range errs { + var err Error + + switch daErr.(type) { + case ErrorCode: + err = daErr.(ErrorCode).WithDetail(nil) + case Error: + err = daErr.(Error) + default: + err = ErrorCodeUnknown.WithDetail(daErr) + + } + + // If the Error struct was setup and they forgot to set the + // Message field (meaning its "") then grab it from the ErrCode + msg := err.Message + if msg == "" { + msg = err.Code.Message() + } + + tmpErrs.Errors = append(tmpErrs.Errors, Error{ + Code: err.Code, + Message: msg, + Detail: err.Detail, + }) + } + + return json.Marshal(tmpErrs) +} + +// UnmarshalJSON deserializes []Error and then converts it into slice of +// Error or ErrorCode +func (errs *Errors) UnmarshalJSON(data []byte) error { + var tmpErrs struct { + Errors []Error + } + + if err := json.Unmarshal(data, &tmpErrs); err != nil { + return err + } + + var newErrs Errors + for _, daErr := range tmpErrs.Errors { + // If Message is empty or exactly matches the Code's message string + // then just use the Code, no need for a full Error struct + if daErr.Detail == nil && (daErr.Message == "" || daErr.Message == daErr.Code.Message()) { + // Error's w/o details get converted to ErrorCode + newErrs = append(newErrs, daErr.Code) + } else { + // Error's w/ details are untouched + newErrs = append(newErrs, Error{ + Code: daErr.Code, + Message: daErr.Message, + Detail: daErr.Detail, + }) + } + } + + *errs = newErrs + return nil +} diff --git a/vendor/github.com/docker/distribution/registry/api/errcode/handler.go b/vendor/github.com/docker/distribution/registry/api/errcode/handler.go new file mode 100644 index 00000000..d77e7047 --- /dev/null +++ b/vendor/github.com/docker/distribution/registry/api/errcode/handler.go @@ -0,0 +1,40 @@ +package errcode + +import ( + "encoding/json" + "net/http" +) + +// ServeJSON attempts to serve the errcode in a JSON envelope. It marshals err +// and sets the content-type header to 'application/json'. It will handle +// ErrorCoder and Errors, and if necessary will create an envelope. +func ServeJSON(w http.ResponseWriter, err error) error { + w.Header().Set("Content-Type", "application/json; charset=utf-8") + var sc int + + switch errs := err.(type) { + case Errors: + if len(errs) < 1 { + break + } + + if err, ok := errs[0].(ErrorCoder); ok { + sc = err.ErrorCode().Descriptor().HTTPStatusCode + } + case ErrorCoder: + sc = errs.ErrorCode().Descriptor().HTTPStatusCode + err = Errors{err} // create an envelope. + default: + // We just have an unhandled error type, so just place in an envelope + // and move along. + err = Errors{err} + } + + if sc == 0 { + sc = http.StatusInternalServerError + } + + w.WriteHeader(sc) + + return json.NewEncoder(w).Encode(err) +} diff --git a/vendor/github.com/docker/distribution/registry/api/errcode/register.go b/vendor/github.com/docker/distribution/registry/api/errcode/register.go new file mode 100644 index 00000000..d1e8826c --- /dev/null +++ b/vendor/github.com/docker/distribution/registry/api/errcode/register.go @@ -0,0 +1,138 @@ +package errcode + +import ( + "fmt" + "net/http" + "sort" + "sync" +) + +var ( + errorCodeToDescriptors = map[ErrorCode]ErrorDescriptor{} + idToDescriptors = map[string]ErrorDescriptor{} + groupToDescriptors = map[string][]ErrorDescriptor{} +) + +var ( + // ErrorCodeUnknown is a generic error that can be used as a last + // resort if there is no situation-specific error message that can be used + ErrorCodeUnknown = Register("errcode", ErrorDescriptor{ + Value: "UNKNOWN", + Message: "unknown error", + Description: `Generic error returned when the error does not have an + API classification.`, + HTTPStatusCode: http.StatusInternalServerError, + }) + + // ErrorCodeUnsupported is returned when an operation is not supported. + ErrorCodeUnsupported = Register("errcode", ErrorDescriptor{ + Value: "UNSUPPORTED", + Message: "The operation is unsupported.", + Description: `The operation was unsupported due to a missing + implementation or invalid set of parameters.`, + HTTPStatusCode: http.StatusMethodNotAllowed, + }) + + // ErrorCodeUnauthorized is returned if a request requires + // authentication. + ErrorCodeUnauthorized = Register("errcode", ErrorDescriptor{ + Value: "UNAUTHORIZED", + Message: "authentication required", + Description: `The access controller was unable to authenticate + the client. Often this will be accompanied by a + Www-Authenticate HTTP response header indicating how to + authenticate.`, + HTTPStatusCode: http.StatusUnauthorized, + }) + + // ErrorCodeDenied is returned if a client does not have sufficient + // permission to perform an action. + ErrorCodeDenied = Register("errcode", ErrorDescriptor{ + Value: "DENIED", + Message: "requested access to the resource is denied", + Description: `The access controller denied access for the + operation on a resource.`, + HTTPStatusCode: http.StatusForbidden, + }) + + // ErrorCodeUnavailable provides a common error to report unavailability + // of a service or endpoint. + ErrorCodeUnavailable = Register("errcode", ErrorDescriptor{ + Value: "UNAVAILABLE", + Message: "service unavailable", + Description: "Returned when a service is not available", + HTTPStatusCode: http.StatusServiceUnavailable, + }) + + // ErrorCodeTooManyRequests is returned if a client attempts too many + // times to contact a service endpoint. + ErrorCodeTooManyRequests = Register("errcode", ErrorDescriptor{ + Value: "TOOMANYREQUESTS", + Message: "too many requests", + Description: `Returned when a client attempts to contact a + service too many times`, + HTTPStatusCode: http.StatusTooManyRequests, + }) +) + +var nextCode = 1000 +var registerLock sync.Mutex + +// Register will make the passed-in error known to the environment and +// return a new ErrorCode +func Register(group string, descriptor ErrorDescriptor) ErrorCode { + registerLock.Lock() + defer registerLock.Unlock() + + descriptor.Code = ErrorCode(nextCode) + + if _, ok := idToDescriptors[descriptor.Value]; ok { + panic(fmt.Sprintf("ErrorValue %q is already registered", descriptor.Value)) + } + if _, ok := errorCodeToDescriptors[descriptor.Code]; ok { + panic(fmt.Sprintf("ErrorCode %v is already registered", descriptor.Code)) + } + + groupToDescriptors[group] = append(groupToDescriptors[group], descriptor) + errorCodeToDescriptors[descriptor.Code] = descriptor + idToDescriptors[descriptor.Value] = descriptor + + nextCode++ + return descriptor.Code +} + +type byValue []ErrorDescriptor + +func (a byValue) Len() int { return len(a) } +func (a byValue) Swap(i, j int) { a[i], a[j] = a[j], a[i] } +func (a byValue) Less(i, j int) bool { return a[i].Value < a[j].Value } + +// GetGroupNames returns the list of Error group names that are registered +func GetGroupNames() []string { + keys := []string{} + + for k := range groupToDescriptors { + keys = append(keys, k) + } + sort.Strings(keys) + return keys +} + +// GetErrorCodeGroup returns the named group of error descriptors +func GetErrorCodeGroup(name string) []ErrorDescriptor { + desc := groupToDescriptors[name] + sort.Sort(byValue(desc)) + return desc +} + +// GetErrorAllDescriptors returns a slice of all ErrorDescriptors that are +// registered, irrespective of what group they're in +func GetErrorAllDescriptors() []ErrorDescriptor { + result := []ErrorDescriptor{} + + for _, group := range GetGroupNames() { + result = append(result, GetErrorCodeGroup(group)...) + } + sort.Sort(byValue(result)) + return result +} diff --git a/vendor/github.com/docker/docker/AUTHORS b/vendor/github.com/docker/docker/AUTHORS index 46102d74..ad166ba8 100644 --- a/vendor/github.com/docker/docker/AUTHORS +++ b/vendor/github.com/docker/docker/AUTHORS @@ -4,6 +4,7 @@ Aanand Prasad Aaron Davidson Aaron Feng +Aaron Hnatiw Aaron Huslage Aaron L. Xu Aaron Lehmann @@ -17,6 +18,7 @@ Abhishek Chanda Abhishek Sharma Abin Shahab Adam Avilla +Adam Dobrawy Adam Eijdenberg Adam Kunk Adam Miller @@ -44,7 +46,7 @@ Ajey Charantimath ajneu Akash Gupta Akihiro Matsushima -Akihiro Suda +Akihiro Suda Akim Demaille Akira Koyasu Akshay Karle @@ -81,6 +83,7 @@ Alexandre Garnier Alexandre González Alexandre Jomin Alexandru Sfirlogea +Alexei Margasov Alexey Guskov Alexey Kotlyarov Alexey Shamrin @@ -111,6 +114,7 @@ Anda Xu Anders Janmyr Andre Dublin <81dublin@gmail.com> Andre Granovsky +Andrea Denisse Gómez Andrea Luzzardi Andrea Turli Andreas Elvers @@ -118,6 +122,7 @@ Andreas Köhler Andreas Savvides Andreas Tiefenthaler Andrei Gherzan +Andrei Vagin Andrew C. Bodine Andrew Clay Shafer Andrew Duckworth @@ -137,6 +142,7 @@ Andrew Po Andrew Weiss Andrew Williams Andrews Medina +Andrey Kolomentsev Andrey Petrov Andrey Stolbovsky André Martins @@ -151,6 +157,7 @@ Andy Wilson Anes Hasicic Anil Belur Anil Madhavapeddy +Ankit Jain Ankush Agarwal Anonmily Anran Qiao @@ -172,8 +179,10 @@ Anusha Ragunathan apocas Arash Deshmeh ArikaChen +Arko Dasgupta Arnaud Lefebvre Arnaud Porterie +Arnaud Rebillout Arthur Barr Arthur Gautier Artur Meyster @@ -182,6 +191,7 @@ Asad Saeeduddin Asbjørn Enge averagehuman Avi Das +Avi Kivity Avi Miller Avi Vaid ayoshitake @@ -195,23 +205,27 @@ bdevloed Ben Bonnefoy Ben Firshman Ben Golub +Ben Gould Ben Hall Ben Sargent Ben Severson Ben Toews Ben Wiklund Benjamin Atkin +Benjamin Baker Benjamin Boudreau Benjamin Yolken Benoit Chesneau Bernerd Schaefer Bernhard M. Wiedemann Bert Goethals +Bevisy Zhang Bharath Thiruveedula Bhiraj Butala Bhumika Bayani Bilal Amarni Bill Wang +Bily Zhang Bin Liu Bingshen Wang Blake Geno @@ -246,6 +260,7 @@ Brian Torres-Gil Brian Trump Brice Jaglin Briehan Lombaard +Brielle Broder Bruno Bigras Bruno Binet Bruno Gazzera @@ -269,6 +284,7 @@ Carl Loa Odin Carl X. Su Carlo Mion Carlos Alexandro Becker +Carlos de Paula Carlos Sanchez Carol Fager-Higgins Cary @@ -300,6 +316,7 @@ Chen Min Chen Mingjie Chen Qiu Cheng-mean Liu +Chengfei Shang Chengguang Xu chenyuzhu Chetan Birajdar @@ -317,6 +334,7 @@ Chris Gibson Chris Khoo Chris McKinnel Chris McKinnel +Chris Price Chris Seto Chris Snow Chris St. Pierre @@ -325,9 +343,11 @@ Chris Swan Chris Telfer Chris Wahl Chris Weyl +Chris White Christian Berendt Christian Brauner Christian Böhme +Christian Muehlhaeuser Christian Persson Christian Rotzoll Christian Simon @@ -350,6 +370,7 @@ Cody Roseborough Coenraad Loubser Colin Dunklau Colin Hebert +Colin Panisset Colin Rice Colin Walters Collin Guarino @@ -385,6 +406,7 @@ Dan Levy Dan McPherson Dan Stine Dan Williams +Dani Hodovic Dani Louca Daniel Antlinger Daniel Dao @@ -402,12 +424,14 @@ Daniel Norberg Daniel Nordberg Daniel Robinson Daniel S +Daniel Sweet Daniel Von Fange Daniel Watkins Daniel X Moore Daniel YC Lin Daniel Zhang Danny Berger +Danny Milosavljevic Danny Yates Danyal Khaliq Darren Coxall @@ -438,12 +462,14 @@ David Mackey David Mat David Mcanulty David McKay +David P Hilton David Pelaez David R. Jenni David Röthlisberger David Sheets David Sissitka David Trott +David Wang <00107082@163.com> David Williamson David Xia David Young @@ -451,8 +477,10 @@ Davide Ceretti Dawn Chen dbdd dcylabs +Debayan De Deborah Gertrude Digges deed02392 +Deep Debroy Deng Guangxing Deni Bertovic Denis Defreyne @@ -477,6 +505,7 @@ Dieter Reuter Dillon Dixon Dima Stopel Dimitri John Ledkov +Dimitris Mandalidis Dimitris Rozakis Dimitry Andric Dinesh Subhraveti @@ -490,11 +519,14 @@ Dmitri Shuralyov Dmitry Demeshchuk Dmitry Gusev Dmitry Kononenko +Dmitry Sharshakov Dmitry Shyshkin Dmitry Smirnov Dmitry V. Krivenok Dmitry Vorobev Dolph Mathews +Dominic Tubach +Dominic Yin Dominik Dingel Dominik Finkbeiner Dominik Honnef @@ -503,6 +535,7 @@ Don Kjer Don Spaulding Donald Huang Dong Chen +Donghwa Kim Donovan Jones Doron Podoleanu Doug Davis @@ -562,6 +595,7 @@ Erik Weathers Erno Hopearuoho Erwin van der Koogh Ethan Bell +Ethan Mosbaugh Euan Kemp Eugen Krizo Eugene Yakubovich @@ -579,7 +613,9 @@ Ewa Czechowska Eystein Måløy Stenberg ezbercih Ezra Silvera +Fabian Kramm Fabian Lauer +Fabian Raetz Fabiano Rosas Fabio Falci Fabio Kung @@ -591,10 +627,12 @@ Faiz Khan falmp Fangming Fang Fangyuan Gao <21551127@zju.edu.cn> +fanjiyun Fareed Dudhia Fathi Boudra Federico Gimenez Felipe Oliveira +Felipe Ruhland Felix Abecassis Felix Geisendörfer Felix Hupfeld @@ -621,6 +659,7 @@ Florin Patan fonglh Foysal Iqbal Francesc Campoy +Francesco Mari Francis Chuang Francisco Carriedo Francisco Souza @@ -628,12 +667,14 @@ Frank Groeneveld Frank Herrmann Frank Macreery Frank Rosquin +frankyang Fred Lifton Frederick F. Kautz IV Frederik Loeffert Frederik Nordahl Jul Sabroe Freek Kalter Frieder Bluemle +Fu JinLin Félix Baylac-Jacqué Félix Cantournet Gabe Rosenhouse @@ -653,6 +694,7 @@ Gaël PORTAY Genki Takiuchi GennadySpb Geoffrey Bachelet +Geon Kim George Kontridze George MacRorie George Xie @@ -665,6 +707,7 @@ Ghislain Bourgeois Giampaolo Mancini Gianluca Borello Gildas Cuisinier +Giovan Isa Musthofa gissehel Giuseppe Mazzotta Gleb Fotengauer-Malinovskiy @@ -672,10 +715,12 @@ Gleb M Borisov Glyn Normington GoBella Goffert van Gool +Goldwyn Rodrigues Gopikannan Venugopalsamy Gosuke Miyashita Gou Rao Govinda Fichtner +Grant Millar Grant Reaber Graydon Hoare Greg Fausak @@ -694,14 +739,19 @@ Guruprasad Gustav Sinder gwx296173 Günter Zöchbauer +Haichao Yang +haikuoliu Hakan Özler +Hamish Hutchings Hans Kristian Flaatten Hans Rødtang Hao Shu Wei Hao Zhang <21521210@zju.edu.cn> Harald Albers +Harald Niesche Harley Laue Harold Cooper +Harrison Turton Harry Zhang Harshal Patil Harshal Patil @@ -713,13 +763,16 @@ Hector Castro Helen Xie Henning Sprang Hiroshi Hatake +Hiroyuki Sasagawa Hobofan Hollie Teal Hong Xu Hongbin Lu +Hongxu Jia hsinko <21551195@zju.edu.cn> Hu Keping Hu Tao +HuanHuan Ye Huanzhong Zhang Huayi Zhang Hugo Duncan @@ -735,6 +788,7 @@ Ian Bishop Ian Bull Ian Calvert Ian Campbell +Ian Chen Ian Lee Ian Main Ian Philpot @@ -752,9 +806,11 @@ Ilya Khlopotov imre Fitos inglesp Ingo Gottwald +Innovimax Isaac Dupree Isabel Jimenez Isao Jonas +Iskander Sharipov Ivan Babrou Ivan Fraixedes Ivan Grcic @@ -785,6 +841,7 @@ James Mills James Nesbitt James Nugent James Turnbull +James Watkins-Harvey Jamie Hannaford Jamshid Afshar Jan Keromnes @@ -817,6 +874,7 @@ jaxgeller Jay Jay Jay Kamat +Jean Rouge Jean-Baptiste Barth Jean-Baptiste Dalido Jean-Christophe Berthon @@ -847,29 +905,32 @@ Jeroen Franse Jeroen Jacobs Jesse Dearing Jesse Dubay -Jessica Frazelle +Jessica Frazelle Jezeniel Zapanta Jhon Honce Ji.Zhilong +Jian Liao Jian Zhang +Jiang Jinyang Jie Luo Jihyun Hwang Jilles Oldenbeuving Jim Alateras +Jim Ehrismann Jim Galasyn Jim Minter Jim Perrin Jimmy Cuadra Jimmy Puckett Jimmy Song -jimmyxian Jinsoo Park +Jintao Zhang +Jiri Appl Jiri Popelka Jiuyue Ma Jiří Župka -jjy -jmzwcn Joao Fernandes +Joao Trindade Joe Beda Joe Doliner Joe Ferguson @@ -893,7 +954,7 @@ John Feminella John Gardiner Myers John Gossman John Harris -John Howard (VM) +John Howard John Laswell John Maguire John Mulhausen @@ -907,7 +968,9 @@ John Willis Jon Johnson Jon Surrell Jon Wedaman +Jonas Dohse Jonas Pfenniger +Jonathan A. Schweder Jonathan A. Sternberg Jonathan Boulle Jonathan Camp @@ -928,7 +991,7 @@ Jordan Jennings Jordan Sissel Jorge Marin Jorit Kleine-Möllhoff -Jose Diaz-Gonzalez +Jose Diaz-Gonzalez Joseph Anthony Pasquale Holsten Joseph Hager Joseph Kern @@ -959,6 +1022,7 @@ Julio Montes Jun-Ru Chang Jussi Nummelin Justas Brazauskas +Justen Martin Justin Cormack Justin Force Justin Menga @@ -967,6 +1031,7 @@ Justin Simonelis Justin Terry Justyn Temme Jyrki Puttonen +Jérémy Leherpeur Jérôme Petazzoni Jörg Thalheim K. Heller @@ -982,7 +1047,8 @@ kargakis Karl Grzeszczak Karol Duleba Karthik Karanth -Karthik Nayak +Karthik Nayak +Kasper Fabæch Brandt Kate Heddleston Katie McLaughlin Kato Kazuyoshi @@ -990,6 +1056,7 @@ Katrina Owen Kawsar Saiyeed Kay Yan kayrus +Kazuhiro Sera Ke Li Ke Xu Kei Ohmura @@ -998,9 +1065,11 @@ Keli Hu Ken Cochrane Ken Herner Ken ICHIKAWA +Ken Reese Kenfe-Mickaël Laventure Kenjiro Nakayama Kent Johnson +Kenta Tada Kevin "qwazerty" Houdebert Kevin Burke Kevin Clark @@ -1011,6 +1080,7 @@ Kevin Kern Kevin Menard Kevin Meredith Kevin P. Kucharczyk +Kevin Parsons Kevin Richardson Kevin Shi Kevin Wallace @@ -1035,11 +1105,13 @@ Krasimir Georgiev Kris-Mikael Krister Kristian Haugene Kristina Zabunova -krrg +Krystian Wojcicki Kun Zhang Kunal Kushwaha +Kunal Tyagi Kyle Conroy Kyle Linden +Kyle Wuolle kyu Lachlan Coote Lai Jiangshan @@ -1060,6 +1132,7 @@ Leandro Siqueira Lee Chao <932819864@qq.com> Lee, Meng-Han leeplay +Lei Gong Lei Jitang Len Weincier Lennie @@ -1076,6 +1149,8 @@ Liana Lo Liang Mingqiang Liang-Chi Hsieh Liao Qingwei +Lifubang +Lihua Tang Lily Guo limsy Lin Lu @@ -1094,7 +1169,9 @@ Lloyd Dewolf Lokesh Mandvekar longliqiang88 <394564827@qq.com> Lorenz Leutgeb -Lorenzo Fontana +Lorenzo Fontana +Lotus Fenn +Louis Delossantos Louis Opter Luca Favatella Luca Marturana @@ -1103,15 +1180,18 @@ Luca-Bogdan Grigorescu Lucas Chan Lucas Chi Lucas Molas +Lucas Silvestre Luciano Mores Luis Martínez de Bartolomé Izquierdo Luiz Svoboda +Lukas Heeren Lukas Waslowski lukaspustina Lukasz Zajaczkowski Luke Marsden Lyn Lynda O'Leary +lzhfromutsc Lénaïc Huard Ma Müller Ma Shimiao @@ -1151,6 +1231,7 @@ Marius Gundersen Marius Sturm Marius Voila Mark Allen +Mark Jeromin Mark McGranaghan Mark McKinstry Mark Milstein @@ -1167,6 +1248,7 @@ Martijn van Oosterhout Martin Honermeyer Martin Kelly Martin Mosegaard Amdisen +Martin Muzatko Martin Redmond Mary Anthony Masahito Zembutsu @@ -1200,6 +1282,7 @@ Matthias Klumpp Matthias Kühnle Matthias Rampke Matthieu Hauglustaine +Mattias Jernberg Mauricio Garavaglia mauriyouth Max Shytikov @@ -1208,6 +1291,8 @@ Maxim Ivanov Maxim Kulkin Maxim Treskin Maxime Petazzoni +Maximiliano Maccanti +Maxwell Meaglith Ma meejah Megan Kostick @@ -1240,6 +1325,7 @@ Michael Stapelberg Michael Steinert Michael Thies Michael West +Michael Zhao Michal Fojtik Michal Gebauer Michal Jemala @@ -1248,8 +1334,9 @@ Michal Wieczorek Michaël Pailloncy Michał Czeraszkiewicz Michał Gryko -Michiel@unhosted -Mickaël FORTUNATO +Michiel de Jong +Mickaël Fortunato +Mickaël Remars Miguel Angel Fernández Miguel Morales Mihai Borobocea @@ -1280,6 +1367,7 @@ Mitch Capper Mizuki Urushida mlarcher Mohammad Banikazemi +Mohammad Nasirifar Mohammed Aaqib Ansari Mohit Soni Moorthy RS @@ -1304,6 +1392,7 @@ Nan Monnand Deng Naoki Orii Natalie Parker Natanael Copa +Natasha Jarus Nate Brennand Nate Eagleson Nate Jones @@ -1321,6 +1410,7 @@ Neyazul Haque Nghia Tran Niall O'Higgins Nicholas E. Rabenau +Nick Adcock Nick DeCoursin Nick Irvine Nick Neisen @@ -1337,6 +1427,7 @@ Nicolas Dudebout Nicolas Goy Nicolas Kaiser Nicolas Sterchele +Nicolas V Castet Nicolás Hock Isaza Nigel Poulton Nik Nyby @@ -1352,19 +1443,25 @@ Noah Treuhaft NobodyOnSE noducks Nolan Darilek +Noriki Nakamura nponeccop Nuutti Kotivuori nzwsch O.S. Tezer objectified +Odin Ugedal Oguz Bilgic Oh Jinkyun Ohad Schneider ohmystack Ole Reifschneider Oliver Neal +Oliver Reason Olivier Gambier Olle Jonsson +Olli Janatuinen +Olly Pomeroy +Omri Shiv Oriol Francès Oskar Niburski Otto Kekäläinen @@ -1373,6 +1470,7 @@ Ovidio Mallo Panagiotis Moustafellos Paolo G. Giarrusso Pascal +Pascal Bach Pascal Borreli Pascal Hartig Patrick Böänziger @@ -1397,6 +1495,7 @@ Paul Nasrat Paul Weaver Paulo Ribeiro Pavel Lobashov +Pavel Matěja Pavel Pletenev Pavel Pospisil Pavel Sutyrin @@ -1420,6 +1519,7 @@ Peter Edge Peter Ericson Peter Esbensen Peter Jaffe +Peter Kang Peter Malmgren Peter Salvatore Peter Volpe @@ -1452,6 +1552,7 @@ Prasanna Gautam Pratik Karki Prayag Verma Priya Wadhwa +Projjol Banerji Przemek Hejman Pure White pysqz @@ -1462,6 +1563,7 @@ Quentin Brossard Quentin Perez Quentin Tayssier r0n22 +Radostin Stoyanov Rafal Jeczalik Rafe Colton Raghavendra K T @@ -1475,6 +1577,7 @@ Ralph Bean Ramkumar Ramachandra Ramon Brooker Ramon van Alteren +RaviTeja Pothana Ray Tsang ReadmeCritic Recursive Madman @@ -1504,6 +1607,7 @@ Riku Voipio Riley Guerin Ritesh H Shukla Riyaz Faizullabhoy +Rob Gulewich Rob Vesse Robert Bachmann Robert Bittle @@ -1512,11 +1616,13 @@ Robert Schneider Robert Stern Robert Terhaar Robert Wallis +Robert Wang Roberto G. Hashioka Roberto Muñoz Fernández Robin Naundorf Robin Schneider Robin Speekenbrink +Robin Thoni robpc Rodolfo Carvalho Rodrigo Vaz @@ -1524,6 +1630,7 @@ Roel Van Nyen Roger Peppe Rohit Jnagal Rohit Kadam +Rohit Kapur Rojin George Roland Huß Roland Kammerer @@ -1533,6 +1640,9 @@ Roman Dudin Roman Strashkin Ron Smits Ron Williams +Rong Gao +Rong Zhang +Rongxiang Song root root root @@ -1544,8 +1654,11 @@ Rovanion Luckey Royce Remer Rozhnov Alexandr Rudolph Gottesheim +Rui Cao Rui Lopes +Ruilin Li Runshen Zhu +Russ Magee Ryan Abrams Ryan Anderson Ryan Aslett @@ -1564,6 +1677,7 @@ Ryan Wallner Ryan Zhang ryancooper7 RyanDeng +Ryo Nakao Rémy Greinhofer s. rannou s00318865 @@ -1572,6 +1686,7 @@ Sachin Joshi Sagar Hani Sainath Grandhi Sakeven Jiang +Salahuddin Khan Sally O'Malley Sam Abed Sam Alba @@ -1580,6 +1695,7 @@ Sam J Sharpe Sam Neirinck Sam Reis Sam Rijs +Sam Whited Sambuddha Basu Sami Wagiaalla Samuel Andaya @@ -1593,6 +1709,8 @@ Santhosh Manohar sapphiredev Sargun Dhillon Sascha Andres +Sascha Grunert +SataQiu Satnam Singh Satoshi Amemiya Satoshi Tagomori @@ -1619,7 +1737,9 @@ Serge Hallyn Sergey Alekseev Sergey Evstifeev Sergii Kabashniuk +Sergio Lopez Serhat Gülçiçek +SeungUkLee Sevki Hasirci Shane Canon Shane da Silva @@ -1639,6 +1759,7 @@ Shijun Qin Shishir Mahajan Shoubhik Bose Shourya Sarcar +Shu-Wai Chow shuai-z Shukui Yang Shuwei Hao @@ -1647,7 +1768,9 @@ Sidhartha Mani sidharthamani Silas Sewell Silvan Jegen +Simão Reis Simei He +Simon Barendse Simon Eskildsen Simon Ferquel Simon Leinen @@ -1656,6 +1779,7 @@ Simon Taranto Simon Vikstrom Sindhu S Sjoerd Langkemper +skanehira Solganik Alexander Solomon Hykes Song Gao @@ -1667,16 +1791,18 @@ Sridatta Thatipamala Sridhar Ratnakumar Srini Brahmaroutu Srinivasan Srivatsan +Staf Wagemakers Stanislav Bondarenko Steeve Morin Stefan Berger Stefan J. Wernli Stefan Praszalowicz Stefan S. -Stefan Scherer +Stefan Scherer Stefan Staudenmeyer Stefan Weil Stephan Spindler +Stephen Benjamin Stephen Crosby Stephen Day Stephen Drake @@ -1693,10 +1819,12 @@ Steven Iveson Steven Merrill Steven Richards Steven Taylor +Stig Larsson Subhajit Ghosh Sujith Haridasan Sun Gengze <690388648@qq.com> Sun Jianbo +Sune Keller Sunny Gogoi Suryakumar Sudar Sven Dowideit @@ -1714,10 +1842,11 @@ tang0th Tangi Colin Tatsuki Sugiura Tatsushi Inagaki +Taylan Isikdemir Taylor Jones -tbonza Ted M. Young Tehmasp Chaudhri +Tejaswini Duggaraju Tejesh Mehta terryding77 <550147740@qq.com> tgic @@ -1746,6 +1875,7 @@ Tianyi Wang Tibor Vass Tiffany Jernigan Tiffany Low +Tim Tim Bart Tim Bosse Tim Dettrick @@ -1811,6 +1941,7 @@ Tristan Carel Troy Denton Tycho Andersen Tyler Brock +Tyler Brown Tzu-Jung Lee uhayate Ulysse Carion @@ -1830,6 +1961,7 @@ Victor Palma Victor Vieux Victoria Bialas Vijaya Kumar K +Vikram bir Singh Viktor Stanchev Viktor Vojnovski VinayRaghavanKS @@ -1871,6 +2003,7 @@ Wassim Dhif Wayne Chang Wayne Song Weerasak Chongnguluam +Wei Fu Wei Wu Wei-Ting Kuo weipeng @@ -1886,6 +2019,7 @@ Wenyu You <21551128@zju.edu.cn> Wenzhi Liang Wes Morgan Wewang Xiaorenfine +Wiktor Kwapisiewicz Will Dietz Will Rouesnel Will Weaver @@ -1900,17 +2034,25 @@ WiseTrem Wolfgang Powisch Wonjun Kim xamyzhao +Xian Chaobo Xianglin Gao Xianlu Bird +Xiao YongBiao XiaoBing Jiang +Xiaodong Zhang +Xiaoxi He Xiaoxu Chen Xiaoyu Zhang +xichengliudui <1693291525@qq.com> xiekeyang +Ximo Guanter Gonzálbez Xinbo Weng +Xinfeng Liu Xinzi Zhou Xiuming Chen Xuecong Liao xuzhaokui +Yadnyawalkya Tale Yahya YAMADA Tsuyoshi Yamasaki Masahide @@ -1920,6 +2062,7 @@ Yang Pengfei yangchenliang Yanqiang Miao Yao Zaiyong +Yash Murty Yassine Tijani Yasunori Mahata Yazhong Liu @@ -1930,9 +2073,11 @@ Yihang Ho Ying Li Yohei Ueda Yong Tang +Yongxin Li Yongzhi Pan Yosef Fertel You-Sheng Yang (楊有勝) +youcai Youcef YEKHLEF Yu Changchun Yu Chengxia @@ -1940,9 +2085,12 @@ Yu Peng Yu-Ju Hong Yuan Sun Yuanhong Peng +Yue Zhang Yuhao Fang +Yuichiro Kaneko Yunxiang Huang Yurii Rashkovskii +Yusuf Tarık Günaydın Yves Junqueira Zac Dover Zach Borboa @@ -1959,11 +2107,14 @@ ZhangHang zhangxianwei Zhenan Ye <21551168@zju.edu.cn> zhenghenghuo +Zhenhai Gao Zhenkun Bi Zhou Hao +Zhoulin Xie Zhu Guihua Zhu Kunjia Zhuoyun Wei +Ziheng Liu Zilin Du zimbatm Ziming Dong @@ -1972,7 +2123,7 @@ zmarouf Zoltan Tombol Zou Yu zqh -Zuhayr Elahi +Zuhayr Elahi Zunayed Ali Álex González Álvaro Lázaro diff --git a/vendor/github.com/docker/docker/LICENSE b/vendor/github.com/docker/docker/LICENSE index 9c8e20ab..6d8d58fb 100644 --- a/vendor/github.com/docker/docker/LICENSE +++ b/vendor/github.com/docker/docker/LICENSE @@ -176,7 +176,7 @@ END OF TERMS AND CONDITIONS - Copyright 2013-2017 Docker, Inc. + Copyright 2013-2018 Docker, Inc. Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. diff --git a/vendor/github.com/docker/docker/NOTICE b/vendor/github.com/docker/docker/NOTICE index 0c74e15b..58b19b6d 100644 --- a/vendor/github.com/docker/docker/NOTICE +++ b/vendor/github.com/docker/docker/NOTICE @@ -3,7 +3,7 @@ Copyright 2012-2017 Docker, Inc. This product includes software developed at Docker, Inc. (https://www.docker.com). -This product contains software (https://github.com/kr/pty) developed +This product contains software (https://github.com/creack/pty) developed by Keith Rarick, licensed under the MIT License. The following is courtesy of our legal counsel: diff --git a/vendor/github.com/docker/docker/api/types/auth.go b/vendor/github.com/docker/docker/api/types/auth.go deleted file mode 100644 index ddf15bb1..00000000 --- a/vendor/github.com/docker/docker/api/types/auth.go +++ /dev/null @@ -1,22 +0,0 @@ -package types // import "github.com/docker/docker/api/types" - -// AuthConfig contains authorization information for connecting to a Registry -type AuthConfig struct { - Username string `json:"username,omitempty"` - Password string `json:"password,omitempty"` - Auth string `json:"auth,omitempty"` - - // Email is an optional value associated with the username. - // This field is deprecated and will be removed in a later - // version of docker. - Email string `json:"email,omitempty"` - - ServerAddress string `json:"serveraddress,omitempty"` - - // IdentityToken is used to authenticate the user and get - // an access token for the registry. - IdentityToken string `json:"identitytoken,omitempty"` - - // RegistryToken is a bearer token to be sent to a registry - RegistryToken string `json:"registrytoken,omitempty"` -} diff --git a/vendor/github.com/docker/docker/api/types/client.go b/vendor/github.com/docker/docker/api/types/client.go deleted file mode 100644 index 3b698c2c..00000000 --- a/vendor/github.com/docker/docker/api/types/client.go +++ /dev/null @@ -1,406 +0,0 @@ -package types // import "github.com/docker/docker/api/types" - -import ( - "bufio" - "io" - "net" - - "github.com/docker/docker/api/types/container" - "github.com/docker/docker/api/types/filters" - units "github.com/docker/go-units" -) - -// CheckpointCreateOptions holds parameters to create a checkpoint from a container -type CheckpointCreateOptions struct { - CheckpointID string - CheckpointDir string - Exit bool -} - -// CheckpointListOptions holds parameters to list checkpoints for a container -type CheckpointListOptions struct { - CheckpointDir string -} - -// CheckpointDeleteOptions holds parameters to delete a checkpoint from a container -type CheckpointDeleteOptions struct { - CheckpointID string - CheckpointDir string -} - -// ContainerAttachOptions holds parameters to attach to a container. -type ContainerAttachOptions struct { - Stream bool - Stdin bool - Stdout bool - Stderr bool - DetachKeys string - Logs bool -} - -// ContainerCommitOptions holds parameters to commit changes into a container. -type ContainerCommitOptions struct { - Reference string - Comment string - Author string - Changes []string - Pause bool - Config *container.Config -} - -// ContainerExecInspect holds information returned by exec inspect. -type ContainerExecInspect struct { - ExecID string - ContainerID string - Running bool - ExitCode int - Pid int -} - -// ContainerListOptions holds parameters to list containers with. -type ContainerListOptions struct { - Quiet bool - Size bool - All bool - Latest bool - Since string - Before string - Limit int - Filters filters.Args -} - -// ContainerLogsOptions holds parameters to filter logs with. -type ContainerLogsOptions struct { - ShowStdout bool - ShowStderr bool - Since string - Until string - Timestamps bool - Follow bool - Tail string - Details bool -} - -// ContainerRemoveOptions holds parameters to remove containers. -type ContainerRemoveOptions struct { - RemoveVolumes bool - RemoveLinks bool - Force bool -} - -// ContainerStartOptions holds parameters to start containers. -type ContainerStartOptions struct { - CheckpointID string - CheckpointDir string -} - -// CopyToContainerOptions holds information -// about files to copy into a container -type CopyToContainerOptions struct { - AllowOverwriteDirWithFile bool - CopyUIDGID bool -} - -// EventsOptions holds parameters to filter events with. -type EventsOptions struct { - Since string - Until string - Filters filters.Args -} - -// NetworkListOptions holds parameters to filter the list of networks with. -type NetworkListOptions struct { - Filters filters.Args -} - -// HijackedResponse holds connection information for a hijacked request. -type HijackedResponse struct { - Conn net.Conn - Reader *bufio.Reader -} - -// Close closes the hijacked connection and reader. -func (h *HijackedResponse) Close() { - h.Conn.Close() -} - -// CloseWriter is an interface that implements structs -// that close input streams to prevent from writing. -type CloseWriter interface { - CloseWrite() error -} - -// CloseWrite closes a readWriter for writing. -func (h *HijackedResponse) CloseWrite() error { - if conn, ok := h.Conn.(CloseWriter); ok { - return conn.CloseWrite() - } - return nil -} - -// ImageBuildOptions holds the information -// necessary to build images. -type ImageBuildOptions struct { - Tags []string - SuppressOutput bool - RemoteContext string - NoCache bool - Remove bool - ForceRemove bool - PullParent bool - Isolation container.Isolation - CPUSetCPUs string - CPUSetMems string - CPUShares int64 - CPUQuota int64 - CPUPeriod int64 - Memory int64 - MemorySwap int64 - CgroupParent string - NetworkMode string - ShmSize int64 - Dockerfile string - Ulimits []*units.Ulimit - // BuildArgs needs to be a *string instead of just a string so that - // we can tell the difference between "" (empty string) and no value - // at all (nil). See the parsing of buildArgs in - // api/server/router/build/build_routes.go for even more info. - BuildArgs map[string]*string - AuthConfigs map[string]AuthConfig - Context io.Reader - Labels map[string]string - // squash the resulting image's layers to the parent - // preserves the original image and creates a new one from the parent with all - // the changes applied to a single layer - Squash bool - // CacheFrom specifies images that are used for matching cache. Images - // specified here do not need to have a valid parent chain to match cache. - CacheFrom []string - SecurityOpt []string - ExtraHosts []string // List of extra hosts - Target string - SessionID string - Platform string - // Version specifies the version of the unerlying builder to use - Version BuilderVersion - // BuildID is an optional identifier that can be passed together with the - // build request. The same identifier can be used to gracefully cancel the - // build with the cancel request. - BuildID string -} - -// BuilderVersion sets the version of underlying builder to use -type BuilderVersion string - -const ( - // BuilderV1 is the first generation builder in docker daemon - BuilderV1 BuilderVersion = "1" - // BuilderBuildKit is builder based on moby/buildkit project - BuilderBuildKit = "2" -) - -// ImageBuildResponse holds information -// returned by a server after building -// an image. -type ImageBuildResponse struct { - Body io.ReadCloser - OSType string -} - -// ImageCreateOptions holds information to create images. -type ImageCreateOptions struct { - RegistryAuth string // RegistryAuth is the base64 encoded credentials for the registry. - Platform string // Platform is the target platform of the image if it needs to be pulled from the registry. -} - -// ImageImportSource holds source information for ImageImport -type ImageImportSource struct { - Source io.Reader // Source is the data to send to the server to create this image from. You must set SourceName to "-" to leverage this. - SourceName string // SourceName is the name of the image to pull. Set to "-" to leverage the Source attribute. -} - -// ImageImportOptions holds information to import images from the client host. -type ImageImportOptions struct { - Tag string // Tag is the name to tag this image with. This attribute is deprecated. - Message string // Message is the message to tag the image with - Changes []string // Changes are the raw changes to apply to this image - Platform string // Platform is the target platform of the image -} - -// ImageListOptions holds parameters to filter the list of images with. -type ImageListOptions struct { - All bool - Filters filters.Args -} - -// ImageLoadResponse returns information to the client about a load process. -type ImageLoadResponse struct { - // Body must be closed to avoid a resource leak - Body io.ReadCloser - JSON bool -} - -// ImagePullOptions holds information to pull images. -type ImagePullOptions struct { - All bool - RegistryAuth string // RegistryAuth is the base64 encoded credentials for the registry - PrivilegeFunc RequestPrivilegeFunc - Platform string -} - -// RequestPrivilegeFunc is a function interface that -// clients can supply to retry operations after -// getting an authorization error. -// This function returns the registry authentication -// header value in base 64 format, or an error -// if the privilege request fails. -type RequestPrivilegeFunc func() (string, error) - -//ImagePushOptions holds information to push images. -type ImagePushOptions ImagePullOptions - -// ImageRemoveOptions holds parameters to remove images. -type ImageRemoveOptions struct { - Force bool - PruneChildren bool -} - -// ImageSearchOptions holds parameters to search images with. -type ImageSearchOptions struct { - RegistryAuth string - PrivilegeFunc RequestPrivilegeFunc - Filters filters.Args - Limit int -} - -// ResizeOptions holds parameters to resize a tty. -// It can be used to resize container ttys and -// exec process ttys too. -type ResizeOptions struct { - Height uint - Width uint -} - -// NodeListOptions holds parameters to list nodes with. -type NodeListOptions struct { - Filters filters.Args -} - -// NodeRemoveOptions holds parameters to remove nodes with. -type NodeRemoveOptions struct { - Force bool -} - -// ServiceCreateOptions contains the options to use when creating a service. -type ServiceCreateOptions struct { - // EncodedRegistryAuth is the encoded registry authorization credentials to - // use when updating the service. - // - // This field follows the format of the X-Registry-Auth header. - EncodedRegistryAuth string - - // QueryRegistry indicates whether the service update requires - // contacting a registry. A registry may be contacted to retrieve - // the image digest and manifest, which in turn can be used to update - // platform or other information about the service. - QueryRegistry bool -} - -// ServiceCreateResponse contains the information returned to a client -// on the creation of a new service. -type ServiceCreateResponse struct { - // ID is the ID of the created service. - ID string - // Warnings is a set of non-fatal warning messages to pass on to the user. - Warnings []string `json:",omitempty"` -} - -// Values for RegistryAuthFrom in ServiceUpdateOptions -const ( - RegistryAuthFromSpec = "spec" - RegistryAuthFromPreviousSpec = "previous-spec" -) - -// ServiceUpdateOptions contains the options to be used for updating services. -type ServiceUpdateOptions struct { - // EncodedRegistryAuth is the encoded registry authorization credentials to - // use when updating the service. - // - // This field follows the format of the X-Registry-Auth header. - EncodedRegistryAuth string - - // TODO(stevvooe): Consider moving the version parameter of ServiceUpdate - // into this field. While it does open API users up to racy writes, most - // users may not need that level of consistency in practice. - - // RegistryAuthFrom specifies where to find the registry authorization - // credentials if they are not given in EncodedRegistryAuth. Valid - // values are "spec" and "previous-spec". - RegistryAuthFrom string - - // Rollback indicates whether a server-side rollback should be - // performed. When this is set, the provided spec will be ignored. - // The valid values are "previous" and "none". An empty value is the - // same as "none". - Rollback string - - // QueryRegistry indicates whether the service update requires - // contacting a registry. A registry may be contacted to retrieve - // the image digest and manifest, which in turn can be used to update - // platform or other information about the service. - QueryRegistry bool -} - -// ServiceListOptions holds parameters to list services with. -type ServiceListOptions struct { - Filters filters.Args -} - -// ServiceInspectOptions holds parameters related to the "service inspect" -// operation. -type ServiceInspectOptions struct { - InsertDefaults bool -} - -// TaskListOptions holds parameters to list tasks with. -type TaskListOptions struct { - Filters filters.Args -} - -// PluginRemoveOptions holds parameters to remove plugins. -type PluginRemoveOptions struct { - Force bool -} - -// PluginEnableOptions holds parameters to enable plugins. -type PluginEnableOptions struct { - Timeout int -} - -// PluginDisableOptions holds parameters to disable plugins. -type PluginDisableOptions struct { - Force bool -} - -// PluginInstallOptions holds parameters to install a plugin. -type PluginInstallOptions struct { - Disabled bool - AcceptAllPermissions bool - RegistryAuth string // RegistryAuth is the base64 encoded credentials for the registry - RemoteRef string // RemoteRef is the plugin name on the registry - PrivilegeFunc RequestPrivilegeFunc - AcceptPermissionsFunc func(PluginPrivileges) (bool, error) - Args []string -} - -// SwarmUnlockKeyResponse contains the response for Engine API: -// GET /swarm/unlockkey -type SwarmUnlockKeyResponse struct { - // UnlockKey is the unlock key in ASCII-armored format. - UnlockKey string -} - -// PluginCreateOptions hold all options to plugin create. -type PluginCreateOptions struct { - RepoName string -} diff --git a/vendor/github.com/docker/docker/api/types/configs.go b/vendor/github.com/docker/docker/api/types/configs.go deleted file mode 100644 index 178e911a..00000000 --- a/vendor/github.com/docker/docker/api/types/configs.go +++ /dev/null @@ -1,64 +0,0 @@ -package types // import "github.com/docker/docker/api/types" - -import ( - "github.com/docker/docker/api/types/container" - "github.com/docker/docker/api/types/network" -) - -// configs holds structs used for internal communication between the -// frontend (such as an http server) and the backend (such as the -// docker daemon). - -// ContainerCreateConfig is the parameter set to ContainerCreate() -type ContainerCreateConfig struct { - Name string - Config *container.Config - HostConfig *container.HostConfig - NetworkingConfig *network.NetworkingConfig - AdjustCPUShares bool -} - -// ContainerRmConfig holds arguments for the container remove -// operation. This struct is used to tell the backend what operations -// to perform. -type ContainerRmConfig struct { - ForceRemove, RemoveVolume, RemoveLink bool -} - -// ExecConfig is a small subset of the Config struct that holds the configuration -// for the exec feature of docker. -type ExecConfig struct { - User string // User that will run the command - Privileged bool // Is the container in privileged mode - Tty bool // Attach standard streams to a tty. - AttachStdin bool // Attach the standard input, makes possible user interaction - AttachStderr bool // Attach the standard error - AttachStdout bool // Attach the standard output - Detach bool // Execute in detach mode - DetachKeys string // Escape keys for detach - Env []string // Environment variables - WorkingDir string // Working directory - Cmd []string // Execution commands and args -} - -// PluginRmConfig holds arguments for plugin remove. -type PluginRmConfig struct { - ForceRemove bool -} - -// PluginEnableConfig holds arguments for plugin enable -type PluginEnableConfig struct { - Timeout int -} - -// PluginDisableConfig holds arguments for plugin disable. -type PluginDisableConfig struct { - ForceDisable bool -} - -// NetworkListConfig stores the options available for listing networks -type NetworkListConfig struct { - // TODO(@cpuguy83): naming is hard, this is pulled from what was being used in the router before moving here - Detailed bool - Verbose bool -} diff --git a/vendor/github.com/docker/docker/api/types/container/config.go b/vendor/github.com/docker/docker/api/types/container/config.go index 89ad08c2..f767195b 100644 --- a/vendor/github.com/docker/docker/api/types/container/config.go +++ b/vendor/github.com/docker/docker/api/types/container/config.go @@ -54,7 +54,7 @@ type Config struct { Env []string // List of environment variable to set in the container Cmd strslice.StrSlice // Command to run when starting the container Healthcheck *HealthConfig `json:",omitempty"` // Healthcheck describes how to check the container is healthy - ArgsEscaped bool `json:",omitempty"` // True if command is already escaped (Windows specific) + ArgsEscaped bool `json:",omitempty"` // True if command is already escaped (meaning treat as a command line) (Windows specific). Image string // Name of the image as it was passed by the operator (e.g. could be symbolic) Volumes map[string]struct{} // List of volumes (mounts) used for the container WorkingDir string // Current directory (PWD) in the command will be launched diff --git a/vendor/github.com/docker/docker/api/types/container/container_changes.go b/vendor/github.com/docker/docker/api/types/container/container_changes.go index c909d6ca..16dd5019 100644 --- a/vendor/github.com/docker/docker/api/types/container/container_changes.go +++ b/vendor/github.com/docker/docker/api/types/container/container_changes.go @@ -1,8 +1,7 @@ -package container +package container // import "github.com/docker/docker/api/types/container" // ---------------------------------------------------------------------------- -// DO NOT EDIT THIS FILE -// This file was generated by `swagger generate operation` +// Code generated by `swagger generate operation`. DO NOT EDIT. // // See hack/generate-swagger-api.sh // ---------------------------------------------------------------------------- diff --git a/vendor/github.com/docker/docker/api/types/container/container_create.go b/vendor/github.com/docker/docker/api/types/container/container_create.go index 49efa0f2..d0c852f8 100644 --- a/vendor/github.com/docker/docker/api/types/container/container_create.go +++ b/vendor/github.com/docker/docker/api/types/container/container_create.go @@ -1,8 +1,7 @@ -package container +package container // import "github.com/docker/docker/api/types/container" // ---------------------------------------------------------------------------- -// DO NOT EDIT THIS FILE -// This file was generated by `swagger generate operation` +// Code generated by `swagger generate operation`. DO NOT EDIT. // // See hack/generate-swagger-api.sh // ---------------------------------------------------------------------------- diff --git a/vendor/github.com/docker/docker/api/types/container/container_top.go b/vendor/github.com/docker/docker/api/types/container/container_top.go index ba41edcf..f0ee9dde 100644 --- a/vendor/github.com/docker/docker/api/types/container/container_top.go +++ b/vendor/github.com/docker/docker/api/types/container/container_top.go @@ -1,8 +1,7 @@ -package container +package container // import "github.com/docker/docker/api/types/container" // ---------------------------------------------------------------------------- -// DO NOT EDIT THIS FILE -// This file was generated by `swagger generate operation` +// Code generated by `swagger generate operation`. DO NOT EDIT. // // See hack/generate-swagger-api.sh // ---------------------------------------------------------------------------- diff --git a/vendor/github.com/docker/docker/api/types/container/container_update.go b/vendor/github.com/docker/docker/api/types/container/container_update.go index 7630ae54..c10f175e 100644 --- a/vendor/github.com/docker/docker/api/types/container/container_update.go +++ b/vendor/github.com/docker/docker/api/types/container/container_update.go @@ -1,8 +1,7 @@ -package container +package container // import "github.com/docker/docker/api/types/container" // ---------------------------------------------------------------------------- -// DO NOT EDIT THIS FILE -// This file was generated by `swagger generate operation` +// Code generated by `swagger generate operation`. DO NOT EDIT. // // See hack/generate-swagger-api.sh // ---------------------------------------------------------------------------- diff --git a/vendor/github.com/docker/docker/api/types/container/container_wait.go b/vendor/github.com/docker/docker/api/types/container/container_wait.go index 9e3910a6..49e05ae6 100644 --- a/vendor/github.com/docker/docker/api/types/container/container_wait.go +++ b/vendor/github.com/docker/docker/api/types/container/container_wait.go @@ -1,8 +1,7 @@ -package container +package container // import "github.com/docker/docker/api/types/container" // ---------------------------------------------------------------------------- -// DO NOT EDIT THIS FILE -// This file was generated by `swagger generate operation` +// Code generated by `swagger generate operation`. DO NOT EDIT. // // See hack/generate-swagger-api.sh // ---------------------------------------------------------------------------- diff --git a/vendor/github.com/docker/docker/api/types/container/host_config.go b/vendor/github.com/docker/docker/api/types/container/host_config.go index 4ef26fa6..b8a4b3aa 100644 --- a/vendor/github.com/docker/docker/api/types/container/host_config.go +++ b/vendor/github.com/docker/docker/api/types/container/host_config.go @@ -7,9 +7,32 @@ import ( "github.com/docker/docker/api/types/mount" "github.com/docker/docker/api/types/strslice" "github.com/docker/go-connections/nat" - "github.com/docker/go-units" + units "github.com/docker/go-units" ) +// CgroupnsMode represents the cgroup namespace mode of the container +type CgroupnsMode string + +// IsPrivate indicates whether the container uses its own private cgroup namespace +func (c CgroupnsMode) IsPrivate() bool { + return c == "private" +} + +// IsHost indicates whether the container shares the host's cgroup namespace +func (c CgroupnsMode) IsHost() bool { + return c == "host" +} + +// IsEmpty indicates whether the container cgroup namespace mode is unset +func (c CgroupnsMode) IsEmpty() bool { + return c == "" +} + +// Valid indicates whether the cgroup namespace mode is valid +func (c CgroupnsMode) Valid() bool { + return c.IsEmpty() || c.IsPrivate() || c.IsHost() +} + // Isolation represents the isolation technology of a container. The supported // values are platform specific type Isolation string @@ -122,7 +145,7 @@ func (n NetworkMode) ConnectedContainer() string { return "" } -//UserDefined indicates user-created network +// UserDefined indicates user-created network func (n NetworkMode) UserDefined() string { if n.IsUserDefined() { return string(n) @@ -244,6 +267,16 @@ func (n PidMode) Container() string { return "" } +// DeviceRequest represents a request for devices from a device driver. +// Used by GPU device drivers. +type DeviceRequest struct { + Driver string // Name of device driver + Count int // Number of devices to request (-1 = All) + DeviceIDs []string // List of device IDs as recognizable by the device driver + Capabilities [][]string // An OR list of AND lists of device capabilities (e.g. "gpu") + Options map[string]string // Options to pass onto the device driver +} + // DeviceMapping represents the device mapping between the host and the container. type DeviceMapping struct { PathOnHost string @@ -327,13 +360,14 @@ type Resources struct { CpusetMems string // CpusetMems 0-2, 0,1 Devices []DeviceMapping // List of devices to map inside the container DeviceCgroupRules []string // List of rule to be added to the device cgroup - DiskQuota int64 // Disk limit (in bytes) + DeviceRequests []DeviceRequest // List of device requests for device drivers KernelMemory int64 // Kernel memory limit (in bytes) + KernelMemoryTCP int64 // Hard limit for kernel TCP buffer memory (in bytes) MemoryReservation int64 // Memory soft limit (in bytes) MemorySwap int64 // Total memory usage (memory + swap); set `-1` to enable unlimited swap MemorySwappiness *int64 // Tuning container memory swappiness behaviour OomKillDisable *bool // Whether to disable OOM Killer or not - PidsLimit int64 // Setting pids limit for a container + PidsLimit *int64 // Setting PIDs limit for a container; Set `0` or `-1` for unlimited, or `null` to not change. Ulimits []*units.Ulimit // List of ulimits to be set in the container // Applicable to Windows @@ -369,6 +403,8 @@ type HostConfig struct { // Applicable to UNIX platforms CapAdd strslice.StrSlice // List of kernel capabilities to add to the container CapDrop strslice.StrSlice // List of kernel capabilities to remove from the container + Capabilities []string `json:"Capabilities"` // List of kernel capabilities to be available for container (this overrides the default set) + CgroupnsMode CgroupnsMode // Cgroup namespace mode to use for the container DNS []string `json:"Dns"` // List of DNS server to lookup DNSOptions []string `json:"DnsOptions"` // List of DNSOption to look for DNSSearch []string `json:"DnsSearch"` // List of DNSSearch to look for diff --git a/vendor/github.com/docker/docker/api/types/error_response.go b/vendor/github.com/docker/docker/api/types/error_response.go deleted file mode 100644 index dc942d9d..00000000 --- a/vendor/github.com/docker/docker/api/types/error_response.go +++ /dev/null @@ -1,13 +0,0 @@ -package types - -// This file was generated by the swagger tool. -// Editing this file might prove futile when you re-run the swagger generate command - -// ErrorResponse Represents an error. -// swagger:model ErrorResponse -type ErrorResponse struct { - - // The error message. - // Required: true - Message string `json:"message"` -} diff --git a/vendor/github.com/docker/docker/api/types/filters/parse.go b/vendor/github.com/docker/docker/api/types/filters/parse.go index a41e3d8d..4bc91cff 100644 --- a/vendor/github.com/docker/docker/api/types/filters/parse.go +++ b/vendor/github.com/docker/docker/api/types/filters/parse.go @@ -5,7 +5,6 @@ package filters // import "github.com/docker/docker/api/types/filters" import ( "encoding/json" - "errors" "regexp" "strings" @@ -37,39 +36,13 @@ func NewArgs(initialArgs ...KeyValuePair) Args { return args } -// ParseFlag parses a key=value string and adds it to an Args. -// -// Deprecated: Use Args.Add() -func ParseFlag(arg string, prev Args) (Args, error) { - filters := prev - if len(arg) == 0 { - return filters, nil +// Keys returns all the keys in list of Args +func (args Args) Keys() []string { + keys := make([]string, 0, len(args.fields)) + for k := range args.fields { + keys = append(keys, k) } - - if !strings.Contains(arg, "=") { - return filters, ErrBadFormat - } - - f := strings.SplitN(arg, "=", 2) - - name := strings.ToLower(strings.TrimSpace(f[0])) - value := strings.TrimSpace(f[1]) - - filters.Add(name, value) - - return filters, nil -} - -// ErrBadFormat is an error returned when a filter is not in the form key=value -// -// Deprecated: this error will be removed in a future version -var ErrBadFormat = errors.New("bad format of filter (expected name=value)") - -// ToParam encodes the Args as args JSON encoded string -// -// Deprecated: use ToJSON -func ToParam(a Args) (string, error) { - return ToJSON(a) + return keys } // MarshalJSON returns a JSON byte representation of the Args @@ -93,7 +66,7 @@ func ToJSON(a Args) (string, error) { // then the encoded format will use an older legacy format where the values are a // list of strings, instead of a set. // -// Deprecated: Use ToJSON +// Deprecated: do not use in any new code; use ToJSON instead func ToParamWithVersion(version string, a Args) (string, error) { if a.Len() == 0 { return "", nil @@ -107,13 +80,6 @@ func ToParamWithVersion(version string, a Args) (string, error) { return ToJSON(a) } -// FromParam decodes a JSON encoded string into Args -// -// Deprecated: use FromJSON -func FromParam(p string) (Args, error) { - return FromJSON(p) -} - // FromJSON decodes a JSON encoded string into Args func FromJSON(p string) (Args, error) { args := NewArgs() @@ -188,7 +154,7 @@ func (args Args) Len() int { func (args Args) MatchKVList(key string, sources map[string]string) bool { fieldValues := args.fields[key] - //do not filter if there is no filter set or cannot determine filter + // do not filter if there is no filter set or cannot determine filter if len(fieldValues) == 0 { return true } @@ -234,7 +200,7 @@ func (args Args) Match(field, source string) bool { // ExactMatch returns true if the source matches exactly one of the values. func (args Args) ExactMatch(key, source string) bool { fieldValues, ok := args.fields[key] - //do not filter if there is no filter set or cannot determine filter + // do not filter if there is no filter set or cannot determine filter if !ok || len(fieldValues) == 0 { return true } @@ -247,7 +213,7 @@ func (args Args) ExactMatch(key, source string) bool { // matches exactly the value. func (args Args) UniqueExactMatch(key, source string) bool { fieldValues := args.fields[key] - //do not filter if there is no filter set or cannot determine filter + // do not filter if there is no filter set or cannot determine filter if len(fieldValues) == 0 { return true } @@ -275,14 +241,6 @@ func (args Args) FuzzyMatch(key, source string) bool { return false } -// Include returns true if the key exists in the mapping -// -// Deprecated: use Contains -func (args Args) Include(field string) bool { - _, ok := args.fields[field] - return ok -} - // Contains returns true if the key exists in the mapping func (args Args) Contains(field string) bool { _, ok := args.fields[field] @@ -323,6 +281,22 @@ func (args Args) WalkValues(field string, op func(value string) error) error { return nil } +// Clone returns a copy of args. +func (args Args) Clone() (newArgs Args) { + newArgs.fields = make(map[string]map[string]bool, len(args.fields)) + for k, m := range args.fields { + var mm map[string]bool + if m != nil { + mm = make(map[string]bool, len(m)) + for kk, v := range m { + mm[kk] = v + } + } + newArgs.fields[k] = mm + } + return newArgs +} + func deprecatedArgs(d map[string][]string) map[string]map[string]bool { m := map[string]map[string]bool{} for k, v := range d { diff --git a/vendor/github.com/docker/docker/api/types/graph_driver_data.go b/vendor/github.com/docker/docker/api/types/graph_driver_data.go deleted file mode 100644 index 4d9bf1c6..00000000 --- a/vendor/github.com/docker/docker/api/types/graph_driver_data.go +++ /dev/null @@ -1,17 +0,0 @@ -package types - -// This file was generated by the swagger tool. -// Editing this file might prove futile when you re-run the swagger generate command - -// GraphDriverData Information about a container's graph driver. -// swagger:model GraphDriverData -type GraphDriverData struct { - - // data - // Required: true - Data map[string]string `json:"Data"` - - // name - // Required: true - Name string `json:"Name"` -} diff --git a/vendor/github.com/docker/docker/api/types/id_response.go b/vendor/github.com/docker/docker/api/types/id_response.go deleted file mode 100644 index 7592d2f8..00000000 --- a/vendor/github.com/docker/docker/api/types/id_response.go +++ /dev/null @@ -1,13 +0,0 @@ -package types - -// This file was generated by the swagger tool. -// Editing this file might prove futile when you re-run the swagger generate command - -// IDResponse Response to an API call that returns just an Id -// swagger:model IdResponse -type IDResponse struct { - - // The id of the newly created object. - // Required: true - ID string `json:"Id"` -} diff --git a/vendor/github.com/docker/docker/api/types/image_delete_response_item.go b/vendor/github.com/docker/docker/api/types/image_delete_response_item.go deleted file mode 100644 index b9a65a0d..00000000 --- a/vendor/github.com/docker/docker/api/types/image_delete_response_item.go +++ /dev/null @@ -1,15 +0,0 @@ -package types - -// This file was generated by the swagger tool. -// Editing this file might prove futile when you re-run the swagger generate command - -// ImageDeleteResponseItem image delete response item -// swagger:model ImageDeleteResponseItem -type ImageDeleteResponseItem struct { - - // The image ID of an image that was deleted - Deleted string `json:"Deleted,omitempty"` - - // The image ID of an image that was untagged - Untagged string `json:"Untagged,omitempty"` -} diff --git a/vendor/github.com/docker/docker/api/types/image_summary.go b/vendor/github.com/docker/docker/api/types/image_summary.go deleted file mode 100644 index e145b3dc..00000000 --- a/vendor/github.com/docker/docker/api/types/image_summary.go +++ /dev/null @@ -1,49 +0,0 @@ -package types - -// This file was generated by the swagger tool. -// Editing this file might prove futile when you re-run the swagger generate command - -// ImageSummary image summary -// swagger:model ImageSummary -type ImageSummary struct { - - // containers - // Required: true - Containers int64 `json:"Containers"` - - // created - // Required: true - Created int64 `json:"Created"` - - // Id - // Required: true - ID string `json:"Id"` - - // labels - // Required: true - Labels map[string]string `json:"Labels"` - - // parent Id - // Required: true - ParentID string `json:"ParentId"` - - // repo digests - // Required: true - RepoDigests []string `json:"RepoDigests"` - - // repo tags - // Required: true - RepoTags []string `json:"RepoTags"` - - // shared size - // Required: true - SharedSize int64 `json:"SharedSize"` - - // size - // Required: true - Size int64 `json:"Size"` - - // virtual size - // Required: true - VirtualSize int64 `json:"VirtualSize"` -} diff --git a/vendor/github.com/docker/docker/api/types/mount/mount.go b/vendor/github.com/docker/docker/api/types/mount/mount.go index 3fef974d..ab4446b3 100644 --- a/vendor/github.com/docker/docker/api/types/mount/mount.go +++ b/vendor/github.com/docker/docker/api/types/mount/mount.go @@ -79,7 +79,8 @@ const ( // BindOptions defines options specific to mounts of type "bind". type BindOptions struct { - Propagation Propagation `json:",omitempty"` + Propagation Propagation `json:",omitempty"` + NonRecursive bool `json:",omitempty"` } // VolumeOptions represents the options for a mount of type volume. diff --git a/vendor/github.com/docker/docker/api/types/network/network.go b/vendor/github.com/docker/docker/api/types/network/network.go index ccb448f2..7927dbff 100644 --- a/vendor/github.com/docker/docker/api/types/network/network.go +++ b/vendor/github.com/docker/docker/api/types/network/network.go @@ -13,7 +13,7 @@ type Address struct { // IPAM represents IP Address Management type IPAM struct { Driver string - Options map[string]string //Per network IPAM driver options + Options map[string]string // Per network IPAM driver options Config []IPAMConfig } @@ -112,12 +112,13 @@ type ConfigReference struct { } var acceptedFilters = map[string]bool{ - "driver": true, - "type": true, - "name": true, - "id": true, - "label": true, - "scope": true, + "dangling": true, + "driver": true, + "id": true, + "label": true, + "name": true, + "scope": true, + "type": true, } // ValidateFilters validates the list of filter args with the available filters. diff --git a/vendor/github.com/docker/docker/api/types/plugin.go b/vendor/github.com/docker/docker/api/types/plugin.go deleted file mode 100644 index abae48b9..00000000 --- a/vendor/github.com/docker/docker/api/types/plugin.go +++ /dev/null @@ -1,203 +0,0 @@ -package types - -// This file was generated by the swagger tool. -// Editing this file might prove futile when you re-run the swagger generate command - -// Plugin A plugin for the Engine API -// swagger:model Plugin -type Plugin struct { - - // config - // Required: true - Config PluginConfig `json:"Config"` - - // True if the plugin is running. False if the plugin is not running, only installed. - // Required: true - Enabled bool `json:"Enabled"` - - // Id - ID string `json:"Id,omitempty"` - - // name - // Required: true - Name string `json:"Name"` - - // plugin remote reference used to push/pull the plugin - PluginReference string `json:"PluginReference,omitempty"` - - // settings - // Required: true - Settings PluginSettings `json:"Settings"` -} - -// PluginConfig The config of a plugin. -// swagger:model PluginConfig -type PluginConfig struct { - - // args - // Required: true - Args PluginConfigArgs `json:"Args"` - - // description - // Required: true - Description string `json:"Description"` - - // Docker Version used to create the plugin - DockerVersion string `json:"DockerVersion,omitempty"` - - // documentation - // Required: true - Documentation string `json:"Documentation"` - - // entrypoint - // Required: true - Entrypoint []string `json:"Entrypoint"` - - // env - // Required: true - Env []PluginEnv `json:"Env"` - - // interface - // Required: true - Interface PluginConfigInterface `json:"Interface"` - - // ipc host - // Required: true - IpcHost bool `json:"IpcHost"` - - // linux - // Required: true - Linux PluginConfigLinux `json:"Linux"` - - // mounts - // Required: true - Mounts []PluginMount `json:"Mounts"` - - // network - // Required: true - Network PluginConfigNetwork `json:"Network"` - - // pid host - // Required: true - PidHost bool `json:"PidHost"` - - // propagated mount - // Required: true - PropagatedMount string `json:"PropagatedMount"` - - // user - User PluginConfigUser `json:"User,omitempty"` - - // work dir - // Required: true - WorkDir string `json:"WorkDir"` - - // rootfs - Rootfs *PluginConfigRootfs `json:"rootfs,omitempty"` -} - -// PluginConfigArgs plugin config args -// swagger:model PluginConfigArgs -type PluginConfigArgs struct { - - // description - // Required: true - Description string `json:"Description"` - - // name - // Required: true - Name string `json:"Name"` - - // settable - // Required: true - Settable []string `json:"Settable"` - - // value - // Required: true - Value []string `json:"Value"` -} - -// PluginConfigInterface The interface between Docker and the plugin -// swagger:model PluginConfigInterface -type PluginConfigInterface struct { - - // Protocol to use for clients connecting to the plugin. - ProtocolScheme string `json:"ProtocolScheme,omitempty"` - - // socket - // Required: true - Socket string `json:"Socket"` - - // types - // Required: true - Types []PluginInterfaceType `json:"Types"` -} - -// PluginConfigLinux plugin config linux -// swagger:model PluginConfigLinux -type PluginConfigLinux struct { - - // allow all devices - // Required: true - AllowAllDevices bool `json:"AllowAllDevices"` - - // capabilities - // Required: true - Capabilities []string `json:"Capabilities"` - - // devices - // Required: true - Devices []PluginDevice `json:"Devices"` -} - -// PluginConfigNetwork plugin config network -// swagger:model PluginConfigNetwork -type PluginConfigNetwork struct { - - // type - // Required: true - Type string `json:"Type"` -} - -// PluginConfigRootfs plugin config rootfs -// swagger:model PluginConfigRootfs -type PluginConfigRootfs struct { - - // diff ids - DiffIds []string `json:"diff_ids"` - - // type - Type string `json:"type,omitempty"` -} - -// PluginConfigUser plugin config user -// swagger:model PluginConfigUser -type PluginConfigUser struct { - - // g ID - GID uint32 `json:"GID,omitempty"` - - // UID - UID uint32 `json:"UID,omitempty"` -} - -// PluginSettings Settings that can be modified by users. -// swagger:model PluginSettings -type PluginSettings struct { - - // args - // Required: true - Args []string `json:"Args"` - - // devices - // Required: true - Devices []PluginDevice `json:"Devices"` - - // env - // Required: true - Env []string `json:"Env"` - - // mounts - // Required: true - Mounts []PluginMount `json:"Mounts"` -} diff --git a/vendor/github.com/docker/docker/api/types/plugin_device.go b/vendor/github.com/docker/docker/api/types/plugin_device.go deleted file mode 100644 index 56990106..00000000 --- a/vendor/github.com/docker/docker/api/types/plugin_device.go +++ /dev/null @@ -1,25 +0,0 @@ -package types - -// This file was generated by the swagger tool. -// Editing this file might prove futile when you re-run the swagger generate command - -// PluginDevice plugin device -// swagger:model PluginDevice -type PluginDevice struct { - - // description - // Required: true - Description string `json:"Description"` - - // name - // Required: true - Name string `json:"Name"` - - // path - // Required: true - Path *string `json:"Path"` - - // settable - // Required: true - Settable []string `json:"Settable"` -} diff --git a/vendor/github.com/docker/docker/api/types/plugin_env.go b/vendor/github.com/docker/docker/api/types/plugin_env.go deleted file mode 100644 index 32962dc2..00000000 --- a/vendor/github.com/docker/docker/api/types/plugin_env.go +++ /dev/null @@ -1,25 +0,0 @@ -package types - -// This file was generated by the swagger tool. -// Editing this file might prove futile when you re-run the swagger generate command - -// PluginEnv plugin env -// swagger:model PluginEnv -type PluginEnv struct { - - // description - // Required: true - Description string `json:"Description"` - - // name - // Required: true - Name string `json:"Name"` - - // settable - // Required: true - Settable []string `json:"Settable"` - - // value - // Required: true - Value *string `json:"Value"` -} diff --git a/vendor/github.com/docker/docker/api/types/plugin_interface_type.go b/vendor/github.com/docker/docker/api/types/plugin_interface_type.go deleted file mode 100644 index c82f204e..00000000 --- a/vendor/github.com/docker/docker/api/types/plugin_interface_type.go +++ /dev/null @@ -1,21 +0,0 @@ -package types - -// This file was generated by the swagger tool. -// Editing this file might prove futile when you re-run the swagger generate command - -// PluginInterfaceType plugin interface type -// swagger:model PluginInterfaceType -type PluginInterfaceType struct { - - // capability - // Required: true - Capability string `json:"Capability"` - - // prefix - // Required: true - Prefix string `json:"Prefix"` - - // version - // Required: true - Version string `json:"Version"` -} diff --git a/vendor/github.com/docker/docker/api/types/plugin_mount.go b/vendor/github.com/docker/docker/api/types/plugin_mount.go deleted file mode 100644 index 5c031cf8..00000000 --- a/vendor/github.com/docker/docker/api/types/plugin_mount.go +++ /dev/null @@ -1,37 +0,0 @@ -package types - -// This file was generated by the swagger tool. -// Editing this file might prove futile when you re-run the swagger generate command - -// PluginMount plugin mount -// swagger:model PluginMount -type PluginMount struct { - - // description - // Required: true - Description string `json:"Description"` - - // destination - // Required: true - Destination string `json:"Destination"` - - // name - // Required: true - Name string `json:"Name"` - - // options - // Required: true - Options []string `json:"Options"` - - // settable - // Required: true - Settable []string `json:"Settable"` - - // source - // Required: true - Source *string `json:"Source"` - - // type - // Required: true - Type string `json:"Type"` -} diff --git a/vendor/github.com/docker/docker/api/types/plugin_responses.go b/vendor/github.com/docker/docker/api/types/plugin_responses.go deleted file mode 100644 index 60d1fb5a..00000000 --- a/vendor/github.com/docker/docker/api/types/plugin_responses.go +++ /dev/null @@ -1,71 +0,0 @@ -package types // import "github.com/docker/docker/api/types" - -import ( - "encoding/json" - "fmt" - "sort" -) - -// PluginsListResponse contains the response for the Engine API -type PluginsListResponse []*Plugin - -// UnmarshalJSON implements json.Unmarshaler for PluginInterfaceType -func (t *PluginInterfaceType) UnmarshalJSON(p []byte) error { - versionIndex := len(p) - prefixIndex := 0 - if len(p) < 2 || p[0] != '"' || p[len(p)-1] != '"' { - return fmt.Errorf("%q is not a plugin interface type", p) - } - p = p[1 : len(p)-1] -loop: - for i, b := range p { - switch b { - case '.': - prefixIndex = i - case '/': - versionIndex = i - break loop - } - } - t.Prefix = string(p[:prefixIndex]) - t.Capability = string(p[prefixIndex+1 : versionIndex]) - if versionIndex < len(p) { - t.Version = string(p[versionIndex+1:]) - } - return nil -} - -// MarshalJSON implements json.Marshaler for PluginInterfaceType -func (t *PluginInterfaceType) MarshalJSON() ([]byte, error) { - return json.Marshal(t.String()) -} - -// String implements fmt.Stringer for PluginInterfaceType -func (t PluginInterfaceType) String() string { - return fmt.Sprintf("%s.%s/%s", t.Prefix, t.Capability, t.Version) -} - -// PluginPrivilege describes a permission the user has to accept -// upon installing a plugin. -type PluginPrivilege struct { - Name string - Description string - Value []string -} - -// PluginPrivileges is a list of PluginPrivilege -type PluginPrivileges []PluginPrivilege - -func (s PluginPrivileges) Len() int { - return len(s) -} - -func (s PluginPrivileges) Less(i, j int) bool { - return s[i].Name < s[j].Name -} - -func (s PluginPrivileges) Swap(i, j int) { - sort.Strings(s[i].Value) - sort.Strings(s[j].Value) - s[i], s[j] = s[j], s[i] -} diff --git a/vendor/github.com/docker/docker/api/types/port.go b/vendor/github.com/docker/docker/api/types/port.go deleted file mode 100644 index d9123474..00000000 --- a/vendor/github.com/docker/docker/api/types/port.go +++ /dev/null @@ -1,23 +0,0 @@ -package types - -// This file was generated by the swagger tool. -// Editing this file might prove futile when you re-run the swagger generate command - -// Port An open port on a container -// swagger:model Port -type Port struct { - - // Host IP address that the container's port is mapped to - IP string `json:"IP,omitempty"` - - // Port on the container - // Required: true - PrivatePort uint16 `json:"PrivatePort"` - - // Port exposed on the host - PublicPort uint16 `json:"PublicPort,omitempty"` - - // type - // Required: true - Type string `json:"Type"` -} diff --git a/vendor/github.com/docker/docker/api/types/registry/registry.go b/vendor/github.com/docker/docker/api/types/registry/registry.go index 8789ad3b..53e47084 100644 --- a/vendor/github.com/docker/docker/api/types/registry/registry.go +++ b/vendor/github.com/docker/docker/api/types/registry/registry.go @@ -4,7 +4,7 @@ import ( "encoding/json" "net" - "github.com/opencontainers/image-spec/specs-go/v1" + v1 "github.com/opencontainers/image-spec/specs-go/v1" ) // ServiceConfig stores daemon registry services configuration. diff --git a/vendor/github.com/docker/docker/api/types/seccomp.go b/vendor/github.com/docker/docker/api/types/seccomp.go deleted file mode 100644 index 67a41e1a..00000000 --- a/vendor/github.com/docker/docker/api/types/seccomp.go +++ /dev/null @@ -1,93 +0,0 @@ -package types // import "github.com/docker/docker/api/types" - -// Seccomp represents the config for a seccomp profile for syscall restriction. -type Seccomp struct { - DefaultAction Action `json:"defaultAction"` - // Architectures is kept to maintain backward compatibility with the old - // seccomp profile. - Architectures []Arch `json:"architectures,omitempty"` - ArchMap []Architecture `json:"archMap,omitempty"` - Syscalls []*Syscall `json:"syscalls"` -} - -// Architecture is used to represent a specific architecture -// and its sub-architectures -type Architecture struct { - Arch Arch `json:"architecture"` - SubArches []Arch `json:"subArchitectures"` -} - -// Arch used for architectures -type Arch string - -// Additional architectures permitted to be used for system calls -// By default only the native architecture of the kernel is permitted -const ( - ArchX86 Arch = "SCMP_ARCH_X86" - ArchX86_64 Arch = "SCMP_ARCH_X86_64" - ArchX32 Arch = "SCMP_ARCH_X32" - ArchARM Arch = "SCMP_ARCH_ARM" - ArchAARCH64 Arch = "SCMP_ARCH_AARCH64" - ArchMIPS Arch = "SCMP_ARCH_MIPS" - ArchMIPS64 Arch = "SCMP_ARCH_MIPS64" - ArchMIPS64N32 Arch = "SCMP_ARCH_MIPS64N32" - ArchMIPSEL Arch = "SCMP_ARCH_MIPSEL" - ArchMIPSEL64 Arch = "SCMP_ARCH_MIPSEL64" - ArchMIPSEL64N32 Arch = "SCMP_ARCH_MIPSEL64N32" - ArchPPC Arch = "SCMP_ARCH_PPC" - ArchPPC64 Arch = "SCMP_ARCH_PPC64" - ArchPPC64LE Arch = "SCMP_ARCH_PPC64LE" - ArchS390 Arch = "SCMP_ARCH_S390" - ArchS390X Arch = "SCMP_ARCH_S390X" -) - -// Action taken upon Seccomp rule match -type Action string - -// Define actions for Seccomp rules -const ( - ActKill Action = "SCMP_ACT_KILL" - ActTrap Action = "SCMP_ACT_TRAP" - ActErrno Action = "SCMP_ACT_ERRNO" - ActTrace Action = "SCMP_ACT_TRACE" - ActAllow Action = "SCMP_ACT_ALLOW" -) - -// Operator used to match syscall arguments in Seccomp -type Operator string - -// Define operators for syscall arguments in Seccomp -const ( - OpNotEqual Operator = "SCMP_CMP_NE" - OpLessThan Operator = "SCMP_CMP_LT" - OpLessEqual Operator = "SCMP_CMP_LE" - OpEqualTo Operator = "SCMP_CMP_EQ" - OpGreaterEqual Operator = "SCMP_CMP_GE" - OpGreaterThan Operator = "SCMP_CMP_GT" - OpMaskedEqual Operator = "SCMP_CMP_MASKED_EQ" -) - -// Arg used for matching specific syscall arguments in Seccomp -type Arg struct { - Index uint `json:"index"` - Value uint64 `json:"value"` - ValueTwo uint64 `json:"valueTwo"` - Op Operator `json:"op"` -} - -// Filter is used to conditionally apply Seccomp rules -type Filter struct { - Caps []string `json:"caps,omitempty"` - Arches []string `json:"arches,omitempty"` -} - -// Syscall is used to match a group of syscalls in Seccomp -type Syscall struct { - Name string `json:"name,omitempty"` - Names []string `json:"names,omitempty"` - Action Action `json:"action"` - Args []*Arg `json:"args"` - Comment string `json:"comment"` - Includes Filter `json:"includes"` - Excludes Filter `json:"excludes"` -} diff --git a/vendor/github.com/docker/docker/api/types/service_update_response.go b/vendor/github.com/docker/docker/api/types/service_update_response.go deleted file mode 100644 index 74ea64b1..00000000 --- a/vendor/github.com/docker/docker/api/types/service_update_response.go +++ /dev/null @@ -1,12 +0,0 @@ -package types - -// This file was generated by the swagger tool. -// Editing this file might prove futile when you re-run the swagger generate command - -// ServiceUpdateResponse service update response -// swagger:model ServiceUpdateResponse -type ServiceUpdateResponse struct { - - // Optional warning messages - Warnings []string `json:"Warnings"` -} diff --git a/vendor/github.com/docker/docker/api/types/stats.go b/vendor/github.com/docker/docker/api/types/stats.go deleted file mode 100644 index 60175c06..00000000 --- a/vendor/github.com/docker/docker/api/types/stats.go +++ /dev/null @@ -1,181 +0,0 @@ -// Package types is used for API stability in the types and response to the -// consumers of the API stats endpoint. -package types // import "github.com/docker/docker/api/types" - -import "time" - -// ThrottlingData stores CPU throttling stats of one running container. -// Not used on Windows. -type ThrottlingData struct { - // Number of periods with throttling active - Periods uint64 `json:"periods"` - // Number of periods when the container hits its throttling limit. - ThrottledPeriods uint64 `json:"throttled_periods"` - // Aggregate time the container was throttled for in nanoseconds. - ThrottledTime uint64 `json:"throttled_time"` -} - -// CPUUsage stores All CPU stats aggregated since container inception. -type CPUUsage struct { - // Total CPU time consumed. - // Units: nanoseconds (Linux) - // Units: 100's of nanoseconds (Windows) - TotalUsage uint64 `json:"total_usage"` - - // Total CPU time consumed per core (Linux). Not used on Windows. - // Units: nanoseconds. - PercpuUsage []uint64 `json:"percpu_usage,omitempty"` - - // Time spent by tasks of the cgroup in kernel mode (Linux). - // Time spent by all container processes in kernel mode (Windows). - // Units: nanoseconds (Linux). - // Units: 100's of nanoseconds (Windows). Not populated for Hyper-V Containers. - UsageInKernelmode uint64 `json:"usage_in_kernelmode"` - - // Time spent by tasks of the cgroup in user mode (Linux). - // Time spent by all container processes in user mode (Windows). - // Units: nanoseconds (Linux). - // Units: 100's of nanoseconds (Windows). Not populated for Hyper-V Containers - UsageInUsermode uint64 `json:"usage_in_usermode"` -} - -// CPUStats aggregates and wraps all CPU related info of container -type CPUStats struct { - // CPU Usage. Linux and Windows. - CPUUsage CPUUsage `json:"cpu_usage"` - - // System Usage. Linux only. - SystemUsage uint64 `json:"system_cpu_usage,omitempty"` - - // Online CPUs. Linux only. - OnlineCPUs uint32 `json:"online_cpus,omitempty"` - - // Throttling Data. Linux only. - ThrottlingData ThrottlingData `json:"throttling_data,omitempty"` -} - -// MemoryStats aggregates all memory stats since container inception on Linux. -// Windows returns stats for commit and private working set only. -type MemoryStats struct { - // Linux Memory Stats - - // current res_counter usage for memory - Usage uint64 `json:"usage,omitempty"` - // maximum usage ever recorded. - MaxUsage uint64 `json:"max_usage,omitempty"` - // TODO(vishh): Export these as stronger types. - // all the stats exported via memory.stat. - Stats map[string]uint64 `json:"stats,omitempty"` - // number of times memory usage hits limits. - Failcnt uint64 `json:"failcnt,omitempty"` - Limit uint64 `json:"limit,omitempty"` - - // Windows Memory Stats - // See https://technet.microsoft.com/en-us/magazine/ff382715.aspx - - // committed bytes - Commit uint64 `json:"commitbytes,omitempty"` - // peak committed bytes - CommitPeak uint64 `json:"commitpeakbytes,omitempty"` - // private working set - PrivateWorkingSet uint64 `json:"privateworkingset,omitempty"` -} - -// BlkioStatEntry is one small entity to store a piece of Blkio stats -// Not used on Windows. -type BlkioStatEntry struct { - Major uint64 `json:"major"` - Minor uint64 `json:"minor"` - Op string `json:"op"` - Value uint64 `json:"value"` -} - -// BlkioStats stores All IO service stats for data read and write. -// This is a Linux specific structure as the differences between expressing -// block I/O on Windows and Linux are sufficiently significant to make -// little sense attempting to morph into a combined structure. -type BlkioStats struct { - // number of bytes transferred to and from the block device - IoServiceBytesRecursive []BlkioStatEntry `json:"io_service_bytes_recursive"` - IoServicedRecursive []BlkioStatEntry `json:"io_serviced_recursive"` - IoQueuedRecursive []BlkioStatEntry `json:"io_queue_recursive"` - IoServiceTimeRecursive []BlkioStatEntry `json:"io_service_time_recursive"` - IoWaitTimeRecursive []BlkioStatEntry `json:"io_wait_time_recursive"` - IoMergedRecursive []BlkioStatEntry `json:"io_merged_recursive"` - IoTimeRecursive []BlkioStatEntry `json:"io_time_recursive"` - SectorsRecursive []BlkioStatEntry `json:"sectors_recursive"` -} - -// StorageStats is the disk I/O stats for read/write on Windows. -type StorageStats struct { - ReadCountNormalized uint64 `json:"read_count_normalized,omitempty"` - ReadSizeBytes uint64 `json:"read_size_bytes,omitempty"` - WriteCountNormalized uint64 `json:"write_count_normalized,omitempty"` - WriteSizeBytes uint64 `json:"write_size_bytes,omitempty"` -} - -// NetworkStats aggregates the network stats of one container -type NetworkStats struct { - // Bytes received. Windows and Linux. - RxBytes uint64 `json:"rx_bytes"` - // Packets received. Windows and Linux. - RxPackets uint64 `json:"rx_packets"` - // Received errors. Not used on Windows. Note that we dont `omitempty` this - // field as it is expected in the >=v1.21 API stats structure. - RxErrors uint64 `json:"rx_errors"` - // Incoming packets dropped. Windows and Linux. - RxDropped uint64 `json:"rx_dropped"` - // Bytes sent. Windows and Linux. - TxBytes uint64 `json:"tx_bytes"` - // Packets sent. Windows and Linux. - TxPackets uint64 `json:"tx_packets"` - // Sent errors. Not used on Windows. Note that we dont `omitempty` this - // field as it is expected in the >=v1.21 API stats structure. - TxErrors uint64 `json:"tx_errors"` - // Outgoing packets dropped. Windows and Linux. - TxDropped uint64 `json:"tx_dropped"` - // Endpoint ID. Not used on Linux. - EndpointID string `json:"endpoint_id,omitempty"` - // Instance ID. Not used on Linux. - InstanceID string `json:"instance_id,omitempty"` -} - -// PidsStats contains the stats of a container's pids -type PidsStats struct { - // Current is the number of pids in the cgroup - Current uint64 `json:"current,omitempty"` - // Limit is the hard limit on the number of pids in the cgroup. - // A "Limit" of 0 means that there is no limit. - Limit uint64 `json:"limit,omitempty"` -} - -// Stats is Ultimate struct aggregating all types of stats of one container -type Stats struct { - // Common stats - Read time.Time `json:"read"` - PreRead time.Time `json:"preread"` - - // Linux specific stats, not populated on Windows. - PidsStats PidsStats `json:"pids_stats,omitempty"` - BlkioStats BlkioStats `json:"blkio_stats,omitempty"` - - // Windows specific stats, not populated on Linux. - NumProcs uint32 `json:"num_procs"` - StorageStats StorageStats `json:"storage_stats,omitempty"` - - // Shared stats - CPUStats CPUStats `json:"cpu_stats,omitempty"` - PreCPUStats CPUStats `json:"precpu_stats,omitempty"` // "Pre"="Previous" - MemoryStats MemoryStats `json:"memory_stats,omitempty"` -} - -// StatsJSON is newly used Networks -type StatsJSON struct { - Stats - - Name string `json:"name,omitempty"` - ID string `json:"id,omitempty"` - - // Networks request version >=1.21 - Networks map[string]NetworkStats `json:"networks,omitempty"` -} diff --git a/vendor/github.com/docker/docker/api/types/swarm/config.go b/vendor/github.com/docker/docker/api/types/swarm/config.go index a1555cf4..16202ccc 100644 --- a/vendor/github.com/docker/docker/api/types/swarm/config.go +++ b/vendor/github.com/docker/docker/api/types/swarm/config.go @@ -27,9 +27,14 @@ type ConfigReferenceFileTarget struct { Mode os.FileMode } +// ConfigReferenceRuntimeTarget is a target for a config specifying that it +// isn't mounted into the container but instead has some other purpose. +type ConfigReferenceRuntimeTarget struct{} + // ConfigReference is a reference to a config in swarm type ConfigReference struct { - File *ConfigReferenceFileTarget + File *ConfigReferenceFileTarget `json:",omitempty"` + Runtime *ConfigReferenceRuntimeTarget `json:",omitempty"` ConfigID string ConfigName string } diff --git a/vendor/github.com/docker/docker/api/types/swarm/container.go b/vendor/github.com/docker/docker/api/types/swarm/container.go index 151211ff..2eeee9f7 100644 --- a/vendor/github.com/docker/docker/api/types/swarm/container.go +++ b/vendor/github.com/docker/docker/api/types/swarm/container.go @@ -33,6 +33,7 @@ type SELinuxContext struct { // CredentialSpec for managed service account (Windows only) type CredentialSpec struct { + Config string File string Registry string } @@ -66,9 +67,12 @@ type ContainerSpec struct { // The format of extra hosts on swarmkit is specified in: // http://man7.org/linux/man-pages/man5/hosts.5.html // IP_address canonical_hostname [aliases...] - Hosts []string `json:",omitempty"` - DNSConfig *DNSConfig `json:",omitempty"` - Secrets []*SecretReference `json:",omitempty"` - Configs []*ConfigReference `json:",omitempty"` - Isolation container.Isolation `json:",omitempty"` + Hosts []string `json:",omitempty"` + DNSConfig *DNSConfig `json:",omitempty"` + Secrets []*SecretReference `json:",omitempty"` + Configs []*ConfigReference `json:",omitempty"` + Isolation container.Isolation `json:",omitempty"` + PidsLimit int64 `json:",omitempty"` + Sysctls map[string]string `json:",omitempty"` + Capabilities []string `json:",omitempty"` } diff --git a/vendor/github.com/docker/docker/api/types/swarm/runtime/plugin.pb.go b/vendor/github.com/docker/docker/api/types/swarm/runtime/plugin.pb.go index 1fdc9b04..e4504586 100644 --- a/vendor/github.com/docker/docker/api/types/swarm/runtime/plugin.pb.go +++ b/vendor/github.com/docker/docker/api/types/swarm/runtime/plugin.pb.go @@ -1,6 +1,5 @@ -// Code generated by protoc-gen-gogo. +// Code generated by protoc-gen-gogo. DO NOT EDIT. // source: plugin.proto -// DO NOT EDIT! /* Package runtime is a generated protocol buffer package. @@ -38,6 +37,7 @@ type PluginSpec struct { Remote string `protobuf:"bytes,2,opt,name=remote,proto3" json:"remote,omitempty"` Privileges []*PluginPrivilege `protobuf:"bytes,3,rep,name=privileges" json:"privileges,omitempty"` Disabled bool `protobuf:"varint,4,opt,name=disabled,proto3" json:"disabled,omitempty"` + Env []string `protobuf:"bytes,5,rep,name=env" json:"env,omitempty"` } func (m *PluginSpec) Reset() { *m = PluginSpec{} } @@ -73,6 +73,13 @@ func (m *PluginSpec) GetDisabled() bool { return false } +func (m *PluginSpec) GetEnv() []string { + if m != nil { + return m.Env + } + return nil +} + // PluginPrivilege describes a permission the user has to accept // upon installing a plugin. type PluginPrivilege struct { @@ -160,6 +167,21 @@ func (m *PluginSpec) MarshalTo(dAtA []byte) (int, error) { } i++ } + if len(m.Env) > 0 { + for _, s := range m.Env { + dAtA[i] = 0x2a + i++ + l = len(s) + for l >= 1<<7 { + dAtA[i] = uint8(uint64(l)&0x7f | 0x80) + l >>= 7 + i++ + } + dAtA[i] = uint8(l) + i++ + i += copy(dAtA[i:], s) + } + } return i, nil } @@ -208,24 +230,6 @@ func (m *PluginPrivilege) MarshalTo(dAtA []byte) (int, error) { return i, nil } -func encodeFixed64Plugin(dAtA []byte, offset int, v uint64) int { - dAtA[offset] = uint8(v) - dAtA[offset+1] = uint8(v >> 8) - dAtA[offset+2] = uint8(v >> 16) - dAtA[offset+3] = uint8(v >> 24) - dAtA[offset+4] = uint8(v >> 32) - dAtA[offset+5] = uint8(v >> 40) - dAtA[offset+6] = uint8(v >> 48) - dAtA[offset+7] = uint8(v >> 56) - return offset + 8 -} -func encodeFixed32Plugin(dAtA []byte, offset int, v uint32) int { - dAtA[offset] = uint8(v) - dAtA[offset+1] = uint8(v >> 8) - dAtA[offset+2] = uint8(v >> 16) - dAtA[offset+3] = uint8(v >> 24) - return offset + 4 -} func encodeVarintPlugin(dAtA []byte, offset int, v uint64) int { for v >= 1<<7 { dAtA[offset] = uint8(v&0x7f | 0x80) @@ -255,6 +259,12 @@ func (m *PluginSpec) Size() (n int) { if m.Disabled { n += 2 } + if len(m.Env) > 0 { + for _, s := range m.Env { + l = len(s) + n += 1 + l + sovPlugin(uint64(l)) + } + } return n } @@ -429,6 +439,35 @@ func (m *PluginSpec) Unmarshal(dAtA []byte) error { } } m.Disabled = bool(v != 0) + case 5: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Env", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowPlugin + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthPlugin + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Env = append(m.Env, string(dAtA[iNdEx:postIndex])) + iNdEx = postIndex default: iNdEx = preIndex skippy, err := skipPlugin(dAtA[iNdEx:]) @@ -695,18 +734,21 @@ var ( func init() { proto.RegisterFile("plugin.proto", fileDescriptorPlugin) } var fileDescriptorPlugin = []byte{ - // 196 bytes of a gzipped FileDescriptorProto - 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x09, 0x6e, 0x88, 0x02, 0xff, 0xe2, 0xe2, 0x29, 0xc8, 0x29, 0x4d, - 0xcf, 0xcc, 0xd3, 0x2b, 0x28, 0xca, 0x2f, 0xc9, 0x57, 0x6a, 0x63, 0xe4, 0xe2, 0x0a, 0x00, 0x0b, - 0x04, 0x17, 0xa4, 0x26, 0x0b, 0x09, 0x71, 0xb1, 0xe4, 0x25, 0xe6, 0xa6, 0x4a, 0x30, 0x2a, 0x30, - 0x6a, 0x70, 0x06, 0x81, 0xd9, 0x42, 0x62, 0x5c, 0x6c, 0x45, 0xa9, 0xb9, 0xf9, 0x25, 0xa9, 0x12, - 0x4c, 0x60, 0x51, 0x28, 0x4f, 0xc8, 0x80, 0x8b, 0xab, 0xa0, 0x28, 0xb3, 0x2c, 0x33, 0x27, 0x35, - 0x3d, 0xb5, 0x58, 0x82, 0x59, 0x81, 0x59, 0x83, 0xdb, 0x48, 0x40, 0x0f, 0x62, 0x58, 0x00, 0x4c, - 0x22, 0x08, 0x49, 0x8d, 0x90, 0x14, 0x17, 0x47, 0x4a, 0x66, 0x71, 0x62, 0x52, 0x4e, 0x6a, 0x8a, - 0x04, 0x8b, 0x02, 0xa3, 0x06, 0x47, 0x10, 0x9c, 0xaf, 0x14, 0xcb, 0xc5, 0x8f, 0xa6, 0x15, 0xab, - 0x63, 0x14, 0xb8, 0xb8, 0x53, 0x52, 0x8b, 0x93, 0x8b, 0x32, 0x0b, 0x4a, 0x32, 0xf3, 0xf3, 0xa0, - 0x2e, 0x42, 0x16, 0x12, 0x12, 0xe1, 0x62, 0x2d, 0x4b, 0xcc, 0x29, 0x4d, 0x05, 0xbb, 0x88, 0x33, - 0x08, 0xc2, 0x71, 0xe2, 0x39, 0xf1, 0x48, 0x8e, 0xf1, 0xc2, 0x23, 0x39, 0xc6, 0x07, 0x8f, 0xe4, - 0x18, 0x93, 0xd8, 0xc0, 0x9e, 0x37, 0x06, 0x04, 0x00, 0x00, 0xff, 0xff, 0xb8, 0x84, 0xad, 0x79, - 0x0c, 0x01, 0x00, 0x00, + // 256 bytes of a gzipped FileDescriptorProto + 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0x6c, 0x90, 0x4d, 0x4b, 0xc3, 0x30, + 0x18, 0xc7, 0x89, 0xdd, 0xc6, 0xfa, 0x4c, 0x70, 0x04, 0x91, 0xe2, 0xa1, 0x94, 0x9d, 0x7a, 0x6a, + 0x45, 0x2f, 0x82, 0x37, 0x0f, 0x9e, 0x47, 0xbc, 0x09, 0x1e, 0xd2, 0xf6, 0xa1, 0x06, 0x9b, 0x17, + 0x92, 0xb4, 0xe2, 0x37, 0xf1, 0x23, 0x79, 0xf4, 0x23, 0x48, 0x3f, 0x89, 0x98, 0x75, 0x32, 0x64, + 0xa7, 0xff, 0x4b, 0xc2, 0x9f, 0x1f, 0x0f, 0x9c, 0x9a, 0xae, 0x6f, 0x85, 0x2a, 0x8c, 0xd5, 0x5e, + 0x6f, 0x3e, 0x08, 0xc0, 0x36, 0x14, 0x8f, 0x06, 0x6b, 0x4a, 0x61, 0xa6, 0xb8, 0xc4, 0x84, 0x64, + 0x24, 0x8f, 0x59, 0xf0, 0xf4, 0x02, 0x16, 0x16, 0xa5, 0xf6, 0x98, 0x9c, 0x84, 0x76, 0x4a, 0xf4, + 0x0a, 0xc0, 0x58, 0x31, 0x88, 0x0e, 0x5b, 0x74, 0x49, 0x94, 0x45, 0xf9, 0xea, 0x7a, 0x5d, 0xec, + 0xc6, 0xb6, 0xfb, 0x07, 0x76, 0xf0, 0x87, 0x5e, 0xc2, 0xb2, 0x11, 0x8e, 0x57, 0x1d, 0x36, 0xc9, + 0x2c, 0x23, 0xf9, 0x92, 0xfd, 0x65, 0xba, 0x86, 0x08, 0xd5, 0x90, 0xcc, 0xb3, 0x28, 0x8f, 0xd9, + 0xaf, 0xdd, 0x3c, 0xc3, 0xd9, 0xbf, 0xb1, 0xa3, 0x78, 0x19, 0xac, 0x1a, 0x74, 0xb5, 0x15, 0xc6, + 0x0b, 0xad, 0x26, 0xc6, 0xc3, 0x8a, 0x9e, 0xc3, 0x7c, 0xe0, 0x5d, 0x8f, 0x81, 0x31, 0x66, 0xbb, + 0x70, 0xff, 0xf0, 0x39, 0xa6, 0xe4, 0x6b, 0x4c, 0xc9, 0xf7, 0x98, 0x92, 0xa7, 0xdb, 0x56, 0xf8, + 0x97, 0xbe, 0x2a, 0x6a, 0x2d, 0xcb, 0x46, 0xd7, 0xaf, 0x68, 0xf7, 0xc2, 0x8d, 0x28, 0xfd, 0xbb, + 0x41, 0x57, 0xba, 0x37, 0x6e, 0x65, 0x69, 0x7b, 0xe5, 0x85, 0xc4, 0xbb, 0x49, 0xab, 0x45, 0x38, + 0xe4, 0xcd, 0x4f, 0x00, 0x00, 0x00, 0xff, 0xff, 0x99, 0xa8, 0xd9, 0x9b, 0x58, 0x01, 0x00, 0x00, } diff --git a/vendor/github.com/docker/docker/api/types/swarm/runtime/plugin.proto b/vendor/github.com/docker/docker/api/types/swarm/runtime/plugin.proto index 6d63b778..9ef16904 100644 --- a/vendor/github.com/docker/docker/api/types/swarm/runtime/plugin.proto +++ b/vendor/github.com/docker/docker/api/types/swarm/runtime/plugin.proto @@ -9,6 +9,7 @@ message PluginSpec { string remote = 2; repeated PluginPrivilege privileges = 3; bool disabled = 4; + repeated string env = 5; } // PluginPrivilege describes a permission the user has to accept diff --git a/vendor/github.com/docker/docker/api/types/swarm/service.go b/vendor/github.com/docker/docker/api/types/swarm/service.go index abf192e7..6eb452d2 100644 --- a/vendor/github.com/docker/docker/api/types/swarm/service.go +++ b/vendor/github.com/docker/docker/api/types/swarm/service.go @@ -10,6 +10,17 @@ type Service struct { PreviousSpec *ServiceSpec `json:",omitempty"` Endpoint Endpoint `json:",omitempty"` UpdateStatus *UpdateStatus `json:",omitempty"` + + // ServiceStatus is an optional, extra field indicating the number of + // desired and running tasks. It is provided primarily as a shortcut to + // calculating these values client-side, which otherwise would require + // listing all tasks for a service, an operation that could be + // computation and network expensive. + ServiceStatus *ServiceStatus `json:",omitempty"` + + // JobStatus is the status of a Service which is in one of ReplicatedJob or + // GlobalJob modes. It is absent on Replicated and Global services. + JobStatus *JobStatus `json:",omitempty"` } // ServiceSpec represents the spec of a service. @@ -32,8 +43,10 @@ type ServiceSpec struct { // ServiceMode represents the mode of a service. type ServiceMode struct { - Replicated *ReplicatedService `json:",omitempty"` - Global *GlobalService `json:",omitempty"` + Replicated *ReplicatedService `json:",omitempty"` + Global *GlobalService `json:",omitempty"` + ReplicatedJob *ReplicatedJob `json:",omitempty"` + GlobalJob *GlobalJob `json:",omitempty"` } // UpdateState is the state of a service update. @@ -70,6 +83,32 @@ type ReplicatedService struct { // GlobalService is a kind of ServiceMode. type GlobalService struct{} +// ReplicatedJob is the a type of Service which executes a defined Tasks +// in parallel until the specified number of Tasks have succeeded. +type ReplicatedJob struct { + // MaxConcurrent indicates the maximum number of Tasks that should be + // executing simultaneously for this job at any given time. There may be + // fewer Tasks that MaxConcurrent executing simultaneously; for example, if + // there are fewer than MaxConcurrent tasks needed to reach + // TotalCompletions. + // + // If this field is empty, it will default to a max concurrency of 1. + MaxConcurrent *uint64 `json:",omitempty"` + + // TotalCompletions is the total number of Tasks desired to run to + // completion. + // + // If this field is empty, the value of MaxConcurrent will be used. + TotalCompletions *uint64 `json:",omitempty"` +} + +// GlobalJob is the type of a Service which executes a Task on every Node +// matching the Service's placement constraints. These tasks run to completion +// and then exit. +// +// This type is deliberately empty. +type GlobalJob struct{} + const ( // UpdateFailureActionPause PAUSE UpdateFailureActionPause = "pause" @@ -122,3 +161,42 @@ type UpdateConfig struct { // started, or the new task is started before the old task is shut down. Order string } + +// ServiceStatus represents the number of running tasks in a service and the +// number of tasks desired to be running. +type ServiceStatus struct { + // RunningTasks is the number of tasks for the service actually in the + // Running state + RunningTasks uint64 + + // DesiredTasks is the number of tasks desired to be running by the + // service. For replicated services, this is the replica count. For global + // services, this is computed by taking the number of tasks with desired + // state of not-Shutdown. + DesiredTasks uint64 + + // CompletedTasks is the number of tasks in the state Completed, if this + // service is in ReplicatedJob or GlobalJob mode. This field must be + // cross-referenced with the service type, because the default value of 0 + // may mean that a service is not in a job mode, or it may mean that the + // job has yet to complete any tasks. + CompletedTasks uint64 +} + +// JobStatus is the status of a job-type service. +type JobStatus struct { + // JobIteration is a value increased each time a Job is executed, + // successfully or otherwise. "Executed", in this case, means the job as a + // whole has been started, not that an individual Task has been launched. A + // job is "Executed" when its ServiceSpec is updated. JobIteration can be + // used to disambiguate Tasks belonging to different executions of a job. + // + // Though JobIteration will increase with each subsequent execution, it may + // not necessarily increase by 1, and so JobIteration should not be used to + // keep track of the number of times a job has been executed. + JobIteration Version + + // LastExecution is the time that the job was last executed, as observed by + // Swarm manager. + LastExecution time.Time `json:",omitempty"` +} diff --git a/vendor/github.com/docker/docker/api/types/swarm/swarm.go b/vendor/github.com/docker/docker/api/types/swarm/swarm.go index b742cf1b..b25f9996 100644 --- a/vendor/github.com/docker/docker/api/types/swarm/swarm.go +++ b/vendor/github.com/docker/docker/api/types/swarm/swarm.go @@ -14,6 +14,7 @@ type ClusterInfo struct { RootRotationInProgress bool DefaultAddrPool []string SubnetSize uint32 + DataPathPort uint32 } // Swarm represents a swarm. @@ -153,6 +154,7 @@ type InitRequest struct { ListenAddr string AdvertiseAddr string DataPathAddr string + DataPathPort uint32 ForceNewCluster bool Spec Spec AutoLockManagers bool @@ -207,6 +209,8 @@ type Info struct { Managers int `json:",omitempty"` Cluster *ClusterInfo `json:",omitempty"` + + Warnings []string `json:",omitempty"` } // Peer represents a peer. diff --git a/vendor/github.com/docker/docker/api/types/swarm/task.go b/vendor/github.com/docker/docker/api/types/swarm/task.go index b35605d1..9f193df3 100644 --- a/vendor/github.com/docker/docker/api/types/swarm/task.go +++ b/vendor/github.com/docker/docker/api/types/swarm/task.go @@ -56,6 +56,12 @@ type Task struct { DesiredState TaskState `json:",omitempty"` NetworksAttachments []NetworkAttachment `json:",omitempty"` GenericResources []GenericResource `json:",omitempty"` + + // JobIteration is the JobIteration of the Service that this Task was + // spawned from, if the Service is a ReplicatedJob or GlobalJob. This is + // used to determine which Tasks belong to which run of the job. This field + // is absent if the Service mode is Replicated or Global. + JobIteration *Version `json:",omitempty"` } // TaskSpec represents the spec of a task. @@ -127,6 +133,7 @@ type ResourceRequirements struct { type Placement struct { Constraints []string `json:",omitempty"` Preferences []PlacementPreference `json:",omitempty"` + MaxReplicas uint64 `json:",omitempty"` // Platforms stores all the platforms that the image can run on. // This field is used in the platform filter for scheduling. If empty, diff --git a/vendor/github.com/docker/docker/api/types/types.go b/vendor/github.com/docker/docker/api/types/types.go deleted file mode 100644 index ed62fd41..00000000 --- a/vendor/github.com/docker/docker/api/types/types.go +++ /dev/null @@ -1,605 +0,0 @@ -package types // import "github.com/docker/docker/api/types" - -import ( - "errors" - "fmt" - "io" - "os" - "strings" - "time" - - "github.com/docker/docker/api/types/container" - "github.com/docker/docker/api/types/filters" - "github.com/docker/docker/api/types/mount" - "github.com/docker/docker/api/types/network" - "github.com/docker/docker/api/types/registry" - "github.com/docker/docker/api/types/swarm" - "github.com/docker/go-connections/nat" -) - -// RootFS returns Image's RootFS description including the layer IDs. -type RootFS struct { - Type string - Layers []string `json:",omitempty"` - BaseLayer string `json:",omitempty"` -} - -// ImageInspect contains response of Engine API: -// GET "/images/{name:.*}/json" -type ImageInspect struct { - ID string `json:"Id"` - RepoTags []string - RepoDigests []string - Parent string - Comment string - Created string - Container string - ContainerConfig *container.Config - DockerVersion string - Author string - Config *container.Config - Architecture string - Os string - OsVersion string `json:",omitempty"` - Size int64 - VirtualSize int64 - GraphDriver GraphDriverData - RootFS RootFS - Metadata ImageMetadata -} - -// ImageMetadata contains engine-local data about the image -type ImageMetadata struct { - LastTagTime time.Time `json:",omitempty"` -} - -// Container contains response of Engine API: -// GET "/containers/json" -type Container struct { - ID string `json:"Id"` - Names []string - Image string - ImageID string - Command string - Created int64 - Ports []Port - SizeRw int64 `json:",omitempty"` - SizeRootFs int64 `json:",omitempty"` - Labels map[string]string - State string - Status string - HostConfig struct { - NetworkMode string `json:",omitempty"` - } - NetworkSettings *SummaryNetworkSettings - Mounts []MountPoint -} - -// CopyConfig contains request body of Engine API: -// POST "/containers/"+containerID+"/copy" -type CopyConfig struct { - Resource string -} - -// ContainerPathStat is used to encode the header from -// GET "/containers/{name:.*}/archive" -// "Name" is the file or directory name. -type ContainerPathStat struct { - Name string `json:"name"` - Size int64 `json:"size"` - Mode os.FileMode `json:"mode"` - Mtime time.Time `json:"mtime"` - LinkTarget string `json:"linkTarget"` -} - -// ContainerStats contains response of Engine API: -// GET "/stats" -type ContainerStats struct { - Body io.ReadCloser `json:"body"` - OSType string `json:"ostype"` -} - -// Ping contains response of Engine API: -// GET "/_ping" -type Ping struct { - APIVersion string - OSType string - Experimental bool - BuilderVersion BuilderVersion -} - -// ComponentVersion describes the version information for a specific component. -type ComponentVersion struct { - Name string - Version string - Details map[string]string `json:",omitempty"` -} - -// Version contains response of Engine API: -// GET "/version" -type Version struct { - Platform struct{ Name string } `json:",omitempty"` - Components []ComponentVersion `json:",omitempty"` - - // The following fields are deprecated, they relate to the Engine component and are kept for backwards compatibility - - Version string - APIVersion string `json:"ApiVersion"` - MinAPIVersion string `json:"MinAPIVersion,omitempty"` - GitCommit string - GoVersion string - Os string - Arch string - KernelVersion string `json:",omitempty"` - Experimental bool `json:",omitempty"` - BuildTime string `json:",omitempty"` -} - -// Commit holds the Git-commit (SHA1) that a binary was built from, as reported -// in the version-string of external tools, such as containerd, or runC. -type Commit struct { - ID string // ID is the actual commit ID of external tool. - Expected string // Expected is the commit ID of external tool expected by dockerd as set at build time. -} - -// Info contains response of Engine API: -// GET "/info" -type Info struct { - ID string - Containers int - ContainersRunning int - ContainersPaused int - ContainersStopped int - Images int - Driver string - DriverStatus [][2]string - SystemStatus [][2]string - Plugins PluginsInfo - MemoryLimit bool - SwapLimit bool - KernelMemory bool - CPUCfsPeriod bool `json:"CpuCfsPeriod"` - CPUCfsQuota bool `json:"CpuCfsQuota"` - CPUShares bool - CPUSet bool - IPv4Forwarding bool - BridgeNfIptables bool - BridgeNfIP6tables bool `json:"BridgeNfIp6tables"` - Debug bool - NFd int - OomKillDisable bool - NGoroutines int - SystemTime string - LoggingDriver string - CgroupDriver string - NEventsListener int - KernelVersion string - OperatingSystem string - OSType string - Architecture string - IndexServerAddress string - RegistryConfig *registry.ServiceConfig - NCPU int - MemTotal int64 - GenericResources []swarm.GenericResource - DockerRootDir string - HTTPProxy string `json:"HttpProxy"` - HTTPSProxy string `json:"HttpsProxy"` - NoProxy string - Name string - Labels []string - ExperimentalBuild bool - ServerVersion string - ClusterStore string - ClusterAdvertise string - Runtimes map[string]Runtime - DefaultRuntime string - Swarm swarm.Info - // LiveRestoreEnabled determines whether containers should be kept - // running when the daemon is shutdown or upon daemon start if - // running containers are detected - LiveRestoreEnabled bool - Isolation container.Isolation - InitBinary string - ContainerdCommit Commit - RuncCommit Commit - InitCommit Commit - SecurityOptions []string - ProductLicense string `json:",omitempty"` - Warnings []string -} - -// KeyValue holds a key/value pair -type KeyValue struct { - Key, Value string -} - -// SecurityOpt contains the name and options of a security option -type SecurityOpt struct { - Name string - Options []KeyValue -} - -// DecodeSecurityOptions decodes a security options string slice to a type safe -// SecurityOpt -func DecodeSecurityOptions(opts []string) ([]SecurityOpt, error) { - so := []SecurityOpt{} - for _, opt := range opts { - // support output from a < 1.13 docker daemon - if !strings.Contains(opt, "=") { - so = append(so, SecurityOpt{Name: opt}) - continue - } - secopt := SecurityOpt{} - split := strings.Split(opt, ",") - for _, s := range split { - kv := strings.SplitN(s, "=", 2) - if len(kv) != 2 { - return nil, fmt.Errorf("invalid security option %q", s) - } - if kv[0] == "" || kv[1] == "" { - return nil, errors.New("invalid empty security option") - } - if kv[0] == "name" { - secopt.Name = kv[1] - continue - } - secopt.Options = append(secopt.Options, KeyValue{Key: kv[0], Value: kv[1]}) - } - so = append(so, secopt) - } - return so, nil -} - -// PluginsInfo is a temp struct holding Plugins name -// registered with docker daemon. It is used by Info struct -type PluginsInfo struct { - // List of Volume plugins registered - Volume []string - // List of Network plugins registered - Network []string - // List of Authorization plugins registered - Authorization []string - // List of Log plugins registered - Log []string -} - -// ExecStartCheck is a temp struct used by execStart -// Config fields is part of ExecConfig in runconfig package -type ExecStartCheck struct { - // ExecStart will first check if it's detached - Detach bool - // Check if there's a tty - Tty bool -} - -// HealthcheckResult stores information about a single run of a healthcheck probe -type HealthcheckResult struct { - Start time.Time // Start is the time this check started - End time.Time // End is the time this check ended - ExitCode int // ExitCode meanings: 0=healthy, 1=unhealthy, 2=reserved (considered unhealthy), else=error running probe - Output string // Output from last check -} - -// Health states -const ( - NoHealthcheck = "none" // Indicates there is no healthcheck - Starting = "starting" // Starting indicates that the container is not yet ready - Healthy = "healthy" // Healthy indicates that the container is running correctly - Unhealthy = "unhealthy" // Unhealthy indicates that the container has a problem -) - -// Health stores information about the container's healthcheck results -type Health struct { - Status string // Status is one of Starting, Healthy or Unhealthy - FailingStreak int // FailingStreak is the number of consecutive failures - Log []*HealthcheckResult // Log contains the last few results (oldest first) -} - -// ContainerState stores container's running state -// it's part of ContainerJSONBase and will return by "inspect" command -type ContainerState struct { - Status string // String representation of the container state. Can be one of "created", "running", "paused", "restarting", "removing", "exited", or "dead" - Running bool - Paused bool - Restarting bool - OOMKilled bool - Dead bool - Pid int - ExitCode int - Error string - StartedAt string - FinishedAt string - Health *Health `json:",omitempty"` -} - -// ContainerNode stores information about the node that a container -// is running on. It's only available in Docker Swarm -type ContainerNode struct { - ID string - IPAddress string `json:"IP"` - Addr string - Name string - Cpus int - Memory int64 - Labels map[string]string -} - -// ContainerJSONBase contains response of Engine API: -// GET "/containers/{name:.*}/json" -type ContainerJSONBase struct { - ID string `json:"Id"` - Created string - Path string - Args []string - State *ContainerState - Image string - ResolvConfPath string - HostnamePath string - HostsPath string - LogPath string - Node *ContainerNode `json:",omitempty"` - Name string - RestartCount int - Driver string - Platform string - MountLabel string - ProcessLabel string - AppArmorProfile string - ExecIDs []string - HostConfig *container.HostConfig - GraphDriver GraphDriverData - SizeRw *int64 `json:",omitempty"` - SizeRootFs *int64 `json:",omitempty"` -} - -// ContainerJSON is newly used struct along with MountPoint -type ContainerJSON struct { - *ContainerJSONBase - Mounts []MountPoint - Config *container.Config - NetworkSettings *NetworkSettings -} - -// NetworkSettings exposes the network settings in the api -type NetworkSettings struct { - NetworkSettingsBase - DefaultNetworkSettings - Networks map[string]*network.EndpointSettings -} - -// SummaryNetworkSettings provides a summary of container's networks -// in /containers/json -type SummaryNetworkSettings struct { - Networks map[string]*network.EndpointSettings -} - -// NetworkSettingsBase holds basic information about networks -type NetworkSettingsBase struct { - Bridge string // Bridge is the Bridge name the network uses(e.g. `docker0`) - SandboxID string // SandboxID uniquely represents a container's network stack - HairpinMode bool // HairpinMode specifies if hairpin NAT should be enabled on the virtual interface - LinkLocalIPv6Address string // LinkLocalIPv6Address is an IPv6 unicast address using the link-local prefix - LinkLocalIPv6PrefixLen int // LinkLocalIPv6PrefixLen is the prefix length of an IPv6 unicast address - Ports nat.PortMap // Ports is a collection of PortBinding indexed by Port - SandboxKey string // SandboxKey identifies the sandbox - SecondaryIPAddresses []network.Address - SecondaryIPv6Addresses []network.Address -} - -// DefaultNetworkSettings holds network information -// during the 2 release deprecation period. -// It will be removed in Docker 1.11. -type DefaultNetworkSettings struct { - EndpointID string // EndpointID uniquely represents a service endpoint in a Sandbox - Gateway string // Gateway holds the gateway address for the network - GlobalIPv6Address string // GlobalIPv6Address holds network's global IPv6 address - GlobalIPv6PrefixLen int // GlobalIPv6PrefixLen represents mask length of network's global IPv6 address - IPAddress string // IPAddress holds the IPv4 address for the network - IPPrefixLen int // IPPrefixLen represents mask length of network's IPv4 address - IPv6Gateway string // IPv6Gateway holds gateway address specific for IPv6 - MacAddress string // MacAddress holds the MAC address for the network -} - -// MountPoint represents a mount point configuration inside the container. -// This is used for reporting the mountpoints in use by a container. -type MountPoint struct { - Type mount.Type `json:",omitempty"` - Name string `json:",omitempty"` - Source string - Destination string - Driver string `json:",omitempty"` - Mode string - RW bool - Propagation mount.Propagation -} - -// NetworkResource is the body of the "get network" http response message -type NetworkResource struct { - Name string // Name is the requested name of the network - ID string `json:"Id"` // ID uniquely identifies a network on a single machine - Created time.Time // Created is the time the network created - Scope string // Scope describes the level at which the network exists (e.g. `swarm` for cluster-wide or `local` for machine level) - Driver string // Driver is the Driver name used to create the network (e.g. `bridge`, `overlay`) - EnableIPv6 bool // EnableIPv6 represents whether to enable IPv6 - IPAM network.IPAM // IPAM is the network's IP Address Management - Internal bool // Internal represents if the network is used internal only - Attachable bool // Attachable represents if the global scope is manually attachable by regular containers from workers in swarm mode. - Ingress bool // Ingress indicates the network is providing the routing-mesh for the swarm cluster. - ConfigFrom network.ConfigReference // ConfigFrom specifies the source which will provide the configuration for this network. - ConfigOnly bool // ConfigOnly networks are place-holder networks for network configurations to be used by other networks. ConfigOnly networks cannot be used directly to run containers or services. - Containers map[string]EndpointResource // Containers contains endpoints belonging to the network - Options map[string]string // Options holds the network specific options to use for when creating the network - Labels map[string]string // Labels holds metadata specific to the network being created - Peers []network.PeerInfo `json:",omitempty"` // List of peer nodes for an overlay network - Services map[string]network.ServiceInfo `json:",omitempty"` -} - -// EndpointResource contains network resources allocated and used for a container in a network -type EndpointResource struct { - Name string - EndpointID string - MacAddress string - IPv4Address string - IPv6Address string -} - -// NetworkCreate is the expected body of the "create network" http request message -type NetworkCreate struct { - // Check for networks with duplicate names. - // Network is primarily keyed based on a random ID and not on the name. - // Network name is strictly a user-friendly alias to the network - // which is uniquely identified using ID. - // And there is no guaranteed way to check for duplicates. - // Option CheckDuplicate is there to provide a best effort checking of any networks - // which has the same name but it is not guaranteed to catch all name collisions. - CheckDuplicate bool - Driver string - Scope string - EnableIPv6 bool - IPAM *network.IPAM - Internal bool - Attachable bool - Ingress bool - ConfigOnly bool - ConfigFrom *network.ConfigReference - Options map[string]string - Labels map[string]string -} - -// NetworkCreateRequest is the request message sent to the server for network create call. -type NetworkCreateRequest struct { - NetworkCreate - Name string -} - -// NetworkCreateResponse is the response message sent by the server for network create call -type NetworkCreateResponse struct { - ID string `json:"Id"` - Warning string -} - -// NetworkConnect represents the data to be used to connect a container to the network -type NetworkConnect struct { - Container string - EndpointConfig *network.EndpointSettings `json:",omitempty"` -} - -// NetworkDisconnect represents the data to be used to disconnect a container from the network -type NetworkDisconnect struct { - Container string - Force bool -} - -// NetworkInspectOptions holds parameters to inspect network -type NetworkInspectOptions struct { - Scope string - Verbose bool -} - -// Checkpoint represents the details of a checkpoint -type Checkpoint struct { - Name string // Name is the name of the checkpoint -} - -// Runtime describes an OCI runtime -type Runtime struct { - Path string `json:"path"` - Args []string `json:"runtimeArgs,omitempty"` -} - -// DiskUsage contains response of Engine API: -// GET "/system/df" -type DiskUsage struct { - LayersSize int64 - Images []*ImageSummary - Containers []*Container - Volumes []*Volume - BuildCache []*BuildCache - BuilderSize int64 // deprecated -} - -// ContainersPruneReport contains the response for Engine API: -// POST "/containers/prune" -type ContainersPruneReport struct { - ContainersDeleted []string - SpaceReclaimed uint64 -} - -// VolumesPruneReport contains the response for Engine API: -// POST "/volumes/prune" -type VolumesPruneReport struct { - VolumesDeleted []string - SpaceReclaimed uint64 -} - -// ImagesPruneReport contains the response for Engine API: -// POST "/images/prune" -type ImagesPruneReport struct { - ImagesDeleted []ImageDeleteResponseItem - SpaceReclaimed uint64 -} - -// BuildCachePruneReport contains the response for Engine API: -// POST "/build/prune" -type BuildCachePruneReport struct { - SpaceReclaimed uint64 -} - -// NetworksPruneReport contains the response for Engine API: -// POST "/networks/prune" -type NetworksPruneReport struct { - NetworksDeleted []string -} - -// SecretCreateResponse contains the information returned to a client -// on the creation of a new secret. -type SecretCreateResponse struct { - // ID is the id of the created secret. - ID string -} - -// SecretListOptions holds parameters to list secrets -type SecretListOptions struct { - Filters filters.Args -} - -// ConfigCreateResponse contains the information returned to a client -// on the creation of a new config. -type ConfigCreateResponse struct { - // ID is the id of the created config. - ID string -} - -// ConfigListOptions holds parameters to list configs -type ConfigListOptions struct { - Filters filters.Args -} - -// PushResult contains the tag, manifest digest, and manifest size from the -// push. It's used to signal this information to the trust code in the client -// so it can sign the manifest if necessary. -type PushResult struct { - Tag string - Digest string - Size int -} - -// BuildResult contains the image id of a successful build -type BuildResult struct { - ID string -} - -// BuildCache contains information about a build cache record -type BuildCache struct { - ID string - Mutable bool - InUse bool - Size int64 - - CreatedAt time.Time - LastUsedAt *time.Time - UsageCount int - Parent string - Description string -} diff --git a/vendor/github.com/docker/docker/api/types/volume.go b/vendor/github.com/docker/docker/api/types/volume.go deleted file mode 100644 index b5ee96a5..00000000 --- a/vendor/github.com/docker/docker/api/types/volume.go +++ /dev/null @@ -1,69 +0,0 @@ -package types - -// This file was generated by the swagger tool. -// Editing this file might prove futile when you re-run the swagger generate command - -// Volume volume -// swagger:model Volume -type Volume struct { - - // Date/Time the volume was created. - CreatedAt string `json:"CreatedAt,omitempty"` - - // Name of the volume driver used by the volume. - // Required: true - Driver string `json:"Driver"` - - // User-defined key/value metadata. - // Required: true - Labels map[string]string `json:"Labels"` - - // Mount path of the volume on the host. - // Required: true - Mountpoint string `json:"Mountpoint"` - - // Name of the volume. - // Required: true - Name string `json:"Name"` - - // The driver specific options used when creating the volume. - // Required: true - Options map[string]string `json:"Options"` - - // The level at which the volume exists. Either `global` for cluster-wide, or `local` for machine level. - // Required: true - Scope string `json:"Scope"` - - // Low-level details about the volume, provided by the volume driver. - // Details are returned as a map with key/value pairs: - // `{"key":"value","key2":"value2"}`. - // - // The `Status` field is optional, and is omitted if the volume driver - // does not support this feature. - // - Status map[string]interface{} `json:"Status,omitempty"` - - // usage data - UsageData *VolumeUsageData `json:"UsageData,omitempty"` -} - -// VolumeUsageData Usage details about the volume. This information is used by the -// `GET /system/df` endpoint, and omitted in other endpoints. -// -// swagger:model VolumeUsageData -type VolumeUsageData struct { - - // The number of containers referencing this volume. This field - // is set to `-1` if the reference-count is not available. - // - // Required: true - RefCount int64 `json:"RefCount"` - - // Amount of disk space used by the volume (in bytes). This information - // is only available for volumes created with the `"local"` volume - // driver. For volumes created with other volume drivers, this field - // is set to `-1` ("not available") - // - // Required: true - Size int64 `json:"Size"` -} diff --git a/vendor/github.com/docker/docker/errdefs/defs.go b/vendor/github.com/docker/docker/errdefs/defs.go index e6a2275b..61e7456b 100644 --- a/vendor/github.com/docker/docker/errdefs/defs.go +++ b/vendor/github.com/docker/docker/errdefs/defs.go @@ -43,11 +43,6 @@ type ErrNotModified interface { NotModified() } -// ErrAlreadyExists is a special case of ErrConflict which signals that the desired object already exists -type ErrAlreadyExists interface { - AlreadyExists() -} - // ErrNotImplemented signals that the requested action/feature is not implemented on the system as configured. type ErrNotImplemented interface { NotImplemented() diff --git a/vendor/github.com/docker/docker/errdefs/helpers.go b/vendor/github.com/docker/docker/errdefs/helpers.go index 6169c2bc..c9916e01 100644 --- a/vendor/github.com/docker/docker/errdefs/helpers.go +++ b/vendor/github.com/docker/docker/errdefs/helpers.go @@ -12,8 +12,8 @@ func (e errNotFound) Cause() error { // NotFound is a helper to create an error of the class with the same name from any error type func NotFound(err error) error { - if err == nil { - return nil + if err == nil || IsNotFound(err) { + return err } return errNotFound{err} } @@ -28,8 +28,8 @@ func (e errInvalidParameter) Cause() error { // InvalidParameter is a helper to create an error of the class with the same name from any error type func InvalidParameter(err error) error { - if err == nil { - return nil + if err == nil || IsInvalidParameter(err) { + return err } return errInvalidParameter{err} } @@ -44,8 +44,8 @@ func (e errConflict) Cause() error { // Conflict is a helper to create an error of the class with the same name from any error type func Conflict(err error) error { - if err == nil { - return nil + if err == nil || IsConflict(err) { + return err } return errConflict{err} } @@ -60,8 +60,8 @@ func (e errUnauthorized) Cause() error { // Unauthorized is a helper to create an error of the class with the same name from any error type func Unauthorized(err error) error { - if err == nil { - return nil + if err == nil || IsUnauthorized(err) { + return err } return errUnauthorized{err} } @@ -76,6 +76,9 @@ func (e errUnavailable) Cause() error { // Unavailable is a helper to create an error of the class with the same name from any error type func Unavailable(err error) error { + if err == nil || IsUnavailable(err) { + return err + } return errUnavailable{err} } @@ -89,8 +92,8 @@ func (e errForbidden) Cause() error { // Forbidden is a helper to create an error of the class with the same name from any error type func Forbidden(err error) error { - if err == nil { - return nil + if err == nil || IsForbidden(err) { + return err } return errForbidden{err} } @@ -105,8 +108,8 @@ func (e errSystem) Cause() error { // System is a helper to create an error of the class with the same name from any error type func System(err error) error { - if err == nil { - return nil + if err == nil || IsSystem(err) { + return err } return errSystem{err} } @@ -121,28 +124,12 @@ func (e errNotModified) Cause() error { // NotModified is a helper to create an error of the class with the same name from any error type func NotModified(err error) error { - if err == nil { - return nil + if err == nil || IsNotModified(err) { + return err } return errNotModified{err} } -type errAlreadyExists struct{ error } - -func (errAlreadyExists) AlreadyExists() {} - -func (e errAlreadyExists) Cause() error { - return e.error -} - -// AlreadyExists is a helper to create an error of the class with the same name from any error type -func AlreadyExists(err error) error { - if err == nil { - return nil - } - return errAlreadyExists{err} -} - type errNotImplemented struct{ error } func (errNotImplemented) NotImplemented() {} @@ -153,8 +140,8 @@ func (e errNotImplemented) Cause() error { // NotImplemented is a helper to create an error of the class with the same name from any error type func NotImplemented(err error) error { - if err == nil { - return nil + if err == nil || IsNotImplemented(err) { + return err } return errNotImplemented{err} } @@ -169,8 +156,8 @@ func (e errUnknown) Cause() error { // Unknown is a helper to create an error of the class with the same name from any error type func Unknown(err error) error { - if err == nil { - return nil + if err == nil || IsUnknown(err) { + return err } return errUnknown{err} } @@ -185,8 +172,8 @@ func (e errCancelled) Cause() error { // Cancelled is a helper to create an error of the class with the same name from any error type func Cancelled(err error) error { - if err == nil { - return nil + if err == nil || IsCancelled(err) { + return err } return errCancelled{err} } @@ -201,8 +188,8 @@ func (e errDeadline) Cause() error { // Deadline is a helper to create an error of the class with the same name from any error type func Deadline(err error) error { - if err == nil { - return nil + if err == nil || IsDeadline(err) { + return err } return errDeadline{err} } @@ -217,8 +204,8 @@ func (e errDataLoss) Cause() error { // DataLoss is a helper to create an error of the class with the same name from any error type func DataLoss(err error) error { - if err == nil { - return nil + if err == nil || IsDataLoss(err) { + return err } return errDataLoss{err} } diff --git a/vendor/github.com/docker/docker/errdefs/http_helpers.go b/vendor/github.com/docker/docker/errdefs/http_helpers.go new file mode 100644 index 00000000..07552f1c --- /dev/null +++ b/vendor/github.com/docker/docker/errdefs/http_helpers.go @@ -0,0 +1,191 @@ +package errdefs // import "github.com/docker/docker/errdefs" + +import ( + "fmt" + "net/http" + + containerderrors "github.com/containerd/containerd/errdefs" + "github.com/docker/distribution/registry/api/errcode" + "github.com/sirupsen/logrus" + "google.golang.org/grpc/codes" + "google.golang.org/grpc/status" +) + +// GetHTTPErrorStatusCode retrieves status code from error message. +func GetHTTPErrorStatusCode(err error) int { + if err == nil { + logrus.WithFields(logrus.Fields{"error": err}).Error("unexpected HTTP error handling") + return http.StatusInternalServerError + } + + var statusCode int + + // Stop right there + // Are you sure you should be adding a new error class here? Do one of the existing ones work? + + // Note that the below functions are already checking the error causal chain for matches. + switch { + case IsNotFound(err): + statusCode = http.StatusNotFound + case IsInvalidParameter(err): + statusCode = http.StatusBadRequest + case IsConflict(err): + statusCode = http.StatusConflict + case IsUnauthorized(err): + statusCode = http.StatusUnauthorized + case IsUnavailable(err): + statusCode = http.StatusServiceUnavailable + case IsForbidden(err): + statusCode = http.StatusForbidden + case IsNotModified(err): + statusCode = http.StatusNotModified + case IsNotImplemented(err): + statusCode = http.StatusNotImplemented + case IsSystem(err) || IsUnknown(err) || IsDataLoss(err) || IsDeadline(err) || IsCancelled(err): + statusCode = http.StatusInternalServerError + default: + statusCode = statusCodeFromGRPCError(err) + if statusCode != http.StatusInternalServerError { + return statusCode + } + statusCode = statusCodeFromContainerdError(err) + if statusCode != http.StatusInternalServerError { + return statusCode + } + statusCode = statusCodeFromDistributionError(err) + if statusCode != http.StatusInternalServerError { + return statusCode + } + if e, ok := err.(causer); ok { + return GetHTTPErrorStatusCode(e.Cause()) + } + + logrus.WithFields(logrus.Fields{ + "module": "api", + "error_type": fmt.Sprintf("%T", err), + }).Debugf("FIXME: Got an API for which error does not match any expected type!!!: %+v", err) + } + + if statusCode == 0 { + statusCode = http.StatusInternalServerError + } + + return statusCode +} + +// FromStatusCode creates an errdef error, based on the provided HTTP status-code +func FromStatusCode(err error, statusCode int) error { + if err == nil { + return err + } + switch statusCode { + case http.StatusNotFound: + err = NotFound(err) + case http.StatusBadRequest: + err = InvalidParameter(err) + case http.StatusConflict: + err = Conflict(err) + case http.StatusUnauthorized: + err = Unauthorized(err) + case http.StatusServiceUnavailable: + err = Unavailable(err) + case http.StatusForbidden: + err = Forbidden(err) + case http.StatusNotModified: + err = NotModified(err) + case http.StatusNotImplemented: + err = NotImplemented(err) + case http.StatusInternalServerError: + if !IsSystem(err) && !IsUnknown(err) && !IsDataLoss(err) && !IsDeadline(err) && !IsCancelled(err) { + err = System(err) + } + default: + logrus.WithFields(logrus.Fields{ + "module": "api", + "status_code": fmt.Sprintf("%d", statusCode), + }).Debugf("FIXME: Got an status-code for which error does not match any expected type!!!: %d", statusCode) + + switch { + case statusCode >= 200 && statusCode < 400: + // it's a client error + case statusCode >= 400 && statusCode < 500: + err = InvalidParameter(err) + case statusCode >= 500 && statusCode < 600: + err = System(err) + default: + err = Unknown(err) + } + } + return err +} + +// statusCodeFromGRPCError returns status code according to gRPC error +func statusCodeFromGRPCError(err error) int { + switch status.Code(err) { + case codes.InvalidArgument: // code 3 + return http.StatusBadRequest + case codes.NotFound: // code 5 + return http.StatusNotFound + case codes.AlreadyExists: // code 6 + return http.StatusConflict + case codes.PermissionDenied: // code 7 + return http.StatusForbidden + case codes.FailedPrecondition: // code 9 + return http.StatusBadRequest + case codes.Unauthenticated: // code 16 + return http.StatusUnauthorized + case codes.OutOfRange: // code 11 + return http.StatusBadRequest + case codes.Unimplemented: // code 12 + return http.StatusNotImplemented + case codes.Unavailable: // code 14 + return http.StatusServiceUnavailable + default: + // codes.Canceled(1) + // codes.Unknown(2) + // codes.DeadlineExceeded(4) + // codes.ResourceExhausted(8) + // codes.Aborted(10) + // codes.Internal(13) + // codes.DataLoss(15) + return http.StatusInternalServerError + } +} + +// statusCodeFromDistributionError returns status code according to registry errcode +// code is loosely based on errcode.ServeJSON() in docker/distribution +func statusCodeFromDistributionError(err error) int { + switch errs := err.(type) { + case errcode.Errors: + if len(errs) < 1 { + return http.StatusInternalServerError + } + if _, ok := errs[0].(errcode.ErrorCoder); ok { + return statusCodeFromDistributionError(errs[0]) + } + case errcode.ErrorCoder: + return errs.ErrorCode().Descriptor().HTTPStatusCode + } + return http.StatusInternalServerError +} + +// statusCodeFromContainerdError returns status code for containerd errors when +// consumed directly (not through gRPC) +func statusCodeFromContainerdError(err error) int { + switch { + case containerderrors.IsInvalidArgument(err): + return http.StatusBadRequest + case containerderrors.IsNotFound(err): + return http.StatusNotFound + case containerderrors.IsAlreadyExists(err): + return http.StatusConflict + case containerderrors.IsFailedPrecondition(err): + return http.StatusPreconditionFailed + case containerderrors.IsUnavailable(err): + return http.StatusServiceUnavailable + case containerderrors.IsNotImplemented(err): + return http.StatusNotImplemented + default: + return http.StatusInternalServerError + } +} diff --git a/vendor/github.com/docker/docker/errdefs/is.go b/vendor/github.com/docker/docker/errdefs/is.go index e0513331..3abf07d0 100644 --- a/vendor/github.com/docker/docker/errdefs/is.go +++ b/vendor/github.com/docker/docker/errdefs/is.go @@ -15,7 +15,6 @@ func getImplementer(err error) error { ErrForbidden, ErrSystem, ErrNotModified, - ErrAlreadyExists, ErrNotImplemented, ErrCancelled, ErrDeadline, @@ -77,12 +76,6 @@ func IsNotModified(err error) bool { return ok } -// IsAlreadyExists returns if the passed in error is a AlreadyExists error -func IsAlreadyExists(err error) bool { - _, ok := getImplementer(err).(ErrAlreadyExists) - return ok -} - // IsNotImplemented returns if the passed in error is an ErrNotImplemented func IsNotImplemented(err error) bool { _, ok := getImplementer(err).(ErrNotImplemented) diff --git a/vendor/github.com/docker/docker/opts/address_pools.go b/vendor/github.com/docker/docker/opts/address_pools.go deleted file mode 100644 index 9b27a628..00000000 --- a/vendor/github.com/docker/docker/opts/address_pools.go +++ /dev/null @@ -1,84 +0,0 @@ -package opts - -import ( - "encoding/csv" - "encoding/json" - "fmt" - "strconv" - "strings" - - types "github.com/docker/libnetwork/ipamutils" -) - -// PoolsOpt is a Value type for parsing the default address pools definitions -type PoolsOpt struct { - values []*types.NetworkToSplit -} - -// UnmarshalJSON fills values structure info from JSON input -func (p *PoolsOpt) UnmarshalJSON(raw []byte) error { - return json.Unmarshal(raw, &(p.values)) -} - -// Set predefined pools -func (p *PoolsOpt) Set(value string) error { - csvReader := csv.NewReader(strings.NewReader(value)) - fields, err := csvReader.Read() - if err != nil { - return err - } - - poolsDef := types.NetworkToSplit{} - - for _, field := range fields { - parts := strings.SplitN(field, "=", 2) - if len(parts) != 2 { - return fmt.Errorf("invalid field '%s' must be a key=value pair", field) - } - - key := strings.ToLower(parts[0]) - value := strings.ToLower(parts[1]) - - switch key { - case "base": - poolsDef.Base = value - case "size": - size, err := strconv.Atoi(value) - if err != nil { - return fmt.Errorf("invalid size value: %q (must be integer): %v", value, err) - } - poolsDef.Size = size - default: - return fmt.Errorf("unexpected key '%s' in '%s'", key, field) - } - } - - p.values = append(p.values, &poolsDef) - - return nil -} - -// Type returns the type of this option -func (p *PoolsOpt) Type() string { - return "pool-options" -} - -// String returns a string repr of this option -func (p *PoolsOpt) String() string { - var pools []string - for _, pool := range p.values { - repr := fmt.Sprintf("%s %d", pool.Base, pool.Size) - pools = append(pools, repr) - } - return strings.Join(pools, ", ") -} - -// Value returns the mounts -func (p *PoolsOpt) Value() []*types.NetworkToSplit { - return p.values -} - -// Name returns the flag name of this option -func (p *PoolsOpt) Name() string { - return "default-address-pools" -} diff --git a/vendor/github.com/docker/docker/opts/env.go b/vendor/github.com/docker/docker/opts/env.go deleted file mode 100644 index f6e5e907..00000000 --- a/vendor/github.com/docker/docker/opts/env.go +++ /dev/null @@ -1,48 +0,0 @@ -package opts // import "github.com/docker/docker/opts" - -import ( - "fmt" - "os" - "runtime" - "strings" - - "github.com/pkg/errors" -) - -// ValidateEnv validates an environment variable and returns it. -// If no value is specified, it returns the current value using os.Getenv. -// -// As on ParseEnvFile and related to #16585, environment variable names -// are not validate what so ever, it's up to application inside docker -// to validate them or not. -// -// The only validation here is to check if name is empty, per #25099 -func ValidateEnv(val string) (string, error) { - arr := strings.Split(val, "=") - if arr[0] == "" { - return "", errors.Errorf("invalid environment variable: %s", val) - } - if len(arr) > 1 { - return val, nil - } - if !doesEnvExist(val) { - return val, nil - } - return fmt.Sprintf("%s=%s", val, os.Getenv(val)), nil -} - -func doesEnvExist(name string) bool { - for _, entry := range os.Environ() { - parts := strings.SplitN(entry, "=", 2) - if runtime.GOOS == "windows" { - // Environment variable are case-insensitive on Windows. PaTh, path and PATH are equivalent. - if strings.EqualFold(parts[0], name) { - return true - } - } - if parts[0] == name { - return true - } - } - return false -} diff --git a/vendor/github.com/docker/docker/opts/hosts.go b/vendor/github.com/docker/docker/opts/hosts.go deleted file mode 100644 index 2adf4211..00000000 --- a/vendor/github.com/docker/docker/opts/hosts.go +++ /dev/null @@ -1,165 +0,0 @@ -package opts // import "github.com/docker/docker/opts" - -import ( - "fmt" - "net" - "net/url" - "strconv" - "strings" -) - -var ( - // DefaultHTTPPort Default HTTP Port used if only the protocol is provided to -H flag e.g. dockerd -H tcp:// - // These are the IANA registered port numbers for use with Docker - // see http://www.iana.org/assignments/service-names-port-numbers/service-names-port-numbers.xhtml?search=docker - DefaultHTTPPort = 2375 // Default HTTP Port - // DefaultTLSHTTPPort Default HTTP Port used when TLS enabled - DefaultTLSHTTPPort = 2376 // Default TLS encrypted HTTP Port - // DefaultUnixSocket Path for the unix socket. - // Docker daemon by default always listens on the default unix socket - DefaultUnixSocket = "/var/run/docker.sock" - // DefaultTCPHost constant defines the default host string used by docker on Windows - DefaultTCPHost = fmt.Sprintf("tcp://%s:%d", DefaultHTTPHost, DefaultHTTPPort) - // DefaultTLSHost constant defines the default host string used by docker for TLS sockets - DefaultTLSHost = fmt.Sprintf("tcp://%s:%d", DefaultHTTPHost, DefaultTLSHTTPPort) - // DefaultNamedPipe defines the default named pipe used by docker on Windows - DefaultNamedPipe = `//./pipe/docker_engine` -) - -// ValidateHost validates that the specified string is a valid host and returns it. -func ValidateHost(val string) (string, error) { - host := strings.TrimSpace(val) - // The empty string means default and is not handled by parseDaemonHost - if host != "" { - _, err := parseDaemonHost(host) - if err != nil { - return val, err - } - } - // Note: unlike most flag validators, we don't return the mutated value here - // we need to know what the user entered later (using ParseHost) to adjust for TLS - return val, nil -} - -// ParseHost and set defaults for a Daemon host string -func ParseHost(defaultToTLS bool, val string) (string, error) { - host := strings.TrimSpace(val) - if host == "" { - if defaultToTLS { - host = DefaultTLSHost - } else { - host = DefaultHost - } - } else { - var err error - host, err = parseDaemonHost(host) - if err != nil { - return val, err - } - } - return host, nil -} - -// parseDaemonHost parses the specified address and returns an address that will be used as the host. -// Depending of the address specified, this may return one of the global Default* strings defined in hosts.go. -func parseDaemonHost(addr string) (string, error) { - addrParts := strings.SplitN(addr, "://", 2) - if len(addrParts) == 1 && addrParts[0] != "" { - addrParts = []string{"tcp", addrParts[0]} - } - - switch addrParts[0] { - case "tcp": - return ParseTCPAddr(addrParts[1], DefaultTCPHost) - case "unix": - return parseSimpleProtoAddr("unix", addrParts[1], DefaultUnixSocket) - case "npipe": - return parseSimpleProtoAddr("npipe", addrParts[1], DefaultNamedPipe) - case "fd": - return addr, nil - default: - return "", fmt.Errorf("Invalid bind address format: %s", addr) - } -} - -// parseSimpleProtoAddr parses and validates that the specified address is a valid -// socket address for simple protocols like unix and npipe. It returns a formatted -// socket address, either using the address parsed from addr, or the contents of -// defaultAddr if addr is a blank string. -func parseSimpleProtoAddr(proto, addr, defaultAddr string) (string, error) { - addr = strings.TrimPrefix(addr, proto+"://") - if strings.Contains(addr, "://") { - return "", fmt.Errorf("Invalid proto, expected %s: %s", proto, addr) - } - if addr == "" { - addr = defaultAddr - } - return fmt.Sprintf("%s://%s", proto, addr), nil -} - -// ParseTCPAddr parses and validates that the specified address is a valid TCP -// address. It returns a formatted TCP address, either using the address parsed -// from tryAddr, or the contents of defaultAddr if tryAddr is a blank string. -// tryAddr is expected to have already been Trim()'d -// defaultAddr must be in the full `tcp://host:port` form -func ParseTCPAddr(tryAddr string, defaultAddr string) (string, error) { - if tryAddr == "" || tryAddr == "tcp://" { - return defaultAddr, nil - } - addr := strings.TrimPrefix(tryAddr, "tcp://") - if strings.Contains(addr, "://") || addr == "" { - return "", fmt.Errorf("Invalid proto, expected tcp: %s", tryAddr) - } - - defaultAddr = strings.TrimPrefix(defaultAddr, "tcp://") - defaultHost, defaultPort, err := net.SplitHostPort(defaultAddr) - if err != nil { - return "", err - } - // url.Parse fails for trailing colon on IPv6 brackets on Go 1.5, but - // not 1.4. See https://github.com/golang/go/issues/12200 and - // https://github.com/golang/go/issues/6530. - if strings.HasSuffix(addr, "]:") { - addr += defaultPort - } - - u, err := url.Parse("tcp://" + addr) - if err != nil { - return "", err - } - host, port, err := net.SplitHostPort(u.Host) - if err != nil { - // try port addition once - host, port, err = net.SplitHostPort(net.JoinHostPort(u.Host, defaultPort)) - } - if err != nil { - return "", fmt.Errorf("Invalid bind address format: %s", tryAddr) - } - - if host == "" { - host = defaultHost - } - if port == "" { - port = defaultPort - } - p, err := strconv.Atoi(port) - if err != nil && p == 0 { - return "", fmt.Errorf("Invalid bind address format: %s", tryAddr) - } - - return fmt.Sprintf("tcp://%s%s", net.JoinHostPort(host, port), u.Path), nil -} - -// ValidateExtraHost validates that the specified string is a valid extrahost and returns it. -// ExtraHost is in the form of name:ip where the ip has to be a valid ip (IPv4 or IPv6). -func ValidateExtraHost(val string) (string, error) { - // allow for IPv6 addresses in extra hosts by only splitting on first ":" - arr := strings.SplitN(val, ":", 2) - if len(arr) != 2 || len(arr[0]) == 0 { - return "", fmt.Errorf("bad format for add-host: %q", val) - } - if _, err := ValidateIPAddress(arr[1]); err != nil { - return "", fmt.Errorf("invalid IP address in add-host: %q", arr[1]) - } - return val, nil -} diff --git a/vendor/github.com/docker/docker/opts/hosts_unix.go b/vendor/github.com/docker/docker/opts/hosts_unix.go deleted file mode 100644 index 9d5bb645..00000000 --- a/vendor/github.com/docker/docker/opts/hosts_unix.go +++ /dev/null @@ -1,8 +0,0 @@ -// +build !windows - -package opts // import "github.com/docker/docker/opts" - -import "fmt" - -// DefaultHost constant defines the default host string used by docker on other hosts than Windows -var DefaultHost = fmt.Sprintf("unix://%s", DefaultUnixSocket) diff --git a/vendor/github.com/docker/docker/opts/hosts_windows.go b/vendor/github.com/docker/docker/opts/hosts_windows.go deleted file mode 100644 index 906eba53..00000000 --- a/vendor/github.com/docker/docker/opts/hosts_windows.go +++ /dev/null @@ -1,4 +0,0 @@ -package opts // import "github.com/docker/docker/opts" - -// DefaultHost constant defines the default host string used by docker on Windows -var DefaultHost = "npipe://" + DefaultNamedPipe diff --git a/vendor/github.com/docker/docker/opts/ip.go b/vendor/github.com/docker/docker/opts/ip.go deleted file mode 100644 index cfbff3a9..00000000 --- a/vendor/github.com/docker/docker/opts/ip.go +++ /dev/null @@ -1,47 +0,0 @@ -package opts // import "github.com/docker/docker/opts" - -import ( - "fmt" - "net" -) - -// IPOpt holds an IP. It is used to store values from CLI flags. -type IPOpt struct { - *net.IP -} - -// NewIPOpt creates a new IPOpt from a reference net.IP and a -// string representation of an IP. If the string is not a valid -// IP it will fallback to the specified reference. -func NewIPOpt(ref *net.IP, defaultVal string) *IPOpt { - o := &IPOpt{ - IP: ref, - } - o.Set(defaultVal) - return o -} - -// Set sets an IPv4 or IPv6 address from a given string. If the given -// string is not parsable as an IP address it returns an error. -func (o *IPOpt) Set(val string) error { - ip := net.ParseIP(val) - if ip == nil { - return fmt.Errorf("%s is not an ip address", val) - } - *o.IP = ip - return nil -} - -// String returns the IP address stored in the IPOpt. If stored IP is a -// nil pointer, it returns an empty string. -func (o *IPOpt) String() string { - if *o.IP == nil { - return "" - } - return o.IP.String() -} - -// Type returns the type of the option -func (o *IPOpt) Type() string { - return "ip" -} diff --git a/vendor/github.com/docker/docker/opts/opts.go b/vendor/github.com/docker/docker/opts/opts.go deleted file mode 100644 index de8aacb8..00000000 --- a/vendor/github.com/docker/docker/opts/opts.go +++ /dev/null @@ -1,337 +0,0 @@ -package opts // import "github.com/docker/docker/opts" - -import ( - "fmt" - "net" - "path" - "regexp" - "strings" - - "github.com/docker/go-units" -) - -var ( - alphaRegexp = regexp.MustCompile(`[a-zA-Z]`) - domainRegexp = regexp.MustCompile(`^(:?(:?[a-zA-Z0-9]|(:?[a-zA-Z0-9][a-zA-Z0-9\-]*[a-zA-Z0-9]))(:?\.(:?[a-zA-Z0-9]|(:?[a-zA-Z0-9][a-zA-Z0-9\-]*[a-zA-Z0-9])))*)\.?\s*$`) -) - -// ListOpts holds a list of values and a validation function. -type ListOpts struct { - values *[]string - validator ValidatorFctType -} - -// NewListOpts creates a new ListOpts with the specified validator. -func NewListOpts(validator ValidatorFctType) ListOpts { - var values []string - return *NewListOptsRef(&values, validator) -} - -// NewListOptsRef creates a new ListOpts with the specified values and validator. -func NewListOptsRef(values *[]string, validator ValidatorFctType) *ListOpts { - return &ListOpts{ - values: values, - validator: validator, - } -} - -func (opts *ListOpts) String() string { - if len(*opts.values) == 0 { - return "" - } - return fmt.Sprintf("%v", *opts.values) -} - -// Set validates if needed the input value and adds it to the -// internal slice. -func (opts *ListOpts) Set(value string) error { - if opts.validator != nil { - v, err := opts.validator(value) - if err != nil { - return err - } - value = v - } - *opts.values = append(*opts.values, value) - return nil -} - -// Delete removes the specified element from the slice. -func (opts *ListOpts) Delete(key string) { - for i, k := range *opts.values { - if k == key { - *opts.values = append((*opts.values)[:i], (*opts.values)[i+1:]...) - return - } - } -} - -// GetMap returns the content of values in a map in order to avoid -// duplicates. -func (opts *ListOpts) GetMap() map[string]struct{} { - ret := make(map[string]struct{}) - for _, k := range *opts.values { - ret[k] = struct{}{} - } - return ret -} - -// GetAll returns the values of slice. -func (opts *ListOpts) GetAll() []string { - return *opts.values -} - -// GetAllOrEmpty returns the values of the slice -// or an empty slice when there are no values. -func (opts *ListOpts) GetAllOrEmpty() []string { - v := *opts.values - if v == nil { - return make([]string, 0) - } - return v -} - -// Get checks the existence of the specified key. -func (opts *ListOpts) Get(key string) bool { - for _, k := range *opts.values { - if k == key { - return true - } - } - return false -} - -// Len returns the amount of element in the slice. -func (opts *ListOpts) Len() int { - return len(*opts.values) -} - -// Type returns a string name for this Option type -func (opts *ListOpts) Type() string { - return "list" -} - -// WithValidator returns the ListOpts with validator set. -func (opts *ListOpts) WithValidator(validator ValidatorFctType) *ListOpts { - opts.validator = validator - return opts -} - -// NamedOption is an interface that list and map options -// with names implement. -type NamedOption interface { - Name() string -} - -// NamedListOpts is a ListOpts with a configuration name. -// This struct is useful to keep reference to the assigned -// field name in the internal configuration struct. -type NamedListOpts struct { - name string - ListOpts -} - -var _ NamedOption = &NamedListOpts{} - -// NewNamedListOptsRef creates a reference to a new NamedListOpts struct. -func NewNamedListOptsRef(name string, values *[]string, validator ValidatorFctType) *NamedListOpts { - return &NamedListOpts{ - name: name, - ListOpts: *NewListOptsRef(values, validator), - } -} - -// Name returns the name of the NamedListOpts in the configuration. -func (o *NamedListOpts) Name() string { - return o.name -} - -// MapOpts holds a map of values and a validation function. -type MapOpts struct { - values map[string]string - validator ValidatorFctType -} - -// Set validates if needed the input value and add it to the -// internal map, by splitting on '='. -func (opts *MapOpts) Set(value string) error { - if opts.validator != nil { - v, err := opts.validator(value) - if err != nil { - return err - } - value = v - } - vals := strings.SplitN(value, "=", 2) - if len(vals) == 1 { - (opts.values)[vals[0]] = "" - } else { - (opts.values)[vals[0]] = vals[1] - } - return nil -} - -// GetAll returns the values of MapOpts as a map. -func (opts *MapOpts) GetAll() map[string]string { - return opts.values -} - -func (opts *MapOpts) String() string { - return fmt.Sprintf("%v", opts.values) -} - -// Type returns a string name for this Option type -func (opts *MapOpts) Type() string { - return "map" -} - -// NewMapOpts creates a new MapOpts with the specified map of values and a validator. -func NewMapOpts(values map[string]string, validator ValidatorFctType) *MapOpts { - if values == nil { - values = make(map[string]string) - } - return &MapOpts{ - values: values, - validator: validator, - } -} - -// NamedMapOpts is a MapOpts struct with a configuration name. -// This struct is useful to keep reference to the assigned -// field name in the internal configuration struct. -type NamedMapOpts struct { - name string - MapOpts -} - -var _ NamedOption = &NamedMapOpts{} - -// NewNamedMapOpts creates a reference to a new NamedMapOpts struct. -func NewNamedMapOpts(name string, values map[string]string, validator ValidatorFctType) *NamedMapOpts { - return &NamedMapOpts{ - name: name, - MapOpts: *NewMapOpts(values, validator), - } -} - -// Name returns the name of the NamedMapOpts in the configuration. -func (o *NamedMapOpts) Name() string { - return o.name -} - -// ValidatorFctType defines a validator function that returns a validated string and/or an error. -type ValidatorFctType func(val string) (string, error) - -// ValidatorFctListType defines a validator function that returns a validated list of string and/or an error -type ValidatorFctListType func(val string) ([]string, error) - -// ValidateIPAddress validates an Ip address. -func ValidateIPAddress(val string) (string, error) { - var ip = net.ParseIP(strings.TrimSpace(val)) - if ip != nil { - return ip.String(), nil - } - return "", fmt.Errorf("%s is not an ip address", val) -} - -// ValidateDNSSearch validates domain for resolvconf search configuration. -// A zero length domain is represented by a dot (.). -func ValidateDNSSearch(val string) (string, error) { - if val = strings.Trim(val, " "); val == "." { - return val, nil - } - return validateDomain(val) -} - -func validateDomain(val string) (string, error) { - if alphaRegexp.FindString(val) == "" { - return "", fmt.Errorf("%s is not a valid domain", val) - } - ns := domainRegexp.FindSubmatch([]byte(val)) - if len(ns) > 0 && len(ns[1]) < 255 { - return string(ns[1]), nil - } - return "", fmt.Errorf("%s is not a valid domain", val) -} - -// ValidateLabel validates that the specified string is a valid label, and returns it. -// Labels are in the form on key=value. -func ValidateLabel(val string) (string, error) { - if strings.Count(val, "=") < 1 { - return "", fmt.Errorf("bad attribute format: %s", val) - } - return val, nil -} - -// ValidateSingleGenericResource validates that a single entry in the -// generic resource list is valid. -// i.e 'GPU=UID1' is valid however 'GPU:UID1' or 'UID1' isn't -func ValidateSingleGenericResource(val string) (string, error) { - if strings.Count(val, "=") < 1 { - return "", fmt.Errorf("invalid node-generic-resource format `%s` expected `name=value`", val) - } - return val, nil -} - -// ParseLink parses and validates the specified string as a link format (name:alias) -func ParseLink(val string) (string, string, error) { - if val == "" { - return "", "", fmt.Errorf("empty string specified for links") - } - arr := strings.Split(val, ":") - if len(arr) > 2 { - return "", "", fmt.Errorf("bad format for links: %s", val) - } - if len(arr) == 1 { - return val, val, nil - } - // This is kept because we can actually get a HostConfig with links - // from an already created container and the format is not `foo:bar` - // but `/foo:/c1/bar` - if strings.HasPrefix(arr[0], "/") { - _, alias := path.Split(arr[1]) - return arr[0][1:], alias, nil - } - return arr[0], arr[1], nil -} - -// MemBytes is a type for human readable memory bytes (like 128M, 2g, etc) -type MemBytes int64 - -// String returns the string format of the human readable memory bytes -func (m *MemBytes) String() string { - // NOTE: In spf13/pflag/flag.go, "0" is considered as "zero value" while "0 B" is not. - // We return "0" in case value is 0 here so that the default value is hidden. - // (Sometimes "default 0 B" is actually misleading) - if m.Value() != 0 { - return units.BytesSize(float64(m.Value())) - } - return "0" -} - -// Set sets the value of the MemBytes by passing a string -func (m *MemBytes) Set(value string) error { - val, err := units.RAMInBytes(value) - *m = MemBytes(val) - return err -} - -// Type returns the type -func (m *MemBytes) Type() string { - return "bytes" -} - -// Value returns the value in int64 -func (m *MemBytes) Value() int64 { - return int64(*m) -} - -// UnmarshalJSON is the customized unmarshaler for MemBytes -func (m *MemBytes) UnmarshalJSON(s []byte) error { - if len(s) <= 2 || s[0] != '"' || s[len(s)-1] != '"' { - return fmt.Errorf("invalid size: %q", s) - } - val, err := units.RAMInBytes(string(s[1 : len(s)-1])) - *m = MemBytes(val) - return err -} diff --git a/vendor/github.com/docker/docker/opts/opts_unix.go b/vendor/github.com/docker/docker/opts/opts_unix.go deleted file mode 100644 index 0c32367c..00000000 --- a/vendor/github.com/docker/docker/opts/opts_unix.go +++ /dev/null @@ -1,6 +0,0 @@ -// +build !windows - -package opts // import "github.com/docker/docker/opts" - -// DefaultHTTPHost Default HTTP Host used if only port is provided to -H flag e.g. dockerd -H tcp://:8080 -const DefaultHTTPHost = "localhost" diff --git a/vendor/github.com/docker/docker/opts/opts_windows.go b/vendor/github.com/docker/docker/opts/opts_windows.go deleted file mode 100644 index 0e1b6c6d..00000000 --- a/vendor/github.com/docker/docker/opts/opts_windows.go +++ /dev/null @@ -1,56 +0,0 @@ -package opts // import "github.com/docker/docker/opts" - -// TODO Windows. Identify bug in GOLang 1.5.1+ and/or Windows Server 2016 TP5. -// @jhowardmsft, @swernli. -// -// On Windows, this mitigates a problem with the default options of running -// a docker client against a local docker daemon on TP5. -// -// What was found that if the default host is "localhost", even if the client -// (and daemon as this is local) is not physically on a network, and the DNS -// cache is flushed (ipconfig /flushdns), then the client will pause for -// exactly one second when connecting to the daemon for calls. For example -// using docker run windowsservercore cmd, the CLI will send a create followed -// by an attach. You see the delay between the attach finishing and the attach -// being seen by the daemon. -// -// Here's some daemon debug logs with additional debug spew put in. The -// AfterWriteJSON log is the very last thing the daemon does as part of the -// create call. The POST /attach is the second CLI call. Notice the second -// time gap. -// -// time="2015-11-06T13:38:37.259627400-08:00" level=debug msg="After createRootfs" -// time="2015-11-06T13:38:37.263626300-08:00" level=debug msg="After setHostConfig" -// time="2015-11-06T13:38:37.267631200-08:00" level=debug msg="before createContainerPl...." -// time="2015-11-06T13:38:37.271629500-08:00" level=debug msg=ToDiskLocking.... -// time="2015-11-06T13:38:37.275643200-08:00" level=debug msg="loggin event...." -// time="2015-11-06T13:38:37.277627600-08:00" level=debug msg="logged event...." -// time="2015-11-06T13:38:37.279631800-08:00" level=debug msg="In defer func" -// time="2015-11-06T13:38:37.282628100-08:00" level=debug msg="After daemon.create" -// time="2015-11-06T13:38:37.286651700-08:00" level=debug msg="return 2" -// time="2015-11-06T13:38:37.289629500-08:00" level=debug msg="Returned from daemon.ContainerCreate" -// time="2015-11-06T13:38:37.311629100-08:00" level=debug msg="After WriteJSON" -// ... 1 second gap here.... -// time="2015-11-06T13:38:38.317866200-08:00" level=debug msg="Calling POST /v1.22/containers/984758282b842f779e805664b2c95d563adc9a979c8a3973e68c807843ee4757/attach" -// time="2015-11-06T13:38:38.326882500-08:00" level=info msg="POST /v1.22/containers/984758282b842f779e805664b2c95d563adc9a979c8a3973e68c807843ee4757/attach?stderr=1&stdin=1&stdout=1&stream=1" -// -// We suspect this is either a bug introduced in GOLang 1.5.1, or that a change -// in GOLang 1.5.1 (from 1.4.3) is exposing a bug in Windows. In theory, -// the Windows networking stack is supposed to resolve "localhost" internally, -// without hitting DNS, or even reading the hosts file (which is why localhost -// is commented out in the hosts file on Windows). -// -// We have validated that working around this using the actual IPv4 localhost -// address does not cause the delay. -// -// This does not occur with the docker client built with 1.4.3 on the same -// Windows build, regardless of whether the daemon is built using 1.5.1 -// or 1.4.3. It does not occur on Linux. We also verified we see the same thing -// on a cross-compiled Windows binary (from Linux). -// -// Final note: This is a mitigation, not a 'real' fix. It is still susceptible -// to the delay if a user were to do 'docker run -H=tcp://localhost:2375...' -// explicitly. - -// DefaultHTTPHost Default HTTP Host used if only port is provided to -H flag e.g. dockerd -H tcp://:8080 -const DefaultHTTPHost = "127.0.0.1" diff --git a/vendor/github.com/docker/docker/opts/quotedstring.go b/vendor/github.com/docker/docker/opts/quotedstring.go deleted file mode 100644 index 6c889070..00000000 --- a/vendor/github.com/docker/docker/opts/quotedstring.go +++ /dev/null @@ -1,37 +0,0 @@ -package opts // import "github.com/docker/docker/opts" - -// QuotedString is a string that may have extra quotes around the value. The -// quotes are stripped from the value. -type QuotedString struct { - value *string -} - -// Set sets a new value -func (s *QuotedString) Set(val string) error { - *s.value = trimQuotes(val) - return nil -} - -// Type returns the type of the value -func (s *QuotedString) Type() string { - return "string" -} - -func (s *QuotedString) String() string { - return *s.value -} - -func trimQuotes(value string) string { - lastIndex := len(value) - 1 - for _, char := range []byte{'\'', '"'} { - if value[0] == char && value[lastIndex] == char { - return value[1:lastIndex] - } - } - return value -} - -// NewQuotedString returns a new quoted string option -func NewQuotedString(value *string) *QuotedString { - return &QuotedString{value: value} -} diff --git a/vendor/github.com/docker/docker/opts/runtime.go b/vendor/github.com/docker/docker/opts/runtime.go deleted file mode 100644 index 4b9babf0..00000000 --- a/vendor/github.com/docker/docker/opts/runtime.go +++ /dev/null @@ -1,79 +0,0 @@ -package opts // import "github.com/docker/docker/opts" - -import ( - "fmt" - "strings" - - "github.com/docker/docker/api/types" -) - -// RuntimeOpt defines a map of Runtimes -type RuntimeOpt struct { - name string - stockRuntimeName string - values *map[string]types.Runtime -} - -// NewNamedRuntimeOpt creates a new RuntimeOpt -func NewNamedRuntimeOpt(name string, ref *map[string]types.Runtime, stockRuntime string) *RuntimeOpt { - if ref == nil { - ref = &map[string]types.Runtime{} - } - return &RuntimeOpt{name: name, values: ref, stockRuntimeName: stockRuntime} -} - -// Name returns the name of the NamedListOpts in the configuration. -func (o *RuntimeOpt) Name() string { - return o.name -} - -// Set validates and updates the list of Runtimes -func (o *RuntimeOpt) Set(val string) error { - parts := strings.SplitN(val, "=", 2) - if len(parts) != 2 { - return fmt.Errorf("invalid runtime argument: %s", val) - } - - parts[0] = strings.TrimSpace(parts[0]) - parts[1] = strings.TrimSpace(parts[1]) - if parts[0] == "" || parts[1] == "" { - return fmt.Errorf("invalid runtime argument: %s", val) - } - - parts[0] = strings.ToLower(parts[0]) - if parts[0] == o.stockRuntimeName { - return fmt.Errorf("runtime name '%s' is reserved", o.stockRuntimeName) - } - - if _, ok := (*o.values)[parts[0]]; ok { - return fmt.Errorf("runtime '%s' was already defined", parts[0]) - } - - (*o.values)[parts[0]] = types.Runtime{Path: parts[1]} - - return nil -} - -// String returns Runtime values as a string. -func (o *RuntimeOpt) String() string { - var out []string - for k := range *o.values { - out = append(out, k) - } - - return fmt.Sprintf("%v", out) -} - -// GetMap returns a map of Runtimes (name: path) -func (o *RuntimeOpt) GetMap() map[string]types.Runtime { - if o.values != nil { - return *o.values - } - - return map[string]types.Runtime{} -} - -// Type returns the type of the option -func (o *RuntimeOpt) Type() string { - return "runtime" -} diff --git a/vendor/github.com/docker/docker/opts/ulimit.go b/vendor/github.com/docker/docker/opts/ulimit.go deleted file mode 100644 index 0e2a3623..00000000 --- a/vendor/github.com/docker/docker/opts/ulimit.go +++ /dev/null @@ -1,81 +0,0 @@ -package opts // import "github.com/docker/docker/opts" - -import ( - "fmt" - - "github.com/docker/go-units" -) - -// UlimitOpt defines a map of Ulimits -type UlimitOpt struct { - values *map[string]*units.Ulimit -} - -// NewUlimitOpt creates a new UlimitOpt -func NewUlimitOpt(ref *map[string]*units.Ulimit) *UlimitOpt { - if ref == nil { - ref = &map[string]*units.Ulimit{} - } - return &UlimitOpt{ref} -} - -// Set validates a Ulimit and sets its name as a key in UlimitOpt -func (o *UlimitOpt) Set(val string) error { - l, err := units.ParseUlimit(val) - if err != nil { - return err - } - - (*o.values)[l.Name] = l - - return nil -} - -// String returns Ulimit values as a string. -func (o *UlimitOpt) String() string { - var out []string - for _, v := range *o.values { - out = append(out, v.String()) - } - - return fmt.Sprintf("%v", out) -} - -// GetList returns a slice of pointers to Ulimits. -func (o *UlimitOpt) GetList() []*units.Ulimit { - var ulimits []*units.Ulimit - for _, v := range *o.values { - ulimits = append(ulimits, v) - } - - return ulimits -} - -// Type returns the option type -func (o *UlimitOpt) Type() string { - return "ulimit" -} - -// NamedUlimitOpt defines a named map of Ulimits -type NamedUlimitOpt struct { - name string - UlimitOpt -} - -var _ NamedOption = &NamedUlimitOpt{} - -// NewNamedUlimitOpt creates a new NamedUlimitOpt -func NewNamedUlimitOpt(name string, ref *map[string]*units.Ulimit) *NamedUlimitOpt { - if ref == nil { - ref = &map[string]*units.Ulimit{} - } - return &NamedUlimitOpt{ - name: name, - UlimitOpt: *NewUlimitOpt(ref), - } -} - -// Name returns the option name -func (o *NamedUlimitOpt) Name() string { - return o.name -} diff --git a/vendor/github.com/docker/docker/pkg/archive/archive.go b/vendor/github.com/docker/docker/pkg/archive/archive.go index 070dccb7..d179949a 100644 --- a/vendor/github.com/docker/docker/pkg/archive/archive.go +++ b/vendor/github.com/docker/docker/pkg/archive/archive.go @@ -63,8 +63,9 @@ type ( NoOverwriteDirNonDir bool // For each include when creating an archive, the included name will be // replaced with the matching name from this map. - RebaseNames map[string]string - InUserNS bool + RebaseNames map[string]string + InUserNS bool + ContinueOnError bool } ) @@ -442,7 +443,7 @@ func newTarAppender(idMapping *idtools.IdentityMapping, writer io.Writer, chownO } // canonicalTarName provides a platform-independent and consistent posix-style -//path for files and directories to be archived regardless of the platform. +// path for files and directories to be archived regardless of the platform. func canonicalTarName(name string, isDir bool) string { name = CanonicalTarNameForPath(name) @@ -495,13 +496,13 @@ func (ta *tarAppender) addTarFile(path, name string) error { } } - //check whether the file is overlayfs whiteout - //if yes, skip re-mapping container ID mappings. + // check whether the file is overlayfs whiteout + // if yes, skip re-mapping container ID mappings. isOverlayWhiteout := fi.Mode()&os.ModeCharDevice != 0 && hdr.Devmajor == 0 && hdr.Devminor == 0 - //handle re-mapping container ID mappings back to host ID mappings before - //writing tar headers/files. We skip whiteout files because they were written - //by the kernel and already have proper ownership relative to the host + // handle re-mapping container ID mappings back to host ID mappings before + // writing tar headers/files. We skip whiteout files because they were written + // by the kernel and already have proper ownership relative to the host if !isOverlayWhiteout && !strings.HasPrefix(filepath.Base(hdr.Name), WhiteoutPrefix) && !ta.IdentityMapping.Empty() { fileIDPair, err := getFileUIDGID(fi.Sys()) if err != nil { @@ -570,7 +571,7 @@ func (ta *tarAppender) addTarFile(path, name string) error { return nil } -func createTarFile(path, extractDir string, hdr *tar.Header, reader io.Reader, Lchown bool, chownOpts *idtools.Identity, inUserns bool) error { +func createTarFile(path, extractDir string, hdr *tar.Header, reader io.Reader, Lchown bool, chownOpts *idtools.Identity, inUserns, ContinueOnError bool) error { // hdr.Mode is in linux format, which we can use for sycalls, // but for os.Foo() calls we need the mode converted to os.FileMode, // so use hdrInfo.Mode() (they differ for e.g. setuid bits) @@ -581,7 +582,7 @@ func createTarFile(path, extractDir string, hdr *tar.Header, reader io.Reader, L // Create directory unless it exists as a directory already. // In that case we just want to merge the two if fi, err := os.Lstat(path); !(err == nil && fi.IsDir()) { - if err := os.Mkdir(path, hdrInfo.Mode()); err != nil { + if err := os.Mkdir(path, hdrInfo.Mode()); err != nil && !ContinueOnError { return err } } @@ -660,11 +661,13 @@ func createTarFile(path, extractDir string, hdr *tar.Header, reader io.Reader, L var errors []string for key, value := range hdr.Xattrs { if err := system.Lsetxattr(path, key, []byte(value), 0); err != nil { - if err == syscall.ENOTSUP { + if err == syscall.ENOTSUP || err == syscall.EPERM { // We ignore errors here because not all graphdrivers support // xattrs *cough* old versions of AUFS *cough*. However only // ENOTSUP should be emitted in that case, otherwise we still // bail. + // EPERM occurs if modifying xattrs is not allowed. This can + // happen when running in userns with restrictions (ChromeOS). errors = append(errors, err.Error()) continue } @@ -743,7 +746,7 @@ func TarWithOptions(srcPath string, options *TarOptions) (io.ReadCloser, error) compressWriter, options.ChownOpts, ) - ta.WhiteoutConverter = getWhiteoutConverter(options.WhiteoutFormat) + ta.WhiteoutConverter = getWhiteoutConverter(options.WhiteoutFormat, options.InUserNS) defer func() { // Make sure to check the error on Close. @@ -901,7 +904,7 @@ func Unpack(decompressedArchive io.Reader, dest string, options *TarOptions) err var dirs []*tar.Header idMapping := idtools.NewIDMappingsFromMaps(options.UIDMaps, options.GIDMaps) rootIDs := idMapping.RootPair() - whiteoutConverter := getWhiteoutConverter(options.WhiteoutFormat) + whiteoutConverter := getWhiteoutConverter(options.WhiteoutFormat, options.InUserNS) // Iterate through the files in the archive. loop: @@ -935,7 +938,7 @@ loop: parentPath := filepath.Join(dest, parent) if _, err := os.Lstat(parentPath); err != nil && os.IsNotExist(err) { err = idtools.MkdirAllAndChownNew(parentPath, 0777, rootIDs) - if err != nil { + if err != nil && !options.ContinueOnError { return err } } @@ -993,7 +996,7 @@ loop: } } - if err := createTarFile(path, dest, hdr, trBuf, !options.NoLchown, options.ChownOpts, options.InUserNS); err != nil { + if err := createTarFile(path, dest, hdr, trBuf, !options.NoLchown, options.ChownOpts, options.InUserNS, options.ContinueOnError); err != nil { return err } @@ -1132,7 +1135,7 @@ func (archiver *Archiver) CopyFileWithTar(src, dst string) (err error) { dst = filepath.Join(dst, filepath.Base(src)) } // Create the holding directory if necessary - if err := system.MkdirAll(filepath.Dir(dst), 0700, ""); err != nil { + if err := system.MkdirAll(filepath.Dir(dst), 0700); err != nil { return err } @@ -1216,6 +1219,9 @@ func cmdStream(cmd *exec.Cmd, input io.Reader) (io.ReadCloser, error) { return nil, err } + // Ensure the command has exited before we clean anything up + done := make(chan struct{}) + // Copy stdout to the returned pipe go func() { if err := cmd.Wait(); err != nil { @@ -1223,9 +1229,16 @@ func cmdStream(cmd *exec.Cmd, input io.Reader) (io.ReadCloser, error) { } else { pipeW.Close() } + close(done) }() - return pipeR, nil + return ioutils.NewReadCloserWrapper(pipeR, func() error { + // Close pipeR, and then wait for the command to complete before returning. We have to close pipeR first, as + // cmd.Wait waits for any non-file stdout/stderr/stdin to close. + err := pipeR.Close() + <-done + return err + }), nil } // NewTempArchive reads the content of src into a temporary file, and returns the contents diff --git a/vendor/github.com/docker/docker/pkg/archive/archive_linux.go b/vendor/github.com/docker/docker/pkg/archive/archive_linux.go index 970d4d06..29ddd4b1 100644 --- a/vendor/github.com/docker/docker/pkg/archive/archive_linux.go +++ b/vendor/github.com/docker/docker/pkg/archive/archive_linux.go @@ -2,22 +2,30 @@ package archive // import "github.com/docker/docker/pkg/archive" import ( "archive/tar" + "fmt" + "io/ioutil" "os" "path/filepath" "strings" + "syscall" + "github.com/containerd/continuity/fs" "github.com/docker/docker/pkg/system" + "github.com/moby/sys/mount" + "github.com/pkg/errors" "golang.org/x/sys/unix" ) -func getWhiteoutConverter(format WhiteoutFormat) tarWhiteoutConverter { +func getWhiteoutConverter(format WhiteoutFormat, inUserNS bool) tarWhiteoutConverter { if format == OverlayWhiteoutFormat { - return overlayWhiteoutConverter{} + return overlayWhiteoutConverter{inUserNS: inUserNS} } return nil } -type overlayWhiteoutConverter struct{} +type overlayWhiteoutConverter struct { + inUserNS bool +} func (overlayWhiteoutConverter) ConvertWrite(hdr *tar.Header, path string, fi os.FileInfo) (wo *tar.Header, err error) { // convert whiteouts to AUFS format @@ -61,13 +69,22 @@ func (overlayWhiteoutConverter) ConvertWrite(hdr *tar.Header, path string, fi os return } -func (overlayWhiteoutConverter) ConvertRead(hdr *tar.Header, path string) (bool, error) { +func (c overlayWhiteoutConverter) ConvertRead(hdr *tar.Header, path string) (bool, error) { base := filepath.Base(path) dir := filepath.Dir(path) // if a directory is marked as opaque by the AUFS special file, we need to translate that to overlay if base == WhiteoutOpaqueDir { err := unix.Setxattr(dir, "trusted.overlay.opaque", []byte{'y'}, 0) + if err != nil { + if c.inUserNS { + if err = replaceDirWithOverlayOpaque(dir); err != nil { + return false, errors.Wrapf(err, "replaceDirWithOverlayOpaque(%q) failed", dir) + } + } else { + return false, errors.Wrapf(err, "setxattr(%q, trusted.overlay.opaque=y)", dir) + } + } // don't write the file itself return false, err } @@ -78,7 +95,19 @@ func (overlayWhiteoutConverter) ConvertRead(hdr *tar.Header, path string) (bool, originalPath := filepath.Join(dir, originalBase) if err := unix.Mknod(originalPath, unix.S_IFCHR, 0); err != nil { - return false, err + if c.inUserNS { + // Ubuntu and a few distros support overlayfs in userns. + // + // Although we can't call mknod directly in userns (at least on bionic kernel 4.15), + // we can still create 0,0 char device using mknodChar0Overlay(). + // + // NOTE: we don't need this hack for the containerd snapshotter+unpack model. + if err := mknodChar0Overlay(originalPath); err != nil { + return false, errors.Wrapf(err, "failed to mknodChar0UserNS(%q)", originalPath) + } + } else { + return false, errors.Wrapf(err, "failed to mknod(%q, S_IFCHR, 0)", originalPath) + } } if err := os.Chown(originalPath, hdr.Uid, hdr.Gid); err != nil { return false, err @@ -90,3 +119,142 @@ func (overlayWhiteoutConverter) ConvertRead(hdr *tar.Header, path string) (bool, return true, nil } + +// mknodChar0Overlay creates 0,0 char device by mounting overlayfs and unlinking. +// This function can be used for creating 0,0 char device in userns on Ubuntu. +// +// Steps: +// * Mkdir lower,upper,merged,work +// * Create lower/dummy +// * Mount overlayfs +// * Unlink merged/dummy +// * Unmount overlayfs +// * Make sure a 0,0 char device is created as upper/dummy +// * Rename upper/dummy to cleansedOriginalPath +func mknodChar0Overlay(cleansedOriginalPath string) error { + dir := filepath.Dir(cleansedOriginalPath) + tmp, err := ioutil.TempDir(dir, "mc0o") + if err != nil { + return errors.Wrapf(err, "failed to create a tmp directory under %s", dir) + } + defer os.RemoveAll(tmp) + lower := filepath.Join(tmp, "l") + upper := filepath.Join(tmp, "u") + work := filepath.Join(tmp, "w") + merged := filepath.Join(tmp, "m") + for _, s := range []string{lower, upper, work, merged} { + if err := os.MkdirAll(s, 0700); err != nil { + return errors.Wrapf(err, "failed to mkdir %s", s) + } + } + dummyBase := "d" + lowerDummy := filepath.Join(lower, dummyBase) + if err := ioutil.WriteFile(lowerDummy, []byte{}, 0600); err != nil { + return errors.Wrapf(err, "failed to create a dummy lower file %s", lowerDummy) + } + mOpts := fmt.Sprintf("lowerdir=%s,upperdir=%s,workdir=%s", lower, upper, work) + if err := mount.Mount("overlay", merged, "overlay", mOpts); err != nil { + return err + } + mergedDummy := filepath.Join(merged, dummyBase) + if err := os.Remove(mergedDummy); err != nil { + syscall.Unmount(merged, 0) + return errors.Wrapf(err, "failed to unlink %s", mergedDummy) + } + if err := syscall.Unmount(merged, 0); err != nil { + return errors.Wrapf(err, "failed to unmount %s", merged) + } + upperDummy := filepath.Join(upper, dummyBase) + if err := isChar0(upperDummy); err != nil { + return err + } + if err := os.Rename(upperDummy, cleansedOriginalPath); err != nil { + return errors.Wrapf(err, "failed to rename %s to %s", upperDummy, cleansedOriginalPath) + } + return nil +} + +func isChar0(path string) error { + osStat, err := os.Stat(path) + if err != nil { + return errors.Wrapf(err, "failed to stat %s", path) + } + st, ok := osStat.Sys().(*syscall.Stat_t) + if !ok { + return errors.Errorf("got unsupported stat for %s", path) + } + if os.FileMode(st.Mode)&syscall.S_IFMT != syscall.S_IFCHR { + return errors.Errorf("%s is not a character device, got mode=%d", path, st.Mode) + } + if st.Rdev != 0 { + return errors.Errorf("%s is not a 0,0 character device, got Rdev=%d", path, st.Rdev) + } + return nil +} + +// replaceDirWithOverlayOpaque replaces path with a new directory with trusted.overlay.opaque +// xattr. The contents of the directory are preserved. +func replaceDirWithOverlayOpaque(path string) error { + if path == "/" { + return errors.New("replaceDirWithOverlayOpaque: path must not be \"/\"") + } + dir := filepath.Dir(path) + tmp, err := ioutil.TempDir(dir, "rdwoo") + if err != nil { + return errors.Wrapf(err, "failed to create a tmp directory under %s", dir) + } + defer os.RemoveAll(tmp) + // newPath is a new empty directory crafted with trusted.overlay.opaque xattr. + // we copy the content of path into newPath, remove path, and rename newPath to path. + newPath, err := createDirWithOverlayOpaque(tmp) + if err != nil { + return errors.Wrapf(err, "createDirWithOverlayOpaque(%q) failed", tmp) + } + if err := fs.CopyDir(newPath, path); err != nil { + return errors.Wrapf(err, "CopyDir(%q, %q) failed", newPath, path) + } + if err := os.RemoveAll(path); err != nil { + return err + } + return os.Rename(newPath, path) +} + +// createDirWithOverlayOpaque creates a directory with trusted.overlay.opaque xattr, +// without calling setxattr, so as to allow creating opaque dir in userns on Ubuntu. +func createDirWithOverlayOpaque(tmp string) (string, error) { + lower := filepath.Join(tmp, "l") + upper := filepath.Join(tmp, "u") + work := filepath.Join(tmp, "w") + merged := filepath.Join(tmp, "m") + for _, s := range []string{lower, upper, work, merged} { + if err := os.MkdirAll(s, 0700); err != nil { + return "", errors.Wrapf(err, "failed to mkdir %s", s) + } + } + dummyBase := "d" + lowerDummy := filepath.Join(lower, dummyBase) + if err := os.MkdirAll(lowerDummy, 0700); err != nil { + return "", errors.Wrapf(err, "failed to create a dummy lower directory %s", lowerDummy) + } + mOpts := fmt.Sprintf("lowerdir=%s,upperdir=%s,workdir=%s", lower, upper, work) + if err := mount.Mount("overlay", merged, "overlay", mOpts); err != nil { + return "", err + } + mergedDummy := filepath.Join(merged, dummyBase) + if err := os.Remove(mergedDummy); err != nil { + syscall.Unmount(merged, 0) + return "", errors.Wrapf(err, "failed to rmdir %s", mergedDummy) + } + // upperDummy becomes a 0,0-char device file here + if err := os.Mkdir(mergedDummy, 0700); err != nil { + syscall.Unmount(merged, 0) + return "", errors.Wrapf(err, "failed to mkdir %s", mergedDummy) + } + // upperDummy becomes a directory with trusted.overlay.opaque xattr + // (but can't be verified in userns) + if err := syscall.Unmount(merged, 0); err != nil { + return "", errors.Wrapf(err, "failed to unmount %s", merged) + } + upperDummy := filepath.Join(upper, dummyBase) + return upperDummy, nil +} diff --git a/vendor/github.com/docker/docker/pkg/archive/archive_other.go b/vendor/github.com/docker/docker/pkg/archive/archive_other.go index 462dfc63..65a73354 100644 --- a/vendor/github.com/docker/docker/pkg/archive/archive_other.go +++ b/vendor/github.com/docker/docker/pkg/archive/archive_other.go @@ -2,6 +2,6 @@ package archive // import "github.com/docker/docker/pkg/archive" -func getWhiteoutConverter(format WhiteoutFormat) tarWhiteoutConverter { +func getWhiteoutConverter(format WhiteoutFormat, inUserNS bool) tarWhiteoutConverter { return nil } diff --git a/vendor/github.com/docker/docker/pkg/archive/archive_unix.go b/vendor/github.com/docker/docker/pkg/archive/archive_unix.go index 1eec912b..d6263360 100644 --- a/vendor/github.com/docker/docker/pkg/archive/archive_unix.go +++ b/vendor/github.com/docker/docker/pkg/archive/archive_unix.go @@ -7,6 +7,7 @@ import ( "errors" "os" "path/filepath" + "strings" "syscall" "github.com/docker/docker/pkg/idtools" @@ -26,7 +27,7 @@ func fixVolumePathPrefix(srcPath string) string { // can't use filepath.Join(srcPath,include) because this will clean away // a trailing "." or "/" which may be important. func getWalkRoot(srcPath string, include string) string { - return srcPath + string(filepath.Separator) + include + return strings.TrimSuffix(srcPath, string(filepath.Separator)) + string(filepath.Separator) + include } // CanonicalTarNameForPath returns platform-specific filepath diff --git a/vendor/github.com/docker/docker/pkg/archive/archive_windows.go b/vendor/github.com/docker/docker/pkg/archive/archive_windows.go index ae6b89fd..7260174b 100644 --- a/vendor/github.com/docker/docker/pkg/archive/archive_windows.go +++ b/vendor/github.com/docker/docker/pkg/archive/archive_windows.go @@ -31,7 +31,7 @@ func CanonicalTarNameForPath(p string) string { // chmodTarEntry is used to adjust the file permissions used in tar header based // on the platform the archival is done. func chmodTarEntry(perm os.FileMode) os.FileMode { - //perm &= 0755 // this 0-ed out tar flags (like link, regular file, directory marker etc.) + // perm &= 0755 // this 0-ed out tar flags (like link, regular file, directory marker etc.) permPart := perm & os.ModePerm noPermPart := perm &^ os.ModePerm // Add the x bit: make everything +x from windows diff --git a/vendor/github.com/docker/docker/pkg/archive/changes.go b/vendor/github.com/docker/docker/pkg/archive/changes.go index 43734db5..aedb91b0 100644 --- a/vendor/github.com/docker/docker/pkg/archive/changes.go +++ b/vendor/github.com/docker/docker/pkg/archive/changes.go @@ -63,12 +63,16 @@ func (c changesByPath) Less(i, j int) bool { return c[i].Path < c[j].Path } func (c changesByPath) Len() int { return len(c) } func (c changesByPath) Swap(i, j int) { c[j], c[i] = c[i], c[j] } -// Gnu tar and the go tar writer don't have sub-second mtime -// precision, which is problematic when we apply changes via tar -// files, we handle this by comparing for exact times, *or* same +// Gnu tar doesn't have sub-second mtime precision. The go tar +// writer (1.10+) does when using PAX format, but we round times to seconds +// to ensure archives have the same hashes for backwards compatibility. +// See https://github.com/moby/moby/pull/35739/commits/fb170206ba12752214630b269a40ac7be6115ed4. +// +// Non-sub-second is problematic when we apply changes via tar +// files. We handle this by comparing for exact times, *or* same // second count and either a or b having exactly 0 nanoseconds func sameFsTime(a, b time.Time) bool { - return a == b || + return a.Equal(b) || (a.Unix() == b.Unix() && (a.Nanosecond() == 0 || b.Nanosecond() == 0)) } diff --git a/vendor/github.com/docker/docker/pkg/archive/changes_unix.go b/vendor/github.com/docker/docker/pkg/archive/changes_unix.go index c06a209d..06217b71 100644 --- a/vendor/github.com/docker/docker/pkg/archive/changes_unix.go +++ b/vendor/github.com/docker/docker/pkg/archive/changes_unix.go @@ -16,7 +16,13 @@ func statDifferent(oldStat *system.StatT, newStat *system.StatT) bool { oldStat.UID() != newStat.UID() || oldStat.GID() != newStat.GID() || oldStat.Rdev() != newStat.Rdev() || - // Don't look at size for dirs, its not a good measure of change + // Don't look at size or modification time for dirs, its not a good + // measure of change. See https://github.com/moby/moby/issues/9874 + // for a description of the issue with modification time, and + // https://github.com/moby/moby/pull/11422 for the change. + // (Note that in the Windows implementation of this function, + // modification time IS taken as a change). See + // https://github.com/moby/moby/pull/37982 for more information. (oldStat.Mode()&unix.S_IFDIR != unix.S_IFDIR && (!sameFsTimeSpec(oldStat.Mtim(), newStat.Mtim()) || (oldStat.Size() != newStat.Size()))) { return true diff --git a/vendor/github.com/docker/docker/pkg/archive/changes_windows.go b/vendor/github.com/docker/docker/pkg/archive/changes_windows.go index 6555c013..9906685e 100644 --- a/vendor/github.com/docker/docker/pkg/archive/changes_windows.go +++ b/vendor/github.com/docker/docker/pkg/archive/changes_windows.go @@ -7,9 +7,13 @@ import ( ) func statDifferent(oldStat *system.StatT, newStat *system.StatT) bool { + // Note there is slight difference between the Linux and Windows + // implementations here. Due to https://github.com/moby/moby/issues/9874, + // and the fix at https://github.com/moby/moby/pull/11422, Linux does not + // consider a change to the directory time as a change. Windows on NTFS + // does. See https://github.com/moby/moby/pull/37982 for more information. - // Don't look at size for dirs, its not a good measure of change - if oldStat.Mtim() != newStat.Mtim() || + if !sameFsTime(oldStat.Mtim(), newStat.Mtim()) || oldStat.Mode() != newStat.Mode() || oldStat.Size() != newStat.Size() && !oldStat.Mode().IsDir() { return true diff --git a/vendor/github.com/docker/docker/pkg/archive/copy.go b/vendor/github.com/docker/docker/pkg/archive/copy.go index d0f13ca7..57fddac0 100644 --- a/vendor/github.com/docker/docker/pkg/archive/copy.go +++ b/vendor/github.com/docker/docker/pkg/archive/copy.go @@ -336,6 +336,14 @@ func RebaseArchiveEntries(srcContent io.Reader, oldBase, newBase string) io.Read return } + // srcContent tar stream, as served by TarWithOptions(), is + // definitely in PAX format, but tar.Next() mistakenly guesses it + // as USTAR, which creates a problem: if the newBase is >100 + // characters long, WriteHeader() returns an error like + // "archive/tar: cannot encode header: Format specifies USTAR; and USTAR cannot encode Name=...". + // + // To fix, set the format to PAX here. See docker/for-linux issue #484. + hdr.Format = tar.FormatPAX hdr.Name = strings.Replace(hdr.Name, oldBase, newBase, 1) if hdr.Typeflag == tar.TypeLink { hdr.Linkname = strings.Replace(hdr.Linkname, oldBase, newBase, 1) diff --git a/vendor/github.com/docker/docker/pkg/archive/diff.go b/vendor/github.com/docker/docker/pkg/archive/diff.go index 6883ba13..7c4f5675 100644 --- a/vendor/github.com/docker/docker/pkg/archive/diff.go +++ b/vendor/github.com/docker/docker/pkg/archive/diff.go @@ -84,7 +84,7 @@ func UnpackLayer(dest string, layer io.Reader, options *TarOptions) (size int64, parentPath := filepath.Join(dest, parent) if _, err := os.Lstat(parentPath); err != nil && os.IsNotExist(err) { - err = system.MkdirAll(parentPath, 0600, "") + err = system.MkdirAll(parentPath, 0600) if err != nil { return 0, err } @@ -105,7 +105,7 @@ func UnpackLayer(dest string, layer io.Reader, options *TarOptions) (size int64, } defer os.RemoveAll(aufsTempdir) } - if err := createTarFile(filepath.Join(aufsTempdir, basename), dest, hdr, tr, true, nil, options.InUserNS); err != nil { + if err := createTarFile(filepath.Join(aufsTempdir, basename), dest, hdr, tr, true, nil, options.InUserNS, options.ContinueOnError); err != nil { return 0, err } } @@ -196,7 +196,7 @@ func UnpackLayer(dest string, layer io.Reader, options *TarOptions) (size int64, return 0, err } - if err := createTarFile(path, dest, srcHdr, srcData, true, nil, options.InUserNS); err != nil { + if err := createTarFile(path, dest, srcHdr, srcData, !options.NoLchown, nil, options.InUserNS, options.ContinueOnError); err != nil { return 0, err } @@ -240,11 +240,13 @@ func applyLayerHandler(dest string, layer io.Reader, options *TarOptions, decomp dest = filepath.Clean(dest) // We need to be able to set any perms - oldmask, err := system.Umask(0) - if err != nil { - return 0, err + if runtime.GOOS != "windows" { + oldmask, err := system.Umask(0) + if err != nil { + return 0, err + } + defer system.Umask(oldmask) } - defer system.Umask(oldmask) // ignore err, ErrNotSupportedPlatform if decompress { decompLayer, err := DecompressStream(layer) diff --git a/vendor/github.com/docker/docker/pkg/archive/example_changes.go b/vendor/github.com/docker/docker/pkg/archive/example_changes.go deleted file mode 100644 index 495db809..00000000 --- a/vendor/github.com/docker/docker/pkg/archive/example_changes.go +++ /dev/null @@ -1,97 +0,0 @@ -// +build ignore - -// Simple tool to create an archive stream from an old and new directory -// -// By default it will stream the comparison of two temporary directories with junk files -package main - -import ( - "flag" - "fmt" - "io" - "io/ioutil" - "os" - "path" - - "github.com/docker/docker/pkg/archive" - "github.com/sirupsen/logrus" -) - -var ( - flDebug = flag.Bool("D", false, "debugging output") - flNewDir = flag.String("newdir", "", "") - flOldDir = flag.String("olddir", "", "") - log = logrus.New() -) - -func main() { - flag.Usage = func() { - fmt.Println("Produce a tar from comparing two directory paths. By default a demo tar is created of around 200 files (including hardlinks)") - fmt.Printf("%s [OPTIONS]\n", os.Args[0]) - flag.PrintDefaults() - } - flag.Parse() - log.Out = os.Stderr - if (len(os.Getenv("DEBUG")) > 0) || *flDebug { - logrus.SetLevel(logrus.DebugLevel) - } - var newDir, oldDir string - - if len(*flNewDir) == 0 { - var err error - newDir, err = ioutil.TempDir("", "docker-test-newDir") - if err != nil { - log.Fatal(err) - } - defer os.RemoveAll(newDir) - if _, err := prepareUntarSourceDirectory(100, newDir, true); err != nil { - log.Fatal(err) - } - } else { - newDir = *flNewDir - } - - if len(*flOldDir) == 0 { - oldDir, err := ioutil.TempDir("", "docker-test-oldDir") - if err != nil { - log.Fatal(err) - } - defer os.RemoveAll(oldDir) - } else { - oldDir = *flOldDir - } - - changes, err := archive.ChangesDirs(newDir, oldDir) - if err != nil { - log.Fatal(err) - } - - a, err := archive.ExportChanges(newDir, changes) - if err != nil { - log.Fatal(err) - } - defer a.Close() - - i, err := io.Copy(os.Stdout, a) - if err != nil && err != io.EOF { - log.Fatal(err) - } - fmt.Fprintf(os.Stderr, "wrote archive of %d bytes", i) -} - -func prepareUntarSourceDirectory(numberOfFiles int, targetPath string, makeLinks bool) (int, error) { - fileData := []byte("fooo") - for n := 0; n < numberOfFiles; n++ { - fileName := fmt.Sprintf("file-%d", n) - if err := ioutil.WriteFile(path.Join(targetPath, fileName), fileData, 0700); err != nil { - return 0, err - } - if makeLinks { - if err := os.Link(path.Join(targetPath, fileName), path.Join(targetPath, fileName+"-link")); err != nil { - return 0, err - } - } - } - totalSize := numberOfFiles * len(fileData) - return totalSize, nil -} diff --git a/vendor/github.com/docker/docker/pkg/fileutils/fileutils.go b/vendor/github.com/docker/docker/pkg/fileutils/fileutils.go index 28cad499..34f1c726 100644 --- a/vendor/github.com/docker/docker/pkg/fileutils/fileutils.go +++ b/vendor/github.com/docker/docker/pkg/fileutils/fileutils.go @@ -106,7 +106,7 @@ func (pm *PatternMatcher) Patterns() []*Pattern { return pm.patterns } -// Pattern defines a single regexp used used to filter file paths. +// Pattern defines a single regexp used to filter file paths. type Pattern struct { cleanedPattern string dirs []string diff --git a/vendor/github.com/docker/docker/pkg/homedir/homedir_linux.go b/vendor/github.com/docker/docker/pkg/homedir/homedir_linux.go index ee15ed52..5e6310fd 100644 --- a/vendor/github.com/docker/docker/pkg/homedir/homedir_linux.go +++ b/vendor/github.com/docker/docker/pkg/homedir/homedir_linux.go @@ -1,21 +1,93 @@ package homedir // import "github.com/docker/docker/pkg/homedir" import ( + "errors" "os" - - "github.com/docker/docker/pkg/idtools" + "path/filepath" + "strings" ) -// GetStatic returns the home directory for the current user without calling -// os/user.Current(). This is useful for static-linked binary on glibc-based -// system, because a call to os/user.Current() in a static binary leads to -// segfault due to a glibc issue that won't be fixed in a short term. -// (#29344, golang/go#13470, https://sourceware.org/bugzilla/show_bug.cgi?id=19341) -func GetStatic() (string, error) { - uid := os.Getuid() - usr, err := idtools.LookupUID(uid) - if err != nil { - return "", err +// GetRuntimeDir returns XDG_RUNTIME_DIR. +// XDG_RUNTIME_DIR is typically configured via pam_systemd. +// GetRuntimeDir returns non-nil error if XDG_RUNTIME_DIR is not set. +// +// See also https://standards.freedesktop.org/basedir-spec/latest/ar01s03.html +func GetRuntimeDir() (string, error) { + if xdgRuntimeDir := os.Getenv("XDG_RUNTIME_DIR"); xdgRuntimeDir != "" { + return xdgRuntimeDir, nil } - return usr.Home, nil + return "", errors.New("could not get XDG_RUNTIME_DIR") +} + +// StickRuntimeDirContents sets the sticky bit on files that are under +// XDG_RUNTIME_DIR, so that the files won't be periodically removed by the system. +// +// StickyRuntimeDir returns slice of sticked files. +// StickyRuntimeDir returns nil error if XDG_RUNTIME_DIR is not set. +// +// See also https://standards.freedesktop.org/basedir-spec/latest/ar01s03.html +func StickRuntimeDirContents(files []string) ([]string, error) { + runtimeDir, err := GetRuntimeDir() + if err != nil { + // ignore error if runtimeDir is empty + return nil, nil + } + runtimeDir, err = filepath.Abs(runtimeDir) + if err != nil { + return nil, err + } + var sticked []string + for _, f := range files { + f, err = filepath.Abs(f) + if err != nil { + return sticked, err + } + if strings.HasPrefix(f, runtimeDir+"/") { + if err = stick(f); err != nil { + return sticked, err + } + sticked = append(sticked, f) + } + } + return sticked, nil +} + +func stick(f string) error { + st, err := os.Stat(f) + if err != nil { + return err + } + m := st.Mode() + m |= os.ModeSticky + return os.Chmod(f, m) +} + +// GetDataHome returns XDG_DATA_HOME. +// GetDataHome returns $HOME/.local/share and nil error if XDG_DATA_HOME is not set. +// +// See also https://standards.freedesktop.org/basedir-spec/latest/ar01s03.html +func GetDataHome() (string, error) { + if xdgDataHome := os.Getenv("XDG_DATA_HOME"); xdgDataHome != "" { + return xdgDataHome, nil + } + home := os.Getenv("HOME") + if home == "" { + return "", errors.New("could not get either XDG_DATA_HOME or HOME") + } + return filepath.Join(home, ".local", "share"), nil +} + +// GetConfigHome returns XDG_CONFIG_HOME. +// GetConfigHome returns $HOME/.config and nil error if XDG_CONFIG_HOME is not set. +// +// See also https://standards.freedesktop.org/basedir-spec/latest/ar01s03.html +func GetConfigHome() (string, error) { + if xdgConfigHome := os.Getenv("XDG_CONFIG_HOME"); xdgConfigHome != "" { + return xdgConfigHome, nil + } + home := os.Getenv("HOME") + if home == "" { + return "", errors.New("could not get either XDG_CONFIG_HOME or HOME") + } + return filepath.Join(home, ".config"), nil } diff --git a/vendor/github.com/docker/docker/pkg/homedir/homedir_others.go b/vendor/github.com/docker/docker/pkg/homedir/homedir_others.go index 75ada2fe..67ab9e9b 100644 --- a/vendor/github.com/docker/docker/pkg/homedir/homedir_others.go +++ b/vendor/github.com/docker/docker/pkg/homedir/homedir_others.go @@ -6,8 +6,22 @@ import ( "errors" ) -// GetStatic is not needed for non-linux systems. -// (Precisely, it is needed only for glibc-based linux systems.) -func GetStatic() (string, error) { - return "", errors.New("homedir.GetStatic() is not supported on this system") +// GetRuntimeDir is unsupported on non-linux system. +func GetRuntimeDir() (string, error) { + return "", errors.New("homedir.GetRuntimeDir() is not supported on this system") +} + +// StickRuntimeDirContents is unsupported on non-linux system. +func StickRuntimeDirContents(files []string) ([]string, error) { + return nil, errors.New("homedir.StickRuntimeDirContents() is not supported on this system") +} + +// GetDataHome is unsupported on non-linux system. +func GetDataHome() (string, error) { + return "", errors.New("homedir.GetDataHome() is not supported on this system") +} + +// GetConfigHome is unsupported on non-linux system. +func GetConfigHome() (string, error) { + return "", errors.New("homedir.GetConfigHome() is not supported on this system") } diff --git a/vendor/github.com/docker/docker/pkg/homedir/homedir_unix.go b/vendor/github.com/docker/docker/pkg/homedir/homedir_unix.go index d85e1244..441bd727 100644 --- a/vendor/github.com/docker/docker/pkg/homedir/homedir_unix.go +++ b/vendor/github.com/docker/docker/pkg/homedir/homedir_unix.go @@ -4,8 +4,7 @@ package homedir // import "github.com/docker/docker/pkg/homedir" import ( "os" - - "github.com/opencontainers/runc/libcontainer/user" + "os/user" ) // Key returns the env var name for the user's home dir based on @@ -17,11 +16,16 @@ func Key() string { // Get returns the home directory of the current user with the help of // environment variables depending on the target operating system. // Returned path should be used with "path/filepath" to form new paths. +// +// If linking statically with cgo enabled against glibc, ensure the +// osusergo build tag is used. +// +// If needing to do nss lookups, do not disable cgo or set osusergo. func Get() string { home := os.Getenv(Key()) if home == "" { - if u, err := user.CurrentUser(); err == nil { - return u.Home + if u, err := user.Current(); err == nil { + return u.HomeDir } } return home diff --git a/vendor/github.com/docker/docker/pkg/idtools/idtools.go b/vendor/github.com/docker/docker/pkg/idtools/idtools.go index 230422ea..b3af7a42 100644 --- a/vendor/github.com/docker/docker/pkg/idtools/idtools.go +++ b/vendor/github.com/docker/docker/pkg/idtools/idtools.go @@ -4,7 +4,6 @@ import ( "bufio" "fmt" "os" - "sort" "strconv" "strings" ) @@ -203,8 +202,6 @@ func (i *IdentityMapping) GIDs() []IDMap { func createIDMap(subidRanges ranges) []IDMap { idMap := []IDMap{} - // sort the ranges by lowest ID first - sort.Sort(subidRanges) containerID := 0 for _, idrange := range subidRanges { idMap = append(idMap, IDMap{ diff --git a/vendor/github.com/docker/docker/pkg/idtools/idtools_unix.go b/vendor/github.com/docker/docker/pkg/idtools/idtools_unix.go index fb239743..3981ff64 100644 --- a/vendor/github.com/docker/docker/pkg/idtools/idtools_unix.go +++ b/vendor/github.com/docker/docker/pkg/idtools/idtools_unix.go @@ -59,7 +59,7 @@ func mkdirAs(path string, mode os.FileMode, owner Identity, mkAll, chownExisting paths = append(paths, dirPath) } } - if err := system.MkdirAll(path, mode, ""); err != nil { + if err := system.MkdirAll(path, mode); err != nil { return err } } else { diff --git a/vendor/github.com/docker/docker/pkg/idtools/idtools_windows.go b/vendor/github.com/docker/docker/pkg/idtools/idtools_windows.go index 4ae38a1b..35ede0ff 100644 --- a/vendor/github.com/docker/docker/pkg/idtools/idtools_windows.go +++ b/vendor/github.com/docker/docker/pkg/idtools/idtools_windows.go @@ -11,7 +11,7 @@ import ( // Ownership is handled elsewhere, but in the future could be support here // too. func mkdirAs(path string, mode os.FileMode, owner Identity, mkAll, chownExisting bool) error { - if err := system.MkdirAll(path, mode, ""); err != nil { + if err := system.MkdirAll(path, mode); err != nil { return err } return nil diff --git a/vendor/github.com/docker/docker/pkg/idtools/utils_unix.go b/vendor/github.com/docker/docker/pkg/idtools/utils_unix.go index 903ac450..bcf6a4ff 100644 --- a/vendor/github.com/docker/docker/pkg/idtools/utils_unix.go +++ b/vendor/github.com/docker/docker/pkg/idtools/utils_unix.go @@ -18,8 +18,8 @@ func resolveBinary(binname string) (string, error) { if err != nil { return "", err } - //only return no error if the final resolved binary basename - //matches what was searched for + // only return no error if the final resolved binary basename + // matches what was searched for if filepath.Base(resolvedPath) == binname { return resolvedPath, nil } diff --git a/vendor/github.com/docker/docker/pkg/ioutils/bytespipe.go b/vendor/github.com/docker/docker/pkg/ioutils/bytespipe.go index d4bbf3c9..87514b64 100644 --- a/vendor/github.com/docker/docker/pkg/ioutils/bytespipe.go +++ b/vendor/github.com/docker/docker/pkg/ioutils/bytespipe.go @@ -128,8 +128,9 @@ func (bp *BytesPipe) Read(p []byte) (n int, err error) { bp.mu.Lock() if bp.bufLen == 0 { if bp.closeErr != nil { + err := bp.closeErr bp.mu.Unlock() - return 0, bp.closeErr + return 0, err } bp.wait.Wait() if bp.bufLen == 0 && bp.closeErr != nil { diff --git a/vendor/github.com/fsouza/go-dockerclient/internal/jsonmessage/jsonmessage.go b/vendor/github.com/docker/docker/pkg/jsonmessage/jsonmessage.go similarity index 70% rename from vendor/github.com/fsouza/go-dockerclient/internal/jsonmessage/jsonmessage.go rename to vendor/github.com/docker/docker/pkg/jsonmessage/jsonmessage.go index 71b3395c..aa372c20 100644 --- a/vendor/github.com/fsouza/go-dockerclient/internal/jsonmessage/jsonmessage.go +++ b/vendor/github.com/docker/docker/pkg/jsonmessage/jsonmessage.go @@ -1,20 +1,15 @@ -// Copyright 2014 Docker authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the DOCKER-LICENSE file. - -package jsonmessage +package jsonmessage // import "github.com/docker/docker/pkg/jsonmessage" import ( "encoding/json" "fmt" "io" - "os" "strings" "time" - "github.com/Nvveen/Gotty" - "github.com/docker/go-units" - "github.com/fsouza/go-dockerclient/internal/term" + "github.com/docker/docker/pkg/term" + units "github.com/docker/go-units" + "github.com/morikuni/aec" ) // RFC3339NanoFixed is time.RFC3339Nano with nanoseconds padded using zeros to @@ -144,71 +139,34 @@ type JSONMessage struct { Stream string `json:"stream,omitempty"` Status string `json:"status,omitempty"` Progress *JSONProgress `json:"progressDetail,omitempty"` - ProgressMessage string `json:"progress,omitempty"` //deprecated + ProgressMessage string `json:"progress,omitempty"` // deprecated ID string `json:"id,omitempty"` From string `json:"from,omitempty"` Time int64 `json:"time,omitempty"` TimeNano int64 `json:"timeNano,omitempty"` Error *JSONError `json:"errorDetail,omitempty"` - ErrorMessage string `json:"error,omitempty"` //deprecated + ErrorMessage string `json:"error,omitempty"` // deprecated // Aux contains out-of-band data, such as digests for push signing and image id after building. Aux *json.RawMessage `json:"aux,omitempty"` } -/* Satisfied by gotty.TermInfo as well as noTermInfo from below */ -type termInfo interface { - Parse(attr string, params ...interface{}) (string, error) +func clearLine(out io.Writer) { + eraseMode := aec.EraseModes.All + cl := aec.EraseLine(eraseMode) + fmt.Fprint(out, cl) } -type noTermInfo struct{} // canary used when no terminfo. - -func (ti *noTermInfo) Parse(attr string, params ...interface{}) (string, error) { - return "", fmt.Errorf("noTermInfo") +func cursorUp(out io.Writer, l uint) { + fmt.Fprint(out, aec.Up(l)) } -func clearLine(out io.Writer, ti termInfo) { - // el2 (clear whole line) is not exposed by terminfo. - - // First clear line from beginning to cursor - if attr, err := ti.Parse("el1"); err == nil { - fmt.Fprintf(out, "%s", attr) - } else { - fmt.Fprintf(out, "\x1b[1K") - } - // Then clear line from cursor to end - if attr, err := ti.Parse("el"); err == nil { - fmt.Fprintf(out, "%s", attr) - } else { - fmt.Fprintf(out, "\x1b[K") - } +func cursorDown(out io.Writer, l uint) { + fmt.Fprint(out, aec.Down(l)) } -func cursorUp(out io.Writer, ti termInfo, l int) { - if l == 0 { // Should never be the case, but be tolerant - return - } - if attr, err := ti.Parse("cuu", l); err == nil { - fmt.Fprintf(out, "%s", attr) - } else { - fmt.Fprintf(out, "\x1b[%dA", l) - } -} - -func cursorDown(out io.Writer, ti termInfo, l int) { - if l == 0 { // Should never be the case, but be tolerant - return - } - if attr, err := ti.Parse("cud", l); err == nil { - fmt.Fprintf(out, "%s", attr) - } else { - fmt.Fprintf(out, "\x1b[%dB", l) - } -} - -// Display displays the JSONMessage to `out`. `termInfo` is non-nil if `out` -// is a terminal. If this is the case, it will erase the entire current line -// when displaying the progressbar. -func (jm *JSONMessage) Display(out io.Writer, termInfo termInfo) error { +// Display displays the JSONMessage to `out`. If `isTerminal` is true, it will erase the +// entire current line when displaying the progressbar. +func (jm *JSONMessage) Display(out io.Writer, isTerminal bool) error { if jm.Error != nil { if jm.Error.Code == 401 { return fmt.Errorf("authentication is required") @@ -216,11 +174,11 @@ func (jm *JSONMessage) Display(out io.Writer, termInfo termInfo) error { return jm.Error } var endl string - if termInfo != nil && jm.Stream == "" && jm.Progress != nil { - clearLine(out, termInfo) + if isTerminal && jm.Stream == "" && jm.Progress != nil { + clearLine(out) endl = "\r" - fmt.Fprintf(out, endl) - } else if jm.Progress != nil && jm.Progress.String() != "" { //disable progressbar in non-terminal + fmt.Fprint(out, endl) + } else if jm.Progress != nil && jm.Progress.String() != "" { // disable progressbar in non-terminal return nil } if jm.TimeNano != 0 { @@ -234,9 +192,9 @@ func (jm *JSONMessage) Display(out io.Writer, termInfo termInfo) error { if jm.From != "" { fmt.Fprintf(out, "(from %s) ", jm.From) } - if jm.Progress != nil && termInfo != nil { + if jm.Progress != nil && isTerminal { fmt.Fprintf(out, "%s %s%s", jm.Status, jm.Progress.String(), endl) - } else if jm.ProgressMessage != "" { //deprecated + } else if jm.ProgressMessage != "" { // deprecated fmt.Fprintf(out, "%s %s%s", jm.Status, jm.ProgressMessage, endl) } else if jm.Stream != "" { fmt.Fprintf(out, "%s%s", jm.Stream, endl) @@ -252,25 +210,11 @@ func (jm *JSONMessage) Display(out io.Writer, termInfo termInfo) error { func DisplayJSONMessagesStream(in io.Reader, out io.Writer, terminalFd uintptr, isTerminal bool, auxCallback func(JSONMessage)) error { var ( dec = json.NewDecoder(in) - ids = make(map[string]int) + ids = make(map[string]uint) ) - var termInfo termInfo - - if isTerminal { - term := os.Getenv("TERM") - if term == "" { - term = "vt102" - } - - var err error - if termInfo, err = gotty.OpenTermInfo(term); err != nil { - termInfo = &noTermInfo{} - } - } - for { - diff := 0 + var diff uint var jm JSONMessage if err := dec.Decode(&jm); err != nil { if err == io.EOF { @@ -298,15 +242,15 @@ func DisplayJSONMessagesStream(in io.Reader, out io.Writer, terminalFd uintptr, // when we output something that's not // accounted for in the map, such as a line // with no ID. - line = len(ids) + line = uint(len(ids)) ids[jm.ID] = line - if termInfo != nil { + if isTerminal { fmt.Fprintf(out, "\n") } } - diff = len(ids) - line - if termInfo != nil { - cursorUp(out, termInfo, diff) + diff = uint(len(ids)) - line + if isTerminal { + cursorUp(out, diff) } } else { // When outputting something that isn't progress @@ -314,11 +258,11 @@ func DisplayJSONMessagesStream(in io.Reader, out io.Writer, terminalFd uintptr, // don't want progress entries from some previous // operation to be updated (for example, pull -a // with multiple tags). - ids = make(map[string]int) + ids = make(map[string]uint) } - err := jm.Display(out, termInfo) - if jm.ID != "" && termInfo != nil { - cursorDown(out, termInfo, diff) + err := jm.Display(out, isTerminal) + if jm.ID != "" && isTerminal { + cursorDown(out, diff) } if err != nil { return err diff --git a/vendor/github.com/docker/docker/pkg/mount/mount.go b/vendor/github.com/docker/docker/pkg/mount/mount.go deleted file mode 100644 index 874aff65..00000000 --- a/vendor/github.com/docker/docker/pkg/mount/mount.go +++ /dev/null @@ -1,141 +0,0 @@ -package mount // import "github.com/docker/docker/pkg/mount" - -import ( - "sort" - "strings" - "syscall" - - "github.com/sirupsen/logrus" -) - -// FilterFunc is a type defining a callback function -// to filter out unwanted entries. It takes a pointer -// to an Info struct (not fully populated, currently -// only Mountpoint is filled in), and returns two booleans: -// - skip: true if the entry should be skipped -// - stop: true if parsing should be stopped after the entry -type FilterFunc func(*Info) (skip, stop bool) - -// PrefixFilter discards all entries whose mount points -// do not start with a prefix specified -func PrefixFilter(prefix string) FilterFunc { - return func(m *Info) (bool, bool) { - skip := !strings.HasPrefix(m.Mountpoint, prefix) - return skip, false - } -} - -// SingleEntryFilter looks for a specific entry -func SingleEntryFilter(mp string) FilterFunc { - return func(m *Info) (bool, bool) { - if m.Mountpoint == mp { - return false, true // don't skip, stop now - } - return true, false // skip, keep going - } -} - -// ParentsFilter returns all entries whose mount points -// can be parents of a path specified, discarding others. -// For example, given `/var/lib/docker/something`, entries -// like `/var/lib/docker`, `/var` and `/` are returned. -func ParentsFilter(path string) FilterFunc { - return func(m *Info) (bool, bool) { - skip := !strings.HasPrefix(path, m.Mountpoint) - return skip, false - } -} - -// GetMounts retrieves a list of mounts for the current running process, -// with an optional filter applied (use nil for no filter). -func GetMounts(f FilterFunc) ([]*Info, error) { - return parseMountTable(f) -} - -// Mounted determines if a specified mountpoint has been mounted. -// On Linux it looks at /proc/self/mountinfo. -func Mounted(mountpoint string) (bool, error) { - entries, err := GetMounts(SingleEntryFilter(mountpoint)) - if err != nil { - return false, err - } - - return len(entries) > 0, nil -} - -// Mount will mount filesystem according to the specified configuration, on the -// condition that the target path is *not* already mounted. Options must be -// specified like the mount or fstab unix commands: "opt1=val1,opt2=val2". See -// flags.go for supported option flags. -func Mount(device, target, mType, options string) error { - flag, _ := parseOptions(options) - if flag&REMOUNT != REMOUNT { - if mounted, err := Mounted(target); err != nil || mounted { - return err - } - } - return ForceMount(device, target, mType, options) -} - -// ForceMount will mount a filesystem according to the specified configuration, -// *regardless* if the target path is not already mounted. Options must be -// specified like the mount or fstab unix commands: "opt1=val1,opt2=val2". See -// flags.go for supported option flags. -func ForceMount(device, target, mType, options string) error { - flag, data := parseOptions(options) - return mount(device, target, mType, uintptr(flag), data) -} - -// Unmount lazily unmounts a filesystem on supported platforms, otherwise -// does a normal unmount. -func Unmount(target string) error { - err := unmount(target, mntDetach) - if err == syscall.EINVAL { - // ignore "not mounted" error - err = nil - } - return err -} - -// RecursiveUnmount unmounts the target and all mounts underneath, starting with -// the deepsest mount first. -func RecursiveUnmount(target string) error { - mounts, err := parseMountTable(PrefixFilter(target)) - if err != nil { - return err - } - - // Make the deepest mount be first - sort.Slice(mounts, func(i, j int) bool { - return len(mounts[i].Mountpoint) > len(mounts[j].Mountpoint) - }) - - for i, m := range mounts { - logrus.Debugf("Trying to unmount %s", m.Mountpoint) - err = unmount(m.Mountpoint, mntDetach) - if err != nil { - // If the error is EINVAL either this whole package is wrong (invalid flags passed to unmount(2)) or this is - // not a mountpoint (which is ok in this case). - // Meanwhile calling `Mounted()` is very expensive. - // - // We've purposefully used `syscall.EINVAL` here instead of `unix.EINVAL` to avoid platform branching - // Since `EINVAL` is defined for both Windows and Linux in the `syscall` package (and other platforms), - // this is nicer than defining a custom value that we can refer to in each platform file. - if err == syscall.EINVAL { - continue - } - if i == len(mounts)-1 { - if mounted, e := Mounted(m.Mountpoint); e != nil || mounted { - return err - } - continue - } - // This is some submount, we can ignore this error for now, the final unmount will fail if this is a real problem - logrus.WithError(err).Warnf("Failed to unmount submount %s", m.Mountpoint) - continue - } - - logrus.Debugf("Unmounted %s", m.Mountpoint) - } - return nil -} diff --git a/vendor/github.com/docker/docker/pkg/pools/pools.go b/vendor/github.com/docker/docker/pkg/pools/pools.go index 46339c28..3792c67a 100644 --- a/vendor/github.com/docker/docker/pkg/pools/pools.go +++ b/vendor/github.com/docker/docker/pkg/pools/pools.go @@ -62,23 +62,23 @@ type bufferPool struct { func newBufferPoolWithSize(size int) *bufferPool { return &bufferPool{ pool: sync.Pool{ - New: func() interface{} { return make([]byte, size) }, + New: func() interface{} { s := make([]byte, size); return &s }, }, } } -func (bp *bufferPool) Get() []byte { - return bp.pool.Get().([]byte) +func (bp *bufferPool) Get() *[]byte { + return bp.pool.Get().(*[]byte) } -func (bp *bufferPool) Put(b []byte) { +func (bp *bufferPool) Put(b *[]byte) { bp.pool.Put(b) } // Copy is a convenience wrapper which uses a buffer to avoid allocation in io.Copy. func Copy(dst io.Writer, src io.Reader) (written int64, err error) { buf := buffer32KPool.Get() - written, err = io.CopyBuffer(dst, src, buf) + written, err = io.CopyBuffer(dst, src, *buf) buffer32KPool.Put(buf) return } diff --git a/vendor/github.com/docker/docker/pkg/system/args_windows.go b/vendor/github.com/docker/docker/pkg/system/args_windows.go new file mode 100644 index 00000000..b7c9487a --- /dev/null +++ b/vendor/github.com/docker/docker/pkg/system/args_windows.go @@ -0,0 +1,16 @@ +package system // import "github.com/docker/docker/pkg/system" + +import ( + "strings" + + "golang.org/x/sys/windows" +) + +// EscapeArgs makes a Windows-style escaped command line from a set of arguments +func EscapeArgs(args []string) string { + escapedArgs := make([]string, len(args)) + for i, a := range args { + escapedArgs[i] = windows.EscapeArg(a) + } + return strings.Join(escapedArgs, " ") +} diff --git a/vendor/github.com/docker/docker/pkg/system/chtimes_unix.go b/vendor/github.com/docker/docker/pkg/system/chtimes_unix.go index 259138a4..d5fab96f 100644 --- a/vendor/github.com/docker/docker/pkg/system/chtimes_unix.go +++ b/vendor/github.com/docker/docker/pkg/system/chtimes_unix.go @@ -6,9 +6,9 @@ import ( "time" ) -//setCTime will set the create time on a file. On Unix, the create -//time is updated as a side effect of setting the modified time, so -//no action is required. +// setCTime will set the create time on a file. On Unix, the create +// time is updated as a side effect of setting the modified time, so +// no action is required. func setCTime(path string, ctime time.Time) error { return nil } diff --git a/vendor/github.com/docker/docker/pkg/system/chtimes_windows.go b/vendor/github.com/docker/docker/pkg/system/chtimes_windows.go index d3a115ff..6664b8bc 100644 --- a/vendor/github.com/docker/docker/pkg/system/chtimes_windows.go +++ b/vendor/github.com/docker/docker/pkg/system/chtimes_windows.go @@ -6,8 +6,8 @@ import ( "golang.org/x/sys/windows" ) -//setCTime will set the create time on a file. On Windows, this requires -//calling SetFileTime and explicitly including the create time. +// setCTime will set the create time on a file. On Windows, this requires +// calling SetFileTime and explicitly including the create time. func setCTime(path string, ctime time.Time) error { ctimespec := windows.NsecToTimespec(ctime.UnixNano()) pathp, e := windows.UTF16PtrFromString(path) diff --git a/vendor/github.com/docker/docker/pkg/system/filesys.go b/vendor/github.com/docker/docker/pkg/system/filesys_unix.go similarity index 93% rename from vendor/github.com/docker/docker/pkg/system/filesys.go rename to vendor/github.com/docker/docker/pkg/system/filesys_unix.go index adeb1630..dcee3e9f 100644 --- a/vendor/github.com/docker/docker/pkg/system/filesys.go +++ b/vendor/github.com/docker/docker/pkg/system/filesys_unix.go @@ -8,14 +8,14 @@ import ( "path/filepath" ) -// MkdirAllWithACL is a wrapper for MkdirAll on unix systems. +// MkdirAllWithACL is a wrapper for os.MkdirAll on unix systems. func MkdirAllWithACL(path string, perm os.FileMode, sddl string) error { - return MkdirAll(path, perm, sddl) + return os.MkdirAll(path, perm) } // MkdirAll creates a directory named path along with any necessary parents, // with permission specified by attribute perm for all dir created. -func MkdirAll(path string, perm os.FileMode, sddl string) error { +func MkdirAll(path string, perm os.FileMode) error { return os.MkdirAll(path, perm) } diff --git a/vendor/github.com/docker/docker/pkg/system/filesys_windows.go b/vendor/github.com/docker/docker/pkg/system/filesys_windows.go index a1f6013f..b4646277 100644 --- a/vendor/github.com/docker/docker/pkg/system/filesys_windows.go +++ b/vendor/github.com/docker/docker/pkg/system/filesys_windows.go @@ -11,15 +11,12 @@ import ( "time" "unsafe" - winio "github.com/Microsoft/go-winio" "golang.org/x/sys/windows" ) const ( // SddlAdministratorsLocalSystem is local administrators plus NT AUTHORITY\System SddlAdministratorsLocalSystem = "D:P(A;OICI;GA;;;BA)(A;OICI;GA;;;SY)" - // SddlNtvmAdministratorsLocalSystem is NT VIRTUAL MACHINE\Virtual Machines plus local administrators plus NT AUTHORITY\System - SddlNtvmAdministratorsLocalSystem = "D:P(A;OICI;GA;;;S-1-5-83-0)(A;OICI;GA;;;BA)(A;OICI;GA;;;SY)" ) // MkdirAllWithACL is a wrapper for MkdirAll that creates a directory @@ -28,9 +25,10 @@ func MkdirAllWithACL(path string, perm os.FileMode, sddl string) error { return mkdirall(path, true, sddl) } -// MkdirAll implementation that is volume path aware for Windows. -func MkdirAll(path string, _ os.FileMode, sddl string) error { - return mkdirall(path, false, sddl) +// MkdirAll implementation that is volume path aware for Windows. It can be used +// as a drop-in replacement for os.MkdirAll() +func MkdirAll(path string, _ os.FileMode) error { + return mkdirall(path, false, "") } // mkdirall is a custom version of os.MkdirAll modified for use on Windows @@ -104,13 +102,13 @@ func mkdirall(path string, applyACL bool, sddl string) error { // and Local System. func mkdirWithACL(name string, sddl string) error { sa := windows.SecurityAttributes{Length: 0} - sd, err := winio.SddlToSecurityDescriptor(sddl) + sd, err := windows.SecurityDescriptorFromString(sddl) if err != nil { return &os.PathError{Op: "mkdir", Path: name, Err: err} } sa.Length = uint32(unsafe.Sizeof(sa)) sa.InheritHandle = 1 - sa.SecurityDescriptor = uintptr(unsafe.Pointer(&sd[0])) + sa.SecurityDescriptor = sd namep, err := windows.UTF16PtrFromString(name) if err != nil { @@ -132,12 +130,10 @@ func mkdirWithACL(name string, sddl string) error { // by the daemon. This SHOULD be treated as absolute from a docker processing // perspective. func IsAbs(path string) bool { - if !filepath.IsAbs(path) { - if !strings.HasPrefix(path, string(os.PathSeparator)) { - return false - } + if filepath.IsAbs(path) || strings.HasPrefix(path, string(os.PathSeparator)) { + return true } - return true + return false } // The origin of the functions below here are the golang OS and windows packages, @@ -237,7 +233,7 @@ func windowsOpenSequential(path string, mode int, _ uint32) (fd windows.Handle, createmode = windows.OPEN_EXISTING } // Use FILE_FLAG_SEQUENTIAL_SCAN rather than FILE_ATTRIBUTE_NORMAL as implemented in golang. - //https://msdn.microsoft.com/en-us/library/windows/desktop/aa363858(v=vs.85).aspx + // https://msdn.microsoft.com/en-us/library/windows/desktop/aa363858(v=vs.85).aspx const fileFlagSequentialScan = 0x08000000 // FILE_FLAG_SEQUENTIAL_SCAN h, e := windows.CreateFile(pathp, access, sharemode, sa, createmode, fileFlagSequentialScan, 0) return h, e diff --git a/vendor/github.com/docker/docker/pkg/system/init_unix.go b/vendor/github.com/docker/docker/pkg/system/init_unix.go index 4996a67c..c2bb0f4c 100644 --- a/vendor/github.com/docker/docker/pkg/system/init_unix.go +++ b/vendor/github.com/docker/docker/pkg/system/init_unix.go @@ -5,3 +5,8 @@ package system // import "github.com/docker/docker/pkg/system" // InitLCOW does nothing since LCOW is a windows only feature func InitLCOW(experimental bool) { } + +// ContainerdRuntimeSupported returns true if the use of ContainerD runtime is supported. +func ContainerdRuntimeSupported(_ bool, _ string) bool { + return true +} diff --git a/vendor/github.com/docker/docker/pkg/system/init_windows.go b/vendor/github.com/docker/docker/pkg/system/init_windows.go index 4910ff69..7e4ac55d 100644 --- a/vendor/github.com/docker/docker/pkg/system/init_windows.go +++ b/vendor/github.com/docker/docker/pkg/system/init_windows.go @@ -1,12 +1,40 @@ package system // import "github.com/docker/docker/pkg/system" -// lcowSupported determines if Linux Containers on Windows are supported. -var lcowSupported = false +import ( + "os" -// InitLCOW sets whether LCOW is supported or not + "github.com/Microsoft/hcsshim/osversion" + "github.com/sirupsen/logrus" +) + +var ( + // lcowSupported determines if Linux Containers on Windows are supported. + lcowSupported = false + + // containerdRuntimeSupported determines if ContainerD should be the runtime. + // As of March 2019, this is an experimental feature. + containerdRuntimeSupported = false +) + +// InitLCOW sets whether LCOW is supported or not. Requires RS5+ func InitLCOW(experimental bool) { - v := GetOSVersion() - if experimental && v.Build >= 16299 { + if experimental && osversion.Build() >= osversion.RS5 { lcowSupported = true } } + +// InitContainerdRuntime sets whether to use ContainerD for runtime +// on Windows. This is an experimental feature still in development, and +// also requires an environment variable to be set (so as not to turn the +// feature on from simply experimental which would also mean LCOW. +func InitContainerdRuntime(experimental bool, cdPath string) { + if experimental && len(cdPath) > 0 && len(os.Getenv("DOCKER_WINDOWS_CONTAINERD_RUNTIME")) > 0 { + logrus.Warnf("Using ContainerD runtime. This feature is experimental") + containerdRuntimeSupported = true + } +} + +// ContainerdRuntimeSupported returns true if the use of ContainerD runtime is supported. +func ContainerdRuntimeSupported() bool { + return containerdRuntimeSupported +} diff --git a/vendor/github.com/docker/docker/pkg/system/lstat_unix.go b/vendor/github.com/docker/docker/pkg/system/lstat_unix.go index 7477995f..de5a1c0f 100644 --- a/vendor/github.com/docker/docker/pkg/system/lstat_unix.go +++ b/vendor/github.com/docker/docker/pkg/system/lstat_unix.go @@ -3,6 +3,7 @@ package system // import "github.com/docker/docker/pkg/system" import ( + "os" "syscall" ) @@ -13,7 +14,7 @@ import ( func Lstat(path string) (*StatT, error) { s := &syscall.Stat_t{} if err := syscall.Lstat(path, s); err != nil { - return nil, err + return nil, &os.PathError{Op: "Lstat", Path: path, Err: err} } return fromStatT(s) } diff --git a/vendor/github.com/docker/docker/pkg/system/meminfo_linux.go b/vendor/github.com/docker/docker/pkg/system/meminfo_linux.go index d79e8b07..cd060eff 100644 --- a/vendor/github.com/docker/docker/pkg/system/meminfo_linux.go +++ b/vendor/github.com/docker/docker/pkg/system/meminfo_linux.go @@ -7,7 +7,7 @@ import ( "strconv" "strings" - "github.com/docker/go-units" + units "github.com/docker/go-units" ) // ReadMemInfo retrieves memory statistics of the host system and returns a @@ -27,6 +27,7 @@ func ReadMemInfo() (*MemInfo, error) { func parseMemInfo(reader io.Reader) (*MemInfo, error) { meminfo := &MemInfo{} scanner := bufio.NewScanner(reader) + memAvailable := int64(-1) for scanner.Scan() { // Expected format: ["MemTotal:", "1234", "kB"] parts := strings.Fields(scanner.Text()) @@ -48,6 +49,8 @@ func parseMemInfo(reader io.Reader) (*MemInfo, error) { meminfo.MemTotal = bytes case "MemFree:": meminfo.MemFree = bytes + case "MemAvailable:": + memAvailable = bytes case "SwapTotal:": meminfo.SwapTotal = bytes case "SwapFree:": @@ -55,6 +58,9 @@ func parseMemInfo(reader io.Reader) (*MemInfo, error) { } } + if memAvailable != -1 { + meminfo.MemFree = memAvailable + } // Handle errors that may have occurred during the reading of the file. if err := scanner.Err(); err != nil { diff --git a/vendor/github.com/docker/docker/pkg/system/path.go b/vendor/github.com/docker/docker/pkg/system/path.go index a3d957af..64e89228 100644 --- a/vendor/github.com/docker/docker/pkg/system/path.go +++ b/vendor/github.com/docker/docker/pkg/system/path.go @@ -5,8 +5,6 @@ import ( "path/filepath" "runtime" "strings" - - "github.com/containerd/continuity/pathdriver" ) const defaultUnixPathEnv = "/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin" @@ -27,6 +25,12 @@ func DefaultPathEnv(os string) string { } +// PathVerifier defines the subset of a PathDriver that CheckSystemDriveAndRemoveDriveLetter +// actually uses in order to avoid system depending on containerd/continuity. +type PathVerifier interface { + IsAbs(string) bool +} + // CheckSystemDriveAndRemoveDriveLetter verifies that a path, if it includes a drive letter, // is the system drive. // On Linux: this is a no-op. @@ -42,7 +46,7 @@ func DefaultPathEnv(os string) string { // a --> a // /a --> \a // d:\ --> Fail -func CheckSystemDriveAndRemoveDriveLetter(path string, driver pathdriver.PathDriver) (string, error) { +func CheckSystemDriveAndRemoveDriveLetter(path string, driver PathVerifier) (string, error) { if runtime.GOOS != "windows" || LCOWSupported() { return path, nil } diff --git a/vendor/github.com/docker/docker/pkg/system/path_unix.go b/vendor/github.com/docker/docker/pkg/system/path_unix.go new file mode 100644 index 00000000..b0b93196 --- /dev/null +++ b/vendor/github.com/docker/docker/pkg/system/path_unix.go @@ -0,0 +1,10 @@ +// +build !windows + +package system // import "github.com/docker/docker/pkg/system" + +// GetLongPathName converts Windows short pathnames to full pathnames. +// For example C:\Users\ADMIN~1 --> C:\Users\Administrator. +// It is a no-op on non-Windows platforms +func GetLongPathName(path string) (string, error) { + return path, nil +} diff --git a/vendor/github.com/docker/docker/pkg/system/path_windows.go b/vendor/github.com/docker/docker/pkg/system/path_windows.go new file mode 100644 index 00000000..22a56136 --- /dev/null +++ b/vendor/github.com/docker/docker/pkg/system/path_windows.go @@ -0,0 +1,27 @@ +package system // import "github.com/docker/docker/pkg/system" + +import "golang.org/x/sys/windows" + +// GetLongPathName converts Windows short pathnames to full pathnames. +// For example C:\Users\ADMIN~1 --> C:\Users\Administrator. +// It is a no-op on non-Windows platforms +func GetLongPathName(path string) (string, error) { + // See https://groups.google.com/forum/#!topic/golang-dev/1tufzkruoTg + p, err := windows.UTF16FromString(path) + if err != nil { + return "", err + } + b := p // GetLongPathName says we can reuse buffer + n, err := windows.GetLongPathName(&p[0], &b[0], uint32(len(b))) + if err != nil { + return "", err + } + if n > uint32(len(b)) { + b = make([]uint16, n) + _, err = windows.GetLongPathName(&p[0], &b[0], uint32(len(b))) + if err != nil { + return "", err + } + } + return windows.UTF16ToString(b), nil +} diff --git a/vendor/github.com/docker/docker/pkg/system/process_unix.go b/vendor/github.com/docker/docker/pkg/system/process_unix.go index 0195a891..79aebb52 100644 --- a/vendor/github.com/docker/docker/pkg/system/process_unix.go +++ b/vendor/github.com/docker/docker/pkg/system/process_unix.go @@ -3,6 +3,9 @@ package system // import "github.com/docker/docker/pkg/system" import ( + "fmt" + "io/ioutil" + "strings" "syscall" "golang.org/x/sys/unix" @@ -22,3 +25,20 @@ func IsProcessAlive(pid int) bool { func KillProcess(pid int) { unix.Kill(pid, unix.SIGKILL) } + +// IsProcessZombie return true if process has a state with "Z" +// http://man7.org/linux/man-pages/man5/proc.5.html +func IsProcessZombie(pid int) (bool, error) { + statPath := fmt.Sprintf("/proc/%d/stat", pid) + dataBytes, err := ioutil.ReadFile(statPath) + if err != nil { + return false, err + } + data := string(dataBytes) + sdata := strings.SplitN(data, " ", 4) + if len(sdata) >= 3 && sdata[2] == "Z" { + return true, nil + } + + return false, nil +} diff --git a/vendor/github.com/docker/docker/pkg/system/process_windows.go b/vendor/github.com/docker/docker/pkg/system/process_windows.go index 4e70c97b..09bdfa0c 100644 --- a/vendor/github.com/docker/docker/pkg/system/process_windows.go +++ b/vendor/github.com/docker/docker/pkg/system/process_windows.go @@ -13,6 +13,6 @@ func IsProcessAlive(pid int) bool { func KillProcess(pid int) { p, err := os.FindProcess(pid) if err == nil { - p.Kill() + _ = p.Kill() } } diff --git a/vendor/github.com/docker/docker/pkg/system/rm.go b/vendor/github.com/docker/docker/pkg/system/rm.go index b3109918..9e251dc1 100644 --- a/vendor/github.com/docker/docker/pkg/system/rm.go +++ b/vendor/github.com/docker/docker/pkg/system/rm.go @@ -5,7 +5,7 @@ import ( "syscall" "time" - "github.com/docker/docker/pkg/mount" + "github.com/moby/sys/mount" "github.com/pkg/errors" ) @@ -63,12 +63,8 @@ func EnsureRemoveAll(dir string) error { return err } - if mounted, _ := mount.Mounted(pe.Path); mounted { - if e := mount.Unmount(pe.Path); e != nil { - if mounted, _ := mount.Mounted(pe.Path); mounted { - return errors.Wrapf(e, "error while removing %s", dir) - } - } + if e := mount.Unmount(pe.Path); e != nil { + return errors.Wrapf(e, "error while removing %s", dir) } if exitOnErr[pe.Path] == maxRetry { diff --git a/vendor/github.com/docker/docker/pkg/system/stat_linux.go b/vendor/github.com/docker/docker/pkg/system/stat_linux.go index 98c9eb18..17d5d131 100644 --- a/vendor/github.com/docker/docker/pkg/system/stat_linux.go +++ b/vendor/github.com/docker/docker/pkg/system/stat_linux.go @@ -8,7 +8,8 @@ func fromStatT(s *syscall.Stat_t) (*StatT, error) { mode: s.Mode, uid: s.Uid, gid: s.Gid, - rdev: s.Rdev, + // the type is 32bit on mips + rdev: uint64(s.Rdev), // nolint: unconvert mtim: s.Mtim}, nil } diff --git a/vendor/github.com/docker/docker/pkg/system/stat_solaris.go b/vendor/github.com/docker/docker/pkg/system/stat_solaris.go deleted file mode 100644 index 756b92d1..00000000 --- a/vendor/github.com/docker/docker/pkg/system/stat_solaris.go +++ /dev/null @@ -1,13 +0,0 @@ -package system // import "github.com/docker/docker/pkg/system" - -import "syscall" - -// fromStatT converts a syscall.Stat_t type to a system.Stat_t type -func fromStatT(s *syscall.Stat_t) (*StatT, error) { - return &StatT{size: s.Size, - mode: uint32(s.Mode), - uid: s.Uid, - gid: s.Gid, - rdev: uint64(s.Rdev), - mtim: s.Mtim}, nil -} diff --git a/vendor/github.com/docker/docker/pkg/system/stat_unix.go b/vendor/github.com/docker/docker/pkg/system/stat_unix.go index 3d7e2ebb..86bb6dd5 100644 --- a/vendor/github.com/docker/docker/pkg/system/stat_unix.go +++ b/vendor/github.com/docker/docker/pkg/system/stat_unix.go @@ -3,6 +3,7 @@ package system // import "github.com/docker/docker/pkg/system" import ( + "os" "syscall" ) @@ -59,7 +60,7 @@ func (s StatT) IsDir() bool { func Stat(path string) (*StatT, error) { s := &syscall.Stat_t{} if err := syscall.Stat(path, s); err != nil { - return nil, err + return nil, &os.PathError{Op: "Stat", Path: path, Err: err} } return fromStatT(s) } diff --git a/vendor/github.com/docker/docker/pkg/system/syscall_unix.go b/vendor/github.com/docker/docker/pkg/system/syscall_unix.go index 919a412a..905d10f1 100644 --- a/vendor/github.com/docker/docker/pkg/system/syscall_unix.go +++ b/vendor/github.com/docker/docker/pkg/system/syscall_unix.go @@ -9,9 +9,3 @@ import "golang.org/x/sys/unix" func Unmount(dest string) error { return unix.Unmount(dest, 0) } - -// CommandLineToArgv should not be used on Unix. -// It simply returns commandLine in the only element in the returned array. -func CommandLineToArgv(commandLine string) ([]string, error) { - return []string{commandLine}, nil -} diff --git a/vendor/github.com/docker/docker/pkg/system/syscall_windows.go b/vendor/github.com/docker/docker/pkg/system/syscall_windows.go index 4ae92fa6..b6683424 100644 --- a/vendor/github.com/docker/docker/pkg/system/syscall_windows.go +++ b/vendor/github.com/docker/docker/pkg/system/syscall_windows.go @@ -1,45 +1,45 @@ package system // import "github.com/docker/docker/pkg/system" import ( - "fmt" "syscall" "unsafe" + "github.com/Microsoft/hcsshim/osversion" "github.com/sirupsen/logrus" "golang.org/x/sys/windows" ) const ( - OWNER_SECURITY_INFORMATION = 0x00000001 - GROUP_SECURITY_INFORMATION = 0x00000002 - DACL_SECURITY_INFORMATION = 0x00000004 - SACL_SECURITY_INFORMATION = 0x00000008 - LABEL_SECURITY_INFORMATION = 0x00000010 - ATTRIBUTE_SECURITY_INFORMATION = 0x00000020 - SCOPE_SECURITY_INFORMATION = 0x00000040 + OWNER_SECURITY_INFORMATION = windows.OWNER_SECURITY_INFORMATION // Deprecated: use golang.org/x/sys/windows.OWNER_SECURITY_INFORMATION + GROUP_SECURITY_INFORMATION = windows.GROUP_SECURITY_INFORMATION // Deprecated: use golang.org/x/sys/windows.GROUP_SECURITY_INFORMATION + DACL_SECURITY_INFORMATION = windows.DACL_SECURITY_INFORMATION // Deprecated: use golang.org/x/sys/windows.DACL_SECURITY_INFORMATION + SACL_SECURITY_INFORMATION = windows.SACL_SECURITY_INFORMATION // Deprecated: use golang.org/x/sys/windows.SACL_SECURITY_INFORMATION + LABEL_SECURITY_INFORMATION = windows.LABEL_SECURITY_INFORMATION // Deprecated: use golang.org/x/sys/windows.LABEL_SECURITY_INFORMATION + ATTRIBUTE_SECURITY_INFORMATION = windows.ATTRIBUTE_SECURITY_INFORMATION // Deprecated: use golang.org/x/sys/windows.ATTRIBUTE_SECURITY_INFORMATION + SCOPE_SECURITY_INFORMATION = windows.SCOPE_SECURITY_INFORMATION // Deprecated: use golang.org/x/sys/windows.SCOPE_SECURITY_INFORMATION PROCESS_TRUST_LABEL_SECURITY_INFORMATION = 0x00000080 ACCESS_FILTER_SECURITY_INFORMATION = 0x00000100 - BACKUP_SECURITY_INFORMATION = 0x00010000 - PROTECTED_DACL_SECURITY_INFORMATION = 0x80000000 - PROTECTED_SACL_SECURITY_INFORMATION = 0x40000000 - UNPROTECTED_DACL_SECURITY_INFORMATION = 0x20000000 - UNPROTECTED_SACL_SECURITY_INFORMATION = 0x10000000 + BACKUP_SECURITY_INFORMATION = windows.BACKUP_SECURITY_INFORMATION // Deprecated: use golang.org/x/sys/windows.BACKUP_SECURITY_INFORMATION + PROTECTED_DACL_SECURITY_INFORMATION = windows.PROTECTED_DACL_SECURITY_INFORMATION // Deprecated: use golang.org/x/sys/windows.PROTECTED_DACL_SECURITY_INFORMATION + PROTECTED_SACL_SECURITY_INFORMATION = windows.PROTECTED_SACL_SECURITY_INFORMATION // Deprecated: use golang.org/x/sys/windows.PROTECTED_SACL_SECURITY_INFORMATION + UNPROTECTED_DACL_SECURITY_INFORMATION = windows.UNPROTECTED_DACL_SECURITY_INFORMATION // Deprecated: use golang.org/x/sys/windows.UNPROTECTED_DACL_SECURITY_INFORMATION + UNPROTECTED_SACL_SECURITY_INFORMATION = windows.UNPROTECTED_SACL_SECURITY_INFORMATION // Deprecated: use golang.org/x/sys/windows.UNPROTECTED_SACL_SECURITY_INFORMATION ) const ( - SE_UNKNOWN_OBJECT_TYPE = iota - SE_FILE_OBJECT - SE_SERVICE - SE_PRINTER - SE_REGISTRY_KEY - SE_LMSHARE - SE_KERNEL_OBJECT - SE_WINDOW_OBJECT - SE_DS_OBJECT - SE_DS_OBJECT_ALL - SE_PROVIDER_DEFINED_OBJECT - SE_WMIGUID_OBJECT - SE_REGISTRY_WOW64_32KEY + SE_UNKNOWN_OBJECT_TYPE = windows.SE_UNKNOWN_OBJECT_TYPE // Deprecated: use golang.org/x/sys/windows.SE_UNKNOWN_OBJECT_TYPE + SE_FILE_OBJECT = windows.SE_FILE_OBJECT // Deprecated: use golang.org/x/sys/windows.SE_FILE_OBJECT + SE_SERVICE = windows.SE_SERVICE // Deprecated: use golang.org/x/sys/windows.SE_SERVICE + SE_PRINTER = windows.SE_PRINTER // Deprecated: use golang.org/x/sys/windows.SE_PRINTER + SE_REGISTRY_KEY = windows.SE_REGISTRY_KEY // Deprecated: use golang.org/x/sys/windows.SE_REGISTRY_KEY + SE_LMSHARE = windows.SE_LMSHARE // Deprecated: use golang.org/x/sys/windows.SE_LMSHARE + SE_KERNEL_OBJECT = windows.SE_KERNEL_OBJECT // Deprecated: use golang.org/x/sys/windows.SE_KERNEL_OBJECT + SE_WINDOW_OBJECT = windows.SE_WINDOW_OBJECT // Deprecated: use golang.org/x/sys/windows.SE_WINDOW_OBJECT + SE_DS_OBJECT = windows.SE_DS_OBJECT // Deprecated: use golang.org/x/sys/windows.SE_DS_OBJECT + SE_DS_OBJECT_ALL = windows.SE_DS_OBJECT_ALL // Deprecated: use golang.org/x/sys/windows.SE_DS_OBJECT_ALL + SE_PROVIDER_DEFINED_OBJECT = windows.SE_PROVIDER_DEFINED_OBJECT // Deprecated: use golang.org/x/sys/windows.SE_PROVIDER_DEFINED_OBJECT + SE_WMIGUID_OBJECT = windows.SE_WMIGUID_OBJECT // Deprecated: use golang.org/x/sys/windows.SE_WMIGUID_OBJECT + SE_REGISTRY_WOW64_32KEY = windows.SE_REGISTRY_WOW64_32KEY // Deprecated: use golang.org/x/sys/windows.SE_REGISTRY_WOW64_32KEY ) const ( @@ -55,21 +55,16 @@ var ( ntuserApiset = windows.NewLazyDLL("ext-ms-win-ntuser-window-l1-1-0") modadvapi32 = windows.NewLazySystemDLL("advapi32.dll") procGetVersionExW = modkernel32.NewProc("GetVersionExW") - procGetProductInfo = modkernel32.NewProc("GetProductInfo") procSetNamedSecurityInfo = modadvapi32.NewProc("SetNamedSecurityInfoW") procGetSecurityDescriptorDacl = modadvapi32.NewProc("GetSecurityDescriptorDacl") ) // OSVersion is a wrapper for Windows version information // https://msdn.microsoft.com/en-us/library/windows/desktop/ms724439(v=vs.85).aspx -type OSVersion struct { - Version uint32 - MajorVersion uint8 - MinorVersion uint8 - Build uint16 -} +type OSVersion = osversion.OSVersion // https://msdn.microsoft.com/en-us/library/windows/desktop/ms724833(v=vs.85).aspx +// TODO: use golang.org/x/sys/windows.OsVersionInfoEx (needs OSVersionInfoSize to be exported) type osVersionInfoEx struct { OSVersionInfoSize uint32 MajorVersion uint32 @@ -85,28 +80,13 @@ type osVersionInfoEx struct { } // GetOSVersion gets the operating system version on Windows. Note that -// docker.exe must be manifested to get the correct version information. +// dockerd.exe must be manifested to get the correct version information. +// Deprecated: use github.com/Microsoft/hcsshim/osversion.Get() instead func GetOSVersion() OSVersion { - var err error - osv := OSVersion{} - osv.Version, err = windows.GetVersion() - if err != nil { - // GetVersion never fails. - panic(err) - } - osv.MajorVersion = uint8(osv.Version & 0xFF) - osv.MinorVersion = uint8(osv.Version >> 8 & 0xFF) - osv.Build = uint16(osv.Version >> 16) - return osv -} - -func (osv OSVersion) ToString() string { - return fmt.Sprintf("%d.%d.%d", osv.MajorVersion, osv.MinorVersion, osv.Build) + return osversion.Get() } // IsWindowsClient returns true if the SKU is client -// @engine maintainers - this function should not be removed or modified as it -// is used to enforce licensing restrictions on Windows. func IsWindowsClient() bool { osviex := &osVersionInfoEx{OSVersionInfoSize: 284} r1, _, err := procGetVersionExW.Call(uintptr(unsafe.Pointer(osviex))) @@ -118,51 +98,12 @@ func IsWindowsClient() bool { return osviex.ProductType == verNTWorkstation } -// IsIoTCore returns true if the currently running image is based off of -// Windows 10 IoT Core. -// @engine maintainers - this function should not be removed or modified as it -// is used to enforce licensing restrictions on Windows. -func IsIoTCore() bool { - var returnedProductType uint32 - r1, _, err := procGetProductInfo.Call(6, 1, 0, 0, uintptr(unsafe.Pointer(&returnedProductType))) - if r1 == 0 { - logrus.Warnf("GetProductInfo failed - assuming this is not IoT: %v", err) - return false - } - const productIoTUAP = 0x0000007B - const productIoTUAPCommercial = 0x00000083 - return returnedProductType == productIoTUAP || returnedProductType == productIoTUAPCommercial -} - // Unmount is a platform-specific helper function to call // the unmount syscall. Not supported on Windows -func Unmount(dest string) error { +func Unmount(_ string) error { return nil } -// CommandLineToArgv wraps the Windows syscall to turn a commandline into an argument array. -func CommandLineToArgv(commandLine string) ([]string, error) { - var argc int32 - - argsPtr, err := windows.UTF16PtrFromString(commandLine) - if err != nil { - return nil, err - } - - argv, err := windows.CommandLineToArgv(argsPtr, &argc) - if err != nil { - return nil, err - } - defer windows.LocalFree(windows.Handle(uintptr(unsafe.Pointer(argv)))) - - newArgs := make([]string, argc) - for i, v := range (*argv)[:argc] { - newArgs[i] = string(windows.UTF16ToString((*v)[:])) - } - - return newArgs, nil -} - // HasWin32KSupport determines whether containers that depend on win32k can // run on this machine. Win32k is the driver used to implement windowing. func HasWin32KSupport() bool { @@ -184,7 +125,7 @@ func GetSecurityDescriptorDacl(securityDescriptor *byte, daclPresent *uint32, da r1, _, e1 := syscall.Syscall6(procGetSecurityDescriptorDacl.Addr(), 4, uintptr(unsafe.Pointer(securityDescriptor)), uintptr(unsafe.Pointer(daclPresent)), uintptr(unsafe.Pointer(dacl)), uintptr(unsafe.Pointer(daclDefaulted)), 0, 0) if r1 == 0 { if e1 != 0 { - result = syscall.Errno(e1) + result = e1 } else { result = syscall.EINVAL } diff --git a/vendor/github.com/docker/docker/pkg/system/utimes_linux.go b/vendor/github.com/docker/docker/pkg/system/utimes_linux.go deleted file mode 100644 index 0afe8545..00000000 --- a/vendor/github.com/docker/docker/pkg/system/utimes_linux.go +++ /dev/null @@ -1,25 +0,0 @@ -package system // import "github.com/docker/docker/pkg/system" - -import ( - "syscall" - "unsafe" - - "golang.org/x/sys/unix" -) - -// LUtimesNano is used to change access and modification time of the specified path. -// It's used for symbol link file because unix.UtimesNano doesn't support a NOFOLLOW flag atm. -func LUtimesNano(path string, ts []syscall.Timespec) error { - atFdCwd := unix.AT_FDCWD - - var _path *byte - _path, err := unix.BytePtrFromString(path) - if err != nil { - return err - } - if _, _, err := unix.Syscall6(unix.SYS_UTIMENSAT, uintptr(atFdCwd), uintptr(unsafe.Pointer(_path)), uintptr(unsafe.Pointer(&ts[0])), unix.AT_SYMLINK_NOFOLLOW, 0, 0); err != 0 && err != unix.ENOSYS { - return err - } - - return nil -} diff --git a/vendor/github.com/docker/docker/pkg/system/utimes_freebsd.go b/vendor/github.com/docker/docker/pkg/system/utimes_unix.go similarity index 58% rename from vendor/github.com/docker/docker/pkg/system/utimes_freebsd.go rename to vendor/github.com/docker/docker/pkg/system/utimes_unix.go index ed1b9fad..61ba8c47 100644 --- a/vendor/github.com/docker/docker/pkg/system/utimes_freebsd.go +++ b/vendor/github.com/docker/docker/pkg/system/utimes_unix.go @@ -1,8 +1,9 @@ +// +build linux freebsd + package system // import "github.com/docker/docker/pkg/system" import ( "syscall" - "unsafe" "golang.org/x/sys/unix" ) @@ -10,13 +11,12 @@ import ( // LUtimesNano is used to change access and modification time of the specified path. // It's used for symbol link file because unix.UtimesNano doesn't support a NOFOLLOW flag atm. func LUtimesNano(path string, ts []syscall.Timespec) error { - var _path *byte - _path, err := unix.BytePtrFromString(path) - if err != nil { - return err + uts := []unix.Timespec{ + unix.NsecToTimespec(syscall.TimespecToNsec(ts[0])), + unix.NsecToTimespec(syscall.TimespecToNsec(ts[1])), } - - if _, _, err := unix.Syscall(unix.SYS_LUTIMES, uintptr(unsafe.Pointer(_path)), uintptr(unsafe.Pointer(&ts[0])), 0); err != 0 && err != unix.ENOSYS { + err := unix.UtimesNanoAt(unix.AT_FDCWD, path, uts, unix.AT_SYMLINK_NOFOLLOW) + if err != nil && err != unix.ENOSYS { return err } diff --git a/vendor/github.com/docker/docker/pkg/system/xattrs_linux.go b/vendor/github.com/docker/docker/pkg/system/xattrs_linux.go index 66d4895b..95b609fe 100644 --- a/vendor/github.com/docker/docker/pkg/system/xattrs_linux.go +++ b/vendor/github.com/docker/docker/pkg/system/xattrs_linux.go @@ -6,16 +6,24 @@ import "golang.org/x/sys/unix" // and associated with the given path in the file system. // It will returns a nil slice and nil error if the xattr is not set. func Lgetxattr(path string, attr string) ([]byte, error) { + // Start with a 128 length byte array dest := make([]byte, 128) sz, errno := unix.Lgetxattr(path, attr, dest) - if errno == unix.ENODATA { - return nil, nil - } - if errno == unix.ERANGE { + + for errno == unix.ERANGE { + // Buffer too small, use zero-sized buffer to get the actual size + sz, errno = unix.Lgetxattr(path, attr, []byte{}) + if errno != nil { + return nil, errno + } dest = make([]byte, sz) sz, errno = unix.Lgetxattr(path, attr, dest) } - if errno != nil { + + switch { + case errno == unix.ENODATA: + return nil, nil + case errno != nil: return nil, errno } diff --git a/vendor/github.com/docker/docker/pkg/term/ascii.go b/vendor/github.com/docker/docker/pkg/term/ascii.go new file mode 100644 index 00000000..87bca8d4 --- /dev/null +++ b/vendor/github.com/docker/docker/pkg/term/ascii.go @@ -0,0 +1,66 @@ +package term // import "github.com/docker/docker/pkg/term" + +import ( + "fmt" + "strings" +) + +// ASCII list the possible supported ASCII key sequence +var ASCII = []string{ + "ctrl-@", + "ctrl-a", + "ctrl-b", + "ctrl-c", + "ctrl-d", + "ctrl-e", + "ctrl-f", + "ctrl-g", + "ctrl-h", + "ctrl-i", + "ctrl-j", + "ctrl-k", + "ctrl-l", + "ctrl-m", + "ctrl-n", + "ctrl-o", + "ctrl-p", + "ctrl-q", + "ctrl-r", + "ctrl-s", + "ctrl-t", + "ctrl-u", + "ctrl-v", + "ctrl-w", + "ctrl-x", + "ctrl-y", + "ctrl-z", + "ctrl-[", + "ctrl-\\", + "ctrl-]", + "ctrl-^", + "ctrl-_", +} + +// ToBytes converts a string representing a suite of key-sequence to the corresponding ASCII code. +func ToBytes(keys string) ([]byte, error) { + codes := []byte{} +next: + for _, key := range strings.Split(keys, ",") { + if len(key) != 1 { + for code, ctrl := range ASCII { + if ctrl == key { + codes = append(codes, byte(code)) + continue next + } + } + if key == "DEL" { + codes = append(codes, 127) + } else { + return nil, fmt.Errorf("Unknown character: '%s'", key) + } + } else { + codes = append(codes, key[0]) + } + } + return codes, nil +} diff --git a/vendor/github.com/docker/docker/pkg/term/proxy.go b/vendor/github.com/docker/docker/pkg/term/proxy.go new file mode 100644 index 00000000..42158bd6 --- /dev/null +++ b/vendor/github.com/docker/docker/pkg/term/proxy.go @@ -0,0 +1,88 @@ +package term // import "github.com/docker/docker/pkg/term" + +import ( + "io" +) + +// EscapeError is special error which returned by a TTY proxy reader's Read() +// method in case its detach escape sequence is read. +type EscapeError struct{} + +func (EscapeError) Error() string { + return "read escape sequence" +} + +// escapeProxy is used only for attaches with a TTY. It is used to proxy +// stdin keypresses from the underlying reader and look for the passed in +// escape key sequence to signal a detach. +type escapeProxy struct { + escapeKeys []byte + escapeKeyPos int + r io.Reader + buf []byte +} + +// NewEscapeProxy returns a new TTY proxy reader which wraps the given reader +// and detects when the specified escape keys are read, in which case the Read +// method will return an error of type EscapeError. +func NewEscapeProxy(r io.Reader, escapeKeys []byte) io.Reader { + return &escapeProxy{ + escapeKeys: escapeKeys, + r: r, + } +} + +func (r *escapeProxy) Read(buf []byte) (n int, err error) { + if len(r.escapeKeys) > 0 && r.escapeKeyPos == len(r.escapeKeys) { + return 0, EscapeError{} + } + + if len(r.buf) > 0 { + n = copy(buf, r.buf) + r.buf = r.buf[n:] + } + + nr, err := r.r.Read(buf[n:]) + n += nr + if len(r.escapeKeys) == 0 { + return n, err + } + + for i := 0; i < n; i++ { + if buf[i] == r.escapeKeys[r.escapeKeyPos] { + r.escapeKeyPos++ + + // Check if the full escape sequence is matched. + if r.escapeKeyPos == len(r.escapeKeys) { + n = i + 1 - r.escapeKeyPos + if n < 0 { + n = 0 + } + return n, EscapeError{} + } + continue + } + + // If we need to prepend a partial escape sequence from the previous + // read, make sure the new buffer size doesn't exceed len(buf). + // Otherwise, preserve any extra data in a buffer for the next read. + if i < r.escapeKeyPos { + preserve := make([]byte, 0, r.escapeKeyPos+n) + preserve = append(preserve, r.escapeKeys[:r.escapeKeyPos]...) + preserve = append(preserve, buf[:n]...) + n = copy(buf, preserve) + i += r.escapeKeyPos + r.buf = append(r.buf, preserve[n:]...) + } + r.escapeKeyPos = 0 + } + + // If we're in the middle of reading an escape sequence, make sure we don't + // let the caller read it. If later on we find that this is not the escape + // sequence, we'll prepend it back to buf. + n -= r.escapeKeyPos + if n < 0 { + n = 0 + } + return n, err +} diff --git a/vendor/github.com/docker/docker/pkg/term/tc.go b/vendor/github.com/docker/docker/pkg/term/tc.go new file mode 100644 index 00000000..01bcaa8a --- /dev/null +++ b/vendor/github.com/docker/docker/pkg/term/tc.go @@ -0,0 +1,20 @@ +// +build !windows + +package term // import "github.com/docker/docker/pkg/term" + +import ( + "syscall" + "unsafe" + + "golang.org/x/sys/unix" +) + +func tcget(fd uintptr, p *Termios) syscall.Errno { + _, _, err := unix.Syscall(unix.SYS_IOCTL, fd, uintptr(getTermios), uintptr(unsafe.Pointer(p))) + return err +} + +func tcset(fd uintptr, p *Termios) syscall.Errno { + _, _, err := unix.Syscall(unix.SYS_IOCTL, fd, setTermios, uintptr(unsafe.Pointer(p))) + return err +} diff --git a/vendor/github.com/docker/docker/pkg/term/term.go b/vendor/github.com/docker/docker/pkg/term/term.go new file mode 100644 index 00000000..0589a955 --- /dev/null +++ b/vendor/github.com/docker/docker/pkg/term/term.go @@ -0,0 +1,124 @@ +// +build !windows + +// Package term provides structures and helper functions to work with +// terminal (state, sizes). +package term // import "github.com/docker/docker/pkg/term" + +import ( + "errors" + "fmt" + "io" + "os" + "os/signal" + + "golang.org/x/sys/unix" +) + +var ( + // ErrInvalidState is returned if the state of the terminal is invalid. + ErrInvalidState = errors.New("Invalid terminal state") +) + +// State represents the state of the terminal. +type State struct { + termios Termios +} + +// Winsize represents the size of the terminal window. +type Winsize struct { + Height uint16 + Width uint16 + x uint16 + y uint16 +} + +// StdStreams returns the standard streams (stdin, stdout, stderr). +func StdStreams() (stdIn io.ReadCloser, stdOut, stdErr io.Writer) { + return os.Stdin, os.Stdout, os.Stderr +} + +// GetFdInfo returns the file descriptor for an os.File and indicates whether the file represents a terminal. +func GetFdInfo(in interface{}) (uintptr, bool) { + var inFd uintptr + var isTerminalIn bool + if file, ok := in.(*os.File); ok { + inFd = file.Fd() + isTerminalIn = IsTerminal(inFd) + } + return inFd, isTerminalIn +} + +// IsTerminal returns true if the given file descriptor is a terminal. +func IsTerminal(fd uintptr) bool { + var termios Termios + return tcget(fd, &termios) == 0 +} + +// RestoreTerminal restores the terminal connected to the given file descriptor +// to a previous state. +func RestoreTerminal(fd uintptr, state *State) error { + if state == nil { + return ErrInvalidState + } + if err := tcset(fd, &state.termios); err != 0 { + return err + } + return nil +} + +// SaveState saves the state of the terminal connected to the given file descriptor. +func SaveState(fd uintptr) (*State, error) { + var oldState State + if err := tcget(fd, &oldState.termios); err != 0 { + return nil, err + } + + return &oldState, nil +} + +// DisableEcho applies the specified state to the terminal connected to the file +// descriptor, with echo disabled. +func DisableEcho(fd uintptr, state *State) error { + newState := state.termios + newState.Lflag &^= unix.ECHO + + if err := tcset(fd, &newState); err != 0 { + return err + } + handleInterrupt(fd, state) + return nil +} + +// SetRawTerminal puts the terminal connected to the given file descriptor into +// raw mode and returns the previous state. On UNIX, this puts both the input +// and output into raw mode. On Windows, it only puts the input into raw mode. +func SetRawTerminal(fd uintptr) (*State, error) { + oldState, err := MakeRaw(fd) + if err != nil { + return nil, err + } + handleInterrupt(fd, oldState) + return oldState, err +} + +// SetRawTerminalOutput puts the output of terminal connected to the given file +// descriptor into raw mode. On UNIX, this does nothing and returns nil for the +// state. On Windows, it disables LF -> CRLF translation. +func SetRawTerminalOutput(fd uintptr) (*State, error) { + return nil, nil +} + +func handleInterrupt(fd uintptr, state *State) { + sigchan := make(chan os.Signal, 1) + signal.Notify(sigchan, os.Interrupt) + go func() { + for range sigchan { + // quit cleanly and the new terminal item is on a new line + fmt.Println() + signal.Stop(sigchan) + close(sigchan) + RestoreTerminal(fd, state) + os.Exit(1) + } + }() +} diff --git a/vendor/github.com/docker/docker/pkg/term/term_windows.go b/vendor/github.com/docker/docker/pkg/term/term_windows.go new file mode 100644 index 00000000..6e83b59e --- /dev/null +++ b/vendor/github.com/docker/docker/pkg/term/term_windows.go @@ -0,0 +1,221 @@ +package term // import "github.com/docker/docker/pkg/term" + +import ( + "io" + "os" + "os/signal" + "syscall" // used for STD_INPUT_HANDLE, STD_OUTPUT_HANDLE and STD_ERROR_HANDLE + + "github.com/Azure/go-ansiterm/winterm" + windowsconsole "github.com/docker/docker/pkg/term/windows" +) + +// State holds the console mode for the terminal. +type State struct { + mode uint32 +} + +// Winsize is used for window size. +type Winsize struct { + Height uint16 + Width uint16 +} + +// vtInputSupported is true if winterm.ENABLE_VIRTUAL_TERMINAL_INPUT is supported by the console +var vtInputSupported bool + +// StdStreams returns the standard streams (stdin, stdout, stderr). +func StdStreams() (stdIn io.ReadCloser, stdOut, stdErr io.Writer) { + // Turn on VT handling on all std handles, if possible. This might + // fail, in which case we will fall back to terminal emulation. + var emulateStdin, emulateStdout, emulateStderr bool + fd := os.Stdin.Fd() + if mode, err := winterm.GetConsoleMode(fd); err == nil { + // Validate that winterm.ENABLE_VIRTUAL_TERMINAL_INPUT is supported, but do not set it. + if err = winterm.SetConsoleMode(fd, mode|winterm.ENABLE_VIRTUAL_TERMINAL_INPUT); err != nil { + emulateStdin = true + } else { + vtInputSupported = true + } + // Unconditionally set the console mode back even on failure because SetConsoleMode + // remembers invalid bits on input handles. + winterm.SetConsoleMode(fd, mode) + } + + fd = os.Stdout.Fd() + if mode, err := winterm.GetConsoleMode(fd); err == nil { + // Validate winterm.DISABLE_NEWLINE_AUTO_RETURN is supported, but do not set it. + if err = winterm.SetConsoleMode(fd, mode|winterm.ENABLE_VIRTUAL_TERMINAL_PROCESSING|winterm.DISABLE_NEWLINE_AUTO_RETURN); err != nil { + emulateStdout = true + } else { + winterm.SetConsoleMode(fd, mode|winterm.ENABLE_VIRTUAL_TERMINAL_PROCESSING) + } + } + + fd = os.Stderr.Fd() + if mode, err := winterm.GetConsoleMode(fd); err == nil { + // Validate winterm.DISABLE_NEWLINE_AUTO_RETURN is supported, but do not set it. + if err = winterm.SetConsoleMode(fd, mode|winterm.ENABLE_VIRTUAL_TERMINAL_PROCESSING|winterm.DISABLE_NEWLINE_AUTO_RETURN); err != nil { + emulateStderr = true + } else { + winterm.SetConsoleMode(fd, mode|winterm.ENABLE_VIRTUAL_TERMINAL_PROCESSING) + } + } + + // Temporarily use STD_INPUT_HANDLE, STD_OUTPUT_HANDLE and + // STD_ERROR_HANDLE from syscall rather than x/sys/windows as long as + // go-ansiterm hasn't switch to x/sys/windows. + // TODO: switch back to x/sys/windows once go-ansiterm has switched + if emulateStdin { + stdIn = windowsconsole.NewAnsiReader(syscall.STD_INPUT_HANDLE) + } else { + stdIn = os.Stdin + } + + if emulateStdout { + stdOut = windowsconsole.NewAnsiWriter(syscall.STD_OUTPUT_HANDLE) + } else { + stdOut = os.Stdout + } + + if emulateStderr { + stdErr = windowsconsole.NewAnsiWriter(syscall.STD_ERROR_HANDLE) + } else { + stdErr = os.Stderr + } + + return +} + +// GetFdInfo returns the file descriptor for an os.File and indicates whether the file represents a terminal. +func GetFdInfo(in interface{}) (uintptr, bool) { + return windowsconsole.GetHandleInfo(in) +} + +// GetWinsize returns the window size based on the specified file descriptor. +func GetWinsize(fd uintptr) (*Winsize, error) { + info, err := winterm.GetConsoleScreenBufferInfo(fd) + if err != nil { + return nil, err + } + + winsize := &Winsize{ + Width: uint16(info.Window.Right - info.Window.Left + 1), + Height: uint16(info.Window.Bottom - info.Window.Top + 1), + } + + return winsize, nil +} + +// IsTerminal returns true if the given file descriptor is a terminal. +func IsTerminal(fd uintptr) bool { + return windowsconsole.IsConsole(fd) +} + +// RestoreTerminal restores the terminal connected to the given file descriptor +// to a previous state. +func RestoreTerminal(fd uintptr, state *State) error { + return winterm.SetConsoleMode(fd, state.mode) +} + +// SaveState saves the state of the terminal connected to the given file descriptor. +func SaveState(fd uintptr) (*State, error) { + mode, e := winterm.GetConsoleMode(fd) + if e != nil { + return nil, e + } + + return &State{mode: mode}, nil +} + +// DisableEcho disables echo for the terminal connected to the given file descriptor. +// -- See https://msdn.microsoft.com/en-us/library/windows/desktop/ms683462(v=vs.85).aspx +func DisableEcho(fd uintptr, state *State) error { + mode := state.mode + mode &^= winterm.ENABLE_ECHO_INPUT + mode |= winterm.ENABLE_PROCESSED_INPUT | winterm.ENABLE_LINE_INPUT + err := winterm.SetConsoleMode(fd, mode) + if err != nil { + return err + } + + // Register an interrupt handler to catch and restore prior state + restoreAtInterrupt(fd, state) + return nil +} + +// SetRawTerminal puts the terminal connected to the given file descriptor into +// raw mode and returns the previous state. On UNIX, this puts both the input +// and output into raw mode. On Windows, it only puts the input into raw mode. +func SetRawTerminal(fd uintptr) (*State, error) { + state, err := MakeRaw(fd) + if err != nil { + return nil, err + } + + // Register an interrupt handler to catch and restore prior state + restoreAtInterrupt(fd, state) + return state, err +} + +// SetRawTerminalOutput puts the output of terminal connected to the given file +// descriptor into raw mode. On UNIX, this does nothing and returns nil for the +// state. On Windows, it disables LF -> CRLF translation. +func SetRawTerminalOutput(fd uintptr) (*State, error) { + state, err := SaveState(fd) + if err != nil { + return nil, err + } + + // Ignore failures, since winterm.DISABLE_NEWLINE_AUTO_RETURN might not be supported on this + // version of Windows. + winterm.SetConsoleMode(fd, state.mode|winterm.DISABLE_NEWLINE_AUTO_RETURN) + return state, err +} + +// MakeRaw puts the terminal (Windows Console) connected to the given file descriptor into raw +// mode and returns the previous state of the terminal so that it can be restored. +func MakeRaw(fd uintptr) (*State, error) { + state, err := SaveState(fd) + if err != nil { + return nil, err + } + + mode := state.mode + + // See + // -- https://msdn.microsoft.com/en-us/library/windows/desktop/ms686033(v=vs.85).aspx + // -- https://msdn.microsoft.com/en-us/library/windows/desktop/ms683462(v=vs.85).aspx + + // Disable these modes + mode &^= winterm.ENABLE_ECHO_INPUT + mode &^= winterm.ENABLE_LINE_INPUT + mode &^= winterm.ENABLE_MOUSE_INPUT + mode &^= winterm.ENABLE_WINDOW_INPUT + mode &^= winterm.ENABLE_PROCESSED_INPUT + + // Enable these modes + mode |= winterm.ENABLE_EXTENDED_FLAGS + mode |= winterm.ENABLE_INSERT_MODE + mode |= winterm.ENABLE_QUICK_EDIT_MODE + if vtInputSupported { + mode |= winterm.ENABLE_VIRTUAL_TERMINAL_INPUT + } + + err = winterm.SetConsoleMode(fd, mode) + if err != nil { + return nil, err + } + return state, nil +} + +func restoreAtInterrupt(fd uintptr, state *State) { + sigchan := make(chan os.Signal, 1) + signal.Notify(sigchan, os.Interrupt) + + go func() { + _ = <-sigchan + RestoreTerminal(fd, state) + os.Exit(0) + }() +} diff --git a/vendor/github.com/docker/docker/pkg/term/termios_bsd.go b/vendor/github.com/docker/docker/pkg/term/termios_bsd.go new file mode 100644 index 00000000..48b16f52 --- /dev/null +++ b/vendor/github.com/docker/docker/pkg/term/termios_bsd.go @@ -0,0 +1,42 @@ +// +build darwin freebsd openbsd netbsd + +package term // import "github.com/docker/docker/pkg/term" + +import ( + "unsafe" + + "golang.org/x/sys/unix" +) + +const ( + getTermios = unix.TIOCGETA + setTermios = unix.TIOCSETA +) + +// Termios is the Unix API for terminal I/O. +type Termios unix.Termios + +// MakeRaw put the terminal connected to the given file descriptor into raw +// mode and returns the previous state of the terminal so that it can be +// restored. +func MakeRaw(fd uintptr) (*State, error) { + var oldState State + if _, _, err := unix.Syscall(unix.SYS_IOCTL, fd, getTermios, uintptr(unsafe.Pointer(&oldState.termios))); err != 0 { + return nil, err + } + + newState := oldState.termios + newState.Iflag &^= (unix.IGNBRK | unix.BRKINT | unix.PARMRK | unix.ISTRIP | unix.INLCR | unix.IGNCR | unix.ICRNL | unix.IXON) + newState.Oflag &^= unix.OPOST + newState.Lflag &^= (unix.ECHO | unix.ECHONL | unix.ICANON | unix.ISIG | unix.IEXTEN) + newState.Cflag &^= (unix.CSIZE | unix.PARENB) + newState.Cflag |= unix.CS8 + newState.Cc[unix.VMIN] = 1 + newState.Cc[unix.VTIME] = 0 + + if _, _, err := unix.Syscall(unix.SYS_IOCTL, fd, setTermios, uintptr(unsafe.Pointer(&newState))); err != 0 { + return nil, err + } + + return &oldState, nil +} diff --git a/vendor/github.com/docker/docker/pkg/term/termios_linux.go b/vendor/github.com/docker/docker/pkg/term/termios_linux.go new file mode 100644 index 00000000..6d4c63fd --- /dev/null +++ b/vendor/github.com/docker/docker/pkg/term/termios_linux.go @@ -0,0 +1,39 @@ +package term // import "github.com/docker/docker/pkg/term" + +import ( + "golang.org/x/sys/unix" +) + +const ( + getTermios = unix.TCGETS + setTermios = unix.TCSETS +) + +// Termios is the Unix API for terminal I/O. +type Termios unix.Termios + +// MakeRaw put the terminal connected to the given file descriptor into raw +// mode and returns the previous state of the terminal so that it can be +// restored. +func MakeRaw(fd uintptr) (*State, error) { + termios, err := unix.IoctlGetTermios(int(fd), getTermios) + if err != nil { + return nil, err + } + + var oldState State + oldState.termios = Termios(*termios) + + termios.Iflag &^= (unix.IGNBRK | unix.BRKINT | unix.PARMRK | unix.ISTRIP | unix.INLCR | unix.IGNCR | unix.ICRNL | unix.IXON) + termios.Oflag &^= unix.OPOST + termios.Lflag &^= (unix.ECHO | unix.ECHONL | unix.ICANON | unix.ISIG | unix.IEXTEN) + termios.Cflag &^= (unix.CSIZE | unix.PARENB) + termios.Cflag |= unix.CS8 + termios.Cc[unix.VMIN] = 1 + termios.Cc[unix.VTIME] = 0 + + if err := unix.IoctlSetTermios(int(fd), setTermios, termios); err != nil { + return nil, err + } + return &oldState, nil +} diff --git a/vendor/github.com/docker/docker/pkg/term/windows/ansi_reader.go b/vendor/github.com/docker/docker/pkg/term/windows/ansi_reader.go new file mode 100644 index 00000000..1d7c452c --- /dev/null +++ b/vendor/github.com/docker/docker/pkg/term/windows/ansi_reader.go @@ -0,0 +1,263 @@ +// +build windows + +package windowsconsole // import "github.com/docker/docker/pkg/term/windows" + +import ( + "bytes" + "errors" + "fmt" + "io" + "os" + "strings" + "unsafe" + + ansiterm "github.com/Azure/go-ansiterm" + "github.com/Azure/go-ansiterm/winterm" +) + +const ( + escapeSequence = ansiterm.KEY_ESC_CSI +) + +// ansiReader wraps a standard input file (e.g., os.Stdin) providing ANSI sequence translation. +type ansiReader struct { + file *os.File + fd uintptr + buffer []byte + cbBuffer int + command []byte +} + +// NewAnsiReader returns an io.ReadCloser that provides VT100 terminal emulation on top of a +// Windows console input handle. +func NewAnsiReader(nFile int) io.ReadCloser { + initLogger() + file, fd := winterm.GetStdFile(nFile) + return &ansiReader{ + file: file, + fd: fd, + command: make([]byte, 0, ansiterm.ANSI_MAX_CMD_LENGTH), + buffer: make([]byte, 0), + } +} + +// Close closes the wrapped file. +func (ar *ansiReader) Close() (err error) { + return ar.file.Close() +} + +// Fd returns the file descriptor of the wrapped file. +func (ar *ansiReader) Fd() uintptr { + return ar.fd +} + +// Read reads up to len(p) bytes of translated input events into p. +func (ar *ansiReader) Read(p []byte) (int, error) { + if len(p) == 0 { + return 0, nil + } + + // Previously read bytes exist, read as much as we can and return + if len(ar.buffer) > 0 { + logger.Debugf("Reading previously cached bytes") + + originalLength := len(ar.buffer) + copiedLength := copy(p, ar.buffer) + + if copiedLength == originalLength { + ar.buffer = make([]byte, 0, len(p)) + } else { + ar.buffer = ar.buffer[copiedLength:] + } + + logger.Debugf("Read from cache p[%d]: % x", copiedLength, p) + return copiedLength, nil + } + + // Read and translate key events + events, err := readInputEvents(ar.fd, len(p)) + if err != nil { + return 0, err + } else if len(events) == 0 { + logger.Debug("No input events detected") + return 0, nil + } + + keyBytes := translateKeyEvents(events, []byte(escapeSequence)) + + // Save excess bytes and right-size keyBytes + if len(keyBytes) > len(p) { + logger.Debugf("Received %d keyBytes, only room for %d bytes", len(keyBytes), len(p)) + ar.buffer = keyBytes[len(p):] + keyBytes = keyBytes[:len(p)] + } else if len(keyBytes) == 0 { + logger.Debug("No key bytes returned from the translator") + return 0, nil + } + + copiedLength := copy(p, keyBytes) + if copiedLength != len(keyBytes) { + return 0, errors.New("unexpected copy length encountered") + } + + logger.Debugf("Read p[%d]: % x", copiedLength, p) + logger.Debugf("Read keyBytes[%d]: % x", copiedLength, keyBytes) + return copiedLength, nil +} + +// readInputEvents polls until at least one event is available. +func readInputEvents(fd uintptr, maxBytes int) ([]winterm.INPUT_RECORD, error) { + // Determine the maximum number of records to retrieve + // -- Cast around the type system to obtain the size of a single INPUT_RECORD. + // unsafe.Sizeof requires an expression vs. a type-reference; the casting + // tricks the type system into believing it has such an expression. + recordSize := int(unsafe.Sizeof(*((*winterm.INPUT_RECORD)(unsafe.Pointer(&maxBytes))))) + countRecords := maxBytes / recordSize + if countRecords > ansiterm.MAX_INPUT_EVENTS { + countRecords = ansiterm.MAX_INPUT_EVENTS + } else if countRecords == 0 { + countRecords = 1 + } + logger.Debugf("[windows] readInputEvents: Reading %v records (buffer size %v, record size %v)", countRecords, maxBytes, recordSize) + + // Wait for and read input events + events := make([]winterm.INPUT_RECORD, countRecords) + nEvents := uint32(0) + eventsExist, err := winterm.WaitForSingleObject(fd, winterm.WAIT_INFINITE) + if err != nil { + return nil, err + } + + if eventsExist { + err = winterm.ReadConsoleInput(fd, events, &nEvents) + if err != nil { + return nil, err + } + } + + // Return a slice restricted to the number of returned records + logger.Debugf("[windows] readInputEvents: Read %v events", nEvents) + return events[:nEvents], nil +} + +// KeyEvent Translation Helpers + +var arrowKeyMapPrefix = map[uint16]string{ + winterm.VK_UP: "%s%sA", + winterm.VK_DOWN: "%s%sB", + winterm.VK_RIGHT: "%s%sC", + winterm.VK_LEFT: "%s%sD", +} + +var keyMapPrefix = map[uint16]string{ + winterm.VK_UP: "\x1B[%sA", + winterm.VK_DOWN: "\x1B[%sB", + winterm.VK_RIGHT: "\x1B[%sC", + winterm.VK_LEFT: "\x1B[%sD", + winterm.VK_HOME: "\x1B[1%s~", // showkey shows ^[[1 + winterm.VK_END: "\x1B[4%s~", // showkey shows ^[[4 + winterm.VK_INSERT: "\x1B[2%s~", + winterm.VK_DELETE: "\x1B[3%s~", + winterm.VK_PRIOR: "\x1B[5%s~", + winterm.VK_NEXT: "\x1B[6%s~", + winterm.VK_F1: "", + winterm.VK_F2: "", + winterm.VK_F3: "\x1B[13%s~", + winterm.VK_F4: "\x1B[14%s~", + winterm.VK_F5: "\x1B[15%s~", + winterm.VK_F6: "\x1B[17%s~", + winterm.VK_F7: "\x1B[18%s~", + winterm.VK_F8: "\x1B[19%s~", + winterm.VK_F9: "\x1B[20%s~", + winterm.VK_F10: "\x1B[21%s~", + winterm.VK_F11: "\x1B[23%s~", + winterm.VK_F12: "\x1B[24%s~", +} + +// translateKeyEvents converts the input events into the appropriate ANSI string. +func translateKeyEvents(events []winterm.INPUT_RECORD, escapeSequence []byte) []byte { + var buffer bytes.Buffer + for _, event := range events { + if event.EventType == winterm.KEY_EVENT && event.KeyEvent.KeyDown != 0 { + buffer.WriteString(keyToString(&event.KeyEvent, escapeSequence)) + } + } + + return buffer.Bytes() +} + +// keyToString maps the given input event record to the corresponding string. +func keyToString(keyEvent *winterm.KEY_EVENT_RECORD, escapeSequence []byte) string { + if keyEvent.UnicodeChar == 0 { + return formatVirtualKey(keyEvent.VirtualKeyCode, keyEvent.ControlKeyState, escapeSequence) + } + + _, alt, control := getControlKeys(keyEvent.ControlKeyState) + if control { + // TODO(azlinux): Implement following control sequences + // -D Signals the end of input from the keyboard; also exits current shell. + // -H Deletes the first character to the left of the cursor. Also called the ERASE key. + // -Q Restarts printing after it has been stopped with -s. + // -S Suspends printing on the screen (does not stop the program). + // -U Deletes all characters on the current line. Also called the KILL key. + // -E Quits current command and creates a core + + } + + // +Key generates ESC N Key + if !control && alt { + return ansiterm.KEY_ESC_N + strings.ToLower(string(keyEvent.UnicodeChar)) + } + + return string(keyEvent.UnicodeChar) +} + +// formatVirtualKey converts a virtual key (e.g., up arrow) into the appropriate ANSI string. +func formatVirtualKey(key uint16, controlState uint32, escapeSequence []byte) string { + shift, alt, control := getControlKeys(controlState) + modifier := getControlKeysModifier(shift, alt, control) + + if format, ok := arrowKeyMapPrefix[key]; ok { + return fmt.Sprintf(format, escapeSequence, modifier) + } + + if format, ok := keyMapPrefix[key]; ok { + return fmt.Sprintf(format, modifier) + } + + return "" +} + +// getControlKeys extracts the shift, alt, and ctrl key states. +func getControlKeys(controlState uint32) (shift, alt, control bool) { + shift = 0 != (controlState & winterm.SHIFT_PRESSED) + alt = 0 != (controlState & (winterm.LEFT_ALT_PRESSED | winterm.RIGHT_ALT_PRESSED)) + control = 0 != (controlState & (winterm.LEFT_CTRL_PRESSED | winterm.RIGHT_CTRL_PRESSED)) + return shift, alt, control +} + +// getControlKeysModifier returns the ANSI modifier for the given combination of control keys. +func getControlKeysModifier(shift, alt, control bool) string { + if shift && alt && control { + return ansiterm.KEY_CONTROL_PARAM_8 + } + if alt && control { + return ansiterm.KEY_CONTROL_PARAM_7 + } + if shift && control { + return ansiterm.KEY_CONTROL_PARAM_6 + } + if control { + return ansiterm.KEY_CONTROL_PARAM_5 + } + if shift && alt { + return ansiterm.KEY_CONTROL_PARAM_4 + } + if alt { + return ansiterm.KEY_CONTROL_PARAM_3 + } + if shift { + return ansiterm.KEY_CONTROL_PARAM_2 + } + return "" +} diff --git a/vendor/github.com/docker/docker/pkg/term/windows/ansi_writer.go b/vendor/github.com/docker/docker/pkg/term/windows/ansi_writer.go new file mode 100644 index 00000000..7799a03f --- /dev/null +++ b/vendor/github.com/docker/docker/pkg/term/windows/ansi_writer.go @@ -0,0 +1,64 @@ +// +build windows + +package windowsconsole // import "github.com/docker/docker/pkg/term/windows" + +import ( + "io" + "os" + + ansiterm "github.com/Azure/go-ansiterm" + "github.com/Azure/go-ansiterm/winterm" +) + +// ansiWriter wraps a standard output file (e.g., os.Stdout) providing ANSI sequence translation. +type ansiWriter struct { + file *os.File + fd uintptr + infoReset *winterm.CONSOLE_SCREEN_BUFFER_INFO + command []byte + escapeSequence []byte + inAnsiSequence bool + parser *ansiterm.AnsiParser +} + +// NewAnsiWriter returns an io.Writer that provides VT100 terminal emulation on top of a +// Windows console output handle. +func NewAnsiWriter(nFile int) io.Writer { + initLogger() + file, fd := winterm.GetStdFile(nFile) + info, err := winterm.GetConsoleScreenBufferInfo(fd) + if err != nil { + return nil + } + + parser := ansiterm.CreateParser("Ground", winterm.CreateWinEventHandler(fd, file)) + logger.Infof("newAnsiWriter: parser %p", parser) + + aw := &ansiWriter{ + file: file, + fd: fd, + infoReset: info, + command: make([]byte, 0, ansiterm.ANSI_MAX_CMD_LENGTH), + escapeSequence: []byte(ansiterm.KEY_ESC_CSI), + parser: parser, + } + + logger.Infof("newAnsiWriter: aw.parser %p", aw.parser) + logger.Infof("newAnsiWriter: %v", aw) + return aw +} + +func (aw *ansiWriter) Fd() uintptr { + return aw.fd +} + +// Write writes len(p) bytes from p to the underlying data stream. +func (aw *ansiWriter) Write(p []byte) (total int, err error) { + if len(p) == 0 { + return 0, nil + } + + logger.Infof("Write: % x", p) + logger.Infof("Write: %s", string(p)) + return aw.parser.Parse(p) +} diff --git a/vendor/github.com/docker/docker/pkg/term/windows/console.go b/vendor/github.com/docker/docker/pkg/term/windows/console.go new file mode 100644 index 00000000..52740197 --- /dev/null +++ b/vendor/github.com/docker/docker/pkg/term/windows/console.go @@ -0,0 +1,35 @@ +// +build windows + +package windowsconsole // import "github.com/docker/docker/pkg/term/windows" + +import ( + "os" + + "github.com/Azure/go-ansiterm/winterm" +) + +// GetHandleInfo returns file descriptor and bool indicating whether the file is a console. +func GetHandleInfo(in interface{}) (uintptr, bool) { + switch t := in.(type) { + case *ansiReader: + return t.Fd(), true + case *ansiWriter: + return t.Fd(), true + } + + var inFd uintptr + var isTerminal bool + + if file, ok := in.(*os.File); ok { + inFd = file.Fd() + isTerminal = IsConsole(inFd) + } + return inFd, isTerminal +} + +// IsConsole returns true if the given file descriptor is a Windows Console. +// The code assumes that GetConsoleMode will return an error for file descriptors that are not a console. +func IsConsole(fd uintptr) bool { + _, e := winterm.GetConsoleMode(fd) + return e == nil +} diff --git a/vendor/github.com/docker/docker/pkg/term/windows/windows.go b/vendor/github.com/docker/docker/pkg/term/windows/windows.go new file mode 100644 index 00000000..7e8f265d --- /dev/null +++ b/vendor/github.com/docker/docker/pkg/term/windows/windows.go @@ -0,0 +1,34 @@ +// +build windows +// These files implement ANSI-aware input and output streams for use by the Docker Windows client. +// When asked for the set of standard streams (e.g., stdin, stdout, stderr), the code will create +// and return pseudo-streams that convert ANSI sequences to / from Windows Console API calls. + +package windowsconsole // import "github.com/docker/docker/pkg/term/windows" + +import ( + "io/ioutil" + "os" + "sync" + + ansiterm "github.com/Azure/go-ansiterm" + "github.com/sirupsen/logrus" +) + +var logger *logrus.Logger +var initOnce sync.Once + +func initLogger() { + initOnce.Do(func() { + logFile := ioutil.Discard + + if isDebugEnv := os.Getenv(ansiterm.LogEnv); isDebugEnv == "1" { + logFile, _ = os.Create("ansiReaderWriter.log") + } + + logger = &logrus.Logger{ + Out: logFile, + Formatter: new(logrus.TextFormatter), + Level: logrus.DebugLevel, + } + }) +} diff --git a/vendor/github.com/docker/docker/pkg/term/winsize.go b/vendor/github.com/docker/docker/pkg/term/winsize.go new file mode 100644 index 00000000..a19663ad --- /dev/null +++ b/vendor/github.com/docker/docker/pkg/term/winsize.go @@ -0,0 +1,20 @@ +// +build !windows + +package term // import "github.com/docker/docker/pkg/term" + +import ( + "golang.org/x/sys/unix" +) + +// GetWinsize returns the window size based on the specified file descriptor. +func GetWinsize(fd uintptr) (*Winsize, error) { + uws, err := unix.IoctlGetWinsize(int(fd), unix.TIOCGWINSZ) + ws := &Winsize{Height: uws.Row, Width: uws.Col, x: uws.Xpixel, y: uws.Ypixel} + return ws, err +} + +// SetWinsize tries to set the specified window size for the specified file descriptor. +func SetWinsize(fd uintptr, ws *Winsize) error { + uws := &unix.Winsize{Row: ws.Height, Col: ws.Width, Xpixel: ws.x, Ypixel: ws.y} + return unix.IoctlSetWinsize(int(fd), unix.TIOCSWINSZ, uws) +} diff --git a/vendor/github.com/docker/libnetwork/ipamutils/utils.go b/vendor/github.com/docker/libnetwork/ipamutils/utils.go deleted file mode 100644 index f8eca58e..00000000 --- a/vendor/github.com/docker/libnetwork/ipamutils/utils.go +++ /dev/null @@ -1,96 +0,0 @@ -// Package ipamutils provides utility functions for ipam management -package ipamutils - -import ( - "fmt" - "net" - "sync" - - "github.com/sirupsen/logrus" -) - -var ( - // PredefinedBroadNetworks contains a list of 31 IPv4 private networks with host size 16 and 12 - // (172.17-31.x.x/16, 192.168.x.x/20) which do not overlap with the networks in `PredefinedGranularNetworks` - PredefinedBroadNetworks []*net.IPNet - // PredefinedGranularNetworks contains a list of 64K IPv4 private networks with host size 8 - // (10.x.x.x/24) which do not overlap with the networks in `PredefinedBroadNetworks` - PredefinedGranularNetworks []*net.IPNet - initNetworksOnce sync.Once - - defaultBroadNetwork = []*NetworkToSplit{{"172.17.0.0/16", 16}, {"172.18.0.0/16", 16}, {"172.19.0.0/16", 16}, - {"172.20.0.0/14", 16}, {"172.24.0.0/14", 16}, {"172.28.0.0/14", 16}, - {"192.168.0.0/16", 20}} - defaultGranularNetwork = []*NetworkToSplit{{"10.0.0.0/8", 24}} -) - -// NetworkToSplit represent a network that has to be split in chunks with mask length Size. -// Each subnet in the set is derived from the Base pool. Base is to be passed -// in CIDR format. -// Example: a Base "10.10.0.0/16 with Size 24 will define the set of 256 -// 10.10.[0-255].0/24 address pools -type NetworkToSplit struct { - Base string `json:"base"` - Size int `json:"size"` -} - -// InitNetworks initializes the broad network pool and the granular network pool -func InitNetworks(defaultAddressPool []*NetworkToSplit) { - initNetworksOnce.Do(func() { - // error ingnored should never fail - PredefinedGranularNetworks, _ = splitNetworks(defaultGranularNetwork) - if defaultAddressPool == nil { - defaultAddressPool = defaultBroadNetwork - } - var err error - if PredefinedBroadNetworks, err = splitNetworks(defaultAddressPool); err != nil { - logrus.WithError(err).Error("InitAddressPools failed to initialize the default address pool") - } - }) -} - -// splitNetworks takes a slice of networks, split them accordingly and returns them -func splitNetworks(list []*NetworkToSplit) ([]*net.IPNet, error) { - localPools := make([]*net.IPNet, 0, len(list)) - - for _, p := range list { - _, b, err := net.ParseCIDR(p.Base) - if err != nil { - return nil, fmt.Errorf("invalid base pool %q: %v", p.Base, err) - } - ones, _ := b.Mask.Size() - if p.Size <= 0 || p.Size < ones { - return nil, fmt.Errorf("invalid pools size: %d", p.Size) - } - localPools = append(localPools, splitNetwork(p.Size, b)...) - } - return localPools, nil -} - -func splitNetwork(size int, base *net.IPNet) []*net.IPNet { - one, bits := base.Mask.Size() - mask := net.CIDRMask(size, bits) - n := 1 << uint(size-one) - s := uint(bits - size) - list := make([]*net.IPNet, 0, n) - - for i := 0; i < n; i++ { - ip := copyIP(base.IP) - addIntToIP(ip, uint(i<= 0; i-- { - array[i] |= (byte)(ordinal & 0xff) - ordinal >>= 8 - } -} diff --git a/vendor/github.com/fsouza/go-dockerclient/.gitattributes b/vendor/github.com/fsouza/go-dockerclient/.gitattributes new file mode 100644 index 00000000..6313b56c --- /dev/null +++ b/vendor/github.com/fsouza/go-dockerclient/.gitattributes @@ -0,0 +1 @@ +* text=auto eol=lf diff --git a/vendor/github.com/fsouza/go-dockerclient/.gitignore b/vendor/github.com/fsouza/go-dockerclient/.gitignore index ef22245e..5f6b48ea 100644 --- a/vendor/github.com/fsouza/go-dockerclient/.gitignore +++ b/vendor/github.com/fsouza/go-dockerclient/.gitignore @@ -1,4 +1,2 @@ # temporary symlink for testing testing/data/symlink -Gopkg.lock -vendor/ diff --git a/vendor/github.com/fsouza/go-dockerclient/.golangci.yaml b/vendor/github.com/fsouza/go-dockerclient/.golangci.yaml new file mode 100644 index 00000000..3a21b76f --- /dev/null +++ b/vendor/github.com/fsouza/go-dockerclient/.golangci.yaml @@ -0,0 +1,30 @@ +run: + deadline: 5m + + skip-dirs: + - internal + +issues: + exclude-rules: + - path: _test\.go + linters: + - bodyclose + - goconst + - gosec + - scopelint + - path: testing[/\\].+\.go + linters: + - gosec + +linters: + enable-all: true + disable: + - dupl + - errcheck + - funlen + - gochecknoglobals + - gocognit + - goconst + - gomnd + - lll + - wsl diff --git a/vendor/github.com/fsouza/go-dockerclient/.travis.yml b/vendor/github.com/fsouza/go-dockerclient/.travis.yml deleted file mode 100644 index 3756a1ff..00000000 --- a/vendor/github.com/fsouza/go-dockerclient/.travis.yml +++ /dev/null @@ -1,30 +0,0 @@ -language: go -sudo: required -go: - - 1.10.x - - 1.11.x -os: - - linux - - osx -env: - matrix: - - GOARCH=amd64 DOCKER_PKG_VERSION=18.03.0~ce-0~ubuntu - - GOARCH=386 DOCKER_PKG_VERSION=18.03.0~ce-0~ubuntu - - GOARCH=amd64 DOCKER_PKG_VERSION=18.02.0~ce-0~ubuntu - - GOARCH=386 DOCKER_PKG_VERSION=18.02.0~ce-0~ubuntu - global: - - DOCKER_HOST=tcp://127.0.0.1:2375 -install: - - make testdeps - - travis_retry travis-scripts/install-docker.bash -script: - - travis-scripts/run-tests.bash -services: - - docker -matrix: - fast_finish: true - exclude: - - os: osx - env: GOARCH=amd64 DOCKER_PKG_VERSION=18.02.0~ce-0~ubuntu - - os: osx - env: GOARCH=386 DOCKER_PKG_VERSION=18.02.0~ce-0~ubuntu diff --git a/vendor/github.com/fsouza/go-dockerclient/AUTHORS b/vendor/github.com/fsouza/go-dockerclient/AUTHORS index 7990cd04..08f89afd 100644 --- a/vendor/github.com/fsouza/go-dockerclient/AUTHORS +++ b/vendor/github.com/fsouza/go-dockerclient/AUTHORS @@ -15,6 +15,7 @@ Andrews Medina Andrey Sibiryov Andy Goldstein Anirudh Aithal +Antoine Brechon Antonio Murdaca Artem Sidorenko Arthur Rodrigues @@ -24,6 +25,7 @@ Ben Parees Benno van den Berg Bradley Cicenas Brendan Fosberry +Brett Buddin Brian Lalor Brian P. Hamachek Brian Palmer @@ -50,6 +52,7 @@ Damien Lespiau Damon Wang Dan Williams Daniel, Dao Quang Minh +Daniel Black Daniel Garcia Daniel Hess Daniel Hiltgen @@ -116,6 +119,7 @@ Kevin Xu Kim, Hirokuni Kostas Lekkas Kyle Allan +Kyle Quest Yunhee Lee Liron Levin Lior Yankovich @@ -135,6 +139,7 @@ Michal Fojtik Mike Dillon Mrunal Patel Nate Jones +Nathan Pemberton Nguyen Sy Thanh Son Nicholas Van Wiggeren Nick Ethier @@ -184,6 +189,7 @@ Tim Schindler Timothy St. Clair Tobi Knaup Tom Wilkie +Tomas Knappek Tonic ttyh061 upccup diff --git a/vendor/github.com/fsouza/go-dockerclient/Gopkg.toml b/vendor/github.com/fsouza/go-dockerclient/Gopkg.toml deleted file mode 100644 index 726e898a..00000000 --- a/vendor/github.com/fsouza/go-dockerclient/Gopkg.toml +++ /dev/null @@ -1,28 +0,0 @@ -[[constraint]] - name = "github.com/Microsoft/go-winio" - version = "v0.4.5" - -[[constraint]] - branch = "master" - name = "github.com/docker/docker" - -[[constraint]] - name = "github.com/docker/go-units" - version = "v0.3.2" - -[[constraint]] - name = "github.com/google/go-cmp" - version = "v0.2.0" - -[[constraint]] - name = "github.com/gorilla/mux" - version = "v1.5.0" - -[[override]] - name = "github.com/Nvveen/Gotty" - source = "https://github.com/ijc25/Gotty.git" - revision = "a8b993ba6abdb0e0c12b0125c603323a71c7790c" - -[[override]] - name = "github.com/docker/libnetwork" - revision = "19279f0492417475b6bfbd0aa529f73e8f178fb5" diff --git a/vendor/github.com/fsouza/go-dockerclient/LICENSE b/vendor/github.com/fsouza/go-dockerclient/LICENSE index fc7e73f8..7a70a8c4 100644 --- a/vendor/github.com/fsouza/go-dockerclient/LICENSE +++ b/vendor/github.com/fsouza/go-dockerclient/LICENSE @@ -1,4 +1,4 @@ -Copyright (c) 2013-2018, go-dockerclient authors +Copyright (c) 2013-2020, go-dockerclient authors All rights reserved. Redistribution and use in source and binary forms, with or without diff --git a/vendor/github.com/fsouza/go-dockerclient/Makefile b/vendor/github.com/fsouza/go-dockerclient/Makefile index d03f9847..bd383946 100644 --- a/vendor/github.com/fsouza/go-dockerclient/Makefile +++ b/vendor/github.com/fsouza/go-dockerclient/Makefile @@ -1,32 +1,25 @@ .PHONY: \ all \ lint \ - vet \ - fmtcheck \ pretest \ test \ integration + +ifeq "$(strip $(shell go env GOARCH))" "amd64" +RACE_FLAG := -race +endif + all: test lint: - @ go get -v golang.org/x/lint/golint - [ -z "$$(golint . | grep -v 'type name will be used as docker.DockerInfo' | grep -v 'context.Context should be the first' | tee /dev/stderr)" ] + cd /tmp && GO111MODULE=on go get github.com/golangci/golangci-lint/cmd/golangci-lint@latest + golangci-lint run -vet: - go vet ./... - -fmtcheck: - if [ -z "$${SKIP_FMT_CHECK}" ]; then [ -z "$$(gofmt -s -d *.go ./testing | tee /dev/stderr)" ]; fi - -testdeps: - go get -u github.com/golang/dep/cmd/dep - dep ensure -v - -pretest: testdeps lint vet fmtcheck +pretest: lint gotest: - go test -race ./... + go test $(RACE_FLAG) -vet all ./... test: pretest gotest diff --git a/vendor/github.com/fsouza/go-dockerclient/README.markdown b/vendor/github.com/fsouza/go-dockerclient/README.md similarity index 53% rename from vendor/github.com/fsouza/go-dockerclient/README.markdown rename to vendor/github.com/fsouza/go-dockerclient/README.md index 86824d6c..b44ff79a 100644 --- a/vendor/github.com/fsouza/go-dockerclient/README.markdown +++ b/vendor/github.com/fsouza/go-dockerclient/README.md @@ -1,19 +1,35 @@ # go-dockerclient -[![Travis Build Status](https://travis-ci.org/fsouza/go-dockerclient.svg?branch=master)](https://travis-ci.org/fsouza/go-dockerclient) -[![AppVeyor Build Status](https://ci.appveyor.com/api/projects/status/4m374pti06ubg2l7?svg=true)](https://ci.appveyor.com/project/fsouza/go-dockerclient) -[![GoDoc](https://img.shields.io/badge/api-Godoc-blue.svg?style=flat-square)](https://godoc.org/github.com/fsouza/go-dockerclient) +[![Build Status](https://github.com/fsouza/go-dockerclient/workflows/Build/badge.svg)](https://github.com/fsouza/go-dockerclient/actions?query=branch:master+workflow:Build) +[![GoDoc](https://img.shields.io/badge/api-Godoc-blue.svg?style=flat-square)](https://pkg.go.dev/github.com/fsouza/go-dockerclient) This package presents a client for the Docker remote API. It also provides support for the extensions in the [Swarm API](https://docs.docker.com/swarm/swarm-api/). This package also provides support for docker's network API, which is a simple -passthrough to the libnetwork remote API. Note that docker's network API is -only available in docker 1.8 and above, and only enabled in docker if -DOCKER_EXPERIMENTAL is defined during the docker build process. +passthrough to the libnetwork remote API. For more details, check the [remote API -documentation](http://docs.docker.com/engine/reference/api/docker_remote_api/). +documentation](https://docs.docker.com/engine/api/latest/). + +## Difference between go-dockerclient and the official SDK + +Link for the official SDK: https://docs.docker.com/develop/sdk/ + +go-dockerclient was created before Docker had an official Go SDK and is +still maintained and active because it's still used out there. New features in +the Docker API do not get automatically implemented here: it's based on demand, +if someone wants it, they can file an issue or a PR and the feature may get +implemented/merged. + +For new projects, using the official SDK is probably more appropriate as +go-dockerclient lags behind the official SDK. + +When using the official SDK, keep in mind that because of how the its +dependencies are organized, you may need some extra steps in order to be able +to import it in your projects (see +[#784](https://github.com/fsouza/go-dockerclient/issues/784) and +[moby/moby#28269](https://github.com/moby/moby/issues/28269)). ## Example @@ -23,12 +39,11 @@ package main import ( "fmt" - "github.com/fsouza/go-dockerclient" + docker "github.com/fsouza/go-dockerclient" ) func main() { - endpoint := "unix:///var/run/docker.sock" - client, err := docker.NewClient(endpoint) + client, err := docker.NewClientFromEnv() if err != nil { panic(err) } @@ -59,11 +74,11 @@ package main import ( "fmt" - "github.com/fsouza/go-dockerclient" + docker "github.com/fsouza/go-dockerclient" ) func main() { - endpoint := "tcp://[ip]:[port]" + const endpoint = "tcp://[ip]:[port]" path := os.Getenv("DOCKER_CERT_PATH") ca := fmt.Sprintf("%s/ca.pem", path) cert := fmt.Sprintf("%s/cert.pem", path) @@ -75,7 +90,8 @@ func main() { If using [docker-machine](https://docs.docker.com/machine/), or another application that exports environment variables `DOCKER_HOST`, -`DOCKER_TLS_VERIFY`, `DOCKER_CERT_PATH`, you can use NewClientFromEnv. +`DOCKER_TLS_VERIFY`, `DOCKER_CERT_PATH`, `DOCKER_API_VERSION`, you can use +NewClientFromEnv. ```go @@ -84,11 +100,14 @@ package main import ( "fmt" - "github.com/fsouza/go-dockerclient" + docker "github.com/fsouza/go-dockerclient" ) func main() { - client, _ := docker.NewClientFromEnv() + client, err := docker.NewClientFromEnv() + if err != nil { + // handle err + } // use client } ``` @@ -101,22 +120,21 @@ All development commands can be seen in the [Makefile](Makefile). Commited code must pass: -* [golint](https://github.com/golang/lint) (with some exceptions, see the Makefile). -* [go vet](https://golang.org/cmd/vet/) -* [gofmt](https://golang.org/cmd/gofmt) +* [golangci-lint](https://github.com/golangci/golangci-lint) * [go test](https://golang.org/cmd/go/#hdr-Test_packages) -Running `make test` will check all of these. If your editor does not -automatically call ``gofmt -s``, `make fmt` will format all go files in this -repository. +Running ``make test`` will run all checks, as well as install any required +dependencies. -## Vendoring +## Modules -go-dockerclient uses [dep](https://github.com/golang/dep/) for vendoring. If -you're using dep, you should be able to pick go-dockerclient releases and get -the proper dependencies. +go-dockerclient supports Go modules. -With other vendoring tools, users might need to specify go-dockerclient's +If you're using dep, you can check the [releases +page](https://github.com/fsouza/go-dockerclient/releases) for the latest +release fully compatible with dep. + +With other vendoring tools, users need to specify go-dockerclient's dependencies manually. ## Using with Docker 1.9 and Go 1.4 diff --git a/vendor/github.com/fsouza/go-dockerclient/appveyor.yml b/vendor/github.com/fsouza/go-dockerclient/appveyor.yml deleted file mode 100644 index 78440e91..00000000 --- a/vendor/github.com/fsouza/go-dockerclient/appveyor.yml +++ /dev/null @@ -1,21 +0,0 @@ -version: '{build}' -platform: x64 -clone_depth: 2 -clone_folder: c:\gopath\src\github.com\fsouza\go-dockerclient -environment: - GOPATH: c:\gopath - matrix: - - GOVERSION: 1.10.3 - - GOVERSION: 1.11 -install: - - set PATH=%GOPATH%\bin;c:\go\bin;%PATH% - - rmdir c:\go /s /q - - appveyor DownloadFile https://storage.googleapis.com/golang/go%GOVERSION%.windows-amd64.zip - - 7z x go%GOVERSION%.windows-amd64.zip -y -oC:\ > NUL -build_script: - - go get -u github.com/golang/dep/cmd/dep - - dep ensure -v -test_script: - - for /f "" %%G in ('go list ./... ^| find /i /v "/vendor/"') do ( go test %%G & IF ERRORLEVEL == 1 EXIT 1) -matrix: - fast_finish: true diff --git a/vendor/github.com/fsouza/go-dockerclient/auth.go b/vendor/github.com/fsouza/go-dockerclient/auth.go index 7bdcb6de..5b498b74 100644 --- a/vendor/github.com/fsouza/go-dockerclient/auth.go +++ b/vendor/github.com/fsouza/go-dockerclient/auth.go @@ -9,16 +9,16 @@ import ( "encoding/base64" "encoding/json" "errors" - "fmt" "io" "io/ioutil" + "net/http" "os" "path" "strings" ) // ErrCannotParseDockercfg is the error returned by NewAuthConfigurations when the dockercfg cannot be parsed. -var ErrCannotParseDockercfg = errors.New("Failed to read authentication from dockercfg") +var ErrCannotParseDockercfg = errors.New("failed to read authentication from dockercfg") // AuthConfiguration represents authentication options to use in the PushImage // method. It represents the authentication in the Docker index server. @@ -29,7 +29,7 @@ type AuthConfiguration struct { ServerAddress string `json:"serveraddress,omitempty"` // IdentityToken can be supplied with the identitytoken response of the AuthCheck call - // see https://godoc.org/github.com/docker/docker/api/types#AuthConfig + // see https://pkg.go.dev/github.com/docker/docker/api/types?tab=doc#AuthConfig // It can be used in place of password not in conjunction with it IdentityToken string `json:"identitytoken,omitempty"` @@ -55,10 +55,23 @@ func (c AuthConfigurations) isEmpty() bool { return len(c.Configs) == 0 } -func (c AuthConfigurations) headerKey() string { +func (AuthConfigurations) headerKey() string { return "X-Registry-Config" } +// merge updates the configuration. If a key is defined in both maps, the one +// in c.Configs takes precedence. +func (c *AuthConfigurations) merge(other AuthConfigurations) { + for k, v := range other.Configs { + if c.Configs == nil { + c.Configs = make(map[string]AuthConfiguration) + } + if _, ok := c.Configs[k]; !ok { + c.Configs[k] = v + } + } +} + // AuthConfigurations119 is used to serialize a set of AuthConfigurations // for Docker API >= 1.19. type AuthConfigurations119 map[string]AuthConfiguration @@ -91,15 +104,20 @@ func NewAuthConfigurationsFromFile(path string) (*AuthConfigurations, error) { } func cfgPaths(dockerConfigEnv string, homeEnv string) []string { - var paths []string if dockerConfigEnv != "" { - paths = append(paths, path.Join(dockerConfigEnv, "config.json")) + return []string{ + path.Join(dockerConfigEnv, "plaintext-passwords.json"), + path.Join(dockerConfigEnv, "config.json"), + } } if homeEnv != "" { - paths = append(paths, path.Join(homeEnv, ".docker", "config.json")) - paths = append(paths, path.Join(homeEnv, ".dockercfg")) + return []string{ + path.Join(homeEnv, ".docker", "plaintext-passwords.json"), + path.Join(homeEnv, ".docker", "config.json"), + path.Join(homeEnv, ".dockercfg"), + } } - return paths + return nil } // NewAuthConfigurationsFromDockerCfg returns AuthConfigurations from @@ -108,17 +126,34 @@ func cfgPaths(dockerConfigEnv string, homeEnv string) []string { // - $HOME/.docker/config.json // - $HOME/.dockercfg func NewAuthConfigurationsFromDockerCfg() (*AuthConfigurations, error) { - err := fmt.Errorf("No docker configuration found") - var auths *AuthConfigurations - pathsToTry := cfgPaths(os.Getenv("DOCKER_CONFIG"), os.Getenv("HOME")) + if len(pathsToTry) < 1 { + return nil, errors.New("no docker configuration found") + } + return newAuthConfigurationsFromDockerCfg(pathsToTry) +} + +func newAuthConfigurationsFromDockerCfg(pathsToTry []string) (*AuthConfigurations, error) { + var result *AuthConfigurations + var auths *AuthConfigurations + var err error for _, path := range pathsToTry { auths, err = NewAuthConfigurationsFromFile(path) - if err == nil { - return auths, nil + if err != nil { + continue + } + + if result == nil { + result = auths + } else { + result.merge(*auths) } } - return auths, err + + if result != nil { + return result, nil + } + return result, err } // NewAuthConfigurations returns AuthConfigurations from a JSON encoded string in the @@ -167,9 +202,14 @@ func authConfigs(confs map[string]dockerConfig) (*AuthConfigurations, error) { if conf.Auth == "" { continue } + + // support both padded and unpadded encoding data, err := base64.StdEncoding.DecodeString(conf.Auth) if err != nil { - return nil, err + data, err = base64.StdEncoding.WithPadding(base64.NoPadding).DecodeString(conf.Auth) + } + if err != nil { + return nil, errors.New("error decoding plaintext credentials") } userpass := strings.SplitN(string(data), ":", 2) @@ -217,7 +257,7 @@ func (c *Client) AuthCheck(conf *AuthConfiguration) (AuthStatus, error) { if conf == nil { return authStatus, errors.New("conf is nil") } - resp, err := c.do("POST", "/auth", doOptions{data: conf}) + resp, err := c.do(http.MethodPost, "/auth", doOptions{data: conf}) if err != nil { return authStatus, err } diff --git a/vendor/github.com/fsouza/go-dockerclient/client.go b/vendor/github.com/fsouza/go-dockerclient/client.go index 581e3141..db394f6c 100644 --- a/vendor/github.com/fsouza/go-dockerclient/client.go +++ b/vendor/github.com/fsouza/go-dockerclient/client.go @@ -31,10 +31,9 @@ import ( "sync/atomic" "time" - "github.com/docker/docker/opts" "github.com/docker/docker/pkg/homedir" + "github.com/docker/docker/pkg/jsonmessage" "github.com/docker/docker/pkg/stdcopy" - "github.com/fsouza/go-dockerclient/internal/jsonmessage" ) const ( @@ -55,7 +54,9 @@ var ( ErrInactivityTimeout = errors.New("inactivity time exceeded timeout") apiVersion112, _ = NewAPIVersion("1.12") + apiVersion118, _ = NewAPIVersion("1.18") apiVersion119, _ = NewAPIVersion("1.19") + apiVersion121, _ = NewAPIVersion("1.21") apiVersion124, _ = NewAPIVersion("1.24") apiVersion125, _ = NewAPIVersion("1.25") apiVersion135, _ = NewAPIVersion("1.35") @@ -70,7 +71,7 @@ type APIVersion []int // and are integer numbers. func NewAPIVersion(input string) (APIVersion, error) { if !strings.Contains(input, ".") { - return nil, fmt.Errorf("Unable to parse version %q", input) + return nil, fmt.Errorf("unable to parse version %q", input) } raw := strings.Split(input, "-") arr := strings.Split(raw[0], ".") @@ -79,21 +80,18 @@ func NewAPIVersion(input string) (APIVersion, error) { for i, val := range arr { ret[i], err = strconv.Atoi(val) if err != nil { - return nil, fmt.Errorf("Unable to parse version %q: %q is not an integer", input, val) + return nil, fmt.Errorf("unable to parse version %q: %q is not an integer", input, val) } } return ret, nil } func (version APIVersion) String() string { - var str string + parts := make([]string, len(version)) for i, val := range version { - str += strconv.Itoa(val) - if i < len(version)-1 { - str += "." - } + parts[i] = strconv.Itoa(val) } - return str + return strings.Join(parts, ".") } // LessThan is a function for comparing APIVersion structs @@ -263,16 +261,19 @@ func NewVersionedTLSClient(endpoint string, cert, key, ca, apiVersionString stri } // NewClientFromEnv returns a Client instance ready for communication created from -// Docker's default logic for the environment variables DOCKER_HOST, DOCKER_TLS_VERIFY, and DOCKER_CERT_PATH. +// Docker's default logic for the environment variables DOCKER_HOST, DOCKER_TLS_VERIFY, DOCKER_CERT_PATH, +// and DOCKER_API_VERSION. // // See https://github.com/docker/docker/blob/1f963af697e8df3a78217f6fdbf67b8123a7db94/docker/docker.go#L68. // See https://github.com/docker/compose/blob/81707ef1ad94403789166d2fe042c8a718a4c748/compose/cli/docker_client.py#L7. +// See https://github.com/moby/moby/blob/28d7dba41d0c0d9c7f0dafcc79d3c59f2b3f5dc3/client/options.go#L51 func NewClientFromEnv() (*Client, error) { - client, err := NewVersionedClientFromEnv("") + apiVersionString := os.Getenv("DOCKER_API_VERSION") + client, err := NewVersionedClientFromEnv(apiVersionString) if err != nil { return nil, err } - client.SkipServerVersionCheck = true + client.SkipServerVersionCheck = apiVersionString == "" return client, nil } @@ -329,7 +330,7 @@ func NewVersionedTLSClientFromBytes(endpoint string, certPEMBlock, keyPEMBlock, } else { caPool := x509.NewCertPool() if !caPool.AppendCertsFromPEM(caPEMCert) { - return nil, errors.New("Could not add RootCA pem") + return nil, errors.New("could not add RootCA pem") } tlsConfig.RootCAs = caPool } @@ -387,7 +388,7 @@ func (c *Client) Endpoint() string { // // See https://goo.gl/wYfgY1 for more details. func (c *Client) Ping() error { - return c.PingWithContext(nil) + return c.PingWithContext(context.TODO()) } // PingWithContext pings the docker server @@ -396,7 +397,7 @@ func (c *Client) Ping() error { // See https://goo.gl/wYfgY1 for more details. func (c *Client) PingWithContext(ctx context.Context) error { path := "/_ping" - resp, err := c.do("GET", path, doOptions{context: ctx}) + resp, err := c.do(http.MethodGet, path, doOptions{context: ctx}) if err != nil { return err } @@ -408,13 +409,13 @@ func (c *Client) PingWithContext(ctx context.Context) error { } func (c *Client) getServerAPIVersionString() (version string, err error) { - resp, err := c.do("GET", "/version", doOptions{}) + resp, err := c.do(http.MethodGet, "/version", doOptions{}) if err != nil { return "", err } defer resp.Body.Close() if resp.StatusCode != http.StatusOK { - return "", fmt.Errorf("Received unexpected status %d while trying to retrieve the server version", resp.StatusCode) + return "", fmt.Errorf("received unexpected status %d while trying to retrieve the server version", resp.StatusCode) } var versionResponse map[string]interface{} if err := json.NewDecoder(resp.Body).Decode(&versionResponse); err != nil { @@ -464,7 +465,7 @@ func (c *Client) do(method, path string, doOptions doOptions) (*http.Response, e req.Header.Set("User-Agent", userAgent) if doOptions.data != nil { req.Header.Set("Content-Type", "application/json") - } else if method == "POST" { + } else if method == http.MethodPost { req.Header.Set("Content-Type", "plain/text") } @@ -519,7 +520,7 @@ func chooseError(ctx context.Context, err error) error { } func (c *Client) stream(method, path string, streamOptions streamOptions) error { - if (method == "POST" || method == "PUT") && streamOptions.in == nil { + if (method == http.MethodPost || method == http.MethodPut) && streamOptions.in == nil { streamOptions.in = bytes.NewReader(nil) } if path != "/version" && !c.SkipServerVersionCheck && c.expectedAPIVersion == nil { @@ -528,12 +529,25 @@ func (c *Client) stream(method, path string, streamOptions streamOptions) error return err } } - req, err := http.NewRequest(method, c.getURL(path), streamOptions.in) + return c.streamURL(method, c.getURL(path), streamOptions) +} + +func (c *Client) streamURL(method, url string, streamOptions streamOptions) error { + if (method == http.MethodPost || method == http.MethodPut) && streamOptions.in == nil { + streamOptions.in = bytes.NewReader(nil) + } + if !c.SkipServerVersionCheck && c.expectedAPIVersion == nil { + err := c.checkAPIVersion() + if err != nil { + return err + } + } + req, err := http.NewRequest(method, url, streamOptions.in) if err != nil { return err } req.Header.Set("User-Agent", userAgent) - if method == "POST" { + if method == http.MethodPost { req.Header.Set("Content-Type", "plain/text") } for key, val := range streamOptions.headers { @@ -592,6 +606,7 @@ func (c *Client) stream(method, path string, streamOptions streamOptions) error return chooseError(subCtx, err) } + defer resp.Body.Close() } else { if resp, err = c.HTTPClient.Do(req.WithContext(subCtx)); err != nil { if strings.Contains(err.Error(), "connection refused") { @@ -599,11 +614,11 @@ func (c *Client) stream(method, path string, streamOptions streamOptions) error } return chooseError(subCtx, err) } + defer resp.Body.Close() if streamOptions.reqSent != nil { close(streamOptions.reqSent) } } - defer resp.Body.Close() if resp.StatusCode < 200 || resp.StatusCode >= 400 { return newError(resp) } @@ -639,11 +654,7 @@ func handleStreamResponse(resp *http.Response, streamOptions *streamOptions) err _, err = io.Copy(streamOptions.stdout, resp.Body) return err } - if st, ok := streamOptions.stdout.(interface { - io.Writer - FD() uintptr - IsTerminal() bool - }); ok { + if st, ok := streamOptions.stdout.(stream); ok { err = jsonmessage.DisplayJSONMessagesToStream(resp.Body, st, nil) } else { err = jsonmessage.DisplayJSONMessagesStream(resp.Body, streamOptions.stdout, 0, false, nil) @@ -651,6 +662,12 @@ func handleStreamResponse(resp *http.Response, streamOptions *streamOptions) err return err } +type stream interface { + io.Writer + FD() uintptr + IsTerminal() bool +} + type proxyReader struct { io.ReadCloser calls uint64 @@ -760,8 +777,10 @@ func (c *Client) hijack(method, path string, hijackOptions hijackOptions) (Close errs := make(chan error, 1) quit := make(chan struct{}) go func() { + //nolint:staticcheck clientconn := httputil.NewClientConn(dial, nil) defer clientconn.Close() + //nolint:bodyclose clientconn.Do(req) if hijackOptions.success != nil { hijackOptions.success <- struct{}{} @@ -856,6 +875,29 @@ func (c *Client) getURL(path string) string { return fmt.Sprintf("%s%s", urlStr, path) } +func (c *Client) getPath(basepath string, opts interface{}) (string, error) { + queryStr, requiredAPIVersion := queryStringVersion(opts) + return c.pathVersionCheck(basepath, queryStr, requiredAPIVersion) +} + +func (c *Client) pathVersionCheck(basepath, queryStr string, requiredAPIVersion APIVersion) (string, error) { + urlStr := strings.TrimRight(c.endpointURL.String(), "/") + if c.endpointURL.Scheme == unixProtocol || c.endpointURL.Scheme == namedPipeProtocol { + urlStr = "" + } + if c.requestedAPIVersion != nil { + if c.requestedAPIVersion.GreaterThanOrEqualTo(requiredAPIVersion) { + return fmt.Sprintf("%s/v%s%s?%s", urlStr, c.requestedAPIVersion, basepath, queryStr), nil + } + return "", fmt.Errorf("API %s requires version %s, requested version %s is insufficient", + basepath, requiredAPIVersion, c.requestedAPIVersion) + } + if requiredAPIVersion != nil { + return fmt.Sprintf("%s/v%s%s?%s", urlStr, requiredAPIVersion, basepath, queryStr), nil + } + return fmt.Sprintf("%s%s?%s", urlStr, basepath, queryStr), nil +} + // getFakeNativeURL returns the URL needed to make an HTTP request over a UNIX // domain socket to the given path. func (c *Client) getFakeNativeURL(path string) string { @@ -872,24 +914,18 @@ func (c *Client) getFakeNativeURL(path string) string { return fmt.Sprintf("%s%s", urlStr, path) } -type jsonMessage struct { - Status string `json:"status,omitempty"` - Progress string `json:"progress,omitempty"` - Error string `json:"error,omitempty"` - Stream string `json:"stream,omitempty"` -} - -func queryString(opts interface{}) string { +func queryStringVersion(opts interface{}) (string, APIVersion) { if opts == nil { - return "" + return "", nil } value := reflect.ValueOf(opts) if value.Kind() == reflect.Ptr { value = value.Elem() } if value.Kind() != reflect.Struct { - return "" + return "", nil } + var apiVersion APIVersion items := url.Values(map[string][]string{}) for i := 0; i < value.NumField(); i++ { field := value.Type().Field(i) @@ -902,53 +938,80 @@ func queryString(opts interface{}) string { } else if key == "-" { continue } - addQueryStringValue(items, key, value.Field(i)) + if addQueryStringValue(items, key, value.Field(i)) { + verstr := field.Tag.Get("ver") + if verstr != "" { + ver, _ := NewAPIVersion(verstr) + if apiVersion == nil { + apiVersion = ver + } else if ver.GreaterThan(apiVersion) { + apiVersion = ver + } + } + } } - return items.Encode() + return items.Encode(), apiVersion } -func addQueryStringValue(items url.Values, key string, v reflect.Value) { +func queryString(opts interface{}) string { + s, _ := queryStringVersion(opts) + return s +} + +func addQueryStringValue(items url.Values, key string, v reflect.Value) bool { switch v.Kind() { case reflect.Bool: if v.Bool() { items.Add(key, "1") + return true } case reflect.Int, reflect.Int8, reflect.Int16, reflect.Int32, reflect.Int64: if v.Int() > 0 { items.Add(key, strconv.FormatInt(v.Int(), 10)) + return true } case reflect.Uint, reflect.Uint8, reflect.Uint16, reflect.Uint32, reflect.Uint64: if v.Uint() > 0 { items.Add(key, strconv.FormatUint(v.Uint(), 10)) + return true } case reflect.Float32, reflect.Float64: if v.Float() > 0 { items.Add(key, strconv.FormatFloat(v.Float(), 'f', -1, 64)) + return true } case reflect.String: if v.String() != "" { items.Add(key, v.String()) + return true } case reflect.Ptr: if !v.IsNil() { if b, err := json.Marshal(v.Interface()); err == nil { items.Add(key, string(b)) + return true } } case reflect.Map: if len(v.MapKeys()) > 0 { if b, err := json.Marshal(v.Interface()); err == nil { items.Add(key, string(b)) + return true } } case reflect.Array, reflect.Slice: vLen := v.Len() + var valuesAdded int if vLen > 0 { for i := 0; i < vLen; i++ { - addQueryStringValue(items, key, v.Index(i)) + if addQueryStringValue(items, key, v.Index(i)) { + valuesAdded++ + } } } + return valuesAdded > 0 } + return false } // Error represents failures in the API. It represents a failure from the API. @@ -1029,7 +1092,7 @@ func getDockerEnv() (*dockerEnv, error) { dockerHost := os.Getenv("DOCKER_HOST") var err error if dockerHost == "" { - dockerHost = opts.DefaultHost + dockerHost = defaultHost } dockerTLSVerify := os.Getenv("DOCKER_TLS_VERIFY") != "" var dockerCertPath string diff --git a/vendor/github.com/fsouza/go-dockerclient/client_unix.go b/vendor/github.com/fsouza/go-dockerclient/client_unix.go index 57d7904e..cd203430 100644 --- a/vendor/github.com/fsouza/go-dockerclient/client_unix.go +++ b/vendor/github.com/fsouza/go-dockerclient/client_unix.go @@ -12,6 +12,8 @@ import ( "net/http" ) +const defaultHost = "unix:///var/run/docker.sock" + // initializeNativeClient initializes the native Unix domain socket client on // Unix-style operating systems func (c *Client) initializeNativeClient(trFunc func() *http.Transport) { @@ -21,11 +23,8 @@ func (c *Client) initializeNativeClient(trFunc func() *http.Transport) { sockPath := c.endpointURL.Path tr := trFunc() - - tr.Dial = func(network, addr string) (net.Conn, error) { - return c.Dialer.Dial(unixProtocol, sockPath) - } - tr.DialContext = func(ctx context.Context, network, addr string) (net.Conn, error) { + tr.Proxy = nil + tr.DialContext = func(_ context.Context, network, addr string) (net.Conn, error) { return c.Dialer.Dial(unixProtocol, sockPath) } c.HTTPClient.Transport = tr diff --git a/vendor/github.com/fsouza/go-dockerclient/client_windows.go b/vendor/github.com/fsouza/go-dockerclient/client_windows.go index 8e7b457d..731d5c96 100644 --- a/vendor/github.com/fsouza/go-dockerclient/client_windows.go +++ b/vendor/github.com/fsouza/go-dockerclient/client_windows.go @@ -2,8 +2,6 @@ // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. -// +build windows - package docker import ( @@ -12,10 +10,13 @@ import ( "net/http" "time" - "github.com/Microsoft/go-winio" + winio "github.com/Microsoft/go-winio" ) -const namedPipeConnectTimeout = 2 * time.Second +const ( + defaultHost = "npipe:////./pipe/docker_engine" + namedPipeConnectTimeout = 2 * time.Second +) type pipeDialer struct { dialFunc func(network, addr string) (net.Conn, error) @@ -31,12 +32,13 @@ func (c *Client) initializeNativeClient(trFunc func() *http.Transport) { return } namedPipePath := c.endpointURL.Path - dialFunc := func(network, addr string) (net.Conn, error) { + //nolint:unparam + dialFunc := func(_, addr string) (net.Conn, error) { timeout := namedPipeConnectTimeout return winio.DialPipe(namedPipePath, &timeout) } tr := trFunc() - tr.Dial = dialFunc + tr.Proxy = nil tr.DialContext = func(ctx context.Context, network, addr string) (net.Conn, error) { return dialFunc(network, addr) } diff --git a/vendor/github.com/fsouza/go-dockerclient/container.go b/vendor/github.com/fsouza/go-dockerclient/container.go index b48bc2cf..0300661a 100644 --- a/vendor/github.com/fsouza/go-dockerclient/container.go +++ b/vendor/github.com/fsouza/go-dockerclient/container.go @@ -16,7 +16,7 @@ import ( "strings" "time" - "github.com/docker/go-units" + units "github.com/docker/go-units" ) // ErrContainerAlreadyExists is the error returned by CreateContainer when the @@ -52,7 +52,8 @@ type APIMount struct { Driver string `json:"Driver,omitempty" yaml:"Driver,omitempty" toml:"Driver,omitempty"` Mode string `json:"Mode,omitempty" yaml:"Mode,omitempty" toml:"Mode,omitempty"` RW bool `json:"RW,omitempty" yaml:"RW,omitempty" toml:"RW,omitempty"` - Propogation string `json:"Propogation,omitempty" yaml:"Propogation,omitempty" toml:"Propogation,omitempty"` + Propagation string `json:"Propagation,omitempty" yaml:"Propagation,omitempty" toml:"Propagation,omitempty"` + Type string `json:"Type,omitempty" yaml:"Type,omitempty" toml:"Type,omitempty"` } // APIContainers represents each container in the list returned by @@ -84,7 +85,7 @@ type NetworkList struct { // See https://goo.gl/kaOHGw for more details. func (c *Client) ListContainers(opts ListContainersOptions) ([]APIContainers, error) { path := "/containers/json?" + queryString(opts) - resp, err := c.do("GET", path, doOptions{context: opts.Context}) + resp, err := c.do(http.MethodGet, path, doOptions{context: opts.Context}) if err != nil { return nil, err } @@ -473,6 +474,12 @@ type Container struct { RestartCount int `json:"RestartCount,omitempty" yaml:"RestartCount,omitempty" toml:"RestartCount,omitempty"` AppArmorProfile string `json:"AppArmorProfile,omitempty" yaml:"AppArmorProfile,omitempty" toml:"AppArmorProfile,omitempty"` + + MountLabel string `json:"MountLabel,omitempty" yaml:"MountLabel,omitempty" toml:"MountLabel,omitempty"` + ProcessLabel string `json:"ProcessLabel,omitempty" yaml:"ProcessLabel,omitempty" toml:"ProcessLabel,omitempty"` + Platform string `json:"Platform,omitempty" yaml:"Platform,omitempty" toml:"Platform,omitempty"` + SizeRw int64 `json:"SizeRw,omitempty" yaml:"SizeRw,omitempty" toml:"SizeRw,omitempty"` + SizeRootFs int64 `json:"SizeRootFs,omitempty" yaml:"SizeRootFs,omitempty" toml:"SizeRootFs,omitempty"` } // UpdateContainerOptions specify parameters to the UpdateContainer function. @@ -499,7 +506,7 @@ type UpdateContainerOptions struct { // // See https://goo.gl/Y6fXUy for more details. func (c *Client) UpdateContainer(id string, opts UpdateContainerOptions) error { - resp, err := c.do("POST", fmt.Sprintf("/containers/"+id+"/update"), doOptions{ + resp, err := c.do(http.MethodPost, fmt.Sprintf("/containers/"+id+"/update"), doOptions{ data: opts, forceJSON: true, context: opts.Context, @@ -527,7 +534,7 @@ type RenameContainerOptions struct { // // See https://goo.gl/46inai for more details. func (c *Client) RenameContainer(opts RenameContainerOptions) error { - resp, err := c.do("POST", fmt.Sprintf("/containers/"+opts.ID+"/rename?%s", queryString(opts)), doOptions{ + resp, err := c.do(http.MethodPost, fmt.Sprintf("/containers/"+opts.ID+"/rename?%s", queryString(opts)), doOptions{ context: opts.Context, }) if err != nil { @@ -539,25 +546,31 @@ func (c *Client) RenameContainer(opts RenameContainerOptions) error { // InspectContainer returns information about a container by its ID. // -// See https://goo.gl/FaI5JT for more details. +// Deprecated: Use InspectContainerWithOptions instead. func (c *Client) InspectContainer(id string) (*Container, error) { - return c.inspectContainer(id, doOptions{}) + return c.InspectContainerWithOptions(InspectContainerOptions{ID: id}) } // InspectContainerWithContext returns information about a container by its ID. // The context object can be used to cancel the inspect request. // -// See https://goo.gl/FaI5JT for more details. +// Deprecated: Use InspectContainerWithOptions instead. +//nolint:golint func (c *Client) InspectContainerWithContext(id string, ctx context.Context) (*Container, error) { - return c.inspectContainer(id, doOptions{context: ctx}) + return c.InspectContainerWithOptions(InspectContainerOptions{ID: id, Context: ctx}) } -func (c *Client) inspectContainer(id string, opts doOptions) (*Container, error) { - path := "/containers/" + id + "/json" - resp, err := c.do("GET", path, opts) +// InspectContainerWithOptions returns information about a container by its ID. +// +// See https://goo.gl/FaI5JT for more details. +func (c *Client) InspectContainerWithOptions(opts InspectContainerOptions) (*Container, error) { + path := "/containers/" + opts.ID + "/json?" + queryString(opts) + resp, err := c.do(http.MethodGet, path, doOptions{ + context: opts.Context, + }) if err != nil { if e, ok := err.(*Error); ok && e.Status == http.StatusNotFound { - return nil, &NoSuchContainer{ID: id} + return nil, &NoSuchContainer{ID: opts.ID} } return nil, err } @@ -569,12 +582,21 @@ func (c *Client) inspectContainer(id string, opts doOptions) (*Container, error) return &container, nil } +// InspectContainerOptions specifies parameters for InspectContainerWithOptions. +// +// See https://goo.gl/FaI5JT for more details. +type InspectContainerOptions struct { + Context context.Context + ID string `qs:"-"` + Size bool +} + // ContainerChanges returns changes in the filesystem of the given container. // // See https://goo.gl/15KKzh for more details. func (c *Client) ContainerChanges(id string) ([]Change, error) { path := "/containers/" + id + "/changes" - resp, err := c.do("GET", path, doOptions{}) + resp, err := c.do(http.MethodGet, path, doOptions{}) if err != nil { if e, ok := err.(*Error); ok && e.Status == http.StatusNotFound { return nil, &NoSuchContainer{ID: id} @@ -610,7 +632,7 @@ type CreateContainerOptions struct { func (c *Client) CreateContainer(opts CreateContainerOptions) (*Container, error) { path := "/containers/create?" + queryString(opts) resp, err := c.do( - "POST", + http.MethodPost, path, doOptions{ data: struct { @@ -627,7 +649,7 @@ func (c *Client) CreateContainer(opts CreateContainerOptions) (*Container, error ) if e, ok := err.(*Error); ok { - if e.Status == http.StatusNotFound { + if e.Status == http.StatusNotFound && strings.Contains(e.Message, "No such image") { return nil, ErrNoSuchImage } if e.Status == http.StatusConflict { @@ -708,6 +730,15 @@ type Device struct { CgroupPermissions string `json:"CgroupPermissions,omitempty" yaml:"CgroupPermissions,omitempty" toml:"CgroupPermissions,omitempty"` } +// DeviceRequest represents a request for device that's sent to device drivers. +type DeviceRequest struct { + Driver string `json:"Driver,omitempty" yaml:"Driver,omitempty" toml:"Driver,omitempty"` + Count int `json:"Count,omitempty" yaml:"Count,omitempty" toml:"Count,omitempty"` + DeviceIDs []string `json:"DeviceIDs,omitempty" yaml:"DeviceIDs,omitempty" toml:"DeviceIDs,omitempty"` + Capabilities [][]string `json:"Capabilities,omitempty" yaml:"Capabilities,omitempty" toml:"Capabilities,omitempty"` + Options map[string]string `json:"Options,omitempty" yaml:"Options,omitempty" toml:"Options,omitempty"` +} + // BlockWeight represents a relative device weight for an individual device inside // of a container type BlockWeight struct { @@ -728,6 +759,7 @@ type HostConfig struct { Binds []string `json:"Binds,omitempty" yaml:"Binds,omitempty" toml:"Binds,omitempty"` CapAdd []string `json:"CapAdd,omitempty" yaml:"CapAdd,omitempty" toml:"CapAdd,omitempty"` CapDrop []string `json:"CapDrop,omitempty" yaml:"CapDrop,omitempty" toml:"CapDrop,omitempty"` + Capabilities []string `json:"Capabilities,omitempty" yaml:"Capabilities,omitempty" toml:"Capabilities,omitempty"` // Mutually exclusive w.r.t. CapAdd and CapDrop API v1.40 GroupAdd []string `json:"GroupAdd,omitempty" yaml:"GroupAdd,omitempty" toml:"GroupAdd,omitempty"` ContainerIDFile string `json:"ContainerIDFile,omitempty" yaml:"ContainerIDFile,omitempty" toml:"ContainerIDFile,omitempty"` LxcConf []KeyValuePair `json:"LxcConf,omitempty" yaml:"LxcConf,omitempty" toml:"LxcConf,omitempty"` @@ -741,20 +773,23 @@ type HostConfig struct { UsernsMode string `json:"UsernsMode,omitempty" yaml:"UsernsMode,omitempty" toml:"UsernsMode,omitempty"` NetworkMode string `json:"NetworkMode,omitempty" yaml:"NetworkMode,omitempty" toml:"NetworkMode,omitempty"` IpcMode string `json:"IpcMode,omitempty" yaml:"IpcMode,omitempty" toml:"IpcMode,omitempty"` + Isolation string `json:"Isolation,omitempty" yaml:"Isolation,omitempty" toml:"Isolation,omitempty"` // Windows only + ConsoleSize [2]int `json:"ConsoleSize,omitempty" yaml:"ConsoleSize,omitempty" toml:"ConsoleSize,omitempty"` // Windows only height x width PidMode string `json:"PidMode,omitempty" yaml:"PidMode,omitempty" toml:"PidMode,omitempty"` UTSMode string `json:"UTSMode,omitempty" yaml:"UTSMode,omitempty" toml:"UTSMode,omitempty"` RestartPolicy RestartPolicy `json:"RestartPolicy,omitempty" yaml:"RestartPolicy,omitempty" toml:"RestartPolicy,omitempty"` Devices []Device `json:"Devices,omitempty" yaml:"Devices,omitempty" toml:"Devices,omitempty"` DeviceCgroupRules []string `json:"DeviceCgroupRules,omitempty" yaml:"DeviceCgroupRules,omitempty" toml:"DeviceCgroupRules,omitempty"` + DeviceRequests []DeviceRequest `json:"DeviceRequests,omitempty" yaml:"DeviceRequests,omitempty" toml:"DeviceRequests,omitempty"` LogConfig LogConfig `json:"LogConfig,omitempty" yaml:"LogConfig,omitempty" toml:"LogConfig,omitempty"` SecurityOpt []string `json:"SecurityOpt,omitempty" yaml:"SecurityOpt,omitempty" toml:"SecurityOpt,omitempty"` + CgroupnsMode string `json:"CgroupnsMode,omitempty" yaml:"CgroupnsMode,omitempty" toml:"CgroupnsMode,omitempty"` // v1.40+ Cgroup string `json:"Cgroup,omitempty" yaml:"Cgroup,omitempty" toml:"Cgroup,omitempty"` CgroupParent string `json:"CgroupParent,omitempty" yaml:"CgroupParent,omitempty" toml:"CgroupParent,omitempty"` Memory int64 `json:"Memory,omitempty" yaml:"Memory,omitempty" toml:"Memory,omitempty"` MemoryReservation int64 `json:"MemoryReservation,omitempty" yaml:"MemoryReservation,omitempty" toml:"MemoryReservation,omitempty"` KernelMemory int64 `json:"KernelMemory,omitempty" yaml:"KernelMemory,omitempty" toml:"KernelMemory,omitempty"` MemorySwap int64 `json:"MemorySwap,omitempty" yaml:"MemorySwap,omitempty" toml:"MemorySwap,omitempty"` - MemorySwappiness int64 `json:"MemorySwappiness,omitempty" yaml:"MemorySwappiness,omitempty" toml:"MemorySwappiness,omitempty"` CPUShares int64 `json:"CpuShares,omitempty" yaml:"CpuShares,omitempty" toml:"CpuShares,omitempty"` CPUSet string `json:"Cpuset,omitempty" yaml:"Cpuset,omitempty" toml:"Cpuset,omitempty"` CPUSetCPUs string `json:"CpusetCpus,omitempty" yaml:"CpusetCpus,omitempty" toml:"CpusetCpus,omitempty"` @@ -763,6 +798,7 @@ type HostConfig struct { CPUPeriod int64 `json:"CpuPeriod,omitempty" yaml:"CpuPeriod,omitempty" toml:"CpuPeriod,omitempty"` CPURealtimePeriod int64 `json:"CpuRealtimePeriod,omitempty" yaml:"CpuRealtimePeriod,omitempty" toml:"CpuRealtimePeriod,omitempty"` CPURealtimeRuntime int64 `json:"CpuRealtimeRuntime,omitempty" yaml:"CpuRealtimeRuntime,omitempty" toml:"CpuRealtimeRuntime,omitempty"` + NanoCPUs int64 `json:"NanoCpus,omitempty" yaml:"NanoCpus,omitempty" toml:"NanoCpus,omitempty"` BlkioWeight int64 `json:"BlkioWeight,omitempty" yaml:"BlkioWeight,omitempty" toml:"BlkioWeight,omitempty"` BlkioWeightDevice []BlockWeight `json:"BlkioWeightDevice,omitempty" yaml:"BlkioWeightDevice,omitempty" toml:"BlkioWeightDevice,omitempty"` BlkioDeviceReadBps []BlockLimit `json:"BlkioDeviceReadBps,omitempty" yaml:"BlkioDeviceReadBps,omitempty" toml:"BlkioDeviceReadBps,omitempty"` @@ -772,14 +808,11 @@ type HostConfig struct { Ulimits []ULimit `json:"Ulimits,omitempty" yaml:"Ulimits,omitempty" toml:"Ulimits,omitempty"` VolumeDriver string `json:"VolumeDriver,omitempty" yaml:"VolumeDriver,omitempty" toml:"VolumeDriver,omitempty"` OomScoreAdj int `json:"OomScoreAdj,omitempty" yaml:"OomScoreAdj,omitempty" toml:"OomScoreAdj,omitempty"` - PidsLimit int64 `json:"PidsLimit,omitempty" yaml:"PidsLimit,omitempty" toml:"PidsLimit,omitempty"` + MemorySwappiness *int64 `json:"MemorySwappiness,omitempty" yaml:"MemorySwappiness,omitempty" toml:"MemorySwappiness,omitempty"` + PidsLimit *int64 `json:"PidsLimit,omitempty" yaml:"PidsLimit,omitempty" toml:"PidsLimit,omitempty"` + OOMKillDisable *bool `json:"OomKillDisable,omitempty" yaml:"OomKillDisable,omitempty" toml:"OomKillDisable,omitempty"` ShmSize int64 `json:"ShmSize,omitempty" yaml:"ShmSize,omitempty" toml:"ShmSize,omitempty"` Tmpfs map[string]string `json:"Tmpfs,omitempty" yaml:"Tmpfs,omitempty" toml:"Tmpfs,omitempty"` - Privileged bool `json:"Privileged,omitempty" yaml:"Privileged,omitempty" toml:"Privileged,omitempty"` - PublishAllPorts bool `json:"PublishAllPorts,omitempty" yaml:"PublishAllPorts,omitempty" toml:"PublishAllPorts,omitempty"` - ReadonlyRootfs bool `json:"ReadonlyRootfs,omitempty" yaml:"ReadonlyRootfs,omitempty" toml:"ReadonlyRootfs,omitempty"` - OOMKillDisable bool `json:"OomKillDisable,omitempty" yaml:"OomKillDisable,omitempty" toml:"OomKillDisable,omitempty"` - AutoRemove bool `json:"AutoRemove,omitempty" yaml:"AutoRemove,omitempty" toml:"AutoRemove,omitempty"` StorageOpt map[string]string `json:"StorageOpt,omitempty" yaml:"StorageOpt,omitempty" toml:"StorageOpt,omitempty"` Sysctls map[string]string `json:"Sysctls,omitempty" yaml:"Sysctls,omitempty" toml:"Sysctls,omitempty"` CPUCount int64 `json:"CpuCount,omitempty" yaml:"CpuCount,omitempty"` @@ -787,8 +820,14 @@ type HostConfig struct { IOMaximumBandwidth int64 `json:"IOMaximumBandwidth,omitempty" yaml:"IOMaximumBandwidth,omitempty"` IOMaximumIOps int64 `json:"IOMaximumIOps,omitempty" yaml:"IOMaximumIOps,omitempty"` Mounts []HostMount `json:"Mounts,omitempty" yaml:"Mounts,omitempty" toml:"Mounts,omitempty"` - Init bool `json:",omitempty" yaml:",omitempty"` + MaskedPaths []string `json:"MaskedPaths,omitempty" yaml:"MaskedPaths,omitempty" toml:"MaskedPaths,omitempty"` + ReadonlyPaths []string `json:"ReadonlyPaths,omitempty" yaml:"ReadonlyPaths,omitempty" toml:"ReadonlyPaths,omitempty"` Runtime string `json:"Runtime,omitempty" yaml:"Runtime,omitempty" toml:"Runtime,omitempty"` + Init bool `json:",omitempty" yaml:",omitempty"` + Privileged bool `json:"Privileged,omitempty" yaml:"Privileged,omitempty" toml:"Privileged,omitempty"` + PublishAllPorts bool `json:"PublishAllPorts,omitempty" yaml:"PublishAllPorts,omitempty" toml:"PublishAllPorts,omitempty"` + ReadonlyRootfs bool `json:"ReadonlyRootfs,omitempty" yaml:"ReadonlyRootfs,omitempty" toml:"ReadonlyRootfs,omitempty"` + AutoRemove bool `json:"AutoRemove,omitempty" yaml:"AutoRemove,omitempty" toml:"AutoRemove,omitempty"` } // NetworkingConfig represents the container's networking configuration for each of its interfaces @@ -819,6 +858,7 @@ func (c *Client) StartContainer(id string, hostConfig *HostConfig) error { // API 1.24 or greater. // // See https://goo.gl/fbOSZy for more details. +//nolint:golint func (c *Client) StartContainerWithContext(id string, hostConfig *HostConfig, ctx context.Context) error { return c.startContainer(id, hostConfig, doOptions{context: ctx}) } @@ -832,7 +872,7 @@ func (c *Client) startContainer(id string, hostConfig *HostConfig, opts doOption opts.data = hostConfig opts.forceJSON = true } - resp, err := c.do("POST", path, opts) + resp, err := c.do(http.MethodPost, path, opts) if err != nil { if e, ok := err.(*Error); ok && e.Status == http.StatusNotFound { return &NoSuchContainer{ID: id, Err: err} @@ -859,13 +899,14 @@ func (c *Client) StopContainer(id string, timeout uint) error { // container request. // // See https://goo.gl/R9dZcV for more details. +//nolint:golint func (c *Client) StopContainerWithContext(id string, timeout uint, ctx context.Context) error { return c.stopContainer(id, timeout, doOptions{context: ctx}) } func (c *Client) stopContainer(id string, timeout uint, opts doOptions) error { path := fmt.Sprintf("/containers/%s/stop?t=%d", id, timeout) - resp, err := c.do("POST", path, opts) + resp, err := c.do(http.MethodPost, path, opts) if err != nil { if e, ok := err.(*Error); ok && e.Status == http.StatusNotFound { return &NoSuchContainer{ID: id} @@ -885,7 +926,7 @@ func (c *Client) stopContainer(id string, timeout uint, opts doOptions) error { // See https://goo.gl/MrAKQ5 for more details. func (c *Client) RestartContainer(id string, timeout uint) error { path := fmt.Sprintf("/containers/%s/restart?t=%d", id, timeout) - resp, err := c.do("POST", path, doOptions{}) + resp, err := c.do(http.MethodPost, path, doOptions{}) if err != nil { if e, ok := err.(*Error); ok && e.Status == http.StatusNotFound { return &NoSuchContainer{ID: id} @@ -901,7 +942,7 @@ func (c *Client) RestartContainer(id string, timeout uint) error { // See https://goo.gl/D1Yaii for more details. func (c *Client) PauseContainer(id string) error { path := fmt.Sprintf("/containers/%s/pause", id) - resp, err := c.do("POST", path, doOptions{}) + resp, err := c.do(http.MethodPost, path, doOptions{}) if err != nil { if e, ok := err.(*Error); ok && e.Status == http.StatusNotFound { return &NoSuchContainer{ID: id} @@ -917,7 +958,7 @@ func (c *Client) PauseContainer(id string) error { // See https://goo.gl/sZ2faO for more details. func (c *Client) UnpauseContainer(id string) error { path := fmt.Sprintf("/containers/%s/unpause", id) - resp, err := c.do("POST", path, doOptions{}) + resp, err := c.do(http.MethodPost, path, doOptions{}) if err != nil { if e, ok := err.(*Error); ok && e.Status == http.StatusNotFound { return &NoSuchContainer{ID: id} @@ -947,7 +988,7 @@ func (c *Client) TopContainer(id string, psArgs string) (TopResult, error) { args = fmt.Sprintf("?ps_args=%s", psArgs) } path := fmt.Sprintf("/containers/%s/top%s", id, args) - resp, err := c.do("GET", path, doOptions{}) + resp, err := c.do(http.MethodGet, path, doOptions{}) if err != nil { if e, ok := err.(*Error); ok && e.Status == http.StatusNotFound { return result, &NoSuchContainer{ID: id} @@ -1103,13 +1144,8 @@ func (c *Client) Stats(opts StatsOptions) (retErr error) { defer func() { close(opts.Stats) - select { - case err := <-errC: - if err != nil && retErr == nil { - retErr = err - } - default: - // No errors + if err := <-errC; err != nil && retErr == nil { + retErr = err } if err := readCloser.Close(); err != nil && retErr == nil { @@ -1119,7 +1155,8 @@ func (c *Client) Stats(opts StatsOptions) (retErr error) { reqSent := make(chan struct{}) go func() { - err := c.stream("GET", fmt.Sprintf("/containers/%s/stats?stream=%v", opts.ID, opts.Stream), streamOptions{ + defer close(errC) + err := c.stream(http.MethodGet, fmt.Sprintf("/containers/%s/stats?stream=%v", opts.ID, opts.Stream), streamOptions{ rawJSONStream: true, useJSONDecoder: true, stdout: writeCloser, @@ -1140,7 +1177,6 @@ func (c *Client) Stats(opts StatsOptions) (retErr error) { err = closeErr } errC <- err - close(errC) }() quit := make(chan struct{}) @@ -1188,7 +1224,7 @@ type KillContainerOptions struct { // See https://goo.gl/JnTxXZ for more details. func (c *Client) KillContainer(opts KillContainerOptions) error { path := "/containers/" + opts.ID + "/kill" + "?" + queryString(opts) - resp, err := c.do("POST", path, doOptions{context: opts.Context}) + resp, err := c.do(http.MethodPost, path, doOptions{context: opts.Context}) if err != nil { e, ok := err.(*Error) if !ok { @@ -1229,7 +1265,7 @@ type RemoveContainerOptions struct { // See https://goo.gl/hL5IPC for more details. func (c *Client) RemoveContainer(opts RemoveContainerOptions) error { path := "/containers/" + opts.ID + "?" + queryString(opts) - resp, err := c.do("DELETE", path, doOptions{context: opts.Context}) + resp, err := c.do(http.MethodDelete, path, doOptions{context: opts.Context}) if err != nil { if e, ok := err.(*Error); ok && e.Status == http.StatusNotFound { return &NoSuchContainer{ID: opts.ID} @@ -1258,7 +1294,7 @@ type UploadToContainerOptions struct { func (c *Client) UploadToContainer(id string, opts UploadToContainerOptions) error { url := fmt.Sprintf("/containers/%s/archive?", id) + queryString(opts) - return c.stream("PUT", url, streamOptions{ + return c.stream(http.MethodPut, url, streamOptions{ in: opts.InputStream, context: opts.Context, }) @@ -1281,7 +1317,7 @@ type DownloadFromContainerOptions struct { func (c *Client) DownloadFromContainer(id string, opts DownloadFromContainerOptions) error { url := fmt.Sprintf("/containers/%s/archive?", id) + queryString(opts) - return c.stream("GET", url, streamOptions{ + return c.stream(http.MethodGet, url, streamOptions{ setRawTerminal: true, stdout: opts.OutputStream, inactivityTimeout: opts.InactivityTimeout, @@ -1314,7 +1350,7 @@ func (c *Client) CopyFromContainer(opts CopyFromContainerOptions) error { return errors.New("go-dockerclient: CopyFromContainer is no longer available in Docker >= 1.12, use DownloadFromContainer instead") } url := fmt.Sprintf("/containers/%s/copy", opts.Container) - resp, err := c.do("POST", url, doOptions{ + resp, err := c.do(http.MethodPost, url, doOptions{ data: opts, context: opts.Context, }) @@ -1342,12 +1378,13 @@ func (c *Client) WaitContainer(id string) (int, error) { // inspect request. // // See https://goo.gl/4AGweZ for more details. +//nolint:golint func (c *Client) WaitContainerWithContext(id string, ctx context.Context) (int, error) { return c.waitContainer(id, doOptions{context: ctx}) } func (c *Client) waitContainer(id string, opts doOptions) (int, error) { - resp, err := c.do("POST", "/containers/"+id+"/wait", opts) + resp, err := c.do(http.MethodPost, "/containers/"+id+"/wait", opts) if err != nil { if e, ok := err.(*Error); ok && e.Status == http.StatusNotFound { return 0, &NoSuchContainer{ID: id} @@ -1381,7 +1418,7 @@ type CommitContainerOptions struct { // See https://goo.gl/CzIguf for more details. func (c *Client) CommitContainer(opts CommitContainerOptions) (*Image, error) { path := "/commit?" + queryString(opts) - resp, err := c.do("POST", path, doOptions{ + resp, err := c.do(http.MethodPost, path, doOptions{ data: opts.Run, context: opts.Context, }) @@ -1416,6 +1453,9 @@ type AttachToContainerOptions struct { // to unexpected behavior. Success chan struct{} + // Override the key sequence for detaching a container. + DetachKeys string + // Use raw terminal? Usually true when the container contains a TTY. RawTerminal bool `qs:"-"` @@ -1455,7 +1495,7 @@ func (c *Client) AttachToContainerNonBlocking(opts AttachToContainerOptions) (Cl return nil, &NoSuchContainer{ID: opts.Container} } path := "/containers/" + opts.Container + "/attach?" + queryString(opts) - return c.hijack("POST", path, hijackOptions{ + return c.hijack(http.MethodPost, path, hijackOptions{ success: opts.Success, setRawTerminal: opts.RawTerminal, in: opts.InputStream, @@ -1505,7 +1545,7 @@ func (c *Client) Logs(opts LogsOptions) error { opts.Tail = "all" } path := "/containers/" + opts.Container + "/logs?" + queryString(opts) - return c.stream("GET", path, streamOptions{ + return c.stream(http.MethodGet, path, streamOptions{ setRawTerminal: opts.RawTerminal, stdout: opts.OutputStream, stderr: opts.ErrorStream, @@ -1521,7 +1561,7 @@ func (c *Client) ResizeContainerTTY(id string, height, width int) error { params := make(url.Values) params.Set("h", strconv.Itoa(height)) params.Set("w", strconv.Itoa(width)) - resp, err := c.do("POST", "/containers/"+id+"/resize?"+params.Encode(), doOptions{}) + resp, err := c.do(http.MethodPost, "/containers/"+id+"/resize?"+params.Encode(), doOptions{}) if err != nil { return err } @@ -1549,7 +1589,7 @@ func (c *Client) ExportContainer(opts ExportContainerOptions) error { return &NoSuchContainer{ID: opts.ID} } url := fmt.Sprintf("/containers/%s/export", opts.ID) - return c.stream("GET", url, streamOptions{ + return c.stream(http.MethodGet, url, streamOptions{ setRawTerminal: true, stdout: opts.OutputStream, inactivityTimeout: opts.InactivityTimeout, @@ -1578,7 +1618,7 @@ type PruneContainersResults struct { // See https://goo.gl/wnkgDT for more details. func (c *Client) PruneContainers(opts PruneContainersOptions) (*PruneContainersResults, error) { path := "/containers/prune?" + queryString(opts) - resp, err := c.do("POST", path, doOptions{context: opts.Context}) + resp, err := c.do(http.MethodPost, path, doOptions{context: opts.Context}) if err != nil { return nil, err } diff --git a/vendor/github.com/fsouza/go-dockerclient/distribution.go b/vendor/github.com/fsouza/go-dockerclient/distribution.go index d0f8ce74..6e5e12f7 100644 --- a/vendor/github.com/fsouza/go-dockerclient/distribution.go +++ b/vendor/github.com/fsouza/go-dockerclient/distribution.go @@ -6,6 +6,7 @@ package docker import ( "encoding/json" + "net/http" "github.com/docker/docker/api/types/registry" ) @@ -13,7 +14,7 @@ import ( // InspectDistribution returns image digest and platform information by contacting the registry func (c *Client) InspectDistribution(name string) (*registry.DistributionInspect, error) { path := "/distribution/" + name + "/json" - resp, err := c.do("GET", path, doOptions{}) + resp, err := c.do(http.MethodGet, path, doOptions{}) if err != nil { return nil, err } diff --git a/vendor/github.com/fsouza/go-dockerclient/event.go b/vendor/github.com/fsouza/go-dockerclient/event.go index 18ae5d5a..6de7c553 100644 --- a/vendor/github.com/fsouza/go-dockerclient/event.go +++ b/vendor/github.com/fsouza/go-dockerclient/event.go @@ -178,7 +178,7 @@ func (eventState *eventMonitoringState) enableEventMonitoring(c *Client) error { return nil } -func (eventState *eventMonitoringState) disableEventMonitoring() error { +func (eventState *eventMonitoringState) disableEventMonitoring() { eventState.Lock() defer eventState.Unlock() @@ -191,7 +191,6 @@ func (eventState *eventMonitoringState) disableEventMonitoring() error { close(eventState.C) close(eventState.errC) } - return nil } func (eventState *eventMonitoringState) monitorEvents(c *Client) { @@ -330,15 +329,18 @@ func (c *Client) eventHijack(startTime int64, eventChan chan *APIEvents, errChan if err != nil { return err } + //nolint:staticcheck conn := httputil.NewClientConn(dial, nil) - req, err := http.NewRequest("GET", uri, nil) + req, err := http.NewRequest(http.MethodGet, uri, nil) if err != nil { return err } + //nolint:bodyclose res, err := conn.Do(req) if err != nil { return err } + //nolint:staticcheck go func(res *http.Response, conn *httputil.ClientConn) { defer conn.Close() defer res.Body.Close() diff --git a/vendor/github.com/fsouza/go-dockerclient/exec.go b/vendor/github.com/fsouza/go-dockerclient/exec.go index 5e7ea87f..48d1ad34 100644 --- a/vendor/github.com/fsouza/go-dockerclient/exec.go +++ b/vendor/github.com/fsouza/go-dockerclient/exec.go @@ -25,16 +25,17 @@ type Exec struct { // // See https://goo.gl/60TeBP for more details type CreateExecOptions struct { - AttachStdin bool `json:"AttachStdin,omitempty" yaml:"AttachStdin,omitempty" toml:"AttachStdin,omitempty"` - AttachStdout bool `json:"AttachStdout,omitempty" yaml:"AttachStdout,omitempty" toml:"AttachStdout,omitempty"` - AttachStderr bool `json:"AttachStderr,omitempty" yaml:"AttachStderr,omitempty" toml:"AttachStderr,omitempty"` - Tty bool `json:"Tty,omitempty" yaml:"Tty,omitempty" toml:"Tty,omitempty"` Env []string `json:"Env,omitempty" yaml:"Env,omitempty" toml:"Env,omitempty"` Cmd []string `json:"Cmd,omitempty" yaml:"Cmd,omitempty" toml:"Cmd,omitempty"` Container string `json:"Container,omitempty" yaml:"Container,omitempty" toml:"Container,omitempty"` User string `json:"User,omitempty" yaml:"User,omitempty" toml:"User,omitempty"` WorkingDir string `json:"WorkingDir,omitempty" yaml:"WorkingDir,omitempty" toml:"WorkingDir,omitempty"` + DetachKeys string `json:"DetachKeys,omitempty" yaml:"DetachKeys,omitempty" toml:"DetachKeys,omitempty"` Context context.Context `json:"-"` + AttachStdin bool `json:"AttachStdin,omitempty" yaml:"AttachStdin,omitempty" toml:"AttachStdin,omitempty"` + AttachStdout bool `json:"AttachStdout,omitempty" yaml:"AttachStdout,omitempty" toml:"AttachStdout,omitempty"` + AttachStderr bool `json:"AttachStderr,omitempty" yaml:"AttachStderr,omitempty" toml:"AttachStderr,omitempty"` + Tty bool `json:"Tty,omitempty" yaml:"Tty,omitempty" toml:"Tty,omitempty"` Privileged bool `json:"Privileged,omitempty" yaml:"Privileged,omitempty" toml:"Privileged,omitempty"` } @@ -50,7 +51,7 @@ func (c *Client) CreateExec(opts CreateExecOptions) (*Exec, error) { return nil, errors.New("exec configuration WorkingDir is only supported in API#1.35 and above") } path := fmt.Sprintf("/containers/%s/exec", opts.Container) - resp, err := c.do("POST", path, doOptions{data: opts, context: opts.Context}) + resp, err := c.do(http.MethodPost, path, doOptions{data: opts, context: opts.Context}) if err != nil { if e, ok := err.(*Error); ok && e.Status == http.StatusNotFound { return nil, &NoSuchContainer{ID: opts.Container} @@ -119,7 +120,7 @@ func (c *Client) StartExecNonBlocking(id string, opts StartExecOptions) (CloseWa path := fmt.Sprintf("/exec/%s/start", id) if opts.Detach { - resp, err := c.do("POST", path, doOptions{data: opts, context: opts.Context}) + resp, err := c.do(http.MethodPost, path, doOptions{data: opts, context: opts.Context}) if err != nil { if e, ok := err.(*Error); ok && e.Status == http.StatusNotFound { return nil, &NoSuchExec{ID: id} @@ -130,7 +131,7 @@ func (c *Client) StartExecNonBlocking(id string, opts StartExecOptions) (CloseWa return nil, nil } - return c.hijack("POST", path, hijackOptions{ + return c.hijack(http.MethodPost, path, hijackOptions{ success: opts.Success, setRawTerminal: opts.RawTerminal, in: opts.InputStream, @@ -151,7 +152,7 @@ func (c *Client) ResizeExecTTY(id string, height, width int) error { params.Set("w", strconv.Itoa(width)) path := fmt.Sprintf("/exec/%s/resize?%s", id, params.Encode()) - resp, err := c.do("POST", path, doOptions{}) + resp, err := c.do(http.MethodPost, path, doOptions{}) if err != nil { return err } @@ -177,13 +178,13 @@ type ExecProcessConfig struct { type ExecInspect struct { ID string `json:"ID,omitempty" yaml:"ID,omitempty" toml:"ID,omitempty"` ExitCode int `json:"ExitCode,omitempty" yaml:"ExitCode,omitempty" toml:"ExitCode,omitempty"` + ProcessConfig ExecProcessConfig `json:"ProcessConfig,omitempty" yaml:"ProcessConfig,omitempty" toml:"ProcessConfig,omitempty"` + ContainerID string `json:"ContainerID,omitempty" yaml:"ContainerID,omitempty" toml:"ContainerID,omitempty"` + DetachKeys string `json:"DetachKeys,omitempty" yaml:"DetachKeys,omitempty" toml:"DetachKeys,omitempty"` Running bool `json:"Running,omitempty" yaml:"Running,omitempty" toml:"Running,omitempty"` OpenStdin bool `json:"OpenStdin,omitempty" yaml:"OpenStdin,omitempty" toml:"OpenStdin,omitempty"` OpenStderr bool `json:"OpenStderr,omitempty" yaml:"OpenStderr,omitempty" toml:"OpenStderr,omitempty"` OpenStdout bool `json:"OpenStdout,omitempty" yaml:"OpenStdout,omitempty" toml:"OpenStdout,omitempty"` - ProcessConfig ExecProcessConfig `json:"ProcessConfig,omitempty" yaml:"ProcessConfig,omitempty" toml:"ProcessConfig,omitempty"` - ContainerID string `json:"ContainerID,omitempty" yaml:"ContainerID,omitempty" toml:"ContainerID,omitempty"` - DetachKeys string `json:"DetachKeys,omitempty" yaml:"DetachKeys,omitempty" toml:"DetachKeys,omitempty"` CanRemove bool `json:"CanRemove,omitempty" yaml:"CanRemove,omitempty" toml:"CanRemove,omitempty"` } @@ -192,7 +193,7 @@ type ExecInspect struct { // See https://goo.gl/ctMUiW for more details func (c *Client) InspectExec(id string) (*ExecInspect, error) { path := fmt.Sprintf("/exec/%s/json", id) - resp, err := c.do("GET", path, doOptions{}) + resp, err := c.do(http.MethodGet, path, doOptions{}) if err != nil { if e, ok := err.(*Error); ok && e.Status == http.StatusNotFound { return nil, &NoSuchExec{ID: id} diff --git a/vendor/github.com/fsouza/go-dockerclient/go.mod b/vendor/github.com/fsouza/go-dockerclient/go.mod index bcf549c2..cf98b1b6 100644 --- a/vendor/github.com/fsouza/go-dockerclient/go.mod +++ b/vendor/github.com/fsouza/go-dockerclient/go.mod @@ -1,42 +1,23 @@ module github.com/fsouza/go-dockerclient +go 1.12 + require ( - github.com/Azure/go-ansiterm v0.0.0-20170929234023-d6e3b3328b78 - github.com/Microsoft/go-winio v0.4.11 - github.com/Nvveen/Gotty v0.0.0-20120604004816-cd527374f1e5 - github.com/containerd/continuity v0.0.0-20180814194400-c7c5070e6f6e // indirect - github.com/davecgh/go-spew v1.1.1 // indirect - github.com/docker/docker v0.7.3-0.20180827131323-0c5f8d2b9b23 + github.com/Azure/go-ansiterm v0.0.0-20170929234023-d6e3b3328b78 // indirect + github.com/Microsoft/go-winio v0.4.15-0.20200113171025-3fe6c5262873 + github.com/Microsoft/hcsshim v0.8.7 // indirect + github.com/containerd/containerd v1.3.0 // indirect + github.com/containerd/continuity v0.0.0-20200228182428-0f16d7a0959c // indirect + github.com/docker/distribution v2.7.1+incompatible // indirect + github.com/docker/docker v1.4.2-0.20191101170500-ac7306503d23 github.com/docker/go-connections v0.4.0 // indirect - github.com/docker/go-units v0.3.3 - github.com/docker/libnetwork v0.8.0-dev.2.0.20180608203834-19279f049241 // indirect - github.com/fsnotify/fsnotify v1.4.7 // indirect - github.com/gogo/protobuf v1.1.1 // indirect - github.com/golang/protobuf v1.2.0 // indirect - github.com/google/go-cmp v0.2.0 - github.com/gorilla/context v1.1.1 // indirect - github.com/gorilla/mux v1.6.2 - github.com/hpcloud/tail v1.0.0 // indirect - github.com/onsi/ginkgo v1.6.0 // indirect - github.com/onsi/gomega v1.4.1 // indirect - github.com/opencontainers/go-digest v1.0.0-rc1 // indirect + github.com/docker/go-units v0.4.0 + github.com/gogo/protobuf v1.3.1 // indirect + github.com/google/go-cmp v0.4.0 + github.com/gorilla/mux v1.7.4 + github.com/morikuni/aec v1.0.0 // indirect github.com/opencontainers/image-spec v1.0.1 // indirect github.com/opencontainers/runc v0.1.1 // indirect - github.com/pkg/errors v0.8.0 // indirect - github.com/pmezard/go-difflib v1.0.0 // indirect - github.com/sirupsen/logrus v1.0.6 - github.com/stretchr/testify v1.2.2 // indirect - github.com/vishvananda/netlink v1.0.0 // indirect - github.com/vishvananda/netns v0.0.0-20180720170159-13995c7128cc // indirect - golang.org/x/crypto v0.0.0-20180820150726-614d502a4dac // indirect - golang.org/x/net v0.0.0-20180826012351-8a410e7b638d // indirect - golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f // indirect - golang.org/x/sys v0.0.0-20180824143301-4910a1d54f87 - golang.org/x/text v0.3.0 // indirect - gopkg.in/airbrake/gobrake.v2 v2.0.9 // indirect - gopkg.in/fsnotify.v1 v1.4.7 // indirect - gopkg.in/gemnasium/logrus-airbrake-hook.v2 v2.1.2 // indirect - gopkg.in/tomb.v1 v1.0.0-20141024135613-dd632973f1e7 // indirect - gopkg.in/yaml.v2 v2.2.1 // indirect - gotest.tools v2.1.0+incompatible // indirect + golang.org/x/crypto v0.0.0-20200220183623-bac4c82f6975 + google.golang.org/grpc v1.27.1 // indirect ) diff --git a/vendor/github.com/fsouza/go-dockerclient/go.sum b/vendor/github.com/fsouza/go-dockerclient/go.sum index 10eb8573..5c7d610d 100644 --- a/vendor/github.com/fsouza/go-dockerclient/go.sum +++ b/vendor/github.com/fsouza/go-dockerclient/go.sum @@ -1,78 +1,185 @@ +bazil.org/fuse v0.0.0-20160811212531-371fbbdaa898/go.mod h1:Xbm+BRKSBEpa4q4hTSxohYNQpsxXPbPry4JJWOB3LB8= +cloud.google.com/go v0.26.0/go.mod h1:aQUYkXzVsufM+DwF1aE+0xfcU+56JwCaLick0ClmMTw= github.com/Azure/go-ansiterm v0.0.0-20170929234023-d6e3b3328b78 h1:w+iIsaOQNcT7OZ575w+acHgRric5iCyQh+xv+KJ4HB8= github.com/Azure/go-ansiterm v0.0.0-20170929234023-d6e3b3328b78/go.mod h1:LmzpDX56iTiv29bbRTIsUNlaFfuhWRQBWjQdVyAevI8= -github.com/Microsoft/go-winio v0.4.11 h1:zoIOcVf0xPN1tnMVbTtEdI+P8OofVk3NObnwOQ6nK2Q= -github.com/Microsoft/go-winio v0.4.11/go.mod h1:VhR8bwka0BXejwEJY73c50VrPtXAaKcyvVC4A4RozmA= -github.com/Nvveen/Gotty v0.0.0-20120604004816-cd527374f1e5 h1:TngWCqHvy9oXAN6lEVMRuU21PR1EtLVZJmdB18Gu3Rw= -github.com/Nvveen/Gotty v0.0.0-20120604004816-cd527374f1e5/go.mod h1:lmUJ/7eu/Q8D7ML55dXQrVaamCz2vxCfdQBasLZfHKk= -github.com/containerd/continuity v0.0.0-20180814194400-c7c5070e6f6e h1:KEBqsIJcjops96ysfjRTg3x6STnVHBxe7CZLwwnlkWA= -github.com/containerd/continuity v0.0.0-20180814194400-c7c5070e6f6e/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y= +github.com/BurntSushi/toml v0.3.1/go.mod h1:xHWCNGjB5oqiDr8zfno3MHue2Ht5sIBksp03qcyfWMU= +github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5 h1:ygIc8M6trr62pF5DucadTWGdEB4mEyvzi0e2nbcmcyA= +github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5/go.mod h1:tTuCMEN+UleMWgg9dVx4Hu52b1bJo+59jBh3ajtinzw= +github.com/Microsoft/go-winio v0.4.15-0.20200113171025-3fe6c5262873 h1:93nQ7k53GjoMQ07HVP8g6Zj1fQZDDj7Xy2VkNNtvX8o= +github.com/Microsoft/go-winio v0.4.15-0.20200113171025-3fe6c5262873/go.mod h1:tTuCMEN+UleMWgg9dVx4Hu52b1bJo+59jBh3ajtinzw= +github.com/Microsoft/hcsshim v0.8.7 h1:ptnOoufxGSzauVTsdE+wMYnCWA301PdoN4xg5oRdZpg= +github.com/Microsoft/hcsshim v0.8.7/go.mod h1:OHd7sQqRFrYd3RmSgbgji+ctCwkbq2wbEYNSzOYtcBQ= +github.com/blang/semver v3.1.0+incompatible/go.mod h1:kRBLl5iJ+tD4TcOOxsy/0fnwebNt5EWlYSAyrTnjyyk= +github.com/census-instrumentation/opencensus-proto v0.2.1/go.mod h1:f6KPmirojxKA12rnyqOA5BBL4O983OfeGPqjHWSTneU= +github.com/client9/misspell v0.3.4/go.mod h1:qj6jICC3Q7zFZvVWo7KLAzC3yx5G7kyvSDkc90ppPyw= +github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f h1:tSNMc+rJDfmYntojat8lljbt1mgKNpTxUZJsSzJ9Y1s= +github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f/go.mod h1:OApqhQ4XNSNC13gXIwDjhOQxjWa/NxkwZXJ1EvqT0ko= +github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1/go.mod h1:Tj/on1eG8kiEhd0+fhSDzsPAFESxzBBvdyEgyryXffw= +github.com/containerd/containerd v1.3.0-beta.2.0.20190828155532-0293cbd26c69/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= +github.com/containerd/containerd v1.3.0 h1:xjvXQWABwS2uiv3TWgQt5Uth60Gu86LTGZXMJkjc7rY= +github.com/containerd/containerd v1.3.0/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= +github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc h1:TP+534wVlf61smEIq1nwLLAjQVEK2EADoW3CX9AuT+8= +github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y= +github.com/containerd/continuity v0.0.0-20200228182428-0f16d7a0959c h1:8ahmSVELW1wghbjerVAyuEYD5+Dio66RYvSS0iGfL1M= +github.com/containerd/continuity v0.0.0-20200228182428-0f16d7a0959c/go.mod h1:Dq467ZllaHgAtVp4p1xUQWBrFXR9s/wyoTpG8zOJGkY= +github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448/go.mod h1:ODA38xgv3Kuk8dQz2ZQXpnv/UZZUHUCL7pnLehbXgQI= +github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3/go.mod h1:IV7qH3hrUgRmyYrtgEeGWJfWbgcHL9CSRruz2Vqcph0= +github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de/go.mod h1:PvCDdDGpgqzQIzDW1TphrGLssLDZp2GuS+X5DkEJB8o= +github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd/go.mod h1:Cm3kwCdlkCfMSHURc+r6fwoGH6/F1hH3S4sg0rLFWPc= +github.com/coreos/go-systemd v0.0.0-20190321100706-95778dfbb74e/go.mod h1:F5haX7vjVVG0kc13fIWeqUViNPyEJxv/OmvnBo0Yme4= +github.com/davecgh/go-spew v1.1.0/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38= github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c= github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38= -github.com/docker/docker v0.7.3-0.20180827131323-0c5f8d2b9b23 h1:Zl/9mUfPbYbnv895OXx9WfxPjwqSZHohuZzVcjJ5QPQ= -github.com/docker/docker v0.7.3-0.20180827131323-0c5f8d2b9b23/go.mod h1:eEKB0N0r5NX/I1kEveEz05bcu8tLC/8azJZsviup8Sk= +github.com/docker/distribution v2.7.1+incompatible h1:a5mlkVzth6W5A4fOsS3D2EO5BUmsJpcB+cRlLU7cSug= +github.com/docker/distribution v2.7.1+incompatible/go.mod h1:J2gT2udsDAN96Uj4KfcMRqY0/ypR+oyYUYmja8H+y+w= +github.com/docker/docker v1.4.2-0.20191101170500-ac7306503d23 h1:oqgGT9O61YAYvI41EBsLePOr+LE6roB0xY4gpkZuFSE= +github.com/docker/docker v1.4.2-0.20191101170500-ac7306503d23/go.mod h1:eEKB0N0r5NX/I1kEveEz05bcu8tLC/8azJZsviup8Sk= github.com/docker/go-connections v0.4.0 h1:El9xVISelRB7BuFusrZozjnkIM5YnzCViNKohAFqRJQ= github.com/docker/go-connections v0.4.0/go.mod h1:Gbd7IOopHjR8Iph03tsViu4nIes5XhDvyHbTtUxmeec= -github.com/docker/go-units v0.3.3 h1:Xk8S3Xj5sLGlG5g67hJmYMmUgXv5N4PhkjJHHqrwnTk= -github.com/docker/go-units v0.3.3/go.mod h1:fgPhTUdO+D/Jk86RDLlptpiXQzgHJF7gydDDbaIK4Dk= -github.com/docker/libnetwork v0.8.0-dev.2.0.20180608203834-19279f049241 h1:+ebE/hCU02srkeIg8Vp/vlUp182JapYWtXzV+bCeR2I= -github.com/docker/libnetwork v0.8.0-dev.2.0.20180608203834-19279f049241/go.mod h1:93m0aTqz6z+g32wla4l4WxTrdtvBRmVzYRkYvasA5Z8= -github.com/fsnotify/fsnotify v1.4.7 h1:IXs+QLmnXW2CcXuY+8Mzv/fWEsPGWxqefPtCP5CnV9I= +github.com/docker/go-units v0.4.0 h1:3uh0PgVws3nIA0Q+MwDC8yjEPf9zjRfZZWXZYDct3Tw= +github.com/docker/go-units v0.4.0/go.mod h1:fgPhTUdO+D/Jk86RDLlptpiXQzgHJF7gydDDbaIK4Dk= +github.com/dustin/go-humanize v0.0.0-20171111073723-bb3d318650d4/go.mod h1:HtrtbFcZ19U5GC7JDqmcUSB87Iq5E25KnS6fMYU6eOk= +github.com/envoyproxy/go-control-plane v0.9.1-0.20191026205805-5f8ba28d4473/go.mod h1:YTl/9mNaCwkRvm6d1a2C3ymFceY/DCBVvsKhRF0iEA4= +github.com/envoyproxy/protoc-gen-validate v0.1.0/go.mod h1:iSmxcyjqTsJpI2R4NaDN7+kN2VEUnK/pcBlmesArF7c= github.com/fsnotify/fsnotify v1.4.7/go.mod h1:jwhsz4b93w/PPRr/qN1Yymfu8t87LnFCMoQvtojpjFo= -github.com/gogo/protobuf v1.1.1 h1:72R+M5VuhED/KujmZVcIquuo8mBgX4oVda//DQb3PXo= -github.com/gogo/protobuf v1.1.1/go.mod h1:r8qH/GZQm5c6nD/R0oafs1akxWv10x8SbQlK7atdtwQ= -github.com/golang/protobuf v1.2.0 h1:P3YflyNX/ehuJFLhxviNdFxQPkGK5cDcApsge1SqnvM= +github.com/godbus/dbus v0.0.0-20190422162347-ade71ed3457e/go.mod h1:bBOAhwG1umN6/6ZUMtDFBMQR8jRg9O75tm9K00oMsK4= +github.com/gogo/protobuf v1.2.1 h1:/s5zKNz0uPFCZ5hddgPdo2TK2TVrUNMn0OOX8/aZMTE= +github.com/gogo/protobuf v1.2.1/go.mod h1:hp+jE20tsWTFYpLwKvXlhS1hjn+gTNwPg2I6zVXpSg4= +github.com/gogo/protobuf v1.3.1 h1:DqDEcV5aeaTmdFBePNpYsp3FlcVH/2ISVVM9Qf8PSls= +github.com/gogo/protobuf v1.3.1/go.mod h1:SlYgWuQ5SjCEi6WLHjHCa1yvBfUnHcTbrrZtXPKa29o= +github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b h1:VKtxabqXZkF25pY9ekfRL6a582T4P37/31XEstQ5p58= +github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b/go.mod h1:SBH7ygxi8pfUlaOkMMuAQtPIUF8ecWP5IEl/CR7VP2Q= +github.com/golang/mock v1.1.1/go.mod h1:oTYuIxOrZwtPieC+H1uAHpcLFnEyAGVDL/k47Jfbm0A= github.com/golang/protobuf v1.2.0/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= -github.com/google/go-cmp v0.2.0 h1:+dTQ8DZQJz0Mb/HjFlkptS1FeQ4cWSnN941F8aEG4SQ= +github.com/golang/protobuf v1.3.1 h1:YF8+flBXS5eO826T4nzqPrxfhQThhXl0YzfuUPu4SBg= +github.com/golang/protobuf v1.3.1/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= +github.com/golang/protobuf v1.3.2 h1:6nsPYzhq5kReh6QImI3k5qWzO4PEbvbIW2cwSfR/6xs= +github.com/golang/protobuf v1.3.2/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= github.com/google/go-cmp v0.2.0/go.mod h1:oXzfMopK8JAjlY9xF4vHSVASa0yLyX7SntLO5aqRK0M= -github.com/gorilla/context v1.1.1 h1:AWwleXJkX/nhcU9bZSnZoi3h/qGYqQAGhq6zZe/aQW8= -github.com/gorilla/context v1.1.1/go.mod h1:kBGZzfjB9CEq2AlWe17Uuf7NDRt0dE0s8S51q0aT7Yg= -github.com/gorilla/mux v1.6.2 h1:Pgr17XVTNXAk3q/r4CpKzC5xBM/qW1uVLV+IhRZpIIk= -github.com/gorilla/mux v1.6.2/go.mod h1:1lud6UwP+6orDFRuTfBEV8e9/aOM/c4fVVCaMa2zaAs= -github.com/hpcloud/tail v1.0.0 h1:nfCOvKYfkgYP8hkirhJocXT2+zOD8yUNjXaWfTlyFKI= +github.com/google/go-cmp v0.3.0/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU= +github.com/google/go-cmp v0.4.0 h1:xsAVV57WRhGj6kEIi8ReJzQlHHqcBYCElAvkovg3B/4= +github.com/google/go-cmp v0.4.0/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE= +github.com/gorilla/mux v1.7.4 h1:VuZ8uybHlWmqV03+zRzdwKL4tUnIp1MAQtp1mIFE1bc= +github.com/gorilla/mux v1.7.4/go.mod h1:DVbg23sWSpFRCP0SfiEN6jmj59UnW/n46BH5rLB71So= +github.com/hashicorp/errwrap v0.0.0-20141028054710-7554cd9344ce/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4= +github.com/hashicorp/go-multierror v0.0.0-20161216184304-ed905158d874/go.mod h1:JMRHfdO9jKNzS/+BTlxCjKNQHg/jZAft8U7LloJvN7I= +github.com/hashicorp/golang-lru v0.5.1 h1:0hERBMJE1eitiLkihrMvRVBYAkpHzc/J3QdDN+dAcgU= +github.com/hashicorp/golang-lru v0.5.1/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8= github.com/hpcloud/tail v1.0.0/go.mod h1:ab1qPbhIpdTxEkNHXyeSf5vhxWSCs/tWer42PpOxQnU= -github.com/onsi/ginkgo v1.6.0 h1:Ix8l273rp3QzYgXSR+c8d1fTG7UPgYkOSELPhiY/YGw= +github.com/inconshreveable/mousetrap v1.0.0/go.mod h1:PxqpIevigyE2G7u3NXJIT2ANytuPF1OarO4DADm73n8= +github.com/kisielk/errcheck v1.1.0/go.mod h1:EZBBE59ingxPouuu3KfxchcWSUPOHkagtvWXihfKN4Q= +github.com/kisielk/errcheck v1.2.0/go.mod h1:/BMXB+zMLi60iA8Vv6Ksmxu/1UDYcXs4uQLJ+jE2L00= +github.com/kisielk/gotool v1.0.0/go.mod h1:XhKaO+MFFWcvkIS/tQcRk01m1F5IRFswLeQ+oQHNcck= +github.com/konsorten/go-windows-terminal-sequences v1.0.1 h1:mweAR1A6xJ3oS2pRaGiHgQ4OO8tzTaLawm8vnODuwDk= +github.com/konsorten/go-windows-terminal-sequences v1.0.1/go.mod h1:T0+1ngSBFLxvqU3pZ+m/2kptfBszLMUkC4ZK/EgS/cQ= +github.com/morikuni/aec v1.0.0 h1:nP9CBfwrvYnBRgY6qfDQkygYDmYwOilePFkwzv4dU8A= +github.com/morikuni/aec v1.0.0/go.mod h1:BbKIizmSmc5MMPqRYbxO4ZU0S0+P200+tUnFx7PXmsc= github.com/onsi/ginkgo v1.6.0/go.mod h1:lLunBs/Ym6LB5Z9jYTR76FiuTmxDTDusOGeTQH+WWjE= -github.com/onsi/gomega v1.4.1 h1:PZSj/UFNaVp3KxrzHOcS7oyuWA7LoOY/77yCTEFu21U= -github.com/onsi/gomega v1.4.1/go.mod h1:C1qb7wdrVGGVU+Z6iS04AVkA3Q65CEZX59MT0QO5uiA= +github.com/onsi/ginkgo v1.10.1/go.mod h1:lLunBs/Ym6LB5Z9jYTR76FiuTmxDTDusOGeTQH+WWjE= +github.com/onsi/gomega v1.7.0/go.mod h1:ex+gbHU/CVuBBDIJjb2X0qEXbFg53c61hWP/1CpauHY= +github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s= github.com/opencontainers/go-digest v1.0.0-rc1 h1:WzifXhOVOEOuFYOJAW6aQqW0TooG2iki3E3Ii+WN7gQ= github.com/opencontainers/go-digest v1.0.0-rc1/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s= github.com/opencontainers/image-spec v1.0.1 h1:JMemWkRwHx4Zj+fVxWoMCFm/8sYGGrUVojFA6h/TRcI= github.com/opencontainers/image-spec v1.0.1/go.mod h1:BtxoFyWECRxE4U/7sNtV5W15zMzWCbyJoFRP3s7yZA0= +github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U= github.com/opencontainers/runc v0.1.1 h1:GlxAyO6x8rfZYN9Tt0Kti5a/cP41iuiO2yYT0IJGY8Y= github.com/opencontainers/runc v0.1.1/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U= -github.com/pkg/errors v0.8.0 h1:WdK/asTD0HN+q6hsWO3/vpuAkAr+tw6aNJNDFFf0+qw= -github.com/pkg/errors v0.8.0/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0= +github.com/opencontainers/runtime-spec v0.1.2-0.20190507144316-5b71a03e2700/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0= +github.com/opencontainers/runtime-tools v0.0.0-20181011054405-1d69bd0f9c39/go.mod h1:r3f7wjNzSs2extwzU3Y+6pKfobzPh+kKFJ3ofN+3nfs= +github.com/pkg/errors v0.8.1-0.20171018195549-f15c970de5b7/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0= +github.com/pkg/errors v0.8.1 h1:iURUrRGxPUNPdy5/HRSm+Yj6okJ6UtLINN0Q9M4+h3I= +github.com/pkg/errors v0.8.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0= github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM= github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4= -github.com/sirupsen/logrus v1.0.6 h1:hcP1GmhGigz/O7h1WVUM5KklBp1JoNS9FggWKdj/j3s= -github.com/sirupsen/logrus v1.0.6/go.mod h1:pMByvHTf9Beacp5x1UXfOR9xyW/9antXMhjMPG0dEzc= +github.com/prometheus/client_model v0.0.0-20190812154241-14fe0d1b01d4/go.mod h1:xMI15A0UPsDsEKsMN9yxemIoYk6Tm2C1GtYGdfGttqA= +github.com/prometheus/procfs v0.0.5/go.mod h1:4A/X28fw3Fc593LaREMrKMqOKvUAntwMDaekg4FpcdQ= +github.com/sirupsen/logrus v1.0.4-0.20170822132746-89742aefa4b2/go.mod h1:pMByvHTf9Beacp5x1UXfOR9xyW/9antXMhjMPG0dEzc= +github.com/sirupsen/logrus v1.4.1 h1:GL2rEmy6nsikmW0r8opw9JIRScdMF5hA8cOYLH7In1k= +github.com/sirupsen/logrus v1.4.1/go.mod h1:ni0Sbl8bgC9z8RoU9G6nDWqqs/fq4eDPysMBDgk/93Q= +github.com/spf13/cobra v0.0.2-0.20171109065643-2da4a54c5cee/go.mod h1:1l0Ry5zgKvJasoi3XT1TypsSe7PqH0Sj9dhYf7v3XqQ= +github.com/spf13/pflag v1.0.1-0.20171106142849-4c012f6dcd95/go.mod h1:DYY7MBk1bdzusC3SYhjObp+wFpr4gzcvqqNjLnInEg4= +github.com/stretchr/objx v0.1.0/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME= +github.com/stretchr/objx v0.1.1/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME= github.com/stretchr/testify v1.2.2 h1:bSDNvY7ZPG5RlJ8otE/7V6gMiyenm9RtJ7IUVIAoJ1w= github.com/stretchr/testify v1.2.2/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXfy6kDkUVs= -github.com/vishvananda/netlink v1.0.0 h1:bqNY2lgheFIu1meHUFSH3d7vG93AFyqg3oGbJCOJgSM= -github.com/vishvananda/netlink v1.0.0/go.mod h1:+SR5DhBJrl6ZM7CoCKvpw5BKroDKQ+PJqOg65H/2ktk= -github.com/vishvananda/netns v0.0.0-20180720170159-13995c7128cc h1:R83G5ikgLMxrBvLh22JhdfI8K6YXEPHx5P03Uu3DRs4= -github.com/vishvananda/netns v0.0.0-20180720170159-13995c7128cc/go.mod h1:ZjcWmFBXmLKZu9Nxj3WKYEafiSqer2rnvPr0en9UNpI= -golang.org/x/crypto v0.0.0-20180820150726-614d502a4dac h1:7d7lG9fHOLdL6jZPtnV4LpI41SbohIJ1Atq7U991dMg= -golang.org/x/crypto v0.0.0-20180820150726-614d502a4dac/go.mod h1:6SG95UA2DQfeDnfUPMdvaQW0Q7yPrPDi9nlGo2tz2b4= -golang.org/x/net v0.0.0-20180826012351-8a410e7b638d h1:g9qWBGx4puODJTMVyoPrpoxPFgVGd+z1DZwjfRu4d0I= +github.com/stretchr/testify v1.4.0 h1:2E4SXV/wtOkTonXsotYi4li6zVWxYlZuYNCXe9XRJyk= +github.com/stretchr/testify v1.4.0/go.mod h1:j7eGeouHqKxXV5pUuKE4zz7dFj8WfuZ+81PSLYec5m4= +github.com/syndtr/gocapability v0.0.0-20170704070218-db04d3cc01c8/go.mod h1:hkRG7XYTFWNJGYcbNJQlaLq0fg1yr4J4t/NcTQtrfww= +github.com/urfave/cli v0.0.0-20171014202726-7bc6a0acffa5/go.mod h1:70zkFmudgCuE/ngEzBv17Jvp/497gISqfk5gWijbERA= +github.com/xeipuuv/gojsonpointer v0.0.0-20180127040702-4e3ac2762d5f/go.mod h1:N2zxlSyiKSe5eX1tZViRH5QA0qijqEDrYZiPEAiq3wU= +github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415/go.mod h1:GwrjFmJcFw6At/Gs6z4yjiIwzuJ1/+UwLxMQDVQXShQ= +github.com/xeipuuv/gojsonschema v0.0.0-20180618132009-1d523034197f/go.mod h1:5yf86TLmAcydyeJq5YvxkGPE2fm/u4myDekKRoLuqhs= +go.opencensus.io v0.22.0 h1:C9hSCOW830chIVkdja34wa6Ky+IzWllkUinR+BtRZd4= +go.opencensus.io v0.22.0/go.mod h1:+kGneAE2xo2IficOXnaByMWTGM9T73dGwxeWcUqIpI8= +golang.org/x/crypto v0.0.0-20171113213409-9f005a07e0d3/go.mod h1:6SG95UA2DQfeDnfUPMdvaQW0Q7yPrPDi9nlGo2tz2b4= +golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2 h1:VklqNMn3ovrHsnt90PveolxSbWFaJdECFbxSq0Mqo2M= +golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACkg1iLfiJU5Ep61QUkGW8qpdssI0+w= +golang.org/x/crypto v0.0.0-20200220183623-bac4c82f6975 h1:/Tl7pH94bvbAAHBdZJT947M/+gp0+CqQXDtMRC0fseo= +golang.org/x/crypto v0.0.0-20200220183623-bac4c82f6975/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto= +golang.org/x/exp v0.0.0-20190121172915-509febef88a4/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA= +golang.org/x/lint v0.0.0-20181026193005-c67002cb31c3/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE= +golang.org/x/lint v0.0.0-20190227174305-5b3e6a55c961/go.mod h1:wehouNa3lNwaWXcvxsM5YxQ5yQlVC4a0KAMCusXpPoU= +golang.org/x/lint v0.0.0-20190313153728-d0100b6bd8b3/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc= +golang.org/x/net v0.0.0-20180724234803-3673e40ba225/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= golang.org/x/net v0.0.0-20180826012351-8a410e7b638d/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= -golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f h1:wMNYb4v58l5UBM7MYRLPG6ZhfOqbKu7X5eyFl8ZhKvA= +golang.org/x/net v0.0.0-20180906233101-161cd47e91fd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20190213061140-3a22650c66bd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20190311183353-d8887717615a/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= +golang.org/x/net v0.0.0-20190404232315-eb5bcb51f2a3/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= +golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09 h1:KaQtG+aDELoNmXYas3TVkGNYRuq8JQ1aa7LJt8EXVyo= +golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= +golang.org/x/oauth2 v0.0.0-20180821212333-d2e6202438be/go.mod h1:N/0e6XlmueqKjAGxoOufVs8QHGRruUQn6yWY3a++T0U= golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= -golang.org/x/sys v0.0.0-20180824143301-4910a1d54f87 h1:GqwDwfvIpC33dK9bA1fD+JiDUNsuAiQiEkpHqUKze4o= -golang.org/x/sys v0.0.0-20180824143301-4910a1d54f87/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= -golang.org/x/text v0.3.0 h1:g61tztE5qeGQ89tm6NTjjM9VPIm088od1l6aSorWRWg= +golang.org/x/sync v0.0.0-20181108010431-42b317875d0f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20181221193216-37e7f081c4d4/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20190423024810-112230192c58 h1:8gQV6CLnAEikrhgkHFbMAEhagSSnXWGV915qUMm9mrU= +golang.org/x/sync v0.0.0-20190423024810-112230192c58/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sys v0.0.0-20180830151530-49385e6e1522/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20180905080454-ebe1bf3edb33/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20180909124046-d0be0721c37e/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20190412213103-97732733099d/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190514135907-3a4b5fb9f71f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 h1:7TYNF4UdlohbFwpNH04CoPMp1cHUZgO1Ebq5r2hIjfo= +golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= -gopkg.in/airbrake/gobrake.v2 v2.0.9 h1:7z2uVWwn7oVeeugY1DtlPAy5H+KYgB1KeKTnqjNatLo= +golang.org/x/text v0.3.2 h1:tW2bmiBqwgJj/UpqtC8EpXEZVYOwU0yG4iWbprSVAcs= +golang.org/x/text v0.3.2/go.mod h1:bEr9sfX3Q8Zfm5fL9x+3itogRgK3+ptLWKqgva+5dAk= +golang.org/x/tools v0.0.0-20180221164845-07fd8470d635/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20181030221726-6c7e314b6563/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20190114222345-bf090417da8b/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20190226205152-f727befe758c/go.mod h1:9Yl7xja0Znq3iFh3HoIrodX9oNMXvdceNzlUR8zjMvY= +golang.org/x/tools v0.0.0-20190311212946-11955173bddd/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs= +golang.org/x/tools v0.0.0-20190524140312-2c0ae7006135/go.mod h1:RgjU9mgBXZiqYHBnxXauZ1Gv1EHHAz9KjViQ78xBX0Q= +golang.org/x/xerrors v0.0.0-20191204190536-9bdfabe68543 h1:E7g+9GITq07hpfrRu66IVDexMakfv52eLZ2CXBWiKr4= +golang.org/x/xerrors v0.0.0-20191204190536-9bdfabe68543/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0= +google.golang.org/appengine v1.1.0/go.mod h1:EbEs0AVv82hx2wNQdGPgUI5lhzA/G0D9YwlJXL52JkM= +google.golang.org/appengine v1.4.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4= +google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8/go.mod h1:JiN7NxoALGmiZfu7CAH4rXhgtRTLTxftemlI0sWmxmc= +google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb h1:i1Ppqkc3WQXikh8bXiwHqAN5Rv3/qDCcRk0/Otx73BY= +google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE= +google.golang.org/genproto v0.0.0-20190819201941-24fa4b261c55 h1:gSJIx1SDwno+2ElGhA4+qG2zF97qiUzTM+rQ0klBOcE= +google.golang.org/genproto v0.0.0-20190819201941-24fa4b261c55/go.mod h1:DMBHOl98Agz4BDEuKkezgsaosCRResVns1a3J2ZsMNc= +google.golang.org/grpc v1.19.0/go.mod h1:mqu4LbDTu4XGKhr4mRzUsmM4RtVoemTSY81AxZiDr8c= +google.golang.org/grpc v1.20.1/go.mod h1:10oTOabMzJvdu6/UiuZezV6QK5dSlG84ov/aaiqXj38= +google.golang.org/grpc v1.23.0/go.mod h1:Y5yQAOtifL1yxbo5wqy6BxZv8vAUGQwXBOALyacEbxg= +google.golang.org/grpc v1.27.1 h1:zvIju4sqAGvwKspUQOhwnpcqSbzi7/H6QomNNjTL4sk= +google.golang.org/grpc v1.27.1/go.mod h1:qbnxyOmOxrQa7FizSgH+ReBfzJrCY1pSN7KXBS8abTk= gopkg.in/airbrake/gobrake.v2 v2.0.9/go.mod h1:/h5ZAUhDkGaJfjzjKLSjv6zCL6O0LLBxU4K+aSYdM/U= gopkg.in/check.v1 v0.0.0-20161208181325-20d25e280405 h1:yhCVgyC4o1eVCa2tZl7eS0r+SDo693bJlVdllGtEeKM= gopkg.in/check.v1 v0.0.0-20161208181325-20d25e280405/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0= -gopkg.in/fsnotify.v1 v1.4.7 h1:xOHLXZwVvI9hhs+cLKq5+I5onOuwQLhQwiu63xxlHs4= gopkg.in/fsnotify.v1 v1.4.7/go.mod h1:Tz8NjZHkW78fSQdbUxIjBTcgA1z1m8ZHf0WmKUhAMys= -gopkg.in/gemnasium/logrus-airbrake-hook.v2 v2.1.2 h1:OAj3g0cR6Dx/R07QgQe8wkA9RNjB2u4i700xBkIT4e0= gopkg.in/gemnasium/logrus-airbrake-hook.v2 v2.1.2/go.mod h1:Xk6kEKp8OKb+X14hQBKWaSkCsqBpgog8nAV2xsGOxlo= -gopkg.in/tomb.v1 v1.0.0-20141024135613-dd632973f1e7 h1:uRGJdciOHaEIrze2W8Q3AKkepLTh2hOroT7a+7czfdQ= gopkg.in/tomb.v1 v1.0.0-20141024135613-dd632973f1e7/go.mod h1:dt/ZhP58zS4L8KSrWDmTeBkI65Dw0HsyUHuEVlX15mw= -gopkg.in/yaml.v2 v2.2.1 h1:mUhvW9EsL+naU5Q3cakzfE91YhliOondGd6ZrsDBHQE= gopkg.in/yaml.v2 v2.2.1/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI= -gotest.tools v2.1.0+incompatible h1:5USw7CrJBYKqjg9R7QlA6jzqZKEAtvW82aNmsxxGPxw= -gotest.tools v2.1.0+incompatible/go.mod h1:DsYFclhRJ6vuDpmuTbkuFWG+y2sxOXAzmJt81HFBacw= +gopkg.in/yaml.v2 v2.2.2 h1:ZCJp+EgiOT7lHqUV2J862kp8Qj64Jo6az82+3Td9dZw= +gopkg.in/yaml.v2 v2.2.2/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI= +gotest.tools v2.2.0+incompatible h1:VsBPFP1AI068pPrMxtb/S8Zkgf9xEmTLJjfM+P5UIEo= +gotest.tools v2.2.0+incompatible/go.mod h1:DsYFclhRJ6vuDpmuTbkuFWG+y2sxOXAzmJt81HFBacw= +honnef.co/go/tools v0.0.0-20190102054323-c2f93a96b099/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4= +honnef.co/go/tools v0.0.0-20190523083050-ea95bdfd59fc/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4= +k8s.io/kubernetes v1.13.0/go.mod h1:ocZa8+6APFNC2tX1DZASIbocyYT5jHzqFVsY5aoB7Jk= diff --git a/vendor/github.com/fsouza/go-dockerclient/image.go b/vendor/github.com/fsouza/go-dockerclient/image.go index 114ddfb8..5f72d664 100644 --- a/vendor/github.com/fsouza/go-dockerclient/image.go +++ b/vendor/github.com/fsouza/go-dockerclient/image.go @@ -88,7 +88,7 @@ var ( // InputStream are provided in BuildImageOptions ErrMultipleContexts = errors.New("image build may not be provided BOTH context dir and input stream") - // ErrMustSpecifyNames is the error rreturned when the Names field on + // ErrMustSpecifyNames is the error returned when the Names field on // ExportImagesOptions is nil or empty ErrMustSpecifyNames = errors.New("must specify at least one name to export") ) @@ -109,7 +109,7 @@ type ListImagesOptions struct { // See https://goo.gl/BVzauZ for more details. func (c *Client) ListImages(opts ListImagesOptions) ([]APIImages, error) { path := "/images/json?" + queryString(opts) - resp, err := c.do("GET", path, doOptions{context: opts.Context}) + resp, err := c.do(http.MethodGet, path, doOptions{context: opts.Context}) if err != nil { return nil, err } @@ -129,13 +129,14 @@ type ImageHistory struct { Created int64 `json:"Created,omitempty" yaml:"Created,omitempty" toml:"Tags,omitempty"` CreatedBy string `json:"CreatedBy,omitempty" yaml:"CreatedBy,omitempty" toml:"CreatedBy,omitempty"` Size int64 `json:"Size,omitempty" yaml:"Size,omitempty" toml:"Size,omitempty"` + Comment string `json:"Comment,omitempty" yaml:"Comment,omitempty" toml:"Comment,omitempty"` } // ImageHistory returns the history of the image by its name or ID. // // See https://goo.gl/fYtxQa for more details. func (c *Client) ImageHistory(name string) ([]ImageHistory, error) { - resp, err := c.do("GET", "/images/"+name+"/history", doOptions{}) + resp, err := c.do(http.MethodGet, "/images/"+name+"/history", doOptions{}) if err != nil { if e, ok := err.(*Error); ok && e.Status == http.StatusNotFound { return nil, ErrNoSuchImage @@ -154,7 +155,7 @@ func (c *Client) ImageHistory(name string) ([]ImageHistory, error) { // // See https://goo.gl/Vd2Pck for more details. func (c *Client) RemoveImage(name string) error { - resp, err := c.do("DELETE", "/images/"+name, doOptions{}) + resp, err := c.do(http.MethodDelete, "/images/"+name, doOptions{}) if err != nil { if e, ok := err.(*Error); ok && e.Status == http.StatusNotFound { return ErrNoSuchImage @@ -181,7 +182,7 @@ type RemoveImageOptions struct { // See https://goo.gl/Vd2Pck for more details. func (c *Client) RemoveImageExtended(name string, opts RemoveImageOptions) error { uri := fmt.Sprintf("/images/%s?%s", name, queryString(&opts)) - resp, err := c.do("DELETE", uri, doOptions{context: opts.Context}) + resp, err := c.do(http.MethodDelete, uri, doOptions{context: opts.Context}) if err != nil { if e, ok := err.(*Error); ok && e.Status == http.StatusNotFound { return ErrNoSuchImage @@ -196,7 +197,7 @@ func (c *Client) RemoveImageExtended(name string, opts RemoveImageOptions) error // // See https://goo.gl/ncLTG8 for more details. func (c *Client) InspectImage(name string) (*Image, error) { - resp, err := c.do("GET", "/images/"+name+"/json", doOptions{}) + resp, err := c.do(http.MethodGet, "/images/"+name+"/json", doOptions{}) if err != nil { if e, ok := err.(*Error); ok && e.Status == http.StatusNotFound { return nil, ErrNoSuchImage @@ -271,7 +272,7 @@ func (c *Client) PushImage(opts PushImageOptions, auth AuthConfiguration) error name := opts.Name opts.Name = "" path := "/images/" + name + "/push?" + queryString(&opts) - return c.stream("POST", path, streamOptions{ + return c.stream(http.MethodPost, path, streamOptions{ setRawTerminal: true, rawJSONStream: opts.RawJSONStream, headers: headers, @@ -288,6 +289,7 @@ func (c *Client) PushImage(opts PushImageOptions, auth AuthConfiguration) error type PullImageOptions struct { Repository string `qs:"fromImage"` Tag string + Platform string `ver:"1.32"` // Only required for Docker Engine 1.9 or 1.10 w/ Remote API < 1.21 // and Docker Engine < 1.9 @@ -318,12 +320,16 @@ func (c *Client) PullImage(opts PullImageOptions, auth AuthConfiguration) error opts.Repository = parts[0] opts.Tag = parts[1] } - return c.createImage(queryString(&opts), headers, nil, opts.OutputStream, opts.RawJSONStream, opts.InactivityTimeout, opts.Context) + return c.createImage(&opts, headers, nil, opts.OutputStream, opts.RawJSONStream, opts.InactivityTimeout, opts.Context) } -func (c *Client) createImage(qs string, headers map[string]string, in io.Reader, w io.Writer, rawJSONStream bool, timeout time.Duration, context context.Context) error { - path := "/images/create?" + qs - return c.stream("POST", path, streamOptions{ +//nolint:golint +func (c *Client) createImage(opts interface{}, headers map[string]string, in io.Reader, w io.Writer, rawJSONStream bool, timeout time.Duration, context context.Context) error { + url, err := c.getPath("/images/create", opts) + if err != nil { + return err + } + return c.streamURL(http.MethodPost, url, streamOptions{ setRawTerminal: true, headers: headers, in: in, @@ -347,7 +353,7 @@ type LoadImageOptions struct { // // See https://goo.gl/rEsBV3 for more details. func (c *Client) LoadImage(opts LoadImageOptions) error { - return c.stream("POST", "/images/load", streamOptions{ + return c.stream(http.MethodPost, "/images/load", streamOptions{ setRawTerminal: true, in: opts.InputStream, stdout: opts.OutputStream, @@ -369,7 +375,7 @@ type ExportImageOptions struct { // // See https://goo.gl/AuySaA for more details. func (c *Client) ExportImage(opts ExportImageOptions) error { - return c.stream("GET", fmt.Sprintf("/images/%s/get", opts.Name), streamOptions{ + return c.stream(http.MethodGet, fmt.Sprintf("/images/%s/get", opts.Name), streamOptions{ setRawTerminal: true, stdout: opts.OutputStream, inactivityTimeout: opts.InactivityTimeout, @@ -394,7 +400,28 @@ func (c *Client) ExportImages(opts ExportImagesOptions) error { if opts.Names == nil || len(opts.Names) == 0 { return ErrMustSpecifyNames } - return c.stream("GET", "/images/get?"+queryString(&opts), streamOptions{ + // API < 1.25 allows multiple name values + // 1.25 says name must be a comma separated list + var err error + var exporturl string + if c.requestedAPIVersion.GreaterThanOrEqualTo(apiVersion125) { + str := opts.Names[0] + for _, val := range opts.Names[1:] { + str += "," + val + } + exporturl, err = c.getPath("/images/get", ExportImagesOptions{ + Names: []string{str}, + OutputStream: opts.OutputStream, + InactivityTimeout: opts.InactivityTimeout, + Context: opts.Context, + }) + } else { + exporturl, err = c.getPath("/images/get", &opts) + } + if err != nil { + return err + } + return c.streamURL(http.MethodGet, exporturl, streamOptions{ setRawTerminal: true, stdout: opts.OutputStream, inactivityTimeout: opts.InactivityTimeout, @@ -435,7 +462,7 @@ func (c *Client) ImportImage(opts ImportImageOptions) error { opts.InputStream = f opts.Source = "-" } - return c.createImage(queryString(&opts), nil, opts.InputStream, opts.OutputStream, opts.RawJSONStream, opts.InactivityTimeout, opts.Context) + return c.createImage(&opts, nil, opts.InputStream, opts.OutputStream, opts.RawJSONStream, opts.InactivityTimeout, opts.Context) } // BuildImageOptions present the set of informations available for building an @@ -444,36 +471,40 @@ func (c *Client) ImportImage(opts ImportImageOptions) error { // For more details about the Docker building process, see // https://goo.gl/4nYHwV. type BuildImageOptions struct { - Name string `qs:"t"` - Dockerfile string `qs:"dockerfile"` - NoCache bool `qs:"nocache"` - CacheFrom []string `qs:"-"` - SuppressOutput bool `qs:"q"` - Pull bool `qs:"pull"` - RmTmpContainer bool `qs:"rm"` - ForceRmTmpContainer bool `qs:"forcerm"` - RawJSONStream bool `qs:"-"` - Memory int64 `qs:"memory"` - Memswap int64 `qs:"memswap"` - CPUShares int64 `qs:"cpushares"` - CPUQuota int64 `qs:"cpuquota"` - CPUPeriod int64 `qs:"cpuperiod"` - CPUSetCPUs string `qs:"cpusetcpus"` - Labels map[string]string `qs:"labels"` - InputStream io.Reader `qs:"-"` - OutputStream io.Writer `qs:"-"` - Remote string `qs:"remote"` + Context context.Context + Name string `qs:"t"` + Dockerfile string `ver:"1.25"` + ExtraHosts string `ver:"1.28"` + CacheFrom []string `qs:"-" ver:"1.25"` + Memory int64 + Memswap int64 + ShmSize int64 + CPUShares int64 + CPUQuota int64 `ver:"1.21"` + CPUPeriod int64 `ver:"1.21"` + CPUSetCPUs string + Labels map[string]string + InputStream io.Reader `qs:"-"` + OutputStream io.Writer `qs:"-"` + Remote string Auth AuthConfiguration `qs:"-"` // for older docker X-Registry-Auth header AuthConfigs AuthConfigurations `qs:"-"` // for newer docker X-Registry-Config header ContextDir string `qs:"-"` - Ulimits []ULimit `qs:"-"` - BuildArgs []BuildArg `qs:"-"` - NetworkMode string `qs:"networkmode"` + Ulimits []ULimit `qs:"-" ver:"1.18"` + BuildArgs []BuildArg `qs:"-" ver:"1.21"` + NetworkMode string `ver:"1.25"` + Platform string `ver:"1.32"` InactivityTimeout time.Duration `qs:"-"` - CgroupParent string `qs:"cgroupparent"` - SecurityOpt []string `qs:"securityopt"` - Target string `gs:"target"` - Context context.Context + CgroupParent string + SecurityOpt []string + Target string + Outputs string `ver:"1.40"` + NoCache bool + SuppressOutput bool `qs:"q"` + Pull bool `ver:"1.16"` + RmTmpContainer bool `qs:"rm"` + ForceRmTmpContainer bool `qs:"forcerm" ver:"1.12"` + RawJSONStream bool `qs:"-"` } // BuildArg represents arguments that can be passed to the image when building @@ -516,13 +547,16 @@ func (c *Client) BuildImage(opts BuildImageOptions) error { return err } } - qs := queryString(&opts) + qs, ver := queryStringVersion(&opts) - if c.serverAPIVersion.GreaterThanOrEqualTo(apiVersion125) && len(opts.CacheFrom) > 0 { + if len(opts.CacheFrom) > 0 { if b, err := json.Marshal(opts.CacheFrom); err == nil { item := url.Values(map[string][]string{}) item.Add("cachefrom", string(b)) qs = fmt.Sprintf("%s&%s", qs, item.Encode()) + if ver == nil || apiVersion125.GreaterThan(ver) { + ver = apiVersion125 + } } } @@ -531,6 +565,9 @@ func (c *Client) BuildImage(opts BuildImageOptions) error { item := url.Values(map[string][]string{}) item.Add("ulimits", string(b)) qs = fmt.Sprintf("%s&%s", qs, item.Encode()) + if ver == nil || apiVersion118.GreaterThan(ver) { + ver = apiVersion118 + } } } @@ -543,10 +580,18 @@ func (c *Client) BuildImage(opts BuildImageOptions) error { item := url.Values(map[string][]string{}) item.Add("buildargs", string(b)) qs = fmt.Sprintf("%s&%s", qs, item.Encode()) + if ver == nil || apiVersion121.GreaterThan(ver) { + ver = apiVersion121 + } } } - return c.stream("POST", fmt.Sprintf("/build?%s", qs), streamOptions{ + buildURL, err := c.pathVersionCheck("/build", qs, ver) + if err != nil { + return err + } + + return c.streamURL(http.MethodPost, buildURL, streamOptions{ setRawTerminal: true, rawJSONStream: opts.RawJSONStream, headers: headers, @@ -584,10 +629,9 @@ func (c *Client) TagImage(name string, opts TagImageOptions) error { if name == "" { return ErrNoSuchImage } - resp, err := c.do("POST", "/images/"+name+"/tag?"+queryString(&opts), doOptions{ + resp, err := c.do(http.MethodPost, "/images/"+name+"/tag?"+queryString(&opts), doOptions{ context: opts.Context, }) - if err != nil { return err } @@ -610,7 +654,7 @@ func isURL(u string) bool { } func headersWithAuth(auths ...registryAuth) (map[string]string, error) { - var headers = make(map[string]string) + headers := make(map[string]string) for _, auth := range auths { if auth.isEmpty() { @@ -641,7 +685,7 @@ type APIImageSearch struct { // // See https://goo.gl/KLO9IZ for more details. func (c *Client) SearchImages(term string) ([]APIImageSearch, error) { - resp, err := c.do("GET", "/images/search?term="+term, doOptions{}) + resp, err := c.do(http.MethodGet, "/images/search?term="+term, doOptions{}) if err != nil { return nil, err } @@ -662,7 +706,7 @@ func (c *Client) SearchImagesEx(term string, auth AuthConfiguration) ([]APIImage return nil, err } - resp, err := c.do("GET", "/images/search?term="+term, doOptions{ + resp, err := c.do(http.MethodGet, "/images/search?term="+term, doOptions{ headers: headers, }) if err != nil { @@ -700,7 +744,7 @@ type PruneImagesResults struct { // See https://goo.gl/qfZlbZ for more details. func (c *Client) PruneImages(opts PruneImagesOptions) (*PruneImagesResults, error) { path := "/images/prune?" + queryString(opts) - resp, err := c.do("POST", path, doOptions{context: opts.Context}) + resp, err := c.do(http.MethodPost, path, doOptions{context: opts.Context}) if err != nil { return nil, err } diff --git a/vendor/github.com/fsouza/go-dockerclient/internal/archive/archive.go b/vendor/github.com/fsouza/go-dockerclient/internal/archive/archive.go deleted file mode 100644 index 7d7cf496..00000000 --- a/vendor/github.com/fsouza/go-dockerclient/internal/archive/archive.go +++ /dev/null @@ -1,505 +0,0 @@ -// Copyright 2014 Docker authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the DOCKER-LICENSE file. - -package archive - -import ( - "archive/tar" - "bufio" - "compress/gzip" - "fmt" - "io" - "os" - "path/filepath" - "strings" - - "github.com/docker/docker/pkg/fileutils" - "github.com/docker/docker/pkg/idtools" - "github.com/docker/docker/pkg/pools" - "github.com/docker/docker/pkg/system" - "github.com/sirupsen/logrus" -) - -const ( - // Uncompressed represents the uncompressed. - Uncompressed Compression = iota - // Bzip2 is bzip2 compression algorithm. - Bzip2 - // Gzip is gzip compression algorithm. - Gzip - // Xz is xz compression algorithm. - Xz -) - -const ( - modeISDIR = 040000 // Directory - modeISFIFO = 010000 // FIFO - modeISREG = 0100000 // Regular file - modeISLNK = 0120000 // Symbolic link - modeISBLK = 060000 // Block special file - modeISCHR = 020000 // Character special file - modeISSOCK = 0140000 // Socket -) - -// Compression is the state represents if compressed or not. -type Compression int - -// Extension returns the extension of a file that uses the specified compression algorithm. -func (compression *Compression) Extension() string { - switch *compression { - case Uncompressed: - return "tar" - case Bzip2: - return "tar.bz2" - case Gzip: - return "tar.gz" - case Xz: - return "tar.xz" - } - return "" -} - -// WhiteoutFormat is the format of whiteouts unpacked -type WhiteoutFormat int - -// TarOptions wraps the tar options. -type TarOptions struct { - IncludeFiles []string - ExcludePatterns []string - Compression Compression - NoLchown bool - UIDMaps []idtools.IDMap - GIDMaps []idtools.IDMap - ChownOpts *idtools.Identity - IncludeSourceDir bool - // WhiteoutFormat is the expected on disk format for whiteout files. - // This format will be converted to the standard format on pack - // and from the standard format on unpack. - WhiteoutFormat WhiteoutFormat - // When unpacking, specifies whether overwriting a directory with a - // non-directory is allowed and vice versa. - NoOverwriteDirNonDir bool - // For each include when creating an archive, the included name will be - // replaced with the matching name from this map. - RebaseNames map[string]string - InUserNS bool -} - -// TarWithOptions creates an archive from the directory at `path`, only including files whose relative -// paths are included in `options.IncludeFiles` (if non-nil) or not in `options.ExcludePatterns`. -func TarWithOptions(srcPath string, options *TarOptions) (io.ReadCloser, error) { - - // Fix the source path to work with long path names. This is a no-op - // on platforms other than Windows. - srcPath = fixVolumePathPrefix(srcPath) - - pm, err := fileutils.NewPatternMatcher(options.ExcludePatterns) - if err != nil { - return nil, err - } - - pipeReader, pipeWriter := io.Pipe() - - compressWriter, err := CompressStream(pipeWriter, options.Compression) - if err != nil { - return nil, err - } - - go func() { - ta := newTarAppender( - idtools.NewIDMappingsFromMaps(options.UIDMaps, options.GIDMaps), - compressWriter, - options.ChownOpts, - ) - ta.WhiteoutConverter = getWhiteoutConverter(options.WhiteoutFormat) - - defer func() { - // Make sure to check the error on Close. - if err := ta.TarWriter.Close(); err != nil { - logrus.Errorf("Can't close tar writer: %s", err) - } - if err := compressWriter.Close(); err != nil { - logrus.Errorf("Can't close compress writer: %s", err) - } - if err := pipeWriter.Close(); err != nil { - logrus.Errorf("Can't close pipe writer: %s", err) - } - }() - - // this buffer is needed for the duration of this piped stream - defer pools.BufioWriter32KPool.Put(ta.Buffer) - - // In general we log errors here but ignore them because - // during e.g. a diff operation the container can continue - // mutating the filesystem and we can see transient errors - // from this - - stat, err := os.Lstat(srcPath) - if err != nil { - return - } - - if !stat.IsDir() { - // We can't later join a non-dir with any includes because the - // 'walk' will error if "file/." is stat-ed and "file" is not a - // directory. So, we must split the source path and use the - // basename as the include. - if len(options.IncludeFiles) > 0 { - logrus.Warn("Tar: Can't archive a file with includes") - } - - dir, base := SplitPathDirEntry(srcPath) - srcPath = dir - options.IncludeFiles = []string{base} - } - - if len(options.IncludeFiles) == 0 { - options.IncludeFiles = []string{"."} - } - - seen := make(map[string]bool) - - for _, include := range options.IncludeFiles { - rebaseName := options.RebaseNames[include] - - walkRoot := getWalkRoot(srcPath, include) - filepath.Walk(walkRoot, func(filePath string, f os.FileInfo, err error) error { - if err != nil { - logrus.Errorf("Tar: Can't stat file %s to tar: %s", srcPath, err) - return nil - } - - relFilePath, err := filepath.Rel(srcPath, filePath) - if err != nil || (!options.IncludeSourceDir && relFilePath == "." && f.IsDir()) { - // Error getting relative path OR we are looking - // at the source directory path. Skip in both situations. - return nil - } - - if options.IncludeSourceDir && include == "." && relFilePath != "." { - relFilePath = strings.Join([]string{".", relFilePath}, string(filepath.Separator)) - } - - skip := false - - // If "include" is an exact match for the current file - // then even if there's an "excludePatterns" pattern that - // matches it, don't skip it. IOW, assume an explicit 'include' - // is asking for that file no matter what - which is true - // for some files, like .dockerignore and Dockerfile (sometimes) - if include != relFilePath { - skip, err = pm.Matches(relFilePath) - if err != nil { - logrus.Errorf("Error matching %s: %v", relFilePath, err) - return err - } - } - - if skip { - // If we want to skip this file and its a directory - // then we should first check to see if there's an - // excludes pattern (e.g. !dir/file) that starts with this - // dir. If so then we can't skip this dir. - - // Its not a dir then so we can just return/skip. - if !f.IsDir() { - return nil - } - - // No exceptions (!...) in patterns so just skip dir - if !pm.Exclusions() { - return filepath.SkipDir - } - - dirSlash := relFilePath + string(filepath.Separator) - - for _, pat := range pm.Patterns() { - if !pat.Exclusion() { - continue - } - if strings.HasPrefix(pat.String()+string(filepath.Separator), dirSlash) { - // found a match - so can't skip this dir - return nil - } - } - - // No matching exclusion dir so just skip dir - return filepath.SkipDir - } - - if seen[relFilePath] { - return nil - } - seen[relFilePath] = true - - // Rename the base resource. - if rebaseName != "" { - var replacement string - if rebaseName != string(filepath.Separator) { - // Special case the root directory to replace with an - // empty string instead so that we don't end up with - // double slashes in the paths. - replacement = rebaseName - } - - relFilePath = strings.Replace(relFilePath, include, replacement, 1) - } - - if err := ta.addTarFile(filePath, relFilePath); err != nil { - logrus.Errorf("Can't add file %s to tar: %s", filePath, err) - // if pipe is broken, stop writing tar stream to it - if err == io.ErrClosedPipe { - return err - } - } - return nil - }) - } - }() - - return pipeReader, nil -} - -// CompressStream compresses the dest with specified compression algorithm. -func CompressStream(dest io.Writer, compression Compression) (io.WriteCloser, error) { - p := pools.BufioWriter32KPool - buf := p.Get(dest) - switch compression { - case Uncompressed: - writeBufWrapper := p.NewWriteCloserWrapper(buf, buf) - return writeBufWrapper, nil - case Gzip: - gzWriter := gzip.NewWriter(dest) - writeBufWrapper := p.NewWriteCloserWrapper(buf, gzWriter) - return writeBufWrapper, nil - case Bzip2, Xz: - // archive/bzip2 does not support writing, and there is no xz support at all - // However, this is not a problem as docker only currently generates gzipped tars - return nil, fmt.Errorf("Unsupported compression format %s", (&compression).Extension()) - default: - return nil, fmt.Errorf("Unsupported compression format %s", (&compression).Extension()) - } -} - -type tarWhiteoutConverter interface { - ConvertWrite(*tar.Header, string, os.FileInfo) (*tar.Header, error) - ConvertRead(*tar.Header, string) (bool, error) -} - -type tarAppender struct { - TarWriter *tar.Writer - Buffer *bufio.Writer - - // for hardlink mapping - SeenFiles map[uint64]string - IdentityMapping *idtools.IdentityMapping - ChownOpts *idtools.Identity - - // For packing and unpacking whiteout files in the - // non standard format. The whiteout files defined - // by the AUFS standard are used as the tar whiteout - // standard. - WhiteoutConverter tarWhiteoutConverter -} - -func newTarAppender(idMapping *idtools.IdentityMapping, writer io.Writer, chownOpts *idtools.Identity) *tarAppender { - return &tarAppender{ - SeenFiles: make(map[uint64]string), - TarWriter: tar.NewWriter(writer), - Buffer: pools.BufioWriter32KPool.Get(nil), - IdentityMapping: idMapping, - ChownOpts: chownOpts, - } -} - -// addTarFile adds to the tar archive a file from `path` as `name` -func (ta *tarAppender) addTarFile(path, name string) error { - fi, err := os.Lstat(path) - if err != nil { - return err - } - - var link string - if fi.Mode()&os.ModeSymlink != 0 { - var err error - link, err = os.Readlink(path) - if err != nil { - return err - } - } - - hdr, err := FileInfoHeader(name, fi, link) - if err != nil { - return err - } - if err := ReadSecurityXattrToTarHeader(path, hdr); err != nil { - return err - } - - // if it's not a directory and has more than 1 link, - // it's hard linked, so set the type flag accordingly - if !fi.IsDir() && hasHardlinks(fi) { - inode, err := getInodeFromStat(fi.Sys()) - if err != nil { - return err - } - // a link should have a name that it links too - // and that linked name should be first in the tar archive - if oldpath, ok := ta.SeenFiles[inode]; ok { - hdr.Typeflag = tar.TypeLink - hdr.Linkname = oldpath - hdr.Size = 0 // This Must be here for the writer math to add up! - } else { - ta.SeenFiles[inode] = name - } - } - - //check whether the file is overlayfs whiteout - //if yes, skip re-mapping container ID mappings. - isOverlayWhiteout := fi.Mode()&os.ModeCharDevice != 0 && hdr.Devmajor == 0 && hdr.Devminor == 0 - - //handle re-mapping container ID mappings back to host ID mappings before - //writing tar headers/files. We skip whiteout files because they were written - //by the kernel and already have proper ownership relative to the host - if !isOverlayWhiteout && - !strings.HasPrefix(filepath.Base(hdr.Name), WhiteoutPrefix) && - !ta.IdentityMapping.Empty() { - fileIdentity, err := getFileIdentity(fi.Sys()) - if err != nil { - return err - } - hdr.Uid, hdr.Gid, err = ta.IdentityMapping.ToContainer(fileIdentity) - if err != nil { - return err - } - } - - // explicitly override with ChownOpts - if ta.ChownOpts != nil { - hdr.Uid = ta.ChownOpts.UID - hdr.Gid = ta.ChownOpts.GID - } - - if ta.WhiteoutConverter != nil { - wo, err := ta.WhiteoutConverter.ConvertWrite(hdr, path, fi) - if err != nil { - return err - } - - // If a new whiteout file exists, write original hdr, then - // replace hdr with wo to be written after. Whiteouts should - // always be written after the original. Note the original - // hdr may have been updated to be a whiteout with returning - // a whiteout header - if wo != nil { - if err := ta.TarWriter.WriteHeader(hdr); err != nil { - return err - } - if hdr.Typeflag == tar.TypeReg && hdr.Size > 0 { - return fmt.Errorf("tar: cannot use whiteout for non-empty file") - } - hdr = wo - } - } - - if err := ta.TarWriter.WriteHeader(hdr); err != nil { - return err - } - - if hdr.Typeflag == tar.TypeReg && hdr.Size > 0 { - // We use system.OpenSequential to ensure we use sequential file - // access on Windows to avoid depleting the standby list. - // On Linux, this equates to a regular os.Open. - file, err := system.OpenSequential(path) - if err != nil { - return err - } - - ta.Buffer.Reset(ta.TarWriter) - defer ta.Buffer.Reset(nil) - _, err = io.Copy(ta.Buffer, file) - file.Close() - if err != nil { - return err - } - err = ta.Buffer.Flush() - if err != nil { - return err - } - } - - return nil -} - -// ReadSecurityXattrToTarHeader reads security.capability xattr from filesystem -// to a tar header -func ReadSecurityXattrToTarHeader(path string, hdr *tar.Header) error { - capability, _ := system.Lgetxattr(path, "security.capability") - if capability != nil { - hdr.Xattrs = make(map[string]string) - hdr.Xattrs["security.capability"] = string(capability) - } - return nil -} - -// FileInfoHeader creates a populated Header from fi. -// Compared to archive pkg this function fills in more information. -// Also, regardless of Go version, this function fills file type bits (e.g. hdr.Mode |= modeISDIR), -// which have been deleted since Go 1.9 archive/tar. -func FileInfoHeader(name string, fi os.FileInfo, link string) (*tar.Header, error) { - hdr, err := tar.FileInfoHeader(fi, link) - if err != nil { - return nil, err - } - hdr.Mode = fillGo18FileTypeBits(int64(chmodTarEntry(os.FileMode(hdr.Mode))), fi) - name, err = canonicalTarName(name, fi.IsDir()) - if err != nil { - return nil, fmt.Errorf("tar: cannot canonicalize path: %v", err) - } - hdr.Name = name - if err := setHeaderForSpecialDevice(hdr, name, fi.Sys()); err != nil { - return nil, err - } - return hdr, nil -} - -// fillGo18FileTypeBits fills type bits which have been removed on Go 1.9 archive/tar -// https://github.com/golang/go/commit/66b5a2f -func fillGo18FileTypeBits(mode int64, fi os.FileInfo) int64 { - fm := fi.Mode() - switch { - case fm.IsRegular(): - mode |= modeISREG - case fi.IsDir(): - mode |= modeISDIR - case fm&os.ModeSymlink != 0: - mode |= modeISLNK - case fm&os.ModeDevice != 0: - if fm&os.ModeCharDevice != 0 { - mode |= modeISCHR - } else { - mode |= modeISBLK - } - case fm&os.ModeNamedPipe != 0: - mode |= modeISFIFO - case fm&os.ModeSocket != 0: - mode |= modeISSOCK - } - return mode -} - -// canonicalTarName provides a platform-independent and consistent posix-style -//path for files and directories to be archived regardless of the platform. -func canonicalTarName(name string, isDir bool) (string, error) { - name, err := CanonicalTarNameForPath(name) - if err != nil { - return "", err - } - - // suffix with '/' for directories - if isDir && !strings.HasSuffix(name, "/") { - name += "/" - } - return name, nil -} diff --git a/vendor/github.com/fsouza/go-dockerclient/internal/archive/archive_linux.go b/vendor/github.com/fsouza/go-dockerclient/internal/archive/archive_linux.go deleted file mode 100644 index 9e1f3f2f..00000000 --- a/vendor/github.com/fsouza/go-dockerclient/internal/archive/archive_linux.go +++ /dev/null @@ -1,104 +0,0 @@ -// Copyright 2014 Docker authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the DOCKER-LICENSE file. - -package archive - -import ( - "archive/tar" - "os" - "path/filepath" - "strings" - - "github.com/docker/docker/pkg/system" - "golang.org/x/sys/unix" -) - -const ( - // AUFSWhiteoutFormat is the default format for whiteouts - AUFSWhiteoutFormat WhiteoutFormat = iota - // OverlayWhiteoutFormat formats whiteout according to the overlay - // standard. - OverlayWhiteoutFormat -) - -func getWhiteoutConverter(format WhiteoutFormat) tarWhiteoutConverter { - if format == OverlayWhiteoutFormat { - return overlayWhiteoutConverter{} - } - return nil -} - -type overlayWhiteoutConverter struct{} - -func (overlayWhiteoutConverter) ConvertWrite(hdr *tar.Header, path string, fi os.FileInfo) (wo *tar.Header, err error) { - // convert whiteouts to AUFS format - if fi.Mode()&os.ModeCharDevice != 0 && hdr.Devmajor == 0 && hdr.Devminor == 0 { - // we just rename the file and make it normal - dir, filename := filepath.Split(hdr.Name) - hdr.Name = filepath.Join(dir, WhiteoutPrefix+filename) - hdr.Mode = 0600 - hdr.Typeflag = tar.TypeReg - hdr.Size = 0 - } - - if fi.Mode()&os.ModeDir != 0 { - // convert opaque dirs to AUFS format by writing an empty file with the prefix - opaque, err := system.Lgetxattr(path, "trusted.overlay.opaque") - if err != nil { - return nil, err - } - if len(opaque) == 1 && opaque[0] == 'y' { - if hdr.Xattrs != nil { - delete(hdr.Xattrs, "trusted.overlay.opaque") - } - - // create a header for the whiteout file - // it should inherit some properties from the parent, but be a regular file - wo = &tar.Header{ - Typeflag: tar.TypeReg, - Mode: hdr.Mode & int64(os.ModePerm), - Name: filepath.Join(hdr.Name, WhiteoutOpaqueDir), - Size: 0, - Uid: hdr.Uid, - Uname: hdr.Uname, - Gid: hdr.Gid, - Gname: hdr.Gname, - AccessTime: hdr.AccessTime, - ChangeTime: hdr.ChangeTime, - } - } - } - - return -} - -func (overlayWhiteoutConverter) ConvertRead(hdr *tar.Header, path string) (bool, error) { - base := filepath.Base(path) - dir := filepath.Dir(path) - - // if a directory is marked as opaque by the AUFS special file, we need to translate that to overlay - if base == WhiteoutOpaqueDir { - err := unix.Setxattr(dir, "trusted.overlay.opaque", []byte{'y'}, 0) - // don't write the file itself - return false, err - } - - // if a file was deleted and we are using overlay, we need to create a character device - if strings.HasPrefix(base, WhiteoutPrefix) { - originalBase := base[len(WhiteoutPrefix):] - originalPath := filepath.Join(dir, originalBase) - - if err := unix.Mknod(originalPath, unix.S_IFCHR, 0); err != nil { - return false, err - } - if err := os.Chown(originalPath, hdr.Uid, hdr.Gid); err != nil { - return false, err - } - - // don't write the file itself - return false, nil - } - - return true, nil -} diff --git a/vendor/github.com/fsouza/go-dockerclient/internal/archive/archive_other.go b/vendor/github.com/fsouza/go-dockerclient/internal/archive/archive_other.go deleted file mode 100644 index 72822c85..00000000 --- a/vendor/github.com/fsouza/go-dockerclient/internal/archive/archive_other.go +++ /dev/null @@ -1,11 +0,0 @@ -// Copyright 2014 Docker authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the DOCKER-LICENSE file. - -// +build !linux - -package archive - -func getWhiteoutConverter(format WhiteoutFormat) tarWhiteoutConverter { - return nil -} diff --git a/vendor/github.com/fsouza/go-dockerclient/internal/archive/archive_unix.go b/vendor/github.com/fsouza/go-dockerclient/internal/archive/archive_unix.go deleted file mode 100644 index 80199d51..00000000 --- a/vendor/github.com/fsouza/go-dockerclient/internal/archive/archive_unix.go +++ /dev/null @@ -1,77 +0,0 @@ -// Copyright 2014 Docker authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the DOCKER-LICENSE file. - -// +build !windows - -package archive - -import ( - "archive/tar" - "errors" - "os" - "path/filepath" - "syscall" - - "github.com/docker/docker/pkg/idtools" - "golang.org/x/sys/unix" -) - -// CanonicalTarNameForPath returns platform-specific filepath -// to canonical posix-style path for tar archival. p is relative -// path. -func CanonicalTarNameForPath(p string) (string, error) { - return p, nil // already unix-style -} - -// fixVolumePathPrefix does platform specific processing to ensure that if -// the path being passed in is not in a volume path format, convert it to one. -func fixVolumePathPrefix(srcPath string) string { - return srcPath -} - -// getWalkRoot calculates the root path when performing a TarWithOptions. -// We use a separate function as this is platform specific. On Linux, we -// can't use filepath.Join(srcPath,include) because this will clean away -// a trailing "." or "/" which may be important. -func getWalkRoot(srcPath string, include string) string { - return srcPath + string(filepath.Separator) + include -} - -func getInodeFromStat(stat interface{}) (inode uint64, err error) { - s, ok := stat.(*syscall.Stat_t) - - if ok { - inode = uint64(s.Ino) - } - - return -} - -func getFileIdentity(stat interface{}) (idtools.Identity, error) { - s, ok := stat.(*syscall.Stat_t) - - if !ok { - return idtools.Identity{}, errors.New("cannot convert stat value to syscall.Stat_t") - } - return idtools.Identity{UID: int(s.Uid), GID: int(s.Gid)}, nil -} - -func chmodTarEntry(perm os.FileMode) os.FileMode { - return perm // noop for unix as golang APIs provide perm bits correctly -} - -func setHeaderForSpecialDevice(hdr *tar.Header, name string, stat interface{}) (err error) { - s, ok := stat.(*syscall.Stat_t) - - if ok { - // Currently go does not fill in the major/minors - if s.Mode&unix.S_IFBLK != 0 || - s.Mode&unix.S_IFCHR != 0 { - hdr.Devmajor = int64(unix.Major(uint64(s.Rdev))) // nolint: unconvert - hdr.Devminor = int64(unix.Minor(uint64(s.Rdev))) // nolint: unconvert - } - } - - return -} diff --git a/vendor/github.com/fsouza/go-dockerclient/internal/archive/archive_windows.go b/vendor/github.com/fsouza/go-dockerclient/internal/archive/archive_windows.go deleted file mode 100644 index c47768e6..00000000 --- a/vendor/github.com/fsouza/go-dockerclient/internal/archive/archive_windows.go +++ /dev/null @@ -1,71 +0,0 @@ -// Copyright 2014 Docker authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the DOCKER-LICENSE file. - -package archive - -import ( - "archive/tar" - "fmt" - "os" - "path/filepath" - "strings" - - "github.com/docker/docker/pkg/idtools" - "github.com/docker/docker/pkg/longpath" -) - -// CanonicalTarNameForPath returns platform-specific filepath -// to canonical posix-style path for tar archival. p is relative -// path. -func CanonicalTarNameForPath(p string) (string, error) { - // windows: convert windows style relative path with backslashes - // into forward slashes. Since windows does not allow '/' or '\' - // in file names, it is mostly safe to replace however we must - // check just in case - if strings.Contains(p, "/") { - return "", fmt.Errorf("Windows path contains forward slash: %s", p) - } - return strings.Replace(p, string(os.PathSeparator), "/", -1), nil - -} - -// fixVolumePathPrefix does platform specific processing to ensure that if -// the path being passed in is not in a volume path format, convert it to one. -func fixVolumePathPrefix(srcPath string) string { - return longpath.AddPrefix(srcPath) -} - -// getWalkRoot calculates the root path when performing a TarWithOptions. -// We use a separate function as this is platform specific. -func getWalkRoot(srcPath string, include string) string { - return filepath.Join(srcPath, include) -} - -func getInodeFromStat(stat interface{}) (inode uint64, err error) { - // do nothing. no notion of Inode in stat on Windows - return -} - -func getFileIdentity(stat interface{}) (idtools.Identity, error) { - // no notion of file ownership mapping yet on Windows - return idtools.Identity{}, nil -} - -// chmodTarEntry is used to adjust the file permissions used in tar header based -// on the platform the archival is done. -func chmodTarEntry(perm os.FileMode) os.FileMode { - //perm &= 0755 // this 0-ed out tar flags (like link, regular file, directory marker etc.) - permPart := perm & os.ModePerm - noPermPart := perm &^ os.ModePerm - // Add the x bit: make everything +x from windows - permPart |= 0111 - permPart &= 0755 - - return noPermPart | permPart -} - -func setHeaderForSpecialDevice(hdr *tar.Header, name string, stat interface{}) (err error) { - // do nothing. no notion of Rdev, Nlink in stat on Windows - return -} diff --git a/vendor/github.com/fsouza/go-dockerclient/internal/archive/changes_unix.go b/vendor/github.com/fsouza/go-dockerclient/internal/archive/changes_unix.go deleted file mode 100644 index 39ea287b..00000000 --- a/vendor/github.com/fsouza/go-dockerclient/internal/archive/changes_unix.go +++ /dev/null @@ -1,16 +0,0 @@ -// Copyright 2014 Docker authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the DOCKER-LICENSE file. - -// +build !windows - -package archive - -import ( - "os" - "syscall" -) - -func hasHardlinks(fi os.FileInfo) bool { - return fi.Sys().(*syscall.Stat_t).Nlink > 1 -} diff --git a/vendor/github.com/fsouza/go-dockerclient/internal/archive/changes_windows.go b/vendor/github.com/fsouza/go-dockerclient/internal/archive/changes_windows.go deleted file mode 100644 index a9313047..00000000 --- a/vendor/github.com/fsouza/go-dockerclient/internal/archive/changes_windows.go +++ /dev/null @@ -1,11 +0,0 @@ -// Copyright 2014 Docker authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the DOCKER-LICENSE file. - -package archive - -import "os" - -func hasHardlinks(fi os.FileInfo) bool { - return false -} diff --git a/vendor/github.com/fsouza/go-dockerclient/internal/archive/copy.go b/vendor/github.com/fsouza/go-dockerclient/internal/archive/copy.go deleted file mode 100644 index 45d45f20..00000000 --- a/vendor/github.com/fsouza/go-dockerclient/internal/archive/copy.go +++ /dev/null @@ -1,29 +0,0 @@ -// Copyright 2014 Docker authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the DOCKER-LICENSE file. - -package archive - -import ( - "os" - "path/filepath" -) - -// SplitPathDirEntry splits the given path between its directory name and its -// basename by first cleaning the path but preserves a trailing "." if the -// original path specified the current directory. -func SplitPathDirEntry(path string) (dir, base string) { - cleanedPath := filepath.Clean(filepath.FromSlash(path)) - - if specifiesCurrentDir(path) { - cleanedPath += string(os.PathSeparator) + "." - } - - return filepath.Dir(cleanedPath), filepath.Base(cleanedPath) -} - -// specifiesCurrentDir returns whether the given path specifies -// a "current directory", i.e., the last path segment is `.`. -func specifiesCurrentDir(path string) bool { - return filepath.Base(path) == "." -} diff --git a/vendor/github.com/fsouza/go-dockerclient/internal/archive/whiteouts.go b/vendor/github.com/fsouza/go-dockerclient/internal/archive/whiteouts.go deleted file mode 100644 index a61c22a0..00000000 --- a/vendor/github.com/fsouza/go-dockerclient/internal/archive/whiteouts.go +++ /dev/null @@ -1,27 +0,0 @@ -// Copyright 2014 Docker authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the DOCKER-LICENSE file. - -package archive - -// Whiteouts are files with a special meaning for the layered filesystem. -// Docker uses AUFS whiteout files inside exported archives. In other -// filesystems these files are generated/handled on tar creation/extraction. - -// WhiteoutPrefix prefix means file is a whiteout. If this is followed by a -// filename this means that file has been removed from the base layer. -const WhiteoutPrefix = ".wh." - -// WhiteoutMetaPrefix prefix means whiteout has a special meaning and is not -// for removing an actual file. Normally these files are excluded from exported -// archives. -const WhiteoutMetaPrefix = WhiteoutPrefix + WhiteoutPrefix - -// WhiteoutLinkDir is a directory AUFS uses for storing hardlink links to other -// layers. Normally these should not go into exported archives and all changed -// hardlinks should be copied to the top layer. -const WhiteoutLinkDir = WhiteoutMetaPrefix + "plnk" - -// WhiteoutOpaqueDir file means directory has been made opaque - meaning -// readdir calls to this directory do not follow to lower layers. -const WhiteoutOpaqueDir = WhiteoutMetaPrefix + ".opq" diff --git a/vendor/github.com/fsouza/go-dockerclient/internal/term/term.go b/vendor/github.com/fsouza/go-dockerclient/internal/term/term.go deleted file mode 100644 index af06911d..00000000 --- a/vendor/github.com/fsouza/go-dockerclient/internal/term/term.go +++ /dev/null @@ -1,13 +0,0 @@ -// Copyright 2014 Docker authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the DOCKER-LICENSE file. - -package term - -// Winsize represents the size of the terminal window. -type Winsize struct { - Height uint16 - Width uint16 - x uint16 - y uint16 -} diff --git a/vendor/github.com/fsouza/go-dockerclient/internal/term/winsize.go b/vendor/github.com/fsouza/go-dockerclient/internal/term/winsize.go deleted file mode 100644 index 2a9964a0..00000000 --- a/vendor/github.com/fsouza/go-dockerclient/internal/term/winsize.go +++ /dev/null @@ -1,16 +0,0 @@ -// Copyright 2014 Docker authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the DOCKER-LICENSE file. - -// +build !windows - -package term - -import "golang.org/x/sys/unix" - -// GetWinsize returns the window size based on the specified file descriptor. -func GetWinsize(fd uintptr) (*Winsize, error) { - uws, err := unix.IoctlGetWinsize(int(fd), unix.TIOCGWINSZ) - ws := &Winsize{Height: uws.Row, Width: uws.Col, x: uws.Xpixel, y: uws.Ypixel} - return ws, err -} diff --git a/vendor/github.com/fsouza/go-dockerclient/internal/term/winsize_windows.go b/vendor/github.com/fsouza/go-dockerclient/internal/term/winsize_windows.go deleted file mode 100644 index 4a07a5d1..00000000 --- a/vendor/github.com/fsouza/go-dockerclient/internal/term/winsize_windows.go +++ /dev/null @@ -1,22 +0,0 @@ -// Copyright 2014 Docker authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the DOCKER-LICENSE file. - -package term - -import "github.com/Azure/go-ansiterm/winterm" - -// GetWinsize returns the window size based on the specified file descriptor. -func GetWinsize(fd uintptr) (*Winsize, error) { - info, err := winterm.GetConsoleScreenBufferInfo(fd) - if err != nil { - return nil, err - } - - winsize := &Winsize{ - Width: uint16(info.Window.Right - info.Window.Left + 1), - Height: uint16(info.Window.Bottom - info.Window.Top + 1), - } - - return winsize, nil -} diff --git a/vendor/github.com/fsouza/go-dockerclient/misc.go b/vendor/github.com/fsouza/go-dockerclient/misc.go index 1fc37b14..d42a66df 100644 --- a/vendor/github.com/fsouza/go-dockerclient/misc.go +++ b/vendor/github.com/fsouza/go-dockerclient/misc.go @@ -8,6 +8,7 @@ import ( "context" "encoding/json" "net" + "net/http" "strings" "github.com/docker/docker/api/types/swarm" @@ -17,12 +18,12 @@ import ( // // See https://goo.gl/mU7yje for more details. func (c *Client) Version() (*Env, error) { - return c.VersionWithContext(nil) + return c.VersionWithContext(context.TODO()) } // VersionWithContext returns version information about the docker server. func (c *Client) VersionWithContext(ctx context.Context) (*Env, error) { - resp, err := c.do("GET", "/version", doOptions{context: ctx}) + resp, err := c.do(http.MethodGet, "/version", doOptions{context: ctx}) if err != nil { return nil, err } @@ -37,6 +38,7 @@ func (c *Client) VersionWithContext(ctx context.Context) (*Env, error) { // DockerInfo contains information about the Docker server // // See https://goo.gl/bHUoz9 for more details. +//nolint:golint type DockerInfo struct { ID string Containers int @@ -48,19 +50,6 @@ type DockerInfo struct { DriverStatus [][2]string SystemStatus [][2]string Plugins PluginsInfo - MemoryLimit bool - SwapLimit bool - KernelMemory bool - CPUCfsPeriod bool `json:"CpuCfsPeriod"` - CPUCfsQuota bool `json:"CpuCfsQuota"` - CPUShares bool - CPUSet bool - IPv4Forwarding bool - BridgeNfIptables bool - BridgeNfIP6tables bool `json:"BridgeNfIp6tables"` - Debug bool - OomKillDisable bool - ExperimentalBuild bool NFd int NGoroutines int SystemTime string @@ -85,12 +74,34 @@ type DockerInfo struct { Labels []string ServerVersion string ClusterStore string + Runtimes map[string]Runtime ClusterAdvertise string Isolation string InitBinary string DefaultRuntime string - LiveRestoreEnabled bool Swarm swarm.Info + LiveRestoreEnabled bool + MemoryLimit bool + SwapLimit bool + KernelMemory bool + CPUCfsPeriod bool `json:"CpuCfsPeriod"` + CPUCfsQuota bool `json:"CpuCfsQuota"` + CPUShares bool + CPUSet bool + IPv4Forwarding bool + BridgeNfIptables bool + BridgeNfIP6tables bool `json:"BridgeNfIp6tables"` + Debug bool + OomKillDisable bool + ExperimentalBuild bool +} + +// Runtime describes an OCI runtime +// +// for more information, see: https://dockr.ly/2NKM8qq +type Runtime struct { + Path string + Args []string `json:"runtimeArgs"` } // PluginsInfo is a struct with the plugins registered with the docker daemon @@ -153,7 +164,7 @@ type IndexInfo struct { // // See https://goo.gl/ElTHi2 for more details. func (c *Client) Info() (*DockerInfo, error) { - resp, err := c.do("GET", "/info", doOptions{}) + resp, err := c.do(http.MethodGet, "/info", doOptions{}) if err != nil { return nil, err } diff --git a/vendor/github.com/fsouza/go-dockerclient/network.go b/vendor/github.com/fsouza/go-dockerclient/network.go index 8c03b9ae..3a06a52d 100644 --- a/vendor/github.com/fsouza/go-dockerclient/network.go +++ b/vendor/github.com/fsouza/go-dockerclient/network.go @@ -48,7 +48,7 @@ type Endpoint struct { // // See https://goo.gl/6GugX3 for more details. func (c *Client) ListNetworks() ([]Network, error) { - resp, err := c.do("GET", "/networks", doOptions{}) + resp, err := c.do(http.MethodGet, "/networks", doOptions{}) if err != nil { return nil, err } @@ -75,7 +75,7 @@ func (c *Client) FilteredListNetworks(opts NetworkFilterOpts) ([]Network, error) qs := make(url.Values) qs.Add("filters", string(params)) path := "/networks?" + qs.Encode() - resp, err := c.do("GET", path, doOptions{}) + resp, err := c.do(http.MethodGet, path, doOptions{}) if err != nil { return nil, err } @@ -92,7 +92,7 @@ func (c *Client) FilteredListNetworks(opts NetworkFilterOpts) ([]Network, error) // See https://goo.gl/6GugX3 for more details. func (c *Client) NetworkInfo(id string) (*Network, error) { path := "/networks/" + id - resp, err := c.do("GET", path, doOptions{}) + resp, err := c.do(http.MethodGet, path, doOptions{}) if err != nil { if e, ok := err.(*Error); ok && e.Status == http.StatusNotFound { return nil, &NoSuchNetwork{ID: id} @@ -114,15 +114,26 @@ func (c *Client) NetworkInfo(id string) (*Network, error) { type CreateNetworkOptions struct { Name string `json:"Name" yaml:"Name" toml:"Name"` Driver string `json:"Driver" yaml:"Driver" toml:"Driver"` + Scope string `json:"Scope" yaml:"Scope" toml:"Scope"` IPAM *IPAMOptions `json:"IPAM,omitempty" yaml:"IPAM" toml:"IPAM"` + ConfigFrom *NetworkConfigFrom `json:"ConfigFrom,omitempty" yaml:"ConfigFrom" toml:"ConfigFrom"` Options map[string]interface{} `json:"Options" yaml:"Options" toml:"Options"` Labels map[string]string `json:"Labels" yaml:"Labels" toml:"Labels"` CheckDuplicate bool `json:"CheckDuplicate" yaml:"CheckDuplicate" toml:"CheckDuplicate"` Internal bool `json:"Internal" yaml:"Internal" toml:"Internal"` EnableIPv6 bool `json:"EnableIPv6" yaml:"EnableIPv6" toml:"EnableIPv6"` + Attachable bool `json:"Attachable" yaml:"Attachable" toml:"Attachable"` + ConfigOnly bool `json:"ConfigOnly" yaml:"ConfigOnly" toml:"ConfigOnly"` + Ingress bool `json:"Ingress" yaml:"Ingress" toml:"Ingress"` Context context.Context `json:"-"` } +// NetworkConfigFrom is used in network creation for specifying the source of a +// network configuration. +type NetworkConfigFrom struct { + Network string `json:"Network" yaml:"Network" toml:"Network"` +} + // IPAMOptions controls IP Address Management when creating a network // // See https://goo.gl/T8kRVH for more details. @@ -148,7 +159,7 @@ type IPAMConfig struct { // See https://goo.gl/6GugX3 for more details. func (c *Client) CreateNetwork(opts CreateNetworkOptions) (*Network, error) { resp, err := c.do( - "POST", + http.MethodPost, "/networks/create", doOptions{ data: opts, @@ -182,7 +193,7 @@ func (c *Client) CreateNetwork(opts CreateNetworkOptions) (*Network, error) { // // See https://goo.gl/6GugX3 for more details. func (c *Client) RemoveNetwork(id string) error { - resp, err := c.do("DELETE", "/networks/"+id, doOptions{}) + resp, err := c.do(http.MethodDelete, "/networks/"+id, doOptions{}) if err != nil { if e, ok := err.(*Error); ok && e.Status == http.StatusNotFound { return &NoSuchNetwork{ID: id} @@ -225,6 +236,7 @@ type EndpointConfig struct { GlobalIPv6Address string `json:"GlobalIPv6Address,omitempty" yaml:"GlobalIPv6Address,omitempty" toml:"GlobalIPv6Address,omitempty"` GlobalIPv6PrefixLen int `json:"GlobalIPv6PrefixLen,omitempty" yaml:"GlobalIPv6PrefixLen,omitempty" toml:"GlobalIPv6PrefixLen,omitempty"` MacAddress string `json:"MacAddress,omitempty" yaml:"MacAddress,omitempty" toml:"MacAddress,omitempty"` + DriverOpts map[string]string `json:"DriverOpts,omitempty" yaml:"DriverOpts,omitempty" toml:"DriverOpts,omitempty"` } // EndpointIPAMConfig represents IPAM configurations for an @@ -241,7 +253,7 @@ type EndpointIPAMConfig struct { // // See https://goo.gl/6GugX3 for more details. func (c *Client) ConnectNetwork(id string, opts NetworkConnectionOptions) error { - resp, err := c.do("POST", "/networks/"+id+"/connect", doOptions{ + resp, err := c.do(http.MethodPost, "/networks/"+id+"/connect", doOptions{ data: opts, context: opts.Context, }) @@ -260,7 +272,7 @@ func (c *Client) ConnectNetwork(id string, opts NetworkConnectionOptions) error // // See https://goo.gl/6GugX3 for more details. func (c *Client) DisconnectNetwork(id string, opts NetworkConnectionOptions) error { - resp, err := c.do("POST", "/networks/"+id+"/disconnect", doOptions{data: opts}) + resp, err := c.do(http.MethodPost, "/networks/"+id+"/disconnect", doOptions{data: opts}) if err != nil { if e, ok := err.(*Error); ok && e.Status == http.StatusNotFound { return &NoSuchNetworkOrContainer{NetworkID: id, ContainerID: opts.Container} @@ -291,7 +303,7 @@ type PruneNetworksResults struct { // See https://goo.gl/kX0S9h for more details. func (c *Client) PruneNetworks(opts PruneNetworksOptions) (*PruneNetworksResults, error) { path := "/networks/prune?" + queryString(opts) - resp, err := c.do("POST", path, doOptions{context: opts.Context}) + resp, err := c.do(http.MethodPost, path, doOptions{context: opts.Context}) if err != nil { return nil, err } diff --git a/vendor/github.com/fsouza/go-dockerclient/plugin.go b/vendor/github.com/fsouza/go-dockerclient/plugin.go index 95701590..9cec4151 100644 --- a/vendor/github.com/fsouza/go-dockerclient/plugin.go +++ b/vendor/github.com/fsouza/go-dockerclient/plugin.go @@ -35,15 +35,26 @@ type InstallPluginOptions struct { // // See https://goo.gl/C4t7Tz for more details. func (c *Client) InstallPlugins(opts InstallPluginOptions) error { + headers, err := headersWithAuth(opts.Auth) + if err != nil { + return err + } + path := "/plugins/pull?" + queryString(opts) - resp, err := c.do("POST", path, doOptions{ + resp, err := c.do(http.MethodPost, path, doOptions{ data: opts.Plugins, context: opts.Context, + headers: headers, }) - defer resp.Body.Close() if err != nil { return err } + defer resp.Body.Close() + // PullPlugin streams back the progress of the pull, we must consume the whole body + // otherwise the pull will be canceled on the engine. + if _, err := ioutil.ReadAll(resp.Body); err != nil { + return err + } return nil } @@ -152,7 +163,7 @@ type PluginDetail struct { // // See https://goo.gl/C4t7Tz for more details. func (c *Client) ListPlugins(ctx context.Context) ([]PluginDetail, error) { - resp, err := c.do("GET", "/plugins", doOptions{ + resp, err := c.do(http.MethodGet, "/plugins", doOptions{ context: ctx, }) if err != nil { @@ -179,7 +190,7 @@ type ListFilteredPluginsOptions struct { // See https://goo.gl/rmdmWg for more details. func (c *Client) ListFilteredPlugins(opts ListFilteredPluginsOptions) ([]PluginDetail, error) { path := "/plugins/json?" + queryString(opts) - resp, err := c.do("GET", path, doOptions{ + resp, err := c.do(http.MethodGet, path, doOptions{ context: opts.Context, }) if err != nil { @@ -193,12 +204,41 @@ func (c *Client) ListFilteredPlugins(opts ListFilteredPluginsOptions) ([]PluginD return pluginDetails, nil } -// GetPluginPrivileges returns pulginPrivileges or an error. +// GetPluginPrivileges returns pluginPrivileges or an error. // // See https://goo.gl/C4t7Tz for more details. -func (c *Client) GetPluginPrivileges(name string, ctx context.Context) ([]PluginPrivilege, error) { - resp, err := c.do("GET", "/plugins/privileges?remote="+name, doOptions{ - context: ctx, +//nolint:golint +func (c *Client) GetPluginPrivileges(remote string, ctx context.Context) ([]PluginPrivilege, error) { + return c.GetPluginPrivilegesWithOptions( + GetPluginPrivilegesOptions{ + Remote: remote, + Context: ctx, + }) +} + +// GetPluginPrivilegesOptions specify parameters to the GetPluginPrivilegesWithOptions function. +// +// See https://goo.gl/C4t7Tz for more details. +type GetPluginPrivilegesOptions struct { + Remote string + Auth AuthConfiguration + Context context.Context +} + +// GetPluginPrivilegesWithOptions returns pluginPrivileges or an error. +// +// See https://goo.gl/C4t7Tz for more details. +//nolint:golint +func (c *Client) GetPluginPrivilegesWithOptions(opts GetPluginPrivilegesOptions) ([]PluginPrivilege, error) { + headers, err := headersWithAuth(opts.Auth) + if err != nil { + return nil, err + } + + path := "/plugins/privileges?" + queryString(opts) + resp, err := c.do(http.MethodGet, path, doOptions{ + context: opts.Context, + headers: headers, }) if err != nil { return nil, err @@ -214,21 +254,18 @@ func (c *Client) GetPluginPrivileges(name string, ctx context.Context) ([]Plugin // InspectPlugins returns a pluginDetail or an error. // // See https://goo.gl/C4t7Tz for more details. +//nolint:golint func (c *Client) InspectPlugins(name string, ctx context.Context) (*PluginDetail, error) { - resp, err := c.do("GET", "/plugins/"+name+"/json", doOptions{ + resp, err := c.do(http.MethodGet, "/plugins/"+name+"/json", doOptions{ context: ctx, }) - if err != nil { - return nil, err - } - defer resp.Body.Close() if err != nil { if e, ok := err.(*Error); ok && e.Status == http.StatusNotFound { return nil, &NoSuchPlugin{ID: name} } return nil, err } - resp.Body.Close() + defer resp.Body.Close() var pluginDetail PluginDetail if err := json.NewDecoder(resp.Body).Decode(&pluginDetail); err != nil { return nil, err @@ -252,20 +289,26 @@ type RemovePluginOptions struct { // See https://goo.gl/C4t7Tz for more details. func (c *Client) RemovePlugin(opts RemovePluginOptions) (*PluginDetail, error) { path := "/plugins/" + opts.Name + "?" + queryString(opts) - resp, err := c.do("DELETE", path, doOptions{context: opts.Context}) - if err != nil { - return nil, err - } - defer resp.Body.Close() + resp, err := c.do(http.MethodDelete, path, doOptions{context: opts.Context}) if err != nil { if e, ok := err.(*Error); ok && e.Status == http.StatusNotFound { return nil, &NoSuchPlugin{ID: opts.Name} } return nil, err } - resp.Body.Close() + defer resp.Body.Close() + body, err := ioutil.ReadAll(resp.Body) + if err != nil { + return nil, err + } + + if len(body) == 0 { + // Seems like newer docker versions won't return the plugindetail after removal + return nil, nil + } + var pluginDetail PluginDetail - if err := json.NewDecoder(resp.Body).Decode(&pluginDetail); err != nil { + if err := json.Unmarshal(body, &pluginDetail); err != nil { return nil, err } return &pluginDetail, nil @@ -287,8 +330,7 @@ type EnablePluginOptions struct { // See https://goo.gl/C4t7Tz for more details. func (c *Client) EnablePlugin(opts EnablePluginOptions) error { path := "/plugins/" + opts.Name + "/enable?" + queryString(opts) - resp, err := c.do("POST", path, doOptions{context: opts.Context}) - defer resp.Body.Close() + resp, err := c.do(http.MethodPost, path, doOptions{context: opts.Context}) if err != nil { return err } @@ -311,8 +353,7 @@ type DisablePluginOptions struct { // See https://goo.gl/C4t7Tz for more details. func (c *Client) DisablePlugin(opts DisablePluginOptions) error { path := "/plugins/" + opts.Name + "/disable" - resp, err := c.do("POST", path, doOptions{context: opts.Context}) - defer resp.Body.Close() + resp, err := c.do(http.MethodPost, path, doOptions{context: opts.Context}) if err != nil { return err } @@ -337,13 +378,14 @@ type CreatePluginOptions struct { // See https://goo.gl/C4t7Tz for more details. func (c *Client) CreatePlugin(opts CreatePluginOptions) (string, error) { path := "/plugins/create?" + queryString(opts) - resp, err := c.do("POST", path, doOptions{ + resp, err := c.do(http.MethodPost, path, doOptions{ data: opts.Path, - context: opts.Context}) - defer resp.Body.Close() + context: opts.Context, + }) if err != nil { return "", err } + defer resp.Body.Close() containerNameBytes, err := ioutil.ReadAll(resp.Body) if err != nil { return "", err @@ -366,11 +408,11 @@ type PushPluginOptions struct { // See https://goo.gl/C4t7Tz for more details. func (c *Client) PushPlugin(opts PushPluginOptions) error { path := "/plugins/" + opts.Name + "/push" - resp, err := c.do("POST", path, doOptions{context: opts.Context}) - defer resp.Body.Close() + resp, err := c.do(http.MethodPost, path, doOptions{context: opts.Context}) if err != nil { return err } + resp.Body.Close() return nil } @@ -390,17 +432,17 @@ type ConfigurePluginOptions struct { // See https://goo.gl/C4t7Tz for more details. func (c *Client) ConfigurePlugin(opts ConfigurePluginOptions) error { path := "/plugins/" + opts.Name + "/set" - resp, err := c.do("POST", path, doOptions{ + resp, err := c.do(http.MethodPost, path, doOptions{ data: opts.Envs, context: opts.Context, }) - defer resp.Body.Close() if err != nil { if e, ok := err.(*Error); ok && e.Status == http.StatusNotFound { return &NoSuchPlugin{ID: opts.Name} } return err } + resp.Body.Close() return nil } diff --git a/vendor/github.com/fsouza/go-dockerclient/swarm.go b/vendor/github.com/fsouza/go-dockerclient/swarm.go index a257758f..c1bbce76 100644 --- a/vendor/github.com/fsouza/go-dockerclient/swarm.go +++ b/vendor/github.com/fsouza/go-dockerclient/swarm.go @@ -36,7 +36,7 @@ type InitSwarmOptions struct { // See https://goo.gl/ZWyG1M for more details. func (c *Client) InitSwarm(opts InitSwarmOptions) (string, error) { path := "/swarm/init" - resp, err := c.do("POST", path, doOptions{ + resp, err := c.do(http.MethodPost, path, doOptions{ data: opts.InitRequest, forceJSON: true, context: opts.Context, @@ -66,7 +66,7 @@ type JoinSwarmOptions struct { // See https://goo.gl/N59IP1 for more details. func (c *Client) JoinSwarm(opts JoinSwarmOptions) error { path := "/swarm/join" - resp, err := c.do("POST", path, doOptions{ + resp, err := c.do(http.MethodPost, path, doOptions{ data: opts.JoinRequest, forceJSON: true, context: opts.Context, @@ -93,7 +93,7 @@ func (c *Client) LeaveSwarm(opts LeaveSwarmOptions) error { params := make(url.Values) params.Set("force", strconv.FormatBool(opts.Force)) path := "/swarm/leave?" + params.Encode() - resp, err := c.do("POST", path, doOptions{ + resp, err := c.do(http.MethodPost, path, doOptions{ context: opts.Context, }) if err != nil { @@ -123,7 +123,7 @@ func (c *Client) UpdateSwarm(opts UpdateSwarmOptions) error { params.Set("rotateWorkerToken", strconv.FormatBool(opts.RotateWorkerToken)) params.Set("rotateManagerToken", strconv.FormatBool(opts.RotateManagerToken)) path := "/swarm/update?" + params.Encode() - resp, err := c.do("POST", path, doOptions{ + resp, err := c.do(http.MethodPost, path, doOptions{ data: opts.Swarm, forceJSON: true, context: opts.Context, @@ -141,7 +141,7 @@ func (c *Client) UpdateSwarm(opts UpdateSwarmOptions) error { // See https://goo.gl/MFwgX9 for more details. func (c *Client) InspectSwarm(ctx context.Context) (swarm.Swarm, error) { response := swarm.Swarm{} - resp, err := c.do("GET", "/swarm", doOptions{ + resp, err := c.do(http.MethodGet, "/swarm", doOptions{ context: ctx, }) if err != nil { diff --git a/vendor/github.com/fsouza/go-dockerclient/swarm_configs.go b/vendor/github.com/fsouza/go-dockerclient/swarm_configs.go index fb73ab2e..399aa1dc 100644 --- a/vendor/github.com/fsouza/go-dockerclient/swarm_configs.go +++ b/vendor/github.com/fsouza/go-dockerclient/swarm_configs.go @@ -46,7 +46,7 @@ func (c *Client) CreateConfig(opts CreateConfigOptions) (*swarm.Config, error) { return nil, err } path := "/configs/create?" + queryString(opts) - resp, err := c.do("POST", path, doOptions{ + resp, err := c.do(http.MethodPost, path, doOptions{ headers: headers, data: opts.ConfigSpec, forceJSON: true, @@ -76,7 +76,7 @@ type RemoveConfigOptions struct { // See https://goo.gl/Tqrtya for more details. func (c *Client) RemoveConfig(opts RemoveConfigOptions) error { path := "/configs/" + opts.ID - resp, err := c.do("DELETE", path, doOptions{context: opts.Context}) + resp, err := c.do(http.MethodDelete, path, doOptions{context: opts.Context}) if err != nil { if e, ok := err.(*Error); ok && e.Status == http.StatusNotFound { return &NoSuchConfig{ID: opts.ID} @@ -109,7 +109,7 @@ func (c *Client) UpdateConfig(id string, opts UpdateConfigOptions) error { } params := make(url.Values) params.Set("version", strconv.FormatUint(opts.Version, 10)) - resp, err := c.do("POST", "/configs/"+id+"/update?"+params.Encode(), doOptions{ + resp, err := c.do(http.MethodPost, "/configs/"+id+"/update?"+params.Encode(), doOptions{ headers: headers, data: opts.ConfigSpec, forceJSON: true, @@ -130,7 +130,7 @@ func (c *Client) UpdateConfig(id string, opts UpdateConfigOptions) error { // See https://goo.gl/dHmr75 for more details. func (c *Client) InspectConfig(id string) (*swarm.Config, error) { path := "/configs/" + id - resp, err := c.do("GET", path, doOptions{}) + resp, err := c.do(http.MethodGet, path, doOptions{}) if err != nil { if e, ok := err.(*Error); ok && e.Status == http.StatusNotFound { return nil, &NoSuchConfig{ID: id} @@ -158,7 +158,7 @@ type ListConfigsOptions struct { // See https://goo.gl/DwvNMd for more details. func (c *Client) ListConfigs(opts ListConfigsOptions) ([]swarm.Config, error) { path := "/configs?" + queryString(opts) - resp, err := c.do("GET", path, doOptions{context: opts.Context}) + resp, err := c.do(http.MethodGet, path, doOptions{context: opts.Context}) if err != nil { return nil, err } diff --git a/vendor/github.com/fsouza/go-dockerclient/swarm_node.go b/vendor/github.com/fsouza/go-dockerclient/swarm_node.go index 095653cd..c149db28 100644 --- a/vendor/github.com/fsouza/go-dockerclient/swarm_node.go +++ b/vendor/github.com/fsouza/go-dockerclient/swarm_node.go @@ -40,7 +40,7 @@ type ListNodesOptions struct { // See http://goo.gl/3K4GwU for more details. func (c *Client) ListNodes(opts ListNodesOptions) ([]swarm.Node, error) { path := "/nodes?" + queryString(opts) - resp, err := c.do("GET", path, doOptions{context: opts.Context}) + resp, err := c.do(http.MethodGet, path, doOptions{context: opts.Context}) if err != nil { return nil, err } @@ -56,7 +56,7 @@ func (c *Client) ListNodes(opts ListNodesOptions) ([]swarm.Node, error) { // // See http://goo.gl/WjkTOk for more details. func (c *Client) InspectNode(id string) (*swarm.Node, error) { - resp, err := c.do("GET", "/nodes/"+id, doOptions{}) + resp, err := c.do(http.MethodGet, "/nodes/"+id, doOptions{}) if err != nil { if e, ok := err.(*Error); ok && e.Status == http.StatusNotFound { return nil, &NoSuchNode{ID: id} @@ -87,7 +87,7 @@ func (c *Client) UpdateNode(id string, opts UpdateNodeOptions) error { params := make(url.Values) params.Set("version", strconv.FormatUint(opts.Version, 10)) path := "/nodes/" + id + "/update?" + params.Encode() - resp, err := c.do("POST", path, doOptions{ + resp, err := c.do(http.MethodPost, path, doOptions{ context: opts.Context, forceJSON: true, data: opts.NodeSpec, @@ -118,7 +118,7 @@ func (c *Client) RemoveNode(opts RemoveNodeOptions) error { params := make(url.Values) params.Set("force", strconv.FormatBool(opts.Force)) path := "/nodes/" + opts.ID + "?" + params.Encode() - resp, err := c.do("DELETE", path, doOptions{context: opts.Context}) + resp, err := c.do(http.MethodDelete, path, doOptions{context: opts.Context}) if err != nil { if e, ok := err.(*Error); ok && e.Status == http.StatusNotFound { return &NoSuchNode{ID: opts.ID} diff --git a/vendor/github.com/fsouza/go-dockerclient/swarm_secrets.go b/vendor/github.com/fsouza/go-dockerclient/swarm_secrets.go index 5a3b82ca..058c4a4a 100644 --- a/vendor/github.com/fsouza/go-dockerclient/swarm_secrets.go +++ b/vendor/github.com/fsouza/go-dockerclient/swarm_secrets.go @@ -46,7 +46,7 @@ func (c *Client) CreateSecret(opts CreateSecretOptions) (*swarm.Secret, error) { return nil, err } path := "/secrets/create?" + queryString(opts) - resp, err := c.do("POST", path, doOptions{ + resp, err := c.do(http.MethodPost, path, doOptions{ headers: headers, data: opts.SecretSpec, forceJSON: true, @@ -76,7 +76,7 @@ type RemoveSecretOptions struct { // See https://goo.gl/Tqrtya for more details. func (c *Client) RemoveSecret(opts RemoveSecretOptions) error { path := "/secrets/" + opts.ID - resp, err := c.do("DELETE", path, doOptions{context: opts.Context}) + resp, err := c.do(http.MethodDelete, path, doOptions{context: opts.Context}) if err != nil { if e, ok := err.(*Error); ok && e.Status == http.StatusNotFound { return &NoSuchSecret{ID: opts.ID} @@ -109,7 +109,7 @@ func (c *Client) UpdateSecret(id string, opts UpdateSecretOptions) error { } params := make(url.Values) params.Set("version", strconv.FormatUint(opts.Version, 10)) - resp, err := c.do("POST", "/secrets/"+id+"/update?"+params.Encode(), doOptions{ + resp, err := c.do(http.MethodPost, "/secrets/"+id+"/update?"+params.Encode(), doOptions{ headers: headers, data: opts.SecretSpec, forceJSON: true, @@ -130,7 +130,7 @@ func (c *Client) UpdateSecret(id string, opts UpdateSecretOptions) error { // See https://goo.gl/dHmr75 for more details. func (c *Client) InspectSecret(id string) (*swarm.Secret, error) { path := "/secrets/" + id - resp, err := c.do("GET", path, doOptions{}) + resp, err := c.do(http.MethodGet, path, doOptions{}) if err != nil { if e, ok := err.(*Error); ok && e.Status == http.StatusNotFound { return nil, &NoSuchSecret{ID: id} @@ -158,7 +158,7 @@ type ListSecretsOptions struct { // See https://goo.gl/DwvNMd for more details. func (c *Client) ListSecrets(opts ListSecretsOptions) ([]swarm.Secret, error) { path := "/secrets?" + queryString(opts) - resp, err := c.do("GET", path, doOptions{context: opts.Context}) + resp, err := c.do(http.MethodGet, path, doOptions{context: opts.Context}) if err != nil { return nil, err } diff --git a/vendor/github.com/fsouza/go-dockerclient/swarm_service.go b/vendor/github.com/fsouza/go-dockerclient/swarm_service.go index ca7e2372..4accb2cb 100644 --- a/vendor/github.com/fsouza/go-dockerclient/swarm_service.go +++ b/vendor/github.com/fsouza/go-dockerclient/swarm_service.go @@ -46,7 +46,7 @@ func (c *Client) CreateService(opts CreateServiceOptions) (*swarm.Service, error return nil, err } path := "/services/create?" + queryString(opts) - resp, err := c.do("POST", path, doOptions{ + resp, err := c.do(http.MethodPost, path, doOptions{ headers: headers, data: opts.ServiceSpec, forceJSON: true, @@ -76,7 +76,7 @@ type RemoveServiceOptions struct { // See https://goo.gl/Tqrtya for more details. func (c *Client) RemoveService(opts RemoveServiceOptions) error { path := "/services/" + opts.ID - resp, err := c.do("DELETE", path, doOptions{context: opts.Context}) + resp, err := c.do(http.MethodDelete, path, doOptions{context: opts.Context}) if err != nil { if e, ok := err.(*Error); ok && e.Status == http.StatusNotFound { return &NoSuchService{ID: opts.ID} @@ -106,7 +106,7 @@ func (c *Client) UpdateService(id string, opts UpdateServiceOptions) error { if err != nil { return err } - resp, err := c.do("POST", "/services/"+id+"/update?"+queryString(opts), doOptions{ + resp, err := c.do(http.MethodPost, "/services/"+id+"/update?"+queryString(opts), doOptions{ headers: headers, data: opts.ServiceSpec, forceJSON: true, @@ -127,7 +127,7 @@ func (c *Client) UpdateService(id string, opts UpdateServiceOptions) error { // See https://goo.gl/dHmr75 for more details. func (c *Client) InspectService(id string) (*swarm.Service, error) { path := "/services/" + id - resp, err := c.do("GET", path, doOptions{}) + resp, err := c.do(http.MethodGet, path, doOptions{}) if err != nil { if e, ok := err.(*Error); ok && e.Status == http.StatusNotFound { return nil, &NoSuchService{ID: id} @@ -147,6 +147,7 @@ func (c *Client) InspectService(id string) (*swarm.Service, error) { // See https://goo.gl/DwvNMd for more details. type ListServicesOptions struct { Filters map[string][]string + Status bool Context context.Context } @@ -155,7 +156,7 @@ type ListServicesOptions struct { // See https://goo.gl/DwvNMd for more details. func (c *Client) ListServices(opts ListServicesOptions) ([]swarm.Service, error) { path := "/services?" + queryString(opts) - resp, err := c.do("GET", path, doOptions{context: opts.Context}) + resp, err := c.do(http.MethodGet, path, doOptions{context: opts.Context}) if err != nil { return nil, err } @@ -176,10 +177,10 @@ type LogsServiceOptions struct { ErrorStream io.Writer `qs:"-"` InactivityTimeout time.Duration `qs:"-"` Tail string + Since int64 // Use raw terminal? Usually true when the container contains a TTY. RawTerminal bool `qs:"-"` - Since int64 Follow bool Stdout bool Stderr bool @@ -203,7 +204,7 @@ func (c *Client) GetServiceLogs(opts LogsServiceOptions) error { opts.Tail = "all" } path := "/services/" + opts.Service + "/logs?" + queryString(opts) - return c.stream("GET", path, streamOptions{ + return c.stream(http.MethodGet, path, streamOptions{ setRawTerminal: opts.RawTerminal, stdout: opts.OutputStream, stderr: opts.ErrorStream, diff --git a/vendor/github.com/fsouza/go-dockerclient/swarm_task.go b/vendor/github.com/fsouza/go-dockerclient/swarm_task.go index 3b1161ab..547642f5 100644 --- a/vendor/github.com/fsouza/go-dockerclient/swarm_task.go +++ b/vendor/github.com/fsouza/go-dockerclient/swarm_task.go @@ -38,7 +38,7 @@ type ListTasksOptions struct { // See http://goo.gl/rByLzw for more details. func (c *Client) ListTasks(opts ListTasksOptions) ([]swarm.Task, error) { path := "/tasks?" + queryString(opts) - resp, err := c.do("GET", path, doOptions{context: opts.Context}) + resp, err := c.do(http.MethodGet, path, doOptions{context: opts.Context}) if err != nil { return nil, err } @@ -54,7 +54,7 @@ func (c *Client) ListTasks(opts ListTasksOptions) ([]swarm.Task, error) { // // See http://goo.gl/kyziuq for more details. func (c *Client) InspectTask(id string) (*swarm.Task, error) { - resp, err := c.do("GET", "/tasks/"+id, doOptions{}) + resp, err := c.do(http.MethodGet, "/tasks/"+id, doOptions{}) if err != nil { if e, ok := err.(*Error); ok && e.Status == http.StatusNotFound { return nil, &NoSuchTask{ID: id} diff --git a/vendor/github.com/fsouza/go-dockerclient/system.go b/vendor/github.com/fsouza/go-dockerclient/system.go index a43dfb5a..46b9faf0 100644 --- a/vendor/github.com/fsouza/go-dockerclient/system.go +++ b/vendor/github.com/fsouza/go-dockerclient/system.go @@ -3,6 +3,7 @@ package docker import ( "context" "encoding/json" + "net/http" ) // VolumeUsageData represents usage data from the docker system api @@ -59,7 +60,7 @@ type DiskUsageOptions struct { // More Info Here https://dockr.ly/2PNzQyO func (c *Client) DiskUsage(opts DiskUsageOptions) (*DiskUsage, error) { path := "/system/df" - resp, err := c.do("GET", path, doOptions{context: opts.Context}) + resp, err := c.do(http.MethodGet, path, doOptions{context: opts.Context}) if err != nil { return nil, err } diff --git a/vendor/github.com/fsouza/go-dockerclient/tar.go b/vendor/github.com/fsouza/go-dockerclient/tar.go index 611da8c9..f27a7bbf 100644 --- a/vendor/github.com/fsouza/go-dockerclient/tar.go +++ b/vendor/github.com/fsouza/go-dockerclient/tar.go @@ -13,8 +13,8 @@ import ( "path/filepath" "strings" + "github.com/docker/docker/pkg/archive" "github.com/docker/docker/pkg/fileutils" - "github.com/fsouza/go-dockerclient/internal/archive" ) func createTarStream(srcPath, dockerfilePath string) (io.ReadCloser, error) { @@ -47,7 +47,7 @@ func createTarStream(srcPath, dockerfilePath string) (io.ReadCloser, error) { } keepThem, err := fileutils.Matches(includeFile, excludes) if err != nil { - return nil, fmt.Errorf("cannot match .dockerfile: '%s', error: %s", includeFile, err) + return nil, fmt.Errorf("cannot match .dockerfileignore: '%s', error: %w", includeFile, err) } if keepThem { includes = append(includes, includeFile) @@ -85,7 +85,7 @@ func validateContextDirectory(srcPath string, excludes []string) error { if err != nil { if os.IsPermission(err) { - return fmt.Errorf("can't stat '%s'", filePath) + return fmt.Errorf("cannot stat %q: %w", filePath, err) } if os.IsNotExist(err) { return nil @@ -101,8 +101,8 @@ func validateContextDirectory(srcPath string, excludes []string) error { if !f.IsDir() { currentFile, err := os.Open(filePath) - if err != nil && os.IsPermission(err) { - return fmt.Errorf("no permission to read from '%s'", filePath) + if err != nil { + return fmt.Errorf("cannot open %q for reading: %w", filePath, err) } currentFile.Close() } @@ -114,7 +114,7 @@ func parseDockerignore(root string) ([]string, error) { var excludes []string ignore, err := ioutil.ReadFile(path.Join(root, ".dockerignore")) if err != nil && !os.IsNotExist(err) { - return excludes, fmt.Errorf("error reading .dockerignore: '%s'", err) + return excludes, fmt.Errorf("error reading .dockerignore: %w", err) } excludes = strings.Split(string(ignore), "\n") diff --git a/vendor/github.com/fsouza/go-dockerclient/tls.go b/vendor/github.com/fsouza/go-dockerclient/tls.go index 5f0e2e31..8a76f0db 100644 --- a/vendor/github.com/fsouza/go-dockerclient/tls.go +++ b/vendor/github.com/fsouza/go-dockerclient/tls.go @@ -38,7 +38,7 @@ func tlsDialWithDialer(dialer *net.Dialer, network, addr string, config *tls.Con timeout := dialer.Timeout if !dialer.Deadline.IsZero() { - deadlineTimeout := dialer.Deadline.Sub(time.Now()) + deadlineTimeout := time.Until(dialer.Deadline) if timeout == 0 || deadlineTimeout < timeout { timeout = deadlineTimeout } @@ -103,10 +103,9 @@ func copyTLSConfig(cfg *tls.Config) *tls.Config { ClientCAs: cfg.ClientCAs, ClientSessionCache: cfg.ClientSessionCache, CurvePreferences: cfg.CurvePreferences, - InsecureSkipVerify: cfg.InsecureSkipVerify, + InsecureSkipVerify: cfg.InsecureSkipVerify, //nolint:gosec MaxVersion: cfg.MaxVersion, MinVersion: cfg.MinVersion, - NameToCertificate: cfg.NameToCertificate, NextProtos: cfg.NextProtos, PreferServerCipherSuites: cfg.PreferServerCipherSuites, Rand: cfg.Rand, diff --git a/vendor/github.com/fsouza/go-dockerclient/volume.go b/vendor/github.com/fsouza/go-dockerclient/volume.go index c8f50469..c39a273b 100644 --- a/vendor/github.com/fsouza/go-dockerclient/volume.go +++ b/vendor/github.com/fsouza/go-dockerclient/volume.go @@ -44,7 +44,7 @@ type ListVolumesOptions struct { // // See https://goo.gl/3wgTsd for more details. func (c *Client) ListVolumes(opts ListVolumesOptions) ([]Volume, error) { - resp, err := c.do("GET", "/volumes?"+queryString(opts), doOptions{ + resp, err := c.do(http.MethodGet, "/volumes?"+queryString(opts), doOptions{ context: opts.Context, }) if err != nil { @@ -85,7 +85,7 @@ type CreateVolumeOptions struct { // // See https://goo.gl/qEhmEC for more details. func (c *Client) CreateVolume(opts CreateVolumeOptions) (*Volume, error) { - resp, err := c.do("POST", "/volumes/create", doOptions{ + resp, err := c.do(http.MethodPost, "/volumes/create", doOptions{ data: opts, context: opts.Context, }) @@ -104,7 +104,7 @@ func (c *Client) CreateVolume(opts CreateVolumeOptions) (*Volume, error) { // // See https://goo.gl/GMjsMc for more details. func (c *Client) InspectVolume(name string) (*Volume, error) { - resp, err := c.do("GET", "/volumes/"+name, doOptions{}) + resp, err := c.do(http.MethodGet, "/volumes/"+name, doOptions{}) if err != nil { if e, ok := err.(*Error); ok && e.Status == http.StatusNotFound { return nil, ErrNoSuchVolume @@ -142,7 +142,7 @@ type RemoveVolumeOptions struct { // See https://goo.gl/nvd6qj for more details. func (c *Client) RemoveVolumeWithOptions(opts RemoveVolumeOptions) error { path := "/volumes/" + opts.Name - resp, err := c.do("DELETE", path+"?"+queryString(opts), doOptions{context: opts.Context}) + resp, err := c.do(http.MethodDelete, path+"?"+queryString(opts), doOptions{context: opts.Context}) if err != nil { if e, ok := err.(*Error); ok { if e.Status == http.StatusNotFound { @@ -179,7 +179,7 @@ type PruneVolumesResults struct { // See https://goo.gl/f9XDem for more details. func (c *Client) PruneVolumes(opts PruneVolumesOptions) (*PruneVolumesResults, error) { path := "/volumes/prune?" + queryString(opts) - resp, err := c.do("POST", path, doOptions{context: opts.Context}) + resp, err := c.do(http.MethodPost, path, doOptions{context: opts.Context}) if err != nil { return nil, err } diff --git a/vendor/github.com/gogo/protobuf/gogoproto/Makefile b/vendor/github.com/gogo/protobuf/gogoproto/Makefile new file mode 100644 index 00000000..0b4659b7 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/gogoproto/Makefile @@ -0,0 +1,37 @@ +# Protocol Buffers for Go with Gadgets +# +# Copyright (c) 2013, The GoGo Authors. All rights reserved. +# http://github.com/gogo/protobuf +# +# Redistribution and use in source and binary forms, with or without +# modification, are permitted provided that the following conditions are +# met: +# +# * Redistributions of source code must retain the above copyright +# notice, this list of conditions and the following disclaimer. +# * Redistributions in binary form must reproduce the above +# copyright notice, this list of conditions and the following disclaimer +# in the documentation and/or other materials provided with the +# distribution. +# +# THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +# "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +# LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +# A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +# OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +# SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +# LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +# DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +# THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +# (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +# OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +regenerate: + go install github.com/gogo/protobuf/protoc-gen-gogo + protoc --gogo_out=Mgoogle/protobuf/descriptor.proto=github.com/gogo/protobuf/protoc-gen-gogo/descriptor:../../../../ --proto_path=../../../../:../protobuf/:. *.proto + +restore: + cp gogo.pb.golden gogo.pb.go + +preserve: + cp gogo.pb.go gogo.pb.golden diff --git a/vendor/github.com/gogo/protobuf/gogoproto/doc.go b/vendor/github.com/gogo/protobuf/gogoproto/doc.go new file mode 100644 index 00000000..081c86fa --- /dev/null +++ b/vendor/github.com/gogo/protobuf/gogoproto/doc.go @@ -0,0 +1,169 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2013, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +/* +Package gogoproto provides extensions for protocol buffers to achieve: + + - fast marshalling and unmarshalling. + - peace of mind by optionally generating test and benchmark code. + - more canonical Go structures. + - less typing by optionally generating extra helper code. + - goprotobuf compatibility + +More Canonical Go Structures + +A lot of time working with a goprotobuf struct will lead you to a place where you create another struct that is easier to work with and then have a function to copy the values between the two structs. +You might also find that basic structs that started their life as part of an API need to be sent over the wire. With gob, you could just send it. With goprotobuf, you need to make a parallel struct. +Gogoprotobuf tries to fix these problems with the nullable, embed, customtype and customname field extensions. + + - nullable, if false, a field is generated without a pointer (see warning below). + - embed, if true, the field is generated as an embedded field. + - customtype, It works with the Marshal and Unmarshal methods, to allow you to have your own types in your struct, but marshal to bytes. For example, custom.Uuid or custom.Fixed128 + - customname (beta), Changes the generated fieldname. This is especially useful when generated methods conflict with fieldnames. + - casttype (beta), Changes the generated fieldtype. All generated code assumes that this type is castable to the protocol buffer field type. It does not work for structs or enums. + - castkey (beta), Changes the generated fieldtype for a map key. All generated code assumes that this type is castable to the protocol buffer field type. Only supported on maps. + - castvalue (beta), Changes the generated fieldtype for a map value. All generated code assumes that this type is castable to the protocol buffer field type. Only supported on maps. + +Warning about nullable: According to the Protocol Buffer specification, you should be able to tell whether a field is set or unset. With the option nullable=false this feature is lost, since your non-nullable fields will always be set. It can be seen as a layer on top of Protocol Buffers, where before and after marshalling all non-nullable fields are set and they cannot be unset. + +Let us look at: + + github.com/gogo/protobuf/test/example/example.proto + +for a quicker overview. + +The following message: + + package test; + + import "github.com/gogo/protobuf/gogoproto/gogo.proto"; + + message A { + optional string Description = 1 [(gogoproto.nullable) = false]; + optional int64 Number = 2 [(gogoproto.nullable) = false]; + optional bytes Id = 3 [(gogoproto.customtype) = "github.com/gogo/protobuf/test/custom.Uuid", (gogoproto.nullable) = false]; + } + +Will generate a go struct which looks a lot like this: + + type A struct { + Description string + Number int64 + Id github_com_gogo_protobuf_test_custom.Uuid + } + +You will see there are no pointers, since all fields are non-nullable. +You will also see a custom type which marshals to a string. +Be warned it is your responsibility to test your custom types thoroughly. +You should think of every possible empty and nil case for your marshaling, unmarshaling and size methods. + +Next we will embed the message A in message B. + + message B { + optional A A = 1 [(gogoproto.nullable) = false, (gogoproto.embed) = true]; + repeated bytes G = 2 [(gogoproto.customtype) = "github.com/gogo/protobuf/test/custom.Uint128", (gogoproto.nullable) = false]; + } + +See below that A is embedded in B. + + type B struct { + A + G []github_com_gogo_protobuf_test_custom.Uint128 + } + +Also see the repeated custom type. + + type Uint128 [2]uint64 + +Next we will create a custom name for one of our fields. + + message C { + optional int64 size = 1 [(gogoproto.customname) = "MySize"]; + } + +See below that the field's name is MySize and not Size. + + type C struct { + MySize *int64 + } + +The is useful when having a protocol buffer message with a field name which conflicts with a generated method. +As an example, having a field name size and using the sizer plugin to generate a Size method will cause a go compiler error. +Using customname you can fix this error without changing the field name. +This is typically useful when working with a protocol buffer that was designed before these methods and/or the go language were avialable. + +Gogoprotobuf also has some more subtle changes, these could be changed back: + + - the generated package name for imports do not have the extra /filename.pb, + but are actually the imports specified in the .proto file. + +Gogoprotobuf also has lost some features which should be brought back with time: + + - Marshalling and unmarshalling with reflect and without the unsafe package, + this requires work in pointer_reflect.go + +Why does nullable break protocol buffer specifications: + +The protocol buffer specification states, somewhere, that you should be able to tell whether a +field is set or unset. With the option nullable=false this feature is lost, +since your non-nullable fields will always be set. It can be seen as a layer on top of +protocol buffers, where before and after marshalling all non-nullable fields are set +and they cannot be unset. + +Goprotobuf Compatibility: + +Gogoprotobuf is compatible with Goprotobuf, because it is compatible with protocol buffers. +Gogoprotobuf generates the same code as goprotobuf if no extensions are used. +The enumprefix, getters and stringer extensions can be used to remove some of the unnecessary code generated by goprotobuf: + + - gogoproto_import, if false, the generated code imports github.com/golang/protobuf/proto instead of github.com/gogo/protobuf/proto. + - goproto_enum_prefix, if false, generates the enum constant names without the messagetype prefix + - goproto_enum_stringer (experimental), if false, the enum is generated without the default string method, this is useful for rather using enum_stringer, or allowing you to write your own string method. + - goproto_getters, if false, the message is generated without get methods, this is useful when you would rather want to use face + - goproto_stringer, if false, the message is generated without the default string method, this is useful for rather using stringer, or allowing you to write your own string method. + - goproto_extensions_map (beta), if false, the extensions field is generated as type []byte instead of type map[int32]proto.Extension + - goproto_unrecognized (beta), if false, XXX_unrecognized field is not generated. This is useful in conjunction with gogoproto.nullable=false, to generate structures completely devoid of pointers and reduce GC pressure at the cost of losing information about unrecognized fields. + - goproto_registration (beta), if true, the generated files will register all messages and types against both gogo/protobuf and golang/protobuf. This is necessary when using third-party packages which read registrations from golang/protobuf (such as the grpc-gateway). + +Less Typing and Peace of Mind is explained in their specific plugin folders godoc: + + - github.com/gogo/protobuf/plugin/ + +If you do not use any of these extension the code that is generated +will be the same as if goprotobuf has generated it. + +The most complete way to see examples is to look at + + github.com/gogo/protobuf/test/thetest.proto + +Gogoprototest is a seperate project, +because we want to keep gogoprotobuf independent of goprotobuf, +but we still want to test it thoroughly. + +*/ +package gogoproto diff --git a/vendor/github.com/gogo/protobuf/gogoproto/gogo.pb.go b/vendor/github.com/gogo/protobuf/gogoproto/gogo.pb.go new file mode 100644 index 00000000..1e91766a --- /dev/null +++ b/vendor/github.com/gogo/protobuf/gogoproto/gogo.pb.go @@ -0,0 +1,874 @@ +// Code generated by protoc-gen-gogo. DO NOT EDIT. +// source: gogo.proto + +package gogoproto + +import ( + fmt "fmt" + proto "github.com/gogo/protobuf/proto" + descriptor "github.com/gogo/protobuf/protoc-gen-gogo/descriptor" + math "math" +) + +// Reference imports to suppress errors if they are not otherwise used. +var _ = proto.Marshal +var _ = fmt.Errorf +var _ = math.Inf + +// This is a compile-time assertion to ensure that this generated file +// is compatible with the proto package it is being compiled against. +// A compilation error at this line likely means your copy of the +// proto package needs to be updated. +const _ = proto.GoGoProtoPackageIsVersion3 // please upgrade the proto package + +var E_GoprotoEnumPrefix = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.EnumOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 62001, + Name: "gogoproto.goproto_enum_prefix", + Tag: "varint,62001,opt,name=goproto_enum_prefix", + Filename: "gogo.proto", +} + +var E_GoprotoEnumStringer = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.EnumOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 62021, + Name: "gogoproto.goproto_enum_stringer", + Tag: "varint,62021,opt,name=goproto_enum_stringer", + Filename: "gogo.proto", +} + +var E_EnumStringer = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.EnumOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 62022, + Name: "gogoproto.enum_stringer", + Tag: "varint,62022,opt,name=enum_stringer", + Filename: "gogo.proto", +} + +var E_EnumCustomname = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.EnumOptions)(nil), + ExtensionType: (*string)(nil), + Field: 62023, + Name: "gogoproto.enum_customname", + Tag: "bytes,62023,opt,name=enum_customname", + Filename: "gogo.proto", +} + +var E_Enumdecl = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.EnumOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 62024, + Name: "gogoproto.enumdecl", + Tag: "varint,62024,opt,name=enumdecl", + Filename: "gogo.proto", +} + +var E_EnumvalueCustomname = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.EnumValueOptions)(nil), + ExtensionType: (*string)(nil), + Field: 66001, + Name: "gogoproto.enumvalue_customname", + Tag: "bytes,66001,opt,name=enumvalue_customname", + Filename: "gogo.proto", +} + +var E_GoprotoGettersAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63001, + Name: "gogoproto.goproto_getters_all", + Tag: "varint,63001,opt,name=goproto_getters_all", + Filename: "gogo.proto", +} + +var E_GoprotoEnumPrefixAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63002, + Name: "gogoproto.goproto_enum_prefix_all", + Tag: "varint,63002,opt,name=goproto_enum_prefix_all", + Filename: "gogo.proto", +} + +var E_GoprotoStringerAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63003, + Name: "gogoproto.goproto_stringer_all", + Tag: "varint,63003,opt,name=goproto_stringer_all", + Filename: "gogo.proto", +} + +var E_VerboseEqualAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63004, + Name: "gogoproto.verbose_equal_all", + Tag: "varint,63004,opt,name=verbose_equal_all", + Filename: "gogo.proto", +} + +var E_FaceAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63005, + Name: "gogoproto.face_all", + Tag: "varint,63005,opt,name=face_all", + Filename: "gogo.proto", +} + +var E_GostringAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63006, + Name: "gogoproto.gostring_all", + Tag: "varint,63006,opt,name=gostring_all", + Filename: "gogo.proto", +} + +var E_PopulateAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63007, + Name: "gogoproto.populate_all", + Tag: "varint,63007,opt,name=populate_all", + Filename: "gogo.proto", +} + +var E_StringerAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63008, + Name: "gogoproto.stringer_all", + Tag: "varint,63008,opt,name=stringer_all", + Filename: "gogo.proto", +} + +var E_OnlyoneAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63009, + Name: "gogoproto.onlyone_all", + Tag: "varint,63009,opt,name=onlyone_all", + Filename: "gogo.proto", +} + +var E_EqualAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63013, + Name: "gogoproto.equal_all", + Tag: "varint,63013,opt,name=equal_all", + Filename: "gogo.proto", +} + +var E_DescriptionAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63014, + Name: "gogoproto.description_all", + Tag: "varint,63014,opt,name=description_all", + Filename: "gogo.proto", +} + +var E_TestgenAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63015, + Name: "gogoproto.testgen_all", + Tag: "varint,63015,opt,name=testgen_all", + Filename: "gogo.proto", +} + +var E_BenchgenAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63016, + Name: "gogoproto.benchgen_all", + Tag: "varint,63016,opt,name=benchgen_all", + Filename: "gogo.proto", +} + +var E_MarshalerAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63017, + Name: "gogoproto.marshaler_all", + Tag: "varint,63017,opt,name=marshaler_all", + Filename: "gogo.proto", +} + +var E_UnmarshalerAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63018, + Name: "gogoproto.unmarshaler_all", + Tag: "varint,63018,opt,name=unmarshaler_all", + Filename: "gogo.proto", +} + +var E_StableMarshalerAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63019, + Name: "gogoproto.stable_marshaler_all", + Tag: "varint,63019,opt,name=stable_marshaler_all", + Filename: "gogo.proto", +} + +var E_SizerAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63020, + Name: "gogoproto.sizer_all", + Tag: "varint,63020,opt,name=sizer_all", + Filename: "gogo.proto", +} + +var E_GoprotoEnumStringerAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63021, + Name: "gogoproto.goproto_enum_stringer_all", + Tag: "varint,63021,opt,name=goproto_enum_stringer_all", + Filename: "gogo.proto", +} + +var E_EnumStringerAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63022, + Name: "gogoproto.enum_stringer_all", + Tag: "varint,63022,opt,name=enum_stringer_all", + Filename: "gogo.proto", +} + +var E_UnsafeMarshalerAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63023, + Name: "gogoproto.unsafe_marshaler_all", + Tag: "varint,63023,opt,name=unsafe_marshaler_all", + Filename: "gogo.proto", +} + +var E_UnsafeUnmarshalerAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63024, + Name: "gogoproto.unsafe_unmarshaler_all", + Tag: "varint,63024,opt,name=unsafe_unmarshaler_all", + Filename: "gogo.proto", +} + +var E_GoprotoExtensionsMapAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63025, + Name: "gogoproto.goproto_extensions_map_all", + Tag: "varint,63025,opt,name=goproto_extensions_map_all", + Filename: "gogo.proto", +} + +var E_GoprotoUnrecognizedAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63026, + Name: "gogoproto.goproto_unrecognized_all", + Tag: "varint,63026,opt,name=goproto_unrecognized_all", + Filename: "gogo.proto", +} + +var E_GogoprotoImport = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63027, + Name: "gogoproto.gogoproto_import", + Tag: "varint,63027,opt,name=gogoproto_import", + Filename: "gogo.proto", +} + +var E_ProtosizerAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63028, + Name: "gogoproto.protosizer_all", + Tag: "varint,63028,opt,name=protosizer_all", + Filename: "gogo.proto", +} + +var E_CompareAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63029, + Name: "gogoproto.compare_all", + Tag: "varint,63029,opt,name=compare_all", + Filename: "gogo.proto", +} + +var E_TypedeclAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63030, + Name: "gogoproto.typedecl_all", + Tag: "varint,63030,opt,name=typedecl_all", + Filename: "gogo.proto", +} + +var E_EnumdeclAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63031, + Name: "gogoproto.enumdecl_all", + Tag: "varint,63031,opt,name=enumdecl_all", + Filename: "gogo.proto", +} + +var E_GoprotoRegistration = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63032, + Name: "gogoproto.goproto_registration", + Tag: "varint,63032,opt,name=goproto_registration", + Filename: "gogo.proto", +} + +var E_MessagenameAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63033, + Name: "gogoproto.messagename_all", + Tag: "varint,63033,opt,name=messagename_all", + Filename: "gogo.proto", +} + +var E_GoprotoSizecacheAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63034, + Name: "gogoproto.goproto_sizecache_all", + Tag: "varint,63034,opt,name=goproto_sizecache_all", + Filename: "gogo.proto", +} + +var E_GoprotoUnkeyedAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63035, + Name: "gogoproto.goproto_unkeyed_all", + Tag: "varint,63035,opt,name=goproto_unkeyed_all", + Filename: "gogo.proto", +} + +var E_GoprotoGetters = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64001, + Name: "gogoproto.goproto_getters", + Tag: "varint,64001,opt,name=goproto_getters", + Filename: "gogo.proto", +} + +var E_GoprotoStringer = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64003, + Name: "gogoproto.goproto_stringer", + Tag: "varint,64003,opt,name=goproto_stringer", + Filename: "gogo.proto", +} + +var E_VerboseEqual = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64004, + Name: "gogoproto.verbose_equal", + Tag: "varint,64004,opt,name=verbose_equal", + Filename: "gogo.proto", +} + +var E_Face = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64005, + Name: "gogoproto.face", + Tag: "varint,64005,opt,name=face", + Filename: "gogo.proto", +} + +var E_Gostring = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64006, + Name: "gogoproto.gostring", + Tag: "varint,64006,opt,name=gostring", + Filename: "gogo.proto", +} + +var E_Populate = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64007, + Name: "gogoproto.populate", + Tag: "varint,64007,opt,name=populate", + Filename: "gogo.proto", +} + +var E_Stringer = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 67008, + Name: "gogoproto.stringer", + Tag: "varint,67008,opt,name=stringer", + Filename: "gogo.proto", +} + +var E_Onlyone = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64009, + Name: "gogoproto.onlyone", + Tag: "varint,64009,opt,name=onlyone", + Filename: "gogo.proto", +} + +var E_Equal = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64013, + Name: "gogoproto.equal", + Tag: "varint,64013,opt,name=equal", + Filename: "gogo.proto", +} + +var E_Description = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64014, + Name: "gogoproto.description", + Tag: "varint,64014,opt,name=description", + Filename: "gogo.proto", +} + +var E_Testgen = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64015, + Name: "gogoproto.testgen", + Tag: "varint,64015,opt,name=testgen", + Filename: "gogo.proto", +} + +var E_Benchgen = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64016, + Name: "gogoproto.benchgen", + Tag: "varint,64016,opt,name=benchgen", + Filename: "gogo.proto", +} + +var E_Marshaler = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64017, + Name: "gogoproto.marshaler", + Tag: "varint,64017,opt,name=marshaler", + Filename: "gogo.proto", +} + +var E_Unmarshaler = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64018, + Name: "gogoproto.unmarshaler", + Tag: "varint,64018,opt,name=unmarshaler", + Filename: "gogo.proto", +} + +var E_StableMarshaler = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64019, + Name: "gogoproto.stable_marshaler", + Tag: "varint,64019,opt,name=stable_marshaler", + Filename: "gogo.proto", +} + +var E_Sizer = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64020, + Name: "gogoproto.sizer", + Tag: "varint,64020,opt,name=sizer", + Filename: "gogo.proto", +} + +var E_UnsafeMarshaler = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64023, + Name: "gogoproto.unsafe_marshaler", + Tag: "varint,64023,opt,name=unsafe_marshaler", + Filename: "gogo.proto", +} + +var E_UnsafeUnmarshaler = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64024, + Name: "gogoproto.unsafe_unmarshaler", + Tag: "varint,64024,opt,name=unsafe_unmarshaler", + Filename: "gogo.proto", +} + +var E_GoprotoExtensionsMap = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64025, + Name: "gogoproto.goproto_extensions_map", + Tag: "varint,64025,opt,name=goproto_extensions_map", + Filename: "gogo.proto", +} + +var E_GoprotoUnrecognized = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64026, + Name: "gogoproto.goproto_unrecognized", + Tag: "varint,64026,opt,name=goproto_unrecognized", + Filename: "gogo.proto", +} + +var E_Protosizer = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64028, + Name: "gogoproto.protosizer", + Tag: "varint,64028,opt,name=protosizer", + Filename: "gogo.proto", +} + +var E_Compare = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64029, + Name: "gogoproto.compare", + Tag: "varint,64029,opt,name=compare", + Filename: "gogo.proto", +} + +var E_Typedecl = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64030, + Name: "gogoproto.typedecl", + Tag: "varint,64030,opt,name=typedecl", + Filename: "gogo.proto", +} + +var E_Messagename = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64033, + Name: "gogoproto.messagename", + Tag: "varint,64033,opt,name=messagename", + Filename: "gogo.proto", +} + +var E_GoprotoSizecache = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64034, + Name: "gogoproto.goproto_sizecache", + Tag: "varint,64034,opt,name=goproto_sizecache", + Filename: "gogo.proto", +} + +var E_GoprotoUnkeyed = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64035, + Name: "gogoproto.goproto_unkeyed", + Tag: "varint,64035,opt,name=goproto_unkeyed", + Filename: "gogo.proto", +} + +var E_Nullable = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 65001, + Name: "gogoproto.nullable", + Tag: "varint,65001,opt,name=nullable", + Filename: "gogo.proto", +} + +var E_Embed = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 65002, + Name: "gogoproto.embed", + Tag: "varint,65002,opt,name=embed", + Filename: "gogo.proto", +} + +var E_Customtype = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*string)(nil), + Field: 65003, + Name: "gogoproto.customtype", + Tag: "bytes,65003,opt,name=customtype", + Filename: "gogo.proto", +} + +var E_Customname = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*string)(nil), + Field: 65004, + Name: "gogoproto.customname", + Tag: "bytes,65004,opt,name=customname", + Filename: "gogo.proto", +} + +var E_Jsontag = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*string)(nil), + Field: 65005, + Name: "gogoproto.jsontag", + Tag: "bytes,65005,opt,name=jsontag", + Filename: "gogo.proto", +} + +var E_Moretags = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*string)(nil), + Field: 65006, + Name: "gogoproto.moretags", + Tag: "bytes,65006,opt,name=moretags", + Filename: "gogo.proto", +} + +var E_Casttype = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*string)(nil), + Field: 65007, + Name: "gogoproto.casttype", + Tag: "bytes,65007,opt,name=casttype", + Filename: "gogo.proto", +} + +var E_Castkey = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*string)(nil), + Field: 65008, + Name: "gogoproto.castkey", + Tag: "bytes,65008,opt,name=castkey", + Filename: "gogo.proto", +} + +var E_Castvalue = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*string)(nil), + Field: 65009, + Name: "gogoproto.castvalue", + Tag: "bytes,65009,opt,name=castvalue", + Filename: "gogo.proto", +} + +var E_Stdtime = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 65010, + Name: "gogoproto.stdtime", + Tag: "varint,65010,opt,name=stdtime", + Filename: "gogo.proto", +} + +var E_Stdduration = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 65011, + Name: "gogoproto.stdduration", + Tag: "varint,65011,opt,name=stdduration", + Filename: "gogo.proto", +} + +var E_Wktpointer = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 65012, + Name: "gogoproto.wktpointer", + Tag: "varint,65012,opt,name=wktpointer", + Filename: "gogo.proto", +} + +func init() { + proto.RegisterExtension(E_GoprotoEnumPrefix) + proto.RegisterExtension(E_GoprotoEnumStringer) + proto.RegisterExtension(E_EnumStringer) + proto.RegisterExtension(E_EnumCustomname) + proto.RegisterExtension(E_Enumdecl) + proto.RegisterExtension(E_EnumvalueCustomname) + proto.RegisterExtension(E_GoprotoGettersAll) + proto.RegisterExtension(E_GoprotoEnumPrefixAll) + proto.RegisterExtension(E_GoprotoStringerAll) + proto.RegisterExtension(E_VerboseEqualAll) + proto.RegisterExtension(E_FaceAll) + proto.RegisterExtension(E_GostringAll) + proto.RegisterExtension(E_PopulateAll) + proto.RegisterExtension(E_StringerAll) + proto.RegisterExtension(E_OnlyoneAll) + proto.RegisterExtension(E_EqualAll) + proto.RegisterExtension(E_DescriptionAll) + proto.RegisterExtension(E_TestgenAll) + proto.RegisterExtension(E_BenchgenAll) + proto.RegisterExtension(E_MarshalerAll) + proto.RegisterExtension(E_UnmarshalerAll) + proto.RegisterExtension(E_StableMarshalerAll) + proto.RegisterExtension(E_SizerAll) + proto.RegisterExtension(E_GoprotoEnumStringerAll) + proto.RegisterExtension(E_EnumStringerAll) + proto.RegisterExtension(E_UnsafeMarshalerAll) + proto.RegisterExtension(E_UnsafeUnmarshalerAll) + proto.RegisterExtension(E_GoprotoExtensionsMapAll) + proto.RegisterExtension(E_GoprotoUnrecognizedAll) + proto.RegisterExtension(E_GogoprotoImport) + proto.RegisterExtension(E_ProtosizerAll) + proto.RegisterExtension(E_CompareAll) + proto.RegisterExtension(E_TypedeclAll) + proto.RegisterExtension(E_EnumdeclAll) + proto.RegisterExtension(E_GoprotoRegistration) + proto.RegisterExtension(E_MessagenameAll) + proto.RegisterExtension(E_GoprotoSizecacheAll) + proto.RegisterExtension(E_GoprotoUnkeyedAll) + proto.RegisterExtension(E_GoprotoGetters) + proto.RegisterExtension(E_GoprotoStringer) + proto.RegisterExtension(E_VerboseEqual) + proto.RegisterExtension(E_Face) + proto.RegisterExtension(E_Gostring) + proto.RegisterExtension(E_Populate) + proto.RegisterExtension(E_Stringer) + proto.RegisterExtension(E_Onlyone) + proto.RegisterExtension(E_Equal) + proto.RegisterExtension(E_Description) + proto.RegisterExtension(E_Testgen) + proto.RegisterExtension(E_Benchgen) + proto.RegisterExtension(E_Marshaler) + proto.RegisterExtension(E_Unmarshaler) + proto.RegisterExtension(E_StableMarshaler) + proto.RegisterExtension(E_Sizer) + proto.RegisterExtension(E_UnsafeMarshaler) + proto.RegisterExtension(E_UnsafeUnmarshaler) + proto.RegisterExtension(E_GoprotoExtensionsMap) + proto.RegisterExtension(E_GoprotoUnrecognized) + proto.RegisterExtension(E_Protosizer) + proto.RegisterExtension(E_Compare) + proto.RegisterExtension(E_Typedecl) + proto.RegisterExtension(E_Messagename) + proto.RegisterExtension(E_GoprotoSizecache) + proto.RegisterExtension(E_GoprotoUnkeyed) + proto.RegisterExtension(E_Nullable) + proto.RegisterExtension(E_Embed) + proto.RegisterExtension(E_Customtype) + proto.RegisterExtension(E_Customname) + proto.RegisterExtension(E_Jsontag) + proto.RegisterExtension(E_Moretags) + proto.RegisterExtension(E_Casttype) + proto.RegisterExtension(E_Castkey) + proto.RegisterExtension(E_Castvalue) + proto.RegisterExtension(E_Stdtime) + proto.RegisterExtension(E_Stdduration) + proto.RegisterExtension(E_Wktpointer) +} + +func init() { proto.RegisterFile("gogo.proto", fileDescriptor_592445b5231bc2b9) } + +var fileDescriptor_592445b5231bc2b9 = []byte{ + // 1328 bytes of a gzipped FileDescriptorProto + 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0x94, 0x98, 0x49, 0x6f, 0x1c, 0x45, + 0x14, 0x80, 0x85, 0x48, 0x64, 0x4f, 0x79, 0x8b, 0xc7, 0xc6, 0x84, 0x08, 0x44, 0xe0, 0xc4, 0xc9, + 0x3e, 0x45, 0x28, 0x65, 0x45, 0x96, 0x63, 0x39, 0x56, 0x10, 0x0e, 0xc6, 0x89, 0xc3, 0x76, 0x18, + 0xf5, 0xf4, 0x94, 0xdb, 0x8d, 0xbb, 0xbb, 0x9a, 0xee, 0xea, 0x10, 0xe7, 0x86, 0xc2, 0x22, 0x84, + 0xd8, 0x91, 0x20, 0x21, 0x09, 0x04, 0xc4, 0xbe, 0x86, 0x7d, 0xb9, 0x70, 0x61, 0xb9, 0xf2, 0x1f, + 0xb8, 0x00, 0x66, 0xf7, 0xcd, 0x17, 0xf4, 0xba, 0xdf, 0xeb, 0xa9, 0x69, 0x8f, 0x54, 0x35, 0xb7, + 0xf6, 0xb8, 0xbe, 0x6f, 0xaa, 0xdf, 0xeb, 0x7a, 0xef, 0x4d, 0x33, 0xe6, 0x49, 0x4f, 0x4e, 0xc6, + 0x89, 0x54, 0xb2, 0x5e, 0x83, 0xeb, 0xfc, 0x72, 0xdf, 0x7e, 0x4f, 0x4a, 0x2f, 0x10, 0x53, 0xf9, + 0x5f, 0xcd, 0x6c, 0x75, 0xaa, 0x25, 0x52, 0x37, 0xf1, 0x63, 0x25, 0x93, 0x62, 0x31, 0x3f, 0xc6, + 0xc6, 0x70, 0x71, 0x43, 0x44, 0x59, 0xd8, 0x88, 0x13, 0xb1, 0xea, 0x9f, 0xae, 0x5f, 0x3f, 0x59, + 0x90, 0x93, 0x44, 0x4e, 0xce, 0x47, 0x59, 0x78, 0x47, 0xac, 0x7c, 0x19, 0xa5, 0x7b, 0xaf, 0xfc, + 0x72, 0xf5, 0xfe, 0xab, 0x6e, 0xe9, 0x5f, 0x1e, 0x45, 0x14, 0xfe, 0xb7, 0x94, 0x83, 0x7c, 0x99, + 0x5d, 0xd3, 0xe1, 0x4b, 0x55, 0xe2, 0x47, 0x9e, 0x48, 0x0c, 0xc6, 0xef, 0xd1, 0x38, 0xa6, 0x19, + 0x8f, 0x23, 0xca, 0xe7, 0xd8, 0x50, 0x2f, 0xae, 0x1f, 0xd0, 0x35, 0x28, 0x74, 0xc9, 0x02, 0x1b, + 0xc9, 0x25, 0x6e, 0x96, 0x2a, 0x19, 0x46, 0x4e, 0x28, 0x0c, 0x9a, 0x1f, 0x73, 0x4d, 0x6d, 0x79, + 0x18, 0xb0, 0xb9, 0x92, 0xe2, 0x9c, 0xf5, 0xc3, 0x27, 0x2d, 0xe1, 0x06, 0x06, 0xc3, 0x4f, 0xb8, + 0x91, 0x72, 0x3d, 0x3f, 0xc9, 0xc6, 0xe1, 0xfa, 0x94, 0x13, 0x64, 0x42, 0xdf, 0xc9, 0x4d, 0x5d, + 0x3d, 0x27, 0x61, 0x19, 0xc9, 0x7e, 0x3e, 0xbb, 0x2b, 0xdf, 0xce, 0x58, 0x29, 0xd0, 0xf6, 0xa4, + 0x65, 0xd1, 0x13, 0x4a, 0x89, 0x24, 0x6d, 0x38, 0x41, 0xb7, 0xed, 0x1d, 0xf1, 0x83, 0xd2, 0x78, + 0x6e, 0xb3, 0x33, 0x8b, 0x0b, 0x05, 0x39, 0x1b, 0x04, 0x7c, 0x85, 0x5d, 0xdb, 0xe5, 0xa9, 0xb0, + 0x70, 0x9e, 0x47, 0xe7, 0xf8, 0x8e, 0x27, 0x03, 0xb4, 0x4b, 0x8c, 0x3e, 0x2f, 0x73, 0x69, 0xe1, + 0x7c, 0x19, 0x9d, 0x75, 0x64, 0x29, 0xa5, 0x60, 0xbc, 0x8d, 0x8d, 0x9e, 0x12, 0x49, 0x53, 0xa6, + 0xa2, 0x21, 0x1e, 0xc8, 0x9c, 0xc0, 0x42, 0x77, 0x01, 0x75, 0x23, 0x08, 0xce, 0x03, 0x07, 0xae, + 0x83, 0xac, 0x7f, 0xd5, 0x71, 0x85, 0x85, 0xe2, 0x22, 0x2a, 0xfa, 0x60, 0x3d, 0xa0, 0xb3, 0x6c, + 0xd0, 0x93, 0xc5, 0x2d, 0x59, 0xe0, 0x97, 0x10, 0x1f, 0x20, 0x06, 0x15, 0xb1, 0x8c, 0xb3, 0xc0, + 0x51, 0x36, 0x3b, 0x78, 0x85, 0x14, 0xc4, 0xa0, 0xa2, 0x87, 0xb0, 0xbe, 0x4a, 0x8a, 0x54, 0x8b, + 0xe7, 0x0c, 0x1b, 0x90, 0x51, 0xb0, 0x21, 0x23, 0x9b, 0x4d, 0x5c, 0x46, 0x03, 0x43, 0x04, 0x04, + 0xd3, 0xac, 0x66, 0x9b, 0x88, 0x37, 0x36, 0xe9, 0x78, 0x50, 0x06, 0x16, 0xd8, 0x08, 0x15, 0x28, + 0x5f, 0x46, 0x16, 0x8a, 0x37, 0x51, 0x31, 0xac, 0x61, 0x78, 0x1b, 0x4a, 0xa4, 0xca, 0x13, 0x36, + 0x92, 0xb7, 0xe8, 0x36, 0x10, 0xc1, 0x50, 0x36, 0x45, 0xe4, 0xae, 0xd9, 0x19, 0xde, 0xa6, 0x50, + 0x12, 0x03, 0x8a, 0x39, 0x36, 0x14, 0x3a, 0x49, 0xba, 0xe6, 0x04, 0x56, 0xe9, 0x78, 0x07, 0x1d, + 0x83, 0x25, 0x84, 0x11, 0xc9, 0xa2, 0x5e, 0x34, 0xef, 0x52, 0x44, 0x34, 0x0c, 0x8f, 0x5e, 0xaa, + 0x9c, 0x66, 0x20, 0x1a, 0xbd, 0xd8, 0xde, 0xa3, 0xa3, 0x57, 0xb0, 0x8b, 0xba, 0x71, 0x9a, 0xd5, + 0x52, 0xff, 0x8c, 0x95, 0xe6, 0x7d, 0xca, 0x74, 0x0e, 0x00, 0x7c, 0x0f, 0xbb, 0xae, 0x6b, 0x9b, + 0xb0, 0x90, 0x7d, 0x80, 0xb2, 0x89, 0x2e, 0xad, 0x02, 0x4b, 0x42, 0xaf, 0xca, 0x0f, 0xa9, 0x24, + 0x88, 0x8a, 0x6b, 0x89, 0x8d, 0x67, 0x51, 0xea, 0xac, 0xf6, 0x16, 0xb5, 0x8f, 0x28, 0x6a, 0x05, + 0xdb, 0x11, 0xb5, 0x13, 0x6c, 0x02, 0x8d, 0xbd, 0xe5, 0xf5, 0x63, 0x2a, 0xac, 0x05, 0xbd, 0xd2, + 0x99, 0xdd, 0xfb, 0xd8, 0xbe, 0x32, 0x9c, 0xa7, 0x95, 0x88, 0x52, 0x60, 0x1a, 0xa1, 0x13, 0x5b, + 0x98, 0xaf, 0xa0, 0x99, 0x2a, 0xfe, 0x7c, 0x29, 0x58, 0x74, 0x62, 0x90, 0xdf, 0xcd, 0xf6, 0x92, + 0x3c, 0x8b, 0x12, 0xe1, 0x4a, 0x2f, 0xf2, 0xcf, 0x88, 0x96, 0x85, 0xfa, 0x93, 0x4a, 0xaa, 0x56, + 0x34, 0x1c, 0xcc, 0x47, 0xd9, 0x9e, 0x72, 0x56, 0x69, 0xf8, 0x61, 0x2c, 0x13, 0x65, 0x30, 0x7e, + 0x4a, 0x99, 0x2a, 0xb9, 0xa3, 0x39, 0xc6, 0xe7, 0xd9, 0x70, 0xfe, 0xa7, 0xed, 0x23, 0xf9, 0x19, + 0x8a, 0x86, 0xda, 0x14, 0x16, 0x0e, 0x57, 0x86, 0xb1, 0x93, 0xd8, 0xd4, 0xbf, 0xcf, 0xa9, 0x70, + 0x20, 0x82, 0x85, 0x43, 0x6d, 0xc4, 0x02, 0xba, 0xbd, 0x85, 0xe1, 0x0b, 0x2a, 0x1c, 0xc4, 0xa0, + 0x82, 0x06, 0x06, 0x0b, 0xc5, 0x97, 0xa4, 0x20, 0x06, 0x14, 0x77, 0xb6, 0x1b, 0x6d, 0x22, 0x3c, + 0x3f, 0x55, 0x89, 0x03, 0xab, 0x0d, 0xaa, 0xaf, 0x36, 0x3b, 0x87, 0xb0, 0x65, 0x0d, 0x85, 0x4a, + 0x14, 0x8a, 0x34, 0x75, 0x3c, 0x01, 0x13, 0x87, 0xc5, 0xc6, 0xbe, 0xa6, 0x4a, 0xa4, 0x61, 0xb0, + 0x37, 0x6d, 0x42, 0x84, 0xb0, 0xbb, 0x8e, 0xbb, 0x66, 0xa3, 0xfb, 0xa6, 0xb2, 0xb9, 0xe3, 0xc4, + 0x82, 0x53, 0x9b, 0x7f, 0xb2, 0x68, 0x5d, 0x6c, 0x58, 0x3d, 0x9d, 0xdf, 0x56, 0xe6, 0x9f, 0x95, + 0x82, 0x2c, 0x6a, 0xc8, 0x48, 0x65, 0x9e, 0xaa, 0xdf, 0xb8, 0xc3, 0xb5, 0x58, 0xdc, 0x17, 0xe9, + 0x1e, 0xda, 0xc2, 0xfb, 0xed, 0x1c, 0xa7, 0xf8, 0xed, 0xf0, 0x90, 0x77, 0x0e, 0x3d, 0x66, 0xd9, + 0xd9, 0xad, 0xf2, 0x39, 0xef, 0x98, 0x79, 0xf8, 0x11, 0x36, 0xd4, 0x31, 0xf0, 0x98, 0x55, 0x0f, + 0xa3, 0x6a, 0x50, 0x9f, 0x77, 0xf8, 0x01, 0xb6, 0x0b, 0x86, 0x17, 0x33, 0xfe, 0x08, 0xe2, 0xf9, + 0x72, 0x7e, 0x88, 0xf5, 0xd3, 0xd0, 0x62, 0x46, 0x1f, 0x45, 0xb4, 0x44, 0x00, 0xa7, 0x81, 0xc5, + 0x8c, 0x3f, 0x46, 0x38, 0x21, 0x80, 0xdb, 0x87, 0xf0, 0xbb, 0x27, 0x76, 0x61, 0xd3, 0xa1, 0xd8, + 0x4d, 0xb3, 0x3e, 0x9c, 0x54, 0xcc, 0xf4, 0xe3, 0xf8, 0xe5, 0x44, 0xf0, 0x5b, 0xd9, 0x6e, 0xcb, + 0x80, 0x3f, 0x89, 0x68, 0xb1, 0x9e, 0xcf, 0xb1, 0x01, 0x6d, 0x3a, 0x31, 0xe3, 0x4f, 0x21, 0xae, + 0x53, 0xb0, 0x75, 0x9c, 0x4e, 0xcc, 0x82, 0xa7, 0x69, 0xeb, 0x48, 0x40, 0xd8, 0x68, 0x30, 0x31, + 0xd3, 0xcf, 0x50, 0xd4, 0x09, 0xe1, 0x33, 0xac, 0x56, 0x36, 0x1b, 0x33, 0xff, 0x2c, 0xf2, 0x6d, + 0x06, 0x22, 0xa0, 0x35, 0x3b, 0xb3, 0xe2, 0x39, 0x8a, 0x80, 0x46, 0xc1, 0x31, 0xaa, 0x0e, 0x30, + 0x66, 0xd3, 0xf3, 0x74, 0x8c, 0x2a, 0xf3, 0x0b, 0x64, 0x33, 0xaf, 0xf9, 0x66, 0xc5, 0x0b, 0x94, + 0xcd, 0x7c, 0x3d, 0x6c, 0xa3, 0x3a, 0x11, 0x98, 0x1d, 0x2f, 0xd2, 0x36, 0x2a, 0x03, 0x01, 0x5f, + 0x62, 0xf5, 0x9d, 0xd3, 0x80, 0xd9, 0xf7, 0x12, 0xfa, 0x46, 0x77, 0x0c, 0x03, 0xfc, 0x2e, 0x36, + 0xd1, 0x7d, 0x12, 0x30, 0x5b, 0xcf, 0x6d, 0x55, 0x7e, 0xbb, 0xe9, 0x83, 0x00, 0x3f, 0xd1, 0x6e, + 0x29, 0xfa, 0x14, 0x60, 0xd6, 0x9e, 0xdf, 0xea, 0x2c, 0xdc, 0xfa, 0x10, 0xc0, 0x67, 0x19, 0x6b, + 0x37, 0x60, 0xb3, 0xeb, 0x02, 0xba, 0x34, 0x08, 0x8e, 0x06, 0xf6, 0x5f, 0x33, 0x7f, 0x91, 0x8e, + 0x06, 0x12, 0x70, 0x34, 0xa8, 0xf5, 0x9a, 0xe9, 0x4b, 0x74, 0x34, 0x08, 0x81, 0x27, 0x5b, 0xeb, + 0x6e, 0x66, 0xc3, 0x65, 0x7a, 0xb2, 0x35, 0x8a, 0x1f, 0x63, 0xa3, 0x3b, 0x1a, 0xa2, 0x59, 0xf5, + 0x1a, 0xaa, 0xf6, 0x54, 0xfb, 0xa1, 0xde, 0xbc, 0xb0, 0x19, 0x9a, 0x6d, 0xaf, 0x57, 0x9a, 0x17, + 0xf6, 0x42, 0x3e, 0xcd, 0xfa, 0xa3, 0x2c, 0x08, 0xe0, 0xf0, 0xd4, 0x6f, 0xe8, 0xd2, 0x4d, 0x45, + 0xd0, 0x22, 0xc5, 0xaf, 0xdb, 0x18, 0x1d, 0x02, 0xf8, 0x01, 0xb6, 0x5b, 0x84, 0x4d, 0xd1, 0x32, + 0x91, 0xbf, 0x6d, 0x53, 0xc1, 0x84, 0xd5, 0x7c, 0x86, 0xb1, 0xe2, 0xd5, 0x08, 0x84, 0xd9, 0xc4, + 0xfe, 0xbe, 0x5d, 0xbc, 0xa5, 0xd1, 0x90, 0xb6, 0x20, 0x4f, 0x8a, 0x41, 0xb0, 0xd9, 0x29, 0xc8, + 0x33, 0x72, 0x90, 0xf5, 0xdd, 0x9f, 0xca, 0x48, 0x39, 0x9e, 0x89, 0xfe, 0x03, 0x69, 0x5a, 0x0f, + 0x01, 0x0b, 0x65, 0x22, 0x94, 0xe3, 0xa5, 0x26, 0xf6, 0x4f, 0x64, 0x4b, 0x00, 0x60, 0xd7, 0x49, + 0x95, 0xcd, 0x7d, 0xff, 0x45, 0x30, 0x01, 0xb0, 0x69, 0xb8, 0x5e, 0x17, 0x1b, 0x26, 0xf6, 0x6f, + 0xda, 0x34, 0xae, 0xe7, 0x87, 0x58, 0x0d, 0x2e, 0xf3, 0xb7, 0x4a, 0x26, 0xf8, 0x1f, 0x84, 0xdb, + 0x04, 0x7c, 0x73, 0xaa, 0x5a, 0xca, 0x37, 0x07, 0xfb, 0x5f, 0xcc, 0x34, 0xad, 0xe7, 0xb3, 0x6c, + 0x20, 0x55, 0xad, 0x56, 0x86, 0xf3, 0xa9, 0x01, 0xff, 0x6f, 0xbb, 0x7c, 0x65, 0x51, 0x32, 0x90, + 0xed, 0x07, 0xd7, 0x55, 0x2c, 0xfd, 0x48, 0x89, 0xc4, 0x64, 0xd8, 0x42, 0x83, 0x86, 0x1c, 0x9e, + 0x67, 0x63, 0xae, 0x0c, 0xab, 0xdc, 0x61, 0xb6, 0x20, 0x17, 0xe4, 0x52, 0x5e, 0x67, 0xee, 0xbd, + 0xd9, 0xf3, 0xd5, 0x5a, 0xd6, 0x9c, 0x74, 0x65, 0x38, 0x05, 0xbf, 0x3c, 0xda, 0x2f, 0x54, 0xcb, + 0xdf, 0x21, 0xff, 0x07, 0x00, 0x00, 0xff, 0xff, 0x9c, 0xaf, 0x70, 0x4e, 0x83, 0x15, 0x00, 0x00, +} diff --git a/vendor/github.com/gogo/protobuf/gogoproto/gogo.pb.golden b/vendor/github.com/gogo/protobuf/gogoproto/gogo.pb.golden new file mode 100644 index 00000000..f6502e4b --- /dev/null +++ b/vendor/github.com/gogo/protobuf/gogoproto/gogo.pb.golden @@ -0,0 +1,45 @@ +// Code generated by protoc-gen-go. +// source: gogo.proto +// DO NOT EDIT! + +package gogoproto + +import proto "github.com/gogo/protobuf/proto" +import json "encoding/json" +import math "math" +import google_protobuf "github.com/gogo/protobuf/protoc-gen-gogo/descriptor" + +// Reference proto, json, and math imports to suppress error if they are not otherwise used. +var _ = proto.Marshal +var _ = &json.SyntaxError{} +var _ = math.Inf + +var E_Nullable = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FieldOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 51235, + Name: "gogoproto.nullable", + Tag: "varint,51235,opt,name=nullable", +} + +var E_Embed = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FieldOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 51236, + Name: "gogoproto.embed", + Tag: "varint,51236,opt,name=embed", +} + +var E_Customtype = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FieldOptions)(nil), + ExtensionType: (*string)(nil), + Field: 51237, + Name: "gogoproto.customtype", + Tag: "bytes,51237,opt,name=customtype", +} + +func init() { + proto.RegisterExtension(E_Nullable) + proto.RegisterExtension(E_Embed) + proto.RegisterExtension(E_Customtype) +} diff --git a/vendor/github.com/gogo/protobuf/gogoproto/gogo.proto b/vendor/github.com/gogo/protobuf/gogoproto/gogo.proto new file mode 100644 index 00000000..b80c8565 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/gogoproto/gogo.proto @@ -0,0 +1,144 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2013, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +syntax = "proto2"; +package gogoproto; + +import "google/protobuf/descriptor.proto"; + +option java_package = "com.google.protobuf"; +option java_outer_classname = "GoGoProtos"; +option go_package = "github.com/gogo/protobuf/gogoproto"; + +extend google.protobuf.EnumOptions { + optional bool goproto_enum_prefix = 62001; + optional bool goproto_enum_stringer = 62021; + optional bool enum_stringer = 62022; + optional string enum_customname = 62023; + optional bool enumdecl = 62024; +} + +extend google.protobuf.EnumValueOptions { + optional string enumvalue_customname = 66001; +} + +extend google.protobuf.FileOptions { + optional bool goproto_getters_all = 63001; + optional bool goproto_enum_prefix_all = 63002; + optional bool goproto_stringer_all = 63003; + optional bool verbose_equal_all = 63004; + optional bool face_all = 63005; + optional bool gostring_all = 63006; + optional bool populate_all = 63007; + optional bool stringer_all = 63008; + optional bool onlyone_all = 63009; + + optional bool equal_all = 63013; + optional bool description_all = 63014; + optional bool testgen_all = 63015; + optional bool benchgen_all = 63016; + optional bool marshaler_all = 63017; + optional bool unmarshaler_all = 63018; + optional bool stable_marshaler_all = 63019; + + optional bool sizer_all = 63020; + + optional bool goproto_enum_stringer_all = 63021; + optional bool enum_stringer_all = 63022; + + optional bool unsafe_marshaler_all = 63023; + optional bool unsafe_unmarshaler_all = 63024; + + optional bool goproto_extensions_map_all = 63025; + optional bool goproto_unrecognized_all = 63026; + optional bool gogoproto_import = 63027; + optional bool protosizer_all = 63028; + optional bool compare_all = 63029; + optional bool typedecl_all = 63030; + optional bool enumdecl_all = 63031; + + optional bool goproto_registration = 63032; + optional bool messagename_all = 63033; + + optional bool goproto_sizecache_all = 63034; + optional bool goproto_unkeyed_all = 63035; +} + +extend google.protobuf.MessageOptions { + optional bool goproto_getters = 64001; + optional bool goproto_stringer = 64003; + optional bool verbose_equal = 64004; + optional bool face = 64005; + optional bool gostring = 64006; + optional bool populate = 64007; + optional bool stringer = 67008; + optional bool onlyone = 64009; + + optional bool equal = 64013; + optional bool description = 64014; + optional bool testgen = 64015; + optional bool benchgen = 64016; + optional bool marshaler = 64017; + optional bool unmarshaler = 64018; + optional bool stable_marshaler = 64019; + + optional bool sizer = 64020; + + optional bool unsafe_marshaler = 64023; + optional bool unsafe_unmarshaler = 64024; + + optional bool goproto_extensions_map = 64025; + optional bool goproto_unrecognized = 64026; + + optional bool protosizer = 64028; + optional bool compare = 64029; + + optional bool typedecl = 64030; + + optional bool messagename = 64033; + + optional bool goproto_sizecache = 64034; + optional bool goproto_unkeyed = 64035; +} + +extend google.protobuf.FieldOptions { + optional bool nullable = 65001; + optional bool embed = 65002; + optional string customtype = 65003; + optional string customname = 65004; + optional string jsontag = 65005; + optional string moretags = 65006; + optional string casttype = 65007; + optional string castkey = 65008; + optional string castvalue = 65009; + + optional bool stdtime = 65010; + optional bool stdduration = 65011; + optional bool wktpointer = 65012; + +} diff --git a/vendor/github.com/gogo/protobuf/gogoproto/helper.go b/vendor/github.com/gogo/protobuf/gogoproto/helper.go new file mode 100644 index 00000000..390d4e4b --- /dev/null +++ b/vendor/github.com/gogo/protobuf/gogoproto/helper.go @@ -0,0 +1,415 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2013, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package gogoproto + +import google_protobuf "github.com/gogo/protobuf/protoc-gen-gogo/descriptor" +import proto "github.com/gogo/protobuf/proto" + +func IsEmbed(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Embed, false) +} + +func IsNullable(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Nullable, true) +} + +func IsStdTime(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Stdtime, false) +} + +func IsStdDuration(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Stdduration, false) +} + +func IsStdDouble(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Wktpointer, false) && *field.TypeName == ".google.protobuf.DoubleValue" +} + +func IsStdFloat(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Wktpointer, false) && *field.TypeName == ".google.protobuf.FloatValue" +} + +func IsStdInt64(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Wktpointer, false) && *field.TypeName == ".google.protobuf.Int64Value" +} + +func IsStdUInt64(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Wktpointer, false) && *field.TypeName == ".google.protobuf.UInt64Value" +} + +func IsStdInt32(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Wktpointer, false) && *field.TypeName == ".google.protobuf.Int32Value" +} + +func IsStdUInt32(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Wktpointer, false) && *field.TypeName == ".google.protobuf.UInt32Value" +} + +func IsStdBool(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Wktpointer, false) && *field.TypeName == ".google.protobuf.BoolValue" +} + +func IsStdString(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Wktpointer, false) && *field.TypeName == ".google.protobuf.StringValue" +} + +func IsStdBytes(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Wktpointer, false) && *field.TypeName == ".google.protobuf.BytesValue" +} + +func IsStdType(field *google_protobuf.FieldDescriptorProto) bool { + return (IsStdTime(field) || IsStdDuration(field) || + IsStdDouble(field) || IsStdFloat(field) || + IsStdInt64(field) || IsStdUInt64(field) || + IsStdInt32(field) || IsStdUInt32(field) || + IsStdBool(field) || + IsStdString(field) || IsStdBytes(field)) +} + +func IsWktPtr(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Wktpointer, false) +} + +func NeedsNilCheck(proto3 bool, field *google_protobuf.FieldDescriptorProto) bool { + nullable := IsNullable(field) + if field.IsMessage() || IsCustomType(field) { + return nullable + } + if proto3 { + return false + } + return nullable || *field.Type == google_protobuf.FieldDescriptorProto_TYPE_BYTES +} + +func IsCustomType(field *google_protobuf.FieldDescriptorProto) bool { + typ := GetCustomType(field) + if len(typ) > 0 { + return true + } + return false +} + +func IsCastType(field *google_protobuf.FieldDescriptorProto) bool { + typ := GetCastType(field) + if len(typ) > 0 { + return true + } + return false +} + +func IsCastKey(field *google_protobuf.FieldDescriptorProto) bool { + typ := GetCastKey(field) + if len(typ) > 0 { + return true + } + return false +} + +func IsCastValue(field *google_protobuf.FieldDescriptorProto) bool { + typ := GetCastValue(field) + if len(typ) > 0 { + return true + } + return false +} + +func HasEnumDecl(file *google_protobuf.FileDescriptorProto, enum *google_protobuf.EnumDescriptorProto) bool { + return proto.GetBoolExtension(enum.Options, E_Enumdecl, proto.GetBoolExtension(file.Options, E_EnumdeclAll, true)) +} + +func HasTypeDecl(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Typedecl, proto.GetBoolExtension(file.Options, E_TypedeclAll, true)) +} + +func GetCustomType(field *google_protobuf.FieldDescriptorProto) string { + if field == nil { + return "" + } + if field.Options != nil { + v, err := proto.GetExtension(field.Options, E_Customtype) + if err == nil && v.(*string) != nil { + return *(v.(*string)) + } + } + return "" +} + +func GetCastType(field *google_protobuf.FieldDescriptorProto) string { + if field == nil { + return "" + } + if field.Options != nil { + v, err := proto.GetExtension(field.Options, E_Casttype) + if err == nil && v.(*string) != nil { + return *(v.(*string)) + } + } + return "" +} + +func GetCastKey(field *google_protobuf.FieldDescriptorProto) string { + if field == nil { + return "" + } + if field.Options != nil { + v, err := proto.GetExtension(field.Options, E_Castkey) + if err == nil && v.(*string) != nil { + return *(v.(*string)) + } + } + return "" +} + +func GetCastValue(field *google_protobuf.FieldDescriptorProto) string { + if field == nil { + return "" + } + if field.Options != nil { + v, err := proto.GetExtension(field.Options, E_Castvalue) + if err == nil && v.(*string) != nil { + return *(v.(*string)) + } + } + return "" +} + +func IsCustomName(field *google_protobuf.FieldDescriptorProto) bool { + name := GetCustomName(field) + if len(name) > 0 { + return true + } + return false +} + +func IsEnumCustomName(field *google_protobuf.EnumDescriptorProto) bool { + name := GetEnumCustomName(field) + if len(name) > 0 { + return true + } + return false +} + +func IsEnumValueCustomName(field *google_protobuf.EnumValueDescriptorProto) bool { + name := GetEnumValueCustomName(field) + if len(name) > 0 { + return true + } + return false +} + +func GetCustomName(field *google_protobuf.FieldDescriptorProto) string { + if field == nil { + return "" + } + if field.Options != nil { + v, err := proto.GetExtension(field.Options, E_Customname) + if err == nil && v.(*string) != nil { + return *(v.(*string)) + } + } + return "" +} + +func GetEnumCustomName(field *google_protobuf.EnumDescriptorProto) string { + if field == nil { + return "" + } + if field.Options != nil { + v, err := proto.GetExtension(field.Options, E_EnumCustomname) + if err == nil && v.(*string) != nil { + return *(v.(*string)) + } + } + return "" +} + +func GetEnumValueCustomName(field *google_protobuf.EnumValueDescriptorProto) string { + if field == nil { + return "" + } + if field.Options != nil { + v, err := proto.GetExtension(field.Options, E_EnumvalueCustomname) + if err == nil && v.(*string) != nil { + return *(v.(*string)) + } + } + return "" +} + +func GetJsonTag(field *google_protobuf.FieldDescriptorProto) *string { + if field == nil { + return nil + } + if field.Options != nil { + v, err := proto.GetExtension(field.Options, E_Jsontag) + if err == nil && v.(*string) != nil { + return (v.(*string)) + } + } + return nil +} + +func GetMoreTags(field *google_protobuf.FieldDescriptorProto) *string { + if field == nil { + return nil + } + if field.Options != nil { + v, err := proto.GetExtension(field.Options, E_Moretags) + if err == nil && v.(*string) != nil { + return (v.(*string)) + } + } + return nil +} + +type EnableFunc func(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool + +func EnabledGoEnumPrefix(file *google_protobuf.FileDescriptorProto, enum *google_protobuf.EnumDescriptorProto) bool { + return proto.GetBoolExtension(enum.Options, E_GoprotoEnumPrefix, proto.GetBoolExtension(file.Options, E_GoprotoEnumPrefixAll, true)) +} + +func EnabledGoStringer(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_GoprotoStringer, proto.GetBoolExtension(file.Options, E_GoprotoStringerAll, true)) +} + +func HasGoGetters(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_GoprotoGetters, proto.GetBoolExtension(file.Options, E_GoprotoGettersAll, true)) +} + +func IsUnion(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Onlyone, proto.GetBoolExtension(file.Options, E_OnlyoneAll, false)) +} + +func HasGoString(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Gostring, proto.GetBoolExtension(file.Options, E_GostringAll, false)) +} + +func HasEqual(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Equal, proto.GetBoolExtension(file.Options, E_EqualAll, false)) +} + +func HasVerboseEqual(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_VerboseEqual, proto.GetBoolExtension(file.Options, E_VerboseEqualAll, false)) +} + +func IsStringer(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Stringer, proto.GetBoolExtension(file.Options, E_StringerAll, false)) +} + +func IsFace(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Face, proto.GetBoolExtension(file.Options, E_FaceAll, false)) +} + +func HasDescription(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Description, proto.GetBoolExtension(file.Options, E_DescriptionAll, false)) +} + +func HasPopulate(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Populate, proto.GetBoolExtension(file.Options, E_PopulateAll, false)) +} + +func HasTestGen(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Testgen, proto.GetBoolExtension(file.Options, E_TestgenAll, false)) +} + +func HasBenchGen(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Benchgen, proto.GetBoolExtension(file.Options, E_BenchgenAll, false)) +} + +func IsMarshaler(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Marshaler, proto.GetBoolExtension(file.Options, E_MarshalerAll, false)) +} + +func IsUnmarshaler(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Unmarshaler, proto.GetBoolExtension(file.Options, E_UnmarshalerAll, false)) +} + +func IsStableMarshaler(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_StableMarshaler, proto.GetBoolExtension(file.Options, E_StableMarshalerAll, false)) +} + +func IsSizer(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Sizer, proto.GetBoolExtension(file.Options, E_SizerAll, false)) +} + +func IsProtoSizer(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Protosizer, proto.GetBoolExtension(file.Options, E_ProtosizerAll, false)) +} + +func IsGoEnumStringer(file *google_protobuf.FileDescriptorProto, enum *google_protobuf.EnumDescriptorProto) bool { + return proto.GetBoolExtension(enum.Options, E_GoprotoEnumStringer, proto.GetBoolExtension(file.Options, E_GoprotoEnumStringerAll, true)) +} + +func IsEnumStringer(file *google_protobuf.FileDescriptorProto, enum *google_protobuf.EnumDescriptorProto) bool { + return proto.GetBoolExtension(enum.Options, E_EnumStringer, proto.GetBoolExtension(file.Options, E_EnumStringerAll, false)) +} + +func IsUnsafeMarshaler(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_UnsafeMarshaler, proto.GetBoolExtension(file.Options, E_UnsafeMarshalerAll, false)) +} + +func IsUnsafeUnmarshaler(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_UnsafeUnmarshaler, proto.GetBoolExtension(file.Options, E_UnsafeUnmarshalerAll, false)) +} + +func HasExtensionsMap(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_GoprotoExtensionsMap, proto.GetBoolExtension(file.Options, E_GoprotoExtensionsMapAll, true)) +} + +func HasUnrecognized(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_GoprotoUnrecognized, proto.GetBoolExtension(file.Options, E_GoprotoUnrecognizedAll, true)) +} + +func IsProto3(file *google_protobuf.FileDescriptorProto) bool { + return file.GetSyntax() == "proto3" +} + +func ImportsGoGoProto(file *google_protobuf.FileDescriptorProto) bool { + return proto.GetBoolExtension(file.Options, E_GogoprotoImport, true) +} + +func HasCompare(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Compare, proto.GetBoolExtension(file.Options, E_CompareAll, false)) +} + +func RegistersGolangProto(file *google_protobuf.FileDescriptorProto) bool { + return proto.GetBoolExtension(file.Options, E_GoprotoRegistration, false) +} + +func HasMessageName(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Messagename, proto.GetBoolExtension(file.Options, E_MessagenameAll, false)) +} + +func HasSizecache(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_GoprotoSizecache, proto.GetBoolExtension(file.Options, E_GoprotoSizecacheAll, true)) +} + +func HasUnkeyed(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_GoprotoUnkeyed, proto.GetBoolExtension(file.Options, E_GoprotoUnkeyedAll, true)) +} diff --git a/vendor/github.com/gogo/protobuf/proto/encode.go b/vendor/github.com/gogo/protobuf/proto/encode.go index 3abfed2c..9581ccd3 100644 --- a/vendor/github.com/gogo/protobuf/proto/encode.go +++ b/vendor/github.com/gogo/protobuf/proto/encode.go @@ -189,6 +189,8 @@ type Marshaler interface { // prefixed by a varint-encoded length. func (p *Buffer) EncodeMessage(pb Message) error { siz := Size(pb) + sizVar := SizeVarint(uint64(siz)) + p.grow(siz + sizVar) p.EncodeVarint(uint64(siz)) return p.Marshal(pb) } diff --git a/vendor/github.com/gogo/protobuf/proto/extensions.go b/vendor/github.com/gogo/protobuf/proto/extensions.go index 686bd2a0..341c6f57 100644 --- a/vendor/github.com/gogo/protobuf/proto/extensions.go +++ b/vendor/github.com/gogo/protobuf/proto/extensions.go @@ -527,6 +527,7 @@ func ExtensionDescs(pb Message) ([]*ExtensionDesc, error) { // SetExtension sets the specified extension of pb to the specified value. func SetExtension(pb Message, extension *ExtensionDesc, value interface{}) error { if epb, ok := pb.(extensionsBytes); ok { + ClearExtension(pb, extension) newb, err := encodeExtension(extension, value) if err != nil { return err diff --git a/vendor/github.com/gogo/protobuf/proto/extensions_gogo.go b/vendor/github.com/gogo/protobuf/proto/extensions_gogo.go index 53ebd8cc..6f1ae120 100644 --- a/vendor/github.com/gogo/protobuf/proto/extensions_gogo.go +++ b/vendor/github.com/gogo/protobuf/proto/extensions_gogo.go @@ -154,6 +154,10 @@ func EncodeInternalExtension(m extendableProto, data []byte) (n int, err error) return EncodeExtensionMap(m.extensionsWrite(), data) } +func EncodeInternalExtensionBackwards(m extendableProto, data []byte) (n int, err error) { + return EncodeExtensionMapBackwards(m.extensionsWrite(), data) +} + func EncodeExtensionMap(m map[int32]Extension, data []byte) (n int, err error) { o := 0 for _, e := range m { @@ -169,6 +173,23 @@ func EncodeExtensionMap(m map[int32]Extension, data []byte) (n int, err error) { return o, nil } +func EncodeExtensionMapBackwards(m map[int32]Extension, data []byte) (n int, err error) { + o := 0 + end := len(data) + for _, e := range m { + if err := e.Encode(); err != nil { + return 0, err + } + n := copy(data[end-len(e.enc):], e.enc) + if n != len(e.enc) { + return 0, io.ErrShortBuffer + } + end -= n + o += n + } + return o, nil +} + func GetRawExtension(m map[int32]Extension, id int32) ([]byte, error) { e := m[id] if err := e.Encode(); err != nil { diff --git a/vendor/github.com/gogo/protobuf/proto/lib.go b/vendor/github.com/gogo/protobuf/proto/lib.go index d17f8020..80db1c15 100644 --- a/vendor/github.com/gogo/protobuf/proto/lib.go +++ b/vendor/github.com/gogo/protobuf/proto/lib.go @@ -948,13 +948,19 @@ func isProto3Zero(v reflect.Value) bool { return false } -// ProtoPackageIsVersion2 is referenced from generated protocol buffer files -// to assert that that code is compatible with this version of the proto package. -const GoGoProtoPackageIsVersion2 = true +const ( + // ProtoPackageIsVersion3 is referenced from generated protocol buffer files + // to assert that that code is compatible with this version of the proto package. + GoGoProtoPackageIsVersion3 = true -// ProtoPackageIsVersion1 is referenced from generated protocol buffer files -// to assert that that code is compatible with this version of the proto package. -const GoGoProtoPackageIsVersion1 = true + // ProtoPackageIsVersion2 is referenced from generated protocol buffer files + // to assert that that code is compatible with this version of the proto package. + GoGoProtoPackageIsVersion2 = true + + // ProtoPackageIsVersion1 is referenced from generated protocol buffer files + // to assert that that code is compatible with this version of the proto package. + GoGoProtoPackageIsVersion1 = true +) // InternalMessageInfo is a type used internally by generated .pb.go files. // This type is not intended to be used by non-generated code. diff --git a/vendor/github.com/gogo/protobuf/proto/properties.go b/vendor/github.com/gogo/protobuf/proto/properties.go index c9e5fa02..28da1475 100644 --- a/vendor/github.com/gogo/protobuf/proto/properties.go +++ b/vendor/github.com/gogo/protobuf/proto/properties.go @@ -43,7 +43,6 @@ package proto import ( "fmt" "log" - "os" "reflect" "sort" "strconv" @@ -205,7 +204,7 @@ func (p *Properties) Parse(s string) { // "bytes,49,opt,name=foo,def=hello!" fields := strings.Split(s, ",") // breaks def=, but handled below. if len(fields) < 2 { - fmt.Fprintf(os.Stderr, "proto: tag has too few fields: %q\n", s) + log.Printf("proto: tag has too few fields: %q", s) return } @@ -225,7 +224,7 @@ func (p *Properties) Parse(s string) { p.WireType = WireBytes // no numeric converter for non-numeric types default: - fmt.Fprintf(os.Stderr, "proto: tag has unknown wire type: %q\n", s) + log.Printf("proto: tag has unknown wire type: %q", s) return } @@ -400,6 +399,15 @@ func GetProperties(t reflect.Type) *StructProperties { return sprop } +type ( + oneofFuncsIface interface { + XXX_OneofFuncs() (func(Message, *Buffer) error, func(Message, int, int, *Buffer) (bool, error), func(Message) int, []interface{}) + } + oneofWrappersIface interface { + XXX_OneofWrappers() []interface{} + } +) + // getPropertiesLocked requires that propertiesMu is held. func getPropertiesLocked(t reflect.Type) *StructProperties { if prop, ok := propertiesMap[t]; ok { @@ -441,37 +449,40 @@ func getPropertiesLocked(t reflect.Type) *StructProperties { // Re-order prop.order. sort.Sort(prop) - type oneofMessage interface { - XXX_OneofFuncs() (func(Message, *Buffer) error, func(Message, int, int, *Buffer) (bool, error), func(Message) int, []interface{}) - } - if om, ok := reflect.Zero(reflect.PtrTo(t)).Interface().(oneofMessage); isOneofMessage && ok { + if isOneofMessage { var oots []interface{} - _, _, _, oots = om.XXX_OneofFuncs() - - // Interpret oneof metadata. - prop.OneofTypes = make(map[string]*OneofProperties) - for _, oot := range oots { - oop := &OneofProperties{ - Type: reflect.ValueOf(oot).Type(), // *T - Prop: new(Properties), - } - sft := oop.Type.Elem().Field(0) - oop.Prop.Name = sft.Name - oop.Prop.Parse(sft.Tag.Get("protobuf")) - // There will be exactly one interface field that - // this new value is assignable to. - for i := 0; i < t.NumField(); i++ { - f := t.Field(i) - if f.Type.Kind() != reflect.Interface { - continue + switch m := reflect.Zero(reflect.PtrTo(t)).Interface().(type) { + case oneofFuncsIface: + _, _, _, oots = m.XXX_OneofFuncs() + case oneofWrappersIface: + oots = m.XXX_OneofWrappers() + } + if len(oots) > 0 { + // Interpret oneof metadata. + prop.OneofTypes = make(map[string]*OneofProperties) + for _, oot := range oots { + oop := &OneofProperties{ + Type: reflect.ValueOf(oot).Type(), // *T + Prop: new(Properties), } - if !oop.Type.AssignableTo(f.Type) { - continue + sft := oop.Type.Elem().Field(0) + oop.Prop.Name = sft.Name + oop.Prop.Parse(sft.Tag.Get("protobuf")) + // There will be exactly one interface field that + // this new value is assignable to. + for i := 0; i < t.NumField(); i++ { + f := t.Field(i) + if f.Type.Kind() != reflect.Interface { + continue + } + if !oop.Type.AssignableTo(f.Type) { + continue + } + oop.Field = i + break } - oop.Field = i - break + prop.OneofTypes[oop.Prop.OrigName] = oop } - prop.OneofTypes[oop.Prop.OrigName] = oop } } diff --git a/vendor/github.com/gogo/protobuf/proto/table_marshal.go b/vendor/github.com/gogo/protobuf/proto/table_marshal.go index 9b1538d0..f8babdef 100644 --- a/vendor/github.com/gogo/protobuf/proto/table_marshal.go +++ b/vendor/github.com/gogo/protobuf/proto/table_marshal.go @@ -389,8 +389,13 @@ func (u *marshalInfo) computeMarshalInfo() { // get oneof implementers var oneofImplementers []interface{} // gogo: isOneofMessage is needed for embedded oneof messages, without a marshaler and unmarshaler - if m, ok := reflect.Zero(reflect.PtrTo(t)).Interface().(oneofMessage); ok && isOneofMessage { - _, _, _, oneofImplementers = m.XXX_OneofFuncs() + if isOneofMessage { + switch m := reflect.Zero(reflect.PtrTo(t)).Interface().(type) { + case oneofFuncsIface: + _, _, _, oneofImplementers = m.XXX_OneofFuncs() + case oneofWrappersIface: + oneofImplementers = m.XXX_OneofWrappers() + } } // normal fields @@ -519,10 +524,6 @@ func (fi *marshalFieldInfo) computeOneofFieldInfo(f *reflect.StructField, oneofI } } -type oneofMessage interface { - XXX_OneofFuncs() (func(Message, *Buffer) error, func(Message, int, int, *Buffer) (bool, error), func(Message) int, []interface{}) -} - // wiretype returns the wire encoding of the type. func wiretype(encoding string) uint64 { switch encoding { @@ -2968,7 +2969,9 @@ func (p *Buffer) Marshal(pb Message) error { if m, ok := pb.(newMarshaler); ok { siz := m.XXX_Size() p.grow(siz) // make sure buf has enough capacity - p.buf, err = m.XXX_Marshal(p.buf, p.deterministic) + pp := p.buf[len(p.buf) : len(p.buf) : len(p.buf)+siz] + pp, err = m.XXX_Marshal(pp, p.deterministic) + p.buf = append(p.buf, pp...) return err } if m, ok := pb.(Marshaler); ok { diff --git a/vendor/github.com/gogo/protobuf/proto/table_merge.go b/vendor/github.com/gogo/protobuf/proto/table_merge.go index f520106e..60dcf70d 100644 --- a/vendor/github.com/gogo/protobuf/proto/table_merge.go +++ b/vendor/github.com/gogo/protobuf/proto/table_merge.go @@ -530,6 +530,25 @@ func (mi *mergeInfo) computeMergeInfo() { } case reflect.Struct: switch { + case isSlice && !isPointer: // E.g. []pb.T + mergeInfo := getMergeInfo(tf) + zero := reflect.Zero(tf) + mfi.merge = func(dst, src pointer) { + // TODO: Make this faster? + dstsp := dst.asPointerTo(f.Type) + dsts := dstsp.Elem() + srcs := src.asPointerTo(f.Type).Elem() + for i := 0; i < srcs.Len(); i++ { + dsts = reflect.Append(dsts, zero) + srcElement := srcs.Index(i).Addr() + dstElement := dsts.Index(dsts.Len() - 1).Addr() + mergeInfo.merge(valToPointer(dstElement), valToPointer(srcElement)) + } + if dsts.IsNil() { + dsts = reflect.MakeSlice(f.Type, 0, 0) + } + dstsp.Elem().Set(dsts) + } case !isPointer: mergeInfo := getMergeInfo(tf) mfi.merge = func(dst, src pointer) { diff --git a/vendor/github.com/gogo/protobuf/proto/table_unmarshal.go b/vendor/github.com/gogo/protobuf/proto/table_unmarshal.go index bb2622f2..93722938 100644 --- a/vendor/github.com/gogo/protobuf/proto/table_unmarshal.go +++ b/vendor/github.com/gogo/protobuf/proto/table_unmarshal.go @@ -371,15 +371,18 @@ func (u *unmarshalInfo) computeUnmarshalInfo() { } // Find any types associated with oneof fields. - // TODO: XXX_OneofFuncs returns more info than we need. Get rid of some of it? - fn := reflect.Zero(reflect.PtrTo(t)).MethodByName("XXX_OneofFuncs") // gogo: len(oneofFields) > 0 is needed for embedded oneof messages, without a marshaler and unmarshaler - if fn.IsValid() && len(oneofFields) > 0 { - res := fn.Call(nil)[3] // last return value from XXX_OneofFuncs: []interface{} - for i := res.Len() - 1; i >= 0; i-- { - v := res.Index(i) // interface{} - tptr := reflect.ValueOf(v.Interface()).Type() // *Msg_X - typ := tptr.Elem() // Msg_X + if len(oneofFields) > 0 { + var oneofImplementers []interface{} + switch m := reflect.Zero(reflect.PtrTo(t)).Interface().(type) { + case oneofFuncsIface: + _, _, _, oneofImplementers = m.XXX_OneofFuncs() + case oneofWrappersIface: + oneofImplementers = m.XXX_OneofWrappers() + } + for _, v := range oneofImplementers { + tptr := reflect.TypeOf(v) // *Msg_X + typ := tptr.Elem() // Msg_X f := typ.Field(0) // oneof implementers have one field baseUnmarshal := fieldUnmarshaler(&f) @@ -407,11 +410,12 @@ func (u *unmarshalInfo) computeUnmarshalInfo() { u.setTag(fieldNum, of.field, unmarshal, 0, name) } } + } } // Get extension ranges, if any. - fn = reflect.Zero(reflect.PtrTo(t)).MethodByName("ExtensionRangeArray") + fn := reflect.Zero(reflect.PtrTo(t)).MethodByName("ExtensionRangeArray") if fn.IsValid() { if !u.extensions.IsValid() && !u.oldExtensions.IsValid() && !u.bytesExtensions.IsValid() { panic("a message with extensions, but no extensions field in " + t.Name()) diff --git a/vendor/github.com/gogo/protobuf/proto/text.go b/vendor/github.com/gogo/protobuf/proto/text.go index 0407ba85..87416afe 100644 --- a/vendor/github.com/gogo/protobuf/proto/text.go +++ b/vendor/github.com/gogo/protobuf/proto/text.go @@ -476,6 +476,8 @@ func (tm *TextMarshaler) writeStruct(w *textWriter, sv reflect.Value) error { return nil } +var textMarshalerType = reflect.TypeOf((*encoding.TextMarshaler)(nil)).Elem() + // writeAny writes an arbitrary field. func (tm *TextMarshaler) writeAny(w *textWriter, v reflect.Value, props *Properties) error { v = reflect.Indirect(v) @@ -589,8 +591,8 @@ func (tm *TextMarshaler) writeAny(w *textWriter, v reflect.Value, props *Propert // mutating this value. v = v.Addr() } - if etm, ok := v.Interface().(encoding.TextMarshaler); ok { - text, err := etm.MarshalText() + if v.Type().Implements(textMarshalerType) { + text, err := v.Interface().(encoding.TextMarshaler).MarshalText() if err != nil { return err } diff --git a/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/Makefile b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/Makefile new file mode 100644 index 00000000..3496dc99 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/Makefile @@ -0,0 +1,36 @@ +# Go support for Protocol Buffers - Google's data interchange format +# +# Copyright 2010 The Go Authors. All rights reserved. +# https://github.com/golang/protobuf +# +# Redistribution and use in source and binary forms, with or without +# modification, are permitted provided that the following conditions are +# met: +# +# * Redistributions of source code must retain the above copyright +# notice, this list of conditions and the following disclaimer. +# * Redistributions in binary form must reproduce the above +# copyright notice, this list of conditions and the following disclaimer +# in the documentation and/or other materials provided with the +# distribution. +# * Neither the name of Google Inc. nor the names of its +# contributors may be used to endorse or promote products derived from +# this software without specific prior written permission. +# +# THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +# "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +# LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +# A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +# OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +# SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +# LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +# DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +# THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +# (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +# OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +regenerate: + go install github.com/gogo/protobuf/protoc-gen-gogo + go install github.com/gogo/protobuf/protoc-gen-gostring + protoc --gogo_out=. -I=../../protobuf/google/protobuf ../../protobuf/google/protobuf/descriptor.proto + protoc --gostring_out=. -I=../../protobuf/google/protobuf ../../protobuf/google/protobuf/descriptor.proto diff --git a/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor.go b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor.go new file mode 100644 index 00000000..a85bf198 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor.go @@ -0,0 +1,118 @@ +// Go support for Protocol Buffers - Google's data interchange format +// +// Copyright 2016 The Go Authors. All rights reserved. +// https://github.com/golang/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// * Neither the name of Google Inc. nor the names of its +// contributors may be used to endorse or promote products derived from +// this software without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +// Package descriptor provides functions for obtaining protocol buffer +// descriptors for generated Go types. +// +// These functions cannot go in package proto because they depend on the +// generated protobuf descriptor messages, which themselves depend on proto. +package descriptor + +import ( + "bytes" + "compress/gzip" + "fmt" + "io/ioutil" + + "github.com/gogo/protobuf/proto" +) + +// extractFile extracts a FileDescriptorProto from a gzip'd buffer. +func extractFile(gz []byte) (*FileDescriptorProto, error) { + r, err := gzip.NewReader(bytes.NewReader(gz)) + if err != nil { + return nil, fmt.Errorf("failed to open gzip reader: %v", err) + } + defer r.Close() + + b, err := ioutil.ReadAll(r) + if err != nil { + return nil, fmt.Errorf("failed to uncompress descriptor: %v", err) + } + + fd := new(FileDescriptorProto) + if err := proto.Unmarshal(b, fd); err != nil { + return nil, fmt.Errorf("malformed FileDescriptorProto: %v", err) + } + + return fd, nil +} + +// Message is a proto.Message with a method to return its descriptor. +// +// Message types generated by the protocol compiler always satisfy +// the Message interface. +type Message interface { + proto.Message + Descriptor() ([]byte, []int) +} + +// ForMessage returns a FileDescriptorProto and a DescriptorProto from within it +// describing the given message. +func ForMessage(msg Message) (fd *FileDescriptorProto, md *DescriptorProto) { + gz, path := msg.Descriptor() + fd, err := extractFile(gz) + if err != nil { + panic(fmt.Sprintf("invalid FileDescriptorProto for %T: %v", msg, err)) + } + + md = fd.MessageType[path[0]] + for _, i := range path[1:] { + md = md.NestedType[i] + } + return fd, md +} + +// Is this field a scalar numeric type? +func (field *FieldDescriptorProto) IsScalar() bool { + if field.Type == nil { + return false + } + switch *field.Type { + case FieldDescriptorProto_TYPE_DOUBLE, + FieldDescriptorProto_TYPE_FLOAT, + FieldDescriptorProto_TYPE_INT64, + FieldDescriptorProto_TYPE_UINT64, + FieldDescriptorProto_TYPE_INT32, + FieldDescriptorProto_TYPE_FIXED64, + FieldDescriptorProto_TYPE_FIXED32, + FieldDescriptorProto_TYPE_BOOL, + FieldDescriptorProto_TYPE_UINT32, + FieldDescriptorProto_TYPE_ENUM, + FieldDescriptorProto_TYPE_SFIXED32, + FieldDescriptorProto_TYPE_SFIXED64, + FieldDescriptorProto_TYPE_SINT32, + FieldDescriptorProto_TYPE_SINT64: + return true + default: + return false + } +} diff --git a/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor.pb.go b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor.pb.go new file mode 100644 index 00000000..18b2a331 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor.pb.go @@ -0,0 +1,2865 @@ +// Code generated by protoc-gen-gogo. DO NOT EDIT. +// source: descriptor.proto + +package descriptor + +import ( + fmt "fmt" + proto "github.com/gogo/protobuf/proto" + math "math" +) + +// Reference imports to suppress errors if they are not otherwise used. +var _ = proto.Marshal +var _ = fmt.Errorf +var _ = math.Inf + +// This is a compile-time assertion to ensure that this generated file +// is compatible with the proto package it is being compiled against. +// A compilation error at this line likely means your copy of the +// proto package needs to be updated. +const _ = proto.GoGoProtoPackageIsVersion3 // please upgrade the proto package + +type FieldDescriptorProto_Type int32 + +const ( + // 0 is reserved for errors. + // Order is weird for historical reasons. + FieldDescriptorProto_TYPE_DOUBLE FieldDescriptorProto_Type = 1 + FieldDescriptorProto_TYPE_FLOAT FieldDescriptorProto_Type = 2 + // Not ZigZag encoded. Negative numbers take 10 bytes. Use TYPE_SINT64 if + // negative values are likely. + FieldDescriptorProto_TYPE_INT64 FieldDescriptorProto_Type = 3 + FieldDescriptorProto_TYPE_UINT64 FieldDescriptorProto_Type = 4 + // Not ZigZag encoded. Negative numbers take 10 bytes. Use TYPE_SINT32 if + // negative values are likely. + FieldDescriptorProto_TYPE_INT32 FieldDescriptorProto_Type = 5 + FieldDescriptorProto_TYPE_FIXED64 FieldDescriptorProto_Type = 6 + FieldDescriptorProto_TYPE_FIXED32 FieldDescriptorProto_Type = 7 + FieldDescriptorProto_TYPE_BOOL FieldDescriptorProto_Type = 8 + FieldDescriptorProto_TYPE_STRING FieldDescriptorProto_Type = 9 + // Tag-delimited aggregate. + // Group type is deprecated and not supported in proto3. However, Proto3 + // implementations should still be able to parse the group wire format and + // treat group fields as unknown fields. + FieldDescriptorProto_TYPE_GROUP FieldDescriptorProto_Type = 10 + FieldDescriptorProto_TYPE_MESSAGE FieldDescriptorProto_Type = 11 + // New in version 2. + FieldDescriptorProto_TYPE_BYTES FieldDescriptorProto_Type = 12 + FieldDescriptorProto_TYPE_UINT32 FieldDescriptorProto_Type = 13 + FieldDescriptorProto_TYPE_ENUM FieldDescriptorProto_Type = 14 + FieldDescriptorProto_TYPE_SFIXED32 FieldDescriptorProto_Type = 15 + FieldDescriptorProto_TYPE_SFIXED64 FieldDescriptorProto_Type = 16 + FieldDescriptorProto_TYPE_SINT32 FieldDescriptorProto_Type = 17 + FieldDescriptorProto_TYPE_SINT64 FieldDescriptorProto_Type = 18 +) + +var FieldDescriptorProto_Type_name = map[int32]string{ + 1: "TYPE_DOUBLE", + 2: "TYPE_FLOAT", + 3: "TYPE_INT64", + 4: "TYPE_UINT64", + 5: "TYPE_INT32", + 6: "TYPE_FIXED64", + 7: "TYPE_FIXED32", + 8: "TYPE_BOOL", + 9: "TYPE_STRING", + 10: "TYPE_GROUP", + 11: "TYPE_MESSAGE", + 12: "TYPE_BYTES", + 13: "TYPE_UINT32", + 14: "TYPE_ENUM", + 15: "TYPE_SFIXED32", + 16: "TYPE_SFIXED64", + 17: "TYPE_SINT32", + 18: "TYPE_SINT64", +} + +var FieldDescriptorProto_Type_value = map[string]int32{ + "TYPE_DOUBLE": 1, + "TYPE_FLOAT": 2, + "TYPE_INT64": 3, + "TYPE_UINT64": 4, + "TYPE_INT32": 5, + "TYPE_FIXED64": 6, + "TYPE_FIXED32": 7, + "TYPE_BOOL": 8, + "TYPE_STRING": 9, + "TYPE_GROUP": 10, + "TYPE_MESSAGE": 11, + "TYPE_BYTES": 12, + "TYPE_UINT32": 13, + "TYPE_ENUM": 14, + "TYPE_SFIXED32": 15, + "TYPE_SFIXED64": 16, + "TYPE_SINT32": 17, + "TYPE_SINT64": 18, +} + +func (x FieldDescriptorProto_Type) Enum() *FieldDescriptorProto_Type { + p := new(FieldDescriptorProto_Type) + *p = x + return p +} + +func (x FieldDescriptorProto_Type) String() string { + return proto.EnumName(FieldDescriptorProto_Type_name, int32(x)) +} + +func (x *FieldDescriptorProto_Type) UnmarshalJSON(data []byte) error { + value, err := proto.UnmarshalJSONEnum(FieldDescriptorProto_Type_value, data, "FieldDescriptorProto_Type") + if err != nil { + return err + } + *x = FieldDescriptorProto_Type(value) + return nil +} + +func (FieldDescriptorProto_Type) EnumDescriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{4, 0} +} + +type FieldDescriptorProto_Label int32 + +const ( + // 0 is reserved for errors + FieldDescriptorProto_LABEL_OPTIONAL FieldDescriptorProto_Label = 1 + FieldDescriptorProto_LABEL_REQUIRED FieldDescriptorProto_Label = 2 + FieldDescriptorProto_LABEL_REPEATED FieldDescriptorProto_Label = 3 +) + +var FieldDescriptorProto_Label_name = map[int32]string{ + 1: "LABEL_OPTIONAL", + 2: "LABEL_REQUIRED", + 3: "LABEL_REPEATED", +} + +var FieldDescriptorProto_Label_value = map[string]int32{ + "LABEL_OPTIONAL": 1, + "LABEL_REQUIRED": 2, + "LABEL_REPEATED": 3, +} + +func (x FieldDescriptorProto_Label) Enum() *FieldDescriptorProto_Label { + p := new(FieldDescriptorProto_Label) + *p = x + return p +} + +func (x FieldDescriptorProto_Label) String() string { + return proto.EnumName(FieldDescriptorProto_Label_name, int32(x)) +} + +func (x *FieldDescriptorProto_Label) UnmarshalJSON(data []byte) error { + value, err := proto.UnmarshalJSONEnum(FieldDescriptorProto_Label_value, data, "FieldDescriptorProto_Label") + if err != nil { + return err + } + *x = FieldDescriptorProto_Label(value) + return nil +} + +func (FieldDescriptorProto_Label) EnumDescriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{4, 1} +} + +// Generated classes can be optimized for speed or code size. +type FileOptions_OptimizeMode int32 + +const ( + FileOptions_SPEED FileOptions_OptimizeMode = 1 + // etc. + FileOptions_CODE_SIZE FileOptions_OptimizeMode = 2 + FileOptions_LITE_RUNTIME FileOptions_OptimizeMode = 3 +) + +var FileOptions_OptimizeMode_name = map[int32]string{ + 1: "SPEED", + 2: "CODE_SIZE", + 3: "LITE_RUNTIME", +} + +var FileOptions_OptimizeMode_value = map[string]int32{ + "SPEED": 1, + "CODE_SIZE": 2, + "LITE_RUNTIME": 3, +} + +func (x FileOptions_OptimizeMode) Enum() *FileOptions_OptimizeMode { + p := new(FileOptions_OptimizeMode) + *p = x + return p +} + +func (x FileOptions_OptimizeMode) String() string { + return proto.EnumName(FileOptions_OptimizeMode_name, int32(x)) +} + +func (x *FileOptions_OptimizeMode) UnmarshalJSON(data []byte) error { + value, err := proto.UnmarshalJSONEnum(FileOptions_OptimizeMode_value, data, "FileOptions_OptimizeMode") + if err != nil { + return err + } + *x = FileOptions_OptimizeMode(value) + return nil +} + +func (FileOptions_OptimizeMode) EnumDescriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{10, 0} +} + +type FieldOptions_CType int32 + +const ( + // Default mode. + FieldOptions_STRING FieldOptions_CType = 0 + FieldOptions_CORD FieldOptions_CType = 1 + FieldOptions_STRING_PIECE FieldOptions_CType = 2 +) + +var FieldOptions_CType_name = map[int32]string{ + 0: "STRING", + 1: "CORD", + 2: "STRING_PIECE", +} + +var FieldOptions_CType_value = map[string]int32{ + "STRING": 0, + "CORD": 1, + "STRING_PIECE": 2, +} + +func (x FieldOptions_CType) Enum() *FieldOptions_CType { + p := new(FieldOptions_CType) + *p = x + return p +} + +func (x FieldOptions_CType) String() string { + return proto.EnumName(FieldOptions_CType_name, int32(x)) +} + +func (x *FieldOptions_CType) UnmarshalJSON(data []byte) error { + value, err := proto.UnmarshalJSONEnum(FieldOptions_CType_value, data, "FieldOptions_CType") + if err != nil { + return err + } + *x = FieldOptions_CType(value) + return nil +} + +func (FieldOptions_CType) EnumDescriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{12, 0} +} + +type FieldOptions_JSType int32 + +const ( + // Use the default type. + FieldOptions_JS_NORMAL FieldOptions_JSType = 0 + // Use JavaScript strings. + FieldOptions_JS_STRING FieldOptions_JSType = 1 + // Use JavaScript numbers. + FieldOptions_JS_NUMBER FieldOptions_JSType = 2 +) + +var FieldOptions_JSType_name = map[int32]string{ + 0: "JS_NORMAL", + 1: "JS_STRING", + 2: "JS_NUMBER", +} + +var FieldOptions_JSType_value = map[string]int32{ + "JS_NORMAL": 0, + "JS_STRING": 1, + "JS_NUMBER": 2, +} + +func (x FieldOptions_JSType) Enum() *FieldOptions_JSType { + p := new(FieldOptions_JSType) + *p = x + return p +} + +func (x FieldOptions_JSType) String() string { + return proto.EnumName(FieldOptions_JSType_name, int32(x)) +} + +func (x *FieldOptions_JSType) UnmarshalJSON(data []byte) error { + value, err := proto.UnmarshalJSONEnum(FieldOptions_JSType_value, data, "FieldOptions_JSType") + if err != nil { + return err + } + *x = FieldOptions_JSType(value) + return nil +} + +func (FieldOptions_JSType) EnumDescriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{12, 1} +} + +// Is this method side-effect-free (or safe in HTTP parlance), or idempotent, +// or neither? HTTP based RPC implementation may choose GET verb for safe +// methods, and PUT verb for idempotent methods instead of the default POST. +type MethodOptions_IdempotencyLevel int32 + +const ( + MethodOptions_IDEMPOTENCY_UNKNOWN MethodOptions_IdempotencyLevel = 0 + MethodOptions_NO_SIDE_EFFECTS MethodOptions_IdempotencyLevel = 1 + MethodOptions_IDEMPOTENT MethodOptions_IdempotencyLevel = 2 +) + +var MethodOptions_IdempotencyLevel_name = map[int32]string{ + 0: "IDEMPOTENCY_UNKNOWN", + 1: "NO_SIDE_EFFECTS", + 2: "IDEMPOTENT", +} + +var MethodOptions_IdempotencyLevel_value = map[string]int32{ + "IDEMPOTENCY_UNKNOWN": 0, + "NO_SIDE_EFFECTS": 1, + "IDEMPOTENT": 2, +} + +func (x MethodOptions_IdempotencyLevel) Enum() *MethodOptions_IdempotencyLevel { + p := new(MethodOptions_IdempotencyLevel) + *p = x + return p +} + +func (x MethodOptions_IdempotencyLevel) String() string { + return proto.EnumName(MethodOptions_IdempotencyLevel_name, int32(x)) +} + +func (x *MethodOptions_IdempotencyLevel) UnmarshalJSON(data []byte) error { + value, err := proto.UnmarshalJSONEnum(MethodOptions_IdempotencyLevel_value, data, "MethodOptions_IdempotencyLevel") + if err != nil { + return err + } + *x = MethodOptions_IdempotencyLevel(value) + return nil +} + +func (MethodOptions_IdempotencyLevel) EnumDescriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{17, 0} +} + +// The protocol compiler can output a FileDescriptorSet containing the .proto +// files it parses. +type FileDescriptorSet struct { + File []*FileDescriptorProto `protobuf:"bytes,1,rep,name=file" json:"file,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *FileDescriptorSet) Reset() { *m = FileDescriptorSet{} } +func (m *FileDescriptorSet) String() string { return proto.CompactTextString(m) } +func (*FileDescriptorSet) ProtoMessage() {} +func (*FileDescriptorSet) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{0} +} +func (m *FileDescriptorSet) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_FileDescriptorSet.Unmarshal(m, b) +} +func (m *FileDescriptorSet) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_FileDescriptorSet.Marshal(b, m, deterministic) +} +func (m *FileDescriptorSet) XXX_Merge(src proto.Message) { + xxx_messageInfo_FileDescriptorSet.Merge(m, src) +} +func (m *FileDescriptorSet) XXX_Size() int { + return xxx_messageInfo_FileDescriptorSet.Size(m) +} +func (m *FileDescriptorSet) XXX_DiscardUnknown() { + xxx_messageInfo_FileDescriptorSet.DiscardUnknown(m) +} + +var xxx_messageInfo_FileDescriptorSet proto.InternalMessageInfo + +func (m *FileDescriptorSet) GetFile() []*FileDescriptorProto { + if m != nil { + return m.File + } + return nil +} + +// Describes a complete .proto file. +type FileDescriptorProto struct { + Name *string `protobuf:"bytes,1,opt,name=name" json:"name,omitempty"` + Package *string `protobuf:"bytes,2,opt,name=package" json:"package,omitempty"` + // Names of files imported by this file. + Dependency []string `protobuf:"bytes,3,rep,name=dependency" json:"dependency,omitempty"` + // Indexes of the public imported files in the dependency list above. + PublicDependency []int32 `protobuf:"varint,10,rep,name=public_dependency,json=publicDependency" json:"public_dependency,omitempty"` + // Indexes of the weak imported files in the dependency list. + // For Google-internal migration only. Do not use. + WeakDependency []int32 `protobuf:"varint,11,rep,name=weak_dependency,json=weakDependency" json:"weak_dependency,omitempty"` + // All top-level definitions in this file. + MessageType []*DescriptorProto `protobuf:"bytes,4,rep,name=message_type,json=messageType" json:"message_type,omitempty"` + EnumType []*EnumDescriptorProto `protobuf:"bytes,5,rep,name=enum_type,json=enumType" json:"enum_type,omitempty"` + Service []*ServiceDescriptorProto `protobuf:"bytes,6,rep,name=service" json:"service,omitempty"` + Extension []*FieldDescriptorProto `protobuf:"bytes,7,rep,name=extension" json:"extension,omitempty"` + Options *FileOptions `protobuf:"bytes,8,opt,name=options" json:"options,omitempty"` + // This field contains optional information about the original source code. + // You may safely remove this entire field without harming runtime + // functionality of the descriptors -- the information is needed only by + // development tools. + SourceCodeInfo *SourceCodeInfo `protobuf:"bytes,9,opt,name=source_code_info,json=sourceCodeInfo" json:"source_code_info,omitempty"` + // The syntax of the proto file. + // The supported values are "proto2" and "proto3". + Syntax *string `protobuf:"bytes,12,opt,name=syntax" json:"syntax,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *FileDescriptorProto) Reset() { *m = FileDescriptorProto{} } +func (m *FileDescriptorProto) String() string { return proto.CompactTextString(m) } +func (*FileDescriptorProto) ProtoMessage() {} +func (*FileDescriptorProto) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{1} +} +func (m *FileDescriptorProto) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_FileDescriptorProto.Unmarshal(m, b) +} +func (m *FileDescriptorProto) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_FileDescriptorProto.Marshal(b, m, deterministic) +} +func (m *FileDescriptorProto) XXX_Merge(src proto.Message) { + xxx_messageInfo_FileDescriptorProto.Merge(m, src) +} +func (m *FileDescriptorProto) XXX_Size() int { + return xxx_messageInfo_FileDescriptorProto.Size(m) +} +func (m *FileDescriptorProto) XXX_DiscardUnknown() { + xxx_messageInfo_FileDescriptorProto.DiscardUnknown(m) +} + +var xxx_messageInfo_FileDescriptorProto proto.InternalMessageInfo + +func (m *FileDescriptorProto) GetName() string { + if m != nil && m.Name != nil { + return *m.Name + } + return "" +} + +func (m *FileDescriptorProto) GetPackage() string { + if m != nil && m.Package != nil { + return *m.Package + } + return "" +} + +func (m *FileDescriptorProto) GetDependency() []string { + if m != nil { + return m.Dependency + } + return nil +} + +func (m *FileDescriptorProto) GetPublicDependency() []int32 { + if m != nil { + return m.PublicDependency + } + return nil +} + +func (m *FileDescriptorProto) GetWeakDependency() []int32 { + if m != nil { + return m.WeakDependency + } + return nil +} + +func (m *FileDescriptorProto) GetMessageType() []*DescriptorProto { + if m != nil { + return m.MessageType + } + return nil +} + +func (m *FileDescriptorProto) GetEnumType() []*EnumDescriptorProto { + if m != nil { + return m.EnumType + } + return nil +} + +func (m *FileDescriptorProto) GetService() []*ServiceDescriptorProto { + if m != nil { + return m.Service + } + return nil +} + +func (m *FileDescriptorProto) GetExtension() []*FieldDescriptorProto { + if m != nil { + return m.Extension + } + return nil +} + +func (m *FileDescriptorProto) GetOptions() *FileOptions { + if m != nil { + return m.Options + } + return nil +} + +func (m *FileDescriptorProto) GetSourceCodeInfo() *SourceCodeInfo { + if m != nil { + return m.SourceCodeInfo + } + return nil +} + +func (m *FileDescriptorProto) GetSyntax() string { + if m != nil && m.Syntax != nil { + return *m.Syntax + } + return "" +} + +// Describes a message type. +type DescriptorProto struct { + Name *string `protobuf:"bytes,1,opt,name=name" json:"name,omitempty"` + Field []*FieldDescriptorProto `protobuf:"bytes,2,rep,name=field" json:"field,omitempty"` + Extension []*FieldDescriptorProto `protobuf:"bytes,6,rep,name=extension" json:"extension,omitempty"` + NestedType []*DescriptorProto `protobuf:"bytes,3,rep,name=nested_type,json=nestedType" json:"nested_type,omitempty"` + EnumType []*EnumDescriptorProto `protobuf:"bytes,4,rep,name=enum_type,json=enumType" json:"enum_type,omitempty"` + ExtensionRange []*DescriptorProto_ExtensionRange `protobuf:"bytes,5,rep,name=extension_range,json=extensionRange" json:"extension_range,omitempty"` + OneofDecl []*OneofDescriptorProto `protobuf:"bytes,8,rep,name=oneof_decl,json=oneofDecl" json:"oneof_decl,omitempty"` + Options *MessageOptions `protobuf:"bytes,7,opt,name=options" json:"options,omitempty"` + ReservedRange []*DescriptorProto_ReservedRange `protobuf:"bytes,9,rep,name=reserved_range,json=reservedRange" json:"reserved_range,omitempty"` + // Reserved field names, which may not be used by fields in the same message. + // A given name may only be reserved once. + ReservedName []string `protobuf:"bytes,10,rep,name=reserved_name,json=reservedName" json:"reserved_name,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *DescriptorProto) Reset() { *m = DescriptorProto{} } +func (m *DescriptorProto) String() string { return proto.CompactTextString(m) } +func (*DescriptorProto) ProtoMessage() {} +func (*DescriptorProto) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{2} +} +func (m *DescriptorProto) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_DescriptorProto.Unmarshal(m, b) +} +func (m *DescriptorProto) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_DescriptorProto.Marshal(b, m, deterministic) +} +func (m *DescriptorProto) XXX_Merge(src proto.Message) { + xxx_messageInfo_DescriptorProto.Merge(m, src) +} +func (m *DescriptorProto) XXX_Size() int { + return xxx_messageInfo_DescriptorProto.Size(m) +} +func (m *DescriptorProto) XXX_DiscardUnknown() { + xxx_messageInfo_DescriptorProto.DiscardUnknown(m) +} + +var xxx_messageInfo_DescriptorProto proto.InternalMessageInfo + +func (m *DescriptorProto) GetName() string { + if m != nil && m.Name != nil { + return *m.Name + } + return "" +} + +func (m *DescriptorProto) GetField() []*FieldDescriptorProto { + if m != nil { + return m.Field + } + return nil +} + +func (m *DescriptorProto) GetExtension() []*FieldDescriptorProto { + if m != nil { + return m.Extension + } + return nil +} + +func (m *DescriptorProto) GetNestedType() []*DescriptorProto { + if m != nil { + return m.NestedType + } + return nil +} + +func (m *DescriptorProto) GetEnumType() []*EnumDescriptorProto { + if m != nil { + return m.EnumType + } + return nil +} + +func (m *DescriptorProto) GetExtensionRange() []*DescriptorProto_ExtensionRange { + if m != nil { + return m.ExtensionRange + } + return nil +} + +func (m *DescriptorProto) GetOneofDecl() []*OneofDescriptorProto { + if m != nil { + return m.OneofDecl + } + return nil +} + +func (m *DescriptorProto) GetOptions() *MessageOptions { + if m != nil { + return m.Options + } + return nil +} + +func (m *DescriptorProto) GetReservedRange() []*DescriptorProto_ReservedRange { + if m != nil { + return m.ReservedRange + } + return nil +} + +func (m *DescriptorProto) GetReservedName() []string { + if m != nil { + return m.ReservedName + } + return nil +} + +type DescriptorProto_ExtensionRange struct { + Start *int32 `protobuf:"varint,1,opt,name=start" json:"start,omitempty"` + End *int32 `protobuf:"varint,2,opt,name=end" json:"end,omitempty"` + Options *ExtensionRangeOptions `protobuf:"bytes,3,opt,name=options" json:"options,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *DescriptorProto_ExtensionRange) Reset() { *m = DescriptorProto_ExtensionRange{} } +func (m *DescriptorProto_ExtensionRange) String() string { return proto.CompactTextString(m) } +func (*DescriptorProto_ExtensionRange) ProtoMessage() {} +func (*DescriptorProto_ExtensionRange) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{2, 0} +} +func (m *DescriptorProto_ExtensionRange) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_DescriptorProto_ExtensionRange.Unmarshal(m, b) +} +func (m *DescriptorProto_ExtensionRange) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_DescriptorProto_ExtensionRange.Marshal(b, m, deterministic) +} +func (m *DescriptorProto_ExtensionRange) XXX_Merge(src proto.Message) { + xxx_messageInfo_DescriptorProto_ExtensionRange.Merge(m, src) +} +func (m *DescriptorProto_ExtensionRange) XXX_Size() int { + return xxx_messageInfo_DescriptorProto_ExtensionRange.Size(m) +} +func (m *DescriptorProto_ExtensionRange) XXX_DiscardUnknown() { + xxx_messageInfo_DescriptorProto_ExtensionRange.DiscardUnknown(m) +} + +var xxx_messageInfo_DescriptorProto_ExtensionRange proto.InternalMessageInfo + +func (m *DescriptorProto_ExtensionRange) GetStart() int32 { + if m != nil && m.Start != nil { + return *m.Start + } + return 0 +} + +func (m *DescriptorProto_ExtensionRange) GetEnd() int32 { + if m != nil && m.End != nil { + return *m.End + } + return 0 +} + +func (m *DescriptorProto_ExtensionRange) GetOptions() *ExtensionRangeOptions { + if m != nil { + return m.Options + } + return nil +} + +// Range of reserved tag numbers. Reserved tag numbers may not be used by +// fields or extension ranges in the same message. Reserved ranges may +// not overlap. +type DescriptorProto_ReservedRange struct { + Start *int32 `protobuf:"varint,1,opt,name=start" json:"start,omitempty"` + End *int32 `protobuf:"varint,2,opt,name=end" json:"end,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *DescriptorProto_ReservedRange) Reset() { *m = DescriptorProto_ReservedRange{} } +func (m *DescriptorProto_ReservedRange) String() string { return proto.CompactTextString(m) } +func (*DescriptorProto_ReservedRange) ProtoMessage() {} +func (*DescriptorProto_ReservedRange) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{2, 1} +} +func (m *DescriptorProto_ReservedRange) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_DescriptorProto_ReservedRange.Unmarshal(m, b) +} +func (m *DescriptorProto_ReservedRange) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_DescriptorProto_ReservedRange.Marshal(b, m, deterministic) +} +func (m *DescriptorProto_ReservedRange) XXX_Merge(src proto.Message) { + xxx_messageInfo_DescriptorProto_ReservedRange.Merge(m, src) +} +func (m *DescriptorProto_ReservedRange) XXX_Size() int { + return xxx_messageInfo_DescriptorProto_ReservedRange.Size(m) +} +func (m *DescriptorProto_ReservedRange) XXX_DiscardUnknown() { + xxx_messageInfo_DescriptorProto_ReservedRange.DiscardUnknown(m) +} + +var xxx_messageInfo_DescriptorProto_ReservedRange proto.InternalMessageInfo + +func (m *DescriptorProto_ReservedRange) GetStart() int32 { + if m != nil && m.Start != nil { + return *m.Start + } + return 0 +} + +func (m *DescriptorProto_ReservedRange) GetEnd() int32 { + if m != nil && m.End != nil { + return *m.End + } + return 0 +} + +type ExtensionRangeOptions struct { + // The parser stores options it doesn't recognize here. See above. + UninterpretedOption []*UninterpretedOption `protobuf:"bytes,999,rep,name=uninterpreted_option,json=uninterpretedOption" json:"uninterpreted_option,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + proto.XXX_InternalExtensions `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *ExtensionRangeOptions) Reset() { *m = ExtensionRangeOptions{} } +func (m *ExtensionRangeOptions) String() string { return proto.CompactTextString(m) } +func (*ExtensionRangeOptions) ProtoMessage() {} +func (*ExtensionRangeOptions) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{3} +} + +var extRange_ExtensionRangeOptions = []proto.ExtensionRange{ + {Start: 1000, End: 536870911}, +} + +func (*ExtensionRangeOptions) ExtensionRangeArray() []proto.ExtensionRange { + return extRange_ExtensionRangeOptions +} + +func (m *ExtensionRangeOptions) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_ExtensionRangeOptions.Unmarshal(m, b) +} +func (m *ExtensionRangeOptions) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_ExtensionRangeOptions.Marshal(b, m, deterministic) +} +func (m *ExtensionRangeOptions) XXX_Merge(src proto.Message) { + xxx_messageInfo_ExtensionRangeOptions.Merge(m, src) +} +func (m *ExtensionRangeOptions) XXX_Size() int { + return xxx_messageInfo_ExtensionRangeOptions.Size(m) +} +func (m *ExtensionRangeOptions) XXX_DiscardUnknown() { + xxx_messageInfo_ExtensionRangeOptions.DiscardUnknown(m) +} + +var xxx_messageInfo_ExtensionRangeOptions proto.InternalMessageInfo + +func (m *ExtensionRangeOptions) GetUninterpretedOption() []*UninterpretedOption { + if m != nil { + return m.UninterpretedOption + } + return nil +} + +// Describes a field within a message. +type FieldDescriptorProto struct { + Name *string `protobuf:"bytes,1,opt,name=name" json:"name,omitempty"` + Number *int32 `protobuf:"varint,3,opt,name=number" json:"number,omitempty"` + Label *FieldDescriptorProto_Label `protobuf:"varint,4,opt,name=label,enum=google.protobuf.FieldDescriptorProto_Label" json:"label,omitempty"` + // If type_name is set, this need not be set. If both this and type_name + // are set, this must be one of TYPE_ENUM, TYPE_MESSAGE or TYPE_GROUP. + Type *FieldDescriptorProto_Type `protobuf:"varint,5,opt,name=type,enum=google.protobuf.FieldDescriptorProto_Type" json:"type,omitempty"` + // For message and enum types, this is the name of the type. If the name + // starts with a '.', it is fully-qualified. Otherwise, C++-like scoping + // rules are used to find the type (i.e. first the nested types within this + // message are searched, then within the parent, on up to the root + // namespace). + TypeName *string `protobuf:"bytes,6,opt,name=type_name,json=typeName" json:"type_name,omitempty"` + // For extensions, this is the name of the type being extended. It is + // resolved in the same manner as type_name. + Extendee *string `protobuf:"bytes,2,opt,name=extendee" json:"extendee,omitempty"` + // For numeric types, contains the original text representation of the value. + // For booleans, "true" or "false". + // For strings, contains the default text contents (not escaped in any way). + // For bytes, contains the C escaped value. All bytes >= 128 are escaped. + // TODO(kenton): Base-64 encode? + DefaultValue *string `protobuf:"bytes,7,opt,name=default_value,json=defaultValue" json:"default_value,omitempty"` + // If set, gives the index of a oneof in the containing type's oneof_decl + // list. This field is a member of that oneof. + OneofIndex *int32 `protobuf:"varint,9,opt,name=oneof_index,json=oneofIndex" json:"oneof_index,omitempty"` + // JSON name of this field. The value is set by protocol compiler. If the + // user has set a "json_name" option on this field, that option's value + // will be used. Otherwise, it's deduced from the field's name by converting + // it to camelCase. + JsonName *string `protobuf:"bytes,10,opt,name=json_name,json=jsonName" json:"json_name,omitempty"` + Options *FieldOptions `protobuf:"bytes,8,opt,name=options" json:"options,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *FieldDescriptorProto) Reset() { *m = FieldDescriptorProto{} } +func (m *FieldDescriptorProto) String() string { return proto.CompactTextString(m) } +func (*FieldDescriptorProto) ProtoMessage() {} +func (*FieldDescriptorProto) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{4} +} +func (m *FieldDescriptorProto) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_FieldDescriptorProto.Unmarshal(m, b) +} +func (m *FieldDescriptorProto) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_FieldDescriptorProto.Marshal(b, m, deterministic) +} +func (m *FieldDescriptorProto) XXX_Merge(src proto.Message) { + xxx_messageInfo_FieldDescriptorProto.Merge(m, src) +} +func (m *FieldDescriptorProto) XXX_Size() int { + return xxx_messageInfo_FieldDescriptorProto.Size(m) +} +func (m *FieldDescriptorProto) XXX_DiscardUnknown() { + xxx_messageInfo_FieldDescriptorProto.DiscardUnknown(m) +} + +var xxx_messageInfo_FieldDescriptorProto proto.InternalMessageInfo + +func (m *FieldDescriptorProto) GetName() string { + if m != nil && m.Name != nil { + return *m.Name + } + return "" +} + +func (m *FieldDescriptorProto) GetNumber() int32 { + if m != nil && m.Number != nil { + return *m.Number + } + return 0 +} + +func (m *FieldDescriptorProto) GetLabel() FieldDescriptorProto_Label { + if m != nil && m.Label != nil { + return *m.Label + } + return FieldDescriptorProto_LABEL_OPTIONAL +} + +func (m *FieldDescriptorProto) GetType() FieldDescriptorProto_Type { + if m != nil && m.Type != nil { + return *m.Type + } + return FieldDescriptorProto_TYPE_DOUBLE +} + +func (m *FieldDescriptorProto) GetTypeName() string { + if m != nil && m.TypeName != nil { + return *m.TypeName + } + return "" +} + +func (m *FieldDescriptorProto) GetExtendee() string { + if m != nil && m.Extendee != nil { + return *m.Extendee + } + return "" +} + +func (m *FieldDescriptorProto) GetDefaultValue() string { + if m != nil && m.DefaultValue != nil { + return *m.DefaultValue + } + return "" +} + +func (m *FieldDescriptorProto) GetOneofIndex() int32 { + if m != nil && m.OneofIndex != nil { + return *m.OneofIndex + } + return 0 +} + +func (m *FieldDescriptorProto) GetJsonName() string { + if m != nil && m.JsonName != nil { + return *m.JsonName + } + return "" +} + +func (m *FieldDescriptorProto) GetOptions() *FieldOptions { + if m != nil { + return m.Options + } + return nil +} + +// Describes a oneof. +type OneofDescriptorProto struct { + Name *string `protobuf:"bytes,1,opt,name=name" json:"name,omitempty"` + Options *OneofOptions `protobuf:"bytes,2,opt,name=options" json:"options,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *OneofDescriptorProto) Reset() { *m = OneofDescriptorProto{} } +func (m *OneofDescriptorProto) String() string { return proto.CompactTextString(m) } +func (*OneofDescriptorProto) ProtoMessage() {} +func (*OneofDescriptorProto) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{5} +} +func (m *OneofDescriptorProto) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_OneofDescriptorProto.Unmarshal(m, b) +} +func (m *OneofDescriptorProto) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_OneofDescriptorProto.Marshal(b, m, deterministic) +} +func (m *OneofDescriptorProto) XXX_Merge(src proto.Message) { + xxx_messageInfo_OneofDescriptorProto.Merge(m, src) +} +func (m *OneofDescriptorProto) XXX_Size() int { + return xxx_messageInfo_OneofDescriptorProto.Size(m) +} +func (m *OneofDescriptorProto) XXX_DiscardUnknown() { + xxx_messageInfo_OneofDescriptorProto.DiscardUnknown(m) +} + +var xxx_messageInfo_OneofDescriptorProto proto.InternalMessageInfo + +func (m *OneofDescriptorProto) GetName() string { + if m != nil && m.Name != nil { + return *m.Name + } + return "" +} + +func (m *OneofDescriptorProto) GetOptions() *OneofOptions { + if m != nil { + return m.Options + } + return nil +} + +// Describes an enum type. +type EnumDescriptorProto struct { + Name *string `protobuf:"bytes,1,opt,name=name" json:"name,omitempty"` + Value []*EnumValueDescriptorProto `protobuf:"bytes,2,rep,name=value" json:"value,omitempty"` + Options *EnumOptions `protobuf:"bytes,3,opt,name=options" json:"options,omitempty"` + // Range of reserved numeric values. Reserved numeric values may not be used + // by enum values in the same enum declaration. Reserved ranges may not + // overlap. + ReservedRange []*EnumDescriptorProto_EnumReservedRange `protobuf:"bytes,4,rep,name=reserved_range,json=reservedRange" json:"reserved_range,omitempty"` + // Reserved enum value names, which may not be reused. A given name may only + // be reserved once. + ReservedName []string `protobuf:"bytes,5,rep,name=reserved_name,json=reservedName" json:"reserved_name,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *EnumDescriptorProto) Reset() { *m = EnumDescriptorProto{} } +func (m *EnumDescriptorProto) String() string { return proto.CompactTextString(m) } +func (*EnumDescriptorProto) ProtoMessage() {} +func (*EnumDescriptorProto) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{6} +} +func (m *EnumDescriptorProto) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_EnumDescriptorProto.Unmarshal(m, b) +} +func (m *EnumDescriptorProto) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_EnumDescriptorProto.Marshal(b, m, deterministic) +} +func (m *EnumDescriptorProto) XXX_Merge(src proto.Message) { + xxx_messageInfo_EnumDescriptorProto.Merge(m, src) +} +func (m *EnumDescriptorProto) XXX_Size() int { + return xxx_messageInfo_EnumDescriptorProto.Size(m) +} +func (m *EnumDescriptorProto) XXX_DiscardUnknown() { + xxx_messageInfo_EnumDescriptorProto.DiscardUnknown(m) +} + +var xxx_messageInfo_EnumDescriptorProto proto.InternalMessageInfo + +func (m *EnumDescriptorProto) GetName() string { + if m != nil && m.Name != nil { + return *m.Name + } + return "" +} + +func (m *EnumDescriptorProto) GetValue() []*EnumValueDescriptorProto { + if m != nil { + return m.Value + } + return nil +} + +func (m *EnumDescriptorProto) GetOptions() *EnumOptions { + if m != nil { + return m.Options + } + return nil +} + +func (m *EnumDescriptorProto) GetReservedRange() []*EnumDescriptorProto_EnumReservedRange { + if m != nil { + return m.ReservedRange + } + return nil +} + +func (m *EnumDescriptorProto) GetReservedName() []string { + if m != nil { + return m.ReservedName + } + return nil +} + +// Range of reserved numeric values. Reserved values may not be used by +// entries in the same enum. Reserved ranges may not overlap. +// +// Note that this is distinct from DescriptorProto.ReservedRange in that it +// is inclusive such that it can appropriately represent the entire int32 +// domain. +type EnumDescriptorProto_EnumReservedRange struct { + Start *int32 `protobuf:"varint,1,opt,name=start" json:"start,omitempty"` + End *int32 `protobuf:"varint,2,opt,name=end" json:"end,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *EnumDescriptorProto_EnumReservedRange) Reset() { *m = EnumDescriptorProto_EnumReservedRange{} } +func (m *EnumDescriptorProto_EnumReservedRange) String() string { return proto.CompactTextString(m) } +func (*EnumDescriptorProto_EnumReservedRange) ProtoMessage() {} +func (*EnumDescriptorProto_EnumReservedRange) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{6, 0} +} +func (m *EnumDescriptorProto_EnumReservedRange) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_EnumDescriptorProto_EnumReservedRange.Unmarshal(m, b) +} +func (m *EnumDescriptorProto_EnumReservedRange) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_EnumDescriptorProto_EnumReservedRange.Marshal(b, m, deterministic) +} +func (m *EnumDescriptorProto_EnumReservedRange) XXX_Merge(src proto.Message) { + xxx_messageInfo_EnumDescriptorProto_EnumReservedRange.Merge(m, src) +} +func (m *EnumDescriptorProto_EnumReservedRange) XXX_Size() int { + return xxx_messageInfo_EnumDescriptorProto_EnumReservedRange.Size(m) +} +func (m *EnumDescriptorProto_EnumReservedRange) XXX_DiscardUnknown() { + xxx_messageInfo_EnumDescriptorProto_EnumReservedRange.DiscardUnknown(m) +} + +var xxx_messageInfo_EnumDescriptorProto_EnumReservedRange proto.InternalMessageInfo + +func (m *EnumDescriptorProto_EnumReservedRange) GetStart() int32 { + if m != nil && m.Start != nil { + return *m.Start + } + return 0 +} + +func (m *EnumDescriptorProto_EnumReservedRange) GetEnd() int32 { + if m != nil && m.End != nil { + return *m.End + } + return 0 +} + +// Describes a value within an enum. +type EnumValueDescriptorProto struct { + Name *string `protobuf:"bytes,1,opt,name=name" json:"name,omitempty"` + Number *int32 `protobuf:"varint,2,opt,name=number" json:"number,omitempty"` + Options *EnumValueOptions `protobuf:"bytes,3,opt,name=options" json:"options,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *EnumValueDescriptorProto) Reset() { *m = EnumValueDescriptorProto{} } +func (m *EnumValueDescriptorProto) String() string { return proto.CompactTextString(m) } +func (*EnumValueDescriptorProto) ProtoMessage() {} +func (*EnumValueDescriptorProto) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{7} +} +func (m *EnumValueDescriptorProto) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_EnumValueDescriptorProto.Unmarshal(m, b) +} +func (m *EnumValueDescriptorProto) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_EnumValueDescriptorProto.Marshal(b, m, deterministic) +} +func (m *EnumValueDescriptorProto) XXX_Merge(src proto.Message) { + xxx_messageInfo_EnumValueDescriptorProto.Merge(m, src) +} +func (m *EnumValueDescriptorProto) XXX_Size() int { + return xxx_messageInfo_EnumValueDescriptorProto.Size(m) +} +func (m *EnumValueDescriptorProto) XXX_DiscardUnknown() { + xxx_messageInfo_EnumValueDescriptorProto.DiscardUnknown(m) +} + +var xxx_messageInfo_EnumValueDescriptorProto proto.InternalMessageInfo + +func (m *EnumValueDescriptorProto) GetName() string { + if m != nil && m.Name != nil { + return *m.Name + } + return "" +} + +func (m *EnumValueDescriptorProto) GetNumber() int32 { + if m != nil && m.Number != nil { + return *m.Number + } + return 0 +} + +func (m *EnumValueDescriptorProto) GetOptions() *EnumValueOptions { + if m != nil { + return m.Options + } + return nil +} + +// Describes a service. +type ServiceDescriptorProto struct { + Name *string `protobuf:"bytes,1,opt,name=name" json:"name,omitempty"` + Method []*MethodDescriptorProto `protobuf:"bytes,2,rep,name=method" json:"method,omitempty"` + Options *ServiceOptions `protobuf:"bytes,3,opt,name=options" json:"options,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *ServiceDescriptorProto) Reset() { *m = ServiceDescriptorProto{} } +func (m *ServiceDescriptorProto) String() string { return proto.CompactTextString(m) } +func (*ServiceDescriptorProto) ProtoMessage() {} +func (*ServiceDescriptorProto) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{8} +} +func (m *ServiceDescriptorProto) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_ServiceDescriptorProto.Unmarshal(m, b) +} +func (m *ServiceDescriptorProto) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_ServiceDescriptorProto.Marshal(b, m, deterministic) +} +func (m *ServiceDescriptorProto) XXX_Merge(src proto.Message) { + xxx_messageInfo_ServiceDescriptorProto.Merge(m, src) +} +func (m *ServiceDescriptorProto) XXX_Size() int { + return xxx_messageInfo_ServiceDescriptorProto.Size(m) +} +func (m *ServiceDescriptorProto) XXX_DiscardUnknown() { + xxx_messageInfo_ServiceDescriptorProto.DiscardUnknown(m) +} + +var xxx_messageInfo_ServiceDescriptorProto proto.InternalMessageInfo + +func (m *ServiceDescriptorProto) GetName() string { + if m != nil && m.Name != nil { + return *m.Name + } + return "" +} + +func (m *ServiceDescriptorProto) GetMethod() []*MethodDescriptorProto { + if m != nil { + return m.Method + } + return nil +} + +func (m *ServiceDescriptorProto) GetOptions() *ServiceOptions { + if m != nil { + return m.Options + } + return nil +} + +// Describes a method of a service. +type MethodDescriptorProto struct { + Name *string `protobuf:"bytes,1,opt,name=name" json:"name,omitempty"` + // Input and output type names. These are resolved in the same way as + // FieldDescriptorProto.type_name, but must refer to a message type. + InputType *string `protobuf:"bytes,2,opt,name=input_type,json=inputType" json:"input_type,omitempty"` + OutputType *string `protobuf:"bytes,3,opt,name=output_type,json=outputType" json:"output_type,omitempty"` + Options *MethodOptions `protobuf:"bytes,4,opt,name=options" json:"options,omitempty"` + // Identifies if client streams multiple client messages + ClientStreaming *bool `protobuf:"varint,5,opt,name=client_streaming,json=clientStreaming,def=0" json:"client_streaming,omitempty"` + // Identifies if server streams multiple server messages + ServerStreaming *bool `protobuf:"varint,6,opt,name=server_streaming,json=serverStreaming,def=0" json:"server_streaming,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *MethodDescriptorProto) Reset() { *m = MethodDescriptorProto{} } +func (m *MethodDescriptorProto) String() string { return proto.CompactTextString(m) } +func (*MethodDescriptorProto) ProtoMessage() {} +func (*MethodDescriptorProto) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{9} +} +func (m *MethodDescriptorProto) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_MethodDescriptorProto.Unmarshal(m, b) +} +func (m *MethodDescriptorProto) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_MethodDescriptorProto.Marshal(b, m, deterministic) +} +func (m *MethodDescriptorProto) XXX_Merge(src proto.Message) { + xxx_messageInfo_MethodDescriptorProto.Merge(m, src) +} +func (m *MethodDescriptorProto) XXX_Size() int { + return xxx_messageInfo_MethodDescriptorProto.Size(m) +} +func (m *MethodDescriptorProto) XXX_DiscardUnknown() { + xxx_messageInfo_MethodDescriptorProto.DiscardUnknown(m) +} + +var xxx_messageInfo_MethodDescriptorProto proto.InternalMessageInfo + +const Default_MethodDescriptorProto_ClientStreaming bool = false +const Default_MethodDescriptorProto_ServerStreaming bool = false + +func (m *MethodDescriptorProto) GetName() string { + if m != nil && m.Name != nil { + return *m.Name + } + return "" +} + +func (m *MethodDescriptorProto) GetInputType() string { + if m != nil && m.InputType != nil { + return *m.InputType + } + return "" +} + +func (m *MethodDescriptorProto) GetOutputType() string { + if m != nil && m.OutputType != nil { + return *m.OutputType + } + return "" +} + +func (m *MethodDescriptorProto) GetOptions() *MethodOptions { + if m != nil { + return m.Options + } + return nil +} + +func (m *MethodDescriptorProto) GetClientStreaming() bool { + if m != nil && m.ClientStreaming != nil { + return *m.ClientStreaming + } + return Default_MethodDescriptorProto_ClientStreaming +} + +func (m *MethodDescriptorProto) GetServerStreaming() bool { + if m != nil && m.ServerStreaming != nil { + return *m.ServerStreaming + } + return Default_MethodDescriptorProto_ServerStreaming +} + +type FileOptions struct { + // Sets the Java package where classes generated from this .proto will be + // placed. By default, the proto package is used, but this is often + // inappropriate because proto packages do not normally start with backwards + // domain names. + JavaPackage *string `protobuf:"bytes,1,opt,name=java_package,json=javaPackage" json:"java_package,omitempty"` + // If set, all the classes from the .proto file are wrapped in a single + // outer class with the given name. This applies to both Proto1 + // (equivalent to the old "--one_java_file" option) and Proto2 (where + // a .proto always translates to a single class, but you may want to + // explicitly choose the class name). + JavaOuterClassname *string `protobuf:"bytes,8,opt,name=java_outer_classname,json=javaOuterClassname" json:"java_outer_classname,omitempty"` + // If set true, then the Java code generator will generate a separate .java + // file for each top-level message, enum, and service defined in the .proto + // file. Thus, these types will *not* be nested inside the outer class + // named by java_outer_classname. However, the outer class will still be + // generated to contain the file's getDescriptor() method as well as any + // top-level extensions defined in the file. + JavaMultipleFiles *bool `protobuf:"varint,10,opt,name=java_multiple_files,json=javaMultipleFiles,def=0" json:"java_multiple_files,omitempty"` + // This option does nothing. + JavaGenerateEqualsAndHash *bool `protobuf:"varint,20,opt,name=java_generate_equals_and_hash,json=javaGenerateEqualsAndHash" json:"java_generate_equals_and_hash,omitempty"` // Deprecated: Do not use. + // If set true, then the Java2 code generator will generate code that + // throws an exception whenever an attempt is made to assign a non-UTF-8 + // byte sequence to a string field. + // Message reflection will do the same. + // However, an extension field still accepts non-UTF-8 byte sequences. + // This option has no effect on when used with the lite runtime. + JavaStringCheckUtf8 *bool `protobuf:"varint,27,opt,name=java_string_check_utf8,json=javaStringCheckUtf8,def=0" json:"java_string_check_utf8,omitempty"` + OptimizeFor *FileOptions_OptimizeMode `protobuf:"varint,9,opt,name=optimize_for,json=optimizeFor,enum=google.protobuf.FileOptions_OptimizeMode,def=1" json:"optimize_for,omitempty"` + // Sets the Go package where structs generated from this .proto will be + // placed. If omitted, the Go package will be derived from the following: + // - The basename of the package import path, if provided. + // - Otherwise, the package statement in the .proto file, if present. + // - Otherwise, the basename of the .proto file, without extension. + GoPackage *string `protobuf:"bytes,11,opt,name=go_package,json=goPackage" json:"go_package,omitempty"` + // Should generic services be generated in each language? "Generic" services + // are not specific to any particular RPC system. They are generated by the + // main code generators in each language (without additional plugins). + // Generic services were the only kind of service generation supported by + // early versions of google.protobuf. + // + // Generic services are now considered deprecated in favor of using plugins + // that generate code specific to your particular RPC system. Therefore, + // these default to false. Old code which depends on generic services should + // explicitly set them to true. + CcGenericServices *bool `protobuf:"varint,16,opt,name=cc_generic_services,json=ccGenericServices,def=0" json:"cc_generic_services,omitempty"` + JavaGenericServices *bool `protobuf:"varint,17,opt,name=java_generic_services,json=javaGenericServices,def=0" json:"java_generic_services,omitempty"` + PyGenericServices *bool `protobuf:"varint,18,opt,name=py_generic_services,json=pyGenericServices,def=0" json:"py_generic_services,omitempty"` + PhpGenericServices *bool `protobuf:"varint,42,opt,name=php_generic_services,json=phpGenericServices,def=0" json:"php_generic_services,omitempty"` + // Is this file deprecated? + // Depending on the target platform, this can emit Deprecated annotations + // for everything in the file, or it will be completely ignored; in the very + // least, this is a formalization for deprecating files. + Deprecated *bool `protobuf:"varint,23,opt,name=deprecated,def=0" json:"deprecated,omitempty"` + // Enables the use of arenas for the proto messages in this file. This applies + // only to generated classes for C++. + CcEnableArenas *bool `protobuf:"varint,31,opt,name=cc_enable_arenas,json=ccEnableArenas,def=0" json:"cc_enable_arenas,omitempty"` + // Sets the objective c class prefix which is prepended to all objective c + // generated classes from this .proto. There is no default. + ObjcClassPrefix *string `protobuf:"bytes,36,opt,name=objc_class_prefix,json=objcClassPrefix" json:"objc_class_prefix,omitempty"` + // Namespace for generated classes; defaults to the package. + CsharpNamespace *string `protobuf:"bytes,37,opt,name=csharp_namespace,json=csharpNamespace" json:"csharp_namespace,omitempty"` + // By default Swift generators will take the proto package and CamelCase it + // replacing '.' with underscore and use that to prefix the types/symbols + // defined. When this options is provided, they will use this value instead + // to prefix the types/symbols defined. + SwiftPrefix *string `protobuf:"bytes,39,opt,name=swift_prefix,json=swiftPrefix" json:"swift_prefix,omitempty"` + // Sets the php class prefix which is prepended to all php generated classes + // from this .proto. Default is empty. + PhpClassPrefix *string `protobuf:"bytes,40,opt,name=php_class_prefix,json=phpClassPrefix" json:"php_class_prefix,omitempty"` + // Use this option to change the namespace of php generated classes. Default + // is empty. When this option is empty, the package name will be used for + // determining the namespace. + PhpNamespace *string `protobuf:"bytes,41,opt,name=php_namespace,json=phpNamespace" json:"php_namespace,omitempty"` + // Use this option to change the namespace of php generated metadata classes. + // Default is empty. When this option is empty, the proto file name will be + // used for determining the namespace. + PhpMetadataNamespace *string `protobuf:"bytes,44,opt,name=php_metadata_namespace,json=phpMetadataNamespace" json:"php_metadata_namespace,omitempty"` + // Use this option to change the package of ruby generated classes. Default + // is empty. When this option is not set, the package name will be used for + // determining the ruby package. + RubyPackage *string `protobuf:"bytes,45,opt,name=ruby_package,json=rubyPackage" json:"ruby_package,omitempty"` + // The parser stores options it doesn't recognize here. + // See the documentation for the "Options" section above. + UninterpretedOption []*UninterpretedOption `protobuf:"bytes,999,rep,name=uninterpreted_option,json=uninterpretedOption" json:"uninterpreted_option,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + proto.XXX_InternalExtensions `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *FileOptions) Reset() { *m = FileOptions{} } +func (m *FileOptions) String() string { return proto.CompactTextString(m) } +func (*FileOptions) ProtoMessage() {} +func (*FileOptions) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{10} +} + +var extRange_FileOptions = []proto.ExtensionRange{ + {Start: 1000, End: 536870911}, +} + +func (*FileOptions) ExtensionRangeArray() []proto.ExtensionRange { + return extRange_FileOptions +} + +func (m *FileOptions) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_FileOptions.Unmarshal(m, b) +} +func (m *FileOptions) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_FileOptions.Marshal(b, m, deterministic) +} +func (m *FileOptions) XXX_Merge(src proto.Message) { + xxx_messageInfo_FileOptions.Merge(m, src) +} +func (m *FileOptions) XXX_Size() int { + return xxx_messageInfo_FileOptions.Size(m) +} +func (m *FileOptions) XXX_DiscardUnknown() { + xxx_messageInfo_FileOptions.DiscardUnknown(m) +} + +var xxx_messageInfo_FileOptions proto.InternalMessageInfo + +const Default_FileOptions_JavaMultipleFiles bool = false +const Default_FileOptions_JavaStringCheckUtf8 bool = false +const Default_FileOptions_OptimizeFor FileOptions_OptimizeMode = FileOptions_SPEED +const Default_FileOptions_CcGenericServices bool = false +const Default_FileOptions_JavaGenericServices bool = false +const Default_FileOptions_PyGenericServices bool = false +const Default_FileOptions_PhpGenericServices bool = false +const Default_FileOptions_Deprecated bool = false +const Default_FileOptions_CcEnableArenas bool = false + +func (m *FileOptions) GetJavaPackage() string { + if m != nil && m.JavaPackage != nil { + return *m.JavaPackage + } + return "" +} + +func (m *FileOptions) GetJavaOuterClassname() string { + if m != nil && m.JavaOuterClassname != nil { + return *m.JavaOuterClassname + } + return "" +} + +func (m *FileOptions) GetJavaMultipleFiles() bool { + if m != nil && m.JavaMultipleFiles != nil { + return *m.JavaMultipleFiles + } + return Default_FileOptions_JavaMultipleFiles +} + +// Deprecated: Do not use. +func (m *FileOptions) GetJavaGenerateEqualsAndHash() bool { + if m != nil && m.JavaGenerateEqualsAndHash != nil { + return *m.JavaGenerateEqualsAndHash + } + return false +} + +func (m *FileOptions) GetJavaStringCheckUtf8() bool { + if m != nil && m.JavaStringCheckUtf8 != nil { + return *m.JavaStringCheckUtf8 + } + return Default_FileOptions_JavaStringCheckUtf8 +} + +func (m *FileOptions) GetOptimizeFor() FileOptions_OptimizeMode { + if m != nil && m.OptimizeFor != nil { + return *m.OptimizeFor + } + return Default_FileOptions_OptimizeFor +} + +func (m *FileOptions) GetGoPackage() string { + if m != nil && m.GoPackage != nil { + return *m.GoPackage + } + return "" +} + +func (m *FileOptions) GetCcGenericServices() bool { + if m != nil && m.CcGenericServices != nil { + return *m.CcGenericServices + } + return Default_FileOptions_CcGenericServices +} + +func (m *FileOptions) GetJavaGenericServices() bool { + if m != nil && m.JavaGenericServices != nil { + return *m.JavaGenericServices + } + return Default_FileOptions_JavaGenericServices +} + +func (m *FileOptions) GetPyGenericServices() bool { + if m != nil && m.PyGenericServices != nil { + return *m.PyGenericServices + } + return Default_FileOptions_PyGenericServices +} + +func (m *FileOptions) GetPhpGenericServices() bool { + if m != nil && m.PhpGenericServices != nil { + return *m.PhpGenericServices + } + return Default_FileOptions_PhpGenericServices +} + +func (m *FileOptions) GetDeprecated() bool { + if m != nil && m.Deprecated != nil { + return *m.Deprecated + } + return Default_FileOptions_Deprecated +} + +func (m *FileOptions) GetCcEnableArenas() bool { + if m != nil && m.CcEnableArenas != nil { + return *m.CcEnableArenas + } + return Default_FileOptions_CcEnableArenas +} + +func (m *FileOptions) GetObjcClassPrefix() string { + if m != nil && m.ObjcClassPrefix != nil { + return *m.ObjcClassPrefix + } + return "" +} + +func (m *FileOptions) GetCsharpNamespace() string { + if m != nil && m.CsharpNamespace != nil { + return *m.CsharpNamespace + } + return "" +} + +func (m *FileOptions) GetSwiftPrefix() string { + if m != nil && m.SwiftPrefix != nil { + return *m.SwiftPrefix + } + return "" +} + +func (m *FileOptions) GetPhpClassPrefix() string { + if m != nil && m.PhpClassPrefix != nil { + return *m.PhpClassPrefix + } + return "" +} + +func (m *FileOptions) GetPhpNamespace() string { + if m != nil && m.PhpNamespace != nil { + return *m.PhpNamespace + } + return "" +} + +func (m *FileOptions) GetPhpMetadataNamespace() string { + if m != nil && m.PhpMetadataNamespace != nil { + return *m.PhpMetadataNamespace + } + return "" +} + +func (m *FileOptions) GetRubyPackage() string { + if m != nil && m.RubyPackage != nil { + return *m.RubyPackage + } + return "" +} + +func (m *FileOptions) GetUninterpretedOption() []*UninterpretedOption { + if m != nil { + return m.UninterpretedOption + } + return nil +} + +type MessageOptions struct { + // Set true to use the old proto1 MessageSet wire format for extensions. + // This is provided for backwards-compatibility with the MessageSet wire + // format. You should not use this for any other reason: It's less + // efficient, has fewer features, and is more complicated. + // + // The message must be defined exactly as follows: + // message Foo { + // option message_set_wire_format = true; + // extensions 4 to max; + // } + // Note that the message cannot have any defined fields; MessageSets only + // have extensions. + // + // All extensions of your type must be singular messages; e.g. they cannot + // be int32s, enums, or repeated messages. + // + // Because this is an option, the above two restrictions are not enforced by + // the protocol compiler. + MessageSetWireFormat *bool `protobuf:"varint,1,opt,name=message_set_wire_format,json=messageSetWireFormat,def=0" json:"message_set_wire_format,omitempty"` + // Disables the generation of the standard "descriptor()" accessor, which can + // conflict with a field of the same name. This is meant to make migration + // from proto1 easier; new code should avoid fields named "descriptor". + NoStandardDescriptorAccessor *bool `protobuf:"varint,2,opt,name=no_standard_descriptor_accessor,json=noStandardDescriptorAccessor,def=0" json:"no_standard_descriptor_accessor,omitempty"` + // Is this message deprecated? + // Depending on the target platform, this can emit Deprecated annotations + // for the message, or it will be completely ignored; in the very least, + // this is a formalization for deprecating messages. + Deprecated *bool `protobuf:"varint,3,opt,name=deprecated,def=0" json:"deprecated,omitempty"` + // Whether the message is an automatically generated map entry type for the + // maps field. + // + // For maps fields: + // map map_field = 1; + // The parsed descriptor looks like: + // message MapFieldEntry { + // option map_entry = true; + // optional KeyType key = 1; + // optional ValueType value = 2; + // } + // repeated MapFieldEntry map_field = 1; + // + // Implementations may choose not to generate the map_entry=true message, but + // use a native map in the target language to hold the keys and values. + // The reflection APIs in such implementations still need to work as + // if the field is a repeated message field. + // + // NOTE: Do not set the option in .proto files. Always use the maps syntax + // instead. The option should only be implicitly set by the proto compiler + // parser. + MapEntry *bool `protobuf:"varint,7,opt,name=map_entry,json=mapEntry" json:"map_entry,omitempty"` + // The parser stores options it doesn't recognize here. See above. + UninterpretedOption []*UninterpretedOption `protobuf:"bytes,999,rep,name=uninterpreted_option,json=uninterpretedOption" json:"uninterpreted_option,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + proto.XXX_InternalExtensions `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *MessageOptions) Reset() { *m = MessageOptions{} } +func (m *MessageOptions) String() string { return proto.CompactTextString(m) } +func (*MessageOptions) ProtoMessage() {} +func (*MessageOptions) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{11} +} + +var extRange_MessageOptions = []proto.ExtensionRange{ + {Start: 1000, End: 536870911}, +} + +func (*MessageOptions) ExtensionRangeArray() []proto.ExtensionRange { + return extRange_MessageOptions +} + +func (m *MessageOptions) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_MessageOptions.Unmarshal(m, b) +} +func (m *MessageOptions) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_MessageOptions.Marshal(b, m, deterministic) +} +func (m *MessageOptions) XXX_Merge(src proto.Message) { + xxx_messageInfo_MessageOptions.Merge(m, src) +} +func (m *MessageOptions) XXX_Size() int { + return xxx_messageInfo_MessageOptions.Size(m) +} +func (m *MessageOptions) XXX_DiscardUnknown() { + xxx_messageInfo_MessageOptions.DiscardUnknown(m) +} + +var xxx_messageInfo_MessageOptions proto.InternalMessageInfo + +const Default_MessageOptions_MessageSetWireFormat bool = false +const Default_MessageOptions_NoStandardDescriptorAccessor bool = false +const Default_MessageOptions_Deprecated bool = false + +func (m *MessageOptions) GetMessageSetWireFormat() bool { + if m != nil && m.MessageSetWireFormat != nil { + return *m.MessageSetWireFormat + } + return Default_MessageOptions_MessageSetWireFormat +} + +func (m *MessageOptions) GetNoStandardDescriptorAccessor() bool { + if m != nil && m.NoStandardDescriptorAccessor != nil { + return *m.NoStandardDescriptorAccessor + } + return Default_MessageOptions_NoStandardDescriptorAccessor +} + +func (m *MessageOptions) GetDeprecated() bool { + if m != nil && m.Deprecated != nil { + return *m.Deprecated + } + return Default_MessageOptions_Deprecated +} + +func (m *MessageOptions) GetMapEntry() bool { + if m != nil && m.MapEntry != nil { + return *m.MapEntry + } + return false +} + +func (m *MessageOptions) GetUninterpretedOption() []*UninterpretedOption { + if m != nil { + return m.UninterpretedOption + } + return nil +} + +type FieldOptions struct { + // The ctype option instructs the C++ code generator to use a different + // representation of the field than it normally would. See the specific + // options below. This option is not yet implemented in the open source + // release -- sorry, we'll try to include it in a future version! + Ctype *FieldOptions_CType `protobuf:"varint,1,opt,name=ctype,enum=google.protobuf.FieldOptions_CType,def=0" json:"ctype,omitempty"` + // The packed option can be enabled for repeated primitive fields to enable + // a more efficient representation on the wire. Rather than repeatedly + // writing the tag and type for each element, the entire array is encoded as + // a single length-delimited blob. In proto3, only explicit setting it to + // false will avoid using packed encoding. + Packed *bool `protobuf:"varint,2,opt,name=packed" json:"packed,omitempty"` + // The jstype option determines the JavaScript type used for values of the + // field. The option is permitted only for 64 bit integral and fixed types + // (int64, uint64, sint64, fixed64, sfixed64). A field with jstype JS_STRING + // is represented as JavaScript string, which avoids loss of precision that + // can happen when a large value is converted to a floating point JavaScript. + // Specifying JS_NUMBER for the jstype causes the generated JavaScript code to + // use the JavaScript "number" type. The behavior of the default option + // JS_NORMAL is implementation dependent. + // + // This option is an enum to permit additional types to be added, e.g. + // goog.math.Integer. + Jstype *FieldOptions_JSType `protobuf:"varint,6,opt,name=jstype,enum=google.protobuf.FieldOptions_JSType,def=0" json:"jstype,omitempty"` + // Should this field be parsed lazily? Lazy applies only to message-type + // fields. It means that when the outer message is initially parsed, the + // inner message's contents will not be parsed but instead stored in encoded + // form. The inner message will actually be parsed when it is first accessed. + // + // This is only a hint. Implementations are free to choose whether to use + // eager or lazy parsing regardless of the value of this option. However, + // setting this option true suggests that the protocol author believes that + // using lazy parsing on this field is worth the additional bookkeeping + // overhead typically needed to implement it. + // + // This option does not affect the public interface of any generated code; + // all method signatures remain the same. Furthermore, thread-safety of the + // interface is not affected by this option; const methods remain safe to + // call from multiple threads concurrently, while non-const methods continue + // to require exclusive access. + // + // + // Note that implementations may choose not to check required fields within + // a lazy sub-message. That is, calling IsInitialized() on the outer message + // may return true even if the inner message has missing required fields. + // This is necessary because otherwise the inner message would have to be + // parsed in order to perform the check, defeating the purpose of lazy + // parsing. An implementation which chooses not to check required fields + // must be consistent about it. That is, for any particular sub-message, the + // implementation must either *always* check its required fields, or *never* + // check its required fields, regardless of whether or not the message has + // been parsed. + Lazy *bool `protobuf:"varint,5,opt,name=lazy,def=0" json:"lazy,omitempty"` + // Is this field deprecated? + // Depending on the target platform, this can emit Deprecated annotations + // for accessors, or it will be completely ignored; in the very least, this + // is a formalization for deprecating fields. + Deprecated *bool `protobuf:"varint,3,opt,name=deprecated,def=0" json:"deprecated,omitempty"` + // For Google-internal migration only. Do not use. + Weak *bool `protobuf:"varint,10,opt,name=weak,def=0" json:"weak,omitempty"` + // The parser stores options it doesn't recognize here. See above. + UninterpretedOption []*UninterpretedOption `protobuf:"bytes,999,rep,name=uninterpreted_option,json=uninterpretedOption" json:"uninterpreted_option,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + proto.XXX_InternalExtensions `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *FieldOptions) Reset() { *m = FieldOptions{} } +func (m *FieldOptions) String() string { return proto.CompactTextString(m) } +func (*FieldOptions) ProtoMessage() {} +func (*FieldOptions) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{12} +} + +var extRange_FieldOptions = []proto.ExtensionRange{ + {Start: 1000, End: 536870911}, +} + +func (*FieldOptions) ExtensionRangeArray() []proto.ExtensionRange { + return extRange_FieldOptions +} + +func (m *FieldOptions) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_FieldOptions.Unmarshal(m, b) +} +func (m *FieldOptions) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_FieldOptions.Marshal(b, m, deterministic) +} +func (m *FieldOptions) XXX_Merge(src proto.Message) { + xxx_messageInfo_FieldOptions.Merge(m, src) +} +func (m *FieldOptions) XXX_Size() int { + return xxx_messageInfo_FieldOptions.Size(m) +} +func (m *FieldOptions) XXX_DiscardUnknown() { + xxx_messageInfo_FieldOptions.DiscardUnknown(m) +} + +var xxx_messageInfo_FieldOptions proto.InternalMessageInfo + +const Default_FieldOptions_Ctype FieldOptions_CType = FieldOptions_STRING +const Default_FieldOptions_Jstype FieldOptions_JSType = FieldOptions_JS_NORMAL +const Default_FieldOptions_Lazy bool = false +const Default_FieldOptions_Deprecated bool = false +const Default_FieldOptions_Weak bool = false + +func (m *FieldOptions) GetCtype() FieldOptions_CType { + if m != nil && m.Ctype != nil { + return *m.Ctype + } + return Default_FieldOptions_Ctype +} + +func (m *FieldOptions) GetPacked() bool { + if m != nil && m.Packed != nil { + return *m.Packed + } + return false +} + +func (m *FieldOptions) GetJstype() FieldOptions_JSType { + if m != nil && m.Jstype != nil { + return *m.Jstype + } + return Default_FieldOptions_Jstype +} + +func (m *FieldOptions) GetLazy() bool { + if m != nil && m.Lazy != nil { + return *m.Lazy + } + return Default_FieldOptions_Lazy +} + +func (m *FieldOptions) GetDeprecated() bool { + if m != nil && m.Deprecated != nil { + return *m.Deprecated + } + return Default_FieldOptions_Deprecated +} + +func (m *FieldOptions) GetWeak() bool { + if m != nil && m.Weak != nil { + return *m.Weak + } + return Default_FieldOptions_Weak +} + +func (m *FieldOptions) GetUninterpretedOption() []*UninterpretedOption { + if m != nil { + return m.UninterpretedOption + } + return nil +} + +type OneofOptions struct { + // The parser stores options it doesn't recognize here. See above. + UninterpretedOption []*UninterpretedOption `protobuf:"bytes,999,rep,name=uninterpreted_option,json=uninterpretedOption" json:"uninterpreted_option,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + proto.XXX_InternalExtensions `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *OneofOptions) Reset() { *m = OneofOptions{} } +func (m *OneofOptions) String() string { return proto.CompactTextString(m) } +func (*OneofOptions) ProtoMessage() {} +func (*OneofOptions) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{13} +} + +var extRange_OneofOptions = []proto.ExtensionRange{ + {Start: 1000, End: 536870911}, +} + +func (*OneofOptions) ExtensionRangeArray() []proto.ExtensionRange { + return extRange_OneofOptions +} + +func (m *OneofOptions) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_OneofOptions.Unmarshal(m, b) +} +func (m *OneofOptions) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_OneofOptions.Marshal(b, m, deterministic) +} +func (m *OneofOptions) XXX_Merge(src proto.Message) { + xxx_messageInfo_OneofOptions.Merge(m, src) +} +func (m *OneofOptions) XXX_Size() int { + return xxx_messageInfo_OneofOptions.Size(m) +} +func (m *OneofOptions) XXX_DiscardUnknown() { + xxx_messageInfo_OneofOptions.DiscardUnknown(m) +} + +var xxx_messageInfo_OneofOptions proto.InternalMessageInfo + +func (m *OneofOptions) GetUninterpretedOption() []*UninterpretedOption { + if m != nil { + return m.UninterpretedOption + } + return nil +} + +type EnumOptions struct { + // Set this option to true to allow mapping different tag names to the same + // value. + AllowAlias *bool `protobuf:"varint,2,opt,name=allow_alias,json=allowAlias" json:"allow_alias,omitempty"` + // Is this enum deprecated? + // Depending on the target platform, this can emit Deprecated annotations + // for the enum, or it will be completely ignored; in the very least, this + // is a formalization for deprecating enums. + Deprecated *bool `protobuf:"varint,3,opt,name=deprecated,def=0" json:"deprecated,omitempty"` + // The parser stores options it doesn't recognize here. See above. + UninterpretedOption []*UninterpretedOption `protobuf:"bytes,999,rep,name=uninterpreted_option,json=uninterpretedOption" json:"uninterpreted_option,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + proto.XXX_InternalExtensions `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *EnumOptions) Reset() { *m = EnumOptions{} } +func (m *EnumOptions) String() string { return proto.CompactTextString(m) } +func (*EnumOptions) ProtoMessage() {} +func (*EnumOptions) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{14} +} + +var extRange_EnumOptions = []proto.ExtensionRange{ + {Start: 1000, End: 536870911}, +} + +func (*EnumOptions) ExtensionRangeArray() []proto.ExtensionRange { + return extRange_EnumOptions +} + +func (m *EnumOptions) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_EnumOptions.Unmarshal(m, b) +} +func (m *EnumOptions) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_EnumOptions.Marshal(b, m, deterministic) +} +func (m *EnumOptions) XXX_Merge(src proto.Message) { + xxx_messageInfo_EnumOptions.Merge(m, src) +} +func (m *EnumOptions) XXX_Size() int { + return xxx_messageInfo_EnumOptions.Size(m) +} +func (m *EnumOptions) XXX_DiscardUnknown() { + xxx_messageInfo_EnumOptions.DiscardUnknown(m) +} + +var xxx_messageInfo_EnumOptions proto.InternalMessageInfo + +const Default_EnumOptions_Deprecated bool = false + +func (m *EnumOptions) GetAllowAlias() bool { + if m != nil && m.AllowAlias != nil { + return *m.AllowAlias + } + return false +} + +func (m *EnumOptions) GetDeprecated() bool { + if m != nil && m.Deprecated != nil { + return *m.Deprecated + } + return Default_EnumOptions_Deprecated +} + +func (m *EnumOptions) GetUninterpretedOption() []*UninterpretedOption { + if m != nil { + return m.UninterpretedOption + } + return nil +} + +type EnumValueOptions struct { + // Is this enum value deprecated? + // Depending on the target platform, this can emit Deprecated annotations + // for the enum value, or it will be completely ignored; in the very least, + // this is a formalization for deprecating enum values. + Deprecated *bool `protobuf:"varint,1,opt,name=deprecated,def=0" json:"deprecated,omitempty"` + // The parser stores options it doesn't recognize here. See above. + UninterpretedOption []*UninterpretedOption `protobuf:"bytes,999,rep,name=uninterpreted_option,json=uninterpretedOption" json:"uninterpreted_option,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + proto.XXX_InternalExtensions `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *EnumValueOptions) Reset() { *m = EnumValueOptions{} } +func (m *EnumValueOptions) String() string { return proto.CompactTextString(m) } +func (*EnumValueOptions) ProtoMessage() {} +func (*EnumValueOptions) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{15} +} + +var extRange_EnumValueOptions = []proto.ExtensionRange{ + {Start: 1000, End: 536870911}, +} + +func (*EnumValueOptions) ExtensionRangeArray() []proto.ExtensionRange { + return extRange_EnumValueOptions +} + +func (m *EnumValueOptions) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_EnumValueOptions.Unmarshal(m, b) +} +func (m *EnumValueOptions) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_EnumValueOptions.Marshal(b, m, deterministic) +} +func (m *EnumValueOptions) XXX_Merge(src proto.Message) { + xxx_messageInfo_EnumValueOptions.Merge(m, src) +} +func (m *EnumValueOptions) XXX_Size() int { + return xxx_messageInfo_EnumValueOptions.Size(m) +} +func (m *EnumValueOptions) XXX_DiscardUnknown() { + xxx_messageInfo_EnumValueOptions.DiscardUnknown(m) +} + +var xxx_messageInfo_EnumValueOptions proto.InternalMessageInfo + +const Default_EnumValueOptions_Deprecated bool = false + +func (m *EnumValueOptions) GetDeprecated() bool { + if m != nil && m.Deprecated != nil { + return *m.Deprecated + } + return Default_EnumValueOptions_Deprecated +} + +func (m *EnumValueOptions) GetUninterpretedOption() []*UninterpretedOption { + if m != nil { + return m.UninterpretedOption + } + return nil +} + +type ServiceOptions struct { + // Is this service deprecated? + // Depending on the target platform, this can emit Deprecated annotations + // for the service, or it will be completely ignored; in the very least, + // this is a formalization for deprecating services. + Deprecated *bool `protobuf:"varint,33,opt,name=deprecated,def=0" json:"deprecated,omitempty"` + // The parser stores options it doesn't recognize here. See above. + UninterpretedOption []*UninterpretedOption `protobuf:"bytes,999,rep,name=uninterpreted_option,json=uninterpretedOption" json:"uninterpreted_option,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + proto.XXX_InternalExtensions `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *ServiceOptions) Reset() { *m = ServiceOptions{} } +func (m *ServiceOptions) String() string { return proto.CompactTextString(m) } +func (*ServiceOptions) ProtoMessage() {} +func (*ServiceOptions) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{16} +} + +var extRange_ServiceOptions = []proto.ExtensionRange{ + {Start: 1000, End: 536870911}, +} + +func (*ServiceOptions) ExtensionRangeArray() []proto.ExtensionRange { + return extRange_ServiceOptions +} + +func (m *ServiceOptions) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_ServiceOptions.Unmarshal(m, b) +} +func (m *ServiceOptions) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_ServiceOptions.Marshal(b, m, deterministic) +} +func (m *ServiceOptions) XXX_Merge(src proto.Message) { + xxx_messageInfo_ServiceOptions.Merge(m, src) +} +func (m *ServiceOptions) XXX_Size() int { + return xxx_messageInfo_ServiceOptions.Size(m) +} +func (m *ServiceOptions) XXX_DiscardUnknown() { + xxx_messageInfo_ServiceOptions.DiscardUnknown(m) +} + +var xxx_messageInfo_ServiceOptions proto.InternalMessageInfo + +const Default_ServiceOptions_Deprecated bool = false + +func (m *ServiceOptions) GetDeprecated() bool { + if m != nil && m.Deprecated != nil { + return *m.Deprecated + } + return Default_ServiceOptions_Deprecated +} + +func (m *ServiceOptions) GetUninterpretedOption() []*UninterpretedOption { + if m != nil { + return m.UninterpretedOption + } + return nil +} + +type MethodOptions struct { + // Is this method deprecated? + // Depending on the target platform, this can emit Deprecated annotations + // for the method, or it will be completely ignored; in the very least, + // this is a formalization for deprecating methods. + Deprecated *bool `protobuf:"varint,33,opt,name=deprecated,def=0" json:"deprecated,omitempty"` + IdempotencyLevel *MethodOptions_IdempotencyLevel `protobuf:"varint,34,opt,name=idempotency_level,json=idempotencyLevel,enum=google.protobuf.MethodOptions_IdempotencyLevel,def=0" json:"idempotency_level,omitempty"` + // The parser stores options it doesn't recognize here. See above. + UninterpretedOption []*UninterpretedOption `protobuf:"bytes,999,rep,name=uninterpreted_option,json=uninterpretedOption" json:"uninterpreted_option,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + proto.XXX_InternalExtensions `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *MethodOptions) Reset() { *m = MethodOptions{} } +func (m *MethodOptions) String() string { return proto.CompactTextString(m) } +func (*MethodOptions) ProtoMessage() {} +func (*MethodOptions) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{17} +} + +var extRange_MethodOptions = []proto.ExtensionRange{ + {Start: 1000, End: 536870911}, +} + +func (*MethodOptions) ExtensionRangeArray() []proto.ExtensionRange { + return extRange_MethodOptions +} + +func (m *MethodOptions) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_MethodOptions.Unmarshal(m, b) +} +func (m *MethodOptions) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_MethodOptions.Marshal(b, m, deterministic) +} +func (m *MethodOptions) XXX_Merge(src proto.Message) { + xxx_messageInfo_MethodOptions.Merge(m, src) +} +func (m *MethodOptions) XXX_Size() int { + return xxx_messageInfo_MethodOptions.Size(m) +} +func (m *MethodOptions) XXX_DiscardUnknown() { + xxx_messageInfo_MethodOptions.DiscardUnknown(m) +} + +var xxx_messageInfo_MethodOptions proto.InternalMessageInfo + +const Default_MethodOptions_Deprecated bool = false +const Default_MethodOptions_IdempotencyLevel MethodOptions_IdempotencyLevel = MethodOptions_IDEMPOTENCY_UNKNOWN + +func (m *MethodOptions) GetDeprecated() bool { + if m != nil && m.Deprecated != nil { + return *m.Deprecated + } + return Default_MethodOptions_Deprecated +} + +func (m *MethodOptions) GetIdempotencyLevel() MethodOptions_IdempotencyLevel { + if m != nil && m.IdempotencyLevel != nil { + return *m.IdempotencyLevel + } + return Default_MethodOptions_IdempotencyLevel +} + +func (m *MethodOptions) GetUninterpretedOption() []*UninterpretedOption { + if m != nil { + return m.UninterpretedOption + } + return nil +} + +// A message representing a option the parser does not recognize. This only +// appears in options protos created by the compiler::Parser class. +// DescriptorPool resolves these when building Descriptor objects. Therefore, +// options protos in descriptor objects (e.g. returned by Descriptor::options(), +// or produced by Descriptor::CopyTo()) will never have UninterpretedOptions +// in them. +type UninterpretedOption struct { + Name []*UninterpretedOption_NamePart `protobuf:"bytes,2,rep,name=name" json:"name,omitempty"` + // The value of the uninterpreted option, in whatever type the tokenizer + // identified it as during parsing. Exactly one of these should be set. + IdentifierValue *string `protobuf:"bytes,3,opt,name=identifier_value,json=identifierValue" json:"identifier_value,omitempty"` + PositiveIntValue *uint64 `protobuf:"varint,4,opt,name=positive_int_value,json=positiveIntValue" json:"positive_int_value,omitempty"` + NegativeIntValue *int64 `protobuf:"varint,5,opt,name=negative_int_value,json=negativeIntValue" json:"negative_int_value,omitempty"` + DoubleValue *float64 `protobuf:"fixed64,6,opt,name=double_value,json=doubleValue" json:"double_value,omitempty"` + StringValue []byte `protobuf:"bytes,7,opt,name=string_value,json=stringValue" json:"string_value,omitempty"` + AggregateValue *string `protobuf:"bytes,8,opt,name=aggregate_value,json=aggregateValue" json:"aggregate_value,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *UninterpretedOption) Reset() { *m = UninterpretedOption{} } +func (m *UninterpretedOption) String() string { return proto.CompactTextString(m) } +func (*UninterpretedOption) ProtoMessage() {} +func (*UninterpretedOption) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{18} +} +func (m *UninterpretedOption) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_UninterpretedOption.Unmarshal(m, b) +} +func (m *UninterpretedOption) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_UninterpretedOption.Marshal(b, m, deterministic) +} +func (m *UninterpretedOption) XXX_Merge(src proto.Message) { + xxx_messageInfo_UninterpretedOption.Merge(m, src) +} +func (m *UninterpretedOption) XXX_Size() int { + return xxx_messageInfo_UninterpretedOption.Size(m) +} +func (m *UninterpretedOption) XXX_DiscardUnknown() { + xxx_messageInfo_UninterpretedOption.DiscardUnknown(m) +} + +var xxx_messageInfo_UninterpretedOption proto.InternalMessageInfo + +func (m *UninterpretedOption) GetName() []*UninterpretedOption_NamePart { + if m != nil { + return m.Name + } + return nil +} + +func (m *UninterpretedOption) GetIdentifierValue() string { + if m != nil && m.IdentifierValue != nil { + return *m.IdentifierValue + } + return "" +} + +func (m *UninterpretedOption) GetPositiveIntValue() uint64 { + if m != nil && m.PositiveIntValue != nil { + return *m.PositiveIntValue + } + return 0 +} + +func (m *UninterpretedOption) GetNegativeIntValue() int64 { + if m != nil && m.NegativeIntValue != nil { + return *m.NegativeIntValue + } + return 0 +} + +func (m *UninterpretedOption) GetDoubleValue() float64 { + if m != nil && m.DoubleValue != nil { + return *m.DoubleValue + } + return 0 +} + +func (m *UninterpretedOption) GetStringValue() []byte { + if m != nil { + return m.StringValue + } + return nil +} + +func (m *UninterpretedOption) GetAggregateValue() string { + if m != nil && m.AggregateValue != nil { + return *m.AggregateValue + } + return "" +} + +// The name of the uninterpreted option. Each string represents a segment in +// a dot-separated name. is_extension is true iff a segment represents an +// extension (denoted with parentheses in options specs in .proto files). +// E.g.,{ ["foo", false], ["bar.baz", true], ["qux", false] } represents +// "foo.(bar.baz).qux". +type UninterpretedOption_NamePart struct { + NamePart *string `protobuf:"bytes,1,req,name=name_part,json=namePart" json:"name_part,omitempty"` + IsExtension *bool `protobuf:"varint,2,req,name=is_extension,json=isExtension" json:"is_extension,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *UninterpretedOption_NamePart) Reset() { *m = UninterpretedOption_NamePart{} } +func (m *UninterpretedOption_NamePart) String() string { return proto.CompactTextString(m) } +func (*UninterpretedOption_NamePart) ProtoMessage() {} +func (*UninterpretedOption_NamePart) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{18, 0} +} +func (m *UninterpretedOption_NamePart) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_UninterpretedOption_NamePart.Unmarshal(m, b) +} +func (m *UninterpretedOption_NamePart) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_UninterpretedOption_NamePart.Marshal(b, m, deterministic) +} +func (m *UninterpretedOption_NamePart) XXX_Merge(src proto.Message) { + xxx_messageInfo_UninterpretedOption_NamePart.Merge(m, src) +} +func (m *UninterpretedOption_NamePart) XXX_Size() int { + return xxx_messageInfo_UninterpretedOption_NamePart.Size(m) +} +func (m *UninterpretedOption_NamePart) XXX_DiscardUnknown() { + xxx_messageInfo_UninterpretedOption_NamePart.DiscardUnknown(m) +} + +var xxx_messageInfo_UninterpretedOption_NamePart proto.InternalMessageInfo + +func (m *UninterpretedOption_NamePart) GetNamePart() string { + if m != nil && m.NamePart != nil { + return *m.NamePart + } + return "" +} + +func (m *UninterpretedOption_NamePart) GetIsExtension() bool { + if m != nil && m.IsExtension != nil { + return *m.IsExtension + } + return false +} + +// Encapsulates information about the original source file from which a +// FileDescriptorProto was generated. +type SourceCodeInfo struct { + // A Location identifies a piece of source code in a .proto file which + // corresponds to a particular definition. This information is intended + // to be useful to IDEs, code indexers, documentation generators, and similar + // tools. + // + // For example, say we have a file like: + // message Foo { + // optional string foo = 1; + // } + // Let's look at just the field definition: + // optional string foo = 1; + // ^ ^^ ^^ ^ ^^^ + // a bc de f ghi + // We have the following locations: + // span path represents + // [a,i) [ 4, 0, 2, 0 ] The whole field definition. + // [a,b) [ 4, 0, 2, 0, 4 ] The label (optional). + // [c,d) [ 4, 0, 2, 0, 5 ] The type (string). + // [e,f) [ 4, 0, 2, 0, 1 ] The name (foo). + // [g,h) [ 4, 0, 2, 0, 3 ] The number (1). + // + // Notes: + // - A location may refer to a repeated field itself (i.e. not to any + // particular index within it). This is used whenever a set of elements are + // logically enclosed in a single code segment. For example, an entire + // extend block (possibly containing multiple extension definitions) will + // have an outer location whose path refers to the "extensions" repeated + // field without an index. + // - Multiple locations may have the same path. This happens when a single + // logical declaration is spread out across multiple places. The most + // obvious example is the "extend" block again -- there may be multiple + // extend blocks in the same scope, each of which will have the same path. + // - A location's span is not always a subset of its parent's span. For + // example, the "extendee" of an extension declaration appears at the + // beginning of the "extend" block and is shared by all extensions within + // the block. + // - Just because a location's span is a subset of some other location's span + // does not mean that it is a descendant. For example, a "group" defines + // both a type and a field in a single declaration. Thus, the locations + // corresponding to the type and field and their components will overlap. + // - Code which tries to interpret locations should probably be designed to + // ignore those that it doesn't understand, as more types of locations could + // be recorded in the future. + Location []*SourceCodeInfo_Location `protobuf:"bytes,1,rep,name=location" json:"location,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *SourceCodeInfo) Reset() { *m = SourceCodeInfo{} } +func (m *SourceCodeInfo) String() string { return proto.CompactTextString(m) } +func (*SourceCodeInfo) ProtoMessage() {} +func (*SourceCodeInfo) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{19} +} +func (m *SourceCodeInfo) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_SourceCodeInfo.Unmarshal(m, b) +} +func (m *SourceCodeInfo) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_SourceCodeInfo.Marshal(b, m, deterministic) +} +func (m *SourceCodeInfo) XXX_Merge(src proto.Message) { + xxx_messageInfo_SourceCodeInfo.Merge(m, src) +} +func (m *SourceCodeInfo) XXX_Size() int { + return xxx_messageInfo_SourceCodeInfo.Size(m) +} +func (m *SourceCodeInfo) XXX_DiscardUnknown() { + xxx_messageInfo_SourceCodeInfo.DiscardUnknown(m) +} + +var xxx_messageInfo_SourceCodeInfo proto.InternalMessageInfo + +func (m *SourceCodeInfo) GetLocation() []*SourceCodeInfo_Location { + if m != nil { + return m.Location + } + return nil +} + +type SourceCodeInfo_Location struct { + // Identifies which part of the FileDescriptorProto was defined at this + // location. + // + // Each element is a field number or an index. They form a path from + // the root FileDescriptorProto to the place where the definition. For + // example, this path: + // [ 4, 3, 2, 7, 1 ] + // refers to: + // file.message_type(3) // 4, 3 + // .field(7) // 2, 7 + // .name() // 1 + // This is because FileDescriptorProto.message_type has field number 4: + // repeated DescriptorProto message_type = 4; + // and DescriptorProto.field has field number 2: + // repeated FieldDescriptorProto field = 2; + // and FieldDescriptorProto.name has field number 1: + // optional string name = 1; + // + // Thus, the above path gives the location of a field name. If we removed + // the last element: + // [ 4, 3, 2, 7 ] + // this path refers to the whole field declaration (from the beginning + // of the label to the terminating semicolon). + Path []int32 `protobuf:"varint,1,rep,packed,name=path" json:"path,omitempty"` + // Always has exactly three or four elements: start line, start column, + // end line (optional, otherwise assumed same as start line), end column. + // These are packed into a single field for efficiency. Note that line + // and column numbers are zero-based -- typically you will want to add + // 1 to each before displaying to a user. + Span []int32 `protobuf:"varint,2,rep,packed,name=span" json:"span,omitempty"` + // If this SourceCodeInfo represents a complete declaration, these are any + // comments appearing before and after the declaration which appear to be + // attached to the declaration. + // + // A series of line comments appearing on consecutive lines, with no other + // tokens appearing on those lines, will be treated as a single comment. + // + // leading_detached_comments will keep paragraphs of comments that appear + // before (but not connected to) the current element. Each paragraph, + // separated by empty lines, will be one comment element in the repeated + // field. + // + // Only the comment content is provided; comment markers (e.g. //) are + // stripped out. For block comments, leading whitespace and an asterisk + // will be stripped from the beginning of each line other than the first. + // Newlines are included in the output. + // + // Examples: + // + // optional int32 foo = 1; // Comment attached to foo. + // // Comment attached to bar. + // optional int32 bar = 2; + // + // optional string baz = 3; + // // Comment attached to baz. + // // Another line attached to baz. + // + // // Comment attached to qux. + // // + // // Another line attached to qux. + // optional double qux = 4; + // + // // Detached comment for corge. This is not leading or trailing comments + // // to qux or corge because there are blank lines separating it from + // // both. + // + // // Detached comment for corge paragraph 2. + // + // optional string corge = 5; + // /* Block comment attached + // * to corge. Leading asterisks + // * will be removed. */ + // /* Block comment attached to + // * grault. */ + // optional int32 grault = 6; + // + // // ignored detached comments. + LeadingComments *string `protobuf:"bytes,3,opt,name=leading_comments,json=leadingComments" json:"leading_comments,omitempty"` + TrailingComments *string `protobuf:"bytes,4,opt,name=trailing_comments,json=trailingComments" json:"trailing_comments,omitempty"` + LeadingDetachedComments []string `protobuf:"bytes,6,rep,name=leading_detached_comments,json=leadingDetachedComments" json:"leading_detached_comments,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *SourceCodeInfo_Location) Reset() { *m = SourceCodeInfo_Location{} } +func (m *SourceCodeInfo_Location) String() string { return proto.CompactTextString(m) } +func (*SourceCodeInfo_Location) ProtoMessage() {} +func (*SourceCodeInfo_Location) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{19, 0} +} +func (m *SourceCodeInfo_Location) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_SourceCodeInfo_Location.Unmarshal(m, b) +} +func (m *SourceCodeInfo_Location) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_SourceCodeInfo_Location.Marshal(b, m, deterministic) +} +func (m *SourceCodeInfo_Location) XXX_Merge(src proto.Message) { + xxx_messageInfo_SourceCodeInfo_Location.Merge(m, src) +} +func (m *SourceCodeInfo_Location) XXX_Size() int { + return xxx_messageInfo_SourceCodeInfo_Location.Size(m) +} +func (m *SourceCodeInfo_Location) XXX_DiscardUnknown() { + xxx_messageInfo_SourceCodeInfo_Location.DiscardUnknown(m) +} + +var xxx_messageInfo_SourceCodeInfo_Location proto.InternalMessageInfo + +func (m *SourceCodeInfo_Location) GetPath() []int32 { + if m != nil { + return m.Path + } + return nil +} + +func (m *SourceCodeInfo_Location) GetSpan() []int32 { + if m != nil { + return m.Span + } + return nil +} + +func (m *SourceCodeInfo_Location) GetLeadingComments() string { + if m != nil && m.LeadingComments != nil { + return *m.LeadingComments + } + return "" +} + +func (m *SourceCodeInfo_Location) GetTrailingComments() string { + if m != nil && m.TrailingComments != nil { + return *m.TrailingComments + } + return "" +} + +func (m *SourceCodeInfo_Location) GetLeadingDetachedComments() []string { + if m != nil { + return m.LeadingDetachedComments + } + return nil +} + +// Describes the relationship between generated code and its original source +// file. A GeneratedCodeInfo message is associated with only one generated +// source file, but may contain references to different source .proto files. +type GeneratedCodeInfo struct { + // An Annotation connects some span of text in generated code to an element + // of its generating .proto file. + Annotation []*GeneratedCodeInfo_Annotation `protobuf:"bytes,1,rep,name=annotation" json:"annotation,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *GeneratedCodeInfo) Reset() { *m = GeneratedCodeInfo{} } +func (m *GeneratedCodeInfo) String() string { return proto.CompactTextString(m) } +func (*GeneratedCodeInfo) ProtoMessage() {} +func (*GeneratedCodeInfo) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{20} +} +func (m *GeneratedCodeInfo) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_GeneratedCodeInfo.Unmarshal(m, b) +} +func (m *GeneratedCodeInfo) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_GeneratedCodeInfo.Marshal(b, m, deterministic) +} +func (m *GeneratedCodeInfo) XXX_Merge(src proto.Message) { + xxx_messageInfo_GeneratedCodeInfo.Merge(m, src) +} +func (m *GeneratedCodeInfo) XXX_Size() int { + return xxx_messageInfo_GeneratedCodeInfo.Size(m) +} +func (m *GeneratedCodeInfo) XXX_DiscardUnknown() { + xxx_messageInfo_GeneratedCodeInfo.DiscardUnknown(m) +} + +var xxx_messageInfo_GeneratedCodeInfo proto.InternalMessageInfo + +func (m *GeneratedCodeInfo) GetAnnotation() []*GeneratedCodeInfo_Annotation { + if m != nil { + return m.Annotation + } + return nil +} + +type GeneratedCodeInfo_Annotation struct { + // Identifies the element in the original source .proto file. This field + // is formatted the same as SourceCodeInfo.Location.path. + Path []int32 `protobuf:"varint,1,rep,packed,name=path" json:"path,omitempty"` + // Identifies the filesystem path to the original source .proto. + SourceFile *string `protobuf:"bytes,2,opt,name=source_file,json=sourceFile" json:"source_file,omitempty"` + // Identifies the starting offset in bytes in the generated code + // that relates to the identified object. + Begin *int32 `protobuf:"varint,3,opt,name=begin" json:"begin,omitempty"` + // Identifies the ending offset in bytes in the generated code that + // relates to the identified offset. The end offset should be one past + // the last relevant byte (so the length of the text = end - begin). + End *int32 `protobuf:"varint,4,opt,name=end" json:"end,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *GeneratedCodeInfo_Annotation) Reset() { *m = GeneratedCodeInfo_Annotation{} } +func (m *GeneratedCodeInfo_Annotation) String() string { return proto.CompactTextString(m) } +func (*GeneratedCodeInfo_Annotation) ProtoMessage() {} +func (*GeneratedCodeInfo_Annotation) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{20, 0} +} +func (m *GeneratedCodeInfo_Annotation) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_GeneratedCodeInfo_Annotation.Unmarshal(m, b) +} +func (m *GeneratedCodeInfo_Annotation) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_GeneratedCodeInfo_Annotation.Marshal(b, m, deterministic) +} +func (m *GeneratedCodeInfo_Annotation) XXX_Merge(src proto.Message) { + xxx_messageInfo_GeneratedCodeInfo_Annotation.Merge(m, src) +} +func (m *GeneratedCodeInfo_Annotation) XXX_Size() int { + return xxx_messageInfo_GeneratedCodeInfo_Annotation.Size(m) +} +func (m *GeneratedCodeInfo_Annotation) XXX_DiscardUnknown() { + xxx_messageInfo_GeneratedCodeInfo_Annotation.DiscardUnknown(m) +} + +var xxx_messageInfo_GeneratedCodeInfo_Annotation proto.InternalMessageInfo + +func (m *GeneratedCodeInfo_Annotation) GetPath() []int32 { + if m != nil { + return m.Path + } + return nil +} + +func (m *GeneratedCodeInfo_Annotation) GetSourceFile() string { + if m != nil && m.SourceFile != nil { + return *m.SourceFile + } + return "" +} + +func (m *GeneratedCodeInfo_Annotation) GetBegin() int32 { + if m != nil && m.Begin != nil { + return *m.Begin + } + return 0 +} + +func (m *GeneratedCodeInfo_Annotation) GetEnd() int32 { + if m != nil && m.End != nil { + return *m.End + } + return 0 +} + +func init() { + proto.RegisterEnum("google.protobuf.FieldDescriptorProto_Type", FieldDescriptorProto_Type_name, FieldDescriptorProto_Type_value) + proto.RegisterEnum("google.protobuf.FieldDescriptorProto_Label", FieldDescriptorProto_Label_name, FieldDescriptorProto_Label_value) + proto.RegisterEnum("google.protobuf.FileOptions_OptimizeMode", FileOptions_OptimizeMode_name, FileOptions_OptimizeMode_value) + proto.RegisterEnum("google.protobuf.FieldOptions_CType", FieldOptions_CType_name, FieldOptions_CType_value) + proto.RegisterEnum("google.protobuf.FieldOptions_JSType", FieldOptions_JSType_name, FieldOptions_JSType_value) + proto.RegisterEnum("google.protobuf.MethodOptions_IdempotencyLevel", MethodOptions_IdempotencyLevel_name, MethodOptions_IdempotencyLevel_value) + proto.RegisterType((*FileDescriptorSet)(nil), "google.protobuf.FileDescriptorSet") + proto.RegisterType((*FileDescriptorProto)(nil), "google.protobuf.FileDescriptorProto") + proto.RegisterType((*DescriptorProto)(nil), "google.protobuf.DescriptorProto") + proto.RegisterType((*DescriptorProto_ExtensionRange)(nil), "google.protobuf.DescriptorProto.ExtensionRange") + proto.RegisterType((*DescriptorProto_ReservedRange)(nil), "google.protobuf.DescriptorProto.ReservedRange") + proto.RegisterType((*ExtensionRangeOptions)(nil), "google.protobuf.ExtensionRangeOptions") + proto.RegisterType((*FieldDescriptorProto)(nil), "google.protobuf.FieldDescriptorProto") + proto.RegisterType((*OneofDescriptorProto)(nil), "google.protobuf.OneofDescriptorProto") + proto.RegisterType((*EnumDescriptorProto)(nil), "google.protobuf.EnumDescriptorProto") + proto.RegisterType((*EnumDescriptorProto_EnumReservedRange)(nil), "google.protobuf.EnumDescriptorProto.EnumReservedRange") + proto.RegisterType((*EnumValueDescriptorProto)(nil), "google.protobuf.EnumValueDescriptorProto") + proto.RegisterType((*ServiceDescriptorProto)(nil), "google.protobuf.ServiceDescriptorProto") + proto.RegisterType((*MethodDescriptorProto)(nil), "google.protobuf.MethodDescriptorProto") + proto.RegisterType((*FileOptions)(nil), "google.protobuf.FileOptions") + proto.RegisterType((*MessageOptions)(nil), "google.protobuf.MessageOptions") + proto.RegisterType((*FieldOptions)(nil), "google.protobuf.FieldOptions") + proto.RegisterType((*OneofOptions)(nil), "google.protobuf.OneofOptions") + proto.RegisterType((*EnumOptions)(nil), "google.protobuf.EnumOptions") + proto.RegisterType((*EnumValueOptions)(nil), "google.protobuf.EnumValueOptions") + proto.RegisterType((*ServiceOptions)(nil), "google.protobuf.ServiceOptions") + proto.RegisterType((*MethodOptions)(nil), "google.protobuf.MethodOptions") + proto.RegisterType((*UninterpretedOption)(nil), "google.protobuf.UninterpretedOption") + proto.RegisterType((*UninterpretedOption_NamePart)(nil), "google.protobuf.UninterpretedOption.NamePart") + proto.RegisterType((*SourceCodeInfo)(nil), "google.protobuf.SourceCodeInfo") + proto.RegisterType((*SourceCodeInfo_Location)(nil), "google.protobuf.SourceCodeInfo.Location") + proto.RegisterType((*GeneratedCodeInfo)(nil), "google.protobuf.GeneratedCodeInfo") + proto.RegisterType((*GeneratedCodeInfo_Annotation)(nil), "google.protobuf.GeneratedCodeInfo.Annotation") +} + +func init() { proto.RegisterFile("descriptor.proto", fileDescriptor_308767df5ffe18af) } + +var fileDescriptor_308767df5ffe18af = []byte{ + // 2522 bytes of a gzipped FileDescriptorProto + 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0xc4, 0x59, 0xcd, 0x6f, 0xdb, 0xc8, + 0x15, 0x5f, 0x7d, 0x5a, 0x7a, 0x92, 0x65, 0x7a, 0xec, 0x75, 0x18, 0xef, 0x47, 0x1c, 0xed, 0x66, + 0xe3, 0x24, 0xbb, 0xca, 0xc2, 0x49, 0x9c, 0xac, 0x53, 0x6c, 0x2b, 0x4b, 0x8c, 0x57, 0xa9, 0xbe, + 0x4a, 0xc9, 0xdd, 0x64, 0x8b, 0x82, 0x18, 0x93, 0x23, 0x89, 0x09, 0x45, 0x72, 0x49, 0x2a, 0x89, + 0x83, 0x1e, 0x02, 0xf4, 0x54, 0xa0, 0x7f, 0x40, 0x51, 0x14, 0x3d, 0xf4, 0xb2, 0x40, 0xff, 0x80, + 0x02, 0xed, 0xbd, 0xd7, 0x02, 0xbd, 0xf7, 0x50, 0xa0, 0x05, 0xda, 0x3f, 0xa1, 0xc7, 0x62, 0x66, + 0x48, 0x8a, 0xd4, 0x47, 0xe2, 0x5d, 0x20, 0xd9, 0x93, 0x3d, 0xef, 0xfd, 0xde, 0x9b, 0x37, 0x8f, + 0xbf, 0x79, 0xf3, 0x66, 0x04, 0x82, 0x46, 0x5c, 0xd5, 0xd1, 0x6d, 0xcf, 0x72, 0x2a, 0xb6, 0x63, + 0x79, 0x16, 0x5a, 0x1b, 0x5a, 0xd6, 0xd0, 0x20, 0x7c, 0x74, 0x32, 0x19, 0x94, 0x5b, 0xb0, 0x7e, + 0x4f, 0x37, 0x48, 0x3d, 0x04, 0xf6, 0x88, 0x87, 0xee, 0x40, 0x7a, 0xa0, 0x1b, 0x44, 0x4c, 0xec, + 0xa4, 0x76, 0x0b, 0x7b, 0x1f, 0x56, 0x66, 0x8c, 0x2a, 0x71, 0x8b, 0x2e, 0x15, 0xcb, 0xcc, 0xa2, + 0xfc, 0xef, 0x34, 0x6c, 0x2c, 0xd0, 0x22, 0x04, 0x69, 0x13, 0x8f, 0xa9, 0xc7, 0xc4, 0x6e, 0x5e, + 0x66, 0xff, 0x23, 0x11, 0x56, 0x6c, 0xac, 0x3e, 0xc6, 0x43, 0x22, 0x26, 0x99, 0x38, 0x18, 0xa2, + 0xf7, 0x01, 0x34, 0x62, 0x13, 0x53, 0x23, 0xa6, 0x7a, 0x2a, 0xa6, 0x76, 0x52, 0xbb, 0x79, 0x39, + 0x22, 0x41, 0xd7, 0x60, 0xdd, 0x9e, 0x9c, 0x18, 0xba, 0xaa, 0x44, 0x60, 0xb0, 0x93, 0xda, 0xcd, + 0xc8, 0x02, 0x57, 0xd4, 0xa7, 0xe0, 0xcb, 0xb0, 0xf6, 0x94, 0xe0, 0xc7, 0x51, 0x68, 0x81, 0x41, + 0x4b, 0x54, 0x1c, 0x01, 0xd6, 0xa0, 0x38, 0x26, 0xae, 0x8b, 0x87, 0x44, 0xf1, 0x4e, 0x6d, 0x22, + 0xa6, 0xd9, 0xea, 0x77, 0xe6, 0x56, 0x3f, 0xbb, 0xf2, 0x82, 0x6f, 0xd5, 0x3f, 0xb5, 0x09, 0xaa, + 0x42, 0x9e, 0x98, 0x93, 0x31, 0xf7, 0x90, 0x59, 0x92, 0x3f, 0xc9, 0x9c, 0x8c, 0x67, 0xbd, 0xe4, + 0xa8, 0x99, 0xef, 0x62, 0xc5, 0x25, 0xce, 0x13, 0x5d, 0x25, 0x62, 0x96, 0x39, 0xb8, 0x3c, 0xe7, + 0xa0, 0xc7, 0xf5, 0xb3, 0x3e, 0x02, 0x3b, 0x54, 0x83, 0x3c, 0x79, 0xe6, 0x11, 0xd3, 0xd5, 0x2d, + 0x53, 0x5c, 0x61, 0x4e, 0x2e, 0x2d, 0xf8, 0x8a, 0xc4, 0xd0, 0x66, 0x5d, 0x4c, 0xed, 0xd0, 0x3e, + 0xac, 0x58, 0xb6, 0xa7, 0x5b, 0xa6, 0x2b, 0xe6, 0x76, 0x12, 0xbb, 0x85, 0xbd, 0x77, 0x17, 0x12, + 0xa1, 0xc3, 0x31, 0x72, 0x00, 0x46, 0x0d, 0x10, 0x5c, 0x6b, 0xe2, 0xa8, 0x44, 0x51, 0x2d, 0x8d, + 0x28, 0xba, 0x39, 0xb0, 0xc4, 0x3c, 0x73, 0x70, 0x61, 0x7e, 0x21, 0x0c, 0x58, 0xb3, 0x34, 0xd2, + 0x30, 0x07, 0x96, 0x5c, 0x72, 0x63, 0x63, 0xb4, 0x05, 0x59, 0xf7, 0xd4, 0xf4, 0xf0, 0x33, 0xb1, + 0xc8, 0x18, 0xe2, 0x8f, 0xca, 0x7f, 0xce, 0xc2, 0xda, 0x59, 0x28, 0x76, 0x17, 0x32, 0x03, 0xba, + 0x4a, 0x31, 0xf9, 0x6d, 0x72, 0xc0, 0x6d, 0xe2, 0x49, 0xcc, 0x7e, 0xc7, 0x24, 0x56, 0xa1, 0x60, + 0x12, 0xd7, 0x23, 0x1a, 0x67, 0x44, 0xea, 0x8c, 0x9c, 0x02, 0x6e, 0x34, 0x4f, 0xa9, 0xf4, 0x77, + 0xa2, 0xd4, 0x03, 0x58, 0x0b, 0x43, 0x52, 0x1c, 0x6c, 0x0e, 0x03, 0x6e, 0x5e, 0x7f, 0x55, 0x24, + 0x15, 0x29, 0xb0, 0x93, 0xa9, 0x99, 0x5c, 0x22, 0xb1, 0x31, 0xaa, 0x03, 0x58, 0x26, 0xb1, 0x06, + 0x8a, 0x46, 0x54, 0x43, 0xcc, 0x2d, 0xc9, 0x52, 0x87, 0x42, 0xe6, 0xb2, 0x64, 0x71, 0xa9, 0x6a, + 0xa0, 0xcf, 0xa6, 0x54, 0x5b, 0x59, 0xc2, 0x94, 0x16, 0xdf, 0x64, 0x73, 0x6c, 0x3b, 0x86, 0x92, + 0x43, 0x28, 0xef, 0x89, 0xe6, 0xaf, 0x2c, 0xcf, 0x82, 0xa8, 0xbc, 0x72, 0x65, 0xb2, 0x6f, 0xc6, + 0x17, 0xb6, 0xea, 0x44, 0x87, 0xe8, 0x03, 0x08, 0x05, 0x0a, 0xa3, 0x15, 0xb0, 0x2a, 0x54, 0x0c, + 0x84, 0x6d, 0x3c, 0x26, 0xdb, 0xcf, 0xa1, 0x14, 0x4f, 0x0f, 0xda, 0x84, 0x8c, 0xeb, 0x61, 0xc7, + 0x63, 0x2c, 0xcc, 0xc8, 0x7c, 0x80, 0x04, 0x48, 0x11, 0x53, 0x63, 0x55, 0x2e, 0x23, 0xd3, 0x7f, + 0xd1, 0x8f, 0xa6, 0x0b, 0x4e, 0xb1, 0x05, 0x7f, 0x34, 0xff, 0x45, 0x63, 0x9e, 0x67, 0xd7, 0xbd, + 0x7d, 0x1b, 0x56, 0x63, 0x0b, 0x38, 0xeb, 0xd4, 0xe5, 0x5f, 0xc0, 0xdb, 0x0b, 0x5d, 0xa3, 0x07, + 0xb0, 0x39, 0x31, 0x75, 0xd3, 0x23, 0x8e, 0xed, 0x10, 0xca, 0x58, 0x3e, 0x95, 0xf8, 0x9f, 0x95, + 0x25, 0x9c, 0x3b, 0x8e, 0xa2, 0xb9, 0x17, 0x79, 0x63, 0x32, 0x2f, 0xbc, 0x9a, 0xcf, 0xfd, 0x77, + 0x45, 0x78, 0xf1, 0xe2, 0xc5, 0x8b, 0x64, 0xf9, 0x37, 0x59, 0xd8, 0x5c, 0xb4, 0x67, 0x16, 0x6e, + 0xdf, 0x2d, 0xc8, 0x9a, 0x93, 0xf1, 0x09, 0x71, 0x58, 0x92, 0x32, 0xb2, 0x3f, 0x42, 0x55, 0xc8, + 0x18, 0xf8, 0x84, 0x18, 0x62, 0x7a, 0x27, 0xb1, 0x5b, 0xda, 0xbb, 0x76, 0xa6, 0x5d, 0x59, 0x69, + 0x52, 0x13, 0x99, 0x5b, 0xa2, 0xcf, 0x21, 0xed, 0x97, 0x68, 0xea, 0xe1, 0xea, 0xd9, 0x3c, 0xd0, + 0xbd, 0x24, 0x33, 0x3b, 0xf4, 0x0e, 0xe4, 0xe9, 0x5f, 0xce, 0x8d, 0x2c, 0x8b, 0x39, 0x47, 0x05, + 0x94, 0x17, 0x68, 0x1b, 0x72, 0x6c, 0x9b, 0x68, 0x24, 0x38, 0xda, 0xc2, 0x31, 0x25, 0x96, 0x46, + 0x06, 0x78, 0x62, 0x78, 0xca, 0x13, 0x6c, 0x4c, 0x08, 0x23, 0x7c, 0x5e, 0x2e, 0xfa, 0xc2, 0x9f, + 0x52, 0x19, 0xba, 0x00, 0x05, 0xbe, 0xab, 0x74, 0x53, 0x23, 0xcf, 0x58, 0xf5, 0xcc, 0xc8, 0x7c, + 0xa3, 0x35, 0xa8, 0x84, 0x4e, 0xff, 0xc8, 0xb5, 0xcc, 0x80, 0x9a, 0x6c, 0x0a, 0x2a, 0x60, 0xd3, + 0xdf, 0x9e, 0x2d, 0xdc, 0xef, 0x2d, 0x5e, 0xde, 0x2c, 0xa7, 0xca, 0x7f, 0x4a, 0x42, 0x9a, 0xd5, + 0x8b, 0x35, 0x28, 0xf4, 0x1f, 0x76, 0x25, 0xa5, 0xde, 0x39, 0x3e, 0x6c, 0x4a, 0x42, 0x02, 0x95, + 0x00, 0x98, 0xe0, 0x5e, 0xb3, 0x53, 0xed, 0x0b, 0xc9, 0x70, 0xdc, 0x68, 0xf7, 0xf7, 0x6f, 0x0a, + 0xa9, 0xd0, 0xe0, 0x98, 0x0b, 0xd2, 0x51, 0xc0, 0x8d, 0x3d, 0x21, 0x83, 0x04, 0x28, 0x72, 0x07, + 0x8d, 0x07, 0x52, 0x7d, 0xff, 0xa6, 0x90, 0x8d, 0x4b, 0x6e, 0xec, 0x09, 0x2b, 0x68, 0x15, 0xf2, + 0x4c, 0x72, 0xd8, 0xe9, 0x34, 0x85, 0x5c, 0xe8, 0xb3, 0xd7, 0x97, 0x1b, 0xed, 0x23, 0x21, 0x1f, + 0xfa, 0x3c, 0x92, 0x3b, 0xc7, 0x5d, 0x01, 0x42, 0x0f, 0x2d, 0xa9, 0xd7, 0xab, 0x1e, 0x49, 0x42, + 0x21, 0x44, 0x1c, 0x3e, 0xec, 0x4b, 0x3d, 0xa1, 0x18, 0x0b, 0xeb, 0xc6, 0x9e, 0xb0, 0x1a, 0x4e, + 0x21, 0xb5, 0x8f, 0x5b, 0x42, 0x09, 0xad, 0xc3, 0x2a, 0x9f, 0x22, 0x08, 0x62, 0x6d, 0x46, 0xb4, + 0x7f, 0x53, 0x10, 0xa6, 0x81, 0x70, 0x2f, 0xeb, 0x31, 0xc1, 0xfe, 0x4d, 0x01, 0x95, 0x6b, 0x90, + 0x61, 0xec, 0x42, 0x08, 0x4a, 0xcd, 0xea, 0xa1, 0xd4, 0x54, 0x3a, 0xdd, 0x7e, 0xa3, 0xd3, 0xae, + 0x36, 0x85, 0xc4, 0x54, 0x26, 0x4b, 0x3f, 0x39, 0x6e, 0xc8, 0x52, 0x5d, 0x48, 0x46, 0x65, 0x5d, + 0xa9, 0xda, 0x97, 0xea, 0x42, 0xaa, 0xac, 0xc2, 0xe6, 0xa2, 0x3a, 0xb9, 0x70, 0x67, 0x44, 0x3e, + 0x71, 0x72, 0xc9, 0x27, 0x66, 0xbe, 0xe6, 0x3e, 0xf1, 0xbf, 0x92, 0xb0, 0xb1, 0xe0, 0xac, 0x58, + 0x38, 0xc9, 0x0f, 0x21, 0xc3, 0x29, 0xca, 0x4f, 0xcf, 0x2b, 0x0b, 0x0f, 0x1d, 0x46, 0xd8, 0xb9, + 0x13, 0x94, 0xd9, 0x45, 0x3b, 0x88, 0xd4, 0x92, 0x0e, 0x82, 0xba, 0x98, 0xab, 0xe9, 0x3f, 0x9f, + 0xab, 0xe9, 0xfc, 0xd8, 0xdb, 0x3f, 0xcb, 0xb1, 0xc7, 0x64, 0xdf, 0xae, 0xb6, 0x67, 0x16, 0xd4, + 0xf6, 0xbb, 0xb0, 0x3e, 0xe7, 0xe8, 0xcc, 0x35, 0xf6, 0x97, 0x09, 0x10, 0x97, 0x25, 0xe7, 0x15, + 0x95, 0x2e, 0x19, 0xab, 0x74, 0x77, 0x67, 0x33, 0x78, 0x71, 0xf9, 0x47, 0x98, 0xfb, 0xd6, 0xdf, + 0x24, 0x60, 0x6b, 0x71, 0xa7, 0xb8, 0x30, 0x86, 0xcf, 0x21, 0x3b, 0x26, 0xde, 0xc8, 0x0a, 0xba, + 0xa5, 0x8f, 0x16, 0x9c, 0xc1, 0x54, 0x3d, 0xfb, 0xb1, 0x7d, 0xab, 0xe8, 0x21, 0x9e, 0x5a, 0xd6, + 0xee, 0xf1, 0x68, 0xe6, 0x22, 0xfd, 0x55, 0x12, 0xde, 0x5e, 0xe8, 0x7c, 0x61, 0xa0, 0xef, 0x01, + 0xe8, 0xa6, 0x3d, 0xf1, 0x78, 0x47, 0xc4, 0x0b, 0x6c, 0x9e, 0x49, 0x58, 0xf1, 0xa2, 0xc5, 0x73, + 0xe2, 0x85, 0xfa, 0x14, 0xd3, 0x03, 0x17, 0x31, 0xc0, 0x9d, 0x69, 0xa0, 0x69, 0x16, 0xe8, 0xfb, + 0x4b, 0x56, 0x3a, 0x47, 0xcc, 0x4f, 0x41, 0x50, 0x0d, 0x9d, 0x98, 0x9e, 0xe2, 0x7a, 0x0e, 0xc1, + 0x63, 0xdd, 0x1c, 0xb2, 0x13, 0x24, 0x77, 0x90, 0x19, 0x60, 0xc3, 0x25, 0xf2, 0x1a, 0x57, 0xf7, + 0x02, 0x2d, 0xb5, 0x60, 0x04, 0x72, 0x22, 0x16, 0xd9, 0x98, 0x05, 0x57, 0x87, 0x16, 0xe5, 0x5f, + 0xe7, 0xa1, 0x10, 0xe9, 0xab, 0xd1, 0x45, 0x28, 0x3e, 0xc2, 0x4f, 0xb0, 0x12, 0xdc, 0x95, 0x78, + 0x26, 0x0a, 0x54, 0xd6, 0xf5, 0xef, 0x4b, 0x9f, 0xc2, 0x26, 0x83, 0x58, 0x13, 0x8f, 0x38, 0x8a, + 0x6a, 0x60, 0xd7, 0x65, 0x49, 0xcb, 0x31, 0x28, 0xa2, 0xba, 0x0e, 0x55, 0xd5, 0x02, 0x0d, 0xba, + 0x05, 0x1b, 0xcc, 0x62, 0x3c, 0x31, 0x3c, 0xdd, 0x36, 0x88, 0x42, 0x6f, 0x6f, 0x2e, 0x3b, 0x49, + 0xc2, 0xc8, 0xd6, 0x29, 0xa2, 0xe5, 0x03, 0x68, 0x44, 0x2e, 0xaa, 0xc3, 0x7b, 0xcc, 0x6c, 0x48, + 0x4c, 0xe2, 0x60, 0x8f, 0x28, 0xe4, 0xeb, 0x09, 0x36, 0x5c, 0x05, 0x9b, 0x9a, 0x32, 0xc2, 0xee, + 0x48, 0xdc, 0xa4, 0x0e, 0x0e, 0x93, 0x62, 0x42, 0x3e, 0x4f, 0x81, 0x47, 0x3e, 0x4e, 0x62, 0xb0, + 0xaa, 0xa9, 0x7d, 0x81, 0xdd, 0x11, 0x3a, 0x80, 0x2d, 0xe6, 0xc5, 0xf5, 0x1c, 0xdd, 0x1c, 0x2a, + 0xea, 0x88, 0xa8, 0x8f, 0x95, 0x89, 0x37, 0xb8, 0x23, 0xbe, 0x13, 0x9d, 0x9f, 0x45, 0xd8, 0x63, + 0x98, 0x1a, 0x85, 0x1c, 0x7b, 0x83, 0x3b, 0xa8, 0x07, 0x45, 0xfa, 0x31, 0xc6, 0xfa, 0x73, 0xa2, + 0x0c, 0x2c, 0x87, 0x1d, 0x8d, 0xa5, 0x05, 0xa5, 0x29, 0x92, 0xc1, 0x4a, 0xc7, 0x37, 0x68, 0x59, + 0x1a, 0x39, 0xc8, 0xf4, 0xba, 0x92, 0x54, 0x97, 0x0b, 0x81, 0x97, 0x7b, 0x96, 0x43, 0x09, 0x35, + 0xb4, 0xc2, 0x04, 0x17, 0x38, 0xa1, 0x86, 0x56, 0x90, 0xde, 0x5b, 0xb0, 0xa1, 0xaa, 0x7c, 0xcd, + 0xba, 0xaa, 0xf8, 0x77, 0x2c, 0x57, 0x14, 0x62, 0xc9, 0x52, 0xd5, 0x23, 0x0e, 0xf0, 0x39, 0xee, + 0xa2, 0xcf, 0xe0, 0xed, 0x69, 0xb2, 0xa2, 0x86, 0xeb, 0x73, 0xab, 0x9c, 0x35, 0xbd, 0x05, 0x1b, + 0xf6, 0xe9, 0xbc, 0x21, 0x8a, 0xcd, 0x68, 0x9f, 0xce, 0x9a, 0xdd, 0x86, 0x4d, 0x7b, 0x64, 0xcf, + 0xdb, 0x5d, 0x8d, 0xda, 0x21, 0x7b, 0x64, 0xcf, 0x1a, 0x5e, 0x62, 0x17, 0x6e, 0x87, 0xa8, 0xd8, + 0x23, 0x9a, 0x78, 0x2e, 0x0a, 0x8f, 0x28, 0xd0, 0x75, 0x10, 0x54, 0x55, 0x21, 0x26, 0x3e, 0x31, + 0x88, 0x82, 0x1d, 0x62, 0x62, 0x57, 0xbc, 0x10, 0x05, 0x97, 0x54, 0x55, 0x62, 0xda, 0x2a, 0x53, + 0xa2, 0xab, 0xb0, 0x6e, 0x9d, 0x3c, 0x52, 0x39, 0x25, 0x15, 0xdb, 0x21, 0x03, 0xfd, 0x99, 0xf8, + 0x21, 0xcb, 0xef, 0x1a, 0x55, 0x30, 0x42, 0x76, 0x99, 0x18, 0x5d, 0x01, 0x41, 0x75, 0x47, 0xd8, + 0xb1, 0x59, 0x4d, 0x76, 0x6d, 0xac, 0x12, 0xf1, 0x12, 0x87, 0x72, 0x79, 0x3b, 0x10, 0xd3, 0x2d, + 0xe1, 0x3e, 0xd5, 0x07, 0x5e, 0xe0, 0xf1, 0x32, 0xdf, 0x12, 0x4c, 0xe6, 0x7b, 0xdb, 0x05, 0x81, + 0xa6, 0x22, 0x36, 0xf1, 0x2e, 0x83, 0x95, 0xec, 0x91, 0x1d, 0x9d, 0xf7, 0x03, 0x58, 0xa5, 0xc8, + 0xe9, 0xa4, 0x57, 0x78, 0x43, 0x66, 0x8f, 0x22, 0x33, 0xde, 0x84, 0x2d, 0x0a, 0x1a, 0x13, 0x0f, + 0x6b, 0xd8, 0xc3, 0x11, 0xf4, 0xc7, 0x0c, 0x4d, 0xf3, 0xde, 0xf2, 0x95, 0xb1, 0x38, 0x9d, 0xc9, + 0xc9, 0x69, 0xc8, 0xac, 0x4f, 0x78, 0x9c, 0x54, 0x16, 0x70, 0xeb, 0xb5, 0x35, 0xdd, 0xe5, 0x03, + 0x28, 0x46, 0x89, 0x8f, 0xf2, 0xc0, 0xa9, 0x2f, 0x24, 0x68, 0x17, 0x54, 0xeb, 0xd4, 0x69, 0xff, + 0xf2, 0x95, 0x24, 0x24, 0x69, 0x1f, 0xd5, 0x6c, 0xf4, 0x25, 0x45, 0x3e, 0x6e, 0xf7, 0x1b, 0x2d, + 0x49, 0x48, 0x45, 0x1b, 0xf6, 0xbf, 0x26, 0xa1, 0x14, 0xbf, 0x7b, 0xa1, 0x1f, 0xc0, 0xb9, 0xe0, + 0xa1, 0xc4, 0x25, 0x9e, 0xf2, 0x54, 0x77, 0xd8, 0x5e, 0x1c, 0x63, 0x7e, 0x2e, 0x86, 0x6c, 0xd8, + 0xf4, 0x51, 0x3d, 0xe2, 0x7d, 0xa9, 0x3b, 0x74, 0xa7, 0x8d, 0xb1, 0x87, 0x9a, 0x70, 0xc1, 0xb4, + 0x14, 0xd7, 0xc3, 0xa6, 0x86, 0x1d, 0x4d, 0x99, 0x3e, 0x51, 0x29, 0x58, 0x55, 0x89, 0xeb, 0x5a, + 0xfc, 0x0c, 0x0c, 0xbd, 0xbc, 0x6b, 0x5a, 0x3d, 0x1f, 0x3c, 0x3d, 0x1c, 0xaa, 0x3e, 0x74, 0x86, + 0xb9, 0xa9, 0x65, 0xcc, 0x7d, 0x07, 0xf2, 0x63, 0x6c, 0x2b, 0xc4, 0xf4, 0x9c, 0x53, 0xd6, 0x71, + 0xe7, 0xe4, 0xdc, 0x18, 0xdb, 0x12, 0x1d, 0xbf, 0x99, 0x8b, 0xcf, 0x3f, 0x52, 0x50, 0x8c, 0x76, + 0xdd, 0xf4, 0x12, 0xa3, 0xb2, 0x03, 0x2a, 0xc1, 0x4a, 0xd8, 0x07, 0x2f, 0xed, 0xd1, 0x2b, 0x35, + 0x7a, 0x72, 0x1d, 0x64, 0x79, 0x2f, 0x2c, 0x73, 0x4b, 0xda, 0x35, 0x50, 0x6a, 0x11, 0xde, 0x7b, + 0xe4, 0x64, 0x7f, 0x84, 0x8e, 0x20, 0xfb, 0xc8, 0x65, 0xbe, 0xb3, 0xcc, 0xf7, 0x87, 0x2f, 0xf7, + 0x7d, 0xbf, 0xc7, 0x9c, 0xe7, 0xef, 0xf7, 0x94, 0x76, 0x47, 0x6e, 0x55, 0x9b, 0xb2, 0x6f, 0x8e, + 0xce, 0x43, 0xda, 0xc0, 0xcf, 0x4f, 0xe3, 0x67, 0x1c, 0x13, 0x9d, 0x35, 0xf1, 0xe7, 0x21, 0xfd, + 0x94, 0xe0, 0xc7, 0xf1, 0x93, 0x85, 0x89, 0x5e, 0x23, 0xf5, 0xaf, 0x43, 0x86, 0xe5, 0x0b, 0x01, + 0xf8, 0x19, 0x13, 0xde, 0x42, 0x39, 0x48, 0xd7, 0x3a, 0x32, 0xa5, 0xbf, 0x00, 0x45, 0x2e, 0x55, + 0xba, 0x0d, 0xa9, 0x26, 0x09, 0xc9, 0xf2, 0x2d, 0xc8, 0xf2, 0x24, 0xd0, 0xad, 0x11, 0xa6, 0x41, + 0x78, 0xcb, 0x1f, 0xfa, 0x3e, 0x12, 0x81, 0xf6, 0xb8, 0x75, 0x28, 0xc9, 0x42, 0x32, 0xfa, 0x79, + 0x5d, 0x28, 0x46, 0x1b, 0xee, 0x37, 0xc3, 0xa9, 0xbf, 0x24, 0xa0, 0x10, 0x69, 0xa0, 0x69, 0xe7, + 0x83, 0x0d, 0xc3, 0x7a, 0xaa, 0x60, 0x43, 0xc7, 0xae, 0x4f, 0x0a, 0x60, 0xa2, 0x2a, 0x95, 0x9c, + 0xf5, 0xa3, 0xbd, 0x91, 0xe0, 0x7f, 0x9f, 0x00, 0x61, 0xb6, 0x77, 0x9d, 0x09, 0x30, 0xf1, 0xbd, + 0x06, 0xf8, 0xbb, 0x04, 0x94, 0xe2, 0x0d, 0xeb, 0x4c, 0x78, 0x17, 0xbf, 0xd7, 0xf0, 0xfe, 0x99, + 0x84, 0xd5, 0x58, 0x9b, 0x7a, 0xd6, 0xe8, 0xbe, 0x86, 0x75, 0x5d, 0x23, 0x63, 0xdb, 0xf2, 0x88, + 0xa9, 0x9e, 0x2a, 0x06, 0x79, 0x42, 0x0c, 0xb1, 0xcc, 0x0a, 0xc5, 0xf5, 0x97, 0x37, 0xc2, 0x95, + 0xc6, 0xd4, 0xae, 0x49, 0xcd, 0x0e, 0x36, 0x1a, 0x75, 0xa9, 0xd5, 0xed, 0xf4, 0xa5, 0x76, 0xed, + 0xa1, 0x72, 0xdc, 0xfe, 0x71, 0xbb, 0xf3, 0x65, 0x5b, 0x16, 0xf4, 0x19, 0xd8, 0x6b, 0xdc, 0xea, + 0x5d, 0x10, 0x66, 0x83, 0x42, 0xe7, 0x60, 0x51, 0x58, 0xc2, 0x5b, 0x68, 0x03, 0xd6, 0xda, 0x1d, + 0xa5, 0xd7, 0xa8, 0x4b, 0x8a, 0x74, 0xef, 0x9e, 0x54, 0xeb, 0xf7, 0xf8, 0xd3, 0x46, 0x88, 0xee, + 0xc7, 0x37, 0xf5, 0x6f, 0x53, 0xb0, 0xb1, 0x20, 0x12, 0x54, 0xf5, 0x2f, 0x25, 0xfc, 0x9e, 0xf4, + 0xc9, 0x59, 0xa2, 0xaf, 0xd0, 0xae, 0xa0, 0x8b, 0x1d, 0xcf, 0xbf, 0xc3, 0x5c, 0x01, 0x9a, 0x25, + 0xd3, 0xd3, 0x07, 0x3a, 0x71, 0xfc, 0x97, 0x20, 0x7e, 0x53, 0x59, 0x9b, 0xca, 0xf9, 0x63, 0xd0, + 0xc7, 0x80, 0x6c, 0xcb, 0xd5, 0x3d, 0xfd, 0x09, 0x51, 0x74, 0x33, 0x78, 0x36, 0xa2, 0x37, 0x97, + 0xb4, 0x2c, 0x04, 0x9a, 0x86, 0xe9, 0x85, 0x68, 0x93, 0x0c, 0xf1, 0x0c, 0x9a, 0x16, 0xf0, 0x94, + 0x2c, 0x04, 0x9a, 0x10, 0x7d, 0x11, 0x8a, 0x9a, 0x35, 0xa1, 0xed, 0x1c, 0xc7, 0xd1, 0xf3, 0x22, + 0x21, 0x17, 0xb8, 0x2c, 0x84, 0xf8, 0x8d, 0xfa, 0xf4, 0xbd, 0xaa, 0x28, 0x17, 0xb8, 0x8c, 0x43, + 0x2e, 0xc3, 0x1a, 0x1e, 0x0e, 0x1d, 0xea, 0x3c, 0x70, 0xc4, 0xaf, 0x1e, 0xa5, 0x50, 0xcc, 0x80, + 0xdb, 0xf7, 0x21, 0x17, 0xe4, 0x81, 0x1e, 0xc9, 0x34, 0x13, 0x8a, 0xcd, 0xef, 0xd3, 0xc9, 0xdd, + 0xbc, 0x9c, 0x33, 0x03, 0xe5, 0x45, 0x28, 0xea, 0xae, 0x32, 0x7d, 0x7e, 0x4f, 0xee, 0x24, 0x77, + 0x73, 0x72, 0x41, 0x77, 0xc3, 0xa7, 0xcb, 0xf2, 0x37, 0x49, 0x28, 0xc5, 0x7f, 0x3e, 0x40, 0x75, + 0xc8, 0x19, 0x96, 0x8a, 0x19, 0xb5, 0xf8, 0x6f, 0x57, 0xbb, 0xaf, 0xf8, 0xc5, 0xa1, 0xd2, 0xf4, + 0xf1, 0x72, 0x68, 0xb9, 0xfd, 0xb7, 0x04, 0xe4, 0x02, 0x31, 0xda, 0x82, 0xb4, 0x8d, 0xbd, 0x11, + 0x73, 0x97, 0x39, 0x4c, 0x0a, 0x09, 0x99, 0x8d, 0xa9, 0xdc, 0xb5, 0xb1, 0xc9, 0x28, 0xe0, 0xcb, + 0xe9, 0x98, 0x7e, 0x57, 0x83, 0x60, 0x8d, 0xdd, 0x6b, 0xac, 0xf1, 0x98, 0x98, 0x9e, 0x1b, 0x7c, + 0x57, 0x5f, 0x5e, 0xf3, 0xc5, 0xe8, 0x1a, 0xac, 0x7b, 0x0e, 0xd6, 0x8d, 0x18, 0x36, 0xcd, 0xb0, + 0x42, 0xa0, 0x08, 0xc1, 0x07, 0x70, 0x3e, 0xf0, 0xab, 0x11, 0x0f, 0xab, 0x23, 0xa2, 0x4d, 0x8d, + 0xb2, 0xec, 0xfd, 0xe2, 0x9c, 0x0f, 0xa8, 0xfb, 0xfa, 0xc0, 0xb6, 0xfc, 0xf7, 0x04, 0xac, 0x07, + 0x37, 0x31, 0x2d, 0x4c, 0x56, 0x0b, 0x00, 0x9b, 0xa6, 0xe5, 0x45, 0xd3, 0x35, 0x4f, 0xe5, 0x39, + 0xbb, 0x4a, 0x35, 0x34, 0x92, 0x23, 0x0e, 0xb6, 0xc7, 0x00, 0x53, 0xcd, 0xd2, 0xb4, 0x5d, 0x80, + 0x82, 0xff, 0xdb, 0x10, 0xfb, 0x81, 0x91, 0xdf, 0xdd, 0x81, 0x8b, 0xe8, 0x95, 0x0d, 0x6d, 0x42, + 0xe6, 0x84, 0x0c, 0x75, 0xd3, 0x7f, 0xf1, 0xe5, 0x83, 0xe0, 0x85, 0x25, 0x1d, 0xbe, 0xb0, 0x1c, + 0xfe, 0x0c, 0x36, 0x54, 0x6b, 0x3c, 0x1b, 0xee, 0xa1, 0x30, 0xf3, 0x7e, 0xe0, 0x7e, 0x91, 0xf8, + 0x0a, 0xa6, 0x2d, 0xe6, 0xff, 0x12, 0x89, 0x3f, 0x24, 0x53, 0x47, 0xdd, 0xc3, 0x3f, 0x26, 0xb7, + 0x8f, 0xb8, 0x69, 0x37, 0x58, 0xa9, 0x4c, 0x06, 0x06, 0x51, 0x69, 0xf4, 0xff, 0x0f, 0x00, 0x00, + 0xff, 0xff, 0x88, 0x17, 0xc1, 0xbe, 0x38, 0x1d, 0x00, 0x00, +} diff --git a/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor_gostring.gen.go b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor_gostring.gen.go new file mode 100644 index 00000000..165b2110 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor_gostring.gen.go @@ -0,0 +1,752 @@ +// Code generated by protoc-gen-gogo. DO NOT EDIT. +// source: descriptor.proto + +package descriptor + +import ( + fmt "fmt" + github_com_gogo_protobuf_proto "github.com/gogo/protobuf/proto" + proto "github.com/gogo/protobuf/proto" + math "math" + reflect "reflect" + sort "sort" + strconv "strconv" + strings "strings" +) + +// Reference imports to suppress errors if they are not otherwise used. +var _ = proto.Marshal +var _ = fmt.Errorf +var _ = math.Inf + +func (this *FileDescriptorSet) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 5) + s = append(s, "&descriptor.FileDescriptorSet{") + if this.File != nil { + s = append(s, "File: "+fmt.Sprintf("%#v", this.File)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *FileDescriptorProto) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 16) + s = append(s, "&descriptor.FileDescriptorProto{") + if this.Name != nil { + s = append(s, "Name: "+valueToGoStringDescriptor(this.Name, "string")+",\n") + } + if this.Package != nil { + s = append(s, "Package: "+valueToGoStringDescriptor(this.Package, "string")+",\n") + } + if this.Dependency != nil { + s = append(s, "Dependency: "+fmt.Sprintf("%#v", this.Dependency)+",\n") + } + if this.PublicDependency != nil { + s = append(s, "PublicDependency: "+fmt.Sprintf("%#v", this.PublicDependency)+",\n") + } + if this.WeakDependency != nil { + s = append(s, "WeakDependency: "+fmt.Sprintf("%#v", this.WeakDependency)+",\n") + } + if this.MessageType != nil { + s = append(s, "MessageType: "+fmt.Sprintf("%#v", this.MessageType)+",\n") + } + if this.EnumType != nil { + s = append(s, "EnumType: "+fmt.Sprintf("%#v", this.EnumType)+",\n") + } + if this.Service != nil { + s = append(s, "Service: "+fmt.Sprintf("%#v", this.Service)+",\n") + } + if this.Extension != nil { + s = append(s, "Extension: "+fmt.Sprintf("%#v", this.Extension)+",\n") + } + if this.Options != nil { + s = append(s, "Options: "+fmt.Sprintf("%#v", this.Options)+",\n") + } + if this.SourceCodeInfo != nil { + s = append(s, "SourceCodeInfo: "+fmt.Sprintf("%#v", this.SourceCodeInfo)+",\n") + } + if this.Syntax != nil { + s = append(s, "Syntax: "+valueToGoStringDescriptor(this.Syntax, "string")+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *DescriptorProto) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 14) + s = append(s, "&descriptor.DescriptorProto{") + if this.Name != nil { + s = append(s, "Name: "+valueToGoStringDescriptor(this.Name, "string")+",\n") + } + if this.Field != nil { + s = append(s, "Field: "+fmt.Sprintf("%#v", this.Field)+",\n") + } + if this.Extension != nil { + s = append(s, "Extension: "+fmt.Sprintf("%#v", this.Extension)+",\n") + } + if this.NestedType != nil { + s = append(s, "NestedType: "+fmt.Sprintf("%#v", this.NestedType)+",\n") + } + if this.EnumType != nil { + s = append(s, "EnumType: "+fmt.Sprintf("%#v", this.EnumType)+",\n") + } + if this.ExtensionRange != nil { + s = append(s, "ExtensionRange: "+fmt.Sprintf("%#v", this.ExtensionRange)+",\n") + } + if this.OneofDecl != nil { + s = append(s, "OneofDecl: "+fmt.Sprintf("%#v", this.OneofDecl)+",\n") + } + if this.Options != nil { + s = append(s, "Options: "+fmt.Sprintf("%#v", this.Options)+",\n") + } + if this.ReservedRange != nil { + s = append(s, "ReservedRange: "+fmt.Sprintf("%#v", this.ReservedRange)+",\n") + } + if this.ReservedName != nil { + s = append(s, "ReservedName: "+fmt.Sprintf("%#v", this.ReservedName)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *DescriptorProto_ExtensionRange) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 7) + s = append(s, "&descriptor.DescriptorProto_ExtensionRange{") + if this.Start != nil { + s = append(s, "Start: "+valueToGoStringDescriptor(this.Start, "int32")+",\n") + } + if this.End != nil { + s = append(s, "End: "+valueToGoStringDescriptor(this.End, "int32")+",\n") + } + if this.Options != nil { + s = append(s, "Options: "+fmt.Sprintf("%#v", this.Options)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *DescriptorProto_ReservedRange) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 6) + s = append(s, "&descriptor.DescriptorProto_ReservedRange{") + if this.Start != nil { + s = append(s, "Start: "+valueToGoStringDescriptor(this.Start, "int32")+",\n") + } + if this.End != nil { + s = append(s, "End: "+valueToGoStringDescriptor(this.End, "int32")+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *ExtensionRangeOptions) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 5) + s = append(s, "&descriptor.ExtensionRangeOptions{") + if this.UninterpretedOption != nil { + s = append(s, "UninterpretedOption: "+fmt.Sprintf("%#v", this.UninterpretedOption)+",\n") + } + s = append(s, "XXX_InternalExtensions: "+extensionToGoStringDescriptor(this)+",\n") + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *FieldDescriptorProto) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 14) + s = append(s, "&descriptor.FieldDescriptorProto{") + if this.Name != nil { + s = append(s, "Name: "+valueToGoStringDescriptor(this.Name, "string")+",\n") + } + if this.Number != nil { + s = append(s, "Number: "+valueToGoStringDescriptor(this.Number, "int32")+",\n") + } + if this.Label != nil { + s = append(s, "Label: "+valueToGoStringDescriptor(this.Label, "FieldDescriptorProto_Label")+",\n") + } + if this.Type != nil { + s = append(s, "Type: "+valueToGoStringDescriptor(this.Type, "FieldDescriptorProto_Type")+",\n") + } + if this.TypeName != nil { + s = append(s, "TypeName: "+valueToGoStringDescriptor(this.TypeName, "string")+",\n") + } + if this.Extendee != nil { + s = append(s, "Extendee: "+valueToGoStringDescriptor(this.Extendee, "string")+",\n") + } + if this.DefaultValue != nil { + s = append(s, "DefaultValue: "+valueToGoStringDescriptor(this.DefaultValue, "string")+",\n") + } + if this.OneofIndex != nil { + s = append(s, "OneofIndex: "+valueToGoStringDescriptor(this.OneofIndex, "int32")+",\n") + } + if this.JsonName != nil { + s = append(s, "JsonName: "+valueToGoStringDescriptor(this.JsonName, "string")+",\n") + } + if this.Options != nil { + s = append(s, "Options: "+fmt.Sprintf("%#v", this.Options)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *OneofDescriptorProto) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 6) + s = append(s, "&descriptor.OneofDescriptorProto{") + if this.Name != nil { + s = append(s, "Name: "+valueToGoStringDescriptor(this.Name, "string")+",\n") + } + if this.Options != nil { + s = append(s, "Options: "+fmt.Sprintf("%#v", this.Options)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *EnumDescriptorProto) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 9) + s = append(s, "&descriptor.EnumDescriptorProto{") + if this.Name != nil { + s = append(s, "Name: "+valueToGoStringDescriptor(this.Name, "string")+",\n") + } + if this.Value != nil { + s = append(s, "Value: "+fmt.Sprintf("%#v", this.Value)+",\n") + } + if this.Options != nil { + s = append(s, "Options: "+fmt.Sprintf("%#v", this.Options)+",\n") + } + if this.ReservedRange != nil { + s = append(s, "ReservedRange: "+fmt.Sprintf("%#v", this.ReservedRange)+",\n") + } + if this.ReservedName != nil { + s = append(s, "ReservedName: "+fmt.Sprintf("%#v", this.ReservedName)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *EnumDescriptorProto_EnumReservedRange) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 6) + s = append(s, "&descriptor.EnumDescriptorProto_EnumReservedRange{") + if this.Start != nil { + s = append(s, "Start: "+valueToGoStringDescriptor(this.Start, "int32")+",\n") + } + if this.End != nil { + s = append(s, "End: "+valueToGoStringDescriptor(this.End, "int32")+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *EnumValueDescriptorProto) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 7) + s = append(s, "&descriptor.EnumValueDescriptorProto{") + if this.Name != nil { + s = append(s, "Name: "+valueToGoStringDescriptor(this.Name, "string")+",\n") + } + if this.Number != nil { + s = append(s, "Number: "+valueToGoStringDescriptor(this.Number, "int32")+",\n") + } + if this.Options != nil { + s = append(s, "Options: "+fmt.Sprintf("%#v", this.Options)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *ServiceDescriptorProto) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 7) + s = append(s, "&descriptor.ServiceDescriptorProto{") + if this.Name != nil { + s = append(s, "Name: "+valueToGoStringDescriptor(this.Name, "string")+",\n") + } + if this.Method != nil { + s = append(s, "Method: "+fmt.Sprintf("%#v", this.Method)+",\n") + } + if this.Options != nil { + s = append(s, "Options: "+fmt.Sprintf("%#v", this.Options)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *MethodDescriptorProto) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 10) + s = append(s, "&descriptor.MethodDescriptorProto{") + if this.Name != nil { + s = append(s, "Name: "+valueToGoStringDescriptor(this.Name, "string")+",\n") + } + if this.InputType != nil { + s = append(s, "InputType: "+valueToGoStringDescriptor(this.InputType, "string")+",\n") + } + if this.OutputType != nil { + s = append(s, "OutputType: "+valueToGoStringDescriptor(this.OutputType, "string")+",\n") + } + if this.Options != nil { + s = append(s, "Options: "+fmt.Sprintf("%#v", this.Options)+",\n") + } + if this.ClientStreaming != nil { + s = append(s, "ClientStreaming: "+valueToGoStringDescriptor(this.ClientStreaming, "bool")+",\n") + } + if this.ServerStreaming != nil { + s = append(s, "ServerStreaming: "+valueToGoStringDescriptor(this.ServerStreaming, "bool")+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *FileOptions) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 25) + s = append(s, "&descriptor.FileOptions{") + if this.JavaPackage != nil { + s = append(s, "JavaPackage: "+valueToGoStringDescriptor(this.JavaPackage, "string")+",\n") + } + if this.JavaOuterClassname != nil { + s = append(s, "JavaOuterClassname: "+valueToGoStringDescriptor(this.JavaOuterClassname, "string")+",\n") + } + if this.JavaMultipleFiles != nil { + s = append(s, "JavaMultipleFiles: "+valueToGoStringDescriptor(this.JavaMultipleFiles, "bool")+",\n") + } + if this.JavaGenerateEqualsAndHash != nil { + s = append(s, "JavaGenerateEqualsAndHash: "+valueToGoStringDescriptor(this.JavaGenerateEqualsAndHash, "bool")+",\n") + } + if this.JavaStringCheckUtf8 != nil { + s = append(s, "JavaStringCheckUtf8: "+valueToGoStringDescriptor(this.JavaStringCheckUtf8, "bool")+",\n") + } + if this.OptimizeFor != nil { + s = append(s, "OptimizeFor: "+valueToGoStringDescriptor(this.OptimizeFor, "FileOptions_OptimizeMode")+",\n") + } + if this.GoPackage != nil { + s = append(s, "GoPackage: "+valueToGoStringDescriptor(this.GoPackage, "string")+",\n") + } + if this.CcGenericServices != nil { + s = append(s, "CcGenericServices: "+valueToGoStringDescriptor(this.CcGenericServices, "bool")+",\n") + } + if this.JavaGenericServices != nil { + s = append(s, "JavaGenericServices: "+valueToGoStringDescriptor(this.JavaGenericServices, "bool")+",\n") + } + if this.PyGenericServices != nil { + s = append(s, "PyGenericServices: "+valueToGoStringDescriptor(this.PyGenericServices, "bool")+",\n") + } + if this.PhpGenericServices != nil { + s = append(s, "PhpGenericServices: "+valueToGoStringDescriptor(this.PhpGenericServices, "bool")+",\n") + } + if this.Deprecated != nil { + s = append(s, "Deprecated: "+valueToGoStringDescriptor(this.Deprecated, "bool")+",\n") + } + if this.CcEnableArenas != nil { + s = append(s, "CcEnableArenas: "+valueToGoStringDescriptor(this.CcEnableArenas, "bool")+",\n") + } + if this.ObjcClassPrefix != nil { + s = append(s, "ObjcClassPrefix: "+valueToGoStringDescriptor(this.ObjcClassPrefix, "string")+",\n") + } + if this.CsharpNamespace != nil { + s = append(s, "CsharpNamespace: "+valueToGoStringDescriptor(this.CsharpNamespace, "string")+",\n") + } + if this.SwiftPrefix != nil { + s = append(s, "SwiftPrefix: "+valueToGoStringDescriptor(this.SwiftPrefix, "string")+",\n") + } + if this.PhpClassPrefix != nil { + s = append(s, "PhpClassPrefix: "+valueToGoStringDescriptor(this.PhpClassPrefix, "string")+",\n") + } + if this.PhpNamespace != nil { + s = append(s, "PhpNamespace: "+valueToGoStringDescriptor(this.PhpNamespace, "string")+",\n") + } + if this.PhpMetadataNamespace != nil { + s = append(s, "PhpMetadataNamespace: "+valueToGoStringDescriptor(this.PhpMetadataNamespace, "string")+",\n") + } + if this.RubyPackage != nil { + s = append(s, "RubyPackage: "+valueToGoStringDescriptor(this.RubyPackage, "string")+",\n") + } + if this.UninterpretedOption != nil { + s = append(s, "UninterpretedOption: "+fmt.Sprintf("%#v", this.UninterpretedOption)+",\n") + } + s = append(s, "XXX_InternalExtensions: "+extensionToGoStringDescriptor(this)+",\n") + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *MessageOptions) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 9) + s = append(s, "&descriptor.MessageOptions{") + if this.MessageSetWireFormat != nil { + s = append(s, "MessageSetWireFormat: "+valueToGoStringDescriptor(this.MessageSetWireFormat, "bool")+",\n") + } + if this.NoStandardDescriptorAccessor != nil { + s = append(s, "NoStandardDescriptorAccessor: "+valueToGoStringDescriptor(this.NoStandardDescriptorAccessor, "bool")+",\n") + } + if this.Deprecated != nil { + s = append(s, "Deprecated: "+valueToGoStringDescriptor(this.Deprecated, "bool")+",\n") + } + if this.MapEntry != nil { + s = append(s, "MapEntry: "+valueToGoStringDescriptor(this.MapEntry, "bool")+",\n") + } + if this.UninterpretedOption != nil { + s = append(s, "UninterpretedOption: "+fmt.Sprintf("%#v", this.UninterpretedOption)+",\n") + } + s = append(s, "XXX_InternalExtensions: "+extensionToGoStringDescriptor(this)+",\n") + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *FieldOptions) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 11) + s = append(s, "&descriptor.FieldOptions{") + if this.Ctype != nil { + s = append(s, "Ctype: "+valueToGoStringDescriptor(this.Ctype, "FieldOptions_CType")+",\n") + } + if this.Packed != nil { + s = append(s, "Packed: "+valueToGoStringDescriptor(this.Packed, "bool")+",\n") + } + if this.Jstype != nil { + s = append(s, "Jstype: "+valueToGoStringDescriptor(this.Jstype, "FieldOptions_JSType")+",\n") + } + if this.Lazy != nil { + s = append(s, "Lazy: "+valueToGoStringDescriptor(this.Lazy, "bool")+",\n") + } + if this.Deprecated != nil { + s = append(s, "Deprecated: "+valueToGoStringDescriptor(this.Deprecated, "bool")+",\n") + } + if this.Weak != nil { + s = append(s, "Weak: "+valueToGoStringDescriptor(this.Weak, "bool")+",\n") + } + if this.UninterpretedOption != nil { + s = append(s, "UninterpretedOption: "+fmt.Sprintf("%#v", this.UninterpretedOption)+",\n") + } + s = append(s, "XXX_InternalExtensions: "+extensionToGoStringDescriptor(this)+",\n") + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *OneofOptions) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 5) + s = append(s, "&descriptor.OneofOptions{") + if this.UninterpretedOption != nil { + s = append(s, "UninterpretedOption: "+fmt.Sprintf("%#v", this.UninterpretedOption)+",\n") + } + s = append(s, "XXX_InternalExtensions: "+extensionToGoStringDescriptor(this)+",\n") + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *EnumOptions) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 7) + s = append(s, "&descriptor.EnumOptions{") + if this.AllowAlias != nil { + s = append(s, "AllowAlias: "+valueToGoStringDescriptor(this.AllowAlias, "bool")+",\n") + } + if this.Deprecated != nil { + s = append(s, "Deprecated: "+valueToGoStringDescriptor(this.Deprecated, "bool")+",\n") + } + if this.UninterpretedOption != nil { + s = append(s, "UninterpretedOption: "+fmt.Sprintf("%#v", this.UninterpretedOption)+",\n") + } + s = append(s, "XXX_InternalExtensions: "+extensionToGoStringDescriptor(this)+",\n") + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *EnumValueOptions) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 6) + s = append(s, "&descriptor.EnumValueOptions{") + if this.Deprecated != nil { + s = append(s, "Deprecated: "+valueToGoStringDescriptor(this.Deprecated, "bool")+",\n") + } + if this.UninterpretedOption != nil { + s = append(s, "UninterpretedOption: "+fmt.Sprintf("%#v", this.UninterpretedOption)+",\n") + } + s = append(s, "XXX_InternalExtensions: "+extensionToGoStringDescriptor(this)+",\n") + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *ServiceOptions) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 6) + s = append(s, "&descriptor.ServiceOptions{") + if this.Deprecated != nil { + s = append(s, "Deprecated: "+valueToGoStringDescriptor(this.Deprecated, "bool")+",\n") + } + if this.UninterpretedOption != nil { + s = append(s, "UninterpretedOption: "+fmt.Sprintf("%#v", this.UninterpretedOption)+",\n") + } + s = append(s, "XXX_InternalExtensions: "+extensionToGoStringDescriptor(this)+",\n") + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *MethodOptions) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 7) + s = append(s, "&descriptor.MethodOptions{") + if this.Deprecated != nil { + s = append(s, "Deprecated: "+valueToGoStringDescriptor(this.Deprecated, "bool")+",\n") + } + if this.IdempotencyLevel != nil { + s = append(s, "IdempotencyLevel: "+valueToGoStringDescriptor(this.IdempotencyLevel, "MethodOptions_IdempotencyLevel")+",\n") + } + if this.UninterpretedOption != nil { + s = append(s, "UninterpretedOption: "+fmt.Sprintf("%#v", this.UninterpretedOption)+",\n") + } + s = append(s, "XXX_InternalExtensions: "+extensionToGoStringDescriptor(this)+",\n") + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *UninterpretedOption) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 11) + s = append(s, "&descriptor.UninterpretedOption{") + if this.Name != nil { + s = append(s, "Name: "+fmt.Sprintf("%#v", this.Name)+",\n") + } + if this.IdentifierValue != nil { + s = append(s, "IdentifierValue: "+valueToGoStringDescriptor(this.IdentifierValue, "string")+",\n") + } + if this.PositiveIntValue != nil { + s = append(s, "PositiveIntValue: "+valueToGoStringDescriptor(this.PositiveIntValue, "uint64")+",\n") + } + if this.NegativeIntValue != nil { + s = append(s, "NegativeIntValue: "+valueToGoStringDescriptor(this.NegativeIntValue, "int64")+",\n") + } + if this.DoubleValue != nil { + s = append(s, "DoubleValue: "+valueToGoStringDescriptor(this.DoubleValue, "float64")+",\n") + } + if this.StringValue != nil { + s = append(s, "StringValue: "+valueToGoStringDescriptor(this.StringValue, "byte")+",\n") + } + if this.AggregateValue != nil { + s = append(s, "AggregateValue: "+valueToGoStringDescriptor(this.AggregateValue, "string")+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *UninterpretedOption_NamePart) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 6) + s = append(s, "&descriptor.UninterpretedOption_NamePart{") + if this.NamePart != nil { + s = append(s, "NamePart: "+valueToGoStringDescriptor(this.NamePart, "string")+",\n") + } + if this.IsExtension != nil { + s = append(s, "IsExtension: "+valueToGoStringDescriptor(this.IsExtension, "bool")+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *SourceCodeInfo) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 5) + s = append(s, "&descriptor.SourceCodeInfo{") + if this.Location != nil { + s = append(s, "Location: "+fmt.Sprintf("%#v", this.Location)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *SourceCodeInfo_Location) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 9) + s = append(s, "&descriptor.SourceCodeInfo_Location{") + if this.Path != nil { + s = append(s, "Path: "+fmt.Sprintf("%#v", this.Path)+",\n") + } + if this.Span != nil { + s = append(s, "Span: "+fmt.Sprintf("%#v", this.Span)+",\n") + } + if this.LeadingComments != nil { + s = append(s, "LeadingComments: "+valueToGoStringDescriptor(this.LeadingComments, "string")+",\n") + } + if this.TrailingComments != nil { + s = append(s, "TrailingComments: "+valueToGoStringDescriptor(this.TrailingComments, "string")+",\n") + } + if this.LeadingDetachedComments != nil { + s = append(s, "LeadingDetachedComments: "+fmt.Sprintf("%#v", this.LeadingDetachedComments)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *GeneratedCodeInfo) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 5) + s = append(s, "&descriptor.GeneratedCodeInfo{") + if this.Annotation != nil { + s = append(s, "Annotation: "+fmt.Sprintf("%#v", this.Annotation)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *GeneratedCodeInfo_Annotation) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 8) + s = append(s, "&descriptor.GeneratedCodeInfo_Annotation{") + if this.Path != nil { + s = append(s, "Path: "+fmt.Sprintf("%#v", this.Path)+",\n") + } + if this.SourceFile != nil { + s = append(s, "SourceFile: "+valueToGoStringDescriptor(this.SourceFile, "string")+",\n") + } + if this.Begin != nil { + s = append(s, "Begin: "+valueToGoStringDescriptor(this.Begin, "int32")+",\n") + } + if this.End != nil { + s = append(s, "End: "+valueToGoStringDescriptor(this.End, "int32")+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func valueToGoStringDescriptor(v interface{}, typ string) string { + rv := reflect.ValueOf(v) + if rv.IsNil() { + return "nil" + } + pv := reflect.Indirect(rv).Interface() + return fmt.Sprintf("func(v %v) *%v { return &v } ( %#v )", typ, typ, pv) +} +func extensionToGoStringDescriptor(m github_com_gogo_protobuf_proto.Message) string { + e := github_com_gogo_protobuf_proto.GetUnsafeExtensionsMap(m) + if e == nil { + return "nil" + } + s := "proto.NewUnsafeXXX_InternalExtensions(map[int32]proto.Extension{" + keys := make([]int, 0, len(e)) + for k := range e { + keys = append(keys, int(k)) + } + sort.Ints(keys) + ss := []string{} + for _, k := range keys { + ss = append(ss, strconv.Itoa(k)+": "+e[int32(k)].GoString()) + } + s += strings.Join(ss, ",") + "})" + return s +} diff --git a/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/helper.go b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/helper.go new file mode 100644 index 00000000..e0846a35 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/helper.go @@ -0,0 +1,390 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2013, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package descriptor + +import ( + "strings" +) + +func (msg *DescriptorProto) GetMapFields() (*FieldDescriptorProto, *FieldDescriptorProto) { + if !msg.GetOptions().GetMapEntry() { + return nil, nil + } + return msg.GetField()[0], msg.GetField()[1] +} + +func dotToUnderscore(r rune) rune { + if r == '.' { + return '_' + } + return r +} + +func (field *FieldDescriptorProto) WireType() (wire int) { + switch *field.Type { + case FieldDescriptorProto_TYPE_DOUBLE: + return 1 + case FieldDescriptorProto_TYPE_FLOAT: + return 5 + case FieldDescriptorProto_TYPE_INT64: + return 0 + case FieldDescriptorProto_TYPE_UINT64: + return 0 + case FieldDescriptorProto_TYPE_INT32: + return 0 + case FieldDescriptorProto_TYPE_UINT32: + return 0 + case FieldDescriptorProto_TYPE_FIXED64: + return 1 + case FieldDescriptorProto_TYPE_FIXED32: + return 5 + case FieldDescriptorProto_TYPE_BOOL: + return 0 + case FieldDescriptorProto_TYPE_STRING: + return 2 + case FieldDescriptorProto_TYPE_GROUP: + return 2 + case FieldDescriptorProto_TYPE_MESSAGE: + return 2 + case FieldDescriptorProto_TYPE_BYTES: + return 2 + case FieldDescriptorProto_TYPE_ENUM: + return 0 + case FieldDescriptorProto_TYPE_SFIXED32: + return 5 + case FieldDescriptorProto_TYPE_SFIXED64: + return 1 + case FieldDescriptorProto_TYPE_SINT32: + return 0 + case FieldDescriptorProto_TYPE_SINT64: + return 0 + } + panic("unreachable") +} + +func (field *FieldDescriptorProto) GetKeyUint64() (x uint64) { + packed := field.IsPacked() + wireType := field.WireType() + fieldNumber := field.GetNumber() + if packed { + wireType = 2 + } + x = uint64(uint32(fieldNumber)<<3 | uint32(wireType)) + return x +} + +func (field *FieldDescriptorProto) GetKey3Uint64() (x uint64) { + packed := field.IsPacked3() + wireType := field.WireType() + fieldNumber := field.GetNumber() + if packed { + wireType = 2 + } + x = uint64(uint32(fieldNumber)<<3 | uint32(wireType)) + return x +} + +func (field *FieldDescriptorProto) GetKey() []byte { + x := field.GetKeyUint64() + i := 0 + keybuf := make([]byte, 0) + for i = 0; x > 127; i++ { + keybuf = append(keybuf, 0x80|uint8(x&0x7F)) + x >>= 7 + } + keybuf = append(keybuf, uint8(x)) + return keybuf +} + +func (field *FieldDescriptorProto) GetKey3() []byte { + x := field.GetKey3Uint64() + i := 0 + keybuf := make([]byte, 0) + for i = 0; x > 127; i++ { + keybuf = append(keybuf, 0x80|uint8(x&0x7F)) + x >>= 7 + } + keybuf = append(keybuf, uint8(x)) + return keybuf +} + +func (desc *FileDescriptorSet) GetField(packageName, messageName, fieldName string) *FieldDescriptorProto { + msg := desc.GetMessage(packageName, messageName) + if msg == nil { + return nil + } + for _, field := range msg.GetField() { + if field.GetName() == fieldName { + return field + } + } + return nil +} + +func (file *FileDescriptorProto) GetMessage(typeName string) *DescriptorProto { + for _, msg := range file.GetMessageType() { + if msg.GetName() == typeName { + return msg + } + nes := file.GetNestedMessage(msg, strings.TrimPrefix(typeName, msg.GetName()+".")) + if nes != nil { + return nes + } + } + return nil +} + +func (file *FileDescriptorProto) GetNestedMessage(msg *DescriptorProto, typeName string) *DescriptorProto { + for _, nes := range msg.GetNestedType() { + if nes.GetName() == typeName { + return nes + } + res := file.GetNestedMessage(nes, strings.TrimPrefix(typeName, nes.GetName()+".")) + if res != nil { + return res + } + } + return nil +} + +func (desc *FileDescriptorSet) GetMessage(packageName string, typeName string) *DescriptorProto { + for _, file := range desc.GetFile() { + if strings.Map(dotToUnderscore, file.GetPackage()) != strings.Map(dotToUnderscore, packageName) { + continue + } + for _, msg := range file.GetMessageType() { + if msg.GetName() == typeName { + return msg + } + } + for _, msg := range file.GetMessageType() { + for _, nes := range msg.GetNestedType() { + if nes.GetName() == typeName { + return nes + } + if msg.GetName()+"."+nes.GetName() == typeName { + return nes + } + } + } + } + return nil +} + +func (desc *FileDescriptorSet) IsProto3(packageName string, typeName string) bool { + for _, file := range desc.GetFile() { + if strings.Map(dotToUnderscore, file.GetPackage()) != strings.Map(dotToUnderscore, packageName) { + continue + } + for _, msg := range file.GetMessageType() { + if msg.GetName() == typeName { + return file.GetSyntax() == "proto3" + } + } + for _, msg := range file.GetMessageType() { + for _, nes := range msg.GetNestedType() { + if nes.GetName() == typeName { + return file.GetSyntax() == "proto3" + } + if msg.GetName()+"."+nes.GetName() == typeName { + return file.GetSyntax() == "proto3" + } + } + } + } + return false +} + +func (msg *DescriptorProto) IsExtendable() bool { + return len(msg.GetExtensionRange()) > 0 +} + +func (desc *FileDescriptorSet) FindExtension(packageName string, typeName string, fieldName string) (extPackageName string, field *FieldDescriptorProto) { + parent := desc.GetMessage(packageName, typeName) + if parent == nil { + return "", nil + } + if !parent.IsExtendable() { + return "", nil + } + extendee := "." + packageName + "." + typeName + for _, file := range desc.GetFile() { + for _, ext := range file.GetExtension() { + if strings.Map(dotToUnderscore, file.GetPackage()) == strings.Map(dotToUnderscore, packageName) { + if !(ext.GetExtendee() == typeName || ext.GetExtendee() == extendee) { + continue + } + } else { + if ext.GetExtendee() != extendee { + continue + } + } + if ext.GetName() == fieldName { + return file.GetPackage(), ext + } + } + } + return "", nil +} + +func (desc *FileDescriptorSet) FindExtensionByFieldNumber(packageName string, typeName string, fieldNum int32) (extPackageName string, field *FieldDescriptorProto) { + parent := desc.GetMessage(packageName, typeName) + if parent == nil { + return "", nil + } + if !parent.IsExtendable() { + return "", nil + } + extendee := "." + packageName + "." + typeName + for _, file := range desc.GetFile() { + for _, ext := range file.GetExtension() { + if strings.Map(dotToUnderscore, file.GetPackage()) == strings.Map(dotToUnderscore, packageName) { + if !(ext.GetExtendee() == typeName || ext.GetExtendee() == extendee) { + continue + } + } else { + if ext.GetExtendee() != extendee { + continue + } + } + if ext.GetNumber() == fieldNum { + return file.GetPackage(), ext + } + } + } + return "", nil +} + +func (desc *FileDescriptorSet) FindMessage(packageName string, typeName string, fieldName string) (msgPackageName string, msgName string) { + parent := desc.GetMessage(packageName, typeName) + if parent == nil { + return "", "" + } + field := parent.GetFieldDescriptor(fieldName) + if field == nil { + var extPackageName string + extPackageName, field = desc.FindExtension(packageName, typeName, fieldName) + if field == nil { + return "", "" + } + packageName = extPackageName + } + typeNames := strings.Split(field.GetTypeName(), ".") + if len(typeNames) == 1 { + msg := desc.GetMessage(packageName, typeName) + if msg == nil { + return "", "" + } + return packageName, msg.GetName() + } + if len(typeNames) > 2 { + for i := 1; i < len(typeNames)-1; i++ { + packageName = strings.Join(typeNames[1:len(typeNames)-i], ".") + typeName = strings.Join(typeNames[len(typeNames)-i:], ".") + msg := desc.GetMessage(packageName, typeName) + if msg != nil { + typeNames := strings.Split(msg.GetName(), ".") + if len(typeNames) == 1 { + return packageName, msg.GetName() + } + return strings.Join(typeNames[1:len(typeNames)-1], "."), typeNames[len(typeNames)-1] + } + } + } + return "", "" +} + +func (msg *DescriptorProto) GetFieldDescriptor(fieldName string) *FieldDescriptorProto { + for _, field := range msg.GetField() { + if field.GetName() == fieldName { + return field + } + } + return nil +} + +func (desc *FileDescriptorSet) GetEnum(packageName string, typeName string) *EnumDescriptorProto { + for _, file := range desc.GetFile() { + if strings.Map(dotToUnderscore, file.GetPackage()) != strings.Map(dotToUnderscore, packageName) { + continue + } + for _, enum := range file.GetEnumType() { + if enum.GetName() == typeName { + return enum + } + } + } + return nil +} + +func (f *FieldDescriptorProto) IsEnum() bool { + return *f.Type == FieldDescriptorProto_TYPE_ENUM +} + +func (f *FieldDescriptorProto) IsMessage() bool { + return *f.Type == FieldDescriptorProto_TYPE_MESSAGE +} + +func (f *FieldDescriptorProto) IsBytes() bool { + return *f.Type == FieldDescriptorProto_TYPE_BYTES +} + +func (f *FieldDescriptorProto) IsRepeated() bool { + return f.Label != nil && *f.Label == FieldDescriptorProto_LABEL_REPEATED +} + +func (f *FieldDescriptorProto) IsString() bool { + return *f.Type == FieldDescriptorProto_TYPE_STRING +} + +func (f *FieldDescriptorProto) IsBool() bool { + return *f.Type == FieldDescriptorProto_TYPE_BOOL +} + +func (f *FieldDescriptorProto) IsRequired() bool { + return f.Label != nil && *f.Label == FieldDescriptorProto_LABEL_REQUIRED +} + +func (f *FieldDescriptorProto) IsPacked() bool { + return f.Options != nil && f.GetOptions().GetPacked() +} + +func (f *FieldDescriptorProto) IsPacked3() bool { + if f.IsRepeated() && f.IsScalar() { + if f.Options == nil || f.GetOptions().Packed == nil { + return true + } + return f.Options != nil && f.GetOptions().GetPacked() + } + return false +} + +func (m *DescriptorProto) HasExtension() bool { + return len(m.ExtensionRange) > 0 +} diff --git a/vendor/github.com/golang/protobuf/ptypes/any.go b/vendor/github.com/golang/protobuf/ptypes/any.go new file mode 100644 index 00000000..70276e8f --- /dev/null +++ b/vendor/github.com/golang/protobuf/ptypes/any.go @@ -0,0 +1,141 @@ +// Go support for Protocol Buffers - Google's data interchange format +// +// Copyright 2016 The Go Authors. All rights reserved. +// https://github.com/golang/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// * Neither the name of Google Inc. nor the names of its +// contributors may be used to endorse or promote products derived from +// this software without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package ptypes + +// This file implements functions to marshal proto.Message to/from +// google.protobuf.Any message. + +import ( + "fmt" + "reflect" + "strings" + + "github.com/golang/protobuf/proto" + "github.com/golang/protobuf/ptypes/any" +) + +const googleApis = "type.googleapis.com/" + +// AnyMessageName returns the name of the message contained in a google.protobuf.Any message. +// +// Note that regular type assertions should be done using the Is +// function. AnyMessageName is provided for less common use cases like filtering a +// sequence of Any messages based on a set of allowed message type names. +func AnyMessageName(any *any.Any) (string, error) { + if any == nil { + return "", fmt.Errorf("message is nil") + } + slash := strings.LastIndex(any.TypeUrl, "/") + if slash < 0 { + return "", fmt.Errorf("message type url %q is invalid", any.TypeUrl) + } + return any.TypeUrl[slash+1:], nil +} + +// MarshalAny takes the protocol buffer and encodes it into google.protobuf.Any. +func MarshalAny(pb proto.Message) (*any.Any, error) { + value, err := proto.Marshal(pb) + if err != nil { + return nil, err + } + return &any.Any{TypeUrl: googleApis + proto.MessageName(pb), Value: value}, nil +} + +// DynamicAny is a value that can be passed to UnmarshalAny to automatically +// allocate a proto.Message for the type specified in a google.protobuf.Any +// message. The allocated message is stored in the embedded proto.Message. +// +// Example: +// +// var x ptypes.DynamicAny +// if err := ptypes.UnmarshalAny(a, &x); err != nil { ... } +// fmt.Printf("unmarshaled message: %v", x.Message) +type DynamicAny struct { + proto.Message +} + +// Empty returns a new proto.Message of the type specified in a +// google.protobuf.Any message. It returns an error if corresponding message +// type isn't linked in. +func Empty(any *any.Any) (proto.Message, error) { + aname, err := AnyMessageName(any) + if err != nil { + return nil, err + } + + t := proto.MessageType(aname) + if t == nil { + return nil, fmt.Errorf("any: message type %q isn't linked in", aname) + } + return reflect.New(t.Elem()).Interface().(proto.Message), nil +} + +// UnmarshalAny parses the protocol buffer representation in a google.protobuf.Any +// message and places the decoded result in pb. It returns an error if type of +// contents of Any message does not match type of pb message. +// +// pb can be a proto.Message, or a *DynamicAny. +func UnmarshalAny(any *any.Any, pb proto.Message) error { + if d, ok := pb.(*DynamicAny); ok { + if d.Message == nil { + var err error + d.Message, err = Empty(any) + if err != nil { + return err + } + } + return UnmarshalAny(any, d.Message) + } + + aname, err := AnyMessageName(any) + if err != nil { + return err + } + + mname := proto.MessageName(pb) + if aname != mname { + return fmt.Errorf("mismatched message type: got %q want %q", aname, mname) + } + return proto.Unmarshal(any.Value, pb) +} + +// Is returns true if any value contains a given message type. +func Is(any *any.Any, pb proto.Message) bool { + // The following is equivalent to AnyMessageName(any) == proto.MessageName(pb), + // but it avoids scanning TypeUrl for the slash. + if any == nil { + return false + } + name := proto.MessageName(pb) + prefix := len(any.TypeUrl) - len(name) + return prefix >= 1 && any.TypeUrl[prefix-1] == '/' && any.TypeUrl[prefix:] == name +} diff --git a/vendor/github.com/golang/protobuf/ptypes/any/any.pb.go b/vendor/github.com/golang/protobuf/ptypes/any/any.pb.go new file mode 100644 index 00000000..78ee5233 --- /dev/null +++ b/vendor/github.com/golang/protobuf/ptypes/any/any.pb.go @@ -0,0 +1,200 @@ +// Code generated by protoc-gen-go. DO NOT EDIT. +// source: google/protobuf/any.proto + +package any + +import ( + fmt "fmt" + proto "github.com/golang/protobuf/proto" + math "math" +) + +// Reference imports to suppress errors if they are not otherwise used. +var _ = proto.Marshal +var _ = fmt.Errorf +var _ = math.Inf + +// This is a compile-time assertion to ensure that this generated file +// is compatible with the proto package it is being compiled against. +// A compilation error at this line likely means your copy of the +// proto package needs to be updated. +const _ = proto.ProtoPackageIsVersion3 // please upgrade the proto package + +// `Any` contains an arbitrary serialized protocol buffer message along with a +// URL that describes the type of the serialized message. +// +// Protobuf library provides support to pack/unpack Any values in the form +// of utility functions or additional generated methods of the Any type. +// +// Example 1: Pack and unpack a message in C++. +// +// Foo foo = ...; +// Any any; +// any.PackFrom(foo); +// ... +// if (any.UnpackTo(&foo)) { +// ... +// } +// +// Example 2: Pack and unpack a message in Java. +// +// Foo foo = ...; +// Any any = Any.pack(foo); +// ... +// if (any.is(Foo.class)) { +// foo = any.unpack(Foo.class); +// } +// +// Example 3: Pack and unpack a message in Python. +// +// foo = Foo(...) +// any = Any() +// any.Pack(foo) +// ... +// if any.Is(Foo.DESCRIPTOR): +// any.Unpack(foo) +// ... +// +// Example 4: Pack and unpack a message in Go +// +// foo := &pb.Foo{...} +// any, err := ptypes.MarshalAny(foo) +// ... +// foo := &pb.Foo{} +// if err := ptypes.UnmarshalAny(any, foo); err != nil { +// ... +// } +// +// The pack methods provided by protobuf library will by default use +// 'type.googleapis.com/full.type.name' as the type URL and the unpack +// methods only use the fully qualified type name after the last '/' +// in the type URL, for example "foo.bar.com/x/y.z" will yield type +// name "y.z". +// +// +// JSON +// ==== +// The JSON representation of an `Any` value uses the regular +// representation of the deserialized, embedded message, with an +// additional field `@type` which contains the type URL. Example: +// +// package google.profile; +// message Person { +// string first_name = 1; +// string last_name = 2; +// } +// +// { +// "@type": "type.googleapis.com/google.profile.Person", +// "firstName": , +// "lastName": +// } +// +// If the embedded message type is well-known and has a custom JSON +// representation, that representation will be embedded adding a field +// `value` which holds the custom JSON in addition to the `@type` +// field. Example (for message [google.protobuf.Duration][]): +// +// { +// "@type": "type.googleapis.com/google.protobuf.Duration", +// "value": "1.212s" +// } +// +type Any struct { + // A URL/resource name that uniquely identifies the type of the serialized + // protocol buffer message. The last segment of the URL's path must represent + // the fully qualified name of the type (as in + // `path/google.protobuf.Duration`). The name should be in a canonical form + // (e.g., leading "." is not accepted). + // + // In practice, teams usually precompile into the binary all types that they + // expect it to use in the context of Any. However, for URLs which use the + // scheme `http`, `https`, or no scheme, one can optionally set up a type + // server that maps type URLs to message definitions as follows: + // + // * If no scheme is provided, `https` is assumed. + // * An HTTP GET on the URL must yield a [google.protobuf.Type][] + // value in binary format, or produce an error. + // * Applications are allowed to cache lookup results based on the + // URL, or have them precompiled into a binary to avoid any + // lookup. Therefore, binary compatibility needs to be preserved + // on changes to types. (Use versioned type names to manage + // breaking changes.) + // + // Note: this functionality is not currently available in the official + // protobuf release, and it is not used for type URLs beginning with + // type.googleapis.com. + // + // Schemes other than `http`, `https` (or the empty scheme) might be + // used with implementation specific semantics. + // + TypeUrl string `protobuf:"bytes,1,opt,name=type_url,json=typeUrl,proto3" json:"type_url,omitempty"` + // Must be a valid serialized protocol buffer of the above specified type. + Value []byte `protobuf:"bytes,2,opt,name=value,proto3" json:"value,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *Any) Reset() { *m = Any{} } +func (m *Any) String() string { return proto.CompactTextString(m) } +func (*Any) ProtoMessage() {} +func (*Any) Descriptor() ([]byte, []int) { + return fileDescriptor_b53526c13ae22eb4, []int{0} +} + +func (*Any) XXX_WellKnownType() string { return "Any" } + +func (m *Any) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_Any.Unmarshal(m, b) +} +func (m *Any) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_Any.Marshal(b, m, deterministic) +} +func (m *Any) XXX_Merge(src proto.Message) { + xxx_messageInfo_Any.Merge(m, src) +} +func (m *Any) XXX_Size() int { + return xxx_messageInfo_Any.Size(m) +} +func (m *Any) XXX_DiscardUnknown() { + xxx_messageInfo_Any.DiscardUnknown(m) +} + +var xxx_messageInfo_Any proto.InternalMessageInfo + +func (m *Any) GetTypeUrl() string { + if m != nil { + return m.TypeUrl + } + return "" +} + +func (m *Any) GetValue() []byte { + if m != nil { + return m.Value + } + return nil +} + +func init() { + proto.RegisterType((*Any)(nil), "google.protobuf.Any") +} + +func init() { proto.RegisterFile("google/protobuf/any.proto", fileDescriptor_b53526c13ae22eb4) } + +var fileDescriptor_b53526c13ae22eb4 = []byte{ + // 185 bytes of a gzipped FileDescriptorProto + 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0xe2, 0x92, 0x4c, 0xcf, 0xcf, 0x4f, + 0xcf, 0x49, 0xd5, 0x2f, 0x28, 0xca, 0x2f, 0xc9, 0x4f, 0x2a, 0x4d, 0xd3, 0x4f, 0xcc, 0xab, 0xd4, + 0x03, 0x73, 0x84, 0xf8, 0x21, 0x52, 0x7a, 0x30, 0x29, 0x25, 0x33, 0x2e, 0x66, 0xc7, 0xbc, 0x4a, + 0x21, 0x49, 0x2e, 0x8e, 0x92, 0xca, 0x82, 0xd4, 0xf8, 0xd2, 0xa2, 0x1c, 0x09, 0x46, 0x05, 0x46, + 0x0d, 0xce, 0x20, 0x76, 0x10, 0x3f, 0xb4, 0x28, 0x47, 0x48, 0x84, 0x8b, 0xb5, 0x2c, 0x31, 0xa7, + 0x34, 0x55, 0x82, 0x49, 0x81, 0x51, 0x83, 0x27, 0x08, 0xc2, 0x71, 0xca, 0xe7, 0x12, 0x4e, 0xce, + 0xcf, 0xd5, 0x43, 0x33, 0xce, 0x89, 0xc3, 0x31, 0xaf, 0x32, 0x00, 0xc4, 0x09, 0x60, 0x8c, 0x52, + 0x4d, 0xcf, 0x2c, 0xc9, 0x28, 0x4d, 0xd2, 0x4b, 0xce, 0xcf, 0xd5, 0x4f, 0xcf, 0xcf, 0x49, 0xcc, + 0x4b, 0x47, 0xb8, 0xa8, 0x00, 0x64, 0x7a, 0x31, 0xc8, 0x61, 0x8b, 0x98, 0x98, 0xdd, 0x03, 0x9c, + 0x56, 0x31, 0xc9, 0xb9, 0x43, 0x8c, 0x0a, 0x80, 0x2a, 0xd1, 0x0b, 0x4f, 0xcd, 0xc9, 0xf1, 0xce, + 0xcb, 0x2f, 0xcf, 0x0b, 0x01, 0x29, 0x4d, 0x62, 0x03, 0xeb, 0x35, 0x06, 0x04, 0x00, 0x00, 0xff, + 0xff, 0x13, 0xf8, 0xe8, 0x42, 0xdd, 0x00, 0x00, 0x00, +} diff --git a/vendor/github.com/golang/protobuf/ptypes/any/any.proto b/vendor/github.com/golang/protobuf/ptypes/any/any.proto new file mode 100644 index 00000000..49329425 --- /dev/null +++ b/vendor/github.com/golang/protobuf/ptypes/any/any.proto @@ -0,0 +1,154 @@ +// Protocol Buffers - Google's data interchange format +// Copyright 2008 Google Inc. All rights reserved. +// https://developers.google.com/protocol-buffers/ +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// * Neither the name of Google Inc. nor the names of its +// contributors may be used to endorse or promote products derived from +// this software without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +syntax = "proto3"; + +package google.protobuf; + +option csharp_namespace = "Google.Protobuf.WellKnownTypes"; +option go_package = "github.com/golang/protobuf/ptypes/any"; +option java_package = "com.google.protobuf"; +option java_outer_classname = "AnyProto"; +option java_multiple_files = true; +option objc_class_prefix = "GPB"; + +// `Any` contains an arbitrary serialized protocol buffer message along with a +// URL that describes the type of the serialized message. +// +// Protobuf library provides support to pack/unpack Any values in the form +// of utility functions or additional generated methods of the Any type. +// +// Example 1: Pack and unpack a message in C++. +// +// Foo foo = ...; +// Any any; +// any.PackFrom(foo); +// ... +// if (any.UnpackTo(&foo)) { +// ... +// } +// +// Example 2: Pack and unpack a message in Java. +// +// Foo foo = ...; +// Any any = Any.pack(foo); +// ... +// if (any.is(Foo.class)) { +// foo = any.unpack(Foo.class); +// } +// +// Example 3: Pack and unpack a message in Python. +// +// foo = Foo(...) +// any = Any() +// any.Pack(foo) +// ... +// if any.Is(Foo.DESCRIPTOR): +// any.Unpack(foo) +// ... +// +// Example 4: Pack and unpack a message in Go +// +// foo := &pb.Foo{...} +// any, err := ptypes.MarshalAny(foo) +// ... +// foo := &pb.Foo{} +// if err := ptypes.UnmarshalAny(any, foo); err != nil { +// ... +// } +// +// The pack methods provided by protobuf library will by default use +// 'type.googleapis.com/full.type.name' as the type URL and the unpack +// methods only use the fully qualified type name after the last '/' +// in the type URL, for example "foo.bar.com/x/y.z" will yield type +// name "y.z". +// +// +// JSON +// ==== +// The JSON representation of an `Any` value uses the regular +// representation of the deserialized, embedded message, with an +// additional field `@type` which contains the type URL. Example: +// +// package google.profile; +// message Person { +// string first_name = 1; +// string last_name = 2; +// } +// +// { +// "@type": "type.googleapis.com/google.profile.Person", +// "firstName": , +// "lastName": +// } +// +// If the embedded message type is well-known and has a custom JSON +// representation, that representation will be embedded adding a field +// `value` which holds the custom JSON in addition to the `@type` +// field. Example (for message [google.protobuf.Duration][]): +// +// { +// "@type": "type.googleapis.com/google.protobuf.Duration", +// "value": "1.212s" +// } +// +message Any { + // A URL/resource name that uniquely identifies the type of the serialized + // protocol buffer message. The last segment of the URL's path must represent + // the fully qualified name of the type (as in + // `path/google.protobuf.Duration`). The name should be in a canonical form + // (e.g., leading "." is not accepted). + // + // In practice, teams usually precompile into the binary all types that they + // expect it to use in the context of Any. However, for URLs which use the + // scheme `http`, `https`, or no scheme, one can optionally set up a type + // server that maps type URLs to message definitions as follows: + // + // * If no scheme is provided, `https` is assumed. + // * An HTTP GET on the URL must yield a [google.protobuf.Type][] + // value in binary format, or produce an error. + // * Applications are allowed to cache lookup results based on the + // URL, or have them precompiled into a binary to avoid any + // lookup. Therefore, binary compatibility needs to be preserved + // on changes to types. (Use versioned type names to manage + // breaking changes.) + // + // Note: this functionality is not currently available in the official + // protobuf release, and it is not used for type URLs beginning with + // type.googleapis.com. + // + // Schemes other than `http`, `https` (or the empty scheme) might be + // used with implementation specific semantics. + // + string type_url = 1; + + // Must be a valid serialized protocol buffer of the above specified type. + bytes value = 2; +} diff --git a/vendor/github.com/golang/protobuf/ptypes/doc.go b/vendor/github.com/golang/protobuf/ptypes/doc.go new file mode 100644 index 00000000..c0d595da --- /dev/null +++ b/vendor/github.com/golang/protobuf/ptypes/doc.go @@ -0,0 +1,35 @@ +// Go support for Protocol Buffers - Google's data interchange format +// +// Copyright 2016 The Go Authors. All rights reserved. +// https://github.com/golang/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// * Neither the name of Google Inc. nor the names of its +// contributors may be used to endorse or promote products derived from +// this software without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +/* +Package ptypes contains code for interacting with well-known types. +*/ +package ptypes diff --git a/vendor/github.com/golang/protobuf/ptypes/duration.go b/vendor/github.com/golang/protobuf/ptypes/duration.go new file mode 100644 index 00000000..26d1ca2f --- /dev/null +++ b/vendor/github.com/golang/protobuf/ptypes/duration.go @@ -0,0 +1,102 @@ +// Go support for Protocol Buffers - Google's data interchange format +// +// Copyright 2016 The Go Authors. All rights reserved. +// https://github.com/golang/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// * Neither the name of Google Inc. nor the names of its +// contributors may be used to endorse or promote products derived from +// this software without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package ptypes + +// This file implements conversions between google.protobuf.Duration +// and time.Duration. + +import ( + "errors" + "fmt" + "time" + + durpb "github.com/golang/protobuf/ptypes/duration" +) + +const ( + // Range of a durpb.Duration in seconds, as specified in + // google/protobuf/duration.proto. This is about 10,000 years in seconds. + maxSeconds = int64(10000 * 365.25 * 24 * 60 * 60) + minSeconds = -maxSeconds +) + +// validateDuration determines whether the durpb.Duration is valid according to the +// definition in google/protobuf/duration.proto. A valid durpb.Duration +// may still be too large to fit into a time.Duration (the range of durpb.Duration +// is about 10,000 years, and the range of time.Duration is about 290). +func validateDuration(d *durpb.Duration) error { + if d == nil { + return errors.New("duration: nil Duration") + } + if d.Seconds < minSeconds || d.Seconds > maxSeconds { + return fmt.Errorf("duration: %v: seconds out of range", d) + } + if d.Nanos <= -1e9 || d.Nanos >= 1e9 { + return fmt.Errorf("duration: %v: nanos out of range", d) + } + // Seconds and Nanos must have the same sign, unless d.Nanos is zero. + if (d.Seconds < 0 && d.Nanos > 0) || (d.Seconds > 0 && d.Nanos < 0) { + return fmt.Errorf("duration: %v: seconds and nanos have different signs", d) + } + return nil +} + +// Duration converts a durpb.Duration to a time.Duration. Duration +// returns an error if the durpb.Duration is invalid or is too large to be +// represented in a time.Duration. +func Duration(p *durpb.Duration) (time.Duration, error) { + if err := validateDuration(p); err != nil { + return 0, err + } + d := time.Duration(p.Seconds) * time.Second + if int64(d/time.Second) != p.Seconds { + return 0, fmt.Errorf("duration: %v is out of range for time.Duration", p) + } + if p.Nanos != 0 { + d += time.Duration(p.Nanos) * time.Nanosecond + if (d < 0) != (p.Nanos < 0) { + return 0, fmt.Errorf("duration: %v is out of range for time.Duration", p) + } + } + return d, nil +} + +// DurationProto converts a time.Duration to a durpb.Duration. +func DurationProto(d time.Duration) *durpb.Duration { + nanos := d.Nanoseconds() + secs := nanos / 1e9 + nanos -= secs * 1e9 + return &durpb.Duration{ + Seconds: secs, + Nanos: int32(nanos), + } +} diff --git a/vendor/github.com/golang/protobuf/ptypes/duration/duration.pb.go b/vendor/github.com/golang/protobuf/ptypes/duration/duration.pb.go new file mode 100644 index 00000000..0d681ee2 --- /dev/null +++ b/vendor/github.com/golang/protobuf/ptypes/duration/duration.pb.go @@ -0,0 +1,161 @@ +// Code generated by protoc-gen-go. DO NOT EDIT. +// source: google/protobuf/duration.proto + +package duration + +import ( + fmt "fmt" + proto "github.com/golang/protobuf/proto" + math "math" +) + +// Reference imports to suppress errors if they are not otherwise used. +var _ = proto.Marshal +var _ = fmt.Errorf +var _ = math.Inf + +// This is a compile-time assertion to ensure that this generated file +// is compatible with the proto package it is being compiled against. +// A compilation error at this line likely means your copy of the +// proto package needs to be updated. +const _ = proto.ProtoPackageIsVersion3 // please upgrade the proto package + +// A Duration represents a signed, fixed-length span of time represented +// as a count of seconds and fractions of seconds at nanosecond +// resolution. It is independent of any calendar and concepts like "day" +// or "month". It is related to Timestamp in that the difference between +// two Timestamp values is a Duration and it can be added or subtracted +// from a Timestamp. Range is approximately +-10,000 years. +// +// # Examples +// +// Example 1: Compute Duration from two Timestamps in pseudo code. +// +// Timestamp start = ...; +// Timestamp end = ...; +// Duration duration = ...; +// +// duration.seconds = end.seconds - start.seconds; +// duration.nanos = end.nanos - start.nanos; +// +// if (duration.seconds < 0 && duration.nanos > 0) { +// duration.seconds += 1; +// duration.nanos -= 1000000000; +// } else if (durations.seconds > 0 && duration.nanos < 0) { +// duration.seconds -= 1; +// duration.nanos += 1000000000; +// } +// +// Example 2: Compute Timestamp from Timestamp + Duration in pseudo code. +// +// Timestamp start = ...; +// Duration duration = ...; +// Timestamp end = ...; +// +// end.seconds = start.seconds + duration.seconds; +// end.nanos = start.nanos + duration.nanos; +// +// if (end.nanos < 0) { +// end.seconds -= 1; +// end.nanos += 1000000000; +// } else if (end.nanos >= 1000000000) { +// end.seconds += 1; +// end.nanos -= 1000000000; +// } +// +// Example 3: Compute Duration from datetime.timedelta in Python. +// +// td = datetime.timedelta(days=3, minutes=10) +// duration = Duration() +// duration.FromTimedelta(td) +// +// # JSON Mapping +// +// In JSON format, the Duration type is encoded as a string rather than an +// object, where the string ends in the suffix "s" (indicating seconds) and +// is preceded by the number of seconds, with nanoseconds expressed as +// fractional seconds. For example, 3 seconds with 0 nanoseconds should be +// encoded in JSON format as "3s", while 3 seconds and 1 nanosecond should +// be expressed in JSON format as "3.000000001s", and 3 seconds and 1 +// microsecond should be expressed in JSON format as "3.000001s". +// +// +type Duration struct { + // Signed seconds of the span of time. Must be from -315,576,000,000 + // to +315,576,000,000 inclusive. Note: these bounds are computed from: + // 60 sec/min * 60 min/hr * 24 hr/day * 365.25 days/year * 10000 years + Seconds int64 `protobuf:"varint,1,opt,name=seconds,proto3" json:"seconds,omitempty"` + // Signed fractions of a second at nanosecond resolution of the span + // of time. Durations less than one second are represented with a 0 + // `seconds` field and a positive or negative `nanos` field. For durations + // of one second or more, a non-zero value for the `nanos` field must be + // of the same sign as the `seconds` field. Must be from -999,999,999 + // to +999,999,999 inclusive. + Nanos int32 `protobuf:"varint,2,opt,name=nanos,proto3" json:"nanos,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *Duration) Reset() { *m = Duration{} } +func (m *Duration) String() string { return proto.CompactTextString(m) } +func (*Duration) ProtoMessage() {} +func (*Duration) Descriptor() ([]byte, []int) { + return fileDescriptor_23597b2ebd7ac6c5, []int{0} +} + +func (*Duration) XXX_WellKnownType() string { return "Duration" } + +func (m *Duration) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_Duration.Unmarshal(m, b) +} +func (m *Duration) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_Duration.Marshal(b, m, deterministic) +} +func (m *Duration) XXX_Merge(src proto.Message) { + xxx_messageInfo_Duration.Merge(m, src) +} +func (m *Duration) XXX_Size() int { + return xxx_messageInfo_Duration.Size(m) +} +func (m *Duration) XXX_DiscardUnknown() { + xxx_messageInfo_Duration.DiscardUnknown(m) +} + +var xxx_messageInfo_Duration proto.InternalMessageInfo + +func (m *Duration) GetSeconds() int64 { + if m != nil { + return m.Seconds + } + return 0 +} + +func (m *Duration) GetNanos() int32 { + if m != nil { + return m.Nanos + } + return 0 +} + +func init() { + proto.RegisterType((*Duration)(nil), "google.protobuf.Duration") +} + +func init() { proto.RegisterFile("google/protobuf/duration.proto", fileDescriptor_23597b2ebd7ac6c5) } + +var fileDescriptor_23597b2ebd7ac6c5 = []byte{ + // 190 bytes of a gzipped FileDescriptorProto + 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0xe2, 0x92, 0x4b, 0xcf, 0xcf, 0x4f, + 0xcf, 0x49, 0xd5, 0x2f, 0x28, 0xca, 0x2f, 0xc9, 0x4f, 0x2a, 0x4d, 0xd3, 0x4f, 0x29, 0x2d, 0x4a, + 0x2c, 0xc9, 0xcc, 0xcf, 0xd3, 0x03, 0x8b, 0x08, 0xf1, 0x43, 0xe4, 0xf5, 0x60, 0xf2, 0x4a, 0x56, + 0x5c, 0x1c, 0x2e, 0x50, 0x25, 0x42, 0x12, 0x5c, 0xec, 0xc5, 0xa9, 0xc9, 0xf9, 0x79, 0x29, 0xc5, + 0x12, 0x8c, 0x0a, 0x8c, 0x1a, 0xcc, 0x41, 0x30, 0xae, 0x90, 0x08, 0x17, 0x6b, 0x5e, 0x62, 0x5e, + 0x7e, 0xb1, 0x04, 0x93, 0x02, 0xa3, 0x06, 0x6b, 0x10, 0x84, 0xe3, 0x54, 0xc3, 0x25, 0x9c, 0x9c, + 0x9f, 0xab, 0x87, 0x66, 0xa4, 0x13, 0x2f, 0xcc, 0xc0, 0x00, 0x90, 0x48, 0x00, 0x63, 0x94, 0x56, + 0x7a, 0x66, 0x49, 0x46, 0x69, 0x92, 0x5e, 0x72, 0x7e, 0xae, 0x7e, 0x7a, 0x7e, 0x4e, 0x62, 0x5e, + 0x3a, 0xc2, 0x7d, 0x05, 0x25, 0x95, 0x05, 0xa9, 0xc5, 0x70, 0x67, 0xfe, 0x60, 0x64, 0x5c, 0xc4, + 0xc4, 0xec, 0x1e, 0xe0, 0xb4, 0x8a, 0x49, 0xce, 0x1d, 0x62, 0x6e, 0x00, 0x54, 0xa9, 0x5e, 0x78, + 0x6a, 0x4e, 0x8e, 0x77, 0x5e, 0x7e, 0x79, 0x5e, 0x08, 0x48, 0x4b, 0x12, 0x1b, 0xd8, 0x0c, 0x63, + 0x40, 0x00, 0x00, 0x00, 0xff, 0xff, 0xdc, 0x84, 0x30, 0xff, 0xf3, 0x00, 0x00, 0x00, +} diff --git a/vendor/github.com/golang/protobuf/ptypes/duration/duration.proto b/vendor/github.com/golang/protobuf/ptypes/duration/duration.proto new file mode 100644 index 00000000..975fce41 --- /dev/null +++ b/vendor/github.com/golang/protobuf/ptypes/duration/duration.proto @@ -0,0 +1,117 @@ +// Protocol Buffers - Google's data interchange format +// Copyright 2008 Google Inc. All rights reserved. +// https://developers.google.com/protocol-buffers/ +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// * Neither the name of Google Inc. nor the names of its +// contributors may be used to endorse or promote products derived from +// this software without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +syntax = "proto3"; + +package google.protobuf; + +option csharp_namespace = "Google.Protobuf.WellKnownTypes"; +option cc_enable_arenas = true; +option go_package = "github.com/golang/protobuf/ptypes/duration"; +option java_package = "com.google.protobuf"; +option java_outer_classname = "DurationProto"; +option java_multiple_files = true; +option objc_class_prefix = "GPB"; + +// A Duration represents a signed, fixed-length span of time represented +// as a count of seconds and fractions of seconds at nanosecond +// resolution. It is independent of any calendar and concepts like "day" +// or "month". It is related to Timestamp in that the difference between +// two Timestamp values is a Duration and it can be added or subtracted +// from a Timestamp. Range is approximately +-10,000 years. +// +// # Examples +// +// Example 1: Compute Duration from two Timestamps in pseudo code. +// +// Timestamp start = ...; +// Timestamp end = ...; +// Duration duration = ...; +// +// duration.seconds = end.seconds - start.seconds; +// duration.nanos = end.nanos - start.nanos; +// +// if (duration.seconds < 0 && duration.nanos > 0) { +// duration.seconds += 1; +// duration.nanos -= 1000000000; +// } else if (durations.seconds > 0 && duration.nanos < 0) { +// duration.seconds -= 1; +// duration.nanos += 1000000000; +// } +// +// Example 2: Compute Timestamp from Timestamp + Duration in pseudo code. +// +// Timestamp start = ...; +// Duration duration = ...; +// Timestamp end = ...; +// +// end.seconds = start.seconds + duration.seconds; +// end.nanos = start.nanos + duration.nanos; +// +// if (end.nanos < 0) { +// end.seconds -= 1; +// end.nanos += 1000000000; +// } else if (end.nanos >= 1000000000) { +// end.seconds += 1; +// end.nanos -= 1000000000; +// } +// +// Example 3: Compute Duration from datetime.timedelta in Python. +// +// td = datetime.timedelta(days=3, minutes=10) +// duration = Duration() +// duration.FromTimedelta(td) +// +// # JSON Mapping +// +// In JSON format, the Duration type is encoded as a string rather than an +// object, where the string ends in the suffix "s" (indicating seconds) and +// is preceded by the number of seconds, with nanoseconds expressed as +// fractional seconds. For example, 3 seconds with 0 nanoseconds should be +// encoded in JSON format as "3s", while 3 seconds and 1 nanosecond should +// be expressed in JSON format as "3.000000001s", and 3 seconds and 1 +// microsecond should be expressed in JSON format as "3.000001s". +// +// +message Duration { + + // Signed seconds of the span of time. Must be from -315,576,000,000 + // to +315,576,000,000 inclusive. Note: these bounds are computed from: + // 60 sec/min * 60 min/hr * 24 hr/day * 365.25 days/year * 10000 years + int64 seconds = 1; + + // Signed fractions of a second at nanosecond resolution of the span + // of time. Durations less than one second are represented with a 0 + // `seconds` field and a positive or negative `nanos` field. For durations + // of one second or more, a non-zero value for the `nanos` field must be + // of the same sign as the `seconds` field. Must be from -999,999,999 + // to +999,999,999 inclusive. + int32 nanos = 2; +} diff --git a/vendor/github.com/golang/protobuf/ptypes/timestamp.go b/vendor/github.com/golang/protobuf/ptypes/timestamp.go new file mode 100644 index 00000000..8da0df01 --- /dev/null +++ b/vendor/github.com/golang/protobuf/ptypes/timestamp.go @@ -0,0 +1,132 @@ +// Go support for Protocol Buffers - Google's data interchange format +// +// Copyright 2016 The Go Authors. All rights reserved. +// https://github.com/golang/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// * Neither the name of Google Inc. nor the names of its +// contributors may be used to endorse or promote products derived from +// this software without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package ptypes + +// This file implements operations on google.protobuf.Timestamp. + +import ( + "errors" + "fmt" + "time" + + tspb "github.com/golang/protobuf/ptypes/timestamp" +) + +const ( + // Seconds field of the earliest valid Timestamp. + // This is time.Date(1, 1, 1, 0, 0, 0, 0, time.UTC).Unix(). + minValidSeconds = -62135596800 + // Seconds field just after the latest valid Timestamp. + // This is time.Date(10000, 1, 1, 0, 0, 0, 0, time.UTC).Unix(). + maxValidSeconds = 253402300800 +) + +// validateTimestamp determines whether a Timestamp is valid. +// A valid timestamp represents a time in the range +// [0001-01-01, 10000-01-01) and has a Nanos field +// in the range [0, 1e9). +// +// If the Timestamp is valid, validateTimestamp returns nil. +// Otherwise, it returns an error that describes +// the problem. +// +// Every valid Timestamp can be represented by a time.Time, but the converse is not true. +func validateTimestamp(ts *tspb.Timestamp) error { + if ts == nil { + return errors.New("timestamp: nil Timestamp") + } + if ts.Seconds < minValidSeconds { + return fmt.Errorf("timestamp: %v before 0001-01-01", ts) + } + if ts.Seconds >= maxValidSeconds { + return fmt.Errorf("timestamp: %v after 10000-01-01", ts) + } + if ts.Nanos < 0 || ts.Nanos >= 1e9 { + return fmt.Errorf("timestamp: %v: nanos not in range [0, 1e9)", ts) + } + return nil +} + +// Timestamp converts a google.protobuf.Timestamp proto to a time.Time. +// It returns an error if the argument is invalid. +// +// Unlike most Go functions, if Timestamp returns an error, the first return value +// is not the zero time.Time. Instead, it is the value obtained from the +// time.Unix function when passed the contents of the Timestamp, in the UTC +// locale. This may or may not be a meaningful time; many invalid Timestamps +// do map to valid time.Times. +// +// A nil Timestamp returns an error. The first return value in that case is +// undefined. +func Timestamp(ts *tspb.Timestamp) (time.Time, error) { + // Don't return the zero value on error, because corresponds to a valid + // timestamp. Instead return whatever time.Unix gives us. + var t time.Time + if ts == nil { + t = time.Unix(0, 0).UTC() // treat nil like the empty Timestamp + } else { + t = time.Unix(ts.Seconds, int64(ts.Nanos)).UTC() + } + return t, validateTimestamp(ts) +} + +// TimestampNow returns a google.protobuf.Timestamp for the current time. +func TimestampNow() *tspb.Timestamp { + ts, err := TimestampProto(time.Now()) + if err != nil { + panic("ptypes: time.Now() out of Timestamp range") + } + return ts +} + +// TimestampProto converts the time.Time to a google.protobuf.Timestamp proto. +// It returns an error if the resulting Timestamp is invalid. +func TimestampProto(t time.Time) (*tspb.Timestamp, error) { + ts := &tspb.Timestamp{ + Seconds: t.Unix(), + Nanos: int32(t.Nanosecond()), + } + if err := validateTimestamp(ts); err != nil { + return nil, err + } + return ts, nil +} + +// TimestampString returns the RFC 3339 string for valid Timestamps. For invalid +// Timestamps, it returns an error message in parentheses. +func TimestampString(ts *tspb.Timestamp) string { + t, err := Timestamp(ts) + if err != nil { + return fmt.Sprintf("(%v)", err) + } + return t.Format(time.RFC3339Nano) +} diff --git a/vendor/github.com/golang/protobuf/ptypes/timestamp/timestamp.pb.go b/vendor/github.com/golang/protobuf/ptypes/timestamp/timestamp.pb.go new file mode 100644 index 00000000..31cd846d --- /dev/null +++ b/vendor/github.com/golang/protobuf/ptypes/timestamp/timestamp.pb.go @@ -0,0 +1,179 @@ +// Code generated by protoc-gen-go. DO NOT EDIT. +// source: google/protobuf/timestamp.proto + +package timestamp + +import ( + fmt "fmt" + proto "github.com/golang/protobuf/proto" + math "math" +) + +// Reference imports to suppress errors if they are not otherwise used. +var _ = proto.Marshal +var _ = fmt.Errorf +var _ = math.Inf + +// This is a compile-time assertion to ensure that this generated file +// is compatible with the proto package it is being compiled against. +// A compilation error at this line likely means your copy of the +// proto package needs to be updated. +const _ = proto.ProtoPackageIsVersion3 // please upgrade the proto package + +// A Timestamp represents a point in time independent of any time zone +// or calendar, represented as seconds and fractions of seconds at +// nanosecond resolution in UTC Epoch time. It is encoded using the +// Proleptic Gregorian Calendar which extends the Gregorian calendar +// backwards to year one. It is encoded assuming all minutes are 60 +// seconds long, i.e. leap seconds are "smeared" so that no leap second +// table is needed for interpretation. Range is from +// 0001-01-01T00:00:00Z to 9999-12-31T23:59:59.999999999Z. +// By restricting to that range, we ensure that we can convert to +// and from RFC 3339 date strings. +// See [https://www.ietf.org/rfc/rfc3339.txt](https://www.ietf.org/rfc/rfc3339.txt). +// +// # Examples +// +// Example 1: Compute Timestamp from POSIX `time()`. +// +// Timestamp timestamp; +// timestamp.set_seconds(time(NULL)); +// timestamp.set_nanos(0); +// +// Example 2: Compute Timestamp from POSIX `gettimeofday()`. +// +// struct timeval tv; +// gettimeofday(&tv, NULL); +// +// Timestamp timestamp; +// timestamp.set_seconds(tv.tv_sec); +// timestamp.set_nanos(tv.tv_usec * 1000); +// +// Example 3: Compute Timestamp from Win32 `GetSystemTimeAsFileTime()`. +// +// FILETIME ft; +// GetSystemTimeAsFileTime(&ft); +// UINT64 ticks = (((UINT64)ft.dwHighDateTime) << 32) | ft.dwLowDateTime; +// +// // A Windows tick is 100 nanoseconds. Windows epoch 1601-01-01T00:00:00Z +// // is 11644473600 seconds before Unix epoch 1970-01-01T00:00:00Z. +// Timestamp timestamp; +// timestamp.set_seconds((INT64) ((ticks / 10000000) - 11644473600LL)); +// timestamp.set_nanos((INT32) ((ticks % 10000000) * 100)); +// +// Example 4: Compute Timestamp from Java `System.currentTimeMillis()`. +// +// long millis = System.currentTimeMillis(); +// +// Timestamp timestamp = Timestamp.newBuilder().setSeconds(millis / 1000) +// .setNanos((int) ((millis % 1000) * 1000000)).build(); +// +// +// Example 5: Compute Timestamp from current time in Python. +// +// timestamp = Timestamp() +// timestamp.GetCurrentTime() +// +// # JSON Mapping +// +// In JSON format, the Timestamp type is encoded as a string in the +// [RFC 3339](https://www.ietf.org/rfc/rfc3339.txt) format. That is, the +// format is "{year}-{month}-{day}T{hour}:{min}:{sec}[.{frac_sec}]Z" +// where {year} is always expressed using four digits while {month}, {day}, +// {hour}, {min}, and {sec} are zero-padded to two digits each. The fractional +// seconds, which can go up to 9 digits (i.e. up to 1 nanosecond resolution), +// are optional. The "Z" suffix indicates the timezone ("UTC"); the timezone +// is required. A proto3 JSON serializer should always use UTC (as indicated by +// "Z") when printing the Timestamp type and a proto3 JSON parser should be +// able to accept both UTC and other timezones (as indicated by an offset). +// +// For example, "2017-01-15T01:30:15.01Z" encodes 15.01 seconds past +// 01:30 UTC on January 15, 2017. +// +// In JavaScript, one can convert a Date object to this format using the +// standard [toISOString()](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Date/toISOString] +// method. In Python, a standard `datetime.datetime` object can be converted +// to this format using [`strftime`](https://docs.python.org/2/library/time.html#time.strftime) +// with the time format spec '%Y-%m-%dT%H:%M:%S.%fZ'. Likewise, in Java, one +// can use the Joda Time's [`ISODateTimeFormat.dateTime()`]( +// http://www.joda.org/joda-time/apidocs/org/joda/time/format/ISODateTimeFormat.html#dateTime-- +// ) to obtain a formatter capable of generating timestamps in this format. +// +// +type Timestamp struct { + // Represents seconds of UTC time since Unix epoch + // 1970-01-01T00:00:00Z. Must be from 0001-01-01T00:00:00Z to + // 9999-12-31T23:59:59Z inclusive. + Seconds int64 `protobuf:"varint,1,opt,name=seconds,proto3" json:"seconds,omitempty"` + // Non-negative fractions of a second at nanosecond resolution. Negative + // second values with fractions must still have non-negative nanos values + // that count forward in time. Must be from 0 to 999,999,999 + // inclusive. + Nanos int32 `protobuf:"varint,2,opt,name=nanos,proto3" json:"nanos,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *Timestamp) Reset() { *m = Timestamp{} } +func (m *Timestamp) String() string { return proto.CompactTextString(m) } +func (*Timestamp) ProtoMessage() {} +func (*Timestamp) Descriptor() ([]byte, []int) { + return fileDescriptor_292007bbfe81227e, []int{0} +} + +func (*Timestamp) XXX_WellKnownType() string { return "Timestamp" } + +func (m *Timestamp) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_Timestamp.Unmarshal(m, b) +} +func (m *Timestamp) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_Timestamp.Marshal(b, m, deterministic) +} +func (m *Timestamp) XXX_Merge(src proto.Message) { + xxx_messageInfo_Timestamp.Merge(m, src) +} +func (m *Timestamp) XXX_Size() int { + return xxx_messageInfo_Timestamp.Size(m) +} +func (m *Timestamp) XXX_DiscardUnknown() { + xxx_messageInfo_Timestamp.DiscardUnknown(m) +} + +var xxx_messageInfo_Timestamp proto.InternalMessageInfo + +func (m *Timestamp) GetSeconds() int64 { + if m != nil { + return m.Seconds + } + return 0 +} + +func (m *Timestamp) GetNanos() int32 { + if m != nil { + return m.Nanos + } + return 0 +} + +func init() { + proto.RegisterType((*Timestamp)(nil), "google.protobuf.Timestamp") +} + +func init() { proto.RegisterFile("google/protobuf/timestamp.proto", fileDescriptor_292007bbfe81227e) } + +var fileDescriptor_292007bbfe81227e = []byte{ + // 191 bytes of a gzipped FileDescriptorProto + 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0xe2, 0x92, 0x4f, 0xcf, 0xcf, 0x4f, + 0xcf, 0x49, 0xd5, 0x2f, 0x28, 0xca, 0x2f, 0xc9, 0x4f, 0x2a, 0x4d, 0xd3, 0x2f, 0xc9, 0xcc, 0x4d, + 0x2d, 0x2e, 0x49, 0xcc, 0x2d, 0xd0, 0x03, 0x0b, 0x09, 0xf1, 0x43, 0x14, 0xe8, 0xc1, 0x14, 0x28, + 0x59, 0x73, 0x71, 0x86, 0xc0, 0xd4, 0x08, 0x49, 0x70, 0xb1, 0x17, 0xa7, 0x26, 0xe7, 0xe7, 0xa5, + 0x14, 0x4b, 0x30, 0x2a, 0x30, 0x6a, 0x30, 0x07, 0xc1, 0xb8, 0x42, 0x22, 0x5c, 0xac, 0x79, 0x89, + 0x79, 0xf9, 0xc5, 0x12, 0x4c, 0x0a, 0x8c, 0x1a, 0xac, 0x41, 0x10, 0x8e, 0x53, 0x1d, 0x97, 0x70, + 0x72, 0x7e, 0xae, 0x1e, 0x9a, 0x99, 0x4e, 0x7c, 0x70, 0x13, 0x03, 0x40, 0x42, 0x01, 0x8c, 0x51, + 0xda, 0xe9, 0x99, 0x25, 0x19, 0xa5, 0x49, 0x7a, 0xc9, 0xf9, 0xb9, 0xfa, 0xe9, 0xf9, 0x39, 0x89, + 0x79, 0xe9, 0x08, 0x27, 0x16, 0x94, 0x54, 0x16, 0xa4, 0x16, 0x23, 0x5c, 0xfa, 0x83, 0x91, 0x71, + 0x11, 0x13, 0xb3, 0x7b, 0x80, 0xd3, 0x2a, 0x26, 0x39, 0x77, 0x88, 0xc9, 0x01, 0x50, 0xb5, 0x7a, + 0xe1, 0xa9, 0x39, 0x39, 0xde, 0x79, 0xf9, 0xe5, 0x79, 0x21, 0x20, 0x3d, 0x49, 0x6c, 0x60, 0x43, + 0x8c, 0x01, 0x01, 0x00, 0x00, 0xff, 0xff, 0xbc, 0x77, 0x4a, 0x07, 0xf7, 0x00, 0x00, 0x00, +} diff --git a/vendor/github.com/golang/protobuf/ptypes/timestamp/timestamp.proto b/vendor/github.com/golang/protobuf/ptypes/timestamp/timestamp.proto new file mode 100644 index 00000000..eafb3fa0 --- /dev/null +++ b/vendor/github.com/golang/protobuf/ptypes/timestamp/timestamp.proto @@ -0,0 +1,135 @@ +// Protocol Buffers - Google's data interchange format +// Copyright 2008 Google Inc. All rights reserved. +// https://developers.google.com/protocol-buffers/ +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// * Neither the name of Google Inc. nor the names of its +// contributors may be used to endorse or promote products derived from +// this software without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +syntax = "proto3"; + +package google.protobuf; + +option csharp_namespace = "Google.Protobuf.WellKnownTypes"; +option cc_enable_arenas = true; +option go_package = "github.com/golang/protobuf/ptypes/timestamp"; +option java_package = "com.google.protobuf"; +option java_outer_classname = "TimestampProto"; +option java_multiple_files = true; +option objc_class_prefix = "GPB"; + +// A Timestamp represents a point in time independent of any time zone +// or calendar, represented as seconds and fractions of seconds at +// nanosecond resolution in UTC Epoch time. It is encoded using the +// Proleptic Gregorian Calendar which extends the Gregorian calendar +// backwards to year one. It is encoded assuming all minutes are 60 +// seconds long, i.e. leap seconds are "smeared" so that no leap second +// table is needed for interpretation. Range is from +// 0001-01-01T00:00:00Z to 9999-12-31T23:59:59.999999999Z. +// By restricting to that range, we ensure that we can convert to +// and from RFC 3339 date strings. +// See [https://www.ietf.org/rfc/rfc3339.txt](https://www.ietf.org/rfc/rfc3339.txt). +// +// # Examples +// +// Example 1: Compute Timestamp from POSIX `time()`. +// +// Timestamp timestamp; +// timestamp.set_seconds(time(NULL)); +// timestamp.set_nanos(0); +// +// Example 2: Compute Timestamp from POSIX `gettimeofday()`. +// +// struct timeval tv; +// gettimeofday(&tv, NULL); +// +// Timestamp timestamp; +// timestamp.set_seconds(tv.tv_sec); +// timestamp.set_nanos(tv.tv_usec * 1000); +// +// Example 3: Compute Timestamp from Win32 `GetSystemTimeAsFileTime()`. +// +// FILETIME ft; +// GetSystemTimeAsFileTime(&ft); +// UINT64 ticks = (((UINT64)ft.dwHighDateTime) << 32) | ft.dwLowDateTime; +// +// // A Windows tick is 100 nanoseconds. Windows epoch 1601-01-01T00:00:00Z +// // is 11644473600 seconds before Unix epoch 1970-01-01T00:00:00Z. +// Timestamp timestamp; +// timestamp.set_seconds((INT64) ((ticks / 10000000) - 11644473600LL)); +// timestamp.set_nanos((INT32) ((ticks % 10000000) * 100)); +// +// Example 4: Compute Timestamp from Java `System.currentTimeMillis()`. +// +// long millis = System.currentTimeMillis(); +// +// Timestamp timestamp = Timestamp.newBuilder().setSeconds(millis / 1000) +// .setNanos((int) ((millis % 1000) * 1000000)).build(); +// +// +// Example 5: Compute Timestamp from current time in Python. +// +// timestamp = Timestamp() +// timestamp.GetCurrentTime() +// +// # JSON Mapping +// +// In JSON format, the Timestamp type is encoded as a string in the +// [RFC 3339](https://www.ietf.org/rfc/rfc3339.txt) format. That is, the +// format is "{year}-{month}-{day}T{hour}:{min}:{sec}[.{frac_sec}]Z" +// where {year} is always expressed using four digits while {month}, {day}, +// {hour}, {min}, and {sec} are zero-padded to two digits each. The fractional +// seconds, which can go up to 9 digits (i.e. up to 1 nanosecond resolution), +// are optional. The "Z" suffix indicates the timezone ("UTC"); the timezone +// is required. A proto3 JSON serializer should always use UTC (as indicated by +// "Z") when printing the Timestamp type and a proto3 JSON parser should be +// able to accept both UTC and other timezones (as indicated by an offset). +// +// For example, "2017-01-15T01:30:15.01Z" encodes 15.01 seconds past +// 01:30 UTC on January 15, 2017. +// +// In JavaScript, one can convert a Date object to this format using the +// standard [toISOString()](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Date/toISOString] +// method. In Python, a standard `datetime.datetime` object can be converted +// to this format using [`strftime`](https://docs.python.org/2/library/time.html#time.strftime) +// with the time format spec '%Y-%m-%dT%H:%M:%S.%fZ'. Likewise, in Java, one +// can use the Joda Time's [`ISODateTimeFormat.dateTime()`]( +// http://www.joda.org/joda-time/apidocs/org/joda/time/format/ISODateTimeFormat.html#dateTime-- +// ) to obtain a formatter capable of generating timestamps in this format. +// +// +message Timestamp { + + // Represents seconds of UTC time since Unix epoch + // 1970-01-01T00:00:00Z. Must be from 0001-01-01T00:00:00Z to + // 9999-12-31T23:59:59Z inclusive. + int64 seconds = 1; + + // Non-negative fractions of a second at nanosecond resolution. Negative + // second values with fractions must still have non-negative nanos values + // that count forward in time. Must be from 0 to 999,999,999 + // inclusive. + int32 nanos = 2; +} diff --git a/vendor/github.com/hashicorp/golang-lru/LICENSE b/vendor/github.com/hashicorp/golang-lru/LICENSE new file mode 100644 index 00000000..be2cc4df --- /dev/null +++ b/vendor/github.com/hashicorp/golang-lru/LICENSE @@ -0,0 +1,362 @@ +Mozilla Public License, version 2.0 + +1. Definitions + +1.1. "Contributor" + + means each individual or legal entity that creates, contributes to the + creation of, or owns Covered Software. + +1.2. "Contributor Version" + + means the combination of the Contributions of others (if any) used by a + Contributor and that particular Contributor's Contribution. + +1.3. "Contribution" + + means Covered Software of a particular Contributor. + +1.4. "Covered Software" + + means Source Code Form to which the initial Contributor has attached the + notice in Exhibit A, the Executable Form of such Source Code Form, and + Modifications of such Source Code Form, in each case including portions + thereof. + +1.5. "Incompatible With Secondary Licenses" + means + + a. that the initial Contributor has attached the notice described in + Exhibit B to the Covered Software; or + + b. that the Covered Software was made available under the terms of + version 1.1 or earlier of the License, but not also under the terms of + a Secondary License. + +1.6. "Executable Form" + + means any form of the work other than Source Code Form. + +1.7. "Larger Work" + + means a work that combines Covered Software with other material, in a + separate file or files, that is not Covered Software. + +1.8. "License" + + means this document. + +1.9. "Licensable" + + means having the right to grant, to the maximum extent possible, whether + at the time of the initial grant or subsequently, any and all of the + rights conveyed by this License. + +1.10. "Modifications" + + means any of the following: + + a. any file in Source Code Form that results from an addition to, + deletion from, or modification of the contents of Covered Software; or + + b. any new file in Source Code Form that contains any Covered Software. + +1.11. "Patent Claims" of a Contributor + + means any patent claim(s), including without limitation, method, + process, and apparatus claims, in any patent Licensable by such + Contributor that would be infringed, but for the grant of the License, + by the making, using, selling, offering for sale, having made, import, + or transfer of either its Contributions or its Contributor Version. + +1.12. "Secondary License" + + means either the GNU General Public License, Version 2.0, the GNU Lesser + General Public License, Version 2.1, the GNU Affero General Public + License, Version 3.0, or any later versions of those licenses. + +1.13. "Source Code Form" + + means the form of the work preferred for making modifications. + +1.14. "You" (or "Your") + + means an individual or a legal entity exercising rights under this + License. For legal entities, "You" includes any entity that controls, is + controlled by, or is under common control with You. For purposes of this + definition, "control" means (a) the power, direct or indirect, to cause + the direction or management of such entity, whether by contract or + otherwise, or (b) ownership of more than fifty percent (50%) of the + outstanding shares or beneficial ownership of such entity. + + +2. License Grants and Conditions + +2.1. Grants + + Each Contributor hereby grants You a world-wide, royalty-free, + non-exclusive license: + + a. under intellectual property rights (other than patent or trademark) + Licensable by such Contributor to use, reproduce, make available, + modify, display, perform, distribute, and otherwise exploit its + Contributions, either on an unmodified basis, with Modifications, or + as part of a Larger Work; and + + b. under Patent Claims of such Contributor to make, use, sell, offer for + sale, have made, import, and otherwise transfer either its + Contributions or its Contributor Version. + +2.2. Effective Date + + The licenses granted in Section 2.1 with respect to any Contribution + become effective for each Contribution on the date the Contributor first + distributes such Contribution. + +2.3. Limitations on Grant Scope + + The licenses granted in this Section 2 are the only rights granted under + this License. No additional rights or licenses will be implied from the + distribution or licensing of Covered Software under this License. + Notwithstanding Section 2.1(b) above, no patent license is granted by a + Contributor: + + a. for any code that a Contributor has removed from Covered Software; or + + b. for infringements caused by: (i) Your and any other third party's + modifications of Covered Software, or (ii) the combination of its + Contributions with other software (except as part of its Contributor + Version); or + + c. under Patent Claims infringed by Covered Software in the absence of + its Contributions. + + This License does not grant any rights in the trademarks, service marks, + or logos of any Contributor (except as may be necessary to comply with + the notice requirements in Section 3.4). + +2.4. Subsequent Licenses + + No Contributor makes additional grants as a result of Your choice to + distribute the Covered Software under a subsequent version of this + License (see Section 10.2) or under the terms of a Secondary License (if + permitted under the terms of Section 3.3). + +2.5. Representation + + Each Contributor represents that the Contributor believes its + Contributions are its original creation(s) or it has sufficient rights to + grant the rights to its Contributions conveyed by this License. + +2.6. Fair Use + + This License is not intended to limit any rights You have under + applicable copyright doctrines of fair use, fair dealing, or other + equivalents. + +2.7. Conditions + + Sections 3.1, 3.2, 3.3, and 3.4 are conditions of the licenses granted in + Section 2.1. + + +3. Responsibilities + +3.1. Distribution of Source Form + + All distribution of Covered Software in Source Code Form, including any + Modifications that You create or to which You contribute, must be under + the terms of this License. You must inform recipients that the Source + Code Form of the Covered Software is governed by the terms of this + License, and how they can obtain a copy of this License. You may not + attempt to alter or restrict the recipients' rights in the Source Code + Form. + +3.2. Distribution of Executable Form + + If You distribute Covered Software in Executable Form then: + + a. such Covered Software must also be made available in Source Code Form, + as described in Section 3.1, and You must inform recipients of the + Executable Form how they can obtain a copy of such Source Code Form by + reasonable means in a timely manner, at a charge no more than the cost + of distribution to the recipient; and + + b. You may distribute such Executable Form under the terms of this + License, or sublicense it under different terms, provided that the + license for the Executable Form does not attempt to limit or alter the + recipients' rights in the Source Code Form under this License. + +3.3. Distribution of a Larger Work + + You may create and distribute a Larger Work under terms of Your choice, + provided that You also comply with the requirements of this License for + the Covered Software. If the Larger Work is a combination of Covered + Software with a work governed by one or more Secondary Licenses, and the + Covered Software is not Incompatible With Secondary Licenses, this + License permits You to additionally distribute such Covered Software + under the terms of such Secondary License(s), so that the recipient of + the Larger Work may, at their option, further distribute the Covered + Software under the terms of either this License or such Secondary + License(s). + +3.4. Notices + + You may not remove or alter the substance of any license notices + (including copyright notices, patent notices, disclaimers of warranty, or + limitations of liability) contained within the Source Code Form of the + Covered Software, except that You may alter any license notices to the + extent required to remedy known factual inaccuracies. + +3.5. Application of Additional Terms + + You may choose to offer, and to charge a fee for, warranty, support, + indemnity or liability obligations to one or more recipients of Covered + Software. However, You may do so only on Your own behalf, and not on + behalf of any Contributor. You must make it absolutely clear that any + such warranty, support, indemnity, or liability obligation is offered by + You alone, and You hereby agree to indemnify every Contributor for any + liability incurred by such Contributor as a result of warranty, support, + indemnity or liability terms You offer. You may include additional + disclaimers of warranty and limitations of liability specific to any + jurisdiction. + +4. Inability to Comply Due to Statute or Regulation + + If it is impossible for You to comply with any of the terms of this License + with respect to some or all of the Covered Software due to statute, + judicial order, or regulation then You must: (a) comply with the terms of + this License to the maximum extent possible; and (b) describe the + limitations and the code they affect. Such description must be placed in a + text file included with all distributions of the Covered Software under + this License. Except to the extent prohibited by statute or regulation, + such description must be sufficiently detailed for a recipient of ordinary + skill to be able to understand it. + +5. Termination + +5.1. The rights granted under this License will terminate automatically if You + fail to comply with any of its terms. However, if You become compliant, + then the rights granted under this License from a particular Contributor + are reinstated (a) provisionally, unless and until such Contributor + explicitly and finally terminates Your grants, and (b) on an ongoing + basis, if such Contributor fails to notify You of the non-compliance by + some reasonable means prior to 60 days after You have come back into + compliance. Moreover, Your grants from a particular Contributor are + reinstated on an ongoing basis if such Contributor notifies You of the + non-compliance by some reasonable means, this is the first time You have + received notice of non-compliance with this License from such + Contributor, and You become compliant prior to 30 days after Your receipt + of the notice. + +5.2. If You initiate litigation against any entity by asserting a patent + infringement claim (excluding declaratory judgment actions, + counter-claims, and cross-claims) alleging that a Contributor Version + directly or indirectly infringes any patent, then the rights granted to + You by any and all Contributors for the Covered Software under Section + 2.1 of this License shall terminate. + +5.3. In the event of termination under Sections 5.1 or 5.2 above, all end user + license agreements (excluding distributors and resellers) which have been + validly granted by You or Your distributors under this License prior to + termination shall survive termination. + +6. Disclaimer of Warranty + + Covered Software is provided under this License on an "as is" basis, + without warranty of any kind, either expressed, implied, or statutory, + including, without limitation, warranties that the Covered Software is free + of defects, merchantable, fit for a particular purpose or non-infringing. + The entire risk as to the quality and performance of the Covered Software + is with You. Should any Covered Software prove defective in any respect, + You (not any Contributor) assume the cost of any necessary servicing, + repair, or correction. This disclaimer of warranty constitutes an essential + part of this License. No use of any Covered Software is authorized under + this License except under this disclaimer. + +7. Limitation of Liability + + Under no circumstances and under no legal theory, whether tort (including + negligence), contract, or otherwise, shall any Contributor, or anyone who + distributes Covered Software as permitted above, be liable to You for any + direct, indirect, special, incidental, or consequential damages of any + character including, without limitation, damages for lost profits, loss of + goodwill, work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses, even if such party shall have been + informed of the possibility of such damages. This limitation of liability + shall not apply to liability for death or personal injury resulting from + such party's negligence to the extent applicable law prohibits such + limitation. Some jurisdictions do not allow the exclusion or limitation of + incidental or consequential damages, so this exclusion and limitation may + not apply to You. + +8. Litigation + + Any litigation relating to this License may be brought only in the courts + of a jurisdiction where the defendant maintains its principal place of + business and such litigation shall be governed by laws of that + jurisdiction, without reference to its conflict-of-law provisions. Nothing + in this Section shall prevent a party's ability to bring cross-claims or + counter-claims. + +9. Miscellaneous + + This License represents the complete agreement concerning the subject + matter hereof. If any provision of this License is held to be + unenforceable, such provision shall be reformed only to the extent + necessary to make it enforceable. Any law or regulation which provides that + the language of a contract shall be construed against the drafter shall not + be used to construe this License against a Contributor. + + +10. Versions of the License + +10.1. New Versions + + Mozilla Foundation is the license steward. Except as provided in Section + 10.3, no one other than the license steward has the right to modify or + publish new versions of this License. Each version will be given a + distinguishing version number. + +10.2. Effect of New Versions + + You may distribute the Covered Software under the terms of the version + of the License under which You originally received the Covered Software, + or under the terms of any subsequent version published by the license + steward. + +10.3. Modified Versions + + If you create software not governed by this License, and you want to + create a new license for such software, you may create and use a + modified version of this License if you rename the license and remove + any references to the name of the license steward (except to note that + such modified license differs from this License). + +10.4. Distributing Source Code Form that is Incompatible With Secondary + Licenses If You choose to distribute Source Code Form that is + Incompatible With Secondary Licenses under the terms of this version of + the License, the notice described in Exhibit B of this License must be + attached. + +Exhibit A - Source Code Form License Notice + + This Source Code Form is subject to the + terms of the Mozilla Public License, v. + 2.0. If a copy of the MPL was not + distributed with this file, You can + obtain one at + http://mozilla.org/MPL/2.0/. + +If it is not possible or desirable to put the notice in a particular file, +then You may include the notice in a location (such as a LICENSE file in a +relevant directory) where a recipient would be likely to look for such a +notice. + +You may add additional accurate notices of copyright ownership. + +Exhibit B - "Incompatible With Secondary Licenses" Notice + + This Source Code Form is "Incompatible + With Secondary Licenses", as defined by + the Mozilla Public License, v. 2.0. diff --git a/vendor/github.com/hashicorp/golang-lru/simplelru/lru.go b/vendor/github.com/hashicorp/golang-lru/simplelru/lru.go new file mode 100644 index 00000000..5673773b --- /dev/null +++ b/vendor/github.com/hashicorp/golang-lru/simplelru/lru.go @@ -0,0 +1,161 @@ +package simplelru + +import ( + "container/list" + "errors" +) + +// EvictCallback is used to get a callback when a cache entry is evicted +type EvictCallback func(key interface{}, value interface{}) + +// LRU implements a non-thread safe fixed size LRU cache +type LRU struct { + size int + evictList *list.List + items map[interface{}]*list.Element + onEvict EvictCallback +} + +// entry is used to hold a value in the evictList +type entry struct { + key interface{} + value interface{} +} + +// NewLRU constructs an LRU of the given size +func NewLRU(size int, onEvict EvictCallback) (*LRU, error) { + if size <= 0 { + return nil, errors.New("Must provide a positive size") + } + c := &LRU{ + size: size, + evictList: list.New(), + items: make(map[interface{}]*list.Element), + onEvict: onEvict, + } + return c, nil +} + +// Purge is used to completely clear the cache. +func (c *LRU) Purge() { + for k, v := range c.items { + if c.onEvict != nil { + c.onEvict(k, v.Value.(*entry).value) + } + delete(c.items, k) + } + c.evictList.Init() +} + +// Add adds a value to the cache. Returns true if an eviction occurred. +func (c *LRU) Add(key, value interface{}) (evicted bool) { + // Check for existing item + if ent, ok := c.items[key]; ok { + c.evictList.MoveToFront(ent) + ent.Value.(*entry).value = value + return false + } + + // Add new item + ent := &entry{key, value} + entry := c.evictList.PushFront(ent) + c.items[key] = entry + + evict := c.evictList.Len() > c.size + // Verify size not exceeded + if evict { + c.removeOldest() + } + return evict +} + +// Get looks up a key's value from the cache. +func (c *LRU) Get(key interface{}) (value interface{}, ok bool) { + if ent, ok := c.items[key]; ok { + c.evictList.MoveToFront(ent) + return ent.Value.(*entry).value, true + } + return +} + +// Contains checks if a key is in the cache, without updating the recent-ness +// or deleting it for being stale. +func (c *LRU) Contains(key interface{}) (ok bool) { + _, ok = c.items[key] + return ok +} + +// Peek returns the key value (or undefined if not found) without updating +// the "recently used"-ness of the key. +func (c *LRU) Peek(key interface{}) (value interface{}, ok bool) { + var ent *list.Element + if ent, ok = c.items[key]; ok { + return ent.Value.(*entry).value, true + } + return nil, ok +} + +// Remove removes the provided key from the cache, returning if the +// key was contained. +func (c *LRU) Remove(key interface{}) (present bool) { + if ent, ok := c.items[key]; ok { + c.removeElement(ent) + return true + } + return false +} + +// RemoveOldest removes the oldest item from the cache. +func (c *LRU) RemoveOldest() (key interface{}, value interface{}, ok bool) { + ent := c.evictList.Back() + if ent != nil { + c.removeElement(ent) + kv := ent.Value.(*entry) + return kv.key, kv.value, true + } + return nil, nil, false +} + +// GetOldest returns the oldest entry +func (c *LRU) GetOldest() (key interface{}, value interface{}, ok bool) { + ent := c.evictList.Back() + if ent != nil { + kv := ent.Value.(*entry) + return kv.key, kv.value, true + } + return nil, nil, false +} + +// Keys returns a slice of the keys in the cache, from oldest to newest. +func (c *LRU) Keys() []interface{} { + keys := make([]interface{}, len(c.items)) + i := 0 + for ent := c.evictList.Back(); ent != nil; ent = ent.Prev() { + keys[i] = ent.Value.(*entry).key + i++ + } + return keys +} + +// Len returns the number of items in the cache. +func (c *LRU) Len() int { + return c.evictList.Len() +} + +// removeOldest removes the oldest item from the cache. +func (c *LRU) removeOldest() { + ent := c.evictList.Back() + if ent != nil { + c.removeElement(ent) + } +} + +// removeElement is used to remove a given list element from the cache +func (c *LRU) removeElement(e *list.Element) { + c.evictList.Remove(e) + kv := e.Value.(*entry) + delete(c.items, kv.key) + if c.onEvict != nil { + c.onEvict(kv.key, kv.value) + } +} diff --git a/vendor/github.com/hashicorp/golang-lru/simplelru/lru_interface.go b/vendor/github.com/hashicorp/golang-lru/simplelru/lru_interface.go new file mode 100644 index 00000000..74c70774 --- /dev/null +++ b/vendor/github.com/hashicorp/golang-lru/simplelru/lru_interface.go @@ -0,0 +1,36 @@ +package simplelru + +// LRUCache is the interface for simple LRU cache. +type LRUCache interface { + // Adds a value to the cache, returns true if an eviction occurred and + // updates the "recently used"-ness of the key. + Add(key, value interface{}) bool + + // Returns key's value from the cache and + // updates the "recently used"-ness of the key. #value, isFound + Get(key interface{}) (value interface{}, ok bool) + + // Check if a key exsists in cache without updating the recent-ness. + Contains(key interface{}) (ok bool) + + // Returns key's value without updating the "recently used"-ness of the key. + Peek(key interface{}) (value interface{}, ok bool) + + // Removes a key from the cache. + Remove(key interface{}) bool + + // Removes the oldest entry from cache. + RemoveOldest() (interface{}, interface{}, bool) + + // Returns the oldest entry from the cache. #key, value, isFound + GetOldest() (interface{}, interface{}, bool) + + // Returns a slice of the keys in the cache, from oldest to newest. + Keys() []interface{} + + // Returns the number of items in the cache. + Len() int + + // Clear all cache entries + Purge() +} diff --git a/vendor/github.com/klauspost/compress/flate/gen.go b/vendor/github.com/klauspost/compress/flate/gen.go deleted file mode 100644 index 154c89a4..00000000 --- a/vendor/github.com/klauspost/compress/flate/gen.go +++ /dev/null @@ -1,265 +0,0 @@ -// Copyright 2012 The Go Authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the LICENSE file. - -// +build ignore - -// This program generates fixedhuff.go -// Invoke as -// -// go run gen.go -output fixedhuff.go - -package main - -import ( - "bytes" - "flag" - "fmt" - "go/format" - "io/ioutil" - "log" -) - -var filename = flag.String("output", "fixedhuff.go", "output file name") - -const maxCodeLen = 16 - -// Note: the definition of the huffmanDecoder struct is copied from -// inflate.go, as it is private to the implementation. - -// chunk & 15 is number of bits -// chunk >> 4 is value, including table link - -const ( - huffmanChunkBits = 9 - huffmanNumChunks = 1 << huffmanChunkBits - huffmanCountMask = 15 - huffmanValueShift = 4 -) - -type huffmanDecoder struct { - min int // the minimum code length - chunks [huffmanNumChunks]uint32 // chunks as described above - links [][]uint32 // overflow links - linkMask uint32 // mask the width of the link table -} - -// Initialize Huffman decoding tables from array of code lengths. -// Following this function, h is guaranteed to be initialized into a complete -// tree (i.e., neither over-subscribed nor under-subscribed). The exception is a -// degenerate case where the tree has only a single symbol with length 1. Empty -// trees are permitted. -func (h *huffmanDecoder) init(bits []int) bool { - // Sanity enables additional runtime tests during Huffman - // table construction. It's intended to be used during - // development to supplement the currently ad-hoc unit tests. - const sanity = false - - if h.min != 0 { - *h = huffmanDecoder{} - } - - // Count number of codes of each length, - // compute min and max length. - var count [maxCodeLen]int - var min, max int - for _, n := range bits { - if n == 0 { - continue - } - if min == 0 || n < min { - min = n - } - if n > max { - max = n - } - count[n]++ - } - - // Empty tree. The decompressor.huffSym function will fail later if the tree - // is used. Technically, an empty tree is only valid for the HDIST tree and - // not the HCLEN and HLIT tree. However, a stream with an empty HCLEN tree - // is guaranteed to fail since it will attempt to use the tree to decode the - // codes for the HLIT and HDIST trees. Similarly, an empty HLIT tree is - // guaranteed to fail later since the compressed data section must be - // composed of at least one symbol (the end-of-block marker). - if max == 0 { - return true - } - - code := 0 - var nextcode [maxCodeLen]int - for i := min; i <= max; i++ { - code <<= 1 - nextcode[i] = code - code += count[i] - } - - // Check that the coding is complete (i.e., that we've - // assigned all 2-to-the-max possible bit sequences). - // Exception: To be compatible with zlib, we also need to - // accept degenerate single-code codings. See also - // TestDegenerateHuffmanCoding. - if code != 1< huffmanChunkBits { - numLinks := 1 << (uint(max) - huffmanChunkBits) - h.linkMask = uint32(numLinks - 1) - - // create link tables - link := nextcode[huffmanChunkBits+1] >> 1 - h.links = make([][]uint32, huffmanNumChunks-link) - for j := uint(link); j < huffmanNumChunks; j++ { - reverse := int(reverseByte[j>>8]) | int(reverseByte[j&0xff])<<8 - reverse >>= uint(16 - huffmanChunkBits) - off := j - uint(link) - if sanity && h.chunks[reverse] != 0 { - panic("impossible: overwriting existing chunk") - } - h.chunks[reverse] = uint32(off<>8]) | int(reverseByte[code&0xff])<<8 - reverse >>= uint(16 - n) - if n <= huffmanChunkBits { - for off := reverse; off < len(h.chunks); off += 1 << uint(n) { - // We should never need to overwrite - // an existing chunk. Also, 0 is - // never a valid chunk, because the - // lower 4 "count" bits should be - // between 1 and 15. - if sanity && h.chunks[off] != 0 { - panic("impossible: overwriting existing chunk") - } - h.chunks[off] = chunk - } - } else { - j := reverse & (huffmanNumChunks - 1) - if sanity && h.chunks[j]&huffmanCountMask != huffmanChunkBits+1 { - // Longer codes should have been - // associated with a link table above. - panic("impossible: not an indirect chunk") - } - value := h.chunks[j] >> huffmanValueShift - linktab := h.links[value] - reverse >>= huffmanChunkBits - for off := reverse; off < len(linktab); off += 1 << uint(n-huffmanChunkBits) { - if sanity && linktab[off] != 0 { - panic("impossible: overwriting existing chunk") - } - linktab[off] = chunk - } - } - } - - if sanity { - // Above we've sanity checked that we never overwrote - // an existing entry. Here we additionally check that - // we filled the tables completely. - for i, chunk := range h.chunks { - if chunk == 0 { - // As an exception, in the degenerate - // single-code case, we allow odd - // chunks to be missing. - if code == 1 && i%2 == 1 { - continue - } - panic("impossible: missing chunk") - } - } - for _, linktab := range h.links { - for _, chunk := range linktab { - if chunk == 0 { - panic("impossible: missing chunk") - } - } - } - } - - return true -} - -func main() { - flag.Parse() - - var h huffmanDecoder - var bits [288]int - initReverseByte() - for i := 0; i < 144; i++ { - bits[i] = 8 - } - for i := 144; i < 256; i++ { - bits[i] = 9 - } - for i := 256; i < 280; i++ { - bits[i] = 7 - } - for i := 280; i < 288; i++ { - bits[i] = 8 - } - h.init(bits[:]) - if h.links != nil { - log.Fatal("Unexpected links table in fixed Huffman decoder") - } - - var buf bytes.Buffer - - fmt.Fprintf(&buf, `// Copyright 2013 The Go Authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the LICENSE file.`+"\n\n") - - fmt.Fprintln(&buf, "package flate") - fmt.Fprintln(&buf) - fmt.Fprintln(&buf, "// autogenerated by go run gen.go -output fixedhuff.go, DO NOT EDIT") - fmt.Fprintln(&buf) - fmt.Fprintln(&buf, "var fixedHuffmanDecoder = huffmanDecoder{") - fmt.Fprintf(&buf, "\t%d,\n", h.min) - fmt.Fprintln(&buf, "\t[huffmanNumChunks]uint32{") - for i := 0; i < huffmanNumChunks; i++ { - if i&7 == 0 { - fmt.Fprintf(&buf, "\t\t") - } else { - fmt.Fprintf(&buf, " ") - } - fmt.Fprintf(&buf, "0x%04x,", h.chunks[i]) - if i&7 == 7 { - fmt.Fprintln(&buf) - } - } - fmt.Fprintln(&buf, "\t},") - fmt.Fprintln(&buf, "\tnil, 0,") - fmt.Fprintln(&buf, "}") - - data, err := format.Source(buf.Bytes()) - if err != nil { - log.Fatal(err) - } - err = ioutil.WriteFile(*filename, data, 0644) - if err != nil { - log.Fatal(err) - } -} - -var reverseByte [256]byte - -func initReverseByte() { - for x := 0; x < 256; x++ { - var result byte - for i := uint(0); i < 8; i++ { - result |= byte(((x >> i) & 1) << (7 - i)) - } - reverseByte[x] = result - } -} diff --git a/vendor/github.com/klauspost/cpuid/private-gen.go b/vendor/github.com/klauspost/cpuid/private-gen.go deleted file mode 100644 index 437333d2..00000000 --- a/vendor/github.com/klauspost/cpuid/private-gen.go +++ /dev/null @@ -1,476 +0,0 @@ -// +build ignore - -package main - -import ( - "bytes" - "fmt" - "go/ast" - "go/parser" - "go/printer" - "go/token" - "io" - "io/ioutil" - "log" - "os" - "reflect" - "strings" - "unicode" - "unicode/utf8" -) - -var inFiles = []string{"cpuid.go", "cpuid_test.go"} -var copyFiles = []string{"cpuid_amd64.s", "cpuid_386.s", "detect_ref.go", "detect_intel.go"} -var fileSet = token.NewFileSet() -var reWrites = []rewrite{ - initRewrite("CPUInfo -> cpuInfo"), - initRewrite("Vendor -> vendor"), - initRewrite("Flags -> flags"), - initRewrite("Detect -> detect"), - initRewrite("CPU -> cpu"), -} -var excludeNames = map[string]bool{"string": true, "join": true, "trim": true, - // cpuid_test.go - "t": true, "println": true, "logf": true, "log": true, "fatalf": true, "fatal": true, -} - -var excludePrefixes = []string{"test", "benchmark"} - -func main() { - Package := "private" - parserMode := parser.ParseComments - exported := make(map[string]rewrite) - for _, file := range inFiles { - in, err := os.Open(file) - if err != nil { - log.Fatalf("opening input", err) - } - - src, err := ioutil.ReadAll(in) - if err != nil { - log.Fatalf("reading input", err) - } - - astfile, err := parser.ParseFile(fileSet, file, src, parserMode) - if err != nil { - log.Fatalf("parsing input", err) - } - - for _, rw := range reWrites { - astfile = rw(astfile) - } - - // Inspect the AST and print all identifiers and literals. - var startDecl token.Pos - var endDecl token.Pos - ast.Inspect(astfile, func(n ast.Node) bool { - var s string - switch x := n.(type) { - case *ast.Ident: - if x.IsExported() { - t := strings.ToLower(x.Name) - for _, pre := range excludePrefixes { - if strings.HasPrefix(t, pre) { - return true - } - } - if excludeNames[t] != true { - //if x.Pos() > startDecl && x.Pos() < endDecl { - exported[x.Name] = initRewrite(x.Name + " -> " + t) - } - } - - case *ast.GenDecl: - if x.Tok == token.CONST && x.Lparen > 0 { - startDecl = x.Lparen - endDecl = x.Rparen - // fmt.Printf("Decl:%s -> %s\n", fileSet.Position(startDecl), fileSet.Position(endDecl)) - } - } - if s != "" { - fmt.Printf("%s:\t%s\n", fileSet.Position(n.Pos()), s) - } - return true - }) - - for _, rw := range exported { - astfile = rw(astfile) - } - - var buf bytes.Buffer - - printer.Fprint(&buf, fileSet, astfile) - - // Remove package documentation and insert information - s := buf.String() - ind := strings.Index(buf.String(), "\npackage cpuid") - s = s[ind:] - s = "// Generated, DO NOT EDIT,\n" + - "// but copy it to your own project and rename the package.\n" + - "// See more at http://github.com/klauspost/cpuid\n" + - s - - outputName := Package + string(os.PathSeparator) + file - - err = ioutil.WriteFile(outputName, []byte(s), 0644) - if err != nil { - log.Fatalf("writing output: %s", err) - } - log.Println("Generated", outputName) - } - - for _, file := range copyFiles { - dst := "" - if strings.HasPrefix(file, "cpuid") { - dst = Package + string(os.PathSeparator) + file - } else { - dst = Package + string(os.PathSeparator) + "cpuid_" + file - } - err := copyFile(file, dst) - if err != nil { - log.Fatalf("copying file: %s", err) - } - log.Println("Copied", dst) - } -} - -// CopyFile copies a file from src to dst. If src and dst files exist, and are -// the same, then return success. Copy the file contents from src to dst. -func copyFile(src, dst string) (err error) { - sfi, err := os.Stat(src) - if err != nil { - return - } - if !sfi.Mode().IsRegular() { - // cannot copy non-regular files (e.g., directories, - // symlinks, devices, etc.) - return fmt.Errorf("CopyFile: non-regular source file %s (%q)", sfi.Name(), sfi.Mode().String()) - } - dfi, err := os.Stat(dst) - if err != nil { - if !os.IsNotExist(err) { - return - } - } else { - if !(dfi.Mode().IsRegular()) { - return fmt.Errorf("CopyFile: non-regular destination file %s (%q)", dfi.Name(), dfi.Mode().String()) - } - if os.SameFile(sfi, dfi) { - return - } - } - err = copyFileContents(src, dst) - return -} - -// copyFileContents copies the contents of the file named src to the file named -// by dst. The file will be created if it does not already exist. If the -// destination file exists, all it's contents will be replaced by the contents -// of the source file. -func copyFileContents(src, dst string) (err error) { - in, err := os.Open(src) - if err != nil { - return - } - defer in.Close() - out, err := os.Create(dst) - if err != nil { - return - } - defer func() { - cerr := out.Close() - if err == nil { - err = cerr - } - }() - if _, err = io.Copy(out, in); err != nil { - return - } - err = out.Sync() - return -} - -type rewrite func(*ast.File) *ast.File - -// Mostly copied from gofmt -func initRewrite(rewriteRule string) rewrite { - f := strings.Split(rewriteRule, "->") - if len(f) != 2 { - fmt.Fprintf(os.Stderr, "rewrite rule must be of the form 'pattern -> replacement'\n") - os.Exit(2) - } - pattern := parseExpr(f[0], "pattern") - replace := parseExpr(f[1], "replacement") - return func(p *ast.File) *ast.File { return rewriteFile(pattern, replace, p) } -} - -// parseExpr parses s as an expression. -// It might make sense to expand this to allow statement patterns, -// but there are problems with preserving formatting and also -// with what a wildcard for a statement looks like. -func parseExpr(s, what string) ast.Expr { - x, err := parser.ParseExpr(s) - if err != nil { - fmt.Fprintf(os.Stderr, "parsing %s %s at %s\n", what, s, err) - os.Exit(2) - } - return x -} - -// Keep this function for debugging. -/* -func dump(msg string, val reflect.Value) { - fmt.Printf("%s:\n", msg) - ast.Print(fileSet, val.Interface()) - fmt.Println() -} -*/ - -// rewriteFile applies the rewrite rule 'pattern -> replace' to an entire file. -func rewriteFile(pattern, replace ast.Expr, p *ast.File) *ast.File { - cmap := ast.NewCommentMap(fileSet, p, p.Comments) - m := make(map[string]reflect.Value) - pat := reflect.ValueOf(pattern) - repl := reflect.ValueOf(replace) - - var rewriteVal func(val reflect.Value) reflect.Value - rewriteVal = func(val reflect.Value) reflect.Value { - // don't bother if val is invalid to start with - if !val.IsValid() { - return reflect.Value{} - } - for k := range m { - delete(m, k) - } - val = apply(rewriteVal, val) - if match(m, pat, val) { - val = subst(m, repl, reflect.ValueOf(val.Interface().(ast.Node).Pos())) - } - return val - } - - r := apply(rewriteVal, reflect.ValueOf(p)).Interface().(*ast.File) - r.Comments = cmap.Filter(r).Comments() // recreate comments list - return r -} - -// set is a wrapper for x.Set(y); it protects the caller from panics if x cannot be changed to y. -func set(x, y reflect.Value) { - // don't bother if x cannot be set or y is invalid - if !x.CanSet() || !y.IsValid() { - return - } - defer func() { - if x := recover(); x != nil { - if s, ok := x.(string); ok && - (strings.Contains(s, "type mismatch") || strings.Contains(s, "not assignable")) { - // x cannot be set to y - ignore this rewrite - return - } - panic(x) - } - }() - x.Set(y) -} - -// Values/types for special cases. -var ( - objectPtrNil = reflect.ValueOf((*ast.Object)(nil)) - scopePtrNil = reflect.ValueOf((*ast.Scope)(nil)) - - identType = reflect.TypeOf((*ast.Ident)(nil)) - objectPtrType = reflect.TypeOf((*ast.Object)(nil)) - positionType = reflect.TypeOf(token.NoPos) - callExprType = reflect.TypeOf((*ast.CallExpr)(nil)) - scopePtrType = reflect.TypeOf((*ast.Scope)(nil)) -) - -// apply replaces each AST field x in val with f(x), returning val. -// To avoid extra conversions, f operates on the reflect.Value form. -func apply(f func(reflect.Value) reflect.Value, val reflect.Value) reflect.Value { - if !val.IsValid() { - return reflect.Value{} - } - - // *ast.Objects introduce cycles and are likely incorrect after - // rewrite; don't follow them but replace with nil instead - if val.Type() == objectPtrType { - return objectPtrNil - } - - // similarly for scopes: they are likely incorrect after a rewrite; - // replace them with nil - if val.Type() == scopePtrType { - return scopePtrNil - } - - switch v := reflect.Indirect(val); v.Kind() { - case reflect.Slice: - for i := 0; i < v.Len(); i++ { - e := v.Index(i) - set(e, f(e)) - } - case reflect.Struct: - for i := 0; i < v.NumField(); i++ { - e := v.Field(i) - set(e, f(e)) - } - case reflect.Interface: - e := v.Elem() - set(v, f(e)) - } - return val -} - -func isWildcard(s string) bool { - rune, size := utf8.DecodeRuneInString(s) - return size == len(s) && unicode.IsLower(rune) -} - -// match returns true if pattern matches val, -// recording wildcard submatches in m. -// If m == nil, match checks whether pattern == val. -func match(m map[string]reflect.Value, pattern, val reflect.Value) bool { - // Wildcard matches any expression. If it appears multiple - // times in the pattern, it must match the same expression - // each time. - if m != nil && pattern.IsValid() && pattern.Type() == identType { - name := pattern.Interface().(*ast.Ident).Name - if isWildcard(name) && val.IsValid() { - // wildcards only match valid (non-nil) expressions. - if _, ok := val.Interface().(ast.Expr); ok && !val.IsNil() { - if old, ok := m[name]; ok { - return match(nil, old, val) - } - m[name] = val - return true - } - } - } - - // Otherwise, pattern and val must match recursively. - if !pattern.IsValid() || !val.IsValid() { - return !pattern.IsValid() && !val.IsValid() - } - if pattern.Type() != val.Type() { - return false - } - - // Special cases. - switch pattern.Type() { - case identType: - // For identifiers, only the names need to match - // (and none of the other *ast.Object information). - // This is a common case, handle it all here instead - // of recursing down any further via reflection. - p := pattern.Interface().(*ast.Ident) - v := val.Interface().(*ast.Ident) - return p == nil && v == nil || p != nil && v != nil && p.Name == v.Name - case objectPtrType, positionType: - // object pointers and token positions always match - return true - case callExprType: - // For calls, the Ellipsis fields (token.Position) must - // match since that is how f(x) and f(x...) are different. - // Check them here but fall through for the remaining fields. - p := pattern.Interface().(*ast.CallExpr) - v := val.Interface().(*ast.CallExpr) - if p.Ellipsis.IsValid() != v.Ellipsis.IsValid() { - return false - } - } - - p := reflect.Indirect(pattern) - v := reflect.Indirect(val) - if !p.IsValid() || !v.IsValid() { - return !p.IsValid() && !v.IsValid() - } - - switch p.Kind() { - case reflect.Slice: - if p.Len() != v.Len() { - return false - } - for i := 0; i < p.Len(); i++ { - if !match(m, p.Index(i), v.Index(i)) { - return false - } - } - return true - - case reflect.Struct: - for i := 0; i < p.NumField(); i++ { - if !match(m, p.Field(i), v.Field(i)) { - return false - } - } - return true - - case reflect.Interface: - return match(m, p.Elem(), v.Elem()) - } - - // Handle token integers, etc. - return p.Interface() == v.Interface() -} - -// subst returns a copy of pattern with values from m substituted in place -// of wildcards and pos used as the position of tokens from the pattern. -// if m == nil, subst returns a copy of pattern and doesn't change the line -// number information. -func subst(m map[string]reflect.Value, pattern reflect.Value, pos reflect.Value) reflect.Value { - if !pattern.IsValid() { - return reflect.Value{} - } - - // Wildcard gets replaced with map value. - if m != nil && pattern.Type() == identType { - name := pattern.Interface().(*ast.Ident).Name - if isWildcard(name) { - if old, ok := m[name]; ok { - return subst(nil, old, reflect.Value{}) - } - } - } - - if pos.IsValid() && pattern.Type() == positionType { - // use new position only if old position was valid in the first place - if old := pattern.Interface().(token.Pos); !old.IsValid() { - return pattern - } - return pos - } - - // Otherwise copy. - switch p := pattern; p.Kind() { - case reflect.Slice: - v := reflect.MakeSlice(p.Type(), p.Len(), p.Len()) - for i := 0; i < p.Len(); i++ { - v.Index(i).Set(subst(m, p.Index(i), pos)) - } - return v - - case reflect.Struct: - v := reflect.New(p.Type()).Elem() - for i := 0; i < p.NumField(); i++ { - v.Field(i).Set(subst(m, p.Field(i), pos)) - } - return v - - case reflect.Ptr: - v := reflect.New(p.Type()).Elem() - if elem := p.Elem(); elem.IsValid() { - v.Set(subst(m, elem, pos).Addr()) - } - return v - - case reflect.Interface: - v := reflect.New(p.Type()).Elem() - if elem := p.Elem(); elem.IsValid() { - v.Set(subst(m, elem, pos)) - } - return v - } - - return pattern -} diff --git a/vendor/github.com/moby/sys/mount/LICENSE b/vendor/github.com/moby/sys/mount/LICENSE new file mode 100644 index 00000000..d6456956 --- /dev/null +++ b/vendor/github.com/moby/sys/mount/LICENSE @@ -0,0 +1,202 @@ + + Apache License + Version 2.0, January 2004 + http://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + APPENDIX: How to apply the Apache License to your work. + + To apply the Apache License to your work, attach the following + boilerplate notice, with the fields enclosed by brackets "[]" + replaced with your own identifying information. (Don't include + the brackets!) The text should be enclosed in the appropriate + comment syntax for the file format. We also recommend that a + file or class name and description of purpose be included on the + same "printed page" as the copyright notice for easier + identification within third-party archives. + + Copyright [yyyy] [name of copyright owner] + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. diff --git a/vendor/github.com/docker/docker/pkg/mount/flags.go b/vendor/github.com/moby/sys/mount/flags.go similarity index 89% rename from vendor/github.com/docker/docker/pkg/mount/flags.go rename to vendor/github.com/moby/sys/mount/flags.go index 272363b6..d514a9d8 100644 --- a/vendor/github.com/docker/docker/pkg/mount/flags.go +++ b/vendor/github.com/moby/sys/mount/flags.go @@ -1,4 +1,4 @@ -package mount // import "github.com/docker/docker/pkg/mount" +package mount import ( "fmt" @@ -135,15 +135,3 @@ func parseOptions(options string) (int, string) { } return flag, strings.Join(data, ",") } - -// ParseTmpfsOptions parse fstab type mount options into flags and data -func ParseTmpfsOptions(options string) (int, string, error) { - flags, data := parseOptions(options) - for _, o := range strings.Split(data, ",") { - opt := strings.SplitN(o, "=", 2) - if !validFlags[opt[0]] { - return 0, "", fmt.Errorf("Invalid tmpfs option %q", opt) - } - } - return flags, data, nil -} diff --git a/vendor/github.com/docker/docker/pkg/mount/flags_freebsd.go b/vendor/github.com/moby/sys/mount/flags_freebsd.go similarity index 92% rename from vendor/github.com/docker/docker/pkg/mount/flags_freebsd.go rename to vendor/github.com/moby/sys/mount/flags_freebsd.go index ef35ef90..69c50680 100644 --- a/vendor/github.com/docker/docker/pkg/mount/flags_freebsd.go +++ b/vendor/github.com/moby/sys/mount/flags_freebsd.go @@ -1,6 +1,6 @@ // +build freebsd,cgo -package mount // import "github.com/docker/docker/pkg/mount" +package mount /* #include @@ -41,7 +41,6 @@ const ( SLAVE = 0 RSLAVE = 0 RBIND = 0 - RELATIVE = 0 RELATIME = 0 REMOUNT = 0 STRICTATIME = 0 diff --git a/vendor/github.com/docker/docker/pkg/mount/flags_linux.go b/vendor/github.com/moby/sys/mount/flags_linux.go similarity index 97% rename from vendor/github.com/docker/docker/pkg/mount/flags_linux.go rename to vendor/github.com/moby/sys/mount/flags_linux.go index a1b199a3..0425d0dd 100644 --- a/vendor/github.com/docker/docker/pkg/mount/flags_linux.go +++ b/vendor/github.com/moby/sys/mount/flags_linux.go @@ -1,4 +1,4 @@ -package mount // import "github.com/docker/docker/pkg/mount" +package mount import ( "golang.org/x/sys/unix" diff --git a/vendor/github.com/docker/docker/pkg/mount/flags_unsupported.go b/vendor/github.com/moby/sys/mount/flags_unsupported.go similarity index 85% rename from vendor/github.com/docker/docker/pkg/mount/flags_unsupported.go rename to vendor/github.com/moby/sys/mount/flags_unsupported.go index cc6c4759..e1d64f6b 100644 --- a/vendor/github.com/docker/docker/pkg/mount/flags_unsupported.go +++ b/vendor/github.com/moby/sys/mount/flags_unsupported.go @@ -1,6 +1,6 @@ // +build !linux,!freebsd freebsd,!cgo -package mount // import "github.com/docker/docker/pkg/mount" +package mount // These flags are unsupported. const ( @@ -22,7 +22,6 @@ const ( RSLAVE = 0 RBIND = 0 RELATIME = 0 - RELATIVE = 0 REMOUNT = 0 STRICTATIME = 0 SYNCHRONOUS = 0 diff --git a/vendor/github.com/moby/sys/mount/go.mod b/vendor/github.com/moby/sys/mount/go.mod new file mode 100644 index 00000000..21cef0a9 --- /dev/null +++ b/vendor/github.com/moby/sys/mount/go.mod @@ -0,0 +1,8 @@ +module github.com/moby/sys/mount + +go 1.14 + +require ( + github.com/moby/sys/mountinfo v0.1.0 + golang.org/x/sys v0.0.0-20200223170610-d5e6a3e2c0ae +) diff --git a/vendor/github.com/moby/sys/mount/go.sum b/vendor/github.com/moby/sys/mount/go.sum new file mode 100644 index 00000000..ae99f859 --- /dev/null +++ b/vendor/github.com/moby/sys/mount/go.sum @@ -0,0 +1,4 @@ +github.com/moby/sys/mountinfo v0.1.0 h1:r8vMRbMAFEAfiNptYVokP+nfxPJzvRuia5e2vzXtENo= +github.com/moby/sys/mountinfo v0.1.0/go.mod h1:w2t2Avltqx8vE7gX5l+QiBKxODu2TX0+Syr3h52Tw4o= +golang.org/x/sys v0.0.0-20200223170610-d5e6a3e2c0ae h1:/WDfKMnPU+m5M4xB+6x4kaepxRw6jWvR5iDRdvjHgy8= +golang.org/x/sys v0.0.0-20200223170610-d5e6a3e2c0ae/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= diff --git a/vendor/github.com/moby/sys/mount/mount.go b/vendor/github.com/moby/sys/mount/mount.go new file mode 100644 index 00000000..e28bd5e8 --- /dev/null +++ b/vendor/github.com/moby/sys/mount/mount.go @@ -0,0 +1,98 @@ +// +build go1.13 + +package mount + +import ( + "fmt" + "sort" + "strconv" + + "github.com/moby/sys/mountinfo" +) + +// mountError records an error from mount or unmount operation +type mountError struct { + op string + source, target string + flags uintptr + data string + err error +} + +func (e *mountError) Error() string { + out := e.op + " " + + if e.source != "" { + out += e.source + ":" + e.target + } else { + out += e.target + } + + if e.flags != uintptr(0) { + out += ", flags: 0x" + strconv.FormatUint(uint64(e.flags), 16) + } + if e.data != "" { + out += ", data: " + e.data + } + + out += ": " + e.err.Error() + return out +} + +// Cause returns the underlying cause of the error. +// This is a convention used in github.com/pkg/errors +func (e *mountError) Cause() error { + return e.err +} + +// Unwrap returns the underlying error. +// This is a convention used in golang 1.13+ +func (e *mountError) Unwrap() error { + return e.err +} + +// Mount will mount filesystem according to the specified configuration. +// Options must be specified like the mount or fstab unix commands: +// "opt1=val1,opt2=val2". See flags.go for supported option flags. +func Mount(device, target, mType, options string) error { + flag, data := parseOptions(options) + return mount(device, target, mType, uintptr(flag), data) +} + +// Unmount lazily unmounts a filesystem on supported platforms, otherwise +// does a normal unmount. +func Unmount(target string) error { + return unmount(target, mntDetach) +} + +// RecursiveUnmount unmounts the target and all mounts underneath, starting with +// the deepsest mount first. +func RecursiveUnmount(target string) error { + mounts, err := mountinfo.GetMounts(mountinfo.PrefixFilter(target)) + if err != nil { + return err + } + + // Make the deepest mount be first + sort.Slice(mounts, func(i, j int) bool { + return len(mounts[i].Mountpoint) > len(mounts[j].Mountpoint) + }) + + var suberr error + for i, m := range mounts { + err = unmount(m.Mountpoint, mntDetach) + if err != nil { + if i == len(mounts)-1 { // last mount + return fmt.Errorf("%w (possible cause: %s)", err, suberr) + } + // This is a submount, we can ignore the error for now, + // the final unmount will fail if this is a real problem. + // With that in mind, the _first_ failed unmount error + // might be the real error cause, so let's keep it. + if suberr == nil { + suberr = err + } + } + } + return nil +} diff --git a/vendor/github.com/docker/docker/pkg/mount/mounter_freebsd.go b/vendor/github.com/moby/sys/mount/mounter_freebsd.go similarity index 78% rename from vendor/github.com/docker/docker/pkg/mount/mounter_freebsd.go rename to vendor/github.com/moby/sys/mount/mounter_freebsd.go index b6ab83a2..3964af4f 100644 --- a/vendor/github.com/docker/docker/pkg/mount/mounter_freebsd.go +++ b/vendor/github.com/moby/sys/mount/mounter_freebsd.go @@ -1,4 +1,4 @@ -package mount // import "github.com/docker/docker/pkg/mount" +package mount /* #include @@ -11,11 +11,9 @@ package mount // import "github.com/docker/docker/pkg/mount" import "C" import ( - "fmt" "strings" + "syscall" "unsafe" - - "golang.org/x/sys/unix" ) func allocateIOVecs(options []string) []C.struct_iovec { @@ -49,12 +47,13 @@ func mount(device, target, mType string, flag uintptr, data string) error { } if errno := C.nmount(&rawOptions[0], C.uint(len(options)), C.int(flag)); errno != 0 { - reason := C.GoString(C.strerror(*C.__error())) - return fmt.Errorf("Failed to call nmount: %s", reason) + return &mountError{ + op: "mount", + source: device, + target: target, + flags: flag, + err: syscall.Errno(errno), + } } return nil } - -func unmount(target string, flag int) error { - return unix.Unmount(target, flag) -} diff --git a/vendor/github.com/docker/docker/pkg/mount/mounter_linux.go b/vendor/github.com/moby/sys/mount/mounter_linux.go similarity index 74% rename from vendor/github.com/docker/docker/pkg/mount/mounter_linux.go rename to vendor/github.com/moby/sys/mount/mounter_linux.go index 631daf10..0c477cc3 100644 --- a/vendor/github.com/docker/docker/pkg/mount/mounter_linux.go +++ b/vendor/github.com/moby/sys/mount/mounter_linux.go @@ -1,4 +1,4 @@ -package mount // import "github.com/docker/docker/pkg/mount" +package mount import ( "golang.org/x/sys/unix" @@ -33,25 +33,41 @@ func mount(device, target, mType string, flags uintptr, data string) error { // Initial call applying all non-propagation flags for mount // or remount with changed data if err := unix.Mount(device, target, mType, oflags, data); err != nil { - return err + return &mountError{ + op: "mount", + source: device, + target: target, + flags: oflags, + data: data, + err: err, + } } } if flags&ptypes != 0 { // Change the propagation type. if err := unix.Mount("", target, "", flags&pflags, ""); err != nil { - return err + return &mountError{ + op: "remount", + target: target, + flags: flags & pflags, + err: err, + } } } if oflags&broflags == broflags { // Remount the bind to apply read only. - return unix.Mount("", target, "", oflags|unix.MS_REMOUNT, "") + if err := unix.Mount("", target, "", oflags|unix.MS_REMOUNT, ""); err != nil { + return &mountError{ + op: "remount-ro", + target: target, + flags: oflags | unix.MS_REMOUNT, + err: err, + } + + } } return nil } - -func unmount(target string, flag int) error { - return unix.Unmount(target, flag) -} diff --git a/vendor/github.com/docker/docker/pkg/mount/mounter_unsupported.go b/vendor/github.com/moby/sys/mount/mounter_unsupported.go similarity index 51% rename from vendor/github.com/docker/docker/pkg/mount/mounter_unsupported.go rename to vendor/github.com/moby/sys/mount/mounter_unsupported.go index 1428dffa..15380671 100644 --- a/vendor/github.com/docker/docker/pkg/mount/mounter_unsupported.go +++ b/vendor/github.com/moby/sys/mount/mounter_unsupported.go @@ -1,11 +1,7 @@ // +build !linux,!freebsd freebsd,!cgo -package mount // import "github.com/docker/docker/pkg/mount" +package mount func mount(device, target, mType string, flag uintptr, data string) error { panic("Not implemented") } - -func unmount(target string, flag int) error { - panic("Not implemented") -} diff --git a/vendor/github.com/docker/docker/pkg/mount/sharedsubtree_linux.go b/vendor/github.com/moby/sys/mount/sharedsubtree_linux.go similarity index 65% rename from vendor/github.com/docker/docker/pkg/mount/sharedsubtree_linux.go rename to vendor/github.com/moby/sys/mount/sharedsubtree_linux.go index 538f6637..948e6bac 100644 --- a/vendor/github.com/docker/docker/pkg/mount/sharedsubtree_linux.go +++ b/vendor/github.com/moby/sys/mount/sharedsubtree_linux.go @@ -1,67 +1,73 @@ -package mount // import "github.com/docker/docker/pkg/mount" +package mount + +import "github.com/moby/sys/mountinfo" // MakeShared ensures a mounted filesystem has the SHARED mount option enabled. // See the supported options in flags.go for further reference. func MakeShared(mountPoint string) error { - return ensureMountedAs(mountPoint, "shared") + return ensureMountedAs(mountPoint, SHARED) } // MakeRShared ensures a mounted filesystem has the RSHARED mount option enabled. // See the supported options in flags.go for further reference. func MakeRShared(mountPoint string) error { - return ensureMountedAs(mountPoint, "rshared") + return ensureMountedAs(mountPoint, RSHARED) } // MakePrivate ensures a mounted filesystem has the PRIVATE mount option enabled. // See the supported options in flags.go for further reference. func MakePrivate(mountPoint string) error { - return ensureMountedAs(mountPoint, "private") + return ensureMountedAs(mountPoint, PRIVATE) } // MakeRPrivate ensures a mounted filesystem has the RPRIVATE mount option // enabled. See the supported options in flags.go for further reference. func MakeRPrivate(mountPoint string) error { - return ensureMountedAs(mountPoint, "rprivate") + return ensureMountedAs(mountPoint, RPRIVATE) } // MakeSlave ensures a mounted filesystem has the SLAVE mount option enabled. // See the supported options in flags.go for further reference. func MakeSlave(mountPoint string) error { - return ensureMountedAs(mountPoint, "slave") + return ensureMountedAs(mountPoint, SLAVE) } // MakeRSlave ensures a mounted filesystem has the RSLAVE mount option enabled. // See the supported options in flags.go for further reference. func MakeRSlave(mountPoint string) error { - return ensureMountedAs(mountPoint, "rslave") + return ensureMountedAs(mountPoint, RSLAVE) } // MakeUnbindable ensures a mounted filesystem has the UNBINDABLE mount option // enabled. See the supported options in flags.go for further reference. func MakeUnbindable(mountPoint string) error { - return ensureMountedAs(mountPoint, "unbindable") + return ensureMountedAs(mountPoint, UNBINDABLE) } // MakeRUnbindable ensures a mounted filesystem has the RUNBINDABLE mount // option enabled. See the supported options in flags.go for further reference. func MakeRUnbindable(mountPoint string) error { - return ensureMountedAs(mountPoint, "runbindable") + return ensureMountedAs(mountPoint, RUNBINDABLE) } -func ensureMountedAs(mountPoint, options string) error { - mounted, err := Mounted(mountPoint) +// MakeMount ensures that the file or directory given is a mount point, +// bind mounting it to itself it case it is not. +func MakeMount(mnt string) error { + mounted, err := mountinfo.Mounted(mnt) if err != nil { return err } - - if !mounted { - if err := Mount(mountPoint, mountPoint, "none", "bind,rw"); err != nil { - return err - } + if mounted { + return nil } - if _, err = Mounted(mountPoint); err != nil { + + return mount(mnt, mnt, "none", uintptr(BIND), "") +} + +func ensureMountedAs(mnt string, flags int) error { + if err := MakeMount(mnt); err != nil { return err } - return ForceMount("", mountPoint, "none", options) + return mount("", mnt, "none", uintptr(flags), "") } diff --git a/vendor/github.com/moby/sys/mount/unmount_unix.go b/vendor/github.com/moby/sys/mount/unmount_unix.go new file mode 100644 index 00000000..1d1afeee --- /dev/null +++ b/vendor/github.com/moby/sys/mount/unmount_unix.go @@ -0,0 +1,22 @@ +// +build !windows + +package mount + +import "golang.org/x/sys/unix" + +func unmount(target string, flags int) error { + err := unix.Unmount(target, flags) + if err == nil || err == unix.EINVAL { + // Ignore "not mounted" error here. Note the same error + // can be returned if flags are invalid, so this code + // assumes that the flags value is always correct. + return nil + } + + return &mountError{ + op: "umount", + target: target, + flags: uintptr(flags), + err: err, + } +} diff --git a/vendor/github.com/moby/sys/mount/unmount_unsupported.go b/vendor/github.com/moby/sys/mount/unmount_unsupported.go new file mode 100644 index 00000000..eebc4ab8 --- /dev/null +++ b/vendor/github.com/moby/sys/mount/unmount_unsupported.go @@ -0,0 +1,7 @@ +// +build windows + +package mount + +func unmount(target string, flag int) error { + panic("Not implemented") +} diff --git a/vendor/github.com/moby/sys/mountinfo/LICENSE b/vendor/github.com/moby/sys/mountinfo/LICENSE new file mode 100644 index 00000000..d6456956 --- /dev/null +++ b/vendor/github.com/moby/sys/mountinfo/LICENSE @@ -0,0 +1,202 @@ + + Apache License + Version 2.0, January 2004 + http://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + APPENDIX: How to apply the Apache License to your work. + + To apply the Apache License to your work, attach the following + boilerplate notice, with the fields enclosed by brackets "[]" + replaced with your own identifying information. (Don't include + the brackets!) The text should be enclosed in the appropriate + comment syntax for the file format. We also recommend that a + file or class name and description of purpose be included on the + same "printed page" as the copyright notice for easier + identification within third-party archives. + + Copyright [yyyy] [name of copyright owner] + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. diff --git a/vendor/github.com/moby/sys/mountinfo/go.mod b/vendor/github.com/moby/sys/mountinfo/go.mod new file mode 100644 index 00000000..10d9a15a --- /dev/null +++ b/vendor/github.com/moby/sys/mountinfo/go.mod @@ -0,0 +1,3 @@ +module github.com/moby/sys/mountinfo + +go 1.14 diff --git a/vendor/github.com/docker/docker/pkg/mount/mountinfo.go b/vendor/github.com/moby/sys/mountinfo/mountinfo.go similarity index 66% rename from vendor/github.com/docker/docker/pkg/mount/mountinfo.go rename to vendor/github.com/moby/sys/mountinfo/mountinfo.go index ecd03fc0..ec3b5934 100644 --- a/vendor/github.com/docker/docker/pkg/mount/mountinfo.go +++ b/vendor/github.com/moby/sys/mountinfo/mountinfo.go @@ -1,4 +1,21 @@ -package mount // import "github.com/docker/docker/pkg/mount" +package mountinfo + +// GetMounts retrieves a list of mounts for the current running process, +// with an optional filter applied (use nil for no filter). +func GetMounts(f FilterFunc) ([]*Info, error) { + return parseMountTable(f) +} + +// Mounted determines if a specified mountpoint has been mounted. +// On Linux it looks at /proc/self/mountinfo. +func Mounted(mountpoint string) (bool, error) { + entries, err := GetMounts(SingleEntryFilter(mountpoint)) + if err != nil { + return false, err + } + + return len(entries) > 0, nil +} // Info reveals information about a particular mounted filesystem. This // struct is populated from the content in the /proc//mountinfo file. diff --git a/vendor/github.com/moby/sys/mountinfo/mountinfo_filters.go b/vendor/github.com/moby/sys/mountinfo/mountinfo_filters.go new file mode 100644 index 00000000..96d49414 --- /dev/null +++ b/vendor/github.com/moby/sys/mountinfo/mountinfo_filters.go @@ -0,0 +1,56 @@ +package mountinfo + +import "strings" + +// FilterFunc is a type defining a callback function for GetMount(), +// used to filter out mountinfo entries we're not interested in. +// +// It takes a pointer to the Info struct (not fully populated, +// currently only Mountpoint is filled in), and returns two booleans: +// +// - skip: true if the entry should be skipped +// - stop: true if parsing should be stopped after the entry +type FilterFunc func(*Info) (skip, stop bool) + +// PrefixFilter discards all entries whose mount points +// do not start with a specific prefix +func PrefixFilter(prefix string) FilterFunc { + return func(m *Info) (bool, bool) { + skip := !strings.HasPrefix(m.Mountpoint, prefix) + return skip, false + } +} + +// SingleEntryFilter looks for a specific entry +func SingleEntryFilter(mp string) FilterFunc { + return func(m *Info) (bool, bool) { + if m.Mountpoint == mp { + return false, true // don't skip, stop now + } + return true, false // skip, keep going + } +} + +// ParentsFilter returns all entries whose mount points +// can be parents of a path specified, discarding others. +// +// For example, given `/var/lib/docker/something`, entries +// like `/var/lib/docker`, `/var` and `/` are returned. +func ParentsFilter(path string) FilterFunc { + return func(m *Info) (bool, bool) { + skip := !strings.HasPrefix(path, m.Mountpoint) + return skip, false + } +} + +// FstypeFilter returns all entries that match provided fstype(s). +func FstypeFilter(fstype ...string) FilterFunc { + return func(m *Info) (bool, bool) { + for _, t := range fstype { + if m.Fstype == t { + return false, false // don't skeep, keep going + } + } + return true, false // skip, keep going + } +} diff --git a/vendor/github.com/docker/docker/pkg/mount/mountinfo_freebsd.go b/vendor/github.com/moby/sys/mountinfo/mountinfo_freebsd.go similarity index 84% rename from vendor/github.com/docker/docker/pkg/mount/mountinfo_freebsd.go rename to vendor/github.com/moby/sys/mountinfo/mountinfo_freebsd.go index 36c89dc1..ea02568b 100644 --- a/vendor/github.com/docker/docker/pkg/mount/mountinfo_freebsd.go +++ b/vendor/github.com/moby/sys/mountinfo/mountinfo_freebsd.go @@ -1,4 +1,4 @@ -package mount // import "github.com/docker/docker/pkg/mount" +package mountinfo /* #include @@ -13,8 +13,7 @@ import ( "unsafe" ) -// Parse /proc/self/mountinfo because comparing Dev and ino does not work from -// bind mounts. +// parseMountTable returns information about mounted filesystems func parseMountTable(filter FilterFunc) ([]*Info, error) { var rawEntries *C.struct_statfs @@ -34,17 +33,17 @@ func parseMountTable(filter FilterFunc) ([]*Info, error) { var mountinfo Info var skip, stop bool mountinfo.Mountpoint = C.GoString(&entry.f_mntonname[0]) + mountinfo.Fstype = C.GoString(&entry.f_fstypename[0]) if filter != nil { // filter out entries we're not interested in - skip, stop = filter(p) + skip, stop = filter(&mountinfo) if skip { continue } } mountinfo.Source = C.GoString(&entry.f_mntfromname[0]) - mountinfo.Fstype = C.GoString(&entry.f_fstypename[0]) out = append(out, &mountinfo) if stop { diff --git a/vendor/github.com/docker/docker/pkg/mount/mountinfo_linux.go b/vendor/github.com/moby/sys/mountinfo/mountinfo_linux.go similarity index 59% rename from vendor/github.com/docker/docker/pkg/mount/mountinfo_linux.go rename to vendor/github.com/moby/sys/mountinfo/mountinfo_linux.go index c1dba01f..a2c60e91 100644 --- a/vendor/github.com/docker/docker/pkg/mount/mountinfo_linux.go +++ b/vendor/github.com/moby/sys/mountinfo/mountinfo_linux.go @@ -1,4 +1,6 @@ -package mount // import "github.com/docker/docker/pkg/mount" +// +build go1.13 + +package mountinfo import ( "bufio" @@ -12,11 +14,14 @@ import ( func parseInfoFile(r io.Reader, filter FilterFunc) ([]*Info, error) { s := bufio.NewScanner(r) out := []*Info{} + var err error for s.Scan() { - if err := s.Err(); err != nil { + if err = s.Err(); err != nil { return nil, err } /* + See http://man7.org/linux/man-pages/man5/proc.5.html + 36 35 98:0 /mnt1 /mnt2 rw,noatime master:1 - ext3 /dev/root rw,errors=continue (1)(2)(3) (4) (5) (6) (7) (8) (9) (10) (11) @@ -31,6 +36,12 @@ func parseInfoFile(r io.Reader, filter FilterFunc) ([]*Info, error) { (9) filesystem type: name of filesystem of the form "type[.subtype]" (10) mount source: filesystem specific information or "none" (11) super options: per super block options + + In other words, we have: + * 6 mandatory fields (1)..(6) + * 0 or more optional fields (7) + * a separator field (8) + * 3 mandatory fields (9)..(11) */ text := s.Text() @@ -41,7 +52,44 @@ func parseInfoFile(r io.Reader, filter FilterFunc) ([]*Info, error) { return nil, fmt.Errorf("Parsing '%s' failed: not enough fields (%d)", text, numFields) } + // separator field + sepIdx := numFields - 4 + // In Linux <= 3.9 mounting a cifs with spaces in a share + // name (like "//srv/My Docs") _may_ end up having a space + // in the last field of mountinfo (like "unc=//serv/My Docs"). + // Since kernel 3.10-rc1, cifs option "unc=" is ignored, + // so spaces should not appear. + // + // Check for a separator, and work around the spaces bug + for fields[sepIdx] != "-" { + sepIdx-- + if sepIdx == 5 { + return nil, fmt.Errorf("Parsing '%s' failed: missing - separator", text) + } + } + p := &Info{} + + // Fill in the fields that a filter might check + // (currently only Mountpoint and Fstype) + p.Mountpoint, err = strconv.Unquote(`"` + fields[4] + `"`) + if err != nil { + return nil, fmt.Errorf("Parsing '%s' failed: unable to unquote mount point field: %w", fields[4], err) + } + p.Fstype = fields[sepIdx+1] + + // Run a filter soon so we can skip parsing/adding entries + // the caller is not interested in + var skip, stop bool + if filter != nil { + skip, stop = filter(p) + if skip { + continue + } + } + + // Fill in the rest of the fields + // ignore any numbers parsing errors, as there should not be any p.ID, _ = strconv.Atoi(fields[0]) p.Parent, _ = strconv.Atoi(fields[1]) @@ -52,51 +100,25 @@ func parseInfoFile(r io.Reader, filter FilterFunc) ([]*Info, error) { p.Major, _ = strconv.Atoi(mm[0]) p.Minor, _ = strconv.Atoi(mm[1]) - p.Root = fields[3] - p.Mountpoint = fields[4] + p.Root, err = strconv.Unquote(`"` + fields[3] + `"`) + if err != nil { + return nil, fmt.Errorf("Parsing '%s' failed: unable to unquote root field: %w", fields[3], err) + } + p.Opts = fields[5] - var skip, stop bool - if filter != nil { - // filter out entries we're not interested in - skip, stop = filter(p) - if skip { - continue - } + // zero or more optional fields + switch { + case sepIdx == 6: + // zero, do nothing + case sepIdx == 7: + p.Optional = fields[6] + default: + p.Optional = strings.Join(fields[6:sepIdx-1], " ") } - // one or more optional fields, when a separator (-) - i := 6 - for ; i < numFields && fields[i] != "-"; i++ { - switch i { - case 6: - p.Optional = fields[6] - default: - /* NOTE there might be more optional fields before the such as - fields[7]...fields[N] (where N < sepIndex), although - as of Linux kernel 4.15 the only known ones are - mount propagation flags in fields[6]. The correct - behavior is to ignore any unknown optional fields. - */ - break - } - } - if i == numFields { - return nil, fmt.Errorf("Parsing '%s' failed: missing separator ('-')", text) - } - - // There should be 3 fields after the separator... - if i+4 > numFields { - return nil, fmt.Errorf("Parsing '%s' failed: not enough fields after a separator", text) - } - // ... but in Linux <= 3.9 mounting a cifs with spaces in a share name - // (like "//serv/My Documents") _may_ end up having a space in the last field - // of mountinfo (like "unc=//serv/My Documents"). Since kernel 3.10-rc1, cifs - // option unc= is ignored, so a space should not appear. In here we ignore - // those "extra" fields caused by extra spaces. - p.Fstype = fields[i+1] - p.Source = fields[i+2] - p.VfsOpts = fields[i+3] + p.Source = fields[sepIdx+2] + p.VfsOpts = fields[sepIdx+3] out = append(out, p) if stop { diff --git a/vendor/github.com/docker/docker/pkg/mount/mountinfo_unsupported.go b/vendor/github.com/moby/sys/mountinfo/mountinfo_unsupported.go similarity index 79% rename from vendor/github.com/docker/docker/pkg/mount/mountinfo_unsupported.go rename to vendor/github.com/moby/sys/mountinfo/mountinfo_unsupported.go index fd16d3ed..8ff917e0 100644 --- a/vendor/github.com/docker/docker/pkg/mount/mountinfo_unsupported.go +++ b/vendor/github.com/moby/sys/mountinfo/mountinfo_unsupported.go @@ -1,6 +1,6 @@ // +build !windows,!linux,!freebsd freebsd,!cgo -package mount // import "github.com/docker/docker/pkg/mount" +package mountinfo import ( "fmt" diff --git a/vendor/github.com/docker/docker/pkg/mount/mountinfo_windows.go b/vendor/github.com/moby/sys/mountinfo/mountinfo_windows.go similarity index 62% rename from vendor/github.com/docker/docker/pkg/mount/mountinfo_windows.go rename to vendor/github.com/moby/sys/mountinfo/mountinfo_windows.go index 27e0f697..efd0b271 100644 --- a/vendor/github.com/docker/docker/pkg/mount/mountinfo_windows.go +++ b/vendor/github.com/moby/sys/mountinfo/mountinfo_windows.go @@ -1,4 +1,4 @@ -package mount // import "github.com/docker/docker/pkg/mount" +package mountinfo func parseMountTable(f FilterFunc) ([]*Info, error) { // Do NOT return an error! diff --git a/vendor/github.com/morikuni/aec/LICENSE b/vendor/github.com/morikuni/aec/LICENSE new file mode 100644 index 00000000..1c264016 --- /dev/null +++ b/vendor/github.com/morikuni/aec/LICENSE @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2016 Taihei Morikuni + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/vendor/github.com/morikuni/aec/README.md b/vendor/github.com/morikuni/aec/README.md new file mode 100644 index 00000000..3cbc4343 --- /dev/null +++ b/vendor/github.com/morikuni/aec/README.md @@ -0,0 +1,178 @@ +# aec + +[![GoDoc](https://godoc.org/github.com/morikuni/aec?status.svg)](https://godoc.org/github.com/morikuni/aec) + +Go wrapper for ANSI escape code. + +## Install + +```bash +go get github.com/morikuni/aec +``` + +## Features + +ANSI escape codes depend on terminal environment. +Some of these features may not work. +Check supported Font-Style/Font-Color features with [checkansi](./checkansi). + +[Wikipedia](https://en.wikipedia.org/wiki/ANSI_escape_code) for more detail. + +### Cursor + +- `Up(n)` +- `Down(n)` +- `Right(n)` +- `Left(n)` +- `NextLine(n)` +- `PreviousLine(n)` +- `Column(col)` +- `Position(row, col)` +- `Save` +- `Restore` +- `Hide` +- `Show` +- `Report` + +### Erase + +- `EraseDisplay(mode)` +- `EraseLine(mode)` + +### Scroll + +- `ScrollUp(n)` +- `ScrollDown(n)` + +### Font Style + +- `Bold` +- `Faint` +- `Italic` +- `Underline` +- `BlinkSlow` +- `BlinkRapid` +- `Inverse` +- `Conceal` +- `CrossOut` +- `Frame` +- `Encircle` +- `Overline` + +### Font Color + +Foreground color. + +- `DefaultF` +- `BlackF` +- `RedF` +- `GreenF` +- `YellowF` +- `BlueF` +- `MagentaF` +- `CyanF` +- `WhiteF` +- `LightBlackF` +- `LightRedF` +- `LightGreenF` +- `LightYellowF` +- `LightBlueF` +- `LightMagentaF` +- `LightCyanF` +- `LightWhiteF` +- `Color3BitF(color)` +- `Color8BitF(color)` +- `FullColorF(r, g, b)` + +Background color. + +- `DefaultB` +- `BlackB` +- `RedB` +- `GreenB` +- `YellowB` +- `BlueB` +- `MagentaB` +- `CyanB` +- `WhiteB` +- `LightBlackB` +- `LightRedB` +- `LightGreenB` +- `LightYellowB` +- `LightBlueB` +- `LightMagentaB` +- `LightCyanB` +- `LightWhiteB` +- `Color3BitB(color)` +- `Color8BitB(color)` +- `FullColorB(r, g, b)` + +### Color Converter + +24bit RGB color to ANSI color. + +- `NewRGB3Bit(r, g, b)` +- `NewRGB8Bit(r, g, b)` + +### Builder + +To mix these features. + +```go +custom := aec.EmptyBuilder.Right(2).RGB8BitF(128, 255, 64).RedB().ANSI +custom.Apply("Hello World") +``` + +## Usage + +1. Create ANSI by `aec.XXX().With(aec.YYY())` or `aec.EmptyBuilder.XXX().YYY().ANSI` +2. Print ANSI by `fmt.Print(ansi, "some string", aec.Reset)` or `fmt.Print(ansi.Apply("some string"))` + +`aec.Reset` should be added when using font style or font color features. + +## Example + +Simple progressbar. + +![sample](./sample.gif) + +```go +package main + +import ( + "fmt" + "strings" + "time" + + "github.com/morikuni/aec" +) + +func main() { + const n = 20 + builder := aec.EmptyBuilder + + up2 := aec.Up(2) + col := aec.Column(n + 2) + bar := aec.Color8BitF(aec.NewRGB8Bit(64, 255, 64)) + label := builder.LightRedF().Underline().With(col).Right(1).ANSI + + // for up2 + fmt.Println() + fmt.Println() + + for i := 0; i <= n; i++ { + fmt.Print(up2) + fmt.Println(label.Apply(fmt.Sprint(i, "/", n))) + fmt.Print("[") + fmt.Print(bar.Apply(strings.Repeat("=", i))) + fmt.Println(col.Apply("]")) + time.Sleep(100 * time.Millisecond) + } +} +``` + +## License + +[MIT](./LICENSE) + + diff --git a/vendor/github.com/morikuni/aec/aec.go b/vendor/github.com/morikuni/aec/aec.go new file mode 100644 index 00000000..566be6eb --- /dev/null +++ b/vendor/github.com/morikuni/aec/aec.go @@ -0,0 +1,137 @@ +package aec + +import "fmt" + +// EraseMode is listed in a variable EraseModes. +type EraseMode uint + +var ( + // EraseModes is a list of EraseMode. + EraseModes struct { + // All erase all. + All EraseMode + + // Head erase to head. + Head EraseMode + + // Tail erase to tail. + Tail EraseMode + } + + // Save saves the cursor position. + Save ANSI + + // Restore restores the cursor position. + Restore ANSI + + // Hide hides the cursor. + Hide ANSI + + // Show shows the cursor. + Show ANSI + + // Report reports the cursor position. + Report ANSI +) + +// Up moves up the cursor. +func Up(n uint) ANSI { + if n == 0 { + return empty + } + return newAnsi(fmt.Sprintf(esc+"%dA", n)) +} + +// Down moves down the cursor. +func Down(n uint) ANSI { + if n == 0 { + return empty + } + return newAnsi(fmt.Sprintf(esc+"%dB", n)) +} + +// Right moves right the cursor. +func Right(n uint) ANSI { + if n == 0 { + return empty + } + return newAnsi(fmt.Sprintf(esc+"%dC", n)) +} + +// Left moves left the cursor. +func Left(n uint) ANSI { + if n == 0 { + return empty + } + return newAnsi(fmt.Sprintf(esc+"%dD", n)) +} + +// NextLine moves down the cursor to head of a line. +func NextLine(n uint) ANSI { + if n == 0 { + return empty + } + return newAnsi(fmt.Sprintf(esc+"%dE", n)) +} + +// PreviousLine moves up the cursor to head of a line. +func PreviousLine(n uint) ANSI { + if n == 0 { + return empty + } + return newAnsi(fmt.Sprintf(esc+"%dF", n)) +} + +// Column set the cursor position to a given column. +func Column(col uint) ANSI { + return newAnsi(fmt.Sprintf(esc+"%dG", col)) +} + +// Position set the cursor position to a given absolute position. +func Position(row, col uint) ANSI { + return newAnsi(fmt.Sprintf(esc+"%d;%dH", row, col)) +} + +// EraseDisplay erases display by given EraseMode. +func EraseDisplay(m EraseMode) ANSI { + return newAnsi(fmt.Sprintf(esc+"%dJ", m)) +} + +// EraseLine erases lines by given EraseMode. +func EraseLine(m EraseMode) ANSI { + return newAnsi(fmt.Sprintf(esc+"%dK", m)) +} + +// ScrollUp scrolls up the page. +func ScrollUp(n int) ANSI { + if n == 0 { + return empty + } + return newAnsi(fmt.Sprintf(esc+"%dS", n)) +} + +// ScrollDown scrolls down the page. +func ScrollDown(n int) ANSI { + if n == 0 { + return empty + } + return newAnsi(fmt.Sprintf(esc+"%dT", n)) +} + +func init() { + EraseModes = struct { + All EraseMode + Head EraseMode + Tail EraseMode + }{ + Tail: 0, + Head: 1, + All: 2, + } + + Save = newAnsi(esc + "s") + Restore = newAnsi(esc + "u") + Hide = newAnsi(esc + "?25l") + Show = newAnsi(esc + "?25h") + Report = newAnsi(esc + "6n") +} diff --git a/vendor/github.com/morikuni/aec/ansi.go b/vendor/github.com/morikuni/aec/ansi.go new file mode 100644 index 00000000..e60722e6 --- /dev/null +++ b/vendor/github.com/morikuni/aec/ansi.go @@ -0,0 +1,59 @@ +package aec + +import ( + "fmt" + "strings" +) + +const esc = "\x1b[" + +// Reset resets SGR effect. +const Reset string = "\x1b[0m" + +var empty = newAnsi("") + +// ANSI represents ANSI escape code. +type ANSI interface { + fmt.Stringer + + // With adapts given ANSIs. + With(...ANSI) ANSI + + // Apply wraps given string in ANSI. + Apply(string) string +} + +type ansiImpl string + +func newAnsi(s string) *ansiImpl { + r := ansiImpl(s) + return &r +} + +func (a *ansiImpl) With(ansi ...ANSI) ANSI { + return concat(append([]ANSI{a}, ansi...)) +} + +func (a *ansiImpl) Apply(s string) string { + return a.String() + s + Reset +} + +func (a *ansiImpl) String() string { + return string(*a) +} + +// Apply wraps given string in ANSIs. +func Apply(s string, ansi ...ANSI) string { + if len(ansi) == 0 { + return s + } + return concat(ansi).Apply(s) +} + +func concat(ansi []ANSI) ANSI { + strs := make([]string, 0, len(ansi)) + for _, p := range ansi { + strs = append(strs, p.String()) + } + return newAnsi(strings.Join(strs, "")) +} diff --git a/vendor/github.com/morikuni/aec/builder.go b/vendor/github.com/morikuni/aec/builder.go new file mode 100644 index 00000000..13bd002d --- /dev/null +++ b/vendor/github.com/morikuni/aec/builder.go @@ -0,0 +1,388 @@ +package aec + +// Builder is a lightweight syntax to construct customized ANSI. +type Builder struct { + ANSI ANSI +} + +// EmptyBuilder is an initialized Builder. +var EmptyBuilder *Builder + +// NewBuilder creates a Builder from existing ANSI. +func NewBuilder(a ...ANSI) *Builder { + return &Builder{concat(a)} +} + +// With is a syntax for With. +func (builder *Builder) With(a ...ANSI) *Builder { + return NewBuilder(builder.ANSI.With(a...)) +} + +// Up is a syntax for Up. +func (builder *Builder) Up(n uint) *Builder { + return builder.With(Up(n)) +} + +// Down is a syntax for Down. +func (builder *Builder) Down(n uint) *Builder { + return builder.With(Down(n)) +} + +// Right is a syntax for Right. +func (builder *Builder) Right(n uint) *Builder { + return builder.With(Right(n)) +} + +// Left is a syntax for Left. +func (builder *Builder) Left(n uint) *Builder { + return builder.With(Left(n)) +} + +// NextLine is a syntax for NextLine. +func (builder *Builder) NextLine(n uint) *Builder { + return builder.With(NextLine(n)) +} + +// PreviousLine is a syntax for PreviousLine. +func (builder *Builder) PreviousLine(n uint) *Builder { + return builder.With(PreviousLine(n)) +} + +// Column is a syntax for Column. +func (builder *Builder) Column(col uint) *Builder { + return builder.With(Column(col)) +} + +// Position is a syntax for Position. +func (builder *Builder) Position(row, col uint) *Builder { + return builder.With(Position(row, col)) +} + +// EraseDisplay is a syntax for EraseDisplay. +func (builder *Builder) EraseDisplay(m EraseMode) *Builder { + return builder.With(EraseDisplay(m)) +} + +// EraseLine is a syntax for EraseLine. +func (builder *Builder) EraseLine(m EraseMode) *Builder { + return builder.With(EraseLine(m)) +} + +// ScrollUp is a syntax for ScrollUp. +func (builder *Builder) ScrollUp(n int) *Builder { + return builder.With(ScrollUp(n)) +} + +// ScrollDown is a syntax for ScrollDown. +func (builder *Builder) ScrollDown(n int) *Builder { + return builder.With(ScrollDown(n)) +} + +// Save is a syntax for Save. +func (builder *Builder) Save() *Builder { + return builder.With(Save) +} + +// Restore is a syntax for Restore. +func (builder *Builder) Restore() *Builder { + return builder.With(Restore) +} + +// Hide is a syntax for Hide. +func (builder *Builder) Hide() *Builder { + return builder.With(Hide) +} + +// Show is a syntax for Show. +func (builder *Builder) Show() *Builder { + return builder.With(Show) +} + +// Report is a syntax for Report. +func (builder *Builder) Report() *Builder { + return builder.With(Report) +} + +// Bold is a syntax for Bold. +func (builder *Builder) Bold() *Builder { + return builder.With(Bold) +} + +// Faint is a syntax for Faint. +func (builder *Builder) Faint() *Builder { + return builder.With(Faint) +} + +// Italic is a syntax for Italic. +func (builder *Builder) Italic() *Builder { + return builder.With(Italic) +} + +// Underline is a syntax for Underline. +func (builder *Builder) Underline() *Builder { + return builder.With(Underline) +} + +// BlinkSlow is a syntax for BlinkSlow. +func (builder *Builder) BlinkSlow() *Builder { + return builder.With(BlinkSlow) +} + +// BlinkRapid is a syntax for BlinkRapid. +func (builder *Builder) BlinkRapid() *Builder { + return builder.With(BlinkRapid) +} + +// Inverse is a syntax for Inverse. +func (builder *Builder) Inverse() *Builder { + return builder.With(Inverse) +} + +// Conceal is a syntax for Conceal. +func (builder *Builder) Conceal() *Builder { + return builder.With(Conceal) +} + +// CrossOut is a syntax for CrossOut. +func (builder *Builder) CrossOut() *Builder { + return builder.With(CrossOut) +} + +// BlackF is a syntax for BlackF. +func (builder *Builder) BlackF() *Builder { + return builder.With(BlackF) +} + +// RedF is a syntax for RedF. +func (builder *Builder) RedF() *Builder { + return builder.With(RedF) +} + +// GreenF is a syntax for GreenF. +func (builder *Builder) GreenF() *Builder { + return builder.With(GreenF) +} + +// YellowF is a syntax for YellowF. +func (builder *Builder) YellowF() *Builder { + return builder.With(YellowF) +} + +// BlueF is a syntax for BlueF. +func (builder *Builder) BlueF() *Builder { + return builder.With(BlueF) +} + +// MagentaF is a syntax for MagentaF. +func (builder *Builder) MagentaF() *Builder { + return builder.With(MagentaF) +} + +// CyanF is a syntax for CyanF. +func (builder *Builder) CyanF() *Builder { + return builder.With(CyanF) +} + +// WhiteF is a syntax for WhiteF. +func (builder *Builder) WhiteF() *Builder { + return builder.With(WhiteF) +} + +// DefaultF is a syntax for DefaultF. +func (builder *Builder) DefaultF() *Builder { + return builder.With(DefaultF) +} + +// BlackB is a syntax for BlackB. +func (builder *Builder) BlackB() *Builder { + return builder.With(BlackB) +} + +// RedB is a syntax for RedB. +func (builder *Builder) RedB() *Builder { + return builder.With(RedB) +} + +// GreenB is a syntax for GreenB. +func (builder *Builder) GreenB() *Builder { + return builder.With(GreenB) +} + +// YellowB is a syntax for YellowB. +func (builder *Builder) YellowB() *Builder { + return builder.With(YellowB) +} + +// BlueB is a syntax for BlueB. +func (builder *Builder) BlueB() *Builder { + return builder.With(BlueB) +} + +// MagentaB is a syntax for MagentaB. +func (builder *Builder) MagentaB() *Builder { + return builder.With(MagentaB) +} + +// CyanB is a syntax for CyanB. +func (builder *Builder) CyanB() *Builder { + return builder.With(CyanB) +} + +// WhiteB is a syntax for WhiteB. +func (builder *Builder) WhiteB() *Builder { + return builder.With(WhiteB) +} + +// DefaultB is a syntax for DefaultB. +func (builder *Builder) DefaultB() *Builder { + return builder.With(DefaultB) +} + +// Frame is a syntax for Frame. +func (builder *Builder) Frame() *Builder { + return builder.With(Frame) +} + +// Encircle is a syntax for Encircle. +func (builder *Builder) Encircle() *Builder { + return builder.With(Encircle) +} + +// Overline is a syntax for Overline. +func (builder *Builder) Overline() *Builder { + return builder.With(Overline) +} + +// LightBlackF is a syntax for LightBlueF. +func (builder *Builder) LightBlackF() *Builder { + return builder.With(LightBlackF) +} + +// LightRedF is a syntax for LightRedF. +func (builder *Builder) LightRedF() *Builder { + return builder.With(LightRedF) +} + +// LightGreenF is a syntax for LightGreenF. +func (builder *Builder) LightGreenF() *Builder { + return builder.With(LightGreenF) +} + +// LightYellowF is a syntax for LightYellowF. +func (builder *Builder) LightYellowF() *Builder { + return builder.With(LightYellowF) +} + +// LightBlueF is a syntax for LightBlueF. +func (builder *Builder) LightBlueF() *Builder { + return builder.With(LightBlueF) +} + +// LightMagentaF is a syntax for LightMagentaF. +func (builder *Builder) LightMagentaF() *Builder { + return builder.With(LightMagentaF) +} + +// LightCyanF is a syntax for LightCyanF. +func (builder *Builder) LightCyanF() *Builder { + return builder.With(LightCyanF) +} + +// LightWhiteF is a syntax for LightWhiteF. +func (builder *Builder) LightWhiteF() *Builder { + return builder.With(LightWhiteF) +} + +// LightBlackB is a syntax for LightBlackB. +func (builder *Builder) LightBlackB() *Builder { + return builder.With(LightBlackB) +} + +// LightRedB is a syntax for LightRedB. +func (builder *Builder) LightRedB() *Builder { + return builder.With(LightRedB) +} + +// LightGreenB is a syntax for LightGreenB. +func (builder *Builder) LightGreenB() *Builder { + return builder.With(LightGreenB) +} + +// LightYellowB is a syntax for LightYellowB. +func (builder *Builder) LightYellowB() *Builder { + return builder.With(LightYellowB) +} + +// LightBlueB is a syntax for LightBlueB. +func (builder *Builder) LightBlueB() *Builder { + return builder.With(LightBlueB) +} + +// LightMagentaB is a syntax for LightMagentaB. +func (builder *Builder) LightMagentaB() *Builder { + return builder.With(LightMagentaB) +} + +// LightCyanB is a syntax for LightCyanB. +func (builder *Builder) LightCyanB() *Builder { + return builder.With(LightCyanB) +} + +// LightWhiteB is a syntax for LightWhiteB. +func (builder *Builder) LightWhiteB() *Builder { + return builder.With(LightWhiteB) +} + +// Color3BitF is a syntax for Color3BitF. +func (builder *Builder) Color3BitF(c RGB3Bit) *Builder { + return builder.With(Color3BitF(c)) +} + +// Color3BitB is a syntax for Color3BitB. +func (builder *Builder) Color3BitB(c RGB3Bit) *Builder { + return builder.With(Color3BitB(c)) +} + +// Color8BitF is a syntax for Color8BitF. +func (builder *Builder) Color8BitF(c RGB8Bit) *Builder { + return builder.With(Color8BitF(c)) +} + +// Color8BitB is a syntax for Color8BitB. +func (builder *Builder) Color8BitB(c RGB8Bit) *Builder { + return builder.With(Color8BitB(c)) +} + +// FullColorF is a syntax for FullColorF. +func (builder *Builder) FullColorF(r, g, b uint8) *Builder { + return builder.With(FullColorF(r, g, b)) +} + +// FullColorB is a syntax for FullColorB. +func (builder *Builder) FullColorB(r, g, b uint8) *Builder { + return builder.With(FullColorB(r, g, b)) +} + +// RGB3BitF is a syntax for Color3BitF with NewRGB3Bit. +func (builder *Builder) RGB3BitF(r, g, b uint8) *Builder { + return builder.Color3BitF(NewRGB3Bit(r, g, b)) +} + +// RGB3BitB is a syntax for Color3BitB with NewRGB3Bit. +func (builder *Builder) RGB3BitB(r, g, b uint8) *Builder { + return builder.Color3BitB(NewRGB3Bit(r, g, b)) +} + +// RGB8BitF is a syntax for Color8BitF with NewRGB8Bit. +func (builder *Builder) RGB8BitF(r, g, b uint8) *Builder { + return builder.Color8BitF(NewRGB8Bit(r, g, b)) +} + +// RGB8BitB is a syntax for Color8BitB with NewRGB8Bit. +func (builder *Builder) RGB8BitB(r, g, b uint8) *Builder { + return builder.Color8BitB(NewRGB8Bit(r, g, b)) +} + +func init() { + EmptyBuilder = &Builder{empty} +} diff --git a/vendor/github.com/morikuni/aec/sample.gif b/vendor/github.com/morikuni/aec/sample.gif new file mode 100644 index 0000000000000000000000000000000000000000..c6c613bb70645efa4e184726060ea1ff981eeceb GIT binary patch literal 12548 zcmeHtXHe7ox^?KiNed7{8X;7XCP*=%29P2G0wRPS6cCY(5D}@N_aaD@UX-rVRGLyn ziUk#vP5`li6zlsB?&3b@?0xn-bLW1#I^&ms!?1qqS><^Q4E0qHIxs9l8jiG4D5=G zkc%wJQx+903onrs@|6>>krR&H55KY>eoh`;asZm7fND|@8CDR!sE7_%MAs^cwkwL% zD8UkxCDWAAxhk0ZDx%L+gi8*hnhqkK92Ch^mCRSgl&MNwQ$;^kh1^y{4XcSwtBI7U zOIE2%HL9a~)WsLnMc33J&6<)AG*RQ4$Z0M3oEDOz1$(b0YH(Pw?XYC`VaYpKsV=P4 z7FJXVhd0D24dNsp;UpHd#UJTNZt5VXbS0+rBajp4Phz6_~W&Tz}DWZtdlR_FHdX zbw;p>nRc|ipYKnXb{y$w-B=ziF)lQ{-S%;9vg!1zk=yOtZ)bYq9mUM%UMfA9n94_HLw{y+a(h(q-H)YoF^N>j>XMNzW=%^r(B zo(sGdWe;Xm(&m&J4NpP=hLMdqme=}W3IoesvgnH&z-y5>+3elk1COcaV|B0R4H$9Y zV*2>z@q}O<@LD9v%r8`##56I&r^e>X2z1>hQ07gn4Oe)0x)57)f?6Z+T3DWpO+>(w z>MQt9F%RMD^U($GTVz$+w>n>xyGT1aY;RqzrjI&k+M=7B6Ttxi%Q#QpELdhJQ~WMw zrd9O}%uo?|yP&=kswoRaNCawq{q$jH<8$z(&I>QTF$-N~5~0(e?+vAYzwBrOT3w!r zIIv#MgcGuVLgREB?jH?3m{G>GkIoQ(H43Z^ycVgIdj(kkQGrfjQfKIB7>WB`iZeTV zDFP?^gs~(6!zhWus|6oSv9)GywvA@u-yUUr%Yidbb%azIq|wNzEo9j{_eP}B_#TW- zr16?9#`Q1WA7vD=qshlQS__p!U07Yq&z@YW^3YK)59q?W-}e|55j$k54LvS^H!pPh z>M0R?L0_s0XR*@INk(%=>L+B7Gm$#t_D_0q>8waq&>YTY$&~b)Z5}jE4d2Dfyh!xc zqvg6veBEv^D18mIao_Qpn%-4O0~-fstT}^Is@kX{Nw;&9USun7v>{JYox4d{U~N5X zYUTY3c1q1@)ZJD|mncx`v+Rjm43R#Q!eOs+67*;_)hVXq0E*zp`ncvfcK40?+b&LW zuF##nVk`4s{20GLStcc=Qo3nPM&-L9hw*yXoa~pPnrK@qnC`Jz-I{b}<=Z?^4?m~x z*QbxFck?DmxZQ}6BRz~$@PFN3$guW!E!ZHi<@ zMhcql2!%1dB+rs1iuusFx^h7aQ7BGTc)D4^zJY zH=l4Jr6WOWbx-BYUssFVYg@lLuciL>#^*bq(9Lv*+upVDp6OWY7rgQLL)JmFM;oI| za$n6K9sj=lQQNKV;;Sj9#jo2JqPZUJEG&C}Gow^o+Ww?<<88?FyKU6>FXx^-9Zx!hv)_14rhhu5DCU4NsxrVV%*@?Lx>=@Sb;o*5Cyd;CimDp(W!r0-= z{HeGa4(&)phc3(U{%(P`cTw^QPHYUg9^vQj$l)nhIoZN{pig|GvFxE-DHp-LqMQxU zdXHv#&SvWh$-O6=B+T-9gZ03s@1w2!XZby|^<;e-;uXIjz{gweL6RCG-87KG_bT-n z%Nr7XT#=B^+xOMRk0u59JBn^p8fbiYf8oLxBWTrb%qQ{ji!nMIg+vEJKl+S9s284(QkX=Nod_q1+A_ULu0)}7Y7rh6OE zx-99*MnLOiNdZ)?GrXBd)wr#t6AL46eeUF%4*DhZ9J z9~ShtozIU{i47IouQjo~A^$?v?%}sF^af>qXmi8i&ezMEv#(y6DIEU(9kI(a6DrCA zK8ngm0b0jmp*?evQJarN0?;~mRGJ3SF;X}H!xIf9Pjbf~vSPSn(dDY#acnf>{qgem zcbs8T7JbFq%nFq*;>xDyU9`zZ5DO`~tU>tX@vkxF*grJyFVR8(Xqo;4v=}id*gu?! zVFE*B?^uste|Y+D&LmRkb$wn>T3K}No-^5Wr^}}bLD4a;@ZvpZ@{urtW)PVfQ!K5f zI+HZ7nN9+arh6~dnaJuwWTpXUa$JU6(`yw#OArIr#D8Li9@!~j%VK8*oJrs;S<_y` zxS%7jM^w|A)f{jpKCv3vO#V<4J1-V3(iNiIgEr+y+?90g1tu?+B8M7Juf06^A+bQF zCWuWeX^eTOqBmVSdJ?1%8^NKwzfkL<;ls73{N}F;g4wp-K5vb`^Jixg|7yPPqFG_> zmz|IQ!I{K8Vnnj5^b-&)`pmrWTuY);R1UrpZs@H#HyfSol{QO8U0H~Z5ieIAk408f ziuGmgV37I;Mu_ve%KChU5*k|+WOBw-AR&ocuX`XBj}9tDX$#|B)6Ef^t{Ik`N^Y5! z4zc1Hc5?K1B!Mi6&JOe1b-c{FzB7L%GkZns3X71!K%V~-wPm=^7L$bb&&EdqfK=-r zK>CN-+|0f@2+<_n_Xq!GHuyb)Svx&Sj+U4ez-T|0R&Z60JLHY<@Y10#( z(aCa{W$u#z0iUwq?()?GX7gB^gho8{_OZBvyQRl!pq{#1sgLVj&d{H;1I#9CJORT@ z>qeaF467MEcE1NJcpmuCg*#fkAS!PouewZxZ>%*OjBH&YDQvy1=6&69eOB~mv&qmp zbeHAsx2L;1>;G;xKRo>%(jA`PA)VF#3DST)NGr#vkRtQ|NK149NL_S(h7|lKNNK5% zvI3Brm>Mo7T05w@WKqd`nLyrkgW0Y2m1(Pgt8^E4dw$-XO5Wu>|G^-9?#J7)|A@TW zASRF;&4K?iYWb`vV>+Ne$U8s|PzliZ73ntD#?+GGAF)C~*Cbbi8Y}#XqMF8*0@PS> zELrKyJM&Leq^&QKSmgOJPXO}1)F6dQTQvZq_G7kxbZ4#fQ-HjJSD%FWuB}c>Z)4~> zJa$>3Uz%mRIwE`+bQ7dfUQ~baFI^(6nE>UYoC@(yu*V- zs5xNN9t)Ojzv&&-d}i%s{)Jm-p54Cm=UDM}Wc1*nLI>qT{;NO7iqt*wE_j2h9P6~k zcDG?H-dD^ng`jtK_TN0)d-r>Z$@Zc|kwFMZbtX)J9}Ej;*DfVQa39(vMDn4PoODzD zi-A~i3U3(o;w1A?R9*&P6vd5bivtj~%+B$07R)XQ+#`5ogbJ09d*lt9qSz;~x=qfe zW->p6q*D2qZmz$(05?+TL;Z=5763}n|AtbW#U^p8CAI(FAK}kVwR$t~*YJmG)i;Z0 zP(3Gym;Vv|$iXGi5u?=bXL727GENPDwIS)?!;*(2XNbHzy-=WazjyZ(+ zMc2JwE=g2+rOL#(xmLJ;xbpo~&=xiPHT)Q{RaVu@F?YU>e|$InZ{aWeF(Z;*08c>B zpj81DDp3d#IT*~Wj<>4wY*ez>zS&5K{z5caluQ|o7KtMwv{40>#W=}YiZe)-I#`vS z5Rr))9Ylu&>R?UAGVYe34rTSZq{5-GsAwZONvCvEH1nc%sFL$yrj4BtK4ZqDYBb>> z*_P$g%6x10Qx19fF-0DSf%As0*&-R{U{i2$fra;)Q zB-Hi-F_jghV~+O!$o6a#lpLfsfll6m8MH^jBsKFxFdI>x42MxD<>|L?2G+CW>0GX=472}$wC?^CsDP76MjH4FauEC~M zCuJY7B7Ql|p2acCIRx*XBU%uN&i=CCv6 zYK$-mUo^}S_wyX~1Cag(`iIWeAX#lQ24a}@pzlYElLq5Xlm8g(x!2+x6tSNi*a&A& zmGz~zIK=x11QU3##W_SGsRAv|su4dz$Odq>(t5I_yg;DEk?Eoh-b|1my6J6IO3G-< zH$IQCtomhR^|q8n*UP)1YNliJ;y{bTw@rx+YiV$af`0@D9%=OhDLKiW*0-mjEIkZ$ zT*ZOf{9hi-F{$x+VQV(}xPG8pllxCCjY|siKb-9s_5P!sv`DE>ORb4 zqh<3w5KE|_7Hta6CCj?Fa`_A(e0(f7WMFtqSvgAeKKv$r7>t1#TRk;=fG37R!{A4R zZH#aEJZ>R1@;&JEkDk68nmi|8wQM*5595^%X^pIh?q?G)E_i*G0uiw~GSYwrW^FV9 z%FEpnwvyLc2za0D2uv5_k=SbmUt6!e3cvo5uk68v1BK;`IQw-IjdyP=8KTy@>^jt@ z8y#8sT%9dKH`Y9v*1GoD63jGjHN^LC8%>vH=b&>F9N+RAK>E&&G!{C3>`o98qx|lD z@VPGZ0+^XFKK{xgL*{=i+9nAi3H}tP=vX2i4$sXXI>+Y3s5*%xHB;u0xuul|a!9W# zGEwCv(J4`36%S9=vSuy?gw%N<6)$XPn9|GvkTGwMj7HrHUZxJage*Iiez(g^AuR5p z&I*8#63eU5SHcojY;)N7a~AS4Tb>E!u>wL`5WLm83=gm%d;CdA(*ST^{yn%ej7YaPB-oQ{i%6 z?(^}R-u;@XQ!hQuJ)^LB{w18&gqFmQm;4;nJhG+mEvO zV%KiLHzwM5^99_8>wSN3QD0T=eBN1GJ05fQ@W9u9ZBZM6z{0K1?1bQWV$hEUyT>@8 z`NyAIIpNa-3@}Ug_-CQ*;-sPv%u-zePgH8! z7raf1QFotf`WsD_#UKmQm6Mt5z%0$O4`_9RS&u|5YO8)Ax{EsvDwhMZbZ#lvw=D>N z1Bi=8@$Wn>qKjVOH;`ds0-fNaQ3Xf_?j-*fh0?vMoG&{p9*SVo z=^QIr9$|?gZ0a7c!QvqWB(e;?GQHwq4mFV4`D*i*s`9pBttcw`E7XDS>r-ZtMeY=I2XRW?uo!|+6$Y_-vjX??a+1lR>g{uJGTwin0v&C zN&Z^eNYW&GAT#PPZg=y&YvBcY0WeQ6V?MR=eD@e$>5X1fQ!M_3^wt%r63Nq?7#YTtC&V{MwJ?dT7+o6ija;!0|pOs$%dxN-md_@nXHh zg5w3qv6}&Q9m?Y#BdoLYxP0_>GDq{7yPIhCiF%sQwaa(zaawVoJuUYL8;F7&#B`+L zWHP#8`#Vl(Thmv##tTnoC=^d@jV79-bc5b5Q-yO`ynu)8FDV-_es z4>!gx$ghirX zqE6#O8oQX)`w?}ni<>QGW}53y9JwxRb<&RaZ_h-3zX*HY)2mtCL01Y@p~HN@1~WLsd0W zw_6NaIlBt8rUmlns4=t{A|o$Ayc+b5I9`T}2SoSrj6gYSo&I&8@iV>7(M1w9Rwwr{_QZQck(H&=D+e#q&4>oZ?@`?Eprcn#AViEqK5w%&fO-S2q# z%(rhJ8HK2tla=gcm4(?dmC6+?~fhi z0cUC*i;;n$k_ysw1pN1U*(BcTJoX&S>^wI;GSd`cedib|pI&ky1!vLi zVyyKE(9t6*E2#7|$bdzf#VG@~%!!k+Wqx)(lJ=Kn03FSC%~ErRIh>+jGQ#d#aToV= zZ+15TGRbm&;PW7S9{9n)(Vw{YmvD~*aM%6~+`q1z_q)#&N5^!tTP;z>6w7t)Q^QK6 z>ea#iB$jg>d9ki#04eut<*@L=g*6Qz^u&7Cg`_;7bx_7Iu_Z9rkq}?Zx%>NRjGIn9 zXw|FkN#(g2Cz{((V-OR(87V$=b6uy2`(y%Y=4S15gs-T3J>6!l|bz8u* zN9>6+Hy?-~yrKy1+fcdp=R*--)^PB^m6i?iT`P*@yi-xUI%$}2aYS?W3}pY?$op3} z#av`9GC&B)_a@Lw;L_z}k zoe)Bt0Or(KiiU4JAtPmO0+?gU`}4)*2UT4XRSp@rB&c!Ta!Ky}nhjvi=edxoXF*%4 zt33x`ZmusWo{=UabTr+%jqH|H;XP31;SeHen=J`oo71W2p92b|0?=R7ejJLvV>%00Sv5(_*k7*+BrLn|@2`p`2;-!IKho9cG7xeie*kHuz|OO=Gy;Si&MAby6VU&eOXVB!OHAajo_;w4zX5di zkUBZksyOIr0%4-s3S&JxLFe9Ho3DOLw!2cDzChXNR^9P-#sSW$wOj9Al`|G9fMuT6 z&zFR<%!%W78rj`u=23^ICG{!QcYXHpP{vE%0J} z8?{?+$?aTQ-%KD*z7aj~(vER~P9GKrlLdo0Z?}a0R{NdrtLcf)6{}lT5Bxys%l*?e z!InzGhqZ@={aQZSx%3!9XwJ^Iok$X}VL|5d5n*RTly+c|`%Eb(B0241M99KR_njTtPhefJN|+>WJU8 zviQK&tOU$KG61Cbkc1>}?bw8K*n?cQeJwzB?QH)@V2+3*5Q{l}VTO^iJV$l9+JA=db5wOxd;!kv4QS8HFDoo5Sg`B4$d zk#>dxJqY0(S+6lRu!i*e*~hiqW9Ey)hKtmF95A!aANe-%8{;N-!j!P?XwBI~d z$-)Faa<<``_lp`{f1DF{0#xyCdYy`CI_!vMZ#rF{cYWv4mg7ZJaG9^SUW4>+y42^< zm0a+n;n*t+LwA2Y3klKA0M0@TJYT&As-xAhSARMS**Pkbpo?*ej8&Zk!*g9Loya*h z{Wc;=kr*JJ0=bnKk`aiAld8?OjYGFhf)f;+^^sOU&pV%_v5JpPIHKALQBI4 z3i;22Rwo*${Q`fz?Ez>Rc{Np?r0xDblMDsv1FlbYx%_3mh4&p;u z*KH#;HdQ^1&%b^VVX+Bg=|m3atKt%#hz5VC?NTNs6^-pq(9ZS=atH=*9OKI3VzcSp zZ53$rAg8fdJei0f(5aUmuCWG_V2d)0^H*$5UJy=)Wf%({sp-S6zoPMBdOFctL{4E1 zeJbFin=CjF7s6D?PU+!a(O+NVk-vE39Vl>9VC2io{5RVO_<44|@Q#jCAMAl5u+f%_ zWBYA8!oK*NDbtslvwh|?GQ;n1G@##f)g?g>a6bu}F?`h9p6IBbZ+j@VA_=9H&T+BX zlLGMEUW`jZPD{VFND`1rk-3kENT-m^9b}3&r|t0+E#YSZX-4DsN^JlpFJ@R88OFw# zodO{K(f<)_UDI9N49jiY3v#TkoI>A2TZAg@ty_d*vJKt&-7f^_)XWSA*VgA(mkea)AWycwY#2v*f5OUJSUN>8Y~HHb1Rk*_GP$xDMW=rLjtX z%{JCqL|~@Gqxab@&Itv}>S)QSc9uoCJUjk6#|RRy-{X>*y4kQW9-tarte@{?0;<8; z9r=ZDk&oa?uN?)P5^2!y+nOyQs-VQsz@*ZGEBsN2F;gI~aKP)wOlE8EJwN++wlR_B z`C-4_b=?|l1e`A^%Q(_hv~BZ`yRN|(@&VLF5b+Mn;%)aZ(4PJJW%Yoqcu; z^rD@48c|v!5kJaqa(+hC-h96{1XJh_(QawL_Ap(bA7V5H%!Uj@TZ!~tIV zl0G(?Fp(=G4QyAg6T{RrSVbp`Rwkb~Ix=CUTL`aY67t zqYJA=)-TgC}e>hXU zhfQ(#9nGa5Cw3zq6VwyCA}9-b6R6>}!9Sna@!#m`k3l76Gshr#8VBNJYO`755J22a zP||7~h?gH(=u1>v?RQB&upWa*fkNH_TUU;iR#ar-!)TKKFi9@Yae%Vf2EU%}>z&CH)it%uW9T z=6K%-Ix=upDf6QT`q2X>#=>;=<(Ws#--~2;>6_Pd)GUhz;i4VvoQBkoJaH(5J0>Ez z0Im>${t;j#xX3g8)Iw0ZWbVi*^Ir==_zmfPzi^LaJ@KBLY|<;Y&gM1rnZ5yE8ta)o-#<<3w9mD;?+DF2 zES0URSfg`al4y|umsWkG;Q?p6@%qs_n%8h_zNgZj8A3~6M^T%>(K~yQrjPHz-Mg2@ zcE3u@gq~gT`2DOB3=G#F`q=_(SbpedrTOprc~$pU{bW80=w}Oef`WqXyytKFX?Xl# zfWXiC$-*$OfHT#yHP5i%)Gf3BNk8?o_Vjbf>ks{`_<6W$10ZVsD~JpN_>}sYZU98Y zUJ8xZ5kRriEYIch?$gm8CM?h8#S3ae{KNJwa;D0&sbHQhgkibFKf*BJxw#>b+71QB z(}Wp7E4-%&S=1*LKq&`R$sKb&;heeHSJ6sPCX&t=kao zSPyvys>#$=JS=jn+73mhY>&#u5u?)}p9I{hqPwtJz6|3*!h}R9IL^tZWyqhvSx5KS zj;B)ZVd60S;MAB4!)q+Gh>n=AgPjo=tb}Lv_mHr-ej3thtNgow_$dx!X79NxMRD-U~8KZm@LAKgE$Ll1{C#o(5BI7i+Vv2*c7*|S?05=O%_UI~9s<-^y0f%V4+@&lKGB*Zz!stBk& zdMQd#n9+E}6+hMmkK*{jXO!Gz2PQl+!}^qDSr}xs{8GT`il_LMZel;GH0zX9Rdi&W Y(?6j)4M_L*quqaULH)mVw5$IA0FB)@mjD0& literal 0 HcmV?d00001 diff --git a/vendor/github.com/morikuni/aec/sgr.go b/vendor/github.com/morikuni/aec/sgr.go new file mode 100644 index 00000000..0ba3464e --- /dev/null +++ b/vendor/github.com/morikuni/aec/sgr.go @@ -0,0 +1,202 @@ +package aec + +import ( + "fmt" +) + +// RGB3Bit is a 3bit RGB color. +type RGB3Bit uint8 + +// RGB8Bit is a 8bit RGB color. +type RGB8Bit uint8 + +func newSGR(n uint) ANSI { + return newAnsi(fmt.Sprintf(esc+"%dm", n)) +} + +// NewRGB3Bit create a RGB3Bit from given RGB. +func NewRGB3Bit(r, g, b uint8) RGB3Bit { + return RGB3Bit((r >> 7) | ((g >> 6) & 0x2) | ((b >> 5) & 0x4)) +} + +// NewRGB8Bit create a RGB8Bit from given RGB. +func NewRGB8Bit(r, g, b uint8) RGB8Bit { + return RGB8Bit(16 + 36*(r/43) + 6*(g/43) + b/43) +} + +// Color3BitF set the foreground color of text. +func Color3BitF(c RGB3Bit) ANSI { + return newAnsi(fmt.Sprintf(esc+"%dm", c+30)) +} + +// Color3BitB set the background color of text. +func Color3BitB(c RGB3Bit) ANSI { + return newAnsi(fmt.Sprintf(esc+"%dm", c+40)) +} + +// Color8BitF set the foreground color of text. +func Color8BitF(c RGB8Bit) ANSI { + return newAnsi(fmt.Sprintf(esc+"38;5;%dm", c)) +} + +// Color8BitB set the background color of text. +func Color8BitB(c RGB8Bit) ANSI { + return newAnsi(fmt.Sprintf(esc+"48;5;%dm", c)) +} + +// FullColorF set the foreground color of text. +func FullColorF(r, g, b uint8) ANSI { + return newAnsi(fmt.Sprintf(esc+"38;2;%d;%d;%dm", r, g, b)) +} + +// FullColorB set the foreground color of text. +func FullColorB(r, g, b uint8) ANSI { + return newAnsi(fmt.Sprintf(esc+"48;2;%d;%d;%dm", r, g, b)) +} + +// Style +var ( + // Bold set the text style to bold or increased intensity. + Bold ANSI + + // Faint set the text style to faint. + Faint ANSI + + // Italic set the text style to italic. + Italic ANSI + + // Underline set the text style to underline. + Underline ANSI + + // BlinkSlow set the text style to slow blink. + BlinkSlow ANSI + + // BlinkRapid set the text style to rapid blink. + BlinkRapid ANSI + + // Inverse swap the foreground color and background color. + Inverse ANSI + + // Conceal set the text style to conceal. + Conceal ANSI + + // CrossOut set the text style to crossed out. + CrossOut ANSI + + // Frame set the text style to framed. + Frame ANSI + + // Encircle set the text style to encircled. + Encircle ANSI + + // Overline set the text style to overlined. + Overline ANSI +) + +// Foreground color of text. +var ( + // DefaultF is the default color of foreground. + DefaultF ANSI + + // Normal color + BlackF ANSI + RedF ANSI + GreenF ANSI + YellowF ANSI + BlueF ANSI + MagentaF ANSI + CyanF ANSI + WhiteF ANSI + + // Light color + LightBlackF ANSI + LightRedF ANSI + LightGreenF ANSI + LightYellowF ANSI + LightBlueF ANSI + LightMagentaF ANSI + LightCyanF ANSI + LightWhiteF ANSI +) + +// Background color of text. +var ( + // DefaultB is the default color of background. + DefaultB ANSI + + // Normal color + BlackB ANSI + RedB ANSI + GreenB ANSI + YellowB ANSI + BlueB ANSI + MagentaB ANSI + CyanB ANSI + WhiteB ANSI + + // Light color + LightBlackB ANSI + LightRedB ANSI + LightGreenB ANSI + LightYellowB ANSI + LightBlueB ANSI + LightMagentaB ANSI + LightCyanB ANSI + LightWhiteB ANSI +) + +func init() { + Bold = newSGR(1) + Faint = newSGR(2) + Italic = newSGR(3) + Underline = newSGR(4) + BlinkSlow = newSGR(5) + BlinkRapid = newSGR(6) + Inverse = newSGR(7) + Conceal = newSGR(8) + CrossOut = newSGR(9) + + BlackF = newSGR(30) + RedF = newSGR(31) + GreenF = newSGR(32) + YellowF = newSGR(33) + BlueF = newSGR(34) + MagentaF = newSGR(35) + CyanF = newSGR(36) + WhiteF = newSGR(37) + + DefaultF = newSGR(39) + + BlackB = newSGR(40) + RedB = newSGR(41) + GreenB = newSGR(42) + YellowB = newSGR(43) + BlueB = newSGR(44) + MagentaB = newSGR(45) + CyanB = newSGR(46) + WhiteB = newSGR(47) + + DefaultB = newSGR(49) + + Frame = newSGR(51) + Encircle = newSGR(52) + Overline = newSGR(53) + + LightBlackF = newSGR(90) + LightRedF = newSGR(91) + LightGreenF = newSGR(92) + LightYellowF = newSGR(93) + LightBlueF = newSGR(94) + LightMagentaF = newSGR(95) + LightCyanF = newSGR(96) + LightWhiteF = newSGR(97) + + LightBlackB = newSGR(100) + LightRedB = newSGR(101) + LightGreenB = newSGR(102) + LightYellowB = newSGR(103) + LightBlueB = newSGR(104) + LightMagentaB = newSGR(105) + LightCyanB = newSGR(106) + LightWhiteB = newSGR(107) +} diff --git a/vendor/github.com/urfave/cli/build.go b/vendor/github.com/urfave/cli/build.go deleted file mode 100644 index a828ae40..00000000 --- a/vendor/github.com/urfave/cli/build.go +++ /dev/null @@ -1,164 +0,0 @@ -//+build ignore - -package main - -import ( - "bufio" - "bytes" - "fmt" - "io/ioutil" - "log" - "os" - "os/exec" - "strings" - - "github.com/urfave/cli" -) - -var packages = []string{"cli", "altsrc"} - -func main() { - app := cli.NewApp() - - app.Name = "builder" - app.Usage = "Generates a new urfave/cli build!" - - app.Commands = cli.Commands{ - cli.Command{ - Name: "vet", - Action: VetActionFunc, - }, - cli.Command{ - Name: "test", - Action: TestActionFunc, - }, - cli.Command{ - Name: "gfmrun", - Action: GfmrunActionFunc, - }, - cli.Command{ - Name: "toc", - Action: TocActionFunc, - }, - } - - err := app.Run(os.Args) - if err != nil { - log.Fatal(err) - } -} - -func runCmd(arg string, args ...string) error { - cmd := exec.Command(arg, args...) - - cmd.Stdin = os.Stdin - cmd.Stdout = os.Stdout - cmd.Stderr = os.Stderr - - return cmd.Run() -} - -func VetActionFunc(_ *cli.Context) error { - return runCmd("go", "vet") -} - -func TestActionFunc(c *cli.Context) error { - for _, pkg := range packages { - var packageName string - - if pkg == "cli" { - packageName = "github.com/urfave/cli" - } else { - packageName = fmt.Sprintf("github.com/urfave/cli/%s", pkg) - } - - coverProfile := fmt.Sprintf("--coverprofile=%s.coverprofile", pkg) - - err := runCmd("go", "test", "-v", coverProfile, packageName) - if err != nil { - return err - } - } - - return testCleanup() -} - -func testCleanup() error { - var out bytes.Buffer - - for _, pkg := range packages { - file, err := os.Open(fmt.Sprintf("%s.coverprofile", pkg)) - if err != nil { - return err - } - - b, err := ioutil.ReadAll(file) - if err != nil { - return err - } - - out.Write(b) - err = file.Close() - if err != nil { - return err - } - - err = os.Remove(fmt.Sprintf("%s.coverprofile", pkg)) - if err != nil { - return err - } - } - - outFile, err := os.Create("coverage.txt") - if err != nil { - return err - } - - _, err = out.WriteTo(outFile) - if err != nil { - return err - } - - err = outFile.Close() - if err != nil { - return err - } - - return nil -} - -func GfmrunActionFunc(_ *cli.Context) error { - file, err := os.Open("README.md") - if err != nil { - return err - } - - var counter int - scanner := bufio.NewScanner(file) - for scanner.Scan() { - if strings.Contains(scanner.Text(), "package main") { - counter++ - } - } - - err = scanner.Err() - if err != nil { - return err - } - - return runCmd("gfmrun", "-c", fmt.Sprint(counter), "-s", "README.md") -} - -func TocActionFunc(_ *cli.Context) error { - err := runCmd("node_modules/.bin/markdown-toc", "-i", "README.md") - if err != nil { - return err - } - - err = runCmd("git", "diff", "--exit-code") - if err != nil { - return err - } - - return nil -} diff --git a/vendor/go.opencensus.io/.gitignore b/vendor/go.opencensus.io/.gitignore new file mode 100644 index 00000000..74a6db47 --- /dev/null +++ b/vendor/go.opencensus.io/.gitignore @@ -0,0 +1,9 @@ +/.idea/ + +# go.opencensus.io/exporter/aws +/exporter/aws/ + +# Exclude vendor, use dep ensure after checkout: +/vendor/github.com/ +/vendor/golang.org/ +/vendor/google.golang.org/ diff --git a/vendor/go.opencensus.io/.travis.yml b/vendor/go.opencensus.io/.travis.yml new file mode 100644 index 00000000..bd6b66ee --- /dev/null +++ b/vendor/go.opencensus.io/.travis.yml @@ -0,0 +1,17 @@ +language: go + +go_import_path: go.opencensus.io + +go: + - 1.11.x + +env: + global: + GO111MODULE=on + +before_script: + - make install-tools + +script: + - make travis-ci + - go run internal/check/version.go # TODO move this to makefile diff --git a/vendor/go.opencensus.io/AUTHORS b/vendor/go.opencensus.io/AUTHORS new file mode 100644 index 00000000..e491a9e7 --- /dev/null +++ b/vendor/go.opencensus.io/AUTHORS @@ -0,0 +1 @@ +Google Inc. diff --git a/vendor/go.opencensus.io/CONTRIBUTING.md b/vendor/go.opencensus.io/CONTRIBUTING.md new file mode 100644 index 00000000..1ba3962c --- /dev/null +++ b/vendor/go.opencensus.io/CONTRIBUTING.md @@ -0,0 +1,63 @@ +# How to contribute + +We'd love to accept your patches and contributions to this project. There are +just a few small guidelines you need to follow. + +## Contributor License Agreement + +Contributions to this project must be accompanied by a Contributor License +Agreement. You (or your employer) retain the copyright to your contribution, +this simply gives us permission to use and redistribute your contributions as +part of the project. Head over to to see +your current agreements on file or to sign a new one. + +You generally only need to submit a CLA once, so if you've already submitted one +(even if it was for a different project), you probably don't need to do it +again. + +## Code reviews + +All submissions, including submissions by project members, require review. We +use GitHub pull requests for this purpose. Consult [GitHub Help] for more +information on using pull requests. + +[GitHub Help]: https://help.github.com/articles/about-pull-requests/ + +## Instructions + +Fork the repo, checkout the upstream repo to your GOPATH by: + +``` +$ go get -d go.opencensus.io +``` + +Add your fork as an origin: + +``` +cd $(go env GOPATH)/src/go.opencensus.io +git remote add fork git@github.com:YOUR_GITHUB_USERNAME/opencensus-go.git +``` + +Run tests: + +``` +$ make install-tools # Only first time. +$ make +``` + +Checkout a new branch, make modifications and push the branch to your fork: + +``` +$ git checkout -b feature +# edit files +$ git commit +$ git push fork feature +``` + +Open a pull request against the main opencensus-go repo. + +## General Notes +This project uses Appveyor and Travis for CI. + +The dependencies are managed with `go mod` if you work with the sources under your +`$GOPATH` you need to set the environment variable `GO111MODULE=on`. \ No newline at end of file diff --git a/vendor/go.opencensus.io/Gopkg.lock b/vendor/go.opencensus.io/Gopkg.lock new file mode 100644 index 00000000..3be12ac8 --- /dev/null +++ b/vendor/go.opencensus.io/Gopkg.lock @@ -0,0 +1,231 @@ +# This file is autogenerated, do not edit; changes may be undone by the next 'dep ensure'. + + +[[projects]] + branch = "master" + digest = "1:eee9386329f4fcdf8d6c0def0c9771b634bdd5ba460d888aa98c17d59b37a76c" + name = "git.apache.org/thrift.git" + packages = ["lib/go/thrift"] + pruneopts = "UT" + revision = "6e67faa92827ece022380b211c2caaadd6145bf5" + source = "github.com/apache/thrift" + +[[projects]] + branch = "master" + digest = "1:d6afaeed1502aa28e80a4ed0981d570ad91b2579193404256ce672ed0a609e0d" + name = "github.com/beorn7/perks" + packages = ["quantile"] + pruneopts = "UT" + revision = "3a771d992973f24aa725d07868b467d1ddfceafb" + +[[projects]] + digest = "1:4c0989ca0bcd10799064318923b9bc2db6b4d6338dd75f3f2d86c3511aaaf5cf" + name = "github.com/golang/protobuf" + packages = [ + "proto", + "ptypes", + "ptypes/any", + "ptypes/duration", + "ptypes/timestamp", + ] + pruneopts = "UT" + revision = "aa810b61a9c79d51363740d207bb46cf8e620ed5" + version = "v1.2.0" + +[[projects]] + digest = "1:ff5ebae34cfbf047d505ee150de27e60570e8c394b3b8fdbb720ff6ac71985fc" + name = "github.com/matttproud/golang_protobuf_extensions" + packages = ["pbutil"] + pruneopts = "UT" + revision = "c12348ce28de40eed0136aa2b644d0ee0650e56c" + version = "v1.0.1" + +[[projects]] + digest = "1:824c8f3aa4c5f23928fa84ebbd5ed2e9443b3f0cb958a40c1f2fbed5cf5e64b1" + name = "github.com/openzipkin/zipkin-go" + packages = [ + ".", + "idgenerator", + "model", + "propagation", + "reporter", + "reporter/http", + ] + pruneopts = "UT" + revision = "d455a5674050831c1e187644faa4046d653433c2" + version = "v0.1.1" + +[[projects]] + digest = "1:d14a5f4bfecf017cb780bdde1b6483e5deb87e12c332544d2c430eda58734bcb" + name = "github.com/prometheus/client_golang" + packages = [ + "prometheus", + "prometheus/promhttp", + ] + pruneopts = "UT" + revision = "c5b7fccd204277076155f10851dad72b76a49317" + version = "v0.8.0" + +[[projects]] + branch = "master" + digest = "1:2d5cd61daa5565187e1d96bae64dbbc6080dacf741448e9629c64fd93203b0d4" + name = "github.com/prometheus/client_model" + packages = ["go"] + pruneopts = "UT" + revision = "5c3871d89910bfb32f5fcab2aa4b9ec68e65a99f" + +[[projects]] + branch = "master" + digest = "1:63b68062b8968092eb86bedc4e68894bd096ea6b24920faca8b9dcf451f54bb5" + name = "github.com/prometheus/common" + packages = [ + "expfmt", + "internal/bitbucket.org/ww/goautoneg", + "model", + ] + pruneopts = "UT" + revision = "c7de2306084e37d54b8be01f3541a8464345e9a5" + +[[projects]] + branch = "master" + digest = "1:8c49953a1414305f2ff5465147ee576dd705487c35b15918fcd4efdc0cb7a290" + name = "github.com/prometheus/procfs" + packages = [ + ".", + "internal/util", + "nfs", + "xfs", + ] + pruneopts = "UT" + revision = "05ee40e3a273f7245e8777337fc7b46e533a9a92" + +[[projects]] + branch = "master" + digest = "1:deafe4ab271911fec7de5b693d7faae3f38796d9eb8622e2b9e7df42bb3dfea9" + name = "golang.org/x/net" + packages = [ + "context", + "http/httpguts", + "http2", + "http2/hpack", + "idna", + "internal/timeseries", + "trace", + ] + pruneopts = "UT" + revision = "922f4815f713f213882e8ef45e0d315b164d705c" + +[[projects]] + branch = "master" + digest = "1:e0140c0c868c6e0f01c0380865194592c011fe521d6e12d78bfd33e756fe018a" + name = "golang.org/x/sync" + packages = ["semaphore"] + pruneopts = "UT" + revision = "1d60e4601c6fd243af51cc01ddf169918a5407ca" + +[[projects]] + branch = "master" + digest = "1:a3f00ac457c955fe86a41e1495e8f4c54cb5399d609374c5cc26aa7d72e542c8" + name = "golang.org/x/sys" + packages = ["unix"] + pruneopts = "UT" + revision = "3b58ed4ad3395d483fc92d5d14123ce2c3581fec" + +[[projects]] + digest = "1:a2ab62866c75542dd18d2b069fec854577a20211d7c0ea6ae746072a1dccdd18" + name = "golang.org/x/text" + packages = [ + "collate", + "collate/build", + "internal/colltab", + "internal/gen", + "internal/tag", + "internal/triegen", + "internal/ucd", + "language", + "secure/bidirule", + "transform", + "unicode/bidi", + "unicode/cldr", + "unicode/norm", + "unicode/rangetable", + ] + pruneopts = "UT" + revision = "f21a4dfb5e38f5895301dc265a8def02365cc3d0" + version = "v0.3.0" + +[[projects]] + branch = "master" + digest = "1:c0c17c94fe8bc1ab34e7f586a4a8b788c5e1f4f9f750ff23395b8b2f5a523530" + name = "google.golang.org/api" + packages = ["support/bundler"] + pruneopts = "UT" + revision = "e21acd801f91da814261b938941d193bb036441a" + +[[projects]] + branch = "master" + digest = "1:077c1c599507b3b3e9156d17d36e1e61928ee9b53a5b420f10f28ebd4a0b275c" + name = "google.golang.org/genproto" + packages = ["googleapis/rpc/status"] + pruneopts = "UT" + revision = "c66870c02cf823ceb633bcd05be3c7cda29976f4" + +[[projects]] + digest = "1:3dd7996ce6bf52dec6a2f69fa43e7c4cefea1d4dfa3c8ab7a5f8a9f7434e239d" + name = "google.golang.org/grpc" + packages = [ + ".", + "balancer", + "balancer/base", + "balancer/roundrobin", + "codes", + "connectivity", + "credentials", + "encoding", + "encoding/proto", + "grpclog", + "internal", + "internal/backoff", + "internal/channelz", + "internal/envconfig", + "internal/grpcrand", + "internal/transport", + "keepalive", + "metadata", + "naming", + "peer", + "resolver", + "resolver/dns", + "resolver/passthrough", + "stats", + "status", + "tap", + ] + pruneopts = "UT" + revision = "32fb0ac620c32ba40a4626ddf94d90d12cce3455" + version = "v1.14.0" + +[solve-meta] + analyzer-name = "dep" + analyzer-version = 1 + input-imports = [ + "git.apache.org/thrift.git/lib/go/thrift", + "github.com/golang/protobuf/proto", + "github.com/openzipkin/zipkin-go", + "github.com/openzipkin/zipkin-go/model", + "github.com/openzipkin/zipkin-go/reporter", + "github.com/openzipkin/zipkin-go/reporter/http", + "github.com/prometheus/client_golang/prometheus", + "github.com/prometheus/client_golang/prometheus/promhttp", + "golang.org/x/net/context", + "golang.org/x/net/http2", + "google.golang.org/api/support/bundler", + "google.golang.org/grpc", + "google.golang.org/grpc/codes", + "google.golang.org/grpc/grpclog", + "google.golang.org/grpc/metadata", + "google.golang.org/grpc/stats", + "google.golang.org/grpc/status", + ] + solver-name = "gps-cdcl" + solver-version = 1 diff --git a/vendor/go.opencensus.io/Gopkg.toml b/vendor/go.opencensus.io/Gopkg.toml new file mode 100644 index 00000000..a9f3cd68 --- /dev/null +++ b/vendor/go.opencensus.io/Gopkg.toml @@ -0,0 +1,36 @@ +# For v0.x.y dependencies, prefer adding a constraints of the form: version=">= 0.x.y" +# to avoid locking to a particular minor version which can cause dep to not be +# able to find a satisfying dependency graph. + +[[constraint]] + branch = "master" + name = "git.apache.org/thrift.git" + source = "github.com/apache/thrift" + +[[constraint]] + name = "github.com/golang/protobuf" + version = "1.0.0" + +[[constraint]] + name = "github.com/openzipkin/zipkin-go" + version = ">=0.1.0" + +[[constraint]] + name = "github.com/prometheus/client_golang" + version = ">=0.8.0" + +[[constraint]] + branch = "master" + name = "golang.org/x/net" + +[[constraint]] + branch = "master" + name = "google.golang.org/api" + +[[constraint]] + name = "google.golang.org/grpc" + version = "1.11.3" + +[prune] + go-tests = true + unused-packages = true diff --git a/vendor/go.opencensus.io/LICENSE b/vendor/go.opencensus.io/LICENSE new file mode 100644 index 00000000..7a4a3ea2 --- /dev/null +++ b/vendor/go.opencensus.io/LICENSE @@ -0,0 +1,202 @@ + + Apache License + Version 2.0, January 2004 + http://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + APPENDIX: How to apply the Apache License to your work. + + To apply the Apache License to your work, attach the following + boilerplate notice, with the fields enclosed by brackets "[]" + replaced with your own identifying information. (Don't include + the brackets!) The text should be enclosed in the appropriate + comment syntax for the file format. We also recommend that a + file or class name and description of purpose be included on the + same "printed page" as the copyright notice for easier + identification within third-party archives. + + Copyright [yyyy] [name of copyright owner] + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. \ No newline at end of file diff --git a/vendor/go.opencensus.io/Makefile b/vendor/go.opencensus.io/Makefile new file mode 100644 index 00000000..457866cb --- /dev/null +++ b/vendor/go.opencensus.io/Makefile @@ -0,0 +1,96 @@ +# TODO: Fix this on windows. +ALL_SRC := $(shell find . -name '*.go' \ + -not -path './vendor/*' \ + -not -path '*/gen-go/*' \ + -type f | sort) +ALL_PKGS := $(shell go list $(sort $(dir $(ALL_SRC)))) + +GOTEST_OPT?=-v -race -timeout 30s +GOTEST_OPT_WITH_COVERAGE = $(GOTEST_OPT) -coverprofile=coverage.txt -covermode=atomic +GOTEST=go test +GOFMT=gofmt +GOLINT=golint +GOVET=go vet +EMBEDMD=embedmd +# TODO decide if we need to change these names. +TRACE_ID_LINT_EXCEPTION="type name will be used as trace.TraceID by other packages" +TRACE_OPTION_LINT_EXCEPTION="type name will be used as trace.TraceOptions by other packages" +README_FILES := $(shell find . -name '*README.md' | sort | tr '\n' ' ') + +.DEFAULT_GOAL := fmt-lint-vet-embedmd-test + +.PHONY: fmt-lint-vet-embedmd-test +fmt-lint-vet-embedmd-test: fmt lint vet embedmd test + +# TODO enable test-with-coverage in tavis +.PHONY: travis-ci +travis-ci: fmt lint vet embedmd test test-386 + +all-pkgs: + @echo $(ALL_PKGS) | tr ' ' '\n' | sort + +all-srcs: + @echo $(ALL_SRC) | tr ' ' '\n' | sort + +.PHONY: test +test: + $(GOTEST) $(GOTEST_OPT) $(ALL_PKGS) + +.PHONY: test-386 +test-386: + GOARCH=386 $(GOTEST) -v -timeout 30s $(ALL_PKGS) + +.PHONY: test-with-coverage +test-with-coverage: + $(GOTEST) $(GOTEST_OPT_WITH_COVERAGE) $(ALL_PKGS) + +.PHONY: fmt +fmt: + @FMTOUT=`$(GOFMT) -s -l $(ALL_SRC) 2>&1`; \ + if [ "$$FMTOUT" ]; then \ + echo "$(GOFMT) FAILED => gofmt the following files:\n"; \ + echo "$$FMTOUT\n"; \ + exit 1; \ + else \ + echo "Fmt finished successfully"; \ + fi + +.PHONY: lint +lint: + @LINTOUT=`$(GOLINT) $(ALL_PKGS) | grep -v $(TRACE_ID_LINT_EXCEPTION) | grep -v $(TRACE_OPTION_LINT_EXCEPTION) 2>&1`; \ + if [ "$$LINTOUT" ]; then \ + echo "$(GOLINT) FAILED => clean the following lint errors:\n"; \ + echo "$$LINTOUT\n"; \ + exit 1; \ + else \ + echo "Lint finished successfully"; \ + fi + +.PHONY: vet +vet: + # TODO: Understand why go vet downloads "github.com/google/go-cmp v0.2.0" + @VETOUT=`$(GOVET) ./... | grep -v "go: downloading" 2>&1`; \ + if [ "$$VETOUT" ]; then \ + echo "$(GOVET) FAILED => go vet the following files:\n"; \ + echo "$$VETOUT\n"; \ + exit 1; \ + else \ + echo "Vet finished successfully"; \ + fi + +.PHONY: embedmd +embedmd: + @EMBEDMDOUT=`$(EMBEDMD) -d $(README_FILES) 2>&1`; \ + if [ "$$EMBEDMDOUT" ]; then \ + echo "$(EMBEDMD) FAILED => embedmd the following files:\n"; \ + echo "$$EMBEDMDOUT\n"; \ + exit 1; \ + else \ + echo "Embedmd finished successfully"; \ + fi + +.PHONY: install-tools +install-tools: + go get -u golang.org/x/tools/cmd/cover + go get -u golang.org/x/lint/golint + go get -u github.com/rakyll/embedmd diff --git a/vendor/go.opencensus.io/README.md b/vendor/go.opencensus.io/README.md new file mode 100644 index 00000000..fabab2e0 --- /dev/null +++ b/vendor/go.opencensus.io/README.md @@ -0,0 +1,263 @@ +# OpenCensus Libraries for Go + +[![Build Status][travis-image]][travis-url] +[![Windows Build Status][appveyor-image]][appveyor-url] +[![GoDoc][godoc-image]][godoc-url] +[![Gitter chat][gitter-image]][gitter-url] + +OpenCensus Go is a Go implementation of OpenCensus, a toolkit for +collecting application performance and behavior monitoring data. +Currently it consists of three major components: tags, stats and tracing. + +## Installation + +``` +$ go get -u go.opencensus.io +``` + +The API of this project is still evolving, see: [Deprecation Policy](#deprecation-policy). +The use of vendoring or a dependency management tool is recommended. + +## Prerequisites + +OpenCensus Go libraries require Go 1.8 or later. + +## Getting Started + +The easiest way to get started using OpenCensus in your application is to use an existing +integration with your RPC framework: + +* [net/http](https://godoc.org/go.opencensus.io/plugin/ochttp) +* [gRPC](https://godoc.org/go.opencensus.io/plugin/ocgrpc) +* [database/sql](https://godoc.org/github.com/opencensus-integrations/ocsql) +* [Go kit](https://godoc.org/github.com/go-kit/kit/tracing/opencensus) +* [Groupcache](https://godoc.org/github.com/orijtech/groupcache) +* [Caddy webserver](https://godoc.org/github.com/orijtech/caddy) +* [MongoDB](https://godoc.org/github.com/orijtech/mongo-go-driver) +* [Redis gomodule/redigo](https://godoc.org/github.com/orijtech/redigo) +* [Redis goredis/redis](https://godoc.org/github.com/orijtech/redis) +* [Memcache](https://godoc.org/github.com/orijtech/gomemcache) + +If you're using a framework not listed here, you could either implement your own middleware for your +framework or use [custom stats](#stats) and [spans](#spans) directly in your application. + +## Exporters + +OpenCensus can export instrumentation data to various backends. +OpenCensus has exporter implementations for the following, users +can implement their own exporters by implementing the exporter interfaces +([stats](https://godoc.org/go.opencensus.io/stats/view#Exporter), +[trace](https://godoc.org/go.opencensus.io/trace#Exporter)): + +* [Prometheus][exporter-prom] for stats +* [OpenZipkin][exporter-zipkin] for traces +* [Stackdriver][exporter-stackdriver] Monitoring for stats and Trace for traces +* [Jaeger][exporter-jaeger] for traces +* [AWS X-Ray][exporter-xray] for traces +* [Datadog][exporter-datadog] for stats and traces +* [Graphite][exporter-graphite] for stats +* [Honeycomb][exporter-honeycomb] for traces + +## Overview + +![OpenCensus Overview](https://i.imgur.com/cf4ElHE.jpg) + +In a microservices environment, a user request may go through +multiple services until there is a response. OpenCensus allows +you to instrument your services and collect diagnostics data all +through your services end-to-end. + +## Tags + +Tags represent propagated key-value pairs. They are propagated using `context.Context` +in the same process or can be encoded to be transmitted on the wire. Usually, this will +be handled by an integration plugin, e.g. `ocgrpc.ServerHandler` and `ocgrpc.ClientHandler` +for gRPC. + +Package `tag` allows adding or modifying tags in the current context. + +[embedmd]:# (internal/readme/tags.go new) +```go +ctx, err = tag.New(ctx, + tag.Insert(osKey, "macOS-10.12.5"), + tag.Upsert(userIDKey, "cde36753ed"), +) +if err != nil { + log.Fatal(err) +} +``` + +## Stats + +OpenCensus is a low-overhead framework even if instrumentation is always enabled. +In order to be so, it is optimized to make recording of data points fast +and separate from the data aggregation. + +OpenCensus stats collection happens in two stages: + +* Definition of measures and recording of data points +* Definition of views and aggregation of the recorded data + +### Recording + +Measurements are data points associated with a measure. +Recording implicitly tags the set of Measurements with the tags from the +provided context: + +[embedmd]:# (internal/readme/stats.go record) +```go +stats.Record(ctx, videoSize.M(102478)) +``` + +### Views + +Views are how Measures are aggregated. You can think of them as queries over the +set of recorded data points (measurements). + +Views have two parts: the tags to group by and the aggregation type used. + +Currently three types of aggregations are supported: +* CountAggregation is used to count the number of times a sample was recorded. +* DistributionAggregation is used to provide a histogram of the values of the samples. +* SumAggregation is used to sum up all sample values. + +[embedmd]:# (internal/readme/stats.go aggs) +```go +distAgg := view.Distribution(1<<32, 2<<32, 3<<32) +countAgg := view.Count() +sumAgg := view.Sum() +``` + +Here we create a view with the DistributionAggregation over our measure. + +[embedmd]:# (internal/readme/stats.go view) +```go +if err := view.Register(&view.View{ + Name: "example.com/video_size_distribution", + Description: "distribution of processed video size over time", + Measure: videoSize, + Aggregation: view.Distribution(1<<32, 2<<32, 3<<32), +}); err != nil { + log.Fatalf("Failed to register view: %v", err) +} +``` + +Register begins collecting data for the view. Registered views' data will be +exported via the registered exporters. + +## Traces + +A distributed trace tracks the progression of a single user request as +it is handled by the services and processes that make up an application. +Each step is called a span in the trace. Spans include metadata about the step, +including especially the time spent in the step, called the span’s latency. + +Below you see a trace and several spans underneath it. + +![Traces and spans](https://i.imgur.com/7hZwRVj.png) + +### Spans + +Span is the unit step in a trace. Each span has a name, latency, status and +additional metadata. + +Below we are starting a span for a cache read and ending it +when we are done: + +[embedmd]:# (internal/readme/trace.go startend) +```go +ctx, span := trace.StartSpan(ctx, "cache.Get") +defer span.End() + +// Do work to get from cache. +``` + +### Propagation + +Spans can have parents or can be root spans if they don't have any parents. +The current span is propagated in-process and across the network to allow associating +new child spans with the parent. + +In the same process, `context.Context` is used to propagate spans. +`trace.StartSpan` creates a new span as a root if the current context +doesn't contain a span. Or, it creates a child of the span that is +already in current context. The returned context can be used to keep +propagating the newly created span in the current context. + +[embedmd]:# (internal/readme/trace.go startend) +```go +ctx, span := trace.StartSpan(ctx, "cache.Get") +defer span.End() + +// Do work to get from cache. +``` + +Across the network, OpenCensus provides different propagation +methods for different protocols. + +* gRPC integrations use the OpenCensus' [binary propagation format](https://godoc.org/go.opencensus.io/trace/propagation). +* HTTP integrations use Zipkin's [B3](https://github.com/openzipkin/b3-propagation) + by default but can be configured to use a custom propagation method by setting another + [propagation.HTTPFormat](https://godoc.org/go.opencensus.io/trace/propagation#HTTPFormat). + +## Execution Tracer + +With Go 1.11, OpenCensus Go will support integration with the Go execution tracer. +See [Debugging Latency in Go](https://medium.com/observability/debugging-latency-in-go-1-11-9f97a7910d68) +for an example of their mutual use. + +## Profiles + +OpenCensus tags can be applied as profiler labels +for users who are on Go 1.9 and above. + +[embedmd]:# (internal/readme/tags.go profiler) +```go +ctx, err = tag.New(ctx, + tag.Insert(osKey, "macOS-10.12.5"), + tag.Insert(userIDKey, "fff0989878"), +) +if err != nil { + log.Fatal(err) +} +tag.Do(ctx, func(ctx context.Context) { + // Do work. + // When profiling is on, samples will be + // recorded with the key/values from the tag map. +}) +``` + +A screenshot of the CPU profile from the program above: + +![CPU profile](https://i.imgur.com/jBKjlkw.png) + +## Deprecation Policy + +Before version 1.0.0, the following deprecation policy will be observed: + +No backwards-incompatible changes will be made except for the removal of symbols that have +been marked as *Deprecated* for at least one minor release (e.g. 0.9.0 to 0.10.0). A release +removing the *Deprecated* functionality will be made no sooner than 28 days after the first +release in which the functionality was marked *Deprecated*. + +[travis-image]: https://travis-ci.org/census-instrumentation/opencensus-go.svg?branch=master +[travis-url]: https://travis-ci.org/census-instrumentation/opencensus-go +[appveyor-image]: https://ci.appveyor.com/api/projects/status/vgtt29ps1783ig38?svg=true +[appveyor-url]: https://ci.appveyor.com/project/opencensusgoteam/opencensus-go/branch/master +[godoc-image]: https://godoc.org/go.opencensus.io?status.svg +[godoc-url]: https://godoc.org/go.opencensus.io +[gitter-image]: https://badges.gitter.im/census-instrumentation/lobby.svg +[gitter-url]: https://gitter.im/census-instrumentation/lobby?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge + + +[new-ex]: https://godoc.org/go.opencensus.io/tag#example-NewMap +[new-replace-ex]: https://godoc.org/go.opencensus.io/tag#example-NewMap--Replace + +[exporter-prom]: https://godoc.org/contrib.go.opencensus.io/exporter/prometheus +[exporter-stackdriver]: https://godoc.org/contrib.go.opencensus.io/exporter/stackdriver +[exporter-zipkin]: https://godoc.org/contrib.go.opencensus.io/exporter/zipkin +[exporter-jaeger]: https://godoc.org/contrib.go.opencensus.io/exporter/jaeger +[exporter-xray]: https://github.com/census-ecosystem/opencensus-go-exporter-aws +[exporter-datadog]: https://github.com/DataDog/opencensus-go-exporter-datadog +[exporter-graphite]: https://github.com/census-ecosystem/opencensus-go-exporter-graphite +[exporter-honeycomb]: https://github.com/honeycombio/opencensus-exporter diff --git a/vendor/go.opencensus.io/appveyor.yml b/vendor/go.opencensus.io/appveyor.yml new file mode 100644 index 00000000..12bd7c4c --- /dev/null +++ b/vendor/go.opencensus.io/appveyor.yml @@ -0,0 +1,25 @@ +version: "{build}" + +platform: x64 + +clone_folder: c:\gopath\src\go.opencensus.io + +environment: + GOPATH: 'c:\gopath' + GOVERSION: '1.11' + GO111MODULE: 'on' + CGO_ENABLED: '0' # See: https://github.com/appveyor/ci/issues/2613 + +install: + - set PATH=%GOPATH%\bin;c:\go\bin;%PATH% + - choco upgrade golang --version 1.11.5 # Temporary fix because of a go.sum bug in 1.11 + - go version + - go env + +build: false +deploy: false + +test_script: + - cd %APPVEYOR_BUILD_FOLDER% + - go build -v .\... + - go test -v .\... # No -race because cgo is disabled diff --git a/vendor/go.opencensus.io/go.mod b/vendor/go.opencensus.io/go.mod new file mode 100644 index 00000000..cb4de80f --- /dev/null +++ b/vendor/go.opencensus.io/go.mod @@ -0,0 +1,12 @@ +module go.opencensus.io + +require ( + github.com/golang/protobuf v1.3.1 + github.com/google/go-cmp v0.3.0 + github.com/hashicorp/golang-lru v0.5.1 + golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09 + golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd // indirect + golang.org/x/text v0.3.2 // indirect + google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb // indirect + google.golang.org/grpc v1.20.1 +) diff --git a/vendor/go.opencensus.io/go.sum b/vendor/go.opencensus.io/go.sum new file mode 100644 index 00000000..0b948c2b --- /dev/null +++ b/vendor/go.opencensus.io/go.sum @@ -0,0 +1,61 @@ +cloud.google.com/go v0.26.0/go.mod h1:aQUYkXzVsufM+DwF1aE+0xfcU+56JwCaLick0ClmMTw= +github.com/BurntSushi/toml v0.3.1/go.mod h1:xHWCNGjB5oqiDr8zfno3MHue2Ht5sIBksp03qcyfWMU= +github.com/client9/misspell v0.3.4/go.mod h1:qj6jICC3Q7zFZvVWo7KLAzC3yx5G7kyvSDkc90ppPyw= +github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b h1:VKtxabqXZkF25pY9ekfRL6a582T4P37/31XEstQ5p58= +github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b/go.mod h1:SBH7ygxi8pfUlaOkMMuAQtPIUF8ecWP5IEl/CR7VP2Q= +github.com/golang/mock v1.1.1/go.mod h1:oTYuIxOrZwtPieC+H1uAHpcLFnEyAGVDL/k47Jfbm0A= +github.com/golang/protobuf v1.2.0 h1:P3YflyNX/ehuJFLhxviNdFxQPkGK5cDcApsge1SqnvM= +github.com/golang/protobuf v1.2.0/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= +github.com/golang/protobuf v1.3.1 h1:YF8+flBXS5eO826T4nzqPrxfhQThhXl0YzfuUPu4SBg= +github.com/golang/protobuf v1.3.1/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= +github.com/google/go-cmp v0.3.0 h1:crn/baboCvb5fXaQ0IJ1SGTsTVrWpDsCWC8EGETZijY= +github.com/google/go-cmp v0.3.0/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU= +github.com/hashicorp/golang-lru v0.5.1 h1:0hERBMJE1eitiLkihrMvRVBYAkpHzc/J3QdDN+dAcgU= +github.com/hashicorp/golang-lru v0.5.1/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8= +golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACkg1iLfiJU5Ep61QUkGW8qpdssI0+w= +golang.org/x/exp v0.0.0-20190121172915-509febef88a4/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA= +golang.org/x/lint v0.0.0-20181026193005-c67002cb31c3/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE= +golang.org/x/lint v0.0.0-20190227174305-5b3e6a55c961/go.mod h1:wehouNa3lNwaWXcvxsM5YxQ5yQlVC4a0KAMCusXpPoU= +golang.org/x/lint v0.0.0-20190313153728-d0100b6bd8b3/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc= +golang.org/x/net v0.0.0-20180724234803-3673e40ba225/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20180826012351-8a410e7b638d/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20190213061140-3a22650c66bd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20190311183353-d8887717615a h1:oWX7TPOiFAMXLq8o0ikBYfCJVlRHBcsciT5bXOrH628= +golang.org/x/net v0.0.0-20190311183353-d8887717615a/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= +golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09 h1:KaQtG+aDELoNmXYas3TVkGNYRuq8JQ1aa7LJt8EXVyo= +golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= +golang.org/x/oauth2 v0.0.0-20180821212333-d2e6202438be/go.mod h1:N/0e6XlmueqKjAGxoOufVs8QHGRruUQn6yWY3a++T0U= +golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f h1:wMNYb4v58l5UBM7MYRLPG6ZhfOqbKu7X5eyFl8ZhKvA= +golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20181108010431-42b317875d0f h1:Bl/8QSvNqXvPGPGXa2z5xUTmV7VDcZyvRZ+QQXkXTZQ= +golang.org/x/sync v0.0.0-20181108010431-42b317875d0f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6 h1:bjcUS9ztw9kFmmIxJInhon/0Is3p+EHBKNgquIzo1OI= +golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sys v0.0.0-20180830151530-49385e6e1522/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a h1:1BGLXjeY4akVXGgbC9HugT3Jv3hCI0z56oJR5vAMgBU= +golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd h1:r7DufRZuZbWB7j439YfAzP8RPDa9unLkpwQKUYbIMPI= +golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/text v0.3.0 h1:g61tztE5qeGQ89tm6NTjjM9VPIm088od1l6aSorWRWg= +golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= +golang.org/x/text v0.3.2 h1:tW2bmiBqwgJj/UpqtC8EpXEZVYOwU0yG4iWbprSVAcs= +golang.org/x/text v0.3.2/go.mod h1:bEr9sfX3Q8Zfm5fL9x+3itogRgK3+ptLWKqgva+5dAk= +golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20190114222345-bf090417da8b/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20190114222345-bf090417da8b/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20190226205152-f727befe758c/go.mod h1:9Yl7xja0Znq3iFh3HoIrodX9oNMXvdceNzlUR8zjMvY= +golang.org/x/tools v0.0.0-20190226205152-f727befe758c/go.mod h1:9Yl7xja0Znq3iFh3HoIrodX9oNMXvdceNzlUR8zjMvY= +golang.org/x/tools v0.0.0-20190311212946-11955173bddd/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs= +google.golang.org/appengine v1.1.0/go.mod h1:EbEs0AVv82hx2wNQdGPgUI5lhzA/G0D9YwlJXL52JkM= +google.golang.org/appengine v1.4.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4= +google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8 h1:Nw54tB0rB7hY/N0NQvRW8DG4Yk3Q6T9cu9RcFQDu1tc= +google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8/go.mod h1:JiN7NxoALGmiZfu7CAH4rXhgtRTLTxftemlI0sWmxmc= +google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb h1:i1Ppqkc3WQXikh8bXiwHqAN5Rv3/qDCcRk0/Otx73BY= +google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE= +google.golang.org/grpc v1.19.0 h1:cfg4PD8YEdSFnm7qLV4++93WcmhH2nIUhMjhdCvl3j8= +google.golang.org/grpc v1.19.0 h1:cfg4PD8YEdSFnm7qLV4++93WcmhH2nIUhMjhdCvl3j8= +google.golang.org/grpc v1.19.0/go.mod h1:mqu4LbDTu4XGKhr4mRzUsmM4RtVoemTSY81AxZiDr8c= +google.golang.org/grpc v1.19.0/go.mod h1:mqu4LbDTu4XGKhr4mRzUsmM4RtVoemTSY81AxZiDr8c= +google.golang.org/grpc v1.20.1 h1:Hz2g2wirWK7H0qIIhGIqRGTuMwTE8HEKFnDZZ7lm9NU= +google.golang.org/grpc v1.20.1/go.mod h1:10oTOabMzJvdu6/UiuZezV6QK5dSlG84ov/aaiqXj38= +honnef.co/go/tools v0.0.0-20190102054323-c2f93a96b099/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4= diff --git a/vendor/go.opencensus.io/internal/internal.go b/vendor/go.opencensus.io/internal/internal.go new file mode 100644 index 00000000..9a638781 --- /dev/null +++ b/vendor/go.opencensus.io/internal/internal.go @@ -0,0 +1,37 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package internal // import "go.opencensus.io/internal" + +import ( + "fmt" + "time" + + opencensus "go.opencensus.io" +) + +// UserAgent is the user agent to be added to the outgoing +// requests from the exporters. +var UserAgent = fmt.Sprintf("opencensus-go/%s", opencensus.Version()) + +// MonotonicEndTime returns the end time at present +// but offset from start, monotonically. +// +// The monotonic clock is used in subtractions hence +// the duration since start added back to start gives +// end as a monotonic time. +// See https://golang.org/pkg/time/#hdr-Monotonic_Clocks +func MonotonicEndTime(start time.Time) time.Time { + return start.Add(time.Now().Sub(start)) +} diff --git a/vendor/go.opencensus.io/internal/sanitize.go b/vendor/go.opencensus.io/internal/sanitize.go new file mode 100644 index 00000000..de8ccf23 --- /dev/null +++ b/vendor/go.opencensus.io/internal/sanitize.go @@ -0,0 +1,50 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package internal + +import ( + "strings" + "unicode" +) + +const labelKeySizeLimit = 100 + +// Sanitize returns a string that is trunacated to 100 characters if it's too +// long, and replaces non-alphanumeric characters to underscores. +func Sanitize(s string) string { + if len(s) == 0 { + return s + } + if len(s) > labelKeySizeLimit { + s = s[:labelKeySizeLimit] + } + s = strings.Map(sanitizeRune, s) + if unicode.IsDigit(rune(s[0])) { + s = "key_" + s + } + if s[0] == '_' { + s = "key" + s + } + return s +} + +// converts anything that is not a letter or digit to an underscore +func sanitizeRune(r rune) rune { + if unicode.IsLetter(r) || unicode.IsDigit(r) { + return r + } + // Everything else turns into an underscore + return '_' +} diff --git a/vendor/go.opencensus.io/internal/traceinternals.go b/vendor/go.opencensus.io/internal/traceinternals.go new file mode 100644 index 00000000..073af7b4 --- /dev/null +++ b/vendor/go.opencensus.io/internal/traceinternals.go @@ -0,0 +1,53 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package internal + +import ( + "time" +) + +// Trace allows internal access to some trace functionality. +// TODO(#412): remove this +var Trace interface{} + +// LocalSpanStoreEnabled true if the local span store is enabled. +var LocalSpanStoreEnabled bool + +// BucketConfiguration stores the number of samples to store for span buckets +// for successful and failed spans for a particular span name. +type BucketConfiguration struct { + Name string + MaxRequestsSucceeded int + MaxRequestsErrors int +} + +// PerMethodSummary is a summary of the spans stored for a single span name. +type PerMethodSummary struct { + Active int + LatencyBuckets []LatencyBucketSummary + ErrorBuckets []ErrorBucketSummary +} + +// LatencyBucketSummary is a summary of a latency bucket. +type LatencyBucketSummary struct { + MinLatency, MaxLatency time.Duration + Size int +} + +// ErrorBucketSummary is a summary of an error bucket. +type ErrorBucketSummary struct { + ErrorCode int32 + Size int +} diff --git a/vendor/go.opencensus.io/opencensus.go b/vendor/go.opencensus.io/opencensus.go new file mode 100644 index 00000000..626d7364 --- /dev/null +++ b/vendor/go.opencensus.io/opencensus.go @@ -0,0 +1,21 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// Package opencensus contains Go support for OpenCensus. +package opencensus // import "go.opencensus.io" + +// Version is the current release version of OpenCensus in use. +func Version() string { + return "0.22.0" +} diff --git a/vendor/go.opencensus.io/trace/basetypes.go b/vendor/go.opencensus.io/trace/basetypes.go new file mode 100644 index 00000000..0c54492a --- /dev/null +++ b/vendor/go.opencensus.io/trace/basetypes.go @@ -0,0 +1,119 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "fmt" + "time" +) + +type ( + // TraceID is a 16-byte identifier for a set of spans. + TraceID [16]byte + + // SpanID is an 8-byte identifier for a single span. + SpanID [8]byte +) + +func (t TraceID) String() string { + return fmt.Sprintf("%02x", t[:]) +} + +func (s SpanID) String() string { + return fmt.Sprintf("%02x", s[:]) +} + +// Annotation represents a text annotation with a set of attributes and a timestamp. +type Annotation struct { + Time time.Time + Message string + Attributes map[string]interface{} +} + +// Attribute represents a key-value pair on a span, link or annotation. +// Construct with one of: BoolAttribute, Int64Attribute, or StringAttribute. +type Attribute struct { + key string + value interface{} +} + +// BoolAttribute returns a bool-valued attribute. +func BoolAttribute(key string, value bool) Attribute { + return Attribute{key: key, value: value} +} + +// Int64Attribute returns an int64-valued attribute. +func Int64Attribute(key string, value int64) Attribute { + return Attribute{key: key, value: value} +} + +// Float64Attribute returns a float64-valued attribute. +func Float64Attribute(key string, value float64) Attribute { + return Attribute{key: key, value: value} +} + +// StringAttribute returns a string-valued attribute. +func StringAttribute(key string, value string) Attribute { + return Attribute{key: key, value: value} +} + +// LinkType specifies the relationship between the span that had the link +// added, and the linked span. +type LinkType int32 + +// LinkType values. +const ( + LinkTypeUnspecified LinkType = iota // The relationship of the two spans is unknown. + LinkTypeChild // The linked span is a child of the current span. + LinkTypeParent // The linked span is the parent of the current span. +) + +// Link represents a reference from one span to another span. +type Link struct { + TraceID TraceID + SpanID SpanID + Type LinkType + // Attributes is a set of attributes on the link. + Attributes map[string]interface{} +} + +// MessageEventType specifies the type of message event. +type MessageEventType int32 + +// MessageEventType values. +const ( + MessageEventTypeUnspecified MessageEventType = iota // Unknown event type. + MessageEventTypeSent // Indicates a sent RPC message. + MessageEventTypeRecv // Indicates a received RPC message. +) + +// MessageEvent represents an event describing a message sent or received on the network. +type MessageEvent struct { + Time time.Time + EventType MessageEventType + MessageID int64 + UncompressedByteSize int64 + CompressedByteSize int64 +} + +// Status is the status of a Span. +type Status struct { + // Code is a status code. Zero indicates success. + // + // If Code will be propagated to Google APIs, it ideally should be a value from + // https://github.com/googleapis/googleapis/blob/master/google/rpc/code.proto . + Code int32 + Message string +} diff --git a/vendor/go.opencensus.io/trace/config.go b/vendor/go.opencensus.io/trace/config.go new file mode 100644 index 00000000..775f8274 --- /dev/null +++ b/vendor/go.opencensus.io/trace/config.go @@ -0,0 +1,86 @@ +// Copyright 2018, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "sync" + + "go.opencensus.io/trace/internal" +) + +// Config represents the global tracing configuration. +type Config struct { + // DefaultSampler is the default sampler used when creating new spans. + DefaultSampler Sampler + + // IDGenerator is for internal use only. + IDGenerator internal.IDGenerator + + // MaxAnnotationEventsPerSpan is max number of annotation events per span + MaxAnnotationEventsPerSpan int + + // MaxMessageEventsPerSpan is max number of message events per span + MaxMessageEventsPerSpan int + + // MaxAnnotationEventsPerSpan is max number of attributes per span + MaxAttributesPerSpan int + + // MaxLinksPerSpan is max number of links per span + MaxLinksPerSpan int +} + +var configWriteMu sync.Mutex + +const ( + // DefaultMaxAnnotationEventsPerSpan is default max number of annotation events per span + DefaultMaxAnnotationEventsPerSpan = 32 + + // DefaultMaxMessageEventsPerSpan is default max number of message events per span + DefaultMaxMessageEventsPerSpan = 128 + + // DefaultMaxAttributesPerSpan is default max number of attributes per span + DefaultMaxAttributesPerSpan = 32 + + // DefaultMaxLinksPerSpan is default max number of links per span + DefaultMaxLinksPerSpan = 32 +) + +// ApplyConfig applies changes to the global tracing configuration. +// +// Fields not provided in the given config are going to be preserved. +func ApplyConfig(cfg Config) { + configWriteMu.Lock() + defer configWriteMu.Unlock() + c := *config.Load().(*Config) + if cfg.DefaultSampler != nil { + c.DefaultSampler = cfg.DefaultSampler + } + if cfg.IDGenerator != nil { + c.IDGenerator = cfg.IDGenerator + } + if cfg.MaxAnnotationEventsPerSpan > 0 { + c.MaxAnnotationEventsPerSpan = cfg.MaxAnnotationEventsPerSpan + } + if cfg.MaxMessageEventsPerSpan > 0 { + c.MaxMessageEventsPerSpan = cfg.MaxMessageEventsPerSpan + } + if cfg.MaxAttributesPerSpan > 0 { + c.MaxAttributesPerSpan = cfg.MaxAttributesPerSpan + } + if cfg.MaxLinksPerSpan > 0 { + c.MaxLinksPerSpan = cfg.MaxLinksPerSpan + } + config.Store(&c) +} diff --git a/vendor/go.opencensus.io/trace/doc.go b/vendor/go.opencensus.io/trace/doc.go new file mode 100644 index 00000000..04b1ee4f --- /dev/null +++ b/vendor/go.opencensus.io/trace/doc.go @@ -0,0 +1,53 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +/* +Package trace contains support for OpenCensus distributed tracing. + +The following assumes a basic familiarity with OpenCensus concepts. +See http://opencensus.io + + +Exporting Traces + +To export collected tracing data, register at least one exporter. You can use +one of the provided exporters or write your own. + + trace.RegisterExporter(exporter) + +By default, traces will be sampled relatively rarely. To change the sampling +frequency for your entire program, call ApplyConfig. Use a ProbabilitySampler +to sample a subset of traces, or use AlwaysSample to collect a trace on every run: + + trace.ApplyConfig(trace.Config{DefaultSampler: trace.AlwaysSample()}) + +Be careful about using trace.AlwaysSample in a production application with +significant traffic: a new trace will be started and exported for every request. + +Adding Spans to a Trace + +A trace consists of a tree of spans. In Go, the current span is carried in a +context.Context. + +It is common to want to capture all the activity of a function call in a span. For +this to work, the function must take a context.Context as a parameter. Add these two +lines to the top of the function: + + ctx, span := trace.StartSpan(ctx, "example.com/Run") + defer span.End() + +StartSpan will create a new top-level span if the context +doesn't contain another span, otherwise it will create a child span. +*/ +package trace // import "go.opencensus.io/trace" diff --git a/vendor/go.opencensus.io/trace/evictedqueue.go b/vendor/go.opencensus.io/trace/evictedqueue.go new file mode 100644 index 00000000..ffc264f2 --- /dev/null +++ b/vendor/go.opencensus.io/trace/evictedqueue.go @@ -0,0 +1,38 @@ +// Copyright 2019, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +type evictedQueue struct { + queue []interface{} + capacity int + droppedCount int +} + +func newEvictedQueue(capacity int) *evictedQueue { + eq := &evictedQueue{ + capacity: capacity, + queue: make([]interface{}, 0), + } + + return eq +} + +func (eq *evictedQueue) add(value interface{}) { + if len(eq.queue) == eq.capacity { + eq.queue = eq.queue[1:] + eq.droppedCount++ + } + eq.queue = append(eq.queue, value) +} diff --git a/vendor/go.opencensus.io/trace/export.go b/vendor/go.opencensus.io/trace/export.go new file mode 100644 index 00000000..e0d9a4b9 --- /dev/null +++ b/vendor/go.opencensus.io/trace/export.go @@ -0,0 +1,97 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "sync" + "sync/atomic" + "time" +) + +// Exporter is a type for functions that receive sampled trace spans. +// +// The ExportSpan method should be safe for concurrent use and should return +// quickly; if an Exporter takes a significant amount of time to process a +// SpanData, that work should be done on another goroutine. +// +// The SpanData should not be modified, but a pointer to it can be kept. +type Exporter interface { + ExportSpan(s *SpanData) +} + +type exportersMap map[Exporter]struct{} + +var ( + exporterMu sync.Mutex + exporters atomic.Value +) + +// RegisterExporter adds to the list of Exporters that will receive sampled +// trace spans. +// +// Binaries can register exporters, libraries shouldn't register exporters. +func RegisterExporter(e Exporter) { + exporterMu.Lock() + new := make(exportersMap) + if old, ok := exporters.Load().(exportersMap); ok { + for k, v := range old { + new[k] = v + } + } + new[e] = struct{}{} + exporters.Store(new) + exporterMu.Unlock() +} + +// UnregisterExporter removes from the list of Exporters the Exporter that was +// registered with the given name. +func UnregisterExporter(e Exporter) { + exporterMu.Lock() + new := make(exportersMap) + if old, ok := exporters.Load().(exportersMap); ok { + for k, v := range old { + new[k] = v + } + } + delete(new, e) + exporters.Store(new) + exporterMu.Unlock() +} + +// SpanData contains all the information collected by a Span. +type SpanData struct { + SpanContext + ParentSpanID SpanID + SpanKind int + Name string + StartTime time.Time + // The wall clock time of EndTime will be adjusted to always be offset + // from StartTime by the duration of the span. + EndTime time.Time + // The values of Attributes each have type string, bool, or int64. + Attributes map[string]interface{} + Annotations []Annotation + MessageEvents []MessageEvent + Status + Links []Link + HasRemoteParent bool + DroppedAttributeCount int + DroppedAnnotationCount int + DroppedMessageEventCount int + DroppedLinkCount int + + // ChildSpanCount holds the number of child span created for this span. + ChildSpanCount int +} diff --git a/vendor/go.opencensus.io/trace/internal/internal.go b/vendor/go.opencensus.io/trace/internal/internal.go new file mode 100644 index 00000000..7e808d8f --- /dev/null +++ b/vendor/go.opencensus.io/trace/internal/internal.go @@ -0,0 +1,22 @@ +// Copyright 2018, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// Package internal provides trace internals. +package internal + +// IDGenerator allows custom generators for TraceId and SpanId. +type IDGenerator interface { + NewTraceID() [16]byte + NewSpanID() [8]byte +} diff --git a/vendor/go.opencensus.io/trace/lrumap.go b/vendor/go.opencensus.io/trace/lrumap.go new file mode 100644 index 00000000..3f80a336 --- /dev/null +++ b/vendor/go.opencensus.io/trace/lrumap.go @@ -0,0 +1,37 @@ +// Copyright 2019, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "github.com/hashicorp/golang-lru/simplelru" +) + +type lruMap struct { + simpleLruMap *simplelru.LRU + droppedCount int +} + +func newLruMap(size int) *lruMap { + lm := &lruMap{} + lm.simpleLruMap, _ = simplelru.NewLRU(size, nil) + return lm +} + +func (lm *lruMap) add(key, value interface{}) { + evicted := lm.simpleLruMap.Add(key, value) + if evicted { + lm.droppedCount++ + } +} diff --git a/vendor/go.opencensus.io/trace/sampling.go b/vendor/go.opencensus.io/trace/sampling.go new file mode 100644 index 00000000..71c10f9e --- /dev/null +++ b/vendor/go.opencensus.io/trace/sampling.go @@ -0,0 +1,75 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "encoding/binary" +) + +const defaultSamplingProbability = 1e-4 + +// Sampler decides whether a trace should be sampled and exported. +type Sampler func(SamplingParameters) SamplingDecision + +// SamplingParameters contains the values passed to a Sampler. +type SamplingParameters struct { + ParentContext SpanContext + TraceID TraceID + SpanID SpanID + Name string + HasRemoteParent bool +} + +// SamplingDecision is the value returned by a Sampler. +type SamplingDecision struct { + Sample bool +} + +// ProbabilitySampler returns a Sampler that samples a given fraction of traces. +// +// It also samples spans whose parents are sampled. +func ProbabilitySampler(fraction float64) Sampler { + if !(fraction >= 0) { + fraction = 0 + } else if fraction >= 1 { + return AlwaysSample() + } + + traceIDUpperBound := uint64(fraction * (1 << 63)) + return Sampler(func(p SamplingParameters) SamplingDecision { + if p.ParentContext.IsSampled() { + return SamplingDecision{Sample: true} + } + x := binary.BigEndian.Uint64(p.TraceID[0:8]) >> 1 + return SamplingDecision{Sample: x < traceIDUpperBound} + }) +} + +// AlwaysSample returns a Sampler that samples every trace. +// Be careful about using this sampler in a production application with +// significant traffic: a new trace will be started and exported for every +// request. +func AlwaysSample() Sampler { + return func(p SamplingParameters) SamplingDecision { + return SamplingDecision{Sample: true} + } +} + +// NeverSample returns a Sampler that samples no traces. +func NeverSample() Sampler { + return func(p SamplingParameters) SamplingDecision { + return SamplingDecision{Sample: false} + } +} diff --git a/vendor/go.opencensus.io/trace/spanbucket.go b/vendor/go.opencensus.io/trace/spanbucket.go new file mode 100644 index 00000000..fbabad34 --- /dev/null +++ b/vendor/go.opencensus.io/trace/spanbucket.go @@ -0,0 +1,130 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "time" +) + +// samplePeriod is the minimum time between accepting spans in a single bucket. +const samplePeriod = time.Second + +// defaultLatencies contains the default latency bucket bounds. +// TODO: consider defaults, make configurable +var defaultLatencies = [...]time.Duration{ + 10 * time.Microsecond, + 100 * time.Microsecond, + time.Millisecond, + 10 * time.Millisecond, + 100 * time.Millisecond, + time.Second, + 10 * time.Second, + time.Minute, +} + +// bucket is a container for a set of spans for a particular error code or latency range. +type bucket struct { + nextTime time.Time // next time we can accept a span + buffer []*SpanData // circular buffer of spans + nextIndex int // location next SpanData should be placed in buffer + overflow bool // whether the circular buffer has wrapped around +} + +func makeBucket(bufferSize int) bucket { + return bucket{ + buffer: make([]*SpanData, bufferSize), + } +} + +// add adds a span to the bucket, if nextTime has been reached. +func (b *bucket) add(s *SpanData) { + if s.EndTime.Before(b.nextTime) { + return + } + if len(b.buffer) == 0 { + return + } + b.nextTime = s.EndTime.Add(samplePeriod) + b.buffer[b.nextIndex] = s + b.nextIndex++ + if b.nextIndex == len(b.buffer) { + b.nextIndex = 0 + b.overflow = true + } +} + +// size returns the number of spans in the bucket. +func (b *bucket) size() int { + if b.overflow { + return len(b.buffer) + } + return b.nextIndex +} + +// span returns the ith span in the bucket. +func (b *bucket) span(i int) *SpanData { + if !b.overflow { + return b.buffer[i] + } + if i < len(b.buffer)-b.nextIndex { + return b.buffer[b.nextIndex+i] + } + return b.buffer[b.nextIndex+i-len(b.buffer)] +} + +// resize changes the size of the bucket to n, keeping up to n existing spans. +func (b *bucket) resize(n int) { + cur := b.size() + newBuffer := make([]*SpanData, n) + if cur < n { + for i := 0; i < cur; i++ { + newBuffer[i] = b.span(i) + } + b.buffer = newBuffer + b.nextIndex = cur + b.overflow = false + return + } + for i := 0; i < n; i++ { + newBuffer[i] = b.span(i + cur - n) + } + b.buffer = newBuffer + b.nextIndex = 0 + b.overflow = true +} + +// latencyBucket returns the appropriate bucket number for a given latency. +func latencyBucket(latency time.Duration) int { + i := 0 + for i < len(defaultLatencies) && latency >= defaultLatencies[i] { + i++ + } + return i +} + +// latencyBucketBounds returns the lower and upper bounds for a latency bucket +// number. +// +// The lower bound is inclusive, the upper bound is exclusive (except for the +// last bucket.) +func latencyBucketBounds(index int) (lower time.Duration, upper time.Duration) { + if index == 0 { + return 0, defaultLatencies[index] + } + if index == len(defaultLatencies) { + return defaultLatencies[index-1], 1<<63 - 1 + } + return defaultLatencies[index-1], defaultLatencies[index] +} diff --git a/vendor/go.opencensus.io/trace/spanstore.go b/vendor/go.opencensus.io/trace/spanstore.go new file mode 100644 index 00000000..c442d990 --- /dev/null +++ b/vendor/go.opencensus.io/trace/spanstore.go @@ -0,0 +1,306 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "sync" + "time" + + "go.opencensus.io/internal" +) + +const ( + maxBucketSize = 100000 + defaultBucketSize = 10 +) + +var ( + ssmu sync.RWMutex // protects spanStores + spanStores = make(map[string]*spanStore) +) + +// This exists purely to avoid exposing internal methods used by z-Pages externally. +type internalOnly struct{} + +func init() { + //TODO(#412): remove + internal.Trace = &internalOnly{} +} + +// ReportActiveSpans returns the active spans for the given name. +func (i internalOnly) ReportActiveSpans(name string) []*SpanData { + s := spanStoreForName(name) + if s == nil { + return nil + } + var out []*SpanData + s.mu.Lock() + defer s.mu.Unlock() + for span := range s.active { + out = append(out, span.makeSpanData()) + } + return out +} + +// ReportSpansByError returns a sample of error spans. +// +// If code is nonzero, only spans with that status code are returned. +func (i internalOnly) ReportSpansByError(name string, code int32) []*SpanData { + s := spanStoreForName(name) + if s == nil { + return nil + } + var out []*SpanData + s.mu.Lock() + defer s.mu.Unlock() + if code != 0 { + if b, ok := s.errors[code]; ok { + for _, sd := range b.buffer { + if sd == nil { + break + } + out = append(out, sd) + } + } + } else { + for _, b := range s.errors { + for _, sd := range b.buffer { + if sd == nil { + break + } + out = append(out, sd) + } + } + } + return out +} + +// ConfigureBucketSizes sets the number of spans to keep per latency and error +// bucket for different span names. +func (i internalOnly) ConfigureBucketSizes(bcs []internal.BucketConfiguration) { + for _, bc := range bcs { + latencyBucketSize := bc.MaxRequestsSucceeded + if latencyBucketSize < 0 { + latencyBucketSize = 0 + } + if latencyBucketSize > maxBucketSize { + latencyBucketSize = maxBucketSize + } + errorBucketSize := bc.MaxRequestsErrors + if errorBucketSize < 0 { + errorBucketSize = 0 + } + if errorBucketSize > maxBucketSize { + errorBucketSize = maxBucketSize + } + spanStoreSetSize(bc.Name, latencyBucketSize, errorBucketSize) + } +} + +// ReportSpansPerMethod returns a summary of what spans are being stored for each span name. +func (i internalOnly) ReportSpansPerMethod() map[string]internal.PerMethodSummary { + out := make(map[string]internal.PerMethodSummary) + ssmu.RLock() + defer ssmu.RUnlock() + for name, s := range spanStores { + s.mu.Lock() + p := internal.PerMethodSummary{ + Active: len(s.active), + } + for code, b := range s.errors { + p.ErrorBuckets = append(p.ErrorBuckets, internal.ErrorBucketSummary{ + ErrorCode: code, + Size: b.size(), + }) + } + for i, b := range s.latency { + min, max := latencyBucketBounds(i) + p.LatencyBuckets = append(p.LatencyBuckets, internal.LatencyBucketSummary{ + MinLatency: min, + MaxLatency: max, + Size: b.size(), + }) + } + s.mu.Unlock() + out[name] = p + } + return out +} + +// ReportSpansByLatency returns a sample of successful spans. +// +// minLatency is the minimum latency of spans to be returned. +// maxLatency, if nonzero, is the maximum latency of spans to be returned. +func (i internalOnly) ReportSpansByLatency(name string, minLatency, maxLatency time.Duration) []*SpanData { + s := spanStoreForName(name) + if s == nil { + return nil + } + var out []*SpanData + s.mu.Lock() + defer s.mu.Unlock() + for i, b := range s.latency { + min, max := latencyBucketBounds(i) + if i+1 != len(s.latency) && max <= minLatency { + continue + } + if maxLatency != 0 && maxLatency < min { + continue + } + for _, sd := range b.buffer { + if sd == nil { + break + } + if minLatency != 0 || maxLatency != 0 { + d := sd.EndTime.Sub(sd.StartTime) + if d < minLatency { + continue + } + if maxLatency != 0 && d > maxLatency { + continue + } + } + out = append(out, sd) + } + } + return out +} + +// spanStore keeps track of spans stored for a particular span name. +// +// It contains all active spans; a sample of spans for failed requests, +// categorized by error code; and a sample of spans for successful requests, +// bucketed by latency. +type spanStore struct { + mu sync.Mutex // protects everything below. + active map[*Span]struct{} + errors map[int32]*bucket + latency []bucket + maxSpansPerErrorBucket int +} + +// newSpanStore creates a span store. +func newSpanStore(name string, latencyBucketSize int, errorBucketSize int) *spanStore { + s := &spanStore{ + active: make(map[*Span]struct{}), + latency: make([]bucket, len(defaultLatencies)+1), + maxSpansPerErrorBucket: errorBucketSize, + } + for i := range s.latency { + s.latency[i] = makeBucket(latencyBucketSize) + } + return s +} + +// spanStoreForName returns the spanStore for the given name. +// +// It returns nil if it doesn't exist. +func spanStoreForName(name string) *spanStore { + var s *spanStore + ssmu.RLock() + s, _ = spanStores[name] + ssmu.RUnlock() + return s +} + +// spanStoreForNameCreateIfNew returns the spanStore for the given name. +// +// It creates it if it didn't exist. +func spanStoreForNameCreateIfNew(name string) *spanStore { + ssmu.RLock() + s, ok := spanStores[name] + ssmu.RUnlock() + if ok { + return s + } + ssmu.Lock() + defer ssmu.Unlock() + s, ok = spanStores[name] + if ok { + return s + } + s = newSpanStore(name, defaultBucketSize, defaultBucketSize) + spanStores[name] = s + return s +} + +// spanStoreSetSize resizes the spanStore for the given name. +// +// It creates it if it didn't exist. +func spanStoreSetSize(name string, latencyBucketSize int, errorBucketSize int) { + ssmu.RLock() + s, ok := spanStores[name] + ssmu.RUnlock() + if ok { + s.resize(latencyBucketSize, errorBucketSize) + return + } + ssmu.Lock() + defer ssmu.Unlock() + s, ok = spanStores[name] + if ok { + s.resize(latencyBucketSize, errorBucketSize) + return + } + s = newSpanStore(name, latencyBucketSize, errorBucketSize) + spanStores[name] = s +} + +func (s *spanStore) resize(latencyBucketSize int, errorBucketSize int) { + s.mu.Lock() + for i := range s.latency { + s.latency[i].resize(latencyBucketSize) + } + for _, b := range s.errors { + b.resize(errorBucketSize) + } + s.maxSpansPerErrorBucket = errorBucketSize + s.mu.Unlock() +} + +// add adds a span to the active bucket of the spanStore. +func (s *spanStore) add(span *Span) { + s.mu.Lock() + s.active[span] = struct{}{} + s.mu.Unlock() +} + +// finished removes a span from the active set, and adds a corresponding +// SpanData to a latency or error bucket. +func (s *spanStore) finished(span *Span, sd *SpanData) { + latency := sd.EndTime.Sub(sd.StartTime) + if latency < 0 { + latency = 0 + } + code := sd.Status.Code + + s.mu.Lock() + delete(s.active, span) + if code == 0 { + s.latency[latencyBucket(latency)].add(sd) + } else { + if s.errors == nil { + s.errors = make(map[int32]*bucket) + } + if b := s.errors[code]; b != nil { + b.add(sd) + } else { + b := makeBucket(s.maxSpansPerErrorBucket) + s.errors[code] = &b + b.add(sd) + } + } + s.mu.Unlock() +} diff --git a/vendor/go.opencensus.io/trace/status_codes.go b/vendor/go.opencensus.io/trace/status_codes.go new file mode 100644 index 00000000..ec60effd --- /dev/null +++ b/vendor/go.opencensus.io/trace/status_codes.go @@ -0,0 +1,37 @@ +// Copyright 2018, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +// Status codes for use with Span.SetStatus. These correspond to the status +// codes used by gRPC defined here: https://github.com/googleapis/googleapis/blob/master/google/rpc/code.proto +const ( + StatusCodeOK = 0 + StatusCodeCancelled = 1 + StatusCodeUnknown = 2 + StatusCodeInvalidArgument = 3 + StatusCodeDeadlineExceeded = 4 + StatusCodeNotFound = 5 + StatusCodeAlreadyExists = 6 + StatusCodePermissionDenied = 7 + StatusCodeResourceExhausted = 8 + StatusCodeFailedPrecondition = 9 + StatusCodeAborted = 10 + StatusCodeOutOfRange = 11 + StatusCodeUnimplemented = 12 + StatusCodeInternal = 13 + StatusCodeUnavailable = 14 + StatusCodeDataLoss = 15 + StatusCodeUnauthenticated = 16 +) diff --git a/vendor/go.opencensus.io/trace/trace.go b/vendor/go.opencensus.io/trace/trace.go new file mode 100644 index 00000000..38ead7bf --- /dev/null +++ b/vendor/go.opencensus.io/trace/trace.go @@ -0,0 +1,598 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "context" + crand "crypto/rand" + "encoding/binary" + "fmt" + "math/rand" + "sync" + "sync/atomic" + "time" + + "go.opencensus.io/internal" + "go.opencensus.io/trace/tracestate" +) + +// Span represents a span of a trace. It has an associated SpanContext, and +// stores data accumulated while the span is active. +// +// Ideally users should interact with Spans by calling the functions in this +// package that take a Context parameter. +type Span struct { + // data contains information recorded about the span. + // + // It will be non-nil if we are exporting the span or recording events for it. + // Otherwise, data is nil, and the Span is simply a carrier for the + // SpanContext, so that the trace ID is propagated. + data *SpanData + mu sync.Mutex // protects the contents of *data (but not the pointer value.) + spanContext SpanContext + + // lruAttributes are capped at configured limit. When the capacity is reached an oldest entry + // is removed to create room for a new entry. + lruAttributes *lruMap + + // annotations are stored in FIFO queue capped by configured limit. + annotations *evictedQueue + + // messageEvents are stored in FIFO queue capped by configured limit. + messageEvents *evictedQueue + + // links are stored in FIFO queue capped by configured limit. + links *evictedQueue + + // spanStore is the spanStore this span belongs to, if any, otherwise it is nil. + *spanStore + endOnce sync.Once + + executionTracerTaskEnd func() // ends the execution tracer span +} + +// IsRecordingEvents returns true if events are being recorded for this span. +// Use this check to avoid computing expensive annotations when they will never +// be used. +func (s *Span) IsRecordingEvents() bool { + if s == nil { + return false + } + return s.data != nil +} + +// TraceOptions contains options associated with a trace span. +type TraceOptions uint32 + +// IsSampled returns true if the span will be exported. +func (sc SpanContext) IsSampled() bool { + return sc.TraceOptions.IsSampled() +} + +// setIsSampled sets the TraceOptions bit that determines whether the span will be exported. +func (sc *SpanContext) setIsSampled(sampled bool) { + if sampled { + sc.TraceOptions |= 1 + } else { + sc.TraceOptions &= ^TraceOptions(1) + } +} + +// IsSampled returns true if the span will be exported. +func (t TraceOptions) IsSampled() bool { + return t&1 == 1 +} + +// SpanContext contains the state that must propagate across process boundaries. +// +// SpanContext is not an implementation of context.Context. +// TODO: add reference to external Census docs for SpanContext. +type SpanContext struct { + TraceID TraceID + SpanID SpanID + TraceOptions TraceOptions + Tracestate *tracestate.Tracestate +} + +type contextKey struct{} + +// FromContext returns the Span stored in a context, or nil if there isn't one. +func FromContext(ctx context.Context) *Span { + s, _ := ctx.Value(contextKey{}).(*Span) + return s +} + +// NewContext returns a new context with the given Span attached. +func NewContext(parent context.Context, s *Span) context.Context { + return context.WithValue(parent, contextKey{}, s) +} + +// All available span kinds. Span kind must be either one of these values. +const ( + SpanKindUnspecified = iota + SpanKindServer + SpanKindClient +) + +// StartOptions contains options concerning how a span is started. +type StartOptions struct { + // Sampler to consult for this Span. If provided, it is always consulted. + // + // If not provided, then the behavior differs based on whether + // the parent of this Span is remote, local, or there is no parent. + // In the case of a remote parent or no parent, the + // default sampler (see Config) will be consulted. Otherwise, + // when there is a non-remote parent, no new sampling decision will be made: + // we will preserve the sampling of the parent. + Sampler Sampler + + // SpanKind represents the kind of a span. If none is set, + // SpanKindUnspecified is used. + SpanKind int +} + +// StartOption apply changes to StartOptions. +type StartOption func(*StartOptions) + +// WithSpanKind makes new spans to be created with the given kind. +func WithSpanKind(spanKind int) StartOption { + return func(o *StartOptions) { + o.SpanKind = spanKind + } +} + +// WithSampler makes new spans to be be created with a custom sampler. +// Otherwise, the global sampler is used. +func WithSampler(sampler Sampler) StartOption { + return func(o *StartOptions) { + o.Sampler = sampler + } +} + +// StartSpan starts a new child span of the current span in the context. If +// there is no span in the context, creates a new trace and span. +// +// Returned context contains the newly created span. You can use it to +// propagate the returned span in process. +func StartSpan(ctx context.Context, name string, o ...StartOption) (context.Context, *Span) { + var opts StartOptions + var parent SpanContext + if p := FromContext(ctx); p != nil { + p.addChild() + parent = p.spanContext + } + for _, op := range o { + op(&opts) + } + span := startSpanInternal(name, parent != SpanContext{}, parent, false, opts) + + ctx, end := startExecutionTracerTask(ctx, name) + span.executionTracerTaskEnd = end + return NewContext(ctx, span), span +} + +// StartSpanWithRemoteParent starts a new child span of the span from the given parent. +// +// If the incoming context contains a parent, it ignores. StartSpanWithRemoteParent is +// preferred for cases where the parent is propagated via an incoming request. +// +// Returned context contains the newly created span. You can use it to +// propagate the returned span in process. +func StartSpanWithRemoteParent(ctx context.Context, name string, parent SpanContext, o ...StartOption) (context.Context, *Span) { + var opts StartOptions + for _, op := range o { + op(&opts) + } + span := startSpanInternal(name, parent != SpanContext{}, parent, true, opts) + ctx, end := startExecutionTracerTask(ctx, name) + span.executionTracerTaskEnd = end + return NewContext(ctx, span), span +} + +func startSpanInternal(name string, hasParent bool, parent SpanContext, remoteParent bool, o StartOptions) *Span { + span := &Span{} + span.spanContext = parent + + cfg := config.Load().(*Config) + + if !hasParent { + span.spanContext.TraceID = cfg.IDGenerator.NewTraceID() + } + span.spanContext.SpanID = cfg.IDGenerator.NewSpanID() + sampler := cfg.DefaultSampler + + if !hasParent || remoteParent || o.Sampler != nil { + // If this span is the child of a local span and no Sampler is set in the + // options, keep the parent's TraceOptions. + // + // Otherwise, consult the Sampler in the options if it is non-nil, otherwise + // the default sampler. + if o.Sampler != nil { + sampler = o.Sampler + } + span.spanContext.setIsSampled(sampler(SamplingParameters{ + ParentContext: parent, + TraceID: span.spanContext.TraceID, + SpanID: span.spanContext.SpanID, + Name: name, + HasRemoteParent: remoteParent}).Sample) + } + + if !internal.LocalSpanStoreEnabled && !span.spanContext.IsSampled() { + return span + } + + span.data = &SpanData{ + SpanContext: span.spanContext, + StartTime: time.Now(), + SpanKind: o.SpanKind, + Name: name, + HasRemoteParent: remoteParent, + } + span.lruAttributes = newLruMap(cfg.MaxAttributesPerSpan) + span.annotations = newEvictedQueue(cfg.MaxAnnotationEventsPerSpan) + span.messageEvents = newEvictedQueue(cfg.MaxMessageEventsPerSpan) + span.links = newEvictedQueue(cfg.MaxLinksPerSpan) + + if hasParent { + span.data.ParentSpanID = parent.SpanID + } + if internal.LocalSpanStoreEnabled { + var ss *spanStore + ss = spanStoreForNameCreateIfNew(name) + if ss != nil { + span.spanStore = ss + ss.add(span) + } + } + + return span +} + +// End ends the span. +func (s *Span) End() { + if s == nil { + return + } + if s.executionTracerTaskEnd != nil { + s.executionTracerTaskEnd() + } + if !s.IsRecordingEvents() { + return + } + s.endOnce.Do(func() { + exp, _ := exporters.Load().(exportersMap) + mustExport := s.spanContext.IsSampled() && len(exp) > 0 + if s.spanStore != nil || mustExport { + sd := s.makeSpanData() + sd.EndTime = internal.MonotonicEndTime(sd.StartTime) + if s.spanStore != nil { + s.spanStore.finished(s, sd) + } + if mustExport { + for e := range exp { + e.ExportSpan(sd) + } + } + } + }) +} + +// makeSpanData produces a SpanData representing the current state of the Span. +// It requires that s.data is non-nil. +func (s *Span) makeSpanData() *SpanData { + var sd SpanData + s.mu.Lock() + sd = *s.data + if s.lruAttributes.simpleLruMap.Len() > 0 { + sd.Attributes = s.lruAttributesToAttributeMap() + sd.DroppedAttributeCount = s.lruAttributes.droppedCount + } + if len(s.annotations.queue) > 0 { + sd.Annotations = s.interfaceArrayToAnnotationArray() + sd.DroppedAnnotationCount = s.annotations.droppedCount + } + if len(s.messageEvents.queue) > 0 { + sd.MessageEvents = s.interfaceArrayToMessageEventArray() + sd.DroppedMessageEventCount = s.messageEvents.droppedCount + } + if len(s.links.queue) > 0 { + sd.Links = s.interfaceArrayToLinksArray() + sd.DroppedLinkCount = s.links.droppedCount + } + s.mu.Unlock() + return &sd +} + +// SpanContext returns the SpanContext of the span. +func (s *Span) SpanContext() SpanContext { + if s == nil { + return SpanContext{} + } + return s.spanContext +} + +// SetName sets the name of the span, if it is recording events. +func (s *Span) SetName(name string) { + if !s.IsRecordingEvents() { + return + } + s.mu.Lock() + s.data.Name = name + s.mu.Unlock() +} + +// SetStatus sets the status of the span, if it is recording events. +func (s *Span) SetStatus(status Status) { + if !s.IsRecordingEvents() { + return + } + s.mu.Lock() + s.data.Status = status + s.mu.Unlock() +} + +func (s *Span) interfaceArrayToLinksArray() []Link { + linksArr := make([]Link, 0) + for _, value := range s.links.queue { + linksArr = append(linksArr, value.(Link)) + } + return linksArr +} + +func (s *Span) interfaceArrayToMessageEventArray() []MessageEvent { + messageEventArr := make([]MessageEvent, 0) + for _, value := range s.messageEvents.queue { + messageEventArr = append(messageEventArr, value.(MessageEvent)) + } + return messageEventArr +} + +func (s *Span) interfaceArrayToAnnotationArray() []Annotation { + annotationArr := make([]Annotation, 0) + for _, value := range s.annotations.queue { + annotationArr = append(annotationArr, value.(Annotation)) + } + return annotationArr +} + +func (s *Span) lruAttributesToAttributeMap() map[string]interface{} { + attributes := make(map[string]interface{}) + for _, key := range s.lruAttributes.simpleLruMap.Keys() { + value, ok := s.lruAttributes.simpleLruMap.Get(key) + if ok { + keyStr := key.(string) + attributes[keyStr] = value + } + } + return attributes +} + +func (s *Span) copyToCappedAttributes(attributes []Attribute) { + for _, a := range attributes { + s.lruAttributes.add(a.key, a.value) + } +} + +func (s *Span) addChild() { + if !s.IsRecordingEvents() { + return + } + s.mu.Lock() + s.data.ChildSpanCount++ + s.mu.Unlock() +} + +// AddAttributes sets attributes in the span. +// +// Existing attributes whose keys appear in the attributes parameter are overwritten. +func (s *Span) AddAttributes(attributes ...Attribute) { + if !s.IsRecordingEvents() { + return + } + s.mu.Lock() + s.copyToCappedAttributes(attributes) + s.mu.Unlock() +} + +// copyAttributes copies a slice of Attributes into a map. +func copyAttributes(m map[string]interface{}, attributes []Attribute) { + for _, a := range attributes { + m[a.key] = a.value + } +} + +func (s *Span) lazyPrintfInternal(attributes []Attribute, format string, a ...interface{}) { + now := time.Now() + msg := fmt.Sprintf(format, a...) + var m map[string]interface{} + s.mu.Lock() + if len(attributes) != 0 { + m = make(map[string]interface{}) + copyAttributes(m, attributes) + } + s.annotations.add(Annotation{ + Time: now, + Message: msg, + Attributes: m, + }) + s.mu.Unlock() +} + +func (s *Span) printStringInternal(attributes []Attribute, str string) { + now := time.Now() + var a map[string]interface{} + s.mu.Lock() + if len(attributes) != 0 { + a = make(map[string]interface{}) + copyAttributes(a, attributes) + } + s.annotations.add(Annotation{ + Time: now, + Message: str, + Attributes: a, + }) + s.mu.Unlock() +} + +// Annotate adds an annotation with attributes. +// Attributes can be nil. +func (s *Span) Annotate(attributes []Attribute, str string) { + if !s.IsRecordingEvents() { + return + } + s.printStringInternal(attributes, str) +} + +// Annotatef adds an annotation with attributes. +func (s *Span) Annotatef(attributes []Attribute, format string, a ...interface{}) { + if !s.IsRecordingEvents() { + return + } + s.lazyPrintfInternal(attributes, format, a...) +} + +// AddMessageSendEvent adds a message send event to the span. +// +// messageID is an identifier for the message, which is recommended to be +// unique in this span and the same between the send event and the receive +// event (this allows to identify a message between the sender and receiver). +// For example, this could be a sequence id. +func (s *Span) AddMessageSendEvent(messageID, uncompressedByteSize, compressedByteSize int64) { + if !s.IsRecordingEvents() { + return + } + now := time.Now() + s.mu.Lock() + s.messageEvents.add(MessageEvent{ + Time: now, + EventType: MessageEventTypeSent, + MessageID: messageID, + UncompressedByteSize: uncompressedByteSize, + CompressedByteSize: compressedByteSize, + }) + s.mu.Unlock() +} + +// AddMessageReceiveEvent adds a message receive event to the span. +// +// messageID is an identifier for the message, which is recommended to be +// unique in this span and the same between the send event and the receive +// event (this allows to identify a message between the sender and receiver). +// For example, this could be a sequence id. +func (s *Span) AddMessageReceiveEvent(messageID, uncompressedByteSize, compressedByteSize int64) { + if !s.IsRecordingEvents() { + return + } + now := time.Now() + s.mu.Lock() + s.messageEvents.add(MessageEvent{ + Time: now, + EventType: MessageEventTypeRecv, + MessageID: messageID, + UncompressedByteSize: uncompressedByteSize, + CompressedByteSize: compressedByteSize, + }) + s.mu.Unlock() +} + +// AddLink adds a link to the span. +func (s *Span) AddLink(l Link) { + if !s.IsRecordingEvents() { + return + } + s.mu.Lock() + s.links.add(l) + s.mu.Unlock() +} + +func (s *Span) String() string { + if s == nil { + return "" + } + if s.data == nil { + return fmt.Sprintf("span %s", s.spanContext.SpanID) + } + s.mu.Lock() + str := fmt.Sprintf("span %s %q", s.spanContext.SpanID, s.data.Name) + s.mu.Unlock() + return str +} + +var config atomic.Value // access atomically + +func init() { + gen := &defaultIDGenerator{} + // initialize traceID and spanID generators. + var rngSeed int64 + for _, p := range []interface{}{ + &rngSeed, &gen.traceIDAdd, &gen.nextSpanID, &gen.spanIDInc, + } { + binary.Read(crand.Reader, binary.LittleEndian, p) + } + gen.traceIDRand = rand.New(rand.NewSource(rngSeed)) + gen.spanIDInc |= 1 + + config.Store(&Config{ + DefaultSampler: ProbabilitySampler(defaultSamplingProbability), + IDGenerator: gen, + MaxAttributesPerSpan: DefaultMaxAttributesPerSpan, + MaxAnnotationEventsPerSpan: DefaultMaxAnnotationEventsPerSpan, + MaxMessageEventsPerSpan: DefaultMaxMessageEventsPerSpan, + MaxLinksPerSpan: DefaultMaxLinksPerSpan, + }) +} + +type defaultIDGenerator struct { + sync.Mutex + + // Please keep these as the first fields + // so that these 8 byte fields will be aligned on addresses + // divisible by 8, on both 32-bit and 64-bit machines when + // performing atomic increments and accesses. + // See: + // * https://github.com/census-instrumentation/opencensus-go/issues/587 + // * https://github.com/census-instrumentation/opencensus-go/issues/865 + // * https://golang.org/pkg/sync/atomic/#pkg-note-BUG + nextSpanID uint64 + spanIDInc uint64 + + traceIDAdd [2]uint64 + traceIDRand *rand.Rand +} + +// NewSpanID returns a non-zero span ID from a randomly-chosen sequence. +func (gen *defaultIDGenerator) NewSpanID() [8]byte { + var id uint64 + for id == 0 { + id = atomic.AddUint64(&gen.nextSpanID, gen.spanIDInc) + } + var sid [8]byte + binary.LittleEndian.PutUint64(sid[:], id) + return sid +} + +// NewTraceID returns a non-zero trace ID from a randomly-chosen sequence. +// mu should be held while this function is called. +func (gen *defaultIDGenerator) NewTraceID() [16]byte { + var tid [16]byte + // Construct the trace ID from two outputs of traceIDRand, with a constant + // added to each half for additional entropy. + gen.Lock() + binary.LittleEndian.PutUint64(tid[0:8], gen.traceIDRand.Uint64()+gen.traceIDAdd[0]) + binary.LittleEndian.PutUint64(tid[8:16], gen.traceIDRand.Uint64()+gen.traceIDAdd[1]) + gen.Unlock() + return tid +} diff --git a/vendor/go.opencensus.io/trace/trace_go11.go b/vendor/go.opencensus.io/trace/trace_go11.go new file mode 100644 index 00000000..b7d8aaf2 --- /dev/null +++ b/vendor/go.opencensus.io/trace/trace_go11.go @@ -0,0 +1,32 @@ +// Copyright 2018, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// +build go1.11 + +package trace + +import ( + "context" + t "runtime/trace" +) + +func startExecutionTracerTask(ctx context.Context, name string) (context.Context, func()) { + if !t.IsEnabled() { + // Avoid additional overhead if + // runtime/trace is not enabled. + return ctx, func() {} + } + nctx, task := t.NewTask(ctx, name) + return nctx, task.End +} diff --git a/vendor/go.opencensus.io/trace/trace_nongo11.go b/vendor/go.opencensus.io/trace/trace_nongo11.go new file mode 100644 index 00000000..e2541985 --- /dev/null +++ b/vendor/go.opencensus.io/trace/trace_nongo11.go @@ -0,0 +1,25 @@ +// Copyright 2018, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// +build !go1.11 + +package trace + +import ( + "context" +) + +func startExecutionTracerTask(ctx context.Context, name string) (context.Context, func()) { + return ctx, func() {} +} diff --git a/vendor/go.opencensus.io/trace/tracestate/tracestate.go b/vendor/go.opencensus.io/trace/tracestate/tracestate.go new file mode 100644 index 00000000..2d6c713e --- /dev/null +++ b/vendor/go.opencensus.io/trace/tracestate/tracestate.go @@ -0,0 +1,147 @@ +// Copyright 2018, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// Package tracestate implements support for the Tracestate header of the +// W3C TraceContext propagation format. +package tracestate + +import ( + "fmt" + "regexp" +) + +const ( + keyMaxSize = 256 + valueMaxSize = 256 + maxKeyValuePairs = 32 +) + +const ( + keyWithoutVendorFormat = `[a-z][_0-9a-z\-\*\/]{0,255}` + keyWithVendorFormat = `[a-z][_0-9a-z\-\*\/]{0,240}@[a-z][_0-9a-z\-\*\/]{0,13}` + keyFormat = `(` + keyWithoutVendorFormat + `)|(` + keyWithVendorFormat + `)` + valueFormat = `[\x20-\x2b\x2d-\x3c\x3e-\x7e]{0,255}[\x21-\x2b\x2d-\x3c\x3e-\x7e]` +) + +var keyValidationRegExp = regexp.MustCompile(`^(` + keyFormat + `)$`) +var valueValidationRegExp = regexp.MustCompile(`^(` + valueFormat + `)$`) + +// Tracestate represents tracing-system specific context in a list of key-value pairs. Tracestate allows different +// vendors propagate additional information and inter-operate with their legacy Id formats. +type Tracestate struct { + entries []Entry +} + +// Entry represents one key-value pair in a list of key-value pair of Tracestate. +type Entry struct { + // Key is an opaque string up to 256 characters printable. It MUST begin with a lowercase letter, + // and can only contain lowercase letters a-z, digits 0-9, underscores _, dashes -, asterisks *, and + // forward slashes /. + Key string + + // Value is an opaque string up to 256 characters printable ASCII RFC0020 characters (i.e., the + // range 0x20 to 0x7E) except comma , and =. + Value string +} + +// Entries returns a slice of Entry. +func (ts *Tracestate) Entries() []Entry { + if ts == nil { + return nil + } + return ts.entries +} + +func (ts *Tracestate) remove(key string) *Entry { + for index, entry := range ts.entries { + if entry.Key == key { + ts.entries = append(ts.entries[:index], ts.entries[index+1:]...) + return &entry + } + } + return nil +} + +func (ts *Tracestate) add(entries []Entry) error { + for _, entry := range entries { + ts.remove(entry.Key) + } + if len(ts.entries)+len(entries) > maxKeyValuePairs { + return fmt.Errorf("adding %d key-value pairs to current %d pairs exceeds the limit of %d", + len(entries), len(ts.entries), maxKeyValuePairs) + } + ts.entries = append(entries, ts.entries...) + return nil +} + +func isValid(entry Entry) bool { + return keyValidationRegExp.MatchString(entry.Key) && + valueValidationRegExp.MatchString(entry.Value) +} + +func containsDuplicateKey(entries ...Entry) (string, bool) { + keyMap := make(map[string]int) + for _, entry := range entries { + if _, ok := keyMap[entry.Key]; ok { + return entry.Key, true + } + keyMap[entry.Key] = 1 + } + return "", false +} + +func areEntriesValid(entries ...Entry) (*Entry, bool) { + for _, entry := range entries { + if !isValid(entry) { + return &entry, false + } + } + return nil, true +} + +// New creates a Tracestate object from a parent and/or entries (key-value pair). +// Entries from the parent are copied if present. The entries passed to this function +// are inserted in front of those copied from the parent. If an entry copied from the +// parent contains the same key as one of the entry in entries then the entry copied +// from the parent is removed. See add func. +// +// An error is returned with nil Tracestate if +// 1. one or more entry in entries is invalid. +// 2. two or more entries in the input entries have the same key. +// 3. the number of entries combined from the parent and the input entries exceeds maxKeyValuePairs. +// (duplicate entry is counted only once). +func New(parent *Tracestate, entries ...Entry) (*Tracestate, error) { + if parent == nil && len(entries) == 0 { + return nil, nil + } + if entry, ok := areEntriesValid(entries...); !ok { + return nil, fmt.Errorf("key-value pair {%s, %s} is invalid", entry.Key, entry.Value) + } + + if key, duplicate := containsDuplicateKey(entries...); duplicate { + return nil, fmt.Errorf("contains duplicate keys (%s)", key) + } + + tracestate := Tracestate{} + + if parent != nil && len(parent.entries) > 0 { + tracestate.entries = append([]Entry{}, parent.entries...) + } + + err := tracestate.add(entries) + if err != nil { + return nil, err + } + return &tracestate, nil +} diff --git a/vendor/golang.org/x/crypto/ssh/terminal/terminal.go b/vendor/golang.org/x/crypto/ssh/terminal/terminal.go index 2f04ee5b..d1b4fca3 100644 --- a/vendor/golang.org/x/crypto/ssh/terminal/terminal.go +++ b/vendor/golang.org/x/crypto/ssh/terminal/terminal.go @@ -7,6 +7,7 @@ package terminal import ( "bytes" "io" + "runtime" "strconv" "sync" "unicode/utf8" @@ -939,6 +940,8 @@ func (s *stRingBuffer) NthPreviousEntry(n int) (value string, ok bool) { // readPasswordLine reads from reader until it finds \n or io.EOF. // The slice returned does not include the \n. // readPasswordLine also ignores any \r it finds. +// Windows uses \r as end of line. So, on Windows, readPasswordLine +// reads until it finds \r and ignores any \n it finds during processing. func readPasswordLine(reader io.Reader) ([]byte, error) { var buf [1]byte var ret []byte @@ -947,10 +950,20 @@ func readPasswordLine(reader io.Reader) ([]byte, error) { n, err := reader.Read(buf[:]) if n > 0 { switch buf[0] { + case '\b': + if len(ret) > 0 { + ret = ret[:len(ret)-1] + } case '\n': - return ret, nil + if runtime.GOOS != "windows" { + return ret, nil + } + // otherwise ignore \n case '\r': - // remove \r from passwords on Windows + if runtime.GOOS == "windows" { + return ret, nil + } + // otherwise ignore \r default: ret = append(ret, buf[0]) } diff --git a/vendor/golang.org/x/crypto/ssh/terminal/util_windows.go b/vendor/golang.org/x/crypto/ssh/terminal/util_windows.go index 5cfdf8f3..f614e9cb 100644 --- a/vendor/golang.org/x/crypto/ssh/terminal/util_windows.go +++ b/vendor/golang.org/x/crypto/ssh/terminal/util_windows.go @@ -85,8 +85,8 @@ func ReadPassword(fd int) ([]byte, error) { } old := st - st &^= (windows.ENABLE_ECHO_INPUT) - st |= (windows.ENABLE_PROCESSED_INPUT | windows.ENABLE_LINE_INPUT | windows.ENABLE_PROCESSED_OUTPUT) + st &^= (windows.ENABLE_ECHO_INPUT | windows.ENABLE_LINE_INPUT) + st |= (windows.ENABLE_PROCESSED_OUTPUT | windows.ENABLE_PROCESSED_INPUT) if err := windows.SetConsoleMode(windows.Handle(fd), st); err != nil { return nil, err } diff --git a/vendor/golang.org/x/net/html/atom/gen.go b/vendor/golang.org/x/net/html/atom/gen.go deleted file mode 100644 index 5d052781..00000000 --- a/vendor/golang.org/x/net/html/atom/gen.go +++ /dev/null @@ -1,712 +0,0 @@ -// Copyright 2012 The Go Authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the LICENSE file. - -// +build ignore - -//go:generate go run gen.go -//go:generate go run gen.go -test - -package main - -import ( - "bytes" - "flag" - "fmt" - "go/format" - "io/ioutil" - "math/rand" - "os" - "sort" - "strings" -) - -// identifier converts s to a Go exported identifier. -// It converts "div" to "Div" and "accept-charset" to "AcceptCharset". -func identifier(s string) string { - b := make([]byte, 0, len(s)) - cap := true - for _, c := range s { - if c == '-' { - cap = true - continue - } - if cap && 'a' <= c && c <= 'z' { - c -= 'a' - 'A' - } - cap = false - b = append(b, byte(c)) - } - return string(b) -} - -var test = flag.Bool("test", false, "generate table_test.go") - -func genFile(name string, buf *bytes.Buffer) { - b, err := format.Source(buf.Bytes()) - if err != nil { - fmt.Fprintln(os.Stderr, err) - os.Exit(1) - } - if err := ioutil.WriteFile(name, b, 0644); err != nil { - fmt.Fprintln(os.Stderr, err) - os.Exit(1) - } -} - -func main() { - flag.Parse() - - var all []string - all = append(all, elements...) - all = append(all, attributes...) - all = append(all, eventHandlers...) - all = append(all, extra...) - sort.Strings(all) - - // uniq - lists have dups - w := 0 - for _, s := range all { - if w == 0 || all[w-1] != s { - all[w] = s - w++ - } - } - all = all[:w] - - if *test { - var buf bytes.Buffer - fmt.Fprintln(&buf, "// Code generated by go generate gen.go; DO NOT EDIT.\n") - fmt.Fprintln(&buf, "//go:generate go run gen.go -test\n") - fmt.Fprintln(&buf, "package atom\n") - fmt.Fprintln(&buf, "var testAtomList = []string{") - for _, s := range all { - fmt.Fprintf(&buf, "\t%q,\n", s) - } - fmt.Fprintln(&buf, "}") - - genFile("table_test.go", &buf) - return - } - - // Find hash that minimizes table size. - var best *table - for i := 0; i < 1000000; i++ { - if best != nil && 1<<(best.k-1) < len(all) { - break - } - h := rand.Uint32() - for k := uint(0); k <= 16; k++ { - if best != nil && k >= best.k { - break - } - var t table - if t.init(h, k, all) { - best = &t - break - } - } - } - if best == nil { - fmt.Fprintf(os.Stderr, "failed to construct string table\n") - os.Exit(1) - } - - // Lay out strings, using overlaps when possible. - layout := append([]string{}, all...) - - // Remove strings that are substrings of other strings - for changed := true; changed; { - changed = false - for i, s := range layout { - if s == "" { - continue - } - for j, t := range layout { - if i != j && t != "" && strings.Contains(s, t) { - changed = true - layout[j] = "" - } - } - } - } - - // Join strings where one suffix matches another prefix. - for { - // Find best i, j, k such that layout[i][len-k:] == layout[j][:k], - // maximizing overlap length k. - besti := -1 - bestj := -1 - bestk := 0 - for i, s := range layout { - if s == "" { - continue - } - for j, t := range layout { - if i == j { - continue - } - for k := bestk + 1; k <= len(s) && k <= len(t); k++ { - if s[len(s)-k:] == t[:k] { - besti = i - bestj = j - bestk = k - } - } - } - } - if bestk > 0 { - layout[besti] += layout[bestj][bestk:] - layout[bestj] = "" - continue - } - break - } - - text := strings.Join(layout, "") - - atom := map[string]uint32{} - for _, s := range all { - off := strings.Index(text, s) - if off < 0 { - panic("lost string " + s) - } - atom[s] = uint32(off<<8 | len(s)) - } - - var buf bytes.Buffer - // Generate the Go code. - fmt.Fprintln(&buf, "// Code generated by go generate gen.go; DO NOT EDIT.\n") - fmt.Fprintln(&buf, "//go:generate go run gen.go\n") - fmt.Fprintln(&buf, "package atom\n\nconst (") - - // compute max len - maxLen := 0 - for _, s := range all { - if maxLen < len(s) { - maxLen = len(s) - } - fmt.Fprintf(&buf, "\t%s Atom = %#x\n", identifier(s), atom[s]) - } - fmt.Fprintln(&buf, ")\n") - - fmt.Fprintf(&buf, "const hash0 = %#x\n\n", best.h0) - fmt.Fprintf(&buf, "const maxAtomLen = %d\n\n", maxLen) - - fmt.Fprintf(&buf, "var table = [1<<%d]Atom{\n", best.k) - for i, s := range best.tab { - if s == "" { - continue - } - fmt.Fprintf(&buf, "\t%#x: %#x, // %s\n", i, atom[s], s) - } - fmt.Fprintf(&buf, "}\n") - datasize := (1 << best.k) * 4 - - fmt.Fprintln(&buf, "const atomText =") - textsize := len(text) - for len(text) > 60 { - fmt.Fprintf(&buf, "\t%q +\n", text[:60]) - text = text[60:] - } - fmt.Fprintf(&buf, "\t%q\n\n", text) - - genFile("table.go", &buf) - - fmt.Fprintf(os.Stdout, "%d atoms; %d string bytes + %d tables = %d total data\n", len(all), textsize, datasize, textsize+datasize) -} - -type byLen []string - -func (x byLen) Less(i, j int) bool { return len(x[i]) > len(x[j]) } -func (x byLen) Swap(i, j int) { x[i], x[j] = x[j], x[i] } -func (x byLen) Len() int { return len(x) } - -// fnv computes the FNV hash with an arbitrary starting value h. -func fnv(h uint32, s string) uint32 { - for i := 0; i < len(s); i++ { - h ^= uint32(s[i]) - h *= 16777619 - } - return h -} - -// A table represents an attempt at constructing the lookup table. -// The lookup table uses cuckoo hashing, meaning that each string -// can be found in one of two positions. -type table struct { - h0 uint32 - k uint - mask uint32 - tab []string -} - -// hash returns the two hashes for s. -func (t *table) hash(s string) (h1, h2 uint32) { - h := fnv(t.h0, s) - h1 = h & t.mask - h2 = (h >> 16) & t.mask - return -} - -// init initializes the table with the given parameters. -// h0 is the initial hash value, -// k is the number of bits of hash value to use, and -// x is the list of strings to store in the table. -// init returns false if the table cannot be constructed. -func (t *table) init(h0 uint32, k uint, x []string) bool { - t.h0 = h0 - t.k = k - t.tab = make([]string, 1< len(t.tab) { - return false - } - s := t.tab[i] - h1, h2 := t.hash(s) - j := h1 + h2 - i - if t.tab[j] != "" && !t.push(j, depth+1) { - return false - } - t.tab[j] = s - return true -} - -// The lists of element names and attribute keys were taken from -// https://html.spec.whatwg.org/multipage/indices.html#index -// as of the "HTML Living Standard - Last Updated 16 April 2018" version. - -// "command", "keygen" and "menuitem" have been removed from the spec, -// but are kept here for backwards compatibility. -var elements = []string{ - "a", - "abbr", - "address", - "area", - "article", - "aside", - "audio", - "b", - "base", - "bdi", - "bdo", - "blockquote", - "body", - "br", - "button", - "canvas", - "caption", - "cite", - "code", - "col", - "colgroup", - "command", - "data", - "datalist", - "dd", - "del", - "details", - "dfn", - "dialog", - "div", - "dl", - "dt", - "em", - "embed", - "fieldset", - "figcaption", - "figure", - "footer", - "form", - "h1", - "h2", - "h3", - "h4", - "h5", - "h6", - "head", - "header", - "hgroup", - "hr", - "html", - "i", - "iframe", - "img", - "input", - "ins", - "kbd", - "keygen", - "label", - "legend", - "li", - "link", - "main", - "map", - "mark", - "menu", - "menuitem", - "meta", - "meter", - "nav", - "noscript", - "object", - "ol", - "optgroup", - "option", - "output", - "p", - "param", - "picture", - "pre", - "progress", - "q", - "rp", - "rt", - "ruby", - "s", - "samp", - "script", - "section", - "select", - "slot", - "small", - "source", - "span", - "strong", - "style", - "sub", - "summary", - "sup", - "table", - "tbody", - "td", - "template", - "textarea", - "tfoot", - "th", - "thead", - "time", - "title", - "tr", - "track", - "u", - "ul", - "var", - "video", - "wbr", -} - -// https://html.spec.whatwg.org/multipage/indices.html#attributes-3 -// -// "challenge", "command", "contextmenu", "dropzone", "icon", "keytype", "mediagroup", -// "radiogroup", "spellcheck", "scoped", "seamless", "sortable" and "sorted" have been removed from the spec, -// but are kept here for backwards compatibility. -var attributes = []string{ - "abbr", - "accept", - "accept-charset", - "accesskey", - "action", - "allowfullscreen", - "allowpaymentrequest", - "allowusermedia", - "alt", - "as", - "async", - "autocomplete", - "autofocus", - "autoplay", - "challenge", - "charset", - "checked", - "cite", - "class", - "color", - "cols", - "colspan", - "command", - "content", - "contenteditable", - "contextmenu", - "controls", - "coords", - "crossorigin", - "data", - "datetime", - "default", - "defer", - "dir", - "dirname", - "disabled", - "download", - "draggable", - "dropzone", - "enctype", - "for", - "form", - "formaction", - "formenctype", - "formmethod", - "formnovalidate", - "formtarget", - "headers", - "height", - "hidden", - "high", - "href", - "hreflang", - "http-equiv", - "icon", - "id", - "inputmode", - "integrity", - "is", - "ismap", - "itemid", - "itemprop", - "itemref", - "itemscope", - "itemtype", - "keytype", - "kind", - "label", - "lang", - "list", - "loop", - "low", - "manifest", - "max", - "maxlength", - "media", - "mediagroup", - "method", - "min", - "minlength", - "multiple", - "muted", - "name", - "nomodule", - "nonce", - "novalidate", - "open", - "optimum", - "pattern", - "ping", - "placeholder", - "playsinline", - "poster", - "preload", - "radiogroup", - "readonly", - "referrerpolicy", - "rel", - "required", - "reversed", - "rows", - "rowspan", - "sandbox", - "spellcheck", - "scope", - "scoped", - "seamless", - "selected", - "shape", - "size", - "sizes", - "sortable", - "sorted", - "slot", - "span", - "spellcheck", - "src", - "srcdoc", - "srclang", - "srcset", - "start", - "step", - "style", - "tabindex", - "target", - "title", - "translate", - "type", - "typemustmatch", - "updateviacache", - "usemap", - "value", - "width", - "workertype", - "wrap", -} - -// "onautocomplete", "onautocompleteerror", "onmousewheel", -// "onshow" and "onsort" have been removed from the spec, -// but are kept here for backwards compatibility. -var eventHandlers = []string{ - "onabort", - "onautocomplete", - "onautocompleteerror", - "onauxclick", - "onafterprint", - "onbeforeprint", - "onbeforeunload", - "onblur", - "oncancel", - "oncanplay", - "oncanplaythrough", - "onchange", - "onclick", - "onclose", - "oncontextmenu", - "oncopy", - "oncuechange", - "oncut", - "ondblclick", - "ondrag", - "ondragend", - "ondragenter", - "ondragexit", - "ondragleave", - "ondragover", - "ondragstart", - "ondrop", - "ondurationchange", - "onemptied", - "onended", - "onerror", - "onfocus", - "onhashchange", - "oninput", - "oninvalid", - "onkeydown", - "onkeypress", - "onkeyup", - "onlanguagechange", - "onload", - "onloadeddata", - "onloadedmetadata", - "onloadend", - "onloadstart", - "onmessage", - "onmessageerror", - "onmousedown", - "onmouseenter", - "onmouseleave", - "onmousemove", - "onmouseout", - "onmouseover", - "onmouseup", - "onmousewheel", - "onwheel", - "onoffline", - "ononline", - "onpagehide", - "onpageshow", - "onpaste", - "onpause", - "onplay", - "onplaying", - "onpopstate", - "onprogress", - "onratechange", - "onreset", - "onresize", - "onrejectionhandled", - "onscroll", - "onsecuritypolicyviolation", - "onseeked", - "onseeking", - "onselect", - "onshow", - "onsort", - "onstalled", - "onstorage", - "onsubmit", - "onsuspend", - "ontimeupdate", - "ontoggle", - "onunhandledrejection", - "onunload", - "onvolumechange", - "onwaiting", -} - -// extra are ad-hoc values not covered by any of the lists above. -var extra = []string{ - "acronym", - "align", - "annotation", - "annotation-xml", - "applet", - "basefont", - "bgsound", - "big", - "blink", - "center", - "color", - "desc", - "face", - "font", - "foreignObject", // HTML is case-insensitive, but SVG-embedded-in-HTML is case-sensitive. - "foreignobject", - "frame", - "frameset", - "image", - "isindex", - "listing", - "malignmark", - "marquee", - "math", - "mglyph", - "mi", - "mn", - "mo", - "ms", - "mtext", - "nobr", - "noembed", - "noframes", - "plaintext", - "prompt", - "public", - "rb", - "rtc", - "spacer", - "strike", - "svg", - "system", - "tt", - "xmp", -} diff --git a/vendor/golang.org/x/sys/unix/asm_linux_riscv64.s b/vendor/golang.org/x/sys/unix/asm_linux_riscv64.s index 6db717de..3cfefed2 100644 --- a/vendor/golang.org/x/sys/unix/asm_linux_riscv64.s +++ b/vendor/golang.org/x/sys/unix/asm_linux_riscv64.s @@ -23,10 +23,6 @@ TEXT ·SyscallNoError(SB),NOSPLIT,$0-48 MOV a1+8(FP), A0 MOV a2+16(FP), A1 MOV a3+24(FP), A2 - MOV $0, A3 - MOV $0, A4 - MOV $0, A5 - MOV $0, A6 MOV trap+0(FP), A7 // syscall entry ECALL MOV A0, r1+32(FP) // r1 @@ -44,9 +40,6 @@ TEXT ·RawSyscallNoError(SB),NOSPLIT,$0-48 MOV a1+8(FP), A0 MOV a2+16(FP), A1 MOV a3+24(FP), A2 - MOV ZERO, A3 - MOV ZERO, A4 - MOV ZERO, A5 MOV trap+0(FP), A7 // syscall entry ECALL MOV A0, r1+32(FP) diff --git a/vendor/golang.org/x/sys/unix/mkasm_darwin.go b/vendor/golang.org/x/sys/unix/mkasm_darwin.go deleted file mode 100644 index 6f7bb6ed..00000000 --- a/vendor/golang.org/x/sys/unix/mkasm_darwin.go +++ /dev/null @@ -1,78 +0,0 @@ -// Copyright 2018 The Go Authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the LICENSE file. - -// +build ignore - -// mkasm_darwin.go generates assembly trampolines to call libSystem routines from Go. -//This program must be run after mksyscall.go. -package main - -import ( - "bytes" - "fmt" - "io/ioutil" - "log" - "os" - "strings" -) - -func writeASMFile(in string, fileName string, buildTags string) { - trampolines := map[string]bool{} - - var out bytes.Buffer - - fmt.Fprintf(&out, "// go run mkasm_darwin.go %s\n", strings.Join(os.Args[1:], " ")) - fmt.Fprintf(&out, "// Code generated by the command above; DO NOT EDIT.\n") - fmt.Fprintf(&out, "\n") - fmt.Fprintf(&out, "// +build %s\n", buildTags) - fmt.Fprintf(&out, "\n") - fmt.Fprintf(&out, "#include \"textflag.h\"\n") - for _, line := range strings.Split(in, "\n") { - if !strings.HasPrefix(line, "func ") || !strings.HasSuffix(line, "_trampoline()") { - continue - } - fn := line[5 : len(line)-13] - if !trampolines[fn] { - trampolines[fn] = true - fmt.Fprintf(&out, "TEXT ·%s_trampoline(SB),NOSPLIT,$0-0\n", fn) - fmt.Fprintf(&out, "\tJMP\t%s(SB)\n", fn) - } - } - err := ioutil.WriteFile(fileName, out.Bytes(), 0644) - if err != nil { - log.Fatalf("can't write %s: %s", fileName, err) - } -} - -func main() { - in1, err := ioutil.ReadFile("syscall_darwin.go") - if err != nil { - log.Fatalf("can't open syscall_darwin.go: %s", err) - } - arch := os.Args[1] - in2, err := ioutil.ReadFile(fmt.Sprintf("syscall_darwin_%s.go", arch)) - if err != nil { - log.Fatalf("can't open syscall_darwin_%s.go: %s", arch, err) - } - in3, err := ioutil.ReadFile(fmt.Sprintf("zsyscall_darwin_%s.go", arch)) - if err != nil { - log.Fatalf("can't open zsyscall_darwin_%s.go: %s", arch, err) - } - in := string(in1) + string(in2) + string(in3) - - writeASMFile(in, fmt.Sprintf("zsyscall_darwin_%s.s", arch), "go1.12") - - in1, err = ioutil.ReadFile("syscall_darwin.1_13.go") - if err != nil { - log.Fatalf("can't open syscall_darwin.1_13.go: %s", err) - } - in2, err = ioutil.ReadFile(fmt.Sprintf("zsyscall_darwin_%s.1_13.go", arch)) - if err != nil { - log.Fatalf("can't open zsyscall_darwin_%s.1_13.go: %s", arch, err) - } - - in = string(in1) + string(in2) - - writeASMFile(in, fmt.Sprintf("zsyscall_darwin_%s.1_13.s", arch), "go1.13") -} diff --git a/vendor/golang.org/x/sys/unix/mkerrors.sh b/vendor/golang.org/x/sys/unix/mkerrors.sh index 6ffac925..96bf2a91 100644 --- a/vendor/golang.org/x/sys/unix/mkerrors.sh +++ b/vendor/golang.org/x/sys/unix/mkerrors.sh @@ -486,7 +486,7 @@ ccflags="$@" $2 ~ /^TCSET/ || $2 ~ /^TC(FLSH|SBRKP?|XONC)$/ || $2 !~ "RTF_BITS" && - $2 ~ /^(IFF|IFT|NET_RT|RTM|RTF|RTV|RTA|RTAX)_/ || + $2 ~ /^(IFF|IFT|NET_RT|RTM(GRP)?|RTF|RTV|RTA|RTAX)_/ || $2 ~ /^BIOC/ || $2 ~ /^RUSAGE_(SELF|CHILDREN|THREAD)/ || $2 ~ /^RLIMIT_(AS|CORE|CPU|DATA|FSIZE|LOCKS|MEMLOCK|MSGQUEUE|NICE|NOFILE|NPROC|RSS|RTPRIO|RTTIME|SIGPENDING|STACK)|RLIM_INFINITY/ || diff --git a/vendor/golang.org/x/sys/unix/mkpost.go b/vendor/golang.org/x/sys/unix/mkpost.go deleted file mode 100644 index 5ee1a16b..00000000 --- a/vendor/golang.org/x/sys/unix/mkpost.go +++ /dev/null @@ -1,127 +0,0 @@ -// Copyright 2016 The Go Authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the LICENSE file. - -// +build ignore - -// mkpost processes the output of cgo -godefs to -// modify the generated types. It is used to clean up -// the sys API in an architecture specific manner. -// -// mkpost is run after cgo -godefs; see README.md. -package main - -import ( - "bytes" - "fmt" - "go/format" - "io/ioutil" - "log" - "os" - "regexp" -) - -func main() { - // Get the OS and architecture (using GOARCH_TARGET if it exists) - goos := os.Getenv("GOOS") - goarch := os.Getenv("GOARCH_TARGET") - if goarch == "" { - goarch = os.Getenv("GOARCH") - } - // Check that we are using the Docker-based build system if we should be. - if goos == "linux" { - if os.Getenv("GOLANG_SYS_BUILD") != "docker" { - os.Stderr.WriteString("In the Docker-based build system, mkpost should not be called directly.\n") - os.Stderr.WriteString("See README.md\n") - os.Exit(1) - } - } - - b, err := ioutil.ReadAll(os.Stdin) - if err != nil { - log.Fatal(err) - } - - if goos == "aix" { - // Replace type of Atim, Mtim and Ctim by Timespec in Stat_t - // to avoid having both StTimespec and Timespec. - sttimespec := regexp.MustCompile(`_Ctype_struct_st_timespec`) - b = sttimespec.ReplaceAll(b, []byte("Timespec")) - } - - // Intentionally export __val fields in Fsid and Sigset_t - valRegex := regexp.MustCompile(`type (Fsid|Sigset_t) struct {(\s+)X__(bits|val)(\s+\S+\s+)}`) - b = valRegex.ReplaceAll(b, []byte("type $1 struct {${2}Val$4}")) - - // Intentionally export __fds_bits field in FdSet - fdSetRegex := regexp.MustCompile(`type (FdSet) struct {(\s+)X__fds_bits(\s+\S+\s+)}`) - b = fdSetRegex.ReplaceAll(b, []byte("type $1 struct {${2}Bits$3}")) - - // If we have empty Ptrace structs, we should delete them. Only s390x emits - // nonempty Ptrace structs. - ptraceRexexp := regexp.MustCompile(`type Ptrace((Psw|Fpregs|Per) struct {\s*})`) - b = ptraceRexexp.ReplaceAll(b, nil) - - // Replace the control_regs union with a blank identifier for now. - controlRegsRegex := regexp.MustCompile(`(Control_regs)\s+\[0\]uint64`) - b = controlRegsRegex.ReplaceAll(b, []byte("_ [0]uint64")) - - // Remove fields that are added by glibc - // Note that this is unstable as the identifers are private. - removeFieldsRegex := regexp.MustCompile(`X__glibc\S*`) - b = removeFieldsRegex.ReplaceAll(b, []byte("_")) - - // Convert [65]int8 to [65]byte in Utsname members to simplify - // conversion to string; see golang.org/issue/20753 - convertUtsnameRegex := regexp.MustCompile(`((Sys|Node|Domain)name|Release|Version|Machine)(\s+)\[(\d+)\]u?int8`) - b = convertUtsnameRegex.ReplaceAll(b, []byte("$1$3[$4]byte")) - - // Convert [n]int8 to [n]byte in Statvfs_t members to simplify - // conversion to string. - convertStatvfsRegex := regexp.MustCompile(`((Fstype|Mnton|Mntfrom)name)(\s+)\[(\d+)\]int8`) - b = convertStatvfsRegex.ReplaceAll(b, []byte("$1$3[$4]byte")) - - // Convert [1024]int8 to [1024]byte in Ptmget members - convertPtmget := regexp.MustCompile(`([SC]n)(\s+)\[(\d+)\]u?int8`) - b = convertPtmget.ReplaceAll(b, []byte("$1[$3]byte")) - - // Remove spare fields (e.g. in Statx_t) - spareFieldsRegex := regexp.MustCompile(`X__spare\S*`) - b = spareFieldsRegex.ReplaceAll(b, []byte("_")) - - // Remove cgo padding fields - removePaddingFieldsRegex := regexp.MustCompile(`Pad_cgo_\d+`) - b = removePaddingFieldsRegex.ReplaceAll(b, []byte("_")) - - // Remove padding, hidden, or unused fields - removeFieldsRegex = regexp.MustCompile(`\b(X_\S+|Padding)`) - b = removeFieldsRegex.ReplaceAll(b, []byte("_")) - - // Remove the first line of warning from cgo - b = b[bytes.IndexByte(b, '\n')+1:] - // Modify the command in the header to include: - // mkpost, our own warning, and a build tag. - replacement := fmt.Sprintf(`$1 | go run mkpost.go -// Code generated by the command above; see README.md. DO NOT EDIT. - -// +build %s,%s`, goarch, goos) - cgoCommandRegex := regexp.MustCompile(`(cgo -godefs .*)`) - b = cgoCommandRegex.ReplaceAll(b, []byte(replacement)) - - // Rename Stat_t time fields - if goos == "freebsd" && goarch == "386" { - // Hide Stat_t.[AMCB]tim_ext fields - renameStatTimeExtFieldsRegex := regexp.MustCompile(`[AMCB]tim_ext`) - b = renameStatTimeExtFieldsRegex.ReplaceAll(b, []byte("_")) - } - renameStatTimeFieldsRegex := regexp.MustCompile(`([AMCB])(?:irth)?time?(?:spec)?\s+(Timespec|StTimespec)`) - b = renameStatTimeFieldsRegex.ReplaceAll(b, []byte("${1}tim ${2}")) - - // gofmt - b, err = format.Source(b) - if err != nil { - log.Fatal(err) - } - - os.Stdout.Write(b) -} diff --git a/vendor/golang.org/x/sys/unix/mksyscall.go b/vendor/golang.org/x/sys/unix/mksyscall.go deleted file mode 100644 index 9e540cc8..00000000 --- a/vendor/golang.org/x/sys/unix/mksyscall.go +++ /dev/null @@ -1,402 +0,0 @@ -// Copyright 2018 The Go Authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the LICENSE file. - -// +build ignore - -/* -This program reads a file containing function prototypes -(like syscall_darwin.go) and generates system call bodies. -The prototypes are marked by lines beginning with "//sys" -and read like func declarations if //sys is replaced by func, but: - * The parameter lists must give a name for each argument. - This includes return parameters. - * The parameter lists must give a type for each argument: - the (x, y, z int) shorthand is not allowed. - * If the return parameter is an error number, it must be named errno. - -A line beginning with //sysnb is like //sys, except that the -goroutine will not be suspended during the execution of the system -call. This must only be used for system calls which can never -block, as otherwise the system call could cause all goroutines to -hang. -*/ -package main - -import ( - "bufio" - "flag" - "fmt" - "os" - "regexp" - "strings" -) - -var ( - b32 = flag.Bool("b32", false, "32bit big-endian") - l32 = flag.Bool("l32", false, "32bit little-endian") - plan9 = flag.Bool("plan9", false, "plan9") - openbsd = flag.Bool("openbsd", false, "openbsd") - netbsd = flag.Bool("netbsd", false, "netbsd") - dragonfly = flag.Bool("dragonfly", false, "dragonfly") - arm = flag.Bool("arm", false, "arm") // 64-bit value should use (even, odd)-pair - tags = flag.String("tags", "", "build tags") - filename = flag.String("output", "", "output file name (standard output if omitted)") -) - -// cmdLine returns this programs's commandline arguments -func cmdLine() string { - return "go run mksyscall.go " + strings.Join(os.Args[1:], " ") -} - -// buildTags returns build tags -func buildTags() string { - return *tags -} - -// Param is function parameter -type Param struct { - Name string - Type string -} - -// usage prints the program usage -func usage() { - fmt.Fprintf(os.Stderr, "usage: go run mksyscall.go [-b32 | -l32] [-tags x,y] [file ...]\n") - os.Exit(1) -} - -// parseParamList parses parameter list and returns a slice of parameters -func parseParamList(list string) []string { - list = strings.TrimSpace(list) - if list == "" { - return []string{} - } - return regexp.MustCompile(`\s*,\s*`).Split(list, -1) -} - -// parseParam splits a parameter into name and type -func parseParam(p string) Param { - ps := regexp.MustCompile(`^(\S*) (\S*)$`).FindStringSubmatch(p) - if ps == nil { - fmt.Fprintf(os.Stderr, "malformed parameter: %s\n", p) - os.Exit(1) - } - return Param{ps[1], ps[2]} -} - -func main() { - // Get the OS and architecture (using GOARCH_TARGET if it exists) - goos := os.Getenv("GOOS") - if goos == "" { - fmt.Fprintln(os.Stderr, "GOOS not defined in environment") - os.Exit(1) - } - goarch := os.Getenv("GOARCH_TARGET") - if goarch == "" { - goarch = os.Getenv("GOARCH") - } - - // Check that we are using the Docker-based build system if we should - if goos == "linux" { - if os.Getenv("GOLANG_SYS_BUILD") != "docker" { - fmt.Fprintf(os.Stderr, "In the Docker-based build system, mksyscall should not be called directly.\n") - fmt.Fprintf(os.Stderr, "See README.md\n") - os.Exit(1) - } - } - - flag.Usage = usage - flag.Parse() - if len(flag.Args()) <= 0 { - fmt.Fprintf(os.Stderr, "no files to parse provided\n") - usage() - } - - endianness := "" - if *b32 { - endianness = "big-endian" - } else if *l32 { - endianness = "little-endian" - } - - libc := false - if goos == "darwin" && (strings.Contains(buildTags(), ",go1.12") || strings.Contains(buildTags(), ",go1.13")) { - libc = true - } - trampolines := map[string]bool{} - - text := "" - for _, path := range flag.Args() { - file, err := os.Open(path) - if err != nil { - fmt.Fprintf(os.Stderr, err.Error()) - os.Exit(1) - } - s := bufio.NewScanner(file) - for s.Scan() { - t := s.Text() - t = strings.TrimSpace(t) - t = regexp.MustCompile(`\s+`).ReplaceAllString(t, ` `) - nonblock := regexp.MustCompile(`^\/\/sysnb `).FindStringSubmatch(t) - if regexp.MustCompile(`^\/\/sys `).FindStringSubmatch(t) == nil && nonblock == nil { - continue - } - - // Line must be of the form - // func Open(path string, mode int, perm int) (fd int, errno error) - // Split into name, in params, out params. - f := regexp.MustCompile(`^\/\/sys(nb)? (\w+)\(([^()]*)\)\s*(?:\(([^()]+)\))?\s*(?:=\s*((?i)SYS_[A-Z0-9_]+))?$`).FindStringSubmatch(t) - if f == nil { - fmt.Fprintf(os.Stderr, "%s:%s\nmalformed //sys declaration\n", path, t) - os.Exit(1) - } - funct, inps, outps, sysname := f[2], f[3], f[4], f[5] - - // ClockGettime doesn't have a syscall number on Darwin, only generate libc wrappers. - if goos == "darwin" && !libc && funct == "ClockGettime" { - continue - } - - // Split argument lists on comma. - in := parseParamList(inps) - out := parseParamList(outps) - - // Try in vain to keep people from editing this file. - // The theory is that they jump into the middle of the file - // without reading the header. - text += "// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT\n\n" - - // Go function header. - outDecl := "" - if len(out) > 0 { - outDecl = fmt.Sprintf(" (%s)", strings.Join(out, ", ")) - } - text += fmt.Sprintf("func %s(%s)%s {\n", funct, strings.Join(in, ", "), outDecl) - - // Check if err return available - errvar := "" - for _, param := range out { - p := parseParam(param) - if p.Type == "error" { - errvar = p.Name - break - } - } - - // Prepare arguments to Syscall. - var args []string - n := 0 - for _, param := range in { - p := parseParam(param) - if regexp.MustCompile(`^\*`).FindStringSubmatch(p.Type) != nil { - args = append(args, "uintptr(unsafe.Pointer("+p.Name+"))") - } else if p.Type == "string" && errvar != "" { - text += fmt.Sprintf("\tvar _p%d *byte\n", n) - text += fmt.Sprintf("\t_p%d, %s = BytePtrFromString(%s)\n", n, errvar, p.Name) - text += fmt.Sprintf("\tif %s != nil {\n\t\treturn\n\t}\n", errvar) - args = append(args, fmt.Sprintf("uintptr(unsafe.Pointer(_p%d))", n)) - n++ - } else if p.Type == "string" { - fmt.Fprintf(os.Stderr, path+":"+funct+" uses string arguments, but has no error return\n") - text += fmt.Sprintf("\tvar _p%d *byte\n", n) - text += fmt.Sprintf("\t_p%d, _ = BytePtrFromString(%s)\n", n, p.Name) - args = append(args, fmt.Sprintf("uintptr(unsafe.Pointer(_p%d))", n)) - n++ - } else if regexp.MustCompile(`^\[\](.*)`).FindStringSubmatch(p.Type) != nil { - // Convert slice into pointer, length. - // Have to be careful not to take address of &a[0] if len == 0: - // pass dummy pointer in that case. - // Used to pass nil, but some OSes or simulators reject write(fd, nil, 0). - text += fmt.Sprintf("\tvar _p%d unsafe.Pointer\n", n) - text += fmt.Sprintf("\tif len(%s) > 0 {\n\t\t_p%d = unsafe.Pointer(&%s[0])\n\t}", p.Name, n, p.Name) - text += fmt.Sprintf(" else {\n\t\t_p%d = unsafe.Pointer(&_zero)\n\t}\n", n) - args = append(args, fmt.Sprintf("uintptr(_p%d)", n), fmt.Sprintf("uintptr(len(%s))", p.Name)) - n++ - } else if p.Type == "int64" && (*openbsd || *netbsd) { - args = append(args, "0") - if endianness == "big-endian" { - args = append(args, fmt.Sprintf("uintptr(%s>>32)", p.Name), fmt.Sprintf("uintptr(%s)", p.Name)) - } else if endianness == "little-endian" { - args = append(args, fmt.Sprintf("uintptr(%s)", p.Name), fmt.Sprintf("uintptr(%s>>32)", p.Name)) - } else { - args = append(args, fmt.Sprintf("uintptr(%s)", p.Name)) - } - } else if p.Type == "int64" && *dragonfly { - if regexp.MustCompile(`^(?i)extp(read|write)`).FindStringSubmatch(funct) == nil { - args = append(args, "0") - } - if endianness == "big-endian" { - args = append(args, fmt.Sprintf("uintptr(%s>>32)", p.Name), fmt.Sprintf("uintptr(%s)", p.Name)) - } else if endianness == "little-endian" { - args = append(args, fmt.Sprintf("uintptr(%s)", p.Name), fmt.Sprintf("uintptr(%s>>32)", p.Name)) - } else { - args = append(args, fmt.Sprintf("uintptr(%s)", p.Name)) - } - } else if (p.Type == "int64" || p.Type == "uint64") && endianness != "" { - if len(args)%2 == 1 && *arm { - // arm abi specifies 64-bit argument uses - // (even, odd) pair - args = append(args, "0") - } - if endianness == "big-endian" { - args = append(args, fmt.Sprintf("uintptr(%s>>32)", p.Name), fmt.Sprintf("uintptr(%s)", p.Name)) - } else { - args = append(args, fmt.Sprintf("uintptr(%s)", p.Name), fmt.Sprintf("uintptr(%s>>32)", p.Name)) - } - } else { - args = append(args, fmt.Sprintf("uintptr(%s)", p.Name)) - } - } - - // Determine which form to use; pad args with zeros. - asm := "Syscall" - if nonblock != nil { - if errvar == "" && goos == "linux" { - asm = "RawSyscallNoError" - } else { - asm = "RawSyscall" - } - } else { - if errvar == "" && goos == "linux" { - asm = "SyscallNoError" - } - } - if len(args) <= 3 { - for len(args) < 3 { - args = append(args, "0") - } - } else if len(args) <= 6 { - asm += "6" - for len(args) < 6 { - args = append(args, "0") - } - } else if len(args) <= 9 { - asm += "9" - for len(args) < 9 { - args = append(args, "0") - } - } else { - fmt.Fprintf(os.Stderr, "%s:%s too many arguments to system call\n", path, funct) - } - - // System call number. - if sysname == "" { - sysname = "SYS_" + funct - sysname = regexp.MustCompile(`([a-z])([A-Z])`).ReplaceAllString(sysname, `${1}_$2`) - sysname = strings.ToUpper(sysname) - } - - var libcFn string - if libc { - asm = "syscall_" + strings.ToLower(asm[:1]) + asm[1:] // internal syscall call - sysname = strings.TrimPrefix(sysname, "SYS_") // remove SYS_ - sysname = strings.ToLower(sysname) // lowercase - libcFn = sysname - sysname = "funcPC(libc_" + sysname + "_trampoline)" - } - - // Actual call. - arglist := strings.Join(args, ", ") - call := fmt.Sprintf("%s(%s, %s)", asm, sysname, arglist) - - // Assign return values. - body := "" - ret := []string{"_", "_", "_"} - doErrno := false - for i := 0; i < len(out); i++ { - p := parseParam(out[i]) - reg := "" - if p.Name == "err" && !*plan9 { - reg = "e1" - ret[2] = reg - doErrno = true - } else if p.Name == "err" && *plan9 { - ret[0] = "r0" - ret[2] = "e1" - break - } else { - reg = fmt.Sprintf("r%d", i) - ret[i] = reg - } - if p.Type == "bool" { - reg = fmt.Sprintf("%s != 0", reg) - } - if p.Type == "int64" && endianness != "" { - // 64-bit number in r1:r0 or r0:r1. - if i+2 > len(out) { - fmt.Fprintf(os.Stderr, "%s:%s not enough registers for int64 return\n", path, funct) - } - if endianness == "big-endian" { - reg = fmt.Sprintf("int64(r%d)<<32 | int64(r%d)", i, i+1) - } else { - reg = fmt.Sprintf("int64(r%d)<<32 | int64(r%d)", i+1, i) - } - ret[i] = fmt.Sprintf("r%d", i) - ret[i+1] = fmt.Sprintf("r%d", i+1) - } - if reg != "e1" || *plan9 { - body += fmt.Sprintf("\t%s = %s(%s)\n", p.Name, p.Type, reg) - } - } - if ret[0] == "_" && ret[1] == "_" && ret[2] == "_" { - text += fmt.Sprintf("\t%s\n", call) - } else { - if errvar == "" && goos == "linux" { - // raw syscall without error on Linux, see golang.org/issue/22924 - text += fmt.Sprintf("\t%s, %s := %s\n", ret[0], ret[1], call) - } else { - text += fmt.Sprintf("\t%s, %s, %s := %s\n", ret[0], ret[1], ret[2], call) - } - } - text += body - - if *plan9 && ret[2] == "e1" { - text += "\tif int32(r0) == -1 {\n" - text += "\t\terr = e1\n" - text += "\t}\n" - } else if doErrno { - text += "\tif e1 != 0 {\n" - text += "\t\terr = errnoErr(e1)\n" - text += "\t}\n" - } - text += "\treturn\n" - text += "}\n\n" - - if libc && !trampolines[libcFn] { - // some system calls share a trampoline, like read and readlen. - trampolines[libcFn] = true - // Declare assembly trampoline. - text += fmt.Sprintf("func libc_%s_trampoline()\n", libcFn) - // Assembly trampoline calls the libc_* function, which this magic - // redirects to use the function from libSystem. - text += fmt.Sprintf("//go:linkname libc_%s libc_%s\n", libcFn, libcFn) - text += fmt.Sprintf("//go:cgo_import_dynamic libc_%s %s \"/usr/lib/libSystem.B.dylib\"\n", libcFn, libcFn) - text += "\n" - } - } - if err := s.Err(); err != nil { - fmt.Fprintf(os.Stderr, err.Error()) - os.Exit(1) - } - file.Close() - } - fmt.Printf(srcTemplate, cmdLine(), buildTags(), text) -} - -const srcTemplate = `// %s -// Code generated by the command above; see README.md. DO NOT EDIT. - -// +build %s - -package unix - -import ( - "syscall" - "unsafe" -) - -var _ syscall.Errno - -%s -` diff --git a/vendor/golang.org/x/sys/unix/mksyscall_aix_ppc.go b/vendor/golang.org/x/sys/unix/mksyscall_aix_ppc.go deleted file mode 100644 index 3be3cdfc..00000000 --- a/vendor/golang.org/x/sys/unix/mksyscall_aix_ppc.go +++ /dev/null @@ -1,415 +0,0 @@ -// Copyright 2019 The Go Authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the LICENSE file. - -// +build ignore - -/* -This program reads a file containing function prototypes -(like syscall_aix.go) and generates system call bodies. -The prototypes are marked by lines beginning with "//sys" -and read like func declarations if //sys is replaced by func, but: - * The parameter lists must give a name for each argument. - This includes return parameters. - * The parameter lists must give a type for each argument: - the (x, y, z int) shorthand is not allowed. - * If the return parameter is an error number, it must be named err. - * If go func name needs to be different than its libc name, - * or the function is not in libc, name could be specified - * at the end, after "=" sign, like - //sys getsockopt(s int, level int, name int, val uintptr, vallen *_Socklen) (err error) = libsocket.getsockopt -*/ -package main - -import ( - "bufio" - "flag" - "fmt" - "os" - "regexp" - "strings" -) - -var ( - b32 = flag.Bool("b32", false, "32bit big-endian") - l32 = flag.Bool("l32", false, "32bit little-endian") - aix = flag.Bool("aix", false, "aix") - tags = flag.String("tags", "", "build tags") -) - -// cmdLine returns this programs's commandline arguments -func cmdLine() string { - return "go run mksyscall_aix_ppc.go " + strings.Join(os.Args[1:], " ") -} - -// buildTags returns build tags -func buildTags() string { - return *tags -} - -// Param is function parameter -type Param struct { - Name string - Type string -} - -// usage prints the program usage -func usage() { - fmt.Fprintf(os.Stderr, "usage: go run mksyscall_aix_ppc.go [-b32 | -l32] [-tags x,y] [file ...]\n") - os.Exit(1) -} - -// parseParamList parses parameter list and returns a slice of parameters -func parseParamList(list string) []string { - list = strings.TrimSpace(list) - if list == "" { - return []string{} - } - return regexp.MustCompile(`\s*,\s*`).Split(list, -1) -} - -// parseParam splits a parameter into name and type -func parseParam(p string) Param { - ps := regexp.MustCompile(`^(\S*) (\S*)$`).FindStringSubmatch(p) - if ps == nil { - fmt.Fprintf(os.Stderr, "malformed parameter: %s\n", p) - os.Exit(1) - } - return Param{ps[1], ps[2]} -} - -func main() { - flag.Usage = usage - flag.Parse() - if len(flag.Args()) <= 0 { - fmt.Fprintf(os.Stderr, "no files to parse provided\n") - usage() - } - - endianness := "" - if *b32 { - endianness = "big-endian" - } else if *l32 { - endianness = "little-endian" - } - - pack := "" - text := "" - cExtern := "/*\n#include \n#include \n" - for _, path := range flag.Args() { - file, err := os.Open(path) - if err != nil { - fmt.Fprintf(os.Stderr, err.Error()) - os.Exit(1) - } - s := bufio.NewScanner(file) - for s.Scan() { - t := s.Text() - t = strings.TrimSpace(t) - t = regexp.MustCompile(`\s+`).ReplaceAllString(t, ` `) - if p := regexp.MustCompile(`^package (\S+)$`).FindStringSubmatch(t); p != nil && pack == "" { - pack = p[1] - } - nonblock := regexp.MustCompile(`^\/\/sysnb `).FindStringSubmatch(t) - if regexp.MustCompile(`^\/\/sys `).FindStringSubmatch(t) == nil && nonblock == nil { - continue - } - - // Line must be of the form - // func Open(path string, mode int, perm int) (fd int, err error) - // Split into name, in params, out params. - f := regexp.MustCompile(`^\/\/sys(nb)? (\w+)\(([^()]*)\)\s*(?:\(([^()]+)\))?\s*(?:=\s*(?:(\w*)\.)?(\w*))?$`).FindStringSubmatch(t) - if f == nil { - fmt.Fprintf(os.Stderr, "%s:%s\nmalformed //sys declaration\n", path, t) - os.Exit(1) - } - funct, inps, outps, modname, sysname := f[2], f[3], f[4], f[5], f[6] - - // Split argument lists on comma. - in := parseParamList(inps) - out := parseParamList(outps) - - inps = strings.Join(in, ", ") - outps = strings.Join(out, ", ") - - // Try in vain to keep people from editing this file. - // The theory is that they jump into the middle of the file - // without reading the header. - text += "// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT\n\n" - - // Check if value return, err return available - errvar := "" - retvar := "" - rettype := "" - for _, param := range out { - p := parseParam(param) - if p.Type == "error" { - errvar = p.Name - } else { - retvar = p.Name - rettype = p.Type - } - } - - // System call name. - if sysname == "" { - sysname = funct - } - sysname = regexp.MustCompile(`([a-z])([A-Z])`).ReplaceAllString(sysname, `${1}_$2`) - sysname = strings.ToLower(sysname) // All libc functions are lowercase. - - cRettype := "" - if rettype == "unsafe.Pointer" { - cRettype = "uintptr_t" - } else if rettype == "uintptr" { - cRettype = "uintptr_t" - } else if regexp.MustCompile(`^_`).FindStringSubmatch(rettype) != nil { - cRettype = "uintptr_t" - } else if rettype == "int" { - cRettype = "int" - } else if rettype == "int32" { - cRettype = "int" - } else if rettype == "int64" { - cRettype = "long long" - } else if rettype == "uint32" { - cRettype = "unsigned int" - } else if rettype == "uint64" { - cRettype = "unsigned long long" - } else { - cRettype = "int" - } - if sysname == "exit" { - cRettype = "void" - } - - // Change p.Types to c - var cIn []string - for _, param := range in { - p := parseParam(param) - if regexp.MustCompile(`^\*`).FindStringSubmatch(p.Type) != nil { - cIn = append(cIn, "uintptr_t") - } else if p.Type == "string" { - cIn = append(cIn, "uintptr_t") - } else if regexp.MustCompile(`^\[\](.*)`).FindStringSubmatch(p.Type) != nil { - cIn = append(cIn, "uintptr_t", "size_t") - } else if p.Type == "unsafe.Pointer" { - cIn = append(cIn, "uintptr_t") - } else if p.Type == "uintptr" { - cIn = append(cIn, "uintptr_t") - } else if regexp.MustCompile(`^_`).FindStringSubmatch(p.Type) != nil { - cIn = append(cIn, "uintptr_t") - } else if p.Type == "int" { - cIn = append(cIn, "int") - } else if p.Type == "int32" { - cIn = append(cIn, "int") - } else if p.Type == "int64" { - cIn = append(cIn, "long long") - } else if p.Type == "uint32" { - cIn = append(cIn, "unsigned int") - } else if p.Type == "uint64" { - cIn = append(cIn, "unsigned long long") - } else { - cIn = append(cIn, "int") - } - } - - if funct != "fcntl" && funct != "FcntlInt" && funct != "readlen" && funct != "writelen" { - if sysname == "select" { - // select is a keyword of Go. Its name is - // changed to c_select. - cExtern += "#define c_select select\n" - } - // Imports of system calls from libc - cExtern += fmt.Sprintf("%s %s", cRettype, sysname) - cIn := strings.Join(cIn, ", ") - cExtern += fmt.Sprintf("(%s);\n", cIn) - } - - // So file name. - if *aix { - if modname == "" { - modname = "libc.a/shr_64.o" - } else { - fmt.Fprintf(os.Stderr, "%s: only syscall using libc are available\n", funct) - os.Exit(1) - } - } - - strconvfunc := "C.CString" - - // Go function header. - if outps != "" { - outps = fmt.Sprintf(" (%s)", outps) - } - if text != "" { - text += "\n" - } - - text += fmt.Sprintf("func %s(%s)%s {\n", funct, strings.Join(in, ", "), outps) - - // Prepare arguments to Syscall. - var args []string - n := 0 - argN := 0 - for _, param := range in { - p := parseParam(param) - if regexp.MustCompile(`^\*`).FindStringSubmatch(p.Type) != nil { - args = append(args, "C.uintptr_t(uintptr(unsafe.Pointer("+p.Name+")))") - } else if p.Type == "string" && errvar != "" { - text += fmt.Sprintf("\t_p%d := uintptr(unsafe.Pointer(%s(%s)))\n", n, strconvfunc, p.Name) - args = append(args, fmt.Sprintf("C.uintptr_t(_p%d)", n)) - n++ - } else if p.Type == "string" { - fmt.Fprintf(os.Stderr, path+":"+funct+" uses string arguments, but has no error return\n") - text += fmt.Sprintf("\t_p%d := uintptr(unsafe.Pointer(%s(%s)))\n", n, strconvfunc, p.Name) - args = append(args, fmt.Sprintf("C.uintptr_t(_p%d)", n)) - n++ - } else if m := regexp.MustCompile(`^\[\](.*)`).FindStringSubmatch(p.Type); m != nil { - // Convert slice into pointer, length. - // Have to be careful not to take address of &a[0] if len == 0: - // pass nil in that case. - text += fmt.Sprintf("\tvar _p%d *%s\n", n, m[1]) - text += fmt.Sprintf("\tif len(%s) > 0 {\n\t\t_p%d = &%s[0]\n\t}\n", p.Name, n, p.Name) - args = append(args, fmt.Sprintf("C.uintptr_t(uintptr(unsafe.Pointer(_p%d)))", n)) - n++ - text += fmt.Sprintf("\tvar _p%d int\n", n) - text += fmt.Sprintf("\t_p%d = len(%s)\n", n, p.Name) - args = append(args, fmt.Sprintf("C.size_t(_p%d)", n)) - n++ - } else if p.Type == "int64" && endianness != "" { - if endianness == "big-endian" { - args = append(args, fmt.Sprintf("uintptr(%s>>32)", p.Name), fmt.Sprintf("uintptr(%s)", p.Name)) - } else { - args = append(args, fmt.Sprintf("uintptr(%s)", p.Name), fmt.Sprintf("uintptr(%s>>32)", p.Name)) - } - n++ - } else if p.Type == "bool" { - text += fmt.Sprintf("\tvar _p%d uint32\n", n) - text += fmt.Sprintf("\tif %s {\n\t\t_p%d = 1\n\t} else {\n\t\t_p%d = 0\n\t}\n", p.Name, n, n) - args = append(args, fmt.Sprintf("_p%d", n)) - } else if regexp.MustCompile(`^_`).FindStringSubmatch(p.Type) != nil { - args = append(args, fmt.Sprintf("C.uintptr_t(uintptr(%s))", p.Name)) - } else if p.Type == "unsafe.Pointer" { - args = append(args, fmt.Sprintf("C.uintptr_t(uintptr(%s))", p.Name)) - } else if p.Type == "int" { - if (argN == 2) && ((funct == "readlen") || (funct == "writelen")) { - args = append(args, fmt.Sprintf("C.size_t(%s)", p.Name)) - } else if argN == 0 && funct == "fcntl" { - args = append(args, fmt.Sprintf("C.uintptr_t(%s)", p.Name)) - } else if (argN == 2) && ((funct == "fcntl") || (funct == "FcntlInt")) { - args = append(args, fmt.Sprintf("C.uintptr_t(%s)", p.Name)) - } else { - args = append(args, fmt.Sprintf("C.int(%s)", p.Name)) - } - } else if p.Type == "int32" { - args = append(args, fmt.Sprintf("C.int(%s)", p.Name)) - } else if p.Type == "int64" { - args = append(args, fmt.Sprintf("C.longlong(%s)", p.Name)) - } else if p.Type == "uint32" { - args = append(args, fmt.Sprintf("C.uint(%s)", p.Name)) - } else if p.Type == "uint64" { - args = append(args, fmt.Sprintf("C.ulonglong(%s)", p.Name)) - } else if p.Type == "uintptr" { - args = append(args, fmt.Sprintf("C.uintptr_t(%s)", p.Name)) - } else { - args = append(args, fmt.Sprintf("C.int(%s)", p.Name)) - } - argN++ - } - - // Actual call. - arglist := strings.Join(args, ", ") - call := "" - if sysname == "exit" { - if errvar != "" { - call += "er :=" - } else { - call += "" - } - } else if errvar != "" { - call += "r0,er :=" - } else if retvar != "" { - call += "r0,_ :=" - } else { - call += "" - } - if sysname == "select" { - // select is a keyword of Go. Its name is - // changed to c_select. - call += fmt.Sprintf("C.c_%s(%s)", sysname, arglist) - } else { - call += fmt.Sprintf("C.%s(%s)", sysname, arglist) - } - - // Assign return values. - body := "" - for i := 0; i < len(out); i++ { - p := parseParam(out[i]) - reg := "" - if p.Name == "err" { - reg = "e1" - } else { - reg = "r0" - } - if reg != "e1" { - body += fmt.Sprintf("\t%s = %s(%s)\n", p.Name, p.Type, reg) - } - } - - // verify return - if sysname != "exit" && errvar != "" { - if regexp.MustCompile(`^uintptr`).FindStringSubmatch(cRettype) != nil { - body += "\tif (uintptr(r0) ==^uintptr(0) && er != nil) {\n" - body += fmt.Sprintf("\t\t%s = er\n", errvar) - body += "\t}\n" - } else { - body += "\tif (r0 ==-1 && er != nil) {\n" - body += fmt.Sprintf("\t\t%s = er\n", errvar) - body += "\t}\n" - } - } else if errvar != "" { - body += "\tif (er != nil) {\n" - body += fmt.Sprintf("\t\t%s = er\n", errvar) - body += "\t}\n" - } - - text += fmt.Sprintf("\t%s\n", call) - text += body - - text += "\treturn\n" - text += "}\n" - } - if err := s.Err(); err != nil { - fmt.Fprintf(os.Stderr, err.Error()) - os.Exit(1) - } - file.Close() - } - imp := "" - if pack != "unix" { - imp = "import \"golang.org/x/sys/unix\"\n" - - } - fmt.Printf(srcTemplate, cmdLine(), buildTags(), pack, cExtern, imp, text) -} - -const srcTemplate = `// %s -// Code generated by the command above; see README.md. DO NOT EDIT. - -// +build %s - -package %s - - -%s -*/ -import "C" -import ( - "unsafe" -) - - -%s - -%s -` diff --git a/vendor/golang.org/x/sys/unix/mksyscall_aix_ppc64.go b/vendor/golang.org/x/sys/unix/mksyscall_aix_ppc64.go deleted file mode 100644 index c9600995..00000000 --- a/vendor/golang.org/x/sys/unix/mksyscall_aix_ppc64.go +++ /dev/null @@ -1,614 +0,0 @@ -// Copyright 2019 The Go Authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the LICENSE file. - -// +build ignore - -/* -This program reads a file containing function prototypes -(like syscall_aix.go) and generates system call bodies. -The prototypes are marked by lines beginning with "//sys" -and read like func declarations if //sys is replaced by func, but: - * The parameter lists must give a name for each argument. - This includes return parameters. - * The parameter lists must give a type for each argument: - the (x, y, z int) shorthand is not allowed. - * If the return parameter is an error number, it must be named err. - * If go func name needs to be different than its libc name, - * or the function is not in libc, name could be specified - * at the end, after "=" sign, like - //sys getsockopt(s int, level int, name int, val uintptr, vallen *_Socklen) (err error) = libsocket.getsockopt - - -This program will generate three files and handle both gc and gccgo implementation: - - zsyscall_aix_ppc64.go: the common part of each implementation (error handler, pointer creation) - - zsyscall_aix_ppc64_gc.go: gc part with //go_cgo_import_dynamic and a call to syscall6 - - zsyscall_aix_ppc64_gccgo.go: gccgo part with C function and conversion to C type. - - The generated code looks like this - -zsyscall_aix_ppc64.go -func asyscall(...) (n int, err error) { - // Pointer Creation - r1, e1 := callasyscall(...) - // Type Conversion - // Error Handler - return -} - -zsyscall_aix_ppc64_gc.go -//go:cgo_import_dynamic libc_asyscall asyscall "libc.a/shr_64.o" -//go:linkname libc_asyscall libc_asyscall -var asyscall syscallFunc - -func callasyscall(...) (r1 uintptr, e1 Errno) { - r1, _, e1 = syscall6(uintptr(unsafe.Pointer(&libc_asyscall)), "nb_args", ... ) - return -} - -zsyscall_aix_ppc64_ggcgo.go - -// int asyscall(...) - -import "C" - -func callasyscall(...) (r1 uintptr, e1 Errno) { - r1 = uintptr(C.asyscall(...)) - e1 = syscall.GetErrno() - return -} -*/ - -package main - -import ( - "bufio" - "flag" - "fmt" - "io/ioutil" - "os" - "regexp" - "strings" -) - -var ( - b32 = flag.Bool("b32", false, "32bit big-endian") - l32 = flag.Bool("l32", false, "32bit little-endian") - aix = flag.Bool("aix", false, "aix") - tags = flag.String("tags", "", "build tags") -) - -// cmdLine returns this programs's commandline arguments -func cmdLine() string { - return "go run mksyscall_aix_ppc64.go " + strings.Join(os.Args[1:], " ") -} - -// buildTags returns build tags -func buildTags() string { - return *tags -} - -// Param is function parameter -type Param struct { - Name string - Type string -} - -// usage prints the program usage -func usage() { - fmt.Fprintf(os.Stderr, "usage: go run mksyscall_aix_ppc64.go [-b32 | -l32] [-tags x,y] [file ...]\n") - os.Exit(1) -} - -// parseParamList parses parameter list and returns a slice of parameters -func parseParamList(list string) []string { - list = strings.TrimSpace(list) - if list == "" { - return []string{} - } - return regexp.MustCompile(`\s*,\s*`).Split(list, -1) -} - -// parseParam splits a parameter into name and type -func parseParam(p string) Param { - ps := regexp.MustCompile(`^(\S*) (\S*)$`).FindStringSubmatch(p) - if ps == nil { - fmt.Fprintf(os.Stderr, "malformed parameter: %s\n", p) - os.Exit(1) - } - return Param{ps[1], ps[2]} -} - -func main() { - flag.Usage = usage - flag.Parse() - if len(flag.Args()) <= 0 { - fmt.Fprintf(os.Stderr, "no files to parse provided\n") - usage() - } - - endianness := "" - if *b32 { - endianness = "big-endian" - } else if *l32 { - endianness = "little-endian" - } - - pack := "" - // GCCGO - textgccgo := "" - cExtern := "/*\n#include \n" - // GC - textgc := "" - dynimports := "" - linknames := "" - var vars []string - // COMMON - textcommon := "" - for _, path := range flag.Args() { - file, err := os.Open(path) - if err != nil { - fmt.Fprintf(os.Stderr, err.Error()) - os.Exit(1) - } - s := bufio.NewScanner(file) - for s.Scan() { - t := s.Text() - t = strings.TrimSpace(t) - t = regexp.MustCompile(`\s+`).ReplaceAllString(t, ` `) - if p := regexp.MustCompile(`^package (\S+)$`).FindStringSubmatch(t); p != nil && pack == "" { - pack = p[1] - } - nonblock := regexp.MustCompile(`^\/\/sysnb `).FindStringSubmatch(t) - if regexp.MustCompile(`^\/\/sys `).FindStringSubmatch(t) == nil && nonblock == nil { - continue - } - - // Line must be of the form - // func Open(path string, mode int, perm int) (fd int, err error) - // Split into name, in params, out params. - f := regexp.MustCompile(`^\/\/sys(nb)? (\w+)\(([^()]*)\)\s*(?:\(([^()]+)\))?\s*(?:=\s*(?:(\w*)\.)?(\w*))?$`).FindStringSubmatch(t) - if f == nil { - fmt.Fprintf(os.Stderr, "%s:%s\nmalformed //sys declaration\n", path, t) - os.Exit(1) - } - funct, inps, outps, modname, sysname := f[2], f[3], f[4], f[5], f[6] - - // Split argument lists on comma. - in := parseParamList(inps) - out := parseParamList(outps) - - inps = strings.Join(in, ", ") - outps = strings.Join(out, ", ") - - if sysname == "" { - sysname = funct - } - - onlyCommon := false - if funct == "readlen" || funct == "writelen" || funct == "FcntlInt" || funct == "FcntlFlock" { - // This function call another syscall which is already implemented. - // Therefore, the gc and gccgo part must not be generated. - onlyCommon = true - } - - // Try in vain to keep people from editing this file. - // The theory is that they jump into the middle of the file - // without reading the header. - - textcommon += "// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT\n\n" - if !onlyCommon { - textgccgo += "// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT\n\n" - textgc += "// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT\n\n" - } - - // Check if value return, err return available - errvar := "" - rettype := "" - for _, param := range out { - p := parseParam(param) - if p.Type == "error" { - errvar = p.Name - } else { - rettype = p.Type - } - } - - sysname = regexp.MustCompile(`([a-z])([A-Z])`).ReplaceAllString(sysname, `${1}_$2`) - sysname = strings.ToLower(sysname) // All libc functions are lowercase. - - // GCCGO Prototype return type - cRettype := "" - if rettype == "unsafe.Pointer" { - cRettype = "uintptr_t" - } else if rettype == "uintptr" { - cRettype = "uintptr_t" - } else if regexp.MustCompile(`^_`).FindStringSubmatch(rettype) != nil { - cRettype = "uintptr_t" - } else if rettype == "int" { - cRettype = "int" - } else if rettype == "int32" { - cRettype = "int" - } else if rettype == "int64" { - cRettype = "long long" - } else if rettype == "uint32" { - cRettype = "unsigned int" - } else if rettype == "uint64" { - cRettype = "unsigned long long" - } else { - cRettype = "int" - } - if sysname == "exit" { - cRettype = "void" - } - - // GCCGO Prototype arguments type - var cIn []string - for i, param := range in { - p := parseParam(param) - if regexp.MustCompile(`^\*`).FindStringSubmatch(p.Type) != nil { - cIn = append(cIn, "uintptr_t") - } else if p.Type == "string" { - cIn = append(cIn, "uintptr_t") - } else if regexp.MustCompile(`^\[\](.*)`).FindStringSubmatch(p.Type) != nil { - cIn = append(cIn, "uintptr_t", "size_t") - } else if p.Type == "unsafe.Pointer" { - cIn = append(cIn, "uintptr_t") - } else if p.Type == "uintptr" { - cIn = append(cIn, "uintptr_t") - } else if regexp.MustCompile(`^_`).FindStringSubmatch(p.Type) != nil { - cIn = append(cIn, "uintptr_t") - } else if p.Type == "int" { - if (i == 0 || i == 2) && funct == "fcntl" { - // These fcntl arguments needs to be uintptr to be able to call FcntlInt and FcntlFlock - cIn = append(cIn, "uintptr_t") - } else { - cIn = append(cIn, "int") - } - - } else if p.Type == "int32" { - cIn = append(cIn, "int") - } else if p.Type == "int64" { - cIn = append(cIn, "long long") - } else if p.Type == "uint32" { - cIn = append(cIn, "unsigned int") - } else if p.Type == "uint64" { - cIn = append(cIn, "unsigned long long") - } else { - cIn = append(cIn, "int") - } - } - - if !onlyCommon { - // GCCGO Prototype Generation - // Imports of system calls from libc - if sysname == "select" { - // select is a keyword of Go. Its name is - // changed to c_select. - cExtern += "#define c_select select\n" - } - cExtern += fmt.Sprintf("%s %s", cRettype, sysname) - cIn := strings.Join(cIn, ", ") - cExtern += fmt.Sprintf("(%s);\n", cIn) - } - // GC Library name - if modname == "" { - modname = "libc.a/shr_64.o" - } else { - fmt.Fprintf(os.Stderr, "%s: only syscall using libc are available\n", funct) - os.Exit(1) - } - sysvarname := fmt.Sprintf("libc_%s", sysname) - - if !onlyCommon { - // GC Runtime import of function to allow cross-platform builds. - dynimports += fmt.Sprintf("//go:cgo_import_dynamic %s %s \"%s\"\n", sysvarname, sysname, modname) - // GC Link symbol to proc address variable. - linknames += fmt.Sprintf("//go:linkname %s %s\n", sysvarname, sysvarname) - // GC Library proc address variable. - vars = append(vars, sysvarname) - } - - strconvfunc := "BytePtrFromString" - strconvtype := "*byte" - - // Go function header. - if outps != "" { - outps = fmt.Sprintf(" (%s)", outps) - } - if textcommon != "" { - textcommon += "\n" - } - - textcommon += fmt.Sprintf("func %s(%s)%s {\n", funct, strings.Join(in, ", "), outps) - - // Prepare arguments tocall. - var argscommon []string // Arguments in the common part - var argscall []string // Arguments for call prototype - var argsgc []string // Arguments for gc call (with syscall6) - var argsgccgo []string // Arguments for gccgo call (with C.name_of_syscall) - n := 0 - argN := 0 - for _, param := range in { - p := parseParam(param) - if regexp.MustCompile(`^\*`).FindStringSubmatch(p.Type) != nil { - argscommon = append(argscommon, fmt.Sprintf("uintptr(unsafe.Pointer(%s))", p.Name)) - argscall = append(argscall, fmt.Sprintf("%s uintptr", p.Name)) - argsgc = append(argsgc, p.Name) - argsgccgo = append(argsgccgo, fmt.Sprintf("C.uintptr_t(%s)", p.Name)) - } else if p.Type == "string" && errvar != "" { - textcommon += fmt.Sprintf("\tvar _p%d %s\n", n, strconvtype) - textcommon += fmt.Sprintf("\t_p%d, %s = %s(%s)\n", n, errvar, strconvfunc, p.Name) - textcommon += fmt.Sprintf("\tif %s != nil {\n\t\treturn\n\t}\n", errvar) - - argscommon = append(argscommon, fmt.Sprintf("uintptr(unsafe.Pointer(_p%d))", n)) - argscall = append(argscall, fmt.Sprintf("_p%d uintptr ", n)) - argsgc = append(argsgc, fmt.Sprintf("_p%d", n)) - argsgccgo = append(argsgccgo, fmt.Sprintf("C.uintptr_t(_p%d)", n)) - n++ - } else if p.Type == "string" { - fmt.Fprintf(os.Stderr, path+":"+funct+" uses string arguments, but has no error return\n") - textcommon += fmt.Sprintf("\tvar _p%d %s\n", n, strconvtype) - textcommon += fmt.Sprintf("\t_p%d, %s = %s(%s)\n", n, errvar, strconvfunc, p.Name) - textcommon += fmt.Sprintf("\tif %s != nil {\n\t\treturn\n\t}\n", errvar) - - argscommon = append(argscommon, fmt.Sprintf("uintptr(unsafe.Pointer(_p%d))", n)) - argscall = append(argscall, fmt.Sprintf("_p%d uintptr", n)) - argsgc = append(argsgc, fmt.Sprintf("_p%d", n)) - argsgccgo = append(argsgccgo, fmt.Sprintf("C.uintptr_t(_p%d)", n)) - n++ - } else if m := regexp.MustCompile(`^\[\](.*)`).FindStringSubmatch(p.Type); m != nil { - // Convert slice into pointer, length. - // Have to be careful not to take address of &a[0] if len == 0: - // pass nil in that case. - textcommon += fmt.Sprintf("\tvar _p%d *%s\n", n, m[1]) - textcommon += fmt.Sprintf("\tif len(%s) > 0 {\n\t\t_p%d = &%s[0]\n\t}\n", p.Name, n, p.Name) - argscommon = append(argscommon, fmt.Sprintf("uintptr(unsafe.Pointer(_p%d))", n), fmt.Sprintf("len(%s)", p.Name)) - argscall = append(argscall, fmt.Sprintf("_p%d uintptr", n), fmt.Sprintf("_lenp%d int", n)) - argsgc = append(argsgc, fmt.Sprintf("_p%d", n), fmt.Sprintf("uintptr(_lenp%d)", n)) - argsgccgo = append(argsgccgo, fmt.Sprintf("C.uintptr_t(_p%d)", n), fmt.Sprintf("C.size_t(_lenp%d)", n)) - n++ - } else if p.Type == "int64" && endianness != "" { - fmt.Fprintf(os.Stderr, path+":"+funct+" uses int64 with 32 bits mode. Case not yet implemented\n") - } else if p.Type == "bool" { - fmt.Fprintf(os.Stderr, path+":"+funct+" uses bool. Case not yet implemented\n") - } else if regexp.MustCompile(`^_`).FindStringSubmatch(p.Type) != nil || p.Type == "unsafe.Pointer" { - argscommon = append(argscommon, fmt.Sprintf("uintptr(%s)", p.Name)) - argscall = append(argscall, fmt.Sprintf("%s uintptr", p.Name)) - argsgc = append(argsgc, p.Name) - argsgccgo = append(argsgccgo, fmt.Sprintf("C.uintptr_t(%s)", p.Name)) - } else if p.Type == "int" { - if (argN == 0 || argN == 2) && ((funct == "fcntl") || (funct == "FcntlInt") || (funct == "FcntlFlock")) { - // These fcntl arguments need to be uintptr to be able to call FcntlInt and FcntlFlock - argscommon = append(argscommon, fmt.Sprintf("uintptr(%s)", p.Name)) - argscall = append(argscall, fmt.Sprintf("%s uintptr", p.Name)) - argsgc = append(argsgc, p.Name) - argsgccgo = append(argsgccgo, fmt.Sprintf("C.uintptr_t(%s)", p.Name)) - - } else { - argscommon = append(argscommon, p.Name) - argscall = append(argscall, fmt.Sprintf("%s int", p.Name)) - argsgc = append(argsgc, fmt.Sprintf("uintptr(%s)", p.Name)) - argsgccgo = append(argsgccgo, fmt.Sprintf("C.int(%s)", p.Name)) - } - } else if p.Type == "int32" { - argscommon = append(argscommon, p.Name) - argscall = append(argscall, fmt.Sprintf("%s int32", p.Name)) - argsgc = append(argsgc, fmt.Sprintf("uintptr(%s)", p.Name)) - argsgccgo = append(argsgccgo, fmt.Sprintf("C.int(%s)", p.Name)) - } else if p.Type == "int64" { - argscommon = append(argscommon, p.Name) - argscall = append(argscall, fmt.Sprintf("%s int64", p.Name)) - argsgc = append(argsgc, fmt.Sprintf("uintptr(%s)", p.Name)) - argsgccgo = append(argsgccgo, fmt.Sprintf("C.longlong(%s)", p.Name)) - } else if p.Type == "uint32" { - argscommon = append(argscommon, p.Name) - argscall = append(argscall, fmt.Sprintf("%s uint32", p.Name)) - argsgc = append(argsgc, fmt.Sprintf("uintptr(%s)", p.Name)) - argsgccgo = append(argsgccgo, fmt.Sprintf("C.uint(%s)", p.Name)) - } else if p.Type == "uint64" { - argscommon = append(argscommon, p.Name) - argscall = append(argscall, fmt.Sprintf("%s uint64", p.Name)) - argsgc = append(argsgc, fmt.Sprintf("uintptr(%s)", p.Name)) - argsgccgo = append(argsgccgo, fmt.Sprintf("C.ulonglong(%s)", p.Name)) - } else if p.Type == "uintptr" { - argscommon = append(argscommon, p.Name) - argscall = append(argscall, fmt.Sprintf("%s uintptr", p.Name)) - argsgc = append(argsgc, p.Name) - argsgccgo = append(argsgccgo, fmt.Sprintf("C.uintptr_t(%s)", p.Name)) - } else { - argscommon = append(argscommon, fmt.Sprintf("int(%s)", p.Name)) - argscall = append(argscall, fmt.Sprintf("%s int", p.Name)) - argsgc = append(argsgc, fmt.Sprintf("uintptr(%s)", p.Name)) - argsgccgo = append(argsgccgo, fmt.Sprintf("C.int(%s)", p.Name)) - } - argN++ - } - nargs := len(argsgc) - - // COMMON function generation - argscommonlist := strings.Join(argscommon, ", ") - callcommon := fmt.Sprintf("call%s(%s)", sysname, argscommonlist) - ret := []string{"_", "_"} - body := "" - doErrno := false - for i := 0; i < len(out); i++ { - p := parseParam(out[i]) - reg := "" - if p.Name == "err" { - reg = "e1" - ret[1] = reg - doErrno = true - } else { - reg = "r0" - ret[0] = reg - } - if p.Type == "bool" { - reg = fmt.Sprintf("%s != 0", reg) - } - if reg != "e1" { - body += fmt.Sprintf("\t%s = %s(%s)\n", p.Name, p.Type, reg) - } - } - if ret[0] == "_" && ret[1] == "_" { - textcommon += fmt.Sprintf("\t%s\n", callcommon) - } else { - textcommon += fmt.Sprintf("\t%s, %s := %s\n", ret[0], ret[1], callcommon) - } - textcommon += body - - if doErrno { - textcommon += "\tif e1 != 0 {\n" - textcommon += "\t\terr = errnoErr(e1)\n" - textcommon += "\t}\n" - } - textcommon += "\treturn\n" - textcommon += "}\n" - - if onlyCommon { - continue - } - - // CALL Prototype - callProto := fmt.Sprintf("func call%s(%s) (r1 uintptr, e1 Errno) {\n", sysname, strings.Join(argscall, ", ")) - - // GC function generation - asm := "syscall6" - if nonblock != nil { - asm = "rawSyscall6" - } - - if len(argsgc) <= 6 { - for len(argsgc) < 6 { - argsgc = append(argsgc, "0") - } - } else { - fmt.Fprintf(os.Stderr, "%s: too many arguments to system call", funct) - os.Exit(1) - } - argsgclist := strings.Join(argsgc, ", ") - callgc := fmt.Sprintf("%s(uintptr(unsafe.Pointer(&%s)), %d, %s)", asm, sysvarname, nargs, argsgclist) - - textgc += callProto - textgc += fmt.Sprintf("\tr1, _, e1 = %s\n", callgc) - textgc += "\treturn\n}\n" - - // GCCGO function generation - argsgccgolist := strings.Join(argsgccgo, ", ") - var callgccgo string - if sysname == "select" { - // select is a keyword of Go. Its name is - // changed to c_select. - callgccgo = fmt.Sprintf("C.c_%s(%s)", sysname, argsgccgolist) - } else { - callgccgo = fmt.Sprintf("C.%s(%s)", sysname, argsgccgolist) - } - textgccgo += callProto - textgccgo += fmt.Sprintf("\tr1 = uintptr(%s)\n", callgccgo) - textgccgo += "\te1 = syscall.GetErrno()\n" - textgccgo += "\treturn\n}\n" - } - if err := s.Err(); err != nil { - fmt.Fprintf(os.Stderr, err.Error()) - os.Exit(1) - } - file.Close() - } - imp := "" - if pack != "unix" { - imp = "import \"golang.org/x/sys/unix\"\n" - - } - - // Print zsyscall_aix_ppc64.go - err := ioutil.WriteFile("zsyscall_aix_ppc64.go", - []byte(fmt.Sprintf(srcTemplate1, cmdLine(), buildTags(), pack, imp, textcommon)), - 0644) - if err != nil { - fmt.Fprintf(os.Stderr, err.Error()) - os.Exit(1) - } - - // Print zsyscall_aix_ppc64_gc.go - vardecls := "\t" + strings.Join(vars, ",\n\t") - vardecls += " syscallFunc" - err = ioutil.WriteFile("zsyscall_aix_ppc64_gc.go", - []byte(fmt.Sprintf(srcTemplate2, cmdLine(), buildTags(), pack, imp, dynimports, linknames, vardecls, textgc)), - 0644) - if err != nil { - fmt.Fprintf(os.Stderr, err.Error()) - os.Exit(1) - } - - // Print zsyscall_aix_ppc64_gccgo.go - err = ioutil.WriteFile("zsyscall_aix_ppc64_gccgo.go", - []byte(fmt.Sprintf(srcTemplate3, cmdLine(), buildTags(), pack, cExtern, imp, textgccgo)), - 0644) - if err != nil { - fmt.Fprintf(os.Stderr, err.Error()) - os.Exit(1) - } -} - -const srcTemplate1 = `// %s -// Code generated by the command above; see README.md. DO NOT EDIT. - -// +build %s - -package %s - -import ( - "unsafe" -) - - -%s - -%s -` -const srcTemplate2 = `// %s -// Code generated by the command above; see README.md. DO NOT EDIT. - -// +build %s -// +build !gccgo - -package %s - -import ( - "unsafe" -) -%s -%s -%s -type syscallFunc uintptr - -var ( -%s -) - -// Implemented in runtime/syscall_aix.go. -func rawSyscall6(trap, nargs, a1, a2, a3, a4, a5, a6 uintptr) (r1, r2 uintptr, err Errno) -func syscall6(trap, nargs, a1, a2, a3, a4, a5, a6 uintptr) (r1, r2 uintptr, err Errno) - -%s -` -const srcTemplate3 = `// %s -// Code generated by the command above; see README.md. DO NOT EDIT. - -// +build %s -// +build gccgo - -package %s - -%s -*/ -import "C" -import ( - "syscall" -) - - -%s - -%s -` diff --git a/vendor/golang.org/x/sys/unix/mksyscall_solaris.go b/vendor/golang.org/x/sys/unix/mksyscall_solaris.go deleted file mode 100644 index 3d864738..00000000 --- a/vendor/golang.org/x/sys/unix/mksyscall_solaris.go +++ /dev/null @@ -1,335 +0,0 @@ -// Copyright 2019 The Go Authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the LICENSE file. - -// +build ignore - -/* - This program reads a file containing function prototypes - (like syscall_solaris.go) and generates system call bodies. - The prototypes are marked by lines beginning with "//sys" - and read like func declarations if //sys is replaced by func, but: - * The parameter lists must give a name for each argument. - This includes return parameters. - * The parameter lists must give a type for each argument: - the (x, y, z int) shorthand is not allowed. - * If the return parameter is an error number, it must be named err. - * If go func name needs to be different than its libc name, - * or the function is not in libc, name could be specified - * at the end, after "=" sign, like - //sys getsockopt(s int, level int, name int, val uintptr, vallen *_Socklen) (err error) = libsocket.getsockopt -*/ - -package main - -import ( - "bufio" - "flag" - "fmt" - "os" - "regexp" - "strings" -) - -var ( - b32 = flag.Bool("b32", false, "32bit big-endian") - l32 = flag.Bool("l32", false, "32bit little-endian") - tags = flag.String("tags", "", "build tags") -) - -// cmdLine returns this programs's commandline arguments -func cmdLine() string { - return "go run mksyscall_solaris.go " + strings.Join(os.Args[1:], " ") -} - -// buildTags returns build tags -func buildTags() string { - return *tags -} - -// Param is function parameter -type Param struct { - Name string - Type string -} - -// usage prints the program usage -func usage() { - fmt.Fprintf(os.Stderr, "usage: go run mksyscall_solaris.go [-b32 | -l32] [-tags x,y] [file ...]\n") - os.Exit(1) -} - -// parseParamList parses parameter list and returns a slice of parameters -func parseParamList(list string) []string { - list = strings.TrimSpace(list) - if list == "" { - return []string{} - } - return regexp.MustCompile(`\s*,\s*`).Split(list, -1) -} - -// parseParam splits a parameter into name and type -func parseParam(p string) Param { - ps := regexp.MustCompile(`^(\S*) (\S*)$`).FindStringSubmatch(p) - if ps == nil { - fmt.Fprintf(os.Stderr, "malformed parameter: %s\n", p) - os.Exit(1) - } - return Param{ps[1], ps[2]} -} - -func main() { - flag.Usage = usage - flag.Parse() - if len(flag.Args()) <= 0 { - fmt.Fprintf(os.Stderr, "no files to parse provided\n") - usage() - } - - endianness := "" - if *b32 { - endianness = "big-endian" - } else if *l32 { - endianness = "little-endian" - } - - pack := "" - text := "" - dynimports := "" - linknames := "" - var vars []string - for _, path := range flag.Args() { - file, err := os.Open(path) - if err != nil { - fmt.Fprintf(os.Stderr, err.Error()) - os.Exit(1) - } - s := bufio.NewScanner(file) - for s.Scan() { - t := s.Text() - t = strings.TrimSpace(t) - t = regexp.MustCompile(`\s+`).ReplaceAllString(t, ` `) - if p := regexp.MustCompile(`^package (\S+)$`).FindStringSubmatch(t); p != nil && pack == "" { - pack = p[1] - } - nonblock := regexp.MustCompile(`^\/\/sysnb `).FindStringSubmatch(t) - if regexp.MustCompile(`^\/\/sys `).FindStringSubmatch(t) == nil && nonblock == nil { - continue - } - - // Line must be of the form - // func Open(path string, mode int, perm int) (fd int, err error) - // Split into name, in params, out params. - f := regexp.MustCompile(`^\/\/sys(nb)? (\w+)\(([^()]*)\)\s*(?:\(([^()]+)\))?\s*(?:=\s*(?:(\w*)\.)?(\w*))?$`).FindStringSubmatch(t) - if f == nil { - fmt.Fprintf(os.Stderr, "%s:%s\nmalformed //sys declaration\n", path, t) - os.Exit(1) - } - funct, inps, outps, modname, sysname := f[2], f[3], f[4], f[5], f[6] - - // Split argument lists on comma. - in := parseParamList(inps) - out := parseParamList(outps) - - inps = strings.Join(in, ", ") - outps = strings.Join(out, ", ") - - // Try in vain to keep people from editing this file. - // The theory is that they jump into the middle of the file - // without reading the header. - text += "// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT\n\n" - - // So file name. - if modname == "" { - modname = "libc" - } - - // System call name. - if sysname == "" { - sysname = funct - } - - // System call pointer variable name. - sysvarname := fmt.Sprintf("proc%s", sysname) - - strconvfunc := "BytePtrFromString" - strconvtype := "*byte" - - sysname = strings.ToLower(sysname) // All libc functions are lowercase. - - // Runtime import of function to allow cross-platform builds. - dynimports += fmt.Sprintf("//go:cgo_import_dynamic libc_%s %s \"%s.so\"\n", sysname, sysname, modname) - // Link symbol to proc address variable. - linknames += fmt.Sprintf("//go:linkname %s libc_%s\n", sysvarname, sysname) - // Library proc address variable. - vars = append(vars, sysvarname) - - // Go function header. - outlist := strings.Join(out, ", ") - if outlist != "" { - outlist = fmt.Sprintf(" (%s)", outlist) - } - if text != "" { - text += "\n" - } - text += fmt.Sprintf("func %s(%s)%s {\n", funct, strings.Join(in, ", "), outlist) - - // Check if err return available - errvar := "" - for _, param := range out { - p := parseParam(param) - if p.Type == "error" { - errvar = p.Name - continue - } - } - - // Prepare arguments to Syscall. - var args []string - n := 0 - for _, param := range in { - p := parseParam(param) - if regexp.MustCompile(`^\*`).FindStringSubmatch(p.Type) != nil { - args = append(args, "uintptr(unsafe.Pointer("+p.Name+"))") - } else if p.Type == "string" && errvar != "" { - text += fmt.Sprintf("\tvar _p%d %s\n", n, strconvtype) - text += fmt.Sprintf("\t_p%d, %s = %s(%s)\n", n, errvar, strconvfunc, p.Name) - text += fmt.Sprintf("\tif %s != nil {\n\t\treturn\n\t}\n", errvar) - args = append(args, fmt.Sprintf("uintptr(unsafe.Pointer(_p%d))", n)) - n++ - } else if p.Type == "string" { - fmt.Fprintf(os.Stderr, path+":"+funct+" uses string arguments, but has no error return\n") - text += fmt.Sprintf("\tvar _p%d %s\n", n, strconvtype) - text += fmt.Sprintf("\t_p%d, _ = %s(%s)\n", n, strconvfunc, p.Name) - args = append(args, fmt.Sprintf("uintptr(unsafe.Pointer(_p%d))", n)) - n++ - } else if s := regexp.MustCompile(`^\[\](.*)`).FindStringSubmatch(p.Type); s != nil { - // Convert slice into pointer, length. - // Have to be careful not to take address of &a[0] if len == 0: - // pass nil in that case. - text += fmt.Sprintf("\tvar _p%d *%s\n", n, s[1]) - text += fmt.Sprintf("\tif len(%s) > 0 {\n\t\t_p%d = &%s[0]\n\t}\n", p.Name, n, p.Name) - args = append(args, fmt.Sprintf("uintptr(unsafe.Pointer(_p%d))", n), fmt.Sprintf("uintptr(len(%s))", p.Name)) - n++ - } else if p.Type == "int64" && endianness != "" { - if endianness == "big-endian" { - args = append(args, fmt.Sprintf("uintptr(%s>>32)", p.Name), fmt.Sprintf("uintptr(%s)", p.Name)) - } else { - args = append(args, fmt.Sprintf("uintptr(%s)", p.Name), fmt.Sprintf("uintptr(%s>>32)", p.Name)) - } - } else if p.Type == "bool" { - text += fmt.Sprintf("\tvar _p%d uint32\n", n) - text += fmt.Sprintf("\tif %s {\n\t\t_p%d = 1\n\t} else {\n\t\t_p%d = 0\n\t}\n", p.Name, n, n) - args = append(args, fmt.Sprintf("uintptr(_p%d)", n)) - n++ - } else { - args = append(args, fmt.Sprintf("uintptr(%s)", p.Name)) - } - } - nargs := len(args) - - // Determine which form to use; pad args with zeros. - asm := "sysvicall6" - if nonblock != nil { - asm = "rawSysvicall6" - } - if len(args) <= 6 { - for len(args) < 6 { - args = append(args, "0") - } - } else { - fmt.Fprintf(os.Stderr, "%s: too many arguments to system call\n", path) - os.Exit(1) - } - - // Actual call. - arglist := strings.Join(args, ", ") - call := fmt.Sprintf("%s(uintptr(unsafe.Pointer(&%s)), %d, %s)", asm, sysvarname, nargs, arglist) - - // Assign return values. - body := "" - ret := []string{"_", "_", "_"} - doErrno := false - for i := 0; i < len(out); i++ { - p := parseParam(out[i]) - reg := "" - if p.Name == "err" { - reg = "e1" - ret[2] = reg - doErrno = true - } else { - reg = fmt.Sprintf("r%d", i) - ret[i] = reg - } - if p.Type == "bool" { - reg = fmt.Sprintf("%d != 0", reg) - } - if p.Type == "int64" && endianness != "" { - // 64-bit number in r1:r0 or r0:r1. - if i+2 > len(out) { - fmt.Fprintf(os.Stderr, "%s: not enough registers for int64 return\n", path) - os.Exit(1) - } - if endianness == "big-endian" { - reg = fmt.Sprintf("int64(r%d)<<32 | int64(r%d)", i, i+1) - } else { - reg = fmt.Sprintf("int64(r%d)<<32 | int64(r%d)", i+1, i) - } - ret[i] = fmt.Sprintf("r%d", i) - ret[i+1] = fmt.Sprintf("r%d", i+1) - } - if reg != "e1" { - body += fmt.Sprintf("\t%s = %s(%s)\n", p.Name, p.Type, reg) - } - } - if ret[0] == "_" && ret[1] == "_" && ret[2] == "_" { - text += fmt.Sprintf("\t%s\n", call) - } else { - text += fmt.Sprintf("\t%s, %s, %s := %s\n", ret[0], ret[1], ret[2], call) - } - text += body - - if doErrno { - text += "\tif e1 != 0 {\n" - text += "\t\terr = e1\n" - text += "\t}\n" - } - text += "\treturn\n" - text += "}\n" - } - if err := s.Err(); err != nil { - fmt.Fprintf(os.Stderr, err.Error()) - os.Exit(1) - } - file.Close() - } - imp := "" - if pack != "unix" { - imp = "import \"golang.org/x/sys/unix\"\n" - - } - vardecls := "\t" + strings.Join(vars, ",\n\t") - vardecls += " syscallFunc" - fmt.Printf(srcTemplate, cmdLine(), buildTags(), pack, imp, dynimports, linknames, vardecls, text) -} - -const srcTemplate = `// %s -// Code generated by the command above; see README.md. DO NOT EDIT. - -// +build %s - -package %s - -import ( - "syscall" - "unsafe" -) -%s -%s -%s -var ( -%s -) - -%s -` diff --git a/vendor/golang.org/x/sys/unix/mksysctl_openbsd.go b/vendor/golang.org/x/sys/unix/mksysctl_openbsd.go deleted file mode 100644 index b6b40990..00000000 --- a/vendor/golang.org/x/sys/unix/mksysctl_openbsd.go +++ /dev/null @@ -1,355 +0,0 @@ -// Copyright 2019 The Go Authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the LICENSE file. - -// +build ignore - -// Parse the header files for OpenBSD and generate a Go usable sysctl MIB. -// -// Build a MIB with each entry being an array containing the level, type and -// a hash that will contain additional entries if the current entry is a node. -// We then walk this MIB and create a flattened sysctl name to OID hash. - -package main - -import ( - "bufio" - "fmt" - "os" - "path/filepath" - "regexp" - "sort" - "strings" -) - -var ( - goos, goarch string -) - -// cmdLine returns this programs's commandline arguments. -func cmdLine() string { - return "go run mksysctl_openbsd.go " + strings.Join(os.Args[1:], " ") -} - -// buildTags returns build tags. -func buildTags() string { - return fmt.Sprintf("%s,%s", goarch, goos) -} - -// reMatch performs regular expression match and stores the substring slice to value pointed by m. -func reMatch(re *regexp.Regexp, str string, m *[]string) bool { - *m = re.FindStringSubmatch(str) - if *m != nil { - return true - } - return false -} - -type nodeElement struct { - n int - t string - pE *map[string]nodeElement -} - -var ( - debugEnabled bool - mib map[string]nodeElement - node *map[string]nodeElement - nodeMap map[string]string - sysCtl []string -) - -var ( - ctlNames1RE = regexp.MustCompile(`^#define\s+(CTL_NAMES)\s+{`) - ctlNames2RE = regexp.MustCompile(`^#define\s+(CTL_(.*)_NAMES)\s+{`) - ctlNames3RE = regexp.MustCompile(`^#define\s+((.*)CTL_NAMES)\s+{`) - netInetRE = regexp.MustCompile(`^netinet/`) - netInet6RE = regexp.MustCompile(`^netinet6/`) - netRE = regexp.MustCompile(`^net/`) - bracesRE = regexp.MustCompile(`{.*}`) - ctlTypeRE = regexp.MustCompile(`{\s+"(\w+)",\s+(CTLTYPE_[A-Z]+)\s+}`) - fsNetKernRE = regexp.MustCompile(`^(fs|net|kern)_`) -) - -func debug(s string) { - if debugEnabled { - fmt.Fprintln(os.Stderr, s) - } -} - -// Walk the MIB and build a sysctl name to OID mapping. -func buildSysctl(pNode *map[string]nodeElement, name string, oid []int) { - lNode := pNode // local copy of pointer to node - var keys []string - for k := range *lNode { - keys = append(keys, k) - } - sort.Strings(keys) - - for _, key := range keys { - nodename := name - if name != "" { - nodename += "." - } - nodename += key - - nodeoid := append(oid, (*pNode)[key].n) - - if (*pNode)[key].t == `CTLTYPE_NODE` { - if _, ok := nodeMap[nodename]; ok { - lNode = &mib - ctlName := nodeMap[nodename] - for _, part := range strings.Split(ctlName, ".") { - lNode = ((*lNode)[part]).pE - } - } else { - lNode = (*pNode)[key].pE - } - buildSysctl(lNode, nodename, nodeoid) - } else if (*pNode)[key].t != "" { - oidStr := []string{} - for j := range nodeoid { - oidStr = append(oidStr, fmt.Sprintf("%d", nodeoid[j])) - } - text := "\t{ \"" + nodename + "\", []_C_int{ " + strings.Join(oidStr, ", ") + " } }, \n" - sysCtl = append(sysCtl, text) - } - } -} - -func main() { - // Get the OS (using GOOS_TARGET if it exist) - goos = os.Getenv("GOOS_TARGET") - if goos == "" { - goos = os.Getenv("GOOS") - } - // Get the architecture (using GOARCH_TARGET if it exists) - goarch = os.Getenv("GOARCH_TARGET") - if goarch == "" { - goarch = os.Getenv("GOARCH") - } - // Check if GOOS and GOARCH environment variables are defined - if goarch == "" || goos == "" { - fmt.Fprintf(os.Stderr, "GOARCH or GOOS not defined in environment\n") - os.Exit(1) - } - - mib = make(map[string]nodeElement) - headers := [...]string{ - `sys/sysctl.h`, - `sys/socket.h`, - `sys/tty.h`, - `sys/malloc.h`, - `sys/mount.h`, - `sys/namei.h`, - `sys/sem.h`, - `sys/shm.h`, - `sys/vmmeter.h`, - `uvm/uvmexp.h`, - `uvm/uvm_param.h`, - `uvm/uvm_swap_encrypt.h`, - `ddb/db_var.h`, - `net/if.h`, - `net/if_pfsync.h`, - `net/pipex.h`, - `netinet/in.h`, - `netinet/icmp_var.h`, - `netinet/igmp_var.h`, - `netinet/ip_ah.h`, - `netinet/ip_carp.h`, - `netinet/ip_divert.h`, - `netinet/ip_esp.h`, - `netinet/ip_ether.h`, - `netinet/ip_gre.h`, - `netinet/ip_ipcomp.h`, - `netinet/ip_ipip.h`, - `netinet/pim_var.h`, - `netinet/tcp_var.h`, - `netinet/udp_var.h`, - `netinet6/in6.h`, - `netinet6/ip6_divert.h`, - `netinet6/pim6_var.h`, - `netinet/icmp6.h`, - `netmpls/mpls.h`, - } - - ctls := [...]string{ - `kern`, - `vm`, - `fs`, - `net`, - //debug /* Special handling required */ - `hw`, - //machdep /* Arch specific */ - `user`, - `ddb`, - //vfs /* Special handling required */ - `fs.posix`, - `kern.forkstat`, - `kern.intrcnt`, - `kern.malloc`, - `kern.nchstats`, - `kern.seminfo`, - `kern.shminfo`, - `kern.timecounter`, - `kern.tty`, - `kern.watchdog`, - `net.bpf`, - `net.ifq`, - `net.inet`, - `net.inet.ah`, - `net.inet.carp`, - `net.inet.divert`, - `net.inet.esp`, - `net.inet.etherip`, - `net.inet.gre`, - `net.inet.icmp`, - `net.inet.igmp`, - `net.inet.ip`, - `net.inet.ip.ifq`, - `net.inet.ipcomp`, - `net.inet.ipip`, - `net.inet.mobileip`, - `net.inet.pfsync`, - `net.inet.pim`, - `net.inet.tcp`, - `net.inet.udp`, - `net.inet6`, - `net.inet6.divert`, - `net.inet6.ip6`, - `net.inet6.icmp6`, - `net.inet6.pim6`, - `net.inet6.tcp6`, - `net.inet6.udp6`, - `net.mpls`, - `net.mpls.ifq`, - `net.key`, - `net.pflow`, - `net.pfsync`, - `net.pipex`, - `net.rt`, - `vm.swapencrypt`, - //vfsgenctl /* Special handling required */ - } - - // Node name "fixups" - ctlMap := map[string]string{ - "ipproto": "net.inet", - "net.inet.ipproto": "net.inet", - "net.inet6.ipv6proto": "net.inet6", - "net.inet6.ipv6": "net.inet6.ip6", - "net.inet.icmpv6": "net.inet6.icmp6", - "net.inet6.divert6": "net.inet6.divert", - "net.inet6.tcp6": "net.inet.tcp", - "net.inet6.udp6": "net.inet.udp", - "mpls": "net.mpls", - "swpenc": "vm.swapencrypt", - } - - // Node mappings - nodeMap = map[string]string{ - "net.inet.ip.ifq": "net.ifq", - "net.inet.pfsync": "net.pfsync", - "net.mpls.ifq": "net.ifq", - } - - mCtls := make(map[string]bool) - for _, ctl := range ctls { - mCtls[ctl] = true - } - - for _, header := range headers { - debug("Processing " + header) - file, err := os.Open(filepath.Join("/usr/include", header)) - if err != nil { - fmt.Fprintf(os.Stderr, "%v\n", err) - os.Exit(1) - } - s := bufio.NewScanner(file) - for s.Scan() { - var sub []string - if reMatch(ctlNames1RE, s.Text(), &sub) || - reMatch(ctlNames2RE, s.Text(), &sub) || - reMatch(ctlNames3RE, s.Text(), &sub) { - if sub[1] == `CTL_NAMES` { - // Top level. - node = &mib - } else { - // Node. - nodename := strings.ToLower(sub[2]) - ctlName := "" - if reMatch(netInetRE, header, &sub) { - ctlName = "net.inet." + nodename - } else if reMatch(netInet6RE, header, &sub) { - ctlName = "net.inet6." + nodename - } else if reMatch(netRE, header, &sub) { - ctlName = "net." + nodename - } else { - ctlName = nodename - ctlName = fsNetKernRE.ReplaceAllString(ctlName, `$1.`) - } - - if val, ok := ctlMap[ctlName]; ok { - ctlName = val - } - if _, ok := mCtls[ctlName]; !ok { - debug("Ignoring " + ctlName + "...") - continue - } - - // Walk down from the top of the MIB. - node = &mib - for _, part := range strings.Split(ctlName, ".") { - if _, ok := (*node)[part]; !ok { - debug("Missing node " + part) - (*node)[part] = nodeElement{n: 0, t: "", pE: &map[string]nodeElement{}} - } - node = (*node)[part].pE - } - } - - // Populate current node with entries. - i := -1 - for !strings.HasPrefix(s.Text(), "}") { - s.Scan() - if reMatch(bracesRE, s.Text(), &sub) { - i++ - } - if !reMatch(ctlTypeRE, s.Text(), &sub) { - continue - } - (*node)[sub[1]] = nodeElement{n: i, t: sub[2], pE: &map[string]nodeElement{}} - } - } - } - err = s.Err() - if err != nil { - fmt.Fprintf(os.Stderr, "%v\n", err) - os.Exit(1) - } - file.Close() - } - buildSysctl(&mib, "", []int{}) - - sort.Strings(sysCtl) - text := strings.Join(sysCtl, "") - - fmt.Printf(srcTemplate, cmdLine(), buildTags(), text) -} - -const srcTemplate = `// %s -// Code generated by the command above; DO NOT EDIT. - -// +build %s - -package unix - -type mibentry struct { - ctlname string - ctloid []_C_int -} - -var sysctlMib = []mibentry { -%s -} -` diff --git a/vendor/golang.org/x/sys/unix/mksysnum.go b/vendor/golang.org/x/sys/unix/mksysnum.go deleted file mode 100644 index baa6ecd8..00000000 --- a/vendor/golang.org/x/sys/unix/mksysnum.go +++ /dev/null @@ -1,190 +0,0 @@ -// Copyright 2018 The Go Authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the LICENSE file. - -// +build ignore - -// Generate system call table for DragonFly, NetBSD, -// FreeBSD, OpenBSD or Darwin from master list -// (for example, /usr/src/sys/kern/syscalls.master or -// sys/syscall.h). -package main - -import ( - "bufio" - "fmt" - "io" - "io/ioutil" - "net/http" - "os" - "regexp" - "strings" -) - -var ( - goos, goarch string -) - -// cmdLine returns this programs's commandline arguments -func cmdLine() string { - return "go run mksysnum.go " + strings.Join(os.Args[1:], " ") -} - -// buildTags returns build tags -func buildTags() string { - return fmt.Sprintf("%s,%s", goarch, goos) -} - -func checkErr(err error) { - if err != nil { - fmt.Fprintf(os.Stderr, "%v\n", err) - os.Exit(1) - } -} - -// source string and substring slice for regexp -type re struct { - str string // source string - sub []string // matched sub-string -} - -// Match performs regular expression match -func (r *re) Match(exp string) bool { - r.sub = regexp.MustCompile(exp).FindStringSubmatch(r.str) - if r.sub != nil { - return true - } - return false -} - -// fetchFile fetches a text file from URL -func fetchFile(URL string) io.Reader { - resp, err := http.Get(URL) - checkErr(err) - defer resp.Body.Close() - body, err := ioutil.ReadAll(resp.Body) - checkErr(err) - return strings.NewReader(string(body)) -} - -// readFile reads a text file from path -func readFile(path string) io.Reader { - file, err := os.Open(os.Args[1]) - checkErr(err) - return file -} - -func format(name, num, proto string) string { - name = strings.ToUpper(name) - // There are multiple entries for enosys and nosys, so comment them out. - nm := re{str: name} - if nm.Match(`^SYS_E?NOSYS$`) { - name = fmt.Sprintf("// %s", name) - } - if name == `SYS_SYS_EXIT` { - name = `SYS_EXIT` - } - return fmt.Sprintf(" %s = %s; // %s\n", name, num, proto) -} - -func main() { - // Get the OS (using GOOS_TARGET if it exist) - goos = os.Getenv("GOOS_TARGET") - if goos == "" { - goos = os.Getenv("GOOS") - } - // Get the architecture (using GOARCH_TARGET if it exists) - goarch = os.Getenv("GOARCH_TARGET") - if goarch == "" { - goarch = os.Getenv("GOARCH") - } - // Check if GOOS and GOARCH environment variables are defined - if goarch == "" || goos == "" { - fmt.Fprintf(os.Stderr, "GOARCH or GOOS not defined in environment\n") - os.Exit(1) - } - - file := strings.TrimSpace(os.Args[1]) - var syscalls io.Reader - if strings.HasPrefix(file, "https://") || strings.HasPrefix(file, "http://") { - // Download syscalls.master file - syscalls = fetchFile(file) - } else { - syscalls = readFile(file) - } - - var text, line string - s := bufio.NewScanner(syscalls) - for s.Scan() { - t := re{str: line} - if t.Match(`^(.*)\\$`) { - // Handle continuation - line = t.sub[1] - line += strings.TrimLeft(s.Text(), " \t") - } else { - // New line - line = s.Text() - } - t = re{str: line} - if t.Match(`\\$`) { - continue - } - t = re{str: line} - - switch goos { - case "dragonfly": - if t.Match(`^([0-9]+)\s+STD\s+({ \S+\s+(\w+).*)$`) { - num, proto := t.sub[1], t.sub[2] - name := fmt.Sprintf("SYS_%s", t.sub[3]) - text += format(name, num, proto) - } - case "freebsd": - if t.Match(`^([0-9]+)\s+\S+\s+(?:(?:NO)?STD|COMPAT10)\s+({ \S+\s+(\w+).*)$`) { - num, proto := t.sub[1], t.sub[2] - name := fmt.Sprintf("SYS_%s", t.sub[3]) - text += format(name, num, proto) - } - case "openbsd": - if t.Match(`^([0-9]+)\s+STD\s+(NOLOCK\s+)?({ \S+\s+\*?(\w+).*)$`) { - num, proto, name := t.sub[1], t.sub[3], t.sub[4] - text += format(name, num, proto) - } - case "netbsd": - if t.Match(`^([0-9]+)\s+((STD)|(NOERR))\s+(RUMP\s+)?({\s+\S+\s*\*?\s*\|(\S+)\|(\S*)\|(\w+).*\s+})(\s+(\S+))?$`) { - num, proto, compat := t.sub[1], t.sub[6], t.sub[8] - name := t.sub[7] + "_" + t.sub[9] - if t.sub[11] != "" { - name = t.sub[7] + "_" + t.sub[11] - } - name = strings.ToUpper(name) - if compat == "" || compat == "13" || compat == "30" || compat == "50" { - text += fmt.Sprintf(" %s = %s; // %s\n", name, num, proto) - } - } - case "darwin": - if t.Match(`^#define\s+SYS_(\w+)\s+([0-9]+)`) { - name, num := t.sub[1], t.sub[2] - name = strings.ToUpper(name) - text += fmt.Sprintf(" SYS_%s = %s;\n", name, num) - } - default: - fmt.Fprintf(os.Stderr, "unrecognized GOOS=%s\n", goos) - os.Exit(1) - - } - } - err := s.Err() - checkErr(err) - - fmt.Printf(template, cmdLine(), buildTags(), text) -} - -const template = `// %s -// Code generated by the command above; see README.md. DO NOT EDIT. - -// +build %s - -package unix - -const( -%s)` diff --git a/vendor/golang.org/x/sys/unix/syscall_bsd.go b/vendor/golang.org/x/sys/unix/syscall_bsd.go index c7040549..68605db6 100644 --- a/vendor/golang.org/x/sys/unix/syscall_bsd.go +++ b/vendor/golang.org/x/sys/unix/syscall_bsd.go @@ -510,6 +510,23 @@ func SysctlRaw(name string, args ...int) ([]byte, error) { return buf[:n], nil } +func SysctlClockinfo(name string) (*Clockinfo, error) { + mib, err := sysctlmib(name) + if err != nil { + return nil, err + } + + n := uintptr(SizeofClockinfo) + var ci Clockinfo + if err := sysctl(mib, (*byte)(unsafe.Pointer(&ci)), &n, nil, 0); err != nil { + return nil, err + } + if n != SizeofClockinfo { + return nil, EIO + } + return &ci, nil +} + //sys utimes(path string, timeval *[2]Timeval) (err error) func Utimes(path string, tv []Timeval) error { diff --git a/vendor/golang.org/x/sys/unix/syscall_darwin.go b/vendor/golang.org/x/sys/unix/syscall_darwin.go index 3440c52e..9a5a6ee5 100644 --- a/vendor/golang.org/x/sys/unix/syscall_darwin.go +++ b/vendor/golang.org/x/sys/unix/syscall_darwin.go @@ -155,23 +155,6 @@ func getAttrList(path string, attrList attrList, attrBuf []byte, options uint) ( //sys getattrlist(path *byte, list unsafe.Pointer, buf unsafe.Pointer, size uintptr, options int) (err error) -func SysctlClockinfo(name string) (*Clockinfo, error) { - mib, err := sysctlmib(name) - if err != nil { - return nil, err - } - - n := uintptr(SizeofClockinfo) - var ci Clockinfo - if err := sysctl(mib, (*byte)(unsafe.Pointer(&ci)), &n, nil, 0); err != nil { - return nil, err - } - if n != SizeofClockinfo { - return nil, EIO - } - return &ci, nil -} - //sysnb pipe() (r int, w int, err error) func Pipe(p []int) (err error) { diff --git a/vendor/golang.org/x/sys/unix/syscall_freebsd.go b/vendor/golang.org/x/sys/unix/syscall_freebsd.go index 34918d8e..6b2eca49 100644 --- a/vendor/golang.org/x/sys/unix/syscall_freebsd.go +++ b/vendor/golang.org/x/sys/unix/syscall_freebsd.go @@ -529,12 +529,6 @@ func PtraceGetRegs(pid int, regsout *Reg) (err error) { return ptrace(PTRACE_GETREGS, pid, uintptr(unsafe.Pointer(regsout)), 0) } -func PtraceIO(req int, pid int, addr uintptr, out []byte, countin int) (count int, err error) { - ioDesc := PtraceIoDesc{Op: int32(req), Offs: (*byte)(unsafe.Pointer(addr)), Addr: (*byte)(unsafe.Pointer(&out[0])), Len: uint(countin)} - err = ptrace(PTRACE_IO, pid, uintptr(unsafe.Pointer(&ioDesc)), 0) - return int(ioDesc.Len), err -} - func PtraceLwpEvents(pid int, enable int) (err error) { return ptrace(PTRACE_LWPEVENTS, pid, 0, enable) } diff --git a/vendor/golang.org/x/sys/unix/syscall_freebsd_386.go b/vendor/golang.org/x/sys/unix/syscall_freebsd_386.go index dcc56457..0a5a66fa 100644 --- a/vendor/golang.org/x/sys/unix/syscall_freebsd_386.go +++ b/vendor/golang.org/x/sys/unix/syscall_freebsd_386.go @@ -54,3 +54,9 @@ func sendfile(outfd int, infd int, offset *int64, count int) (written int, err e } func Syscall9(num, a1, a2, a3, a4, a5, a6, a7, a8, a9 uintptr) (r1, r2 uintptr, err syscall.Errno) + +func PtraceIO(req int, pid int, addr uintptr, out []byte, countin int) (count int, err error) { + ioDesc := PtraceIoDesc{Op: int32(req), Offs: (*byte)(unsafe.Pointer(addr)), Addr: (*byte)(unsafe.Pointer(&out[0])), Len: uint32(countin)} + err = ptrace(PTRACE_IO, pid, uintptr(unsafe.Pointer(&ioDesc)), 0) + return int(ioDesc.Len), err +} diff --git a/vendor/golang.org/x/sys/unix/syscall_freebsd_amd64.go b/vendor/golang.org/x/sys/unix/syscall_freebsd_amd64.go index 321c3bac..8025b22d 100644 --- a/vendor/golang.org/x/sys/unix/syscall_freebsd_amd64.go +++ b/vendor/golang.org/x/sys/unix/syscall_freebsd_amd64.go @@ -54,3 +54,9 @@ func sendfile(outfd int, infd int, offset *int64, count int) (written int, err e } func Syscall9(num, a1, a2, a3, a4, a5, a6, a7, a8, a9 uintptr) (r1, r2 uintptr, err syscall.Errno) + +func PtraceIO(req int, pid int, addr uintptr, out []byte, countin int) (count int, err error) { + ioDesc := PtraceIoDesc{Op: int32(req), Offs: (*byte)(unsafe.Pointer(addr)), Addr: (*byte)(unsafe.Pointer(&out[0])), Len: uint64(countin)} + err = ptrace(PTRACE_IO, pid, uintptr(unsafe.Pointer(&ioDesc)), 0) + return int(ioDesc.Len), err +} diff --git a/vendor/golang.org/x/sys/unix/syscall_freebsd_arm.go b/vendor/golang.org/x/sys/unix/syscall_freebsd_arm.go index 69770083..4ea45bce 100644 --- a/vendor/golang.org/x/sys/unix/syscall_freebsd_arm.go +++ b/vendor/golang.org/x/sys/unix/syscall_freebsd_arm.go @@ -54,3 +54,9 @@ func sendfile(outfd int, infd int, offset *int64, count int) (written int, err e } func Syscall9(num, a1, a2, a3, a4, a5, a6, a7, a8, a9 uintptr) (r1, r2 uintptr, err syscall.Errno) + +func PtraceIO(req int, pid int, addr uintptr, out []byte, countin int) (count int, err error) { + ioDesc := PtraceIoDesc{Op: int32(req), Offs: (*byte)(unsafe.Pointer(addr)), Addr: (*byte)(unsafe.Pointer(&out[0])), Len: uint32(countin)} + err = ptrace(PTRACE_IO, pid, uintptr(unsafe.Pointer(&ioDesc)), 0) + return int(ioDesc.Len), err +} diff --git a/vendor/golang.org/x/sys/unix/syscall_freebsd_arm64.go b/vendor/golang.org/x/sys/unix/syscall_freebsd_arm64.go index dbbbfd60..aa5326db 100644 --- a/vendor/golang.org/x/sys/unix/syscall_freebsd_arm64.go +++ b/vendor/golang.org/x/sys/unix/syscall_freebsd_arm64.go @@ -54,3 +54,9 @@ func sendfile(outfd int, infd int, offset *int64, count int) (written int, err e } func Syscall9(num, a1, a2, a3, a4, a5, a6, a7, a8, a9 uintptr) (r1, r2 uintptr, err syscall.Errno) + +func PtraceIO(req int, pid int, addr uintptr, out []byte, countin int) (count int, err error) { + ioDesc := PtraceIoDesc{Op: int32(req), Offs: (*byte)(unsafe.Pointer(addr)), Addr: (*byte)(unsafe.Pointer(&out[0])), Len: uint64(countin)} + err = ptrace(PTRACE_IO, pid, uintptr(unsafe.Pointer(&ioDesc)), 0) + return int(ioDesc.Len), err +} diff --git a/vendor/golang.org/x/sys/unix/syscall_linux.go b/vendor/golang.org/x/sys/unix/syscall_linux.go index b8837fcc..95f7a159 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux.go @@ -1555,8 +1555,8 @@ func Sendfile(outfd int, infd int, offset *int64, count int) (written int, err e //sys Acct(path string) (err error) //sys AddKey(keyType string, description string, payload []byte, ringid int) (id int, err error) //sys Adjtimex(buf *Timex) (state int, err error) -//sys Capget(hdr *CapUserHeader, data *CapUserData) (err error) -//sys Capset(hdr *CapUserHeader, data *CapUserData) (err error) +//sysnb Capget(hdr *CapUserHeader, data *CapUserData) (err error) +//sysnb Capset(hdr *CapUserHeader, data *CapUserData) (err error) //sys Chdir(path string) (err error) //sys Chroot(path string) (err error) //sys ClockGetres(clockid int32, res *Timespec) (err error) @@ -1654,6 +1654,30 @@ func Setgid(uid int) (err error) { return EOPNOTSUPP } +// SetfsgidRetGid sets fsgid for current thread and returns previous fsgid set. +// setfsgid(2) will return a non-nil error only if its caller lacks CAP_SETUID capability. +// If the call fails due to other reasons, current fsgid will be returned. +func SetfsgidRetGid(gid int) (int, error) { + return setfsgid(gid) +} + +// SetfsuidRetUid sets fsuid for current thread and returns previous fsuid set. +// setfsgid(2) will return a non-nil error only if its caller lacks CAP_SETUID capability +// If the call fails due to other reasons, current fsuid will be returned. +func SetfsuidRetUid(uid int) (int, error) { + return setfsuid(uid) +} + +func Setfsgid(gid int) error { + _, err := setfsgid(gid) + return err +} + +func Setfsuid(uid int) error { + _, err := setfsuid(uid) + return err +} + func Signalfd(fd int, sigmask *Sigset_t, flags int) (newfd int, err error) { return signalfd(fd, sigmask, _C__NSIG/8, flags) } diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_386.go b/vendor/golang.org/x/sys/unix/syscall_linux_386.go index e7fa665e..a8374b67 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_386.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_386.go @@ -70,8 +70,8 @@ func Pipe2(p []int, flags int) (err error) { //sys Pwrite(fd int, p []byte, offset int64) (n int, err error) = SYS_PWRITE64 //sys Renameat(olddirfd int, oldpath string, newdirfd int, newpath string) (err error) //sys sendfile(outfd int, infd int, offset *int64, count int) (written int, err error) = SYS_SENDFILE64 -//sys Setfsgid(gid int) (err error) = SYS_SETFSGID32 -//sys Setfsuid(uid int) (err error) = SYS_SETFSUID32 +//sys setfsgid(gid int) (prev int, err error) = SYS_SETFSGID32 +//sys setfsuid(uid int) (prev int, err error) = SYS_SETFSUID32 //sysnb Setregid(rgid int, egid int) (err error) = SYS_SETREGID32 //sysnb Setresgid(rgid int, egid int, sgid int) (err error) = SYS_SETRESGID32 //sysnb Setresuid(ruid int, euid int, suid int) (err error) = SYS_SETRESUID32 diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_amd64.go b/vendor/golang.org/x/sys/unix/syscall_linux_amd64.go index 088ce0f9..8ed1d546 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_amd64.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_amd64.go @@ -55,8 +55,8 @@ func Select(nfd int, r *FdSet, w *FdSet, e *FdSet, timeout *Timeval) (n int, err } //sys sendfile(outfd int, infd int, offset *int64, count int) (written int, err error) -//sys Setfsgid(gid int) (err error) -//sys Setfsuid(uid int) (err error) +//sys setfsgid(gid int) (prev int, err error) +//sys setfsuid(uid int) (prev int, err error) //sysnb Setregid(rgid int, egid int) (err error) //sysnb Setresgid(rgid int, egid int, sgid int) (err error) //sysnb Setresuid(ruid int, euid int, suid int) (err error) diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_arm.go b/vendor/golang.org/x/sys/unix/syscall_linux_arm.go index 11930fc8..99ae6137 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_arm.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_arm.go @@ -98,8 +98,8 @@ func Seek(fd int, offset int64, whence int) (newoffset int64, err error) { //sys Renameat(olddirfd int, oldpath string, newdirfd int, newpath string) (err error) //sys sendfile(outfd int, infd int, offset *int64, count int) (written int, err error) = SYS_SENDFILE64 //sys Select(nfd int, r *FdSet, w *FdSet, e *FdSet, timeout *Timeval) (n int, err error) = SYS__NEWSELECT -//sys Setfsgid(gid int) (err error) = SYS_SETFSGID32 -//sys Setfsuid(uid int) (err error) = SYS_SETFSUID32 +//sys setfsgid(gid int) (prev int, err error) = SYS_SETFSGID32 +//sys setfsuid(uid int) (prev int, err error) = SYS_SETFSUID32 //sysnb Setregid(rgid int, egid int) (err error) = SYS_SETREGID32 //sysnb Setresgid(rgid int, egid int, sgid int) (err error) = SYS_SETRESGID32 //sysnb Setresuid(ruid int, euid int, suid int) (err error) = SYS_SETRESUID32 diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_arm64.go b/vendor/golang.org/x/sys/unix/syscall_linux_arm64.go index 251e2d97..807a0b20 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_arm64.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_arm64.go @@ -42,8 +42,8 @@ func Select(nfd int, r *FdSet, w *FdSet, e *FdSet, timeout *Timeval) (n int, err } //sys sendfile(outfd int, infd int, offset *int64, count int) (written int, err error) -//sys Setfsgid(gid int) (err error) -//sys Setfsuid(uid int) (err error) +//sys setfsgid(gid int) (prev int, err error) +//sys setfsuid(uid int) (prev int, err error) //sysnb Setregid(rgid int, egid int) (err error) //sysnb Setresgid(rgid int, egid int, sgid int) (err error) //sysnb Setresuid(ruid int, euid int, suid int) (err error) diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_mips64x.go b/vendor/golang.org/x/sys/unix/syscall_linux_mips64x.go index 7562fe97..af77e6e2 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_mips64x.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_mips64x.go @@ -36,8 +36,8 @@ func Select(nfd int, r *FdSet, w *FdSet, e *FdSet, timeout *Timeval) (n int, err } //sys sendfile(outfd int, infd int, offset *int64, count int) (written int, err error) -//sys Setfsgid(gid int) (err error) -//sys Setfsuid(uid int) (err error) +//sys setfsgid(gid int) (prev int, err error) +//sys setfsuid(uid int) (prev int, err error) //sysnb Setregid(rgid int, egid int) (err error) //sysnb Setresgid(rgid int, egid int, sgid int) (err error) //sysnb Setresuid(ruid int, euid int, suid int) (err error) @@ -216,6 +216,10 @@ func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint64(length) } +func InotifyInit() (fd int, err error) { + return InotifyInit1(0) +} + //sys poll(fds *PollFd, nfds int, timeout int) (n int, err error) func Poll(fds []PollFd, timeout int) (n int, err error) { diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_mipsx.go b/vendor/golang.org/x/sys/unix/syscall_linux_mipsx.go index a939ff8f..e286c6ba 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_mipsx.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_mipsx.go @@ -31,8 +31,8 @@ func Syscall9(trap, a1, a2, a3, a4, a5, a6, a7, a8, a9 uintptr) (r1, r2 uintptr, //sys Renameat(olddirfd int, oldpath string, newdirfd int, newpath string) (err error) //sys Select(nfd int, r *FdSet, w *FdSet, e *FdSet, timeout *Timeval) (n int, err error) = SYS__NEWSELECT //sys sendfile(outfd int, infd int, offset *int64, count int) (written int, err error) = SYS_SENDFILE64 -//sys Setfsgid(gid int) (err error) -//sys Setfsuid(uid int) (err error) +//sys setfsgid(gid int) (prev int, err error) +//sys setfsuid(uid int) (prev int, err error) //sysnb Setregid(rgid int, egid int) (err error) //sysnb Setresgid(rgid int, egid int, sgid int) (err error) //sysnb Setresuid(ruid int, euid int, suid int) (err error) diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_ppc64x.go b/vendor/golang.org/x/sys/unix/syscall_linux_ppc64x.go index 28d6d0f2..ca0345aa 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_ppc64x.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_ppc64x.go @@ -34,8 +34,8 @@ package unix //sys Seek(fd int, offset int64, whence int) (off int64, err error) = SYS_LSEEK //sys Select(nfd int, r *FdSet, w *FdSet, e *FdSet, timeout *Timeval) (n int, err error) = SYS__NEWSELECT //sys sendfile(outfd int, infd int, offset *int64, count int) (written int, err error) -//sys Setfsgid(gid int) (err error) -//sys Setfsuid(uid int) (err error) +//sys setfsgid(gid int) (prev int, err error) +//sys setfsuid(uid int) (prev int, err error) //sysnb Setregid(rgid int, egid int) (err error) //sysnb Setresgid(rgid int, egid int, sgid int) (err error) //sysnb Setresuid(ruid int, euid int, suid int) (err error) diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_riscv64.go b/vendor/golang.org/x/sys/unix/syscall_linux_riscv64.go index 6798c262..abdabbac 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_riscv64.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_riscv64.go @@ -41,8 +41,8 @@ func Select(nfd int, r *FdSet, w *FdSet, e *FdSet, timeout *Timeval) (n int, err } //sys sendfile(outfd int, infd int, offset *int64, count int) (written int, err error) -//sys Setfsgid(gid int) (err error) -//sys Setfsuid(uid int) (err error) +//sys setfsgid(gid int) (prev int, err error) +//sys setfsuid(uid int) (prev int, err error) //sysnb Setregid(rgid int, egid int) (err error) //sysnb Setresgid(rgid int, egid int, sgid int) (err error) //sysnb Setresuid(ruid int, euid int, suid int) (err error) diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_s390x.go b/vendor/golang.org/x/sys/unix/syscall_linux_s390x.go index eb5cb1a7..533e9305 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_s390x.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_s390x.go @@ -34,8 +34,8 @@ import ( //sys Seek(fd int, offset int64, whence int) (off int64, err error) = SYS_LSEEK //sys Select(nfd int, r *FdSet, w *FdSet, e *FdSet, timeout *Timeval) (n int, err error) //sys sendfile(outfd int, infd int, offset *int64, count int) (written int, err error) -//sys Setfsgid(gid int) (err error) -//sys Setfsuid(uid int) (err error) +//sys setfsgid(gid int) (prev int, err error) +//sys setfsuid(uid int) (prev int, err error) //sysnb Setregid(rgid int, egid int) (err error) //sysnb Setresgid(rgid int, egid int, sgid int) (err error) //sysnb Setresuid(ruid int, euid int, suid int) (err error) diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_sparc64.go b/vendor/golang.org/x/sys/unix/syscall_linux_sparc64.go index 37321c12..d890a227 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_sparc64.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_sparc64.go @@ -30,8 +30,8 @@ package unix //sys Seek(fd int, offset int64, whence int) (off int64, err error) = SYS_LSEEK //sys Select(nfd int, r *FdSet, w *FdSet, e *FdSet, timeout *Timeval) (n int, err error) //sys sendfile(outfd int, infd int, offset *int64, count int) (written int, err error) -//sys Setfsgid(gid int) (err error) -//sys Setfsuid(uid int) (err error) +//sys setfsgid(gid int) (prev int, err error) +//sys setfsuid(uid int) (prev int, err error) //sysnb Setregid(rgid int, egid int) (err error) //sysnb Setresgid(rgid int, egid int, sgid int) (err error) //sysnb Setresuid(ruid int, euid int, suid int) (err error) diff --git a/vendor/golang.org/x/sys/unix/syscall_netbsd.go b/vendor/golang.org/x/sys/unix/syscall_netbsd.go index c9e9fcb0..45b50a61 100644 --- a/vendor/golang.org/x/sys/unix/syscall_netbsd.go +++ b/vendor/golang.org/x/sys/unix/syscall_netbsd.go @@ -106,23 +106,6 @@ func direntNamlen(buf []byte) (uint64, bool) { return readInt(buf, unsafe.Offsetof(Dirent{}.Namlen), unsafe.Sizeof(Dirent{}.Namlen)) } -func SysctlClockinfo(name string) (*Clockinfo, error) { - mib, err := sysctlmib(name) - if err != nil { - return nil, err - } - - n := uintptr(SizeofClockinfo) - var ci Clockinfo - if err := sysctl(mib, (*byte)(unsafe.Pointer(&ci)), &n, nil, 0); err != nil { - return nil, err - } - if n != SizeofClockinfo { - return nil, EIO - } - return &ci, nil -} - //sysnb pipe() (fd1 int, fd2 int, err error) func Pipe(p []int) (err error) { if len(p) != 2 { @@ -296,7 +279,7 @@ func Statvfs(path string, buf *Statvfs_t) (err error) { //sys Fpathconf(fd int, name int) (val int, err error) //sys Fstat(fd int, stat *Stat_t) (err error) //sys Fstatat(fd int, path string, stat *Stat_t, flags int) (err error) -//sys Fstatvfs1(fd int, buf *Statvfs_t) (err error) = SYS_FSTATVFS1 +//sys Fstatvfs1(fd int, buf *Statvfs_t, flags int) (err error) = SYS_FSTATVFS1 //sys Fsync(fd int) (err error) //sys Ftruncate(fd int, length int64) (err error) //sysnb Getegid() (egid int) @@ -353,7 +336,7 @@ func Statvfs(path string, buf *Statvfs_t) (err error) { //sysnb Settimeofday(tp *Timeval) (err error) //sysnb Setuid(uid int) (err error) //sys Stat(path string, stat *Stat_t) (err error) -//sys Statvfs1(path string, buf *Statvfs_t) (err error) = SYS_STATVFS1 +//sys Statvfs1(path string, buf *Statvfs_t, flags int) (err error) = SYS_STATVFS1 //sys Symlink(path string, link string) (err error) //sys Symlinkat(oldpath string, newdirfd int, newpath string) (err error) //sys Sync() (err error) diff --git a/vendor/golang.org/x/sys/unix/syscall_openbsd.go b/vendor/golang.org/x/sys/unix/syscall_openbsd.go index 5628a68b..a266e92a 100644 --- a/vendor/golang.org/x/sys/unix/syscall_openbsd.go +++ b/vendor/golang.org/x/sys/unix/syscall_openbsd.go @@ -55,23 +55,6 @@ func direntNamlen(buf []byte) (uint64, bool) { return readInt(buf, unsafe.Offsetof(Dirent{}.Namlen), unsafe.Sizeof(Dirent{}.Namlen)) } -func SysctlClockinfo(name string) (*Clockinfo, error) { - mib, err := sysctlmib(name) - if err != nil { - return nil, err - } - - n := uintptr(SizeofClockinfo) - var ci Clockinfo - if err := sysctl(mib, (*byte)(unsafe.Pointer(&ci)), &n, nil, 0); err != nil { - return nil, err - } - if n != SizeofClockinfo { - return nil, EIO - } - return &ci, nil -} - func SysctlUvmexp(name string) (*Uvmexp, error) { mib, err := sysctlmib(name) if err != nil { @@ -89,16 +72,20 @@ func SysctlUvmexp(name string) (*Uvmexp, error) { return &u, nil } -//sysnb pipe(p *[2]_C_int) (err error) func Pipe(p []int) (err error) { + return Pipe2(p, 0) +} + +//sysnb pipe2(p *[2]_C_int, flags int) (err error) +func Pipe2(p []int, flags int) error { if len(p) != 2 { return EINVAL } var pp [2]_C_int - err = pipe(&pp) + err := pipe2(&pp, flags) p[0] = int(pp[0]) p[1] = int(pp[1]) - return + return err } //sys Getdents(fd int, buf []byte) (n int, err error) diff --git a/vendor/golang.org/x/sys/unix/types_aix.go b/vendor/golang.org/x/sys/unix/types_aix.go deleted file mode 100644 index 40d2beed..00000000 --- a/vendor/golang.org/x/sys/unix/types_aix.go +++ /dev/null @@ -1,237 +0,0 @@ -// Copyright 2018 The Go Authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the LICENSE file. - -// +build ignore -// +build aix - -/* -Input to cgo -godefs. See also mkerrors.sh and mkall.sh -*/ - -// +godefs map struct_in_addr [4]byte /* in_addr */ -// +godefs map struct_in6_addr [16]byte /* in6_addr */ - -package unix - -/* -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include - -#include - -#include -#include -#include -#include - - -#include -#include - -enum { - sizeofPtr = sizeof(void*), -}; - -union sockaddr_all { - struct sockaddr s1; // this one gets used for fields - struct sockaddr_in s2; // these pad it out - struct sockaddr_in6 s3; - struct sockaddr_un s4; - struct sockaddr_dl s5; -}; - -struct sockaddr_any { - struct sockaddr addr; - char pad[sizeof(union sockaddr_all) - sizeof(struct sockaddr)]; -}; - -*/ -import "C" - -// Machine characteristics - -const ( - SizeofPtr = C.sizeofPtr - SizeofShort = C.sizeof_short - SizeofInt = C.sizeof_int - SizeofLong = C.sizeof_long - SizeofLongLong = C.sizeof_longlong - PathMax = C.PATH_MAX -) - -// Basic types - -type ( - _C_short C.short - _C_int C.int - _C_long C.long - _C_long_long C.longlong -) - -type off64 C.off64_t -type off C.off_t -type Mode_t C.mode_t - -// Time - -type Timespec C.struct_timespec - -type Timeval C.struct_timeval - -type Timeval32 C.struct_timeval32 - -type Timex C.struct_timex - -type Time_t C.time_t - -type Tms C.struct_tms - -type Utimbuf C.struct_utimbuf - -type Timezone C.struct_timezone - -// Processes - -type Rusage C.struct_rusage - -type Rlimit C.struct_rlimit64 - -type Pid_t C.pid_t - -type _Gid_t C.gid_t - -type dev_t C.dev_t - -// Files - -type Stat_t C.struct_stat - -type StatxTimestamp C.struct_statx_timestamp - -type Statx_t C.struct_statx - -type Dirent C.struct_dirent - -// Sockets - -type RawSockaddrInet4 C.struct_sockaddr_in - -type RawSockaddrInet6 C.struct_sockaddr_in6 - -type RawSockaddrUnix C.struct_sockaddr_un - -type RawSockaddrDatalink C.struct_sockaddr_dl - -type RawSockaddr C.struct_sockaddr - -type RawSockaddrAny C.struct_sockaddr_any - -type _Socklen C.socklen_t - -type Cmsghdr C.struct_cmsghdr - -type ICMPv6Filter C.struct_icmp6_filter - -type Iovec C.struct_iovec - -type IPMreq C.struct_ip_mreq - -type IPv6Mreq C.struct_ipv6_mreq - -type IPv6MTUInfo C.struct_ip6_mtuinfo - -type Linger C.struct_linger - -type Msghdr C.struct_msghdr - -const ( - SizeofSockaddrInet4 = C.sizeof_struct_sockaddr_in - SizeofSockaddrInet6 = C.sizeof_struct_sockaddr_in6 - SizeofSockaddrAny = C.sizeof_struct_sockaddr_any - SizeofSockaddrUnix = C.sizeof_struct_sockaddr_un - SizeofSockaddrDatalink = C.sizeof_struct_sockaddr_dl - SizeofLinger = C.sizeof_struct_linger - SizeofIPMreq = C.sizeof_struct_ip_mreq - SizeofIPv6Mreq = C.sizeof_struct_ipv6_mreq - SizeofIPv6MTUInfo = C.sizeof_struct_ip6_mtuinfo - SizeofMsghdr = C.sizeof_struct_msghdr - SizeofCmsghdr = C.sizeof_struct_cmsghdr - SizeofICMPv6Filter = C.sizeof_struct_icmp6_filter -) - -// Routing and interface messages - -const ( - SizeofIfMsghdr = C.sizeof_struct_if_msghdr -) - -type IfMsgHdr C.struct_if_msghdr - -// Misc - -type FdSet C.fd_set - -type Utsname C.struct_utsname - -type Ustat_t C.struct_ustat - -type Sigset_t C.sigset_t - -const ( - AT_FDCWD = C.AT_FDCWD - AT_REMOVEDIR = C.AT_REMOVEDIR - AT_SYMLINK_NOFOLLOW = C.AT_SYMLINK_NOFOLLOW -) - -// Terminal handling - -type Termios C.struct_termios - -type Termio C.struct_termio - -type Winsize C.struct_winsize - -//poll - -type PollFd struct { - Fd int32 - Events uint16 - Revents uint16 -} - -const ( - POLLERR = C.POLLERR - POLLHUP = C.POLLHUP - POLLIN = C.POLLIN - POLLNVAL = C.POLLNVAL - POLLOUT = C.POLLOUT - POLLPRI = C.POLLPRI - POLLRDBAND = C.POLLRDBAND - POLLRDNORM = C.POLLRDNORM - POLLWRBAND = C.POLLWRBAND - POLLWRNORM = C.POLLWRNORM -) - -//flock_t - -type Flock_t C.struct_flock64 - -// Statfs - -type Fsid_t C.struct_fsid_t -type Fsid64_t C.struct_fsid64_t - -type Statfs_t C.struct_statfs - -const RNDGETENTCNT = 0x80045200 diff --git a/vendor/golang.org/x/sys/unix/types_darwin.go b/vendor/golang.org/x/sys/unix/types_darwin.go deleted file mode 100644 index 155c2e69..00000000 --- a/vendor/golang.org/x/sys/unix/types_darwin.go +++ /dev/null @@ -1,283 +0,0 @@ -// Copyright 2009 The Go Authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the LICENSE file. - -// +build ignore - -/* -Input to cgo -godefs. See README.md -*/ - -// +godefs map struct_in_addr [4]byte /* in_addr */ -// +godefs map struct_in6_addr [16]byte /* in6_addr */ - -package unix - -/* -#define __DARWIN_UNIX03 0 -#define KERNEL -#define _DARWIN_USE_64_BIT_INODE -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include - -enum { - sizeofPtr = sizeof(void*), -}; - -union sockaddr_all { - struct sockaddr s1; // this one gets used for fields - struct sockaddr_in s2; // these pad it out - struct sockaddr_in6 s3; - struct sockaddr_un s4; - struct sockaddr_dl s5; -}; - -struct sockaddr_any { - struct sockaddr addr; - char pad[sizeof(union sockaddr_all) - sizeof(struct sockaddr)]; -}; - -*/ -import "C" - -// Machine characteristics - -const ( - SizeofPtr = C.sizeofPtr - SizeofShort = C.sizeof_short - SizeofInt = C.sizeof_int - SizeofLong = C.sizeof_long - SizeofLongLong = C.sizeof_longlong -) - -// Basic types - -type ( - _C_short C.short - _C_int C.int - _C_long C.long - _C_long_long C.longlong -) - -// Time - -type Timespec C.struct_timespec - -type Timeval C.struct_timeval - -type Timeval32 C.struct_timeval32 - -// Processes - -type Rusage C.struct_rusage - -type Rlimit C.struct_rlimit - -type _Gid_t C.gid_t - -// Files - -type Stat_t C.struct_stat64 - -type Statfs_t C.struct_statfs64 - -type Flock_t C.struct_flock - -type Fstore_t C.struct_fstore - -type Radvisory_t C.struct_radvisory - -type Fbootstraptransfer_t C.struct_fbootstraptransfer - -type Log2phys_t C.struct_log2phys - -type Fsid C.struct_fsid - -type Dirent C.struct_dirent - -// Sockets - -type RawSockaddrInet4 C.struct_sockaddr_in - -type RawSockaddrInet6 C.struct_sockaddr_in6 - -type RawSockaddrUnix C.struct_sockaddr_un - -type RawSockaddrDatalink C.struct_sockaddr_dl - -type RawSockaddr C.struct_sockaddr - -type RawSockaddrAny C.struct_sockaddr_any - -type _Socklen C.socklen_t - -type Linger C.struct_linger - -type Iovec C.struct_iovec - -type IPMreq C.struct_ip_mreq - -type IPv6Mreq C.struct_ipv6_mreq - -type Msghdr C.struct_msghdr - -type Cmsghdr C.struct_cmsghdr - -type Inet4Pktinfo C.struct_in_pktinfo - -type Inet6Pktinfo C.struct_in6_pktinfo - -type IPv6MTUInfo C.struct_ip6_mtuinfo - -type ICMPv6Filter C.struct_icmp6_filter - -const ( - SizeofSockaddrInet4 = C.sizeof_struct_sockaddr_in - SizeofSockaddrInet6 = C.sizeof_struct_sockaddr_in6 - SizeofSockaddrAny = C.sizeof_struct_sockaddr_any - SizeofSockaddrUnix = C.sizeof_struct_sockaddr_un - SizeofSockaddrDatalink = C.sizeof_struct_sockaddr_dl - SizeofLinger = C.sizeof_struct_linger - SizeofIPMreq = C.sizeof_struct_ip_mreq - SizeofIPv6Mreq = C.sizeof_struct_ipv6_mreq - SizeofMsghdr = C.sizeof_struct_msghdr - SizeofCmsghdr = C.sizeof_struct_cmsghdr - SizeofInet4Pktinfo = C.sizeof_struct_in_pktinfo - SizeofInet6Pktinfo = C.sizeof_struct_in6_pktinfo - SizeofIPv6MTUInfo = C.sizeof_struct_ip6_mtuinfo - SizeofICMPv6Filter = C.sizeof_struct_icmp6_filter -) - -// Ptrace requests - -const ( - PTRACE_TRACEME = C.PT_TRACE_ME - PTRACE_CONT = C.PT_CONTINUE - PTRACE_KILL = C.PT_KILL -) - -// Events (kqueue, kevent) - -type Kevent_t C.struct_kevent - -// Select - -type FdSet C.fd_set - -// Routing and interface messages - -const ( - SizeofIfMsghdr = C.sizeof_struct_if_msghdr - SizeofIfData = C.sizeof_struct_if_data - SizeofIfaMsghdr = C.sizeof_struct_ifa_msghdr - SizeofIfmaMsghdr = C.sizeof_struct_ifma_msghdr - SizeofIfmaMsghdr2 = C.sizeof_struct_ifma_msghdr2 - SizeofRtMsghdr = C.sizeof_struct_rt_msghdr - SizeofRtMetrics = C.sizeof_struct_rt_metrics -) - -type IfMsghdr C.struct_if_msghdr - -type IfData C.struct_if_data - -type IfaMsghdr C.struct_ifa_msghdr - -type IfmaMsghdr C.struct_ifma_msghdr - -type IfmaMsghdr2 C.struct_ifma_msghdr2 - -type RtMsghdr C.struct_rt_msghdr - -type RtMetrics C.struct_rt_metrics - -// Berkeley packet filter - -const ( - SizeofBpfVersion = C.sizeof_struct_bpf_version - SizeofBpfStat = C.sizeof_struct_bpf_stat - SizeofBpfProgram = C.sizeof_struct_bpf_program - SizeofBpfInsn = C.sizeof_struct_bpf_insn - SizeofBpfHdr = C.sizeof_struct_bpf_hdr -) - -type BpfVersion C.struct_bpf_version - -type BpfStat C.struct_bpf_stat - -type BpfProgram C.struct_bpf_program - -type BpfInsn C.struct_bpf_insn - -type BpfHdr C.struct_bpf_hdr - -// Terminal handling - -type Termios C.struct_termios - -type Winsize C.struct_winsize - -// fchmodat-like syscalls. - -const ( - AT_FDCWD = C.AT_FDCWD - AT_REMOVEDIR = C.AT_REMOVEDIR - AT_SYMLINK_FOLLOW = C.AT_SYMLINK_FOLLOW - AT_SYMLINK_NOFOLLOW = C.AT_SYMLINK_NOFOLLOW -) - -// poll - -type PollFd C.struct_pollfd - -const ( - POLLERR = C.POLLERR - POLLHUP = C.POLLHUP - POLLIN = C.POLLIN - POLLNVAL = C.POLLNVAL - POLLOUT = C.POLLOUT - POLLPRI = C.POLLPRI - POLLRDBAND = C.POLLRDBAND - POLLRDNORM = C.POLLRDNORM - POLLWRBAND = C.POLLWRBAND - POLLWRNORM = C.POLLWRNORM -) - -// uname - -type Utsname C.struct_utsname - -// Clockinfo - -const SizeofClockinfo = C.sizeof_struct_clockinfo - -type Clockinfo C.struct_clockinfo diff --git a/vendor/golang.org/x/sys/unix/types_dragonfly.go b/vendor/golang.org/x/sys/unix/types_dragonfly.go deleted file mode 100644 index 3365dd79..00000000 --- a/vendor/golang.org/x/sys/unix/types_dragonfly.go +++ /dev/null @@ -1,263 +0,0 @@ -// Copyright 2009 The Go Authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the LICENSE file. - -// +build ignore - -/* -Input to cgo -godefs. See README.md -*/ - -// +godefs map struct_in_addr [4]byte /* in_addr */ -// +godefs map struct_in6_addr [16]byte /* in6_addr */ - -package unix - -/* -#define KERNEL -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include - -enum { - sizeofPtr = sizeof(void*), -}; - -union sockaddr_all { - struct sockaddr s1; // this one gets used for fields - struct sockaddr_in s2; // these pad it out - struct sockaddr_in6 s3; - struct sockaddr_un s4; - struct sockaddr_dl s5; -}; - -struct sockaddr_any { - struct sockaddr addr; - char pad[sizeof(union sockaddr_all) - sizeof(struct sockaddr)]; -}; - -*/ -import "C" - -// Machine characteristics - -const ( - SizeofPtr = C.sizeofPtr - SizeofShort = C.sizeof_short - SizeofInt = C.sizeof_int - SizeofLong = C.sizeof_long - SizeofLongLong = C.sizeof_longlong -) - -// Basic types - -type ( - _C_short C.short - _C_int C.int - _C_long C.long - _C_long_long C.longlong -) - -// Time - -type Timespec C.struct_timespec - -type Timeval C.struct_timeval - -// Processes - -type Rusage C.struct_rusage - -type Rlimit C.struct_rlimit - -type _Gid_t C.gid_t - -// Files - -type Stat_t C.struct_stat - -type Statfs_t C.struct_statfs - -type Flock_t C.struct_flock - -type Dirent C.struct_dirent - -type Fsid C.struct_fsid - -// File system limits - -const ( - PathMax = C.PATH_MAX -) - -// Sockets - -type RawSockaddrInet4 C.struct_sockaddr_in - -type RawSockaddrInet6 C.struct_sockaddr_in6 - -type RawSockaddrUnix C.struct_sockaddr_un - -type RawSockaddrDatalink C.struct_sockaddr_dl - -type RawSockaddr C.struct_sockaddr - -type RawSockaddrAny C.struct_sockaddr_any - -type _Socklen C.socklen_t - -type Linger C.struct_linger - -type Iovec C.struct_iovec - -type IPMreq C.struct_ip_mreq - -type IPv6Mreq C.struct_ipv6_mreq - -type Msghdr C.struct_msghdr - -type Cmsghdr C.struct_cmsghdr - -type Inet6Pktinfo C.struct_in6_pktinfo - -type IPv6MTUInfo C.struct_ip6_mtuinfo - -type ICMPv6Filter C.struct_icmp6_filter - -const ( - SizeofSockaddrInet4 = C.sizeof_struct_sockaddr_in - SizeofSockaddrInet6 = C.sizeof_struct_sockaddr_in6 - SizeofSockaddrAny = C.sizeof_struct_sockaddr_any - SizeofSockaddrUnix = C.sizeof_struct_sockaddr_un - SizeofSockaddrDatalink = C.sizeof_struct_sockaddr_dl - SizeofLinger = C.sizeof_struct_linger - SizeofIPMreq = C.sizeof_struct_ip_mreq - SizeofIPv6Mreq = C.sizeof_struct_ipv6_mreq - SizeofMsghdr = C.sizeof_struct_msghdr - SizeofCmsghdr = C.sizeof_struct_cmsghdr - SizeofInet6Pktinfo = C.sizeof_struct_in6_pktinfo - SizeofIPv6MTUInfo = C.sizeof_struct_ip6_mtuinfo - SizeofICMPv6Filter = C.sizeof_struct_icmp6_filter -) - -// Ptrace requests - -const ( - PTRACE_TRACEME = C.PT_TRACE_ME - PTRACE_CONT = C.PT_CONTINUE - PTRACE_KILL = C.PT_KILL -) - -// Events (kqueue, kevent) - -type Kevent_t C.struct_kevent - -// Select - -type FdSet C.fd_set - -// Routing and interface messages - -const ( - SizeofIfMsghdr = C.sizeof_struct_if_msghdr - SizeofIfData = C.sizeof_struct_if_data - SizeofIfaMsghdr = C.sizeof_struct_ifa_msghdr - SizeofIfmaMsghdr = C.sizeof_struct_ifma_msghdr - SizeofIfAnnounceMsghdr = C.sizeof_struct_if_announcemsghdr - SizeofRtMsghdr = C.sizeof_struct_rt_msghdr - SizeofRtMetrics = C.sizeof_struct_rt_metrics -) - -type IfMsghdr C.struct_if_msghdr - -type IfData C.struct_if_data - -type IfaMsghdr C.struct_ifa_msghdr - -type IfmaMsghdr C.struct_ifma_msghdr - -type IfAnnounceMsghdr C.struct_if_announcemsghdr - -type RtMsghdr C.struct_rt_msghdr - -type RtMetrics C.struct_rt_metrics - -// Berkeley packet filter - -const ( - SizeofBpfVersion = C.sizeof_struct_bpf_version - SizeofBpfStat = C.sizeof_struct_bpf_stat - SizeofBpfProgram = C.sizeof_struct_bpf_program - SizeofBpfInsn = C.sizeof_struct_bpf_insn - SizeofBpfHdr = C.sizeof_struct_bpf_hdr -) - -type BpfVersion C.struct_bpf_version - -type BpfStat C.struct_bpf_stat - -type BpfProgram C.struct_bpf_program - -type BpfInsn C.struct_bpf_insn - -type BpfHdr C.struct_bpf_hdr - -// Terminal handling - -type Termios C.struct_termios - -type Winsize C.struct_winsize - -// fchmodat-like syscalls. - -const ( - AT_FDCWD = C.AT_FDCWD - AT_SYMLINK_NOFOLLOW = C.AT_SYMLINK_NOFOLLOW -) - -// poll - -type PollFd C.struct_pollfd - -const ( - POLLERR = C.POLLERR - POLLHUP = C.POLLHUP - POLLIN = C.POLLIN - POLLNVAL = C.POLLNVAL - POLLOUT = C.POLLOUT - POLLPRI = C.POLLPRI - POLLRDBAND = C.POLLRDBAND - POLLRDNORM = C.POLLRDNORM - POLLWRBAND = C.POLLWRBAND - POLLWRNORM = C.POLLWRNORM -) - -// Uname - -type Utsname C.struct_utsname diff --git a/vendor/golang.org/x/sys/unix/types_freebsd.go b/vendor/golang.org/x/sys/unix/types_freebsd.go deleted file mode 100644 index a121dc33..00000000 --- a/vendor/golang.org/x/sys/unix/types_freebsd.go +++ /dev/null @@ -1,400 +0,0 @@ -// Copyright 2009 The Go Authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the LICENSE file. - -// +build ignore - -/* -Input to cgo -godefs. See README.md -*/ - -// +godefs map struct_in_addr [4]byte /* in_addr */ -// +godefs map struct_in6_addr [16]byte /* in6_addr */ - -package unix - -/* -#define _WANT_FREEBSD11_STAT 1 -#define _WANT_FREEBSD11_STATFS 1 -#define _WANT_FREEBSD11_DIRENT 1 -#define _WANT_FREEBSD11_KEVENT 1 - -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include - -enum { - sizeofPtr = sizeof(void*), -}; - -union sockaddr_all { - struct sockaddr s1; // this one gets used for fields - struct sockaddr_in s2; // these pad it out - struct sockaddr_in6 s3; - struct sockaddr_un s4; - struct sockaddr_dl s5; -}; - -struct sockaddr_any { - struct sockaddr addr; - char pad[sizeof(union sockaddr_all) - sizeof(struct sockaddr)]; -}; - -// This structure is a duplicate of if_data on FreeBSD 8-STABLE. -// See /usr/include/net/if.h. -struct if_data8 { - u_char ifi_type; - u_char ifi_physical; - u_char ifi_addrlen; - u_char ifi_hdrlen; - u_char ifi_link_state; - u_char ifi_spare_char1; - u_char ifi_spare_char2; - u_char ifi_datalen; - u_long ifi_mtu; - u_long ifi_metric; - u_long ifi_baudrate; - u_long ifi_ipackets; - u_long ifi_ierrors; - u_long ifi_opackets; - u_long ifi_oerrors; - u_long ifi_collisions; - u_long ifi_ibytes; - u_long ifi_obytes; - u_long ifi_imcasts; - u_long ifi_omcasts; - u_long ifi_iqdrops; - u_long ifi_noproto; - u_long ifi_hwassist; -// FIXME: these are now unions, so maybe need to change definitions? -#undef ifi_epoch - time_t ifi_epoch; -#undef ifi_lastchange - struct timeval ifi_lastchange; -}; - -// This structure is a duplicate of if_msghdr on FreeBSD 8-STABLE. -// See /usr/include/net/if.h. -struct if_msghdr8 { - u_short ifm_msglen; - u_char ifm_version; - u_char ifm_type; - int ifm_addrs; - int ifm_flags; - u_short ifm_index; - struct if_data8 ifm_data; -}; -*/ -import "C" - -// Machine characteristics - -const ( - SizeofPtr = C.sizeofPtr - SizeofShort = C.sizeof_short - SizeofInt = C.sizeof_int - SizeofLong = C.sizeof_long - SizeofLongLong = C.sizeof_longlong -) - -// Basic types - -type ( - _C_short C.short - _C_int C.int - _C_long C.long - _C_long_long C.longlong -) - -// Time - -type Timespec C.struct_timespec - -type Timeval C.struct_timeval - -// Processes - -type Rusage C.struct_rusage - -type Rlimit C.struct_rlimit - -type _Gid_t C.gid_t - -// Files - -const ( - _statfsVersion = C.STATFS_VERSION - _dirblksiz = C.DIRBLKSIZ -) - -type Stat_t C.struct_stat - -type stat_freebsd11_t C.struct_freebsd11_stat - -type Statfs_t C.struct_statfs - -type statfs_freebsd11_t C.struct_freebsd11_statfs - -type Flock_t C.struct_flock - -type Dirent C.struct_dirent - -type dirent_freebsd11 C.struct_freebsd11_dirent - -type Fsid C.struct_fsid - -// File system limits - -const ( - PathMax = C.PATH_MAX -) - -// Advice to Fadvise - -const ( - FADV_NORMAL = C.POSIX_FADV_NORMAL - FADV_RANDOM = C.POSIX_FADV_RANDOM - FADV_SEQUENTIAL = C.POSIX_FADV_SEQUENTIAL - FADV_WILLNEED = C.POSIX_FADV_WILLNEED - FADV_DONTNEED = C.POSIX_FADV_DONTNEED - FADV_NOREUSE = C.POSIX_FADV_NOREUSE -) - -// Sockets - -type RawSockaddrInet4 C.struct_sockaddr_in - -type RawSockaddrInet6 C.struct_sockaddr_in6 - -type RawSockaddrUnix C.struct_sockaddr_un - -type RawSockaddrDatalink C.struct_sockaddr_dl - -type RawSockaddr C.struct_sockaddr - -type RawSockaddrAny C.struct_sockaddr_any - -type _Socklen C.socklen_t - -type Linger C.struct_linger - -type Iovec C.struct_iovec - -type IPMreq C.struct_ip_mreq - -type IPMreqn C.struct_ip_mreqn - -type IPv6Mreq C.struct_ipv6_mreq - -type Msghdr C.struct_msghdr - -type Cmsghdr C.struct_cmsghdr - -type Inet6Pktinfo C.struct_in6_pktinfo - -type IPv6MTUInfo C.struct_ip6_mtuinfo - -type ICMPv6Filter C.struct_icmp6_filter - -const ( - SizeofSockaddrInet4 = C.sizeof_struct_sockaddr_in - SizeofSockaddrInet6 = C.sizeof_struct_sockaddr_in6 - SizeofSockaddrAny = C.sizeof_struct_sockaddr_any - SizeofSockaddrUnix = C.sizeof_struct_sockaddr_un - SizeofSockaddrDatalink = C.sizeof_struct_sockaddr_dl - SizeofLinger = C.sizeof_struct_linger - SizeofIPMreq = C.sizeof_struct_ip_mreq - SizeofIPMreqn = C.sizeof_struct_ip_mreqn - SizeofIPv6Mreq = C.sizeof_struct_ipv6_mreq - SizeofMsghdr = C.sizeof_struct_msghdr - SizeofCmsghdr = C.sizeof_struct_cmsghdr - SizeofInet6Pktinfo = C.sizeof_struct_in6_pktinfo - SizeofIPv6MTUInfo = C.sizeof_struct_ip6_mtuinfo - SizeofICMPv6Filter = C.sizeof_struct_icmp6_filter -) - -// Ptrace requests - -const ( - PTRACE_ATTACH = C.PT_ATTACH - PTRACE_CONT = C.PT_CONTINUE - PTRACE_DETACH = C.PT_DETACH - PTRACE_GETFPREGS = C.PT_GETFPREGS - PTRACE_GETFSBASE = C.PT_GETFSBASE - PTRACE_GETLWPLIST = C.PT_GETLWPLIST - PTRACE_GETNUMLWPS = C.PT_GETNUMLWPS - PTRACE_GETREGS = C.PT_GETREGS - PTRACE_GETXSTATE = C.PT_GETXSTATE - PTRACE_IO = C.PT_IO - PTRACE_KILL = C.PT_KILL - PTRACE_LWPEVENTS = C.PT_LWP_EVENTS - PTRACE_LWPINFO = C.PT_LWPINFO - PTRACE_SETFPREGS = C.PT_SETFPREGS - PTRACE_SETREGS = C.PT_SETREGS - PTRACE_SINGLESTEP = C.PT_STEP - PTRACE_TRACEME = C.PT_TRACE_ME -) - -const ( - PIOD_READ_D = C.PIOD_READ_D - PIOD_WRITE_D = C.PIOD_WRITE_D - PIOD_READ_I = C.PIOD_READ_I - PIOD_WRITE_I = C.PIOD_WRITE_I -) - -const ( - PL_FLAG_BORN = C.PL_FLAG_BORN - PL_FLAG_EXITED = C.PL_FLAG_EXITED - PL_FLAG_SI = C.PL_FLAG_SI -) - -const ( - TRAP_BRKPT = C.TRAP_BRKPT - TRAP_TRACE = C.TRAP_TRACE -) - -type PtraceLwpInfoStruct C.struct_ptrace_lwpinfo - -type __Siginfo C.struct___siginfo - -type Sigset_t C.sigset_t - -type Reg C.struct_reg - -type FpReg C.struct_fpreg - -type PtraceIoDesc C.struct_ptrace_io_desc - -// Events (kqueue, kevent) - -type Kevent_t C.struct_kevent_freebsd11 - -// Select - -type FdSet C.fd_set - -// Routing and interface messages - -const ( - sizeofIfMsghdr = C.sizeof_struct_if_msghdr - SizeofIfMsghdr = C.sizeof_struct_if_msghdr8 - sizeofIfData = C.sizeof_struct_if_data - SizeofIfData = C.sizeof_struct_if_data8 - SizeofIfaMsghdr = C.sizeof_struct_ifa_msghdr - SizeofIfmaMsghdr = C.sizeof_struct_ifma_msghdr - SizeofIfAnnounceMsghdr = C.sizeof_struct_if_announcemsghdr - SizeofRtMsghdr = C.sizeof_struct_rt_msghdr - SizeofRtMetrics = C.sizeof_struct_rt_metrics -) - -type ifMsghdr C.struct_if_msghdr - -type IfMsghdr C.struct_if_msghdr8 - -type ifData C.struct_if_data - -type IfData C.struct_if_data8 - -type IfaMsghdr C.struct_ifa_msghdr - -type IfmaMsghdr C.struct_ifma_msghdr - -type IfAnnounceMsghdr C.struct_if_announcemsghdr - -type RtMsghdr C.struct_rt_msghdr - -type RtMetrics C.struct_rt_metrics - -// Berkeley packet filter - -const ( - SizeofBpfVersion = C.sizeof_struct_bpf_version - SizeofBpfStat = C.sizeof_struct_bpf_stat - SizeofBpfZbuf = C.sizeof_struct_bpf_zbuf - SizeofBpfProgram = C.sizeof_struct_bpf_program - SizeofBpfInsn = C.sizeof_struct_bpf_insn - SizeofBpfHdr = C.sizeof_struct_bpf_hdr - SizeofBpfZbufHeader = C.sizeof_struct_bpf_zbuf_header -) - -type BpfVersion C.struct_bpf_version - -type BpfStat C.struct_bpf_stat - -type BpfZbuf C.struct_bpf_zbuf - -type BpfProgram C.struct_bpf_program - -type BpfInsn C.struct_bpf_insn - -type BpfHdr C.struct_bpf_hdr - -type BpfZbufHeader C.struct_bpf_zbuf_header - -// Terminal handling - -type Termios C.struct_termios - -type Winsize C.struct_winsize - -// fchmodat-like syscalls. - -const ( - AT_FDCWD = C.AT_FDCWD - AT_REMOVEDIR = C.AT_REMOVEDIR - AT_SYMLINK_FOLLOW = C.AT_SYMLINK_FOLLOW - AT_SYMLINK_NOFOLLOW = C.AT_SYMLINK_NOFOLLOW -) - -// poll - -type PollFd C.struct_pollfd - -const ( - POLLERR = C.POLLERR - POLLHUP = C.POLLHUP - POLLIN = C.POLLIN - POLLINIGNEOF = C.POLLINIGNEOF - POLLNVAL = C.POLLNVAL - POLLOUT = C.POLLOUT - POLLPRI = C.POLLPRI - POLLRDBAND = C.POLLRDBAND - POLLRDNORM = C.POLLRDNORM - POLLWRBAND = C.POLLWRBAND - POLLWRNORM = C.POLLWRNORM -) - -// Capabilities - -type CapRights C.struct_cap_rights - -// Uname - -type Utsname C.struct_utsname diff --git a/vendor/golang.org/x/sys/unix/types_netbsd.go b/vendor/golang.org/x/sys/unix/types_netbsd.go deleted file mode 100644 index 0a81aadb..00000000 --- a/vendor/golang.org/x/sys/unix/types_netbsd.go +++ /dev/null @@ -1,300 +0,0 @@ -// Copyright 2009 The Go Authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the LICENSE file. - -// +build ignore - -/* -Input to cgo -godefs. See README.md -*/ - -// +godefs map struct_in_addr [4]byte /* in_addr */ -// +godefs map struct_in6_addr [16]byte /* in6_addr */ - -package unix - -/* -#define KERNEL -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include - -enum { - sizeofPtr = sizeof(void*), -}; - -union sockaddr_all { - struct sockaddr s1; // this one gets used for fields - struct sockaddr_in s2; // these pad it out - struct sockaddr_in6 s3; - struct sockaddr_un s4; - struct sockaddr_dl s5; -}; - -struct sockaddr_any { - struct sockaddr addr; - char pad[sizeof(union sockaddr_all) - sizeof(struct sockaddr)]; -}; - -*/ -import "C" - -// Machine characteristics - -const ( - SizeofPtr = C.sizeofPtr - SizeofShort = C.sizeof_short - SizeofInt = C.sizeof_int - SizeofLong = C.sizeof_long - SizeofLongLong = C.sizeof_longlong -) - -// Basic types - -type ( - _C_short C.short - _C_int C.int - _C_long C.long - _C_long_long C.longlong -) - -// Time - -type Timespec C.struct_timespec - -type Timeval C.struct_timeval - -// Processes - -type Rusage C.struct_rusage - -type Rlimit C.struct_rlimit - -type _Gid_t C.gid_t - -// Files - -type Stat_t C.struct_stat - -type Statfs_t C.struct_statfs - -type Statvfs_t C.struct_statvfs - -type Flock_t C.struct_flock - -type Dirent C.struct_dirent - -type Fsid C.fsid_t - -// File system limits - -const ( - PathMax = C.PATH_MAX -) - -// Fstatvfs/Statvfs flags - -const ( - ST_WAIT = C.ST_WAIT - ST_NOWAIT = C.ST_NOWAIT -) - -// Advice to Fadvise - -const ( - FADV_NORMAL = C.POSIX_FADV_NORMAL - FADV_RANDOM = C.POSIX_FADV_RANDOM - FADV_SEQUENTIAL = C.POSIX_FADV_SEQUENTIAL - FADV_WILLNEED = C.POSIX_FADV_WILLNEED - FADV_DONTNEED = C.POSIX_FADV_DONTNEED - FADV_NOREUSE = C.POSIX_FADV_NOREUSE -) - -// Sockets - -type RawSockaddrInet4 C.struct_sockaddr_in - -type RawSockaddrInet6 C.struct_sockaddr_in6 - -type RawSockaddrUnix C.struct_sockaddr_un - -type RawSockaddrDatalink C.struct_sockaddr_dl - -type RawSockaddr C.struct_sockaddr - -type RawSockaddrAny C.struct_sockaddr_any - -type _Socklen C.socklen_t - -type Linger C.struct_linger - -type Iovec C.struct_iovec - -type IPMreq C.struct_ip_mreq - -type IPv6Mreq C.struct_ipv6_mreq - -type Msghdr C.struct_msghdr - -type Cmsghdr C.struct_cmsghdr - -type Inet6Pktinfo C.struct_in6_pktinfo - -type IPv6MTUInfo C.struct_ip6_mtuinfo - -type ICMPv6Filter C.struct_icmp6_filter - -const ( - SizeofSockaddrInet4 = C.sizeof_struct_sockaddr_in - SizeofSockaddrInet6 = C.sizeof_struct_sockaddr_in6 - SizeofSockaddrAny = C.sizeof_struct_sockaddr_any - SizeofSockaddrUnix = C.sizeof_struct_sockaddr_un - SizeofSockaddrDatalink = C.sizeof_struct_sockaddr_dl - SizeofLinger = C.sizeof_struct_linger - SizeofIPMreq = C.sizeof_struct_ip_mreq - SizeofIPv6Mreq = C.sizeof_struct_ipv6_mreq - SizeofMsghdr = C.sizeof_struct_msghdr - SizeofCmsghdr = C.sizeof_struct_cmsghdr - SizeofInet6Pktinfo = C.sizeof_struct_in6_pktinfo - SizeofIPv6MTUInfo = C.sizeof_struct_ip6_mtuinfo - SizeofICMPv6Filter = C.sizeof_struct_icmp6_filter -) - -// Ptrace requests - -const ( - PTRACE_TRACEME = C.PT_TRACE_ME - PTRACE_CONT = C.PT_CONTINUE - PTRACE_KILL = C.PT_KILL -) - -// Events (kqueue, kevent) - -type Kevent_t C.struct_kevent - -// Select - -type FdSet C.fd_set - -// Routing and interface messages - -const ( - SizeofIfMsghdr = C.sizeof_struct_if_msghdr - SizeofIfData = C.sizeof_struct_if_data - SizeofIfaMsghdr = C.sizeof_struct_ifa_msghdr - SizeofIfAnnounceMsghdr = C.sizeof_struct_if_announcemsghdr - SizeofRtMsghdr = C.sizeof_struct_rt_msghdr - SizeofRtMetrics = C.sizeof_struct_rt_metrics -) - -type IfMsghdr C.struct_if_msghdr - -type IfData C.struct_if_data - -type IfaMsghdr C.struct_ifa_msghdr - -type IfAnnounceMsghdr C.struct_if_announcemsghdr - -type RtMsghdr C.struct_rt_msghdr - -type RtMetrics C.struct_rt_metrics - -type Mclpool C.struct_mclpool - -// Berkeley packet filter - -const ( - SizeofBpfVersion = C.sizeof_struct_bpf_version - SizeofBpfStat = C.sizeof_struct_bpf_stat - SizeofBpfProgram = C.sizeof_struct_bpf_program - SizeofBpfInsn = C.sizeof_struct_bpf_insn - SizeofBpfHdr = C.sizeof_struct_bpf_hdr -) - -type BpfVersion C.struct_bpf_version - -type BpfStat C.struct_bpf_stat - -type BpfProgram C.struct_bpf_program - -type BpfInsn C.struct_bpf_insn - -type BpfHdr C.struct_bpf_hdr - -type BpfTimeval C.struct_bpf_timeval - -// Terminal handling - -type Termios C.struct_termios - -type Winsize C.struct_winsize - -type Ptmget C.struct_ptmget - -// fchmodat-like syscalls. - -const ( - AT_FDCWD = C.AT_FDCWD - AT_SYMLINK_FOLLOW = C.AT_SYMLINK_FOLLOW - AT_SYMLINK_NOFOLLOW = C.AT_SYMLINK_NOFOLLOW -) - -// poll - -type PollFd C.struct_pollfd - -const ( - POLLERR = C.POLLERR - POLLHUP = C.POLLHUP - POLLIN = C.POLLIN - POLLNVAL = C.POLLNVAL - POLLOUT = C.POLLOUT - POLLPRI = C.POLLPRI - POLLRDBAND = C.POLLRDBAND - POLLRDNORM = C.POLLRDNORM - POLLWRBAND = C.POLLWRBAND - POLLWRNORM = C.POLLWRNORM -) - -// Sysctl - -type Sysctlnode C.struct_sysctlnode - -// Uname - -type Utsname C.struct_utsname - -// Clockinfo - -const SizeofClockinfo = C.sizeof_struct_clockinfo - -type Clockinfo C.struct_clockinfo diff --git a/vendor/golang.org/x/sys/unix/types_openbsd.go b/vendor/golang.org/x/sys/unix/types_openbsd.go deleted file mode 100644 index 775cb57d..00000000 --- a/vendor/golang.org/x/sys/unix/types_openbsd.go +++ /dev/null @@ -1,283 +0,0 @@ -// Copyright 2009 The Go Authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the LICENSE file. - -// +build ignore - -/* -Input to cgo -godefs. See README.md -*/ - -// +godefs map struct_in_addr [4]byte /* in_addr */ -// +godefs map struct_in6_addr [16]byte /* in6_addr */ - -package unix - -/* -#define KERNEL -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include - -enum { - sizeofPtr = sizeof(void*), -}; - -union sockaddr_all { - struct sockaddr s1; // this one gets used for fields - struct sockaddr_in s2; // these pad it out - struct sockaddr_in6 s3; - struct sockaddr_un s4; - struct sockaddr_dl s5; -}; - -struct sockaddr_any { - struct sockaddr addr; - char pad[sizeof(union sockaddr_all) - sizeof(struct sockaddr)]; -}; - -*/ -import "C" - -// Machine characteristics - -const ( - SizeofPtr = C.sizeofPtr - SizeofShort = C.sizeof_short - SizeofInt = C.sizeof_int - SizeofLong = C.sizeof_long - SizeofLongLong = C.sizeof_longlong -) - -// Basic types - -type ( - _C_short C.short - _C_int C.int - _C_long C.long - _C_long_long C.longlong -) - -// Time - -type Timespec C.struct_timespec - -type Timeval C.struct_timeval - -// Processes - -type Rusage C.struct_rusage - -type Rlimit C.struct_rlimit - -type _Gid_t C.gid_t - -// Files - -type Stat_t C.struct_stat - -type Statfs_t C.struct_statfs - -type Flock_t C.struct_flock - -type Dirent C.struct_dirent - -type Fsid C.fsid_t - -// File system limits - -const ( - PathMax = C.PATH_MAX -) - -// Sockets - -type RawSockaddrInet4 C.struct_sockaddr_in - -type RawSockaddrInet6 C.struct_sockaddr_in6 - -type RawSockaddrUnix C.struct_sockaddr_un - -type RawSockaddrDatalink C.struct_sockaddr_dl - -type RawSockaddr C.struct_sockaddr - -type RawSockaddrAny C.struct_sockaddr_any - -type _Socklen C.socklen_t - -type Linger C.struct_linger - -type Iovec C.struct_iovec - -type IPMreq C.struct_ip_mreq - -type IPv6Mreq C.struct_ipv6_mreq - -type Msghdr C.struct_msghdr - -type Cmsghdr C.struct_cmsghdr - -type Inet6Pktinfo C.struct_in6_pktinfo - -type IPv6MTUInfo C.struct_ip6_mtuinfo - -type ICMPv6Filter C.struct_icmp6_filter - -const ( - SizeofSockaddrInet4 = C.sizeof_struct_sockaddr_in - SizeofSockaddrInet6 = C.sizeof_struct_sockaddr_in6 - SizeofSockaddrAny = C.sizeof_struct_sockaddr_any - SizeofSockaddrUnix = C.sizeof_struct_sockaddr_un - SizeofSockaddrDatalink = C.sizeof_struct_sockaddr_dl - SizeofLinger = C.sizeof_struct_linger - SizeofIPMreq = C.sizeof_struct_ip_mreq - SizeofIPv6Mreq = C.sizeof_struct_ipv6_mreq - SizeofMsghdr = C.sizeof_struct_msghdr - SizeofCmsghdr = C.sizeof_struct_cmsghdr - SizeofInet6Pktinfo = C.sizeof_struct_in6_pktinfo - SizeofIPv6MTUInfo = C.sizeof_struct_ip6_mtuinfo - SizeofICMPv6Filter = C.sizeof_struct_icmp6_filter -) - -// Ptrace requests - -const ( - PTRACE_TRACEME = C.PT_TRACE_ME - PTRACE_CONT = C.PT_CONTINUE - PTRACE_KILL = C.PT_KILL -) - -// Events (kqueue, kevent) - -type Kevent_t C.struct_kevent - -// Select - -type FdSet C.fd_set - -// Routing and interface messages - -const ( - SizeofIfMsghdr = C.sizeof_struct_if_msghdr - SizeofIfData = C.sizeof_struct_if_data - SizeofIfaMsghdr = C.sizeof_struct_ifa_msghdr - SizeofIfAnnounceMsghdr = C.sizeof_struct_if_announcemsghdr - SizeofRtMsghdr = C.sizeof_struct_rt_msghdr - SizeofRtMetrics = C.sizeof_struct_rt_metrics -) - -type IfMsghdr C.struct_if_msghdr - -type IfData C.struct_if_data - -type IfaMsghdr C.struct_ifa_msghdr - -type IfAnnounceMsghdr C.struct_if_announcemsghdr - -type RtMsghdr C.struct_rt_msghdr - -type RtMetrics C.struct_rt_metrics - -type Mclpool C.struct_mclpool - -// Berkeley packet filter - -const ( - SizeofBpfVersion = C.sizeof_struct_bpf_version - SizeofBpfStat = C.sizeof_struct_bpf_stat - SizeofBpfProgram = C.sizeof_struct_bpf_program - SizeofBpfInsn = C.sizeof_struct_bpf_insn - SizeofBpfHdr = C.sizeof_struct_bpf_hdr -) - -type BpfVersion C.struct_bpf_version - -type BpfStat C.struct_bpf_stat - -type BpfProgram C.struct_bpf_program - -type BpfInsn C.struct_bpf_insn - -type BpfHdr C.struct_bpf_hdr - -type BpfTimeval C.struct_bpf_timeval - -// Terminal handling - -type Termios C.struct_termios - -type Winsize C.struct_winsize - -// fchmodat-like syscalls. - -const ( - AT_FDCWD = C.AT_FDCWD - AT_SYMLINK_FOLLOW = C.AT_SYMLINK_FOLLOW - AT_SYMLINK_NOFOLLOW = C.AT_SYMLINK_NOFOLLOW -) - -// poll - -type PollFd C.struct_pollfd - -const ( - POLLERR = C.POLLERR - POLLHUP = C.POLLHUP - POLLIN = C.POLLIN - POLLNVAL = C.POLLNVAL - POLLOUT = C.POLLOUT - POLLPRI = C.POLLPRI - POLLRDBAND = C.POLLRDBAND - POLLRDNORM = C.POLLRDNORM - POLLWRBAND = C.POLLWRBAND - POLLWRNORM = C.POLLWRNORM -) - -// Signal Sets - -type Sigset_t C.sigset_t - -// Uname - -type Utsname C.struct_utsname - -// Uvmexp - -const SizeofUvmexp = C.sizeof_struct_uvmexp - -type Uvmexp C.struct_uvmexp - -// Clockinfo - -const SizeofClockinfo = C.sizeof_struct_clockinfo - -type Clockinfo C.struct_clockinfo diff --git a/vendor/golang.org/x/sys/unix/types_solaris.go b/vendor/golang.org/x/sys/unix/types_solaris.go deleted file mode 100644 index 2b716f93..00000000 --- a/vendor/golang.org/x/sys/unix/types_solaris.go +++ /dev/null @@ -1,266 +0,0 @@ -// Copyright 2009 The Go Authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the LICENSE file. - -// +build ignore - -/* -Input to cgo -godefs. See README.md -*/ - -// +godefs map struct_in_addr [4]byte /* in_addr */ -// +godefs map struct_in6_addr [16]byte /* in6_addr */ - -package unix - -/* -#define KERNEL -// These defines ensure that builds done on newer versions of Solaris are -// backwards-compatible with older versions of Solaris and -// OpenSolaris-based derivatives. -#define __USE_SUNOS_SOCKETS__ // msghdr -#define __USE_LEGACY_PROTOTYPES__ // iovec -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include - -enum { - sizeofPtr = sizeof(void*), -}; - -union sockaddr_all { - struct sockaddr s1; // this one gets used for fields - struct sockaddr_in s2; // these pad it out - struct sockaddr_in6 s3; - struct sockaddr_un s4; - struct sockaddr_dl s5; -}; - -struct sockaddr_any { - struct sockaddr addr; - char pad[sizeof(union sockaddr_all) - sizeof(struct sockaddr)]; -}; - -*/ -import "C" - -// Machine characteristics - -const ( - SizeofPtr = C.sizeofPtr - SizeofShort = C.sizeof_short - SizeofInt = C.sizeof_int - SizeofLong = C.sizeof_long - SizeofLongLong = C.sizeof_longlong - PathMax = C.PATH_MAX - MaxHostNameLen = C.MAXHOSTNAMELEN -) - -// Basic types - -type ( - _C_short C.short - _C_int C.int - _C_long C.long - _C_long_long C.longlong -) - -// Time - -type Timespec C.struct_timespec - -type Timeval C.struct_timeval - -type Timeval32 C.struct_timeval32 - -type Tms C.struct_tms - -type Utimbuf C.struct_utimbuf - -// Processes - -type Rusage C.struct_rusage - -type Rlimit C.struct_rlimit - -type _Gid_t C.gid_t - -// Files - -type Stat_t C.struct_stat - -type Flock_t C.struct_flock - -type Dirent C.struct_dirent - -// Filesystems - -type _Fsblkcnt_t C.fsblkcnt_t - -type Statvfs_t C.struct_statvfs - -// Sockets - -type RawSockaddrInet4 C.struct_sockaddr_in - -type RawSockaddrInet6 C.struct_sockaddr_in6 - -type RawSockaddrUnix C.struct_sockaddr_un - -type RawSockaddrDatalink C.struct_sockaddr_dl - -type RawSockaddr C.struct_sockaddr - -type RawSockaddrAny C.struct_sockaddr_any - -type _Socklen C.socklen_t - -type Linger C.struct_linger - -type Iovec C.struct_iovec - -type IPMreq C.struct_ip_mreq - -type IPv6Mreq C.struct_ipv6_mreq - -type Msghdr C.struct_msghdr - -type Cmsghdr C.struct_cmsghdr - -type Inet6Pktinfo C.struct_in6_pktinfo - -type IPv6MTUInfo C.struct_ip6_mtuinfo - -type ICMPv6Filter C.struct_icmp6_filter - -const ( - SizeofSockaddrInet4 = C.sizeof_struct_sockaddr_in - SizeofSockaddrInet6 = C.sizeof_struct_sockaddr_in6 - SizeofSockaddrAny = C.sizeof_struct_sockaddr_any - SizeofSockaddrUnix = C.sizeof_struct_sockaddr_un - SizeofSockaddrDatalink = C.sizeof_struct_sockaddr_dl - SizeofLinger = C.sizeof_struct_linger - SizeofIPMreq = C.sizeof_struct_ip_mreq - SizeofIPv6Mreq = C.sizeof_struct_ipv6_mreq - SizeofMsghdr = C.sizeof_struct_msghdr - SizeofCmsghdr = C.sizeof_struct_cmsghdr - SizeofInet6Pktinfo = C.sizeof_struct_in6_pktinfo - SizeofIPv6MTUInfo = C.sizeof_struct_ip6_mtuinfo - SizeofICMPv6Filter = C.sizeof_struct_icmp6_filter -) - -// Select - -type FdSet C.fd_set - -// Misc - -type Utsname C.struct_utsname - -type Ustat_t C.struct_ustat - -const ( - AT_FDCWD = C.AT_FDCWD - AT_SYMLINK_NOFOLLOW = C.AT_SYMLINK_NOFOLLOW - AT_SYMLINK_FOLLOW = C.AT_SYMLINK_FOLLOW - AT_REMOVEDIR = C.AT_REMOVEDIR - AT_EACCESS = C.AT_EACCESS -) - -// Routing and interface messages - -const ( - SizeofIfMsghdr = C.sizeof_struct_if_msghdr - SizeofIfData = C.sizeof_struct_if_data - SizeofIfaMsghdr = C.sizeof_struct_ifa_msghdr - SizeofRtMsghdr = C.sizeof_struct_rt_msghdr - SizeofRtMetrics = C.sizeof_struct_rt_metrics -) - -type IfMsghdr C.struct_if_msghdr - -type IfData C.struct_if_data - -type IfaMsghdr C.struct_ifa_msghdr - -type RtMsghdr C.struct_rt_msghdr - -type RtMetrics C.struct_rt_metrics - -// Berkeley packet filter - -const ( - SizeofBpfVersion = C.sizeof_struct_bpf_version - SizeofBpfStat = C.sizeof_struct_bpf_stat - SizeofBpfProgram = C.sizeof_struct_bpf_program - SizeofBpfInsn = C.sizeof_struct_bpf_insn - SizeofBpfHdr = C.sizeof_struct_bpf_hdr -) - -type BpfVersion C.struct_bpf_version - -type BpfStat C.struct_bpf_stat - -type BpfProgram C.struct_bpf_program - -type BpfInsn C.struct_bpf_insn - -type BpfTimeval C.struct_bpf_timeval - -type BpfHdr C.struct_bpf_hdr - -// Terminal handling - -type Termios C.struct_termios - -type Termio C.struct_termio - -type Winsize C.struct_winsize - -// poll - -type PollFd C.struct_pollfd - -const ( - POLLERR = C.POLLERR - POLLHUP = C.POLLHUP - POLLIN = C.POLLIN - POLLNVAL = C.POLLNVAL - POLLOUT = C.POLLOUT - POLLPRI = C.POLLPRI - POLLRDBAND = C.POLLRDBAND - POLLRDNORM = C.POLLRDNORM - POLLWRBAND = C.POLLWRBAND - POLLWRNORM = C.POLLWRNORM -) diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_386.go b/vendor/golang.org/x/sys/unix/zerrors_linux_386.go index 62f110fa..72066f80 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_386.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_386.go @@ -243,6 +243,7 @@ const ( BPF_F_LOCK = 0x4 BPF_F_MARK_ENFORCE = 0x40 BPF_F_MARK_MANGLED_0 = 0x20 + BPF_F_MMAPABLE = 0x400 BPF_F_NO_COMMON_LRU = 0x2 BPF_F_NO_PREALLOC = 0x1 BPF_F_NUMA_NODE = 0x4 @@ -417,8 +418,10 @@ const ( CLOCK_TXFROMRX = 0x4 CLOCK_TXINT = 0x3 CLONE_ARGS_SIZE_VER0 = 0x40 + CLONE_ARGS_SIZE_VER1 = 0x50 CLONE_CHILD_CLEARTID = 0x200000 CLONE_CHILD_SETTID = 0x1000000 + CLONE_CLEAR_SIGHAND = 0x100000000 CLONE_DETACHED = 0x400000 CLONE_FILES = 0x400 CLONE_FS = 0x200 @@ -716,8 +719,9 @@ const ( FSCRYPT_POLICY_FLAGS_PAD_4 = 0x0 FSCRYPT_POLICY_FLAGS_PAD_8 = 0x1 FSCRYPT_POLICY_FLAGS_PAD_MASK = 0x3 - FSCRYPT_POLICY_FLAGS_VALID = 0x7 + FSCRYPT_POLICY_FLAGS_VALID = 0xf FSCRYPT_POLICY_FLAG_DIRECT_KEY = 0x4 + FSCRYPT_POLICY_FLAG_IV_INO_LBLK_64 = 0x8 FSCRYPT_POLICY_V1 = 0x0 FSCRYPT_POLICY_V2 = 0x2 FS_ENCRYPTION_MODE_ADIANTUM = 0x9 @@ -747,7 +751,7 @@ const ( FS_POLICY_FLAGS_PAD_4 = 0x0 FS_POLICY_FLAGS_PAD_8 = 0x1 FS_POLICY_FLAGS_PAD_MASK = 0x3 - FS_POLICY_FLAGS_VALID = 0x7 + FS_POLICY_FLAGS_VALID = 0xf FUTEXFS_SUPER_MAGIC = 0xbad1dea F_ADD_SEALS = 0x409 F_DUPFD = 0x0 @@ -1229,6 +1233,7 @@ const ( LOOP_SET_STATUS64 = 0x4c04 LO_KEY_SIZE = 0x20 LO_NAME_SIZE = 0x40 + MADV_COLD = 0x14 MADV_DODUMP = 0x11 MADV_DOFORK = 0xb MADV_DONTDUMP = 0x10 @@ -1241,6 +1246,7 @@ const ( MADV_MERGEABLE = 0xc MADV_NOHUGEPAGE = 0xf MADV_NORMAL = 0x0 + MADV_PAGEOUT = 0x15 MADV_RANDOM = 0x1 MADV_REMOVE = 0x9 MADV_SEQUENTIAL = 0x2 @@ -1583,6 +1589,7 @@ const ( PERF_EVENT_IOC_SET_FILTER = 0x40042406 PERF_EVENT_IOC_SET_OUTPUT = 0x2405 PIPEFS_MAGIC = 0x50495045 + PPC_CMM_MAGIC = 0xc7571590 PPPIOCATTACH = 0x4004743d PPPIOCATTCHAN = 0x40047438 PPPIOCCONNECT = 0x4004743a @@ -1593,6 +1600,8 @@ const ( PPPIOCGDEBUG = 0x80047441 PPPIOCGFLAGS = 0x8004745a PPPIOCGIDLE = 0x8008743f + PPPIOCGIDLE32 = 0x8008743f + PPPIOCGIDLE64 = 0x8010743f PPPIOCGL2TPSTATS = 0x80487436 PPPIOCGMRU = 0x80047453 PPPIOCGNPMODE = 0xc008744c @@ -1929,12 +1938,28 @@ const ( RTF_UP = 0x1 RTF_WINDOW = 0x80 RTF_XRESOLVE = 0x800 + RTMGRP_DECnet_IFADDR = 0x1000 + RTMGRP_DECnet_ROUTE = 0x4000 + RTMGRP_IPV4_IFADDR = 0x10 + RTMGRP_IPV4_MROUTE = 0x20 + RTMGRP_IPV4_ROUTE = 0x40 + RTMGRP_IPV4_RULE = 0x80 + RTMGRP_IPV6_IFADDR = 0x100 + RTMGRP_IPV6_IFINFO = 0x800 + RTMGRP_IPV6_MROUTE = 0x200 + RTMGRP_IPV6_PREFIX = 0x20000 + RTMGRP_IPV6_ROUTE = 0x400 + RTMGRP_LINK = 0x1 + RTMGRP_NEIGH = 0x4 + RTMGRP_NOTIFY = 0x2 + RTMGRP_TC = 0x8 RTM_BASE = 0x10 RTM_DELACTION = 0x31 RTM_DELADDR = 0x15 RTM_DELADDRLABEL = 0x49 RTM_DELCHAIN = 0x65 RTM_DELLINK = 0x11 + RTM_DELLINKPROP = 0x6d RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 @@ -1958,6 +1983,7 @@ const ( RTM_GETCHAIN = 0x66 RTM_GETDCB = 0x4e RTM_GETLINK = 0x12 + RTM_GETLINKPROP = 0x6e RTM_GETMDB = 0x56 RTM_GETMULTICAST = 0x3a RTM_GETNEIGH = 0x1e @@ -1971,13 +1997,14 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x6b + RTM_MAX = 0x6f RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 RTM_NEWCACHEREPORT = 0x60 RTM_NEWCHAIN = 0x64 RTM_NEWLINK = 0x10 + RTM_NEWLINKPROP = 0x6c RTM_NEWMDB = 0x54 RTM_NEWNDUSEROPT = 0x44 RTM_NEWNEIGH = 0x1c @@ -1992,8 +2019,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x17 - RTM_NR_MSGTYPES = 0x5c + RTM_NR_FAMILIES = 0x18 + RTM_NR_MSGTYPES = 0x60 RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -2208,7 +2235,7 @@ const ( SOL_TLS = 0x11a SOL_X25 = 0x106 SOL_XDP = 0x11b - SOMAXCONN = 0x80 + SOMAXCONN = 0x1000 SO_ACCEPTCONN = 0x1e SO_ATTACH_BPF = 0x32 SO_ATTACH_FILTER = 0x1a @@ -2314,6 +2341,7 @@ const ( STATX_ATTR_ENCRYPTED = 0x800 STATX_ATTR_IMMUTABLE = 0x10 STATX_ATTR_NODUMP = 0x40 + STATX_ATTR_VERITY = 0x100000 STATX_BASIC_STATS = 0x7ff STATX_BLOCKS = 0x400 STATX_BTIME = 0x800 @@ -2434,6 +2462,7 @@ const ( TCP_THIN_DUPACK = 0x11 TCP_THIN_LINEAR_TIMEOUTS = 0x10 TCP_TIMESTAMP = 0x18 + TCP_TX_DELAY = 0x25 TCP_ULP = 0x1f TCP_USER_TIMEOUT = 0x12 TCP_WINDOW_CLAMP = 0xa @@ -2530,6 +2559,10 @@ const ( TIPC_ADDR_MCAST = 0x1 TIPC_ADDR_NAME = 0x2 TIPC_ADDR_NAMESEQ = 0x1 + TIPC_AEAD_ALG_NAME = 0x20 + TIPC_AEAD_KEYLEN_MAX = 0x24 + TIPC_AEAD_KEYLEN_MIN = 0x14 + TIPC_AEAD_KEY_SIZE_MAX = 0x48 TIPC_CFG_SRV = 0x0 TIPC_CLUSTER_BITS = 0xc TIPC_CLUSTER_MASK = 0xfff000 @@ -2562,6 +2595,7 @@ const ( TIPC_MCAST_REPLICAST = 0x86 TIPC_MEDIUM_IMPORTANCE = 0x1 TIPC_NODEID_LEN = 0x10 + TIPC_NODELAY = 0x8a TIPC_NODE_BITS = 0xc TIPC_NODE_MASK = 0xfff TIPC_NODE_OFFSET = 0x0 diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_amd64.go b/vendor/golang.org/x/sys/unix/zerrors_linux_amd64.go index 865154d9..ea6bb88d 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_amd64.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_amd64.go @@ -243,6 +243,7 @@ const ( BPF_F_LOCK = 0x4 BPF_F_MARK_ENFORCE = 0x40 BPF_F_MARK_MANGLED_0 = 0x20 + BPF_F_MMAPABLE = 0x400 BPF_F_NO_COMMON_LRU = 0x2 BPF_F_NO_PREALLOC = 0x1 BPF_F_NUMA_NODE = 0x4 @@ -417,8 +418,10 @@ const ( CLOCK_TXFROMRX = 0x4 CLOCK_TXINT = 0x3 CLONE_ARGS_SIZE_VER0 = 0x40 + CLONE_ARGS_SIZE_VER1 = 0x50 CLONE_CHILD_CLEARTID = 0x200000 CLONE_CHILD_SETTID = 0x1000000 + CLONE_CLEAR_SIGHAND = 0x100000000 CLONE_DETACHED = 0x400000 CLONE_FILES = 0x400 CLONE_FS = 0x200 @@ -716,8 +719,9 @@ const ( FSCRYPT_POLICY_FLAGS_PAD_4 = 0x0 FSCRYPT_POLICY_FLAGS_PAD_8 = 0x1 FSCRYPT_POLICY_FLAGS_PAD_MASK = 0x3 - FSCRYPT_POLICY_FLAGS_VALID = 0x7 + FSCRYPT_POLICY_FLAGS_VALID = 0xf FSCRYPT_POLICY_FLAG_DIRECT_KEY = 0x4 + FSCRYPT_POLICY_FLAG_IV_INO_LBLK_64 = 0x8 FSCRYPT_POLICY_V1 = 0x0 FSCRYPT_POLICY_V2 = 0x2 FS_ENCRYPTION_MODE_ADIANTUM = 0x9 @@ -747,7 +751,7 @@ const ( FS_POLICY_FLAGS_PAD_4 = 0x0 FS_POLICY_FLAGS_PAD_8 = 0x1 FS_POLICY_FLAGS_PAD_MASK = 0x3 - FS_POLICY_FLAGS_VALID = 0x7 + FS_POLICY_FLAGS_VALID = 0xf FUTEXFS_SUPER_MAGIC = 0xbad1dea F_ADD_SEALS = 0x409 F_DUPFD = 0x0 @@ -1229,6 +1233,7 @@ const ( LOOP_SET_STATUS64 = 0x4c04 LO_KEY_SIZE = 0x20 LO_NAME_SIZE = 0x40 + MADV_COLD = 0x14 MADV_DODUMP = 0x11 MADV_DOFORK = 0xb MADV_DONTDUMP = 0x10 @@ -1241,6 +1246,7 @@ const ( MADV_MERGEABLE = 0xc MADV_NOHUGEPAGE = 0xf MADV_NORMAL = 0x0 + MADV_PAGEOUT = 0x15 MADV_RANDOM = 0x1 MADV_REMOVE = 0x9 MADV_SEQUENTIAL = 0x2 @@ -1583,6 +1589,7 @@ const ( PERF_EVENT_IOC_SET_FILTER = 0x40082406 PERF_EVENT_IOC_SET_OUTPUT = 0x2405 PIPEFS_MAGIC = 0x50495045 + PPC_CMM_MAGIC = 0xc7571590 PPPIOCATTACH = 0x4004743d PPPIOCATTCHAN = 0x40047438 PPPIOCCONNECT = 0x4004743a @@ -1593,6 +1600,8 @@ const ( PPPIOCGDEBUG = 0x80047441 PPPIOCGFLAGS = 0x8004745a PPPIOCGIDLE = 0x8010743f + PPPIOCGIDLE32 = 0x8008743f + PPPIOCGIDLE64 = 0x8010743f PPPIOCGL2TPSTATS = 0x80487436 PPPIOCGMRU = 0x80047453 PPPIOCGNPMODE = 0xc008744c @@ -1930,12 +1939,28 @@ const ( RTF_UP = 0x1 RTF_WINDOW = 0x80 RTF_XRESOLVE = 0x800 + RTMGRP_DECnet_IFADDR = 0x1000 + RTMGRP_DECnet_ROUTE = 0x4000 + RTMGRP_IPV4_IFADDR = 0x10 + RTMGRP_IPV4_MROUTE = 0x20 + RTMGRP_IPV4_ROUTE = 0x40 + RTMGRP_IPV4_RULE = 0x80 + RTMGRP_IPV6_IFADDR = 0x100 + RTMGRP_IPV6_IFINFO = 0x800 + RTMGRP_IPV6_MROUTE = 0x200 + RTMGRP_IPV6_PREFIX = 0x20000 + RTMGRP_IPV6_ROUTE = 0x400 + RTMGRP_LINK = 0x1 + RTMGRP_NEIGH = 0x4 + RTMGRP_NOTIFY = 0x2 + RTMGRP_TC = 0x8 RTM_BASE = 0x10 RTM_DELACTION = 0x31 RTM_DELADDR = 0x15 RTM_DELADDRLABEL = 0x49 RTM_DELCHAIN = 0x65 RTM_DELLINK = 0x11 + RTM_DELLINKPROP = 0x6d RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 @@ -1959,6 +1984,7 @@ const ( RTM_GETCHAIN = 0x66 RTM_GETDCB = 0x4e RTM_GETLINK = 0x12 + RTM_GETLINKPROP = 0x6e RTM_GETMDB = 0x56 RTM_GETMULTICAST = 0x3a RTM_GETNEIGH = 0x1e @@ -1972,13 +1998,14 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x6b + RTM_MAX = 0x6f RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 RTM_NEWCACHEREPORT = 0x60 RTM_NEWCHAIN = 0x64 RTM_NEWLINK = 0x10 + RTM_NEWLINKPROP = 0x6c RTM_NEWMDB = 0x54 RTM_NEWNDUSEROPT = 0x44 RTM_NEWNEIGH = 0x1c @@ -1993,8 +2020,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x17 - RTM_NR_MSGTYPES = 0x5c + RTM_NR_FAMILIES = 0x18 + RTM_NR_MSGTYPES = 0x60 RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -2209,7 +2236,7 @@ const ( SOL_TLS = 0x11a SOL_X25 = 0x106 SOL_XDP = 0x11b - SOMAXCONN = 0x80 + SOMAXCONN = 0x1000 SO_ACCEPTCONN = 0x1e SO_ATTACH_BPF = 0x32 SO_ATTACH_FILTER = 0x1a @@ -2315,6 +2342,7 @@ const ( STATX_ATTR_ENCRYPTED = 0x800 STATX_ATTR_IMMUTABLE = 0x10 STATX_ATTR_NODUMP = 0x40 + STATX_ATTR_VERITY = 0x100000 STATX_BASIC_STATS = 0x7ff STATX_BLOCKS = 0x400 STATX_BTIME = 0x800 @@ -2435,6 +2463,7 @@ const ( TCP_THIN_DUPACK = 0x11 TCP_THIN_LINEAR_TIMEOUTS = 0x10 TCP_TIMESTAMP = 0x18 + TCP_TX_DELAY = 0x25 TCP_ULP = 0x1f TCP_USER_TIMEOUT = 0x12 TCP_WINDOW_CLAMP = 0xa @@ -2531,6 +2560,10 @@ const ( TIPC_ADDR_MCAST = 0x1 TIPC_ADDR_NAME = 0x2 TIPC_ADDR_NAMESEQ = 0x1 + TIPC_AEAD_ALG_NAME = 0x20 + TIPC_AEAD_KEYLEN_MAX = 0x24 + TIPC_AEAD_KEYLEN_MIN = 0x14 + TIPC_AEAD_KEY_SIZE_MAX = 0x48 TIPC_CFG_SRV = 0x0 TIPC_CLUSTER_BITS = 0xc TIPC_CLUSTER_MASK = 0xfff000 @@ -2563,6 +2596,7 @@ const ( TIPC_MCAST_REPLICAST = 0x86 TIPC_MEDIUM_IMPORTANCE = 0x1 TIPC_NODEID_LEN = 0x10 + TIPC_NODELAY = 0x8a TIPC_NODE_BITS = 0xc TIPC_NODE_MASK = 0xfff TIPC_NODE_OFFSET = 0x0 diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_arm.go b/vendor/golang.org/x/sys/unix/zerrors_linux_arm.go index 386beb45..76b3d3b0 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_arm.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_arm.go @@ -243,6 +243,7 @@ const ( BPF_F_LOCK = 0x4 BPF_F_MARK_ENFORCE = 0x40 BPF_F_MARK_MANGLED_0 = 0x20 + BPF_F_MMAPABLE = 0x400 BPF_F_NO_COMMON_LRU = 0x2 BPF_F_NO_PREALLOC = 0x1 BPF_F_NUMA_NODE = 0x4 @@ -417,8 +418,10 @@ const ( CLOCK_TXFROMRX = 0x4 CLOCK_TXINT = 0x3 CLONE_ARGS_SIZE_VER0 = 0x40 + CLONE_ARGS_SIZE_VER1 = 0x50 CLONE_CHILD_CLEARTID = 0x200000 CLONE_CHILD_SETTID = 0x1000000 + CLONE_CLEAR_SIGHAND = 0x100000000 CLONE_DETACHED = 0x400000 CLONE_FILES = 0x400 CLONE_FS = 0x200 @@ -715,8 +718,9 @@ const ( FSCRYPT_POLICY_FLAGS_PAD_4 = 0x0 FSCRYPT_POLICY_FLAGS_PAD_8 = 0x1 FSCRYPT_POLICY_FLAGS_PAD_MASK = 0x3 - FSCRYPT_POLICY_FLAGS_VALID = 0x7 + FSCRYPT_POLICY_FLAGS_VALID = 0xf FSCRYPT_POLICY_FLAG_DIRECT_KEY = 0x4 + FSCRYPT_POLICY_FLAG_IV_INO_LBLK_64 = 0x8 FSCRYPT_POLICY_V1 = 0x0 FSCRYPT_POLICY_V2 = 0x2 FS_ENCRYPTION_MODE_ADIANTUM = 0x9 @@ -746,7 +750,7 @@ const ( FS_POLICY_FLAGS_PAD_4 = 0x0 FS_POLICY_FLAGS_PAD_8 = 0x1 FS_POLICY_FLAGS_PAD_MASK = 0x3 - FS_POLICY_FLAGS_VALID = 0x7 + FS_POLICY_FLAGS_VALID = 0xf FUTEXFS_SUPER_MAGIC = 0xbad1dea F_ADD_SEALS = 0x409 F_DUPFD = 0x0 @@ -1228,6 +1232,7 @@ const ( LOOP_SET_STATUS64 = 0x4c04 LO_KEY_SIZE = 0x20 LO_NAME_SIZE = 0x40 + MADV_COLD = 0x14 MADV_DODUMP = 0x11 MADV_DOFORK = 0xb MADV_DONTDUMP = 0x10 @@ -1240,6 +1245,7 @@ const ( MADV_MERGEABLE = 0xc MADV_NOHUGEPAGE = 0xf MADV_NORMAL = 0x0 + MADV_PAGEOUT = 0x15 MADV_RANDOM = 0x1 MADV_REMOVE = 0x9 MADV_SEQUENTIAL = 0x2 @@ -1581,6 +1587,7 @@ const ( PERF_EVENT_IOC_SET_FILTER = 0x40042406 PERF_EVENT_IOC_SET_OUTPUT = 0x2405 PIPEFS_MAGIC = 0x50495045 + PPC_CMM_MAGIC = 0xc7571590 PPPIOCATTACH = 0x4004743d PPPIOCATTCHAN = 0x40047438 PPPIOCCONNECT = 0x4004743a @@ -1591,6 +1598,8 @@ const ( PPPIOCGDEBUG = 0x80047441 PPPIOCGFLAGS = 0x8004745a PPPIOCGIDLE = 0x8008743f + PPPIOCGIDLE32 = 0x8008743f + PPPIOCGIDLE64 = 0x8010743f PPPIOCGL2TPSTATS = 0x80487436 PPPIOCGMRU = 0x80047453 PPPIOCGNPMODE = 0xc008744c @@ -1936,12 +1945,28 @@ const ( RTF_UP = 0x1 RTF_WINDOW = 0x80 RTF_XRESOLVE = 0x800 + RTMGRP_DECnet_IFADDR = 0x1000 + RTMGRP_DECnet_ROUTE = 0x4000 + RTMGRP_IPV4_IFADDR = 0x10 + RTMGRP_IPV4_MROUTE = 0x20 + RTMGRP_IPV4_ROUTE = 0x40 + RTMGRP_IPV4_RULE = 0x80 + RTMGRP_IPV6_IFADDR = 0x100 + RTMGRP_IPV6_IFINFO = 0x800 + RTMGRP_IPV6_MROUTE = 0x200 + RTMGRP_IPV6_PREFIX = 0x20000 + RTMGRP_IPV6_ROUTE = 0x400 + RTMGRP_LINK = 0x1 + RTMGRP_NEIGH = 0x4 + RTMGRP_NOTIFY = 0x2 + RTMGRP_TC = 0x8 RTM_BASE = 0x10 RTM_DELACTION = 0x31 RTM_DELADDR = 0x15 RTM_DELADDRLABEL = 0x49 RTM_DELCHAIN = 0x65 RTM_DELLINK = 0x11 + RTM_DELLINKPROP = 0x6d RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 @@ -1965,6 +1990,7 @@ const ( RTM_GETCHAIN = 0x66 RTM_GETDCB = 0x4e RTM_GETLINK = 0x12 + RTM_GETLINKPROP = 0x6e RTM_GETMDB = 0x56 RTM_GETMULTICAST = 0x3a RTM_GETNEIGH = 0x1e @@ -1978,13 +2004,14 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x6b + RTM_MAX = 0x6f RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 RTM_NEWCACHEREPORT = 0x60 RTM_NEWCHAIN = 0x64 RTM_NEWLINK = 0x10 + RTM_NEWLINKPROP = 0x6c RTM_NEWMDB = 0x54 RTM_NEWNDUSEROPT = 0x44 RTM_NEWNEIGH = 0x1c @@ -1999,8 +2026,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x17 - RTM_NR_MSGTYPES = 0x5c + RTM_NR_FAMILIES = 0x18 + RTM_NR_MSGTYPES = 0x60 RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -2215,7 +2242,7 @@ const ( SOL_TLS = 0x11a SOL_X25 = 0x106 SOL_XDP = 0x11b - SOMAXCONN = 0x80 + SOMAXCONN = 0x1000 SO_ACCEPTCONN = 0x1e SO_ATTACH_BPF = 0x32 SO_ATTACH_FILTER = 0x1a @@ -2321,6 +2348,7 @@ const ( STATX_ATTR_ENCRYPTED = 0x800 STATX_ATTR_IMMUTABLE = 0x10 STATX_ATTR_NODUMP = 0x40 + STATX_ATTR_VERITY = 0x100000 STATX_BASIC_STATS = 0x7ff STATX_BLOCKS = 0x400 STATX_BTIME = 0x800 @@ -2441,6 +2469,7 @@ const ( TCP_THIN_DUPACK = 0x11 TCP_THIN_LINEAR_TIMEOUTS = 0x10 TCP_TIMESTAMP = 0x18 + TCP_TX_DELAY = 0x25 TCP_ULP = 0x1f TCP_USER_TIMEOUT = 0x12 TCP_WINDOW_CLAMP = 0xa @@ -2537,6 +2566,10 @@ const ( TIPC_ADDR_MCAST = 0x1 TIPC_ADDR_NAME = 0x2 TIPC_ADDR_NAMESEQ = 0x1 + TIPC_AEAD_ALG_NAME = 0x20 + TIPC_AEAD_KEYLEN_MAX = 0x24 + TIPC_AEAD_KEYLEN_MIN = 0x14 + TIPC_AEAD_KEY_SIZE_MAX = 0x48 TIPC_CFG_SRV = 0x0 TIPC_CLUSTER_BITS = 0xc TIPC_CLUSTER_MASK = 0xfff000 @@ -2569,6 +2602,7 @@ const ( TIPC_MCAST_REPLICAST = 0x86 TIPC_MEDIUM_IMPORTANCE = 0x1 TIPC_NODEID_LEN = 0x10 + TIPC_NODELAY = 0x8a TIPC_NODE_BITS = 0xc TIPC_NODE_MASK = 0xfff TIPC_NODE_OFFSET = 0x0 diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_arm64.go b/vendor/golang.org/x/sys/unix/zerrors_linux_arm64.go index 09e11cc9..1405ea57 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_arm64.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_arm64.go @@ -243,6 +243,7 @@ const ( BPF_F_LOCK = 0x4 BPF_F_MARK_ENFORCE = 0x40 BPF_F_MARK_MANGLED_0 = 0x20 + BPF_F_MMAPABLE = 0x400 BPF_F_NO_COMMON_LRU = 0x2 BPF_F_NO_PREALLOC = 0x1 BPF_F_NUMA_NODE = 0x4 @@ -417,8 +418,10 @@ const ( CLOCK_TXFROMRX = 0x4 CLOCK_TXINT = 0x3 CLONE_ARGS_SIZE_VER0 = 0x40 + CLONE_ARGS_SIZE_VER1 = 0x50 CLONE_CHILD_CLEARTID = 0x200000 CLONE_CHILD_SETTID = 0x1000000 + CLONE_CLEAR_SIGHAND = 0x100000000 CLONE_DETACHED = 0x400000 CLONE_FILES = 0x400 CLONE_FS = 0x200 @@ -718,8 +721,9 @@ const ( FSCRYPT_POLICY_FLAGS_PAD_4 = 0x0 FSCRYPT_POLICY_FLAGS_PAD_8 = 0x1 FSCRYPT_POLICY_FLAGS_PAD_MASK = 0x3 - FSCRYPT_POLICY_FLAGS_VALID = 0x7 + FSCRYPT_POLICY_FLAGS_VALID = 0xf FSCRYPT_POLICY_FLAG_DIRECT_KEY = 0x4 + FSCRYPT_POLICY_FLAG_IV_INO_LBLK_64 = 0x8 FSCRYPT_POLICY_V1 = 0x0 FSCRYPT_POLICY_V2 = 0x2 FS_ENCRYPTION_MODE_ADIANTUM = 0x9 @@ -749,7 +753,7 @@ const ( FS_POLICY_FLAGS_PAD_4 = 0x0 FS_POLICY_FLAGS_PAD_8 = 0x1 FS_POLICY_FLAGS_PAD_MASK = 0x3 - FS_POLICY_FLAGS_VALID = 0x7 + FS_POLICY_FLAGS_VALID = 0xf FUTEXFS_SUPER_MAGIC = 0xbad1dea F_ADD_SEALS = 0x409 F_DUPFD = 0x0 @@ -1231,6 +1235,7 @@ const ( LOOP_SET_STATUS64 = 0x4c04 LO_KEY_SIZE = 0x20 LO_NAME_SIZE = 0x40 + MADV_COLD = 0x14 MADV_DODUMP = 0x11 MADV_DOFORK = 0xb MADV_DONTDUMP = 0x10 @@ -1243,6 +1248,7 @@ const ( MADV_MERGEABLE = 0xc MADV_NOHUGEPAGE = 0xf MADV_NORMAL = 0x0 + MADV_PAGEOUT = 0x15 MADV_RANDOM = 0x1 MADV_REMOVE = 0x9 MADV_SEQUENTIAL = 0x2 @@ -1584,6 +1590,7 @@ const ( PERF_EVENT_IOC_SET_FILTER = 0x40082406 PERF_EVENT_IOC_SET_OUTPUT = 0x2405 PIPEFS_MAGIC = 0x50495045 + PPC_CMM_MAGIC = 0xc7571590 PPPIOCATTACH = 0x4004743d PPPIOCATTCHAN = 0x40047438 PPPIOCCONNECT = 0x4004743a @@ -1594,6 +1601,8 @@ const ( PPPIOCGDEBUG = 0x80047441 PPPIOCGFLAGS = 0x8004745a PPPIOCGIDLE = 0x8010743f + PPPIOCGIDLE32 = 0x8008743f + PPPIOCGIDLE64 = 0x8010743f PPPIOCGL2TPSTATS = 0x80487436 PPPIOCGMRU = 0x80047453 PPPIOCGNPMODE = 0xc008744c @@ -1922,12 +1931,28 @@ const ( RTF_UP = 0x1 RTF_WINDOW = 0x80 RTF_XRESOLVE = 0x800 + RTMGRP_DECnet_IFADDR = 0x1000 + RTMGRP_DECnet_ROUTE = 0x4000 + RTMGRP_IPV4_IFADDR = 0x10 + RTMGRP_IPV4_MROUTE = 0x20 + RTMGRP_IPV4_ROUTE = 0x40 + RTMGRP_IPV4_RULE = 0x80 + RTMGRP_IPV6_IFADDR = 0x100 + RTMGRP_IPV6_IFINFO = 0x800 + RTMGRP_IPV6_MROUTE = 0x200 + RTMGRP_IPV6_PREFIX = 0x20000 + RTMGRP_IPV6_ROUTE = 0x400 + RTMGRP_LINK = 0x1 + RTMGRP_NEIGH = 0x4 + RTMGRP_NOTIFY = 0x2 + RTMGRP_TC = 0x8 RTM_BASE = 0x10 RTM_DELACTION = 0x31 RTM_DELADDR = 0x15 RTM_DELADDRLABEL = 0x49 RTM_DELCHAIN = 0x65 RTM_DELLINK = 0x11 + RTM_DELLINKPROP = 0x6d RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 @@ -1951,6 +1976,7 @@ const ( RTM_GETCHAIN = 0x66 RTM_GETDCB = 0x4e RTM_GETLINK = 0x12 + RTM_GETLINKPROP = 0x6e RTM_GETMDB = 0x56 RTM_GETMULTICAST = 0x3a RTM_GETNEIGH = 0x1e @@ -1964,13 +1990,14 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x6b + RTM_MAX = 0x6f RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 RTM_NEWCACHEREPORT = 0x60 RTM_NEWCHAIN = 0x64 RTM_NEWLINK = 0x10 + RTM_NEWLINKPROP = 0x6c RTM_NEWMDB = 0x54 RTM_NEWNDUSEROPT = 0x44 RTM_NEWNEIGH = 0x1c @@ -1985,8 +2012,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x17 - RTM_NR_MSGTYPES = 0x5c + RTM_NR_FAMILIES = 0x18 + RTM_NR_MSGTYPES = 0x60 RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -2201,7 +2228,7 @@ const ( SOL_TLS = 0x11a SOL_X25 = 0x106 SOL_XDP = 0x11b - SOMAXCONN = 0x80 + SOMAXCONN = 0x1000 SO_ACCEPTCONN = 0x1e SO_ATTACH_BPF = 0x32 SO_ATTACH_FILTER = 0x1a @@ -2307,6 +2334,7 @@ const ( STATX_ATTR_ENCRYPTED = 0x800 STATX_ATTR_IMMUTABLE = 0x10 STATX_ATTR_NODUMP = 0x40 + STATX_ATTR_VERITY = 0x100000 STATX_BASIC_STATS = 0x7ff STATX_BLOCKS = 0x400 STATX_BTIME = 0x800 @@ -2428,6 +2456,7 @@ const ( TCP_THIN_DUPACK = 0x11 TCP_THIN_LINEAR_TIMEOUTS = 0x10 TCP_TIMESTAMP = 0x18 + TCP_TX_DELAY = 0x25 TCP_ULP = 0x1f TCP_USER_TIMEOUT = 0x12 TCP_WINDOW_CLAMP = 0xa @@ -2524,6 +2553,10 @@ const ( TIPC_ADDR_MCAST = 0x1 TIPC_ADDR_NAME = 0x2 TIPC_ADDR_NAMESEQ = 0x1 + TIPC_AEAD_ALG_NAME = 0x20 + TIPC_AEAD_KEYLEN_MAX = 0x24 + TIPC_AEAD_KEYLEN_MIN = 0x14 + TIPC_AEAD_KEY_SIZE_MAX = 0x48 TIPC_CFG_SRV = 0x0 TIPC_CLUSTER_BITS = 0xc TIPC_CLUSTER_MASK = 0xfff000 @@ -2556,6 +2589,7 @@ const ( TIPC_MCAST_REPLICAST = 0x86 TIPC_MEDIUM_IMPORTANCE = 0x1 TIPC_NODEID_LEN = 0x10 + TIPC_NODELAY = 0x8a TIPC_NODE_BITS = 0xc TIPC_NODE_MASK = 0xfff TIPC_NODE_OFFSET = 0x0 diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_mips.go b/vendor/golang.org/x/sys/unix/zerrors_linux_mips.go index e3910aa1..a6cd090e 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_mips.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_mips.go @@ -243,6 +243,7 @@ const ( BPF_F_LOCK = 0x4 BPF_F_MARK_ENFORCE = 0x40 BPF_F_MARK_MANGLED_0 = 0x20 + BPF_F_MMAPABLE = 0x400 BPF_F_NO_COMMON_LRU = 0x2 BPF_F_NO_PREALLOC = 0x1 BPF_F_NUMA_NODE = 0x4 @@ -417,8 +418,10 @@ const ( CLOCK_TXFROMRX = 0x4 CLOCK_TXINT = 0x3 CLONE_ARGS_SIZE_VER0 = 0x40 + CLONE_ARGS_SIZE_VER1 = 0x50 CLONE_CHILD_CLEARTID = 0x200000 CLONE_CHILD_SETTID = 0x1000000 + CLONE_CLEAR_SIGHAND = 0x100000000 CLONE_DETACHED = 0x400000 CLONE_FILES = 0x400 CLONE_FS = 0x200 @@ -715,8 +718,9 @@ const ( FSCRYPT_POLICY_FLAGS_PAD_4 = 0x0 FSCRYPT_POLICY_FLAGS_PAD_8 = 0x1 FSCRYPT_POLICY_FLAGS_PAD_MASK = 0x3 - FSCRYPT_POLICY_FLAGS_VALID = 0x7 + FSCRYPT_POLICY_FLAGS_VALID = 0xf FSCRYPT_POLICY_FLAG_DIRECT_KEY = 0x4 + FSCRYPT_POLICY_FLAG_IV_INO_LBLK_64 = 0x8 FSCRYPT_POLICY_V1 = 0x0 FSCRYPT_POLICY_V2 = 0x2 FS_ENCRYPTION_MODE_ADIANTUM = 0x9 @@ -746,7 +750,7 @@ const ( FS_POLICY_FLAGS_PAD_4 = 0x0 FS_POLICY_FLAGS_PAD_8 = 0x1 FS_POLICY_FLAGS_PAD_MASK = 0x3 - FS_POLICY_FLAGS_VALID = 0x7 + FS_POLICY_FLAGS_VALID = 0xf FUTEXFS_SUPER_MAGIC = 0xbad1dea F_ADD_SEALS = 0x409 F_DUPFD = 0x0 @@ -1228,6 +1232,7 @@ const ( LOOP_SET_STATUS64 = 0x4c04 LO_KEY_SIZE = 0x20 LO_NAME_SIZE = 0x40 + MADV_COLD = 0x14 MADV_DODUMP = 0x11 MADV_DOFORK = 0xb MADV_DONTDUMP = 0x10 @@ -1240,6 +1245,7 @@ const ( MADV_MERGEABLE = 0xc MADV_NOHUGEPAGE = 0xf MADV_NORMAL = 0x0 + MADV_PAGEOUT = 0x15 MADV_RANDOM = 0x1 MADV_REMOVE = 0x9 MADV_SEQUENTIAL = 0x2 @@ -1581,6 +1587,7 @@ const ( PERF_EVENT_IOC_SET_FILTER = 0x80042406 PERF_EVENT_IOC_SET_OUTPUT = 0x20002405 PIPEFS_MAGIC = 0x50495045 + PPC_CMM_MAGIC = 0xc7571590 PPPIOCATTACH = 0x8004743d PPPIOCATTCHAN = 0x80047438 PPPIOCCONNECT = 0x8004743a @@ -1591,6 +1598,8 @@ const ( PPPIOCGDEBUG = 0x40047441 PPPIOCGFLAGS = 0x4004745a PPPIOCGIDLE = 0x4008743f + PPPIOCGIDLE32 = 0x4008743f + PPPIOCGIDLE64 = 0x4010743f PPPIOCGL2TPSTATS = 0x40487436 PPPIOCGMRU = 0x40047453 PPPIOCGNPMODE = 0xc008744c @@ -1929,12 +1938,28 @@ const ( RTF_UP = 0x1 RTF_WINDOW = 0x80 RTF_XRESOLVE = 0x800 + RTMGRP_DECnet_IFADDR = 0x1000 + RTMGRP_DECnet_ROUTE = 0x4000 + RTMGRP_IPV4_IFADDR = 0x10 + RTMGRP_IPV4_MROUTE = 0x20 + RTMGRP_IPV4_ROUTE = 0x40 + RTMGRP_IPV4_RULE = 0x80 + RTMGRP_IPV6_IFADDR = 0x100 + RTMGRP_IPV6_IFINFO = 0x800 + RTMGRP_IPV6_MROUTE = 0x200 + RTMGRP_IPV6_PREFIX = 0x20000 + RTMGRP_IPV6_ROUTE = 0x400 + RTMGRP_LINK = 0x1 + RTMGRP_NEIGH = 0x4 + RTMGRP_NOTIFY = 0x2 + RTMGRP_TC = 0x8 RTM_BASE = 0x10 RTM_DELACTION = 0x31 RTM_DELADDR = 0x15 RTM_DELADDRLABEL = 0x49 RTM_DELCHAIN = 0x65 RTM_DELLINK = 0x11 + RTM_DELLINKPROP = 0x6d RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 @@ -1958,6 +1983,7 @@ const ( RTM_GETCHAIN = 0x66 RTM_GETDCB = 0x4e RTM_GETLINK = 0x12 + RTM_GETLINKPROP = 0x6e RTM_GETMDB = 0x56 RTM_GETMULTICAST = 0x3a RTM_GETNEIGH = 0x1e @@ -1971,13 +1997,14 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x6b + RTM_MAX = 0x6f RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 RTM_NEWCACHEREPORT = 0x60 RTM_NEWCHAIN = 0x64 RTM_NEWLINK = 0x10 + RTM_NEWLINKPROP = 0x6c RTM_NEWMDB = 0x54 RTM_NEWNDUSEROPT = 0x44 RTM_NEWNEIGH = 0x1c @@ -1992,8 +2019,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x17 - RTM_NR_MSGTYPES = 0x5c + RTM_NR_FAMILIES = 0x18 + RTM_NR_MSGTYPES = 0x60 RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -2208,7 +2235,7 @@ const ( SOL_TLS = 0x11a SOL_X25 = 0x106 SOL_XDP = 0x11b - SOMAXCONN = 0x80 + SOMAXCONN = 0x1000 SO_ACCEPTCONN = 0x1009 SO_ATTACH_BPF = 0x32 SO_ATTACH_FILTER = 0x1a @@ -2315,6 +2342,7 @@ const ( STATX_ATTR_ENCRYPTED = 0x800 STATX_ATTR_IMMUTABLE = 0x10 STATX_ATTR_NODUMP = 0x40 + STATX_ATTR_VERITY = 0x100000 STATX_BASIC_STATS = 0x7ff STATX_BLOCKS = 0x400 STATX_BTIME = 0x800 @@ -2434,6 +2462,7 @@ const ( TCP_THIN_DUPACK = 0x11 TCP_THIN_LINEAR_TIMEOUTS = 0x10 TCP_TIMESTAMP = 0x18 + TCP_TX_DELAY = 0x25 TCP_ULP = 0x1f TCP_USER_TIMEOUT = 0x12 TCP_WINDOW_CLAMP = 0xa @@ -2532,6 +2561,10 @@ const ( TIPC_ADDR_MCAST = 0x1 TIPC_ADDR_NAME = 0x2 TIPC_ADDR_NAMESEQ = 0x1 + TIPC_AEAD_ALG_NAME = 0x20 + TIPC_AEAD_KEYLEN_MAX = 0x24 + TIPC_AEAD_KEYLEN_MIN = 0x14 + TIPC_AEAD_KEY_SIZE_MAX = 0x48 TIPC_CFG_SRV = 0x0 TIPC_CLUSTER_BITS = 0xc TIPC_CLUSTER_MASK = 0xfff000 @@ -2564,6 +2597,7 @@ const ( TIPC_MCAST_REPLICAST = 0x86 TIPC_MEDIUM_IMPORTANCE = 0x1 TIPC_NODEID_LEN = 0x10 + TIPC_NODELAY = 0x8a TIPC_NODE_BITS = 0xc TIPC_NODE_MASK = 0xfff TIPC_NODE_OFFSET = 0x0 diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_mips64.go b/vendor/golang.org/x/sys/unix/zerrors_linux_mips64.go index 9877b7c7..9152b5f1 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_mips64.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_mips64.go @@ -243,6 +243,7 @@ const ( BPF_F_LOCK = 0x4 BPF_F_MARK_ENFORCE = 0x40 BPF_F_MARK_MANGLED_0 = 0x20 + BPF_F_MMAPABLE = 0x400 BPF_F_NO_COMMON_LRU = 0x2 BPF_F_NO_PREALLOC = 0x1 BPF_F_NUMA_NODE = 0x4 @@ -417,8 +418,10 @@ const ( CLOCK_TXFROMRX = 0x4 CLOCK_TXINT = 0x3 CLONE_ARGS_SIZE_VER0 = 0x40 + CLONE_ARGS_SIZE_VER1 = 0x50 CLONE_CHILD_CLEARTID = 0x200000 CLONE_CHILD_SETTID = 0x1000000 + CLONE_CLEAR_SIGHAND = 0x100000000 CLONE_DETACHED = 0x400000 CLONE_FILES = 0x400 CLONE_FS = 0x200 @@ -715,8 +718,9 @@ const ( FSCRYPT_POLICY_FLAGS_PAD_4 = 0x0 FSCRYPT_POLICY_FLAGS_PAD_8 = 0x1 FSCRYPT_POLICY_FLAGS_PAD_MASK = 0x3 - FSCRYPT_POLICY_FLAGS_VALID = 0x7 + FSCRYPT_POLICY_FLAGS_VALID = 0xf FSCRYPT_POLICY_FLAG_DIRECT_KEY = 0x4 + FSCRYPT_POLICY_FLAG_IV_INO_LBLK_64 = 0x8 FSCRYPT_POLICY_V1 = 0x0 FSCRYPT_POLICY_V2 = 0x2 FS_ENCRYPTION_MODE_ADIANTUM = 0x9 @@ -746,7 +750,7 @@ const ( FS_POLICY_FLAGS_PAD_4 = 0x0 FS_POLICY_FLAGS_PAD_8 = 0x1 FS_POLICY_FLAGS_PAD_MASK = 0x3 - FS_POLICY_FLAGS_VALID = 0x7 + FS_POLICY_FLAGS_VALID = 0xf FUTEXFS_SUPER_MAGIC = 0xbad1dea F_ADD_SEALS = 0x409 F_DUPFD = 0x0 @@ -1228,6 +1232,7 @@ const ( LOOP_SET_STATUS64 = 0x4c04 LO_KEY_SIZE = 0x20 LO_NAME_SIZE = 0x40 + MADV_COLD = 0x14 MADV_DODUMP = 0x11 MADV_DOFORK = 0xb MADV_DONTDUMP = 0x10 @@ -1240,6 +1245,7 @@ const ( MADV_MERGEABLE = 0xc MADV_NOHUGEPAGE = 0xf MADV_NORMAL = 0x0 + MADV_PAGEOUT = 0x15 MADV_RANDOM = 0x1 MADV_REMOVE = 0x9 MADV_SEQUENTIAL = 0x2 @@ -1581,6 +1587,7 @@ const ( PERF_EVENT_IOC_SET_FILTER = 0x80082406 PERF_EVENT_IOC_SET_OUTPUT = 0x20002405 PIPEFS_MAGIC = 0x50495045 + PPC_CMM_MAGIC = 0xc7571590 PPPIOCATTACH = 0x8004743d PPPIOCATTCHAN = 0x80047438 PPPIOCCONNECT = 0x8004743a @@ -1591,6 +1598,8 @@ const ( PPPIOCGDEBUG = 0x40047441 PPPIOCGFLAGS = 0x4004745a PPPIOCGIDLE = 0x4010743f + PPPIOCGIDLE32 = 0x4008743f + PPPIOCGIDLE64 = 0x4010743f PPPIOCGL2TPSTATS = 0x40487436 PPPIOCGMRU = 0x40047453 PPPIOCGNPMODE = 0xc008744c @@ -1929,12 +1938,28 @@ const ( RTF_UP = 0x1 RTF_WINDOW = 0x80 RTF_XRESOLVE = 0x800 + RTMGRP_DECnet_IFADDR = 0x1000 + RTMGRP_DECnet_ROUTE = 0x4000 + RTMGRP_IPV4_IFADDR = 0x10 + RTMGRP_IPV4_MROUTE = 0x20 + RTMGRP_IPV4_ROUTE = 0x40 + RTMGRP_IPV4_RULE = 0x80 + RTMGRP_IPV6_IFADDR = 0x100 + RTMGRP_IPV6_IFINFO = 0x800 + RTMGRP_IPV6_MROUTE = 0x200 + RTMGRP_IPV6_PREFIX = 0x20000 + RTMGRP_IPV6_ROUTE = 0x400 + RTMGRP_LINK = 0x1 + RTMGRP_NEIGH = 0x4 + RTMGRP_NOTIFY = 0x2 + RTMGRP_TC = 0x8 RTM_BASE = 0x10 RTM_DELACTION = 0x31 RTM_DELADDR = 0x15 RTM_DELADDRLABEL = 0x49 RTM_DELCHAIN = 0x65 RTM_DELLINK = 0x11 + RTM_DELLINKPROP = 0x6d RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 @@ -1958,6 +1983,7 @@ const ( RTM_GETCHAIN = 0x66 RTM_GETDCB = 0x4e RTM_GETLINK = 0x12 + RTM_GETLINKPROP = 0x6e RTM_GETMDB = 0x56 RTM_GETMULTICAST = 0x3a RTM_GETNEIGH = 0x1e @@ -1971,13 +1997,14 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x6b + RTM_MAX = 0x6f RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 RTM_NEWCACHEREPORT = 0x60 RTM_NEWCHAIN = 0x64 RTM_NEWLINK = 0x10 + RTM_NEWLINKPROP = 0x6c RTM_NEWMDB = 0x54 RTM_NEWNDUSEROPT = 0x44 RTM_NEWNEIGH = 0x1c @@ -1992,8 +2019,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x17 - RTM_NR_MSGTYPES = 0x5c + RTM_NR_FAMILIES = 0x18 + RTM_NR_MSGTYPES = 0x60 RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -2208,7 +2235,7 @@ const ( SOL_TLS = 0x11a SOL_X25 = 0x106 SOL_XDP = 0x11b - SOMAXCONN = 0x80 + SOMAXCONN = 0x1000 SO_ACCEPTCONN = 0x1009 SO_ATTACH_BPF = 0x32 SO_ATTACH_FILTER = 0x1a @@ -2315,6 +2342,7 @@ const ( STATX_ATTR_ENCRYPTED = 0x800 STATX_ATTR_IMMUTABLE = 0x10 STATX_ATTR_NODUMP = 0x40 + STATX_ATTR_VERITY = 0x100000 STATX_BASIC_STATS = 0x7ff STATX_BLOCKS = 0x400 STATX_BTIME = 0x800 @@ -2434,6 +2462,7 @@ const ( TCP_THIN_DUPACK = 0x11 TCP_THIN_LINEAR_TIMEOUTS = 0x10 TCP_TIMESTAMP = 0x18 + TCP_TX_DELAY = 0x25 TCP_ULP = 0x1f TCP_USER_TIMEOUT = 0x12 TCP_WINDOW_CLAMP = 0xa @@ -2532,6 +2561,10 @@ const ( TIPC_ADDR_MCAST = 0x1 TIPC_ADDR_NAME = 0x2 TIPC_ADDR_NAMESEQ = 0x1 + TIPC_AEAD_ALG_NAME = 0x20 + TIPC_AEAD_KEYLEN_MAX = 0x24 + TIPC_AEAD_KEYLEN_MIN = 0x14 + TIPC_AEAD_KEY_SIZE_MAX = 0x48 TIPC_CFG_SRV = 0x0 TIPC_CLUSTER_BITS = 0xc TIPC_CLUSTER_MASK = 0xfff000 @@ -2564,6 +2597,7 @@ const ( TIPC_MCAST_REPLICAST = 0x86 TIPC_MEDIUM_IMPORTANCE = 0x1 TIPC_NODEID_LEN = 0x10 + TIPC_NODELAY = 0x8a TIPC_NODE_BITS = 0xc TIPC_NODE_MASK = 0xfff TIPC_NODE_OFFSET = 0x0 diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_mips64le.go b/vendor/golang.org/x/sys/unix/zerrors_linux_mips64le.go index b77dd843..e1aa146b 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_mips64le.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_mips64le.go @@ -243,6 +243,7 @@ const ( BPF_F_LOCK = 0x4 BPF_F_MARK_ENFORCE = 0x40 BPF_F_MARK_MANGLED_0 = 0x20 + BPF_F_MMAPABLE = 0x400 BPF_F_NO_COMMON_LRU = 0x2 BPF_F_NO_PREALLOC = 0x1 BPF_F_NUMA_NODE = 0x4 @@ -417,8 +418,10 @@ const ( CLOCK_TXFROMRX = 0x4 CLOCK_TXINT = 0x3 CLONE_ARGS_SIZE_VER0 = 0x40 + CLONE_ARGS_SIZE_VER1 = 0x50 CLONE_CHILD_CLEARTID = 0x200000 CLONE_CHILD_SETTID = 0x1000000 + CLONE_CLEAR_SIGHAND = 0x100000000 CLONE_DETACHED = 0x400000 CLONE_FILES = 0x400 CLONE_FS = 0x200 @@ -715,8 +718,9 @@ const ( FSCRYPT_POLICY_FLAGS_PAD_4 = 0x0 FSCRYPT_POLICY_FLAGS_PAD_8 = 0x1 FSCRYPT_POLICY_FLAGS_PAD_MASK = 0x3 - FSCRYPT_POLICY_FLAGS_VALID = 0x7 + FSCRYPT_POLICY_FLAGS_VALID = 0xf FSCRYPT_POLICY_FLAG_DIRECT_KEY = 0x4 + FSCRYPT_POLICY_FLAG_IV_INO_LBLK_64 = 0x8 FSCRYPT_POLICY_V1 = 0x0 FSCRYPT_POLICY_V2 = 0x2 FS_ENCRYPTION_MODE_ADIANTUM = 0x9 @@ -746,7 +750,7 @@ const ( FS_POLICY_FLAGS_PAD_4 = 0x0 FS_POLICY_FLAGS_PAD_8 = 0x1 FS_POLICY_FLAGS_PAD_MASK = 0x3 - FS_POLICY_FLAGS_VALID = 0x7 + FS_POLICY_FLAGS_VALID = 0xf FUTEXFS_SUPER_MAGIC = 0xbad1dea F_ADD_SEALS = 0x409 F_DUPFD = 0x0 @@ -1228,6 +1232,7 @@ const ( LOOP_SET_STATUS64 = 0x4c04 LO_KEY_SIZE = 0x20 LO_NAME_SIZE = 0x40 + MADV_COLD = 0x14 MADV_DODUMP = 0x11 MADV_DOFORK = 0xb MADV_DONTDUMP = 0x10 @@ -1240,6 +1245,7 @@ const ( MADV_MERGEABLE = 0xc MADV_NOHUGEPAGE = 0xf MADV_NORMAL = 0x0 + MADV_PAGEOUT = 0x15 MADV_RANDOM = 0x1 MADV_REMOVE = 0x9 MADV_SEQUENTIAL = 0x2 @@ -1581,6 +1587,7 @@ const ( PERF_EVENT_IOC_SET_FILTER = 0x80082406 PERF_EVENT_IOC_SET_OUTPUT = 0x20002405 PIPEFS_MAGIC = 0x50495045 + PPC_CMM_MAGIC = 0xc7571590 PPPIOCATTACH = 0x8004743d PPPIOCATTCHAN = 0x80047438 PPPIOCCONNECT = 0x8004743a @@ -1591,6 +1598,8 @@ const ( PPPIOCGDEBUG = 0x40047441 PPPIOCGFLAGS = 0x4004745a PPPIOCGIDLE = 0x4010743f + PPPIOCGIDLE32 = 0x4008743f + PPPIOCGIDLE64 = 0x4010743f PPPIOCGL2TPSTATS = 0x40487436 PPPIOCGMRU = 0x40047453 PPPIOCGNPMODE = 0xc008744c @@ -1929,12 +1938,28 @@ const ( RTF_UP = 0x1 RTF_WINDOW = 0x80 RTF_XRESOLVE = 0x800 + RTMGRP_DECnet_IFADDR = 0x1000 + RTMGRP_DECnet_ROUTE = 0x4000 + RTMGRP_IPV4_IFADDR = 0x10 + RTMGRP_IPV4_MROUTE = 0x20 + RTMGRP_IPV4_ROUTE = 0x40 + RTMGRP_IPV4_RULE = 0x80 + RTMGRP_IPV6_IFADDR = 0x100 + RTMGRP_IPV6_IFINFO = 0x800 + RTMGRP_IPV6_MROUTE = 0x200 + RTMGRP_IPV6_PREFIX = 0x20000 + RTMGRP_IPV6_ROUTE = 0x400 + RTMGRP_LINK = 0x1 + RTMGRP_NEIGH = 0x4 + RTMGRP_NOTIFY = 0x2 + RTMGRP_TC = 0x8 RTM_BASE = 0x10 RTM_DELACTION = 0x31 RTM_DELADDR = 0x15 RTM_DELADDRLABEL = 0x49 RTM_DELCHAIN = 0x65 RTM_DELLINK = 0x11 + RTM_DELLINKPROP = 0x6d RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 @@ -1958,6 +1983,7 @@ const ( RTM_GETCHAIN = 0x66 RTM_GETDCB = 0x4e RTM_GETLINK = 0x12 + RTM_GETLINKPROP = 0x6e RTM_GETMDB = 0x56 RTM_GETMULTICAST = 0x3a RTM_GETNEIGH = 0x1e @@ -1971,13 +1997,14 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x6b + RTM_MAX = 0x6f RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 RTM_NEWCACHEREPORT = 0x60 RTM_NEWCHAIN = 0x64 RTM_NEWLINK = 0x10 + RTM_NEWLINKPROP = 0x6c RTM_NEWMDB = 0x54 RTM_NEWNDUSEROPT = 0x44 RTM_NEWNEIGH = 0x1c @@ -1992,8 +2019,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x17 - RTM_NR_MSGTYPES = 0x5c + RTM_NR_FAMILIES = 0x18 + RTM_NR_MSGTYPES = 0x60 RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -2208,7 +2235,7 @@ const ( SOL_TLS = 0x11a SOL_X25 = 0x106 SOL_XDP = 0x11b - SOMAXCONN = 0x80 + SOMAXCONN = 0x1000 SO_ACCEPTCONN = 0x1009 SO_ATTACH_BPF = 0x32 SO_ATTACH_FILTER = 0x1a @@ -2315,6 +2342,7 @@ const ( STATX_ATTR_ENCRYPTED = 0x800 STATX_ATTR_IMMUTABLE = 0x10 STATX_ATTR_NODUMP = 0x40 + STATX_ATTR_VERITY = 0x100000 STATX_BASIC_STATS = 0x7ff STATX_BLOCKS = 0x400 STATX_BTIME = 0x800 @@ -2434,6 +2462,7 @@ const ( TCP_THIN_DUPACK = 0x11 TCP_THIN_LINEAR_TIMEOUTS = 0x10 TCP_TIMESTAMP = 0x18 + TCP_TX_DELAY = 0x25 TCP_ULP = 0x1f TCP_USER_TIMEOUT = 0x12 TCP_WINDOW_CLAMP = 0xa @@ -2532,6 +2561,10 @@ const ( TIPC_ADDR_MCAST = 0x1 TIPC_ADDR_NAME = 0x2 TIPC_ADDR_NAMESEQ = 0x1 + TIPC_AEAD_ALG_NAME = 0x20 + TIPC_AEAD_KEYLEN_MAX = 0x24 + TIPC_AEAD_KEYLEN_MIN = 0x14 + TIPC_AEAD_KEY_SIZE_MAX = 0x48 TIPC_CFG_SRV = 0x0 TIPC_CLUSTER_BITS = 0xc TIPC_CLUSTER_MASK = 0xfff000 @@ -2564,6 +2597,7 @@ const ( TIPC_MCAST_REPLICAST = 0x86 TIPC_MEDIUM_IMPORTANCE = 0x1 TIPC_NODEID_LEN = 0x10 + TIPC_NODELAY = 0x8a TIPC_NODE_BITS = 0xc TIPC_NODE_MASK = 0xfff TIPC_NODE_OFFSET = 0x0 diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_mipsle.go b/vendor/golang.org/x/sys/unix/zerrors_linux_mipsle.go index 966d025f..d23b3a94 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_mipsle.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_mipsle.go @@ -243,6 +243,7 @@ const ( BPF_F_LOCK = 0x4 BPF_F_MARK_ENFORCE = 0x40 BPF_F_MARK_MANGLED_0 = 0x20 + BPF_F_MMAPABLE = 0x400 BPF_F_NO_COMMON_LRU = 0x2 BPF_F_NO_PREALLOC = 0x1 BPF_F_NUMA_NODE = 0x4 @@ -417,8 +418,10 @@ const ( CLOCK_TXFROMRX = 0x4 CLOCK_TXINT = 0x3 CLONE_ARGS_SIZE_VER0 = 0x40 + CLONE_ARGS_SIZE_VER1 = 0x50 CLONE_CHILD_CLEARTID = 0x200000 CLONE_CHILD_SETTID = 0x1000000 + CLONE_CLEAR_SIGHAND = 0x100000000 CLONE_DETACHED = 0x400000 CLONE_FILES = 0x400 CLONE_FS = 0x200 @@ -715,8 +718,9 @@ const ( FSCRYPT_POLICY_FLAGS_PAD_4 = 0x0 FSCRYPT_POLICY_FLAGS_PAD_8 = 0x1 FSCRYPT_POLICY_FLAGS_PAD_MASK = 0x3 - FSCRYPT_POLICY_FLAGS_VALID = 0x7 + FSCRYPT_POLICY_FLAGS_VALID = 0xf FSCRYPT_POLICY_FLAG_DIRECT_KEY = 0x4 + FSCRYPT_POLICY_FLAG_IV_INO_LBLK_64 = 0x8 FSCRYPT_POLICY_V1 = 0x0 FSCRYPT_POLICY_V2 = 0x2 FS_ENCRYPTION_MODE_ADIANTUM = 0x9 @@ -746,7 +750,7 @@ const ( FS_POLICY_FLAGS_PAD_4 = 0x0 FS_POLICY_FLAGS_PAD_8 = 0x1 FS_POLICY_FLAGS_PAD_MASK = 0x3 - FS_POLICY_FLAGS_VALID = 0x7 + FS_POLICY_FLAGS_VALID = 0xf FUTEXFS_SUPER_MAGIC = 0xbad1dea F_ADD_SEALS = 0x409 F_DUPFD = 0x0 @@ -1228,6 +1232,7 @@ const ( LOOP_SET_STATUS64 = 0x4c04 LO_KEY_SIZE = 0x20 LO_NAME_SIZE = 0x40 + MADV_COLD = 0x14 MADV_DODUMP = 0x11 MADV_DOFORK = 0xb MADV_DONTDUMP = 0x10 @@ -1240,6 +1245,7 @@ const ( MADV_MERGEABLE = 0xc MADV_NOHUGEPAGE = 0xf MADV_NORMAL = 0x0 + MADV_PAGEOUT = 0x15 MADV_RANDOM = 0x1 MADV_REMOVE = 0x9 MADV_SEQUENTIAL = 0x2 @@ -1581,6 +1587,7 @@ const ( PERF_EVENT_IOC_SET_FILTER = 0x80042406 PERF_EVENT_IOC_SET_OUTPUT = 0x20002405 PIPEFS_MAGIC = 0x50495045 + PPC_CMM_MAGIC = 0xc7571590 PPPIOCATTACH = 0x8004743d PPPIOCATTCHAN = 0x80047438 PPPIOCCONNECT = 0x8004743a @@ -1591,6 +1598,8 @@ const ( PPPIOCGDEBUG = 0x40047441 PPPIOCGFLAGS = 0x4004745a PPPIOCGIDLE = 0x4008743f + PPPIOCGIDLE32 = 0x4008743f + PPPIOCGIDLE64 = 0x4010743f PPPIOCGL2TPSTATS = 0x40487436 PPPIOCGMRU = 0x40047453 PPPIOCGNPMODE = 0xc008744c @@ -1929,12 +1938,28 @@ const ( RTF_UP = 0x1 RTF_WINDOW = 0x80 RTF_XRESOLVE = 0x800 + RTMGRP_DECnet_IFADDR = 0x1000 + RTMGRP_DECnet_ROUTE = 0x4000 + RTMGRP_IPV4_IFADDR = 0x10 + RTMGRP_IPV4_MROUTE = 0x20 + RTMGRP_IPV4_ROUTE = 0x40 + RTMGRP_IPV4_RULE = 0x80 + RTMGRP_IPV6_IFADDR = 0x100 + RTMGRP_IPV6_IFINFO = 0x800 + RTMGRP_IPV6_MROUTE = 0x200 + RTMGRP_IPV6_PREFIX = 0x20000 + RTMGRP_IPV6_ROUTE = 0x400 + RTMGRP_LINK = 0x1 + RTMGRP_NEIGH = 0x4 + RTMGRP_NOTIFY = 0x2 + RTMGRP_TC = 0x8 RTM_BASE = 0x10 RTM_DELACTION = 0x31 RTM_DELADDR = 0x15 RTM_DELADDRLABEL = 0x49 RTM_DELCHAIN = 0x65 RTM_DELLINK = 0x11 + RTM_DELLINKPROP = 0x6d RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 @@ -1958,6 +1983,7 @@ const ( RTM_GETCHAIN = 0x66 RTM_GETDCB = 0x4e RTM_GETLINK = 0x12 + RTM_GETLINKPROP = 0x6e RTM_GETMDB = 0x56 RTM_GETMULTICAST = 0x3a RTM_GETNEIGH = 0x1e @@ -1971,13 +1997,14 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x6b + RTM_MAX = 0x6f RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 RTM_NEWCACHEREPORT = 0x60 RTM_NEWCHAIN = 0x64 RTM_NEWLINK = 0x10 + RTM_NEWLINKPROP = 0x6c RTM_NEWMDB = 0x54 RTM_NEWNDUSEROPT = 0x44 RTM_NEWNEIGH = 0x1c @@ -1992,8 +2019,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x17 - RTM_NR_MSGTYPES = 0x5c + RTM_NR_FAMILIES = 0x18 + RTM_NR_MSGTYPES = 0x60 RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -2208,7 +2235,7 @@ const ( SOL_TLS = 0x11a SOL_X25 = 0x106 SOL_XDP = 0x11b - SOMAXCONN = 0x80 + SOMAXCONN = 0x1000 SO_ACCEPTCONN = 0x1009 SO_ATTACH_BPF = 0x32 SO_ATTACH_FILTER = 0x1a @@ -2315,6 +2342,7 @@ const ( STATX_ATTR_ENCRYPTED = 0x800 STATX_ATTR_IMMUTABLE = 0x10 STATX_ATTR_NODUMP = 0x40 + STATX_ATTR_VERITY = 0x100000 STATX_BASIC_STATS = 0x7ff STATX_BLOCKS = 0x400 STATX_BTIME = 0x800 @@ -2434,6 +2462,7 @@ const ( TCP_THIN_DUPACK = 0x11 TCP_THIN_LINEAR_TIMEOUTS = 0x10 TCP_TIMESTAMP = 0x18 + TCP_TX_DELAY = 0x25 TCP_ULP = 0x1f TCP_USER_TIMEOUT = 0x12 TCP_WINDOW_CLAMP = 0xa @@ -2532,6 +2561,10 @@ const ( TIPC_ADDR_MCAST = 0x1 TIPC_ADDR_NAME = 0x2 TIPC_ADDR_NAMESEQ = 0x1 + TIPC_AEAD_ALG_NAME = 0x20 + TIPC_AEAD_KEYLEN_MAX = 0x24 + TIPC_AEAD_KEYLEN_MIN = 0x14 + TIPC_AEAD_KEY_SIZE_MAX = 0x48 TIPC_CFG_SRV = 0x0 TIPC_CLUSTER_BITS = 0xc TIPC_CLUSTER_MASK = 0xfff000 @@ -2564,6 +2597,7 @@ const ( TIPC_MCAST_REPLICAST = 0x86 TIPC_MEDIUM_IMPORTANCE = 0x1 TIPC_NODEID_LEN = 0x10 + TIPC_NODELAY = 0x8a TIPC_NODE_BITS = 0xc TIPC_NODE_MASK = 0xfff TIPC_NODE_OFFSET = 0x0 diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64.go b/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64.go index 3baadbe2..ab6134eb 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64.go @@ -243,6 +243,7 @@ const ( BPF_F_LOCK = 0x4 BPF_F_MARK_ENFORCE = 0x40 BPF_F_MARK_MANGLED_0 = 0x20 + BPF_F_MMAPABLE = 0x400 BPF_F_NO_COMMON_LRU = 0x2 BPF_F_NO_PREALLOC = 0x1 BPF_F_NUMA_NODE = 0x4 @@ -417,8 +418,10 @@ const ( CLOCK_TXFROMRX = 0x4 CLOCK_TXINT = 0x3 CLONE_ARGS_SIZE_VER0 = 0x40 + CLONE_ARGS_SIZE_VER1 = 0x50 CLONE_CHILD_CLEARTID = 0x200000 CLONE_CHILD_SETTID = 0x1000000 + CLONE_CLEAR_SIGHAND = 0x100000000 CLONE_DETACHED = 0x400000 CLONE_FILES = 0x400 CLONE_FS = 0x200 @@ -715,8 +718,9 @@ const ( FSCRYPT_POLICY_FLAGS_PAD_4 = 0x0 FSCRYPT_POLICY_FLAGS_PAD_8 = 0x1 FSCRYPT_POLICY_FLAGS_PAD_MASK = 0x3 - FSCRYPT_POLICY_FLAGS_VALID = 0x7 + FSCRYPT_POLICY_FLAGS_VALID = 0xf FSCRYPT_POLICY_FLAG_DIRECT_KEY = 0x4 + FSCRYPT_POLICY_FLAG_IV_INO_LBLK_64 = 0x8 FSCRYPT_POLICY_V1 = 0x0 FSCRYPT_POLICY_V2 = 0x2 FS_ENCRYPTION_MODE_ADIANTUM = 0x9 @@ -746,7 +750,7 @@ const ( FS_POLICY_FLAGS_PAD_4 = 0x0 FS_POLICY_FLAGS_PAD_8 = 0x1 FS_POLICY_FLAGS_PAD_MASK = 0x3 - FS_POLICY_FLAGS_VALID = 0x7 + FS_POLICY_FLAGS_VALID = 0xf FUTEXFS_SUPER_MAGIC = 0xbad1dea F_ADD_SEALS = 0x409 F_DUPFD = 0x0 @@ -1228,6 +1232,7 @@ const ( LOOP_SET_STATUS64 = 0x4c04 LO_KEY_SIZE = 0x20 LO_NAME_SIZE = 0x40 + MADV_COLD = 0x14 MADV_DODUMP = 0x11 MADV_DOFORK = 0xb MADV_DONTDUMP = 0x10 @@ -1240,6 +1245,7 @@ const ( MADV_MERGEABLE = 0xc MADV_NOHUGEPAGE = 0xf MADV_NORMAL = 0x0 + MADV_PAGEOUT = 0x15 MADV_RANDOM = 0x1 MADV_REMOVE = 0x9 MADV_SEQUENTIAL = 0x2 @@ -1265,6 +1271,7 @@ const ( MAP_SHARED = 0x1 MAP_SHARED_VALIDATE = 0x3 MAP_STACK = 0x20000 + MAP_SYNC = 0x80000 MAP_TYPE = 0xf MCAST_BLOCK_SOURCE = 0x2b MCAST_EXCLUDE = 0x0 @@ -1582,6 +1589,7 @@ const ( PERF_EVENT_IOC_SET_FILTER = 0x80082406 PERF_EVENT_IOC_SET_OUTPUT = 0x20002405 PIPEFS_MAGIC = 0x50495045 + PPC_CMM_MAGIC = 0xc7571590 PPPIOCATTACH = 0x8004743d PPPIOCATTCHAN = 0x80047438 PPPIOCCONNECT = 0x8004743a @@ -1592,6 +1600,8 @@ const ( PPPIOCGDEBUG = 0x40047441 PPPIOCGFLAGS = 0x4004745a PPPIOCGIDLE = 0x4010743f + PPPIOCGIDLE32 = 0x4008743f + PPPIOCGIDLE64 = 0x4010743f PPPIOCGL2TPSTATS = 0x40487436 PPPIOCGMRU = 0x40047453 PPPIOCGNPMODE = 0xc008744c @@ -1987,12 +1997,28 @@ const ( RTF_UP = 0x1 RTF_WINDOW = 0x80 RTF_XRESOLVE = 0x800 + RTMGRP_DECnet_IFADDR = 0x1000 + RTMGRP_DECnet_ROUTE = 0x4000 + RTMGRP_IPV4_IFADDR = 0x10 + RTMGRP_IPV4_MROUTE = 0x20 + RTMGRP_IPV4_ROUTE = 0x40 + RTMGRP_IPV4_RULE = 0x80 + RTMGRP_IPV6_IFADDR = 0x100 + RTMGRP_IPV6_IFINFO = 0x800 + RTMGRP_IPV6_MROUTE = 0x200 + RTMGRP_IPV6_PREFIX = 0x20000 + RTMGRP_IPV6_ROUTE = 0x400 + RTMGRP_LINK = 0x1 + RTMGRP_NEIGH = 0x4 + RTMGRP_NOTIFY = 0x2 + RTMGRP_TC = 0x8 RTM_BASE = 0x10 RTM_DELACTION = 0x31 RTM_DELADDR = 0x15 RTM_DELADDRLABEL = 0x49 RTM_DELCHAIN = 0x65 RTM_DELLINK = 0x11 + RTM_DELLINKPROP = 0x6d RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 @@ -2016,6 +2042,7 @@ const ( RTM_GETCHAIN = 0x66 RTM_GETDCB = 0x4e RTM_GETLINK = 0x12 + RTM_GETLINKPROP = 0x6e RTM_GETMDB = 0x56 RTM_GETMULTICAST = 0x3a RTM_GETNEIGH = 0x1e @@ -2029,13 +2056,14 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x6b + RTM_MAX = 0x6f RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 RTM_NEWCACHEREPORT = 0x60 RTM_NEWCHAIN = 0x64 RTM_NEWLINK = 0x10 + RTM_NEWLINKPROP = 0x6c RTM_NEWMDB = 0x54 RTM_NEWNDUSEROPT = 0x44 RTM_NEWNEIGH = 0x1c @@ -2050,8 +2078,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x17 - RTM_NR_MSGTYPES = 0x5c + RTM_NR_FAMILIES = 0x18 + RTM_NR_MSGTYPES = 0x60 RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -2266,7 +2294,7 @@ const ( SOL_TLS = 0x11a SOL_X25 = 0x106 SOL_XDP = 0x11b - SOMAXCONN = 0x80 + SOMAXCONN = 0x1000 SO_ACCEPTCONN = 0x1e SO_ATTACH_BPF = 0x32 SO_ATTACH_FILTER = 0x1a @@ -2372,6 +2400,7 @@ const ( STATX_ATTR_ENCRYPTED = 0x800 STATX_ATTR_IMMUTABLE = 0x10 STATX_ATTR_NODUMP = 0x40 + STATX_ATTR_VERITY = 0x100000 STATX_BASIC_STATS = 0x7ff STATX_BLOCKS = 0x400 STATX_BTIME = 0x800 @@ -2490,6 +2519,7 @@ const ( TCP_THIN_DUPACK = 0x11 TCP_THIN_LINEAR_TIMEOUTS = 0x10 TCP_TIMESTAMP = 0x18 + TCP_TX_DELAY = 0x25 TCP_ULP = 0x1f TCP_USER_TIMEOUT = 0x12 TCP_WINDOW_CLAMP = 0xa @@ -2592,6 +2622,10 @@ const ( TIPC_ADDR_MCAST = 0x1 TIPC_ADDR_NAME = 0x2 TIPC_ADDR_NAMESEQ = 0x1 + TIPC_AEAD_ALG_NAME = 0x20 + TIPC_AEAD_KEYLEN_MAX = 0x24 + TIPC_AEAD_KEYLEN_MIN = 0x14 + TIPC_AEAD_KEY_SIZE_MAX = 0x48 TIPC_CFG_SRV = 0x0 TIPC_CLUSTER_BITS = 0xc TIPC_CLUSTER_MASK = 0xfff000 @@ -2624,6 +2658,7 @@ const ( TIPC_MCAST_REPLICAST = 0x86 TIPC_MEDIUM_IMPORTANCE = 0x1 TIPC_NODEID_LEN = 0x10 + TIPC_NODELAY = 0x8a TIPC_NODE_BITS = 0xc TIPC_NODE_MASK = 0xfff TIPC_NODE_OFFSET = 0x0 diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64le.go b/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64le.go index b0bc4876..dc8cafff 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64le.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64le.go @@ -243,6 +243,7 @@ const ( BPF_F_LOCK = 0x4 BPF_F_MARK_ENFORCE = 0x40 BPF_F_MARK_MANGLED_0 = 0x20 + BPF_F_MMAPABLE = 0x400 BPF_F_NO_COMMON_LRU = 0x2 BPF_F_NO_PREALLOC = 0x1 BPF_F_NUMA_NODE = 0x4 @@ -417,8 +418,10 @@ const ( CLOCK_TXFROMRX = 0x4 CLOCK_TXINT = 0x3 CLONE_ARGS_SIZE_VER0 = 0x40 + CLONE_ARGS_SIZE_VER1 = 0x50 CLONE_CHILD_CLEARTID = 0x200000 CLONE_CHILD_SETTID = 0x1000000 + CLONE_CLEAR_SIGHAND = 0x100000000 CLONE_DETACHED = 0x400000 CLONE_FILES = 0x400 CLONE_FS = 0x200 @@ -715,8 +718,9 @@ const ( FSCRYPT_POLICY_FLAGS_PAD_4 = 0x0 FSCRYPT_POLICY_FLAGS_PAD_8 = 0x1 FSCRYPT_POLICY_FLAGS_PAD_MASK = 0x3 - FSCRYPT_POLICY_FLAGS_VALID = 0x7 + FSCRYPT_POLICY_FLAGS_VALID = 0xf FSCRYPT_POLICY_FLAG_DIRECT_KEY = 0x4 + FSCRYPT_POLICY_FLAG_IV_INO_LBLK_64 = 0x8 FSCRYPT_POLICY_V1 = 0x0 FSCRYPT_POLICY_V2 = 0x2 FS_ENCRYPTION_MODE_ADIANTUM = 0x9 @@ -746,7 +750,7 @@ const ( FS_POLICY_FLAGS_PAD_4 = 0x0 FS_POLICY_FLAGS_PAD_8 = 0x1 FS_POLICY_FLAGS_PAD_MASK = 0x3 - FS_POLICY_FLAGS_VALID = 0x7 + FS_POLICY_FLAGS_VALID = 0xf FUTEXFS_SUPER_MAGIC = 0xbad1dea F_ADD_SEALS = 0x409 F_DUPFD = 0x0 @@ -1228,6 +1232,7 @@ const ( LOOP_SET_STATUS64 = 0x4c04 LO_KEY_SIZE = 0x20 LO_NAME_SIZE = 0x40 + MADV_COLD = 0x14 MADV_DODUMP = 0x11 MADV_DOFORK = 0xb MADV_DONTDUMP = 0x10 @@ -1240,6 +1245,7 @@ const ( MADV_MERGEABLE = 0xc MADV_NOHUGEPAGE = 0xf MADV_NORMAL = 0x0 + MADV_PAGEOUT = 0x15 MADV_RANDOM = 0x1 MADV_REMOVE = 0x9 MADV_SEQUENTIAL = 0x2 @@ -1265,6 +1271,7 @@ const ( MAP_SHARED = 0x1 MAP_SHARED_VALIDATE = 0x3 MAP_STACK = 0x20000 + MAP_SYNC = 0x80000 MAP_TYPE = 0xf MCAST_BLOCK_SOURCE = 0x2b MCAST_EXCLUDE = 0x0 @@ -1582,6 +1589,7 @@ const ( PERF_EVENT_IOC_SET_FILTER = 0x80082406 PERF_EVENT_IOC_SET_OUTPUT = 0x20002405 PIPEFS_MAGIC = 0x50495045 + PPC_CMM_MAGIC = 0xc7571590 PPPIOCATTACH = 0x8004743d PPPIOCATTCHAN = 0x80047438 PPPIOCCONNECT = 0x8004743a @@ -1592,6 +1600,8 @@ const ( PPPIOCGDEBUG = 0x40047441 PPPIOCGFLAGS = 0x4004745a PPPIOCGIDLE = 0x4010743f + PPPIOCGIDLE32 = 0x4008743f + PPPIOCGIDLE64 = 0x4010743f PPPIOCGL2TPSTATS = 0x40487436 PPPIOCGMRU = 0x40047453 PPPIOCGNPMODE = 0xc008744c @@ -1987,12 +1997,28 @@ const ( RTF_UP = 0x1 RTF_WINDOW = 0x80 RTF_XRESOLVE = 0x800 + RTMGRP_DECnet_IFADDR = 0x1000 + RTMGRP_DECnet_ROUTE = 0x4000 + RTMGRP_IPV4_IFADDR = 0x10 + RTMGRP_IPV4_MROUTE = 0x20 + RTMGRP_IPV4_ROUTE = 0x40 + RTMGRP_IPV4_RULE = 0x80 + RTMGRP_IPV6_IFADDR = 0x100 + RTMGRP_IPV6_IFINFO = 0x800 + RTMGRP_IPV6_MROUTE = 0x200 + RTMGRP_IPV6_PREFIX = 0x20000 + RTMGRP_IPV6_ROUTE = 0x400 + RTMGRP_LINK = 0x1 + RTMGRP_NEIGH = 0x4 + RTMGRP_NOTIFY = 0x2 + RTMGRP_TC = 0x8 RTM_BASE = 0x10 RTM_DELACTION = 0x31 RTM_DELADDR = 0x15 RTM_DELADDRLABEL = 0x49 RTM_DELCHAIN = 0x65 RTM_DELLINK = 0x11 + RTM_DELLINKPROP = 0x6d RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 @@ -2016,6 +2042,7 @@ const ( RTM_GETCHAIN = 0x66 RTM_GETDCB = 0x4e RTM_GETLINK = 0x12 + RTM_GETLINKPROP = 0x6e RTM_GETMDB = 0x56 RTM_GETMULTICAST = 0x3a RTM_GETNEIGH = 0x1e @@ -2029,13 +2056,14 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x6b + RTM_MAX = 0x6f RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 RTM_NEWCACHEREPORT = 0x60 RTM_NEWCHAIN = 0x64 RTM_NEWLINK = 0x10 + RTM_NEWLINKPROP = 0x6c RTM_NEWMDB = 0x54 RTM_NEWNDUSEROPT = 0x44 RTM_NEWNEIGH = 0x1c @@ -2050,8 +2078,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x17 - RTM_NR_MSGTYPES = 0x5c + RTM_NR_FAMILIES = 0x18 + RTM_NR_MSGTYPES = 0x60 RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -2266,7 +2294,7 @@ const ( SOL_TLS = 0x11a SOL_X25 = 0x106 SOL_XDP = 0x11b - SOMAXCONN = 0x80 + SOMAXCONN = 0x1000 SO_ACCEPTCONN = 0x1e SO_ATTACH_BPF = 0x32 SO_ATTACH_FILTER = 0x1a @@ -2372,6 +2400,7 @@ const ( STATX_ATTR_ENCRYPTED = 0x800 STATX_ATTR_IMMUTABLE = 0x10 STATX_ATTR_NODUMP = 0x40 + STATX_ATTR_VERITY = 0x100000 STATX_BASIC_STATS = 0x7ff STATX_BLOCKS = 0x400 STATX_BTIME = 0x800 @@ -2490,6 +2519,7 @@ const ( TCP_THIN_DUPACK = 0x11 TCP_THIN_LINEAR_TIMEOUTS = 0x10 TCP_TIMESTAMP = 0x18 + TCP_TX_DELAY = 0x25 TCP_ULP = 0x1f TCP_USER_TIMEOUT = 0x12 TCP_WINDOW_CLAMP = 0xa @@ -2592,6 +2622,10 @@ const ( TIPC_ADDR_MCAST = 0x1 TIPC_ADDR_NAME = 0x2 TIPC_ADDR_NAMESEQ = 0x1 + TIPC_AEAD_ALG_NAME = 0x20 + TIPC_AEAD_KEYLEN_MAX = 0x24 + TIPC_AEAD_KEYLEN_MIN = 0x14 + TIPC_AEAD_KEY_SIZE_MAX = 0x48 TIPC_CFG_SRV = 0x0 TIPC_CLUSTER_BITS = 0xc TIPC_CLUSTER_MASK = 0xfff000 @@ -2624,6 +2658,7 @@ const ( TIPC_MCAST_REPLICAST = 0x86 TIPC_MEDIUM_IMPORTANCE = 0x1 TIPC_NODEID_LEN = 0x10 + TIPC_NODELAY = 0x8a TIPC_NODE_BITS = 0xc TIPC_NODE_MASK = 0xfff TIPC_NODE_OFFSET = 0x0 diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_riscv64.go b/vendor/golang.org/x/sys/unix/zerrors_linux_riscv64.go index 86976e41..5d964445 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_riscv64.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_riscv64.go @@ -243,6 +243,7 @@ const ( BPF_F_LOCK = 0x4 BPF_F_MARK_ENFORCE = 0x40 BPF_F_MARK_MANGLED_0 = 0x20 + BPF_F_MMAPABLE = 0x400 BPF_F_NO_COMMON_LRU = 0x2 BPF_F_NO_PREALLOC = 0x1 BPF_F_NUMA_NODE = 0x4 @@ -417,8 +418,10 @@ const ( CLOCK_TXFROMRX = 0x4 CLOCK_TXINT = 0x3 CLONE_ARGS_SIZE_VER0 = 0x40 + CLONE_ARGS_SIZE_VER1 = 0x50 CLONE_CHILD_CLEARTID = 0x200000 CLONE_CHILD_SETTID = 0x1000000 + CLONE_CLEAR_SIGHAND = 0x100000000 CLONE_DETACHED = 0x400000 CLONE_FILES = 0x400 CLONE_FS = 0x200 @@ -715,8 +718,9 @@ const ( FSCRYPT_POLICY_FLAGS_PAD_4 = 0x0 FSCRYPT_POLICY_FLAGS_PAD_8 = 0x1 FSCRYPT_POLICY_FLAGS_PAD_MASK = 0x3 - FSCRYPT_POLICY_FLAGS_VALID = 0x7 + FSCRYPT_POLICY_FLAGS_VALID = 0xf FSCRYPT_POLICY_FLAG_DIRECT_KEY = 0x4 + FSCRYPT_POLICY_FLAG_IV_INO_LBLK_64 = 0x8 FSCRYPT_POLICY_V1 = 0x0 FSCRYPT_POLICY_V2 = 0x2 FS_ENCRYPTION_MODE_ADIANTUM = 0x9 @@ -746,7 +750,7 @@ const ( FS_POLICY_FLAGS_PAD_4 = 0x0 FS_POLICY_FLAGS_PAD_8 = 0x1 FS_POLICY_FLAGS_PAD_MASK = 0x3 - FS_POLICY_FLAGS_VALID = 0x7 + FS_POLICY_FLAGS_VALID = 0xf FUTEXFS_SUPER_MAGIC = 0xbad1dea F_ADD_SEALS = 0x409 F_DUPFD = 0x0 @@ -1228,6 +1232,7 @@ const ( LOOP_SET_STATUS64 = 0x4c04 LO_KEY_SIZE = 0x20 LO_NAME_SIZE = 0x40 + MADV_COLD = 0x14 MADV_DODUMP = 0x11 MADV_DOFORK = 0xb MADV_DONTDUMP = 0x10 @@ -1240,6 +1245,7 @@ const ( MADV_MERGEABLE = 0xc MADV_NOHUGEPAGE = 0xf MADV_NORMAL = 0x0 + MADV_PAGEOUT = 0x15 MADV_RANDOM = 0x1 MADV_REMOVE = 0x9 MADV_SEQUENTIAL = 0x2 @@ -1581,6 +1587,7 @@ const ( PERF_EVENT_IOC_SET_FILTER = 0x40082406 PERF_EVENT_IOC_SET_OUTPUT = 0x2405 PIPEFS_MAGIC = 0x50495045 + PPC_CMM_MAGIC = 0xc7571590 PPPIOCATTACH = 0x4004743d PPPIOCATTCHAN = 0x40047438 PPPIOCCONNECT = 0x4004743a @@ -1591,6 +1598,8 @@ const ( PPPIOCGDEBUG = 0x80047441 PPPIOCGFLAGS = 0x8004745a PPPIOCGIDLE = 0x8010743f + PPPIOCGIDLE32 = 0x8008743f + PPPIOCGIDLE64 = 0x8010743f PPPIOCGL2TPSTATS = 0x80487436 PPPIOCGMRU = 0x80047453 PPPIOCGNPMODE = 0xc008744c @@ -1917,12 +1926,28 @@ const ( RTF_UP = 0x1 RTF_WINDOW = 0x80 RTF_XRESOLVE = 0x800 + RTMGRP_DECnet_IFADDR = 0x1000 + RTMGRP_DECnet_ROUTE = 0x4000 + RTMGRP_IPV4_IFADDR = 0x10 + RTMGRP_IPV4_MROUTE = 0x20 + RTMGRP_IPV4_ROUTE = 0x40 + RTMGRP_IPV4_RULE = 0x80 + RTMGRP_IPV6_IFADDR = 0x100 + RTMGRP_IPV6_IFINFO = 0x800 + RTMGRP_IPV6_MROUTE = 0x200 + RTMGRP_IPV6_PREFIX = 0x20000 + RTMGRP_IPV6_ROUTE = 0x400 + RTMGRP_LINK = 0x1 + RTMGRP_NEIGH = 0x4 + RTMGRP_NOTIFY = 0x2 + RTMGRP_TC = 0x8 RTM_BASE = 0x10 RTM_DELACTION = 0x31 RTM_DELADDR = 0x15 RTM_DELADDRLABEL = 0x49 RTM_DELCHAIN = 0x65 RTM_DELLINK = 0x11 + RTM_DELLINKPROP = 0x6d RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 @@ -1946,6 +1971,7 @@ const ( RTM_GETCHAIN = 0x66 RTM_GETDCB = 0x4e RTM_GETLINK = 0x12 + RTM_GETLINKPROP = 0x6e RTM_GETMDB = 0x56 RTM_GETMULTICAST = 0x3a RTM_GETNEIGH = 0x1e @@ -1959,13 +1985,14 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x6b + RTM_MAX = 0x6f RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 RTM_NEWCACHEREPORT = 0x60 RTM_NEWCHAIN = 0x64 RTM_NEWLINK = 0x10 + RTM_NEWLINKPROP = 0x6c RTM_NEWMDB = 0x54 RTM_NEWNDUSEROPT = 0x44 RTM_NEWNEIGH = 0x1c @@ -1980,8 +2007,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x17 - RTM_NR_MSGTYPES = 0x5c + RTM_NR_FAMILIES = 0x18 + RTM_NR_MSGTYPES = 0x60 RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -2196,7 +2223,7 @@ const ( SOL_TLS = 0x11a SOL_X25 = 0x106 SOL_XDP = 0x11b - SOMAXCONN = 0x80 + SOMAXCONN = 0x1000 SO_ACCEPTCONN = 0x1e SO_ATTACH_BPF = 0x32 SO_ATTACH_FILTER = 0x1a @@ -2302,6 +2329,7 @@ const ( STATX_ATTR_ENCRYPTED = 0x800 STATX_ATTR_IMMUTABLE = 0x10 STATX_ATTR_NODUMP = 0x40 + STATX_ATTR_VERITY = 0x100000 STATX_BASIC_STATS = 0x7ff STATX_BLOCKS = 0x400 STATX_BTIME = 0x800 @@ -2422,6 +2450,7 @@ const ( TCP_THIN_DUPACK = 0x11 TCP_THIN_LINEAR_TIMEOUTS = 0x10 TCP_TIMESTAMP = 0x18 + TCP_TX_DELAY = 0x25 TCP_ULP = 0x1f TCP_USER_TIMEOUT = 0x12 TCP_WINDOW_CLAMP = 0xa @@ -2518,6 +2547,10 @@ const ( TIPC_ADDR_MCAST = 0x1 TIPC_ADDR_NAME = 0x2 TIPC_ADDR_NAMESEQ = 0x1 + TIPC_AEAD_ALG_NAME = 0x20 + TIPC_AEAD_KEYLEN_MAX = 0x24 + TIPC_AEAD_KEYLEN_MIN = 0x14 + TIPC_AEAD_KEY_SIZE_MAX = 0x48 TIPC_CFG_SRV = 0x0 TIPC_CLUSTER_BITS = 0xc TIPC_CLUSTER_MASK = 0xfff000 @@ -2550,6 +2583,7 @@ const ( TIPC_MCAST_REPLICAST = 0x86 TIPC_MEDIUM_IMPORTANCE = 0x1 TIPC_NODEID_LEN = 0x10 + TIPC_NODELAY = 0x8a TIPC_NODE_BITS = 0xc TIPC_NODE_MASK = 0xfff TIPC_NODE_OFFSET = 0x0 diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_s390x.go b/vendor/golang.org/x/sys/unix/zerrors_linux_s390x.go index cd6a0464..7d64d6e7 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_s390x.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_s390x.go @@ -243,6 +243,7 @@ const ( BPF_F_LOCK = 0x4 BPF_F_MARK_ENFORCE = 0x40 BPF_F_MARK_MANGLED_0 = 0x20 + BPF_F_MMAPABLE = 0x400 BPF_F_NO_COMMON_LRU = 0x2 BPF_F_NO_PREALLOC = 0x1 BPF_F_NUMA_NODE = 0x4 @@ -417,8 +418,10 @@ const ( CLOCK_TXFROMRX = 0x4 CLOCK_TXINT = 0x3 CLONE_ARGS_SIZE_VER0 = 0x40 + CLONE_ARGS_SIZE_VER1 = 0x50 CLONE_CHILD_CLEARTID = 0x200000 CLONE_CHILD_SETTID = 0x1000000 + CLONE_CLEAR_SIGHAND = 0x100000000 CLONE_DETACHED = 0x400000 CLONE_FILES = 0x400 CLONE_FS = 0x200 @@ -715,8 +718,9 @@ const ( FSCRYPT_POLICY_FLAGS_PAD_4 = 0x0 FSCRYPT_POLICY_FLAGS_PAD_8 = 0x1 FSCRYPT_POLICY_FLAGS_PAD_MASK = 0x3 - FSCRYPT_POLICY_FLAGS_VALID = 0x7 + FSCRYPT_POLICY_FLAGS_VALID = 0xf FSCRYPT_POLICY_FLAG_DIRECT_KEY = 0x4 + FSCRYPT_POLICY_FLAG_IV_INO_LBLK_64 = 0x8 FSCRYPT_POLICY_V1 = 0x0 FSCRYPT_POLICY_V2 = 0x2 FS_ENCRYPTION_MODE_ADIANTUM = 0x9 @@ -746,7 +750,7 @@ const ( FS_POLICY_FLAGS_PAD_4 = 0x0 FS_POLICY_FLAGS_PAD_8 = 0x1 FS_POLICY_FLAGS_PAD_MASK = 0x3 - FS_POLICY_FLAGS_VALID = 0x7 + FS_POLICY_FLAGS_VALID = 0xf FUTEXFS_SUPER_MAGIC = 0xbad1dea F_ADD_SEALS = 0x409 F_DUPFD = 0x0 @@ -1228,6 +1232,7 @@ const ( LOOP_SET_STATUS64 = 0x4c04 LO_KEY_SIZE = 0x20 LO_NAME_SIZE = 0x40 + MADV_COLD = 0x14 MADV_DODUMP = 0x11 MADV_DOFORK = 0xb MADV_DONTDUMP = 0x10 @@ -1240,6 +1245,7 @@ const ( MADV_MERGEABLE = 0xc MADV_NOHUGEPAGE = 0xf MADV_NORMAL = 0x0 + MADV_PAGEOUT = 0x15 MADV_RANDOM = 0x1 MADV_REMOVE = 0x9 MADV_SEQUENTIAL = 0x2 @@ -1581,6 +1587,7 @@ const ( PERF_EVENT_IOC_SET_FILTER = 0x40082406 PERF_EVENT_IOC_SET_OUTPUT = 0x2405 PIPEFS_MAGIC = 0x50495045 + PPC_CMM_MAGIC = 0xc7571590 PPPIOCATTACH = 0x4004743d PPPIOCATTCHAN = 0x40047438 PPPIOCCONNECT = 0x4004743a @@ -1591,6 +1598,8 @@ const ( PPPIOCGDEBUG = 0x80047441 PPPIOCGFLAGS = 0x8004745a PPPIOCGIDLE = 0x8010743f + PPPIOCGIDLE32 = 0x8008743f + PPPIOCGIDLE64 = 0x8010743f PPPIOCGL2TPSTATS = 0x80487436 PPPIOCGMRU = 0x80047453 PPPIOCGNPMODE = 0xc008744c @@ -1990,12 +1999,28 @@ const ( RTF_UP = 0x1 RTF_WINDOW = 0x80 RTF_XRESOLVE = 0x800 + RTMGRP_DECnet_IFADDR = 0x1000 + RTMGRP_DECnet_ROUTE = 0x4000 + RTMGRP_IPV4_IFADDR = 0x10 + RTMGRP_IPV4_MROUTE = 0x20 + RTMGRP_IPV4_ROUTE = 0x40 + RTMGRP_IPV4_RULE = 0x80 + RTMGRP_IPV6_IFADDR = 0x100 + RTMGRP_IPV6_IFINFO = 0x800 + RTMGRP_IPV6_MROUTE = 0x200 + RTMGRP_IPV6_PREFIX = 0x20000 + RTMGRP_IPV6_ROUTE = 0x400 + RTMGRP_LINK = 0x1 + RTMGRP_NEIGH = 0x4 + RTMGRP_NOTIFY = 0x2 + RTMGRP_TC = 0x8 RTM_BASE = 0x10 RTM_DELACTION = 0x31 RTM_DELADDR = 0x15 RTM_DELADDRLABEL = 0x49 RTM_DELCHAIN = 0x65 RTM_DELLINK = 0x11 + RTM_DELLINKPROP = 0x6d RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 @@ -2019,6 +2044,7 @@ const ( RTM_GETCHAIN = 0x66 RTM_GETDCB = 0x4e RTM_GETLINK = 0x12 + RTM_GETLINKPROP = 0x6e RTM_GETMDB = 0x56 RTM_GETMULTICAST = 0x3a RTM_GETNEIGH = 0x1e @@ -2032,13 +2058,14 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x6b + RTM_MAX = 0x6f RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 RTM_NEWCACHEREPORT = 0x60 RTM_NEWCHAIN = 0x64 RTM_NEWLINK = 0x10 + RTM_NEWLINKPROP = 0x6c RTM_NEWMDB = 0x54 RTM_NEWNDUSEROPT = 0x44 RTM_NEWNEIGH = 0x1c @@ -2053,8 +2080,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x17 - RTM_NR_MSGTYPES = 0x5c + RTM_NR_FAMILIES = 0x18 + RTM_NR_MSGTYPES = 0x60 RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -2269,7 +2296,7 @@ const ( SOL_TLS = 0x11a SOL_X25 = 0x106 SOL_XDP = 0x11b - SOMAXCONN = 0x80 + SOMAXCONN = 0x1000 SO_ACCEPTCONN = 0x1e SO_ATTACH_BPF = 0x32 SO_ATTACH_FILTER = 0x1a @@ -2375,6 +2402,7 @@ const ( STATX_ATTR_ENCRYPTED = 0x800 STATX_ATTR_IMMUTABLE = 0x10 STATX_ATTR_NODUMP = 0x40 + STATX_ATTR_VERITY = 0x100000 STATX_BASIC_STATS = 0x7ff STATX_BLOCKS = 0x400 STATX_BTIME = 0x800 @@ -2495,6 +2523,7 @@ const ( TCP_THIN_DUPACK = 0x11 TCP_THIN_LINEAR_TIMEOUTS = 0x10 TCP_TIMESTAMP = 0x18 + TCP_TX_DELAY = 0x25 TCP_ULP = 0x1f TCP_USER_TIMEOUT = 0x12 TCP_WINDOW_CLAMP = 0xa @@ -2591,6 +2620,10 @@ const ( TIPC_ADDR_MCAST = 0x1 TIPC_ADDR_NAME = 0x2 TIPC_ADDR_NAMESEQ = 0x1 + TIPC_AEAD_ALG_NAME = 0x20 + TIPC_AEAD_KEYLEN_MAX = 0x24 + TIPC_AEAD_KEYLEN_MIN = 0x14 + TIPC_AEAD_KEY_SIZE_MAX = 0x48 TIPC_CFG_SRV = 0x0 TIPC_CLUSTER_BITS = 0xc TIPC_CLUSTER_MASK = 0xfff000 @@ -2623,6 +2656,7 @@ const ( TIPC_MCAST_REPLICAST = 0x86 TIPC_MEDIUM_IMPORTANCE = 0x1 TIPC_NODEID_LEN = 0x10 + TIPC_NODELAY = 0x8a TIPC_NODE_BITS = 0xc TIPC_NODE_MASK = 0xfff TIPC_NODE_OFFSET = 0x0 diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_sparc64.go b/vendor/golang.org/x/sys/unix/zerrors_linux_sparc64.go index 89da22b7..084d55be 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_sparc64.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_sparc64.go @@ -246,6 +246,7 @@ const ( BPF_F_LOCK = 0x4 BPF_F_MARK_ENFORCE = 0x40 BPF_F_MARK_MANGLED_0 = 0x20 + BPF_F_MMAPABLE = 0x400 BPF_F_NO_COMMON_LRU = 0x2 BPF_F_NO_PREALLOC = 0x1 BPF_F_NUMA_NODE = 0x4 @@ -420,8 +421,10 @@ const ( CLOCK_TXFROMRX = 0x4 CLOCK_TXINT = 0x3 CLONE_ARGS_SIZE_VER0 = 0x40 + CLONE_ARGS_SIZE_VER1 = 0x50 CLONE_CHILD_CLEARTID = 0x200000 CLONE_CHILD_SETTID = 0x1000000 + CLONE_CLEAR_SIGHAND = 0x100000000 CLONE_DETACHED = 0x400000 CLONE_FILES = 0x400 CLONE_FS = 0x200 @@ -719,8 +722,9 @@ const ( FSCRYPT_POLICY_FLAGS_PAD_4 = 0x0 FSCRYPT_POLICY_FLAGS_PAD_8 = 0x1 FSCRYPT_POLICY_FLAGS_PAD_MASK = 0x3 - FSCRYPT_POLICY_FLAGS_VALID = 0x7 + FSCRYPT_POLICY_FLAGS_VALID = 0xf FSCRYPT_POLICY_FLAG_DIRECT_KEY = 0x4 + FSCRYPT_POLICY_FLAG_IV_INO_LBLK_64 = 0x8 FSCRYPT_POLICY_V1 = 0x0 FSCRYPT_POLICY_V2 = 0x2 FS_ENCRYPTION_MODE_ADIANTUM = 0x9 @@ -750,7 +754,7 @@ const ( FS_POLICY_FLAGS_PAD_4 = 0x0 FS_POLICY_FLAGS_PAD_8 = 0x1 FS_POLICY_FLAGS_PAD_MASK = 0x3 - FS_POLICY_FLAGS_VALID = 0x7 + FS_POLICY_FLAGS_VALID = 0xf FUTEXFS_SUPER_MAGIC = 0xbad1dea F_ADD_SEALS = 0x409 F_DUPFD = 0x0 @@ -1232,6 +1236,7 @@ const ( LOOP_SET_STATUS64 = 0x4c04 LO_KEY_SIZE = 0x20 LO_NAME_SIZE = 0x40 + MADV_COLD = 0x14 MADV_DODUMP = 0x11 MADV_DOFORK = 0xb MADV_DONTDUMP = 0x10 @@ -1244,6 +1249,7 @@ const ( MADV_MERGEABLE = 0xc MADV_NOHUGEPAGE = 0xf MADV_NORMAL = 0x0 + MADV_PAGEOUT = 0x15 MADV_RANDOM = 0x1 MADV_REMOVE = 0x9 MADV_SEQUENTIAL = 0x2 @@ -1270,6 +1276,7 @@ const ( MAP_SHARED = 0x1 MAP_SHARED_VALIDATE = 0x3 MAP_STACK = 0x20000 + MAP_SYNC = 0x80000 MAP_TYPE = 0xf MCAST_BLOCK_SOURCE = 0x2b MCAST_EXCLUDE = 0x0 @@ -1585,6 +1592,7 @@ const ( PERF_EVENT_IOC_SET_FILTER = 0x80082406 PERF_EVENT_IOC_SET_OUTPUT = 0x20002405 PIPEFS_MAGIC = 0x50495045 + PPC_CMM_MAGIC = 0xc7571590 PPPIOCATTACH = 0x8004743d PPPIOCATTCHAN = 0x80047438 PPPIOCCONNECT = 0x8004743a @@ -1595,6 +1603,8 @@ const ( PPPIOCGDEBUG = 0x40047441 PPPIOCGFLAGS = 0x4004745a PPPIOCGIDLE = 0x4010743f + PPPIOCGIDLE32 = 0x4008743f + PPPIOCGIDLE64 = 0x4010743f PPPIOCGL2TPSTATS = 0x40487436 PPPIOCGMRU = 0x40047453 PPPIOCGNPMODE = 0xc008744c @@ -1982,12 +1992,28 @@ const ( RTF_UP = 0x1 RTF_WINDOW = 0x80 RTF_XRESOLVE = 0x800 + RTMGRP_DECnet_IFADDR = 0x1000 + RTMGRP_DECnet_ROUTE = 0x4000 + RTMGRP_IPV4_IFADDR = 0x10 + RTMGRP_IPV4_MROUTE = 0x20 + RTMGRP_IPV4_ROUTE = 0x40 + RTMGRP_IPV4_RULE = 0x80 + RTMGRP_IPV6_IFADDR = 0x100 + RTMGRP_IPV6_IFINFO = 0x800 + RTMGRP_IPV6_MROUTE = 0x200 + RTMGRP_IPV6_PREFIX = 0x20000 + RTMGRP_IPV6_ROUTE = 0x400 + RTMGRP_LINK = 0x1 + RTMGRP_NEIGH = 0x4 + RTMGRP_NOTIFY = 0x2 + RTMGRP_TC = 0x8 RTM_BASE = 0x10 RTM_DELACTION = 0x31 RTM_DELADDR = 0x15 RTM_DELADDRLABEL = 0x49 RTM_DELCHAIN = 0x65 RTM_DELLINK = 0x11 + RTM_DELLINKPROP = 0x6d RTM_DELMDB = 0x55 RTM_DELNEIGH = 0x1d RTM_DELNETCONF = 0x51 @@ -2011,6 +2037,7 @@ const ( RTM_GETCHAIN = 0x66 RTM_GETDCB = 0x4e RTM_GETLINK = 0x12 + RTM_GETLINKPROP = 0x6e RTM_GETMDB = 0x56 RTM_GETMULTICAST = 0x3a RTM_GETNEIGH = 0x1e @@ -2024,13 +2051,14 @@ const ( RTM_GETSTATS = 0x5e RTM_GETTCLASS = 0x2a RTM_GETTFILTER = 0x2e - RTM_MAX = 0x6b + RTM_MAX = 0x6f RTM_NEWACTION = 0x30 RTM_NEWADDR = 0x14 RTM_NEWADDRLABEL = 0x48 RTM_NEWCACHEREPORT = 0x60 RTM_NEWCHAIN = 0x64 RTM_NEWLINK = 0x10 + RTM_NEWLINKPROP = 0x6c RTM_NEWMDB = 0x54 RTM_NEWNDUSEROPT = 0x44 RTM_NEWNEIGH = 0x1c @@ -2045,8 +2073,8 @@ const ( RTM_NEWSTATS = 0x5c RTM_NEWTCLASS = 0x28 RTM_NEWTFILTER = 0x2c - RTM_NR_FAMILIES = 0x17 - RTM_NR_MSGTYPES = 0x5c + RTM_NR_FAMILIES = 0x18 + RTM_NR_MSGTYPES = 0x60 RTM_SETDCB = 0x4f RTM_SETLINK = 0x13 RTM_SETNEIGHTBL = 0x43 @@ -2261,7 +2289,7 @@ const ( SOL_TLS = 0x11a SOL_X25 = 0x106 SOL_XDP = 0x11b - SOMAXCONN = 0x80 + SOMAXCONN = 0x1000 SO_ACCEPTCONN = 0x8000 SO_ATTACH_BPF = 0x34 SO_ATTACH_FILTER = 0x1a @@ -2367,6 +2395,7 @@ const ( STATX_ATTR_ENCRYPTED = 0x800 STATX_ATTR_IMMUTABLE = 0x10 STATX_ATTR_NODUMP = 0x40 + STATX_ATTR_VERITY = 0x100000 STATX_BASIC_STATS = 0x7ff STATX_BLOCKS = 0x400 STATX_BTIME = 0x800 @@ -2486,6 +2515,7 @@ const ( TCP_THIN_DUPACK = 0x11 TCP_THIN_LINEAR_TIMEOUTS = 0x10 TCP_TIMESTAMP = 0x18 + TCP_TX_DELAY = 0x25 TCP_ULP = 0x1f TCP_USER_TIMEOUT = 0x12 TCP_WINDOW_CLAMP = 0xa @@ -2580,6 +2610,10 @@ const ( TIPC_ADDR_MCAST = 0x1 TIPC_ADDR_NAME = 0x2 TIPC_ADDR_NAMESEQ = 0x1 + TIPC_AEAD_ALG_NAME = 0x20 + TIPC_AEAD_KEYLEN_MAX = 0x24 + TIPC_AEAD_KEYLEN_MIN = 0x14 + TIPC_AEAD_KEY_SIZE_MAX = 0x48 TIPC_CFG_SRV = 0x0 TIPC_CLUSTER_BITS = 0xc TIPC_CLUSTER_MASK = 0xfff000 @@ -2612,6 +2646,7 @@ const ( TIPC_MCAST_REPLICAST = 0x86 TIPC_MEDIUM_IMPORTANCE = 0x1 TIPC_NODEID_LEN = 0x10 + TIPC_NODELAY = 0x8a TIPC_NODE_BITS = 0xc TIPC_NODE_MASK = 0xfff TIPC_NODE_OFFSET = 0x0 diff --git a/vendor/golang.org/x/sys/unix/zsyscall_linux_386.go b/vendor/golang.org/x/sys/unix/zsyscall_linux_386.go index c18f6c6e..a536d9a6 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_linux_386.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_linux_386.go @@ -439,7 +439,7 @@ func Adjtimex(buf *Timex) (state int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT func Capget(hdr *CapUserHeader, data *CapUserData) (err error) { - _, _, e1 := Syscall(SYS_CAPGET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + _, _, e1 := RawSyscall(SYS_CAPGET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) if e1 != 0 { err = errnoErr(e1) } @@ -449,7 +449,7 @@ func Capget(hdr *CapUserHeader, data *CapUserData) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT func Capset(hdr *CapUserHeader, data *CapUserData) (err error) { - _, _, e1 := Syscall(SYS_CAPSET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + _, _, e1 := RawSyscall(SYS_CAPSET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) if e1 != 0 { err = errnoErr(e1) } @@ -2121,8 +2121,9 @@ func sendfile(outfd int, infd int, offset *int64, count int) (written int, err e // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Setfsgid(gid int) (err error) { - _, _, e1 := Syscall(SYS_SETFSGID32, uintptr(gid), 0, 0) +func setfsgid(gid int) (prev int, err error) { + r0, _, e1 := Syscall(SYS_SETFSGID32, uintptr(gid), 0, 0) + prev = int(r0) if e1 != 0 { err = errnoErr(e1) } @@ -2131,8 +2132,9 @@ func Setfsgid(gid int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Setfsuid(uid int) (err error) { - _, _, e1 := Syscall(SYS_SETFSUID32, uintptr(uid), 0, 0) +func setfsuid(uid int) (prev int, err error) { + r0, _, e1 := Syscall(SYS_SETFSUID32, uintptr(uid), 0, 0) + prev = int(r0) if e1 != 0 { err = errnoErr(e1) } diff --git a/vendor/golang.org/x/sys/unix/zsyscall_linux_amd64.go b/vendor/golang.org/x/sys/unix/zsyscall_linux_amd64.go index 54c0f39b..fb5db364 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_linux_amd64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_linux_amd64.go @@ -439,7 +439,7 @@ func Adjtimex(buf *Timex) (state int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT func Capget(hdr *CapUserHeader, data *CapUserData) (err error) { - _, _, e1 := Syscall(SYS_CAPGET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + _, _, e1 := RawSyscall(SYS_CAPGET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) if e1 != 0 { err = errnoErr(e1) } @@ -449,7 +449,7 @@ func Capget(hdr *CapUserHeader, data *CapUserData) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT func Capset(hdr *CapUserHeader, data *CapUserData) (err error) { - _, _, e1 := Syscall(SYS_CAPSET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + _, _, e1 := RawSyscall(SYS_CAPSET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) if e1 != 0 { err = errnoErr(e1) } @@ -2137,8 +2137,9 @@ func sendfile(outfd int, infd int, offset *int64, count int) (written int, err e // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Setfsgid(gid int) (err error) { - _, _, e1 := Syscall(SYS_SETFSGID, uintptr(gid), 0, 0) +func setfsgid(gid int) (prev int, err error) { + r0, _, e1 := Syscall(SYS_SETFSGID, uintptr(gid), 0, 0) + prev = int(r0) if e1 != 0 { err = errnoErr(e1) } @@ -2147,8 +2148,9 @@ func Setfsgid(gid int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Setfsuid(uid int) (err error) { - _, _, e1 := Syscall(SYS_SETFSUID, uintptr(uid), 0, 0) +func setfsuid(uid int) (prev int, err error) { + r0, _, e1 := Syscall(SYS_SETFSUID, uintptr(uid), 0, 0) + prev = int(r0) if e1 != 0 { err = errnoErr(e1) } diff --git a/vendor/golang.org/x/sys/unix/zsyscall_linux_arm.go b/vendor/golang.org/x/sys/unix/zsyscall_linux_arm.go index 3eaa45fb..591d120c 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_linux_arm.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_linux_arm.go @@ -439,7 +439,7 @@ func Adjtimex(buf *Timex) (state int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT func Capget(hdr *CapUserHeader, data *CapUserData) (err error) { - _, _, e1 := Syscall(SYS_CAPGET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + _, _, e1 := RawSyscall(SYS_CAPGET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) if e1 != 0 { err = errnoErr(e1) } @@ -449,7 +449,7 @@ func Capget(hdr *CapUserHeader, data *CapUserData) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT func Capset(hdr *CapUserHeader, data *CapUserData) (err error) { - _, _, e1 := Syscall(SYS_CAPSET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + _, _, e1 := RawSyscall(SYS_CAPSET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) if e1 != 0 { err = errnoErr(e1) } @@ -2257,8 +2257,9 @@ func Select(nfd int, r *FdSet, w *FdSet, e *FdSet, timeout *Timeval) (n int, err // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Setfsgid(gid int) (err error) { - _, _, e1 := Syscall(SYS_SETFSGID32, uintptr(gid), 0, 0) +func setfsgid(gid int) (prev int, err error) { + r0, _, e1 := Syscall(SYS_SETFSGID32, uintptr(gid), 0, 0) + prev = int(r0) if e1 != 0 { err = errnoErr(e1) } @@ -2267,8 +2268,9 @@ func Setfsgid(gid int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Setfsuid(uid int) (err error) { - _, _, e1 := Syscall(SYS_SETFSUID32, uintptr(uid), 0, 0) +func setfsuid(uid int) (prev int, err error) { + r0, _, e1 := Syscall(SYS_SETFSUID32, uintptr(uid), 0, 0) + prev = int(r0) if e1 != 0 { err = errnoErr(e1) } diff --git a/vendor/golang.org/x/sys/unix/zsyscall_linux_arm64.go b/vendor/golang.org/x/sys/unix/zsyscall_linux_arm64.go index be7f2db3..afd54470 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_linux_arm64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_linux_arm64.go @@ -439,7 +439,7 @@ func Adjtimex(buf *Timex) (state int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT func Capget(hdr *CapUserHeader, data *CapUserData) (err error) { - _, _, e1 := Syscall(SYS_CAPGET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + _, _, e1 := RawSyscall(SYS_CAPGET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) if e1 != 0 { err = errnoErr(e1) } @@ -449,7 +449,7 @@ func Capget(hdr *CapUserHeader, data *CapUserData) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT func Capset(hdr *CapUserHeader, data *CapUserData) (err error) { - _, _, e1 := Syscall(SYS_CAPSET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + _, _, e1 := RawSyscall(SYS_CAPSET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) if e1 != 0 { err = errnoErr(e1) } @@ -2060,8 +2060,9 @@ func sendfile(outfd int, infd int, offset *int64, count int) (written int, err e // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Setfsgid(gid int) (err error) { - _, _, e1 := Syscall(SYS_SETFSGID, uintptr(gid), 0, 0) +func setfsgid(gid int) (prev int, err error) { + r0, _, e1 := Syscall(SYS_SETFSGID, uintptr(gid), 0, 0) + prev = int(r0) if e1 != 0 { err = errnoErr(e1) } @@ -2070,8 +2071,9 @@ func Setfsgid(gid int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Setfsuid(uid int) (err error) { - _, _, e1 := Syscall(SYS_SETFSUID, uintptr(uid), 0, 0) +func setfsuid(uid int) (prev int, err error) { + r0, _, e1 := Syscall(SYS_SETFSUID, uintptr(uid), 0, 0) + prev = int(r0) if e1 != 0 { err = errnoErr(e1) } diff --git a/vendor/golang.org/x/sys/unix/zsyscall_linux_mips.go b/vendor/golang.org/x/sys/unix/zsyscall_linux_mips.go index 3a0d9105..054b2189 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_linux_mips.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_linux_mips.go @@ -439,7 +439,7 @@ func Adjtimex(buf *Timex) (state int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT func Capget(hdr *CapUserHeader, data *CapUserData) (err error) { - _, _, e1 := Syscall(SYS_CAPGET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + _, _, e1 := RawSyscall(SYS_CAPGET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) if e1 != 0 { err = errnoErr(e1) } @@ -449,7 +449,7 @@ func Capget(hdr *CapUserHeader, data *CapUserData) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT func Capset(hdr *CapUserHeader, data *CapUserData) (err error) { - _, _, e1 := Syscall(SYS_CAPSET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + _, _, e1 := RawSyscall(SYS_CAPSET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) if e1 != 0 { err = errnoErr(e1) } @@ -2051,8 +2051,9 @@ func sendfile(outfd int, infd int, offset *int64, count int) (written int, err e // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Setfsgid(gid int) (err error) { - _, _, e1 := Syscall(SYS_SETFSGID, uintptr(gid), 0, 0) +func setfsgid(gid int) (prev int, err error) { + r0, _, e1 := Syscall(SYS_SETFSGID, uintptr(gid), 0, 0) + prev = int(r0) if e1 != 0 { err = errnoErr(e1) } @@ -2061,8 +2062,9 @@ func Setfsgid(gid int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Setfsuid(uid int) (err error) { - _, _, e1 := Syscall(SYS_SETFSUID, uintptr(uid), 0, 0) +func setfsuid(uid int) (prev int, err error) { + r0, _, e1 := Syscall(SYS_SETFSUID, uintptr(uid), 0, 0) + prev = int(r0) if e1 != 0 { err = errnoErr(e1) } diff --git a/vendor/golang.org/x/sys/unix/zsyscall_linux_mips64.go b/vendor/golang.org/x/sys/unix/zsyscall_linux_mips64.go index 05f62cbf..bbd48bf2 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_linux_mips64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_linux_mips64.go @@ -439,7 +439,7 @@ func Adjtimex(buf *Timex) (state int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT func Capget(hdr *CapUserHeader, data *CapUserData) (err error) { - _, _, e1 := Syscall(SYS_CAPGET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + _, _, e1 := RawSyscall(SYS_CAPGET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) if e1 != 0 { err = errnoErr(e1) } @@ -449,7 +449,7 @@ func Capget(hdr *CapUserHeader, data *CapUserData) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT func Capset(hdr *CapUserHeader, data *CapUserData) (err error) { - _, _, e1 := Syscall(SYS_CAPSET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + _, _, e1 := RawSyscall(SYS_CAPSET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) if e1 != 0 { err = errnoErr(e1) } @@ -2081,8 +2081,9 @@ func sendfile(outfd int, infd int, offset *int64, count int) (written int, err e // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Setfsgid(gid int) (err error) { - _, _, e1 := Syscall(SYS_SETFSGID, uintptr(gid), 0, 0) +func setfsgid(gid int) (prev int, err error) { + r0, _, e1 := Syscall(SYS_SETFSGID, uintptr(gid), 0, 0) + prev = int(r0) if e1 != 0 { err = errnoErr(e1) } @@ -2091,8 +2092,9 @@ func Setfsgid(gid int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Setfsuid(uid int) (err error) { - _, _, e1 := Syscall(SYS_SETFSUID, uintptr(uid), 0, 0) +func setfsuid(uid int) (prev int, err error) { + r0, _, e1 := Syscall(SYS_SETFSUID, uintptr(uid), 0, 0) + prev = int(r0) if e1 != 0 { err = errnoErr(e1) } diff --git a/vendor/golang.org/x/sys/unix/zsyscall_linux_mips64le.go b/vendor/golang.org/x/sys/unix/zsyscall_linux_mips64le.go index 29bdea98..9c6bee91 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_linux_mips64le.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_linux_mips64le.go @@ -439,7 +439,7 @@ func Adjtimex(buf *Timex) (state int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT func Capget(hdr *CapUserHeader, data *CapUserData) (err error) { - _, _, e1 := Syscall(SYS_CAPGET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + _, _, e1 := RawSyscall(SYS_CAPGET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) if e1 != 0 { err = errnoErr(e1) } @@ -449,7 +449,7 @@ func Capget(hdr *CapUserHeader, data *CapUserData) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT func Capset(hdr *CapUserHeader, data *CapUserData) (err error) { - _, _, e1 := Syscall(SYS_CAPSET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + _, _, e1 := RawSyscall(SYS_CAPSET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) if e1 != 0 { err = errnoErr(e1) } @@ -2081,8 +2081,9 @@ func sendfile(outfd int, infd int, offset *int64, count int) (written int, err e // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Setfsgid(gid int) (err error) { - _, _, e1 := Syscall(SYS_SETFSGID, uintptr(gid), 0, 0) +func setfsgid(gid int) (prev int, err error) { + r0, _, e1 := Syscall(SYS_SETFSGID, uintptr(gid), 0, 0) + prev = int(r0) if e1 != 0 { err = errnoErr(e1) } @@ -2091,8 +2092,9 @@ func Setfsgid(gid int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Setfsuid(uid int) (err error) { - _, _, e1 := Syscall(SYS_SETFSUID, uintptr(uid), 0, 0) +func setfsuid(uid int) (prev int, err error) { + r0, _, e1 := Syscall(SYS_SETFSUID, uintptr(uid), 0, 0) + prev = int(r0) if e1 != 0 { err = errnoErr(e1) } diff --git a/vendor/golang.org/x/sys/unix/zsyscall_linux_mipsle.go b/vendor/golang.org/x/sys/unix/zsyscall_linux_mipsle.go index 1dac2198..676088fa 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_linux_mipsle.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_linux_mipsle.go @@ -439,7 +439,7 @@ func Adjtimex(buf *Timex) (state int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT func Capget(hdr *CapUserHeader, data *CapUserData) (err error) { - _, _, e1 := Syscall(SYS_CAPGET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + _, _, e1 := RawSyscall(SYS_CAPGET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) if e1 != 0 { err = errnoErr(e1) } @@ -449,7 +449,7 @@ func Capget(hdr *CapUserHeader, data *CapUserData) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT func Capset(hdr *CapUserHeader, data *CapUserData) (err error) { - _, _, e1 := Syscall(SYS_CAPSET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + _, _, e1 := RawSyscall(SYS_CAPSET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) if e1 != 0 { err = errnoErr(e1) } @@ -2051,8 +2051,9 @@ func sendfile(outfd int, infd int, offset *int64, count int) (written int, err e // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Setfsgid(gid int) (err error) { - _, _, e1 := Syscall(SYS_SETFSGID, uintptr(gid), 0, 0) +func setfsgid(gid int) (prev int, err error) { + r0, _, e1 := Syscall(SYS_SETFSGID, uintptr(gid), 0, 0) + prev = int(r0) if e1 != 0 { err = errnoErr(e1) } @@ -2061,8 +2062,9 @@ func Setfsgid(gid int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Setfsuid(uid int) (err error) { - _, _, e1 := Syscall(SYS_SETFSUID, uintptr(uid), 0, 0) +func setfsuid(uid int) (prev int, err error) { + r0, _, e1 := Syscall(SYS_SETFSUID, uintptr(uid), 0, 0) + prev = int(r0) if e1 != 0 { err = errnoErr(e1) } diff --git a/vendor/golang.org/x/sys/unix/zsyscall_linux_ppc64.go b/vendor/golang.org/x/sys/unix/zsyscall_linux_ppc64.go index 7b76d602..7ee0b80d 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_linux_ppc64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_linux_ppc64.go @@ -439,7 +439,7 @@ func Adjtimex(buf *Timex) (state int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT func Capget(hdr *CapUserHeader, data *CapUserData) (err error) { - _, _, e1 := Syscall(SYS_CAPGET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + _, _, e1 := RawSyscall(SYS_CAPGET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) if e1 != 0 { err = errnoErr(e1) } @@ -449,7 +449,7 @@ func Capget(hdr *CapUserHeader, data *CapUserData) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT func Capset(hdr *CapUserHeader, data *CapUserData) (err error) { - _, _, e1 := Syscall(SYS_CAPSET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + _, _, e1 := RawSyscall(SYS_CAPSET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) if e1 != 0 { err = errnoErr(e1) } @@ -2163,8 +2163,9 @@ func sendfile(outfd int, infd int, offset *int64, count int) (written int, err e // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Setfsgid(gid int) (err error) { - _, _, e1 := Syscall(SYS_SETFSGID, uintptr(gid), 0, 0) +func setfsgid(gid int) (prev int, err error) { + r0, _, e1 := Syscall(SYS_SETFSGID, uintptr(gid), 0, 0) + prev = int(r0) if e1 != 0 { err = errnoErr(e1) } @@ -2173,8 +2174,9 @@ func Setfsgid(gid int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Setfsuid(uid int) (err error) { - _, _, e1 := Syscall(SYS_SETFSUID, uintptr(uid), 0, 0) +func setfsuid(uid int) (prev int, err error) { + r0, _, e1 := Syscall(SYS_SETFSUID, uintptr(uid), 0, 0) + prev = int(r0) if e1 != 0 { err = errnoErr(e1) } diff --git a/vendor/golang.org/x/sys/unix/zsyscall_linux_ppc64le.go b/vendor/golang.org/x/sys/unix/zsyscall_linux_ppc64le.go index 5f2e31cd..8eaa7c9e 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_linux_ppc64le.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_linux_ppc64le.go @@ -439,7 +439,7 @@ func Adjtimex(buf *Timex) (state int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT func Capget(hdr *CapUserHeader, data *CapUserData) (err error) { - _, _, e1 := Syscall(SYS_CAPGET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + _, _, e1 := RawSyscall(SYS_CAPGET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) if e1 != 0 { err = errnoErr(e1) } @@ -449,7 +449,7 @@ func Capget(hdr *CapUserHeader, data *CapUserData) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT func Capset(hdr *CapUserHeader, data *CapUserData) (err error) { - _, _, e1 := Syscall(SYS_CAPSET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + _, _, e1 := RawSyscall(SYS_CAPSET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) if e1 != 0 { err = errnoErr(e1) } @@ -2163,8 +2163,9 @@ func sendfile(outfd int, infd int, offset *int64, count int) (written int, err e // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Setfsgid(gid int) (err error) { - _, _, e1 := Syscall(SYS_SETFSGID, uintptr(gid), 0, 0) +func setfsgid(gid int) (prev int, err error) { + r0, _, e1 := Syscall(SYS_SETFSGID, uintptr(gid), 0, 0) + prev = int(r0) if e1 != 0 { err = errnoErr(e1) } @@ -2173,8 +2174,9 @@ func Setfsgid(gid int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Setfsuid(uid int) (err error) { - _, _, e1 := Syscall(SYS_SETFSUID, uintptr(uid), 0, 0) +func setfsuid(uid int) (prev int, err error) { + r0, _, e1 := Syscall(SYS_SETFSUID, uintptr(uid), 0, 0) + prev = int(r0) if e1 != 0 { err = errnoErr(e1) } diff --git a/vendor/golang.org/x/sys/unix/zsyscall_linux_riscv64.go b/vendor/golang.org/x/sys/unix/zsyscall_linux_riscv64.go index ea52bd33..b8f212bf 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_linux_riscv64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_linux_riscv64.go @@ -439,7 +439,7 @@ func Adjtimex(buf *Timex) (state int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT func Capget(hdr *CapUserHeader, data *CapUserData) (err error) { - _, _, e1 := Syscall(SYS_CAPGET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + _, _, e1 := RawSyscall(SYS_CAPGET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) if e1 != 0 { err = errnoErr(e1) } @@ -449,7 +449,7 @@ func Capget(hdr *CapUserHeader, data *CapUserData) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT func Capset(hdr *CapUserHeader, data *CapUserData) (err error) { - _, _, e1 := Syscall(SYS_CAPSET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + _, _, e1 := RawSyscall(SYS_CAPSET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) if e1 != 0 { err = errnoErr(e1) } @@ -2040,8 +2040,9 @@ func sendfile(outfd int, infd int, offset *int64, count int) (written int, err e // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Setfsgid(gid int) (err error) { - _, _, e1 := Syscall(SYS_SETFSGID, uintptr(gid), 0, 0) +func setfsgid(gid int) (prev int, err error) { + r0, _, e1 := Syscall(SYS_SETFSGID, uintptr(gid), 0, 0) + prev = int(r0) if e1 != 0 { err = errnoErr(e1) } @@ -2050,8 +2051,9 @@ func Setfsgid(gid int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Setfsuid(uid int) (err error) { - _, _, e1 := Syscall(SYS_SETFSUID, uintptr(uid), 0, 0) +func setfsuid(uid int) (prev int, err error) { + r0, _, e1 := Syscall(SYS_SETFSUID, uintptr(uid), 0, 0) + prev = int(r0) if e1 != 0 { err = errnoErr(e1) } diff --git a/vendor/golang.org/x/sys/unix/zsyscall_linux_s390x.go b/vendor/golang.org/x/sys/unix/zsyscall_linux_s390x.go index 3f1e461c..a7191cdb 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_linux_s390x.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_linux_s390x.go @@ -439,7 +439,7 @@ func Adjtimex(buf *Timex) (state int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT func Capget(hdr *CapUserHeader, data *CapUserData) (err error) { - _, _, e1 := Syscall(SYS_CAPGET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + _, _, e1 := RawSyscall(SYS_CAPGET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) if e1 != 0 { err = errnoErr(e1) } @@ -449,7 +449,7 @@ func Capget(hdr *CapUserHeader, data *CapUserData) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT func Capset(hdr *CapUserHeader, data *CapUserData) (err error) { - _, _, e1 := Syscall(SYS_CAPSET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + _, _, e1 := RawSyscall(SYS_CAPSET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) if e1 != 0 { err = errnoErr(e1) } @@ -2133,8 +2133,9 @@ func sendfile(outfd int, infd int, offset *int64, count int) (written int, err e // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Setfsgid(gid int) (err error) { - _, _, e1 := Syscall(SYS_SETFSGID, uintptr(gid), 0, 0) +func setfsgid(gid int) (prev int, err error) { + r0, _, e1 := Syscall(SYS_SETFSGID, uintptr(gid), 0, 0) + prev = int(r0) if e1 != 0 { err = errnoErr(e1) } @@ -2143,8 +2144,9 @@ func Setfsgid(gid int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Setfsuid(uid int) (err error) { - _, _, e1 := Syscall(SYS_SETFSUID, uintptr(uid), 0, 0) +func setfsuid(uid int) (prev int, err error) { + r0, _, e1 := Syscall(SYS_SETFSUID, uintptr(uid), 0, 0) + prev = int(r0) if e1 != 0 { err = errnoErr(e1) } diff --git a/vendor/golang.org/x/sys/unix/zsyscall_linux_sparc64.go b/vendor/golang.org/x/sys/unix/zsyscall_linux_sparc64.go index 6bcd0a31..9abdbde7 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_linux_sparc64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_linux_sparc64.go @@ -439,7 +439,7 @@ func Adjtimex(buf *Timex) (state int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT func Capget(hdr *CapUserHeader, data *CapUserData) (err error) { - _, _, e1 := Syscall(SYS_CAPGET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + _, _, e1 := RawSyscall(SYS_CAPGET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) if e1 != 0 { err = errnoErr(e1) } @@ -449,7 +449,7 @@ func Capget(hdr *CapUserHeader, data *CapUserData) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT func Capset(hdr *CapUserHeader, data *CapUserData) (err error) { - _, _, e1 := Syscall(SYS_CAPSET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + _, _, e1 := RawSyscall(SYS_CAPSET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) if e1 != 0 { err = errnoErr(e1) } @@ -2132,8 +2132,9 @@ func sendfile(outfd int, infd int, offset *int64, count int) (written int, err e // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Setfsgid(gid int) (err error) { - _, _, e1 := Syscall(SYS_SETFSGID, uintptr(gid), 0, 0) +func setfsgid(gid int) (prev int, err error) { + r0, _, e1 := Syscall(SYS_SETFSGID, uintptr(gid), 0, 0) + prev = int(r0) if e1 != 0 { err = errnoErr(e1) } @@ -2142,8 +2143,9 @@ func Setfsgid(gid int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Setfsuid(uid int) (err error) { - _, _, e1 := Syscall(SYS_SETFSUID, uintptr(uid), 0, 0) +func setfsuid(uid int) (prev int, err error) { + r0, _, e1 := Syscall(SYS_SETFSUID, uintptr(uid), 0, 0) + prev = int(r0) if e1 != 0 { err = errnoErr(e1) } diff --git a/vendor/golang.org/x/sys/unix/zsyscall_netbsd_386.go b/vendor/golang.org/x/sys/unix/zsyscall_netbsd_386.go index a18f7760..3bbd9e39 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_netbsd_386.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_netbsd_386.go @@ -350,22 +350,6 @@ func Munlockall() (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) { - var _p0 unsafe.Pointer - if len(mib) > 0 { - _p0 = unsafe.Pointer(&mib[0]) - } else { - _p0 = unsafe.Pointer(&_zero) - } - _, _, e1 := Syscall6(SYS___SYSCTL, uintptr(_p0), uintptr(len(mib)), uintptr(unsafe.Pointer(old)), uintptr(unsafe.Pointer(oldlen)), uintptr(unsafe.Pointer(new)), uintptr(newlen)) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func pipe() (fd1 int, fd2 int, err error) { r0, r1, e1 := RawSyscall(SYS_PIPE, 0, 0, 0) fd1 = int(r0) @@ -422,6 +406,22 @@ func ioctl(fd int, req uint, arg uintptr) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) { + var _p0 unsafe.Pointer + if len(mib) > 0 { + _p0 = unsafe.Pointer(&mib[0]) + } else { + _p0 = unsafe.Pointer(&_zero) + } + _, _, e1 := Syscall6(SYS___SYSCTL, uintptr(_p0), uintptr(len(mib)), uintptr(unsafe.Pointer(old)), uintptr(unsafe.Pointer(oldlen)), uintptr(unsafe.Pointer(new)), uintptr(newlen)) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Access(path string, mode uint32) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_netbsd_amd64.go b/vendor/golang.org/x/sys/unix/zsyscall_netbsd_amd64.go index 45993a4a..d8cf5012 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_netbsd_amd64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_netbsd_amd64.go @@ -350,22 +350,6 @@ func Munlockall() (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) { - var _p0 unsafe.Pointer - if len(mib) > 0 { - _p0 = unsafe.Pointer(&mib[0]) - } else { - _p0 = unsafe.Pointer(&_zero) - } - _, _, e1 := Syscall6(SYS___SYSCTL, uintptr(_p0), uintptr(len(mib)), uintptr(unsafe.Pointer(old)), uintptr(unsafe.Pointer(oldlen)), uintptr(unsafe.Pointer(new)), uintptr(newlen)) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func pipe() (fd1 int, fd2 int, err error) { r0, r1, e1 := RawSyscall(SYS_PIPE, 0, 0, 0) fd1 = int(r0) @@ -422,6 +406,22 @@ func ioctl(fd int, req uint, arg uintptr) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) { + var _p0 unsafe.Pointer + if len(mib) > 0 { + _p0 = unsafe.Pointer(&mib[0]) + } else { + _p0 = unsafe.Pointer(&_zero) + } + _, _, e1 := Syscall6(SYS___SYSCTL, uintptr(_p0), uintptr(len(mib)), uintptr(unsafe.Pointer(old)), uintptr(unsafe.Pointer(oldlen)), uintptr(unsafe.Pointer(new)), uintptr(newlen)) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Access(path string, mode uint32) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_netbsd_arm.go b/vendor/golang.org/x/sys/unix/zsyscall_netbsd_arm.go index c8421dc6..1153fe69 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_netbsd_arm.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_netbsd_arm.go @@ -350,22 +350,6 @@ func Munlockall() (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) { - var _p0 unsafe.Pointer - if len(mib) > 0 { - _p0 = unsafe.Pointer(&mib[0]) - } else { - _p0 = unsafe.Pointer(&_zero) - } - _, _, e1 := Syscall6(SYS___SYSCTL, uintptr(_p0), uintptr(len(mib)), uintptr(unsafe.Pointer(old)), uintptr(unsafe.Pointer(oldlen)), uintptr(unsafe.Pointer(new)), uintptr(newlen)) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func pipe() (fd1 int, fd2 int, err error) { r0, r1, e1 := RawSyscall(SYS_PIPE, 0, 0, 0) fd1 = int(r0) @@ -422,6 +406,22 @@ func ioctl(fd int, req uint, arg uintptr) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) { + var _p0 unsafe.Pointer + if len(mib) > 0 { + _p0 = unsafe.Pointer(&mib[0]) + } else { + _p0 = unsafe.Pointer(&_zero) + } + _, _, e1 := Syscall6(SYS___SYSCTL, uintptr(_p0), uintptr(len(mib)), uintptr(unsafe.Pointer(old)), uintptr(unsafe.Pointer(oldlen)), uintptr(unsafe.Pointer(new)), uintptr(newlen)) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Access(path string, mode uint32) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_netbsd_arm64.go b/vendor/golang.org/x/sys/unix/zsyscall_netbsd_arm64.go index 9cc849b9..24b4ebb4 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_netbsd_arm64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_netbsd_arm64.go @@ -350,22 +350,6 @@ func Munlockall() (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) { - var _p0 unsafe.Pointer - if len(mib) > 0 { - _p0 = unsafe.Pointer(&mib[0]) - } else { - _p0 = unsafe.Pointer(&_zero) - } - _, _, e1 := Syscall6(SYS___SYSCTL, uintptr(_p0), uintptr(len(mib)), uintptr(unsafe.Pointer(old)), uintptr(unsafe.Pointer(oldlen)), uintptr(unsafe.Pointer(new)), uintptr(newlen)) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func pipe() (fd1 int, fd2 int, err error) { r0, r1, e1 := RawSyscall(SYS_PIPE, 0, 0, 0) fd1 = int(r0) @@ -422,6 +406,22 @@ func ioctl(fd int, req uint, arg uintptr) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) { + var _p0 unsafe.Pointer + if len(mib) > 0 { + _p0 = unsafe.Pointer(&mib[0]) + } else { + _p0 = unsafe.Pointer(&_zero) + } + _, _, e1 := Syscall6(SYS___SYSCTL, uintptr(_p0), uintptr(len(mib)), uintptr(unsafe.Pointer(old)), uintptr(unsafe.Pointer(oldlen)), uintptr(unsafe.Pointer(new)), uintptr(newlen)) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Access(path string, mode uint32) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_386.go b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_386.go index aad7b9c8..b44b31ae 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_386.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_386.go @@ -350,8 +350,8 @@ func Munlockall() (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func pipe(p *[2]_C_int) (err error) { - _, _, e1 := RawSyscall(SYS_PIPE, uintptr(unsafe.Pointer(p)), 0, 0) +func pipe2(p *[2]_C_int, flags int) (err error) { + _, _, e1 := RawSyscall(SYS_PIPE2, uintptr(unsafe.Pointer(p)), uintptr(flags), 0) if e1 != 0 { err = errnoErr(e1) } diff --git a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_amd64.go b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_amd64.go index 365b33d2..67f93ee7 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_amd64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_amd64.go @@ -350,8 +350,8 @@ func Munlockall() (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func pipe(p *[2]_C_int) (err error) { - _, _, e1 := RawSyscall(SYS_PIPE, uintptr(unsafe.Pointer(p)), 0, 0) +func pipe2(p *[2]_C_int, flags int) (err error) { + _, _, e1 := RawSyscall(SYS_PIPE2, uintptr(unsafe.Pointer(p)), uintptr(flags), 0) if e1 != 0 { err = errnoErr(e1) } diff --git a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_arm.go b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_arm.go index 07cba965..d7c878b1 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_arm.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_arm.go @@ -350,8 +350,8 @@ func Munlockall() (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func pipe(p *[2]_C_int) (err error) { - _, _, e1 := RawSyscall(SYS_PIPE, uintptr(unsafe.Pointer(p)), 0, 0) +func pipe2(p *[2]_C_int, flags int) (err error) { + _, _, e1 := RawSyscall(SYS_PIPE2, uintptr(unsafe.Pointer(p)), uintptr(flags), 0) if e1 != 0 { err = errnoErr(e1) } diff --git a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_arm64.go b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_arm64.go index 78951abf..8facd695 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_arm64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_arm64.go @@ -350,8 +350,8 @@ func Munlockall() (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func pipe(p *[2]_C_int) (err error) { - _, _, e1 := RawSyscall(SYS_PIPE, uintptr(unsafe.Pointer(p)), 0, 0) +func pipe2(p *[2]_C_int, flags int) (err error) { + _, _, e1 := RawSyscall(SYS_PIPE2, uintptr(unsafe.Pointer(p)), uintptr(flags), 0) if e1 != 0 { err = errnoErr(e1) } diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_arm64.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_arm64.go index 753def98..1f3b4d15 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_arm64.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_arm64.go @@ -297,4 +297,5 @@ const ( SYS_FSMOUNT = 432 SYS_FSPICK = 433 SYS_PIDFD_OPEN = 434 + SYS_CLONE3 = 435 ) diff --git a/vendor/golang.org/x/sys/unix/ztypes_dragonfly_amd64.go b/vendor/golang.org/x/sys/unix/ztypes_dragonfly_amd64.go index c206f2b0..71ea1d6d 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_dragonfly_amd64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_dragonfly_amd64.go @@ -467,3 +467,13 @@ type Utsname struct { Version [32]byte Machine [32]byte } + +const SizeofClockinfo = 0x14 + +type Clockinfo struct { + Hz int32 + Tick int32 + Tickadj int32 + Stathz int32 + Profhz int32 +} diff --git a/vendor/golang.org/x/sys/unix/ztypes_freebsd_386.go b/vendor/golang.org/x/sys/unix/ztypes_freebsd_386.go index 7312e95f..0ec15968 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_freebsd_386.go +++ b/vendor/golang.org/x/sys/unix/ztypes_freebsd_386.go @@ -423,7 +423,7 @@ type PtraceIoDesc struct { Op int32 Offs *byte Addr *byte - Len uint + Len uint32 } type Kevent_t struct { @@ -698,3 +698,13 @@ type Utsname struct { Version [256]byte Machine [256]byte } + +const SizeofClockinfo = 0x14 + +type Clockinfo struct { + Hz int32 + Tick int32 + Spare int32 + Stathz int32 + Profhz int32 +} diff --git a/vendor/golang.org/x/sys/unix/ztypes_freebsd_amd64.go b/vendor/golang.org/x/sys/unix/ztypes_freebsd_amd64.go index 29ba2f5b..8340f577 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_freebsd_amd64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_freebsd_amd64.go @@ -428,7 +428,7 @@ type PtraceIoDesc struct { Op int32 Offs *byte Addr *byte - Len uint + Len uint64 } type Kevent_t struct { @@ -704,3 +704,13 @@ type Utsname struct { Version [256]byte Machine [256]byte } + +const SizeofClockinfo = 0x14 + +type Clockinfo struct { + Hz int32 + Tick int32 + Spare int32 + Stathz int32 + Profhz int32 +} diff --git a/vendor/golang.org/x/sys/unix/ztypes_freebsd_arm.go b/vendor/golang.org/x/sys/unix/ztypes_freebsd_arm.go index b4090ef3..6f79227d 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_freebsd_arm.go +++ b/vendor/golang.org/x/sys/unix/ztypes_freebsd_arm.go @@ -405,7 +405,7 @@ type PtraceIoDesc struct { Op int32 Offs *byte Addr *byte - Len uint + Len uint32 } type Kevent_t struct { @@ -681,3 +681,13 @@ type Utsname struct { Version [256]byte Machine [256]byte } + +const SizeofClockinfo = 0x14 + +type Clockinfo struct { + Hz int32 + Tick int32 + Spare int32 + Stathz int32 + Profhz int32 +} diff --git a/vendor/golang.org/x/sys/unix/ztypes_freebsd_arm64.go b/vendor/golang.org/x/sys/unix/ztypes_freebsd_arm64.go index c681d7db..e751e003 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_freebsd_arm64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_freebsd_arm64.go @@ -406,7 +406,7 @@ type PtraceIoDesc struct { Op int32 Offs *byte Addr *byte - Len uint + Len uint64 } type Kevent_t struct { @@ -682,3 +682,13 @@ type Utsname struct { Version [256]byte Machine [256]byte } + +const SizeofClockinfo = 0x14 + +type Clockinfo struct { + Hz int32 + Tick int32 + Spare int32 + Stathz int32 + Profhz int32 +} diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_386.go b/vendor/golang.org/x/sys/unix/ztypes_linux_386.go index d2306df4..5d835d08 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_386.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_386.go @@ -55,6 +55,16 @@ type Timex struct { _ [44]byte } +const ( + TIME_OK = 0x0 + TIME_INS = 0x1 + TIME_DEL = 0x2 + TIME_OOP = 0x3 + TIME_WAIT = 0x4 + TIME_ERROR = 0x5 + TIME_BAD = 0x5 +) + type Time_t int32 type Tms struct { @@ -592,7 +602,7 @@ const ( IFLA_NEW_IFINDEX = 0x31 IFLA_MIN_MTU = 0x32 IFLA_MAX_MTU = 0x33 - IFLA_MAX = 0x33 + IFLA_MAX = 0x35 IFLA_INFO_KIND = 0x1 IFLA_INFO_DATA = 0x2 IFLA_INFO_XSTATS = 0x3 @@ -2794,7 +2804,7 @@ const ( DEVLINK_ATTR_DPIPE_FIELD_MAPPING_TYPE = 0x3c DEVLINK_ATTR_PAD = 0x3d DEVLINK_ATTR_ESWITCH_ENCAP_MODE = 0x3e - DEVLINK_ATTR_MAX = 0x89 + DEVLINK_ATTR_MAX = 0x8c DEVLINK_DPIPE_FIELD_MAPPING_TYPE_NONE = 0x0 DEVLINK_DPIPE_FIELD_MAPPING_TYPE_IFINDEX = 0x1 DEVLINK_DPIPE_MATCH_TYPE_FIELD_EXACT = 0x0 diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_amd64.go b/vendor/golang.org/x/sys/unix/ztypes_linux_amd64.go index 88887058..55a9902a 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_amd64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_amd64.go @@ -55,6 +55,16 @@ type Timex struct { _ [44]byte } +const ( + TIME_OK = 0x0 + TIME_INS = 0x1 + TIME_DEL = 0x2 + TIME_OOP = 0x3 + TIME_WAIT = 0x4 + TIME_ERROR = 0x5 + TIME_BAD = 0x5 +) + type Time_t int64 type Tms struct { @@ -593,7 +603,7 @@ const ( IFLA_NEW_IFINDEX = 0x31 IFLA_MIN_MTU = 0x32 IFLA_MAX_MTU = 0x33 - IFLA_MAX = 0x33 + IFLA_MAX = 0x35 IFLA_INFO_KIND = 0x1 IFLA_INFO_DATA = 0x2 IFLA_INFO_XSTATS = 0x3 @@ -2809,7 +2819,7 @@ const ( DEVLINK_ATTR_DPIPE_FIELD_MAPPING_TYPE = 0x3c DEVLINK_ATTR_PAD = 0x3d DEVLINK_ATTR_ESWITCH_ENCAP_MODE = 0x3e - DEVLINK_ATTR_MAX = 0x89 + DEVLINK_ATTR_MAX = 0x8c DEVLINK_DPIPE_FIELD_MAPPING_TYPE_NONE = 0x0 DEVLINK_DPIPE_FIELD_MAPPING_TYPE_IFINDEX = 0x1 DEVLINK_DPIPE_MATCH_TYPE_FIELD_EXACT = 0x0 diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_arm.go b/vendor/golang.org/x/sys/unix/ztypes_linux_arm.go index 5f6f5945..91cbbb74 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_arm.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_arm.go @@ -55,6 +55,16 @@ type Timex struct { _ [44]byte } +const ( + TIME_OK = 0x0 + TIME_INS = 0x1 + TIME_DEL = 0x2 + TIME_OOP = 0x3 + TIME_WAIT = 0x4 + TIME_ERROR = 0x5 + TIME_BAD = 0x5 +) + type Time_t int32 type Tms struct { @@ -596,7 +606,7 @@ const ( IFLA_NEW_IFINDEX = 0x31 IFLA_MIN_MTU = 0x32 IFLA_MAX_MTU = 0x33 - IFLA_MAX = 0x33 + IFLA_MAX = 0x35 IFLA_INFO_KIND = 0x1 IFLA_INFO_DATA = 0x2 IFLA_INFO_XSTATS = 0x3 @@ -2786,7 +2796,7 @@ const ( DEVLINK_ATTR_DPIPE_FIELD_MAPPING_TYPE = 0x3c DEVLINK_ATTR_PAD = 0x3d DEVLINK_ATTR_ESWITCH_ENCAP_MODE = 0x3e - DEVLINK_ATTR_MAX = 0x89 + DEVLINK_ATTR_MAX = 0x8c DEVLINK_DPIPE_FIELD_MAPPING_TYPE_NONE = 0x0 DEVLINK_DPIPE_FIELD_MAPPING_TYPE_IFINDEX = 0x1 DEVLINK_DPIPE_MATCH_TYPE_FIELD_EXACT = 0x0 diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_arm64.go b/vendor/golang.org/x/sys/unix/ztypes_linux_arm64.go index e27030c5..ea231fa9 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_arm64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_arm64.go @@ -55,6 +55,16 @@ type Timex struct { _ [44]byte } +const ( + TIME_OK = 0x0 + TIME_INS = 0x1 + TIME_DEL = 0x2 + TIME_OOP = 0x3 + TIME_WAIT = 0x4 + TIME_ERROR = 0x5 + TIME_BAD = 0x5 +) + type Time_t int64 type Tms struct { @@ -594,7 +604,7 @@ const ( IFLA_NEW_IFINDEX = 0x31 IFLA_MIN_MTU = 0x32 IFLA_MAX_MTU = 0x33 - IFLA_MAX = 0x33 + IFLA_MAX = 0x35 IFLA_INFO_KIND = 0x1 IFLA_INFO_DATA = 0x2 IFLA_INFO_XSTATS = 0x3 @@ -2788,7 +2798,7 @@ const ( DEVLINK_ATTR_DPIPE_FIELD_MAPPING_TYPE = 0x3c DEVLINK_ATTR_PAD = 0x3d DEVLINK_ATTR_ESWITCH_ENCAP_MODE = 0x3e - DEVLINK_ATTR_MAX = 0x89 + DEVLINK_ATTR_MAX = 0x8c DEVLINK_DPIPE_FIELD_MAPPING_TYPE_NONE = 0x0 DEVLINK_DPIPE_FIELD_MAPPING_TYPE_IFINDEX = 0x1 DEVLINK_DPIPE_MATCH_TYPE_FIELD_EXACT = 0x0 diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_mips.go b/vendor/golang.org/x/sys/unix/ztypes_linux_mips.go index 9b1c03da..a577a5ae 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_mips.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_mips.go @@ -55,6 +55,16 @@ type Timex struct { _ [44]byte } +const ( + TIME_OK = 0x0 + TIME_INS = 0x1 + TIME_DEL = 0x2 + TIME_OOP = 0x3 + TIME_WAIT = 0x4 + TIME_ERROR = 0x5 + TIME_BAD = 0x5 +) + type Time_t int32 type Tms struct { @@ -595,7 +605,7 @@ const ( IFLA_NEW_IFINDEX = 0x31 IFLA_MIN_MTU = 0x32 IFLA_MAX_MTU = 0x33 - IFLA_MAX = 0x33 + IFLA_MAX = 0x35 IFLA_INFO_KIND = 0x1 IFLA_INFO_DATA = 0x2 IFLA_INFO_XSTATS = 0x3 @@ -2792,7 +2802,7 @@ const ( DEVLINK_ATTR_DPIPE_FIELD_MAPPING_TYPE = 0x3c DEVLINK_ATTR_PAD = 0x3d DEVLINK_ATTR_ESWITCH_ENCAP_MODE = 0x3e - DEVLINK_ATTR_MAX = 0x89 + DEVLINK_ATTR_MAX = 0x8c DEVLINK_DPIPE_FIELD_MAPPING_TYPE_NONE = 0x0 DEVLINK_DPIPE_FIELD_MAPPING_TYPE_IFINDEX = 0x1 DEVLINK_DPIPE_MATCH_TYPE_FIELD_EXACT = 0x0 diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_mips64.go b/vendor/golang.org/x/sys/unix/ztypes_linux_mips64.go index 3b88e1ff..efbf921d 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_mips64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_mips64.go @@ -55,6 +55,16 @@ type Timex struct { _ [44]byte } +const ( + TIME_OK = 0x0 + TIME_INS = 0x1 + TIME_DEL = 0x2 + TIME_OOP = 0x3 + TIME_WAIT = 0x4 + TIME_ERROR = 0x5 + TIME_BAD = 0x5 +) + type Time_t int64 type Tms struct { @@ -594,7 +604,7 @@ const ( IFLA_NEW_IFINDEX = 0x31 IFLA_MIN_MTU = 0x32 IFLA_MAX_MTU = 0x33 - IFLA_MAX = 0x33 + IFLA_MAX = 0x35 IFLA_INFO_KIND = 0x1 IFLA_INFO_DATA = 0x2 IFLA_INFO_XSTATS = 0x3 @@ -2791,7 +2801,7 @@ const ( DEVLINK_ATTR_DPIPE_FIELD_MAPPING_TYPE = 0x3c DEVLINK_ATTR_PAD = 0x3d DEVLINK_ATTR_ESWITCH_ENCAP_MODE = 0x3e - DEVLINK_ATTR_MAX = 0x89 + DEVLINK_ATTR_MAX = 0x8c DEVLINK_DPIPE_FIELD_MAPPING_TYPE_NONE = 0x0 DEVLINK_DPIPE_FIELD_MAPPING_TYPE_IFINDEX = 0x1 DEVLINK_DPIPE_MATCH_TYPE_FIELD_EXACT = 0x0 diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_mips64le.go b/vendor/golang.org/x/sys/unix/ztypes_linux_mips64le.go index 7277dc3b..4d961479 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_mips64le.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_mips64le.go @@ -55,6 +55,16 @@ type Timex struct { _ [44]byte } +const ( + TIME_OK = 0x0 + TIME_INS = 0x1 + TIME_DEL = 0x2 + TIME_OOP = 0x3 + TIME_WAIT = 0x4 + TIME_ERROR = 0x5 + TIME_BAD = 0x5 +) + type Time_t int64 type Tms struct { @@ -594,7 +604,7 @@ const ( IFLA_NEW_IFINDEX = 0x31 IFLA_MIN_MTU = 0x32 IFLA_MAX_MTU = 0x33 - IFLA_MAX = 0x33 + IFLA_MAX = 0x35 IFLA_INFO_KIND = 0x1 IFLA_INFO_DATA = 0x2 IFLA_INFO_XSTATS = 0x3 @@ -2791,7 +2801,7 @@ const ( DEVLINK_ATTR_DPIPE_FIELD_MAPPING_TYPE = 0x3c DEVLINK_ATTR_PAD = 0x3d DEVLINK_ATTR_ESWITCH_ENCAP_MODE = 0x3e - DEVLINK_ATTR_MAX = 0x89 + DEVLINK_ATTR_MAX = 0x8c DEVLINK_DPIPE_FIELD_MAPPING_TYPE_NONE = 0x0 DEVLINK_DPIPE_FIELD_MAPPING_TYPE_IFINDEX = 0x1 DEVLINK_DPIPE_MATCH_TYPE_FIELD_EXACT = 0x0 diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_mipsle.go b/vendor/golang.org/x/sys/unix/ztypes_linux_mipsle.go index 6f32c175..e7127c23 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_mipsle.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_mipsle.go @@ -55,6 +55,16 @@ type Timex struct { _ [44]byte } +const ( + TIME_OK = 0x0 + TIME_INS = 0x1 + TIME_DEL = 0x2 + TIME_OOP = 0x3 + TIME_WAIT = 0x4 + TIME_ERROR = 0x5 + TIME_BAD = 0x5 +) + type Time_t int32 type Tms struct { @@ -595,7 +605,7 @@ const ( IFLA_NEW_IFINDEX = 0x31 IFLA_MIN_MTU = 0x32 IFLA_MAX_MTU = 0x33 - IFLA_MAX = 0x33 + IFLA_MAX = 0x35 IFLA_INFO_KIND = 0x1 IFLA_INFO_DATA = 0x2 IFLA_INFO_XSTATS = 0x3 @@ -2792,7 +2802,7 @@ const ( DEVLINK_ATTR_DPIPE_FIELD_MAPPING_TYPE = 0x3c DEVLINK_ATTR_PAD = 0x3d DEVLINK_ATTR_ESWITCH_ENCAP_MODE = 0x3e - DEVLINK_ATTR_MAX = 0x89 + DEVLINK_ATTR_MAX = 0x8c DEVLINK_DPIPE_FIELD_MAPPING_TYPE_NONE = 0x0 DEVLINK_DPIPE_FIELD_MAPPING_TYPE_IFINDEX = 0x1 DEVLINK_DPIPE_MATCH_TYPE_FIELD_EXACT = 0x0 diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64.go b/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64.go index 8a9484d6..515c1d7d 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64.go @@ -55,6 +55,16 @@ type Timex struct { _ [44]byte } +const ( + TIME_OK = 0x0 + TIME_INS = 0x1 + TIME_DEL = 0x2 + TIME_OOP = 0x3 + TIME_WAIT = 0x4 + TIME_ERROR = 0x5 + TIME_BAD = 0x5 +) + type Time_t int64 type Tms struct { @@ -595,7 +605,7 @@ const ( IFLA_NEW_IFINDEX = 0x31 IFLA_MIN_MTU = 0x32 IFLA_MAX_MTU = 0x33 - IFLA_MAX = 0x33 + IFLA_MAX = 0x35 IFLA_INFO_KIND = 0x1 IFLA_INFO_DATA = 0x2 IFLA_INFO_XSTATS = 0x3 @@ -2798,7 +2808,7 @@ const ( DEVLINK_ATTR_DPIPE_FIELD_MAPPING_TYPE = 0x3c DEVLINK_ATTR_PAD = 0x3d DEVLINK_ATTR_ESWITCH_ENCAP_MODE = 0x3e - DEVLINK_ATTR_MAX = 0x89 + DEVLINK_ATTR_MAX = 0x8c DEVLINK_DPIPE_FIELD_MAPPING_TYPE_NONE = 0x0 DEVLINK_DPIPE_FIELD_MAPPING_TYPE_IFINDEX = 0x1 DEVLINK_DPIPE_MATCH_TYPE_FIELD_EXACT = 0x0 diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64le.go b/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64le.go index 7190a186..82a35862 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64le.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64le.go @@ -55,6 +55,16 @@ type Timex struct { _ [44]byte } +const ( + TIME_OK = 0x0 + TIME_INS = 0x1 + TIME_DEL = 0x2 + TIME_OOP = 0x3 + TIME_WAIT = 0x4 + TIME_ERROR = 0x5 + TIME_BAD = 0x5 +) + type Time_t int64 type Tms struct { @@ -595,7 +605,7 @@ const ( IFLA_NEW_IFINDEX = 0x31 IFLA_MIN_MTU = 0x32 IFLA_MAX_MTU = 0x33 - IFLA_MAX = 0x33 + IFLA_MAX = 0x35 IFLA_INFO_KIND = 0x1 IFLA_INFO_DATA = 0x2 IFLA_INFO_XSTATS = 0x3 @@ -2798,7 +2808,7 @@ const ( DEVLINK_ATTR_DPIPE_FIELD_MAPPING_TYPE = 0x3c DEVLINK_ATTR_PAD = 0x3d DEVLINK_ATTR_ESWITCH_ENCAP_MODE = 0x3e - DEVLINK_ATTR_MAX = 0x89 + DEVLINK_ATTR_MAX = 0x8c DEVLINK_DPIPE_FIELD_MAPPING_TYPE_NONE = 0x0 DEVLINK_DPIPE_FIELD_MAPPING_TYPE_IFINDEX = 0x1 DEVLINK_DPIPE_MATCH_TYPE_FIELD_EXACT = 0x0 diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_riscv64.go b/vendor/golang.org/x/sys/unix/ztypes_linux_riscv64.go index 502d98aa..826523f9 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_riscv64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_riscv64.go @@ -55,6 +55,16 @@ type Timex struct { _ [44]byte } +const ( + TIME_OK = 0x0 + TIME_INS = 0x1 + TIME_DEL = 0x2 + TIME_OOP = 0x3 + TIME_WAIT = 0x4 + TIME_ERROR = 0x5 + TIME_BAD = 0x5 +) + type Time_t int64 type Tms struct { @@ -594,7 +604,7 @@ const ( IFLA_NEW_IFINDEX = 0x31 IFLA_MIN_MTU = 0x32 IFLA_MAX_MTU = 0x33 - IFLA_MAX = 0x33 + IFLA_MAX = 0x35 IFLA_INFO_KIND = 0x1 IFLA_INFO_DATA = 0x2 IFLA_INFO_XSTATS = 0x3 @@ -2816,7 +2826,7 @@ const ( DEVLINK_ATTR_DPIPE_FIELD_MAPPING_TYPE = 0x3c DEVLINK_ATTR_PAD = 0x3d DEVLINK_ATTR_ESWITCH_ENCAP_MODE = 0x3e - DEVLINK_ATTR_MAX = 0x89 + DEVLINK_ATTR_MAX = 0x8c DEVLINK_DPIPE_FIELD_MAPPING_TYPE_NONE = 0x0 DEVLINK_DPIPE_FIELD_MAPPING_TYPE_IFINDEX = 0x1 DEVLINK_DPIPE_MATCH_TYPE_FIELD_EXACT = 0x0 diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_s390x.go b/vendor/golang.org/x/sys/unix/ztypes_linux_s390x.go index 65e12d7b..a715285b 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_s390x.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_s390x.go @@ -55,6 +55,16 @@ type Timex struct { _ [44]byte } +const ( + TIME_OK = 0x0 + TIME_INS = 0x1 + TIME_DEL = 0x2 + TIME_OOP = 0x3 + TIME_WAIT = 0x4 + TIME_ERROR = 0x5 + TIME_BAD = 0x5 +) + type Time_t int64 type Tms struct { @@ -593,7 +603,7 @@ const ( IFLA_NEW_IFINDEX = 0x31 IFLA_MIN_MTU = 0x32 IFLA_MAX_MTU = 0x33 - IFLA_MAX = 0x33 + IFLA_MAX = 0x35 IFLA_INFO_KIND = 0x1 IFLA_INFO_DATA = 0x2 IFLA_INFO_XSTATS = 0x3 @@ -2812,7 +2822,7 @@ const ( DEVLINK_ATTR_DPIPE_FIELD_MAPPING_TYPE = 0x3c DEVLINK_ATTR_PAD = 0x3d DEVLINK_ATTR_ESWITCH_ENCAP_MODE = 0x3e - DEVLINK_ATTR_MAX = 0x89 + DEVLINK_ATTR_MAX = 0x8c DEVLINK_DPIPE_FIELD_MAPPING_TYPE_NONE = 0x0 DEVLINK_DPIPE_FIELD_MAPPING_TYPE_IFINDEX = 0x1 DEVLINK_DPIPE_MATCH_TYPE_FIELD_EXACT = 0x0 diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_sparc64.go b/vendor/golang.org/x/sys/unix/ztypes_linux_sparc64.go index 26e8a2bb..1755c0c2 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_sparc64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_sparc64.go @@ -56,6 +56,16 @@ type Timex struct { _ [44]byte } +const ( + TIME_OK = 0x0 + TIME_INS = 0x1 + TIME_DEL = 0x2 + TIME_OOP = 0x3 + TIME_WAIT = 0x4 + TIME_ERROR = 0x5 + TIME_BAD = 0x5 +) + type Time_t int64 type Tms struct { @@ -597,7 +607,7 @@ const ( IFLA_NEW_IFINDEX = 0x31 IFLA_MIN_MTU = 0x32 IFLA_MAX_MTU = 0x33 - IFLA_MAX = 0x33 + IFLA_MAX = 0x35 IFLA_INFO_KIND = 0x1 IFLA_INFO_DATA = 0x2 IFLA_INFO_XSTATS = 0x3 @@ -2793,7 +2803,7 @@ const ( DEVLINK_ATTR_DPIPE_FIELD_MAPPING_TYPE = 0x3c DEVLINK_ATTR_PAD = 0x3d DEVLINK_ATTR_ESWITCH_ENCAP_MODE = 0x3e - DEVLINK_ATTR_MAX = 0x89 + DEVLINK_ATTR_MAX = 0x8c DEVLINK_DPIPE_FIELD_MAPPING_TYPE_NONE = 0x0 DEVLINK_DPIPE_FIELD_MAPPING_TYPE_IFINDEX = 0x1 DEVLINK_DPIPE_MATCH_TYPE_FIELD_EXACT = 0x0 diff --git a/vendor/golang.org/x/sys/unix/ztypes_solaris_amd64.go b/vendor/golang.org/x/sys/unix/ztypes_solaris_amd64.go index 8531a190..23ed9fe5 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_solaris_amd64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_solaris_amd64.go @@ -211,6 +211,12 @@ type Cmsghdr struct { Type int32 } +type Inet4Pktinfo struct { + Ifindex uint32 + Spec_dst [4]byte /* in_addr */ + Addr [4]byte /* in_addr */ +} + type Inet6Pktinfo struct { Addr [16]byte /* in6_addr */ Ifindex uint32 @@ -236,6 +242,7 @@ const ( SizeofIPv6Mreq = 0x14 SizeofMsghdr = 0x30 SizeofCmsghdr = 0xc + SizeofInet4Pktinfo = 0xc SizeofInet6Pktinfo = 0x14 SizeofIPv6MTUInfo = 0x24 SizeofICMPv6Filter = 0x20 diff --git a/vendor/golang.org/x/sys/windows/types_windows.go b/vendor/golang.org/x/sys/windows/types_windows.go index aefb7fc3..809fff0b 100644 --- a/vendor/golang.org/x/sys/windows/types_windows.go +++ b/vendor/golang.org/x/sys/windows/types_windows.go @@ -681,19 +681,26 @@ const ( AF_UNSPEC = 0 AF_UNIX = 1 AF_INET = 2 - AF_INET6 = 23 AF_NETBIOS = 17 + AF_INET6 = 23 + AF_IRDA = 26 + AF_BTH = 32 SOCK_STREAM = 1 SOCK_DGRAM = 2 SOCK_RAW = 3 + SOCK_RDM = 4 SOCK_SEQPACKET = 5 - IPPROTO_IP = 0 - IPPROTO_ICMP = 1 - IPPROTO_IPV6 = 0x29 - IPPROTO_TCP = 6 - IPPROTO_UDP = 17 + IPPROTO_IP = 0 + IPPROTO_ICMP = 1 + IPPROTO_IGMP = 2 + BTHPROTO_RFCOMM = 3 + IPPROTO_TCP = 6 + IPPROTO_UDP = 17 + IPPROTO_IPV6 = 41 + IPPROTO_ICMPV6 = 58 + IPPROTO_RM = 113 SOL_SOCKET = 0xffff SO_REUSEADDR = 4 diff --git a/vendor/golang.org/x/text/encoding/charmap/maketables.go b/vendor/golang.org/x/text/encoding/charmap/maketables.go deleted file mode 100644 index f7941701..00000000 --- a/vendor/golang.org/x/text/encoding/charmap/maketables.go +++ /dev/null @@ -1,556 +0,0 @@ -// Copyright 2013 The Go Authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the LICENSE file. - -// +build ignore - -package main - -import ( - "bufio" - "fmt" - "log" - "net/http" - "sort" - "strings" - "unicode/utf8" - - "golang.org/x/text/encoding" - "golang.org/x/text/internal/gen" -) - -const ascii = "\x00\x01\x02\x03\x04\x05\x06\x07\x08\x09\x0a\x0b\x0c\x0d\x0e\x0f" + - "\x10\x11\x12\x13\x14\x15\x16\x17\x18\x19\x1a\x1b\x1c\x1d\x1e\x1f" + - ` !"#$%&'()*+,-./0123456789:;<=>?` + - `@ABCDEFGHIJKLMNOPQRSTUVWXYZ[\]^_` + - "`abcdefghijklmnopqrstuvwxyz{|}~\u007f" - -var encodings = []struct { - name string - mib string - comment string - varName string - replacement byte - mapping string -}{ - { - "IBM Code Page 037", - "IBM037", - "", - "CodePage037", - 0x3f, - "http://source.icu-project.org/repos/icu/data/trunk/charset/data/ucm/glibc-IBM037-2.1.2.ucm", - }, - { - "IBM Code Page 437", - "PC8CodePage437", - "", - "CodePage437", - encoding.ASCIISub, - "http://source.icu-project.org/repos/icu/data/trunk/charset/data/ucm/glibc-IBM437-2.1.2.ucm", - }, - { - "IBM Code Page 850", - "PC850Multilingual", - "", - "CodePage850", - encoding.ASCIISub, - "http://source.icu-project.org/repos/icu/data/trunk/charset/data/ucm/glibc-IBM850-2.1.2.ucm", - }, - { - "IBM Code Page 852", - "PCp852", - "", - "CodePage852", - encoding.ASCIISub, - "http://source.icu-project.org/repos/icu/data/trunk/charset/data/ucm/glibc-IBM852-2.1.2.ucm", - }, - { - "IBM Code Page 855", - "IBM855", - "", - "CodePage855", - encoding.ASCIISub, - "http://source.icu-project.org/repos/icu/data/trunk/charset/data/ucm/glibc-IBM855-2.1.2.ucm", - }, - { - "Windows Code Page 858", // PC latin1 with Euro - "IBM00858", - "", - "CodePage858", - encoding.ASCIISub, - "http://source.icu-project.org/repos/icu/data/trunk/charset/data/ucm/windows-858-2000.ucm", - }, - { - "IBM Code Page 860", - "IBM860", - "", - "CodePage860", - encoding.ASCIISub, - "http://source.icu-project.org/repos/icu/data/trunk/charset/data/ucm/glibc-IBM860-2.1.2.ucm", - }, - { - "IBM Code Page 862", - "PC862LatinHebrew", - "", - "CodePage862", - encoding.ASCIISub, - "http://source.icu-project.org/repos/icu/data/trunk/charset/data/ucm/glibc-IBM862-2.1.2.ucm", - }, - { - "IBM Code Page 863", - "IBM863", - "", - "CodePage863", - encoding.ASCIISub, - "http://source.icu-project.org/repos/icu/data/trunk/charset/data/ucm/glibc-IBM863-2.1.2.ucm", - }, - { - "IBM Code Page 865", - "IBM865", - "", - "CodePage865", - encoding.ASCIISub, - "http://source.icu-project.org/repos/icu/data/trunk/charset/data/ucm/glibc-IBM865-2.1.2.ucm", - }, - { - "IBM Code Page 866", - "IBM866", - "", - "CodePage866", - encoding.ASCIISub, - "http://encoding.spec.whatwg.org/index-ibm866.txt", - }, - { - "IBM Code Page 1047", - "IBM1047", - "", - "CodePage1047", - 0x3f, - "http://source.icu-project.org/repos/icu/data/trunk/charset/data/ucm/glibc-IBM1047-2.1.2.ucm", - }, - { - "IBM Code Page 1140", - "IBM01140", - "", - "CodePage1140", - 0x3f, - "http://source.icu-project.org/repos/icu/data/trunk/charset/data/ucm/ibm-1140_P100-1997.ucm", - }, - { - "ISO 8859-1", - "ISOLatin1", - "", - "ISO8859_1", - encoding.ASCIISub, - "http://source.icu-project.org/repos/icu/data/trunk/charset/data/ucm/iso-8859_1-1998.ucm", - }, - { - "ISO 8859-2", - "ISOLatin2", - "", - "ISO8859_2", - encoding.ASCIISub, - "http://encoding.spec.whatwg.org/index-iso-8859-2.txt", - }, - { - "ISO 8859-3", - "ISOLatin3", - "", - "ISO8859_3", - encoding.ASCIISub, - "http://encoding.spec.whatwg.org/index-iso-8859-3.txt", - }, - { - "ISO 8859-4", - "ISOLatin4", - "", - "ISO8859_4", - encoding.ASCIISub, - "http://encoding.spec.whatwg.org/index-iso-8859-4.txt", - }, - { - "ISO 8859-5", - "ISOLatinCyrillic", - "", - "ISO8859_5", - encoding.ASCIISub, - "http://encoding.spec.whatwg.org/index-iso-8859-5.txt", - }, - { - "ISO 8859-6", - "ISOLatinArabic", - "", - "ISO8859_6,ISO8859_6E,ISO8859_6I", - encoding.ASCIISub, - "http://encoding.spec.whatwg.org/index-iso-8859-6.txt", - }, - { - "ISO 8859-7", - "ISOLatinGreek", - "", - "ISO8859_7", - encoding.ASCIISub, - "http://encoding.spec.whatwg.org/index-iso-8859-7.txt", - }, - { - "ISO 8859-8", - "ISOLatinHebrew", - "", - "ISO8859_8,ISO8859_8E,ISO8859_8I", - encoding.ASCIISub, - "http://encoding.spec.whatwg.org/index-iso-8859-8.txt", - }, - { - "ISO 8859-9", - "ISOLatin5", - "", - "ISO8859_9", - encoding.ASCIISub, - "http://source.icu-project.org/repos/icu/data/trunk/charset/data/ucm/iso-8859_9-1999.ucm", - }, - { - "ISO 8859-10", - "ISOLatin6", - "", - "ISO8859_10", - encoding.ASCIISub, - "http://encoding.spec.whatwg.org/index-iso-8859-10.txt", - }, - { - "ISO 8859-13", - "ISO885913", - "", - "ISO8859_13", - encoding.ASCIISub, - "http://encoding.spec.whatwg.org/index-iso-8859-13.txt", - }, - { - "ISO 8859-14", - "ISO885914", - "", - "ISO8859_14", - encoding.ASCIISub, - "http://encoding.spec.whatwg.org/index-iso-8859-14.txt", - }, - { - "ISO 8859-15", - "ISO885915", - "", - "ISO8859_15", - encoding.ASCIISub, - "http://encoding.spec.whatwg.org/index-iso-8859-15.txt", - }, - { - "ISO 8859-16", - "ISO885916", - "", - "ISO8859_16", - encoding.ASCIISub, - "http://encoding.spec.whatwg.org/index-iso-8859-16.txt", - }, - { - "KOI8-R", - "KOI8R", - "", - "KOI8R", - encoding.ASCIISub, - "http://encoding.spec.whatwg.org/index-koi8-r.txt", - }, - { - "KOI8-U", - "KOI8U", - "", - "KOI8U", - encoding.ASCIISub, - "http://encoding.spec.whatwg.org/index-koi8-u.txt", - }, - { - "Macintosh", - "Macintosh", - "", - "Macintosh", - encoding.ASCIISub, - "http://encoding.spec.whatwg.org/index-macintosh.txt", - }, - { - "Macintosh Cyrillic", - "MacintoshCyrillic", - "", - "MacintoshCyrillic", - encoding.ASCIISub, - "http://encoding.spec.whatwg.org/index-x-mac-cyrillic.txt", - }, - { - "Windows 874", - "Windows874", - "", - "Windows874", - encoding.ASCIISub, - "http://encoding.spec.whatwg.org/index-windows-874.txt", - }, - { - "Windows 1250", - "Windows1250", - "", - "Windows1250", - encoding.ASCIISub, - "http://encoding.spec.whatwg.org/index-windows-1250.txt", - }, - { - "Windows 1251", - "Windows1251", - "", - "Windows1251", - encoding.ASCIISub, - "http://encoding.spec.whatwg.org/index-windows-1251.txt", - }, - { - "Windows 1252", - "Windows1252", - "", - "Windows1252", - encoding.ASCIISub, - "http://encoding.spec.whatwg.org/index-windows-1252.txt", - }, - { - "Windows 1253", - "Windows1253", - "", - "Windows1253", - encoding.ASCIISub, - "http://encoding.spec.whatwg.org/index-windows-1253.txt", - }, - { - "Windows 1254", - "Windows1254", - "", - "Windows1254", - encoding.ASCIISub, - "http://encoding.spec.whatwg.org/index-windows-1254.txt", - }, - { - "Windows 1255", - "Windows1255", - "", - "Windows1255", - encoding.ASCIISub, - "http://encoding.spec.whatwg.org/index-windows-1255.txt", - }, - { - "Windows 1256", - "Windows1256", - "", - "Windows1256", - encoding.ASCIISub, - "http://encoding.spec.whatwg.org/index-windows-1256.txt", - }, - { - "Windows 1257", - "Windows1257", - "", - "Windows1257", - encoding.ASCIISub, - "http://encoding.spec.whatwg.org/index-windows-1257.txt", - }, - { - "Windows 1258", - "Windows1258", - "", - "Windows1258", - encoding.ASCIISub, - "http://encoding.spec.whatwg.org/index-windows-1258.txt", - }, - { - "X-User-Defined", - "XUserDefined", - "It is defined at http://encoding.spec.whatwg.org/#x-user-defined", - "XUserDefined", - encoding.ASCIISub, - ascii + - "\uf780\uf781\uf782\uf783\uf784\uf785\uf786\uf787" + - "\uf788\uf789\uf78a\uf78b\uf78c\uf78d\uf78e\uf78f" + - "\uf790\uf791\uf792\uf793\uf794\uf795\uf796\uf797" + - "\uf798\uf799\uf79a\uf79b\uf79c\uf79d\uf79e\uf79f" + - "\uf7a0\uf7a1\uf7a2\uf7a3\uf7a4\uf7a5\uf7a6\uf7a7" + - "\uf7a8\uf7a9\uf7aa\uf7ab\uf7ac\uf7ad\uf7ae\uf7af" + - "\uf7b0\uf7b1\uf7b2\uf7b3\uf7b4\uf7b5\uf7b6\uf7b7" + - "\uf7b8\uf7b9\uf7ba\uf7bb\uf7bc\uf7bd\uf7be\uf7bf" + - "\uf7c0\uf7c1\uf7c2\uf7c3\uf7c4\uf7c5\uf7c6\uf7c7" + - "\uf7c8\uf7c9\uf7ca\uf7cb\uf7cc\uf7cd\uf7ce\uf7cf" + - "\uf7d0\uf7d1\uf7d2\uf7d3\uf7d4\uf7d5\uf7d6\uf7d7" + - "\uf7d8\uf7d9\uf7da\uf7db\uf7dc\uf7dd\uf7de\uf7df" + - "\uf7e0\uf7e1\uf7e2\uf7e3\uf7e4\uf7e5\uf7e6\uf7e7" + - "\uf7e8\uf7e9\uf7ea\uf7eb\uf7ec\uf7ed\uf7ee\uf7ef" + - "\uf7f0\uf7f1\uf7f2\uf7f3\uf7f4\uf7f5\uf7f6\uf7f7" + - "\uf7f8\uf7f9\uf7fa\uf7fb\uf7fc\uf7fd\uf7fe\uf7ff", - }, -} - -func getWHATWG(url string) string { - res, err := http.Get(url) - if err != nil { - log.Fatalf("%q: Get: %v", url, err) - } - defer res.Body.Close() - - mapping := make([]rune, 128) - for i := range mapping { - mapping[i] = '\ufffd' - } - - scanner := bufio.NewScanner(res.Body) - for scanner.Scan() { - s := strings.TrimSpace(scanner.Text()) - if s == "" || s[0] == '#' { - continue - } - x, y := 0, 0 - if _, err := fmt.Sscanf(s, "%d\t0x%x", &x, &y); err != nil { - log.Fatalf("could not parse %q", s) - } - if x < 0 || 128 <= x { - log.Fatalf("code %d is out of range", x) - } - if 0x80 <= y && y < 0xa0 { - // We diverge from the WHATWG spec by mapping control characters - // in the range [0x80, 0xa0) to U+FFFD. - continue - } - mapping[x] = rune(y) - } - return ascii + string(mapping) -} - -func getUCM(url string) string { - res, err := http.Get(url) - if err != nil { - log.Fatalf("%q: Get: %v", url, err) - } - defer res.Body.Close() - - mapping := make([]rune, 256) - for i := range mapping { - mapping[i] = '\ufffd' - } - - charsFound := 0 - scanner := bufio.NewScanner(res.Body) - for scanner.Scan() { - s := strings.TrimSpace(scanner.Text()) - if s == "" || s[0] == '#' { - continue - } - var c byte - var r rune - if _, err := fmt.Sscanf(s, ` \x%x |0`, &r, &c); err != nil { - continue - } - mapping[c] = r - charsFound++ - } - - if charsFound < 200 { - log.Fatalf("%q: only %d characters found (wrong page format?)", url, charsFound) - } - - return string(mapping) -} - -func main() { - mibs := map[string]bool{} - all := []string{} - - w := gen.NewCodeWriter() - defer w.WriteGoFile("tables.go", "charmap") - - printf := func(s string, a ...interface{}) { fmt.Fprintf(w, s, a...) } - - printf("import (\n") - printf("\t\"golang.org/x/text/encoding\"\n") - printf("\t\"golang.org/x/text/encoding/internal/identifier\"\n") - printf(")\n\n") - for _, e := range encodings { - varNames := strings.Split(e.varName, ",") - all = append(all, varNames...) - varName := varNames[0] - switch { - case strings.HasPrefix(e.mapping, "http://encoding.spec.whatwg.org/"): - e.mapping = getWHATWG(e.mapping) - case strings.HasPrefix(e.mapping, "http://source.icu-project.org/repos/icu/data/trunk/charset/data/ucm/"): - e.mapping = getUCM(e.mapping) - } - - asciiSuperset, low := strings.HasPrefix(e.mapping, ascii), 0x00 - if asciiSuperset { - low = 0x80 - } - lvn := 1 - if strings.HasPrefix(varName, "ISO") || strings.HasPrefix(varName, "KOI") { - lvn = 3 - } - lowerVarName := strings.ToLower(varName[:lvn]) + varName[lvn:] - printf("// %s is the %s encoding.\n", varName, e.name) - if e.comment != "" { - printf("//\n// %s\n", e.comment) - } - printf("var %s *Charmap = &%s\n\nvar %s = Charmap{\nname: %q,\n", - varName, lowerVarName, lowerVarName, e.name) - if mibs[e.mib] { - log.Fatalf("MIB type %q declared multiple times.", e.mib) - } - printf("mib: identifier.%s,\n", e.mib) - printf("asciiSuperset: %t,\n", asciiSuperset) - printf("low: 0x%02x,\n", low) - printf("replacement: 0x%02x,\n", e.replacement) - - printf("decode: [256]utf8Enc{\n") - i, backMapping := 0, map[rune]byte{} - for _, c := range e.mapping { - if _, ok := backMapping[c]; !ok && c != utf8.RuneError { - backMapping[c] = byte(i) - } - var buf [8]byte - n := utf8.EncodeRune(buf[:], c) - if n > 3 { - panic(fmt.Sprintf("rune %q (%U) is too long", c, c)) - } - printf("{%d,[3]byte{0x%02x,0x%02x,0x%02x}},", n, buf[0], buf[1], buf[2]) - if i%2 == 1 { - printf("\n") - } - i++ - } - printf("},\n") - - printf("encode: [256]uint32{\n") - encode := make([]uint32, 0, 256) - for c, i := range backMapping { - encode = append(encode, uint32(i)<<24|uint32(c)) - } - sort.Sort(byRune(encode)) - for len(encode) < cap(encode) { - encode = append(encode, encode[len(encode)-1]) - } - for i, enc := range encode { - printf("0x%08x,", enc) - if i%8 == 7 { - printf("\n") - } - } - printf("},\n}\n") - - // Add an estimate of the size of a single Charmap{} struct value, which - // includes two 256 elem arrays of 4 bytes and some extra fields, which - // align to 3 uint64s on 64-bit architectures. - w.Size += 2*4*256 + 3*8 - } - // TODO: add proper line breaking. - printf("var listAll = []encoding.Encoding{\n%s,\n}\n\n", strings.Join(all, ",\n")) -} - -type byRune []uint32 - -func (b byRune) Len() int { return len(b) } -func (b byRune) Less(i, j int) bool { return b[i]&0xffffff < b[j]&0xffffff } -func (b byRune) Swap(i, j int) { b[i], b[j] = b[j], b[i] } diff --git a/vendor/golang.org/x/text/encoding/htmlindex/gen.go b/vendor/golang.org/x/text/encoding/htmlindex/gen.go deleted file mode 100644 index ac6b4a77..00000000 --- a/vendor/golang.org/x/text/encoding/htmlindex/gen.go +++ /dev/null @@ -1,173 +0,0 @@ -// Copyright 2015 The Go Authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the LICENSE file. - -// +build ignore - -package main - -import ( - "bytes" - "encoding/json" - "fmt" - "log" - "strings" - - "golang.org/x/text/internal/gen" -) - -type group struct { - Encodings []struct { - Labels []string - Name string - } -} - -func main() { - gen.Init() - - r := gen.Open("https://encoding.spec.whatwg.org", "whatwg", "encodings.json") - var groups []group - if err := json.NewDecoder(r).Decode(&groups); err != nil { - log.Fatalf("Error reading encodings.json: %v", err) - } - - w := &bytes.Buffer{} - fmt.Fprintln(w, "type htmlEncoding byte") - fmt.Fprintln(w, "const (") - for i, g := range groups { - for _, e := range g.Encodings { - key := strings.ToLower(e.Name) - name := consts[key] - if name == "" { - log.Fatalf("No const defined for %s.", key) - } - if i == 0 { - fmt.Fprintf(w, "%s htmlEncoding = iota\n", name) - } else { - fmt.Fprintf(w, "%s\n", name) - } - } - } - fmt.Fprintln(w, "numEncodings") - fmt.Fprint(w, ")\n\n") - - fmt.Fprintln(w, "var canonical = [numEncodings]string{") - for _, g := range groups { - for _, e := range g.Encodings { - fmt.Fprintf(w, "%q,\n", strings.ToLower(e.Name)) - } - } - fmt.Fprint(w, "}\n\n") - - fmt.Fprintln(w, "var nameMap = map[string]htmlEncoding{") - for _, g := range groups { - for _, e := range g.Encodings { - for _, l := range e.Labels { - key := strings.ToLower(e.Name) - name := consts[key] - fmt.Fprintf(w, "%q: %s,\n", l, name) - } - } - } - fmt.Fprint(w, "}\n\n") - - var tags []string - fmt.Fprintln(w, "var localeMap = []htmlEncoding{") - for _, loc := range locales { - tags = append(tags, loc.tag) - fmt.Fprintf(w, "%s, // %s \n", consts[loc.name], loc.tag) - } - fmt.Fprint(w, "}\n\n") - - fmt.Fprintf(w, "const locales = %q\n", strings.Join(tags, " ")) - - gen.WriteGoFile("tables.go", "htmlindex", w.Bytes()) -} - -// consts maps canonical encoding name to internal constant. -var consts = map[string]string{ - "utf-8": "utf8", - "ibm866": "ibm866", - "iso-8859-2": "iso8859_2", - "iso-8859-3": "iso8859_3", - "iso-8859-4": "iso8859_4", - "iso-8859-5": "iso8859_5", - "iso-8859-6": "iso8859_6", - "iso-8859-7": "iso8859_7", - "iso-8859-8": "iso8859_8", - "iso-8859-8-i": "iso8859_8I", - "iso-8859-10": "iso8859_10", - "iso-8859-13": "iso8859_13", - "iso-8859-14": "iso8859_14", - "iso-8859-15": "iso8859_15", - "iso-8859-16": "iso8859_16", - "koi8-r": "koi8r", - "koi8-u": "koi8u", - "macintosh": "macintosh", - "windows-874": "windows874", - "windows-1250": "windows1250", - "windows-1251": "windows1251", - "windows-1252": "windows1252", - "windows-1253": "windows1253", - "windows-1254": "windows1254", - "windows-1255": "windows1255", - "windows-1256": "windows1256", - "windows-1257": "windows1257", - "windows-1258": "windows1258", - "x-mac-cyrillic": "macintoshCyrillic", - "gbk": "gbk", - "gb18030": "gb18030", - // "hz-gb-2312": "hzgb2312", // Was removed from WhatWG - "big5": "big5", - "euc-jp": "eucjp", - "iso-2022-jp": "iso2022jp", - "shift_jis": "shiftJIS", - "euc-kr": "euckr", - "replacement": "replacement", - "utf-16be": "utf16be", - "utf-16le": "utf16le", - "x-user-defined": "xUserDefined", -} - -// locales is taken from -// https://html.spec.whatwg.org/multipage/syntax.html#encoding-sniffing-algorithm. -var locales = []struct{ tag, name string }{ - // The default value. Explicitly state latin to benefit from the exact - // script option, while still making 1252 the default encoding for languages - // written in Latin script. - {"und_Latn", "windows-1252"}, - {"ar", "windows-1256"}, - {"ba", "windows-1251"}, - {"be", "windows-1251"}, - {"bg", "windows-1251"}, - {"cs", "windows-1250"}, - {"el", "iso-8859-7"}, - {"et", "windows-1257"}, - {"fa", "windows-1256"}, - {"he", "windows-1255"}, - {"hr", "windows-1250"}, - {"hu", "iso-8859-2"}, - {"ja", "shift_jis"}, - {"kk", "windows-1251"}, - {"ko", "euc-kr"}, - {"ku", "windows-1254"}, - {"ky", "windows-1251"}, - {"lt", "windows-1257"}, - {"lv", "windows-1257"}, - {"mk", "windows-1251"}, - {"pl", "iso-8859-2"}, - {"ru", "windows-1251"}, - {"sah", "windows-1251"}, - {"sk", "windows-1250"}, - {"sl", "iso-8859-2"}, - {"sr", "windows-1251"}, - {"tg", "windows-1251"}, - {"th", "windows-874"}, - {"tr", "windows-1254"}, - {"tt", "windows-1251"}, - {"uk", "windows-1251"}, - {"vi", "windows-1258"}, - {"zh-hans", "gb18030"}, - {"zh-hant", "big5"}, -} diff --git a/vendor/golang.org/x/text/encoding/internal/identifier/gen.go b/vendor/golang.org/x/text/encoding/internal/identifier/gen.go deleted file mode 100644 index 26cfef9c..00000000 --- a/vendor/golang.org/x/text/encoding/internal/identifier/gen.go +++ /dev/null @@ -1,142 +0,0 @@ -// Copyright 2015 The Go Authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the LICENSE file. - -// +build ignore - -package main - -import ( - "bytes" - "encoding/xml" - "fmt" - "io" - "log" - "strings" - - "golang.org/x/text/internal/gen" -) - -type registry struct { - XMLName xml.Name `xml:"registry"` - Updated string `xml:"updated"` - Registry []struct { - ID string `xml:"id,attr"` - Record []struct { - Name string `xml:"name"` - Xref []struct { - Type string `xml:"type,attr"` - Data string `xml:"data,attr"` - } `xml:"xref"` - Desc struct { - Data string `xml:",innerxml"` - // Any []struct { - // Data string `xml:",chardata"` - // } `xml:",any"` - // Data string `xml:",chardata"` - } `xml:"description,"` - MIB string `xml:"value"` - Alias []string `xml:"alias"` - MIME string `xml:"preferred_alias"` - } `xml:"record"` - } `xml:"registry"` -} - -func main() { - r := gen.OpenIANAFile("assignments/character-sets/character-sets.xml") - reg := ®istry{} - if err := xml.NewDecoder(r).Decode(®); err != nil && err != io.EOF { - log.Fatalf("Error decoding charset registry: %v", err) - } - if len(reg.Registry) == 0 || reg.Registry[0].ID != "character-sets-1" { - log.Fatalf("Unexpected ID %s", reg.Registry[0].ID) - } - - w := &bytes.Buffer{} - fmt.Fprintf(w, "const (\n") - for _, rec := range reg.Registry[0].Record { - constName := "" - for _, a := range rec.Alias { - if strings.HasPrefix(a, "cs") && strings.IndexByte(a, '-') == -1 { - // Some of the constant definitions have comments in them. Strip those. - constName = strings.Title(strings.SplitN(a[2:], "\n", 2)[0]) - } - } - if constName == "" { - switch rec.MIB { - case "2085": - constName = "HZGB2312" // Not listed as alias for some reason. - default: - log.Fatalf("No cs alias defined for %s.", rec.MIB) - } - } - if rec.MIME != "" { - rec.MIME = fmt.Sprintf(" (MIME: %s)", rec.MIME) - } - fmt.Fprintf(w, "// %s is the MIB identifier with IANA name %s%s.\n//\n", constName, rec.Name, rec.MIME) - if len(rec.Desc.Data) > 0 { - fmt.Fprint(w, "// ") - d := xml.NewDecoder(strings.NewReader(rec.Desc.Data)) - inElem := true - attr := "" - for { - t, err := d.Token() - if err != nil { - if err != io.EOF { - log.Fatal(err) - } - break - } - switch x := t.(type) { - case xml.CharData: - attr = "" // Don't need attribute info. - a := bytes.Split([]byte(x), []byte("\n")) - for i, b := range a { - if b = bytes.TrimSpace(b); len(b) != 0 { - if !inElem && i > 0 { - fmt.Fprint(w, "\n// ") - } - inElem = false - fmt.Fprintf(w, "%s ", string(b)) - } - } - case xml.StartElement: - if x.Name.Local == "xref" { - inElem = true - use := false - for _, a := range x.Attr { - if a.Name.Local == "type" { - use = use || a.Value != "person" - } - if a.Name.Local == "data" && use { - // Patch up URLs to use https. From some links, the - // https version is different from the http one. - s := a.Value - s = strings.Replace(s, "http://", "https://", -1) - s = strings.Replace(s, "/unicode/", "/", -1) - attr = s + " " - } - } - } - case xml.EndElement: - inElem = false - fmt.Fprint(w, attr) - } - } - fmt.Fprint(w, "\n") - } - for _, x := range rec.Xref { - switch x.Type { - case "rfc": - fmt.Fprintf(w, "// Reference: %s\n", strings.ToUpper(x.Data)) - case "uri": - fmt.Fprintf(w, "// Reference: %s\n", x.Data) - } - } - fmt.Fprintf(w, "%s MIB = %s\n", constName, rec.MIB) - fmt.Fprintln(w) - } - fmt.Fprintln(w, ")") - - gen.WriteGoFile("mib.go", "identifier", w.Bytes()) -} diff --git a/vendor/golang.org/x/text/encoding/japanese/maketables.go b/vendor/golang.org/x/text/encoding/japanese/maketables.go deleted file mode 100644 index 023957a6..00000000 --- a/vendor/golang.org/x/text/encoding/japanese/maketables.go +++ /dev/null @@ -1,161 +0,0 @@ -// Copyright 2013 The Go Authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the LICENSE file. - -// +build ignore - -package main - -// This program generates tables.go: -// go run maketables.go | gofmt > tables.go - -// TODO: Emoji extensions? -// https://www.unicode.org/faq/emoji_dingbats.html -// https://www.unicode.org/Public/UNIDATA/EmojiSources.txt - -import ( - "bufio" - "fmt" - "log" - "net/http" - "sort" - "strings" -) - -type entry struct { - jisCode, table int -} - -func main() { - fmt.Printf("// generated by go run maketables.go; DO NOT EDIT\n\n") - fmt.Printf("// Package japanese provides Japanese encodings such as EUC-JP and Shift JIS.\n") - fmt.Printf(`package japanese // import "golang.org/x/text/encoding/japanese"` + "\n\n") - - reverse := [65536]entry{} - for i := range reverse { - reverse[i].table = -1 - } - - tables := []struct { - url string - name string - }{ - {"http://encoding.spec.whatwg.org/index-jis0208.txt", "0208"}, - {"http://encoding.spec.whatwg.org/index-jis0212.txt", "0212"}, - } - for i, table := range tables { - res, err := http.Get(table.url) - if err != nil { - log.Fatalf("%q: Get: %v", table.url, err) - } - defer res.Body.Close() - - mapping := [65536]uint16{} - - scanner := bufio.NewScanner(res.Body) - for scanner.Scan() { - s := strings.TrimSpace(scanner.Text()) - if s == "" || s[0] == '#' { - continue - } - x, y := 0, uint16(0) - if _, err := fmt.Sscanf(s, "%d 0x%x", &x, &y); err != nil { - log.Fatalf("%q: could not parse %q", table.url, s) - } - if x < 0 || 120*94 <= x { - log.Fatalf("%q: JIS code %d is out of range", table.url, x) - } - mapping[x] = y - if reverse[y].table == -1 { - reverse[y] = entry{jisCode: x, table: i} - } - } - if err := scanner.Err(); err != nil { - log.Fatalf("%q: scanner error: %v", table.url, err) - } - - fmt.Printf("// jis%sDecode is the decoding table from JIS %s code to Unicode.\n// It is defined at %s\n", - table.name, table.name, table.url) - fmt.Printf("var jis%sDecode = [...]uint16{\n", table.name) - for i, m := range mapping { - if m != 0 { - fmt.Printf("\t%d: 0x%04X,\n", i, m) - } - } - fmt.Printf("}\n\n") - } - - // Any run of at least separation continuous zero entries in the reverse map will - // be a separate encode table. - const separation = 1024 - - intervals := []interval(nil) - low, high := -1, -1 - for i, v := range reverse { - if v.table == -1 { - continue - } - if low < 0 { - low = i - } else if i-high >= separation { - if high >= 0 { - intervals = append(intervals, interval{low, high}) - } - low = i - } - high = i + 1 - } - if high >= 0 { - intervals = append(intervals, interval{low, high}) - } - sort.Sort(byDecreasingLength(intervals)) - - fmt.Printf("const (\n") - fmt.Printf("\tjis0208 = 1\n") - fmt.Printf("\tjis0212 = 2\n") - fmt.Printf("\tcodeMask = 0x7f\n") - fmt.Printf("\tcodeShift = 7\n") - fmt.Printf("\ttableShift = 14\n") - fmt.Printf(")\n\n") - - fmt.Printf("const numEncodeTables = %d\n\n", len(intervals)) - fmt.Printf("// encodeX are the encoding tables from Unicode to JIS code,\n") - fmt.Printf("// sorted by decreasing length.\n") - for i, v := range intervals { - fmt.Printf("// encode%d: %5d entries for runes in [%5d, %5d).\n", i, v.len(), v.low, v.high) - } - fmt.Printf("//\n") - fmt.Printf("// The high two bits of the value record whether the JIS code comes from the\n") - fmt.Printf("// JIS0208 table (high bits == 1) or the JIS0212 table (high bits == 2).\n") - fmt.Printf("// The low 14 bits are two 7-bit unsigned integers j1 and j2 that form the\n") - fmt.Printf("// JIS code (94*j1 + j2) within that table.\n") - fmt.Printf("\n") - - for i, v := range intervals { - fmt.Printf("const encode%dLow, encode%dHigh = %d, %d\n\n", i, i, v.low, v.high) - fmt.Printf("var encode%d = [...]uint16{\n", i) - for j := v.low; j < v.high; j++ { - x := reverse[j] - if x.table == -1 { - continue - } - fmt.Printf("\t%d - %d: jis%s<<14 | 0x%02X<<7 | 0x%02X,\n", - j, v.low, tables[x.table].name, x.jisCode/94, x.jisCode%94) - } - fmt.Printf("}\n\n") - } -} - -// interval is a half-open interval [low, high). -type interval struct { - low, high int -} - -func (i interval) len() int { return i.high - i.low } - -// byDecreasingLength sorts intervals by decreasing length. -type byDecreasingLength []interval - -func (b byDecreasingLength) Len() int { return len(b) } -func (b byDecreasingLength) Less(i, j int) bool { return b[i].len() > b[j].len() } -func (b byDecreasingLength) Swap(i, j int) { b[i], b[j] = b[j], b[i] } diff --git a/vendor/golang.org/x/text/encoding/korean/maketables.go b/vendor/golang.org/x/text/encoding/korean/maketables.go deleted file mode 100644 index c84034fb..00000000 --- a/vendor/golang.org/x/text/encoding/korean/maketables.go +++ /dev/null @@ -1,143 +0,0 @@ -// Copyright 2013 The Go Authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the LICENSE file. - -// +build ignore - -package main - -// This program generates tables.go: -// go run maketables.go | gofmt > tables.go - -import ( - "bufio" - "fmt" - "log" - "net/http" - "sort" - "strings" -) - -func main() { - fmt.Printf("// generated by go run maketables.go; DO NOT EDIT\n\n") - fmt.Printf("// Package korean provides Korean encodings such as EUC-KR.\n") - fmt.Printf(`package korean // import "golang.org/x/text/encoding/korean"` + "\n\n") - - res, err := http.Get("http://encoding.spec.whatwg.org/index-euc-kr.txt") - if err != nil { - log.Fatalf("Get: %v", err) - } - defer res.Body.Close() - - mapping := [65536]uint16{} - reverse := [65536]uint16{} - - scanner := bufio.NewScanner(res.Body) - for scanner.Scan() { - s := strings.TrimSpace(scanner.Text()) - if s == "" || s[0] == '#' { - continue - } - x, y := uint16(0), uint16(0) - if _, err := fmt.Sscanf(s, "%d 0x%x", &x, &y); err != nil { - log.Fatalf("could not parse %q", s) - } - if x < 0 || 178*(0xc7-0x81)+(0xfe-0xc7)*94+(0xff-0xa1) <= x { - log.Fatalf("EUC-KR code %d is out of range", x) - } - mapping[x] = y - if reverse[y] == 0 { - c0, c1 := uint16(0), uint16(0) - if x < 178*(0xc7-0x81) { - c0 = uint16(x/178) + 0x81 - c1 = uint16(x % 178) - switch { - case c1 < 1*26: - c1 += 0x41 - case c1 < 2*26: - c1 += 0x47 - default: - c1 += 0x4d - } - } else { - x -= 178 * (0xc7 - 0x81) - c0 = uint16(x/94) + 0xc7 - c1 = uint16(x%94) + 0xa1 - } - reverse[y] = c0<<8 | c1 - } - } - if err := scanner.Err(); err != nil { - log.Fatalf("scanner error: %v", err) - } - - fmt.Printf("// decode is the decoding table from EUC-KR code to Unicode.\n") - fmt.Printf("// It is defined at http://encoding.spec.whatwg.org/index-euc-kr.txt\n") - fmt.Printf("var decode = [...]uint16{\n") - for i, v := range mapping { - if v != 0 { - fmt.Printf("\t%d: 0x%04X,\n", i, v) - } - } - fmt.Printf("}\n\n") - - // Any run of at least separation continuous zero entries in the reverse map will - // be a separate encode table. - const separation = 1024 - - intervals := []interval(nil) - low, high := -1, -1 - for i, v := range reverse { - if v == 0 { - continue - } - if low < 0 { - low = i - } else if i-high >= separation { - if high >= 0 { - intervals = append(intervals, interval{low, high}) - } - low = i - } - high = i + 1 - } - if high >= 0 { - intervals = append(intervals, interval{low, high}) - } - sort.Sort(byDecreasingLength(intervals)) - - fmt.Printf("const numEncodeTables = %d\n\n", len(intervals)) - fmt.Printf("// encodeX are the encoding tables from Unicode to EUC-KR code,\n") - fmt.Printf("// sorted by decreasing length.\n") - for i, v := range intervals { - fmt.Printf("// encode%d: %5d entries for runes in [%5d, %5d).\n", i, v.len(), v.low, v.high) - } - fmt.Printf("\n") - - for i, v := range intervals { - fmt.Printf("const encode%dLow, encode%dHigh = %d, %d\n\n", i, i, v.low, v.high) - fmt.Printf("var encode%d = [...]uint16{\n", i) - for j := v.low; j < v.high; j++ { - x := reverse[j] - if x == 0 { - continue - } - fmt.Printf("\t%d-%d: 0x%04X,\n", j, v.low, x) - } - fmt.Printf("}\n\n") - } -} - -// interval is a half-open interval [low, high). -type interval struct { - low, high int -} - -func (i interval) len() int { return i.high - i.low } - -// byDecreasingLength sorts intervals by decreasing length. -type byDecreasingLength []interval - -func (b byDecreasingLength) Len() int { return len(b) } -func (b byDecreasingLength) Less(i, j int) bool { return b[i].len() > b[j].len() } -func (b byDecreasingLength) Swap(i, j int) { b[i], b[j] = b[j], b[i] } diff --git a/vendor/golang.org/x/text/encoding/simplifiedchinese/maketables.go b/vendor/golang.org/x/text/encoding/simplifiedchinese/maketables.go deleted file mode 100644 index 55016c78..00000000 --- a/vendor/golang.org/x/text/encoding/simplifiedchinese/maketables.go +++ /dev/null @@ -1,161 +0,0 @@ -// Copyright 2013 The Go Authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the LICENSE file. - -// +build ignore - -package main - -// This program generates tables.go: -// go run maketables.go | gofmt > tables.go - -import ( - "bufio" - "fmt" - "log" - "net/http" - "sort" - "strings" -) - -func main() { - fmt.Printf("// generated by go run maketables.go; DO NOT EDIT\n\n") - fmt.Printf("// Package simplifiedchinese provides Simplified Chinese encodings such as GBK.\n") - fmt.Printf(`package simplifiedchinese // import "golang.org/x/text/encoding/simplifiedchinese"` + "\n\n") - - printGB18030() - printGBK() -} - -func printGB18030() { - res, err := http.Get("http://encoding.spec.whatwg.org/index-gb18030.txt") - if err != nil { - log.Fatalf("Get: %v", err) - } - defer res.Body.Close() - - fmt.Printf("// gb18030 is the table from http://encoding.spec.whatwg.org/index-gb18030.txt\n") - fmt.Printf("var gb18030 = [...][2]uint16{\n") - scanner := bufio.NewScanner(res.Body) - for scanner.Scan() { - s := strings.TrimSpace(scanner.Text()) - if s == "" || s[0] == '#' { - continue - } - x, y := uint32(0), uint32(0) - if _, err := fmt.Sscanf(s, "%d 0x%x", &x, &y); err != nil { - log.Fatalf("could not parse %q", s) - } - if x < 0x10000 && y < 0x10000 { - fmt.Printf("\t{0x%04x, 0x%04x},\n", x, y) - } - } - fmt.Printf("}\n\n") -} - -func printGBK() { - res, err := http.Get("http://encoding.spec.whatwg.org/index-gbk.txt") - if err != nil { - log.Fatalf("Get: %v", err) - } - defer res.Body.Close() - - mapping := [65536]uint16{} - reverse := [65536]uint16{} - - scanner := bufio.NewScanner(res.Body) - for scanner.Scan() { - s := strings.TrimSpace(scanner.Text()) - if s == "" || s[0] == '#' { - continue - } - x, y := uint16(0), uint16(0) - if _, err := fmt.Sscanf(s, "%d 0x%x", &x, &y); err != nil { - log.Fatalf("could not parse %q", s) - } - if x < 0 || 126*190 <= x { - log.Fatalf("GBK code %d is out of range", x) - } - mapping[x] = y - if reverse[y] == 0 { - c0, c1 := x/190, x%190 - if c1 >= 0x3f { - c1++ - } - reverse[y] = (0x81+c0)<<8 | (0x40 + c1) - } - } - if err := scanner.Err(); err != nil { - log.Fatalf("scanner error: %v", err) - } - - fmt.Printf("// decode is the decoding table from GBK code to Unicode.\n") - fmt.Printf("// It is defined at http://encoding.spec.whatwg.org/index-gbk.txt\n") - fmt.Printf("var decode = [...]uint16{\n") - for i, v := range mapping { - if v != 0 { - fmt.Printf("\t%d: 0x%04X,\n", i, v) - } - } - fmt.Printf("}\n\n") - - // Any run of at least separation continuous zero entries in the reverse map will - // be a separate encode table. - const separation = 1024 - - intervals := []interval(nil) - low, high := -1, -1 - for i, v := range reverse { - if v == 0 { - continue - } - if low < 0 { - low = i - } else if i-high >= separation { - if high >= 0 { - intervals = append(intervals, interval{low, high}) - } - low = i - } - high = i + 1 - } - if high >= 0 { - intervals = append(intervals, interval{low, high}) - } - sort.Sort(byDecreasingLength(intervals)) - - fmt.Printf("const numEncodeTables = %d\n\n", len(intervals)) - fmt.Printf("// encodeX are the encoding tables from Unicode to GBK code,\n") - fmt.Printf("// sorted by decreasing length.\n") - for i, v := range intervals { - fmt.Printf("// encode%d: %5d entries for runes in [%5d, %5d).\n", i, v.len(), v.low, v.high) - } - fmt.Printf("\n") - - for i, v := range intervals { - fmt.Printf("const encode%dLow, encode%dHigh = %d, %d\n\n", i, i, v.low, v.high) - fmt.Printf("var encode%d = [...]uint16{\n", i) - for j := v.low; j < v.high; j++ { - x := reverse[j] - if x == 0 { - continue - } - fmt.Printf("\t%d-%d: 0x%04X,\n", j, v.low, x) - } - fmt.Printf("}\n\n") - } -} - -// interval is a half-open interval [low, high). -type interval struct { - low, high int -} - -func (i interval) len() int { return i.high - i.low } - -// byDecreasingLength sorts intervals by decreasing length. -type byDecreasingLength []interval - -func (b byDecreasingLength) Len() int { return len(b) } -func (b byDecreasingLength) Less(i, j int) bool { return b[i].len() > b[j].len() } -func (b byDecreasingLength) Swap(i, j int) { b[i], b[j] = b[j], b[i] } diff --git a/vendor/golang.org/x/text/encoding/traditionalchinese/maketables.go b/vendor/golang.org/x/text/encoding/traditionalchinese/maketables.go deleted file mode 100644 index cf7fdb31..00000000 --- a/vendor/golang.org/x/text/encoding/traditionalchinese/maketables.go +++ /dev/null @@ -1,140 +0,0 @@ -// Copyright 2013 The Go Authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the LICENSE file. - -// +build ignore - -package main - -// This program generates tables.go: -// go run maketables.go | gofmt > tables.go - -import ( - "bufio" - "fmt" - "log" - "net/http" - "sort" - "strings" -) - -func main() { - fmt.Printf("// generated by go run maketables.go; DO NOT EDIT\n\n") - fmt.Printf("// Package traditionalchinese provides Traditional Chinese encodings such as Big5.\n") - fmt.Printf(`package traditionalchinese // import "golang.org/x/text/encoding/traditionalchinese"` + "\n\n") - - res, err := http.Get("http://encoding.spec.whatwg.org/index-big5.txt") - if err != nil { - log.Fatalf("Get: %v", err) - } - defer res.Body.Close() - - mapping := [65536]uint32{} - reverse := [65536 * 4]uint16{} - - scanner := bufio.NewScanner(res.Body) - for scanner.Scan() { - s := strings.TrimSpace(scanner.Text()) - if s == "" || s[0] == '#' { - continue - } - x, y := uint16(0), uint32(0) - if _, err := fmt.Sscanf(s, "%d 0x%x", &x, &y); err != nil { - log.Fatalf("could not parse %q", s) - } - if x < 0 || 126*157 <= x { - log.Fatalf("Big5 code %d is out of range", x) - } - mapping[x] = y - - // The WHATWG spec http://encoding.spec.whatwg.org/#indexes says that - // "The index pointer for code point in index is the first pointer - // corresponding to code point in index", which would normally mean - // that the code below should be guarded by "if reverse[y] == 0", but - // last instead of first seems to match the behavior of - // "iconv -f UTF-8 -t BIG5". For example, U+8005 者 occurs twice in - // http://encoding.spec.whatwg.org/index-big5.txt, as index 2148 - // (encoded as "\x8e\xcd") and index 6543 (encoded as "\xaa\xcc") - // and "echo 者 | iconv -f UTF-8 -t BIG5 | xxd" gives "\xaa\xcc". - c0, c1 := x/157, x%157 - if c1 < 0x3f { - c1 += 0x40 - } else { - c1 += 0x62 - } - reverse[y] = (0x81+c0)<<8 | c1 - } - if err := scanner.Err(); err != nil { - log.Fatalf("scanner error: %v", err) - } - - fmt.Printf("// decode is the decoding table from Big5 code to Unicode.\n") - fmt.Printf("// It is defined at http://encoding.spec.whatwg.org/index-big5.txt\n") - fmt.Printf("var decode = [...]uint32{\n") - for i, v := range mapping { - if v != 0 { - fmt.Printf("\t%d: 0x%08X,\n", i, v) - } - } - fmt.Printf("}\n\n") - - // Any run of at least separation continuous zero entries in the reverse map will - // be a separate encode table. - const separation = 1024 - - intervals := []interval(nil) - low, high := -1, -1 - for i, v := range reverse { - if v == 0 { - continue - } - if low < 0 { - low = i - } else if i-high >= separation { - if high >= 0 { - intervals = append(intervals, interval{low, high}) - } - low = i - } - high = i + 1 - } - if high >= 0 { - intervals = append(intervals, interval{low, high}) - } - sort.Sort(byDecreasingLength(intervals)) - - fmt.Printf("const numEncodeTables = %d\n\n", len(intervals)) - fmt.Printf("// encodeX are the encoding tables from Unicode to Big5 code,\n") - fmt.Printf("// sorted by decreasing length.\n") - for i, v := range intervals { - fmt.Printf("// encode%d: %5d entries for runes in [%6d, %6d).\n", i, v.len(), v.low, v.high) - } - fmt.Printf("\n") - - for i, v := range intervals { - fmt.Printf("const encode%dLow, encode%dHigh = %d, %d\n\n", i, i, v.low, v.high) - fmt.Printf("var encode%d = [...]uint16{\n", i) - for j := v.low; j < v.high; j++ { - x := reverse[j] - if x == 0 { - continue - } - fmt.Printf("\t%d-%d: 0x%04X,\n", j, v.low, x) - } - fmt.Printf("}\n\n") - } -} - -// interval is a half-open interval [low, high). -type interval struct { - low, high int -} - -func (i interval) len() int { return i.high - i.low } - -// byDecreasingLength sorts intervals by decreasing length. -type byDecreasingLength []interval - -func (b byDecreasingLength) Len() int { return len(b) } -func (b byDecreasingLength) Less(i, j int) bool { return b[i].len() > b[j].len() } -func (b byDecreasingLength) Swap(i, j int) { b[i], b[j] = b[j], b[i] } diff --git a/vendor/golang.org/x/text/internal/language/compact/gen.go b/vendor/golang.org/x/text/internal/language/compact/gen.go deleted file mode 100644 index 0c36a052..00000000 --- a/vendor/golang.org/x/text/internal/language/compact/gen.go +++ /dev/null @@ -1,64 +0,0 @@ -// Copyright 2013 The Go Authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the LICENSE file. - -// +build ignore - -// Language tag table generator. -// Data read from the web. - -package main - -import ( - "flag" - "fmt" - "log" - - "golang.org/x/text/internal/gen" - "golang.org/x/text/unicode/cldr" -) - -var ( - test = flag.Bool("test", - false, - "test existing tables; can be used to compare web data with package data.") - outputFile = flag.String("output", - "tables.go", - "output file for generated tables") -) - -func main() { - gen.Init() - - w := gen.NewCodeWriter() - defer w.WriteGoFile("tables.go", "compact") - - fmt.Fprintln(w, `import "golang.org/x/text/internal/language"`) - - b := newBuilder(w) - gen.WriteCLDRVersion(w) - - b.writeCompactIndex() -} - -type builder struct { - w *gen.CodeWriter - data *cldr.CLDR - supp *cldr.SupplementalData -} - -func newBuilder(w *gen.CodeWriter) *builder { - r := gen.OpenCLDRCoreZip() - defer r.Close() - d := &cldr.Decoder{} - data, err := d.DecodeZip(r) - if err != nil { - log.Fatal(err) - } - b := builder{ - w: w, - data: data, - supp: data.Supplemental(), - } - return &b -} diff --git a/vendor/golang.org/x/text/internal/language/compact/gen_index.go b/vendor/golang.org/x/text/internal/language/compact/gen_index.go deleted file mode 100644 index 136cefaf..00000000 --- a/vendor/golang.org/x/text/internal/language/compact/gen_index.go +++ /dev/null @@ -1,113 +0,0 @@ -// Copyright 2015 The Go Authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the LICENSE file. - -// +build ignore - -package main - -// This file generates derivative tables based on the language package itself. - -import ( - "fmt" - "log" - "sort" - "strings" - - "golang.org/x/text/internal/language" -) - -// Compact indices: -// Note -va-X variants only apply to localization variants. -// BCP variants only ever apply to language. -// The only ambiguity between tags is with regions. - -func (b *builder) writeCompactIndex() { - // Collect all language tags for which we have any data in CLDR. - m := map[language.Tag]bool{} - for _, lang := range b.data.Locales() { - // We include all locales unconditionally to be consistent with en_US. - // We want en_US, even though it has no data associated with it. - - // TODO: put any of the languages for which no data exists at the end - // of the index. This allows all components based on ICU to use that - // as the cutoff point. - // if x := data.RawLDML(lang); false || - // x.LocaleDisplayNames != nil || - // x.Characters != nil || - // x.Delimiters != nil || - // x.Measurement != nil || - // x.Dates != nil || - // x.Numbers != nil || - // x.Units != nil || - // x.ListPatterns != nil || - // x.Collations != nil || - // x.Segmentations != nil || - // x.Rbnf != nil || - // x.Annotations != nil || - // x.Metadata != nil { - - // TODO: support POSIX natively, albeit non-standard. - tag := language.Make(strings.Replace(lang, "_POSIX", "-u-va-posix", 1)) - m[tag] = true - // } - } - - // TODO: plural rules are also defined for the deprecated tags: - // iw mo sh tl - // Consider removing these as compact tags. - - // Include locales for plural rules, which uses a different structure. - for _, plurals := range b.supp.Plurals { - for _, rules := range plurals.PluralRules { - for _, lang := range strings.Split(rules.Locales, " ") { - m[language.Make(lang)] = true - } - } - } - - var coreTags []language.CompactCoreInfo - var special []string - - for t := range m { - if x := t.Extensions(); len(x) != 0 && fmt.Sprint(x) != "[u-va-posix]" { - log.Fatalf("Unexpected extension %v in %v", x, t) - } - if len(t.Variants()) == 0 && len(t.Extensions()) == 0 { - cci, ok := language.GetCompactCore(t) - if !ok { - log.Fatalf("Locale for non-basic language %q", t) - } - coreTags = append(coreTags, cci) - } else { - special = append(special, t.String()) - } - } - - w := b.w - - sort.Slice(coreTags, func(i, j int) bool { return coreTags[i] < coreTags[j] }) - sort.Strings(special) - - w.WriteComment(` - NumCompactTags is the number of common tags. The maximum tag is - NumCompactTags-1.`) - w.WriteConst("NumCompactTags", len(m)) - - fmt.Fprintln(w, "const (") - for i, t := range coreTags { - fmt.Fprintf(w, "%s ID = %d\n", ident(t.Tag().String()), i) - } - for i, t := range special { - fmt.Fprintf(w, "%s ID = %d\n", ident(t), i+len(coreTags)) - } - fmt.Fprintln(w, ")") - - w.WriteVar("coreTags", coreTags) - - w.WriteConst("specialTagsStr", strings.Join(special, " ")) -} - -func ident(s string) string { - return strings.Replace(s, "-", "", -1) + "Index" -} diff --git a/vendor/golang.org/x/text/internal/language/compact/gen_parents.go b/vendor/golang.org/x/text/internal/language/compact/gen_parents.go deleted file mode 100644 index 9543d583..00000000 --- a/vendor/golang.org/x/text/internal/language/compact/gen_parents.go +++ /dev/null @@ -1,54 +0,0 @@ -// Copyright 2018 The Go Authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the LICENSE file. - -// +build ignore - -package main - -import ( - "log" - - "golang.org/x/text/internal/gen" - "golang.org/x/text/internal/language" - "golang.org/x/text/internal/language/compact" - "golang.org/x/text/unicode/cldr" -) - -func main() { - r := gen.OpenCLDRCoreZip() - defer r.Close() - - d := &cldr.Decoder{} - data, err := d.DecodeZip(r) - if err != nil { - log.Fatalf("DecodeZip: %v", err) - } - - w := gen.NewCodeWriter() - defer w.WriteGoFile("parents.go", "compact") - - // Create parents table. - type ID uint16 - parents := make([]ID, compact.NumCompactTags) - for _, loc := range data.Locales() { - tag := language.MustParse(loc) - index, ok := compact.FromTag(tag) - if !ok { - continue - } - parentIndex := compact.ID(0) // und - for p := tag.Parent(); p != language.Und; p = p.Parent() { - if x, ok := compact.FromTag(p); ok { - parentIndex = x - break - } - } - parents[index] = ID(parentIndex) - } - - w.WriteComment(` - parents maps a compact index of a tag to the compact index of the parent of - this tag.`) - w.WriteVar("parents", parents) -} diff --git a/vendor/golang.org/x/text/internal/language/gen.go b/vendor/golang.org/x/text/internal/language/gen.go deleted file mode 100644 index cdcc7feb..00000000 --- a/vendor/golang.org/x/text/internal/language/gen.go +++ /dev/null @@ -1,1520 +0,0 @@ -// Copyright 2013 The Go Authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the LICENSE file. - -// +build ignore - -// Language tag table generator. -// Data read from the web. - -package main - -import ( - "bufio" - "flag" - "fmt" - "io" - "io/ioutil" - "log" - "math" - "reflect" - "regexp" - "sort" - "strconv" - "strings" - - "golang.org/x/text/internal/gen" - "golang.org/x/text/internal/tag" - "golang.org/x/text/unicode/cldr" -) - -var ( - test = flag.Bool("test", - false, - "test existing tables; can be used to compare web data with package data.") - outputFile = flag.String("output", - "tables.go", - "output file for generated tables") -) - -var comment = []string{ - ` -lang holds an alphabetically sorted list of ISO-639 language identifiers. -All entries are 4 bytes. The index of the identifier (divided by 4) is the language tag. -For 2-byte language identifiers, the two successive bytes have the following meaning: - - if the first letter of the 2- and 3-letter ISO codes are the same: - the second and third letter of the 3-letter ISO code. - - otherwise: a 0 and a by 2 bits right-shifted index into altLangISO3. -For 3-byte language identifiers the 4th byte is 0.`, - ` -langNoIndex is a bit vector of all 3-letter language codes that are not used as an index -in lookup tables. The language ids for these language codes are derived directly -from the letters and are not consecutive.`, - ` -altLangISO3 holds an alphabetically sorted list of 3-letter language code alternatives -to 2-letter language codes that cannot be derived using the method described above. -Each 3-letter code is followed by its 1-byte langID.`, - ` -altLangIndex is used to convert indexes in altLangISO3 to langIDs.`, - ` -AliasMap maps langIDs to their suggested replacements.`, - ` -script is an alphabetically sorted list of ISO 15924 codes. The index -of the script in the string, divided by 4, is the internal scriptID.`, - ` -isoRegionOffset needs to be added to the index of regionISO to obtain the regionID -for 2-letter ISO codes. (The first isoRegionOffset regionIDs are reserved for -the UN.M49 codes used for groups.)`, - ` -regionISO holds a list of alphabetically sorted 2-letter ISO region codes. -Each 2-letter codes is followed by two bytes with the following meaning: - - [A-Z}{2}: the first letter of the 2-letter code plus these two - letters form the 3-letter ISO code. - - 0, n: index into altRegionISO3.`, - ` -regionTypes defines the status of a region for various standards.`, - ` -m49 maps regionIDs to UN.M49 codes. The first isoRegionOffset entries are -codes indicating collections of regions.`, - ` -m49Index gives indexes into fromM49 based on the three most significant bits -of a 10-bit UN.M49 code. To search an UN.M49 code in fromM49, search in - fromM49[m49Index[msb39(code)]:m49Index[msb3(code)+1]] -for an entry where the first 7 bits match the 7 lsb of the UN.M49 code. -The region code is stored in the 9 lsb of the indexed value.`, - ` -fromM49 contains entries to map UN.M49 codes to regions. See m49Index for details.`, - ` -altRegionISO3 holds a list of 3-letter region codes that cannot be -mapped to 2-letter codes using the default algorithm. This is a short list.`, - ` -altRegionIDs holds a list of regionIDs the positions of which match those -of the 3-letter ISO codes in altRegionISO3.`, - ` -variantNumSpecialized is the number of specialized variants in variants.`, - ` -suppressScript is an index from langID to the dominant script for that language, -if it exists. If a script is given, it should be suppressed from the language tag.`, - ` -likelyLang is a lookup table, indexed by langID, for the most likely -scripts and regions given incomplete information. If more entries exist for a -given language, region and script are the index and size respectively -of the list in likelyLangList.`, - ` -likelyLangList holds lists info associated with likelyLang.`, - ` -likelyRegion is a lookup table, indexed by regionID, for the most likely -languages and scripts given incomplete information. If more entries exist -for a given regionID, lang and script are the index and size respectively -of the list in likelyRegionList. -TODO: exclude containers and user-definable regions from the list.`, - ` -likelyRegionList holds lists info associated with likelyRegion.`, - ` -likelyScript is a lookup table, indexed by scriptID, for the most likely -languages and regions given a script.`, - ` -nRegionGroups is the number of region groups.`, - ` -regionInclusion maps region identifiers to sets of regions in regionInclusionBits, -where each set holds all groupings that are directly connected in a region -containment graph.`, - ` -regionInclusionBits is an array of bit vectors where every vector represents -a set of region groupings. These sets are used to compute the distance -between two regions for the purpose of language matching.`, - ` -regionInclusionNext marks, for each entry in regionInclusionBits, the set of -all groups that are reachable from the groups set in the respective entry.`, -} - -// TODO: consider changing some of these structures to tries. This can reduce -// memory, but may increase the need for memory allocations. This could be -// mitigated if we can piggyback on language tags for common cases. - -func failOnError(e error) { - if e != nil { - log.Panic(e) - } -} - -type setType int - -const ( - Indexed setType = 1 + iota // all elements must be of same size - Linear -) - -type stringSet struct { - s []string - sorted, frozen bool - - // We often need to update values after the creation of an index is completed. - // We include a convenience map for keeping track of this. - update map[string]string - typ setType // used for checking. -} - -func (ss *stringSet) clone() stringSet { - c := *ss - c.s = append([]string(nil), c.s...) - return c -} - -func (ss *stringSet) setType(t setType) { - if ss.typ != t && ss.typ != 0 { - log.Panicf("type %d cannot be assigned as it was already %d", t, ss.typ) - } -} - -// parse parses a whitespace-separated string and initializes ss with its -// components. -func (ss *stringSet) parse(s string) { - scan := bufio.NewScanner(strings.NewReader(s)) - scan.Split(bufio.ScanWords) - for scan.Scan() { - ss.add(scan.Text()) - } -} - -func (ss *stringSet) assertChangeable() { - if ss.frozen { - log.Panic("attempt to modify a frozen stringSet") - } -} - -func (ss *stringSet) add(s string) { - ss.assertChangeable() - ss.s = append(ss.s, s) - ss.sorted = ss.frozen -} - -func (ss *stringSet) freeze() { - ss.compact() - ss.frozen = true -} - -func (ss *stringSet) compact() { - if ss.sorted { - return - } - a := ss.s - sort.Strings(a) - k := 0 - for i := 1; i < len(a); i++ { - if a[k] != a[i] { - a[k+1] = a[i] - k++ - } - } - ss.s = a[:k+1] - ss.sorted = ss.frozen -} - -type funcSorter struct { - fn func(a, b string) bool - sort.StringSlice -} - -func (s funcSorter) Less(i, j int) bool { - return s.fn(s.StringSlice[i], s.StringSlice[j]) -} - -func (ss *stringSet) sortFunc(f func(a, b string) bool) { - ss.compact() - sort.Sort(funcSorter{f, sort.StringSlice(ss.s)}) -} - -func (ss *stringSet) remove(s string) { - ss.assertChangeable() - if i, ok := ss.find(s); ok { - copy(ss.s[i:], ss.s[i+1:]) - ss.s = ss.s[:len(ss.s)-1] - } -} - -func (ss *stringSet) replace(ol, nu string) { - ss.s[ss.index(ol)] = nu - ss.sorted = ss.frozen -} - -func (ss *stringSet) index(s string) int { - ss.setType(Indexed) - i, ok := ss.find(s) - if !ok { - if i < len(ss.s) { - log.Panicf("find: item %q is not in list. Closest match is %q.", s, ss.s[i]) - } - log.Panicf("find: item %q is not in list", s) - - } - return i -} - -func (ss *stringSet) find(s string) (int, bool) { - ss.compact() - i := sort.SearchStrings(ss.s, s) - return i, i != len(ss.s) && ss.s[i] == s -} - -func (ss *stringSet) slice() []string { - ss.compact() - return ss.s -} - -func (ss *stringSet) updateLater(v, key string) { - if ss.update == nil { - ss.update = map[string]string{} - } - ss.update[v] = key -} - -// join joins the string and ensures that all entries are of the same length. -func (ss *stringSet) join() string { - ss.setType(Indexed) - n := len(ss.s[0]) - for _, s := range ss.s { - if len(s) != n { - log.Panicf("join: not all entries are of the same length: %q", s) - } - } - ss.s = append(ss.s, strings.Repeat("\xff", n)) - return strings.Join(ss.s, "") -} - -// ianaEntry holds information for an entry in the IANA Language Subtag Repository. -// All types use the same entry. -// See http://tools.ietf.org/html/bcp47#section-5.1 for a description of the various -// fields. -type ianaEntry struct { - typ string - description []string - scope string - added string - preferred string - deprecated string - suppressScript string - macro string - prefix []string -} - -type builder struct { - w *gen.CodeWriter - hw io.Writer // MultiWriter for w and w.Hash - data *cldr.CLDR - supp *cldr.SupplementalData - - // indices - locale stringSet // common locales - lang stringSet // canonical language ids (2 or 3 letter ISO codes) with data - langNoIndex stringSet // 3-letter ISO codes with no associated data - script stringSet // 4-letter ISO codes - region stringSet // 2-letter ISO or 3-digit UN M49 codes - variant stringSet // 4-8-alphanumeric variant code. - - // Region codes that are groups with their corresponding group IDs. - groups map[int]index - - // langInfo - registry map[string]*ianaEntry -} - -type index uint - -func newBuilder(w *gen.CodeWriter) *builder { - r := gen.OpenCLDRCoreZip() - defer r.Close() - d := &cldr.Decoder{} - data, err := d.DecodeZip(r) - failOnError(err) - b := builder{ - w: w, - hw: io.MultiWriter(w, w.Hash), - data: data, - supp: data.Supplemental(), - } - b.parseRegistry() - return &b -} - -func (b *builder) parseRegistry() { - r := gen.OpenIANAFile("assignments/language-subtag-registry") - defer r.Close() - b.registry = make(map[string]*ianaEntry) - - scan := bufio.NewScanner(r) - scan.Split(bufio.ScanWords) - var record *ianaEntry - for more := scan.Scan(); more; { - key := scan.Text() - more = scan.Scan() - value := scan.Text() - switch key { - case "Type:": - record = &ianaEntry{typ: value} - case "Subtag:", "Tag:": - if s := strings.SplitN(value, "..", 2); len(s) > 1 { - for a := s[0]; a <= s[1]; a = inc(a) { - b.addToRegistry(a, record) - } - } else { - b.addToRegistry(value, record) - } - case "Suppress-Script:": - record.suppressScript = value - case "Added:": - record.added = value - case "Deprecated:": - record.deprecated = value - case "Macrolanguage:": - record.macro = value - case "Preferred-Value:": - record.preferred = value - case "Prefix:": - record.prefix = append(record.prefix, value) - case "Scope:": - record.scope = value - case "Description:": - buf := []byte(value) - for more = scan.Scan(); more; more = scan.Scan() { - b := scan.Bytes() - if b[0] == '%' || b[len(b)-1] == ':' { - break - } - buf = append(buf, ' ') - buf = append(buf, b...) - } - record.description = append(record.description, string(buf)) - continue - default: - continue - } - more = scan.Scan() - } - if scan.Err() != nil { - log.Panic(scan.Err()) - } -} - -func (b *builder) addToRegistry(key string, entry *ianaEntry) { - if info, ok := b.registry[key]; ok { - if info.typ != "language" || entry.typ != "extlang" { - log.Fatalf("parseRegistry: tag %q already exists", key) - } - } else { - b.registry[key] = entry - } -} - -var commentIndex = make(map[string]string) - -func init() { - for _, s := range comment { - key := strings.TrimSpace(strings.SplitN(s, " ", 2)[0]) - commentIndex[key] = s - } -} - -func (b *builder) comment(name string) { - if s := commentIndex[name]; len(s) > 0 { - b.w.WriteComment(s) - } else { - fmt.Fprintln(b.w) - } -} - -func (b *builder) pf(f string, x ...interface{}) { - fmt.Fprintf(b.hw, f, x...) - fmt.Fprint(b.hw, "\n") -} - -func (b *builder) p(x ...interface{}) { - fmt.Fprintln(b.hw, x...) -} - -func (b *builder) addSize(s int) { - b.w.Size += s - b.pf("// Size: %d bytes", s) -} - -func (b *builder) writeConst(name string, x interface{}) { - b.comment(name) - b.w.WriteConst(name, x) -} - -// writeConsts computes f(v) for all v in values and writes the results -// as constants named _v to a single constant block. -func (b *builder) writeConsts(f func(string) int, values ...string) { - b.pf("const (") - for _, v := range values { - b.pf("\t_%s = %v", v, f(v)) - } - b.pf(")") -} - -// writeType writes the type of the given value, which must be a struct. -func (b *builder) writeType(value interface{}) { - b.comment(reflect.TypeOf(value).Name()) - b.w.WriteType(value) -} - -func (b *builder) writeSlice(name string, ss interface{}) { - b.writeSliceAddSize(name, 0, ss) -} - -func (b *builder) writeSliceAddSize(name string, extraSize int, ss interface{}) { - b.comment(name) - b.w.Size += extraSize - v := reflect.ValueOf(ss) - t := v.Type().Elem() - b.pf("// Size: %d bytes, %d elements", v.Len()*int(t.Size())+extraSize, v.Len()) - - fmt.Fprintf(b.w, "var %s = ", name) - b.w.WriteArray(ss) - b.p() -} - -type FromTo struct { - From, To uint16 -} - -func (b *builder) writeSortedMap(name string, ss *stringSet, index func(s string) uint16) { - ss.sortFunc(func(a, b string) bool { - return index(a) < index(b) - }) - m := []FromTo{} - for _, s := range ss.s { - m = append(m, FromTo{index(s), index(ss.update[s])}) - } - b.writeSlice(name, m) -} - -const base = 'z' - 'a' + 1 - -func strToInt(s string) uint { - v := uint(0) - for i := 0; i < len(s); i++ { - v *= base - v += uint(s[i] - 'a') - } - return v -} - -// converts the given integer to the original ASCII string passed to strToInt. -// len(s) must match the number of characters obtained. -func intToStr(v uint, s []byte) { - for i := len(s) - 1; i >= 0; i-- { - s[i] = byte(v%base) + 'a' - v /= base - } -} - -func (b *builder) writeBitVector(name string, ss []string) { - vec := make([]uint8, int(math.Ceil(math.Pow(base, float64(len(ss[0])))/8))) - for _, s := range ss { - v := strToInt(s) - vec[v/8] |= 1 << (v % 8) - } - b.writeSlice(name, vec) -} - -// TODO: convert this type into a list or two-stage trie. -func (b *builder) writeMapFunc(name string, m map[string]string, f func(string) uint16) { - b.comment(name) - v := reflect.ValueOf(m) - sz := v.Len() * (2 + int(v.Type().Key().Size())) - for _, k := range m { - sz += len(k) - } - b.addSize(sz) - keys := []string{} - b.pf(`var %s = map[string]uint16{`, name) - for k := range m { - keys = append(keys, k) - } - sort.Strings(keys) - for _, k := range keys { - b.pf("\t%q: %v,", k, f(m[k])) - } - b.p("}") -} - -func (b *builder) writeMap(name string, m interface{}) { - b.comment(name) - v := reflect.ValueOf(m) - sz := v.Len() * (2 + int(v.Type().Key().Size()) + int(v.Type().Elem().Size())) - b.addSize(sz) - f := strings.FieldsFunc(fmt.Sprintf("%#v", m), func(r rune) bool { - return strings.IndexRune("{}, ", r) != -1 - }) - sort.Strings(f[1:]) - b.pf(`var %s = %s{`, name, f[0]) - for _, kv := range f[1:] { - b.pf("\t%s,", kv) - } - b.p("}") -} - -func (b *builder) langIndex(s string) uint16 { - if s == "und" { - return 0 - } - if i, ok := b.lang.find(s); ok { - return uint16(i) - } - return uint16(strToInt(s)) + uint16(len(b.lang.s)) -} - -// inc advances the string to its lexicographical successor. -func inc(s string) string { - const maxTagLength = 4 - var buf [maxTagLength]byte - intToStr(strToInt(strings.ToLower(s))+1, buf[:len(s)]) - for i := 0; i < len(s); i++ { - if s[i] <= 'Z' { - buf[i] -= 'a' - 'A' - } - } - return string(buf[:len(s)]) -} - -func (b *builder) parseIndices() { - meta := b.supp.Metadata - - for k, v := range b.registry { - var ss *stringSet - switch v.typ { - case "language": - if len(k) == 2 || v.suppressScript != "" || v.scope == "special" { - b.lang.add(k) - continue - } else { - ss = &b.langNoIndex - } - case "region": - ss = &b.region - case "script": - ss = &b.script - case "variant": - ss = &b.variant - default: - continue - } - ss.add(k) - } - // Include any language for which there is data. - for _, lang := range b.data.Locales() { - if x := b.data.RawLDML(lang); false || - x.LocaleDisplayNames != nil || - x.Characters != nil || - x.Delimiters != nil || - x.Measurement != nil || - x.Dates != nil || - x.Numbers != nil || - x.Units != nil || - x.ListPatterns != nil || - x.Collations != nil || - x.Segmentations != nil || - x.Rbnf != nil || - x.Annotations != nil || - x.Metadata != nil { - - from := strings.Split(lang, "_") - if lang := from[0]; lang != "root" { - b.lang.add(lang) - } - } - } - // Include locales for plural rules, which uses a different structure. - for _, plurals := range b.data.Supplemental().Plurals { - for _, rules := range plurals.PluralRules { - for _, lang := range strings.Split(rules.Locales, " ") { - if lang = strings.Split(lang, "_")[0]; lang != "root" { - b.lang.add(lang) - } - } - } - } - // Include languages in likely subtags. - for _, m := range b.supp.LikelySubtags.LikelySubtag { - from := strings.Split(m.From, "_") - b.lang.add(from[0]) - } - // Include ISO-639 alpha-3 bibliographic entries. - for _, a := range meta.Alias.LanguageAlias { - if a.Reason == "bibliographic" { - b.langNoIndex.add(a.Type) - } - } - // Include regions in territoryAlias (not all are in the IANA registry!) - for _, reg := range b.supp.Metadata.Alias.TerritoryAlias { - if len(reg.Type) == 2 { - b.region.add(reg.Type) - } - } - - for _, s := range b.lang.s { - if len(s) == 3 { - b.langNoIndex.remove(s) - } - } - b.writeConst("NumLanguages", len(b.lang.slice())+len(b.langNoIndex.slice())) - b.writeConst("NumScripts", len(b.script.slice())) - b.writeConst("NumRegions", len(b.region.slice())) - - // Add dummy codes at the start of each list to represent "unspecified". - b.lang.add("---") - b.script.add("----") - b.region.add("---") - - // common locales - b.locale.parse(meta.DefaultContent.Locales) -} - -// TODO: region inclusion data will probably not be use used in future matchers. - -func (b *builder) computeRegionGroups() { - b.groups = make(map[int]index) - - // Create group indices. - for i := 1; b.region.s[i][0] < 'A'; i++ { // Base M49 indices on regionID. - b.groups[i] = index(len(b.groups)) - } - for _, g := range b.supp.TerritoryContainment.Group { - // Skip UN and EURO zone as they are flattening the containment - // relationship. - if g.Type == "EZ" || g.Type == "UN" { - continue - } - group := b.region.index(g.Type) - if _, ok := b.groups[group]; !ok { - b.groups[group] = index(len(b.groups)) - } - } - if len(b.groups) > 64 { - log.Fatalf("only 64 groups supported, found %d", len(b.groups)) - } - b.writeConst("nRegionGroups", len(b.groups)) -} - -var langConsts = []string{ - "af", "am", "ar", "az", "bg", "bn", "ca", "cs", "da", "de", "el", "en", "es", - "et", "fa", "fi", "fil", "fr", "gu", "he", "hi", "hr", "hu", "hy", "id", "is", - "it", "ja", "ka", "kk", "km", "kn", "ko", "ky", "lo", "lt", "lv", "mk", "ml", - "mn", "mo", "mr", "ms", "mul", "my", "nb", "ne", "nl", "no", "pa", "pl", "pt", - "ro", "ru", "sh", "si", "sk", "sl", "sq", "sr", "sv", "sw", "ta", "te", "th", - "tl", "tn", "tr", "uk", "ur", "uz", "vi", "zh", "zu", - - // constants for grandfathered tags (if not already defined) - "jbo", "ami", "bnn", "hak", "tlh", "lb", "nv", "pwn", "tao", "tay", "tsu", - "nn", "sfb", "vgt", "sgg", "cmn", "nan", "hsn", -} - -// writeLanguage generates all tables needed for language canonicalization. -func (b *builder) writeLanguage() { - meta := b.supp.Metadata - - b.writeConst("nonCanonicalUnd", b.lang.index("und")) - b.writeConsts(func(s string) int { return int(b.langIndex(s)) }, langConsts...) - b.writeConst("langPrivateStart", b.langIndex("qaa")) - b.writeConst("langPrivateEnd", b.langIndex("qtz")) - - // Get language codes that need to be mapped (overlong 3-letter codes, - // deprecated 2-letter codes, legacy and grandfathered tags.) - langAliasMap := stringSet{} - aliasTypeMap := map[string]AliasType{} - - // altLangISO3 get the alternative ISO3 names that need to be mapped. - altLangISO3 := stringSet{} - // Add dummy start to avoid the use of index 0. - altLangISO3.add("---") - altLangISO3.updateLater("---", "aa") - - lang := b.lang.clone() - for _, a := range meta.Alias.LanguageAlias { - if a.Replacement == "" { - a.Replacement = "und" - } - // TODO: support mapping to tags - repl := strings.SplitN(a.Replacement, "_", 2)[0] - if a.Reason == "overlong" { - if len(a.Replacement) == 2 && len(a.Type) == 3 { - lang.updateLater(a.Replacement, a.Type) - } - } else if len(a.Type) <= 3 { - switch a.Reason { - case "macrolanguage": - aliasTypeMap[a.Type] = Macro - case "deprecated": - // handled elsewhere - continue - case "bibliographic", "legacy": - if a.Type == "no" { - continue - } - aliasTypeMap[a.Type] = Legacy - default: - log.Fatalf("new %s alias: %s", a.Reason, a.Type) - } - langAliasMap.add(a.Type) - langAliasMap.updateLater(a.Type, repl) - } - } - // Manually add the mapping of "nb" (Norwegian) to its macro language. - // This can be removed if CLDR adopts this change. - langAliasMap.add("nb") - langAliasMap.updateLater("nb", "no") - aliasTypeMap["nb"] = Macro - - for k, v := range b.registry { - // Also add deprecated values for 3-letter ISO codes, which CLDR omits. - if v.typ == "language" && v.deprecated != "" && v.preferred != "" { - langAliasMap.add(k) - langAliasMap.updateLater(k, v.preferred) - aliasTypeMap[k] = Deprecated - } - } - // Fix CLDR mappings. - lang.updateLater("tl", "tgl") - lang.updateLater("sh", "hbs") - lang.updateLater("mo", "mol") - lang.updateLater("no", "nor") - lang.updateLater("tw", "twi") - lang.updateLater("nb", "nob") - lang.updateLater("ak", "aka") - lang.updateLater("bh", "bih") - - // Ensure that each 2-letter code is matched with a 3-letter code. - for _, v := range lang.s[1:] { - s, ok := lang.update[v] - if !ok { - if s, ok = lang.update[langAliasMap.update[v]]; !ok { - continue - } - lang.update[v] = s - } - if v[0] != s[0] { - altLangISO3.add(s) - altLangISO3.updateLater(s, v) - } - } - - // Complete canonicalized language tags. - lang.freeze() - for i, v := range lang.s { - // We can avoid these manual entries by using the IANA registry directly. - // Seems easier to update the list manually, as changes are rare. - // The panic in this loop will trigger if we miss an entry. - add := "" - if s, ok := lang.update[v]; ok { - if s[0] == v[0] { - add = s[1:] - } else { - add = string([]byte{0, byte(altLangISO3.index(s))}) - } - } else if len(v) == 3 { - add = "\x00" - } else { - log.Panicf("no data for long form of %q", v) - } - lang.s[i] += add - } - b.writeConst("lang", tag.Index(lang.join())) - - b.writeConst("langNoIndexOffset", len(b.lang.s)) - - // space of all valid 3-letter language identifiers. - b.writeBitVector("langNoIndex", b.langNoIndex.slice()) - - altLangIndex := []uint16{} - for i, s := range altLangISO3.slice() { - altLangISO3.s[i] += string([]byte{byte(len(altLangIndex))}) - if i > 0 { - idx := b.lang.index(altLangISO3.update[s]) - altLangIndex = append(altLangIndex, uint16(idx)) - } - } - b.writeConst("altLangISO3", tag.Index(altLangISO3.join())) - b.writeSlice("altLangIndex", altLangIndex) - - b.writeSortedMap("AliasMap", &langAliasMap, b.langIndex) - types := make([]AliasType, len(langAliasMap.s)) - for i, s := range langAliasMap.s { - types[i] = aliasTypeMap[s] - } - b.writeSlice("AliasTypes", types) -} - -var scriptConsts = []string{ - "Latn", "Hani", "Hans", "Hant", "Qaaa", "Qaai", "Qabx", "Zinh", "Zyyy", - "Zzzz", -} - -func (b *builder) writeScript() { - b.writeConsts(b.script.index, scriptConsts...) - b.writeConst("script", tag.Index(b.script.join())) - - supp := make([]uint8, len(b.lang.slice())) - for i, v := range b.lang.slice()[1:] { - if sc := b.registry[v].suppressScript; sc != "" { - supp[i+1] = uint8(b.script.index(sc)) - } - } - b.writeSlice("suppressScript", supp) - - // There is only one deprecated script in CLDR. This value is hard-coded. - // We check here if the code must be updated. - for _, a := range b.supp.Metadata.Alias.ScriptAlias { - if a.Type != "Qaai" { - log.Panicf("unexpected deprecated stript %q", a.Type) - } - } -} - -func parseM49(s string) int16 { - if len(s) == 0 { - return 0 - } - v, err := strconv.ParseUint(s, 10, 10) - failOnError(err) - return int16(v) -} - -var regionConsts = []string{ - "001", "419", "BR", "CA", "ES", "GB", "MD", "PT", "UK", "US", - "ZZ", "XA", "XC", "XK", // Unofficial tag for Kosovo. -} - -func (b *builder) writeRegion() { - b.writeConsts(b.region.index, regionConsts...) - - isoOffset := b.region.index("AA") - m49map := make([]int16, len(b.region.slice())) - fromM49map := make(map[int16]int) - altRegionISO3 := "" - altRegionIDs := []uint16{} - - b.writeConst("isoRegionOffset", isoOffset) - - // 2-letter region lookup and mapping to numeric codes. - regionISO := b.region.clone() - regionISO.s = regionISO.s[isoOffset:] - regionISO.sorted = false - - regionTypes := make([]byte, len(b.region.s)) - - // Is the region valid BCP 47? - for s, e := range b.registry { - if len(s) == 2 && s == strings.ToUpper(s) { - i := b.region.index(s) - for _, d := range e.description { - if strings.Contains(d, "Private use") { - regionTypes[i] = iso3166UserAssigned - } - } - regionTypes[i] |= bcp47Region - } - } - - // Is the region a valid ccTLD? - r := gen.OpenIANAFile("domains/root/db") - defer r.Close() - - buf, err := ioutil.ReadAll(r) - failOnError(err) - re := regexp.MustCompile(`"/domains/root/db/([a-z]{2}).html"`) - for _, m := range re.FindAllSubmatch(buf, -1) { - i := b.region.index(strings.ToUpper(string(m[1]))) - regionTypes[i] |= ccTLD - } - - b.writeSlice("regionTypes", regionTypes) - - iso3Set := make(map[string]int) - update := func(iso2, iso3 string) { - i := regionISO.index(iso2) - if j, ok := iso3Set[iso3]; !ok && iso3[0] == iso2[0] { - regionISO.s[i] += iso3[1:] - iso3Set[iso3] = -1 - } else { - if ok && j >= 0 { - regionISO.s[i] += string([]byte{0, byte(j)}) - } else { - iso3Set[iso3] = len(altRegionISO3) - regionISO.s[i] += string([]byte{0, byte(len(altRegionISO3))}) - altRegionISO3 += iso3 - altRegionIDs = append(altRegionIDs, uint16(isoOffset+i)) - } - } - } - for _, tc := range b.supp.CodeMappings.TerritoryCodes { - i := regionISO.index(tc.Type) + isoOffset - if d := m49map[i]; d != 0 { - log.Panicf("%s found as a duplicate UN.M49 code of %03d", tc.Numeric, d) - } - m49 := parseM49(tc.Numeric) - m49map[i] = m49 - if r := fromM49map[m49]; r == 0 { - fromM49map[m49] = i - } else if r != i { - dep := b.registry[regionISO.s[r-isoOffset]].deprecated - if t := b.registry[tc.Type]; t != nil && dep != "" && (t.deprecated == "" || t.deprecated > dep) { - fromM49map[m49] = i - } - } - } - for _, ta := range b.supp.Metadata.Alias.TerritoryAlias { - if len(ta.Type) == 3 && ta.Type[0] <= '9' && len(ta.Replacement) == 2 { - from := parseM49(ta.Type) - if r := fromM49map[from]; r == 0 { - fromM49map[from] = regionISO.index(ta.Replacement) + isoOffset - } - } - } - for _, tc := range b.supp.CodeMappings.TerritoryCodes { - if len(tc.Alpha3) == 3 { - update(tc.Type, tc.Alpha3) - } - } - // This entries are not included in territoryCodes. Mostly 3-letter variants - // of deleted codes and an entry for QU. - for _, m := range []struct{ iso2, iso3 string }{ - {"CT", "CTE"}, - {"DY", "DHY"}, - {"HV", "HVO"}, - {"JT", "JTN"}, - {"MI", "MID"}, - {"NH", "NHB"}, - {"NQ", "ATN"}, - {"PC", "PCI"}, - {"PU", "PUS"}, - {"PZ", "PCZ"}, - {"RH", "RHO"}, - {"VD", "VDR"}, - {"WK", "WAK"}, - // These three-letter codes are used for others as well. - {"FQ", "ATF"}, - } { - update(m.iso2, m.iso3) - } - for i, s := range regionISO.s { - if len(s) != 4 { - regionISO.s[i] = s + " " - } - } - b.writeConst("regionISO", tag.Index(regionISO.join())) - b.writeConst("altRegionISO3", altRegionISO3) - b.writeSlice("altRegionIDs", altRegionIDs) - - // Create list of deprecated regions. - // TODO: consider inserting SF -> FI. Not included by CLDR, but is the only - // Transitionally-reserved mapping not included. - regionOldMap := stringSet{} - // Include regions in territoryAlias (not all are in the IANA registry!) - for _, reg := range b.supp.Metadata.Alias.TerritoryAlias { - if len(reg.Type) == 2 && reg.Reason == "deprecated" && len(reg.Replacement) == 2 { - regionOldMap.add(reg.Type) - regionOldMap.updateLater(reg.Type, reg.Replacement) - i, _ := regionISO.find(reg.Type) - j, _ := regionISO.find(reg.Replacement) - if k := m49map[i+isoOffset]; k == 0 { - m49map[i+isoOffset] = m49map[j+isoOffset] - } - } - } - b.writeSortedMap("regionOldMap", ®ionOldMap, func(s string) uint16 { - return uint16(b.region.index(s)) - }) - // 3-digit region lookup, groupings. - for i := 1; i < isoOffset; i++ { - m := parseM49(b.region.s[i]) - m49map[i] = m - fromM49map[m] = i - } - b.writeSlice("m49", m49map) - - const ( - searchBits = 7 - regionBits = 9 - ) - if len(m49map) >= 1< %d", len(m49map), 1<>searchBits] = int16(len(fromM49)) - } - b.writeSlice("m49Index", m49Index) - b.writeSlice("fromM49", fromM49) -} - -const ( - // TODO: put these lists in regionTypes as user data? Could be used for - // various optimizations and refinements and could be exposed in the API. - iso3166Except = "AC CP DG EA EU FX IC SU TA UK" - iso3166Trans = "AN BU CS NT TP YU ZR" // SF is not in our set of Regions. - // DY and RH are actually not deleted, but indeterminately reserved. - iso3166DelCLDR = "CT DD DY FQ HV JT MI NH NQ PC PU PZ RH VD WK YD" -) - -const ( - iso3166UserAssigned = 1 << iota - ccTLD - bcp47Region -) - -func find(list []string, s string) int { - for i, t := range list { - if t == s { - return i - } - } - return -1 -} - -// writeVariants generates per-variant information and creates a map from variant -// name to index value. We assign index values such that sorting multiple -// variants by index value will result in the correct order. -// There are two types of variants: specialized and general. Specialized variants -// are only applicable to certain language or language-script pairs. Generalized -// variants apply to any language. Generalized variants always sort after -// specialized variants. We will therefore always assign a higher index value -// to a generalized variant than any other variant. Generalized variants are -// sorted alphabetically among themselves. -// Specialized variants may also sort after other specialized variants. Such -// variants will be ordered after any of the variants they may follow. -// We assume that if a variant x is followed by a variant y, then for any prefix -// p of x, p-x is a prefix of y. This allows us to order tags based on the -// maximum of the length of any of its prefixes. -// TODO: it is possible to define a set of Prefix values on variants such that -// a total order cannot be defined to the point that this algorithm breaks. -// In other words, we cannot guarantee the same order of variants for the -// future using the same algorithm or for non-compliant combinations of -// variants. For this reason, consider using simple alphabetic sorting -// of variants and ignore Prefix restrictions altogether. -func (b *builder) writeVariant() { - generalized := stringSet{} - specialized := stringSet{} - specializedExtend := stringSet{} - // Collate the variants by type and check assumptions. - for _, v := range b.variant.slice() { - e := b.registry[v] - if len(e.prefix) == 0 { - generalized.add(v) - continue - } - c := strings.Split(e.prefix[0], "-") - hasScriptOrRegion := false - if len(c) > 1 { - _, hasScriptOrRegion = b.script.find(c[1]) - if !hasScriptOrRegion { - _, hasScriptOrRegion = b.region.find(c[1]) - - } - } - if len(c) == 1 || len(c) == 2 && hasScriptOrRegion { - // Variant is preceded by a language. - specialized.add(v) - continue - } - // Variant is preceded by another variant. - specializedExtend.add(v) - prefix := c[0] + "-" - if hasScriptOrRegion { - prefix += c[1] - } - for _, p := range e.prefix { - // Verify that the prefix minus the last element is a prefix of the - // predecessor element. - i := strings.LastIndex(p, "-") - pred := b.registry[p[i+1:]] - if find(pred.prefix, p[:i]) < 0 { - log.Fatalf("prefix %q for variant %q not consistent with predecessor spec", p, v) - } - // The sorting used below does not work in the general case. It works - // if we assume that variants that may be followed by others only have - // prefixes of the same length. Verify this. - count := strings.Count(p[:i], "-") - for _, q := range pred.prefix { - if c := strings.Count(q, "-"); c != count { - log.Fatalf("variant %q preceding %q has a prefix %q of size %d; want %d", p[i+1:], v, q, c, count) - } - } - if !strings.HasPrefix(p, prefix) { - log.Fatalf("prefix %q of variant %q should start with %q", p, v, prefix) - } - } - } - - // Sort extended variants. - a := specializedExtend.s - less := func(v, w string) bool { - // Sort by the maximum number of elements. - maxCount := func(s string) (max int) { - for _, p := range b.registry[s].prefix { - if c := strings.Count(p, "-"); c > max { - max = c - } - } - return - } - if cv, cw := maxCount(v), maxCount(w); cv != cw { - return cv < cw - } - // Sort by name as tie breaker. - return v < w - } - sort.Sort(funcSorter{less, sort.StringSlice(a)}) - specializedExtend.frozen = true - - // Create index from variant name to index. - variantIndex := make(map[string]uint8) - add := func(s []string) { - for _, v := range s { - variantIndex[v] = uint8(len(variantIndex)) - } - } - add(specialized.slice()) - add(specializedExtend.s) - numSpecialized := len(variantIndex) - add(generalized.slice()) - if n := len(variantIndex); n > 255 { - log.Fatalf("maximum number of variants exceeded: was %d; want <= 255", n) - } - b.writeMap("variantIndex", variantIndex) - b.writeConst("variantNumSpecialized", numSpecialized) -} - -func (b *builder) writeLanguageInfo() { -} - -// writeLikelyData writes tables that are used both for finding parent relations and for -// language matching. Each entry contains additional bits to indicate the status of the -// data to know when it cannot be used for parent relations. -func (b *builder) writeLikelyData() { - const ( - isList = 1 << iota - scriptInFrom - regionInFrom - ) - type ( // generated types - likelyScriptRegion struct { - region uint16 - script uint8 - flags uint8 - } - likelyLangScript struct { - lang uint16 - script uint8 - flags uint8 - } - likelyLangRegion struct { - lang uint16 - region uint16 - } - // likelyTag is used for getting likely tags for group regions, where - // the likely region might be a region contained in the group. - likelyTag struct { - lang uint16 - region uint16 - script uint8 - } - ) - var ( // generated variables - likelyRegionGroup = make([]likelyTag, len(b.groups)) - likelyLang = make([]likelyScriptRegion, len(b.lang.s)) - likelyRegion = make([]likelyLangScript, len(b.region.s)) - likelyScript = make([]likelyLangRegion, len(b.script.s)) - likelyLangList = []likelyScriptRegion{} - likelyRegionList = []likelyLangScript{} - ) - type fromTo struct { - from, to []string - } - langToOther := map[int][]fromTo{} - regionToOther := map[int][]fromTo{} - for _, m := range b.supp.LikelySubtags.LikelySubtag { - from := strings.Split(m.From, "_") - to := strings.Split(m.To, "_") - if len(to) != 3 { - log.Fatalf("invalid number of subtags in %q: found %d, want 3", m.To, len(to)) - } - if len(from) > 3 { - log.Fatalf("invalid number of subtags: found %d, want 1-3", len(from)) - } - if from[0] != to[0] && from[0] != "und" { - log.Fatalf("unexpected language change in expansion: %s -> %s", from, to) - } - if len(from) == 3 { - if from[2] != to[2] { - log.Fatalf("unexpected region change in expansion: %s -> %s", from, to) - } - if from[0] != "und" { - log.Fatalf("unexpected fully specified from tag: %s -> %s", from, to) - } - } - if len(from) == 1 || from[0] != "und" { - id := 0 - if from[0] != "und" { - id = b.lang.index(from[0]) - } - langToOther[id] = append(langToOther[id], fromTo{from, to}) - } else if len(from) == 2 && len(from[1]) == 4 { - sid := b.script.index(from[1]) - likelyScript[sid].lang = uint16(b.langIndex(to[0])) - likelyScript[sid].region = uint16(b.region.index(to[2])) - } else { - r := b.region.index(from[len(from)-1]) - if id, ok := b.groups[r]; ok { - if from[0] != "und" { - log.Fatalf("region changed unexpectedly: %s -> %s", from, to) - } - likelyRegionGroup[id].lang = uint16(b.langIndex(to[0])) - likelyRegionGroup[id].script = uint8(b.script.index(to[1])) - likelyRegionGroup[id].region = uint16(b.region.index(to[2])) - } else { - regionToOther[r] = append(regionToOther[r], fromTo{from, to}) - } - } - } - b.writeType(likelyLangRegion{}) - b.writeSlice("likelyScript", likelyScript) - - for id := range b.lang.s { - list := langToOther[id] - if len(list) == 1 { - likelyLang[id].region = uint16(b.region.index(list[0].to[2])) - likelyLang[id].script = uint8(b.script.index(list[0].to[1])) - } else if len(list) > 1 { - likelyLang[id].flags = isList - likelyLang[id].region = uint16(len(likelyLangList)) - likelyLang[id].script = uint8(len(list)) - for _, x := range list { - flags := uint8(0) - if len(x.from) > 1 { - if x.from[1] == x.to[2] { - flags = regionInFrom - } else { - flags = scriptInFrom - } - } - likelyLangList = append(likelyLangList, likelyScriptRegion{ - region: uint16(b.region.index(x.to[2])), - script: uint8(b.script.index(x.to[1])), - flags: flags, - }) - } - } - } - // TODO: merge suppressScript data with this table. - b.writeType(likelyScriptRegion{}) - b.writeSlice("likelyLang", likelyLang) - b.writeSlice("likelyLangList", likelyLangList) - - for id := range b.region.s { - list := regionToOther[id] - if len(list) == 1 { - likelyRegion[id].lang = uint16(b.langIndex(list[0].to[0])) - likelyRegion[id].script = uint8(b.script.index(list[0].to[1])) - if len(list[0].from) > 2 { - likelyRegion[id].flags = scriptInFrom - } - } else if len(list) > 1 { - likelyRegion[id].flags = isList - likelyRegion[id].lang = uint16(len(likelyRegionList)) - likelyRegion[id].script = uint8(len(list)) - for i, x := range list { - if len(x.from) == 2 && i != 0 || i > 0 && len(x.from) != 3 { - log.Fatalf("unspecified script must be first in list: %v at %d", x.from, i) - } - x := likelyLangScript{ - lang: uint16(b.langIndex(x.to[0])), - script: uint8(b.script.index(x.to[1])), - } - if len(list[0].from) > 2 { - x.flags = scriptInFrom - } - likelyRegionList = append(likelyRegionList, x) - } - } - } - b.writeType(likelyLangScript{}) - b.writeSlice("likelyRegion", likelyRegion) - b.writeSlice("likelyRegionList", likelyRegionList) - - b.writeType(likelyTag{}) - b.writeSlice("likelyRegionGroup", likelyRegionGroup) -} - -func (b *builder) writeRegionInclusionData() { - var ( - // mm holds for each group the set of groups with a distance of 1. - mm = make(map[int][]index) - - // containment holds for each group the transitive closure of - // containment of other groups. - containment = make(map[index][]index) - ) - for _, g := range b.supp.TerritoryContainment.Group { - // Skip UN and EURO zone as they are flattening the containment - // relationship. - if g.Type == "EZ" || g.Type == "UN" { - continue - } - group := b.region.index(g.Type) - groupIdx := b.groups[group] - for _, mem := range strings.Split(g.Contains, " ") { - r := b.region.index(mem) - mm[r] = append(mm[r], groupIdx) - if g, ok := b.groups[r]; ok { - mm[group] = append(mm[group], g) - containment[groupIdx] = append(containment[groupIdx], g) - } - } - } - - regionContainment := make([]uint64, len(b.groups)) - for _, g := range b.groups { - l := containment[g] - - // Compute the transitive closure of containment. - for i := 0; i < len(l); i++ { - l = append(l, containment[l[i]]...) - } - - // Compute the bitmask. - regionContainment[g] = 1 << g - for _, v := range l { - regionContainment[g] |= 1 << v - } - } - b.writeSlice("regionContainment", regionContainment) - - regionInclusion := make([]uint8, len(b.region.s)) - bvs := make(map[uint64]index) - // Make the first bitvector positions correspond with the groups. - for r, i := range b.groups { - bv := uint64(1 << i) - for _, g := range mm[r] { - bv |= 1 << g - } - bvs[bv] = i - regionInclusion[r] = uint8(bvs[bv]) - } - for r := 1; r < len(b.region.s); r++ { - if _, ok := b.groups[r]; !ok { - bv := uint64(0) - for _, g := range mm[r] { - bv |= 1 << g - } - if bv == 0 { - // Pick the world for unspecified regions. - bv = 1 << b.groups[b.region.index("001")] - } - if _, ok := bvs[bv]; !ok { - bvs[bv] = index(len(bvs)) - } - regionInclusion[r] = uint8(bvs[bv]) - } - } - b.writeSlice("regionInclusion", regionInclusion) - regionInclusionBits := make([]uint64, len(bvs)) - for k, v := range bvs { - regionInclusionBits[v] = uint64(k) - } - // Add bit vectors for increasingly large distances until a fixed point is reached. - regionInclusionNext := []uint8{} - for i := 0; i < len(regionInclusionBits); i++ { - bits := regionInclusionBits[i] - next := bits - for i := uint(0); i < uint(len(b.groups)); i++ { - if bits&(1< 6 { - log.Fatalf("Too many groups: %d", i) - } - idToIndex[mv.Id] = uint8(i + 1) - // TODO: also handle '-' - for _, r := range strings.Split(mv.Value, "+") { - todo := []string{r} - for k := 0; k < len(todo); k++ { - r := todo[k] - regionToGroups[b.regionIndex(r)] |= 1 << uint8(i) - todo = append(todo, regionHierarchy[r]...) - } - } - } - b.w.WriteVar("regionToGroups", regionToGroups) - - // maps language id to in- and out-of-group region. - paradigmLocales := [][3]uint16{} - locales := strings.Split(lm[0].ParadigmLocales[0].Locales, " ") - for i := 0; i < len(locales); i += 2 { - x := [3]uint16{} - for j := 0; j < 2; j++ { - pc := strings.SplitN(locales[i+j], "-", 2) - x[0] = b.langIndex(pc[0]) - if len(pc) == 2 { - x[1+j] = uint16(b.regionIndex(pc[1])) - } - } - paradigmLocales = append(paradigmLocales, x) - } - b.w.WriteVar("paradigmLocales", paradigmLocales) - - b.w.WriteType(mutualIntelligibility{}) - b.w.WriteType(scriptIntelligibility{}) - b.w.WriteType(regionIntelligibility{}) - - matchLang := []mutualIntelligibility{} - matchScript := []scriptIntelligibility{} - matchRegion := []regionIntelligibility{} - // Convert the languageMatch entries in lists keyed by desired language. - for _, m := range lm[0].LanguageMatch { - // Different versions of CLDR use different separators. - desired := strings.Replace(m.Desired, "-", "_", -1) - supported := strings.Replace(m.Supported, "-", "_", -1) - d := strings.Split(desired, "_") - s := strings.Split(supported, "_") - if len(d) != len(s) { - log.Fatalf("not supported: desired=%q; supported=%q", desired, supported) - continue - } - distance, _ := strconv.ParseInt(m.Distance, 10, 8) - switch len(d) { - case 2: - if desired == supported && desired == "*_*" { - continue - } - // language-script pair. - matchScript = append(matchScript, scriptIntelligibility{ - wantLang: uint16(b.langIndex(d[0])), - haveLang: uint16(b.langIndex(s[0])), - wantScript: uint8(b.scriptIndex(d[1])), - haveScript: uint8(b.scriptIndex(s[1])), - distance: uint8(distance), - }) - if m.Oneway != "true" { - matchScript = append(matchScript, scriptIntelligibility{ - wantLang: uint16(b.langIndex(s[0])), - haveLang: uint16(b.langIndex(d[0])), - wantScript: uint8(b.scriptIndex(s[1])), - haveScript: uint8(b.scriptIndex(d[1])), - distance: uint8(distance), - }) - } - case 1: - if desired == supported && desired == "*" { - continue - } - if distance == 1 { - // nb == no is already handled by macro mapping. Check there - // really is only this case. - if d[0] != "no" || s[0] != "nb" { - log.Fatalf("unhandled equivalence %s == %s", s[0], d[0]) - } - continue - } - // TODO: consider dropping oneway field and just doubling the entry. - matchLang = append(matchLang, mutualIntelligibility{ - want: uint16(b.langIndex(d[0])), - have: uint16(b.langIndex(s[0])), - distance: uint8(distance), - oneway: m.Oneway == "true", - }) - case 3: - if desired == supported && desired == "*_*_*" { - continue - } - if desired != supported { - // This is now supported by CLDR, but only one case, which - // should already be covered by paradigm locales. For instance, - // test case "und, en, en-GU, en-IN, en-GB ; en-ZA ; en-GB" in - // testdata/CLDRLocaleMatcherTest.txt tests this. - if supported != "en_*_GB" { - log.Fatalf("not supported: desired=%q; supported=%q", desired, supported) - } - continue - } - ri := regionIntelligibility{ - lang: b.langIndex(d[0]), - distance: uint8(distance), - } - if d[1] != "*" { - ri.script = uint8(b.scriptIndex(d[1])) - } - switch { - case d[2] == "*": - ri.group = 0x80 // not contained in anything - case strings.HasPrefix(d[2], "$!"): - ri.group = 0x80 - d[2] = "$" + d[2][len("$!"):] - fallthrough - case strings.HasPrefix(d[2], "$"): - ri.group |= idToIndex[d[2]] - } - matchRegion = append(matchRegion, ri) - default: - log.Fatalf("not supported: desired=%q; supported=%q", desired, supported) - } - } - sort.SliceStable(matchLang, func(i, j int) bool { - return matchLang[i].distance < matchLang[j].distance - }) - b.w.WriteComment(` - matchLang holds pairs of langIDs of base languages that are typically - mutually intelligible. Each pair is associated with a confidence and - whether the intelligibility goes one or both ways.`) - b.w.WriteVar("matchLang", matchLang) - - b.w.WriteComment(` - matchScript holds pairs of scriptIDs where readers of one script - can typically also read the other. Each is associated with a confidence.`) - sort.SliceStable(matchScript, func(i, j int) bool { - return matchScript[i].distance < matchScript[j].distance - }) - b.w.WriteVar("matchScript", matchScript) - - sort.SliceStable(matchRegion, func(i, j int) bool { - return matchRegion[i].distance < matchRegion[j].distance - }) - b.w.WriteVar("matchRegion", matchRegion) -} diff --git a/vendor/golang.org/x/text/unicode/norm/maketables.go b/vendor/golang.org/x/text/unicode/norm/maketables.go deleted file mode 100644 index 30a3aa93..00000000 --- a/vendor/golang.org/x/text/unicode/norm/maketables.go +++ /dev/null @@ -1,986 +0,0 @@ -// Copyright 2011 The Go Authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the LICENSE file. - -// +build ignore - -// Normalization table generator. -// Data read from the web. -// See forminfo.go for a description of the trie values associated with each rune. - -package main - -import ( - "bytes" - "encoding/binary" - "flag" - "fmt" - "io" - "log" - "sort" - "strconv" - "strings" - - "golang.org/x/text/internal/gen" - "golang.org/x/text/internal/triegen" - "golang.org/x/text/internal/ucd" -) - -func main() { - gen.Init() - loadUnicodeData() - compactCCC() - loadCompositionExclusions() - completeCharFields(FCanonical) - completeCharFields(FCompatibility) - computeNonStarterCounts() - verifyComputed() - printChars() - testDerived() - printTestdata() - makeTables() -} - -var ( - tablelist = flag.String("tables", - "all", - "comma-separated list of which tables to generate; "+ - "can be 'decomp', 'recomp', 'info' and 'all'") - test = flag.Bool("test", - false, - "test existing tables against DerivedNormalizationProps and generate test data for regression testing") - verbose = flag.Bool("verbose", - false, - "write data to stdout as it is parsed") -) - -const MaxChar = 0x10FFFF // anything above this shouldn't exist - -// Quick Check properties of runes allow us to quickly -// determine whether a rune may occur in a normal form. -// For a given normal form, a rune may be guaranteed to occur -// verbatim (QC=Yes), may or may not combine with another -// rune (QC=Maybe), or may not occur (QC=No). -type QCResult int - -const ( - QCUnknown QCResult = iota - QCYes - QCNo - QCMaybe -) - -func (r QCResult) String() string { - switch r { - case QCYes: - return "Yes" - case QCNo: - return "No" - case QCMaybe: - return "Maybe" - } - return "***UNKNOWN***" -} - -const ( - FCanonical = iota // NFC or NFD - FCompatibility // NFKC or NFKD - FNumberOfFormTypes -) - -const ( - MComposed = iota // NFC or NFKC - MDecomposed // NFD or NFKD - MNumberOfModes -) - -// This contains only the properties we're interested in. -type Char struct { - name string - codePoint rune // if zero, this index is not a valid code point. - ccc uint8 // canonical combining class - origCCC uint8 - excludeInComp bool // from CompositionExclusions.txt - compatDecomp bool // it has a compatibility expansion - - nTrailingNonStarters uint8 - nLeadingNonStarters uint8 // must be equal to trailing if non-zero - - forms [FNumberOfFormTypes]FormInfo // For FCanonical and FCompatibility - - state State -} - -var chars = make([]Char, MaxChar+1) -var cccMap = make(map[uint8]uint8) - -func (c Char) String() string { - buf := new(bytes.Buffer) - - fmt.Fprintf(buf, "%U [%s]:\n", c.codePoint, c.name) - fmt.Fprintf(buf, " ccc: %v\n", c.ccc) - fmt.Fprintf(buf, " excludeInComp: %v\n", c.excludeInComp) - fmt.Fprintf(buf, " compatDecomp: %v\n", c.compatDecomp) - fmt.Fprintf(buf, " state: %v\n", c.state) - fmt.Fprintf(buf, " NFC:\n") - fmt.Fprint(buf, c.forms[FCanonical]) - fmt.Fprintf(buf, " NFKC:\n") - fmt.Fprint(buf, c.forms[FCompatibility]) - - return buf.String() -} - -// In UnicodeData.txt, some ranges are marked like this: -// 3400;;Lo;0;L;;;;;N;;;;; -// 4DB5;;Lo;0;L;;;;;N;;;;; -// parseCharacter keeps a state variable indicating the weirdness. -type State int - -const ( - SNormal State = iota // known to be zero for the type - SFirst - SLast - SMissing -) - -var lastChar = rune('\u0000') - -func (c Char) isValid() bool { - return c.codePoint != 0 && c.state != SMissing -} - -type FormInfo struct { - quickCheck [MNumberOfModes]QCResult // index: MComposed or MDecomposed - verified [MNumberOfModes]bool // index: MComposed or MDecomposed - - combinesForward bool // May combine with rune on the right - combinesBackward bool // May combine with rune on the left - isOneWay bool // Never appears in result - inDecomp bool // Some decompositions result in this char. - decomp Decomposition - expandedDecomp Decomposition -} - -func (f FormInfo) String() string { - buf := bytes.NewBuffer(make([]byte, 0)) - - fmt.Fprintf(buf, " quickCheck[C]: %v\n", f.quickCheck[MComposed]) - fmt.Fprintf(buf, " quickCheck[D]: %v\n", f.quickCheck[MDecomposed]) - fmt.Fprintf(buf, " cmbForward: %v\n", f.combinesForward) - fmt.Fprintf(buf, " cmbBackward: %v\n", f.combinesBackward) - fmt.Fprintf(buf, " isOneWay: %v\n", f.isOneWay) - fmt.Fprintf(buf, " inDecomp: %v\n", f.inDecomp) - fmt.Fprintf(buf, " decomposition: %X\n", f.decomp) - fmt.Fprintf(buf, " expandedDecomp: %X\n", f.expandedDecomp) - - return buf.String() -} - -type Decomposition []rune - -func parseDecomposition(s string, skipfirst bool) (a []rune, err error) { - decomp := strings.Split(s, " ") - if len(decomp) > 0 && skipfirst { - decomp = decomp[1:] - } - for _, d := range decomp { - point, err := strconv.ParseUint(d, 16, 64) - if err != nil { - return a, err - } - a = append(a, rune(point)) - } - return a, nil -} - -func loadUnicodeData() { - f := gen.OpenUCDFile("UnicodeData.txt") - defer f.Close() - p := ucd.New(f) - for p.Next() { - r := p.Rune(ucd.CodePoint) - char := &chars[r] - - char.ccc = uint8(p.Uint(ucd.CanonicalCombiningClass)) - decmap := p.String(ucd.DecompMapping) - - exp, err := parseDecomposition(decmap, false) - isCompat := false - if err != nil { - if len(decmap) > 0 { - exp, err = parseDecomposition(decmap, true) - if err != nil { - log.Fatalf(`%U: bad decomp |%v|: "%s"`, r, decmap, err) - } - isCompat = true - } - } - - char.name = p.String(ucd.Name) - char.codePoint = r - char.forms[FCompatibility].decomp = exp - if !isCompat { - char.forms[FCanonical].decomp = exp - } else { - char.compatDecomp = true - } - if len(decmap) > 0 { - char.forms[FCompatibility].decomp = exp - } - } - if err := p.Err(); err != nil { - log.Fatal(err) - } -} - -// compactCCC converts the sparse set of CCC values to a continguous one, -// reducing the number of bits needed from 8 to 6. -func compactCCC() { - m := make(map[uint8]uint8) - for i := range chars { - c := &chars[i] - m[c.ccc] = 0 - } - cccs := []int{} - for v, _ := range m { - cccs = append(cccs, int(v)) - } - sort.Ints(cccs) - for i, c := range cccs { - cccMap[uint8(i)] = uint8(c) - m[uint8(c)] = uint8(i) - } - for i := range chars { - c := &chars[i] - c.origCCC = c.ccc - c.ccc = m[c.ccc] - } - if len(m) >= 1<<6 { - log.Fatalf("too many difference CCC values: %d >= 64", len(m)) - } -} - -// CompositionExclusions.txt has form: -// 0958 # ... -// See https://unicode.org/reports/tr44/ for full explanation -func loadCompositionExclusions() { - f := gen.OpenUCDFile("CompositionExclusions.txt") - defer f.Close() - p := ucd.New(f) - for p.Next() { - c := &chars[p.Rune(0)] - if c.excludeInComp { - log.Fatalf("%U: Duplicate entry in exclusions.", c.codePoint) - } - c.excludeInComp = true - } - if e := p.Err(); e != nil { - log.Fatal(e) - } -} - -// hasCompatDecomp returns true if any of the recursive -// decompositions contains a compatibility expansion. -// In this case, the character may not occur in NFK*. -func hasCompatDecomp(r rune) bool { - c := &chars[r] - if c.compatDecomp { - return true - } - for _, d := range c.forms[FCompatibility].decomp { - if hasCompatDecomp(d) { - return true - } - } - return false -} - -// Hangul related constants. -const ( - HangulBase = 0xAC00 - HangulEnd = 0xD7A4 // hangulBase + Jamo combinations (19 * 21 * 28) - - JamoLBase = 0x1100 - JamoLEnd = 0x1113 - JamoVBase = 0x1161 - JamoVEnd = 0x1176 - JamoTBase = 0x11A8 - JamoTEnd = 0x11C3 - - JamoLVTCount = 19 * 21 * 28 - JamoTCount = 28 -) - -func isHangul(r rune) bool { - return HangulBase <= r && r < HangulEnd -} - -func isHangulWithoutJamoT(r rune) bool { - if !isHangul(r) { - return false - } - r -= HangulBase - return r < JamoLVTCount && r%JamoTCount == 0 -} - -func ccc(r rune) uint8 { - return chars[r].ccc -} - -// Insert a rune in a buffer, ordered by Canonical Combining Class. -func insertOrdered(b Decomposition, r rune) Decomposition { - n := len(b) - b = append(b, 0) - cc := ccc(r) - if cc > 0 { - // Use bubble sort. - for ; n > 0; n-- { - if ccc(b[n-1]) <= cc { - break - } - b[n] = b[n-1] - } - } - b[n] = r - return b -} - -// Recursively decompose. -func decomposeRecursive(form int, r rune, d Decomposition) Decomposition { - dcomp := chars[r].forms[form].decomp - if len(dcomp) == 0 { - return insertOrdered(d, r) - } - for _, c := range dcomp { - d = decomposeRecursive(form, c, d) - } - return d -} - -func completeCharFields(form int) { - // Phase 0: pre-expand decomposition. - for i := range chars { - f := &chars[i].forms[form] - if len(f.decomp) == 0 { - continue - } - exp := make(Decomposition, 0) - for _, c := range f.decomp { - exp = decomposeRecursive(form, c, exp) - } - f.expandedDecomp = exp - } - - // Phase 1: composition exclusion, mark decomposition. - for i := range chars { - c := &chars[i] - f := &c.forms[form] - - // Marks script-specific exclusions and version restricted. - f.isOneWay = c.excludeInComp - - // Singletons - f.isOneWay = f.isOneWay || len(f.decomp) == 1 - - // Non-starter decompositions - if len(f.decomp) > 1 { - chk := c.ccc != 0 || chars[f.decomp[0]].ccc != 0 - f.isOneWay = f.isOneWay || chk - } - - // Runes that decompose into more than two runes. - f.isOneWay = f.isOneWay || len(f.decomp) > 2 - - if form == FCompatibility { - f.isOneWay = f.isOneWay || hasCompatDecomp(c.codePoint) - } - - for _, r := range f.decomp { - chars[r].forms[form].inDecomp = true - } - } - - // Phase 2: forward and backward combining. - for i := range chars { - c := &chars[i] - f := &c.forms[form] - - if !f.isOneWay && len(f.decomp) == 2 { - f0 := &chars[f.decomp[0]].forms[form] - f1 := &chars[f.decomp[1]].forms[form] - if !f0.isOneWay { - f0.combinesForward = true - } - if !f1.isOneWay { - f1.combinesBackward = true - } - } - if isHangulWithoutJamoT(rune(i)) { - f.combinesForward = true - } - } - - // Phase 3: quick check values. - for i := range chars { - c := &chars[i] - f := &c.forms[form] - - switch { - case len(f.decomp) > 0: - f.quickCheck[MDecomposed] = QCNo - case isHangul(rune(i)): - f.quickCheck[MDecomposed] = QCNo - default: - f.quickCheck[MDecomposed] = QCYes - } - switch { - case f.isOneWay: - f.quickCheck[MComposed] = QCNo - case (i & 0xffff00) == JamoLBase: - f.quickCheck[MComposed] = QCYes - if JamoLBase <= i && i < JamoLEnd { - f.combinesForward = true - } - if JamoVBase <= i && i < JamoVEnd { - f.quickCheck[MComposed] = QCMaybe - f.combinesBackward = true - f.combinesForward = true - } - if JamoTBase <= i && i < JamoTEnd { - f.quickCheck[MComposed] = QCMaybe - f.combinesBackward = true - } - case !f.combinesBackward: - f.quickCheck[MComposed] = QCYes - default: - f.quickCheck[MComposed] = QCMaybe - } - } -} - -func computeNonStarterCounts() { - // Phase 4: leading and trailing non-starter count - for i := range chars { - c := &chars[i] - - runes := []rune{rune(i)} - // We always use FCompatibility so that the CGJ insertion points do not - // change for repeated normalizations with different forms. - if exp := c.forms[FCompatibility].expandedDecomp; len(exp) > 0 { - runes = exp - } - // We consider runes that combine backwards to be non-starters for the - // purpose of Stream-Safe Text Processing. - for _, r := range runes { - if cr := &chars[r]; cr.ccc == 0 && !cr.forms[FCompatibility].combinesBackward { - break - } - c.nLeadingNonStarters++ - } - for i := len(runes) - 1; i >= 0; i-- { - if cr := &chars[runes[i]]; cr.ccc == 0 && !cr.forms[FCompatibility].combinesBackward { - break - } - c.nTrailingNonStarters++ - } - if c.nTrailingNonStarters > 3 { - log.Fatalf("%U: Decomposition with more than 3 (%d) trailing modifiers (%U)", i, c.nTrailingNonStarters, runes) - } - - if isHangul(rune(i)) { - c.nTrailingNonStarters = 2 - if isHangulWithoutJamoT(rune(i)) { - c.nTrailingNonStarters = 1 - } - } - - if l, t := c.nLeadingNonStarters, c.nTrailingNonStarters; l > 0 && l != t { - log.Fatalf("%U: number of leading and trailing non-starters should be equal (%d vs %d)", i, l, t) - } - if t := c.nTrailingNonStarters; t > 3 { - log.Fatalf("%U: number of trailing non-starters is %d > 3", t) - } - } -} - -func printBytes(w io.Writer, b []byte, name string) { - fmt.Fprintf(w, "// %s: %d bytes\n", name, len(b)) - fmt.Fprintf(w, "var %s = [...]byte {", name) - for i, c := range b { - switch { - case i%64 == 0: - fmt.Fprintf(w, "\n// Bytes %x - %x\n", i, i+63) - case i%8 == 0: - fmt.Fprintf(w, "\n") - } - fmt.Fprintf(w, "0x%.2X, ", c) - } - fmt.Fprint(w, "\n}\n\n") -} - -// See forminfo.go for format. -func makeEntry(f *FormInfo, c *Char) uint16 { - e := uint16(0) - if r := c.codePoint; HangulBase <= r && r < HangulEnd { - e |= 0x40 - } - if f.combinesForward { - e |= 0x20 - } - if f.quickCheck[MDecomposed] == QCNo { - e |= 0x4 - } - switch f.quickCheck[MComposed] { - case QCYes: - case QCNo: - e |= 0x10 - case QCMaybe: - e |= 0x18 - default: - log.Fatalf("Illegal quickcheck value %v.", f.quickCheck[MComposed]) - } - e |= uint16(c.nTrailingNonStarters) - return e -} - -// decompSet keeps track of unique decompositions, grouped by whether -// the decomposition is followed by a trailing and/or leading CCC. -type decompSet [7]map[string]bool - -const ( - normalDecomp = iota - firstMulti - firstCCC - endMulti - firstLeadingCCC - firstCCCZeroExcept - firstStarterWithNLead - lastDecomp -) - -var cname = []string{"firstMulti", "firstCCC", "endMulti", "firstLeadingCCC", "firstCCCZeroExcept", "firstStarterWithNLead", "lastDecomp"} - -func makeDecompSet() decompSet { - m := decompSet{} - for i := range m { - m[i] = make(map[string]bool) - } - return m -} -func (m *decompSet) insert(key int, s string) { - m[key][s] = true -} - -func printCharInfoTables(w io.Writer) int { - mkstr := func(r rune, f *FormInfo) (int, string) { - d := f.expandedDecomp - s := string([]rune(d)) - if max := 1 << 6; len(s) >= max { - const msg = "%U: too many bytes in decomposition: %d >= %d" - log.Fatalf(msg, r, len(s), max) - } - head := uint8(len(s)) - if f.quickCheck[MComposed] != QCYes { - head |= 0x40 - } - if f.combinesForward { - head |= 0x80 - } - s = string([]byte{head}) + s - - lccc := ccc(d[0]) - tccc := ccc(d[len(d)-1]) - cc := ccc(r) - if cc != 0 && lccc == 0 && tccc == 0 { - log.Fatalf("%U: trailing and leading ccc are 0 for non-zero ccc %d", r, cc) - } - if tccc < lccc && lccc != 0 { - const msg = "%U: lccc (%d) must be <= tcc (%d)" - log.Fatalf(msg, r, lccc, tccc) - } - index := normalDecomp - nTrail := chars[r].nTrailingNonStarters - nLead := chars[r].nLeadingNonStarters - if tccc > 0 || lccc > 0 || nTrail > 0 { - tccc <<= 2 - tccc |= nTrail - s += string([]byte{tccc}) - index = endMulti - for _, r := range d[1:] { - if ccc(r) == 0 { - index = firstCCC - } - } - if lccc > 0 || nLead > 0 { - s += string([]byte{lccc}) - if index == firstCCC { - log.Fatalf("%U: multi-segment decomposition not supported for decompositions with leading CCC != 0", r) - } - index = firstLeadingCCC - } - if cc != lccc { - if cc != 0 { - log.Fatalf("%U: for lccc != ccc, expected ccc to be 0; was %d", r, cc) - } - index = firstCCCZeroExcept - } - } else if len(d) > 1 { - index = firstMulti - } - return index, s - } - - decompSet := makeDecompSet() - const nLeadStr = "\x00\x01" // 0-byte length and tccc with nTrail. - decompSet.insert(firstStarterWithNLead, nLeadStr) - - // Store the uniqued decompositions in a byte buffer, - // preceded by their byte length. - for _, c := range chars { - for _, f := range c.forms { - if len(f.expandedDecomp) == 0 { - continue - } - if f.combinesBackward { - log.Fatalf("%U: combinesBackward and decompose", c.codePoint) - } - index, s := mkstr(c.codePoint, &f) - decompSet.insert(index, s) - } - } - - decompositions := bytes.NewBuffer(make([]byte, 0, 10000)) - size := 0 - positionMap := make(map[string]uint16) - decompositions.WriteString("\000") - fmt.Fprintln(w, "const (") - for i, m := range decompSet { - sa := []string{} - for s := range m { - sa = append(sa, s) - } - sort.Strings(sa) - for _, s := range sa { - p := decompositions.Len() - decompositions.WriteString(s) - positionMap[s] = uint16(p) - } - if cname[i] != "" { - fmt.Fprintf(w, "%s = 0x%X\n", cname[i], decompositions.Len()) - } - } - fmt.Fprintln(w, "maxDecomp = 0x8000") - fmt.Fprintln(w, ")") - b := decompositions.Bytes() - printBytes(w, b, "decomps") - size += len(b) - - varnames := []string{"nfc", "nfkc"} - for i := 0; i < FNumberOfFormTypes; i++ { - trie := triegen.NewTrie(varnames[i]) - - for r, c := range chars { - f := c.forms[i] - d := f.expandedDecomp - if len(d) != 0 { - _, key := mkstr(c.codePoint, &f) - trie.Insert(rune(r), uint64(positionMap[key])) - if c.ccc != ccc(d[0]) { - // We assume the lead ccc of a decomposition !=0 in this case. - if ccc(d[0]) == 0 { - log.Fatalf("Expected leading CCC to be non-zero; ccc is %d", c.ccc) - } - } - } else if c.nLeadingNonStarters > 0 && len(f.expandedDecomp) == 0 && c.ccc == 0 && !f.combinesBackward { - // Handle cases where it can't be detected that the nLead should be equal - // to nTrail. - trie.Insert(c.codePoint, uint64(positionMap[nLeadStr])) - } else if v := makeEntry(&f, &c)<<8 | uint16(c.ccc); v != 0 { - trie.Insert(c.codePoint, uint64(0x8000|v)) - } - } - sz, err := trie.Gen(w, triegen.Compact(&normCompacter{name: varnames[i]})) - if err != nil { - log.Fatal(err) - } - size += sz - } - return size -} - -func contains(sa []string, s string) bool { - for _, a := range sa { - if a == s { - return true - } - } - return false -} - -func makeTables() { - w := &bytes.Buffer{} - - size := 0 - if *tablelist == "" { - return - } - list := strings.Split(*tablelist, ",") - if *tablelist == "all" { - list = []string{"recomp", "info"} - } - - // Compute maximum decomposition size. - max := 0 - for _, c := range chars { - if n := len(string(c.forms[FCompatibility].expandedDecomp)); n > max { - max = n - } - } - fmt.Fprintln(w, `import "sync"`) - fmt.Fprintln(w) - - fmt.Fprintln(w, "const (") - fmt.Fprintln(w, "\t// Version is the Unicode edition from which the tables are derived.") - fmt.Fprintf(w, "\tVersion = %q\n", gen.UnicodeVersion()) - fmt.Fprintln(w) - fmt.Fprintln(w, "\t// MaxTransformChunkSize indicates the maximum number of bytes that Transform") - fmt.Fprintln(w, "\t// may need to write atomically for any Form. Making a destination buffer at") - fmt.Fprintln(w, "\t// least this size ensures that Transform can always make progress and that") - fmt.Fprintln(w, "\t// the user does not need to grow the buffer on an ErrShortDst.") - fmt.Fprintf(w, "\tMaxTransformChunkSize = %d+maxNonStarters*4\n", len(string(0x034F))+max) - fmt.Fprintln(w, ")\n") - - // Print the CCC remap table. - size += len(cccMap) - fmt.Fprintf(w, "var ccc = [%d]uint8{", len(cccMap)) - for i := 0; i < len(cccMap); i++ { - if i%8 == 0 { - fmt.Fprintln(w) - } - fmt.Fprintf(w, "%3d, ", cccMap[uint8(i)]) - } - fmt.Fprintln(w, "\n}\n") - - if contains(list, "info") { - size += printCharInfoTables(w) - } - - if contains(list, "recomp") { - // Note that we use 32 bit keys, instead of 64 bit. - // This clips the bits of three entries, but we know - // this won't cause a collision. The compiler will catch - // any changes made to UnicodeData.txt that introduces - // a collision. - // Note that the recomposition map for NFC and NFKC - // are identical. - - // Recomposition map - nrentries := 0 - for _, c := range chars { - f := c.forms[FCanonical] - if !f.isOneWay && len(f.decomp) > 0 { - nrentries++ - } - } - sz := nrentries * 8 - size += sz - fmt.Fprintf(w, "// recompMap: %d bytes (entries only)\n", sz) - fmt.Fprintln(w, "var recompMap map[uint32]rune") - fmt.Fprintln(w, "var recompMapOnce sync.Once\n") - fmt.Fprintln(w, `const recompMapPacked = "" +`) - var buf [8]byte - for i, c := range chars { - f := c.forms[FCanonical] - d := f.decomp - if !f.isOneWay && len(d) > 0 { - key := uint32(uint16(d[0]))<<16 + uint32(uint16(d[1])) - binary.BigEndian.PutUint32(buf[:4], key) - binary.BigEndian.PutUint32(buf[4:], uint32(i)) - fmt.Fprintf(w, "\t\t%q + // 0x%.8X: 0x%.8X\n", string(buf[:]), key, uint32(i)) - } - } - // hack so we don't have to special case the trailing plus sign - fmt.Fprintf(w, ` ""`) - fmt.Fprintln(w) - } - - fmt.Fprintf(w, "// Total size of tables: %dKB (%d bytes)\n", (size+512)/1024, size) - gen.WriteVersionedGoFile("tables.go", "norm", w.Bytes()) -} - -func printChars() { - if *verbose { - for _, c := range chars { - if !c.isValid() || c.state == SMissing { - continue - } - fmt.Println(c) - } - } -} - -// verifyComputed does various consistency tests. -func verifyComputed() { - for i, c := range chars { - for _, f := range c.forms { - isNo := (f.quickCheck[MDecomposed] == QCNo) - if (len(f.decomp) > 0) != isNo && !isHangul(rune(i)) { - log.Fatalf("%U: NF*D QC must be No if rune decomposes", i) - } - - isMaybe := f.quickCheck[MComposed] == QCMaybe - if f.combinesBackward != isMaybe { - log.Fatalf("%U: NF*C QC must be Maybe if combinesBackward", i) - } - if len(f.decomp) > 0 && f.combinesForward && isMaybe { - log.Fatalf("%U: NF*C QC must be Yes or No if combinesForward and decomposes", i) - } - - if len(f.expandedDecomp) != 0 { - continue - } - if a, b := c.nLeadingNonStarters > 0, (c.ccc > 0 || f.combinesBackward); a != b { - // We accept these runes to be treated differently (it only affects - // segment breaking in iteration, most likely on improper use), but - // reconsider if more characters are added. - // U+FF9E HALFWIDTH KATAKANA VOICED SOUND MARK;Lm;0;L; 3099;;;;N;;;;; - // U+FF9F HALFWIDTH KATAKANA SEMI-VOICED SOUND MARK;Lm;0;L; 309A;;;;N;;;;; - // U+3133 HANGUL LETTER KIYEOK-SIOS;Lo;0;L; 11AA;;;;N;HANGUL LETTER GIYEOG SIOS;;;; - // U+318E HANGUL LETTER ARAEAE;Lo;0;L; 11A1;;;;N;HANGUL LETTER ALAE AE;;;; - // U+FFA3 HALFWIDTH HANGUL LETTER KIYEOK-SIOS;Lo;0;L; 3133;;;;N;HALFWIDTH HANGUL LETTER GIYEOG SIOS;;;; - // U+FFDC HALFWIDTH HANGUL LETTER I;Lo;0;L; 3163;;;;N;;;;; - if i != 0xFF9E && i != 0xFF9F && !(0x3133 <= i && i <= 0x318E) && !(0xFFA3 <= i && i <= 0xFFDC) { - log.Fatalf("%U: nLead was %v; want %v", i, a, b) - } - } - } - nfc := c.forms[FCanonical] - nfkc := c.forms[FCompatibility] - if nfc.combinesBackward != nfkc.combinesBackward { - log.Fatalf("%U: Cannot combine combinesBackward\n", c.codePoint) - } - } -} - -// Use values in DerivedNormalizationProps.txt to compare against the -// values we computed. -// DerivedNormalizationProps.txt has form: -// 00C0..00C5 ; NFD_QC; N # ... -// 0374 ; NFD_QC; N # ... -// See https://unicode.org/reports/tr44/ for full explanation -func testDerived() { - f := gen.OpenUCDFile("DerivedNormalizationProps.txt") - defer f.Close() - p := ucd.New(f) - for p.Next() { - r := p.Rune(0) - c := &chars[r] - - var ftype, mode int - qt := p.String(1) - switch qt { - case "NFC_QC": - ftype, mode = FCanonical, MComposed - case "NFD_QC": - ftype, mode = FCanonical, MDecomposed - case "NFKC_QC": - ftype, mode = FCompatibility, MComposed - case "NFKD_QC": - ftype, mode = FCompatibility, MDecomposed - default: - continue - } - var qr QCResult - switch p.String(2) { - case "Y": - qr = QCYes - case "N": - qr = QCNo - case "M": - qr = QCMaybe - default: - log.Fatalf(`Unexpected quick check value "%s"`, p.String(2)) - } - if got := c.forms[ftype].quickCheck[mode]; got != qr { - log.Printf("%U: FAILED %s (was %v need %v)\n", r, qt, got, qr) - } - c.forms[ftype].verified[mode] = true - } - if err := p.Err(); err != nil { - log.Fatal(err) - } - // Any unspecified value must be QCYes. Verify this. - for i, c := range chars { - for j, fd := range c.forms { - for k, qr := range fd.quickCheck { - if !fd.verified[k] && qr != QCYes { - m := "%U: FAIL F:%d M:%d (was %v need Yes) %s\n" - log.Printf(m, i, j, k, qr, c.name) - } - } - } - } -} - -var testHeader = `const ( - Yes = iota - No - Maybe -) - -type formData struct { - qc uint8 - combinesForward bool - decomposition string -} - -type runeData struct { - r rune - ccc uint8 - nLead uint8 - nTrail uint8 - f [2]formData // 0: canonical; 1: compatibility -} - -func f(qc uint8, cf bool, dec string) [2]formData { - return [2]formData{{qc, cf, dec}, {qc, cf, dec}} -} - -func g(qc, qck uint8, cf, cfk bool, d, dk string) [2]formData { - return [2]formData{{qc, cf, d}, {qck, cfk, dk}} -} - -var testData = []runeData{ -` - -func printTestdata() { - type lastInfo struct { - ccc uint8 - nLead uint8 - nTrail uint8 - f string - } - - last := lastInfo{} - w := &bytes.Buffer{} - fmt.Fprintf(w, testHeader) - for r, c := range chars { - f := c.forms[FCanonical] - qc, cf, d := f.quickCheck[MComposed], f.combinesForward, string(f.expandedDecomp) - f = c.forms[FCompatibility] - qck, cfk, dk := f.quickCheck[MComposed], f.combinesForward, string(f.expandedDecomp) - s := "" - if d == dk && qc == qck && cf == cfk { - s = fmt.Sprintf("f(%s, %v, %q)", qc, cf, d) - } else { - s = fmt.Sprintf("g(%s, %s, %v, %v, %q, %q)", qc, qck, cf, cfk, d, dk) - } - current := lastInfo{c.ccc, c.nLeadingNonStarters, c.nTrailingNonStarters, s} - if last != current { - fmt.Fprintf(w, "\t{0x%x, %d, %d, %d, %s},\n", r, c.origCCC, c.nLeadingNonStarters, c.nTrailingNonStarters, s) - last = current - } - } - fmt.Fprintln(w, "}") - gen.WriteVersionedGoFile("data_test.go", "norm", w.Bytes()) -} diff --git a/vendor/golang.org/x/text/unicode/norm/triegen.go b/vendor/golang.org/x/text/unicode/norm/triegen.go deleted file mode 100644 index 45d71190..00000000 --- a/vendor/golang.org/x/text/unicode/norm/triegen.go +++ /dev/null @@ -1,117 +0,0 @@ -// Copyright 2011 The Go Authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the LICENSE file. - -// +build ignore - -// Trie table generator. -// Used by make*tables tools to generate a go file with trie data structures -// for mapping UTF-8 to a 16-bit value. All but the last byte in a UTF-8 byte -// sequence are used to lookup offsets in the index table to be used for the -// next byte. The last byte is used to index into a table with 16-bit values. - -package main - -import ( - "fmt" - "io" -) - -const maxSparseEntries = 16 - -type normCompacter struct { - sparseBlocks [][]uint64 - sparseOffset []uint16 - sparseCount int - name string -} - -func mostFrequentStride(a []uint64) int { - counts := make(map[int]int) - var v int - for _, x := range a { - if stride := int(x) - v; v != 0 && stride >= 0 { - counts[stride]++ - } - v = int(x) - } - var maxs, maxc int - for stride, cnt := range counts { - if cnt > maxc || (cnt == maxc && stride < maxs) { - maxs, maxc = stride, cnt - } - } - return maxs -} - -func countSparseEntries(a []uint64) int { - stride := mostFrequentStride(a) - var v, count int - for _, tv := range a { - if int(tv)-v != stride { - if tv != 0 { - count++ - } - } - v = int(tv) - } - return count -} - -func (c *normCompacter) Size(v []uint64) (sz int, ok bool) { - if n := countSparseEntries(v); n <= maxSparseEntries { - return (n+1)*4 + 2, true - } - return 0, false -} - -func (c *normCompacter) Store(v []uint64) uint32 { - h := uint32(len(c.sparseOffset)) - c.sparseBlocks = append(c.sparseBlocks, v) - c.sparseOffset = append(c.sparseOffset, uint16(c.sparseCount)) - c.sparseCount += countSparseEntries(v) + 1 - return h -} - -func (c *normCompacter) Handler() string { - return c.name + "Sparse.lookup" -} - -func (c *normCompacter) Print(w io.Writer) (retErr error) { - p := func(f string, x ...interface{}) { - if _, err := fmt.Fprintf(w, f, x...); retErr == nil && err != nil { - retErr = err - } - } - - ls := len(c.sparseBlocks) - p("// %sSparseOffset: %d entries, %d bytes\n", c.name, ls, ls*2) - p("var %sSparseOffset = %#v\n\n", c.name, c.sparseOffset) - - ns := c.sparseCount - p("// %sSparseValues: %d entries, %d bytes\n", c.name, ns, ns*4) - p("var %sSparseValues = [%d]valueRange {", c.name, ns) - for i, b := range c.sparseBlocks { - p("\n// Block %#x, offset %#x", i, c.sparseOffset[i]) - var v int - stride := mostFrequentStride(b) - n := countSparseEntries(b) - p("\n{value:%#04x,lo:%#02x},", stride, uint8(n)) - for i, nv := range b { - if int(nv)-v != stride { - if v != 0 { - p(",hi:%#02x},", 0x80+i-1) - } - if nv != 0 { - p("\n{value:%#04x,lo:%#02x", nv, 0x80+i) - } - } - v = int(nv) - } - if v != 0 { - p(",hi:%#02x},", 0x80+len(b)-1) - } - } - p("\n}\n\n") - return -} diff --git a/vendor/golang.org/x/tools/go/gcexportdata/main.go b/vendor/golang.org/x/tools/go/gcexportdata/main.go deleted file mode 100644 index 2713dce6..00000000 --- a/vendor/golang.org/x/tools/go/gcexportdata/main.go +++ /dev/null @@ -1,99 +0,0 @@ -// Copyright 2017 The Go Authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the LICENSE file. - -// +build ignore - -// The gcexportdata command is a diagnostic tool that displays the -// contents of gc export data files. -package main - -import ( - "flag" - "fmt" - "go/token" - "go/types" - "log" - "os" - - "golang.org/x/tools/go/gcexportdata" - "golang.org/x/tools/go/types/typeutil" -) - -var packageFlag = flag.String("package", "", "alternative package to print") - -func main() { - log.SetPrefix("gcexportdata: ") - log.SetFlags(0) - flag.Usage = func() { - fmt.Fprintln(os.Stderr, "usage: gcexportdata [-package path] file.a") - } - flag.Parse() - if flag.NArg() != 1 { - flag.Usage() - os.Exit(2) - } - filename := flag.Args()[0] - - f, err := os.Open(filename) - if err != nil { - log.Fatal(err) - } - - r, err := gcexportdata.NewReader(f) - if err != nil { - log.Fatalf("%s: %s", filename, err) - } - - // Decode the package. - const primary = "" - imports := make(map[string]*types.Package) - fset := token.NewFileSet() - pkg, err := gcexportdata.Read(r, fset, imports, primary) - if err != nil { - log.Fatalf("%s: %s", filename, err) - } - - // Optionally select an indirectly mentioned package. - if *packageFlag != "" { - pkg = imports[*packageFlag] - if pkg == nil { - fmt.Fprintf(os.Stderr, "export data file %s does not mention %s; has:\n", - filename, *packageFlag) - for p := range imports { - if p != primary { - fmt.Fprintf(os.Stderr, "\t%s\n", p) - } - } - os.Exit(1) - } - } - - // Print all package-level declarations, including non-exported ones. - fmt.Printf("package %s\n", pkg.Name()) - for _, imp := range pkg.Imports() { - fmt.Printf("import %q\n", imp.Path()) - } - qual := func(p *types.Package) string { - if pkg == p { - return "" - } - return p.Name() - } - scope := pkg.Scope() - for _, name := range scope.Names() { - obj := scope.Lookup(name) - fmt.Printf("%s: %s\n", - fset.Position(obj.Pos()), - types.ObjectString(obj, qual)) - - // For types, print each method. - if _, ok := obj.(*types.TypeName); ok { - for _, method := range typeutil.IntuitiveMethodSet(obj.Type(), nil) { - fmt.Printf("%s: %s\n", - fset.Position(method.Obj().Pos()), - types.SelectionString(method, qual)) - } - } - } -} diff --git a/vendor/google.golang.org/genproto/LICENSE b/vendor/google.golang.org/genproto/LICENSE new file mode 100644 index 00000000..d6456956 --- /dev/null +++ b/vendor/google.golang.org/genproto/LICENSE @@ -0,0 +1,202 @@ + + Apache License + Version 2.0, January 2004 + http://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + APPENDIX: How to apply the Apache License to your work. + + To apply the Apache License to your work, attach the following + boilerplate notice, with the fields enclosed by brackets "[]" + replaced with your own identifying information. (Don't include + the brackets!) The text should be enclosed in the appropriate + comment syntax for the file format. We also recommend that a + file or class name and description of purpose be included on the + same "printed page" as the copyright notice for easier + identification within third-party archives. + + Copyright [yyyy] [name of copyright owner] + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. diff --git a/vendor/google.golang.org/genproto/googleapis/rpc/status/status.pb.go b/vendor/google.golang.org/genproto/googleapis/rpc/status/status.pb.go new file mode 100644 index 00000000..0b9907f8 --- /dev/null +++ b/vendor/google.golang.org/genproto/googleapis/rpc/status/status.pb.go @@ -0,0 +1,163 @@ +// Code generated by protoc-gen-go. DO NOT EDIT. +// source: google/rpc/status.proto + +package status + +import ( + fmt "fmt" + math "math" + + proto "github.com/golang/protobuf/proto" + any "github.com/golang/protobuf/ptypes/any" +) + +// Reference imports to suppress errors if they are not otherwise used. +var _ = proto.Marshal +var _ = fmt.Errorf +var _ = math.Inf + +// This is a compile-time assertion to ensure that this generated file +// is compatible with the proto package it is being compiled against. +// A compilation error at this line likely means your copy of the +// proto package needs to be updated. +const _ = proto.ProtoPackageIsVersion3 // please upgrade the proto package + +// The `Status` type defines a logical error model that is suitable for +// different programming environments, including REST APIs and RPC APIs. It is +// used by [gRPC](https://github.com/grpc). The error model is designed to be: +// +// - Simple to use and understand for most users +// - Flexible enough to meet unexpected needs +// +// # Overview +// +// The `Status` message contains three pieces of data: error code, error +// message, and error details. The error code should be an enum value of +// [google.rpc.Code][google.rpc.Code], but it may accept additional error codes +// if needed. The error message should be a developer-facing English message +// that helps developers *understand* and *resolve* the error. If a localized +// user-facing error message is needed, put the localized message in the error +// details or localize it in the client. The optional error details may contain +// arbitrary information about the error. There is a predefined set of error +// detail types in the package `google.rpc` that can be used for common error +// conditions. +// +// # Language mapping +// +// The `Status` message is the logical representation of the error model, but it +// is not necessarily the actual wire format. When the `Status` message is +// exposed in different client libraries and different wire protocols, it can be +// mapped differently. For example, it will likely be mapped to some exceptions +// in Java, but more likely mapped to some error codes in C. +// +// # Other uses +// +// The error model and the `Status` message can be used in a variety of +// environments, either with or without APIs, to provide a +// consistent developer experience across different environments. +// +// Example uses of this error model include: +// +// - Partial errors. If a service needs to return partial errors to the client, +// it may embed the `Status` in the normal response to indicate the partial +// errors. +// +// - Workflow errors. A typical workflow has multiple steps. Each step may +// have a `Status` message for error reporting. +// +// - Batch operations. If a client uses batch request and batch response, the +// `Status` message should be used directly inside batch response, one for +// each error sub-response. +// +// - Asynchronous operations. If an API call embeds asynchronous operation +// results in its response, the status of those operations should be +// represented directly using the `Status` message. +// +// - Logging. If some API errors are stored in logs, the message `Status` could +// be used directly after any stripping needed for security/privacy reasons. +type Status struct { + // The status code, which should be an enum value of + // [google.rpc.Code][google.rpc.Code]. + Code int32 `protobuf:"varint,1,opt,name=code,proto3" json:"code,omitempty"` + // A developer-facing error message, which should be in English. Any + // user-facing error message should be localized and sent in the + // [google.rpc.Status.details][google.rpc.Status.details] field, or localized + // by the client. + Message string `protobuf:"bytes,2,opt,name=message,proto3" json:"message,omitempty"` + // A list of messages that carry the error details. There is a common set of + // message types for APIs to use. + Details []*any.Any `protobuf:"bytes,3,rep,name=details,proto3" json:"details,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *Status) Reset() { *m = Status{} } +func (m *Status) String() string { return proto.CompactTextString(m) } +func (*Status) ProtoMessage() {} +func (*Status) Descriptor() ([]byte, []int) { + return fileDescriptor_24d244abaf643bfe, []int{0} +} + +func (m *Status) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_Status.Unmarshal(m, b) +} +func (m *Status) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_Status.Marshal(b, m, deterministic) +} +func (m *Status) XXX_Merge(src proto.Message) { + xxx_messageInfo_Status.Merge(m, src) +} +func (m *Status) XXX_Size() int { + return xxx_messageInfo_Status.Size(m) +} +func (m *Status) XXX_DiscardUnknown() { + xxx_messageInfo_Status.DiscardUnknown(m) +} + +var xxx_messageInfo_Status proto.InternalMessageInfo + +func (m *Status) GetCode() int32 { + if m != nil { + return m.Code + } + return 0 +} + +func (m *Status) GetMessage() string { + if m != nil { + return m.Message + } + return "" +} + +func (m *Status) GetDetails() []*any.Any { + if m != nil { + return m.Details + } + return nil +} + +func init() { + proto.RegisterType((*Status)(nil), "google.rpc.Status") +} + +func init() { proto.RegisterFile("google/rpc/status.proto", fileDescriptor_24d244abaf643bfe) } + +var fileDescriptor_24d244abaf643bfe = []byte{ + // 209 bytes of a gzipped FileDescriptorProto + 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0xe2, 0x12, 0x4f, 0xcf, 0xcf, 0x4f, + 0xcf, 0x49, 0xd5, 0x2f, 0x2a, 0x48, 0xd6, 0x2f, 0x2e, 0x49, 0x2c, 0x29, 0x2d, 0xd6, 0x2b, 0x28, + 0xca, 0x2f, 0xc9, 0x17, 0xe2, 0x82, 0x48, 0xe8, 0x15, 0x15, 0x24, 0x4b, 0x49, 0x42, 0x15, 0x81, + 0x65, 0x92, 0x4a, 0xd3, 0xf4, 0x13, 0xf3, 0x2a, 0x21, 0xca, 0x94, 0xd2, 0xb8, 0xd8, 0x82, 0xc1, + 0xda, 0x84, 0x84, 0xb8, 0x58, 0x92, 0xf3, 0x53, 0x52, 0x25, 0x18, 0x15, 0x18, 0x35, 0x58, 0x83, + 0xc0, 0x6c, 0x21, 0x09, 0x2e, 0xf6, 0xdc, 0xd4, 0xe2, 0xe2, 0xc4, 0xf4, 0x54, 0x09, 0x26, 0x05, + 0x46, 0x0d, 0xce, 0x20, 0x18, 0x57, 0x48, 0x8f, 0x8b, 0x3d, 0x25, 0xb5, 0x24, 0x31, 0x33, 0xa7, + 0x58, 0x82, 0x59, 0x81, 0x59, 0x83, 0xdb, 0x48, 0x44, 0x0f, 0x6a, 0x21, 0xcc, 0x12, 0x3d, 0xc7, + 0xbc, 0xca, 0x20, 0x98, 0x22, 0xa7, 0x38, 0x2e, 0xbe, 0xe4, 0xfc, 0x5c, 0x3d, 0x84, 0xa3, 0x9c, + 0xb8, 0x21, 0xf6, 0x06, 0x80, 0x94, 0x07, 0x30, 0x46, 0x99, 0x43, 0xa5, 0xd2, 0xf3, 0x73, 0x12, + 0xf3, 0xd2, 0xf5, 0xf2, 0x8b, 0xd2, 0xf5, 0xd3, 0x53, 0xf3, 0xc0, 0x86, 0xe9, 0x43, 0xa4, 0x12, + 0x0b, 0x32, 0x8b, 0x91, 0xfc, 0x69, 0x0d, 0xa1, 0x16, 0x31, 0x31, 0x07, 0x05, 0x38, 0x27, 0xb1, + 0x81, 0x55, 0x1a, 0x03, 0x02, 0x00, 0x00, 0xff, 0xff, 0xa4, 0x53, 0xf0, 0x7c, 0x10, 0x01, 0x00, + 0x00, +} diff --git a/vendor/google.golang.org/grpc/AUTHORS b/vendor/google.golang.org/grpc/AUTHORS new file mode 100644 index 00000000..e491a9e7 --- /dev/null +++ b/vendor/google.golang.org/grpc/AUTHORS @@ -0,0 +1 @@ +Google Inc. diff --git a/vendor/google.golang.org/grpc/LICENSE b/vendor/google.golang.org/grpc/LICENSE new file mode 100644 index 00000000..d6456956 --- /dev/null +++ b/vendor/google.golang.org/grpc/LICENSE @@ -0,0 +1,202 @@ + + Apache License + Version 2.0, January 2004 + http://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + APPENDIX: How to apply the Apache License to your work. + + To apply the Apache License to your work, attach the following + boilerplate notice, with the fields enclosed by brackets "[]" + replaced with your own identifying information. (Don't include + the brackets!) The text should be enclosed in the appropriate + comment syntax for the file format. We also recommend that a + file or class name and description of purpose be included on the + same "printed page" as the copyright notice for easier + identification within third-party archives. + + Copyright [yyyy] [name of copyright owner] + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. diff --git a/vendor/google.golang.org/grpc/codes/code_string.go b/vendor/google.golang.org/grpc/codes/code_string.go new file mode 100644 index 00000000..0b206a57 --- /dev/null +++ b/vendor/google.golang.org/grpc/codes/code_string.go @@ -0,0 +1,62 @@ +/* + * + * Copyright 2017 gRPC authors. + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + */ + +package codes + +import "strconv" + +func (c Code) String() string { + switch c { + case OK: + return "OK" + case Canceled: + return "Canceled" + case Unknown: + return "Unknown" + case InvalidArgument: + return "InvalidArgument" + case DeadlineExceeded: + return "DeadlineExceeded" + case NotFound: + return "NotFound" + case AlreadyExists: + return "AlreadyExists" + case PermissionDenied: + return "PermissionDenied" + case ResourceExhausted: + return "ResourceExhausted" + case FailedPrecondition: + return "FailedPrecondition" + case Aborted: + return "Aborted" + case OutOfRange: + return "OutOfRange" + case Unimplemented: + return "Unimplemented" + case Internal: + return "Internal" + case Unavailable: + return "Unavailable" + case DataLoss: + return "DataLoss" + case Unauthenticated: + return "Unauthenticated" + default: + return "Code(" + strconv.FormatInt(int64(c), 10) + ")" + } +} diff --git a/vendor/google.golang.org/grpc/codes/codes.go b/vendor/google.golang.org/grpc/codes/codes.go new file mode 100644 index 00000000..02738839 --- /dev/null +++ b/vendor/google.golang.org/grpc/codes/codes.go @@ -0,0 +1,198 @@ +/* + * + * Copyright 2014 gRPC authors. + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + */ + +// Package codes defines the canonical error codes used by gRPC. It is +// consistent across various languages. +package codes // import "google.golang.org/grpc/codes" + +import ( + "fmt" + "strconv" +) + +// A Code is an unsigned 32-bit error code as defined in the gRPC spec. +type Code uint32 + +const ( + // OK is returned on success. + OK Code = 0 + + // Canceled indicates the operation was canceled (typically by the caller). + Canceled Code = 1 + + // Unknown error. An example of where this error may be returned is + // if a Status value received from another address space belongs to + // an error-space that is not known in this address space. Also + // errors raised by APIs that do not return enough error information + // may be converted to this error. + Unknown Code = 2 + + // InvalidArgument indicates client specified an invalid argument. + // Note that this differs from FailedPrecondition. It indicates arguments + // that are problematic regardless of the state of the system + // (e.g., a malformed file name). + InvalidArgument Code = 3 + + // DeadlineExceeded means operation expired before completion. + // For operations that change the state of the system, this error may be + // returned even if the operation has completed successfully. For + // example, a successful response from a server could have been delayed + // long enough for the deadline to expire. + DeadlineExceeded Code = 4 + + // NotFound means some requested entity (e.g., file or directory) was + // not found. + NotFound Code = 5 + + // AlreadyExists means an attempt to create an entity failed because one + // already exists. + AlreadyExists Code = 6 + + // PermissionDenied indicates the caller does not have permission to + // execute the specified operation. It must not be used for rejections + // caused by exhausting some resource (use ResourceExhausted + // instead for those errors). It must not be + // used if the caller cannot be identified (use Unauthenticated + // instead for those errors). + PermissionDenied Code = 7 + + // ResourceExhausted indicates some resource has been exhausted, perhaps + // a per-user quota, or perhaps the entire file system is out of space. + ResourceExhausted Code = 8 + + // FailedPrecondition indicates operation was rejected because the + // system is not in a state required for the operation's execution. + // For example, directory to be deleted may be non-empty, an rmdir + // operation is applied to a non-directory, etc. + // + // A litmus test that may help a service implementor in deciding + // between FailedPrecondition, Aborted, and Unavailable: + // (a) Use Unavailable if the client can retry just the failing call. + // (b) Use Aborted if the client should retry at a higher-level + // (e.g., restarting a read-modify-write sequence). + // (c) Use FailedPrecondition if the client should not retry until + // the system state has been explicitly fixed. E.g., if an "rmdir" + // fails because the directory is non-empty, FailedPrecondition + // should be returned since the client should not retry unless + // they have first fixed up the directory by deleting files from it. + // (d) Use FailedPrecondition if the client performs conditional + // REST Get/Update/Delete on a resource and the resource on the + // server does not match the condition. E.g., conflicting + // read-modify-write on the same resource. + FailedPrecondition Code = 9 + + // Aborted indicates the operation was aborted, typically due to a + // concurrency issue like sequencer check failures, transaction aborts, + // etc. + // + // See litmus test above for deciding between FailedPrecondition, + // Aborted, and Unavailable. + Aborted Code = 10 + + // OutOfRange means operation was attempted past the valid range. + // E.g., seeking or reading past end of file. + // + // Unlike InvalidArgument, this error indicates a problem that may + // be fixed if the system state changes. For example, a 32-bit file + // system will generate InvalidArgument if asked to read at an + // offset that is not in the range [0,2^32-1], but it will generate + // OutOfRange if asked to read from an offset past the current + // file size. + // + // There is a fair bit of overlap between FailedPrecondition and + // OutOfRange. We recommend using OutOfRange (the more specific + // error) when it applies so that callers who are iterating through + // a space can easily look for an OutOfRange error to detect when + // they are done. + OutOfRange Code = 11 + + // Unimplemented indicates operation is not implemented or not + // supported/enabled in this service. + Unimplemented Code = 12 + + // Internal errors. Means some invariants expected by underlying + // system has been broken. If you see one of these errors, + // something is very broken. + Internal Code = 13 + + // Unavailable indicates the service is currently unavailable. + // This is a most likely a transient condition and may be corrected + // by retrying with a backoff. Note that it is not always safe to retry + // non-idempotent operations. + // + // See litmus test above for deciding between FailedPrecondition, + // Aborted, and Unavailable. + Unavailable Code = 14 + + // DataLoss indicates unrecoverable data loss or corruption. + DataLoss Code = 15 + + // Unauthenticated indicates the request does not have valid + // authentication credentials for the operation. + Unauthenticated Code = 16 + + _maxCode = 17 +) + +var strToCode = map[string]Code{ + `"OK"`: OK, + `"CANCELLED"`:/* [sic] */ Canceled, + `"UNKNOWN"`: Unknown, + `"INVALID_ARGUMENT"`: InvalidArgument, + `"DEADLINE_EXCEEDED"`: DeadlineExceeded, + `"NOT_FOUND"`: NotFound, + `"ALREADY_EXISTS"`: AlreadyExists, + `"PERMISSION_DENIED"`: PermissionDenied, + `"RESOURCE_EXHAUSTED"`: ResourceExhausted, + `"FAILED_PRECONDITION"`: FailedPrecondition, + `"ABORTED"`: Aborted, + `"OUT_OF_RANGE"`: OutOfRange, + `"UNIMPLEMENTED"`: Unimplemented, + `"INTERNAL"`: Internal, + `"UNAVAILABLE"`: Unavailable, + `"DATA_LOSS"`: DataLoss, + `"UNAUTHENTICATED"`: Unauthenticated, +} + +// UnmarshalJSON unmarshals b into the Code. +func (c *Code) UnmarshalJSON(b []byte) error { + // From json.Unmarshaler: By convention, to approximate the behavior of + // Unmarshal itself, Unmarshalers implement UnmarshalJSON([]byte("null")) as + // a no-op. + if string(b) == "null" { + return nil + } + if c == nil { + return fmt.Errorf("nil receiver passed to UnmarshalJSON") + } + + if ci, err := strconv.ParseUint(string(b), 10, 32); err == nil { + if ci >= _maxCode { + return fmt.Errorf("invalid code: %q", ci) + } + + *c = Code(ci) + return nil + } + + if jc, ok := strToCode[string(b)]; ok { + *c = jc + return nil + } + return fmt.Errorf("invalid code: %q", string(b)) +} diff --git a/vendor/google.golang.org/grpc/connectivity/connectivity.go b/vendor/google.golang.org/grpc/connectivity/connectivity.go new file mode 100644 index 00000000..34ec36fb --- /dev/null +++ b/vendor/google.golang.org/grpc/connectivity/connectivity.go @@ -0,0 +1,73 @@ +/* + * + * Copyright 2017 gRPC authors. + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + */ + +// Package connectivity defines connectivity semantics. +// For details, see https://github.com/grpc/grpc/blob/master/doc/connectivity-semantics-and-api.md. +// All APIs in this package are experimental. +package connectivity + +import ( + "context" + + "google.golang.org/grpc/grpclog" +) + +// State indicates the state of connectivity. +// It can be the state of a ClientConn or SubConn. +type State int + +func (s State) String() string { + switch s { + case Idle: + return "IDLE" + case Connecting: + return "CONNECTING" + case Ready: + return "READY" + case TransientFailure: + return "TRANSIENT_FAILURE" + case Shutdown: + return "SHUTDOWN" + default: + grpclog.Errorf("unknown connectivity state: %d", s) + return "Invalid-State" + } +} + +const ( + // Idle indicates the ClientConn is idle. + Idle State = iota + // Connecting indicates the ClientConn is connecting. + Connecting + // Ready indicates the ClientConn is ready for work. + Ready + // TransientFailure indicates the ClientConn has seen a failure but expects to recover. + TransientFailure + // Shutdown indicates the ClientConn has started shutting down. + Shutdown +) + +// Reporter reports the connectivity states. +type Reporter interface { + // CurrentState returns the current state of the reporter. + CurrentState() State + // WaitForStateChange blocks until the reporter's state is different from the given state, + // and returns true. + // It returns false if <-ctx.Done() can proceed (ctx got timeout or got canceled). + WaitForStateChange(context.Context, State) bool +} diff --git a/vendor/google.golang.org/grpc/grpclog/grpclog.go b/vendor/google.golang.org/grpc/grpclog/grpclog.go new file mode 100644 index 00000000..874ea6d9 --- /dev/null +++ b/vendor/google.golang.org/grpc/grpclog/grpclog.go @@ -0,0 +1,126 @@ +/* + * + * Copyright 2017 gRPC authors. + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + */ + +// Package grpclog defines logging for grpc. +// +// All logs in transport and grpclb packages only go to verbose level 2. +// All logs in other packages in grpc are logged in spite of the verbosity level. +// +// In the default logger, +// severity level can be set by environment variable GRPC_GO_LOG_SEVERITY_LEVEL, +// verbosity level can be set by GRPC_GO_LOG_VERBOSITY_LEVEL. +package grpclog // import "google.golang.org/grpc/grpclog" + +import "os" + +var logger = newLoggerV2() + +// V reports whether verbosity level l is at least the requested verbose level. +func V(l int) bool { + return logger.V(l) +} + +// Info logs to the INFO log. +func Info(args ...interface{}) { + logger.Info(args...) +} + +// Infof logs to the INFO log. Arguments are handled in the manner of fmt.Printf. +func Infof(format string, args ...interface{}) { + logger.Infof(format, args...) +} + +// Infoln logs to the INFO log. Arguments are handled in the manner of fmt.Println. +func Infoln(args ...interface{}) { + logger.Infoln(args...) +} + +// Warning logs to the WARNING log. +func Warning(args ...interface{}) { + logger.Warning(args...) +} + +// Warningf logs to the WARNING log. Arguments are handled in the manner of fmt.Printf. +func Warningf(format string, args ...interface{}) { + logger.Warningf(format, args...) +} + +// Warningln logs to the WARNING log. Arguments are handled in the manner of fmt.Println. +func Warningln(args ...interface{}) { + logger.Warningln(args...) +} + +// Error logs to the ERROR log. +func Error(args ...interface{}) { + logger.Error(args...) +} + +// Errorf logs to the ERROR log. Arguments are handled in the manner of fmt.Printf. +func Errorf(format string, args ...interface{}) { + logger.Errorf(format, args...) +} + +// Errorln logs to the ERROR log. Arguments are handled in the manner of fmt.Println. +func Errorln(args ...interface{}) { + logger.Errorln(args...) +} + +// Fatal logs to the FATAL log. Arguments are handled in the manner of fmt.Print. +// It calls os.Exit() with exit code 1. +func Fatal(args ...interface{}) { + logger.Fatal(args...) + // Make sure fatal logs will exit. + os.Exit(1) +} + +// Fatalf logs to the FATAL log. Arguments are handled in the manner of fmt.Printf. +// It calls os.Exit() with exit code 1. +func Fatalf(format string, args ...interface{}) { + logger.Fatalf(format, args...) + // Make sure fatal logs will exit. + os.Exit(1) +} + +// Fatalln logs to the FATAL log. Arguments are handled in the manner of fmt.Println. +// It calle os.Exit()) with exit code 1. +func Fatalln(args ...interface{}) { + logger.Fatalln(args...) + // Make sure fatal logs will exit. + os.Exit(1) +} + +// Print prints to the logger. Arguments are handled in the manner of fmt.Print. +// +// Deprecated: use Info. +func Print(args ...interface{}) { + logger.Info(args...) +} + +// Printf prints to the logger. Arguments are handled in the manner of fmt.Printf. +// +// Deprecated: use Infof. +func Printf(format string, args ...interface{}) { + logger.Infof(format, args...) +} + +// Println prints to the logger. Arguments are handled in the manner of fmt.Println. +// +// Deprecated: use Infoln. +func Println(args ...interface{}) { + logger.Infoln(args...) +} diff --git a/vendor/google.golang.org/grpc/grpclog/logger.go b/vendor/google.golang.org/grpc/grpclog/logger.go new file mode 100644 index 00000000..097494f7 --- /dev/null +++ b/vendor/google.golang.org/grpc/grpclog/logger.go @@ -0,0 +1,85 @@ +/* + * + * Copyright 2015 gRPC authors. + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + */ + +package grpclog + +// Logger mimics golang's standard Logger as an interface. +// +// Deprecated: use LoggerV2. +type Logger interface { + Fatal(args ...interface{}) + Fatalf(format string, args ...interface{}) + Fatalln(args ...interface{}) + Print(args ...interface{}) + Printf(format string, args ...interface{}) + Println(args ...interface{}) +} + +// SetLogger sets the logger that is used in grpc. Call only from +// init() functions. +// +// Deprecated: use SetLoggerV2. +func SetLogger(l Logger) { + logger = &loggerWrapper{Logger: l} +} + +// loggerWrapper wraps Logger into a LoggerV2. +type loggerWrapper struct { + Logger +} + +func (g *loggerWrapper) Info(args ...interface{}) { + g.Logger.Print(args...) +} + +func (g *loggerWrapper) Infoln(args ...interface{}) { + g.Logger.Println(args...) +} + +func (g *loggerWrapper) Infof(format string, args ...interface{}) { + g.Logger.Printf(format, args...) +} + +func (g *loggerWrapper) Warning(args ...interface{}) { + g.Logger.Print(args...) +} + +func (g *loggerWrapper) Warningln(args ...interface{}) { + g.Logger.Println(args...) +} + +func (g *loggerWrapper) Warningf(format string, args ...interface{}) { + g.Logger.Printf(format, args...) +} + +func (g *loggerWrapper) Error(args ...interface{}) { + g.Logger.Print(args...) +} + +func (g *loggerWrapper) Errorln(args ...interface{}) { + g.Logger.Println(args...) +} + +func (g *loggerWrapper) Errorf(format string, args ...interface{}) { + g.Logger.Printf(format, args...) +} + +func (g *loggerWrapper) V(l int) bool { + // Returns true for all verbose level. + return true +} diff --git a/vendor/google.golang.org/grpc/grpclog/loggerv2.go b/vendor/google.golang.org/grpc/grpclog/loggerv2.go new file mode 100644 index 00000000..d4932577 --- /dev/null +++ b/vendor/google.golang.org/grpc/grpclog/loggerv2.go @@ -0,0 +1,195 @@ +/* + * + * Copyright 2017 gRPC authors. + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + */ + +package grpclog + +import ( + "io" + "io/ioutil" + "log" + "os" + "strconv" +) + +// LoggerV2 does underlying logging work for grpclog. +type LoggerV2 interface { + // Info logs to INFO log. Arguments are handled in the manner of fmt.Print. + Info(args ...interface{}) + // Infoln logs to INFO log. Arguments are handled in the manner of fmt.Println. + Infoln(args ...interface{}) + // Infof logs to INFO log. Arguments are handled in the manner of fmt.Printf. + Infof(format string, args ...interface{}) + // Warning logs to WARNING log. Arguments are handled in the manner of fmt.Print. + Warning(args ...interface{}) + // Warningln logs to WARNING log. Arguments are handled in the manner of fmt.Println. + Warningln(args ...interface{}) + // Warningf logs to WARNING log. Arguments are handled in the manner of fmt.Printf. + Warningf(format string, args ...interface{}) + // Error logs to ERROR log. Arguments are handled in the manner of fmt.Print. + Error(args ...interface{}) + // Errorln logs to ERROR log. Arguments are handled in the manner of fmt.Println. + Errorln(args ...interface{}) + // Errorf logs to ERROR log. Arguments are handled in the manner of fmt.Printf. + Errorf(format string, args ...interface{}) + // Fatal logs to ERROR log. Arguments are handled in the manner of fmt.Print. + // gRPC ensures that all Fatal logs will exit with os.Exit(1). + // Implementations may also call os.Exit() with a non-zero exit code. + Fatal(args ...interface{}) + // Fatalln logs to ERROR log. Arguments are handled in the manner of fmt.Println. + // gRPC ensures that all Fatal logs will exit with os.Exit(1). + // Implementations may also call os.Exit() with a non-zero exit code. + Fatalln(args ...interface{}) + // Fatalf logs to ERROR log. Arguments are handled in the manner of fmt.Printf. + // gRPC ensures that all Fatal logs will exit with os.Exit(1). + // Implementations may also call os.Exit() with a non-zero exit code. + Fatalf(format string, args ...interface{}) + // V reports whether verbosity level l is at least the requested verbose level. + V(l int) bool +} + +// SetLoggerV2 sets logger that is used in grpc to a V2 logger. +// Not mutex-protected, should be called before any gRPC functions. +func SetLoggerV2(l LoggerV2) { + logger = l +} + +const ( + // infoLog indicates Info severity. + infoLog int = iota + // warningLog indicates Warning severity. + warningLog + // errorLog indicates Error severity. + errorLog + // fatalLog indicates Fatal severity. + fatalLog +) + +// severityName contains the string representation of each severity. +var severityName = []string{ + infoLog: "INFO", + warningLog: "WARNING", + errorLog: "ERROR", + fatalLog: "FATAL", +} + +// loggerT is the default logger used by grpclog. +type loggerT struct { + m []*log.Logger + v int +} + +// NewLoggerV2 creates a loggerV2 with the provided writers. +// Fatal logs will be written to errorW, warningW, infoW, followed by exit(1). +// Error logs will be written to errorW, warningW and infoW. +// Warning logs will be written to warningW and infoW. +// Info logs will be written to infoW. +func NewLoggerV2(infoW, warningW, errorW io.Writer) LoggerV2 { + return NewLoggerV2WithVerbosity(infoW, warningW, errorW, 0) +} + +// NewLoggerV2WithVerbosity creates a loggerV2 with the provided writers and +// verbosity level. +func NewLoggerV2WithVerbosity(infoW, warningW, errorW io.Writer, v int) LoggerV2 { + var m []*log.Logger + m = append(m, log.New(infoW, severityName[infoLog]+": ", log.LstdFlags)) + m = append(m, log.New(io.MultiWriter(infoW, warningW), severityName[warningLog]+": ", log.LstdFlags)) + ew := io.MultiWriter(infoW, warningW, errorW) // ew will be used for error and fatal. + m = append(m, log.New(ew, severityName[errorLog]+": ", log.LstdFlags)) + m = append(m, log.New(ew, severityName[fatalLog]+": ", log.LstdFlags)) + return &loggerT{m: m, v: v} +} + +// newLoggerV2 creates a loggerV2 to be used as default logger. +// All logs are written to stderr. +func newLoggerV2() LoggerV2 { + errorW := ioutil.Discard + warningW := ioutil.Discard + infoW := ioutil.Discard + + logLevel := os.Getenv("GRPC_GO_LOG_SEVERITY_LEVEL") + switch logLevel { + case "", "ERROR", "error": // If env is unset, set level to ERROR. + errorW = os.Stderr + case "WARNING", "warning": + warningW = os.Stderr + case "INFO", "info": + infoW = os.Stderr + } + + var v int + vLevel := os.Getenv("GRPC_GO_LOG_VERBOSITY_LEVEL") + if vl, err := strconv.Atoi(vLevel); err == nil { + v = vl + } + return NewLoggerV2WithVerbosity(infoW, warningW, errorW, v) +} + +func (g *loggerT) Info(args ...interface{}) { + g.m[infoLog].Print(args...) +} + +func (g *loggerT) Infoln(args ...interface{}) { + g.m[infoLog].Println(args...) +} + +func (g *loggerT) Infof(format string, args ...interface{}) { + g.m[infoLog].Printf(format, args...) +} + +func (g *loggerT) Warning(args ...interface{}) { + g.m[warningLog].Print(args...) +} + +func (g *loggerT) Warningln(args ...interface{}) { + g.m[warningLog].Println(args...) +} + +func (g *loggerT) Warningf(format string, args ...interface{}) { + g.m[warningLog].Printf(format, args...) +} + +func (g *loggerT) Error(args ...interface{}) { + g.m[errorLog].Print(args...) +} + +func (g *loggerT) Errorln(args ...interface{}) { + g.m[errorLog].Println(args...) +} + +func (g *loggerT) Errorf(format string, args ...interface{}) { + g.m[errorLog].Printf(format, args...) +} + +func (g *loggerT) Fatal(args ...interface{}) { + g.m[fatalLog].Fatal(args...) + // No need to call os.Exit() again because log.Logger.Fatal() calls os.Exit(). +} + +func (g *loggerT) Fatalln(args ...interface{}) { + g.m[fatalLog].Fatalln(args...) + // No need to call os.Exit() again because log.Logger.Fatal() calls os.Exit(). +} + +func (g *loggerT) Fatalf(format string, args ...interface{}) { + g.m[fatalLog].Fatalf(format, args...) + // No need to call os.Exit() again because log.Logger.Fatal() calls os.Exit(). +} + +func (g *loggerT) V(l int) bool { + return l <= g.v +} diff --git a/vendor/google.golang.org/grpc/internal/internal.go b/vendor/google.golang.org/grpc/internal/internal.go new file mode 100644 index 00000000..0912f0bf --- /dev/null +++ b/vendor/google.golang.org/grpc/internal/internal.go @@ -0,0 +1,72 @@ +/* + * Copyright 2016 gRPC authors. + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + */ + +// Package internal contains gRPC-internal code, to avoid polluting +// the godoc of the top-level grpc package. It must not import any grpc +// symbols to avoid circular dependencies. +package internal + +import ( + "context" + "time" + + "google.golang.org/grpc/connectivity" +) + +var ( + // WithHealthCheckFunc is set by dialoptions.go + WithHealthCheckFunc interface{} // func (HealthChecker) DialOption + // HealthCheckFunc is used to provide client-side LB channel health checking + HealthCheckFunc HealthChecker + // BalancerUnregister is exported by package balancer to unregister a balancer. + BalancerUnregister func(name string) + // KeepaliveMinPingTime is the minimum ping interval. This must be 10s by + // default, but tests may wish to set it lower for convenience. + KeepaliveMinPingTime = 10 * time.Second + // StatusRawProto is exported by status/status.go. This func returns a + // pointer to the wrapped Status proto for a given status.Status without a + // call to proto.Clone(). The returned Status proto should not be mutated by + // the caller. + StatusRawProto interface{} // func (*status.Status) *spb.Status + // NewRequestInfoContext creates a new context based on the argument context attaching + // the passed in RequestInfo to the new context. + NewRequestInfoContext interface{} // func(context.Context, credentials.RequestInfo) context.Context + // ParseServiceConfigForTesting is for creating a fake + // ClientConn for resolver testing only + ParseServiceConfigForTesting interface{} // func(string) *serviceconfig.ParseResult +) + +// HealthChecker defines the signature of the client-side LB channel health checking function. +// +// The implementation is expected to create a health checking RPC stream by +// calling newStream(), watch for the health status of serviceName, and report +// it's health back by calling setConnectivityState(). +// +// The health checking protocol is defined at: +// https://github.com/grpc/grpc/blob/master/doc/health-checking.md +type HealthChecker func(ctx context.Context, newStream func(string) (interface{}, error), setConnectivityState func(connectivity.State, error), serviceName string) error + +const ( + // CredsBundleModeFallback switches GoogleDefaultCreds to fallback mode. + CredsBundleModeFallback = "fallback" + // CredsBundleModeBalancer switches GoogleDefaultCreds to grpclb balancer + // mode. + CredsBundleModeBalancer = "balancer" + // CredsBundleModeBackendFromBalancer switches GoogleDefaultCreds to mode + // that supports backend returned by grpclb balancer. + CredsBundleModeBackendFromBalancer = "backend-from-balancer" +) diff --git a/vendor/google.golang.org/grpc/status/status.go b/vendor/google.golang.org/grpc/status/status.go new file mode 100644 index 00000000..a1348e9b --- /dev/null +++ b/vendor/google.golang.org/grpc/status/status.go @@ -0,0 +1,228 @@ +/* + * + * Copyright 2017 gRPC authors. + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + */ + +// Package status implements errors returned by gRPC. These errors are +// serialized and transmitted on the wire between server and client, and allow +// for additional data to be transmitted via the Details field in the status +// proto. gRPC service handlers should return an error created by this +// package, and gRPC clients should expect a corresponding error to be +// returned from the RPC call. +// +// This package upholds the invariants that a non-nil error may not +// contain an OK code, and an OK code must result in a nil error. +package status + +import ( + "context" + "errors" + "fmt" + + "github.com/golang/protobuf/proto" + "github.com/golang/protobuf/ptypes" + spb "google.golang.org/genproto/googleapis/rpc/status" + "google.golang.org/grpc/codes" + "google.golang.org/grpc/internal" +) + +func init() { + internal.StatusRawProto = statusRawProto +} + +func statusRawProto(s *Status) *spb.Status { return s.s } + +// statusError is an alias of a status proto. It implements error and Status, +// and a nil statusError should never be returned by this package. +type statusError spb.Status + +func (se *statusError) Error() string { + p := (*spb.Status)(se) + return fmt.Sprintf("rpc error: code = %s desc = %s", codes.Code(p.GetCode()), p.GetMessage()) +} + +func (se *statusError) GRPCStatus() *Status { + return &Status{s: (*spb.Status)(se)} +} + +// Is implements future error.Is functionality. +// A statusError is equivalent if the code and message are identical. +func (se *statusError) Is(target error) bool { + tse, ok := target.(*statusError) + if !ok { + return false + } + + return proto.Equal((*spb.Status)(se), (*spb.Status)(tse)) +} + +// Status represents an RPC status code, message, and details. It is immutable +// and should be created with New, Newf, or FromProto. +type Status struct { + s *spb.Status +} + +// Code returns the status code contained in s. +func (s *Status) Code() codes.Code { + if s == nil || s.s == nil { + return codes.OK + } + return codes.Code(s.s.Code) +} + +// Message returns the message contained in s. +func (s *Status) Message() string { + if s == nil || s.s == nil { + return "" + } + return s.s.Message +} + +// Proto returns s's status as an spb.Status proto message. +func (s *Status) Proto() *spb.Status { + if s == nil { + return nil + } + return proto.Clone(s.s).(*spb.Status) +} + +// Err returns an immutable error representing s; returns nil if s.Code() is +// OK. +func (s *Status) Err() error { + if s.Code() == codes.OK { + return nil + } + return (*statusError)(s.s) +} + +// New returns a Status representing c and msg. +func New(c codes.Code, msg string) *Status { + return &Status{s: &spb.Status{Code: int32(c), Message: msg}} +} + +// Newf returns New(c, fmt.Sprintf(format, a...)). +func Newf(c codes.Code, format string, a ...interface{}) *Status { + return New(c, fmt.Sprintf(format, a...)) +} + +// Error returns an error representing c and msg. If c is OK, returns nil. +func Error(c codes.Code, msg string) error { + return New(c, msg).Err() +} + +// Errorf returns Error(c, fmt.Sprintf(format, a...)). +func Errorf(c codes.Code, format string, a ...interface{}) error { + return Error(c, fmt.Sprintf(format, a...)) +} + +// ErrorProto returns an error representing s. If s.Code is OK, returns nil. +func ErrorProto(s *spb.Status) error { + return FromProto(s).Err() +} + +// FromProto returns a Status representing s. +func FromProto(s *spb.Status) *Status { + return &Status{s: proto.Clone(s).(*spb.Status)} +} + +// FromError returns a Status representing err if it was produced from this +// package or has a method `GRPCStatus() *Status`. Otherwise, ok is false and a +// Status is returned with codes.Unknown and the original error message. +func FromError(err error) (s *Status, ok bool) { + if err == nil { + return nil, true + } + if se, ok := err.(interface { + GRPCStatus() *Status + }); ok { + return se.GRPCStatus(), true + } + return New(codes.Unknown, err.Error()), false +} + +// Convert is a convenience function which removes the need to handle the +// boolean return value from FromError. +func Convert(err error) *Status { + s, _ := FromError(err) + return s +} + +// WithDetails returns a new status with the provided details messages appended to the status. +// If any errors are encountered, it returns nil and the first error encountered. +func (s *Status) WithDetails(details ...proto.Message) (*Status, error) { + if s.Code() == codes.OK { + return nil, errors.New("no error details for status with code OK") + } + // s.Code() != OK implies that s.Proto() != nil. + p := s.Proto() + for _, detail := range details { + any, err := ptypes.MarshalAny(detail) + if err != nil { + return nil, err + } + p.Details = append(p.Details, any) + } + return &Status{s: p}, nil +} + +// Details returns a slice of details messages attached to the status. +// If a detail cannot be decoded, the error is returned in place of the detail. +func (s *Status) Details() []interface{} { + if s == nil || s.s == nil { + return nil + } + details := make([]interface{}, 0, len(s.s.Details)) + for _, any := range s.s.Details { + detail := &ptypes.DynamicAny{} + if err := ptypes.UnmarshalAny(any, detail); err != nil { + details = append(details, err) + continue + } + details = append(details, detail.Message) + } + return details +} + +// Code returns the Code of the error if it is a Status error, codes.OK if err +// is nil, or codes.Unknown otherwise. +func Code(err error) codes.Code { + // Don't use FromError to avoid allocation of OK status. + if err == nil { + return codes.OK + } + if se, ok := err.(interface { + GRPCStatus() *Status + }); ok { + return se.GRPCStatus().Code() + } + return codes.Unknown +} + +// FromContextError converts a context error into a Status. It returns a +// Status with codes.OK if err is nil, or a Status with codes.Unknown if err is +// non-nil and not a context error. +func FromContextError(err error) *Status { + switch err { + case nil: + return nil + case context.DeadlineExceeded: + return New(codes.DeadlineExceeded, err.Error()) + case context.Canceled: + return New(codes.Canceled, err.Error()) + default: + return New(codes.Unknown, err.Error()) + } +} diff --git a/vendor/modules.txt b/vendor/modules.txt index 43c984fa..be697048 100644 --- a/vendor/modules.txt +++ b/vendor/modules.txt @@ -1,52 +1,56 @@ # github.com/Azure/go-ansiterm v0.0.0-20170929234023-d6e3b3328b78 -github.com/Azure/go-ansiterm/winterm github.com/Azure/go-ansiterm +github.com/Azure/go-ansiterm/winterm # github.com/BurntSushi/toml v0.3.1 github.com/BurntSushi/toml -# github.com/Microsoft/go-winio v0.4.11 +# github.com/Microsoft/go-winio v0.4.15-0.20200113171025-3fe6c5262873 github.com/Microsoft/go-winio -# github.com/Microsoft/hcsshim v0.8.6 +github.com/Microsoft/go-winio/pkg/guid +# github.com/Microsoft/hcsshim v0.8.7 github.com/Microsoft/hcsshim -github.com/Microsoft/hcsshim/internal/guid +github.com/Microsoft/hcsshim/internal/cow github.com/Microsoft/hcsshim/internal/hcs github.com/Microsoft/hcsshim/internal/hcserror github.com/Microsoft/hcsshim/internal/hns -github.com/Microsoft/hcsshim/internal/mergemaps -github.com/Microsoft/hcsshim/internal/schema1 -github.com/Microsoft/hcsshim/internal/wclayer -github.com/Microsoft/hcsshim/internal/guestrequest github.com/Microsoft/hcsshim/internal/interop +github.com/Microsoft/hcsshim/internal/log github.com/Microsoft/hcsshim/internal/logfields -github.com/Microsoft/hcsshim/internal/timeout -github.com/Microsoft/hcsshim/internal/schema2 github.com/Microsoft/hcsshim/internal/longpath +github.com/Microsoft/hcsshim/internal/mergemaps +github.com/Microsoft/hcsshim/internal/oc github.com/Microsoft/hcsshim/internal/safefile -# github.com/Nvveen/Gotty v0.0.0-20120604004816-cd527374f1e5 -github.com/Nvveen/Gotty +github.com/Microsoft/hcsshim/internal/schema1 +github.com/Microsoft/hcsshim/internal/schema2 +github.com/Microsoft/hcsshim/internal/timeout +github.com/Microsoft/hcsshim/internal/vmcompute +github.com/Microsoft/hcsshim/internal/wclayer +github.com/Microsoft/hcsshim/osversion # github.com/Sabayon/pkgs-checker v0.6.2-0.20200404093625-076438c31739 github.com/Sabayon/pkgs-checker/pkg/gentoo # github.com/apex/log v1.1.1 github.com/apex/log # github.com/asdine/storm v0.0.0-20190418133842-e0f77eada154 github.com/asdine/storm -github.com/asdine/storm/q github.com/asdine/storm/codec github.com/asdine/storm/codec/json github.com/asdine/storm/index github.com/asdine/storm/internal +github.com/asdine/storm/q # github.com/briandowns/spinner v1.7.0 github.com/briandowns/spinner # github.com/cavaliercoder/grab v2.0.0+incompatible github.com/cavaliercoder/grab -# github.com/containerd/containerd v1.2.4 +# github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f +github.com/containerd/cgroups/stats/v1 +# github.com/containerd/containerd v1.3.0 github.com/containerd/containerd/archive +github.com/containerd/containerd/errdefs github.com/containerd/containerd/log github.com/containerd/containerd/sys -# github.com/containerd/continuity v0.0.0-20181203112020-004b46473808 +# github.com/containerd/continuity v0.0.0-20200228182428-0f16d7a0959c github.com/containerd/continuity/fs -github.com/containerd/continuity/sysx -github.com/containerd/continuity/pathdriver github.com/containerd/continuity/syscallx +github.com/containerd/continuity/sysx # github.com/cpuguy83/go-md2man/v2 v2.0.0-20190314233015-f79a8a8ca69d github.com/cpuguy83/go-md2man/v2/md2man # github.com/crillab/gophersat v1.1.9-0.20200211102949-9a8bf7f2f0a3 @@ -54,43 +58,42 @@ github.com/crillab/gophersat/bf github.com/crillab/gophersat/solver # github.com/cyphar/filepath-securejoin v0.2.2 github.com/cyphar/filepath-securejoin -# github.com/docker/distribution v2.7.0+incompatible +# github.com/docker/distribution v2.7.1+incompatible github.com/docker/distribution +github.com/docker/distribution/digestset +github.com/docker/distribution/manifest github.com/docker/distribution/manifest/schema1 github.com/docker/distribution/manifest/schema2 github.com/docker/distribution/reference -github.com/docker/distribution/manifest -github.com/docker/distribution/digestset -# github.com/docker/docker v0.7.3-0.20180827131323-0c5f8d2b9b23 -github.com/docker/docker/pkg/archive -github.com/docker/docker/pkg/fileutils -github.com/docker/docker/pkg/idtools -github.com/docker/docker/pkg/ioutils -github.com/docker/docker/pkg/longpath -github.com/docker/docker/pkg/pools -github.com/docker/docker/pkg/system -github.com/docker/docker/api/types/registry -github.com/docker/docker/api/types/swarm -github.com/docker/docker/opts -github.com/docker/docker/pkg/homedir -github.com/docker/docker/pkg/stdcopy -github.com/docker/docker/pkg/mount +github.com/docker/distribution/registry/api/errcode +# github.com/docker/docker v17.12.0-ce-rc1.0.20200417035958-130b0bc6032c+incompatible => github.com/Luet-lab/moby v17.12.0-ce-rc1.0.20200418093736-b2b0766ef22c+incompatible +github.com/docker/docker/api/types/blkiodev github.com/docker/docker/api/types/container +github.com/docker/docker/api/types/filters github.com/docker/docker/api/types/mount github.com/docker/docker/api/types/network -github.com/docker/docker/api/types/swarm/runtime -github.com/docker/docker/api/types -github.com/docker/docker/api/types/blkiodev +github.com/docker/docker/api/types/registry github.com/docker/docker/api/types/strslice -github.com/docker/docker/api/types/filters -github.com/docker/docker/errdefs +github.com/docker/docker/api/types/swarm +github.com/docker/docker/api/types/swarm/runtime github.com/docker/docker/api/types/versions +github.com/docker/docker/errdefs +github.com/docker/docker/pkg/archive +github.com/docker/docker/pkg/fileutils +github.com/docker/docker/pkg/homedir +github.com/docker/docker/pkg/idtools +github.com/docker/docker/pkg/ioutils +github.com/docker/docker/pkg/jsonmessage +github.com/docker/docker/pkg/longpath +github.com/docker/docker/pkg/pools +github.com/docker/docker/pkg/stdcopy +github.com/docker/docker/pkg/system +github.com/docker/docker/pkg/term +github.com/docker/docker/pkg/term/windows # github.com/docker/go-connections v0.4.0 github.com/docker/go-connections/nat # github.com/docker/go-units v0.4.0 github.com/docker/go-units -# github.com/docker/libnetwork v0.8.0-dev.2.0.20180608203834-19279f049241 -github.com/docker/libnetwork/ipamutils # github.com/docker/libtrust v0.0.0-20160708172513-aabc10ec26b7 github.com/docker/libtrust # github.com/ecooper/qlearning v0.0.0-20160612200101-3075011a69fd @@ -99,28 +102,33 @@ github.com/ecooper/qlearning github.com/fatih/color # github.com/fsnotify/fsnotify v1.4.7 github.com/fsnotify/fsnotify -# github.com/fsouza/go-dockerclient v1.3.1 +# github.com/fsouza/go-dockerclient v1.6.4 github.com/fsouza/go-dockerclient -github.com/fsouza/go-dockerclient/internal/archive -github.com/fsouza/go-dockerclient/internal/jsonmessage -github.com/fsouza/go-dockerclient/internal/term # github.com/ghodss/yaml v1.0.0 github.com/ghodss/yaml -# github.com/gogo/protobuf v1.2.1 +# github.com/gogo/protobuf v1.3.1 +github.com/gogo/protobuf/gogoproto github.com/gogo/protobuf/proto +github.com/gogo/protobuf/protoc-gen-gogo/descriptor # github.com/golang/protobuf v1.3.2 github.com/golang/protobuf/proto +github.com/golang/protobuf/ptypes +github.com/golang/protobuf/ptypes/any +github.com/golang/protobuf/ptypes/duration +github.com/golang/protobuf/ptypes/timestamp # github.com/hashicorp/go-version v1.2.0 github.com/hashicorp/go-version +# github.com/hashicorp/golang-lru v0.5.1 +github.com/hashicorp/golang-lru/simplelru # github.com/hashicorp/hcl v1.0.0 github.com/hashicorp/hcl -github.com/hashicorp/hcl/hcl/printer github.com/hashicorp/hcl/hcl/ast github.com/hashicorp/hcl/hcl/parser -github.com/hashicorp/hcl/hcl/token -github.com/hashicorp/hcl/json/parser +github.com/hashicorp/hcl/hcl/printer github.com/hashicorp/hcl/hcl/scanner github.com/hashicorp/hcl/hcl/strconv +github.com/hashicorp/hcl/hcl/token +github.com/hashicorp/hcl/json/parser github.com/hashicorp/hcl/json/scanner github.com/hashicorp/hcl/json/token # github.com/heroku/docker-registry-client v0.0.0-20181004091502-47ecf50fd8d4 @@ -159,60 +167,66 @@ github.com/mattn/go-colorable github.com/mattn/go-isatty # github.com/mitchellh/mapstructure v1.1.2 github.com/mitchellh/mapstructure -# github.com/mudler/docker-companion v0.4.6-0.20191110154655-b8b364100616 +# github.com/moby/sys/mount v0.1.0 +github.com/moby/sys/mount +# github.com/moby/sys/mountinfo v0.1.0 +github.com/moby/sys/mountinfo +# github.com/morikuni/aec v1.0.0 +github.com/morikuni/aec +# github.com/mudler/docker-companion v0.4.6-0.20200418093252-41846f112d87 github.com/mudler/docker-companion/api # github.com/onsi/ginkgo v1.10.1 github.com/onsi/ginkgo github.com/onsi/ginkgo/config github.com/onsi/ginkgo/internal/codelocation +github.com/onsi/ginkgo/internal/containernode github.com/onsi/ginkgo/internal/failer +github.com/onsi/ginkgo/internal/leafnodes github.com/onsi/ginkgo/internal/remote +github.com/onsi/ginkgo/internal/spec +github.com/onsi/ginkgo/internal/spec_iterator +github.com/onsi/ginkgo/internal/specrunner github.com/onsi/ginkgo/internal/suite github.com/onsi/ginkgo/internal/testingtproxy github.com/onsi/ginkgo/internal/writer github.com/onsi/ginkgo/reporters github.com/onsi/ginkgo/reporters/stenographer github.com/onsi/ginkgo/reporters/stenographer/support/go-colorable -github.com/onsi/ginkgo/types -github.com/onsi/ginkgo/internal/spec_iterator -github.com/onsi/ginkgo/internal/containernode -github.com/onsi/ginkgo/internal/leafnodes -github.com/onsi/ginkgo/internal/spec -github.com/onsi/ginkgo/internal/specrunner github.com/onsi/ginkgo/reporters/stenographer/support/go-isatty +github.com/onsi/ginkgo/types # github.com/onsi/gomega v1.7.0 github.com/onsi/gomega +github.com/onsi/gomega/format github.com/onsi/gomega/internal/assertion github.com/onsi/gomega/internal/asyncassertion +github.com/onsi/gomega/internal/oraclematcher github.com/onsi/gomega/internal/testingtsupport github.com/onsi/gomega/matchers -github.com/onsi/gomega/types -github.com/onsi/gomega/internal/oraclematcher -github.com/onsi/gomega/format github.com/onsi/gomega/matchers/support/goraph/bipartitegraph github.com/onsi/gomega/matchers/support/goraph/edge github.com/onsi/gomega/matchers/support/goraph/node github.com/onsi/gomega/matchers/support/goraph/util +github.com/onsi/gomega/types # github.com/openSUSE/umoci v0.1.1-0.20191030112807-c0dd46ae078f -github.com/openSUSE/umoci/oci/layer github.com/openSUSE/umoci/oci/cas github.com/openSUSE/umoci/oci/casext +github.com/openSUSE/umoci/oci/casext/mediatype github.com/openSUSE/umoci/oci/config/convert +github.com/openSUSE/umoci/oci/config/generate +github.com/openSUSE/umoci/oci/layer github.com/openSUSE/umoci/pkg/fseval +github.com/openSUSE/umoci/pkg/hardening github.com/openSUSE/umoci/pkg/idtools github.com/openSUSE/umoci/pkg/system github.com/openSUSE/umoci/pkg/testutils github.com/openSUSE/umoci/pkg/unpriv github.com/openSUSE/umoci/third_party/shared -github.com/openSUSE/umoci/oci/casext/mediatype -github.com/openSUSE/umoci/pkg/hardening -github.com/openSUSE/umoci/oci/config/generate github.com/openSUSE/umoci/third_party/user # github.com/opencontainers/go-digest v1.0.0-rc1 github.com/opencontainers/go-digest # github.com/opencontainers/image-spec v1.0.1 -github.com/opencontainers/image-spec/specs-go/v1 github.com/opencontainers/image-spec/specs-go +github.com/opencontainers/image-spec/specs-go/v1 # github.com/opencontainers/runc v0.1.1 github.com/opencontainers/runc/libcontainer/system github.com/opencontainers/runc/libcontainer/user @@ -259,6 +273,12 @@ github.com/vbatts/go-mtree/pkg/govis github.com/vbatts/go-mtree/xattr # go.etcd.io/bbolt v1.3.3 go.etcd.io/bbolt +# go.opencensus.io v0.22.0 +go.opencensus.io +go.opencensus.io/internal +go.opencensus.io/trace +go.opencensus.io/trace/internal +go.opencensus.io/trace/tracestate # go.uber.org/atomic v1.5.1 go.uber.org/atomic # go.uber.org/multierr v1.4.0 @@ -267,64 +287,72 @@ go.uber.org/multierr go.uber.org/tools/update-license # go.uber.org/zap v1.13.0 go.uber.org/zap -go.uber.org/zap/zapcore -go.uber.org/zap/internal/bufferpool go.uber.org/zap/buffer +go.uber.org/zap/internal/bufferpool go.uber.org/zap/internal/color go.uber.org/zap/internal/exit -# golang.org/x/crypto v0.0.0-20191227163750-53104e6ec876 -golang.org/x/crypto/ssh/terminal +go.uber.org/zap/zapcore +# golang.org/x/crypto v0.0.0-20200220183623-bac4c82f6975 golang.org/x/crypto/ripemd160 +golang.org/x/crypto/ssh/terminal # golang.org/x/lint v0.0.0-20191125180803-fdd1cda4f05f -golang.org/x/lint/golint golang.org/x/lint +golang.org/x/lint/golint # golang.org/x/net v0.0.0-20191209160850-c0dbc17a3553 golang.org/x/net/context -golang.org/x/net/html/charset golang.org/x/net/html golang.org/x/net/html/atom +golang.org/x/net/html/charset # golang.org/x/sync v0.0.0-20190911185100-cd5d95a43a6e golang.org/x/sync/errgroup -# golang.org/x/sys v0.0.0-20200102141924-c96a22e43c9c +# golang.org/x/sys v0.0.0-20200223170610-d5e6a3e2c0ae golang.org/x/sys/unix golang.org/x/sys/windows # golang.org/x/text v0.3.2 -golang.org/x/text/transform -golang.org/x/text/unicode/norm golang.org/x/text/encoding golang.org/x/text/encoding/charmap golang.org/x/text/encoding/htmlindex -golang.org/x/text/encoding/internal/identifier golang.org/x/text/encoding/internal +golang.org/x/text/encoding/internal/identifier golang.org/x/text/encoding/japanese golang.org/x/text/encoding/korean golang.org/x/text/encoding/simplifiedchinese golang.org/x/text/encoding/traditionalchinese golang.org/x/text/encoding/unicode -golang.org/x/text/language -golang.org/x/text/internal/utf8internal -golang.org/x/text/runes golang.org/x/text/internal/language golang.org/x/text/internal/language/compact golang.org/x/text/internal/tag +golang.org/x/text/internal/utf8internal +golang.org/x/text/language +golang.org/x/text/runes +golang.org/x/text/transform +golang.org/x/text/unicode/norm # golang.org/x/tools v0.0.0-20200102200121-6de373a2766c golang.org/x/tools/go/analysis -golang.org/x/tools/go/ast/astutil -golang.org/x/tools/go/gcexportdata -golang.org/x/tools/go/packages -golang.org/x/tools/go/types/objectpath -golang.org/x/tools/go/buildutil golang.org/x/tools/go/analysis/passes/inspect +golang.org/x/tools/go/ast/astutil golang.org/x/tools/go/ast/inspector -golang.org/x/tools/go/types/typeutil +golang.org/x/tools/go/buildutil +golang.org/x/tools/go/gcexportdata golang.org/x/tools/go/internal/gcimporter golang.org/x/tools/go/internal/packagesdriver +golang.org/x/tools/go/packages +golang.org/x/tools/go/types/objectpath +golang.org/x/tools/go/types/typeutil +golang.org/x/tools/internal/fastwalk golang.org/x/tools/internal/gopathwalk golang.org/x/tools/internal/semver -golang.org/x/tools/internal/fastwalk # golang.org/x/xerrors v0.0.0-20191204190536-9bdfabe68543 golang.org/x/xerrors golang.org/x/xerrors/internal +# google.golang.org/genproto v0.0.0-20190819201941-24fa4b261c55 +google.golang.org/genproto/googleapis/rpc/status +# google.golang.org/grpc v1.27.1 +google.golang.org/grpc/codes +google.golang.org/grpc/connectivity +google.golang.org/grpc/grpclog +google.golang.org/grpc/internal +google.golang.org/grpc/status # gopkg.in/fsnotify.v1 v1.4.7 gopkg.in/fsnotify.v1 # gopkg.in/tomb.v1 v1.0.0-20141024135613-dd632973f1e7 @@ -332,34 +360,34 @@ gopkg.in/tomb.v1 # gopkg.in/yaml.v2 v2.2.7 gopkg.in/yaml.v2 # honnef.co/go/tools v0.0.1-2019.2.3 -honnef.co/go/tools/cmd/staticcheck -honnef.co/go/tools/lint -honnef.co/go/tools/lint/lintutil -honnef.co/go/tools/simple -honnef.co/go/tools/staticcheck -honnef.co/go/tools/stylecheck -honnef.co/go/tools/unused -honnef.co/go/tools/config -honnef.co/go/tools/facts -honnef.co/go/tools/internal/cache -honnef.co/go/tools/loader -honnef.co/go/tools/lint/lintutil/format -honnef.co/go/tools/version honnef.co/go/tools/arg -honnef.co/go/tools/internal/passes/buildssa -honnef.co/go/tools/internal/sharedcheck -honnef.co/go/tools/lint/lintdsl +honnef.co/go/tools/cmd/staticcheck +honnef.co/go/tools/config honnef.co/go/tools/deprecated +honnef.co/go/tools/facts honnef.co/go/tools/functions +honnef.co/go/tools/go/types/typeutil +honnef.co/go/tools/internal/cache +honnef.co/go/tools/internal/passes/buildssa +honnef.co/go/tools/internal/renameio +honnef.co/go/tools/internal/sharedcheck +honnef.co/go/tools/lint +honnef.co/go/tools/lint/lintdsl +honnef.co/go/tools/lint/lintutil +honnef.co/go/tools/lint/lintutil/format +honnef.co/go/tools/loader honnef.co/go/tools/printf +honnef.co/go/tools/simple honnef.co/go/tools/ssa honnef.co/go/tools/ssautil +honnef.co/go/tools/staticcheck honnef.co/go/tools/staticcheck/vrp -honnef.co/go/tools/go/types/typeutil -honnef.co/go/tools/internal/renameio +honnef.co/go/tools/stylecheck +honnef.co/go/tools/unused +honnef.co/go/tools/version # mvdan.cc/sh/v3 v3.0.0-beta1 mvdan.cc/sh/v3/expand +mvdan.cc/sh/v3/interp +mvdan.cc/sh/v3/pattern mvdan.cc/sh/v3/shell mvdan.cc/sh/v3/syntax -mvdan.cc/sh/v3/pattern -mvdan.cc/sh/v3/interp