diff --git a/go.mod b/go.mod index b3899262..2ceb664a 100644 --- a/go.mod +++ b/go.mod @@ -3,8 +3,7 @@ module github.com/containernetworking/plugins go 1.14 require ( - github.com/Microsoft/go-winio v0.4.11 // indirect - github.com/Microsoft/hcsshim v0.8.6 + github.com/Microsoft/hcsshim v0.8.16 github.com/alexflint/go-filemutex v0.0.0-20171022225611-72bdc8eae2ae github.com/buger/jsonparser v0.0.0-20180808090653-f4dd9f5a6b44 github.com/containernetworking/cni v0.8.1-0.20201216164644-62e54113f44a @@ -13,7 +12,6 @@ require ( github.com/d2g/dhcp4 v0.0.0-20170904100407-a1d1b6c41b1c github.com/d2g/dhcp4client v1.0.0 github.com/d2g/dhcp4server v0.0.0-20181031114812-7d4a0a7f59a5 - github.com/d2g/hardwareaddr v0.0.0-20190221164911-e7d9fbe030e4 // indirect github.com/godbus/dbus/v5 v5.0.3 github.com/j-keck/arping v0.0.0-20160618110441-2cf9dc699c56 github.com/mattn/go-shellwords v1.0.11 @@ -21,7 +19,6 @@ require ( github.com/onsi/gomega v1.10.3 github.com/safchain/ethtool v0.0.0-20190326074333-42ed695e3de8 github.com/sirupsen/logrus v1.8.1 // indirect - github.com/stretchr/testify v1.3.0 // indirect github.com/vishvananda/netlink v1.1.1-0.20201029203352-d40f9887b852 - golang.org/x/sys v0.0.0-20201117170446-d9b008d0a637 + golang.org/x/sys v0.0.0-20210324051608-47abb6519492 ) diff --git a/go.sum b/go.sum index 66676f21..a69bbb0f 100644 --- a/go.sum +++ b/go.sum @@ -1,17 +1,183 @@ -github.com/Microsoft/go-winio v0.4.11 h1:zoIOcVf0xPN1tnMVbTtEdI+P8OofVk3NObnwOQ6nK2Q= +bazil.org/fuse v0.0.0-20160811212531-371fbbdaa898/go.mod h1:Xbm+BRKSBEpa4q4hTSxohYNQpsxXPbPry4JJWOB3LB8= +cloud.google.com/go v0.26.0/go.mod h1:aQUYkXzVsufM+DwF1aE+0xfcU+56JwCaLick0ClmMTw= +cloud.google.com/go v0.34.0/go.mod h1:aQUYkXzVsufM+DwF1aE+0xfcU+56JwCaLick0ClmMTw= +cloud.google.com/go v0.38.0/go.mod h1:990N+gfupTy94rShfmMCWGDn0LpTmnzTp2qbd1dvSRU= +cloud.google.com/go v0.44.1/go.mod h1:iSa0KzasP4Uvy3f1mN/7PiObzGgflwredwwASm/v6AU= +cloud.google.com/go v0.44.2/go.mod h1:60680Gw3Yr4ikxnPRS/oxxkBccT6SA1yMk63TGekxKY= +cloud.google.com/go v0.45.1/go.mod h1:RpBamKRgapWJb87xiFSdk4g1CME7QZg3uwTez+TSTjc= +cloud.google.com/go v0.46.3/go.mod h1:a6bKKbmY7er1mI7TEI4lsAkts/mkhTSZK8w33B4RAg0= +cloud.google.com/go v0.50.0/go.mod h1:r9sluTvynVuxRIOHXQEHMFffphuXHOMZMycpNR5e6To= +cloud.google.com/go v0.52.0/go.mod h1:pXajvRH/6o3+F9jDHZWQ5PbGhn+o8w9qiu/CffaVdO4= +cloud.google.com/go v0.53.0/go.mod h1:fp/UouUEsRkN6ryDKNW/Upv/JBKnv6WDthjR6+vze6M= +cloud.google.com/go v0.54.0/go.mod h1:1rq2OEkV3YMf6n/9ZvGWI3GWw0VoqH/1x2nd8Is/bPc= +cloud.google.com/go/bigquery v1.0.1/go.mod h1:i/xbL2UlR5RvWAURpBYZTtm/cXjCha9lbfbpx4poX+o= +cloud.google.com/go/bigquery v1.3.0/go.mod h1:PjpwJnslEMmckchkHFfq+HTD2DmtT67aNFKH1/VBDHE= +cloud.google.com/go/bigquery v1.4.0/go.mod h1:S8dzgnTigyfTmLBfrtrhyYhwRxG72rYxvftPBK2Dvzc= +cloud.google.com/go/datastore v1.0.0/go.mod h1:LXYbyblFSglQ5pkeyhO+Qmw7ukd3C+pD7TKLgZqpHYE= +cloud.google.com/go/datastore v1.1.0/go.mod h1:umbIZjpQpHh4hmRpGhH4tLFup+FVzqBi1b3c64qFpCk= +cloud.google.com/go/pubsub v1.0.1/go.mod h1:R0Gpsv3s54REJCy4fxDixWD93lHJMoZTyQ2kNxGRt3I= +cloud.google.com/go/pubsub v1.1.0/go.mod h1:EwwdRX2sKPjnvnqCa270oGRyludottCI76h+R3AArQw= +cloud.google.com/go/pubsub v1.2.0/go.mod h1:jhfEVHT8odbXTkndysNHCcx0awwzvfOlguIAii9o8iA= +cloud.google.com/go/storage v1.0.0/go.mod h1:IhtSnM/ZTZV8YYJWCY8RULGVqBDmpoyjwiyrjsg+URw= +cloud.google.com/go/storage v1.5.0/go.mod h1:tpKbwo567HUNpVclU5sGELwQWBDZ8gh0ZeosJ0Rtdos= +cloud.google.com/go/storage v1.6.0/go.mod h1:N7U0C8pVQ/+NIKOBQyamJIeKQKkZ+mxpohlUTyfDhBk= +dmitri.shuralyov.com/gpu/mtl v0.0.0-20190408044501-666a987793e9/go.mod h1:H6x//7gZCb22OMCxBHrMx7a5I7Hp++hsVxbQ4BYO7hU= +github.com/Azure/azure-sdk-for-go v16.2.1+incompatible/go.mod h1:9XXNKU+eRnpl9moKnB4QOLf1HestfXbmab5FXxiDBjc= +github.com/Azure/go-ansiterm v0.0.0-20170929234023-d6e3b3328b78/go.mod h1:LmzpDX56iTiv29bbRTIsUNlaFfuhWRQBWjQdVyAevI8= +github.com/Azure/go-autorest v10.8.1+incompatible/go.mod h1:r+4oMnoxhatjLLJ6zxSWATqVooLgysK6ZNox3g/xq24= +github.com/Azure/go-autorest v14.2.0+incompatible/go.mod h1:r+4oMnoxhatjLLJ6zxSWATqVooLgysK6ZNox3g/xq24= +github.com/Azure/go-autorest/autorest v0.11.1/go.mod h1:JFgpikqFJ/MleTTxwepExTKnFUKKszPS8UavbQYUMuw= +github.com/Azure/go-autorest/autorest/adal v0.9.0/go.mod h1:/c022QCutn2P7uY+/oQWWNcK9YU+MH96NgK+jErpbcg= +github.com/Azure/go-autorest/autorest/adal v0.9.5/go.mod h1:B7KF7jKIeC9Mct5spmyCB/A8CG/sEz1vwIRGv/bbw7A= +github.com/Azure/go-autorest/autorest/date v0.3.0/go.mod h1:BI0uouVdmngYNUzGWeSYnokU+TrmwEsOqdt8Y6sso74= +github.com/Azure/go-autorest/autorest/mocks v0.4.0/go.mod h1:LTp+uSrOhSkaKrUy935gNZuuIPPVsHlr9DSOxSayd+k= +github.com/Azure/go-autorest/autorest/mocks v0.4.1/go.mod h1:LTp+uSrOhSkaKrUy935gNZuuIPPVsHlr9DSOxSayd+k= +github.com/Azure/go-autorest/logger v0.2.0/go.mod h1:T9E3cAhj2VqvPOtCYAvby9aBXkZmbF5NWuPV8+WeEW8= +github.com/Azure/go-autorest/tracing v0.6.0/go.mod h1:+vhtPC754Xsa23ID7GlGsrdKBpUA79WCAKPPZVC2DeU= +github.com/BurntSushi/toml v0.3.1/go.mod h1:xHWCNGjB5oqiDr8zfno3MHue2Ht5sIBksp03qcyfWMU= +github.com/BurntSushi/xgb v0.0.0-20160522181843-27f122750802/go.mod h1:IVnqGOEym/WlBOVXweHU+Q+/VP0lqqI8lqeDx9IjBqo= github.com/Microsoft/go-winio v0.4.11/go.mod h1:VhR8bwka0BXejwEJY73c50VrPtXAaKcyvVC4A4RozmA= -github.com/Microsoft/hcsshim v0.8.6 h1:ZfF0+zZeYdzMIVMZHKtDKJvLHj76XCuVae/jNkjj0IA= +github.com/Microsoft/go-winio v0.4.14/go.mod h1:qXqCSQ3Xa7+6tgxaGTIe4Kpcdsi+P8jBhyzoq1bpyYA= +github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5/go.mod h1:tTuCMEN+UleMWgg9dVx4Hu52b1bJo+59jBh3ajtinzw= +github.com/Microsoft/go-winio v0.4.16-0.20201130162521-d1ffc52c7331/go.mod h1:XB6nPKklQyQ7GC9LdcBEcBl8PF76WugXOPRXwdLnMv0= +github.com/Microsoft/go-winio v0.4.16/go.mod h1:XB6nPKklQyQ7GC9LdcBEcBl8PF76WugXOPRXwdLnMv0= +github.com/Microsoft/go-winio v0.4.17-0.20210211115548-6eac466e5fa3 h1:mw6pDQqv38/WGF1cO/jF5t/jyAJ2yi7CmtFLLO5tGFI= +github.com/Microsoft/go-winio v0.4.17-0.20210211115548-6eac466e5fa3/go.mod h1:JPGBdM1cNvN/6ISo+n8V5iA4v8pBzdOpzfwIujj1a84= github.com/Microsoft/hcsshim v0.8.6/go.mod h1:Op3hHsoHPAvb6lceZHDtd9OkTew38wNoXnJs8iY7rUg= +github.com/Microsoft/hcsshim v0.8.7-0.20190325164909-8abdbb8205e4/go.mod h1:Op3hHsoHPAvb6lceZHDtd9OkTew38wNoXnJs8iY7rUg= +github.com/Microsoft/hcsshim v0.8.7/go.mod h1:OHd7sQqRFrYd3RmSgbgji+ctCwkbq2wbEYNSzOYtcBQ= +github.com/Microsoft/hcsshim v0.8.9/go.mod h1:5692vkUqntj1idxauYlpoINNKeqCiG6Sg38RRsjT5y8= +github.com/Microsoft/hcsshim v0.8.14/go.mod h1:NtVKoYxQuTLx6gEq0L96c9Ju4JbRJ4nY2ow3VK6a9Lg= +github.com/Microsoft/hcsshim v0.8.15/go.mod h1:x38A4YbHbdxJtc0sF6oIz+RG0npwSCAvn69iY6URG00= +github.com/Microsoft/hcsshim v0.8.16 h1:8/auA4LFIZFTGrqfKhGBSXwM6/4X1fHa/xniyEHu8ac= +github.com/Microsoft/hcsshim v0.8.16/go.mod h1:o5/SZqmR7x9JNKsW3pu+nqHm0MF8vbA+VxGOoXdC600= +github.com/Microsoft/hcsshim/test v0.0.0-20201218223536-d3e5debf77da/go.mod h1:5hlzMzRKMLyo42nCZ9oml8AdTlq/0cvIaBv6tK1RehU= +github.com/Microsoft/hcsshim/test v0.0.0-20210227013316-43a75bb4edd3/go.mod h1:mw7qgWloBUl75W/gVH3cQszUg1+gUITj7D6NY7ywVnY= +github.com/NYTimes/gziphandler v0.0.0-20170623195520-56545f4a5d46/go.mod h1:3wb06e3pkSAbeQ52E9H9iFoQsEEwGN64994WTCIhntQ= +github.com/PuerkitoBio/purell v1.1.1/go.mod h1:c11w/QuzBsJSee3cPx9rAFu61PvFxuPbtSwDGJws/X0= +github.com/PuerkitoBio/urlesc v0.0.0-20170810143723-de5bf2ad4578/go.mod h1:uGdkoq3SwY9Y+13GIhn11/XLaGBb4BfwItxLd5jeuXE= +github.com/Shopify/logrus-bugsnag v0.0.0-20171204204709-577dee27f20d/go.mod h1:HI8ITrYtUY+O+ZhtlqUnD8+KwNPOyugEhfP9fdUIaEQ= +github.com/alecthomas/template v0.0.0-20160405071501-a0175ee3bccc/go.mod h1:LOuyumcjzFXgccqObfd/Ljyb9UuFJ6TxHnclSeseNhc= +github.com/alecthomas/template v0.0.0-20190718012654-fb15b899a751/go.mod h1:LOuyumcjzFXgccqObfd/Ljyb9UuFJ6TxHnclSeseNhc= +github.com/alecthomas/units v0.0.0-20151022065526-2efee857e7cf/go.mod h1:ybxpYRFXyAe+OPACYpWeL0wqObRcbAqCMya13uyzqw0= +github.com/alecthomas/units v0.0.0-20190717042225-c3de453c63f4/go.mod h1:ybxpYRFXyAe+OPACYpWeL0wqObRcbAqCMya13uyzqw0= github.com/alexflint/go-filemutex v0.0.0-20171022225611-72bdc8eae2ae h1:AMzIhMUqU3jMrZiTuW0zkYeKlKDAFD+DG20IoO421/Y= github.com/alexflint/go-filemutex v0.0.0-20171022225611-72bdc8eae2ae/go.mod h1:CgnQgUtFrFz9mxFNtED3jI5tLDjKlOM+oUF/sTk6ps0= +github.com/asaskevich/govalidator v0.0.0-20190424111038-f61b66f89f4a/go.mod h1:lB+ZfQJz7igIIfQNfa7Ml4HSf2uFQQRzpGGRXenZAgY= +github.com/aws/aws-sdk-go v1.15.11/go.mod h1:mFuSZ37Z9YOHbQEwBWztmVzqXrEkub65tZoCYDt7FT0= +github.com/beorn7/perks v0.0.0-20160804104726-4c0e84591b9a/go.mod h1:Dwedo/Wpr24TaqPxmxbtue+5NUziq4I4S80YR8gNf3Q= +github.com/beorn7/perks v0.0.0-20180321164747-3a771d992973/go.mod h1:Dwedo/Wpr24TaqPxmxbtue+5NUziq4I4S80YR8gNf3Q= +github.com/beorn7/perks v1.0.0/go.mod h1:KWe93zE9D1o94FZ5RNwFwVgaQK1VOXiVxmqh+CedLV8= +github.com/beorn7/perks v1.0.1/go.mod h1:G2ZrVWU2WbWT9wwq4/hrbKbnv/1ERSJQ0ibhJ6rlkpw= +github.com/bgentry/speakeasy v0.1.0/go.mod h1:+zsyZBPWlz7T6j88CTgSN5bM796AkVf0kBD4zp0CCIs= +github.com/bitly/go-simplejson v0.5.0/go.mod h1:cXHtHw4XUPsvGaxgjIAn8PhEWG9NfngEKAMDJEczWVA= +github.com/blang/semver v3.1.0+incompatible/go.mod h1:kRBLl5iJ+tD4TcOOxsy/0fnwebNt5EWlYSAyrTnjyyk= +github.com/blang/semver v3.5.1+incompatible/go.mod h1:kRBLl5iJ+tD4TcOOxsy/0fnwebNt5EWlYSAyrTnjyyk= +github.com/bmizerany/assert v0.0.0-20160611221934-b7ed37b82869/go.mod h1:Ekp36dRnpXw/yCqJaO+ZrUyxD+3VXMFFr56k5XYrpB4= +github.com/bshuster-repo/logrus-logstash-hook v0.4.1/go.mod h1:zsTqEiSzDgAa/8GZR7E1qaXrhYNDKBYy5/dWPTIflbk= github.com/buger/jsonparser v0.0.0-20180808090653-f4dd9f5a6b44 h1:y853v6rXx+zefEcjET3JuKAqvhj+FKflQijjeaSv2iA= github.com/buger/jsonparser v0.0.0-20180808090653-f4dd9f5a6b44/go.mod h1:bbYlZJ7hK1yFx9hf58LP0zeX7UjIGs20ufpu3evjr+s= +github.com/bugsnag/bugsnag-go v0.0.0-20141110184014-b1d153021fcd/go.mod h1:2oa8nejYd4cQ/b0hMIopN0lCRxU0bueqREvZLWFrtK8= +github.com/bugsnag/osext v0.0.0-20130617224835-0dd3f918b21b/go.mod h1:obH5gd0BsqsP2LwDJ9aOkm/6J86V6lyAXCoQWGw3K50= +github.com/bugsnag/panicwrap v0.0.0-20151223152923-e2c28503fcd0/go.mod h1:D/8v3kj0zr8ZAKg1AQ6crr+5VwKN5eIywRkfhyM/+dE= +github.com/census-instrumentation/opencensus-proto v0.2.1/go.mod h1:f6KPmirojxKA12rnyqOA5BBL4O983OfeGPqjHWSTneU= +github.com/cespare/xxhash/v2 v2.1.1/go.mod h1:VGX0DQ3Q6kWi7AoAeZDth3/j3BFtOZR5XLFGgcrjCOs= +github.com/checkpoint-restore/go-criu/v4 v4.1.0/go.mod h1:xUQBLp4RLc5zJtWY++yjOoMoB5lihDt7fai+75m+rGw= +github.com/chzyer/logex v1.1.10/go.mod h1:+Ywpsq7O8HXn0nuIou7OrIPyXbp3wmkHB+jjWRnGsAI= +github.com/chzyer/readline v0.0.0-20180603132655-2972be24d48e/go.mod h1:nSuG5e5PlCu98SY8svDHJxuZscDgtXS6KTTbou5AhLI= +github.com/chzyer/test v0.0.0-20180213035817-a1ea475d72b1/go.mod h1:Q3SI9o4m/ZMnBNeIyt5eFwwo7qiLfzFZmjNmxjkiQlU= +github.com/cilium/ebpf v0.0.0-20200110133405-4032b1d8aae3/go.mod h1:MA5e5Lr8slmEg9bt0VpxxWqJlO4iwu3FBdHUzV7wQVg= +github.com/cilium/ebpf v0.0.0-20200702112145-1c8d4c9ef775/go.mod h1:7cR51M8ViRLIdUjrmSXlK9pkrsDlLHbO8jiB8X8JnOc= +github.com/cilium/ebpf v0.2.0/go.mod h1:To2CFviqOWL/M0gIMsvSMlqe7em/l1ALkX1PyjrX2Qs= +github.com/client9/misspell v0.3.4/go.mod h1:qj6jICC3Q7zFZvVWo7KLAzC3yx5G7kyvSDkc90ppPyw= +github.com/cncf/udpa/go v0.0.0-20191209042840-269d4d468f6f/go.mod h1:M8M6+tZqaGXZJjfX53e64911xZQV5JYwmTeXPW+k8Sc= +github.com/cockroachdb/datadriven v0.0.0-20190809214429-80d97fb3cbaa/go.mod h1:zn76sxSg3SzpJ0PPJaLDCu+Bu0Lg3sKTORVIj19EIF8= +github.com/containerd/aufs v0.0.0-20200908144142-dab0cbea06f4/go.mod h1:nukgQABAEopAHvB6j7cnP5zJ+/3aVcE7hCYqvIwAHyE= +github.com/containerd/aufs v0.0.0-20201003224125-76a6863f2989/go.mod h1:AkGGQs9NM2vtYHaUen+NljV0/baGCAPELGm2q9ZXpWU= +github.com/containerd/aufs v0.0.0-20210316121734-20793ff83c97/go.mod h1:kL5kd6KM5TzQjR79jljyi4olc1Vrx6XBlcyj3gNv2PU= +github.com/containerd/btrfs v0.0.0-20201111183144-404b9149801e/go.mod h1:jg2QkJcsabfHugurUvvPhS3E08Oxiuh5W/g1ybB4e0E= +github.com/containerd/btrfs v0.0.0-20210316141732-918d888fb676/go.mod h1:zMcX3qkXTAi9GI50+0HOeuV8LU2ryCE/V2vG/ZBiTss= +github.com/containerd/cgroups v0.0.0-20190717030353-c4b9ac5c7601/go.mod h1:X9rLEHIqSf/wfK8NsPqxJmeZgW4pcfzdXITDrUSJ6uI= +github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f/go.mod h1:OApqhQ4XNSNC13gXIwDjhOQxjWa/NxkwZXJ1EvqT0ko= +github.com/containerd/cgroups v0.0.0-20200531161412-0dbf7f05ba59/go.mod h1:pA0z1pT8KYB3TCXK/ocprsh7MAkoW8bZVzPdih9snmM= +github.com/containerd/cgroups v0.0.0-20200710171044-318312a37340/go.mod h1:s5q4SojHctfxANBDvMeIaIovkq29IP48TKAxnhYRxvo= +github.com/containerd/cgroups v0.0.0-20200824123100-0b889c03f102/go.mod h1:s5q4SojHctfxANBDvMeIaIovkq29IP48TKAxnhYRxvo= +github.com/containerd/cgroups v0.0.0-20210114181951-8a68de567b68 h1:hkGVFjz+plgr5UfxZUTPFbUFIF/Km6/s+RVRIRHLrrY= +github.com/containerd/cgroups v0.0.0-20210114181951-8a68de567b68/go.mod h1:ZJeTFisyysqgcCdecO57Dj79RfL0LNeGiFUqLYQRYLE= +github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1/go.mod h1:Tj/on1eG8kiEhd0+fhSDzsPAFESxzBBvdyEgyryXffw= +github.com/containerd/console v0.0.0-20181022165439-0650fd9eeb50/go.mod h1:Tj/on1eG8kiEhd0+fhSDzsPAFESxzBBvdyEgyryXffw= +github.com/containerd/console v0.0.0-20191206165004-02ecf6a7291e/go.mod h1:8Pf4gM6VEbTNRIT26AyyU7hxdQU3MvAvxVI0sc00XBE= +github.com/containerd/console v1.0.1/go.mod h1:XUsP6YE/mKtz6bxc+I8UiKKTP04qjQL4qcS3XoQ5xkw= +github.com/containerd/containerd v1.2.10/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= +github.com/containerd/containerd v1.3.0-beta.2.0.20190828155532-0293cbd26c69/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= +github.com/containerd/containerd v1.3.0/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= +github.com/containerd/containerd v1.3.1-0.20191213020239-082f7e3aed57/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= +github.com/containerd/containerd v1.3.2/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= +github.com/containerd/containerd v1.4.0-beta.2.0.20200729163537-40b22ef07410/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= +github.com/containerd/containerd v1.4.1/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= +github.com/containerd/containerd v1.4.3/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= +github.com/containerd/containerd v1.5.0-beta.1/go.mod h1:5HfvG1V2FsKesEGQ17k5/T7V960Tmcumvqn8Mc+pCYQ= +github.com/containerd/containerd v1.5.0-beta.3/go.mod h1:/wr9AVtEM7x9c+n0+stptlo/uBBoBORwEx6ardVcmKU= +github.com/containerd/containerd v1.5.0-beta.4/go.mod h1:GmdgZd2zA2GYIBZ0w09ZvgqEq8EfBp/m3lcVZIvPHhI= +github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y= +github.com/containerd/continuity v0.0.0-20190815185530-f2a389ac0a02/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y= +github.com/containerd/continuity v0.0.0-20191127005431-f65d91d395eb/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y= +github.com/containerd/continuity v0.0.0-20200710164510-efbc4488d8fe/go.mod h1:cECdGN1O8G9bgKTlLhuPJimka6Xb/Gg7vYzCTNVxhvo= +github.com/containerd/continuity v0.0.0-20201208142359-180525291bb7/go.mod h1:kR3BEg7bDFaEddKm54WSmrol1fKWDU1nKYkgrcgZT7Y= +github.com/containerd/continuity v0.0.0-20210208174643-50096c924a4e/go.mod h1:EXlVlkqNba9rJe3j7w3Xa924itAMLgZH4UD/Q4PExuQ= +github.com/containerd/fifo v0.0.0-20180307165137-3d5202aec260/go.mod h1:ODA38xgv3Kuk8dQz2ZQXpnv/UZZUHUCL7pnLehbXgQI= +github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448/go.mod h1:ODA38xgv3Kuk8dQz2ZQXpnv/UZZUHUCL7pnLehbXgQI= +github.com/containerd/fifo v0.0.0-20200410184934-f15a3290365b/go.mod h1:jPQ2IAeZRCYxpS/Cm1495vGFww6ecHmMk1YJH2Q5ln0= +github.com/containerd/fifo v0.0.0-20201026212402-0724c46b320c/go.mod h1:jPQ2IAeZRCYxpS/Cm1495vGFww6ecHmMk1YJH2Q5ln0= +github.com/containerd/fifo v0.0.0-20210316144830-115abcc95a1d/go.mod h1:ocF/ME1SX5b1AOlWi9r677YJmCPSwwWnQ9O123vzpE4= +github.com/containerd/go-cni v1.0.1/go.mod h1:+vUpYxKvAF72G9i1WoDOiPGRtQpqsNW/ZHtSlv++smU= +github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3/go.mod h1:IV7qH3hrUgRmyYrtgEeGWJfWbgcHL9CSRruz2Vqcph0= +github.com/containerd/go-runc v0.0.0-20190911050354-e029b79d8cda/go.mod h1:IV7qH3hrUgRmyYrtgEeGWJfWbgcHL9CSRruz2Vqcph0= +github.com/containerd/go-runc v0.0.0-20200220073739-7016d3ce2328/go.mod h1:PpyHrqVs8FTi9vpyHwPwiNEGaACDxT/N/pLcvMSRA9g= +github.com/containerd/go-runc v0.0.0-20201020171139-16b287bc67d0/go.mod h1:cNU0ZbCgCQVZK4lgG3P+9tn9/PaJNmoDXPpoJhDR+Ok= +github.com/containerd/imgcrypt v1.0.1/go.mod h1:mdd8cEPW7TPgNG4FpuP3sGBiQ7Yi/zak9TYCG3juvb0= +github.com/containerd/imgcrypt v1.0.4-0.20210301171431-0ae5c75f59ba/go.mod h1:6TNsg0ctmizkrOgXRNQjAPFWpMYRWuiB6dSF4Pfa5SA= +github.com/containerd/imgcrypt v1.1.1-0.20210312161619-7ed62a527887/go.mod h1:5AZJNI6sLHJljKuI9IHnw1pWqo/F0nGDOuR9zgTs7ow= +github.com/containerd/nri v0.0.0-20201007170849-eb1350a75164/go.mod h1:+2wGSDGFYfE5+So4M5syatU0N0f0LbWpuqyMi4/BE8c= +github.com/containerd/nri v0.0.0-20210316161719-dbaa18c31c14/go.mod h1:lmxnXF6oMkbqs39FiCt1s0R2HSMhcLel9vNL3m4AaeY= +github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de/go.mod h1:PvCDdDGpgqzQIzDW1TphrGLssLDZp2GuS+X5DkEJB8o= +github.com/containerd/ttrpc v0.0.0-20190828172938-92c8520ef9f8/go.mod h1:PvCDdDGpgqzQIzDW1TphrGLssLDZp2GuS+X5DkEJB8o= +github.com/containerd/ttrpc v0.0.0-20191028202541-4f1b8fe65a5c/go.mod h1:LPm1u0xBw8r8NOKoOdNMeVHSawSsltak+Ihv+etqsE8= +github.com/containerd/ttrpc v1.0.1/go.mod h1:UAxOpgT9ziI0gJrmKvgcZivgxOp8iFPSk8httJEt98Y= +github.com/containerd/ttrpc v1.0.2/go.mod h1:UAxOpgT9ziI0gJrmKvgcZivgxOp8iFPSk8httJEt98Y= +github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd/go.mod h1:Cm3kwCdlkCfMSHURc+r6fwoGH6/F1hH3S4sg0rLFWPc= +github.com/containerd/typeurl v0.0.0-20190911142611-5eb25027c9fd/go.mod h1:GeKYzf2pQcqv7tJ0AoCuuhtnqhva5LNU3U+OyKxxJpk= +github.com/containerd/typeurl v1.0.1/go.mod h1:TB1hUtrpaiO88KEK56ijojHS1+NeF0izUACaJW2mdXg= +github.com/containerd/zfs v0.0.0-20200918131355-0a33824f23a2/go.mod h1:8IgZOBdv8fAgXddBT4dBXJPtxyRsejFIpXoklgxgEjw= +github.com/containerd/zfs v0.0.0-20210301145711-11e8f1707f62/go.mod h1:A9zfAbMlQwE+/is6hi0Xw8ktpL+6glmqZYtevJgaB8Y= +github.com/containerd/zfs v0.0.0-20210315114300-dde8f0fda960/go.mod h1:m+m51S1DvAP6r3FcmYCp54bQ34pyOwTieQDNRIRHsFY= +github.com/containernetworking/cni v0.7.1/go.mod h1:LGwApLUm2FpoOfxTDEeq8T9ipbpZ61X79hmU3w8FmsY= +github.com/containernetworking/cni v0.8.0/go.mod h1:LGwApLUm2FpoOfxTDEeq8T9ipbpZ61X79hmU3w8FmsY= github.com/containernetworking/cni v0.8.1-0.20201216164644-62e54113f44a h1:EDko/CXJ2CYF5pFdlTO/qHwkD0IxpSQY+FcTll6A/F4= github.com/containernetworking/cni v0.8.1-0.20201216164644-62e54113f44a/go.mod h1:AKuhXbN5EzmD4yTNtfSsX3tPcmtrBI6QcRV0NiNt15Y= +github.com/containernetworking/plugins v0.8.6/go.mod h1:qnw5mN19D8fIwkqW7oHHYDHVlzhJpcY6TQxn/fUyDDM= +github.com/containers/ocicrypt v1.0.1/go.mod h1:MeJDzk1RJHv89LjsH0Sp5KTY3ZYkjXO/C+bKAeWFIrc= +github.com/containers/ocicrypt v1.1.0/go.mod h1:b8AOe0YR67uU8OqfVNcznfFpAzu3rdgUV4GP9qXPfu4= +github.com/coreos/go-iptables v0.4.5/go.mod h1:/mVI274lEDI2ns62jHCDnCyBF9Iwsmekav8Dbxlm1MU= github.com/coreos/go-iptables v0.5.0 h1:mw6SAibtHKZcNzAsOxjoHIG0gy5YFHhypWSSNc6EjbQ= github.com/coreos/go-iptables v0.5.0/go.mod h1:/mVI274lEDI2ns62jHCDnCyBF9Iwsmekav8Dbxlm1MU= +github.com/coreos/go-oidc v2.1.0+incompatible/go.mod h1:CgnwVTmzoESiwO9qyAFEMiHoZ1nMCKZlZ9V6mm3/LKc= +github.com/coreos/go-semver v0.2.0/go.mod h1:nnelYz7RCh+5ahJtPPxZlU+153eP4D4r3EedlOD2RNk= +github.com/coreos/go-semver v0.3.0/go.mod h1:nnelYz7RCh+5ahJtPPxZlU+153eP4D4r3EedlOD2RNk= +github.com/coreos/go-systemd v0.0.0-20161114122254-48702e0da86b/go.mod h1:F5haX7vjVVG0kc13fIWeqUViNPyEJxv/OmvnBo0Yme4= +github.com/coreos/go-systemd v0.0.0-20180511133405-39ca1b05acc7/go.mod h1:F5haX7vjVVG0kc13fIWeqUViNPyEJxv/OmvnBo0Yme4= +github.com/coreos/go-systemd v0.0.0-20190321100706-95778dfbb74e h1:Wf6HqHfScWJN9/ZjdUKyjop4mf3Qdd+1TvvltAvM3m8= +github.com/coreos/go-systemd v0.0.0-20190321100706-95778dfbb74e/go.mod h1:F5haX7vjVVG0kc13fIWeqUViNPyEJxv/OmvnBo0Yme4= +github.com/coreos/go-systemd/v22 v22.0.0/go.mod h1:xO0FLkIi5MaZafQlIrOotqXZ90ih+1atmu1JpKERPPk= +github.com/coreos/go-systemd/v22 v22.1.0/go.mod h1:xO0FLkIi5MaZafQlIrOotqXZ90ih+1atmu1JpKERPPk= github.com/coreos/go-systemd/v22 v22.2.0 h1:BBmbNtSc5PuUM3Byxs7yE5rLdxQO4/FMoEXY5Rle4GA= github.com/coreos/go-systemd/v22 v22.2.0/go.mod h1:xO0FLkIi5MaZafQlIrOotqXZ90ih+1atmu1JpKERPPk= +github.com/coreos/pkg v0.0.0-20160727233714-3ac0863d7acf/go.mod h1:E3G3o1h8I7cfcXa63jLwjI0eiQQMgzzUDFVpN/nH/eA= +github.com/coreos/pkg v0.0.0-20180928190104-399ea9e2e55f/go.mod h1:E3G3o1h8I7cfcXa63jLwjI0eiQQMgzzUDFVpN/nH/eA= +github.com/cpuguy83/go-md2man/v2 v2.0.0-20190314233015-f79a8a8ca69d/go.mod h1:maD7wRr/U5Z6m/iR4s+kqSMx2CaBsrgA7czyZG/E6dU= +github.com/cpuguy83/go-md2man/v2 v2.0.0/go.mod h1:maD7wRr/U5Z6m/iR4s+kqSMx2CaBsrgA7czyZG/E6dU= +github.com/creack/pty v1.1.7/go.mod h1:lj5s0c3V2DBrqTV7llrYr5NG6My20zk30Fl46Y7DoTY= +github.com/cyphar/filepath-securejoin v0.2.2/go.mod h1:FpkQEhXnPnOthhzymB7CGsFk2G9VLXONKD9G7QGMM+4= github.com/d2g/dhcp4 v0.0.0-20170904100407-a1d1b6c41b1c h1:Xo2rK1pzOm0jO6abTPIQwbAmqBIOj132otexc1mmzFc= github.com/d2g/dhcp4 v0.0.0-20170904100407-a1d1b6c41b1c/go.mod h1:Ct2BUK8SB0YC1SMSibvLzxjeJLnrYEVLULFNiHY9YfQ= github.com/d2g/dhcp4client v1.0.0 h1:suYBsYZIkSlUMEz4TAYCczKf62IA2UWC+O8+KtdOhCo= @@ -20,101 +186,688 @@ github.com/d2g/dhcp4server v0.0.0-20181031114812-7d4a0a7f59a5 h1:+CpLbZIeUn94m02 github.com/d2g/dhcp4server v0.0.0-20181031114812-7d4a0a7f59a5/go.mod h1:Eo87+Kg/IX2hfWJfwxMzLyuSZyxSoAug2nGa1G2QAi8= github.com/d2g/hardwareaddr v0.0.0-20190221164911-e7d9fbe030e4 h1:itqmmf1PFpC4n5JW+j4BU7X4MTfVurhYRTjODoPb2Y8= github.com/d2g/hardwareaddr v0.0.0-20190221164911-e7d9fbe030e4/go.mod h1:bMl4RjIciD2oAxI7DmWRx6gbeqrkoLqv3MV0vzNad+I= -github.com/davecgh/go-spew v1.1.0 h1:ZDRjVQ15GmhC3fiQ8ni8+OwkZQO4DARzQgrnXU1Liz8= github.com/davecgh/go-spew v1.1.0/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38= github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c= github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38= -github.com/fsnotify/fsnotify v1.4.7 h1:IXs+QLmnXW2CcXuY+8Mzv/fWEsPGWxqefPtCP5CnV9I= +github.com/denverdino/aliyungo v0.0.0-20190125010748-a747050bb1ba/go.mod h1:dV8lFg6daOBZbT6/BDGIz6Y3WFGn8juu6G+CQ6LHtl0= +github.com/dgrijalva/jwt-go v0.0.0-20170104182250-a601269ab70c/go.mod h1:E3ru+11k8xSBh+hMPgOLZmtrrCbhqsmaPHjLKYnJCaQ= +github.com/dgrijalva/jwt-go v3.2.0+incompatible/go.mod h1:E3ru+11k8xSBh+hMPgOLZmtrrCbhqsmaPHjLKYnJCaQ= +github.com/dnaeon/go-vcr v1.0.1/go.mod h1:aBB1+wY4s93YsC3HHjMBMrwTj2R9FHDzUr9KyGc8n1E= +github.com/docker/distribution v0.0.0-20190905152932-14b96e55d84c/go.mod h1:0+TTO4EOBfRPhZXAeF1Vu+W3hHZ8eLp8PgKVZlcvtFY= +github.com/docker/distribution v2.7.1-0.20190205005809-0d3efadf0154+incompatible/go.mod h1:J2gT2udsDAN96Uj4KfcMRqY0/ypR+oyYUYmja8H+y+w= +github.com/docker/distribution v2.7.1+incompatible/go.mod h1:J2gT2udsDAN96Uj4KfcMRqY0/ypR+oyYUYmja8H+y+w= +github.com/docker/go-events v0.0.0-20170721190031-9461782956ad/go.mod h1:Uw6UezgYA44ePAFQYUehOuCzmy5zmg/+nl2ZfMWGkpA= +github.com/docker/go-events v0.0.0-20190806004212-e31b211e4f1c/go.mod h1:Uw6UezgYA44ePAFQYUehOuCzmy5zmg/+nl2ZfMWGkpA= +github.com/docker/go-metrics v0.0.0-20180209012529-399ea8c73916/go.mod h1:/u0gXw0Gay3ceNrsHubL3BtdOL2fHf93USgMTe0W5dI= +github.com/docker/go-metrics v0.0.1/go.mod h1:cG1hvH2utMXtqgqqYE9plW6lDxS3/5ayHzueweSI3Vw= +github.com/docker/go-units v0.4.0/go.mod h1:fgPhTUdO+D/Jk86RDLlptpiXQzgHJF7gydDDbaIK4Dk= +github.com/docker/libtrust v0.0.0-20150114040149-fa567046d9b1/go.mod h1:cyGadeNEkKy96OOhEzfZl+yxihPEzKnqJwvfuSUqbZE= +github.com/docker/spdystream v0.0.0-20160310174837-449fdfce4d96/go.mod h1:Qh8CwZgvJUkLughtfhJv5dyTYa91l1fOUCrgjqmcifM= +github.com/docopt/docopt-go v0.0.0-20180111231733-ee0de3bc6815/go.mod h1:WwZ+bS3ebgob9U8Nd0kOddGdZWjyMGR8Wziv+TBNwSE= +github.com/dustin/go-humanize v0.0.0-20171111073723-bb3d318650d4/go.mod h1:HtrtbFcZ19U5GC7JDqmcUSB87Iq5E25KnS6fMYU6eOk= +github.com/dustin/go-humanize v1.0.0/go.mod h1:HtrtbFcZ19U5GC7JDqmcUSB87Iq5E25KnS6fMYU6eOk= +github.com/elazarl/goproxy v0.0.0-20180725130230-947c36da3153/go.mod h1:/Zj4wYkgs4iZTTu3o/KG3Itv/qCCa8VVMlb3i9OVuzc= +github.com/emicklei/go-restful v0.0.0-20170410110728-ff4f55a20633/go.mod h1:otzb+WCGbkyDHkqmQmT5YD2WR4BBwUdeQoFo8l/7tVs= +github.com/emicklei/go-restful v2.9.5+incompatible/go.mod h1:otzb+WCGbkyDHkqmQmT5YD2WR4BBwUdeQoFo8l/7tVs= +github.com/envoyproxy/go-control-plane v0.9.0/go.mod h1:YTl/9mNaCwkRvm6d1a2C3ymFceY/DCBVvsKhRF0iEA4= +github.com/envoyproxy/go-control-plane v0.9.1-0.20191026205805-5f8ba28d4473/go.mod h1:YTl/9mNaCwkRvm6d1a2C3ymFceY/DCBVvsKhRF0iEA4= +github.com/envoyproxy/go-control-plane v0.9.4/go.mod h1:6rpuAdCZL397s3pYoYcLgu1mIlRU8Am5FuJP05cCM98= +github.com/envoyproxy/protoc-gen-validate v0.1.0/go.mod h1:iSmxcyjqTsJpI2R4NaDN7+kN2VEUnK/pcBlmesArF7c= +github.com/evanphx/json-patch v4.9.0+incompatible/go.mod h1:50XU6AFN0ol/bzJsmQLiYLvXMP4fmwYFNcr97nuDLSk= +github.com/fatih/color v1.7.0/go.mod h1:Zm6kSWBoL9eyXnKyktHP6abPY2pDugNf5KwzbycvMj4= +github.com/form3tech-oss/jwt-go v3.2.2+incompatible/go.mod h1:pbq4aXjuKjdthFRnoDwaVPLA+WlJuPGy+QneDUgJi2k= github.com/fsnotify/fsnotify v1.4.7/go.mod h1:jwhsz4b93w/PPRr/qN1Yymfu8t87LnFCMoQvtojpjFo= github.com/fsnotify/fsnotify v1.4.9 h1:hsms1Qyu0jgnwNXIxa+/V/PDsU6CfLf6CNO8H7IWoS4= github.com/fsnotify/fsnotify v1.4.9/go.mod h1:znqG4EE+3YCdAaPaxE2ZRY/06pZUdp0tY4IgpuI1SZQ= +github.com/fullsailor/pkcs7 v0.0.0-20190404230743-d7302db945fa/go.mod h1:KnogPXtdwXqoenmZCw6S+25EAm2MkxbG0deNDu4cbSA= +github.com/garyburd/redigo v0.0.0-20150301180006-535138d7bcd7/go.mod h1:NR3MbYisc3/PwhQ00EMzDiPmrwpPxAn5GI05/YaO1SY= +github.com/ghodss/yaml v0.0.0-20150909031657-73d445a93680/go.mod h1:4dBDuWmgqj2HViK6kFavaiC9ZROes6MMH2rRYeMEF04= +github.com/ghodss/yaml v1.0.0/go.mod h1:4dBDuWmgqj2HViK6kFavaiC9ZROes6MMH2rRYeMEF04= +github.com/go-gl/glfw v0.0.0-20190409004039-e6da0acd62b1/go.mod h1:vR7hzQXu2zJy9AVAgeJqvqgH9Q5CA+iKCZ2gyEVpxRU= +github.com/go-gl/glfw/v3.3/glfw v0.0.0-20191125211704-12ad95a8df72/go.mod h1:tQ2UAYgL5IevRw8kRxooKSPJfGvJ9fJQFa0TUsXzTg8= +github.com/go-gl/glfw/v3.3/glfw v0.0.0-20200222043503-6f7a984d4dc4/go.mod h1:tQ2UAYgL5IevRw8kRxooKSPJfGvJ9fJQFa0TUsXzTg8= +github.com/go-ini/ini v1.25.4/go.mod h1:ByCAeIL28uOIIG0E3PJtZPDL8WnHpFKFOtgjp+3Ies8= +github.com/go-kit/kit v0.8.0/go.mod h1:xBxKIO96dXMWWy0MnWVtmwkA9/13aqxPnvrjFYMA2as= +github.com/go-kit/kit v0.9.0/go.mod h1:xBxKIO96dXMWWy0MnWVtmwkA9/13aqxPnvrjFYMA2as= +github.com/go-logfmt/logfmt v0.3.0/go.mod h1:Qt1PoO58o5twSAckw1HlFXLmHsOX5/0LbT9GBnD5lWE= +github.com/go-logfmt/logfmt v0.4.0/go.mod h1:3RMwSq7FuexP4Kalkev3ejPJsZTpXXBr9+V4qmtdjCk= +github.com/go-logr/logr v0.1.0/go.mod h1:ixOQHD9gLJUVQQ2ZOR7zLEifBX6tGkNJF4QyIY7sIas= +github.com/go-logr/logr v0.2.0/go.mod h1:z6/tIYblkpsD+a4lm/fGIIU9mZ+XfAiaFtq7xTgseGU= +github.com/go-openapi/jsonpointer v0.19.2/go.mod h1:3akKfEdA7DF1sugOqz1dVQHBcuDBPKZGEoHC/NkiQRg= +github.com/go-openapi/jsonpointer v0.19.3/go.mod h1:Pl9vOtqEWErmShwVjC8pYs9cog34VGT37dQOVbmoatg= +github.com/go-openapi/jsonreference v0.19.2/go.mod h1:jMjeRr2HHw6nAVajTXJ4eiUwohSTlpa0o73RUL1owJc= +github.com/go-openapi/jsonreference v0.19.3/go.mod h1:rjx6GuL8TTa9VaixXglHmQmIL98+wF9xc8zWvFonSJ8= +github.com/go-openapi/spec v0.19.3/go.mod h1:FpwSN1ksY1eteniUU7X0N/BgJ7a4WvBFVA8Lj9mJglo= +github.com/go-openapi/swag v0.19.2/go.mod h1:POnQmlKehdgb5mhVOsnJFsivZCEZ/vjK9gh66Z9tfKk= +github.com/go-openapi/swag v0.19.5/go.mod h1:POnQmlKehdgb5mhVOsnJFsivZCEZ/vjK9gh66Z9tfKk= +github.com/go-stack/stack v1.8.0/go.mod h1:v0f6uXyyMGvRgIKkXu+yp6POWl0qKG85gN/melR3HDY= +github.com/godbus/dbus v0.0.0-20151105175453-c7fdd8b5cd55/go.mod h1:/YcGZj5zSblfDWMMoOzV4fas9FZnQYTkDnsGvmh2Grw= +github.com/godbus/dbus v0.0.0-20180201030542-885f9cc04c9c/go.mod h1:/YcGZj5zSblfDWMMoOzV4fas9FZnQYTkDnsGvmh2Grw= +github.com/godbus/dbus v0.0.0-20190422162347-ade71ed3457e h1:BWhy2j3IXJhjCbC68FptL43tDKIq8FladmaTs3Xs7Z8= +github.com/godbus/dbus v0.0.0-20190422162347-ade71ed3457e/go.mod h1:bBOAhwG1umN6/6ZUMtDFBMQR8jRg9O75tm9K00oMsK4= github.com/godbus/dbus/v5 v5.0.3 h1:ZqHaoEF7TBzh4jzPmqVhE/5A1z9of6orkAe5uHoAeME= github.com/godbus/dbus/v5 v5.0.3/go.mod h1:xhWf0FNVPg57R7Z0UbKHbJfkEywrmjJnf7w5xrFpKfA= +github.com/gogo/googleapis v1.2.0/go.mod h1:Njal3psf3qN6dwBtQfUmBZh2ybovJ0tlu3o/AC7HYjU= +github.com/gogo/googleapis v1.4.0/go.mod h1:5YRNX2z1oM5gXdAkurHa942MDgEJyk02w4OecKY87+c= +github.com/gogo/protobuf v1.1.1/go.mod h1:r8qH/GZQm5c6nD/R0oafs1akxWv10x8SbQlK7atdtwQ= +github.com/gogo/protobuf v1.2.1/go.mod h1:hp+jE20tsWTFYpLwKvXlhS1hjn+gTNwPg2I6zVXpSg4= +github.com/gogo/protobuf v1.2.2-0.20190723190241-65acae22fc9d/go.mod h1:SlYgWuQ5SjCEi6WLHjHCa1yvBfUnHcTbrrZtXPKa29o= +github.com/gogo/protobuf v1.3.0/go.mod h1:SlYgWuQ5SjCEi6WLHjHCa1yvBfUnHcTbrrZtXPKa29o= +github.com/gogo/protobuf v1.3.1/go.mod h1:SlYgWuQ5SjCEi6WLHjHCa1yvBfUnHcTbrrZtXPKa29o= +github.com/gogo/protobuf v1.3.2 h1:Ov1cvc58UF3b5XjBnZv7+opcTcQFZebYjWzi34vdm4Q= +github.com/gogo/protobuf v1.3.2/go.mod h1:P1XiOD3dCwIKUDQYPy72D8LYyHL2YPYrpS2s69NZV8Q= +github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b/go.mod h1:SBH7ygxi8pfUlaOkMMuAQtPIUF8ecWP5IEl/CR7VP2Q= +github.com/golang/groupcache v0.0.0-20160516000752-02826c3e7903/go.mod h1:cIg4eruTrX1D+g88fzRXU5OdNfaM+9IcxsU14FzY7Hc= +github.com/golang/groupcache v0.0.0-20190702054246-869f871628b6/go.mod h1:cIg4eruTrX1D+g88fzRXU5OdNfaM+9IcxsU14FzY7Hc= +github.com/golang/groupcache v0.0.0-20191227052852-215e87163ea7/go.mod h1:cIg4eruTrX1D+g88fzRXU5OdNfaM+9IcxsU14FzY7Hc= +github.com/golang/groupcache v0.0.0-20200121045136-8c9f03a8e57e h1:1r7pUrabqp18hOBcwBwiTsbnFeTZHV9eER/QT5JVZxY= +github.com/golang/groupcache v0.0.0-20200121045136-8c9f03a8e57e/go.mod h1:cIg4eruTrX1D+g88fzRXU5OdNfaM+9IcxsU14FzY7Hc= +github.com/golang/mock v1.1.1/go.mod h1:oTYuIxOrZwtPieC+H1uAHpcLFnEyAGVDL/k47Jfbm0A= +github.com/golang/mock v1.2.0/go.mod h1:oTYuIxOrZwtPieC+H1uAHpcLFnEyAGVDL/k47Jfbm0A= +github.com/golang/mock v1.3.1/go.mod h1:sBzyDLLjw3U8JLTeZvSv8jJB+tU5PVekmnlKIyFUx0Y= +github.com/golang/mock v1.4.0/go.mod h1:UOMv5ysSaYNkG+OFQykRIcU/QvvxJf3p21QfJ2Bt3cw= +github.com/golang/mock v1.4.1/go.mod h1:UOMv5ysSaYNkG+OFQykRIcU/QvvxJf3p21QfJ2Bt3cw= github.com/golang/protobuf v1.2.0/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= +github.com/golang/protobuf v1.3.1/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= +github.com/golang/protobuf v1.3.2/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= +github.com/golang/protobuf v1.3.3/go.mod h1:vzj43D7+SQXF/4pzW/hwtAqwc6iTitCiVSaWz5lYuqw= +github.com/golang/protobuf v1.3.4/go.mod h1:vzj43D7+SQXF/4pzW/hwtAqwc6iTitCiVSaWz5lYuqw= +github.com/golang/protobuf v1.3.5/go.mod h1:6O5/vntMXwX2lRkT1hjjk0nAC1IDOTvTlVgjlRvqsdk= github.com/golang/protobuf v1.4.0-rc.1/go.mod h1:ceaxUfeHdC40wWswd/P6IGgMaK3YpKi5j83Wpe3EHw8= github.com/golang/protobuf v1.4.0-rc.1.0.20200221234624-67d41d38c208/go.mod h1:xKAWHe0F5eneWXFV3EuXVDTCmh+JuBKY0li0aMyXATA= github.com/golang/protobuf v1.4.0-rc.2/go.mod h1:LlEzMj4AhA7rCAGe4KMBDvJI+AwstrUpVNzEA03Pprs= github.com/golang/protobuf v1.4.0-rc.4.0.20200313231945-b860323f09d0/go.mod h1:WU3c8KckQ9AFe+yFwt9sWVRKCVIyN9cPHBJSNnbL67w= github.com/golang/protobuf v1.4.0/go.mod h1:jodUvKwWbYaEsadDk5Fwe5c77LiNKVO9IDvqG2KuDX0= -github.com/golang/protobuf v1.4.2 h1:+Z5KGCizgyZCbGh1KZqA0fcLLkwbsjIzS4aV2v7wJX0= +github.com/golang/protobuf v1.4.1/go.mod h1:U8fpvMrcmy5pZrNK1lt4xCsGvpyWQ/VVv6QDs8UjoX8= github.com/golang/protobuf v1.4.2/go.mod h1:oDoupMAO8OvCJWAcko0GGGIgR6R6ocIYbsSw735rRwI= +github.com/golang/protobuf v1.4.3 h1:JjCZWpVbqXDqFVmTfYWEVTMIYrL/NPdPSCHPJ0T/raM= +github.com/golang/protobuf v1.4.3/go.mod h1:oDoupMAO8OvCJWAcko0GGGIgR6R6ocIYbsSw735rRwI= +github.com/google/btree v0.0.0-20180813153112-4030bb1f1f0c/go.mod h1:lNA+9X1NB3Zf8V7Ke586lFgjr2dZNuvo3lPJSGZ5JPQ= +github.com/google/btree v1.0.0/go.mod h1:lNA+9X1NB3Zf8V7Ke586lFgjr2dZNuvo3lPJSGZ5JPQ= +github.com/google/go-cmp v0.2.0/go.mod h1:oXzfMopK8JAjlY9xF4vHSVASa0yLyX7SntLO5aqRK0M= github.com/google/go-cmp v0.3.0/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU= github.com/google/go-cmp v0.3.1/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU= -github.com/google/go-cmp v0.4.0 h1:xsAVV57WRhGj6kEIi8ReJzQlHHqcBYCElAvkovg3B/4= github.com/google/go-cmp v0.4.0/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE= +github.com/google/go-cmp v0.5.0/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE= +github.com/google/go-cmp v0.5.1/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE= +github.com/google/go-cmp v0.5.2/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE= +github.com/google/go-cmp v0.5.4 h1:L8R9j+yAqZuZjsqh/z+F1NCffTKKLShY6zXTItVIZ8M= +github.com/google/go-cmp v0.5.4/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE= +github.com/google/gofuzz v1.0.0/go.mod h1:dBl0BpW6vV/+mYPU4Po3pmUjxk6FQPldtuIdl/M65Eg= +github.com/google/gofuzz v1.1.0/go.mod h1:dBl0BpW6vV/+mYPU4Po3pmUjxk6FQPldtuIdl/M65Eg= +github.com/google/martian v2.1.0+incompatible/go.mod h1:9I4somxYTbIHy5NJKHRl3wXiIaQGbYVAs8BPL6v8lEs= +github.com/google/pprof v0.0.0-20181206194817-3ea8567a2e57/go.mod h1:zfwlbNMJ+OItoe0UupaVj+oy1omPYYDuagoSzA8v9mc= +github.com/google/pprof v0.0.0-20190515194954-54271f7e092f/go.mod h1:zfwlbNMJ+OItoe0UupaVj+oy1omPYYDuagoSzA8v9mc= +github.com/google/pprof v0.0.0-20191218002539-d4f498aebedc/go.mod h1:ZgVRPoUq/hfqzAqh7sHMqb3I9Rq5C59dIz2SbBwJ4eM= +github.com/google/pprof v0.0.0-20200212024743-f11f1df84d12/go.mod h1:ZgVRPoUq/hfqzAqh7sHMqb3I9Rq5C59dIz2SbBwJ4eM= +github.com/google/pprof v0.0.0-20200229191704-1ebb73c60ed3/go.mod h1:ZgVRPoUq/hfqzAqh7sHMqb3I9Rq5C59dIz2SbBwJ4eM= +github.com/google/renameio v0.1.0/go.mod h1:KWCgfxg9yswjAJkECMjeO8J8rahYeXnNhOm40UhjYkI= +github.com/google/uuid v1.0.0/go.mod h1:TIyPZe4MgqvfeYDBFedMoGGpEw/LqOeaOT+nhxU+yHo= +github.com/google/uuid v1.1.1/go.mod h1:TIyPZe4MgqvfeYDBFedMoGGpEw/LqOeaOT+nhxU+yHo= +github.com/google/uuid v1.1.2/go.mod h1:TIyPZe4MgqvfeYDBFedMoGGpEw/LqOeaOT+nhxU+yHo= +github.com/googleapis/gax-go/v2 v2.0.4/go.mod h1:0Wqv26UfaUD9n4G6kQubkQ+KchISgw+vpHVxEJEs9eg= +github.com/googleapis/gax-go/v2 v2.0.5/go.mod h1:DWXyrwAJ9X0FpwwEdw+IPEYBICEFu5mhpdKc/us6bOk= +github.com/googleapis/gnostic v0.4.1/go.mod h1:LRhVm6pbyptWbWbuZ38d1eyptfvIytN3ir6b65WBswg= +github.com/gopherjs/gopherjs v0.0.0-20181017120253-0766667cb4d1/go.mod h1:wJfORRmW1u3UXTncJ5qlYoELFm8eSnnEO6hX4iZ3EWY= +github.com/gorilla/handlers v0.0.0-20150720190736-60c7bfde3e33/go.mod h1:Qkdc/uu4tH4g6mTK6auzZ766c4CA0Ng8+o/OAirnOIQ= +github.com/gorilla/mux v1.7.2/go.mod h1:1lud6UwP+6orDFRuTfBEV8e9/aOM/c4fVVCaMa2zaAs= +github.com/gorilla/websocket v0.0.0-20170926233335-4201258b820c/go.mod h1:E7qHFY5m1UJ88s3WnNqhKjPHQ0heANvMoAMk2YaljkQ= +github.com/gorilla/websocket v1.4.2/go.mod h1:YR8l580nyteQvAITg2hZ9XVh4b55+EU/adAjf1fMHhE= +github.com/gregjones/httpcache v0.0.0-20180305231024-9cad4c3443a7/go.mod h1:FecbI9+v66THATjSRHfNgh1IVFe/9kFxbXtjV0ctIMA= +github.com/grpc-ecosystem/go-grpc-middleware v1.0.1-0.20190118093823-f849b5445de4/go.mod h1:FiyG127CGDf3tlThmgyCl78X/SZQqEOJBCDaAfeWzPs= +github.com/grpc-ecosystem/go-grpc-prometheus v1.2.0/go.mod h1:8NvIoxWQoOIhqOTXgfV/d3M/q6VIi02HzZEHgUlZvzk= +github.com/grpc-ecosystem/grpc-gateway v1.9.5/go.mod h1:vNeuVxBJEsws4ogUvrchl83t/GYV9WGTSLVdBhOQFDY= +github.com/hashicorp/errwrap v0.0.0-20141028054710-7554cd9344ce/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4= +github.com/hashicorp/errwrap v1.0.0/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4= +github.com/hashicorp/go-multierror v0.0.0-20161216184304-ed905158d874/go.mod h1:JMRHfdO9jKNzS/+BTlxCjKNQHg/jZAft8U7LloJvN7I= +github.com/hashicorp/go-multierror v1.0.0/go.mod h1:dHtQlpGsu+cZNNAkkCN/P3hoUDHhCYQXV3UM06sGGrk= +github.com/hashicorp/golang-lru v0.5.0/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8= +github.com/hashicorp/golang-lru v0.5.1/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8= github.com/hpcloud/tail v1.0.0/go.mod h1:ab1qPbhIpdTxEkNHXyeSf5vhxWSCs/tWer42PpOxQnU= +github.com/ianlancetaylor/demangle v0.0.0-20181102032728-5e5cf60278f6/go.mod h1:aSSvb/t6k1mPoxDqO4vJh6VOCGPwU4O0C2/Eqndh1Sc= +github.com/imdario/mergo v0.3.5/go.mod h1:2EnlNZ0deacrJVfApfmtdGgDfMuh/nq6Ok1EcJh5FfA= +github.com/imdario/mergo v0.3.8/go.mod h1:2EnlNZ0deacrJVfApfmtdGgDfMuh/nq6Ok1EcJh5FfA= +github.com/imdario/mergo v0.3.10/go.mod h1:jmQim1M+e3UYxmgPu/WyfjB3N3VflVyUjjjwH0dnCYA= +github.com/imdario/mergo v0.3.11/go.mod h1:jmQim1M+e3UYxmgPu/WyfjB3N3VflVyUjjjwH0dnCYA= +github.com/inconshreveable/mousetrap v1.0.0/go.mod h1:PxqpIevigyE2G7u3NXJIT2ANytuPF1OarO4DADm73n8= github.com/j-keck/arping v0.0.0-20160618110441-2cf9dc699c56 h1:742eGXur0715JMq73aD95/FU0XpVKXqNuTnEfXsLOYQ= github.com/j-keck/arping v0.0.0-20160618110441-2cf9dc699c56/go.mod h1:ymszkNOg6tORTn+6F6j+Jc8TOr5osrynvN6ivFWZ2GA= +github.com/jmespath/go-jmespath v0.0.0-20160202185014-0b12d6b521d8/go.mod h1:Nht3zPeWKUH0NzdCt2Blrr5ys8VGpn0CEB0cQHVjt7k= +github.com/jmespath/go-jmespath v0.0.0-20160803190731-bd40a432e4c7/go.mod h1:Nht3zPeWKUH0NzdCt2Blrr5ys8VGpn0CEB0cQHVjt7k= +github.com/jonboulle/clockwork v0.1.0/go.mod h1:Ii8DK3G1RaLaWxj9trq07+26W01tbo22gdxWY5EU2bo= +github.com/json-iterator/go v1.1.6/go.mod h1:+SdeFBvtyEkXs7REEP0seUULqWtbJapLOCVDaaPEHmU= +github.com/json-iterator/go v1.1.7/go.mod h1:KdQUCv79m/52Kvf8AW2vK1V8akMuk1QjK/uOdHXbAo4= +github.com/json-iterator/go v1.1.10/go.mod h1:KdQUCv79m/52Kvf8AW2vK1V8akMuk1QjK/uOdHXbAo4= +github.com/jstemmer/go-junit-report v0.0.0-20190106144839-af01ea7f8024/go.mod h1:6v2b51hI/fHJwM22ozAgKL4VKDeJcHhJFhtBdhmNjmU= +github.com/jstemmer/go-junit-report v0.9.1/go.mod h1:Brl9GWCQeLvo8nXZwPNNblvFj/XSXhF0NWZEnDohbsk= +github.com/jtolds/gls v4.20.0+incompatible/go.mod h1:QJZ7F/aHp+rZTRtaJ1ow/lLfFfVYBRgL+9YlvaHOwJU= +github.com/julienschmidt/httprouter v1.2.0/go.mod h1:SYymIcj16QtmaHHD7aYtjjsJG7VTCxuUUipMqKk8s4w= +github.com/kisielk/errcheck v1.1.0/go.mod h1:EZBBE59ingxPouuu3KfxchcWSUPOHkagtvWXihfKN4Q= +github.com/kisielk/errcheck v1.2.0/go.mod h1:/BMXB+zMLi60iA8Vv6Ksmxu/1UDYcXs4uQLJ+jE2L00= +github.com/kisielk/errcheck v1.5.0/go.mod h1:pFxgyoBC7bSaBwPgfKdkLd5X25qrDl4LWUI2bnpBCr8= +github.com/kisielk/gotool v1.0.0/go.mod h1:XhKaO+MFFWcvkIS/tQcRk01m1F5IRFswLeQ+oQHNcck= +github.com/klauspost/compress v1.11.3/go.mod h1:aoV0uJVorq1K+umq18yTdKaF57EivdYsUV+/s2qKfXs= +github.com/konsorten/go-windows-terminal-sequences v1.0.1/go.mod h1:T0+1ngSBFLxvqU3pZ+m/2kptfBszLMUkC4ZK/EgS/cQ= +github.com/konsorten/go-windows-terminal-sequences v1.0.2/go.mod h1:T0+1ngSBFLxvqU3pZ+m/2kptfBszLMUkC4ZK/EgS/cQ= +github.com/konsorten/go-windows-terminal-sequences v1.0.3/go.mod h1:T0+1ngSBFLxvqU3pZ+m/2kptfBszLMUkC4ZK/EgS/cQ= +github.com/kr/logfmt v0.0.0-20140226030751-b84e30acd515/go.mod h1:+0opPa2QZZtGFBFZlji/RkVcI2GknAs/DXo4wKdlNEc= +github.com/kr/pretty v0.1.0/go.mod h1:dAy3ld7l9f0ibDNOQOHHMYYIIbhfbHSm3C4ZsoJORNo= +github.com/kr/pretty v0.2.0 h1:s5hAObm+yFO5uHYt5dYjxi2rXrsnmRpJx4OYvIWUaQs= +github.com/kr/pretty v0.2.0/go.mod h1:ipq/a2n7PKx3OHsz4KJII5eveXtPO4qwEXGdVfWzfnI= +github.com/kr/pty v1.1.1/go.mod h1:pFQYn66WHrOpPYNljwOMqo10TkYh1fy3cYio2l3bCsQ= +github.com/kr/pty v1.1.5/go.mod h1:9r2w37qlBe7rQ6e1fg1S/9xpWHSnaqNdHD3WcMdbPDA= +github.com/kr/text v0.1.0 h1:45sCR5RtlFHMR4UwH9sdQ5TC8v0qDQCHnXt+kaKSTVE= +github.com/kr/text v0.1.0/go.mod h1:4Jbv+DJW3UT/LiOwJeYQe1efqtUx/iVham/4vfdArNI= +github.com/mailru/easyjson v0.0.0-20190614124828-94de47d64c63/go.mod h1:C1wdFJiN94OJF2b5HbByQZoLdCWB1Yqtg26g4irojpc= +github.com/mailru/easyjson v0.0.0-20190626092158-b2ccc519800e/go.mod h1:C1wdFJiN94OJF2b5HbByQZoLdCWB1Yqtg26g4irojpc= +github.com/mailru/easyjson v0.7.0/go.mod h1:KAzv3t3aY1NaHWoQz1+4F1ccyAH66Jk7yos7ldAVICs= +github.com/marstr/guid v1.1.0/go.mod h1:74gB1z2wpxxInTG6yaqA7KrtM0NZ+RbrcqDvYHefzho= +github.com/mattn/go-colorable v0.0.9/go.mod h1:9vuHe8Xs5qXnSaW/c/ABM9alt+Vo+STaOChaDxuIBZU= +github.com/mattn/go-isatty v0.0.4/go.mod h1:M+lRXTBqGeGNdLjl/ufCoiOlB5xdOkqRJdNxMWT7Zi4= +github.com/mattn/go-runewidth v0.0.2/go.mod h1:LwmH8dsx7+W8Uxz3IHJYH5QSwggIsqBzpuz5H//U1FU= +github.com/mattn/go-shellwords v1.0.3/go.mod h1:3xCvwCdWdlDJUrvuMn7Wuy9eWs4pE8vqg+NOMyg4B2o= github.com/mattn/go-shellwords v1.0.11 h1:vCoR9VPpsk/TZFW2JwK5I9S0xdrtUq2bph6/YjEPnaw= github.com/mattn/go-shellwords v1.0.11/go.mod h1:EZzvwXDESEeg03EKmM+RmDnNOPKG4lLtQsUlTZDWQ8Y= +github.com/matttproud/golang_protobuf_extensions v1.0.1/go.mod h1:D8He9yQNgCq6Z5Ld7szi9bcBfOoFv/3dc6xSMkL2PC0= +github.com/matttproud/golang_protobuf_extensions v1.0.2-0.20181231171920-c182affec369/go.mod h1:BSXmuO+STAnVfrANrmjBb36TMTDstsz7MSK+HVaYKv4= +github.com/miekg/pkcs11 v1.0.3/go.mod h1:XsNlhZGX73bx86s2hdc/FuaLm2CPZJemRLMA+WTFxgs= +github.com/mistifyio/go-zfs v2.1.2-0.20190413222219-f784269be439+incompatible/go.mod h1:8AuVvqP/mXw1px98n46wfvcGfQ4ci2FwoAjKYxuo3Z4= +github.com/mitchellh/mapstructure v1.1.2/go.mod h1:FVVH3fgwuzCH5S8UJGiWEs2h04kUh9fWfEaFds41c1Y= +github.com/mitchellh/osext v0.0.0-20151018003038-5e2d6d41470f/go.mod h1:OkQIRizQZAeMln+1tSwduZz7+Af5oFlKirV/MSYes2A= +github.com/moby/sys/mountinfo v0.4.0/go.mod h1:rEr8tzG/lsIZHBtN/JjGG+LMYx9eXgW2JI+6q0qou+A= +github.com/moby/sys/mountinfo v0.4.1/go.mod h1:rEr8tzG/lsIZHBtN/JjGG+LMYx9eXgW2JI+6q0qou+A= +github.com/moby/sys/symlink v0.1.0/go.mod h1:GGDODQmbFOjFsXvfLVn3+ZRxkch54RkSiGqsZeMYowQ= +github.com/moby/term v0.0.0-20200312100748-672ec06f55cd/go.mod h1:DdlQx2hp0Ss5/fLikoLlEeIYiATotOjgB//nb973jeo= +github.com/modern-go/concurrent v0.0.0-20180228061459-e0a39a4cb421/go.mod h1:6dJC0mAP4ikYIbvyc7fijjWJddQyLn8Ig3JB5CqoB9Q= +github.com/modern-go/concurrent v0.0.0-20180306012644-bacd9c7ef1dd/go.mod h1:6dJC0mAP4ikYIbvyc7fijjWJddQyLn8Ig3JB5CqoB9Q= +github.com/modern-go/reflect2 v0.0.0-20180701023420-4b7aa43c6742/go.mod h1:bx2lNnkwVCuqBIxFjflWJWanXIb3RllmbCylyMrvgv0= +github.com/modern-go/reflect2 v1.0.1/go.mod h1:bx2lNnkwVCuqBIxFjflWJWanXIb3RllmbCylyMrvgv0= +github.com/mrunalp/fileutils v0.5.0/go.mod h1:M1WthSahJixYnrXQl/DFQuteStB1weuxD2QJNHXfbSQ= +github.com/munnerz/goautoneg v0.0.0-20120707110453-a547fc61f48d/go.mod h1:+n7T8mK8HuQTcFwEeznm/DIxMOiR9yIdICNftLE1DvQ= +github.com/munnerz/goautoneg v0.0.0-20191010083416-a7dc8b61c822/go.mod h1:+n7T8mK8HuQTcFwEeznm/DIxMOiR9yIdICNftLE1DvQ= +github.com/mwitkow/go-conntrack v0.0.0-20161129095857-cc309e4a2223/go.mod h1:qRWi+5nqEBWmkhHvq77mSJWrCKwh8bxhgT7d/eI7P4U= +github.com/mxk/go-flowrate v0.0.0-20140419014527-cca7078d478f/go.mod h1:ZdcZmHo+o7JKHSa8/e818NopupXU1YMK5fe1lsApnBw= +github.com/ncw/swift v1.0.47/go.mod h1:23YIA4yWVnGwv2dQlN4bB7egfYX6YLn0Yo/S6zZO/ZM= github.com/nxadm/tail v1.4.4 h1:DQuhQpB1tVlglWS2hLQ5OV6B5r8aGxSrPc5Qo6uTN78= github.com/nxadm/tail v1.4.4/go.mod h1:kenIhsEOeOJmVchQTgglprH7qJGnHDVpk1VPCcaMI8A= +github.com/olekukonko/tablewriter v0.0.0-20170122224234-a0225b3f23b5/go.mod h1:vsDQFd/mU46D+Z4whnwzcISnGGzXWMclvtLoiIKAKIo= +github.com/onsi/ginkgo v0.0.0-20151202141238-7f8ab55aaf3b/go.mod h1:lLunBs/Ym6LB5Z9jYTR76FiuTmxDTDusOGeTQH+WWjE= +github.com/onsi/ginkgo v0.0.0-20170829012221-11459a886d9c/go.mod h1:lLunBs/Ym6LB5Z9jYTR76FiuTmxDTDusOGeTQH+WWjE= github.com/onsi/ginkgo v1.6.0/go.mod h1:lLunBs/Ym6LB5Z9jYTR76FiuTmxDTDusOGeTQH+WWjE= -github.com/onsi/ginkgo v1.12.1 h1:mFwc4LvZ0xpSvDZ3E+k8Yte0hLOMxXUlP+yXtJqkYfQ= +github.com/onsi/ginkgo v1.10.1/go.mod h1:lLunBs/Ym6LB5Z9jYTR76FiuTmxDTDusOGeTQH+WWjE= +github.com/onsi/ginkgo v1.10.3/go.mod h1:lLunBs/Ym6LB5Z9jYTR76FiuTmxDTDusOGeTQH+WWjE= +github.com/onsi/ginkgo v1.11.0/go.mod h1:lLunBs/Ym6LB5Z9jYTR76FiuTmxDTDusOGeTQH+WWjE= github.com/onsi/ginkgo v1.12.1/go.mod h1:zj2OWP4+oCPe1qIXoGWkgMRwljMUYCdkwsT2108oapk= github.com/onsi/ginkgo v1.13.0 h1:M76yO2HkZASFjXL0HSoZJ1AYEmQxNJmY41Jx1zNUq1Y= github.com/onsi/ginkgo v1.13.0/go.mod h1:+REjRxOmWfHCjfv9TTWB1jD1Frx4XydAD3zm1lskyM0= +github.com/onsi/gomega v0.0.0-20151007035656-2152b45fa28a/go.mod h1:C1qb7wdrVGGVU+Z6iS04AVkA3Q65CEZX59MT0QO5uiA= +github.com/onsi/gomega v0.0.0-20170829124025-dcabb60a477c/go.mod h1:C1qb7wdrVGGVU+Z6iS04AVkA3Q65CEZX59MT0QO5uiA= +github.com/onsi/gomega v1.7.0/go.mod h1:ex+gbHU/CVuBBDIJjb2X0qEXbFg53c61hWP/1CpauHY= github.com/onsi/gomega v1.7.1/go.mod h1:XdKZgCCFLUoM/7CFJVPcG8C1xQ1AJ0vpAezJrB7JYyY= github.com/onsi/gomega v1.10.1/go.mod h1:iN09h71vgCQne3DLsj+A5owkum+a2tYe+TOCB1ybHNo= github.com/onsi/gomega v1.10.3 h1:gph6h/qe9GSUw1NhH1gp+qb+h8rXD8Cy60Z32Qw3ELA= github.com/onsi/gomega v1.10.3/go.mod h1:V9xEwhxec5O8UDM77eCW8vLymOMltsqPVYWrpDsH8xc= +github.com/opencontainers/go-digest v0.0.0-20170106003457-a6d0ee40d420/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s= +github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s= +github.com/opencontainers/go-digest v1.0.0-rc1/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s= +github.com/opencontainers/go-digest v1.0.0-rc1.0.20180430190053-c9281466c8b2/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s= +github.com/opencontainers/go-digest v1.0.0/go.mod h1:0JzlMkj0TRzQZfJkVvzbP0HBR3IKzErnv2BNG4W4MAM= +github.com/opencontainers/image-spec v1.0.0/go.mod h1:BtxoFyWECRxE4U/7sNtV5W15zMzWCbyJoFRP3s7yZA0= +github.com/opencontainers/image-spec v1.0.1/go.mod h1:BtxoFyWECRxE4U/7sNtV5W15zMzWCbyJoFRP3s7yZA0= +github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U= +github.com/opencontainers/runc v0.1.1/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U= +github.com/opencontainers/runc v1.0.0-rc8.0.20190926000215-3e425f80a8c9/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U= +github.com/opencontainers/runc v1.0.0-rc9/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U= +github.com/opencontainers/runc v1.0.0-rc93/go.mod h1:3NOsor4w32B2tC0Zbl8Knk4Wg84SM2ImC1fxBuqJ/H0= +github.com/opencontainers/runtime-spec v0.1.2-0.20190507144316-5b71a03e2700/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0= +github.com/opencontainers/runtime-spec v1.0.1/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0= +github.com/opencontainers/runtime-spec v1.0.2-0.20190207185410-29686dbc5559/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0= +github.com/opencontainers/runtime-spec v1.0.2/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0= +github.com/opencontainers/runtime-spec v1.0.3-0.20200929063507-e6143ca7d51d/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0= +github.com/opencontainers/runtime-tools v0.0.0-20181011054405-1d69bd0f9c39/go.mod h1:r3f7wjNzSs2extwzU3Y+6pKfobzPh+kKFJ3ofN+3nfs= +github.com/opencontainers/selinux v1.6.0/go.mod h1:VVGKuOLlE7v4PJyT6h7mNWvq1rzqiriPsEqVhc+svHE= +github.com/opencontainers/selinux v1.8.0/go.mod h1:RScLhm78qiWa2gbVCcGkC7tCGdgk3ogry1nUQF8Evvo= +github.com/peterbourgon/diskv v2.0.1+incompatible/go.mod h1:uqqh8zWWbv1HBMNONnaR/tNboyR3/BZd58JJSHlUSCU= +github.com/pkg/errors v0.8.0/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0= +github.com/pkg/errors v0.8.1-0.20171018195549-f15c970de5b7/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0= +github.com/pkg/errors v0.8.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0= +github.com/pkg/errors v0.9.1 h1:FEBLx1zS214owpjy7qsBeixbURkuhQAwrK5UwLGTwt4= +github.com/pkg/errors v0.9.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0= github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM= github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4= +github.com/pquerna/cachecontrol v0.0.0-20171018203845-0dec1b30a021/go.mod h1:prYjPmNq4d1NPVmpShWobRqXY3q7Vp+80DqgxxUrUIA= +github.com/prometheus/client_golang v0.0.0-20180209125602-c332b6f63c06/go.mod h1:7SWBe2y4D6OKWSNQJUaRYU/AaXPKyh/dDVn+NZz0KFw= +github.com/prometheus/client_golang v0.9.1/go.mod h1:7SWBe2y4D6OKWSNQJUaRYU/AaXPKyh/dDVn+NZz0KFw= +github.com/prometheus/client_golang v1.0.0/go.mod h1:db9x61etRT2tGnBNRi70OPL5FsnadC4Ky3P0J6CfImo= +github.com/prometheus/client_golang v1.1.0/go.mod h1:I1FGZT9+L76gKKOs5djB6ezCbFQP1xR9D75/vuwEF3g= +github.com/prometheus/client_golang v1.7.1/go.mod h1:PY5Wy2awLA44sXw4AOSfFBetzPP4j5+D6mVACh+pe2M= +github.com/prometheus/client_model v0.0.0-20171117100541-99fa1f4be8e5/go.mod h1:MbSGuTsp3dbXC40dX6PRTWyKYBIrTGTE9sqQNg2J8bo= +github.com/prometheus/client_model v0.0.0-20180712105110-5c3871d89910/go.mod h1:MbSGuTsp3dbXC40dX6PRTWyKYBIrTGTE9sqQNg2J8bo= +github.com/prometheus/client_model v0.0.0-20190129233127-fd36f4220a90/go.mod h1:xMI15A0UPsDsEKsMN9yxemIoYk6Tm2C1GtYGdfGttqA= +github.com/prometheus/client_model v0.0.0-20190812154241-14fe0d1b01d4/go.mod h1:xMI15A0UPsDsEKsMN9yxemIoYk6Tm2C1GtYGdfGttqA= +github.com/prometheus/client_model v0.2.0/go.mod h1:xMI15A0UPsDsEKsMN9yxemIoYk6Tm2C1GtYGdfGttqA= +github.com/prometheus/common v0.0.0-20180110214958-89604d197083/go.mod h1:daVV7qP5qjZbuso7PdcryaAu0sAZbrN9i7WWcTMWvro= +github.com/prometheus/common v0.4.1/go.mod h1:TNfzLD0ON7rHzMJeJkieUDPYmFC7Snx/y86RQel1bk4= +github.com/prometheus/common v0.6.0/go.mod h1:eBmuwkDJBwy6iBfxCBob6t6dR6ENT/y+J+Zk0j9GMYc= +github.com/prometheus/common v0.10.0/go.mod h1:Tlit/dnDKsSWFlCLTWaA1cyBgKHSMdTB80sz/V91rCo= +github.com/prometheus/procfs v0.0.0-20180125133057-cb4147076ac7/go.mod h1:c3At6R/oaqEKCNdg8wHV1ftS6bRYblBhIjjI8uT2IGk= +github.com/prometheus/procfs v0.0.0-20181005140218-185b4288413d/go.mod h1:c3At6R/oaqEKCNdg8wHV1ftS6bRYblBhIjjI8uT2IGk= +github.com/prometheus/procfs v0.0.0-20190522114515-bc1a522cf7b1/go.mod h1:TjEm7ze935MbeOT/UhFTIMYKhuLP4wbCsTZCD3I8kEA= +github.com/prometheus/procfs v0.0.2/go.mod h1:TjEm7ze935MbeOT/UhFTIMYKhuLP4wbCsTZCD3I8kEA= +github.com/prometheus/procfs v0.0.3/go.mod h1:4A/X28fw3Fc593LaREMrKMqOKvUAntwMDaekg4FpcdQ= +github.com/prometheus/procfs v0.0.5/go.mod h1:4A/X28fw3Fc593LaREMrKMqOKvUAntwMDaekg4FpcdQ= +github.com/prometheus/procfs v0.0.8/go.mod h1:7Qr8sr6344vo1JqZ6HhLceV9o3AJ1Ff+GxbHq6oeK9A= +github.com/prometheus/procfs v0.1.3/go.mod h1:lV6e/gmhEcM9IjHGsFOCxxuZ+z1YqCvr4OA4YeYWdaU= +github.com/prometheus/procfs v0.2.0/go.mod h1:lV6e/gmhEcM9IjHGsFOCxxuZ+z1YqCvr4OA4YeYWdaU= +github.com/prometheus/procfs v0.6.0/go.mod h1:cz+aTbrPOrUb4q7XlbU9ygM+/jj0fzG6c1xBZuNvfVA= +github.com/rogpeppe/fastuuid v0.0.0-20150106093220-6724a57986af/go.mod h1:XWv6SoW27p1b0cqNHllgS5HIMJraePCO15w5zCzIWYg= +github.com/rogpeppe/go-internal v1.3.0/go.mod h1:M8bDsm7K2OlrFYOpmOWEs/qY81heoFRclV5y23lUDJ4= +github.com/russross/blackfriday/v2 v2.0.1/go.mod h1:+Rmxgy9KzJVeS9/2gXHxylqXiyQDYRxCVz55jmeOWTM= github.com/safchain/ethtool v0.0.0-20190326074333-42ed695e3de8 h1:2c1EFnZHIPCW8qKWgHMH/fX2PkSabFc5mrVzfUNdg5U= github.com/safchain/ethtool v0.0.0-20190326074333-42ed695e3de8/go.mod h1:Z0q5wiBQGYcxhMZ6gUqHn6pYNLypFAvaL3UvgZLR0U4= +github.com/satori/go.uuid v1.2.0/go.mod h1:dA0hQrYB0VpLJoorglMZABFdXlWrHn1NEOzdhQKdks0= github.com/sclevine/agouti v3.0.0+incompatible/go.mod h1:b4WX9W9L1sfQKXeJf1mUTLZKJ48R1S7H23Ji7oFO5Bw= +github.com/seccomp/libseccomp-golang v0.9.1/go.mod h1:GbW5+tmTXfcxTToHLXlScSlAvWlF4P2Ca7zGrPiEpWo= +github.com/shurcooL/sanitized_anchor_name v1.0.0/go.mod h1:1NzhyTcUVG4SuEtjjoZeVRXNmyL/1OwPU0+IJeTBvfc= +github.com/sirupsen/logrus v1.0.4-0.20170822132746-89742aefa4b2/go.mod h1:pMByvHTf9Beacp5x1UXfOR9xyW/9antXMhjMPG0dEzc= +github.com/sirupsen/logrus v1.0.6/go.mod h1:pMByvHTf9Beacp5x1UXfOR9xyW/9antXMhjMPG0dEzc= +github.com/sirupsen/logrus v1.2.0/go.mod h1:LxeOpSwHxABJmUn/MG1IvRgCAasNZTLOkJPxbbu5VWo= +github.com/sirupsen/logrus v1.4.1/go.mod h1:ni0Sbl8bgC9z8RoU9G6nDWqqs/fq4eDPysMBDgk/93Q= +github.com/sirupsen/logrus v1.4.2/go.mod h1:tLMulIdttU9McNUspp0xgXVQah82FyeX6MwdIuYE2rE= +github.com/sirupsen/logrus v1.6.0/go.mod h1:7uNnSEd1DgxDLC74fIahvMZmmYsHGZGEOFrfsX/uA88= +github.com/sirupsen/logrus v1.7.0/go.mod h1:yWOB1SBYBC5VeMP7gHvWumXLIWorT60ONWic61uBYv0= github.com/sirupsen/logrus v1.8.1 h1:dJKuHgqk1NNQlqoA6BTlM1Wf9DOH3NBjQyu0h9+AZZE= github.com/sirupsen/logrus v1.8.1/go.mod h1:yWOB1SBYBC5VeMP7gHvWumXLIWorT60ONWic61uBYv0= +github.com/smartystreets/assertions v0.0.0-20180927180507-b2de0cb4f26d/go.mod h1:OnSkiWE9lh6wB0YB77sQom3nweQdgAjqCqsofrRNTgc= +github.com/smartystreets/goconvey v0.0.0-20190330032615-68dc04aab96a/go.mod h1:syvi0/a8iFYH4r/RixwvyeAJjdLS9QV7WQ/tjFTllLA= +github.com/soheilhy/cmux v0.1.4/go.mod h1:IM3LyeVVIOuxMH7sFAkER9+bJ4dT7Ms6E4xg4kGIyLM= +github.com/spf13/afero v1.2.2/go.mod h1:9ZxEEn6pIJ8Rxe320qSDBk6AsU0r9pR7Q4OcevTdifk= +github.com/spf13/cobra v0.0.2-0.20171109065643-2da4a54c5cee/go.mod h1:1l0Ry5zgKvJasoi3XT1TypsSe7PqH0Sj9dhYf7v3XqQ= +github.com/spf13/cobra v0.0.3/go.mod h1:1l0Ry5zgKvJasoi3XT1TypsSe7PqH0Sj9dhYf7v3XqQ= +github.com/spf13/pflag v0.0.0-20170130214245-9ff6c6923cff/go.mod h1:DYY7MBk1bdzusC3SYhjObp+wFpr4gzcvqqNjLnInEg4= +github.com/spf13/pflag v1.0.1-0.20171106142849-4c012f6dcd95/go.mod h1:DYY7MBk1bdzusC3SYhjObp+wFpr4gzcvqqNjLnInEg4= +github.com/spf13/pflag v1.0.1/go.mod h1:DYY7MBk1bdzusC3SYhjObp+wFpr4gzcvqqNjLnInEg4= +github.com/spf13/pflag v1.0.3/go.mod h1:DYY7MBk1bdzusC3SYhjObp+wFpr4gzcvqqNjLnInEg4= +github.com/spf13/pflag v1.0.5/go.mod h1:McXfInJRrz4CZXVZOBLb0bTZqETkiAhM9Iw0y3An2Bg= +github.com/stefanberger/go-pkcs11uri v0.0.0-20201008174630-78d3cae3a980/go.mod h1:AO3tvPzVZ/ayst6UlUKUv6rcPQInYe3IknH3jYhAKu8= +github.com/stretchr/objx v0.0.0-20180129172003-8a3f7159479f/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME= github.com/stretchr/objx v0.1.0/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME= +github.com/stretchr/objx v0.1.1/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME= +github.com/stretchr/objx v0.2.0/go.mod h1:qt09Ya8vawLte6SNmTgCsAVtYtaKzEcn8ATUoHMkEqE= +github.com/stretchr/testify v0.0.0-20180303142811-b89eecf5ca5d/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXfy6kDkUVs= github.com/stretchr/testify v1.2.2/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXfy6kDkUVs= -github.com/stretchr/testify v1.3.0 h1:TivCn/peBQ7UY8ooIcPgZFpTNSz0Q2U6UrFlUfqbe0Q= github.com/stretchr/testify v1.3.0/go.mod h1:M5WIy9Dh21IEIfnGCwXGc5bZfKNJtfHm1UVUgZn+9EI= +github.com/stretchr/testify v1.4.0/go.mod h1:j7eGeouHqKxXV5pUuKE4zz7dFj8WfuZ+81PSLYec5m4= +github.com/stretchr/testify v1.6.1 h1:hDPOHmpOpP40lSULcqw7IrRb/u7w6RpDC9399XyoNd0= +github.com/stretchr/testify v1.6.1/go.mod h1:6Fq8oRcR53rry900zMqJjRRixrwX3KX962/h/Wwjteg= +github.com/syndtr/gocapability v0.0.0-20170704070218-db04d3cc01c8/go.mod h1:hkRG7XYTFWNJGYcbNJQlaLq0fg1yr4J4t/NcTQtrfww= +github.com/syndtr/gocapability v0.0.0-20180916011248-d98352740cb2/go.mod h1:hkRG7XYTFWNJGYcbNJQlaLq0fg1yr4J4t/NcTQtrfww= +github.com/syndtr/gocapability v0.0.0-20200815063812-42c35b437635/go.mod h1:hkRG7XYTFWNJGYcbNJQlaLq0fg1yr4J4t/NcTQtrfww= +github.com/tchap/go-patricia v2.2.6+incompatible/go.mod h1:bmLyhP68RS6kStMGxByiQ23RP/odRBOTVjwp2cDyi6I= +github.com/tmc/grpc-websocket-proxy v0.0.0-20170815181823-89b8d40f7ca8/go.mod h1:ncp9v5uamzpCO7NfCPTXjqaC+bZgJeR0sMTm6dMHP7U= +github.com/tmc/grpc-websocket-proxy v0.0.0-20190109142713-0ad062ec5ee5/go.mod h1:ncp9v5uamzpCO7NfCPTXjqaC+bZgJeR0sMTm6dMHP7U= +github.com/urfave/cli v0.0.0-20171014202726-7bc6a0acffa5/go.mod h1:70zkFmudgCuE/ngEzBv17Jvp/497gISqfk5gWijbERA= +github.com/urfave/cli v1.20.0/go.mod h1:70zkFmudgCuE/ngEzBv17Jvp/497gISqfk5gWijbERA= +github.com/urfave/cli v1.22.1/go.mod h1:Gos4lmkARVdJ6EkW0WaNv/tZAAMe9V7XWyB60NtXRu0= +github.com/urfave/cli v1.22.2/go.mod h1:Gos4lmkARVdJ6EkW0WaNv/tZAAMe9V7XWyB60NtXRu0= +github.com/vishvananda/netlink v0.0.0-20181108222139-023a6dafdcdf/go.mod h1:+SR5DhBJrl6ZM7CoCKvpw5BKroDKQ+PJqOg65H/2ktk= +github.com/vishvananda/netlink v1.1.0/go.mod h1:cTgwzPIzzgDAYoQrMm0EdrjRUBkTqKYppBueQtXaqoE= github.com/vishvananda/netlink v1.1.1-0.20201029203352-d40f9887b852 h1:cPXZWzzG0NllBLdjWoD1nDfaqu98YMv+OneaKc8sPOA= github.com/vishvananda/netlink v1.1.1-0.20201029203352-d40f9887b852/go.mod h1:twkDnbuQxJYemMlGd4JFIcuhgX83tXhKS2B/PRMpOho= +github.com/vishvananda/netns v0.0.0-20180720170159-13995c7128cc/go.mod h1:ZjcWmFBXmLKZu9Nxj3WKYEafiSqer2rnvPr0en9UNpI= +github.com/vishvananda/netns v0.0.0-20191106174202-0a2b9b5464df/go.mod h1:JP3t17pCcGlemwknint6hfoeCVQrEMVwxRLRjXpq+BU= github.com/vishvananda/netns v0.0.0-20200728191858-db3c7e526aae h1:4hwBBUfQCFe3Cym0ZtKyq7L16eZUtYKs+BaHDN6mAns= github.com/vishvananda/netns v0.0.0-20200728191858-db3c7e526aae/go.mod h1:DD4vA1DwXk04H54A1oHXtwZmA0grkVMdPxx/VGLCah0= +github.com/willf/bitset v1.1.11-0.20200630133818-d5bec3311243/go.mod h1:RjeCKbqT1RxIR/KWY6phxZiaY1IyutSBfGjNPySAYV4= +github.com/willf/bitset v1.1.11/go.mod h1:83CECat5yLh5zVOf4P1ErAgKA5UDvKtgyUABdr3+MjI= +github.com/xeipuuv/gojsonpointer v0.0.0-20180127040702-4e3ac2762d5f/go.mod h1:N2zxlSyiKSe5eX1tZViRH5QA0qijqEDrYZiPEAiq3wU= +github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415/go.mod h1:GwrjFmJcFw6At/Gs6z4yjiIwzuJ1/+UwLxMQDVQXShQ= +github.com/xeipuuv/gojsonschema v0.0.0-20180618132009-1d523034197f/go.mod h1:5yf86TLmAcydyeJq5YvxkGPE2fm/u4myDekKRoLuqhs= +github.com/xiang90/probing v0.0.0-20190116061207-43a291ad63a2/go.mod h1:UETIi67q53MR2AWcXfiuqkDkRtnGDLqkBTpCHuJHxtU= +github.com/yuin/goldmark v1.1.27/go.mod h1:3hX8gzYuyVAZsxl0MRgGTJEmQBFcNTphYh9decYSb74= +github.com/yuin/goldmark v1.2.1/go.mod h1:3hX8gzYuyVAZsxl0MRgGTJEmQBFcNTphYh9decYSb74= +github.com/yvasiyarov/go-metrics v0.0.0-20140926110328-57bccd1ccd43/go.mod h1:aX5oPXxHm3bOH+xeAttToC8pqch2ScQN/JoXYupl6xs= +github.com/yvasiyarov/gorelic v0.0.0-20141212073537-a9bba5b9ab50/go.mod h1:NUSPSUX/bi6SeDMUh6brw0nXpxHnc96TguQh0+r/ssA= +github.com/yvasiyarov/newrelic_platform_go v0.0.0-20140908184405-b21fdbd4370f/go.mod h1:GlGEuHIJweS1mbCqG+7vt2nvWLzLLnRHbXz5JKd/Qbg= +go.etcd.io/bbolt v1.3.3/go.mod h1:IbVyRI1SCnLcuJnV2u8VeU0CEYM7e686BmAb1XKL+uU= +go.etcd.io/bbolt v1.3.5/go.mod h1:G5EMThwa9y8QZGBClrRx5EY+Yw9kAhnjy3bSjsnlVTQ= +go.etcd.io/etcd v0.5.0-alpha.5.0.20200910180754-dd1b699fc489/go.mod h1:yVHk9ub3CSBatqGNg7GRmsnfLWtoW60w4eDYfh7vHDg= +go.mozilla.org/pkcs7 v0.0.0-20200128120323-432b2356ecb1/go.mod h1:SNgMg+EgDFwmvSmLRTNKC5fegJjB7v23qTQ0XLGUNHk= +go.opencensus.io v0.21.0/go.mod h1:mSImk1erAIZhrmZN+AvHh14ztQfjbGwt4TtuofqLduU= +go.opencensus.io v0.22.0/go.mod h1:+kGneAE2xo2IficOXnaByMWTGM9T73dGwxeWcUqIpI8= +go.opencensus.io v0.22.2/go.mod h1:yxeiOL68Rb0Xd1ddK5vPZ/oVn4vY4Ynel7k9FzqtOIw= +go.opencensus.io v0.22.3 h1:8sGtKOrtQqkN1bp2AtX+misvLIlOmsEsNd+9NIcPEm8= +go.opencensus.io v0.22.3/go.mod h1:yxeiOL68Rb0Xd1ddK5vPZ/oVn4vY4Ynel7k9FzqtOIw= +go.uber.org/atomic v1.3.2/go.mod h1:gD2HeocX3+yG+ygLZcrzQJaqmWj9AIm7n08wl/qW/PE= +go.uber.org/atomic v1.4.0/go.mod h1:gD2HeocX3+yG+ygLZcrzQJaqmWj9AIm7n08wl/qW/PE= +go.uber.org/multierr v1.1.0/go.mod h1:wR5kodmAFQ0UK8QlbwjlSNy0Z68gJhDJUG5sjR94q/0= +go.uber.org/zap v1.10.0/go.mod h1:vwi/ZaCAaUcBkycHslxD9B2zi4UTXhF60s6SWpuDF0Q= +golang.org/x/crypto v0.0.0-20171113213409-9f005a07e0d3/go.mod h1:6SG95UA2DQfeDnfUPMdvaQW0Q7yPrPDi9nlGo2tz2b4= +golang.org/x/crypto v0.0.0-20180904163835-0709b304e793/go.mod h1:6SG95UA2DQfeDnfUPMdvaQW0Q7yPrPDi9nlGo2tz2b4= +golang.org/x/crypto v0.0.0-20181009213950-7c1a557ab941/go.mod h1:6SG95UA2DQfeDnfUPMdvaQW0Q7yPrPDi9nlGo2tz2b4= golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACkg1iLfiJU5Ep61QUkGW8qpdssI0+w= -golang.org/x/crypto v0.0.0-20200622213623-75b288015ac9 h1:psW17arqaxU48Z5kZ0CQnkZWQJsqcURM6tKiBApRjXI= +golang.org/x/crypto v0.0.0-20190510104115-cbcb75029529/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI= +golang.org/x/crypto v0.0.0-20190605123033-f99c8df09eb5/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI= +golang.org/x/crypto v0.0.0-20190611184440-5c40567a22f8/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI= +golang.org/x/crypto v0.0.0-20190701094942-4def268fd1a4/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI= +golang.org/x/crypto v0.0.0-20191011191535-87dc89f01550/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI= golang.org/x/crypto v0.0.0-20200622213623-75b288015ac9/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto= +golang.org/x/crypto v0.0.0-20200728195943-123391ffb6de/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto= +golang.org/x/crypto v0.0.0-20201002170205-7f63de1d35b0/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto= +golang.org/x/exp v0.0.0-20190121172915-509febef88a4/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA= +golang.org/x/exp v0.0.0-20190306152737-a1d7652674e8/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA= +golang.org/x/exp v0.0.0-20190510132918-efd6b22b2522/go.mod h1:ZjyILWgesfNpC6sMxTJOJm9Kp84zZh5NQWvqDGG3Qr8= +golang.org/x/exp v0.0.0-20190829153037-c13cbed26979/go.mod h1:86+5VVa7VpoJ4kLfm080zCjGlMRFzhUhsZKEZO7MGek= +golang.org/x/exp v0.0.0-20191030013958-a1ab85dbe136/go.mod h1:JXzH8nQsPlswgeRAPE3MuO9GYsAcnJvJ4vnMwN/5qkY= +golang.org/x/exp v0.0.0-20191129062945-2f5052295587/go.mod h1:2RIsYlXP63K8oxa1u096TMicItID8zy7Y6sNkU49FU4= +golang.org/x/exp v0.0.0-20191227195350-da58074b4299/go.mod h1:2RIsYlXP63K8oxa1u096TMicItID8zy7Y6sNkU49FU4= +golang.org/x/exp v0.0.0-20200119233911-0405dc783f0a/go.mod h1:2RIsYlXP63K8oxa1u096TMicItID8zy7Y6sNkU49FU4= +golang.org/x/exp v0.0.0-20200207192155-f17229e696bd/go.mod h1:J/WKrq2StrnmMY6+EHIKF9dgMWnmCNThgcyBT1FY9mM= +golang.org/x/exp v0.0.0-20200224162631-6cc2880d07d6/go.mod h1:3jZMyOhIsHpP37uCMkUooju7aAi5cS1Q23tOzKc+0MU= +golang.org/x/image v0.0.0-20190227222117-0694c2d4d067/go.mod h1:kZ7UVZpmo3dzQBMxlp+ypCbDeSB+sBbTgSJuh5dn5js= +golang.org/x/image v0.0.0-20190802002840-cff245a6509b/go.mod h1:FeLwcggjj3mMvU+oOTbSwawSJRM1uh48EjtB4UJZlP0= +golang.org/x/lint v0.0.0-20181026193005-c67002cb31c3/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE= +golang.org/x/lint v0.0.0-20190227174305-5b3e6a55c961/go.mod h1:wehouNa3lNwaWXcvxsM5YxQ5yQlVC4a0KAMCusXpPoU= +golang.org/x/lint v0.0.0-20190301231843-5614ed5bae6f/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE= +golang.org/x/lint v0.0.0-20190313153728-d0100b6bd8b3/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc= +golang.org/x/lint v0.0.0-20190409202823-959b441ac422/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc= +golang.org/x/lint v0.0.0-20190909230951-414d861bb4ac/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc= +golang.org/x/lint v0.0.0-20190930215403-16217165b5de/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc= +golang.org/x/lint v0.0.0-20191125180803-fdd1cda4f05f/go.mod h1:5qLYkcX4OjUUV8bRuDixDT3tpyyb+LUpUlRWLxfhWrs= +golang.org/x/lint v0.0.0-20200130185559-910be7a94367/go.mod h1:3xt1FjdF8hUf6vQPIChWIBhFzV8gjjsPE/fR3IyQdNY= +golang.org/x/lint v0.0.0-20200302205851-738671d3881b/go.mod h1:3xt1FjdF8hUf6vQPIChWIBhFzV8gjjsPE/fR3IyQdNY= +golang.org/x/mobile v0.0.0-20190312151609-d3739f865fa6/go.mod h1:z+o9i4GpDbdi3rU15maQ/Ox0txvL9dWGYEHz965HBQE= +golang.org/x/mobile v0.0.0-20190719004257-d2bd2a29d028/go.mod h1:E/iHnbuqvinMTCcRqshq8CkpyQDoeVncDDYHnLhea+o= +golang.org/x/mod v0.0.0-20190513183733-4bf6d317e70e/go.mod h1:mXi4GBBbnImb6dmsKGUJ2LatrhH/nqhxcFungHvyanc= +golang.org/x/mod v0.1.0/go.mod h1:0QHyrYULN0/3qlju5TqG8bIK38QM8yzMo5ekMj3DlcY= +golang.org/x/mod v0.1.1-0.20191105210325-c90efee705ee/go.mod h1:QqPTAvyqsEbceGzBzNggFXnrqF1CaUcvgkdR5Ot7KZg= +golang.org/x/mod v0.1.1-0.20191107180719-034126e5016b/go.mod h1:QqPTAvyqsEbceGzBzNggFXnrqF1CaUcvgkdR5Ot7KZg= +golang.org/x/mod v0.2.0/go.mod h1:s0Qsj1ACt9ePp/hMypM3fl4fZqREWJwdYDEqhRiZZUA= +golang.org/x/mod v0.3.0/go.mod h1:s0Qsj1ACt9ePp/hMypM3fl4fZqREWJwdYDEqhRiZZUA= +golang.org/x/net v0.0.0-20180724234803-3673e40ba225/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20180826012351-8a410e7b638d/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= golang.org/x/net v0.0.0-20180906233101-161cd47e91fd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20181011144130-49bb7cea24b1/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20181114220301-adae6a3d119a/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20181220203305-927f97764cc3/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20190108225652-1e06a53dbb7e/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20190213061140-3a22650c66bd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20190311183353-d8887717615a/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= golang.org/x/net v0.0.0-20190404232315-eb5bcb51f2a3/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= +golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= +golang.org/x/net v0.0.0-20190503192946-f4e77d36d62c/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= +golang.org/x/net v0.0.0-20190522155817-f3200d17e092/go.mod h1:HSz+uSET+XFnRR8LxR5pz3Of3rY3CfYBVs4xY44aLks= +golang.org/x/net v0.0.0-20190603091049-60506f45cf65/go.mod h1:HSz+uSET+XFnRR8LxR5pz3Of3rY3CfYBVs4xY44aLks= +golang.org/x/net v0.0.0-20190613194153-d28f0bde5980/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= +golang.org/x/net v0.0.0-20190619014844-b5b0513f8c1b/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= +golang.org/x/net v0.0.0-20190620200207-3b0461eec859/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= +golang.org/x/net v0.0.0-20190724013045-ca1201d0de80/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= +golang.org/x/net v0.0.0-20190813141303-74dc4d7220e7/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= +golang.org/x/net v0.0.0-20190827160401-ba9fcec4b297/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= +golang.org/x/net v0.0.0-20191004110552-13f9640d40b9/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= +golang.org/x/net v0.0.0-20191209160850-c0dbc17a3553/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= +golang.org/x/net v0.0.0-20200114155413-6afb5195e5aa/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= +golang.org/x/net v0.0.0-20200202094626-16171245cfb2/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= +golang.org/x/net v0.0.0-20200222125558-5a598a2470a0/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= +golang.org/x/net v0.0.0-20200226121028-0de0cce0169b/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= +golang.org/x/net v0.0.0-20200301022130-244492dfa37a/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= +golang.org/x/net v0.0.0-20200324143707-d3edc9973b7e/go.mod h1:qpuaurCH72eLCgpAm/N6yyVIVM9cpaDIP3A8BGJEC5A= golang.org/x/net v0.0.0-20200520004742-59133d7f0dd7/go.mod h1:qpuaurCH72eLCgpAm/N6yyVIVM9cpaDIP3A8BGJEC5A= -golang.org/x/net v0.0.0-20201006153459-a7d1128ccaa0 h1:wBouT66WTYFXdxfVdz9sVWARVd/2vfGcmI45D2gj45M= +golang.org/x/net v0.0.0-20200707034311-ab3426394381/go.mod h1:/O7V0waA8r7cgGh81Ro3o1hOxt32SMVPicZroKQ2sZA= golang.org/x/net v0.0.0-20201006153459-a7d1128ccaa0/go.mod h1:sp8m0HH+o8qH0wwXwYZr8TS3Oi6o0r6Gce1SSxlDquU= +golang.org/x/net v0.0.0-20201021035429-f5854403a974/go.mod h1:sp8m0HH+o8qH0wwXwYZr8TS3Oi6o0r6Gce1SSxlDquU= +golang.org/x/net v0.0.0-20201110031124-69a78807bb2b/go.mod h1:sp8m0HH+o8qH0wwXwYZr8TS3Oi6o0r6Gce1SSxlDquU= +golang.org/x/net v0.0.0-20201224014010-6772e930b67b h1:iFwSg7t5GZmB/Q5TjiEAsdoLDrdJRC1RiF2WhuV29Qw= +golang.org/x/net v0.0.0-20201224014010-6772e930b67b/go.mod h1:m0MpNAwzfU5UDzcl9v0D8zg8gWTRqZa9RBIspLL5mdg= +golang.org/x/oauth2 v0.0.0-20180821212333-d2e6202438be/go.mod h1:N/0e6XlmueqKjAGxoOufVs8QHGRruUQn6yWY3a++T0U= +golang.org/x/oauth2 v0.0.0-20190226205417-e64efc72b421/go.mod h1:gOpvHmFTYa4IltrdGE7lF6nIHvwfUNPOp7c8zoXwtLw= +golang.org/x/oauth2 v0.0.0-20190604053449-0f29369cfe45/go.mod h1:gOpvHmFTYa4IltrdGE7lF6nIHvwfUNPOp7c8zoXwtLw= +golang.org/x/oauth2 v0.0.0-20191202225959-858c2ad4c8b6/go.mod h1:gOpvHmFTYa4IltrdGE7lF6nIHvwfUNPOp7c8zoXwtLw= +golang.org/x/oauth2 v0.0.0-20200107190931-bf48bf16ab8d/go.mod h1:gOpvHmFTYa4IltrdGE7lF6nIHvwfUNPOp7c8zoXwtLw= golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20181108010431-42b317875d0f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20181221193216-37e7f081c4d4/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20190423024810-112230192c58/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20190911185100-cd5d95a43a6e/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20200625203802-6e8e738ad208/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20201020160332-67f06af15bc9/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20201207232520-09787c993a3a/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sys v0.0.0-20180830151530-49385e6e1522/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20180905080454-ebe1bf3edb33/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20180909124046-d0be0721c37e/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20181107165924-66b7b1311ac8/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20181116152217-5ac8a444bdc5/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20190312061237-fead79001313/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20190412213103-97732733099d/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190422165155-953cdadca894/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190507160741-ecd444e8653b/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190514135907-3a4b5fb9f71f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190522044717-8097e1b27ff5/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190602015325-4c4f7f33c9ed/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190606165138-5da285871e9c/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190606203320-7fc4e5ec1444/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190616124812-15dcb6c0061f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190624142023-c5567b49c5d0/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190726091711-fc99dfbffb4e/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190801041406-cbf593c0f2f3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190812073006-9eafafc0a87e/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190826190057-c7b8b68b1456/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20190904154756-749cb33beabd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20191001151750-bb3f8db39f24/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20191005200804-aed5e4c7ecf9/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20191022100944-742c48ecaeb7/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20191026070338-33540a1f6037/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20191115151921-52ab43148777/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20191120155948-bd437916bb0e/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20191204072324-ce4227a45e2e/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20191210023423-ac6580df4449/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20191228213918-04cbcbbfeed8/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20200106162015-b016eb3dc98e/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20200113162924-86b910548bc1/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20200120151820-655fe14d7479/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20200122134326-e047566fdf82/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20200124204421-9fbb57f87de9/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20200202164722-d101bd2416d5/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20200212091648-12a6c2dcc1e4/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20200217220822-9197077df867/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20200223170610-d5e6a3e2c0ae/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20200302150141-5c8b2ff67527/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20200323222414-85ca7c5b95cd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20200519105757-fe76b779f299/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20200615200032-f1bc736245b1/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20200622214017-ed371f2e16b4/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20200728102440-3e129f6d46b1/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20200817155316-9781c653f443/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20200909081042-eff7692f9009/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20200916030750-2334cc1a136f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20200922070232-aee5d888a860/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20200930185726-fdedc70b468f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= -golang.org/x/sys v0.0.0-20201117170446-d9b008d0a637 h1:O5hKNaGxIT4A8OTMnuh6UpmBdI3SAPxlZ3g0olDrJVM= -golang.org/x/sys v0.0.0-20201117170446-d9b008d0a637/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20201112073958-5cba982894dd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20201119102817-f84b799fce68/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20201201145000-ef89a241ccb3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20201202213521-69691e467435/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20210124154548-22da62e12c0c/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20210324051608-47abb6519492 h1:Paq34FxTluEPvVyayQqMPgHm+vTOrIifmcYxFBx9TLg= +golang.org/x/sys v0.0.0-20210324051608-47abb6519492/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/term v0.0.0-20201126162022-7de9c90e9dd1/go.mod h1:bj7SfCRtBDWHUb9snDiAeCFNEtKQo2Wmx5Cou7ajbmo= +golang.org/x/text v0.0.0-20170915032832-14c0d48ead0c/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= +golang.org/x/text v0.3.1-0.20180807135948-17ff2d5776d2/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= golang.org/x/text v0.3.2/go.mod h1:bEr9sfX3Q8Zfm5fL9x+3itogRgK3+ptLWKqgva+5dAk= -golang.org/x/text v0.3.3 h1:cokOdA+Jmi5PJGXLlLllQSgYigAEfHXJAERHVMaCc2k= golang.org/x/text v0.3.3/go.mod h1:5Zoc/QRtKVWzQhOtBMvqHzDpF6irO9z98xDceosuGiQ= +golang.org/x/text v0.3.4 h1:0YWbFKbhXG/wIiuHDSKpS0Iy7FSA+u45VtBMfQcFTTc= +golang.org/x/text v0.3.4/go.mod h1:5Zoc/QRtKVWzQhOtBMvqHzDpF6irO9z98xDceosuGiQ= +golang.org/x/time v0.0.0-20180412165947-fbb02b2291d2/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ= +golang.org/x/time v0.0.0-20181108054448-85acf8d2951c/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ= +golang.org/x/time v0.0.0-20190308202827-9d24e82272b4/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ= +golang.org/x/time v0.0.0-20191024005414-555d28b269f0/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ= +golang.org/x/time v0.0.0-20200630173020-3af7569d3a1e/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ= +golang.org/x/tools v0.0.0-20180221164845-07fd8470d635/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= -golang.org/x/xerrors v0.0.0-20191204190536-9bdfabe68543 h1:E7g+9GITq07hpfrRu66IVDexMakfv52eLZ2CXBWiKr4= +golang.org/x/tools v0.0.0-20181030221726-6c7e314b6563/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20190114222345-bf090417da8b/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20190226205152-f727befe758c/go.mod h1:9Yl7xja0Znq3iFh3HoIrodX9oNMXvdceNzlUR8zjMvY= +golang.org/x/tools v0.0.0-20190311212946-11955173bddd/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs= +golang.org/x/tools v0.0.0-20190312151545-0bb0c0a6e846/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs= +golang.org/x/tools v0.0.0-20190312170243-e65039ee4138/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs= +golang.org/x/tools v0.0.0-20190328211700-ab21143f2384/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs= +golang.org/x/tools v0.0.0-20190425150028-36563e24a262/go.mod h1:RgjU9mgBXZiqYHBnxXauZ1Gv1EHHAz9KjViQ78xBX0Q= +golang.org/x/tools v0.0.0-20190506145303-2d16b83fe98c/go.mod h1:RgjU9mgBXZiqYHBnxXauZ1Gv1EHHAz9KjViQ78xBX0Q= +golang.org/x/tools v0.0.0-20190524140312-2c0ae7006135/go.mod h1:RgjU9mgBXZiqYHBnxXauZ1Gv1EHHAz9KjViQ78xBX0Q= +golang.org/x/tools v0.0.0-20190606124116-d0a3d012864b/go.mod h1:/rFqwRUd4F7ZHNgwSSTFct+R/Kf4OFW1sUzUTQQTgfc= +golang.org/x/tools v0.0.0-20190614205625-5aca471b1d59/go.mod h1:/rFqwRUd4F7ZHNgwSSTFct+R/Kf4OFW1sUzUTQQTgfc= +golang.org/x/tools v0.0.0-20190621195816-6e04913cbbac/go.mod h1:/rFqwRUd4F7ZHNgwSSTFct+R/Kf4OFW1sUzUTQQTgfc= +golang.org/x/tools v0.0.0-20190624222133-a101b041ded4/go.mod h1:/rFqwRUd4F7ZHNgwSSTFct+R/Kf4OFW1sUzUTQQTgfc= +golang.org/x/tools v0.0.0-20190628153133-6cdbf07be9d0/go.mod h1:/rFqwRUd4F7ZHNgwSSTFct+R/Kf4OFW1sUzUTQQTgfc= +golang.org/x/tools v0.0.0-20190816200558-6889da9d5479/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo= +golang.org/x/tools v0.0.0-20190911174233-4f2ddba30aff/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo= +golang.org/x/tools v0.0.0-20191012152004-8de300cfc20a/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo= +golang.org/x/tools v0.0.0-20191113191852-77e3bb0ad9e7/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo= +golang.org/x/tools v0.0.0-20191115202509-3a792d9c32b2/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo= +golang.org/x/tools v0.0.0-20191119224855-298f0cb1881e/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo= +golang.org/x/tools v0.0.0-20191125144606-a911d9008d1f/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo= +golang.org/x/tools v0.0.0-20191130070609-6e064ea0cf2d/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo= +golang.org/x/tools v0.0.0-20191216173652-a0e659d51361/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28= +golang.org/x/tools v0.0.0-20191227053925-7b8e75db28f4/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28= +golang.org/x/tools v0.0.0-20200117161641-43d50277825c/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28= +golang.org/x/tools v0.0.0-20200122220014-bf1340f18c4a/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28= +golang.org/x/tools v0.0.0-20200130002326-2f3ba24bd6e7/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28= +golang.org/x/tools v0.0.0-20200204074204-1cc6d1ef6c74/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28= +golang.org/x/tools v0.0.0-20200207183749-b753a1ba74fa/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28= +golang.org/x/tools v0.0.0-20200212150539-ea181f53ac56/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28= +golang.org/x/tools v0.0.0-20200224181240-023911ca70b2/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28= +golang.org/x/tools v0.0.0-20200304193943-95d2e580d8eb/go.mod h1:o4KQGtdN14AW+yjsvvwRTJJuXz8XRtIHtEnmAXLyFUw= +golang.org/x/tools v0.0.0-20200619180055-7c47624df98f/go.mod h1:EkVYQZoAsY45+roYkvgYkIh4xh/qjgUK9TdY2XT94GE= +golang.org/x/tools v0.0.0-20210106214847-113979e3529a/go.mod h1:emZCQorbCU4vsT4fOWvOPXz4eW1wZW4PmDk9uLelYpA= +golang.org/x/xerrors v0.0.0-20190717185122-a985d3407aa7/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0= +golang.org/x/xerrors v0.0.0-20191011141410-1b5146add898/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0= golang.org/x/xerrors v0.0.0-20191204190536-9bdfabe68543/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0= +golang.org/x/xerrors v0.0.0-20200804184101-5ec99f83aff1 h1:go1bK/D/BFZV2I8cIQd1NKEZ+0owSTG1fDTci4IqFcE= +golang.org/x/xerrors v0.0.0-20200804184101-5ec99f83aff1/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0= +google.golang.org/api v0.0.0-20160322025152-9bf6e6e569ff/go.mod h1:4mhQ8q/RsB7i+udVvVy5NUi08OU8ZlA0gRVgrF7VFY0= +google.golang.org/api v0.4.0/go.mod h1:8k5glujaEP+g9n7WNsDg8QP6cUVNI86fCNMcbazEtwE= +google.golang.org/api v0.7.0/go.mod h1:WtwebWUNSVBH/HAw79HIFXZNqEvBhG+Ra+ax0hx3E3M= +google.golang.org/api v0.8.0/go.mod h1:o4eAsZoiT+ibD93RtjEohWalFOjRDx6CVaqeizhEnKg= +google.golang.org/api v0.9.0/go.mod h1:o4eAsZoiT+ibD93RtjEohWalFOjRDx6CVaqeizhEnKg= +google.golang.org/api v0.13.0/go.mod h1:iLdEw5Ide6rF15KTC1Kkl0iskquN2gFfn9o9XIsbkAI= +google.golang.org/api v0.14.0/go.mod h1:iLdEw5Ide6rF15KTC1Kkl0iskquN2gFfn9o9XIsbkAI= +google.golang.org/api v0.15.0/go.mod h1:iLdEw5Ide6rF15KTC1Kkl0iskquN2gFfn9o9XIsbkAI= +google.golang.org/api v0.17.0/go.mod h1:BwFmGc8tA3vsd7r/7kR8DY7iEEGSU04BFxCo5jP/sfE= +google.golang.org/api v0.18.0/go.mod h1:BwFmGc8tA3vsd7r/7kR8DY7iEEGSU04BFxCo5jP/sfE= +google.golang.org/api v0.20.0/go.mod h1:BwFmGc8tA3vsd7r/7kR8DY7iEEGSU04BFxCo5jP/sfE= +google.golang.org/appengine v1.1.0/go.mod h1:EbEs0AVv82hx2wNQdGPgUI5lhzA/G0D9YwlJXL52JkM= +google.golang.org/appengine v1.4.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4= +google.golang.org/appengine v1.5.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4= +google.golang.org/appengine v1.6.1/go.mod h1:i06prIuMbXzDqacNJfV5OdTW448YApPu5ww/cMBSeb0= +google.golang.org/appengine v1.6.5/go.mod h1:8WjMMxjGQR8xUklV/ARdw2HLXBOI7O7uCIDZVag1xfc= +google.golang.org/cloud v0.0.0-20151119220103-975617b05ea8/go.mod h1:0H1ncTHf11KCFhTc/+EFRbzSCOZx+VUbRMk55Yv5MYk= +google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8/go.mod h1:JiN7NxoALGmiZfu7CAH4rXhgtRTLTxftemlI0sWmxmc= +google.golang.org/genproto v0.0.0-20190307195333-5fe7a883aa19/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE= +google.golang.org/genproto v0.0.0-20190418145605-e7d98fc518a7/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE= +google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE= +google.golang.org/genproto v0.0.0-20190502173448-54afdca5d873/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE= +google.golang.org/genproto v0.0.0-20190522204451-c2c4e71fbf69/go.mod h1:z3L6/3dTEVtUr6QSP8miRzeRqwQOioJ9I66odjN4I7s= +google.golang.org/genproto v0.0.0-20190801165951-fa694d86fc64/go.mod h1:DMBHOl98Agz4BDEuKkezgsaosCRResVns1a3J2ZsMNc= +google.golang.org/genproto v0.0.0-20190819201941-24fa4b261c55/go.mod h1:DMBHOl98Agz4BDEuKkezgsaosCRResVns1a3J2ZsMNc= +google.golang.org/genproto v0.0.0-20190911173649-1774047e7e51/go.mod h1:IbNlFCBrqXvoKpeg0TB2l7cyZUmoaFKYIwrEpbDKLA8= +google.golang.org/genproto v0.0.0-20191108220845-16a3f7862a1a/go.mod h1:n3cpQtvxv34hfy77yVDNjmbRyujviMdxYliBSkLhpCc= +google.golang.org/genproto v0.0.0-20191115194625-c23dd37a84c9/go.mod h1:n3cpQtvxv34hfy77yVDNjmbRyujviMdxYliBSkLhpCc= +google.golang.org/genproto v0.0.0-20191216164720-4f79533eabd1/go.mod h1:n3cpQtvxv34hfy77yVDNjmbRyujviMdxYliBSkLhpCc= +google.golang.org/genproto v0.0.0-20191230161307-f3c370f40bfb/go.mod h1:n3cpQtvxv34hfy77yVDNjmbRyujviMdxYliBSkLhpCc= +google.golang.org/genproto v0.0.0-20200115191322-ca5a22157cba/go.mod h1:n3cpQtvxv34hfy77yVDNjmbRyujviMdxYliBSkLhpCc= +google.golang.org/genproto v0.0.0-20200117163144-32f20d992d24/go.mod h1:n3cpQtvxv34hfy77yVDNjmbRyujviMdxYliBSkLhpCc= +google.golang.org/genproto v0.0.0-20200122232147-0452cf42e150/go.mod h1:n3cpQtvxv34hfy77yVDNjmbRyujviMdxYliBSkLhpCc= +google.golang.org/genproto v0.0.0-20200204135345-fa8e72b47b90/go.mod h1:GmwEX6Z4W5gMy59cAlVYjN9JhxgbQH6Gn+gFDQe2lzA= +google.golang.org/genproto v0.0.0-20200212174721-66ed5ce911ce/go.mod h1:55QSHmfGQM9UVYDPBsyGGes0y52j32PQ3BqQfXhyH3c= +google.golang.org/genproto v0.0.0-20200224152610-e50cd9704f63/go.mod h1:55QSHmfGQM9UVYDPBsyGGes0y52j32PQ3BqQfXhyH3c= +google.golang.org/genproto v0.0.0-20200305110556-506484158171/go.mod h1:55QSHmfGQM9UVYDPBsyGGes0y52j32PQ3BqQfXhyH3c= +google.golang.org/genproto v0.0.0-20200526211855-cb27e3aa2013/go.mod h1:NbSheEEYHJ7i3ixzK3sjbqSGDJWnxyFXZblF3eUsNvo= +google.golang.org/genproto v0.0.0-20201110150050-8816d57aaa9a/go.mod h1:FWY/as6DDZQgahTzZj3fqbO1CbirC29ZNUFHwi0/+no= +google.golang.org/grpc v0.0.0-20160317175043-d3ddb4469d5a/go.mod h1:yo6s7OP7yaDglbqo1J04qKzAhqBH6lvTonzMVmEdcZw= +google.golang.org/grpc v1.19.0/go.mod h1:mqu4LbDTu4XGKhr4mRzUsmM4RtVoemTSY81AxZiDr8c= +google.golang.org/grpc v1.20.1/go.mod h1:10oTOabMzJvdu6/UiuZezV6QK5dSlG84ov/aaiqXj38= +google.golang.org/grpc v1.21.0/go.mod h1:oYelfM1adQP15Ek0mdvEgi9Df8B9CZIaU1084ijfRaM= +google.golang.org/grpc v1.21.1/go.mod h1:oYelfM1adQP15Ek0mdvEgi9Df8B9CZIaU1084ijfRaM= +google.golang.org/grpc v1.23.0/go.mod h1:Y5yQAOtifL1yxbo5wqy6BxZv8vAUGQwXBOALyacEbxg= +google.golang.org/grpc v1.23.1/go.mod h1:Y5yQAOtifL1yxbo5wqy6BxZv8vAUGQwXBOALyacEbxg= +google.golang.org/grpc v1.24.0/go.mod h1:XDChyiUovWa60DnaeDeZmSW86xtLtjtZbwvSiRnRtcA= +google.golang.org/grpc v1.25.1/go.mod h1:c3i+UQWmh7LiEpx4sFZnkU36qjEYZ0imhYfXVyQciAY= +google.golang.org/grpc v1.26.0/go.mod h1:qbnxyOmOxrQa7FizSgH+ReBfzJrCY1pSN7KXBS8abTk= +google.golang.org/grpc v1.27.0/go.mod h1:qbnxyOmOxrQa7FizSgH+ReBfzJrCY1pSN7KXBS8abTk= +google.golang.org/grpc v1.27.1/go.mod h1:qbnxyOmOxrQa7FizSgH+ReBfzJrCY1pSN7KXBS8abTk= +google.golang.org/grpc v1.30.0/go.mod h1:N36X2cJ7JwdamYAgDz+s+rVMFjt3numwzf/HckM8pak= +google.golang.org/grpc v1.33.2/go.mod h1:JMHMWHQWaTccqQQlmk3MJZS+GWXOdAesneDmEnv2fbc= google.golang.org/protobuf v0.0.0-20200109180630-ec00e32a8dfd/go.mod h1:DFci5gLYBciE7Vtevhsrf46CRTquxDuWsQurQQe4oz8= google.golang.org/protobuf v0.0.0-20200221191635-4d8936d0db64/go.mod h1:kwYJMbMJ01Woi6D6+Kah6886xMZcty6N08ah7+eCXa0= google.golang.org/protobuf v0.0.0-20200228230310-ab0ca4ff8a60/go.mod h1:cfTl7dwQJ+fmap5saPgwCLgHXTUD7jkjRqWcaiX5VyM= google.golang.org/protobuf v1.20.1-0.20200309200217-e05f789c0967/go.mod h1:A+miEFZTKqfCUM6K7xSMQL9OKL/b6hQv+e19PK+JZNE= google.golang.org/protobuf v1.21.0/go.mod h1:47Nbq4nVaFHyn7ilMalzfO3qCViNmqZ2kzikPIcrTAo= -google.golang.org/protobuf v1.23.0 h1:4MY060fB1DLGMB/7MBTLnwQUY6+F09GEiz6SsrNqyzM= +google.golang.org/protobuf v1.22.0/go.mod h1:EGpADcykh3NcUnDUJcl1+ZksZNG86OlYog2l/sGQquU= google.golang.org/protobuf v1.23.0/go.mod h1:EGpADcykh3NcUnDUJcl1+ZksZNG86OlYog2l/sGQquU= -gopkg.in/check.v1 v0.0.0-20161208181325-20d25e280405 h1:yhCVgyC4o1eVCa2tZl7eS0r+SDo693bJlVdllGtEeKM= +google.golang.org/protobuf v1.23.1-0.20200526195155-81db48ad09cc/go.mod h1:EGpADcykh3NcUnDUJcl1+ZksZNG86OlYog2l/sGQquU= +google.golang.org/protobuf v1.24.0/go.mod h1:r/3tXBNzIEhYS9I1OUVjXDlt8tc493IdKGjtUeSXeh4= +google.golang.org/protobuf v1.25.0 h1:Ejskq+SyPohKW+1uil0JJMtmHCgJPJ/qWTxr8qp+R4c= +google.golang.org/protobuf v1.25.0/go.mod h1:9JNX74DMeImyA3h4bdi1ymwjUzf21/xIlbajtzgsN7c= +gopkg.in/airbrake/gobrake.v2 v2.0.9/go.mod h1:/h5ZAUhDkGaJfjzjKLSjv6zCL6O0LLBxU4K+aSYdM/U= +gopkg.in/alecthomas/kingpin.v2 v2.2.6/go.mod h1:FMv+mEhP44yOT+4EoQTLFTRgOQ1FBLkstjWtayDeSgw= gopkg.in/check.v1 v0.0.0-20161208181325-20d25e280405/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0= +gopkg.in/check.v1 v1.0.0-20141024133853-64131543e789/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0= +gopkg.in/check.v1 v1.0.0-20180628173108-788fd7840127/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0= +gopkg.in/check.v1 v1.0.0-20190902080502-41f04d3bba15 h1:YR8cESwS4TdDjEe65xsg0ogRM/Nc3DYOhEAlW+xobZo= +gopkg.in/check.v1 v1.0.0-20190902080502-41f04d3bba15/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0= +gopkg.in/cheggaaa/pb.v1 v1.0.25/go.mod h1:V/YB90LKu/1FcN3WVnfiiE5oMCibMjukxqG/qStrOgw= +gopkg.in/errgo.v2 v2.1.0/go.mod h1:hNsd1EY+bozCKY1Ytp96fpM3vjJbqLJn88ws8XvfDNI= gopkg.in/fsnotify.v1 v1.4.7/go.mod h1:Tz8NjZHkW78fSQdbUxIjBTcgA1z1m8ZHf0WmKUhAMys= +gopkg.in/gemnasium/logrus-airbrake-hook.v2 v2.1.2/go.mod h1:Xk6kEKp8OKb+X14hQBKWaSkCsqBpgog8nAV2xsGOxlo= +gopkg.in/inf.v0 v0.9.1/go.mod h1:cWUDdTG/fYaXco+Dcufb5Vnc6Gp2YChqWtbxRZE0mXw= +gopkg.in/natefinch/lumberjack.v2 v2.0.0/go.mod h1:l0ndWWf7gzL7RNwBG7wST/UCcT4T24xpD6X8LsfU/+k= +gopkg.in/resty.v1 v1.12.0/go.mod h1:mDo4pnntr5jdWRML875a/NmxYqAlA73dVijT2AXvQQo= +gopkg.in/square/go-jose.v2 v2.2.2/go.mod h1:M9dMgbHiYLoDGQrXy7OpJDJWiKiU//h+vD76mk0e1AI= +gopkg.in/square/go-jose.v2 v2.3.1/go.mod h1:M9dMgbHiYLoDGQrXy7OpJDJWiKiU//h+vD76mk0e1AI= +gopkg.in/square/go-jose.v2 v2.5.1/go.mod h1:M9dMgbHiYLoDGQrXy7OpJDJWiKiU//h+vD76mk0e1AI= gopkg.in/tomb.v1 v1.0.0-20141024135613-dd632973f1e7 h1:uRGJdciOHaEIrze2W8Q3AKkepLTh2hOroT7a+7czfdQ= gopkg.in/tomb.v1 v1.0.0-20141024135613-dd632973f1e7/go.mod h1:dt/ZhP58zS4L8KSrWDmTeBkI65Dw0HsyUHuEVlX15mw= +gopkg.in/yaml.v2 v2.0.0-20170812160011-eb3733d160e7/go.mod h1:JAlM8MvJe8wmxCU4Bli9HhUf9+ttbYbLASfIpnQbh74= +gopkg.in/yaml.v2 v2.2.1/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI= +gopkg.in/yaml.v2 v2.2.2/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI= gopkg.in/yaml.v2 v2.2.4/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI= -gopkg.in/yaml.v2 v2.3.0 h1:clyUAQHOM3G0M3f5vQj7LuJrETvjVot3Z5el9nffUtU= +gopkg.in/yaml.v2 v2.2.5/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI= +gopkg.in/yaml.v2 v2.2.8/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI= gopkg.in/yaml.v2 v2.3.0/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI= +gopkg.in/yaml.v2 v2.4.0 h1:D8xgwECY7CYvx+Y2n4sBz93Jn9JRvxdiyyo8CTfuKaY= +gopkg.in/yaml.v2 v2.4.0/go.mod h1:RDklbk79AGWmwhnvt/jBztapEOGDOx6ZbXqjP6csGnQ= +gopkg.in/yaml.v3 v3.0.0-20200313102051-9f266ea9e77c h1:dUUwHk2QECo/6vqA44rthZ8ie2QXMNeKRTHCNY2nXvo= +gopkg.in/yaml.v3 v3.0.0-20200313102051-9f266ea9e77c/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM= +gotest.tools v2.2.0+incompatible/go.mod h1:DsYFclhRJ6vuDpmuTbkuFWG+y2sxOXAzmJt81HFBacw= +gotest.tools/v3 v3.0.2/go.mod h1:3SzNCllyD9/Y+b5r9JIKQ474KzkZyqLqEfYqMsX94Bk= +gotest.tools/v3 v3.0.3/go.mod h1:Z7Lb0S5l+klDB31fvDQX8ss/FlKDxtlFlw3Oa8Ymbl8= +honnef.co/go/tools v0.0.0-20190102054323-c2f93a96b099/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4= +honnef.co/go/tools v0.0.0-20190106161140-3f1c8253044a/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4= +honnef.co/go/tools v0.0.0-20190418001031-e561f6794a2a/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4= +honnef.co/go/tools v0.0.0-20190523083050-ea95bdfd59fc/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4= +honnef.co/go/tools v0.0.1-2019.2.3/go.mod h1:a3bituU0lyd329TUQxRnasdCoJDkEUEAqEt0JzvZhAg= +honnef.co/go/tools v0.0.1-2020.1.3/go.mod h1:X/FiERA/W4tHapMX5mGpAtMSVEeEUOyHaw9vFzvIQ3k= +k8s.io/api v0.20.1/go.mod h1:KqwcCVogGxQY3nBlRpwt+wpAMF/KjaCc7RpywacvqUo= +k8s.io/apimachinery v0.20.1/go.mod h1:WlLqWAHZGg07AeltaI0MV5uk1Omp8xaN0JGLY6gkRpU= +k8s.io/apiserver v0.20.1/go.mod h1:ro5QHeQkgMS7ZGpvf4tSMx6bBOgPfE+f52KwvXfScaU= +k8s.io/client-go v0.20.1/go.mod h1:/zcHdt1TeWSd5HoUe6elJmHSQ6uLLgp4bIJHVEuy+/Y= +k8s.io/component-base v0.20.1/go.mod h1:guxkoJnNoh8LNrbtiQOlyp2Y2XFCZQmrcg2n/DeYNLk= +k8s.io/cri-api v0.17.3/go.mod h1:X1sbHmuXhwaHs9xxYffLqJogVsnI+f6cPRcgPel7ywM= +k8s.io/cri-api v0.20.1/go.mod h1:2JRbKt+BFLTjtrILYVqQK5jqhI+XNdF6UiGMgczeBCI= +k8s.io/gengo v0.0.0-20200413195148-3a45101e95ac/go.mod h1:ezvh/TsK7cY6rbqRK0oQQ8IAqLxYwwyPxAX1Pzy0ii0= +k8s.io/klog/v2 v2.0.0/go.mod h1:PBfzABfn139FHAV07az/IF9Wp1bkk3vpT2XSJ76fSDE= +k8s.io/klog/v2 v2.4.0/go.mod h1:Od+F08eJP+W3HUb4pSrPpgp9DGU4GzlpG/TmITuYh/Y= +k8s.io/kube-openapi v0.0.0-20201113171705-d219536bb9fd/go.mod h1:WOJ3KddDSol4tAGcJo0Tvi+dK12EcqSLqcWsryKMpfM= +k8s.io/kubernetes v1.13.0/go.mod h1:ocZa8+6APFNC2tX1DZASIbocyYT5jHzqFVsY5aoB7Jk= +k8s.io/utils v0.0.0-20201110183641-67b214c5f920/go.mod h1:jPW/WVKK9YHAvNhRxK0md/EJ228hCsBRufyofKtW8HA= +rsc.io/binaryregexp v0.2.0/go.mod h1:qTv7/COck+e2FymRvadv62gMdZztPaShugOCi3I+8D8= +rsc.io/quote/v3 v3.1.0/go.mod h1:yEA65RcK8LyAZtP9Kv3t0HmxON59tX3rD+tICJqUlj0= +rsc.io/sampler v1.3.0/go.mod h1:T1hPZKmBbMNahiBKFy5HrXp6adAjACjK9JXDnKaTXpA= +sigs.k8s.io/apiserver-network-proxy/konnectivity-client v0.0.14/go.mod h1:LEScyzhFmoF5pso/YSeBstl57mOzx9xlU9n85RGrDQg= +sigs.k8s.io/structured-merge-diff/v4 v4.0.2/go.mod h1:bJZC9H9iH24zzfZ/41RGcq60oK1F7G282QMXDPYydCw= +sigs.k8s.io/yaml v1.1.0/go.mod h1:UJmg0vDUVViEyp3mgSv9WPwZCDxu4rQW1olrI1uml+o= +sigs.k8s.io/yaml v1.2.0/go.mod h1:yfXDCHCao9+ENCvLSE62v9VSji2MKu5jeNfTrofGhJc= diff --git a/vendor/github.com/Microsoft/go-winio/CODEOWNERS b/vendor/github.com/Microsoft/go-winio/CODEOWNERS new file mode 100644 index 00000000..ae1b4942 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/CODEOWNERS @@ -0,0 +1 @@ + * @microsoft/containerplat diff --git a/vendor/github.com/Microsoft/go-winio/file.go b/vendor/github.com/Microsoft/go-winio/file.go index 4334ff1c..0385e410 100644 --- a/vendor/github.com/Microsoft/go-winio/file.go +++ b/vendor/github.com/Microsoft/go-winio/file.go @@ -16,6 +16,7 @@ import ( //sys createIoCompletionPort(file syscall.Handle, port syscall.Handle, key uintptr, threadCount uint32) (newport syscall.Handle, err error) = CreateIoCompletionPort //sys getQueuedCompletionStatus(port syscall.Handle, bytes *uint32, key *uintptr, o **ioOperation, timeout uint32) (err error) = GetQueuedCompletionStatus //sys setFileCompletionNotificationModes(h syscall.Handle, flags uint8) (err error) = SetFileCompletionNotificationModes +//sys wsaGetOverlappedResult(h syscall.Handle, o *syscall.Overlapped, bytes *uint32, wait bool, flags *uint32) (err error) = ws2_32.WSAGetOverlappedResult type atomicBool int32 @@ -79,6 +80,7 @@ type win32File struct { wg sync.WaitGroup wgLock sync.RWMutex closing atomicBool + socket bool readDeadline deadlineHandler writeDeadline deadlineHandler } @@ -109,7 +111,13 @@ func makeWin32File(h syscall.Handle) (*win32File, error) { } func MakeOpenFile(h syscall.Handle) (io.ReadWriteCloser, error) { - return makeWin32File(h) + // If we return the result of makeWin32File directly, it can result in an + // interface-wrapped nil, rather than a nil interface value. + f, err := makeWin32File(h) + if err != nil { + return nil, err + } + return f, nil } // closeHandle closes the resources associated with a Win32 handle @@ -190,6 +198,10 @@ func (f *win32File) asyncIo(c *ioOperation, d *deadlineHandler, bytes uint32, er if f.closing.isSet() { err = ErrFileClosed } + } else if err != nil && f.socket { + // err is from Win32. Query the overlapped structure to get the winsock error. + var bytes, flags uint32 + err = wsaGetOverlappedResult(f.handle, &c.o, &bytes, false, &flags) } case <-timeout: cancelIoEx(f.handle, &c.o) @@ -265,6 +277,10 @@ func (f *win32File) Flush() error { return syscall.FlushFileBuffers(f.handle) } +func (f *win32File) Fd() uintptr { + return uintptr(f.handle) +} + func (d *deadlineHandler) set(deadline time.Time) error { d.setLock.Lock() defer d.setLock.Unlock() diff --git a/vendor/github.com/Microsoft/go-winio/fileinfo.go b/vendor/github.com/Microsoft/go-winio/fileinfo.go index ada2fbab..3ab6bff6 100644 --- a/vendor/github.com/Microsoft/go-winio/fileinfo.go +++ b/vendor/github.com/Microsoft/go-winio/fileinfo.go @@ -5,21 +5,14 @@ package winio import ( "os" "runtime" - "syscall" "unsafe" -) -//sys getFileInformationByHandleEx(h syscall.Handle, class uint32, buffer *byte, size uint32) (err error) = GetFileInformationByHandleEx -//sys setFileInformationByHandle(h syscall.Handle, class uint32, buffer *byte, size uint32) (err error) = SetFileInformationByHandle - -const ( - fileBasicInfo = 0 - fileIDInfo = 0x12 + "golang.org/x/sys/windows" ) // FileBasicInfo contains file access time and file attributes information. type FileBasicInfo struct { - CreationTime, LastAccessTime, LastWriteTime, ChangeTime syscall.Filetime + CreationTime, LastAccessTime, LastWriteTime, ChangeTime windows.Filetime FileAttributes uint32 pad uint32 // padding } @@ -27,7 +20,7 @@ type FileBasicInfo struct { // GetFileBasicInfo retrieves times and attributes for a file. func GetFileBasicInfo(f *os.File) (*FileBasicInfo, error) { bi := &FileBasicInfo{} - if err := getFileInformationByHandleEx(syscall.Handle(f.Fd()), fileBasicInfo, (*byte)(unsafe.Pointer(bi)), uint32(unsafe.Sizeof(*bi))); err != nil { + if err := windows.GetFileInformationByHandleEx(windows.Handle(f.Fd()), windows.FileBasicInfo, (*byte)(unsafe.Pointer(bi)), uint32(unsafe.Sizeof(*bi))); err != nil { return nil, &os.PathError{Op: "GetFileInformationByHandleEx", Path: f.Name(), Err: err} } runtime.KeepAlive(f) @@ -36,13 +29,32 @@ func GetFileBasicInfo(f *os.File) (*FileBasicInfo, error) { // SetFileBasicInfo sets times and attributes for a file. func SetFileBasicInfo(f *os.File, bi *FileBasicInfo) error { - if err := setFileInformationByHandle(syscall.Handle(f.Fd()), fileBasicInfo, (*byte)(unsafe.Pointer(bi)), uint32(unsafe.Sizeof(*bi))); err != nil { + if err := windows.SetFileInformationByHandle(windows.Handle(f.Fd()), windows.FileBasicInfo, (*byte)(unsafe.Pointer(bi)), uint32(unsafe.Sizeof(*bi))); err != nil { return &os.PathError{Op: "SetFileInformationByHandle", Path: f.Name(), Err: err} } runtime.KeepAlive(f) return nil } +// FileStandardInfo contains extended information for the file. +// FILE_STANDARD_INFO in WinBase.h +// https://docs.microsoft.com/en-us/windows/win32/api/winbase/ns-winbase-file_standard_info +type FileStandardInfo struct { + AllocationSize, EndOfFile int64 + NumberOfLinks uint32 + DeletePending, Directory bool +} + +// GetFileStandardInfo retrieves ended information for the file. +func GetFileStandardInfo(f *os.File) (*FileStandardInfo, error) { + si := &FileStandardInfo{} + if err := windows.GetFileInformationByHandleEx(windows.Handle(f.Fd()), windows.FileStandardInfo, (*byte)(unsafe.Pointer(si)), uint32(unsafe.Sizeof(*si))); err != nil { + return nil, &os.PathError{Op: "GetFileInformationByHandleEx", Path: f.Name(), Err: err} + } + runtime.KeepAlive(f) + return si, nil +} + // FileIDInfo contains the volume serial number and file ID for a file. This pair should be // unique on a system. type FileIDInfo struct { @@ -53,7 +65,7 @@ type FileIDInfo struct { // GetFileID retrieves the unique (volume, file ID) pair for a file. func GetFileID(f *os.File) (*FileIDInfo, error) { fileID := &FileIDInfo{} - if err := getFileInformationByHandleEx(syscall.Handle(f.Fd()), fileIDInfo, (*byte)(unsafe.Pointer(fileID)), uint32(unsafe.Sizeof(*fileID))); err != nil { + if err := windows.GetFileInformationByHandleEx(windows.Handle(f.Fd()), windows.FileIdInfo, (*byte)(unsafe.Pointer(fileID)), uint32(unsafe.Sizeof(*fileID))); err != nil { return nil, &os.PathError{Op: "GetFileInformationByHandleEx", Path: f.Name(), Err: err} } runtime.KeepAlive(f) diff --git a/vendor/github.com/Microsoft/go-winio/go.mod b/vendor/github.com/Microsoft/go-winio/go.mod new file mode 100644 index 00000000..98a8dea0 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/go.mod @@ -0,0 +1,9 @@ +module github.com/Microsoft/go-winio + +go 1.12 + +require ( + github.com/pkg/errors v0.9.1 + github.com/sirupsen/logrus v1.7.0 + golang.org/x/sys v0.0.0-20210124154548-22da62e12c0c +) diff --git a/vendor/github.com/Microsoft/go-winio/go.sum b/vendor/github.com/Microsoft/go-winio/go.sum new file mode 100644 index 00000000..aa6ad3b5 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/go.sum @@ -0,0 +1,14 @@ +github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c= +github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38= +github.com/pkg/errors v0.9.1 h1:FEBLx1zS214owpjy7qsBeixbURkuhQAwrK5UwLGTwt4= +github.com/pkg/errors v0.9.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0= +github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM= +github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4= +github.com/sirupsen/logrus v1.7.0 h1:ShrD1U9pZB12TX0cVy0DtePoCH97K8EtX+mg7ZARUtM= +github.com/sirupsen/logrus v1.7.0/go.mod h1:yWOB1SBYBC5VeMP7gHvWumXLIWorT60ONWic61uBYv0= +github.com/stretchr/testify v1.2.2 h1:bSDNvY7ZPG5RlJ8otE/7V6gMiyenm9RtJ7IUVIAoJ1w= +github.com/stretchr/testify v1.2.2/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXfy6kDkUVs= +golang.org/x/sys v0.0.0-20191026070338-33540a1f6037 h1:YyJpGZS1sBuBCzLAR1VEpK193GlqGZbnPFnPV/5Rsb4= +golang.org/x/sys v0.0.0-20191026070338-33540a1f6037/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20210124154548-22da62e12c0c h1:VwygUrnw9jn88c4u8GD3rZQbqrP/tgas88tPUbBxQrk= +golang.org/x/sys v0.0.0-20210124154548-22da62e12c0c/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= diff --git a/vendor/github.com/Microsoft/go-winio/hvsock.go b/vendor/github.com/Microsoft/go-winio/hvsock.go new file mode 100644 index 00000000..b632f8f8 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/hvsock.go @@ -0,0 +1,307 @@ +// +build windows + +package winio + +import ( + "fmt" + "io" + "net" + "os" + "syscall" + "time" + "unsafe" + + "github.com/Microsoft/go-winio/pkg/guid" +) + +//sys bind(s syscall.Handle, name unsafe.Pointer, namelen int32) (err error) [failretval==socketError] = ws2_32.bind + +const ( + afHvSock = 34 // AF_HYPERV + + socketError = ^uintptr(0) +) + +// An HvsockAddr is an address for a AF_HYPERV socket. +type HvsockAddr struct { + VMID guid.GUID + ServiceID guid.GUID +} + +type rawHvsockAddr struct { + Family uint16 + _ uint16 + VMID guid.GUID + ServiceID guid.GUID +} + +// Network returns the address's network name, "hvsock". +func (addr *HvsockAddr) Network() string { + return "hvsock" +} + +func (addr *HvsockAddr) String() string { + return fmt.Sprintf("%s:%s", &addr.VMID, &addr.ServiceID) +} + +// VsockServiceID returns an hvsock service ID corresponding to the specified AF_VSOCK port. +func VsockServiceID(port uint32) guid.GUID { + g, _ := guid.FromString("00000000-facb-11e6-bd58-64006a7986d3") + g.Data1 = port + return g +} + +func (addr *HvsockAddr) raw() rawHvsockAddr { + return rawHvsockAddr{ + Family: afHvSock, + VMID: addr.VMID, + ServiceID: addr.ServiceID, + } +} + +func (addr *HvsockAddr) fromRaw(raw *rawHvsockAddr) { + addr.VMID = raw.VMID + addr.ServiceID = raw.ServiceID +} + +// HvsockListener is a socket listener for the AF_HYPERV address family. +type HvsockListener struct { + sock *win32File + addr HvsockAddr +} + +// HvsockConn is a connected socket of the AF_HYPERV address family. +type HvsockConn struct { + sock *win32File + local, remote HvsockAddr +} + +func newHvSocket() (*win32File, error) { + fd, err := syscall.Socket(afHvSock, syscall.SOCK_STREAM, 1) + if err != nil { + return nil, os.NewSyscallError("socket", err) + } + f, err := makeWin32File(fd) + if err != nil { + syscall.Close(fd) + return nil, err + } + f.socket = true + return f, nil +} + +// ListenHvsock listens for connections on the specified hvsock address. +func ListenHvsock(addr *HvsockAddr) (_ *HvsockListener, err error) { + l := &HvsockListener{addr: *addr} + sock, err := newHvSocket() + if err != nil { + return nil, l.opErr("listen", err) + } + sa := addr.raw() + err = bind(sock.handle, unsafe.Pointer(&sa), int32(unsafe.Sizeof(sa))) + if err != nil { + return nil, l.opErr("listen", os.NewSyscallError("socket", err)) + } + err = syscall.Listen(sock.handle, 16) + if err != nil { + return nil, l.opErr("listen", os.NewSyscallError("listen", err)) + } + return &HvsockListener{sock: sock, addr: *addr}, nil +} + +func (l *HvsockListener) opErr(op string, err error) error { + return &net.OpError{Op: op, Net: "hvsock", Addr: &l.addr, Err: err} +} + +// Addr returns the listener's network address. +func (l *HvsockListener) Addr() net.Addr { + return &l.addr +} + +// Accept waits for the next connection and returns it. +func (l *HvsockListener) Accept() (_ net.Conn, err error) { + sock, err := newHvSocket() + if err != nil { + return nil, l.opErr("accept", err) + } + defer func() { + if sock != nil { + sock.Close() + } + }() + c, err := l.sock.prepareIo() + if err != nil { + return nil, l.opErr("accept", err) + } + defer l.sock.wg.Done() + + // AcceptEx, per documentation, requires an extra 16 bytes per address. + const addrlen = uint32(16 + unsafe.Sizeof(rawHvsockAddr{})) + var addrbuf [addrlen * 2]byte + + var bytes uint32 + err = syscall.AcceptEx(l.sock.handle, sock.handle, &addrbuf[0], 0, addrlen, addrlen, &bytes, &c.o) + _, err = l.sock.asyncIo(c, nil, bytes, err) + if err != nil { + return nil, l.opErr("accept", os.NewSyscallError("acceptex", err)) + } + conn := &HvsockConn{ + sock: sock, + } + conn.local.fromRaw((*rawHvsockAddr)(unsafe.Pointer(&addrbuf[0]))) + conn.remote.fromRaw((*rawHvsockAddr)(unsafe.Pointer(&addrbuf[addrlen]))) + sock = nil + return conn, nil +} + +// Close closes the listener, causing any pending Accept calls to fail. +func (l *HvsockListener) Close() error { + return l.sock.Close() +} + +/* Need to finish ConnectEx handling +func DialHvsock(ctx context.Context, addr *HvsockAddr) (*HvsockConn, error) { + sock, err := newHvSocket() + if err != nil { + return nil, err + } + defer func() { + if sock != nil { + sock.Close() + } + }() + c, err := sock.prepareIo() + if err != nil { + return nil, err + } + defer sock.wg.Done() + var bytes uint32 + err = windows.ConnectEx(windows.Handle(sock.handle), sa, nil, 0, &bytes, &c.o) + _, err = sock.asyncIo(ctx, c, nil, bytes, err) + if err != nil { + return nil, err + } + conn := &HvsockConn{ + sock: sock, + remote: *addr, + } + sock = nil + return conn, nil +} +*/ + +func (conn *HvsockConn) opErr(op string, err error) error { + return &net.OpError{Op: op, Net: "hvsock", Source: &conn.local, Addr: &conn.remote, Err: err} +} + +func (conn *HvsockConn) Read(b []byte) (int, error) { + c, err := conn.sock.prepareIo() + if err != nil { + return 0, conn.opErr("read", err) + } + defer conn.sock.wg.Done() + buf := syscall.WSABuf{Buf: &b[0], Len: uint32(len(b))} + var flags, bytes uint32 + err = syscall.WSARecv(conn.sock.handle, &buf, 1, &bytes, &flags, &c.o, nil) + n, err := conn.sock.asyncIo(c, &conn.sock.readDeadline, bytes, err) + if err != nil { + if _, ok := err.(syscall.Errno); ok { + err = os.NewSyscallError("wsarecv", err) + } + return 0, conn.opErr("read", err) + } else if n == 0 { + err = io.EOF + } + return n, err +} + +func (conn *HvsockConn) Write(b []byte) (int, error) { + t := 0 + for len(b) != 0 { + n, err := conn.write(b) + if err != nil { + return t + n, err + } + t += n + b = b[n:] + } + return t, nil +} + +func (conn *HvsockConn) write(b []byte) (int, error) { + c, err := conn.sock.prepareIo() + if err != nil { + return 0, conn.opErr("write", err) + } + defer conn.sock.wg.Done() + buf := syscall.WSABuf{Buf: &b[0], Len: uint32(len(b))} + var bytes uint32 + err = syscall.WSASend(conn.sock.handle, &buf, 1, &bytes, 0, &c.o, nil) + n, err := conn.sock.asyncIo(c, &conn.sock.writeDeadline, bytes, err) + if err != nil { + if _, ok := err.(syscall.Errno); ok { + err = os.NewSyscallError("wsasend", err) + } + return 0, conn.opErr("write", err) + } + return n, err +} + +// Close closes the socket connection, failing any pending read or write calls. +func (conn *HvsockConn) Close() error { + return conn.sock.Close() +} + +func (conn *HvsockConn) shutdown(how int) error { + err := syscall.Shutdown(conn.sock.handle, syscall.SHUT_RD) + if err != nil { + return os.NewSyscallError("shutdown", err) + } + return nil +} + +// CloseRead shuts down the read end of the socket. +func (conn *HvsockConn) CloseRead() error { + err := conn.shutdown(syscall.SHUT_RD) + if err != nil { + return conn.opErr("close", err) + } + return nil +} + +// CloseWrite shuts down the write end of the socket, notifying the other endpoint that +// no more data will be written. +func (conn *HvsockConn) CloseWrite() error { + err := conn.shutdown(syscall.SHUT_WR) + if err != nil { + return conn.opErr("close", err) + } + return nil +} + +// LocalAddr returns the local address of the connection. +func (conn *HvsockConn) LocalAddr() net.Addr { + return &conn.local +} + +// RemoteAddr returns the remote address of the connection. +func (conn *HvsockConn) RemoteAddr() net.Addr { + return &conn.remote +} + +// SetDeadline implements the net.Conn SetDeadline method. +func (conn *HvsockConn) SetDeadline(t time.Time) error { + conn.SetReadDeadline(t) + conn.SetWriteDeadline(t) + return nil +} + +// SetReadDeadline implements the net.Conn SetReadDeadline method. +func (conn *HvsockConn) SetReadDeadline(t time.Time) error { + return conn.sock.SetReadDeadline(t) +} + +// SetWriteDeadline implements the net.Conn SetWriteDeadline method. +func (conn *HvsockConn) SetWriteDeadline(t time.Time) error { + return conn.sock.SetWriteDeadline(t) +} diff --git a/vendor/github.com/Microsoft/go-winio/pipe.go b/vendor/github.com/Microsoft/go-winio/pipe.go index d99eedb6..96700a73 100644 --- a/vendor/github.com/Microsoft/go-winio/pipe.go +++ b/vendor/github.com/Microsoft/go-winio/pipe.go @@ -3,10 +3,13 @@ package winio import ( + "context" "errors" + "fmt" "io" "net" "os" + "runtime" "syscall" "time" "unsafe" @@ -18,6 +21,48 @@ import ( //sys getNamedPipeInfo(pipe syscall.Handle, flags *uint32, outSize *uint32, inSize *uint32, maxInstances *uint32) (err error) = GetNamedPipeInfo //sys getNamedPipeHandleState(pipe syscall.Handle, state *uint32, curInstances *uint32, maxCollectionCount *uint32, collectDataTimeout *uint32, userName *uint16, maxUserNameSize uint32) (err error) = GetNamedPipeHandleStateW //sys localAlloc(uFlags uint32, length uint32) (ptr uintptr) = LocalAlloc +//sys ntCreateNamedPipeFile(pipe *syscall.Handle, access uint32, oa *objectAttributes, iosb *ioStatusBlock, share uint32, disposition uint32, options uint32, typ uint32, readMode uint32, completionMode uint32, maxInstances uint32, inboundQuota uint32, outputQuota uint32, timeout *int64) (status ntstatus) = ntdll.NtCreateNamedPipeFile +//sys rtlNtStatusToDosError(status ntstatus) (winerr error) = ntdll.RtlNtStatusToDosErrorNoTeb +//sys rtlDosPathNameToNtPathName(name *uint16, ntName *unicodeString, filePart uintptr, reserved uintptr) (status ntstatus) = ntdll.RtlDosPathNameToNtPathName_U +//sys rtlDefaultNpAcl(dacl *uintptr) (status ntstatus) = ntdll.RtlDefaultNpAcl + +type ioStatusBlock struct { + Status, Information uintptr +} + +type objectAttributes struct { + Length uintptr + RootDirectory uintptr + ObjectName *unicodeString + Attributes uintptr + SecurityDescriptor *securityDescriptor + SecurityQoS uintptr +} + +type unicodeString struct { + Length uint16 + MaximumLength uint16 + Buffer uintptr +} + +type securityDescriptor struct { + Revision byte + Sbz1 byte + Control uint16 + Owner uintptr + Group uintptr + Sacl uintptr + Dacl uintptr +} + +type ntstatus int32 + +func (status ntstatus) Err() error { + if status >= 0 { + return nil + } + return rtlNtStatusToDosError(status) +} const ( cERROR_PIPE_BUSY = syscall.Errno(231) @@ -25,21 +70,20 @@ const ( cERROR_PIPE_CONNECTED = syscall.Errno(535) cERROR_SEM_TIMEOUT = syscall.Errno(121) - cPIPE_ACCESS_DUPLEX = 0x3 - cFILE_FLAG_FIRST_PIPE_INSTANCE = 0x80000 - cSECURITY_SQOS_PRESENT = 0x100000 - cSECURITY_ANONYMOUS = 0 - - cPIPE_REJECT_REMOTE_CLIENTS = 0x8 - - cPIPE_UNLIMITED_INSTANCES = 255 - - cNMPWAIT_USE_DEFAULT_WAIT = 0 - cNMPWAIT_NOWAIT = 1 + cSECURITY_SQOS_PRESENT = 0x100000 + cSECURITY_ANONYMOUS = 0 cPIPE_TYPE_MESSAGE = 4 cPIPE_READMODE_MESSAGE = 2 + + cFILE_OPEN = 1 + cFILE_CREATE = 2 + + cFILE_PIPE_MESSAGE_TYPE = 1 + cFILE_PIPE_REJECT_REMOTE_CLIENTS = 2 + + cSE_DACL_PRESENT = 4 ) var ( @@ -137,33 +181,60 @@ func (s pipeAddress) String() string { return string(s) } +// tryDialPipe attempts to dial the pipe at `path` until `ctx` cancellation or timeout. +func tryDialPipe(ctx context.Context, path *string, access uint32) (syscall.Handle, error) { + for { + + select { + case <-ctx.Done(): + return syscall.Handle(0), ctx.Err() + default: + h, err := createFile(*path, access, 0, nil, syscall.OPEN_EXISTING, syscall.FILE_FLAG_OVERLAPPED|cSECURITY_SQOS_PRESENT|cSECURITY_ANONYMOUS, 0) + if err == nil { + return h, nil + } + if err != cERROR_PIPE_BUSY { + return h, &os.PathError{Err: err, Op: "open", Path: *path} + } + // Wait 10 msec and try again. This is a rather simplistic + // view, as we always try each 10 milliseconds. + time.Sleep(10 * time.Millisecond) + } + } +} + // DialPipe connects to a named pipe by path, timing out if the connection // takes longer than the specified duration. If timeout is nil, then we use -// a default timeout of 5 seconds. (We do not use WaitNamedPipe.) +// a default timeout of 2 seconds. (We do not use WaitNamedPipe.) func DialPipe(path string, timeout *time.Duration) (net.Conn, error) { var absTimeout time.Time if timeout != nil { absTimeout = time.Now().Add(*timeout) } else { - absTimeout = time.Now().Add(time.Second * 2) + absTimeout = time.Now().Add(2 * time.Second) } + ctx, _ := context.WithDeadline(context.Background(), absTimeout) + conn, err := DialPipeContext(ctx, path) + if err == context.DeadlineExceeded { + return nil, ErrTimeout + } + return conn, err +} + +// DialPipeContext attempts to connect to a named pipe by `path` until `ctx` +// cancellation or timeout. +func DialPipeContext(ctx context.Context, path string) (net.Conn, error) { + return DialPipeAccess(ctx, path, syscall.GENERIC_READ|syscall.GENERIC_WRITE) +} + +// DialPipeAccess attempts to connect to a named pipe by `path` with `access` until `ctx` +// cancellation or timeout. +func DialPipeAccess(ctx context.Context, path string, access uint32) (net.Conn, error) { var err error var h syscall.Handle - for { - h, err = createFile(path, syscall.GENERIC_READ|syscall.GENERIC_WRITE, 0, nil, syscall.OPEN_EXISTING, syscall.FILE_FLAG_OVERLAPPED|cSECURITY_SQOS_PRESENT|cSECURITY_ANONYMOUS, 0) - if err != cERROR_PIPE_BUSY { - break - } - if time.Now().After(absTimeout) { - return nil, ErrTimeout - } - - // Wait 10 msec and try again. This is a rather simplistic - // view, as we always try each 10 milliseconds. - time.Sleep(time.Millisecond * 10) - } + h, err = tryDialPipe(ctx, &path, access) if err != nil { - return nil, &os.PathError{Op: "open", Path: path, Err: err} + return nil, err } var flags uint32 @@ -194,43 +265,87 @@ type acceptResponse struct { } type win32PipeListener struct { - firstHandle syscall.Handle - path string - securityDescriptor []byte - config PipeConfig - acceptCh chan (chan acceptResponse) - closeCh chan int - doneCh chan int + firstHandle syscall.Handle + path string + config PipeConfig + acceptCh chan (chan acceptResponse) + closeCh chan int + doneCh chan int } -func makeServerPipeHandle(path string, securityDescriptor []byte, c *PipeConfig, first bool) (syscall.Handle, error) { - var flags uint32 = cPIPE_ACCESS_DUPLEX | syscall.FILE_FLAG_OVERLAPPED - if first { - flags |= cFILE_FLAG_FIRST_PIPE_INSTANCE - } - - var mode uint32 = cPIPE_REJECT_REMOTE_CLIENTS - if c.MessageMode { - mode |= cPIPE_TYPE_MESSAGE - } - - sa := &syscall.SecurityAttributes{} - sa.Length = uint32(unsafe.Sizeof(*sa)) - if securityDescriptor != nil { - len := uint32(len(securityDescriptor)) - sa.SecurityDescriptor = localAlloc(0, len) - defer localFree(sa.SecurityDescriptor) - copy((*[0xffff]byte)(unsafe.Pointer(sa.SecurityDescriptor))[:], securityDescriptor) - } - h, err := createNamedPipe(path, flags, mode, cPIPE_UNLIMITED_INSTANCES, uint32(c.OutputBufferSize), uint32(c.InputBufferSize), 0, sa) +func makeServerPipeHandle(path string, sd []byte, c *PipeConfig, first bool) (syscall.Handle, error) { + path16, err := syscall.UTF16FromString(path) if err != nil { return 0, &os.PathError{Op: "open", Path: path, Err: err} } + + var oa objectAttributes + oa.Length = unsafe.Sizeof(oa) + + var ntPath unicodeString + if err := rtlDosPathNameToNtPathName(&path16[0], &ntPath, 0, 0).Err(); err != nil { + return 0, &os.PathError{Op: "open", Path: path, Err: err} + } + defer localFree(ntPath.Buffer) + oa.ObjectName = &ntPath + + // The security descriptor is only needed for the first pipe. + if first { + if sd != nil { + len := uint32(len(sd)) + sdb := localAlloc(0, len) + defer localFree(sdb) + copy((*[0xffff]byte)(unsafe.Pointer(sdb))[:], sd) + oa.SecurityDescriptor = (*securityDescriptor)(unsafe.Pointer(sdb)) + } else { + // Construct the default named pipe security descriptor. + var dacl uintptr + if err := rtlDefaultNpAcl(&dacl).Err(); err != nil { + return 0, fmt.Errorf("getting default named pipe ACL: %s", err) + } + defer localFree(dacl) + + sdb := &securityDescriptor{ + Revision: 1, + Control: cSE_DACL_PRESENT, + Dacl: dacl, + } + oa.SecurityDescriptor = sdb + } + } + + typ := uint32(cFILE_PIPE_REJECT_REMOTE_CLIENTS) + if c.MessageMode { + typ |= cFILE_PIPE_MESSAGE_TYPE + } + + disposition := uint32(cFILE_OPEN) + access := uint32(syscall.GENERIC_READ | syscall.GENERIC_WRITE | syscall.SYNCHRONIZE) + if first { + disposition = cFILE_CREATE + // By not asking for read or write access, the named pipe file system + // will put this pipe into an initially disconnected state, blocking + // client connections until the next call with first == false. + access = syscall.SYNCHRONIZE + } + + timeout := int64(-50 * 10000) // 50ms + + var ( + h syscall.Handle + iosb ioStatusBlock + ) + err = ntCreateNamedPipeFile(&h, access, &oa, &iosb, syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE, disposition, 0, typ, 0, 0, 0xffffffff, uint32(c.InputBufferSize), uint32(c.OutputBufferSize), &timeout).Err() + if err != nil { + return 0, &os.PathError{Op: "open", Path: path, Err: err} + } + + runtime.KeepAlive(ntPath) return h, nil } func (l *win32PipeListener) makeServerPipe() (*win32File, error) { - h, err := makeServerPipeHandle(l.path, l.securityDescriptor, &l.config, false) + h, err := makeServerPipeHandle(l.path, nil, &l.config, false) if err != nil { return nil, err } @@ -314,10 +429,10 @@ type PipeConfig struct { // when the pipe is in message mode. MessageMode bool - // InputBufferSize specifies the size the input buffer, in bytes. + // InputBufferSize specifies the size of the input buffer, in bytes. InputBufferSize int32 - // OutputBufferSize specifies the size the input buffer, in bytes. + // OutputBufferSize specifies the size of the output buffer, in bytes. OutputBufferSize int32 } @@ -341,32 +456,13 @@ func ListenPipe(path string, c *PipeConfig) (net.Listener, error) { if err != nil { return nil, err } - // Create a client handle and connect it. This results in the pipe - // instance always existing, so that clients see ERROR_PIPE_BUSY - // rather than ERROR_FILE_NOT_FOUND. This ties the first instance - // up so that no other instances can be used. This would have been - // cleaner if the Win32 API matched CreateFile with ConnectNamedPipe - // instead of CreateNamedPipe. (Apparently created named pipes are - // considered to be in listening state regardless of whether any - // active calls to ConnectNamedPipe are outstanding.) - h2, err := createFile(path, 0, 0, nil, syscall.OPEN_EXISTING, cSECURITY_SQOS_PRESENT|cSECURITY_ANONYMOUS, 0) - if err != nil { - syscall.Close(h) - return nil, err - } - // Close the client handle. The server side of the instance will - // still be busy, leading to ERROR_PIPE_BUSY instead of - // ERROR_NOT_FOUND, as long as we don't close the server handle, - // or disconnect the client with DisconnectNamedPipe. - syscall.Close(h2) l := &win32PipeListener{ - firstHandle: h, - path: path, - securityDescriptor: sd, - config: *c, - acceptCh: make(chan (chan acceptResponse)), - closeCh: make(chan int), - doneCh: make(chan int), + firstHandle: h, + path: path, + config: *c, + acceptCh: make(chan (chan acceptResponse)), + closeCh: make(chan int), + doneCh: make(chan int), } go l.listenerRoutine() return l, nil diff --git a/vendor/github.com/Microsoft/go-winio/pkg/guid/guid.go b/vendor/github.com/Microsoft/go-winio/pkg/guid/guid.go new file mode 100644 index 00000000..f497c0e3 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/pkg/guid/guid.go @@ -0,0 +1,237 @@ +// +build windows + +// Package guid provides a GUID type. The backing structure for a GUID is +// identical to that used by the golang.org/x/sys/windows GUID type. +// There are two main binary encodings used for a GUID, the big-endian encoding, +// and the Windows (mixed-endian) encoding. See here for details: +// https://en.wikipedia.org/wiki/Universally_unique_identifier#Encoding +package guid + +import ( + "crypto/rand" + "crypto/sha1" + "encoding" + "encoding/binary" + "fmt" + "strconv" + + "golang.org/x/sys/windows" +) + +// Variant specifies which GUID variant (or "type") of the GUID. It determines +// how the entirety of the rest of the GUID is interpreted. +type Variant uint8 + +// The variants specified by RFC 4122. +const ( + // VariantUnknown specifies a GUID variant which does not conform to one of + // the variant encodings specified in RFC 4122. + VariantUnknown Variant = iota + VariantNCS + VariantRFC4122 + VariantMicrosoft + VariantFuture +) + +// Version specifies how the bits in the GUID were generated. For instance, a +// version 4 GUID is randomly generated, and a version 5 is generated from the +// hash of an input string. +type Version uint8 + +var _ = (encoding.TextMarshaler)(GUID{}) +var _ = (encoding.TextUnmarshaler)(&GUID{}) + +// GUID represents a GUID/UUID. It has the same structure as +// golang.org/x/sys/windows.GUID so that it can be used with functions expecting +// that type. It is defined as its own type so that stringification and +// marshaling can be supported. The representation matches that used by native +// Windows code. +type GUID windows.GUID + +// NewV4 returns a new version 4 (pseudorandom) GUID, as defined by RFC 4122. +func NewV4() (GUID, error) { + var b [16]byte + if _, err := rand.Read(b[:]); err != nil { + return GUID{}, err + } + + g := FromArray(b) + g.setVersion(4) // Version 4 means randomly generated. + g.setVariant(VariantRFC4122) + + return g, nil +} + +// NewV5 returns a new version 5 (generated from a string via SHA-1 hashing) +// GUID, as defined by RFC 4122. The RFC is unclear on the encoding of the name, +// and the sample code treats it as a series of bytes, so we do the same here. +// +// Some implementations, such as those found on Windows, treat the name as a +// big-endian UTF16 stream of bytes. If that is desired, the string can be +// encoded as such before being passed to this function. +func NewV5(namespace GUID, name []byte) (GUID, error) { + b := sha1.New() + namespaceBytes := namespace.ToArray() + b.Write(namespaceBytes[:]) + b.Write(name) + + a := [16]byte{} + copy(a[:], b.Sum(nil)) + + g := FromArray(a) + g.setVersion(5) // Version 5 means generated from a string. + g.setVariant(VariantRFC4122) + + return g, nil +} + +func fromArray(b [16]byte, order binary.ByteOrder) GUID { + var g GUID + g.Data1 = order.Uint32(b[0:4]) + g.Data2 = order.Uint16(b[4:6]) + g.Data3 = order.Uint16(b[6:8]) + copy(g.Data4[:], b[8:16]) + return g +} + +func (g GUID) toArray(order binary.ByteOrder) [16]byte { + b := [16]byte{} + order.PutUint32(b[0:4], g.Data1) + order.PutUint16(b[4:6], g.Data2) + order.PutUint16(b[6:8], g.Data3) + copy(b[8:16], g.Data4[:]) + return b +} + +// FromArray constructs a GUID from a big-endian encoding array of 16 bytes. +func FromArray(b [16]byte) GUID { + return fromArray(b, binary.BigEndian) +} + +// ToArray returns an array of 16 bytes representing the GUID in big-endian +// encoding. +func (g GUID) ToArray() [16]byte { + return g.toArray(binary.BigEndian) +} + +// FromWindowsArray constructs a GUID from a Windows encoding array of bytes. +func FromWindowsArray(b [16]byte) GUID { + return fromArray(b, binary.LittleEndian) +} + +// ToWindowsArray returns an array of 16 bytes representing the GUID in Windows +// encoding. +func (g GUID) ToWindowsArray() [16]byte { + return g.toArray(binary.LittleEndian) +} + +func (g GUID) String() string { + return fmt.Sprintf( + "%08x-%04x-%04x-%04x-%012x", + g.Data1, + g.Data2, + g.Data3, + g.Data4[:2], + g.Data4[2:]) +} + +// FromString parses a string containing a GUID and returns the GUID. The only +// format currently supported is the `xxxxxxxx-xxxx-xxxx-xxxx-xxxxxxxxxxxx` +// format. +func FromString(s string) (GUID, error) { + if len(s) != 36 { + return GUID{}, fmt.Errorf("invalid GUID %q", s) + } + if s[8] != '-' || s[13] != '-' || s[18] != '-' || s[23] != '-' { + return GUID{}, fmt.Errorf("invalid GUID %q", s) + } + + var g GUID + + data1, err := strconv.ParseUint(s[0:8], 16, 32) + if err != nil { + return GUID{}, fmt.Errorf("invalid GUID %q", s) + } + g.Data1 = uint32(data1) + + data2, err := strconv.ParseUint(s[9:13], 16, 16) + if err != nil { + return GUID{}, fmt.Errorf("invalid GUID %q", s) + } + g.Data2 = uint16(data2) + + data3, err := strconv.ParseUint(s[14:18], 16, 16) + if err != nil { + return GUID{}, fmt.Errorf("invalid GUID %q", s) + } + g.Data3 = uint16(data3) + + for i, x := range []int{19, 21, 24, 26, 28, 30, 32, 34} { + v, err := strconv.ParseUint(s[x:x+2], 16, 8) + if err != nil { + return GUID{}, fmt.Errorf("invalid GUID %q", s) + } + g.Data4[i] = uint8(v) + } + + return g, nil +} + +func (g *GUID) setVariant(v Variant) { + d := g.Data4[0] + switch v { + case VariantNCS: + d = (d & 0x7f) + case VariantRFC4122: + d = (d & 0x3f) | 0x80 + case VariantMicrosoft: + d = (d & 0x1f) | 0xc0 + case VariantFuture: + d = (d & 0x0f) | 0xe0 + case VariantUnknown: + fallthrough + default: + panic(fmt.Sprintf("invalid variant: %d", v)) + } + g.Data4[0] = d +} + +// Variant returns the GUID variant, as defined in RFC 4122. +func (g GUID) Variant() Variant { + b := g.Data4[0] + if b&0x80 == 0 { + return VariantNCS + } else if b&0xc0 == 0x80 { + return VariantRFC4122 + } else if b&0xe0 == 0xc0 { + return VariantMicrosoft + } else if b&0xe0 == 0xe0 { + return VariantFuture + } + return VariantUnknown +} + +func (g *GUID) setVersion(v Version) { + g.Data3 = (g.Data3 & 0x0fff) | (uint16(v) << 12) +} + +// Version returns the GUID version, as defined in RFC 4122. +func (g GUID) Version() Version { + return Version((g.Data3 & 0xF000) >> 12) +} + +// MarshalText returns the textual representation of the GUID. +func (g GUID) MarshalText() ([]byte, error) { + return []byte(g.String()), nil +} + +// UnmarshalText takes the textual representation of a GUID, and unmarhals it +// into this GUID. +func (g *GUID) UnmarshalText(text []byte) error { + g2, err := FromString(string(text)) + if err != nil { + return err + } + *g = g2 + return nil +} diff --git a/vendor/github.com/Microsoft/go-winio/pkg/security/grantvmgroupaccess.go b/vendor/github.com/Microsoft/go-winio/pkg/security/grantvmgroupaccess.go new file mode 100644 index 00000000..fca24159 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/pkg/security/grantvmgroupaccess.go @@ -0,0 +1,161 @@ +// +build windows + +package security + +import ( + "os" + "syscall" + "unsafe" + + "github.com/pkg/errors" +) + +type ( + accessMask uint32 + accessMode uint32 + desiredAccess uint32 + inheritMode uint32 + objectType uint32 + shareMode uint32 + securityInformation uint32 + trusteeForm uint32 + trusteeType uint32 + + explicitAccess struct { + accessPermissions accessMask + accessMode accessMode + inheritance inheritMode + trustee trustee + } + + trustee struct { + multipleTrustee *trustee + multipleTrusteeOperation int32 + trusteeForm trusteeForm + trusteeType trusteeType + name uintptr + } +) + +const ( + accessMaskDesiredPermission accessMask = 1 << 31 // GENERIC_READ + + accessModeGrant accessMode = 1 + + desiredAccessReadControl desiredAccess = 0x20000 + desiredAccessWriteDac desiredAccess = 0x40000 + + gvmga = "GrantVmGroupAccess:" + + inheritModeNoInheritance inheritMode = 0x0 + inheritModeSubContainersAndObjectsInherit inheritMode = 0x3 + + objectTypeFileObject objectType = 0x1 + + securityInformationDACL securityInformation = 0x4 + + shareModeRead shareMode = 0x1 + shareModeWrite shareMode = 0x2 + + sidVmGroup = "S-1-5-83-0" + + trusteeFormIsSid trusteeForm = 0 + + trusteeTypeWellKnownGroup trusteeType = 5 +) + +// GrantVMGroupAccess sets the DACL for a specified file or directory to +// include Grant ACE entries for the VM Group SID. This is a golang re- +// implementation of the same function in vmcompute, just not exported in +// RS5. Which kind of sucks. Sucks a lot :/ +func GrantVmGroupAccess(name string) error { + // Stat (to determine if `name` is a directory). + s, err := os.Stat(name) + if err != nil { + return errors.Wrapf(err, "%s os.Stat %s", gvmga, name) + } + + // Get a handle to the file/directory. Must defer Close on success. + fd, err := createFile(name, s.IsDir()) + if err != nil { + return err // Already wrapped + } + defer syscall.CloseHandle(fd) + + // Get the current DACL and Security Descriptor. Must defer LocalFree on success. + ot := objectTypeFileObject + si := securityInformationDACL + sd := uintptr(0) + origDACL := uintptr(0) + if err := getSecurityInfo(fd, uint32(ot), uint32(si), nil, nil, &origDACL, nil, &sd); err != nil { + return errors.Wrapf(err, "%s GetSecurityInfo %s", gvmga, name) + } + defer syscall.LocalFree((syscall.Handle)(unsafe.Pointer(sd))) + + // Generate a new DACL which is the current DACL with the required ACEs added. + // Must defer LocalFree on success. + newDACL, err := generateDACLWithAcesAdded(name, s.IsDir(), origDACL) + if err != nil { + return err // Already wrapped + } + defer syscall.LocalFree((syscall.Handle)(unsafe.Pointer(newDACL))) + + // And finally use SetSecurityInfo to apply the updated DACL. + if err := setSecurityInfo(fd, uint32(ot), uint32(si), uintptr(0), uintptr(0), newDACL, uintptr(0)); err != nil { + return errors.Wrapf(err, "%s SetSecurityInfo %s", gvmga, name) + } + + return nil +} + +// createFile is a helper function to call [Nt]CreateFile to get a handle to +// the file or directory. +func createFile(name string, isDir bool) (syscall.Handle, error) { + namep := syscall.StringToUTF16(name) + da := uint32(desiredAccessReadControl | desiredAccessWriteDac) + sm := uint32(shareModeRead | shareModeWrite) + fa := uint32(syscall.FILE_ATTRIBUTE_NORMAL) + if isDir { + fa = uint32(fa | syscall.FILE_FLAG_BACKUP_SEMANTICS) + } + fd, err := syscall.CreateFile(&namep[0], da, sm, nil, syscall.OPEN_EXISTING, fa, 0) + if err != nil { + return 0, errors.Wrapf(err, "%s syscall.CreateFile %s", gvmga, name) + } + return fd, nil +} + +// generateDACLWithAcesAdded generates a new DACL with the two needed ACEs added. +// The caller is responsible for LocalFree of the returned DACL on success. +func generateDACLWithAcesAdded(name string, isDir bool, origDACL uintptr) (uintptr, error) { + // Generate pointers to the SIDs based on the string SIDs + sid, err := syscall.StringToSid(sidVmGroup) + if err != nil { + return 0, errors.Wrapf(err, "%s syscall.StringToSid %s %s", gvmga, name, sidVmGroup) + } + + inheritance := inheritModeNoInheritance + if isDir { + inheritance = inheritModeSubContainersAndObjectsInherit + } + + eaArray := []explicitAccess{ + explicitAccess{ + accessPermissions: accessMaskDesiredPermission, + accessMode: accessModeGrant, + inheritance: inheritance, + trustee: trustee{ + trusteeForm: trusteeFormIsSid, + trusteeType: trusteeTypeWellKnownGroup, + name: uintptr(unsafe.Pointer(sid)), + }, + }, + } + + modifiedDACL := uintptr(0) + if err := setEntriesInAcl(uintptr(uint32(1)), uintptr(unsafe.Pointer(&eaArray[0])), origDACL, &modifiedDACL); err != nil { + return 0, errors.Wrapf(err, "%s SetEntriesInAcl %s", gvmga, name) + } + + return modifiedDACL, nil +} diff --git a/vendor/github.com/Microsoft/go-winio/pkg/security/syscall_windows.go b/vendor/github.com/Microsoft/go-winio/pkg/security/syscall_windows.go new file mode 100644 index 00000000..c40c2739 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/pkg/security/syscall_windows.go @@ -0,0 +1,7 @@ +package security + +//go:generate go run mksyscall_windows.go -output zsyscall_windows.go syscall_windows.go + +//sys getSecurityInfo(handle syscall.Handle, objectType uint32, si uint32, ppsidOwner **uintptr, ppsidGroup **uintptr, ppDacl *uintptr, ppSacl *uintptr, ppSecurityDescriptor *uintptr) (err error) [failretval!=0] = advapi32.GetSecurityInfo +//sys setSecurityInfo(handle syscall.Handle, objectType uint32, si uint32, psidOwner uintptr, psidGroup uintptr, pDacl uintptr, pSacl uintptr) (err error) [failretval!=0] = advapi32.SetSecurityInfo +//sys setEntriesInAcl(count uintptr, pListOfEEs uintptr, oldAcl uintptr, newAcl *uintptr) (err error) [failretval!=0] = advapi32.SetEntriesInAclW diff --git a/vendor/github.com/Microsoft/go-winio/pkg/security/zsyscall_windows.go b/vendor/github.com/Microsoft/go-winio/pkg/security/zsyscall_windows.go new file mode 100644 index 00000000..4a90cb3c --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/pkg/security/zsyscall_windows.go @@ -0,0 +1,70 @@ +// Code generated by 'go generate'; DO NOT EDIT. + +package security + +import ( + "syscall" + "unsafe" + + "golang.org/x/sys/windows" +) + +var _ unsafe.Pointer + +// Do the interface allocations only once for common +// Errno values. +const ( + errnoERROR_IO_PENDING = 997 +) + +var ( + errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) + errERROR_EINVAL error = syscall.EINVAL +) + +// errnoErr returns common boxed Errno values, to prevent +// allocations at runtime. +func errnoErr(e syscall.Errno) error { + switch e { + case 0: + return errERROR_EINVAL + case errnoERROR_IO_PENDING: + return errERROR_IO_PENDING + } + // TODO: add more here, after collecting data on the common + // error values see on Windows. (perhaps when running + // all.bat?) + return e +} + +var ( + modadvapi32 = windows.NewLazySystemDLL("advapi32.dll") + + procGetSecurityInfo = modadvapi32.NewProc("GetSecurityInfo") + procSetEntriesInAclW = modadvapi32.NewProc("SetEntriesInAclW") + procSetSecurityInfo = modadvapi32.NewProc("SetSecurityInfo") +) + +func getSecurityInfo(handle syscall.Handle, objectType uint32, si uint32, ppsidOwner **uintptr, ppsidGroup **uintptr, ppDacl *uintptr, ppSacl *uintptr, ppSecurityDescriptor *uintptr) (err error) { + r1, _, e1 := syscall.Syscall9(procGetSecurityInfo.Addr(), 8, uintptr(handle), uintptr(objectType), uintptr(si), uintptr(unsafe.Pointer(ppsidOwner)), uintptr(unsafe.Pointer(ppsidGroup)), uintptr(unsafe.Pointer(ppDacl)), uintptr(unsafe.Pointer(ppSacl)), uintptr(unsafe.Pointer(ppSecurityDescriptor)), 0) + if r1 != 0 { + err = errnoErr(e1) + } + return +} + +func setEntriesInAcl(count uintptr, pListOfEEs uintptr, oldAcl uintptr, newAcl *uintptr) (err error) { + r1, _, e1 := syscall.Syscall6(procSetEntriesInAclW.Addr(), 4, uintptr(count), uintptr(pListOfEEs), uintptr(oldAcl), uintptr(unsafe.Pointer(newAcl)), 0, 0) + if r1 != 0 { + err = errnoErr(e1) + } + return +} + +func setSecurityInfo(handle syscall.Handle, objectType uint32, si uint32, psidOwner uintptr, psidGroup uintptr, pDacl uintptr, pSacl uintptr) (err error) { + r1, _, e1 := syscall.Syscall9(procSetSecurityInfo.Addr(), 7, uintptr(handle), uintptr(objectType), uintptr(si), uintptr(psidOwner), uintptr(psidGroup), uintptr(pDacl), uintptr(pSacl), 0, 0) + if r1 != 0 { + err = errnoErr(e1) + } + return +} diff --git a/vendor/github.com/Microsoft/go-winio/syscall.go b/vendor/github.com/Microsoft/go-winio/syscall.go index 20d64cf4..5955c99f 100644 --- a/vendor/github.com/Microsoft/go-winio/syscall.go +++ b/vendor/github.com/Microsoft/go-winio/syscall.go @@ -1,3 +1,3 @@ package winio -//go:generate go run $GOROOT/src/syscall/mksyscall_windows.go -output zsyscall_windows.go file.go pipe.go sd.go fileinfo.go privilege.go backup.go +//go:generate go run golang.org/x/sys/windows/mkwinsyscall -output zsyscall_windows.go file.go pipe.go sd.go fileinfo.go privilege.go backup.go hvsock.go diff --git a/vendor/github.com/Microsoft/go-winio/vhd/vhd.go b/vendor/github.com/Microsoft/go-winio/vhd/vhd.go new file mode 100644 index 00000000..b03b789e --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/vhd/vhd.go @@ -0,0 +1,323 @@ +// +build windows + +package vhd + +import ( + "fmt" + "syscall" + + "github.com/Microsoft/go-winio/pkg/guid" + "github.com/pkg/errors" + "golang.org/x/sys/windows" +) + +//go:generate go run mksyscall_windows.go -output zvhd_windows.go vhd.go + +//sys createVirtualDisk(virtualStorageType *VirtualStorageType, path string, virtualDiskAccessMask uint32, securityDescriptor *uintptr, createVirtualDiskFlags uint32, providerSpecificFlags uint32, parameters *CreateVirtualDiskParameters, overlapped *syscall.Overlapped, handle *syscall.Handle) (err error) [failretval != 0] = virtdisk.CreateVirtualDisk +//sys openVirtualDisk(virtualStorageType *VirtualStorageType, path string, virtualDiskAccessMask uint32, openVirtualDiskFlags uint32, parameters *OpenVirtualDiskParameters, handle *syscall.Handle) (err error) [failretval != 0] = virtdisk.OpenVirtualDisk +//sys attachVirtualDisk(handle syscall.Handle, securityDescriptor *uintptr, attachVirtualDiskFlag uint32, providerSpecificFlags uint32, parameters *AttachVirtualDiskParameters, overlapped *syscall.Overlapped) (err error) [failretval != 0] = virtdisk.AttachVirtualDisk +//sys detachVirtualDisk(handle syscall.Handle, detachVirtualDiskFlags uint32, providerSpecificFlags uint32) (err error) [failretval != 0] = virtdisk.DetachVirtualDisk +//sys getVirtualDiskPhysicalPath(handle syscall.Handle, diskPathSizeInBytes *uint32, buffer *uint16) (err error) [failretval != 0] = virtdisk.GetVirtualDiskPhysicalPath + +type ( + CreateVirtualDiskFlag uint32 + VirtualDiskFlag uint32 + AttachVirtualDiskFlag uint32 + DetachVirtualDiskFlag uint32 + VirtualDiskAccessMask uint32 +) + +type VirtualStorageType struct { + DeviceID uint32 + VendorID guid.GUID +} + +type CreateVersion2 struct { + UniqueID guid.GUID + MaximumSize uint64 + BlockSizeInBytes uint32 + SectorSizeInBytes uint32 + PhysicalSectorSizeInByte uint32 + ParentPath *uint16 // string + SourcePath *uint16 // string + OpenFlags uint32 + ParentVirtualStorageType VirtualStorageType + SourceVirtualStorageType VirtualStorageType + ResiliencyGUID guid.GUID +} + +type CreateVirtualDiskParameters struct { + Version uint32 // Must always be set to 2 + Version2 CreateVersion2 +} + +type OpenVersion2 struct { + GetInfoOnly bool + ReadOnly bool + ResiliencyGUID guid.GUID +} + +type OpenVirtualDiskParameters struct { + Version uint32 // Must always be set to 2 + Version2 OpenVersion2 +} + +type AttachVersion2 struct { + RestrictedOffset uint64 + RestrictedLength uint64 +} + +type AttachVirtualDiskParameters struct { + Version uint32 // Must always be set to 2 + Version2 AttachVersion2 +} + +const ( + VIRTUAL_STORAGE_TYPE_DEVICE_VHDX = 0x3 + + // Access Mask for opening a VHD + VirtualDiskAccessNone VirtualDiskAccessMask = 0x00000000 + VirtualDiskAccessAttachRO VirtualDiskAccessMask = 0x00010000 + VirtualDiskAccessAttachRW VirtualDiskAccessMask = 0x00020000 + VirtualDiskAccessDetach VirtualDiskAccessMask = 0x00040000 + VirtualDiskAccessGetInfo VirtualDiskAccessMask = 0x00080000 + VirtualDiskAccessCreate VirtualDiskAccessMask = 0x00100000 + VirtualDiskAccessMetaOps VirtualDiskAccessMask = 0x00200000 + VirtualDiskAccessRead VirtualDiskAccessMask = 0x000d0000 + VirtualDiskAccessAll VirtualDiskAccessMask = 0x003f0000 + VirtualDiskAccessWritable VirtualDiskAccessMask = 0x00320000 + + // Flags for creating a VHD + CreateVirtualDiskFlagNone CreateVirtualDiskFlag = 0x0 + CreateVirtualDiskFlagFullPhysicalAllocation CreateVirtualDiskFlag = 0x1 + CreateVirtualDiskFlagPreventWritesToSourceDisk CreateVirtualDiskFlag = 0x2 + CreateVirtualDiskFlagDoNotCopyMetadataFromParent CreateVirtualDiskFlag = 0x4 + CreateVirtualDiskFlagCreateBackingStorage CreateVirtualDiskFlag = 0x8 + CreateVirtualDiskFlagUseChangeTrackingSourceLimit CreateVirtualDiskFlag = 0x10 + CreateVirtualDiskFlagPreserveParentChangeTrackingState CreateVirtualDiskFlag = 0x20 + CreateVirtualDiskFlagVhdSetUseOriginalBackingStorage CreateVirtualDiskFlag = 0x40 + CreateVirtualDiskFlagSparseFile CreateVirtualDiskFlag = 0x80 + CreateVirtualDiskFlagPmemCompatible CreateVirtualDiskFlag = 0x100 + CreateVirtualDiskFlagSupportCompressedVolumes CreateVirtualDiskFlag = 0x200 + + // Flags for opening a VHD + OpenVirtualDiskFlagNone VirtualDiskFlag = 0x00000000 + OpenVirtualDiskFlagNoParents VirtualDiskFlag = 0x00000001 + OpenVirtualDiskFlagBlankFile VirtualDiskFlag = 0x00000002 + OpenVirtualDiskFlagBootDrive VirtualDiskFlag = 0x00000004 + OpenVirtualDiskFlagCachedIO VirtualDiskFlag = 0x00000008 + OpenVirtualDiskFlagCustomDiffChain VirtualDiskFlag = 0x00000010 + OpenVirtualDiskFlagParentCachedIO VirtualDiskFlag = 0x00000020 + OpenVirtualDiskFlagVhdsetFileOnly VirtualDiskFlag = 0x00000040 + OpenVirtualDiskFlagIgnoreRelativeParentLocator VirtualDiskFlag = 0x00000080 + OpenVirtualDiskFlagNoWriteHardening VirtualDiskFlag = 0x00000100 + OpenVirtualDiskFlagSupportCompressedVolumes VirtualDiskFlag = 0x00000200 + + // Flags for attaching a VHD + AttachVirtualDiskFlagNone AttachVirtualDiskFlag = 0x00000000 + AttachVirtualDiskFlagReadOnly AttachVirtualDiskFlag = 0x00000001 + AttachVirtualDiskFlagNoDriveLetter AttachVirtualDiskFlag = 0x00000002 + AttachVirtualDiskFlagPermanentLifetime AttachVirtualDiskFlag = 0x00000004 + AttachVirtualDiskFlagNoLocalHost AttachVirtualDiskFlag = 0x00000008 + AttachVirtualDiskFlagNoSecurityDescriptor AttachVirtualDiskFlag = 0x00000010 + AttachVirtualDiskFlagBypassDefaultEncryptionPolicy AttachVirtualDiskFlag = 0x00000020 + AttachVirtualDiskFlagNonPnp AttachVirtualDiskFlag = 0x00000040 + AttachVirtualDiskFlagRestrictedRange AttachVirtualDiskFlag = 0x00000080 + AttachVirtualDiskFlagSinglePartition AttachVirtualDiskFlag = 0x00000100 + AttachVirtualDiskFlagRegisterVolume AttachVirtualDiskFlag = 0x00000200 + + // Flags for detaching a VHD + DetachVirtualDiskFlagNone DetachVirtualDiskFlag = 0x0 +) + +// CreateVhdx is a helper function to create a simple vhdx file at the given path using +// default values. +func CreateVhdx(path string, maxSizeInGb, blockSizeInMb uint32) error { + params := CreateVirtualDiskParameters{ + Version: 2, + Version2: CreateVersion2{ + MaximumSize: uint64(maxSizeInGb) * 1024 * 1024 * 1024, + BlockSizeInBytes: blockSizeInMb * 1024 * 1024, + }, + } + + handle, err := CreateVirtualDisk(path, VirtualDiskAccessNone, CreateVirtualDiskFlagNone, ¶ms) + if err != nil { + return err + } + + if err := syscall.CloseHandle(handle); err != nil { + return err + } + return nil +} + +// DetachVirtualDisk detaches a virtual hard disk by handle. +func DetachVirtualDisk(handle syscall.Handle) (err error) { + if err := detachVirtualDisk(handle, 0, 0); err != nil { + return errors.Wrap(err, "failed to detach virtual disk") + } + return nil +} + +// DetachVhd detaches a vhd found at `path`. +func DetachVhd(path string) error { + handle, err := OpenVirtualDisk( + path, + VirtualDiskAccessNone, + OpenVirtualDiskFlagCachedIO|OpenVirtualDiskFlagIgnoreRelativeParentLocator, + ) + if err != nil { + return err + } + defer syscall.CloseHandle(handle) + return DetachVirtualDisk(handle) +} + +// AttachVirtualDisk attaches a virtual hard disk for use. +func AttachVirtualDisk(handle syscall.Handle, attachVirtualDiskFlag AttachVirtualDiskFlag, parameters *AttachVirtualDiskParameters) (err error) { + // Supports both version 1 and 2 of the attach parameters as version 2 wasn't present in RS5. + if err := attachVirtualDisk( + handle, + nil, + uint32(attachVirtualDiskFlag), + 0, + parameters, + nil, + ); err != nil { + return errors.Wrap(err, "failed to attach virtual disk") + } + return nil +} + +// AttachVhd attaches a virtual hard disk at `path` for use. Attaches using version 2 +// of the ATTACH_VIRTUAL_DISK_PARAMETERS. +func AttachVhd(path string) (err error) { + handle, err := OpenVirtualDisk( + path, + VirtualDiskAccessNone, + OpenVirtualDiskFlagCachedIO|OpenVirtualDiskFlagIgnoreRelativeParentLocator, + ) + if err != nil { + return err + } + + defer syscall.CloseHandle(handle) + params := AttachVirtualDiskParameters{Version: 2} + if err := AttachVirtualDisk( + handle, + AttachVirtualDiskFlagNone, + ¶ms, + ); err != nil { + return errors.Wrap(err, "failed to attach virtual disk") + } + return nil +} + +// OpenVirtualDisk obtains a handle to a VHD opened with supplied access mask and flags. +func OpenVirtualDisk(vhdPath string, virtualDiskAccessMask VirtualDiskAccessMask, openVirtualDiskFlags VirtualDiskFlag) (syscall.Handle, error) { + parameters := OpenVirtualDiskParameters{Version: 2} + handle, err := OpenVirtualDiskWithParameters( + vhdPath, + virtualDiskAccessMask, + openVirtualDiskFlags, + ¶meters, + ) + if err != nil { + return 0, err + } + return handle, nil +} + +// OpenVirtualDiskWithParameters obtains a handle to a VHD opened with supplied access mask, flags and parameters. +func OpenVirtualDiskWithParameters(vhdPath string, virtualDiskAccessMask VirtualDiskAccessMask, openVirtualDiskFlags VirtualDiskFlag, parameters *OpenVirtualDiskParameters) (syscall.Handle, error) { + var ( + handle syscall.Handle + defaultType VirtualStorageType + ) + if parameters.Version != 2 { + return handle, fmt.Errorf("only version 2 VHDs are supported, found version: %d", parameters.Version) + } + if err := openVirtualDisk( + &defaultType, + vhdPath, + uint32(virtualDiskAccessMask), + uint32(openVirtualDiskFlags), + parameters, + &handle, + ); err != nil { + return 0, errors.Wrap(err, "failed to open virtual disk") + } + return handle, nil +} + +// CreateVirtualDisk creates a virtual harddisk and returns a handle to the disk. +func CreateVirtualDisk(path string, virtualDiskAccessMask VirtualDiskAccessMask, createVirtualDiskFlags CreateVirtualDiskFlag, parameters *CreateVirtualDiskParameters) (syscall.Handle, error) { + var ( + handle syscall.Handle + defaultType VirtualStorageType + ) + if parameters.Version != 2 { + return handle, fmt.Errorf("only version 2 VHDs are supported, found version: %d", parameters.Version) + } + + if err := createVirtualDisk( + &defaultType, + path, + uint32(virtualDiskAccessMask), + nil, + uint32(createVirtualDiskFlags), + 0, + parameters, + nil, + &handle, + ); err != nil { + return handle, errors.Wrap(err, "failed to create virtual disk") + } + return handle, nil +} + +// GetVirtualDiskPhysicalPath takes a handle to a virtual hard disk and returns the physical +// path of the disk on the machine. This path is in the form \\.\PhysicalDriveX where X is an integer +// that represents the particular enumeration of the physical disk on the caller's system. +func GetVirtualDiskPhysicalPath(handle syscall.Handle) (_ string, err error) { + var ( + diskPathSizeInBytes uint32 = 256 * 2 // max path length 256 wide chars + diskPhysicalPathBuf [256]uint16 + ) + if err := getVirtualDiskPhysicalPath( + handle, + &diskPathSizeInBytes, + &diskPhysicalPathBuf[0], + ); err != nil { + return "", errors.Wrap(err, "failed to get disk physical path") + } + return windows.UTF16ToString(diskPhysicalPathBuf[:]), nil +} + +// CreateDiffVhd is a helper function to create a differencing virtual disk. +func CreateDiffVhd(diffVhdPath, baseVhdPath string, blockSizeInMB uint32) error { + // Setting `ParentPath` is how to signal to create a differencing disk. + createParams := &CreateVirtualDiskParameters{ + Version: 2, + Version2: CreateVersion2{ + ParentPath: windows.StringToUTF16Ptr(baseVhdPath), + BlockSizeInBytes: blockSizeInMB * 1024 * 1024, + OpenFlags: uint32(OpenVirtualDiskFlagCachedIO), + }, + } + + vhdHandle, err := CreateVirtualDisk( + diffVhdPath, + VirtualDiskAccessNone, + CreateVirtualDiskFlagNone, + createParams, + ) + if err != nil { + return fmt.Errorf("failed to create differencing vhd: %s", err) + } + if err := syscall.CloseHandle(vhdHandle); err != nil { + return fmt.Errorf("failed to close differencing vhd handle: %s", err) + } + return nil +} diff --git a/vendor/github.com/Microsoft/go-winio/vhd/zvhd_windows.go b/vendor/github.com/Microsoft/go-winio/vhd/zvhd_windows.go new file mode 100644 index 00000000..572f7b42 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/vhd/zvhd_windows.go @@ -0,0 +1,106 @@ +// Code generated by 'go generate'; DO NOT EDIT. + +package vhd + +import ( + "syscall" + "unsafe" + + "golang.org/x/sys/windows" +) + +var _ unsafe.Pointer + +// Do the interface allocations only once for common +// Errno values. +const ( + errnoERROR_IO_PENDING = 997 +) + +var ( + errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) + errERROR_EINVAL error = syscall.EINVAL +) + +// errnoErr returns common boxed Errno values, to prevent +// allocations at runtime. +func errnoErr(e syscall.Errno) error { + switch e { + case 0: + return errERROR_EINVAL + case errnoERROR_IO_PENDING: + return errERROR_IO_PENDING + } + // TODO: add more here, after collecting data on the common + // error values see on Windows. (perhaps when running + // all.bat?) + return e +} + +var ( + modvirtdisk = windows.NewLazySystemDLL("virtdisk.dll") + + procAttachVirtualDisk = modvirtdisk.NewProc("AttachVirtualDisk") + procCreateVirtualDisk = modvirtdisk.NewProc("CreateVirtualDisk") + procDetachVirtualDisk = modvirtdisk.NewProc("DetachVirtualDisk") + procGetVirtualDiskPhysicalPath = modvirtdisk.NewProc("GetVirtualDiskPhysicalPath") + procOpenVirtualDisk = modvirtdisk.NewProc("OpenVirtualDisk") +) + +func attachVirtualDisk(handle syscall.Handle, securityDescriptor *uintptr, attachVirtualDiskFlag uint32, providerSpecificFlags uint32, parameters *AttachVirtualDiskParameters, overlapped *syscall.Overlapped) (err error) { + r1, _, e1 := syscall.Syscall6(procAttachVirtualDisk.Addr(), 6, uintptr(handle), uintptr(unsafe.Pointer(securityDescriptor)), uintptr(attachVirtualDiskFlag), uintptr(providerSpecificFlags), uintptr(unsafe.Pointer(parameters)), uintptr(unsafe.Pointer(overlapped))) + if r1 != 0 { + err = errnoErr(e1) + } + return +} + +func createVirtualDisk(virtualStorageType *VirtualStorageType, path string, virtualDiskAccessMask uint32, securityDescriptor *uintptr, createVirtualDiskFlags uint32, providerSpecificFlags uint32, parameters *CreateVirtualDiskParameters, overlapped *syscall.Overlapped, handle *syscall.Handle) (err error) { + var _p0 *uint16 + _p0, err = syscall.UTF16PtrFromString(path) + if err != nil { + return + } + return _createVirtualDisk(virtualStorageType, _p0, virtualDiskAccessMask, securityDescriptor, createVirtualDiskFlags, providerSpecificFlags, parameters, overlapped, handle) +} + +func _createVirtualDisk(virtualStorageType *VirtualStorageType, path *uint16, virtualDiskAccessMask uint32, securityDescriptor *uintptr, createVirtualDiskFlags uint32, providerSpecificFlags uint32, parameters *CreateVirtualDiskParameters, overlapped *syscall.Overlapped, handle *syscall.Handle) (err error) { + r1, _, e1 := syscall.Syscall9(procCreateVirtualDisk.Addr(), 9, uintptr(unsafe.Pointer(virtualStorageType)), uintptr(unsafe.Pointer(path)), uintptr(virtualDiskAccessMask), uintptr(unsafe.Pointer(securityDescriptor)), uintptr(createVirtualDiskFlags), uintptr(providerSpecificFlags), uintptr(unsafe.Pointer(parameters)), uintptr(unsafe.Pointer(overlapped)), uintptr(unsafe.Pointer(handle))) + if r1 != 0 { + err = errnoErr(e1) + } + return +} + +func detachVirtualDisk(handle syscall.Handle, detachVirtualDiskFlags uint32, providerSpecificFlags uint32) (err error) { + r1, _, e1 := syscall.Syscall(procDetachVirtualDisk.Addr(), 3, uintptr(handle), uintptr(detachVirtualDiskFlags), uintptr(providerSpecificFlags)) + if r1 != 0 { + err = errnoErr(e1) + } + return +} + +func getVirtualDiskPhysicalPath(handle syscall.Handle, diskPathSizeInBytes *uint32, buffer *uint16) (err error) { + r1, _, e1 := syscall.Syscall(procGetVirtualDiskPhysicalPath.Addr(), 3, uintptr(handle), uintptr(unsafe.Pointer(diskPathSizeInBytes)), uintptr(unsafe.Pointer(buffer))) + if r1 != 0 { + err = errnoErr(e1) + } + return +} + +func openVirtualDisk(virtualStorageType *VirtualStorageType, path string, virtualDiskAccessMask uint32, openVirtualDiskFlags uint32, parameters *OpenVirtualDiskParameters, handle *syscall.Handle) (err error) { + var _p0 *uint16 + _p0, err = syscall.UTF16PtrFromString(path) + if err != nil { + return + } + return _openVirtualDisk(virtualStorageType, _p0, virtualDiskAccessMask, openVirtualDiskFlags, parameters, handle) +} + +func _openVirtualDisk(virtualStorageType *VirtualStorageType, path *uint16, virtualDiskAccessMask uint32, openVirtualDiskFlags uint32, parameters *OpenVirtualDiskParameters, handle *syscall.Handle) (err error) { + r1, _, e1 := syscall.Syscall6(procOpenVirtualDisk.Addr(), 6, uintptr(unsafe.Pointer(virtualStorageType)), uintptr(unsafe.Pointer(path)), uintptr(virtualDiskAccessMask), uintptr(openVirtualDiskFlags), uintptr(unsafe.Pointer(parameters)), uintptr(unsafe.Pointer(handle))) + if r1 != 0 { + err = errnoErr(e1) + } + return +} diff --git a/vendor/github.com/Microsoft/go-winio/zsyscall_windows.go b/vendor/github.com/Microsoft/go-winio/zsyscall_windows.go index 3f527639..176ff75e 100644 --- a/vendor/github.com/Microsoft/go-winio/zsyscall_windows.go +++ b/vendor/github.com/Microsoft/go-winio/zsyscall_windows.go @@ -1,4 +1,4 @@ -// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT +// Code generated by 'go generate'; DO NOT EDIT. package winio @@ -19,6 +19,7 @@ const ( var ( errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) + errERROR_EINVAL error = syscall.EINVAL ) // errnoErr returns common boxed Errno values, to prevent @@ -26,7 +27,7 @@ var ( func errnoErr(e syscall.Errno) error { switch e { case 0: - return nil + return errERROR_EINVAL case errnoERROR_IO_PENDING: return errERROR_IO_PENDING } @@ -37,213 +38,62 @@ func errnoErr(e syscall.Errno) error { } var ( - modkernel32 = windows.NewLazySystemDLL("kernel32.dll") modadvapi32 = windows.NewLazySystemDLL("advapi32.dll") + modkernel32 = windows.NewLazySystemDLL("kernel32.dll") + modntdll = windows.NewLazySystemDLL("ntdll.dll") + modws2_32 = windows.NewLazySystemDLL("ws2_32.dll") - procCancelIoEx = modkernel32.NewProc("CancelIoEx") - procCreateIoCompletionPort = modkernel32.NewProc("CreateIoCompletionPort") - procGetQueuedCompletionStatus = modkernel32.NewProc("GetQueuedCompletionStatus") - procSetFileCompletionNotificationModes = modkernel32.NewProc("SetFileCompletionNotificationModes") - procConnectNamedPipe = modkernel32.NewProc("ConnectNamedPipe") - procCreateNamedPipeW = modkernel32.NewProc("CreateNamedPipeW") - procCreateFileW = modkernel32.NewProc("CreateFileW") - procWaitNamedPipeW = modkernel32.NewProc("WaitNamedPipeW") - procGetNamedPipeInfo = modkernel32.NewProc("GetNamedPipeInfo") - procGetNamedPipeHandleStateW = modkernel32.NewProc("GetNamedPipeHandleStateW") - procLocalAlloc = modkernel32.NewProc("LocalAlloc") - procLookupAccountNameW = modadvapi32.NewProc("LookupAccountNameW") + procAdjustTokenPrivileges = modadvapi32.NewProc("AdjustTokenPrivileges") + procConvertSecurityDescriptorToStringSecurityDescriptorW = modadvapi32.NewProc("ConvertSecurityDescriptorToStringSecurityDescriptorW") procConvertSidToStringSidW = modadvapi32.NewProc("ConvertSidToStringSidW") procConvertStringSecurityDescriptorToSecurityDescriptorW = modadvapi32.NewProc("ConvertStringSecurityDescriptorToSecurityDescriptorW") - procConvertSecurityDescriptorToStringSecurityDescriptorW = modadvapi32.NewProc("ConvertSecurityDescriptorToStringSecurityDescriptorW") - procLocalFree = modkernel32.NewProc("LocalFree") procGetSecurityDescriptorLength = modadvapi32.NewProc("GetSecurityDescriptorLength") - procGetFileInformationByHandleEx = modkernel32.NewProc("GetFileInformationByHandleEx") - procSetFileInformationByHandle = modkernel32.NewProc("SetFileInformationByHandle") - procAdjustTokenPrivileges = modadvapi32.NewProc("AdjustTokenPrivileges") procImpersonateSelf = modadvapi32.NewProc("ImpersonateSelf") - procRevertToSelf = modadvapi32.NewProc("RevertToSelf") - procOpenThreadToken = modadvapi32.NewProc("OpenThreadToken") - procGetCurrentThread = modkernel32.NewProc("GetCurrentThread") - procLookupPrivilegeValueW = modadvapi32.NewProc("LookupPrivilegeValueW") - procLookupPrivilegeNameW = modadvapi32.NewProc("LookupPrivilegeNameW") + procLookupAccountNameW = modadvapi32.NewProc("LookupAccountNameW") procLookupPrivilegeDisplayNameW = modadvapi32.NewProc("LookupPrivilegeDisplayNameW") + procLookupPrivilegeNameW = modadvapi32.NewProc("LookupPrivilegeNameW") + procLookupPrivilegeValueW = modadvapi32.NewProc("LookupPrivilegeValueW") + procOpenThreadToken = modadvapi32.NewProc("OpenThreadToken") + procRevertToSelf = modadvapi32.NewProc("RevertToSelf") procBackupRead = modkernel32.NewProc("BackupRead") procBackupWrite = modkernel32.NewProc("BackupWrite") + procCancelIoEx = modkernel32.NewProc("CancelIoEx") + procConnectNamedPipe = modkernel32.NewProc("ConnectNamedPipe") + procCreateFileW = modkernel32.NewProc("CreateFileW") + procCreateIoCompletionPort = modkernel32.NewProc("CreateIoCompletionPort") + procCreateNamedPipeW = modkernel32.NewProc("CreateNamedPipeW") + procGetCurrentThread = modkernel32.NewProc("GetCurrentThread") + procGetNamedPipeHandleStateW = modkernel32.NewProc("GetNamedPipeHandleStateW") + procGetNamedPipeInfo = modkernel32.NewProc("GetNamedPipeInfo") + procGetQueuedCompletionStatus = modkernel32.NewProc("GetQueuedCompletionStatus") + procLocalAlloc = modkernel32.NewProc("LocalAlloc") + procLocalFree = modkernel32.NewProc("LocalFree") + procSetFileCompletionNotificationModes = modkernel32.NewProc("SetFileCompletionNotificationModes") + procNtCreateNamedPipeFile = modntdll.NewProc("NtCreateNamedPipeFile") + procRtlDefaultNpAcl = modntdll.NewProc("RtlDefaultNpAcl") + procRtlDosPathNameToNtPathName_U = modntdll.NewProc("RtlDosPathNameToNtPathName_U") + procRtlNtStatusToDosErrorNoTeb = modntdll.NewProc("RtlNtStatusToDosErrorNoTeb") + procWSAGetOverlappedResult = modws2_32.NewProc("WSAGetOverlappedResult") + procbind = modws2_32.NewProc("bind") ) -func cancelIoEx(file syscall.Handle, o *syscall.Overlapped) (err error) { - r1, _, e1 := syscall.Syscall(procCancelIoEx.Addr(), 2, uintptr(file), uintptr(unsafe.Pointer(o)), 0) +func adjustTokenPrivileges(token windows.Token, releaseAll bool, input *byte, outputSize uint32, output *byte, requiredSize *uint32) (success bool, err error) { + var _p0 uint32 + if releaseAll { + _p0 = 1 + } + r0, _, e1 := syscall.Syscall6(procAdjustTokenPrivileges.Addr(), 6, uintptr(token), uintptr(_p0), uintptr(unsafe.Pointer(input)), uintptr(outputSize), uintptr(unsafe.Pointer(output)), uintptr(unsafe.Pointer(requiredSize))) + success = r0 != 0 + if true { + err = errnoErr(e1) + } + return +} + +func convertSecurityDescriptorToStringSecurityDescriptor(sd *byte, revision uint32, secInfo uint32, sddl **uint16, sddlSize *uint32) (err error) { + r1, _, e1 := syscall.Syscall6(procConvertSecurityDescriptorToStringSecurityDescriptorW.Addr(), 5, uintptr(unsafe.Pointer(sd)), uintptr(revision), uintptr(secInfo), uintptr(unsafe.Pointer(sddl)), uintptr(unsafe.Pointer(sddlSize)), 0) if r1 == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } - } - return -} - -func createIoCompletionPort(file syscall.Handle, port syscall.Handle, key uintptr, threadCount uint32) (newport syscall.Handle, err error) { - r0, _, e1 := syscall.Syscall6(procCreateIoCompletionPort.Addr(), 4, uintptr(file), uintptr(port), uintptr(key), uintptr(threadCount), 0, 0) - newport = syscall.Handle(r0) - if newport == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } - } - return -} - -func getQueuedCompletionStatus(port syscall.Handle, bytes *uint32, key *uintptr, o **ioOperation, timeout uint32) (err error) { - r1, _, e1 := syscall.Syscall6(procGetQueuedCompletionStatus.Addr(), 5, uintptr(port), uintptr(unsafe.Pointer(bytes)), uintptr(unsafe.Pointer(key)), uintptr(unsafe.Pointer(o)), uintptr(timeout), 0) - if r1 == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } - } - return -} - -func setFileCompletionNotificationModes(h syscall.Handle, flags uint8) (err error) { - r1, _, e1 := syscall.Syscall(procSetFileCompletionNotificationModes.Addr(), 2, uintptr(h), uintptr(flags), 0) - if r1 == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } - } - return -} - -func connectNamedPipe(pipe syscall.Handle, o *syscall.Overlapped) (err error) { - r1, _, e1 := syscall.Syscall(procConnectNamedPipe.Addr(), 2, uintptr(pipe), uintptr(unsafe.Pointer(o)), 0) - if r1 == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } - } - return -} - -func createNamedPipe(name string, flags uint32, pipeMode uint32, maxInstances uint32, outSize uint32, inSize uint32, defaultTimeout uint32, sa *syscall.SecurityAttributes) (handle syscall.Handle, err error) { - var _p0 *uint16 - _p0, err = syscall.UTF16PtrFromString(name) - if err != nil { - return - } - return _createNamedPipe(_p0, flags, pipeMode, maxInstances, outSize, inSize, defaultTimeout, sa) -} - -func _createNamedPipe(name *uint16, flags uint32, pipeMode uint32, maxInstances uint32, outSize uint32, inSize uint32, defaultTimeout uint32, sa *syscall.SecurityAttributes) (handle syscall.Handle, err error) { - r0, _, e1 := syscall.Syscall9(procCreateNamedPipeW.Addr(), 8, uintptr(unsafe.Pointer(name)), uintptr(flags), uintptr(pipeMode), uintptr(maxInstances), uintptr(outSize), uintptr(inSize), uintptr(defaultTimeout), uintptr(unsafe.Pointer(sa)), 0) - handle = syscall.Handle(r0) - if handle == syscall.InvalidHandle { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } - } - return -} - -func createFile(name string, access uint32, mode uint32, sa *syscall.SecurityAttributes, createmode uint32, attrs uint32, templatefile syscall.Handle) (handle syscall.Handle, err error) { - var _p0 *uint16 - _p0, err = syscall.UTF16PtrFromString(name) - if err != nil { - return - } - return _createFile(_p0, access, mode, sa, createmode, attrs, templatefile) -} - -func _createFile(name *uint16, access uint32, mode uint32, sa *syscall.SecurityAttributes, createmode uint32, attrs uint32, templatefile syscall.Handle) (handle syscall.Handle, err error) { - r0, _, e1 := syscall.Syscall9(procCreateFileW.Addr(), 7, uintptr(unsafe.Pointer(name)), uintptr(access), uintptr(mode), uintptr(unsafe.Pointer(sa)), uintptr(createmode), uintptr(attrs), uintptr(templatefile), 0, 0) - handle = syscall.Handle(r0) - if handle == syscall.InvalidHandle { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } - } - return -} - -func waitNamedPipe(name string, timeout uint32) (err error) { - var _p0 *uint16 - _p0, err = syscall.UTF16PtrFromString(name) - if err != nil { - return - } - return _waitNamedPipe(_p0, timeout) -} - -func _waitNamedPipe(name *uint16, timeout uint32) (err error) { - r1, _, e1 := syscall.Syscall(procWaitNamedPipeW.Addr(), 2, uintptr(unsafe.Pointer(name)), uintptr(timeout), 0) - if r1 == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } - } - return -} - -func getNamedPipeInfo(pipe syscall.Handle, flags *uint32, outSize *uint32, inSize *uint32, maxInstances *uint32) (err error) { - r1, _, e1 := syscall.Syscall6(procGetNamedPipeInfo.Addr(), 5, uintptr(pipe), uintptr(unsafe.Pointer(flags)), uintptr(unsafe.Pointer(outSize)), uintptr(unsafe.Pointer(inSize)), uintptr(unsafe.Pointer(maxInstances)), 0) - if r1 == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } - } - return -} - -func getNamedPipeHandleState(pipe syscall.Handle, state *uint32, curInstances *uint32, maxCollectionCount *uint32, collectDataTimeout *uint32, userName *uint16, maxUserNameSize uint32) (err error) { - r1, _, e1 := syscall.Syscall9(procGetNamedPipeHandleStateW.Addr(), 7, uintptr(pipe), uintptr(unsafe.Pointer(state)), uintptr(unsafe.Pointer(curInstances)), uintptr(unsafe.Pointer(maxCollectionCount)), uintptr(unsafe.Pointer(collectDataTimeout)), uintptr(unsafe.Pointer(userName)), uintptr(maxUserNameSize), 0, 0) - if r1 == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } - } - return -} - -func localAlloc(uFlags uint32, length uint32) (ptr uintptr) { - r0, _, _ := syscall.Syscall(procLocalAlloc.Addr(), 2, uintptr(uFlags), uintptr(length), 0) - ptr = uintptr(r0) - return -} - -func lookupAccountName(systemName *uint16, accountName string, sid *byte, sidSize *uint32, refDomain *uint16, refDomainSize *uint32, sidNameUse *uint32) (err error) { - var _p0 *uint16 - _p0, err = syscall.UTF16PtrFromString(accountName) - if err != nil { - return - } - return _lookupAccountName(systemName, _p0, sid, sidSize, refDomain, refDomainSize, sidNameUse) -} - -func _lookupAccountName(systemName *uint16, accountName *uint16, sid *byte, sidSize *uint32, refDomain *uint16, refDomainSize *uint32, sidNameUse *uint32) (err error) { - r1, _, e1 := syscall.Syscall9(procLookupAccountNameW.Addr(), 7, uintptr(unsafe.Pointer(systemName)), uintptr(unsafe.Pointer(accountName)), uintptr(unsafe.Pointer(sid)), uintptr(unsafe.Pointer(sidSize)), uintptr(unsafe.Pointer(refDomain)), uintptr(unsafe.Pointer(refDomainSize)), uintptr(unsafe.Pointer(sidNameUse)), 0, 0) - if r1 == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } + err = errnoErr(e1) } return } @@ -251,11 +101,7 @@ func _lookupAccountName(systemName *uint16, accountName *uint16, sid *byte, sidS func convertSidToStringSid(sid *byte, str **uint16) (err error) { r1, _, e1 := syscall.Syscall(procConvertSidToStringSidW.Addr(), 2, uintptr(unsafe.Pointer(sid)), uintptr(unsafe.Pointer(str)), 0) if r1 == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } + err = errnoErr(e1) } return } @@ -272,126 +118,73 @@ func convertStringSecurityDescriptorToSecurityDescriptor(str string, revision ui func _convertStringSecurityDescriptorToSecurityDescriptor(str *uint16, revision uint32, sd *uintptr, size *uint32) (err error) { r1, _, e1 := syscall.Syscall6(procConvertStringSecurityDescriptorToSecurityDescriptorW.Addr(), 4, uintptr(unsafe.Pointer(str)), uintptr(revision), uintptr(unsafe.Pointer(sd)), uintptr(unsafe.Pointer(size)), 0, 0) if r1 == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } + err = errnoErr(e1) } return } -func convertSecurityDescriptorToStringSecurityDescriptor(sd *byte, revision uint32, secInfo uint32, sddl **uint16, sddlSize *uint32) (err error) { - r1, _, e1 := syscall.Syscall6(procConvertSecurityDescriptorToStringSecurityDescriptorW.Addr(), 5, uintptr(unsafe.Pointer(sd)), uintptr(revision), uintptr(secInfo), uintptr(unsafe.Pointer(sddl)), uintptr(unsafe.Pointer(sddlSize)), 0) - if r1 == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } - } - return -} - -func localFree(mem uintptr) { - syscall.Syscall(procLocalFree.Addr(), 1, uintptr(mem), 0, 0) - return -} - func getSecurityDescriptorLength(sd uintptr) (len uint32) { r0, _, _ := syscall.Syscall(procGetSecurityDescriptorLength.Addr(), 1, uintptr(sd), 0, 0) len = uint32(r0) return } -func getFileInformationByHandleEx(h syscall.Handle, class uint32, buffer *byte, size uint32) (err error) { - r1, _, e1 := syscall.Syscall6(procGetFileInformationByHandleEx.Addr(), 4, uintptr(h), uintptr(class), uintptr(unsafe.Pointer(buffer)), uintptr(size), 0, 0) - if r1 == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } - } - return -} - -func setFileInformationByHandle(h syscall.Handle, class uint32, buffer *byte, size uint32) (err error) { - r1, _, e1 := syscall.Syscall6(procSetFileInformationByHandle.Addr(), 4, uintptr(h), uintptr(class), uintptr(unsafe.Pointer(buffer)), uintptr(size), 0, 0) - if r1 == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } - } - return -} - -func adjustTokenPrivileges(token windows.Token, releaseAll bool, input *byte, outputSize uint32, output *byte, requiredSize *uint32) (success bool, err error) { - var _p0 uint32 - if releaseAll { - _p0 = 1 - } else { - _p0 = 0 - } - r0, _, e1 := syscall.Syscall6(procAdjustTokenPrivileges.Addr(), 6, uintptr(token), uintptr(_p0), uintptr(unsafe.Pointer(input)), uintptr(outputSize), uintptr(unsafe.Pointer(output)), uintptr(unsafe.Pointer(requiredSize))) - success = r0 != 0 - if true { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } - } - return -} - func impersonateSelf(level uint32) (err error) { r1, _, e1 := syscall.Syscall(procImpersonateSelf.Addr(), 1, uintptr(level), 0, 0) if r1 == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } + err = errnoErr(e1) } return } -func revertToSelf() (err error) { - r1, _, e1 := syscall.Syscall(procRevertToSelf.Addr(), 0, 0, 0, 0) +func lookupAccountName(systemName *uint16, accountName string, sid *byte, sidSize *uint32, refDomain *uint16, refDomainSize *uint32, sidNameUse *uint32) (err error) { + var _p0 *uint16 + _p0, err = syscall.UTF16PtrFromString(accountName) + if err != nil { + return + } + return _lookupAccountName(systemName, _p0, sid, sidSize, refDomain, refDomainSize, sidNameUse) +} + +func _lookupAccountName(systemName *uint16, accountName *uint16, sid *byte, sidSize *uint32, refDomain *uint16, refDomainSize *uint32, sidNameUse *uint32) (err error) { + r1, _, e1 := syscall.Syscall9(procLookupAccountNameW.Addr(), 7, uintptr(unsafe.Pointer(systemName)), uintptr(unsafe.Pointer(accountName)), uintptr(unsafe.Pointer(sid)), uintptr(unsafe.Pointer(sidSize)), uintptr(unsafe.Pointer(refDomain)), uintptr(unsafe.Pointer(refDomainSize)), uintptr(unsafe.Pointer(sidNameUse)), 0, 0) if r1 == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } + err = errnoErr(e1) } return } -func openThreadToken(thread syscall.Handle, accessMask uint32, openAsSelf bool, token *windows.Token) (err error) { - var _p0 uint32 - if openAsSelf { - _p0 = 1 - } else { - _p0 = 0 +func lookupPrivilegeDisplayName(systemName string, name *uint16, buffer *uint16, size *uint32, languageId *uint32) (err error) { + var _p0 *uint16 + _p0, err = syscall.UTF16PtrFromString(systemName) + if err != nil { + return } - r1, _, e1 := syscall.Syscall6(procOpenThreadToken.Addr(), 4, uintptr(thread), uintptr(accessMask), uintptr(_p0), uintptr(unsafe.Pointer(token)), 0, 0) + return _lookupPrivilegeDisplayName(_p0, name, buffer, size, languageId) +} + +func _lookupPrivilegeDisplayName(systemName *uint16, name *uint16, buffer *uint16, size *uint32, languageId *uint32) (err error) { + r1, _, e1 := syscall.Syscall6(procLookupPrivilegeDisplayNameW.Addr(), 5, uintptr(unsafe.Pointer(systemName)), uintptr(unsafe.Pointer(name)), uintptr(unsafe.Pointer(buffer)), uintptr(unsafe.Pointer(size)), uintptr(unsafe.Pointer(languageId)), 0) if r1 == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } + err = errnoErr(e1) } return } -func getCurrentThread() (h syscall.Handle) { - r0, _, _ := syscall.Syscall(procGetCurrentThread.Addr(), 0, 0, 0, 0) - h = syscall.Handle(r0) +func lookupPrivilegeName(systemName string, luid *uint64, buffer *uint16, size *uint32) (err error) { + var _p0 *uint16 + _p0, err = syscall.UTF16PtrFromString(systemName) + if err != nil { + return + } + return _lookupPrivilegeName(_p0, luid, buffer, size) +} + +func _lookupPrivilegeName(systemName *uint16, luid *uint64, buffer *uint16, size *uint32) (err error) { + r1, _, e1 := syscall.Syscall6(procLookupPrivilegeNameW.Addr(), 4, uintptr(unsafe.Pointer(systemName)), uintptr(unsafe.Pointer(luid)), uintptr(unsafe.Pointer(buffer)), uintptr(unsafe.Pointer(size)), 0, 0) + if r1 == 0 { + err = errnoErr(e1) + } return } @@ -412,53 +205,27 @@ func lookupPrivilegeValue(systemName string, name string, luid *uint64) (err err func _lookupPrivilegeValue(systemName *uint16, name *uint16, luid *uint64) (err error) { r1, _, e1 := syscall.Syscall(procLookupPrivilegeValueW.Addr(), 3, uintptr(unsafe.Pointer(systemName)), uintptr(unsafe.Pointer(name)), uintptr(unsafe.Pointer(luid))) if r1 == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } + err = errnoErr(e1) } return } -func lookupPrivilegeName(systemName string, luid *uint64, buffer *uint16, size *uint32) (err error) { - var _p0 *uint16 - _p0, err = syscall.UTF16PtrFromString(systemName) - if err != nil { - return +func openThreadToken(thread syscall.Handle, accessMask uint32, openAsSelf bool, token *windows.Token) (err error) { + var _p0 uint32 + if openAsSelf { + _p0 = 1 } - return _lookupPrivilegeName(_p0, luid, buffer, size) -} - -func _lookupPrivilegeName(systemName *uint16, luid *uint64, buffer *uint16, size *uint32) (err error) { - r1, _, e1 := syscall.Syscall6(procLookupPrivilegeNameW.Addr(), 4, uintptr(unsafe.Pointer(systemName)), uintptr(unsafe.Pointer(luid)), uintptr(unsafe.Pointer(buffer)), uintptr(unsafe.Pointer(size)), 0, 0) + r1, _, e1 := syscall.Syscall6(procOpenThreadToken.Addr(), 4, uintptr(thread), uintptr(accessMask), uintptr(_p0), uintptr(unsafe.Pointer(token)), 0, 0) if r1 == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } + err = errnoErr(e1) } return } -func lookupPrivilegeDisplayName(systemName string, name *uint16, buffer *uint16, size *uint32, languageId *uint32) (err error) { - var _p0 *uint16 - _p0, err = syscall.UTF16PtrFromString(systemName) - if err != nil { - return - } - return _lookupPrivilegeDisplayName(_p0, name, buffer, size, languageId) -} - -func _lookupPrivilegeDisplayName(systemName *uint16, name *uint16, buffer *uint16, size *uint32, languageId *uint32) (err error) { - r1, _, e1 := syscall.Syscall6(procLookupPrivilegeDisplayNameW.Addr(), 5, uintptr(unsafe.Pointer(systemName)), uintptr(unsafe.Pointer(name)), uintptr(unsafe.Pointer(buffer)), uintptr(unsafe.Pointer(size)), uintptr(unsafe.Pointer(languageId)), 0) +func revertToSelf() (err error) { + r1, _, e1 := syscall.Syscall(procRevertToSelf.Addr(), 0, 0, 0, 0) if r1 == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } + err = errnoErr(e1) } return } @@ -471,22 +238,14 @@ func backupRead(h syscall.Handle, b []byte, bytesRead *uint32, abort bool, proce var _p1 uint32 if abort { _p1 = 1 - } else { - _p1 = 0 } var _p2 uint32 if processSecurity { _p2 = 1 - } else { - _p2 = 0 } r1, _, e1 := syscall.Syscall9(procBackupRead.Addr(), 7, uintptr(h), uintptr(unsafe.Pointer(_p0)), uintptr(len(b)), uintptr(unsafe.Pointer(bytesRead)), uintptr(_p1), uintptr(_p2), uintptr(unsafe.Pointer(context)), 0, 0) if r1 == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } + err = errnoErr(e1) } return } @@ -499,22 +258,170 @@ func backupWrite(h syscall.Handle, b []byte, bytesWritten *uint32, abort bool, p var _p1 uint32 if abort { _p1 = 1 - } else { - _p1 = 0 } var _p2 uint32 if processSecurity { _p2 = 1 - } else { - _p2 = 0 } r1, _, e1 := syscall.Syscall9(procBackupWrite.Addr(), 7, uintptr(h), uintptr(unsafe.Pointer(_p0)), uintptr(len(b)), uintptr(unsafe.Pointer(bytesWritten)), uintptr(_p1), uintptr(_p2), uintptr(unsafe.Pointer(context)), 0, 0) if r1 == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } + err = errnoErr(e1) + } + return +} + +func cancelIoEx(file syscall.Handle, o *syscall.Overlapped) (err error) { + r1, _, e1 := syscall.Syscall(procCancelIoEx.Addr(), 2, uintptr(file), uintptr(unsafe.Pointer(o)), 0) + if r1 == 0 { + err = errnoErr(e1) + } + return +} + +func connectNamedPipe(pipe syscall.Handle, o *syscall.Overlapped) (err error) { + r1, _, e1 := syscall.Syscall(procConnectNamedPipe.Addr(), 2, uintptr(pipe), uintptr(unsafe.Pointer(o)), 0) + if r1 == 0 { + err = errnoErr(e1) + } + return +} + +func createFile(name string, access uint32, mode uint32, sa *syscall.SecurityAttributes, createmode uint32, attrs uint32, templatefile syscall.Handle) (handle syscall.Handle, err error) { + var _p0 *uint16 + _p0, err = syscall.UTF16PtrFromString(name) + if err != nil { + return + } + return _createFile(_p0, access, mode, sa, createmode, attrs, templatefile) +} + +func _createFile(name *uint16, access uint32, mode uint32, sa *syscall.SecurityAttributes, createmode uint32, attrs uint32, templatefile syscall.Handle) (handle syscall.Handle, err error) { + r0, _, e1 := syscall.Syscall9(procCreateFileW.Addr(), 7, uintptr(unsafe.Pointer(name)), uintptr(access), uintptr(mode), uintptr(unsafe.Pointer(sa)), uintptr(createmode), uintptr(attrs), uintptr(templatefile), 0, 0) + handle = syscall.Handle(r0) + if handle == syscall.InvalidHandle { + err = errnoErr(e1) + } + return +} + +func createIoCompletionPort(file syscall.Handle, port syscall.Handle, key uintptr, threadCount uint32) (newport syscall.Handle, err error) { + r0, _, e1 := syscall.Syscall6(procCreateIoCompletionPort.Addr(), 4, uintptr(file), uintptr(port), uintptr(key), uintptr(threadCount), 0, 0) + newport = syscall.Handle(r0) + if newport == 0 { + err = errnoErr(e1) + } + return +} + +func createNamedPipe(name string, flags uint32, pipeMode uint32, maxInstances uint32, outSize uint32, inSize uint32, defaultTimeout uint32, sa *syscall.SecurityAttributes) (handle syscall.Handle, err error) { + var _p0 *uint16 + _p0, err = syscall.UTF16PtrFromString(name) + if err != nil { + return + } + return _createNamedPipe(_p0, flags, pipeMode, maxInstances, outSize, inSize, defaultTimeout, sa) +} + +func _createNamedPipe(name *uint16, flags uint32, pipeMode uint32, maxInstances uint32, outSize uint32, inSize uint32, defaultTimeout uint32, sa *syscall.SecurityAttributes) (handle syscall.Handle, err error) { + r0, _, e1 := syscall.Syscall9(procCreateNamedPipeW.Addr(), 8, uintptr(unsafe.Pointer(name)), uintptr(flags), uintptr(pipeMode), uintptr(maxInstances), uintptr(outSize), uintptr(inSize), uintptr(defaultTimeout), uintptr(unsafe.Pointer(sa)), 0) + handle = syscall.Handle(r0) + if handle == syscall.InvalidHandle { + err = errnoErr(e1) + } + return +} + +func getCurrentThread() (h syscall.Handle) { + r0, _, _ := syscall.Syscall(procGetCurrentThread.Addr(), 0, 0, 0, 0) + h = syscall.Handle(r0) + return +} + +func getNamedPipeHandleState(pipe syscall.Handle, state *uint32, curInstances *uint32, maxCollectionCount *uint32, collectDataTimeout *uint32, userName *uint16, maxUserNameSize uint32) (err error) { + r1, _, e1 := syscall.Syscall9(procGetNamedPipeHandleStateW.Addr(), 7, uintptr(pipe), uintptr(unsafe.Pointer(state)), uintptr(unsafe.Pointer(curInstances)), uintptr(unsafe.Pointer(maxCollectionCount)), uintptr(unsafe.Pointer(collectDataTimeout)), uintptr(unsafe.Pointer(userName)), uintptr(maxUserNameSize), 0, 0) + if r1 == 0 { + err = errnoErr(e1) + } + return +} + +func getNamedPipeInfo(pipe syscall.Handle, flags *uint32, outSize *uint32, inSize *uint32, maxInstances *uint32) (err error) { + r1, _, e1 := syscall.Syscall6(procGetNamedPipeInfo.Addr(), 5, uintptr(pipe), uintptr(unsafe.Pointer(flags)), uintptr(unsafe.Pointer(outSize)), uintptr(unsafe.Pointer(inSize)), uintptr(unsafe.Pointer(maxInstances)), 0) + if r1 == 0 { + err = errnoErr(e1) + } + return +} + +func getQueuedCompletionStatus(port syscall.Handle, bytes *uint32, key *uintptr, o **ioOperation, timeout uint32) (err error) { + r1, _, e1 := syscall.Syscall6(procGetQueuedCompletionStatus.Addr(), 5, uintptr(port), uintptr(unsafe.Pointer(bytes)), uintptr(unsafe.Pointer(key)), uintptr(unsafe.Pointer(o)), uintptr(timeout), 0) + if r1 == 0 { + err = errnoErr(e1) + } + return +} + +func localAlloc(uFlags uint32, length uint32) (ptr uintptr) { + r0, _, _ := syscall.Syscall(procLocalAlloc.Addr(), 2, uintptr(uFlags), uintptr(length), 0) + ptr = uintptr(r0) + return +} + +func localFree(mem uintptr) { + syscall.Syscall(procLocalFree.Addr(), 1, uintptr(mem), 0, 0) + return +} + +func setFileCompletionNotificationModes(h syscall.Handle, flags uint8) (err error) { + r1, _, e1 := syscall.Syscall(procSetFileCompletionNotificationModes.Addr(), 2, uintptr(h), uintptr(flags), 0) + if r1 == 0 { + err = errnoErr(e1) + } + return +} + +func ntCreateNamedPipeFile(pipe *syscall.Handle, access uint32, oa *objectAttributes, iosb *ioStatusBlock, share uint32, disposition uint32, options uint32, typ uint32, readMode uint32, completionMode uint32, maxInstances uint32, inboundQuota uint32, outputQuota uint32, timeout *int64) (status ntstatus) { + r0, _, _ := syscall.Syscall15(procNtCreateNamedPipeFile.Addr(), 14, uintptr(unsafe.Pointer(pipe)), uintptr(access), uintptr(unsafe.Pointer(oa)), uintptr(unsafe.Pointer(iosb)), uintptr(share), uintptr(disposition), uintptr(options), uintptr(typ), uintptr(readMode), uintptr(completionMode), uintptr(maxInstances), uintptr(inboundQuota), uintptr(outputQuota), uintptr(unsafe.Pointer(timeout)), 0) + status = ntstatus(r0) + return +} + +func rtlDefaultNpAcl(dacl *uintptr) (status ntstatus) { + r0, _, _ := syscall.Syscall(procRtlDefaultNpAcl.Addr(), 1, uintptr(unsafe.Pointer(dacl)), 0, 0) + status = ntstatus(r0) + return +} + +func rtlDosPathNameToNtPathName(name *uint16, ntName *unicodeString, filePart uintptr, reserved uintptr) (status ntstatus) { + r0, _, _ := syscall.Syscall6(procRtlDosPathNameToNtPathName_U.Addr(), 4, uintptr(unsafe.Pointer(name)), uintptr(unsafe.Pointer(ntName)), uintptr(filePart), uintptr(reserved), 0, 0) + status = ntstatus(r0) + return +} + +func rtlNtStatusToDosError(status ntstatus) (winerr error) { + r0, _, _ := syscall.Syscall(procRtlNtStatusToDosErrorNoTeb.Addr(), 1, uintptr(status), 0, 0) + if r0 != 0 { + winerr = syscall.Errno(r0) + } + return +} + +func wsaGetOverlappedResult(h syscall.Handle, o *syscall.Overlapped, bytes *uint32, wait bool, flags *uint32) (err error) { + var _p0 uint32 + if wait { + _p0 = 1 + } + r1, _, e1 := syscall.Syscall6(procWSAGetOverlappedResult.Addr(), 5, uintptr(h), uintptr(unsafe.Pointer(o)), uintptr(unsafe.Pointer(bytes)), uintptr(_p0), uintptr(unsafe.Pointer(flags)), 0) + if r1 == 0 { + err = errnoErr(e1) + } + return +} + +func bind(s syscall.Handle, name unsafe.Pointer, namelen int32) (err error) { + r1, _, e1 := syscall.Syscall(procbind.Addr(), 3, uintptr(s), uintptr(name), uintptr(namelen)) + if r1 == socketError { + err = errnoErr(e1) } return } diff --git a/vendor/github.com/Microsoft/hcsshim/.gitattributes b/vendor/github.com/Microsoft/hcsshim/.gitattributes new file mode 100644 index 00000000..94f480de --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/.gitattributes @@ -0,0 +1 @@ +* text=auto eol=lf \ No newline at end of file diff --git a/vendor/github.com/Microsoft/hcsshim/.gitignore b/vendor/github.com/Microsoft/hcsshim/.gitignore index b883f1fd..aec9bd4b 100644 --- a/vendor/github.com/Microsoft/hcsshim/.gitignore +++ b/vendor/github.com/Microsoft/hcsshim/.gitignore @@ -1 +1,3 @@ *.exe +.idea +.vscode diff --git a/vendor/github.com/Microsoft/hcsshim/.gometalinter.json b/vendor/github.com/Microsoft/hcsshim/.gometalinter.json deleted file mode 100644 index 00e9a6e2..00000000 --- a/vendor/github.com/Microsoft/hcsshim/.gometalinter.json +++ /dev/null @@ -1,17 +0,0 @@ -{ - "Vendor": true, - "Deadline": "2m", - "Sort": [ - "linter", - "severity", - "path", - "line" - ], - "Skip": [ - "internal\\schema2" - ], - "EnableGC": true, - "Enable": [ - "gofmt" - ] -} \ No newline at end of file diff --git a/vendor/github.com/Microsoft/hcsshim/CODEOWNERS b/vendor/github.com/Microsoft/hcsshim/CODEOWNERS new file mode 100644 index 00000000..87f49df3 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/CODEOWNERS @@ -0,0 +1,3 @@ +* @microsoft/containerplat + +/hcn/* @nagiesek \ No newline at end of file diff --git a/vendor/github.com/Microsoft/hcsshim/Protobuild.toml b/vendor/github.com/Microsoft/hcsshim/Protobuild.toml new file mode 100644 index 00000000..8bb92085 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/Protobuild.toml @@ -0,0 +1,44 @@ +version = "unstable" +generator = "gogoctrd" +plugins = ["grpc", "fieldpath"] + +# Control protoc include paths. Below are usually some good defaults, but feel +# free to try it without them if it works for your project. +[includes] + # Include paths that will be added before all others. Typically, you want to + # treat the root of the project as an include, but this may not be necessary. + before = ["./protobuf"] + + # Paths that should be treated as include roots in relation to the vendor + # directory. These will be calculated with the vendor directory nearest the + # target package. + packages = ["github.com/gogo/protobuf"] + + # Paths that will be added untouched to the end of the includes. We use + # `/usr/local/include` to pickup the common install location of protobuf. + # This is the default. + after = ["/usr/local/include"] + +# This section maps protobuf imports to Go packages. These will become +# `-M` directives in the call to the go protobuf generator. +[packages] + "gogoproto/gogo.proto" = "github.com/gogo/protobuf/gogoproto" + "google/protobuf/any.proto" = "github.com/gogo/protobuf/types" + "google/protobuf/empty.proto" = "github.com/gogo/protobuf/types" + "google/protobuf/descriptor.proto" = "github.com/gogo/protobuf/protoc-gen-gogo/descriptor" + "google/protobuf/field_mask.proto" = "github.com/gogo/protobuf/types" + "google/protobuf/timestamp.proto" = "github.com/gogo/protobuf/types" + "google/protobuf/duration.proto" = "github.com/gogo/protobuf/types" + "github/containerd/cgroups/stats/v1/metrics.proto" = "github.com/containerd/cgroups/stats/v1" + +[[overrides]] +prefixes = ["github.com/Microsoft/hcsshim/internal/shimdiag"] +plugins = ["ttrpc"] + +[[overrides]] +prefixes = ["github.com/Microsoft/hcsshim/internal/computeagent"] +plugins = ["ttrpc"] + +[[overrides]] +prefixes = ["github.com/Microsoft/hcsshim/internal/ncproxyttrpc"] +plugins = ["ttrpc"] \ No newline at end of file diff --git a/vendor/github.com/Microsoft/hcsshim/README.md b/vendor/github.com/Microsoft/hcsshim/README.md index 15b39181..95c30036 100644 --- a/vendor/github.com/Microsoft/hcsshim/README.md +++ b/vendor/github.com/Microsoft/hcsshim/README.md @@ -1,8 +1,8 @@ # hcsshim -[![Build status](https://ci.appveyor.com/api/projects/status/nbcw28mnkqml0loa/branch/master?svg=true)](https://ci.appveyor.com/project/WindowsVirtualization/hcsshim/branch/master) +[![Build status](https://github.com/microsoft/hcsshim/actions/workflows/ci.yml/badge.svg?branch=master)](https://github.com/microsoft/hcsshim/actions?query=branch%3Amaster) -This package contains the Golang interface for using the Windows [Host Compute Service](https://blogs.technet.microsoft.com/virtualization/2017/01/27/introducing-the-host-compute-service-hcs/) (HCS) to launch and manage [Windows Containers](https://docs.microsoft.com/en-us/virtualization/windowscontainers/about/). It also contains other helpers and functions for managing Windows Containers such as the Golang interface for the Host Network Service (HNS). +This package contains the Golang interface for using the Windows [Host Compute Service](https://techcommunity.microsoft.com/t5/containers/introducing-the-host-compute-service-hcs/ba-p/382332) (HCS) to launch and manage [Windows Containers](https://docs.microsoft.com/en-us/virtualization/windowscontainers/about/). It also contains other helpers and functions for managing Windows Containers such as the Golang interface for the Host Network Service (HNS). It is primarily used in the [Moby Project](https://github.com/moby/moby), but it can be freely used by other projects as well. @@ -16,6 +16,11 @@ When you submit a pull request, a CLA-bot will automatically determine whether y a CLA and decorate the PR appropriately (e.g., label, comment). Simply follow the instructions provided by the bot. You will only need to do this once across all repos using our CLA. +We also ask that contributors [sign their commits](https://git-scm.com/docs/git-commit) using `git commit -s` or `git commit --signoff` to certify they either authored the work themselves or otherwise have permission to use it in this project. + + +## Code of Conduct + This project has adopted the [Microsoft Open Source Code of Conduct](https://opensource.microsoft.com/codeofconduct/). For more information see the [Code of Conduct FAQ](https://opensource.microsoft.com/codeofconduct/faq/) or contact [opencode@microsoft.com](mailto:opencode@microsoft.com) with any additional questions or comments. diff --git a/vendor/github.com/Microsoft/hcsshim/appveyor.yml b/vendor/github.com/Microsoft/hcsshim/appveyor.yml deleted file mode 100644 index a8ec5a59..00000000 --- a/vendor/github.com/Microsoft/hcsshim/appveyor.yml +++ /dev/null @@ -1,29 +0,0 @@ -version: 0.1.{build} - -image: Visual Studio 2017 - -clone_folder: c:\gopath\src\github.com\Microsoft\hcsshim - -environment: - GOPATH: c:\gopath - PATH: C:\mingw-w64\x86_64-7.2.0-posix-seh-rt_v5-rev1\mingw64\bin;%GOPATH%\bin;C:\gometalinter-2.0.12-windows-amd64;%PATH% - -stack: go 1.11 - -build_script: - - appveyor DownloadFile https://github.com/alecthomas/gometalinter/releases/download/v2.0.12/gometalinter-2.0.12-windows-amd64.zip - - 7z x gometalinter-2.0.12-windows-amd64.zip -y -oC:\ > NUL - - gometalinter.exe --config .gometalinter.json ./... - - go build ./cmd/wclayer - - go build ./cmd/runhcs - - go build ./cmd/tar2ext4 - - go test -v ./... -tags admin - - go test -c ./test/functional/ -tags functional - - go test -c ./test/runhcs/ -tags integration - -artifacts: - - path: 'wclayer.exe' - - path: 'runhcs.exe' - - path: 'tar2ext4.exe' - - path: 'functional.test.exe' - - path: 'runhcs.test.exe' \ No newline at end of file diff --git a/vendor/github.com/Microsoft/hcsshim/computestorage/attach.go b/vendor/github.com/Microsoft/hcsshim/computestorage/attach.go new file mode 100644 index 00000000..7f1f2823 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/computestorage/attach.go @@ -0,0 +1,38 @@ +package computestorage + +import ( + "context" + "encoding/json" + + "github.com/Microsoft/hcsshim/internal/oc" + "github.com/pkg/errors" + "go.opencensus.io/trace" +) + +// AttachLayerStorageFilter sets up the layer storage filter on a writable +// container layer. +// +// `layerPath` is a path to a directory the writable layer is mounted. If the +// path does not end in a `\` the platform will append it automatically. +// +// `layerData` is the parent read-only layer data. +func AttachLayerStorageFilter(ctx context.Context, layerPath string, layerData LayerData) (err error) { + title := "hcsshim.AttachLayerStorageFilter" + ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("layerPath", layerPath), + ) + + bytes, err := json.Marshal(layerData) + if err != nil { + return err + } + + err = hcsAttachLayerStorageFilter(layerPath, string(bytes)) + if err != nil { + return errors.Wrap(err, "failed to attach layer storage filter") + } + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/computestorage/destroy.go b/vendor/github.com/Microsoft/hcsshim/computestorage/destroy.go new file mode 100644 index 00000000..8e28e6c5 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/computestorage/destroy.go @@ -0,0 +1,26 @@ +package computestorage + +import ( + "context" + + "github.com/Microsoft/hcsshim/internal/oc" + "github.com/pkg/errors" + "go.opencensus.io/trace" +) + +// DestroyLayer deletes a container layer. +// +// `layerPath` is a path to a directory containing the layer to export. +func DestroyLayer(ctx context.Context, layerPath string) (err error) { + title := "hcsshim.DestroyLayer" + ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("layerPath", layerPath)) + + err = hcsDestroyLayer(layerPath) + if err != nil { + return errors.Wrap(err, "failed to destroy layer") + } + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/computestorage/detach.go b/vendor/github.com/Microsoft/hcsshim/computestorage/detach.go new file mode 100644 index 00000000..43547325 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/computestorage/detach.go @@ -0,0 +1,26 @@ +package computestorage + +import ( + "context" + + "github.com/Microsoft/hcsshim/internal/oc" + "github.com/pkg/errors" + "go.opencensus.io/trace" +) + +// DetachLayerStorageFilter detaches the layer storage filter on a writable container layer. +// +// `layerPath` is a path to a directory containing the layer to export. +func DetachLayerStorageFilter(ctx context.Context, layerPath string) (err error) { + title := "hcsshim.DetachLayerStorageFilter" + ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("layerPath", layerPath)) + + err = hcsDetachLayerStorageFilter(layerPath) + if err != nil { + return errors.Wrap(err, "failed to detach layer storage filter") + } + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/computestorage/export.go b/vendor/github.com/Microsoft/hcsshim/computestorage/export.go new file mode 100644 index 00000000..a1b12dd1 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/computestorage/export.go @@ -0,0 +1,46 @@ +package computestorage + +import ( + "context" + "encoding/json" + + "github.com/Microsoft/hcsshim/internal/oc" + "github.com/pkg/errors" + "go.opencensus.io/trace" +) + +// ExportLayer exports a container layer. +// +// `layerPath` is a path to a directory containing the layer to export. +// +// `exportFolderPath` is a pre-existing folder to export the layer to. +// +// `layerData` is the parent layer data. +// +// `options` are the export options applied to the exported layer. +func ExportLayer(ctx context.Context, layerPath, exportFolderPath string, layerData LayerData, options ExportLayerOptions) (err error) { + title := "hcsshim.ExportLayer" + ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("layerPath", layerPath), + trace.StringAttribute("exportFolderPath", exportFolderPath), + ) + + ldbytes, err := json.Marshal(layerData) + if err != nil { + return err + } + + obytes, err := json.Marshal(options) + if err != nil { + return err + } + + err = hcsExportLayer(layerPath, exportFolderPath, string(ldbytes), string(obytes)) + if err != nil { + return errors.Wrap(err, "failed to export layer") + } + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/computestorage/format.go b/vendor/github.com/Microsoft/hcsshim/computestorage/format.go new file mode 100644 index 00000000..83c0fa33 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/computestorage/format.go @@ -0,0 +1,26 @@ +package computestorage + +import ( + "context" + + "github.com/Microsoft/hcsshim/internal/oc" + "github.com/pkg/errors" + "go.opencensus.io/trace" + "golang.org/x/sys/windows" +) + +// FormatWritableLayerVhd formats a virtual disk for use as a writable container layer. +// +// If the VHD is not mounted it will be temporarily mounted. +func FormatWritableLayerVhd(ctx context.Context, vhdHandle windows.Handle) (err error) { + title := "hcsshim.FormatWritableLayerVhd" + ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + + err = hcsFormatWritableLayerVhd(vhdHandle) + if err != nil { + return errors.Wrap(err, "failed to format writable layer vhd") + } + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/computestorage/helpers.go b/vendor/github.com/Microsoft/hcsshim/computestorage/helpers.go new file mode 100644 index 00000000..87fee452 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/computestorage/helpers.go @@ -0,0 +1,193 @@ +package computestorage + +import ( + "context" + "os" + "path/filepath" + "syscall" + + "github.com/Microsoft/go-winio/pkg/security" + "github.com/Microsoft/go-winio/vhd" + "github.com/pkg/errors" + "golang.org/x/sys/windows" +) + +const defaultVHDXBlockSizeInMB = 1 + +// SetupContainerBaseLayer is a helper to setup a containers scratch. It +// will create and format the vhdx's inside and the size is configurable with the sizeInGB +// parameter. +// +// `layerPath` is the path to the base container layer on disk. +// +// `baseVhdPath` is the path to where the base vhdx for the base layer should be created. +// +// `diffVhdPath` is the path where the differencing disk for the base layer should be created. +// +// `sizeInGB` is the size in gigabytes to make the base vhdx. +func SetupContainerBaseLayer(ctx context.Context, layerPath, baseVhdPath, diffVhdPath string, sizeInGB uint64) (err error) { + var ( + hivesPath = filepath.Join(layerPath, "Hives") + layoutPath = filepath.Join(layerPath, "Layout") + ) + + // We need to remove the hives directory and layout file as `SetupBaseOSLayer` fails if these files + // already exist. `SetupBaseOSLayer` will create these files internally. We also remove the base and + // differencing disks if they exist in case we're asking for a different size. + if _, err := os.Stat(hivesPath); err == nil { + if err := os.RemoveAll(hivesPath); err != nil { + return errors.Wrap(err, "failed to remove prexisting hives directory") + } + } + if _, err := os.Stat(layoutPath); err == nil { + if err := os.RemoveAll(layoutPath); err != nil { + return errors.Wrap(err, "failed to remove prexisting layout file") + } + } + + if _, err := os.Stat(baseVhdPath); err == nil { + if err := os.RemoveAll(baseVhdPath); err != nil { + return errors.Wrap(err, "failed to remove base vhdx path") + } + } + if _, err := os.Stat(diffVhdPath); err == nil { + if err := os.RemoveAll(diffVhdPath); err != nil { + return errors.Wrap(err, "failed to remove differencing vhdx") + } + } + + createParams := &vhd.CreateVirtualDiskParameters{ + Version: 2, + Version2: vhd.CreateVersion2{ + MaximumSize: sizeInGB * 1024 * 1024 * 1024, + BlockSizeInBytes: defaultVHDXBlockSizeInMB * 1024 * 1024, + }, + } + handle, err := vhd.CreateVirtualDisk(baseVhdPath, vhd.VirtualDiskAccessNone, vhd.CreateVirtualDiskFlagNone, createParams) + if err != nil { + return errors.Wrap(err, "failed to create vhdx") + } + + defer func() { + if err != nil { + _ = syscall.CloseHandle(handle) + os.RemoveAll(baseVhdPath) + os.RemoveAll(diffVhdPath) + } + }() + + if err = FormatWritableLayerVhd(ctx, windows.Handle(handle)); err != nil { + return err + } + // Base vhd handle must be closed before calling SetupBaseLayer in case of Container layer + if err = syscall.CloseHandle(handle); err != nil { + return errors.Wrap(err, "failed to close vhdx handle") + } + + options := OsLayerOptions{ + Type: OsLayerTypeContainer, + } + + // SetupBaseOSLayer expects an empty vhd handle for a container layer and will + // error out otherwise. + if err = SetupBaseOSLayer(ctx, layerPath, 0, options); err != nil { + return err + } + // Create the differencing disk that will be what's copied for the final rw layer + // for a container. + if err = vhd.CreateDiffVhd(diffVhdPath, baseVhdPath, defaultVHDXBlockSizeInMB); err != nil { + return errors.Wrap(err, "failed to create differencing disk") + } + + if err = security.GrantVmGroupAccess(baseVhdPath); err != nil { + return errors.Wrapf(err, "failed to grant vm group access to %s", baseVhdPath) + } + if err = security.GrantVmGroupAccess(diffVhdPath); err != nil { + return errors.Wrapf(err, "failed to grant vm group access to %s", diffVhdPath) + } + return nil +} + +// SetupUtilityVMBaseLayer is a helper to setup a UVMs scratch space. It will create and format +// the vhdx inside and the size is configurable by the sizeInGB parameter. +// +// `uvmPath` is the path to the UtilityVM filesystem. +// +// `baseVhdPath` is the path to where the base vhdx for the UVM should be created. +// +// `diffVhdPath` is the path where the differencing disk for the UVM should be created. +// +// `sizeInGB` specifies the size in gigabytes to make the base vhdx. +func SetupUtilityVMBaseLayer(ctx context.Context, uvmPath, baseVhdPath, diffVhdPath string, sizeInGB uint64) (err error) { + // Remove the base and differencing disks if they exist in case we're asking for a different size. + if _, err := os.Stat(baseVhdPath); err == nil { + if err := os.RemoveAll(baseVhdPath); err != nil { + return errors.Wrap(err, "failed to remove base vhdx") + } + } + if _, err := os.Stat(diffVhdPath); err == nil { + if err := os.RemoveAll(diffVhdPath); err != nil { + return errors.Wrap(err, "failed to remove differencing vhdx") + } + } + + // Just create the vhdx for utilityVM layer, no need to format it. + createParams := &vhd.CreateVirtualDiskParameters{ + Version: 2, + Version2: vhd.CreateVersion2{ + MaximumSize: sizeInGB * 1024 * 1024 * 1024, + BlockSizeInBytes: defaultVHDXBlockSizeInMB * 1024 * 1024, + }, + } + handle, err := vhd.CreateVirtualDisk(baseVhdPath, vhd.VirtualDiskAccessNone, vhd.CreateVirtualDiskFlagNone, createParams) + if err != nil { + return errors.Wrap(err, "failed to create vhdx") + } + + defer func() { + if err != nil { + _ = syscall.CloseHandle(handle) + os.RemoveAll(baseVhdPath) + os.RemoveAll(diffVhdPath) + } + }() + + // If it is a UtilityVM layer then the base vhdx must be attached when calling + // `SetupBaseOSLayer` + attachParams := &vhd.AttachVirtualDiskParameters{ + Version: 2, + } + if err := vhd.AttachVirtualDisk(handle, vhd.AttachVirtualDiskFlagNone, attachParams); err != nil { + return errors.Wrapf(err, "failed to attach virtual disk") + } + + options := OsLayerOptions{ + Type: OsLayerTypeVM, + } + if err := SetupBaseOSLayer(ctx, uvmPath, windows.Handle(handle), options); err != nil { + return err + } + + // Detach and close the handle after setting up the layer as we don't need the handle + // for anything else and we no longer need to be attached either. + if err = vhd.DetachVirtualDisk(handle); err != nil { + return errors.Wrap(err, "failed to detach vhdx") + } + if err = syscall.CloseHandle(handle); err != nil { + return errors.Wrap(err, "failed to close vhdx handle") + } + + // Create the differencing disk that will be what's copied for the final rw layer + // for a container. + if err = vhd.CreateDiffVhd(diffVhdPath, baseVhdPath, defaultVHDXBlockSizeInMB); err != nil { + return errors.Wrap(err, "failed to create differencing disk") + } + + if err := security.GrantVmGroupAccess(baseVhdPath); err != nil { + return errors.Wrapf(err, "failed to grant vm group access to %s", baseVhdPath) + } + if err := security.GrantVmGroupAccess(diffVhdPath); err != nil { + return errors.Wrapf(err, "failed to grant vm group access to %s", diffVhdPath) + } + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/computestorage/import.go b/vendor/github.com/Microsoft/hcsshim/computestorage/import.go new file mode 100644 index 00000000..0c61dab3 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/computestorage/import.go @@ -0,0 +1,41 @@ +package computestorage + +import ( + "context" + "encoding/json" + + "github.com/Microsoft/hcsshim/internal/oc" + "github.com/pkg/errors" + "go.opencensus.io/trace" +) + +// ImportLayer imports a container layer. +// +// `layerPath` is a path to a directory to import the layer to. If the directory +// does not exist it will be automatically created. +// +// `sourceFolderpath` is a pre-existing folder that contains the layer to +// import. +// +// `layerData` is the parent layer data. +func ImportLayer(ctx context.Context, layerPath, sourceFolderPath string, layerData LayerData) (err error) { + title := "hcsshim.ImportLayer" + ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("layerPath", layerPath), + trace.StringAttribute("sourceFolderPath", sourceFolderPath), + ) + + bytes, err := json.Marshal(layerData) + if err != nil { + return err + } + + err = hcsImportLayer(layerPath, sourceFolderPath, string(bytes)) + if err != nil { + return errors.Wrap(err, "failed to import layer") + } + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/computestorage/initialize.go b/vendor/github.com/Microsoft/hcsshim/computestorage/initialize.go new file mode 100644 index 00000000..53ed8ea6 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/computestorage/initialize.go @@ -0,0 +1,38 @@ +package computestorage + +import ( + "context" + "encoding/json" + + "github.com/Microsoft/hcsshim/internal/oc" + "github.com/pkg/errors" + "go.opencensus.io/trace" +) + +// InitializeWritableLayer initializes a writable layer for a container. +// +// `layerPath` is a path to a directory the layer is mounted. If the +// path does not end in a `\` the platform will append it automatically. +// +// `layerData` is the parent read-only layer data. +func InitializeWritableLayer(ctx context.Context, layerPath string, layerData LayerData) (err error) { + title := "hcsshim.InitializeWritableLayer" + ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("layerPath", layerPath), + ) + + bytes, err := json.Marshal(layerData) + if err != nil { + return err + } + + // Options are not used in the platform as of RS5 + err = hcsInitializeWritableLayer(layerPath, string(bytes), "") + if err != nil { + return errors.Wrap(err, "failed to intitialize container layer") + } + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/computestorage/mount.go b/vendor/github.com/Microsoft/hcsshim/computestorage/mount.go new file mode 100644 index 00000000..fcdbbef8 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/computestorage/mount.go @@ -0,0 +1,27 @@ +package computestorage + +import ( + "context" + + "github.com/Microsoft/hcsshim/internal/interop" + "github.com/Microsoft/hcsshim/internal/oc" + "github.com/pkg/errors" + "go.opencensus.io/trace" + "golang.org/x/sys/windows" +) + +// GetLayerVhdMountPath returns the volume path for a virtual disk of a writable container layer. +func GetLayerVhdMountPath(ctx context.Context, vhdHandle windows.Handle) (path string, err error) { + title := "hcsshim.GetLayerVhdMountPath" + ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + + var mountPath *uint16 + err = hcsGetLayerVhdMountPath(vhdHandle, &mountPath) + if err != nil { + return "", errors.Wrap(err, "failed to get vhd mount path") + } + path = interop.ConvertAndFreeCoTaskMemString(mountPath) + return path, nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/computestorage/setup.go b/vendor/github.com/Microsoft/hcsshim/computestorage/setup.go new file mode 100644 index 00000000..ca7b40ef --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/computestorage/setup.go @@ -0,0 +1,74 @@ +package computestorage + +import ( + "context" + "encoding/json" + + "github.com/Microsoft/hcsshim/internal/oc" + "github.com/Microsoft/hcsshim/osversion" + "github.com/pkg/errors" + "go.opencensus.io/trace" + "golang.org/x/sys/windows" +) + +// SetupBaseOSLayer sets up a layer that contains a base OS for a container. +// +// `layerPath` is a path to a directory containing the layer. +// +// `vhdHandle` is an empty file handle of `options.Type == OsLayerTypeContainer` +// or else it is a file handle to the 'SystemTemplateBase.vhdx' if `options.Type +// == OsLayerTypeVm`. +// +// `options` are the options applied while processing the layer. +func SetupBaseOSLayer(ctx context.Context, layerPath string, vhdHandle windows.Handle, options OsLayerOptions) (err error) { + title := "hcsshim.SetupBaseOSLayer" + ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("layerPath", layerPath), + ) + + bytes, err := json.Marshal(options) + if err != nil { + return err + } + + err = hcsSetupBaseOSLayer(layerPath, vhdHandle, string(bytes)) + if err != nil { + return errors.Wrap(err, "failed to setup base OS layer") + } + return nil +} + +// SetupBaseOSVolume sets up a volume that contains a base OS for a container. +// +// `layerPath` is a path to a directory containing the layer. +// +// `volumePath` is the path to the volume to be used for setup. +// +// `options` are the options applied while processing the layer. +func SetupBaseOSVolume(ctx context.Context, layerPath, volumePath string, options OsLayerOptions) (err error) { + if osversion.Get().Build < 19645 { + return errors.New("SetupBaseOSVolume is not present on builds older than 19645") + } + title := "hcsshim.SetupBaseOSVolume" + ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("layerPath", layerPath), + trace.StringAttribute("volumePath", volumePath), + ) + + bytes, err := json.Marshal(options) + if err != nil { + return err + } + + err = hcsSetupBaseOSVolume(layerPath, volumePath, string(bytes)) + if err != nil { + return errors.Wrap(err, "failed to setup base OS layer") + } + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/computestorage/storage.go b/vendor/github.com/Microsoft/hcsshim/computestorage/storage.go new file mode 100644 index 00000000..9cd283d4 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/computestorage/storage.go @@ -0,0 +1,50 @@ +// Package computestorage is a wrapper around the HCS storage APIs. These are new storage APIs introduced +// separate from the original graphdriver calls intended to give more freedom around creating +// and managing container layers and scratch spaces. +package computestorage + +import ( + hcsschema "github.com/Microsoft/hcsshim/internal/schema2" +) + +//go:generate go run ../mksyscall_windows.go -output zsyscall_windows.go storage.go + +//sys hcsImportLayer(layerPath string, sourceFolderPath string, layerData string) (hr error) = computestorage.HcsImportLayer? +//sys hcsExportLayer(layerPath string, exportFolderPath string, layerData string, options string) (hr error) = computestorage.HcsExportLayer? +//sys hcsDestroyLayer(layerPath string) (hr error) = computestorage.HcsDestoryLayer? +//sys hcsSetupBaseOSLayer(layerPath string, handle windows.Handle, options string) (hr error) = computestorage.HcsSetupBaseOSLayer? +//sys hcsInitializeWritableLayer(writableLayerPath string, layerData string, options string) (hr error) = computestorage.HcsInitializeWritableLayer? +//sys hcsAttachLayerStorageFilter(layerPath string, layerData string) (hr error) = computestorage.HcsAttachLayerStorageFilter? +//sys hcsDetachLayerStorageFilter(layerPath string) (hr error) = computestorage.HcsDetachLayerStorageFilter? +//sys hcsFormatWritableLayerVhd(handle windows.Handle) (hr error) = computestorage.HcsFormatWritableLayerVhd? +//sys hcsGetLayerVhdMountPath(vhdHandle windows.Handle, mountPath **uint16) (hr error) = computestorage.HcsGetLayerVhdMountPath? +//sys hcsSetupBaseOSVolume(layerPath string, volumePath string, options string) (hr error) = computestorage.HcsSetupBaseOSVolume? + +// LayerData is the data used to describe parent layer information. +type LayerData struct { + SchemaVersion hcsschema.Version `json:"SchemaVersion,omitempty"` + Layers []hcsschema.Layer `json:"Layers,omitempty"` +} + +// ExportLayerOptions are the set of options that are used with the `computestorage.HcsExportLayer` syscall. +type ExportLayerOptions struct { + IsWritableLayer bool `json:"IsWritableLayer,omitempty"` +} + +// OsLayerType is the type of layer being operated on. +type OsLayerType string + +const ( + // OsLayerTypeContainer is a container layer. + OsLayerTypeContainer OsLayerType = "Container" + // OsLayerTypeVM is a virtual machine layer. + OsLayerTypeVM OsLayerType = "Vm" +) + +// OsLayerOptions are the set of options that are used with the `SetupBaseOSLayer` and +// `SetupBaseOSVolume` calls. +type OsLayerOptions struct { + Type OsLayerType `json:"Type,omitempty"` + DisableCiCacheOptimization bool `json:"DisableCiCacheOptimization,omitempty"` + SkipUpdateBcdForBoot bool `json:"SkipUpdateBcdForBoot,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/computestorage/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/computestorage/zsyscall_windows.go new file mode 100644 index 00000000..4f951806 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/computestorage/zsyscall_windows.go @@ -0,0 +1,319 @@ +// Code generated mksyscall_windows.exe DO NOT EDIT + +package computestorage + +import ( + "syscall" + "unsafe" + + "golang.org/x/sys/windows" +) + +var _ unsafe.Pointer + +// Do the interface allocations only once for common +// Errno values. +const ( + errnoERROR_IO_PENDING = 997 +) + +var ( + errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) +) + +// errnoErr returns common boxed Errno values, to prevent +// allocations at runtime. +func errnoErr(e syscall.Errno) error { + switch e { + case 0: + return nil + case errnoERROR_IO_PENDING: + return errERROR_IO_PENDING + } + // TODO: add more here, after collecting data on the common + // error values see on Windows. (perhaps when running + // all.bat?) + return e +} + +var ( + modcomputestorage = windows.NewLazySystemDLL("computestorage.dll") + + procHcsImportLayer = modcomputestorage.NewProc("HcsImportLayer") + procHcsExportLayer = modcomputestorage.NewProc("HcsExportLayer") + procHcsDestoryLayer = modcomputestorage.NewProc("HcsDestoryLayer") + procHcsSetupBaseOSLayer = modcomputestorage.NewProc("HcsSetupBaseOSLayer") + procHcsInitializeWritableLayer = modcomputestorage.NewProc("HcsInitializeWritableLayer") + procHcsAttachLayerStorageFilter = modcomputestorage.NewProc("HcsAttachLayerStorageFilter") + procHcsDetachLayerStorageFilter = modcomputestorage.NewProc("HcsDetachLayerStorageFilter") + procHcsFormatWritableLayerVhd = modcomputestorage.NewProc("HcsFormatWritableLayerVhd") + procHcsGetLayerVhdMountPath = modcomputestorage.NewProc("HcsGetLayerVhdMountPath") + procHcsSetupBaseOSVolume = modcomputestorage.NewProc("HcsSetupBaseOSVolume") +) + +func hcsImportLayer(layerPath string, sourceFolderPath string, layerData string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(layerPath) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(sourceFolderPath) + if hr != nil { + return + } + var _p2 *uint16 + _p2, hr = syscall.UTF16PtrFromString(layerData) + if hr != nil { + return + } + return _hcsImportLayer(_p0, _p1, _p2) +} + +func _hcsImportLayer(layerPath *uint16, sourceFolderPath *uint16, layerData *uint16) (hr error) { + if hr = procHcsImportLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsImportLayer.Addr(), 3, uintptr(unsafe.Pointer(layerPath)), uintptr(unsafe.Pointer(sourceFolderPath)), uintptr(unsafe.Pointer(layerData))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsExportLayer(layerPath string, exportFolderPath string, layerData string, options string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(layerPath) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(exportFolderPath) + if hr != nil { + return + } + var _p2 *uint16 + _p2, hr = syscall.UTF16PtrFromString(layerData) + if hr != nil { + return + } + var _p3 *uint16 + _p3, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsExportLayer(_p0, _p1, _p2, _p3) +} + +func _hcsExportLayer(layerPath *uint16, exportFolderPath *uint16, layerData *uint16, options *uint16) (hr error) { + if hr = procHcsExportLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsExportLayer.Addr(), 4, uintptr(unsafe.Pointer(layerPath)), uintptr(unsafe.Pointer(exportFolderPath)), uintptr(unsafe.Pointer(layerData)), uintptr(unsafe.Pointer(options)), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsDestroyLayer(layerPath string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(layerPath) + if hr != nil { + return + } + return _hcsDestroyLayer(_p0) +} + +func _hcsDestroyLayer(layerPath *uint16) (hr error) { + if hr = procHcsDestoryLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsDestoryLayer.Addr(), 1, uintptr(unsafe.Pointer(layerPath)), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsSetupBaseOSLayer(layerPath string, handle windows.Handle, options string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(layerPath) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsSetupBaseOSLayer(_p0, handle, _p1) +} + +func _hcsSetupBaseOSLayer(layerPath *uint16, handle windows.Handle, options *uint16) (hr error) { + if hr = procHcsSetupBaseOSLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsSetupBaseOSLayer.Addr(), 3, uintptr(unsafe.Pointer(layerPath)), uintptr(handle), uintptr(unsafe.Pointer(options))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsInitializeWritableLayer(writableLayerPath string, layerData string, options string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(writableLayerPath) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(layerData) + if hr != nil { + return + } + var _p2 *uint16 + _p2, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsInitializeWritableLayer(_p0, _p1, _p2) +} + +func _hcsInitializeWritableLayer(writableLayerPath *uint16, layerData *uint16, options *uint16) (hr error) { + if hr = procHcsInitializeWritableLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsInitializeWritableLayer.Addr(), 3, uintptr(unsafe.Pointer(writableLayerPath)), uintptr(unsafe.Pointer(layerData)), uintptr(unsafe.Pointer(options))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsAttachLayerStorageFilter(layerPath string, layerData string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(layerPath) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(layerData) + if hr != nil { + return + } + return _hcsAttachLayerStorageFilter(_p0, _p1) +} + +func _hcsAttachLayerStorageFilter(layerPath *uint16, layerData *uint16) (hr error) { + if hr = procHcsAttachLayerStorageFilter.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsAttachLayerStorageFilter.Addr(), 2, uintptr(unsafe.Pointer(layerPath)), uintptr(unsafe.Pointer(layerData)), 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsDetachLayerStorageFilter(layerPath string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(layerPath) + if hr != nil { + return + } + return _hcsDetachLayerStorageFilter(_p0) +} + +func _hcsDetachLayerStorageFilter(layerPath *uint16) (hr error) { + if hr = procHcsDetachLayerStorageFilter.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsDetachLayerStorageFilter.Addr(), 1, uintptr(unsafe.Pointer(layerPath)), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsFormatWritableLayerVhd(handle windows.Handle) (hr error) { + if hr = procHcsFormatWritableLayerVhd.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsFormatWritableLayerVhd.Addr(), 1, uintptr(handle), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsGetLayerVhdMountPath(vhdHandle windows.Handle, mountPath **uint16) (hr error) { + if hr = procHcsGetLayerVhdMountPath.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsGetLayerVhdMountPath.Addr(), 2, uintptr(vhdHandle), uintptr(unsafe.Pointer(mountPath)), 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsSetupBaseOSVolume(layerPath string, volumePath string, options string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(layerPath) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(volumePath) + if hr != nil { + return + } + var _p2 *uint16 + _p2, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsSetupBaseOSVolume(_p0, _p1, _p2) +} + +func _hcsSetupBaseOSVolume(layerPath *uint16, volumePath *uint16, options *uint16) (hr error) { + if hr = procHcsSetupBaseOSVolume.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsSetupBaseOSVolume.Addr(), 3, uintptr(unsafe.Pointer(layerPath)), uintptr(unsafe.Pointer(volumePath)), uintptr(unsafe.Pointer(options))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} diff --git a/vendor/github.com/Microsoft/hcsshim/container.go b/vendor/github.com/Microsoft/hcsshim/container.go index e142c315..7205a62c 100644 --- a/vendor/github.com/Microsoft/hcsshim/container.go +++ b/vendor/github.com/Microsoft/hcsshim/container.go @@ -1,8 +1,10 @@ package hcsshim import ( + "context" "fmt" "os" + "sync" "time" "github.com/Microsoft/hcsshim/internal/hcs" @@ -52,7 +54,10 @@ const ( type ResourceModificationRequestResponse = schema1.ResourceModificationRequestResponse type container struct { - system *hcs.System + system *hcs.System + waitOnce sync.Once + waitErr error + waitCh chan struct{} } // createComputeSystemAdditionalJSON is read from the environment at initialisation @@ -71,61 +76,87 @@ func CreateContainer(id string, c *ContainerConfig) (Container, error) { return nil, fmt.Errorf("failed to merge additional JSON '%s': %s", createContainerAdditionalJSON, err) } - system, err := hcs.CreateComputeSystem(id, fullConfig) + system, err := hcs.CreateComputeSystem(context.Background(), id, fullConfig) if err != nil { return nil, err } - return &container{system}, err + return &container{system: system}, err } // OpenContainer opens an existing container by ID. func OpenContainer(id string) (Container, error) { - system, err := hcs.OpenComputeSystem(id) + system, err := hcs.OpenComputeSystem(context.Background(), id) if err != nil { return nil, err } - return &container{system}, err + return &container{system: system}, err } // GetContainers gets a list of the containers on the system that match the query func GetContainers(q ComputeSystemQuery) ([]ContainerProperties, error) { - return hcs.GetComputeSystems(q) + return hcs.GetComputeSystems(context.Background(), q) } // Start synchronously starts the container. func (container *container) Start() error { - return convertSystemError(container.system.Start(), container) + return convertSystemError(container.system.Start(context.Background()), container) } // Shutdown requests a container shutdown, but it may not actually be shutdown until Wait() succeeds. func (container *container) Shutdown() error { - return convertSystemError(container.system.Shutdown(), container) + err := container.system.Shutdown(context.Background()) + if err != nil { + return convertSystemError(err, container) + } + return &ContainerError{Container: container, Err: ErrVmcomputeOperationPending, Operation: "hcsshim::ComputeSystem::Shutdown"} } // Terminate requests a container terminate, but it may not actually be terminated until Wait() succeeds. func (container *container) Terminate() error { - return convertSystemError(container.system.Terminate(), container) + err := container.system.Terminate(context.Background()) + if err != nil { + return convertSystemError(err, container) + } + return &ContainerError{Container: container, Err: ErrVmcomputeOperationPending, Operation: "hcsshim::ComputeSystem::Terminate"} } // Waits synchronously waits for the container to shutdown or terminate. func (container *container) Wait() error { - return convertSystemError(container.system.Wait(), container) + err := container.system.Wait() + if err == nil { + err = container.system.ExitError() + } + return convertSystemError(err, container) } // WaitTimeout synchronously waits for the container to terminate or the duration to elapse. It // returns false if timeout occurs. -func (container *container) WaitTimeout(t time.Duration) error { - return convertSystemError(container.system.WaitTimeout(t), container) +func (container *container) WaitTimeout(timeout time.Duration) error { + container.waitOnce.Do(func() { + container.waitCh = make(chan struct{}) + go func() { + container.waitErr = container.Wait() + close(container.waitCh) + }() + }) + t := time.NewTimer(timeout) + defer t.Stop() + select { + case <-t.C: + return &ContainerError{Container: container, Err: ErrTimeout, Operation: "hcsshim::ComputeSystem::Wait"} + case <-container.waitCh: + return container.waitErr + } } // Pause pauses the execution of a container. func (container *container) Pause() error { - return convertSystemError(container.system.Pause(), container) + return convertSystemError(container.system.Pause(context.Background()), container) } // Resume resumes the execution of a container. func (container *container) Resume() error { - return convertSystemError(container.system.Resume(), container) + return convertSystemError(container.system.Resume(context.Background()), container) } // HasPendingUpdates returns true if the container has updates pending to install @@ -135,7 +166,7 @@ func (container *container) HasPendingUpdates() (bool, error) { // Statistics returns statistics for the container. This is a legacy v1 call func (container *container) Statistics() (Statistics, error) { - properties, err := container.system.Properties(schema1.PropertyTypeStatistics) + properties, err := container.system.Properties(context.Background(), schema1.PropertyTypeStatistics) if err != nil { return Statistics{}, convertSystemError(err, container) } @@ -145,7 +176,7 @@ func (container *container) Statistics() (Statistics, error) { // ProcessList returns an array of ProcessListItems for the container. This is a legacy v1 call func (container *container) ProcessList() ([]ProcessListItem, error) { - properties, err := container.system.Properties(schema1.PropertyTypeProcessList) + properties, err := container.system.Properties(context.Background(), schema1.PropertyTypeProcessList) if err != nil { return nil, convertSystemError(err, container) } @@ -155,7 +186,7 @@ func (container *container) ProcessList() ([]ProcessListItem, error) { // This is a legacy v1 call func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskController, error) { - properties, err := container.system.Properties(schema1.PropertyTypeMappedVirtualDisk) + properties, err := container.system.Properties(context.Background(), schema1.PropertyTypeMappedVirtualDisk) if err != nil { return nil, convertSystemError(err, container) } @@ -165,20 +196,20 @@ func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskContr // CreateProcess launches a new process within the container. func (container *container) CreateProcess(c *ProcessConfig) (Process, error) { - p, err := container.system.CreateProcess(c) + p, err := container.system.CreateProcess(context.Background(), c) if err != nil { return nil, convertSystemError(err, container) } - return &process{p}, nil + return &process{p: p.(*hcs.Process)}, nil } // OpenProcess gets an interface to an existing process within the container. func (container *container) OpenProcess(pid int) (Process, error) { - p, err := container.system.OpenProcess(pid) + p, err := container.system.OpenProcess(context.Background(), pid) if err != nil { return nil, convertSystemError(err, container) } - return &process{p}, nil + return &process{p: p}, nil } // Close cleans up any state associated with the container but does not terminate or wait for it. @@ -188,5 +219,5 @@ func (container *container) Close() error { // Modify the System func (container *container) Modify(config *ResourceModificationRequestResponse) error { - return convertSystemError(container.system.Modify(config), container) + return convertSystemError(container.system.Modify(context.Background(), config), container) } diff --git a/vendor/github.com/Microsoft/hcsshim/errors.go b/vendor/github.com/Microsoft/hcsshim/errors.go index 63efa23c..79430867 100644 --- a/vendor/github.com/Microsoft/hcsshim/errors.go +++ b/vendor/github.com/Microsoft/hcsshim/errors.go @@ -83,7 +83,6 @@ type NetworkNotFoundError = hns.NetworkNotFoundError type ProcessError struct { Process *process Operation string - ExtraInfo string Err error Events []hcs.ErrorEvent } @@ -92,7 +91,6 @@ type ProcessError struct { type ContainerError struct { Container *container Operation string - ExtraInfo string Err error Events []hcs.ErrorEvent } @@ -125,22 +123,9 @@ func (e *ContainerError) Error() string { s += "\n" + ev.String() } - if e.ExtraInfo != "" { - s += " extra info: " + e.ExtraInfo - } - return s } -func makeContainerError(container *container, operation string, extraInfo string, err error) error { - // Don't double wrap errors - if _, ok := err.(*ContainerError); ok { - return err - } - containerError := &ContainerError{Container: container, Operation: operation, ExtraInfo: extraInfo, Err: err} - return containerError -} - func (e *ProcessError) Error() string { if e == nil { return "" @@ -171,15 +156,6 @@ func (e *ProcessError) Error() string { return s } -func makeProcessError(process *process, operation string, extraInfo string, err error) error { - // Don't double wrap errors - if _, ok := err.(*ProcessError); ok { - return err - } - processError := &ProcessError{Process: process, Operation: operation, ExtraInfo: extraInfo, Err: err} - return processError -} - // IsNotExist checks if an error is caused by the Container or Process not existing. // Note: Currently, ErrElementNotFound can mean that a Process has either // already exited, or does not exist. Both IsAlreadyStopped and IsNotExist @@ -230,6 +206,18 @@ func IsNotSupported(err error) bool { return hcs.IsNotSupported(getInnerError(err)) } +// IsOperationInvalidState returns true when err is caused by +// `ErrVmcomputeOperationInvalidState`. +func IsOperationInvalidState(err error) bool { + return hcs.IsOperationInvalidState(getInnerError(err)) +} + +// IsAccessIsDenied returns true when err is caused by +// `ErrVmcomputeOperationAccessIsDenied`. +func IsAccessIsDenied(err error) bool { + return hcs.IsAccessIsDenied(getInnerError(err)) +} + func getInnerError(err error) error { switch pe := err.(type) { case nil: @@ -244,7 +232,7 @@ func getInnerError(err error) error { func convertSystemError(err error, c *container) error { if serr, ok := err.(*hcs.SystemError); ok { - return &ContainerError{Container: c, Operation: serr.Op, ExtraInfo: serr.Extra, Err: serr.Err, Events: serr.Events} + return &ContainerError{Container: c, Operation: serr.Op, Err: serr.Err, Events: serr.Events} } return err } diff --git a/vendor/github.com/Microsoft/hcsshim/go.mod b/vendor/github.com/Microsoft/hcsshim/go.mod new file mode 100644 index 00000000..6e52f732 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/go.mod @@ -0,0 +1,22 @@ +module github.com/Microsoft/hcsshim + +go 1.13 + +require ( + github.com/Microsoft/go-winio v0.4.17-0.20210211115548-6eac466e5fa3 + github.com/containerd/cgroups v0.0.0-20210114181951-8a68de567b68 + github.com/containerd/console v1.0.1 + github.com/containerd/containerd v1.5.0-beta.4 + github.com/containerd/go-runc v0.0.0-20201020171139-16b287bc67d0 + github.com/containerd/ttrpc v1.0.2 + github.com/containerd/typeurl v1.0.1 + github.com/gogo/protobuf v1.3.2 + github.com/opencontainers/runtime-spec v1.0.3-0.20200929063507-e6143ca7d51d + github.com/pkg/errors v0.9.1 + github.com/sirupsen/logrus v1.7.0 + github.com/urfave/cli v1.22.2 + go.opencensus.io v0.22.3 + golang.org/x/sync v0.0.0-20201207232520-09787c993a3a + golang.org/x/sys v0.0.0-20210324051608-47abb6519492 + google.golang.org/grpc v1.33.2 +) diff --git a/vendor/github.com/Microsoft/hcsshim/go.sum b/vendor/github.com/Microsoft/hcsshim/go.sum new file mode 100644 index 00000000..545bb60b --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/go.sum @@ -0,0 +1,851 @@ +bazil.org/fuse v0.0.0-20160811212531-371fbbdaa898/go.mod h1:Xbm+BRKSBEpa4q4hTSxohYNQpsxXPbPry4JJWOB3LB8= +cloud.google.com/go v0.26.0/go.mod h1:aQUYkXzVsufM+DwF1aE+0xfcU+56JwCaLick0ClmMTw= +cloud.google.com/go v0.34.0/go.mod h1:aQUYkXzVsufM+DwF1aE+0xfcU+56JwCaLick0ClmMTw= +cloud.google.com/go v0.38.0/go.mod h1:990N+gfupTy94rShfmMCWGDn0LpTmnzTp2qbd1dvSRU= +cloud.google.com/go v0.44.1/go.mod h1:iSa0KzasP4Uvy3f1mN/7PiObzGgflwredwwASm/v6AU= +cloud.google.com/go v0.44.2/go.mod h1:60680Gw3Yr4ikxnPRS/oxxkBccT6SA1yMk63TGekxKY= +cloud.google.com/go v0.45.1/go.mod h1:RpBamKRgapWJb87xiFSdk4g1CME7QZg3uwTez+TSTjc= +cloud.google.com/go v0.46.3/go.mod h1:a6bKKbmY7er1mI7TEI4lsAkts/mkhTSZK8w33B4RAg0= +cloud.google.com/go v0.50.0/go.mod h1:r9sluTvynVuxRIOHXQEHMFffphuXHOMZMycpNR5e6To= +cloud.google.com/go v0.52.0/go.mod h1:pXajvRH/6o3+F9jDHZWQ5PbGhn+o8w9qiu/CffaVdO4= +cloud.google.com/go v0.53.0/go.mod h1:fp/UouUEsRkN6ryDKNW/Upv/JBKnv6WDthjR6+vze6M= +cloud.google.com/go v0.54.0/go.mod h1:1rq2OEkV3YMf6n/9ZvGWI3GWw0VoqH/1x2nd8Is/bPc= +cloud.google.com/go/bigquery v1.0.1/go.mod h1:i/xbL2UlR5RvWAURpBYZTtm/cXjCha9lbfbpx4poX+o= +cloud.google.com/go/bigquery v1.3.0/go.mod h1:PjpwJnslEMmckchkHFfq+HTD2DmtT67aNFKH1/VBDHE= +cloud.google.com/go/bigquery v1.4.0/go.mod h1:S8dzgnTigyfTmLBfrtrhyYhwRxG72rYxvftPBK2Dvzc= +cloud.google.com/go/datastore v1.0.0/go.mod h1:LXYbyblFSglQ5pkeyhO+Qmw7ukd3C+pD7TKLgZqpHYE= +cloud.google.com/go/datastore v1.1.0/go.mod h1:umbIZjpQpHh4hmRpGhH4tLFup+FVzqBi1b3c64qFpCk= +cloud.google.com/go/pubsub v1.0.1/go.mod h1:R0Gpsv3s54REJCy4fxDixWD93lHJMoZTyQ2kNxGRt3I= +cloud.google.com/go/pubsub v1.1.0/go.mod h1:EwwdRX2sKPjnvnqCa270oGRyludottCI76h+R3AArQw= +cloud.google.com/go/pubsub v1.2.0/go.mod h1:jhfEVHT8odbXTkndysNHCcx0awwzvfOlguIAii9o8iA= +cloud.google.com/go/storage v1.0.0/go.mod h1:IhtSnM/ZTZV8YYJWCY8RULGVqBDmpoyjwiyrjsg+URw= +cloud.google.com/go/storage v1.5.0/go.mod h1:tpKbwo567HUNpVclU5sGELwQWBDZ8gh0ZeosJ0Rtdos= +cloud.google.com/go/storage v1.6.0/go.mod h1:N7U0C8pVQ/+NIKOBQyamJIeKQKkZ+mxpohlUTyfDhBk= +dmitri.shuralyov.com/gpu/mtl v0.0.0-20190408044501-666a987793e9/go.mod h1:H6x//7gZCb22OMCxBHrMx7a5I7Hp++hsVxbQ4BYO7hU= +github.com/Azure/azure-sdk-for-go v16.2.1+incompatible/go.mod h1:9XXNKU+eRnpl9moKnB4QOLf1HestfXbmab5FXxiDBjc= +github.com/Azure/go-ansiterm v0.0.0-20170929234023-d6e3b3328b78/go.mod h1:LmzpDX56iTiv29bbRTIsUNlaFfuhWRQBWjQdVyAevI8= +github.com/Azure/go-autorest v10.8.1+incompatible/go.mod h1:r+4oMnoxhatjLLJ6zxSWATqVooLgysK6ZNox3g/xq24= +github.com/Azure/go-autorest v14.2.0+incompatible/go.mod h1:r+4oMnoxhatjLLJ6zxSWATqVooLgysK6ZNox3g/xq24= +github.com/Azure/go-autorest/autorest v0.11.1/go.mod h1:JFgpikqFJ/MleTTxwepExTKnFUKKszPS8UavbQYUMuw= +github.com/Azure/go-autorest/autorest/adal v0.9.0/go.mod h1:/c022QCutn2P7uY+/oQWWNcK9YU+MH96NgK+jErpbcg= +github.com/Azure/go-autorest/autorest/adal v0.9.5/go.mod h1:B7KF7jKIeC9Mct5spmyCB/A8CG/sEz1vwIRGv/bbw7A= +github.com/Azure/go-autorest/autorest/date v0.3.0/go.mod h1:BI0uouVdmngYNUzGWeSYnokU+TrmwEsOqdt8Y6sso74= +github.com/Azure/go-autorest/autorest/mocks v0.4.0/go.mod h1:LTp+uSrOhSkaKrUy935gNZuuIPPVsHlr9DSOxSayd+k= +github.com/Azure/go-autorest/autorest/mocks v0.4.1/go.mod h1:LTp+uSrOhSkaKrUy935gNZuuIPPVsHlr9DSOxSayd+k= +github.com/Azure/go-autorest/logger v0.2.0/go.mod h1:T9E3cAhj2VqvPOtCYAvby9aBXkZmbF5NWuPV8+WeEW8= +github.com/Azure/go-autorest/tracing v0.6.0/go.mod h1:+vhtPC754Xsa23ID7GlGsrdKBpUA79WCAKPPZVC2DeU= +github.com/BurntSushi/toml v0.3.1/go.mod h1:xHWCNGjB5oqiDr8zfno3MHue2Ht5sIBksp03qcyfWMU= +github.com/BurntSushi/xgb v0.0.0-20160522181843-27f122750802/go.mod h1:IVnqGOEym/WlBOVXweHU+Q+/VP0lqqI8lqeDx9IjBqo= +github.com/Microsoft/go-winio v0.4.11/go.mod h1:VhR8bwka0BXejwEJY73c50VrPtXAaKcyvVC4A4RozmA= +github.com/Microsoft/go-winio v0.4.14/go.mod h1:qXqCSQ3Xa7+6tgxaGTIe4Kpcdsi+P8jBhyzoq1bpyYA= +github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5/go.mod h1:tTuCMEN+UleMWgg9dVx4Hu52b1bJo+59jBh3ajtinzw= +github.com/Microsoft/go-winio v0.4.16-0.20201130162521-d1ffc52c7331/go.mod h1:XB6nPKklQyQ7GC9LdcBEcBl8PF76WugXOPRXwdLnMv0= +github.com/Microsoft/go-winio v0.4.16/go.mod h1:XB6nPKklQyQ7GC9LdcBEcBl8PF76WugXOPRXwdLnMv0= +github.com/Microsoft/go-winio v0.4.17-0.20210211115548-6eac466e5fa3 h1:mw6pDQqv38/WGF1cO/jF5t/jyAJ2yi7CmtFLLO5tGFI= +github.com/Microsoft/go-winio v0.4.17-0.20210211115548-6eac466e5fa3/go.mod h1:JPGBdM1cNvN/6ISo+n8V5iA4v8pBzdOpzfwIujj1a84= +github.com/Microsoft/hcsshim v0.8.6/go.mod h1:Op3hHsoHPAvb6lceZHDtd9OkTew38wNoXnJs8iY7rUg= +github.com/Microsoft/hcsshim v0.8.7-0.20190325164909-8abdbb8205e4/go.mod h1:Op3hHsoHPAvb6lceZHDtd9OkTew38wNoXnJs8iY7rUg= +github.com/Microsoft/hcsshim v0.8.7/go.mod h1:OHd7sQqRFrYd3RmSgbgji+ctCwkbq2wbEYNSzOYtcBQ= +github.com/Microsoft/hcsshim v0.8.9/go.mod h1:5692vkUqntj1idxauYlpoINNKeqCiG6Sg38RRsjT5y8= +github.com/Microsoft/hcsshim v0.8.14/go.mod h1:NtVKoYxQuTLx6gEq0L96c9Ju4JbRJ4nY2ow3VK6a9Lg= +github.com/Microsoft/hcsshim v0.8.15/go.mod h1:x38A4YbHbdxJtc0sF6oIz+RG0npwSCAvn69iY6URG00= +github.com/Microsoft/hcsshim/test v0.0.0-20201218223536-d3e5debf77da/go.mod h1:5hlzMzRKMLyo42nCZ9oml8AdTlq/0cvIaBv6tK1RehU= +github.com/Microsoft/hcsshim/test v0.0.0-20210227013316-43a75bb4edd3/go.mod h1:mw7qgWloBUl75W/gVH3cQszUg1+gUITj7D6NY7ywVnY= +github.com/NYTimes/gziphandler v0.0.0-20170623195520-56545f4a5d46/go.mod h1:3wb06e3pkSAbeQ52E9H9iFoQsEEwGN64994WTCIhntQ= +github.com/PuerkitoBio/purell v1.1.1/go.mod h1:c11w/QuzBsJSee3cPx9rAFu61PvFxuPbtSwDGJws/X0= +github.com/PuerkitoBio/urlesc v0.0.0-20170810143723-de5bf2ad4578/go.mod h1:uGdkoq3SwY9Y+13GIhn11/XLaGBb4BfwItxLd5jeuXE= +github.com/Shopify/logrus-bugsnag v0.0.0-20171204204709-577dee27f20d/go.mod h1:HI8ITrYtUY+O+ZhtlqUnD8+KwNPOyugEhfP9fdUIaEQ= +github.com/alecthomas/template v0.0.0-20160405071501-a0175ee3bccc/go.mod h1:LOuyumcjzFXgccqObfd/Ljyb9UuFJ6TxHnclSeseNhc= +github.com/alecthomas/template v0.0.0-20190718012654-fb15b899a751/go.mod h1:LOuyumcjzFXgccqObfd/Ljyb9UuFJ6TxHnclSeseNhc= +github.com/alecthomas/units v0.0.0-20151022065526-2efee857e7cf/go.mod h1:ybxpYRFXyAe+OPACYpWeL0wqObRcbAqCMya13uyzqw0= +github.com/alecthomas/units v0.0.0-20190717042225-c3de453c63f4/go.mod h1:ybxpYRFXyAe+OPACYpWeL0wqObRcbAqCMya13uyzqw0= +github.com/alexflint/go-filemutex v0.0.0-20171022225611-72bdc8eae2ae/go.mod h1:CgnQgUtFrFz9mxFNtED3jI5tLDjKlOM+oUF/sTk6ps0= +github.com/asaskevich/govalidator v0.0.0-20190424111038-f61b66f89f4a/go.mod h1:lB+ZfQJz7igIIfQNfa7Ml4HSf2uFQQRzpGGRXenZAgY= +github.com/aws/aws-sdk-go v1.15.11/go.mod h1:mFuSZ37Z9YOHbQEwBWztmVzqXrEkub65tZoCYDt7FT0= +github.com/beorn7/perks v0.0.0-20160804104726-4c0e84591b9a/go.mod h1:Dwedo/Wpr24TaqPxmxbtue+5NUziq4I4S80YR8gNf3Q= +github.com/beorn7/perks v0.0.0-20180321164747-3a771d992973/go.mod h1:Dwedo/Wpr24TaqPxmxbtue+5NUziq4I4S80YR8gNf3Q= +github.com/beorn7/perks v1.0.0/go.mod h1:KWe93zE9D1o94FZ5RNwFwVgaQK1VOXiVxmqh+CedLV8= +github.com/beorn7/perks v1.0.1/go.mod h1:G2ZrVWU2WbWT9wwq4/hrbKbnv/1ERSJQ0ibhJ6rlkpw= +github.com/bgentry/speakeasy v0.1.0/go.mod h1:+zsyZBPWlz7T6j88CTgSN5bM796AkVf0kBD4zp0CCIs= +github.com/bitly/go-simplejson v0.5.0/go.mod h1:cXHtHw4XUPsvGaxgjIAn8PhEWG9NfngEKAMDJEczWVA= +github.com/blang/semver v3.1.0+incompatible/go.mod h1:kRBLl5iJ+tD4TcOOxsy/0fnwebNt5EWlYSAyrTnjyyk= +github.com/blang/semver v3.5.1+incompatible/go.mod h1:kRBLl5iJ+tD4TcOOxsy/0fnwebNt5EWlYSAyrTnjyyk= +github.com/bmizerany/assert v0.0.0-20160611221934-b7ed37b82869/go.mod h1:Ekp36dRnpXw/yCqJaO+ZrUyxD+3VXMFFr56k5XYrpB4= +github.com/bshuster-repo/logrus-logstash-hook v0.4.1/go.mod h1:zsTqEiSzDgAa/8GZR7E1qaXrhYNDKBYy5/dWPTIflbk= +github.com/buger/jsonparser v0.0.0-20180808090653-f4dd9f5a6b44/go.mod h1:bbYlZJ7hK1yFx9hf58LP0zeX7UjIGs20ufpu3evjr+s= +github.com/bugsnag/bugsnag-go v0.0.0-20141110184014-b1d153021fcd/go.mod h1:2oa8nejYd4cQ/b0hMIopN0lCRxU0bueqREvZLWFrtK8= +github.com/bugsnag/osext v0.0.0-20130617224835-0dd3f918b21b/go.mod h1:obH5gd0BsqsP2LwDJ9aOkm/6J86V6lyAXCoQWGw3K50= +github.com/bugsnag/panicwrap v0.0.0-20151223152923-e2c28503fcd0/go.mod h1:D/8v3kj0zr8ZAKg1AQ6crr+5VwKN5eIywRkfhyM/+dE= +github.com/census-instrumentation/opencensus-proto v0.2.1/go.mod h1:f6KPmirojxKA12rnyqOA5BBL4O983OfeGPqjHWSTneU= +github.com/cespare/xxhash/v2 v2.1.1/go.mod h1:VGX0DQ3Q6kWi7AoAeZDth3/j3BFtOZR5XLFGgcrjCOs= +github.com/checkpoint-restore/go-criu/v4 v4.1.0/go.mod h1:xUQBLp4RLc5zJtWY++yjOoMoB5lihDt7fai+75m+rGw= +github.com/chzyer/logex v1.1.10/go.mod h1:+Ywpsq7O8HXn0nuIou7OrIPyXbp3wmkHB+jjWRnGsAI= +github.com/chzyer/readline v0.0.0-20180603132655-2972be24d48e/go.mod h1:nSuG5e5PlCu98SY8svDHJxuZscDgtXS6KTTbou5AhLI= +github.com/chzyer/test v0.0.0-20180213035817-a1ea475d72b1/go.mod h1:Q3SI9o4m/ZMnBNeIyt5eFwwo7qiLfzFZmjNmxjkiQlU= +github.com/cilium/ebpf v0.0.0-20200110133405-4032b1d8aae3/go.mod h1:MA5e5Lr8slmEg9bt0VpxxWqJlO4iwu3FBdHUzV7wQVg= +github.com/cilium/ebpf v0.0.0-20200702112145-1c8d4c9ef775/go.mod h1:7cR51M8ViRLIdUjrmSXlK9pkrsDlLHbO8jiB8X8JnOc= +github.com/cilium/ebpf v0.2.0/go.mod h1:To2CFviqOWL/M0gIMsvSMlqe7em/l1ALkX1PyjrX2Qs= +github.com/client9/misspell v0.3.4/go.mod h1:qj6jICC3Q7zFZvVWo7KLAzC3yx5G7kyvSDkc90ppPyw= +github.com/cncf/udpa/go v0.0.0-20191209042840-269d4d468f6f/go.mod h1:M8M6+tZqaGXZJjfX53e64911xZQV5JYwmTeXPW+k8Sc= +github.com/cockroachdb/datadriven v0.0.0-20190809214429-80d97fb3cbaa/go.mod h1:zn76sxSg3SzpJ0PPJaLDCu+Bu0Lg3sKTORVIj19EIF8= +github.com/containerd/aufs v0.0.0-20200908144142-dab0cbea06f4/go.mod h1:nukgQABAEopAHvB6j7cnP5zJ+/3aVcE7hCYqvIwAHyE= +github.com/containerd/aufs v0.0.0-20201003224125-76a6863f2989/go.mod h1:AkGGQs9NM2vtYHaUen+NljV0/baGCAPELGm2q9ZXpWU= +github.com/containerd/aufs v0.0.0-20210316121734-20793ff83c97/go.mod h1:kL5kd6KM5TzQjR79jljyi4olc1Vrx6XBlcyj3gNv2PU= +github.com/containerd/btrfs v0.0.0-20201111183144-404b9149801e/go.mod h1:jg2QkJcsabfHugurUvvPhS3E08Oxiuh5W/g1ybB4e0E= +github.com/containerd/btrfs v0.0.0-20210316141732-918d888fb676/go.mod h1:zMcX3qkXTAi9GI50+0HOeuV8LU2ryCE/V2vG/ZBiTss= +github.com/containerd/cgroups v0.0.0-20190717030353-c4b9ac5c7601/go.mod h1:X9rLEHIqSf/wfK8NsPqxJmeZgW4pcfzdXITDrUSJ6uI= +github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f/go.mod h1:OApqhQ4XNSNC13gXIwDjhOQxjWa/NxkwZXJ1EvqT0ko= +github.com/containerd/cgroups v0.0.0-20200531161412-0dbf7f05ba59/go.mod h1:pA0z1pT8KYB3TCXK/ocprsh7MAkoW8bZVzPdih9snmM= +github.com/containerd/cgroups v0.0.0-20200710171044-318312a37340/go.mod h1:s5q4SojHctfxANBDvMeIaIovkq29IP48TKAxnhYRxvo= +github.com/containerd/cgroups v0.0.0-20200824123100-0b889c03f102/go.mod h1:s5q4SojHctfxANBDvMeIaIovkq29IP48TKAxnhYRxvo= +github.com/containerd/cgroups v0.0.0-20210114181951-8a68de567b68 h1:hkGVFjz+plgr5UfxZUTPFbUFIF/Km6/s+RVRIRHLrrY= +github.com/containerd/cgroups v0.0.0-20210114181951-8a68de567b68/go.mod h1:ZJeTFisyysqgcCdecO57Dj79RfL0LNeGiFUqLYQRYLE= +github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1/go.mod h1:Tj/on1eG8kiEhd0+fhSDzsPAFESxzBBvdyEgyryXffw= +github.com/containerd/console v0.0.0-20181022165439-0650fd9eeb50/go.mod h1:Tj/on1eG8kiEhd0+fhSDzsPAFESxzBBvdyEgyryXffw= +github.com/containerd/console v0.0.0-20191206165004-02ecf6a7291e/go.mod h1:8Pf4gM6VEbTNRIT26AyyU7hxdQU3MvAvxVI0sc00XBE= +github.com/containerd/console v1.0.1 h1:u7SFAJyRqWcG6ogaMAx3KjSTy1e3hT9QxqX7Jco7dRc= +github.com/containerd/console v1.0.1/go.mod h1:XUsP6YE/mKtz6bxc+I8UiKKTP04qjQL4qcS3XoQ5xkw= +github.com/containerd/containerd v1.2.10/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= +github.com/containerd/containerd v1.3.0-beta.2.0.20190828155532-0293cbd26c69/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= +github.com/containerd/containerd v1.3.0/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= +github.com/containerd/containerd v1.3.1-0.20191213020239-082f7e3aed57/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= +github.com/containerd/containerd v1.3.2/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= +github.com/containerd/containerd v1.4.0-beta.2.0.20200729163537-40b22ef07410/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= +github.com/containerd/containerd v1.4.1/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= +github.com/containerd/containerd v1.4.3/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= +github.com/containerd/containerd v1.5.0-beta.1/go.mod h1:5HfvG1V2FsKesEGQ17k5/T7V960Tmcumvqn8Mc+pCYQ= +github.com/containerd/containerd v1.5.0-beta.3/go.mod h1:/wr9AVtEM7x9c+n0+stptlo/uBBoBORwEx6ardVcmKU= +github.com/containerd/containerd v1.5.0-beta.4 h1:zjz4MOAOFgdBlwid2nNUlJ3YLpVi/97L36lfMYJex60= +github.com/containerd/containerd v1.5.0-beta.4/go.mod h1:GmdgZd2zA2GYIBZ0w09ZvgqEq8EfBp/m3lcVZIvPHhI= +github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y= +github.com/containerd/continuity v0.0.0-20190815185530-f2a389ac0a02/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y= +github.com/containerd/continuity v0.0.0-20191127005431-f65d91d395eb/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y= +github.com/containerd/continuity v0.0.0-20200710164510-efbc4488d8fe/go.mod h1:cECdGN1O8G9bgKTlLhuPJimka6Xb/Gg7vYzCTNVxhvo= +github.com/containerd/continuity v0.0.0-20201208142359-180525291bb7/go.mod h1:kR3BEg7bDFaEddKm54WSmrol1fKWDU1nKYkgrcgZT7Y= +github.com/containerd/continuity v0.0.0-20210208174643-50096c924a4e h1:6JKvHHt396/qabvMhnhUZvWaHZzfVfldxE60TK8YLhg= +github.com/containerd/continuity v0.0.0-20210208174643-50096c924a4e/go.mod h1:EXlVlkqNba9rJe3j7w3Xa924itAMLgZH4UD/Q4PExuQ= +github.com/containerd/fifo v0.0.0-20180307165137-3d5202aec260/go.mod h1:ODA38xgv3Kuk8dQz2ZQXpnv/UZZUHUCL7pnLehbXgQI= +github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448/go.mod h1:ODA38xgv3Kuk8dQz2ZQXpnv/UZZUHUCL7pnLehbXgQI= +github.com/containerd/fifo v0.0.0-20200410184934-f15a3290365b/go.mod h1:jPQ2IAeZRCYxpS/Cm1495vGFww6ecHmMk1YJH2Q5ln0= +github.com/containerd/fifo v0.0.0-20201026212402-0724c46b320c/go.mod h1:jPQ2IAeZRCYxpS/Cm1495vGFww6ecHmMk1YJH2Q5ln0= +github.com/containerd/fifo v0.0.0-20210316144830-115abcc95a1d h1:u6sWqdNGAy7+O8qG/r1dqdnZE7IdEjteK3WGuvbfreo= +github.com/containerd/fifo v0.0.0-20210316144830-115abcc95a1d/go.mod h1:ocF/ME1SX5b1AOlWi9r677YJmCPSwwWnQ9O123vzpE4= +github.com/containerd/go-cni v1.0.1/go.mod h1:+vUpYxKvAF72G9i1WoDOiPGRtQpqsNW/ZHtSlv++smU= +github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3/go.mod h1:IV7qH3hrUgRmyYrtgEeGWJfWbgcHL9CSRruz2Vqcph0= +github.com/containerd/go-runc v0.0.0-20190911050354-e029b79d8cda/go.mod h1:IV7qH3hrUgRmyYrtgEeGWJfWbgcHL9CSRruz2Vqcph0= +github.com/containerd/go-runc v0.0.0-20200220073739-7016d3ce2328/go.mod h1:PpyHrqVs8FTi9vpyHwPwiNEGaACDxT/N/pLcvMSRA9g= +github.com/containerd/go-runc v0.0.0-20201020171139-16b287bc67d0 h1:e+50zk22gvHLJKe8+d+xSMyA88PPQk/XfWuUw1BdnPA= +github.com/containerd/go-runc v0.0.0-20201020171139-16b287bc67d0/go.mod h1:cNU0ZbCgCQVZK4lgG3P+9tn9/PaJNmoDXPpoJhDR+Ok= +github.com/containerd/imgcrypt v1.0.1/go.mod h1:mdd8cEPW7TPgNG4FpuP3sGBiQ7Yi/zak9TYCG3juvb0= +github.com/containerd/imgcrypt v1.0.4-0.20210301171431-0ae5c75f59ba/go.mod h1:6TNsg0ctmizkrOgXRNQjAPFWpMYRWuiB6dSF4Pfa5SA= +github.com/containerd/imgcrypt v1.1.1-0.20210312161619-7ed62a527887/go.mod h1:5AZJNI6sLHJljKuI9IHnw1pWqo/F0nGDOuR9zgTs7ow= +github.com/containerd/nri v0.0.0-20201007170849-eb1350a75164/go.mod h1:+2wGSDGFYfE5+So4M5syatU0N0f0LbWpuqyMi4/BE8c= +github.com/containerd/nri v0.0.0-20210316161719-dbaa18c31c14/go.mod h1:lmxnXF6oMkbqs39FiCt1s0R2HSMhcLel9vNL3m4AaeY= +github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de/go.mod h1:PvCDdDGpgqzQIzDW1TphrGLssLDZp2GuS+X5DkEJB8o= +github.com/containerd/ttrpc v0.0.0-20190828172938-92c8520ef9f8/go.mod h1:PvCDdDGpgqzQIzDW1TphrGLssLDZp2GuS+X5DkEJB8o= +github.com/containerd/ttrpc v0.0.0-20191028202541-4f1b8fe65a5c/go.mod h1:LPm1u0xBw8r8NOKoOdNMeVHSawSsltak+Ihv+etqsE8= +github.com/containerd/ttrpc v1.0.1/go.mod h1:UAxOpgT9ziI0gJrmKvgcZivgxOp8iFPSk8httJEt98Y= +github.com/containerd/ttrpc v1.0.2 h1:2/O3oTZN36q2xRolk0a2WWGgh7/Vf/liElg5hFYLX9U= +github.com/containerd/ttrpc v1.0.2/go.mod h1:UAxOpgT9ziI0gJrmKvgcZivgxOp8iFPSk8httJEt98Y= +github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd/go.mod h1:Cm3kwCdlkCfMSHURc+r6fwoGH6/F1hH3S4sg0rLFWPc= +github.com/containerd/typeurl v0.0.0-20190911142611-5eb25027c9fd/go.mod h1:GeKYzf2pQcqv7tJ0AoCuuhtnqhva5LNU3U+OyKxxJpk= +github.com/containerd/typeurl v1.0.1 h1:PvuK4E3D5S5q6IqsPDCy928FhP0LUIGcmZ/Yhgp5Djw= +github.com/containerd/typeurl v1.0.1/go.mod h1:TB1hUtrpaiO88KEK56ijojHS1+NeF0izUACaJW2mdXg= +github.com/containerd/zfs v0.0.0-20200918131355-0a33824f23a2/go.mod h1:8IgZOBdv8fAgXddBT4dBXJPtxyRsejFIpXoklgxgEjw= +github.com/containerd/zfs v0.0.0-20210301145711-11e8f1707f62/go.mod h1:A9zfAbMlQwE+/is6hi0Xw8ktpL+6glmqZYtevJgaB8Y= +github.com/containerd/zfs v0.0.0-20210315114300-dde8f0fda960/go.mod h1:m+m51S1DvAP6r3FcmYCp54bQ34pyOwTieQDNRIRHsFY= +github.com/containernetworking/cni v0.7.1/go.mod h1:LGwApLUm2FpoOfxTDEeq8T9ipbpZ61X79hmU3w8FmsY= +github.com/containernetworking/cni v0.8.0/go.mod h1:LGwApLUm2FpoOfxTDEeq8T9ipbpZ61X79hmU3w8FmsY= +github.com/containernetworking/plugins v0.8.6/go.mod h1:qnw5mN19D8fIwkqW7oHHYDHVlzhJpcY6TQxn/fUyDDM= +github.com/containers/ocicrypt v1.0.1/go.mod h1:MeJDzk1RJHv89LjsH0Sp5KTY3ZYkjXO/C+bKAeWFIrc= +github.com/containers/ocicrypt v1.1.0/go.mod h1:b8AOe0YR67uU8OqfVNcznfFpAzu3rdgUV4GP9qXPfu4= +github.com/coreos/go-iptables v0.4.5/go.mod h1:/mVI274lEDI2ns62jHCDnCyBF9Iwsmekav8Dbxlm1MU= +github.com/coreos/go-oidc v2.1.0+incompatible/go.mod h1:CgnwVTmzoESiwO9qyAFEMiHoZ1nMCKZlZ9V6mm3/LKc= +github.com/coreos/go-semver v0.2.0/go.mod h1:nnelYz7RCh+5ahJtPPxZlU+153eP4D4r3EedlOD2RNk= +github.com/coreos/go-semver v0.3.0/go.mod h1:nnelYz7RCh+5ahJtPPxZlU+153eP4D4r3EedlOD2RNk= +github.com/coreos/go-systemd v0.0.0-20161114122254-48702e0da86b/go.mod h1:F5haX7vjVVG0kc13fIWeqUViNPyEJxv/OmvnBo0Yme4= +github.com/coreos/go-systemd v0.0.0-20180511133405-39ca1b05acc7/go.mod h1:F5haX7vjVVG0kc13fIWeqUViNPyEJxv/OmvnBo0Yme4= +github.com/coreos/go-systemd v0.0.0-20190321100706-95778dfbb74e/go.mod h1:F5haX7vjVVG0kc13fIWeqUViNPyEJxv/OmvnBo0Yme4= +github.com/coreos/go-systemd/v22 v22.0.0/go.mod h1:xO0FLkIi5MaZafQlIrOotqXZ90ih+1atmu1JpKERPPk= +github.com/coreos/go-systemd/v22 v22.1.0/go.mod h1:xO0FLkIi5MaZafQlIrOotqXZ90ih+1atmu1JpKERPPk= +github.com/coreos/pkg v0.0.0-20160727233714-3ac0863d7acf/go.mod h1:E3G3o1h8I7cfcXa63jLwjI0eiQQMgzzUDFVpN/nH/eA= +github.com/coreos/pkg v0.0.0-20180928190104-399ea9e2e55f/go.mod h1:E3G3o1h8I7cfcXa63jLwjI0eiQQMgzzUDFVpN/nH/eA= +github.com/cpuguy83/go-md2man/v2 v2.0.0-20190314233015-f79a8a8ca69d/go.mod h1:maD7wRr/U5Z6m/iR4s+kqSMx2CaBsrgA7czyZG/E6dU= +github.com/cpuguy83/go-md2man/v2 v2.0.0 h1:EoUDS0afbrsXAZ9YQ9jdu/mZ2sXgT1/2yyNng4PGlyM= +github.com/cpuguy83/go-md2man/v2 v2.0.0/go.mod h1:maD7wRr/U5Z6m/iR4s+kqSMx2CaBsrgA7czyZG/E6dU= +github.com/creack/pty v1.1.7/go.mod h1:lj5s0c3V2DBrqTV7llrYr5NG6My20zk30Fl46Y7DoTY= +github.com/cyphar/filepath-securejoin v0.2.2/go.mod h1:FpkQEhXnPnOthhzymB7CGsFk2G9VLXONKD9G7QGMM+4= +github.com/d2g/dhcp4 v0.0.0-20170904100407-a1d1b6c41b1c/go.mod h1:Ct2BUK8SB0YC1SMSibvLzxjeJLnrYEVLULFNiHY9YfQ= +github.com/d2g/dhcp4client v1.0.0/go.mod h1:j0hNfjhrt2SxUOw55nL0ATM/z4Yt3t2Kd1mW34z5W5s= +github.com/d2g/dhcp4server v0.0.0-20181031114812-7d4a0a7f59a5/go.mod h1:Eo87+Kg/IX2hfWJfwxMzLyuSZyxSoAug2nGa1G2QAi8= +github.com/d2g/hardwareaddr v0.0.0-20190221164911-e7d9fbe030e4/go.mod h1:bMl4RjIciD2oAxI7DmWRx6gbeqrkoLqv3MV0vzNad+I= +github.com/davecgh/go-spew v1.1.0/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38= +github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c= +github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38= +github.com/denverdino/aliyungo v0.0.0-20190125010748-a747050bb1ba/go.mod h1:dV8lFg6daOBZbT6/BDGIz6Y3WFGn8juu6G+CQ6LHtl0= +github.com/dgrijalva/jwt-go v0.0.0-20170104182250-a601269ab70c/go.mod h1:E3ru+11k8xSBh+hMPgOLZmtrrCbhqsmaPHjLKYnJCaQ= +github.com/dgrijalva/jwt-go v3.2.0+incompatible/go.mod h1:E3ru+11k8xSBh+hMPgOLZmtrrCbhqsmaPHjLKYnJCaQ= +github.com/dnaeon/go-vcr v1.0.1/go.mod h1:aBB1+wY4s93YsC3HHjMBMrwTj2R9FHDzUr9KyGc8n1E= +github.com/docker/distribution v0.0.0-20190905152932-14b96e55d84c/go.mod h1:0+TTO4EOBfRPhZXAeF1Vu+W3hHZ8eLp8PgKVZlcvtFY= +github.com/docker/distribution v2.7.1-0.20190205005809-0d3efadf0154+incompatible/go.mod h1:J2gT2udsDAN96Uj4KfcMRqY0/ypR+oyYUYmja8H+y+w= +github.com/docker/distribution v2.7.1+incompatible/go.mod h1:J2gT2udsDAN96Uj4KfcMRqY0/ypR+oyYUYmja8H+y+w= +github.com/docker/go-events v0.0.0-20170721190031-9461782956ad/go.mod h1:Uw6UezgYA44ePAFQYUehOuCzmy5zmg/+nl2ZfMWGkpA= +github.com/docker/go-events v0.0.0-20190806004212-e31b211e4f1c/go.mod h1:Uw6UezgYA44ePAFQYUehOuCzmy5zmg/+nl2ZfMWGkpA= +github.com/docker/go-metrics v0.0.0-20180209012529-399ea8c73916/go.mod h1:/u0gXw0Gay3ceNrsHubL3BtdOL2fHf93USgMTe0W5dI= +github.com/docker/go-metrics v0.0.1/go.mod h1:cG1hvH2utMXtqgqqYE9plW6lDxS3/5ayHzueweSI3Vw= +github.com/docker/go-units v0.4.0/go.mod h1:fgPhTUdO+D/Jk86RDLlptpiXQzgHJF7gydDDbaIK4Dk= +github.com/docker/libtrust v0.0.0-20150114040149-fa567046d9b1/go.mod h1:cyGadeNEkKy96OOhEzfZl+yxihPEzKnqJwvfuSUqbZE= +github.com/docker/spdystream v0.0.0-20160310174837-449fdfce4d96/go.mod h1:Qh8CwZgvJUkLughtfhJv5dyTYa91l1fOUCrgjqmcifM= +github.com/docopt/docopt-go v0.0.0-20180111231733-ee0de3bc6815/go.mod h1:WwZ+bS3ebgob9U8Nd0kOddGdZWjyMGR8Wziv+TBNwSE= +github.com/dustin/go-humanize v0.0.0-20171111073723-bb3d318650d4/go.mod h1:HtrtbFcZ19U5GC7JDqmcUSB87Iq5E25KnS6fMYU6eOk= +github.com/dustin/go-humanize v1.0.0/go.mod h1:HtrtbFcZ19U5GC7JDqmcUSB87Iq5E25KnS6fMYU6eOk= +github.com/elazarl/goproxy v0.0.0-20180725130230-947c36da3153/go.mod h1:/Zj4wYkgs4iZTTu3o/KG3Itv/qCCa8VVMlb3i9OVuzc= +github.com/emicklei/go-restful v0.0.0-20170410110728-ff4f55a20633/go.mod h1:otzb+WCGbkyDHkqmQmT5YD2WR4BBwUdeQoFo8l/7tVs= +github.com/emicklei/go-restful v2.9.5+incompatible/go.mod h1:otzb+WCGbkyDHkqmQmT5YD2WR4BBwUdeQoFo8l/7tVs= +github.com/envoyproxy/go-control-plane v0.9.0/go.mod h1:YTl/9mNaCwkRvm6d1a2C3ymFceY/DCBVvsKhRF0iEA4= +github.com/envoyproxy/go-control-plane v0.9.1-0.20191026205805-5f8ba28d4473/go.mod h1:YTl/9mNaCwkRvm6d1a2C3ymFceY/DCBVvsKhRF0iEA4= +github.com/envoyproxy/go-control-plane v0.9.4/go.mod h1:6rpuAdCZL397s3pYoYcLgu1mIlRU8Am5FuJP05cCM98= +github.com/envoyproxy/protoc-gen-validate v0.1.0/go.mod h1:iSmxcyjqTsJpI2R4NaDN7+kN2VEUnK/pcBlmesArF7c= +github.com/evanphx/json-patch v4.9.0+incompatible/go.mod h1:50XU6AFN0ol/bzJsmQLiYLvXMP4fmwYFNcr97nuDLSk= +github.com/fatih/color v1.7.0/go.mod h1:Zm6kSWBoL9eyXnKyktHP6abPY2pDugNf5KwzbycvMj4= +github.com/form3tech-oss/jwt-go v3.2.2+incompatible/go.mod h1:pbq4aXjuKjdthFRnoDwaVPLA+WlJuPGy+QneDUgJi2k= +github.com/fsnotify/fsnotify v1.4.7/go.mod h1:jwhsz4b93w/PPRr/qN1Yymfu8t87LnFCMoQvtojpjFo= +github.com/fsnotify/fsnotify v1.4.9/go.mod h1:znqG4EE+3YCdAaPaxE2ZRY/06pZUdp0tY4IgpuI1SZQ= +github.com/fullsailor/pkcs7 v0.0.0-20190404230743-d7302db945fa/go.mod h1:KnogPXtdwXqoenmZCw6S+25EAm2MkxbG0deNDu4cbSA= +github.com/garyburd/redigo v0.0.0-20150301180006-535138d7bcd7/go.mod h1:NR3MbYisc3/PwhQ00EMzDiPmrwpPxAn5GI05/YaO1SY= +github.com/ghodss/yaml v0.0.0-20150909031657-73d445a93680/go.mod h1:4dBDuWmgqj2HViK6kFavaiC9ZROes6MMH2rRYeMEF04= +github.com/ghodss/yaml v1.0.0/go.mod h1:4dBDuWmgqj2HViK6kFavaiC9ZROes6MMH2rRYeMEF04= +github.com/go-gl/glfw v0.0.0-20190409004039-e6da0acd62b1/go.mod h1:vR7hzQXu2zJy9AVAgeJqvqgH9Q5CA+iKCZ2gyEVpxRU= +github.com/go-gl/glfw/v3.3/glfw v0.0.0-20191125211704-12ad95a8df72/go.mod h1:tQ2UAYgL5IevRw8kRxooKSPJfGvJ9fJQFa0TUsXzTg8= +github.com/go-gl/glfw/v3.3/glfw v0.0.0-20200222043503-6f7a984d4dc4/go.mod h1:tQ2UAYgL5IevRw8kRxooKSPJfGvJ9fJQFa0TUsXzTg8= +github.com/go-ini/ini v1.25.4/go.mod h1:ByCAeIL28uOIIG0E3PJtZPDL8WnHpFKFOtgjp+3Ies8= +github.com/go-kit/kit v0.8.0/go.mod h1:xBxKIO96dXMWWy0MnWVtmwkA9/13aqxPnvrjFYMA2as= +github.com/go-kit/kit v0.9.0/go.mod h1:xBxKIO96dXMWWy0MnWVtmwkA9/13aqxPnvrjFYMA2as= +github.com/go-logfmt/logfmt v0.3.0/go.mod h1:Qt1PoO58o5twSAckw1HlFXLmHsOX5/0LbT9GBnD5lWE= +github.com/go-logfmt/logfmt v0.4.0/go.mod h1:3RMwSq7FuexP4Kalkev3ejPJsZTpXXBr9+V4qmtdjCk= +github.com/go-logr/logr v0.1.0/go.mod h1:ixOQHD9gLJUVQQ2ZOR7zLEifBX6tGkNJF4QyIY7sIas= +github.com/go-logr/logr v0.2.0/go.mod h1:z6/tIYblkpsD+a4lm/fGIIU9mZ+XfAiaFtq7xTgseGU= +github.com/go-openapi/jsonpointer v0.19.2/go.mod h1:3akKfEdA7DF1sugOqz1dVQHBcuDBPKZGEoHC/NkiQRg= +github.com/go-openapi/jsonpointer v0.19.3/go.mod h1:Pl9vOtqEWErmShwVjC8pYs9cog34VGT37dQOVbmoatg= +github.com/go-openapi/jsonreference v0.19.2/go.mod h1:jMjeRr2HHw6nAVajTXJ4eiUwohSTlpa0o73RUL1owJc= +github.com/go-openapi/jsonreference v0.19.3/go.mod h1:rjx6GuL8TTa9VaixXglHmQmIL98+wF9xc8zWvFonSJ8= +github.com/go-openapi/spec v0.19.3/go.mod h1:FpwSN1ksY1eteniUU7X0N/BgJ7a4WvBFVA8Lj9mJglo= +github.com/go-openapi/swag v0.19.2/go.mod h1:POnQmlKehdgb5mhVOsnJFsivZCEZ/vjK9gh66Z9tfKk= +github.com/go-openapi/swag v0.19.5/go.mod h1:POnQmlKehdgb5mhVOsnJFsivZCEZ/vjK9gh66Z9tfKk= +github.com/go-stack/stack v1.8.0/go.mod h1:v0f6uXyyMGvRgIKkXu+yp6POWl0qKG85gN/melR3HDY= +github.com/godbus/dbus v0.0.0-20151105175453-c7fdd8b5cd55/go.mod h1:/YcGZj5zSblfDWMMoOzV4fas9FZnQYTkDnsGvmh2Grw= +github.com/godbus/dbus v0.0.0-20180201030542-885f9cc04c9c/go.mod h1:/YcGZj5zSblfDWMMoOzV4fas9FZnQYTkDnsGvmh2Grw= +github.com/godbus/dbus v0.0.0-20190422162347-ade71ed3457e/go.mod h1:bBOAhwG1umN6/6ZUMtDFBMQR8jRg9O75tm9K00oMsK4= +github.com/godbus/dbus/v5 v5.0.3/go.mod h1:xhWf0FNVPg57R7Z0UbKHbJfkEywrmjJnf7w5xrFpKfA= +github.com/gogo/googleapis v1.2.0/go.mod h1:Njal3psf3qN6dwBtQfUmBZh2ybovJ0tlu3o/AC7HYjU= +github.com/gogo/googleapis v1.4.0/go.mod h1:5YRNX2z1oM5gXdAkurHa942MDgEJyk02w4OecKY87+c= +github.com/gogo/protobuf v1.1.1/go.mod h1:r8qH/GZQm5c6nD/R0oafs1akxWv10x8SbQlK7atdtwQ= +github.com/gogo/protobuf v1.2.1/go.mod h1:hp+jE20tsWTFYpLwKvXlhS1hjn+gTNwPg2I6zVXpSg4= +github.com/gogo/protobuf v1.2.2-0.20190723190241-65acae22fc9d/go.mod h1:SlYgWuQ5SjCEi6WLHjHCa1yvBfUnHcTbrrZtXPKa29o= +github.com/gogo/protobuf v1.3.0/go.mod h1:SlYgWuQ5SjCEi6WLHjHCa1yvBfUnHcTbrrZtXPKa29o= +github.com/gogo/protobuf v1.3.1/go.mod h1:SlYgWuQ5SjCEi6WLHjHCa1yvBfUnHcTbrrZtXPKa29o= +github.com/gogo/protobuf v1.3.2 h1:Ov1cvc58UF3b5XjBnZv7+opcTcQFZebYjWzi34vdm4Q= +github.com/gogo/protobuf v1.3.2/go.mod h1:P1XiOD3dCwIKUDQYPy72D8LYyHL2YPYrpS2s69NZV8Q= +github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b/go.mod h1:SBH7ygxi8pfUlaOkMMuAQtPIUF8ecWP5IEl/CR7VP2Q= +github.com/golang/groupcache v0.0.0-20160516000752-02826c3e7903/go.mod h1:cIg4eruTrX1D+g88fzRXU5OdNfaM+9IcxsU14FzY7Hc= +github.com/golang/groupcache v0.0.0-20190702054246-869f871628b6/go.mod h1:cIg4eruTrX1D+g88fzRXU5OdNfaM+9IcxsU14FzY7Hc= +github.com/golang/groupcache v0.0.0-20191227052852-215e87163ea7/go.mod h1:cIg4eruTrX1D+g88fzRXU5OdNfaM+9IcxsU14FzY7Hc= +github.com/golang/groupcache v0.0.0-20200121045136-8c9f03a8e57e h1:1r7pUrabqp18hOBcwBwiTsbnFeTZHV9eER/QT5JVZxY= +github.com/golang/groupcache v0.0.0-20200121045136-8c9f03a8e57e/go.mod h1:cIg4eruTrX1D+g88fzRXU5OdNfaM+9IcxsU14FzY7Hc= +github.com/golang/mock v1.1.1/go.mod h1:oTYuIxOrZwtPieC+H1uAHpcLFnEyAGVDL/k47Jfbm0A= +github.com/golang/mock v1.2.0/go.mod h1:oTYuIxOrZwtPieC+H1uAHpcLFnEyAGVDL/k47Jfbm0A= +github.com/golang/mock v1.3.1/go.mod h1:sBzyDLLjw3U8JLTeZvSv8jJB+tU5PVekmnlKIyFUx0Y= +github.com/golang/mock v1.4.0/go.mod h1:UOMv5ysSaYNkG+OFQykRIcU/QvvxJf3p21QfJ2Bt3cw= +github.com/golang/mock v1.4.1/go.mod h1:UOMv5ysSaYNkG+OFQykRIcU/QvvxJf3p21QfJ2Bt3cw= +github.com/golang/protobuf v1.2.0/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= +github.com/golang/protobuf v1.3.1/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= +github.com/golang/protobuf v1.3.2/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= +github.com/golang/protobuf v1.3.3/go.mod h1:vzj43D7+SQXF/4pzW/hwtAqwc6iTitCiVSaWz5lYuqw= +github.com/golang/protobuf v1.3.4/go.mod h1:vzj43D7+SQXF/4pzW/hwtAqwc6iTitCiVSaWz5lYuqw= +github.com/golang/protobuf v1.3.5/go.mod h1:6O5/vntMXwX2lRkT1hjjk0nAC1IDOTvTlVgjlRvqsdk= +github.com/golang/protobuf v1.4.0-rc.1/go.mod h1:ceaxUfeHdC40wWswd/P6IGgMaK3YpKi5j83Wpe3EHw8= +github.com/golang/protobuf v1.4.0-rc.1.0.20200221234624-67d41d38c208/go.mod h1:xKAWHe0F5eneWXFV3EuXVDTCmh+JuBKY0li0aMyXATA= +github.com/golang/protobuf v1.4.0-rc.2/go.mod h1:LlEzMj4AhA7rCAGe4KMBDvJI+AwstrUpVNzEA03Pprs= +github.com/golang/protobuf v1.4.0-rc.4.0.20200313231945-b860323f09d0/go.mod h1:WU3c8KckQ9AFe+yFwt9sWVRKCVIyN9cPHBJSNnbL67w= +github.com/golang/protobuf v1.4.0/go.mod h1:jodUvKwWbYaEsadDk5Fwe5c77LiNKVO9IDvqG2KuDX0= +github.com/golang/protobuf v1.4.1/go.mod h1:U8fpvMrcmy5pZrNK1lt4xCsGvpyWQ/VVv6QDs8UjoX8= +github.com/golang/protobuf v1.4.2/go.mod h1:oDoupMAO8OvCJWAcko0GGGIgR6R6ocIYbsSw735rRwI= +github.com/golang/protobuf v1.4.3 h1:JjCZWpVbqXDqFVmTfYWEVTMIYrL/NPdPSCHPJ0T/raM= +github.com/golang/protobuf v1.4.3/go.mod h1:oDoupMAO8OvCJWAcko0GGGIgR6R6ocIYbsSw735rRwI= +github.com/google/btree v0.0.0-20180813153112-4030bb1f1f0c/go.mod h1:lNA+9X1NB3Zf8V7Ke586lFgjr2dZNuvo3lPJSGZ5JPQ= +github.com/google/btree v1.0.0/go.mod h1:lNA+9X1NB3Zf8V7Ke586lFgjr2dZNuvo3lPJSGZ5JPQ= +github.com/google/go-cmp v0.2.0/go.mod h1:oXzfMopK8JAjlY9xF4vHSVASa0yLyX7SntLO5aqRK0M= +github.com/google/go-cmp v0.3.0/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU= +github.com/google/go-cmp v0.3.1/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU= +github.com/google/go-cmp v0.4.0/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE= +github.com/google/go-cmp v0.5.0/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE= +github.com/google/go-cmp v0.5.1/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE= +github.com/google/go-cmp v0.5.2/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE= +github.com/google/go-cmp v0.5.4 h1:L8R9j+yAqZuZjsqh/z+F1NCffTKKLShY6zXTItVIZ8M= +github.com/google/go-cmp v0.5.4/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE= +github.com/google/gofuzz v1.0.0/go.mod h1:dBl0BpW6vV/+mYPU4Po3pmUjxk6FQPldtuIdl/M65Eg= +github.com/google/gofuzz v1.1.0/go.mod h1:dBl0BpW6vV/+mYPU4Po3pmUjxk6FQPldtuIdl/M65Eg= +github.com/google/martian v2.1.0+incompatible/go.mod h1:9I4somxYTbIHy5NJKHRl3wXiIaQGbYVAs8BPL6v8lEs= +github.com/google/pprof v0.0.0-20181206194817-3ea8567a2e57/go.mod h1:zfwlbNMJ+OItoe0UupaVj+oy1omPYYDuagoSzA8v9mc= +github.com/google/pprof v0.0.0-20190515194954-54271f7e092f/go.mod h1:zfwlbNMJ+OItoe0UupaVj+oy1omPYYDuagoSzA8v9mc= +github.com/google/pprof v0.0.0-20191218002539-d4f498aebedc/go.mod h1:ZgVRPoUq/hfqzAqh7sHMqb3I9Rq5C59dIz2SbBwJ4eM= +github.com/google/pprof v0.0.0-20200212024743-f11f1df84d12/go.mod h1:ZgVRPoUq/hfqzAqh7sHMqb3I9Rq5C59dIz2SbBwJ4eM= +github.com/google/pprof v0.0.0-20200229191704-1ebb73c60ed3/go.mod h1:ZgVRPoUq/hfqzAqh7sHMqb3I9Rq5C59dIz2SbBwJ4eM= +github.com/google/renameio v0.1.0/go.mod h1:KWCgfxg9yswjAJkECMjeO8J8rahYeXnNhOm40UhjYkI= +github.com/google/uuid v1.0.0/go.mod h1:TIyPZe4MgqvfeYDBFedMoGGpEw/LqOeaOT+nhxU+yHo= +github.com/google/uuid v1.1.1/go.mod h1:TIyPZe4MgqvfeYDBFedMoGGpEw/LqOeaOT+nhxU+yHo= +github.com/google/uuid v1.1.2/go.mod h1:TIyPZe4MgqvfeYDBFedMoGGpEw/LqOeaOT+nhxU+yHo= +github.com/googleapis/gax-go/v2 v2.0.4/go.mod h1:0Wqv26UfaUD9n4G6kQubkQ+KchISgw+vpHVxEJEs9eg= +github.com/googleapis/gax-go/v2 v2.0.5/go.mod h1:DWXyrwAJ9X0FpwwEdw+IPEYBICEFu5mhpdKc/us6bOk= +github.com/googleapis/gnostic v0.4.1/go.mod h1:LRhVm6pbyptWbWbuZ38d1eyptfvIytN3ir6b65WBswg= +github.com/gopherjs/gopherjs v0.0.0-20181017120253-0766667cb4d1/go.mod h1:wJfORRmW1u3UXTncJ5qlYoELFm8eSnnEO6hX4iZ3EWY= +github.com/gorilla/handlers v0.0.0-20150720190736-60c7bfde3e33/go.mod h1:Qkdc/uu4tH4g6mTK6auzZ766c4CA0Ng8+o/OAirnOIQ= +github.com/gorilla/mux v1.7.2/go.mod h1:1lud6UwP+6orDFRuTfBEV8e9/aOM/c4fVVCaMa2zaAs= +github.com/gorilla/websocket v0.0.0-20170926233335-4201258b820c/go.mod h1:E7qHFY5m1UJ88s3WnNqhKjPHQ0heANvMoAMk2YaljkQ= +github.com/gorilla/websocket v1.4.2/go.mod h1:YR8l580nyteQvAITg2hZ9XVh4b55+EU/adAjf1fMHhE= +github.com/gregjones/httpcache v0.0.0-20180305231024-9cad4c3443a7/go.mod h1:FecbI9+v66THATjSRHfNgh1IVFe/9kFxbXtjV0ctIMA= +github.com/grpc-ecosystem/go-grpc-middleware v1.0.1-0.20190118093823-f849b5445de4/go.mod h1:FiyG127CGDf3tlThmgyCl78X/SZQqEOJBCDaAfeWzPs= +github.com/grpc-ecosystem/go-grpc-prometheus v1.2.0/go.mod h1:8NvIoxWQoOIhqOTXgfV/d3M/q6VIi02HzZEHgUlZvzk= +github.com/grpc-ecosystem/grpc-gateway v1.9.5/go.mod h1:vNeuVxBJEsws4ogUvrchl83t/GYV9WGTSLVdBhOQFDY= +github.com/hashicorp/errwrap v0.0.0-20141028054710-7554cd9344ce/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4= +github.com/hashicorp/errwrap v1.0.0/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4= +github.com/hashicorp/go-multierror v0.0.0-20161216184304-ed905158d874/go.mod h1:JMRHfdO9jKNzS/+BTlxCjKNQHg/jZAft8U7LloJvN7I= +github.com/hashicorp/go-multierror v1.0.0/go.mod h1:dHtQlpGsu+cZNNAkkCN/P3hoUDHhCYQXV3UM06sGGrk= +github.com/hashicorp/golang-lru v0.5.0/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8= +github.com/hashicorp/golang-lru v0.5.1/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8= +github.com/hpcloud/tail v1.0.0/go.mod h1:ab1qPbhIpdTxEkNHXyeSf5vhxWSCs/tWer42PpOxQnU= +github.com/ianlancetaylor/demangle v0.0.0-20181102032728-5e5cf60278f6/go.mod h1:aSSvb/t6k1mPoxDqO4vJh6VOCGPwU4O0C2/Eqndh1Sc= +github.com/imdario/mergo v0.3.5/go.mod h1:2EnlNZ0deacrJVfApfmtdGgDfMuh/nq6Ok1EcJh5FfA= +github.com/imdario/mergo v0.3.8/go.mod h1:2EnlNZ0deacrJVfApfmtdGgDfMuh/nq6Ok1EcJh5FfA= +github.com/imdario/mergo v0.3.10/go.mod h1:jmQim1M+e3UYxmgPu/WyfjB3N3VflVyUjjjwH0dnCYA= +github.com/imdario/mergo v0.3.11/go.mod h1:jmQim1M+e3UYxmgPu/WyfjB3N3VflVyUjjjwH0dnCYA= +github.com/inconshreveable/mousetrap v1.0.0/go.mod h1:PxqpIevigyE2G7u3NXJIT2ANytuPF1OarO4DADm73n8= +github.com/j-keck/arping v0.0.0-20160618110441-2cf9dc699c56/go.mod h1:ymszkNOg6tORTn+6F6j+Jc8TOr5osrynvN6ivFWZ2GA= +github.com/jmespath/go-jmespath v0.0.0-20160202185014-0b12d6b521d8/go.mod h1:Nht3zPeWKUH0NzdCt2Blrr5ys8VGpn0CEB0cQHVjt7k= +github.com/jmespath/go-jmespath v0.0.0-20160803190731-bd40a432e4c7/go.mod h1:Nht3zPeWKUH0NzdCt2Blrr5ys8VGpn0CEB0cQHVjt7k= +github.com/jonboulle/clockwork v0.1.0/go.mod h1:Ii8DK3G1RaLaWxj9trq07+26W01tbo22gdxWY5EU2bo= +github.com/json-iterator/go v1.1.6/go.mod h1:+SdeFBvtyEkXs7REEP0seUULqWtbJapLOCVDaaPEHmU= +github.com/json-iterator/go v1.1.7/go.mod h1:KdQUCv79m/52Kvf8AW2vK1V8akMuk1QjK/uOdHXbAo4= +github.com/json-iterator/go v1.1.10/go.mod h1:KdQUCv79m/52Kvf8AW2vK1V8akMuk1QjK/uOdHXbAo4= +github.com/jstemmer/go-junit-report v0.0.0-20190106144839-af01ea7f8024/go.mod h1:6v2b51hI/fHJwM22ozAgKL4VKDeJcHhJFhtBdhmNjmU= +github.com/jstemmer/go-junit-report v0.9.1/go.mod h1:Brl9GWCQeLvo8nXZwPNNblvFj/XSXhF0NWZEnDohbsk= +github.com/jtolds/gls v4.20.0+incompatible/go.mod h1:QJZ7F/aHp+rZTRtaJ1ow/lLfFfVYBRgL+9YlvaHOwJU= +github.com/julienschmidt/httprouter v1.2.0/go.mod h1:SYymIcj16QtmaHHD7aYtjjsJG7VTCxuUUipMqKk8s4w= +github.com/kisielk/errcheck v1.1.0/go.mod h1:EZBBE59ingxPouuu3KfxchcWSUPOHkagtvWXihfKN4Q= +github.com/kisielk/errcheck v1.2.0/go.mod h1:/BMXB+zMLi60iA8Vv6Ksmxu/1UDYcXs4uQLJ+jE2L00= +github.com/kisielk/errcheck v1.5.0/go.mod h1:pFxgyoBC7bSaBwPgfKdkLd5X25qrDl4LWUI2bnpBCr8= +github.com/kisielk/gotool v1.0.0/go.mod h1:XhKaO+MFFWcvkIS/tQcRk01m1F5IRFswLeQ+oQHNcck= +github.com/klauspost/compress v1.11.3/go.mod h1:aoV0uJVorq1K+umq18yTdKaF57EivdYsUV+/s2qKfXs= +github.com/konsorten/go-windows-terminal-sequences v1.0.1/go.mod h1:T0+1ngSBFLxvqU3pZ+m/2kptfBszLMUkC4ZK/EgS/cQ= +github.com/konsorten/go-windows-terminal-sequences v1.0.2/go.mod h1:T0+1ngSBFLxvqU3pZ+m/2kptfBszLMUkC4ZK/EgS/cQ= +github.com/konsorten/go-windows-terminal-sequences v1.0.3/go.mod h1:T0+1ngSBFLxvqU3pZ+m/2kptfBszLMUkC4ZK/EgS/cQ= +github.com/kr/logfmt v0.0.0-20140226030751-b84e30acd515/go.mod h1:+0opPa2QZZtGFBFZlji/RkVcI2GknAs/DXo4wKdlNEc= +github.com/kr/pretty v0.1.0/go.mod h1:dAy3ld7l9f0ibDNOQOHHMYYIIbhfbHSm3C4ZsoJORNo= +github.com/kr/pretty v0.2.0 h1:s5hAObm+yFO5uHYt5dYjxi2rXrsnmRpJx4OYvIWUaQs= +github.com/kr/pretty v0.2.0/go.mod h1:ipq/a2n7PKx3OHsz4KJII5eveXtPO4qwEXGdVfWzfnI= +github.com/kr/pty v1.1.1/go.mod h1:pFQYn66WHrOpPYNljwOMqo10TkYh1fy3cYio2l3bCsQ= +github.com/kr/pty v1.1.5/go.mod h1:9r2w37qlBe7rQ6e1fg1S/9xpWHSnaqNdHD3WcMdbPDA= +github.com/kr/text v0.1.0 h1:45sCR5RtlFHMR4UwH9sdQ5TC8v0qDQCHnXt+kaKSTVE= +github.com/kr/text v0.1.0/go.mod h1:4Jbv+DJW3UT/LiOwJeYQe1efqtUx/iVham/4vfdArNI= +github.com/mailru/easyjson v0.0.0-20190614124828-94de47d64c63/go.mod h1:C1wdFJiN94OJF2b5HbByQZoLdCWB1Yqtg26g4irojpc= +github.com/mailru/easyjson v0.0.0-20190626092158-b2ccc519800e/go.mod h1:C1wdFJiN94OJF2b5HbByQZoLdCWB1Yqtg26g4irojpc= +github.com/mailru/easyjson v0.7.0/go.mod h1:KAzv3t3aY1NaHWoQz1+4F1ccyAH66Jk7yos7ldAVICs= +github.com/marstr/guid v1.1.0/go.mod h1:74gB1z2wpxxInTG6yaqA7KrtM0NZ+RbrcqDvYHefzho= +github.com/mattn/go-colorable v0.0.9/go.mod h1:9vuHe8Xs5qXnSaW/c/ABM9alt+Vo+STaOChaDxuIBZU= +github.com/mattn/go-isatty v0.0.4/go.mod h1:M+lRXTBqGeGNdLjl/ufCoiOlB5xdOkqRJdNxMWT7Zi4= +github.com/mattn/go-runewidth v0.0.2/go.mod h1:LwmH8dsx7+W8Uxz3IHJYH5QSwggIsqBzpuz5H//U1FU= +github.com/mattn/go-shellwords v1.0.3/go.mod h1:3xCvwCdWdlDJUrvuMn7Wuy9eWs4pE8vqg+NOMyg4B2o= +github.com/matttproud/golang_protobuf_extensions v1.0.1/go.mod h1:D8He9yQNgCq6Z5Ld7szi9bcBfOoFv/3dc6xSMkL2PC0= +github.com/matttproud/golang_protobuf_extensions v1.0.2-0.20181231171920-c182affec369/go.mod h1:BSXmuO+STAnVfrANrmjBb36TMTDstsz7MSK+HVaYKv4= +github.com/miekg/pkcs11 v1.0.3/go.mod h1:XsNlhZGX73bx86s2hdc/FuaLm2CPZJemRLMA+WTFxgs= +github.com/mistifyio/go-zfs v2.1.2-0.20190413222219-f784269be439+incompatible/go.mod h1:8AuVvqP/mXw1px98n46wfvcGfQ4ci2FwoAjKYxuo3Z4= +github.com/mitchellh/mapstructure v1.1.2/go.mod h1:FVVH3fgwuzCH5S8UJGiWEs2h04kUh9fWfEaFds41c1Y= +github.com/mitchellh/osext v0.0.0-20151018003038-5e2d6d41470f/go.mod h1:OkQIRizQZAeMln+1tSwduZz7+Af5oFlKirV/MSYes2A= +github.com/moby/sys/mountinfo v0.4.0/go.mod h1:rEr8tzG/lsIZHBtN/JjGG+LMYx9eXgW2JI+6q0qou+A= +github.com/moby/sys/mountinfo v0.4.1 h1:1O+1cHA1aujwEwwVMa2Xm2l+gIpUHyd3+D+d7LZh1kM= +github.com/moby/sys/mountinfo v0.4.1/go.mod h1:rEr8tzG/lsIZHBtN/JjGG+LMYx9eXgW2JI+6q0qou+A= +github.com/moby/sys/symlink v0.1.0/go.mod h1:GGDODQmbFOjFsXvfLVn3+ZRxkch54RkSiGqsZeMYowQ= +github.com/moby/term v0.0.0-20200312100748-672ec06f55cd/go.mod h1:DdlQx2hp0Ss5/fLikoLlEeIYiATotOjgB//nb973jeo= +github.com/modern-go/concurrent v0.0.0-20180228061459-e0a39a4cb421/go.mod h1:6dJC0mAP4ikYIbvyc7fijjWJddQyLn8Ig3JB5CqoB9Q= +github.com/modern-go/concurrent v0.0.0-20180306012644-bacd9c7ef1dd/go.mod h1:6dJC0mAP4ikYIbvyc7fijjWJddQyLn8Ig3JB5CqoB9Q= +github.com/modern-go/reflect2 v0.0.0-20180701023420-4b7aa43c6742/go.mod h1:bx2lNnkwVCuqBIxFjflWJWanXIb3RllmbCylyMrvgv0= +github.com/modern-go/reflect2 v1.0.1/go.mod h1:bx2lNnkwVCuqBIxFjflWJWanXIb3RllmbCylyMrvgv0= +github.com/mrunalp/fileutils v0.5.0/go.mod h1:M1WthSahJixYnrXQl/DFQuteStB1weuxD2QJNHXfbSQ= +github.com/munnerz/goautoneg v0.0.0-20120707110453-a547fc61f48d/go.mod h1:+n7T8mK8HuQTcFwEeznm/DIxMOiR9yIdICNftLE1DvQ= +github.com/munnerz/goautoneg v0.0.0-20191010083416-a7dc8b61c822/go.mod h1:+n7T8mK8HuQTcFwEeznm/DIxMOiR9yIdICNftLE1DvQ= +github.com/mwitkow/go-conntrack v0.0.0-20161129095857-cc309e4a2223/go.mod h1:qRWi+5nqEBWmkhHvq77mSJWrCKwh8bxhgT7d/eI7P4U= +github.com/mxk/go-flowrate v0.0.0-20140419014527-cca7078d478f/go.mod h1:ZdcZmHo+o7JKHSa8/e818NopupXU1YMK5fe1lsApnBw= +github.com/ncw/swift v1.0.47/go.mod h1:23YIA4yWVnGwv2dQlN4bB7egfYX6YLn0Yo/S6zZO/ZM= +github.com/olekukonko/tablewriter v0.0.0-20170122224234-a0225b3f23b5/go.mod h1:vsDQFd/mU46D+Z4whnwzcISnGGzXWMclvtLoiIKAKIo= +github.com/onsi/ginkgo v0.0.0-20151202141238-7f8ab55aaf3b/go.mod h1:lLunBs/Ym6LB5Z9jYTR76FiuTmxDTDusOGeTQH+WWjE= +github.com/onsi/ginkgo v0.0.0-20170829012221-11459a886d9c/go.mod h1:lLunBs/Ym6LB5Z9jYTR76FiuTmxDTDusOGeTQH+WWjE= +github.com/onsi/ginkgo v1.6.0/go.mod h1:lLunBs/Ym6LB5Z9jYTR76FiuTmxDTDusOGeTQH+WWjE= +github.com/onsi/ginkgo v1.10.1/go.mod h1:lLunBs/Ym6LB5Z9jYTR76FiuTmxDTDusOGeTQH+WWjE= +github.com/onsi/ginkgo v1.10.3/go.mod h1:lLunBs/Ym6LB5Z9jYTR76FiuTmxDTDusOGeTQH+WWjE= +github.com/onsi/ginkgo v1.11.0/go.mod h1:lLunBs/Ym6LB5Z9jYTR76FiuTmxDTDusOGeTQH+WWjE= +github.com/onsi/gomega v0.0.0-20151007035656-2152b45fa28a/go.mod h1:C1qb7wdrVGGVU+Z6iS04AVkA3Q65CEZX59MT0QO5uiA= +github.com/onsi/gomega v0.0.0-20170829124025-dcabb60a477c/go.mod h1:C1qb7wdrVGGVU+Z6iS04AVkA3Q65CEZX59MT0QO5uiA= +github.com/onsi/gomega v1.7.0/go.mod h1:ex+gbHU/CVuBBDIJjb2X0qEXbFg53c61hWP/1CpauHY= +github.com/onsi/gomega v1.7.1/go.mod h1:XdKZgCCFLUoM/7CFJVPcG8C1xQ1AJ0vpAezJrB7JYyY= +github.com/opencontainers/go-digest v0.0.0-20170106003457-a6d0ee40d420/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s= +github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s= +github.com/opencontainers/go-digest v1.0.0-rc1/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s= +github.com/opencontainers/go-digest v1.0.0-rc1.0.20180430190053-c9281466c8b2/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s= +github.com/opencontainers/go-digest v1.0.0 h1:apOUWs51W5PlhuyGyz9FCeeBIOUDA/6nW8Oi/yOhh5U= +github.com/opencontainers/go-digest v1.0.0/go.mod h1:0JzlMkj0TRzQZfJkVvzbP0HBR3IKzErnv2BNG4W4MAM= +github.com/opencontainers/image-spec v1.0.0/go.mod h1:BtxoFyWECRxE4U/7sNtV5W15zMzWCbyJoFRP3s7yZA0= +github.com/opencontainers/image-spec v1.0.1/go.mod h1:BtxoFyWECRxE4U/7sNtV5W15zMzWCbyJoFRP3s7yZA0= +github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U= +github.com/opencontainers/runc v0.1.1/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U= +github.com/opencontainers/runc v1.0.0-rc8.0.20190926000215-3e425f80a8c9/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U= +github.com/opencontainers/runc v1.0.0-rc9/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U= +github.com/opencontainers/runc v1.0.0-rc93/go.mod h1:3NOsor4w32B2tC0Zbl8Knk4Wg84SM2ImC1fxBuqJ/H0= +github.com/opencontainers/runtime-spec v0.1.2-0.20190507144316-5b71a03e2700/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0= +github.com/opencontainers/runtime-spec v1.0.1/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0= +github.com/opencontainers/runtime-spec v1.0.2-0.20190207185410-29686dbc5559/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0= +github.com/opencontainers/runtime-spec v1.0.2/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0= +github.com/opencontainers/runtime-spec v1.0.3-0.20200929063507-e6143ca7d51d h1:pNa8metDkwZjb9g4T8s+krQ+HRgZAkqnXml+wNir/+s= +github.com/opencontainers/runtime-spec v1.0.3-0.20200929063507-e6143ca7d51d/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0= +github.com/opencontainers/runtime-tools v0.0.0-20181011054405-1d69bd0f9c39/go.mod h1:r3f7wjNzSs2extwzU3Y+6pKfobzPh+kKFJ3ofN+3nfs= +github.com/opencontainers/selinux v1.6.0/go.mod h1:VVGKuOLlE7v4PJyT6h7mNWvq1rzqiriPsEqVhc+svHE= +github.com/opencontainers/selinux v1.8.0/go.mod h1:RScLhm78qiWa2gbVCcGkC7tCGdgk3ogry1nUQF8Evvo= +github.com/peterbourgon/diskv v2.0.1+incompatible/go.mod h1:uqqh8zWWbv1HBMNONnaR/tNboyR3/BZd58JJSHlUSCU= +github.com/pkg/errors v0.8.0/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0= +github.com/pkg/errors v0.8.1-0.20171018195549-f15c970de5b7/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0= +github.com/pkg/errors v0.8.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0= +github.com/pkg/errors v0.9.1 h1:FEBLx1zS214owpjy7qsBeixbURkuhQAwrK5UwLGTwt4= +github.com/pkg/errors v0.9.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0= +github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM= +github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4= +github.com/pquerna/cachecontrol v0.0.0-20171018203845-0dec1b30a021/go.mod h1:prYjPmNq4d1NPVmpShWobRqXY3q7Vp+80DqgxxUrUIA= +github.com/prometheus/client_golang v0.0.0-20180209125602-c332b6f63c06/go.mod h1:7SWBe2y4D6OKWSNQJUaRYU/AaXPKyh/dDVn+NZz0KFw= +github.com/prometheus/client_golang v0.9.1/go.mod h1:7SWBe2y4D6OKWSNQJUaRYU/AaXPKyh/dDVn+NZz0KFw= +github.com/prometheus/client_golang v1.0.0/go.mod h1:db9x61etRT2tGnBNRi70OPL5FsnadC4Ky3P0J6CfImo= +github.com/prometheus/client_golang v1.1.0/go.mod h1:I1FGZT9+L76gKKOs5djB6ezCbFQP1xR9D75/vuwEF3g= +github.com/prometheus/client_golang v1.7.1/go.mod h1:PY5Wy2awLA44sXw4AOSfFBetzPP4j5+D6mVACh+pe2M= +github.com/prometheus/client_model v0.0.0-20171117100541-99fa1f4be8e5/go.mod h1:MbSGuTsp3dbXC40dX6PRTWyKYBIrTGTE9sqQNg2J8bo= +github.com/prometheus/client_model v0.0.0-20180712105110-5c3871d89910/go.mod h1:MbSGuTsp3dbXC40dX6PRTWyKYBIrTGTE9sqQNg2J8bo= +github.com/prometheus/client_model v0.0.0-20190129233127-fd36f4220a90/go.mod h1:xMI15A0UPsDsEKsMN9yxemIoYk6Tm2C1GtYGdfGttqA= +github.com/prometheus/client_model v0.0.0-20190812154241-14fe0d1b01d4/go.mod h1:xMI15A0UPsDsEKsMN9yxemIoYk6Tm2C1GtYGdfGttqA= +github.com/prometheus/client_model v0.2.0/go.mod h1:xMI15A0UPsDsEKsMN9yxemIoYk6Tm2C1GtYGdfGttqA= +github.com/prometheus/common v0.0.0-20180110214958-89604d197083/go.mod h1:daVV7qP5qjZbuso7PdcryaAu0sAZbrN9i7WWcTMWvro= +github.com/prometheus/common v0.4.1/go.mod h1:TNfzLD0ON7rHzMJeJkieUDPYmFC7Snx/y86RQel1bk4= +github.com/prometheus/common v0.6.0/go.mod h1:eBmuwkDJBwy6iBfxCBob6t6dR6ENT/y+J+Zk0j9GMYc= +github.com/prometheus/common v0.10.0/go.mod h1:Tlit/dnDKsSWFlCLTWaA1cyBgKHSMdTB80sz/V91rCo= +github.com/prometheus/procfs v0.0.0-20180125133057-cb4147076ac7/go.mod h1:c3At6R/oaqEKCNdg8wHV1ftS6bRYblBhIjjI8uT2IGk= +github.com/prometheus/procfs v0.0.0-20181005140218-185b4288413d/go.mod h1:c3At6R/oaqEKCNdg8wHV1ftS6bRYblBhIjjI8uT2IGk= +github.com/prometheus/procfs v0.0.0-20190522114515-bc1a522cf7b1/go.mod h1:TjEm7ze935MbeOT/UhFTIMYKhuLP4wbCsTZCD3I8kEA= +github.com/prometheus/procfs v0.0.2/go.mod h1:TjEm7ze935MbeOT/UhFTIMYKhuLP4wbCsTZCD3I8kEA= +github.com/prometheus/procfs v0.0.3/go.mod h1:4A/X28fw3Fc593LaREMrKMqOKvUAntwMDaekg4FpcdQ= +github.com/prometheus/procfs v0.0.5/go.mod h1:4A/X28fw3Fc593LaREMrKMqOKvUAntwMDaekg4FpcdQ= +github.com/prometheus/procfs v0.0.8/go.mod h1:7Qr8sr6344vo1JqZ6HhLceV9o3AJ1Ff+GxbHq6oeK9A= +github.com/prometheus/procfs v0.1.3/go.mod h1:lV6e/gmhEcM9IjHGsFOCxxuZ+z1YqCvr4OA4YeYWdaU= +github.com/prometheus/procfs v0.2.0/go.mod h1:lV6e/gmhEcM9IjHGsFOCxxuZ+z1YqCvr4OA4YeYWdaU= +github.com/prometheus/procfs v0.6.0 h1:mxy4L2jP6qMonqmq+aTtOx1ifVWUgG/TAmntgbh3xv4= +github.com/prometheus/procfs v0.6.0/go.mod h1:cz+aTbrPOrUb4q7XlbU9ygM+/jj0fzG6c1xBZuNvfVA= +github.com/rogpeppe/fastuuid v0.0.0-20150106093220-6724a57986af/go.mod h1:XWv6SoW27p1b0cqNHllgS5HIMJraePCO15w5zCzIWYg= +github.com/rogpeppe/go-internal v1.3.0/go.mod h1:M8bDsm7K2OlrFYOpmOWEs/qY81heoFRclV5y23lUDJ4= +github.com/russross/blackfriday/v2 v2.0.1 h1:lPqVAte+HuHNfhJ/0LC98ESWRz8afy9tM/0RK8m9o+Q= +github.com/russross/blackfriday/v2 v2.0.1/go.mod h1:+Rmxgy9KzJVeS9/2gXHxylqXiyQDYRxCVz55jmeOWTM= +github.com/safchain/ethtool v0.0.0-20190326074333-42ed695e3de8/go.mod h1:Z0q5wiBQGYcxhMZ6gUqHn6pYNLypFAvaL3UvgZLR0U4= +github.com/satori/go.uuid v1.2.0/go.mod h1:dA0hQrYB0VpLJoorglMZABFdXlWrHn1NEOzdhQKdks0= +github.com/seccomp/libseccomp-golang v0.9.1/go.mod h1:GbW5+tmTXfcxTToHLXlScSlAvWlF4P2Ca7zGrPiEpWo= +github.com/shurcooL/sanitized_anchor_name v1.0.0 h1:PdmoCO6wvbs+7yrJyMORt4/BmY5IYyJwS/kOiWx8mHo= +github.com/shurcooL/sanitized_anchor_name v1.0.0/go.mod h1:1NzhyTcUVG4SuEtjjoZeVRXNmyL/1OwPU0+IJeTBvfc= +github.com/sirupsen/logrus v1.0.4-0.20170822132746-89742aefa4b2/go.mod h1:pMByvHTf9Beacp5x1UXfOR9xyW/9antXMhjMPG0dEzc= +github.com/sirupsen/logrus v1.0.6/go.mod h1:pMByvHTf9Beacp5x1UXfOR9xyW/9antXMhjMPG0dEzc= +github.com/sirupsen/logrus v1.2.0/go.mod h1:LxeOpSwHxABJmUn/MG1IvRgCAasNZTLOkJPxbbu5VWo= +github.com/sirupsen/logrus v1.4.1/go.mod h1:ni0Sbl8bgC9z8RoU9G6nDWqqs/fq4eDPysMBDgk/93Q= +github.com/sirupsen/logrus v1.4.2/go.mod h1:tLMulIdttU9McNUspp0xgXVQah82FyeX6MwdIuYE2rE= +github.com/sirupsen/logrus v1.6.0/go.mod h1:7uNnSEd1DgxDLC74fIahvMZmmYsHGZGEOFrfsX/uA88= +github.com/sirupsen/logrus v1.7.0 h1:ShrD1U9pZB12TX0cVy0DtePoCH97K8EtX+mg7ZARUtM= +github.com/sirupsen/logrus v1.7.0/go.mod h1:yWOB1SBYBC5VeMP7gHvWumXLIWorT60ONWic61uBYv0= +github.com/smartystreets/assertions v0.0.0-20180927180507-b2de0cb4f26d/go.mod h1:OnSkiWE9lh6wB0YB77sQom3nweQdgAjqCqsofrRNTgc= +github.com/smartystreets/goconvey v0.0.0-20190330032615-68dc04aab96a/go.mod h1:syvi0/a8iFYH4r/RixwvyeAJjdLS9QV7WQ/tjFTllLA= +github.com/soheilhy/cmux v0.1.4/go.mod h1:IM3LyeVVIOuxMH7sFAkER9+bJ4dT7Ms6E4xg4kGIyLM= +github.com/spf13/afero v1.2.2/go.mod h1:9ZxEEn6pIJ8Rxe320qSDBk6AsU0r9pR7Q4OcevTdifk= +github.com/spf13/cobra v0.0.2-0.20171109065643-2da4a54c5cee/go.mod h1:1l0Ry5zgKvJasoi3XT1TypsSe7PqH0Sj9dhYf7v3XqQ= +github.com/spf13/cobra v0.0.3/go.mod h1:1l0Ry5zgKvJasoi3XT1TypsSe7PqH0Sj9dhYf7v3XqQ= +github.com/spf13/pflag v0.0.0-20170130214245-9ff6c6923cff/go.mod h1:DYY7MBk1bdzusC3SYhjObp+wFpr4gzcvqqNjLnInEg4= +github.com/spf13/pflag v1.0.1-0.20171106142849-4c012f6dcd95/go.mod h1:DYY7MBk1bdzusC3SYhjObp+wFpr4gzcvqqNjLnInEg4= +github.com/spf13/pflag v1.0.1/go.mod h1:DYY7MBk1bdzusC3SYhjObp+wFpr4gzcvqqNjLnInEg4= +github.com/spf13/pflag v1.0.3/go.mod h1:DYY7MBk1bdzusC3SYhjObp+wFpr4gzcvqqNjLnInEg4= +github.com/spf13/pflag v1.0.5/go.mod h1:McXfInJRrz4CZXVZOBLb0bTZqETkiAhM9Iw0y3An2Bg= +github.com/stefanberger/go-pkcs11uri v0.0.0-20201008174630-78d3cae3a980/go.mod h1:AO3tvPzVZ/ayst6UlUKUv6rcPQInYe3IknH3jYhAKu8= +github.com/stretchr/objx v0.0.0-20180129172003-8a3f7159479f/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME= +github.com/stretchr/objx v0.1.0/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME= +github.com/stretchr/objx v0.1.1/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME= +github.com/stretchr/objx v0.2.0/go.mod h1:qt09Ya8vawLte6SNmTgCsAVtYtaKzEcn8ATUoHMkEqE= +github.com/stretchr/testify v0.0.0-20180303142811-b89eecf5ca5d/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXfy6kDkUVs= +github.com/stretchr/testify v1.2.2/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXfy6kDkUVs= +github.com/stretchr/testify v1.3.0/go.mod h1:M5WIy9Dh21IEIfnGCwXGc5bZfKNJtfHm1UVUgZn+9EI= +github.com/stretchr/testify v1.4.0/go.mod h1:j7eGeouHqKxXV5pUuKE4zz7dFj8WfuZ+81PSLYec5m4= +github.com/stretchr/testify v1.6.1 h1:hDPOHmpOpP40lSULcqw7IrRb/u7w6RpDC9399XyoNd0= +github.com/stretchr/testify v1.6.1/go.mod h1:6Fq8oRcR53rry900zMqJjRRixrwX3KX962/h/Wwjteg= +github.com/syndtr/gocapability v0.0.0-20170704070218-db04d3cc01c8/go.mod h1:hkRG7XYTFWNJGYcbNJQlaLq0fg1yr4J4t/NcTQtrfww= +github.com/syndtr/gocapability v0.0.0-20180916011248-d98352740cb2/go.mod h1:hkRG7XYTFWNJGYcbNJQlaLq0fg1yr4J4t/NcTQtrfww= +github.com/syndtr/gocapability v0.0.0-20200815063812-42c35b437635/go.mod h1:hkRG7XYTFWNJGYcbNJQlaLq0fg1yr4J4t/NcTQtrfww= +github.com/tchap/go-patricia v2.2.6+incompatible/go.mod h1:bmLyhP68RS6kStMGxByiQ23RP/odRBOTVjwp2cDyi6I= +github.com/tmc/grpc-websocket-proxy v0.0.0-20170815181823-89b8d40f7ca8/go.mod h1:ncp9v5uamzpCO7NfCPTXjqaC+bZgJeR0sMTm6dMHP7U= +github.com/tmc/grpc-websocket-proxy v0.0.0-20190109142713-0ad062ec5ee5/go.mod h1:ncp9v5uamzpCO7NfCPTXjqaC+bZgJeR0sMTm6dMHP7U= +github.com/urfave/cli v0.0.0-20171014202726-7bc6a0acffa5/go.mod h1:70zkFmudgCuE/ngEzBv17Jvp/497gISqfk5gWijbERA= +github.com/urfave/cli v1.20.0/go.mod h1:70zkFmudgCuE/ngEzBv17Jvp/497gISqfk5gWijbERA= +github.com/urfave/cli v1.22.1/go.mod h1:Gos4lmkARVdJ6EkW0WaNv/tZAAMe9V7XWyB60NtXRu0= +github.com/urfave/cli v1.22.2 h1:gsqYFH8bb9ekPA12kRo0hfjngWQjkJPlN9R0N78BoUo= +github.com/urfave/cli v1.22.2/go.mod h1:Gos4lmkARVdJ6EkW0WaNv/tZAAMe9V7XWyB60NtXRu0= +github.com/vishvananda/netlink v0.0.0-20181108222139-023a6dafdcdf/go.mod h1:+SR5DhBJrl6ZM7CoCKvpw5BKroDKQ+PJqOg65H/2ktk= +github.com/vishvananda/netlink v1.1.0/go.mod h1:cTgwzPIzzgDAYoQrMm0EdrjRUBkTqKYppBueQtXaqoE= +github.com/vishvananda/netns v0.0.0-20180720170159-13995c7128cc/go.mod h1:ZjcWmFBXmLKZu9Nxj3WKYEafiSqer2rnvPr0en9UNpI= +github.com/vishvananda/netns v0.0.0-20191106174202-0a2b9b5464df/go.mod h1:JP3t17pCcGlemwknint6hfoeCVQrEMVwxRLRjXpq+BU= +github.com/willf/bitset v1.1.11-0.20200630133818-d5bec3311243/go.mod h1:RjeCKbqT1RxIR/KWY6phxZiaY1IyutSBfGjNPySAYV4= +github.com/willf/bitset v1.1.11/go.mod h1:83CECat5yLh5zVOf4P1ErAgKA5UDvKtgyUABdr3+MjI= +github.com/xeipuuv/gojsonpointer v0.0.0-20180127040702-4e3ac2762d5f/go.mod h1:N2zxlSyiKSe5eX1tZViRH5QA0qijqEDrYZiPEAiq3wU= +github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415/go.mod h1:GwrjFmJcFw6At/Gs6z4yjiIwzuJ1/+UwLxMQDVQXShQ= +github.com/xeipuuv/gojsonschema v0.0.0-20180618132009-1d523034197f/go.mod h1:5yf86TLmAcydyeJq5YvxkGPE2fm/u4myDekKRoLuqhs= +github.com/xiang90/probing v0.0.0-20190116061207-43a291ad63a2/go.mod h1:UETIi67q53MR2AWcXfiuqkDkRtnGDLqkBTpCHuJHxtU= +github.com/yuin/goldmark v1.1.27/go.mod h1:3hX8gzYuyVAZsxl0MRgGTJEmQBFcNTphYh9decYSb74= +github.com/yuin/goldmark v1.2.1/go.mod h1:3hX8gzYuyVAZsxl0MRgGTJEmQBFcNTphYh9decYSb74= +github.com/yvasiyarov/go-metrics v0.0.0-20140926110328-57bccd1ccd43/go.mod h1:aX5oPXxHm3bOH+xeAttToC8pqch2ScQN/JoXYupl6xs= +github.com/yvasiyarov/gorelic v0.0.0-20141212073537-a9bba5b9ab50/go.mod h1:NUSPSUX/bi6SeDMUh6brw0nXpxHnc96TguQh0+r/ssA= +github.com/yvasiyarov/newrelic_platform_go v0.0.0-20140908184405-b21fdbd4370f/go.mod h1:GlGEuHIJweS1mbCqG+7vt2nvWLzLLnRHbXz5JKd/Qbg= +go.etcd.io/bbolt v1.3.3/go.mod h1:IbVyRI1SCnLcuJnV2u8VeU0CEYM7e686BmAb1XKL+uU= +go.etcd.io/bbolt v1.3.5/go.mod h1:G5EMThwa9y8QZGBClrRx5EY+Yw9kAhnjy3bSjsnlVTQ= +go.etcd.io/etcd v0.5.0-alpha.5.0.20200910180754-dd1b699fc489/go.mod h1:yVHk9ub3CSBatqGNg7GRmsnfLWtoW60w4eDYfh7vHDg= +go.mozilla.org/pkcs7 v0.0.0-20200128120323-432b2356ecb1/go.mod h1:SNgMg+EgDFwmvSmLRTNKC5fegJjB7v23qTQ0XLGUNHk= +go.opencensus.io v0.21.0/go.mod h1:mSImk1erAIZhrmZN+AvHh14ztQfjbGwt4TtuofqLduU= +go.opencensus.io v0.22.0/go.mod h1:+kGneAE2xo2IficOXnaByMWTGM9T73dGwxeWcUqIpI8= +go.opencensus.io v0.22.2/go.mod h1:yxeiOL68Rb0Xd1ddK5vPZ/oVn4vY4Ynel7k9FzqtOIw= +go.opencensus.io v0.22.3 h1:8sGtKOrtQqkN1bp2AtX+misvLIlOmsEsNd+9NIcPEm8= +go.opencensus.io v0.22.3/go.mod h1:yxeiOL68Rb0Xd1ddK5vPZ/oVn4vY4Ynel7k9FzqtOIw= +go.uber.org/atomic v1.3.2/go.mod h1:gD2HeocX3+yG+ygLZcrzQJaqmWj9AIm7n08wl/qW/PE= +go.uber.org/atomic v1.4.0/go.mod h1:gD2HeocX3+yG+ygLZcrzQJaqmWj9AIm7n08wl/qW/PE= +go.uber.org/multierr v1.1.0/go.mod h1:wR5kodmAFQ0UK8QlbwjlSNy0Z68gJhDJUG5sjR94q/0= +go.uber.org/zap v1.10.0/go.mod h1:vwi/ZaCAaUcBkycHslxD9B2zi4UTXhF60s6SWpuDF0Q= +golang.org/x/crypto v0.0.0-20171113213409-9f005a07e0d3/go.mod h1:6SG95UA2DQfeDnfUPMdvaQW0Q7yPrPDi9nlGo2tz2b4= +golang.org/x/crypto v0.0.0-20180904163835-0709b304e793/go.mod h1:6SG95UA2DQfeDnfUPMdvaQW0Q7yPrPDi9nlGo2tz2b4= +golang.org/x/crypto v0.0.0-20181009213950-7c1a557ab941/go.mod h1:6SG95UA2DQfeDnfUPMdvaQW0Q7yPrPDi9nlGo2tz2b4= +golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACkg1iLfiJU5Ep61QUkGW8qpdssI0+w= +golang.org/x/crypto v0.0.0-20190510104115-cbcb75029529/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI= +golang.org/x/crypto v0.0.0-20190605123033-f99c8df09eb5/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI= +golang.org/x/crypto v0.0.0-20190611184440-5c40567a22f8/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI= +golang.org/x/crypto v0.0.0-20190701094942-4def268fd1a4/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI= +golang.org/x/crypto v0.0.0-20191011191535-87dc89f01550/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI= +golang.org/x/crypto v0.0.0-20200622213623-75b288015ac9/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto= +golang.org/x/crypto v0.0.0-20200728195943-123391ffb6de/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto= +golang.org/x/crypto v0.0.0-20201002170205-7f63de1d35b0/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto= +golang.org/x/exp v0.0.0-20190121172915-509febef88a4/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA= +golang.org/x/exp v0.0.0-20190306152737-a1d7652674e8/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA= +golang.org/x/exp v0.0.0-20190510132918-efd6b22b2522/go.mod h1:ZjyILWgesfNpC6sMxTJOJm9Kp84zZh5NQWvqDGG3Qr8= +golang.org/x/exp v0.0.0-20190829153037-c13cbed26979/go.mod h1:86+5VVa7VpoJ4kLfm080zCjGlMRFzhUhsZKEZO7MGek= +golang.org/x/exp v0.0.0-20191030013958-a1ab85dbe136/go.mod h1:JXzH8nQsPlswgeRAPE3MuO9GYsAcnJvJ4vnMwN/5qkY= +golang.org/x/exp v0.0.0-20191129062945-2f5052295587/go.mod h1:2RIsYlXP63K8oxa1u096TMicItID8zy7Y6sNkU49FU4= +golang.org/x/exp v0.0.0-20191227195350-da58074b4299/go.mod h1:2RIsYlXP63K8oxa1u096TMicItID8zy7Y6sNkU49FU4= +golang.org/x/exp v0.0.0-20200119233911-0405dc783f0a/go.mod h1:2RIsYlXP63K8oxa1u096TMicItID8zy7Y6sNkU49FU4= +golang.org/x/exp v0.0.0-20200207192155-f17229e696bd/go.mod h1:J/WKrq2StrnmMY6+EHIKF9dgMWnmCNThgcyBT1FY9mM= +golang.org/x/exp v0.0.0-20200224162631-6cc2880d07d6/go.mod h1:3jZMyOhIsHpP37uCMkUooju7aAi5cS1Q23tOzKc+0MU= +golang.org/x/image v0.0.0-20190227222117-0694c2d4d067/go.mod h1:kZ7UVZpmo3dzQBMxlp+ypCbDeSB+sBbTgSJuh5dn5js= +golang.org/x/image v0.0.0-20190802002840-cff245a6509b/go.mod h1:FeLwcggjj3mMvU+oOTbSwawSJRM1uh48EjtB4UJZlP0= +golang.org/x/lint v0.0.0-20181026193005-c67002cb31c3/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE= +golang.org/x/lint v0.0.0-20190227174305-5b3e6a55c961/go.mod h1:wehouNa3lNwaWXcvxsM5YxQ5yQlVC4a0KAMCusXpPoU= +golang.org/x/lint v0.0.0-20190301231843-5614ed5bae6f/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE= +golang.org/x/lint v0.0.0-20190313153728-d0100b6bd8b3/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc= +golang.org/x/lint v0.0.0-20190409202823-959b441ac422/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc= +golang.org/x/lint v0.0.0-20190909230951-414d861bb4ac/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc= +golang.org/x/lint v0.0.0-20190930215403-16217165b5de/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc= +golang.org/x/lint v0.0.0-20191125180803-fdd1cda4f05f/go.mod h1:5qLYkcX4OjUUV8bRuDixDT3tpyyb+LUpUlRWLxfhWrs= +golang.org/x/lint v0.0.0-20200130185559-910be7a94367/go.mod h1:3xt1FjdF8hUf6vQPIChWIBhFzV8gjjsPE/fR3IyQdNY= +golang.org/x/lint v0.0.0-20200302205851-738671d3881b/go.mod h1:3xt1FjdF8hUf6vQPIChWIBhFzV8gjjsPE/fR3IyQdNY= +golang.org/x/mobile v0.0.0-20190312151609-d3739f865fa6/go.mod h1:z+o9i4GpDbdi3rU15maQ/Ox0txvL9dWGYEHz965HBQE= +golang.org/x/mobile v0.0.0-20190719004257-d2bd2a29d028/go.mod h1:E/iHnbuqvinMTCcRqshq8CkpyQDoeVncDDYHnLhea+o= +golang.org/x/mod v0.0.0-20190513183733-4bf6d317e70e/go.mod h1:mXi4GBBbnImb6dmsKGUJ2LatrhH/nqhxcFungHvyanc= +golang.org/x/mod v0.1.0/go.mod h1:0QHyrYULN0/3qlju5TqG8bIK38QM8yzMo5ekMj3DlcY= +golang.org/x/mod v0.1.1-0.20191105210325-c90efee705ee/go.mod h1:QqPTAvyqsEbceGzBzNggFXnrqF1CaUcvgkdR5Ot7KZg= +golang.org/x/mod v0.1.1-0.20191107180719-034126e5016b/go.mod h1:QqPTAvyqsEbceGzBzNggFXnrqF1CaUcvgkdR5Ot7KZg= +golang.org/x/mod v0.2.0/go.mod h1:s0Qsj1ACt9ePp/hMypM3fl4fZqREWJwdYDEqhRiZZUA= +golang.org/x/mod v0.3.0/go.mod h1:s0Qsj1ACt9ePp/hMypM3fl4fZqREWJwdYDEqhRiZZUA= +golang.org/x/net v0.0.0-20180724234803-3673e40ba225/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20180826012351-8a410e7b638d/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20180906233101-161cd47e91fd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20181011144130-49bb7cea24b1/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20181114220301-adae6a3d119a/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20181220203305-927f97764cc3/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20190108225652-1e06a53dbb7e/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20190213061140-3a22650c66bd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20190311183353-d8887717615a/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= +golang.org/x/net v0.0.0-20190404232315-eb5bcb51f2a3/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= +golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= +golang.org/x/net v0.0.0-20190503192946-f4e77d36d62c/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= +golang.org/x/net v0.0.0-20190522155817-f3200d17e092/go.mod h1:HSz+uSET+XFnRR8LxR5pz3Of3rY3CfYBVs4xY44aLks= +golang.org/x/net v0.0.0-20190603091049-60506f45cf65/go.mod h1:HSz+uSET+XFnRR8LxR5pz3Of3rY3CfYBVs4xY44aLks= +golang.org/x/net v0.0.0-20190613194153-d28f0bde5980/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= +golang.org/x/net v0.0.0-20190619014844-b5b0513f8c1b/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= +golang.org/x/net v0.0.0-20190620200207-3b0461eec859/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= +golang.org/x/net v0.0.0-20190724013045-ca1201d0de80/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= +golang.org/x/net v0.0.0-20190813141303-74dc4d7220e7/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= +golang.org/x/net v0.0.0-20190827160401-ba9fcec4b297/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= +golang.org/x/net v0.0.0-20191004110552-13f9640d40b9/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= +golang.org/x/net v0.0.0-20191209160850-c0dbc17a3553/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= +golang.org/x/net v0.0.0-20200114155413-6afb5195e5aa/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= +golang.org/x/net v0.0.0-20200202094626-16171245cfb2/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= +golang.org/x/net v0.0.0-20200222125558-5a598a2470a0/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= +golang.org/x/net v0.0.0-20200226121028-0de0cce0169b/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= +golang.org/x/net v0.0.0-20200301022130-244492dfa37a/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= +golang.org/x/net v0.0.0-20200324143707-d3edc9973b7e/go.mod h1:qpuaurCH72eLCgpAm/N6yyVIVM9cpaDIP3A8BGJEC5A= +golang.org/x/net v0.0.0-20200707034311-ab3426394381/go.mod h1:/O7V0waA8r7cgGh81Ro3o1hOxt32SMVPicZroKQ2sZA= +golang.org/x/net v0.0.0-20201021035429-f5854403a974/go.mod h1:sp8m0HH+o8qH0wwXwYZr8TS3Oi6o0r6Gce1SSxlDquU= +golang.org/x/net v0.0.0-20201110031124-69a78807bb2b/go.mod h1:sp8m0HH+o8qH0wwXwYZr8TS3Oi6o0r6Gce1SSxlDquU= +golang.org/x/net v0.0.0-20201224014010-6772e930b67b h1:iFwSg7t5GZmB/Q5TjiEAsdoLDrdJRC1RiF2WhuV29Qw= +golang.org/x/net v0.0.0-20201224014010-6772e930b67b/go.mod h1:m0MpNAwzfU5UDzcl9v0D8zg8gWTRqZa9RBIspLL5mdg= +golang.org/x/oauth2 v0.0.0-20180821212333-d2e6202438be/go.mod h1:N/0e6XlmueqKjAGxoOufVs8QHGRruUQn6yWY3a++T0U= +golang.org/x/oauth2 v0.0.0-20190226205417-e64efc72b421/go.mod h1:gOpvHmFTYa4IltrdGE7lF6nIHvwfUNPOp7c8zoXwtLw= +golang.org/x/oauth2 v0.0.0-20190604053449-0f29369cfe45/go.mod h1:gOpvHmFTYa4IltrdGE7lF6nIHvwfUNPOp7c8zoXwtLw= +golang.org/x/oauth2 v0.0.0-20191202225959-858c2ad4c8b6/go.mod h1:gOpvHmFTYa4IltrdGE7lF6nIHvwfUNPOp7c8zoXwtLw= +golang.org/x/oauth2 v0.0.0-20200107190931-bf48bf16ab8d/go.mod h1:gOpvHmFTYa4IltrdGE7lF6nIHvwfUNPOp7c8zoXwtLw= +golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20181108010431-42b317875d0f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20181221193216-37e7f081c4d4/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20190423024810-112230192c58/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20190911185100-cd5d95a43a6e/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20200625203802-6e8e738ad208/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20201020160332-67f06af15bc9/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20201207232520-09787c993a3a h1:DcqTD9SDLc+1P/r1EmRBwnVsrOwW+kk2vWf9n+1sGhs= +golang.org/x/sync v0.0.0-20201207232520-09787c993a3a/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sys v0.0.0-20180830151530-49385e6e1522/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20180905080454-ebe1bf3edb33/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20180909124046-d0be0721c37e/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20181107165924-66b7b1311ac8/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20181116152217-5ac8a444bdc5/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20190312061237-fead79001313/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190412213103-97732733099d/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190422165155-953cdadca894/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190507160741-ecd444e8653b/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190514135907-3a4b5fb9f71f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190522044717-8097e1b27ff5/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190602015325-4c4f7f33c9ed/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190606165138-5da285871e9c/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190606203320-7fc4e5ec1444/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190616124812-15dcb6c0061f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190624142023-c5567b49c5d0/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190726091711-fc99dfbffb4e/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190801041406-cbf593c0f2f3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190812073006-9eafafc0a87e/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190826190057-c7b8b68b1456/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20191001151750-bb3f8db39f24/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20191005200804-aed5e4c7ecf9/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20191022100944-742c48ecaeb7/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20191026070338-33540a1f6037/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20191115151921-52ab43148777/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20191120155948-bd437916bb0e/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20191204072324-ce4227a45e2e/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20191210023423-ac6580df4449/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20191228213918-04cbcbbfeed8/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20200106162015-b016eb3dc98e/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20200113162924-86b910548bc1/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20200120151820-655fe14d7479/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20200122134326-e047566fdf82/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20200124204421-9fbb57f87de9/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20200202164722-d101bd2416d5/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20200212091648-12a6c2dcc1e4/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20200223170610-d5e6a3e2c0ae/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20200302150141-5c8b2ff67527/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20200323222414-85ca7c5b95cd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20200615200032-f1bc736245b1/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20200622214017-ed371f2e16b4/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20200728102440-3e129f6d46b1/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20200817155316-9781c653f443/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20200909081042-eff7692f9009/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20200916030750-2334cc1a136f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20200922070232-aee5d888a860/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20200930185726-fdedc70b468f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20201112073958-5cba982894dd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20201119102817-f84b799fce68/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20201201145000-ef89a241ccb3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20201202213521-69691e467435/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20210124154548-22da62e12c0c h1:VwygUrnw9jn88c4u8GD3rZQbqrP/tgas88tPUbBxQrk= +golang.org/x/sys v0.0.0-20210124154548-22da62e12c0c/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20210324051608-47abb6519492 h1:Paq34FxTluEPvVyayQqMPgHm+vTOrIifmcYxFBx9TLg= +golang.org/x/sys v0.0.0-20210324051608-47abb6519492/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/term v0.0.0-20201126162022-7de9c90e9dd1/go.mod h1:bj7SfCRtBDWHUb9snDiAeCFNEtKQo2Wmx5Cou7ajbmo= +golang.org/x/text v0.0.0-20170915032832-14c0d48ead0c/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= +golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= +golang.org/x/text v0.3.1-0.20180807135948-17ff2d5776d2/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= +golang.org/x/text v0.3.2/go.mod h1:bEr9sfX3Q8Zfm5fL9x+3itogRgK3+ptLWKqgva+5dAk= +golang.org/x/text v0.3.3/go.mod h1:5Zoc/QRtKVWzQhOtBMvqHzDpF6irO9z98xDceosuGiQ= +golang.org/x/text v0.3.4 h1:0YWbFKbhXG/wIiuHDSKpS0Iy7FSA+u45VtBMfQcFTTc= +golang.org/x/text v0.3.4/go.mod h1:5Zoc/QRtKVWzQhOtBMvqHzDpF6irO9z98xDceosuGiQ= +golang.org/x/time v0.0.0-20180412165947-fbb02b2291d2/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ= +golang.org/x/time v0.0.0-20181108054448-85acf8d2951c/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ= +golang.org/x/time v0.0.0-20190308202827-9d24e82272b4/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ= +golang.org/x/time v0.0.0-20191024005414-555d28b269f0/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ= +golang.org/x/time v0.0.0-20200630173020-3af7569d3a1e/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ= +golang.org/x/tools v0.0.0-20180221164845-07fd8470d635/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20181030221726-6c7e314b6563/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20190114222345-bf090417da8b/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20190226205152-f727befe758c/go.mod h1:9Yl7xja0Znq3iFh3HoIrodX9oNMXvdceNzlUR8zjMvY= +golang.org/x/tools v0.0.0-20190311212946-11955173bddd/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs= +golang.org/x/tools v0.0.0-20190312151545-0bb0c0a6e846/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs= +golang.org/x/tools v0.0.0-20190312170243-e65039ee4138/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs= +golang.org/x/tools v0.0.0-20190328211700-ab21143f2384/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs= +golang.org/x/tools v0.0.0-20190425150028-36563e24a262/go.mod h1:RgjU9mgBXZiqYHBnxXauZ1Gv1EHHAz9KjViQ78xBX0Q= +golang.org/x/tools v0.0.0-20190506145303-2d16b83fe98c/go.mod h1:RgjU9mgBXZiqYHBnxXauZ1Gv1EHHAz9KjViQ78xBX0Q= +golang.org/x/tools v0.0.0-20190524140312-2c0ae7006135/go.mod h1:RgjU9mgBXZiqYHBnxXauZ1Gv1EHHAz9KjViQ78xBX0Q= +golang.org/x/tools v0.0.0-20190606124116-d0a3d012864b/go.mod h1:/rFqwRUd4F7ZHNgwSSTFct+R/Kf4OFW1sUzUTQQTgfc= +golang.org/x/tools v0.0.0-20190614205625-5aca471b1d59/go.mod h1:/rFqwRUd4F7ZHNgwSSTFct+R/Kf4OFW1sUzUTQQTgfc= +golang.org/x/tools v0.0.0-20190621195816-6e04913cbbac/go.mod h1:/rFqwRUd4F7ZHNgwSSTFct+R/Kf4OFW1sUzUTQQTgfc= +golang.org/x/tools v0.0.0-20190624222133-a101b041ded4/go.mod h1:/rFqwRUd4F7ZHNgwSSTFct+R/Kf4OFW1sUzUTQQTgfc= +golang.org/x/tools v0.0.0-20190628153133-6cdbf07be9d0/go.mod h1:/rFqwRUd4F7ZHNgwSSTFct+R/Kf4OFW1sUzUTQQTgfc= +golang.org/x/tools v0.0.0-20190816200558-6889da9d5479/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo= +golang.org/x/tools v0.0.0-20190911174233-4f2ddba30aff/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo= +golang.org/x/tools v0.0.0-20191012152004-8de300cfc20a/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo= +golang.org/x/tools v0.0.0-20191113191852-77e3bb0ad9e7/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo= +golang.org/x/tools v0.0.0-20191115202509-3a792d9c32b2/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo= +golang.org/x/tools v0.0.0-20191119224855-298f0cb1881e/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo= +golang.org/x/tools v0.0.0-20191125144606-a911d9008d1f/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo= +golang.org/x/tools v0.0.0-20191130070609-6e064ea0cf2d/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo= +golang.org/x/tools v0.0.0-20191216173652-a0e659d51361/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28= +golang.org/x/tools v0.0.0-20191227053925-7b8e75db28f4/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28= +golang.org/x/tools v0.0.0-20200117161641-43d50277825c/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28= +golang.org/x/tools v0.0.0-20200122220014-bf1340f18c4a/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28= +golang.org/x/tools v0.0.0-20200130002326-2f3ba24bd6e7/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28= +golang.org/x/tools v0.0.0-20200204074204-1cc6d1ef6c74/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28= +golang.org/x/tools v0.0.0-20200207183749-b753a1ba74fa/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28= +golang.org/x/tools v0.0.0-20200212150539-ea181f53ac56/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28= +golang.org/x/tools v0.0.0-20200224181240-023911ca70b2/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28= +golang.org/x/tools v0.0.0-20200304193943-95d2e580d8eb/go.mod h1:o4KQGtdN14AW+yjsvvwRTJJuXz8XRtIHtEnmAXLyFUw= +golang.org/x/tools v0.0.0-20200619180055-7c47624df98f/go.mod h1:EkVYQZoAsY45+roYkvgYkIh4xh/qjgUK9TdY2XT94GE= +golang.org/x/tools v0.0.0-20210106214847-113979e3529a/go.mod h1:emZCQorbCU4vsT4fOWvOPXz4eW1wZW4PmDk9uLelYpA= +golang.org/x/xerrors v0.0.0-20190717185122-a985d3407aa7/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0= +golang.org/x/xerrors v0.0.0-20191011141410-1b5146add898/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0= +golang.org/x/xerrors v0.0.0-20191204190536-9bdfabe68543/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0= +golang.org/x/xerrors v0.0.0-20200804184101-5ec99f83aff1 h1:go1bK/D/BFZV2I8cIQd1NKEZ+0owSTG1fDTci4IqFcE= +golang.org/x/xerrors v0.0.0-20200804184101-5ec99f83aff1/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0= +google.golang.org/api v0.0.0-20160322025152-9bf6e6e569ff/go.mod h1:4mhQ8q/RsB7i+udVvVy5NUi08OU8ZlA0gRVgrF7VFY0= +google.golang.org/api v0.4.0/go.mod h1:8k5glujaEP+g9n7WNsDg8QP6cUVNI86fCNMcbazEtwE= +google.golang.org/api v0.7.0/go.mod h1:WtwebWUNSVBH/HAw79HIFXZNqEvBhG+Ra+ax0hx3E3M= +google.golang.org/api v0.8.0/go.mod h1:o4eAsZoiT+ibD93RtjEohWalFOjRDx6CVaqeizhEnKg= +google.golang.org/api v0.9.0/go.mod h1:o4eAsZoiT+ibD93RtjEohWalFOjRDx6CVaqeizhEnKg= +google.golang.org/api v0.13.0/go.mod h1:iLdEw5Ide6rF15KTC1Kkl0iskquN2gFfn9o9XIsbkAI= +google.golang.org/api v0.14.0/go.mod h1:iLdEw5Ide6rF15KTC1Kkl0iskquN2gFfn9o9XIsbkAI= +google.golang.org/api v0.15.0/go.mod h1:iLdEw5Ide6rF15KTC1Kkl0iskquN2gFfn9o9XIsbkAI= +google.golang.org/api v0.17.0/go.mod h1:BwFmGc8tA3vsd7r/7kR8DY7iEEGSU04BFxCo5jP/sfE= +google.golang.org/api v0.18.0/go.mod h1:BwFmGc8tA3vsd7r/7kR8DY7iEEGSU04BFxCo5jP/sfE= +google.golang.org/api v0.20.0/go.mod h1:BwFmGc8tA3vsd7r/7kR8DY7iEEGSU04BFxCo5jP/sfE= +google.golang.org/appengine v1.1.0/go.mod h1:EbEs0AVv82hx2wNQdGPgUI5lhzA/G0D9YwlJXL52JkM= +google.golang.org/appengine v1.4.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4= +google.golang.org/appengine v1.5.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4= +google.golang.org/appengine v1.6.1/go.mod h1:i06prIuMbXzDqacNJfV5OdTW448YApPu5ww/cMBSeb0= +google.golang.org/appengine v1.6.5/go.mod h1:8WjMMxjGQR8xUklV/ARdw2HLXBOI7O7uCIDZVag1xfc= +google.golang.org/cloud v0.0.0-20151119220103-975617b05ea8/go.mod h1:0H1ncTHf11KCFhTc/+EFRbzSCOZx+VUbRMk55Yv5MYk= +google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8/go.mod h1:JiN7NxoALGmiZfu7CAH4rXhgtRTLTxftemlI0sWmxmc= +google.golang.org/genproto v0.0.0-20190307195333-5fe7a883aa19/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE= +google.golang.org/genproto v0.0.0-20190418145605-e7d98fc518a7/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE= +google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE= +google.golang.org/genproto v0.0.0-20190502173448-54afdca5d873/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE= +google.golang.org/genproto v0.0.0-20190522204451-c2c4e71fbf69/go.mod h1:z3L6/3dTEVtUr6QSP8miRzeRqwQOioJ9I66odjN4I7s= +google.golang.org/genproto v0.0.0-20190801165951-fa694d86fc64/go.mod h1:DMBHOl98Agz4BDEuKkezgsaosCRResVns1a3J2ZsMNc= +google.golang.org/genproto v0.0.0-20190819201941-24fa4b261c55/go.mod h1:DMBHOl98Agz4BDEuKkezgsaosCRResVns1a3J2ZsMNc= +google.golang.org/genproto v0.0.0-20190911173649-1774047e7e51/go.mod h1:IbNlFCBrqXvoKpeg0TB2l7cyZUmoaFKYIwrEpbDKLA8= +google.golang.org/genproto v0.0.0-20191108220845-16a3f7862a1a/go.mod h1:n3cpQtvxv34hfy77yVDNjmbRyujviMdxYliBSkLhpCc= +google.golang.org/genproto v0.0.0-20191115194625-c23dd37a84c9/go.mod h1:n3cpQtvxv34hfy77yVDNjmbRyujviMdxYliBSkLhpCc= +google.golang.org/genproto v0.0.0-20191216164720-4f79533eabd1/go.mod h1:n3cpQtvxv34hfy77yVDNjmbRyujviMdxYliBSkLhpCc= +google.golang.org/genproto v0.0.0-20191230161307-f3c370f40bfb/go.mod h1:n3cpQtvxv34hfy77yVDNjmbRyujviMdxYliBSkLhpCc= +google.golang.org/genproto v0.0.0-20200115191322-ca5a22157cba/go.mod h1:n3cpQtvxv34hfy77yVDNjmbRyujviMdxYliBSkLhpCc= +google.golang.org/genproto v0.0.0-20200117163144-32f20d992d24/go.mod h1:n3cpQtvxv34hfy77yVDNjmbRyujviMdxYliBSkLhpCc= +google.golang.org/genproto v0.0.0-20200122232147-0452cf42e150/go.mod h1:n3cpQtvxv34hfy77yVDNjmbRyujviMdxYliBSkLhpCc= +google.golang.org/genproto v0.0.0-20200204135345-fa8e72b47b90/go.mod h1:GmwEX6Z4W5gMy59cAlVYjN9JhxgbQH6Gn+gFDQe2lzA= +google.golang.org/genproto v0.0.0-20200212174721-66ed5ce911ce/go.mod h1:55QSHmfGQM9UVYDPBsyGGes0y52j32PQ3BqQfXhyH3c= +google.golang.org/genproto v0.0.0-20200224152610-e50cd9704f63/go.mod h1:55QSHmfGQM9UVYDPBsyGGes0y52j32PQ3BqQfXhyH3c= +google.golang.org/genproto v0.0.0-20200305110556-506484158171/go.mod h1:55QSHmfGQM9UVYDPBsyGGes0y52j32PQ3BqQfXhyH3c= +google.golang.org/genproto v0.0.0-20200526211855-cb27e3aa2013/go.mod h1:NbSheEEYHJ7i3ixzK3sjbqSGDJWnxyFXZblF3eUsNvo= +google.golang.org/genproto v0.0.0-20201110150050-8816d57aaa9a h1:pOwg4OoaRYScjmR4LlLgdtnyoHYTSAVhhqe5uPdpII8= +google.golang.org/genproto v0.0.0-20201110150050-8816d57aaa9a/go.mod h1:FWY/as6DDZQgahTzZj3fqbO1CbirC29ZNUFHwi0/+no= +google.golang.org/grpc v0.0.0-20160317175043-d3ddb4469d5a/go.mod h1:yo6s7OP7yaDglbqo1J04qKzAhqBH6lvTonzMVmEdcZw= +google.golang.org/grpc v1.19.0/go.mod h1:mqu4LbDTu4XGKhr4mRzUsmM4RtVoemTSY81AxZiDr8c= +google.golang.org/grpc v1.20.1/go.mod h1:10oTOabMzJvdu6/UiuZezV6QK5dSlG84ov/aaiqXj38= +google.golang.org/grpc v1.21.0/go.mod h1:oYelfM1adQP15Ek0mdvEgi9Df8B9CZIaU1084ijfRaM= +google.golang.org/grpc v1.21.1/go.mod h1:oYelfM1adQP15Ek0mdvEgi9Df8B9CZIaU1084ijfRaM= +google.golang.org/grpc v1.23.0/go.mod h1:Y5yQAOtifL1yxbo5wqy6BxZv8vAUGQwXBOALyacEbxg= +google.golang.org/grpc v1.23.1/go.mod h1:Y5yQAOtifL1yxbo5wqy6BxZv8vAUGQwXBOALyacEbxg= +google.golang.org/grpc v1.24.0/go.mod h1:XDChyiUovWa60DnaeDeZmSW86xtLtjtZbwvSiRnRtcA= +google.golang.org/grpc v1.25.1/go.mod h1:c3i+UQWmh7LiEpx4sFZnkU36qjEYZ0imhYfXVyQciAY= +google.golang.org/grpc v1.26.0/go.mod h1:qbnxyOmOxrQa7FizSgH+ReBfzJrCY1pSN7KXBS8abTk= +google.golang.org/grpc v1.27.0/go.mod h1:qbnxyOmOxrQa7FizSgH+ReBfzJrCY1pSN7KXBS8abTk= +google.golang.org/grpc v1.27.1/go.mod h1:qbnxyOmOxrQa7FizSgH+ReBfzJrCY1pSN7KXBS8abTk= +google.golang.org/grpc v1.30.0/go.mod h1:N36X2cJ7JwdamYAgDz+s+rVMFjt3numwzf/HckM8pak= +google.golang.org/grpc v1.33.2 h1:EQyQC3sa8M+p6Ulc8yy9SWSS2GVwyRc83gAbG8lrl4o= +google.golang.org/grpc v1.33.2/go.mod h1:JMHMWHQWaTccqQQlmk3MJZS+GWXOdAesneDmEnv2fbc= +google.golang.org/protobuf v0.0.0-20200109180630-ec00e32a8dfd/go.mod h1:DFci5gLYBciE7Vtevhsrf46CRTquxDuWsQurQQe4oz8= +google.golang.org/protobuf v0.0.0-20200221191635-4d8936d0db64/go.mod h1:kwYJMbMJ01Woi6D6+Kah6886xMZcty6N08ah7+eCXa0= +google.golang.org/protobuf v0.0.0-20200228230310-ab0ca4ff8a60/go.mod h1:cfTl7dwQJ+fmap5saPgwCLgHXTUD7jkjRqWcaiX5VyM= +google.golang.org/protobuf v1.20.1-0.20200309200217-e05f789c0967/go.mod h1:A+miEFZTKqfCUM6K7xSMQL9OKL/b6hQv+e19PK+JZNE= +google.golang.org/protobuf v1.21.0/go.mod h1:47Nbq4nVaFHyn7ilMalzfO3qCViNmqZ2kzikPIcrTAo= +google.golang.org/protobuf v1.22.0/go.mod h1:EGpADcykh3NcUnDUJcl1+ZksZNG86OlYog2l/sGQquU= +google.golang.org/protobuf v1.23.0/go.mod h1:EGpADcykh3NcUnDUJcl1+ZksZNG86OlYog2l/sGQquU= +google.golang.org/protobuf v1.23.1-0.20200526195155-81db48ad09cc/go.mod h1:EGpADcykh3NcUnDUJcl1+ZksZNG86OlYog2l/sGQquU= +google.golang.org/protobuf v1.24.0/go.mod h1:r/3tXBNzIEhYS9I1OUVjXDlt8tc493IdKGjtUeSXeh4= +google.golang.org/protobuf v1.25.0 h1:Ejskq+SyPohKW+1uil0JJMtmHCgJPJ/qWTxr8qp+R4c= +google.golang.org/protobuf v1.25.0/go.mod h1:9JNX74DMeImyA3h4bdi1ymwjUzf21/xIlbajtzgsN7c= +gopkg.in/airbrake/gobrake.v2 v2.0.9/go.mod h1:/h5ZAUhDkGaJfjzjKLSjv6zCL6O0LLBxU4K+aSYdM/U= +gopkg.in/alecthomas/kingpin.v2 v2.2.6/go.mod h1:FMv+mEhP44yOT+4EoQTLFTRgOQ1FBLkstjWtayDeSgw= +gopkg.in/check.v1 v0.0.0-20161208181325-20d25e280405/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0= +gopkg.in/check.v1 v1.0.0-20141024133853-64131543e789/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0= +gopkg.in/check.v1 v1.0.0-20180628173108-788fd7840127/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0= +gopkg.in/check.v1 v1.0.0-20190902080502-41f04d3bba15 h1:YR8cESwS4TdDjEe65xsg0ogRM/Nc3DYOhEAlW+xobZo= +gopkg.in/check.v1 v1.0.0-20190902080502-41f04d3bba15/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0= +gopkg.in/cheggaaa/pb.v1 v1.0.25/go.mod h1:V/YB90LKu/1FcN3WVnfiiE5oMCibMjukxqG/qStrOgw= +gopkg.in/errgo.v2 v2.1.0/go.mod h1:hNsd1EY+bozCKY1Ytp96fpM3vjJbqLJn88ws8XvfDNI= +gopkg.in/fsnotify.v1 v1.4.7/go.mod h1:Tz8NjZHkW78fSQdbUxIjBTcgA1z1m8ZHf0WmKUhAMys= +gopkg.in/gemnasium/logrus-airbrake-hook.v2 v2.1.2/go.mod h1:Xk6kEKp8OKb+X14hQBKWaSkCsqBpgog8nAV2xsGOxlo= +gopkg.in/inf.v0 v0.9.1/go.mod h1:cWUDdTG/fYaXco+Dcufb5Vnc6Gp2YChqWtbxRZE0mXw= +gopkg.in/natefinch/lumberjack.v2 v2.0.0/go.mod h1:l0ndWWf7gzL7RNwBG7wST/UCcT4T24xpD6X8LsfU/+k= +gopkg.in/resty.v1 v1.12.0/go.mod h1:mDo4pnntr5jdWRML875a/NmxYqAlA73dVijT2AXvQQo= +gopkg.in/square/go-jose.v2 v2.2.2/go.mod h1:M9dMgbHiYLoDGQrXy7OpJDJWiKiU//h+vD76mk0e1AI= +gopkg.in/square/go-jose.v2 v2.3.1/go.mod h1:M9dMgbHiYLoDGQrXy7OpJDJWiKiU//h+vD76mk0e1AI= +gopkg.in/square/go-jose.v2 v2.5.1/go.mod h1:M9dMgbHiYLoDGQrXy7OpJDJWiKiU//h+vD76mk0e1AI= +gopkg.in/tomb.v1 v1.0.0-20141024135613-dd632973f1e7/go.mod h1:dt/ZhP58zS4L8KSrWDmTeBkI65Dw0HsyUHuEVlX15mw= +gopkg.in/yaml.v2 v2.0.0-20170812160011-eb3733d160e7/go.mod h1:JAlM8MvJe8wmxCU4Bli9HhUf9+ttbYbLASfIpnQbh74= +gopkg.in/yaml.v2 v2.2.1/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI= +gopkg.in/yaml.v2 v2.2.2/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI= +gopkg.in/yaml.v2 v2.2.4/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI= +gopkg.in/yaml.v2 v2.2.5/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI= +gopkg.in/yaml.v2 v2.2.8/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI= +gopkg.in/yaml.v2 v2.3.0/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI= +gopkg.in/yaml.v2 v2.4.0/go.mod h1:RDklbk79AGWmwhnvt/jBztapEOGDOx6ZbXqjP6csGnQ= +gopkg.in/yaml.v3 v3.0.0-20200313102051-9f266ea9e77c h1:dUUwHk2QECo/6vqA44rthZ8ie2QXMNeKRTHCNY2nXvo= +gopkg.in/yaml.v3 v3.0.0-20200313102051-9f266ea9e77c/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM= +gotest.tools v2.2.0+incompatible h1:VsBPFP1AI068pPrMxtb/S8Zkgf9xEmTLJjfM+P5UIEo= +gotest.tools v2.2.0+incompatible/go.mod h1:DsYFclhRJ6vuDpmuTbkuFWG+y2sxOXAzmJt81HFBacw= +gotest.tools/v3 v3.0.2/go.mod h1:3SzNCllyD9/Y+b5r9JIKQ474KzkZyqLqEfYqMsX94Bk= +gotest.tools/v3 v3.0.3 h1:4AuOwCGf4lLR9u3YOe2awrHygurzhO/HeQ6laiA6Sx0= +gotest.tools/v3 v3.0.3/go.mod h1:Z7Lb0S5l+klDB31fvDQX8ss/FlKDxtlFlw3Oa8Ymbl8= +honnef.co/go/tools v0.0.0-20190102054323-c2f93a96b099/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4= +honnef.co/go/tools v0.0.0-20190106161140-3f1c8253044a/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4= +honnef.co/go/tools v0.0.0-20190418001031-e561f6794a2a/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4= +honnef.co/go/tools v0.0.0-20190523083050-ea95bdfd59fc/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4= +honnef.co/go/tools v0.0.1-2019.2.3/go.mod h1:a3bituU0lyd329TUQxRnasdCoJDkEUEAqEt0JzvZhAg= +honnef.co/go/tools v0.0.1-2020.1.3/go.mod h1:X/FiERA/W4tHapMX5mGpAtMSVEeEUOyHaw9vFzvIQ3k= +k8s.io/api v0.20.1/go.mod h1:KqwcCVogGxQY3nBlRpwt+wpAMF/KjaCc7RpywacvqUo= +k8s.io/apimachinery v0.20.1/go.mod h1:WlLqWAHZGg07AeltaI0MV5uk1Omp8xaN0JGLY6gkRpU= +k8s.io/apiserver v0.20.1/go.mod h1:ro5QHeQkgMS7ZGpvf4tSMx6bBOgPfE+f52KwvXfScaU= +k8s.io/client-go v0.20.1/go.mod h1:/zcHdt1TeWSd5HoUe6elJmHSQ6uLLgp4bIJHVEuy+/Y= +k8s.io/component-base v0.20.1/go.mod h1:guxkoJnNoh8LNrbtiQOlyp2Y2XFCZQmrcg2n/DeYNLk= +k8s.io/cri-api v0.17.3/go.mod h1:X1sbHmuXhwaHs9xxYffLqJogVsnI+f6cPRcgPel7ywM= +k8s.io/cri-api v0.20.1/go.mod h1:2JRbKt+BFLTjtrILYVqQK5jqhI+XNdF6UiGMgczeBCI= +k8s.io/gengo v0.0.0-20200413195148-3a45101e95ac/go.mod h1:ezvh/TsK7cY6rbqRK0oQQ8IAqLxYwwyPxAX1Pzy0ii0= +k8s.io/klog/v2 v2.0.0/go.mod h1:PBfzABfn139FHAV07az/IF9Wp1bkk3vpT2XSJ76fSDE= +k8s.io/klog/v2 v2.4.0/go.mod h1:Od+F08eJP+W3HUb4pSrPpgp9DGU4GzlpG/TmITuYh/Y= +k8s.io/kube-openapi v0.0.0-20201113171705-d219536bb9fd/go.mod h1:WOJ3KddDSol4tAGcJo0Tvi+dK12EcqSLqcWsryKMpfM= +k8s.io/kubernetes v1.13.0/go.mod h1:ocZa8+6APFNC2tX1DZASIbocyYT5jHzqFVsY5aoB7Jk= +k8s.io/utils v0.0.0-20201110183641-67b214c5f920/go.mod h1:jPW/WVKK9YHAvNhRxK0md/EJ228hCsBRufyofKtW8HA= +rsc.io/binaryregexp v0.2.0/go.mod h1:qTv7/COck+e2FymRvadv62gMdZztPaShugOCi3I+8D8= +rsc.io/quote/v3 v3.1.0/go.mod h1:yEA65RcK8LyAZtP9Kv3t0HmxON59tX3rD+tICJqUlj0= +rsc.io/sampler v1.3.0/go.mod h1:T1hPZKmBbMNahiBKFy5HrXp6adAjACjK9JXDnKaTXpA= +sigs.k8s.io/apiserver-network-proxy/konnectivity-client v0.0.14/go.mod h1:LEScyzhFmoF5pso/YSeBstl57mOzx9xlU9n85RGrDQg= +sigs.k8s.io/structured-merge-diff/v4 v4.0.2/go.mod h1:bJZC9H9iH24zzfZ/41RGcq60oK1F7G282QMXDPYydCw= +sigs.k8s.io/yaml v1.1.0/go.mod h1:UJmg0vDUVViEyp3mgSv9WPwZCDxu4rQW1olrI1uml+o= +sigs.k8s.io/yaml v1.2.0/go.mod h1:yfXDCHCao9+ENCvLSE62v9VSji2MKu5jeNfTrofGhJc= diff --git a/vendor/github.com/Microsoft/hcsshim/hcn/hcn.go b/vendor/github.com/Microsoft/hcsshim/hcn/hcn.go index 8bae5fc0..ed311fed 100644 --- a/vendor/github.com/Microsoft/hcsshim/hcn/hcn.go +++ b/vendor/github.com/Microsoft/hcsshim/hcn/hcn.go @@ -3,11 +3,10 @@ package hcn import ( - "encoding/json" "fmt" "syscall" - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" ) //go:generate go run ../mksyscall_windows.go -output zsyscall_windows.go hcn.go @@ -55,11 +54,14 @@ import ( //sys hcnDeleteLoadBalancer(id *_guid, result **uint16) (hr error) = computenetwork.HcnDeleteLoadBalancer? //sys hcnCloseLoadBalancer(loadBalancer hcnLoadBalancer) (hr error) = computenetwork.HcnCloseLoadBalancer? -// Service -//sys hcnOpenService(service *hcnService, result **uint16) (hr error) = computenetwork.HcnOpenService? -//sys hcnRegisterServiceCallback(service hcnService, callback int32, context int32, callbackHandle *hcnCallbackHandle) (hr error) = computenetwork.HcnRegisterServiceCallback? -//sys hcnUnregisterServiceCallback(callbackHandle hcnCallbackHandle) (hr error) = computenetwork.HcnUnregisterServiceCallback? -//sys hcnCloseService(service hcnService) (hr error) = computenetwork.HcnCloseService? +// SDN Routes +//sys hcnEnumerateRoutes(query string, routes **uint16, result **uint16) (hr error) = computenetwork.HcnEnumerateSdnRoutes? +//sys hcnCreateRoute(id *_guid, settings string, route *hcnRoute, result **uint16) (hr error) = computenetwork.HcnCreateSdnRoute? +//sys hcnOpenRoute(id *_guid, route *hcnRoute, result **uint16) (hr error) = computenetwork.HcnOpenSdnRoute? +//sys hcnModifyRoute(route hcnRoute, settings string, result **uint16) (hr error) = computenetwork.HcnModifySdnRoute? +//sys hcnQueryRouteProperties(route hcnRoute, query string, properties **uint16, result **uint16) (hr error) = computenetwork.HcnQuerySdnRouteProperties? +//sys hcnDeleteRoute(id *_guid, result **uint16) (hr error) = computenetwork.HcnDeleteSdnRoute? +//sys hcnCloseRoute(route hcnRoute) (hr error) = computenetwork.HcnCloseSdnRoute? type _guid = guid.GUID @@ -67,8 +69,7 @@ type hcnNetwork syscall.Handle type hcnEndpoint syscall.Handle type hcnNamespace syscall.Handle type hcnLoadBalancer syscall.Handle -type hcnService syscall.Handle -type hcnCallbackHandle syscall.Handle +type hcnRoute syscall.Handle // SchemaVersion for HCN Objects/Queries. type SchemaVersion = Version // hcnglobals.go @@ -91,6 +92,20 @@ type HostComputeQuery struct { Filter string `json:",omitempty"` } +type ExtraParams struct { + Resources interface{} `json:",omitempty"` + SharedContainers interface{} `json:",omitempty"` + LayeredOn string `json:",omitempty"` + SwitchGuid string `json:",omitempty"` + UtilityVM string `json:",omitempty"` + VirtualMachine string `json:",omitempty"` +} + +type Health struct { + Data interface{} `json:",omitempty"` + Extra ExtraParams `json:",omitempty"` +} + // defaultQuery generates HCN Query. // Passed into get/enumerate calls to filter results. func defaultQuery() HostComputeQuery { @@ -104,15 +119,6 @@ func defaultQuery() HostComputeQuery { return query } -func defaultQueryJson() string { - query := defaultQuery() - queryJson, err := json.Marshal(query) - if err != nil { - return "" - } - return string(queryJson) -} - // PlatformDoesNotSupportError happens when users are attempting to use a newer shim on an older OS func platformDoesNotSupportError(featureName string) error { return fmt.Errorf("Platform does not support feature %s", featureName) @@ -161,6 +167,78 @@ func DSRSupported() error { return platformDoesNotSupportError("Direct Server Return (DSR)") } +// Slash32EndpointPrefixesSupported returns an error if the HCN version does not support configuring endpoints with /32 prefixes. +func Slash32EndpointPrefixesSupported() error { + supported := GetSupportedFeatures() + if supported.Slash32EndpointPrefixes { + return nil + } + return platformDoesNotSupportError("Slash 32 Endpoint prefixes") +} + +// AclSupportForProtocol252Supported returns an error if the HCN version does not support HNS ACL Policies to support protocol 252 for VXLAN. +func AclSupportForProtocol252Supported() error { + supported := GetSupportedFeatures() + if supported.AclSupportForProtocol252 { + return nil + } + return platformDoesNotSupportError("HNS ACL Policies to support protocol 252 for VXLAN") +} + +// SessionAffinitySupported returns an error if the HCN version does not support Session Affinity. +func SessionAffinitySupported() error { + supported := GetSupportedFeatures() + if supported.SessionAffinity { + return nil + } + return platformDoesNotSupportError("Session Affinity") +} + +// IPv6DualStackSupported returns an error if the HCN version does not support IPv6DualStack. +func IPv6DualStackSupported() error { + supported := GetSupportedFeatures() + if supported.IPv6DualStack { + return nil + } + return platformDoesNotSupportError("IPv6 DualStack") +} + +//L4proxySupported returns an error if the HCN verison does not support L4Proxy +func L4proxyPolicySupported() error { + supported := GetSupportedFeatures() + if supported.L4Proxy { + return nil + } + return platformDoesNotSupportError("L4ProxyPolicy") +} + +// L4WfpProxySupported returns an error if the HCN verison does not support L4WfpProxy +func L4WfpProxyPolicySupported() error { + supported := GetSupportedFeatures() + if supported.L4WfpProxy { + return nil + } + return platformDoesNotSupportError("L4WfpProxyPolicy") +} + +// SetPolicySupported returns an error if the HCN version does not support SetPolicy. +func SetPolicySupported() error { + supported := GetSupportedFeatures() + if supported.SetPolicy { + return nil + } + return platformDoesNotSupportError("SetPolicy") +} + +// VxlanPortSupported returns an error if the HCN version does not support configuring the VXLAN TCP port. +func VxlanPortSupported() error { + supported := GetSupportedFeatures() + if supported.VxlanPort { + return nil + } + return platformDoesNotSupportError("VXLAN port configuration") +} + // RequestType are the different operations performed to settings. // Used to update the settings of Endpoint/Namespace objects. type RequestType string diff --git a/vendor/github.com/Microsoft/hcsshim/hcn/hcnendpoint.go b/vendor/github.com/Microsoft/hcsshim/hcn/hcnendpoint.go index d58335e5..e02146f8 100644 --- a/vendor/github.com/Microsoft/hcsshim/hcn/hcnendpoint.go +++ b/vendor/github.com/Microsoft/hcsshim/hcn/hcnendpoint.go @@ -2,8 +2,9 @@ package hcn import ( "encoding/json" + "errors" - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" "github.com/Microsoft/hcsshim/internal/interop" "github.com/sirupsen/logrus" ) @@ -121,7 +122,10 @@ func enumerateEndpoints(query string) ([]HostComputeEndpoint, error) { } func createEndpoint(networkId string, endpointSettings string) (*HostComputeEndpoint, error) { - networkGuid := guid.FromString(networkId) + networkGuid, err := guid.FromString(networkId) + if err != nil { + return nil, errInvalidNetworkID + } // Open network. var networkHandle hcnNetwork var resultBuffer *uint16 @@ -167,7 +171,10 @@ func createEndpoint(networkId string, endpointSettings string) (*HostComputeEndp } func modifyEndpoint(endpointId string, settings string) (*HostComputeEndpoint, error) { - endpointGuid := guid.FromString(endpointId) + endpointGuid, err := guid.FromString(endpointId) + if err != nil { + return nil, errInvalidEndpointID + } // Open endpoint var ( endpointHandle hcnEndpoint @@ -208,7 +215,10 @@ func modifyEndpoint(endpointId string, settings string) (*HostComputeEndpoint, e } func deleteEndpoint(endpointId string) error { - endpointGuid := guid.FromString(endpointId) + endpointGuid, err := guid.FromString(endpointId) + if err != nil { + return errInvalidEndpointID + } var resultBuffer *uint16 hr := hcnDeleteEndpoint(&endpointGuid, &resultBuffer) if err := checkForErrors("hcnDeleteEndpoint", hr, resultBuffer); err != nil { @@ -299,6 +309,10 @@ func GetEndpointByName(endpointName string) (*HostComputeEndpoint, error) { func (endpoint *HostComputeEndpoint) Create() (*HostComputeEndpoint, error) { logrus.Debugf("hcn::HostComputeEndpoint::Create id=%s", endpoint.Id) + if endpoint.HostComputeNamespace != "" { + return nil, errors.New("endpoint create error, endpoint json HostComputeNamespace is read only and should not be set") + } + jsonString, err := json.Marshal(endpoint) if err != nil { return nil, err @@ -339,7 +353,7 @@ func ModifyEndpointSettings(endpointId string, request *ModifyEndpointSettingReq } // ApplyPolicy applies a Policy (ex: ACL) on the Endpoint. -func (endpoint *HostComputeEndpoint) ApplyPolicy(endpointPolicy PolicyEndpointRequest) error { +func (endpoint *HostComputeEndpoint) ApplyPolicy(requestType RequestType, endpointPolicy PolicyEndpointRequest) error { logrus.Debugf("hcn::HostComputeEndpoint::ApplyPolicy id=%s", endpoint.Id) settingsJson, err := json.Marshal(endpointPolicy) @@ -348,7 +362,7 @@ func (endpoint *HostComputeEndpoint) ApplyPolicy(endpointPolicy PolicyEndpointRe } requestMessage := &ModifyEndpointSettingRequest{ ResourceType: EndpointResourceTypePolicy, - RequestType: RequestTypeUpdate, + RequestType: requestType, Settings: settingsJson, } diff --git a/vendor/github.com/Microsoft/hcsshim/hcn/hcnerrors.go b/vendor/github.com/Microsoft/hcsshim/hcn/hcnerrors.go index 6d46bf8b..ad30d320 100644 --- a/vendor/github.com/Microsoft/hcsshim/hcn/hcnerrors.go +++ b/vendor/github.com/Microsoft/hcsshim/hcn/hcnerrors.go @@ -3,13 +3,23 @@ package hcn import ( + "errors" "fmt" + "github.com/Microsoft/hcsshim/internal/hcs" "github.com/Microsoft/hcsshim/internal/hcserror" "github.com/Microsoft/hcsshim/internal/interop" "github.com/sirupsen/logrus" ) +var ( + errInvalidNetworkID = errors.New("invalid network ID") + errInvalidEndpointID = errors.New("invalid endpoint ID") + errInvalidNamespaceID = errors.New("invalid namespace ID") + errInvalidLoadBalancerID = errors.New("invalid load balancer ID") + errInvalidRouteID = errors.New("invalid route ID") +) + func checkForErrors(methodName string, hr error, resultBuffer *uint16) error { errorFound := false @@ -26,7 +36,7 @@ func checkForErrors(methodName string, hr error, resultBuffer *uint16) error { } if errorFound { - returnError := hcserror.New(hr, methodName, result) + returnError := new(hr, methodName, result) logrus.Debugf(returnError.Error()) // HCN errors logged for debugging. return returnError } @@ -34,6 +44,52 @@ func checkForErrors(methodName string, hr error, resultBuffer *uint16) error { return nil } +type ErrorCode uint32 + +// For common errors, define the error as it is in windows, so we can quickly determine it later +const ( + ERROR_NOT_FOUND = 0x490 + HCN_E_PORT_ALREADY_EXISTS ErrorCode = 0x803b0013 +) + +type HcnError struct { + *hcserror.HcsError + code ErrorCode +} + +func (e *HcnError) Error() string { + return e.HcsError.Error() +} + +func CheckErrorWithCode(err error, code ErrorCode) bool { + hcnError, ok := err.(*HcnError) + if ok { + return hcnError.code == code + } + return false +} + +func IsElementNotFoundError(err error) bool { + return CheckErrorWithCode(err, ERROR_NOT_FOUND) +} + +func IsPortAlreadyExistsError(err error) bool { + return CheckErrorWithCode(err, HCN_E_PORT_ALREADY_EXISTS) +} + +func new(hr error, title string, rest string) error { + err := &HcnError{} + hcsError := hcserror.New(hr, title, rest) + err.HcsError = hcsError.(*hcserror.HcsError) + err.code = ErrorCode(hcserror.Win32FromError(hr)) + return err +} + +// +// Note that the below errors are not errors returned by hcn itself +// we wish to seperate them as they are shim usage error +// + // NetworkNotFoundError results from a failed seach for a network by Id or Name type NetworkNotFoundError struct { NetworkName string @@ -41,10 +97,10 @@ type NetworkNotFoundError struct { } func (e NetworkNotFoundError) Error() string { - if e.NetworkName == "" { - return fmt.Sprintf("Network Name %s not found", e.NetworkName) + if e.NetworkName != "" { + return fmt.Sprintf("Network name %q not found", e.NetworkName) } - return fmt.Sprintf("Network Id %s not found", e.NetworkID) + return fmt.Sprintf("Network ID %q not found", e.NetworkID) } // EndpointNotFoundError results from a failed seach for an endpoint by Id or Name @@ -54,10 +110,10 @@ type EndpointNotFoundError struct { } func (e EndpointNotFoundError) Error() string { - if e.EndpointName == "" { - return fmt.Sprintf("Endpoint Name %s not found", e.EndpointName) + if e.EndpointName != "" { + return fmt.Sprintf("Endpoint name %q not found", e.EndpointName) } - return fmt.Sprintf("Endpoint Id %s not found", e.EndpointID) + return fmt.Sprintf("Endpoint ID %q not found", e.EndpointID) } // NamespaceNotFoundError results from a failed seach for a namsepace by Id @@ -66,7 +122,7 @@ type NamespaceNotFoundError struct { } func (e NamespaceNotFoundError) Error() string { - return fmt.Sprintf("Namespace %s not found", e.NamespaceID) + return fmt.Sprintf("Namespace ID %q not found", e.NamespaceID) } // LoadBalancerNotFoundError results from a failed seach for a loadbalancer by Id @@ -75,13 +131,22 @@ type LoadBalancerNotFoundError struct { } func (e LoadBalancerNotFoundError) Error() string { - return fmt.Sprintf("LoadBalancer %s not found", e.LoadBalancerId) + return fmt.Sprintf("LoadBalancer %q not found", e.LoadBalancerId) +} + +// RouteNotFoundError results from a failed seach for a route by Id +type RouteNotFoundError struct { + RouteId string +} + +func (e RouteNotFoundError) Error() string { + return fmt.Sprintf("SDN Route %q not found", e.RouteId) } // IsNotFoundError returns a boolean indicating whether the error was caused by // a resource not being found. func IsNotFoundError(err error) bool { - switch err.(type) { + switch pe := err.(type) { case NetworkNotFoundError: return true case EndpointNotFoundError: @@ -90,6 +155,10 @@ func IsNotFoundError(err error) bool { return true case LoadBalancerNotFoundError: return true + case RouteNotFoundError: + return true + case *hcserror.HcsError: + return pe.Err == hcs.ErrElementNotFound } return false } diff --git a/vendor/github.com/Microsoft/hcsshim/hcn/hcnglobals.go b/vendor/github.com/Microsoft/hcsshim/hcn/hcnglobals.go index 29d13dea..a2195f57 100644 --- a/vendor/github.com/Microsoft/hcsshim/hcn/hcnglobals.go +++ b/vendor/github.com/Microsoft/hcsshim/hcn/hcnglobals.go @@ -3,6 +3,7 @@ package hcn import ( "encoding/json" "fmt" + "math" "github.com/Microsoft/hcsshim/internal/hcserror" "github.com/Microsoft/hcsshim/internal/interop" @@ -20,17 +21,59 @@ type Version struct { Minor int `json:"Minor"` } +type VersionRange struct { + MinVersion Version + MaxVersion Version +} + +type VersionRanges []VersionRange + var ( // HNSVersion1803 added ACL functionality. - HNSVersion1803 = Version{Major: 7, Minor: 2} + HNSVersion1803 = VersionRanges{VersionRange{MinVersion: Version{Major: 7, Minor: 2}, MaxVersion: Version{Major: math.MaxInt32, Minor: math.MaxInt32}}} // V2ApiSupport allows the use of V2 Api calls and V2 Schema. - V2ApiSupport = Version{Major: 9, Minor: 1} + V2ApiSupport = VersionRanges{VersionRange{MinVersion: Version{Major: 9, Minor: 2}, MaxVersion: Version{Major: math.MaxInt32, Minor: math.MaxInt32}}} // Remote Subnet allows for Remote Subnet policies on Overlay networks - RemoteSubnetVersion = Version{Major: 9, Minor: 2} + RemoteSubnetVersion = VersionRanges{VersionRange{MinVersion: Version{Major: 9, Minor: 2}, MaxVersion: Version{Major: math.MaxInt32, Minor: math.MaxInt32}}} // A Host Route policy allows for local container to local host communication Overlay networks - HostRouteVersion = Version{Major: 9, Minor: 2} - // HNS 10.2 allows for Direct Server Return for loadbalancing - DSRVersion = Version{Major: 10, Minor: 2} + HostRouteVersion = VersionRanges{VersionRange{MinVersion: Version{Major: 9, Minor: 2}, MaxVersion: Version{Major: math.MaxInt32, Minor: math.MaxInt32}}} + // HNS 9.3 through 10.0 (not included), and 10.2+ allows for Direct Server Return for loadbalancing + DSRVersion = VersionRanges{ + VersionRange{MinVersion: Version{Major: 9, Minor: 3}, MaxVersion: Version{Major: 9, Minor: math.MaxInt32}}, + VersionRange{MinVersion: Version{Major: 10, Minor: 2}, MaxVersion: Version{Major: math.MaxInt32, Minor: math.MaxInt32}}, + } + // HNS 9.3 through 10.0 (not included) and, 10.4+ provide support for configuring endpoints with /32 prefixes + Slash32EndpointPrefixesVersion = VersionRanges{ + VersionRange{MinVersion: Version{Major: 9, Minor: 3}, MaxVersion: Version{Major: 9, Minor: math.MaxInt32}}, + VersionRange{MinVersion: Version{Major: 10, Minor: 4}, MaxVersion: Version{Major: math.MaxInt32, Minor: math.MaxInt32}}, + } + // HNS 9.3 through 10.0 (not included) and, 10.4+ allow for HNS ACL Policies to support protocol 252 for VXLAN + AclSupportForProtocol252Version = VersionRanges{ + VersionRange{MinVersion: Version{Major: 11, Minor: 0}, MaxVersion: Version{Major: math.MaxInt32, Minor: math.MaxInt32}}, + } + // HNS 12.0 allows for session affinity for loadbalancing + SessionAffinityVersion = VersionRanges{VersionRange{MinVersion: Version{Major: 12, Minor: 0}, MaxVersion: Version{Major: math.MaxInt32, Minor: math.MaxInt32}}} + // HNS 10.5 through 11 (not included) and 12.0+ supports Ipv6 dual stack. + IPv6DualStackVersion = VersionRanges{ + VersionRange{MinVersion: Version{Major: 10, Minor: 5}, MaxVersion: Version{Major: 10, Minor: math.MaxInt32}}, + VersionRange{MinVersion: Version{Major: 12, Minor: 0}, MaxVersion: Version{Major: math.MaxInt32, Minor: math.MaxInt32}}, + } + // HNS 13.0 allows for Set Policy support + SetPolicyVersion = VersionRanges{VersionRange{MinVersion: Version{Major: 13, Minor: 0}, MaxVersion: Version{Major: math.MaxInt32, Minor: math.MaxInt32}}} + // HNS 10.3 allows for VXLAN ports + VxlanPortVersion = VersionRanges{VersionRange{MinVersion: Version{Major: 10, Minor: 3}, MaxVersion: Version{Major: math.MaxInt32, Minor: math.MaxInt32}}} + + //HNS 9.5 through 10.0(not included), 10.5 through 11.0(not included), 11.11 through 12.0(not included), 12.1 through 13.0(not included), 13.1+ allows for Network L4Proxy Policy support + L4ProxyPolicyVersion = VersionRanges{ + VersionRange{MinVersion: Version{Major: 9, Minor: 5}, MaxVersion: Version{Major: 9, Minor: math.MaxInt32}}, + VersionRange{MinVersion: Version{Major: 10, Minor: 5}, MaxVersion: Version{Major: 10, Minor: math.MaxInt32}}, + VersionRange{MinVersion: Version{Major: 11, Minor: 11}, MaxVersion: Version{Major: 11, Minor: math.MaxInt32}}, + VersionRange{MinVersion: Version{Major: 12, Minor: 1}, MaxVersion: Version{Major: 12, Minor: math.MaxInt32}}, + VersionRange{MinVersion: Version{Major: 13, Minor: 1}, MaxVersion: Version{Major: math.MaxInt32, Minor: math.MaxInt32}}, + } + + //HNS 13.2 allows for L4WfpProxy Policy support + L4WfpProxyPolicyVersion = VersionRanges{VersionRange{MinVersion: Version{Major: 13, Minor: 2}, MaxVersion: Version{Major: math.MaxInt32, Minor: math.MaxInt32}}} ) // GetGlobals returns the global properties of the HCN Service. diff --git a/vendor/github.com/Microsoft/hcsshim/hcn/hcnloadbalancer.go b/vendor/github.com/Microsoft/hcsshim/hcn/hcnloadbalancer.go index cff68e13..e74c7765 100644 --- a/vendor/github.com/Microsoft/hcsshim/hcn/hcnloadbalancer.go +++ b/vendor/github.com/Microsoft/hcsshim/hcn/hcnloadbalancer.go @@ -3,17 +3,18 @@ package hcn import ( "encoding/json" - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" "github.com/Microsoft/hcsshim/internal/interop" "github.com/sirupsen/logrus" ) // LoadBalancerPortMapping is associated with HostComputeLoadBalancer type LoadBalancerPortMapping struct { - Protocol uint32 `json:",omitempty"` // EX: TCP = 6, UDP = 17 - InternalPort uint16 `json:",omitempty"` - ExternalPort uint16 `json:",omitempty"` - Flags LoadBalancerPortMappingFlags `json:",omitempty"` + Protocol uint32 `json:",omitempty"` // EX: TCP = 6, UDP = 17 + InternalPort uint16 `json:",omitempty"` + ExternalPort uint16 `json:",omitempty"` + DistributionType LoadBalancerDistribution `json:",omitempty"` // EX: Distribute per connection = 0, distribute traffic of the same protocol per client IP = 1, distribute per client IP = 2 + Flags LoadBalancerPortMappingFlags `json:",omitempty"` } // HostComputeLoadBalancer represents software load balancer. @@ -53,6 +54,18 @@ var ( LoadBalancerPortMappingFlagsPreserveDIP LoadBalancerPortMappingFlags = 8 ) +// LoadBalancerDistribution specifies how the loadbalancer distributes traffic. +type LoadBalancerDistribution uint32 + +var ( + // LoadBalancerDistributionNone is the default and loadbalances each connection to the same pod. + LoadBalancerDistributionNone LoadBalancerDistribution + // LoadBalancerDistributionSourceIPProtocol loadbalances all traffic of the same protocol from a client IP to the same pod. + LoadBalancerDistributionSourceIPProtocol LoadBalancerDistribution = 1 + // LoadBalancerDistributionSourceIP loadbalances all traffic from a client IP to the same pod. + LoadBalancerDistributionSourceIP LoadBalancerDistribution = 2 +) + func getLoadBalancer(loadBalancerGuid guid.GUID, query string) (*HostComputeLoadBalancer, error) { // Open loadBalancer. var ( @@ -147,49 +160,11 @@ func createLoadBalancer(settings string) (*HostComputeLoadBalancer, error) { return &outputLoadBalancer, nil } -func modifyLoadBalancer(loadBalancerId string, settings string) (*HostComputeLoadBalancer, error) { - loadBalancerGuid := guid.FromString(loadBalancerId) - // Open loadBalancer. - var ( - loadBalancerHandle hcnLoadBalancer - resultBuffer *uint16 - propertiesBuffer *uint16 - ) - hr := hcnOpenLoadBalancer(&loadBalancerGuid, &loadBalancerHandle, &resultBuffer) - if err := checkForErrors("hcnOpenLoadBalancer", hr, resultBuffer); err != nil { - return nil, err - } - // Modify loadBalancer. - hr = hcnModifyLoadBalancer(loadBalancerHandle, settings, &resultBuffer) - if err := checkForErrors("hcnModifyLoadBalancer", hr, resultBuffer); err != nil { - return nil, err - } - // Query loadBalancer. - hcnQuery := defaultQuery() - query, err := json.Marshal(hcnQuery) - if err != nil { - return nil, err - } - hr = hcnQueryLoadBalancerProperties(loadBalancerHandle, string(query), &propertiesBuffer, &resultBuffer) - if err := checkForErrors("hcnQueryLoadBalancerProperties", hr, resultBuffer); err != nil { - return nil, err - } - properties := interop.ConvertAndFreeCoTaskMemString(propertiesBuffer) - // Close loadBalancer. - hr = hcnCloseLoadBalancer(loadBalancerHandle) - if err := checkForErrors("hcnCloseLoadBalancer", hr, nil); err != nil { - return nil, err - } - // Convert output to LoadBalancer - var outputLoadBalancer HostComputeLoadBalancer - if err := json.Unmarshal([]byte(properties), &outputLoadBalancer); err != nil { - return nil, err - } - return &outputLoadBalancer, nil -} - func deleteLoadBalancer(loadBalancerId string) error { - loadBalancerGuid := guid.FromString(loadBalancerId) + loadBalancerGuid, err := guid.FromString(loadBalancerId) + if err != nil { + return errInvalidLoadBalancerID + } var resultBuffer *uint16 hr := hcnDeleteLoadBalancer(&loadBalancerGuid, &resultBuffer) if err := checkForErrors("hcnDeleteLoadBalancer", hr, resultBuffer); err != nil { diff --git a/vendor/github.com/Microsoft/hcsshim/hcn/hcnnamespace.go b/vendor/github.com/Microsoft/hcsshim/hcn/hcnnamespace.go index 6dbef4f2..d2ef2296 100644 --- a/vendor/github.com/Microsoft/hcsshim/hcn/hcnnamespace.go +++ b/vendor/github.com/Microsoft/hcsshim/hcn/hcnnamespace.go @@ -5,8 +5,8 @@ import ( "os" "syscall" + "github.com/Microsoft/go-winio/pkg/guid" icni "github.com/Microsoft/hcsshim/internal/cni" - "github.com/Microsoft/hcsshim/internal/guid" "github.com/Microsoft/hcsshim/internal/interop" "github.com/Microsoft/hcsshim/internal/regstate" "github.com/Microsoft/hcsshim/internal/runhcs" @@ -165,7 +165,10 @@ func createNamespace(settings string) (*HostComputeNamespace, error) { } func modifyNamespace(namespaceId string, settings string) (*HostComputeNamespace, error) { - namespaceGuid := guid.FromString(namespaceId) + namespaceGuid, err := guid.FromString(namespaceId) + if err != nil { + return nil, errInvalidNamespaceID + } // Open namespace. var ( namespaceHandle hcnNamespace @@ -206,7 +209,10 @@ func modifyNamespace(namespaceId string, settings string) (*HostComputeNamespace } func deleteNamespace(namespaceId string) error { - namespaceGuid := guid.FromString(namespaceId) + namespaceGuid, err := guid.FromString(namespaceId) + if err != nil { + return errInvalidNamespaceID + } var resultBuffer *uint16 hr := hcnDeleteNamespace(&namespaceGuid, &resultBuffer) if err := checkForErrors("hcnDeleteNamespace", hr, resultBuffer); err != nil { @@ -241,7 +247,23 @@ func ListNamespacesQuery(query HostComputeQuery) ([]HostComputeNamespace, error) // GetNamespaceByID returns the Namespace specified by Id. func GetNamespaceByID(namespaceId string) (*HostComputeNamespace, error) { - return getNamespace(guid.FromString(namespaceId), defaultQueryJson()) + hcnQuery := defaultQuery() + mapA := map[string]string{"ID": namespaceId} + filter, err := json.Marshal(mapA) + if err != nil { + return nil, err + } + hcnQuery.Filter = string(filter) + + namespaces, err := ListNamespacesQuery(hcnQuery) + if err != nil { + return nil, err + } + if len(namespaces) == 0 { + return nil, NamespaceNotFoundError{NamespaceID: namespaceId} + } + + return &namespaces[0], err } // GetNamespaceEndpointIds returns the endpoints of the Namespace specified by Id. @@ -356,7 +378,7 @@ func (namespace *HostComputeNamespace) Sync() error { // The shim is likey gone. Simply ignore the sync as if it didn't exist. if perr, ok := err.(*os.PathError); ok && perr.Err == syscall.ERROR_FILE_NOT_FOUND { // Remove the reg key there is no point to try again - cfg.Remove() + _ = cfg.Remove() return nil } f := map[string]interface{}{ diff --git a/vendor/github.com/Microsoft/hcsshim/hcn/hcnnetwork.go b/vendor/github.com/Microsoft/hcsshim/hcn/hcnnetwork.go index b5f1db8b..c36b1363 100644 --- a/vendor/github.com/Microsoft/hcsshim/hcn/hcnnetwork.go +++ b/vendor/github.com/Microsoft/hcsshim/hcn/hcnnetwork.go @@ -2,27 +2,28 @@ package hcn import ( "encoding/json" + "errors" - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" "github.com/Microsoft/hcsshim/internal/interop" "github.com/sirupsen/logrus" ) -// Route is assoicated with a subnet. +// Route is associated with a subnet. type Route struct { NextHop string `json:",omitempty"` DestinationPrefix string `json:",omitempty"` Metric uint16 `json:",omitempty"` } -// Subnet is assoicated with a Ipam. +// Subnet is associated with a Ipam. type Subnet struct { IpAddressPrefix string `json:",omitempty"` Policies []json.RawMessage `json:",omitempty"` Routes []Route `json:",omitempty"` } -// Ipam (Internet Protocol Addres Management) is assoicated with a network +// Ipam (Internet Protocol Address Management) is associated with a network // and represents the address space(s) of a network. type Ipam struct { Type string `json:",omitempty"` // Ex: Static, DHCP @@ -35,12 +36,12 @@ type MacRange struct { EndMacAddress string `json:",omitempty"` } -// MacPool is assoicated with a network and represents pool of MacRanges. +// MacPool is associated with a network and represents pool of MacRanges. type MacPool struct { Ranges []MacRange `json:",omitempty"` } -// Dns (Domain Name System is associated with a network. +// Dns (Domain Name System is associated with a network). type Dns struct { Domain string `json:",omitempty"` Search []string `json:",omitempty"` @@ -81,6 +82,7 @@ type HostComputeNetwork struct { Dns Dns `json:",omitempty"` Ipams []Ipam `json:",omitempty"` Flags NetworkFlags `json:",omitempty"` // 0: None + Health Health `json:",omitempty"` SchemaVersion SchemaVersion `json:",omitempty"` } @@ -132,6 +134,12 @@ func getNetwork(networkGuid guid.GUID, query string) (*HostComputeNetwork, error } // Convert output to HostComputeNetwork var outputNetwork HostComputeNetwork + + // If HNS sets the network type to NAT (i.e. '0' in HNS.Schema.Network.NetworkMode), + // the value will be omitted from the JSON blob. We therefore need to initialize NAT here before + // unmarshaling the JSON blob. + outputNetwork.Type = NAT + if err := json.Unmarshal([]byte(properties), &outputNetwork); err != nil { return nil, err } @@ -196,6 +204,12 @@ func createNetwork(settings string) (*HostComputeNetwork, error) { } // Convert output to HostComputeNetwork var outputNetwork HostComputeNetwork + + // If HNS sets the network type to NAT (i.e. '0' in HNS.Schema.Network.NetworkMode), + // the value will be omitted from the JSON blob. We therefore need to initialize NAT here before + // unmarshaling the JSON blob. + outputNetwork.Type = NAT + if err := json.Unmarshal([]byte(properties), &outputNetwork); err != nil { return nil, err } @@ -203,7 +217,10 @@ func createNetwork(settings string) (*HostComputeNetwork, error) { } func modifyNetwork(networkId string, settings string) (*HostComputeNetwork, error) { - networkGuid := guid.FromString(networkId) + networkGuid, err := guid.FromString(networkId) + if err != nil { + return nil, errInvalidNetworkID + } // Open Network var ( networkHandle hcnNetwork @@ -237,6 +254,12 @@ func modifyNetwork(networkId string, settings string) (*HostComputeNetwork, erro } // Convert output to HostComputeNetwork var outputNetwork HostComputeNetwork + + // If HNS sets the network type to NAT (i.e. '0' in HNS.Schema.Network.NetworkMode), + // the value will be omitted from the JSON blob. We therefore need to initialize NAT here before + // unmarshaling the JSON blob. + outputNetwork.Type = NAT + if err := json.Unmarshal([]byte(properties), &outputNetwork); err != nil { return nil, err } @@ -244,7 +267,10 @@ func modifyNetwork(networkId string, settings string) (*HostComputeNetwork, erro } func deleteNetwork(networkId string) error { - networkGuid := guid.FromString(networkId) + networkGuid, err := guid.FromString(networkId) + if err != nil { + return errInvalidNetworkID + } var resultBuffer *uint16 hr := hcnDeleteNetwork(&networkGuid, &resultBuffer) if err := checkForErrors("hcnDeleteNetwork", hr, resultBuffer); err != nil { @@ -320,6 +346,24 @@ func GetNetworkByName(networkName string) (*HostComputeNetwork, error) { // Create Network. func (network *HostComputeNetwork) Create() (*HostComputeNetwork, error) { logrus.Debugf("hcn::HostComputeNetwork::Create id=%s", network.Id) + for _, ipam := range network.Ipams { + for _, subnet := range ipam.Subnets { + if subnet.IpAddressPrefix != "" { + hasDefault := false + for _, route := range subnet.Routes { + if route.NextHop == "" { + return nil, errors.New("network create error, subnet has address prefix but no gateway specified") + } + if route.DestinationPrefix == "0.0.0.0/0" || route.DestinationPrefix == "::/0" { + hasDefault = true + } + } + if !hasDefault { + return nil, errors.New("network create error, no default gateway") + } + } + } + } jsonString, err := json.Marshal(network) if err != nil { diff --git a/vendor/github.com/Microsoft/hcsshim/hcn/hcnpolicy.go b/vendor/github.com/Microsoft/hcsshim/hcn/hcnpolicy.go index 6b12d73c..c032d794 100644 --- a/vendor/github.com/Microsoft/hcsshim/hcn/hcnpolicy.go +++ b/vendor/github.com/Microsoft/hcsshim/hcn/hcnpolicy.go @@ -1,6 +1,8 @@ package hcn -import "encoding/json" +import ( + "encoding/json" +) // EndpointPolicyType are the potential Policies that apply to Endpoints. type EndpointPolicyType string @@ -14,8 +16,10 @@ const ( OutBoundNAT EndpointPolicyType = "OutBoundNAT" SDNRoute EndpointPolicyType = "SDNRoute" L4Proxy EndpointPolicyType = "L4Proxy" + L4WFPPROXY EndpointPolicyType = "L4WFPPROXY" PortName EndpointPolicyType = "PortName" EncapOverhead EndpointPolicyType = "EncapOverhead" + IOV EndpointPolicyType = "Iov" // Endpoint and Network have InterfaceConstraint and ProviderAddress NetworkProviderAddress EndpointPolicyType = "ProviderAddress" NetworkInterfaceConstraint EndpointPolicyType = "InterfaceConstraint" @@ -40,7 +44,11 @@ const ( InterfaceConstraint NetworkPolicyType = "InterfaceConstraint" ProviderAddress NetworkPolicyType = "ProviderAddress" RemoteSubnetRoute NetworkPolicyType = "RemoteSubnetRoute" + VxlanPort NetworkPolicyType = "VxlanPort" HostRoute NetworkPolicyType = "HostRoute" + SetPolicy NetworkPolicyType = "SetPolicy" + NetworkL4Proxy NetworkPolicyType = "L4Proxy" + LayerConstraint NetworkPolicyType = "LayerConstraint" ) // NetworkPolicy is a collection of Policy settings for a Network. @@ -64,14 +72,18 @@ type SubnetPolicy struct { Settings json.RawMessage `json:",omitempty"` } +// NatFlags are flags for portmappings. +type NatFlags uint32 + /// Endpoint Policy objects // PortMappingPolicySetting defines Port Mapping (NAT) type PortMappingPolicySetting struct { - Protocol uint32 `json:",omitempty"` // EX: TCP = 6, UDP = 17 - InternalPort uint16 `json:",omitempty"` - ExternalPort uint16 `json:",omitempty"` - VIP string `json:",omitempty"` + Protocol uint32 `json:",omitempty"` // EX: TCP = 6, UDP = 17 + InternalPort uint16 `json:",omitempty"` + ExternalPort uint16 `json:",omitempty"` + VIP string `json:",omitempty"` + Flags NatFlags `json:",omitempty"` } // ActionType associated with ACLs. Value is either Allow or Block. @@ -120,8 +132,9 @@ type QosPolicySetting struct { // OutboundNatPolicySetting sets outbound Network Address Translation on an Endpoint. type OutboundNatPolicySetting struct { - VirtualIP string `json:",omitempty"` - Exceptions []string `json:",omitempty"` + VirtualIP string `json:",omitempty"` + Exceptions []string `json:",omitempty"` + Destinations []string `json:",omitempty"` } // SDNRoutePolicySetting sets SDN Route on an Endpoint. @@ -131,14 +144,22 @@ type SDNRoutePolicySetting struct { NeedEncap bool `json:",omitempty"` } -// L4ProxyPolicySetting sets Layer-4 Proxy on an endpoint. -type L4ProxyPolicySetting struct { - IP string `json:",omitempty"` - Port string `json:",omitempty"` - Protocol uint32 `json:",omitempty"` // EX: TCP = 6, UDP = 17 - ExceptionList []string `json:",omitempty"` - Destination string `json:","` - OutboundNat bool `json:",omitempty"` +// FiveTuple is nested in L4ProxyPolicySetting for WFP support. +type FiveTuple struct { + Protocols string `json:",omitempty"` + LocalAddresses string `json:",omitempty"` + RemoteAddresses string `json:",omitempty"` + LocalPorts string `json:",omitempty"` + RemotePorts string `json:",omitempty"` + Priority uint16 `json:",omitempty"` +} + +// L4WfpProxyPolicySetting sets Layer-4 Proxy on an endpoint. +type L4WfpProxyPolicySetting struct { + InboundProxyPort string `json:",omitempty"` + OutboundProxyPort string `json:",omitempty"` + FilterTuple FiveTuple `json:",omitempty"` + UserSID string `json:",omitempty"` } // PortnameEndpointPolicySetting sets the port name for an endpoint. @@ -151,6 +172,13 @@ type EncapOverheadEndpointPolicySetting struct { Overhead uint16 `json:",omitempty"` } +// IovPolicySetting sets the Iov settings for an endpoint. +type IovPolicySetting struct { + IovOffloadWeight uint32 `json:",omitempty"` + QueuePairsRequested uint32 `json:",omitempty"` + InterruptModeration uint32 `json:",omitempty"` +} + /// Endpoint and Network Policy objects // ProviderAddressEndpointPolicySetting sets the PA for an endpoint. @@ -196,6 +224,10 @@ type AutomaticDNSNetworkPolicySetting struct { Enable bool `json:",omitempty"` } +type LayerConstraintNetworkPolicySetting struct { + LayerId string `json:",omitempty"` +} + /// Subnet Policy objects // VlanPolicySetting isolates a subnet with VLAN tagging. @@ -215,3 +247,45 @@ type RemoteSubnetRoutePolicySetting struct { ProviderAddress string DistributedRouterMacAddress string } + +// SetPolicyTypes associated with SetPolicy. Value is IPSET. +type SetPolicyType string + +const ( + SetPolicyTypeIpSet SetPolicyType = "IPSET" +) + +// SetPolicySetting creates IPSets on network +type SetPolicySetting struct { + Id string + Name string + Type SetPolicyType + Values string +} + +// VxlanPortPolicySetting allows configuring the VXLAN TCP port +type VxlanPortPolicySetting struct { + Port uint16 +} + +// ProtocolType associated with L4ProxyPolicy +type ProtocolType uint32 + +const ( + ProtocolTypeUnknown ProtocolType = 0 + ProtocolTypeICMPv4 ProtocolType = 1 + ProtocolTypeIGMP ProtocolType = 2 + ProtocolTypeTCP ProtocolType = 6 + ProtocolTypeUDP ProtocolType = 17 + ProtocolTypeICMPv6 ProtocolType = 58 +) + +//L4ProxyPolicySetting applies proxy policy on network/endpoint +type L4ProxyPolicySetting struct { + IP string `json:",omitempty"` + Port string `json:",omitempty"` + Protocol ProtocolType `json:",omitempty"` + Exceptions []string `json:",omitempty"` + Destination string + OutboundNAT bool `json:",omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/hcn/hcnroute.go b/vendor/github.com/Microsoft/hcsshim/hcn/hcnroute.go new file mode 100644 index 00000000..d6d27079 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/hcn/hcnroute.go @@ -0,0 +1,266 @@ +package hcn + +import ( + "encoding/json" + "errors" + + "github.com/Microsoft/go-winio/pkg/guid" + "github.com/Microsoft/hcsshim/internal/interop" + "github.com/sirupsen/logrus" +) + +// HostComputeRoute represents SDN routes. +type HostComputeRoute struct { + ID string `json:"ID,omitempty"` + HostComputeEndpoints []string `json:",omitempty"` + Setting []SDNRoutePolicySetting `json:",omitempty"` + SchemaVersion SchemaVersion `json:",omitempty"` +} + +// ListRoutes makes a call to list all available routes. +func ListRoutes() ([]HostComputeRoute, error) { + hcnQuery := defaultQuery() + routes, err := ListRoutesQuery(hcnQuery) + if err != nil { + return nil, err + } + return routes, nil +} + +// ListRoutesQuery makes a call to query the list of available routes. +func ListRoutesQuery(query HostComputeQuery) ([]HostComputeRoute, error) { + queryJSON, err := json.Marshal(query) + if err != nil { + return nil, err + } + + routes, err := enumerateRoutes(string(queryJSON)) + if err != nil { + return nil, err + } + return routes, nil +} + +// GetRouteByID returns the route specified by Id. +func GetRouteByID(routeID string) (*HostComputeRoute, error) { + hcnQuery := defaultQuery() + mapA := map[string]string{"ID": routeID} + filter, err := json.Marshal(mapA) + if err != nil { + return nil, err + } + hcnQuery.Filter = string(filter) + + routes, err := ListRoutesQuery(hcnQuery) + if err != nil { + return nil, err + } + if len(routes) == 0 { + return nil, RouteNotFoundError{RouteId: routeID} + } + return &routes[0], err +} + +// Create Route. +func (route *HostComputeRoute) Create() (*HostComputeRoute, error) { + logrus.Debugf("hcn::HostComputeRoute::Create id=%s", route.ID) + + jsonString, err := json.Marshal(route) + if err != nil { + return nil, err + } + + logrus.Debugf("hcn::HostComputeRoute::Create JSON: %s", jsonString) + route, hcnErr := createRoute(string(jsonString)) + if hcnErr != nil { + return nil, hcnErr + } + return route, nil +} + +// Delete Route. +func (route *HostComputeRoute) Delete() error { + logrus.Debugf("hcn::HostComputeRoute::Delete id=%s", route.ID) + + existingRoute, _ := GetRouteByID(route.ID) + + if existingRoute != nil { + if err := deleteRoute(route.ID); err != nil { + return err + } + } + + return nil +} + +// AddEndpoint add an endpoint to a route +// Since HCNRoute doesn't implement modify functionality, add operation is essentially delete and add +func (route *HostComputeRoute) AddEndpoint(endpoint *HostComputeEndpoint) (*HostComputeRoute, error) { + logrus.Debugf("hcn::HostComputeRoute::AddEndpoint route=%s endpoint=%s", route.ID, endpoint.Id) + + err := route.Delete() + if err != nil { + return nil, err + } + + // Add Endpoint to the Existing List + route.HostComputeEndpoints = append(route.HostComputeEndpoints, endpoint.Id) + + return route.Create() +} + +// RemoveEndpoint removes an endpoint from a route +// Since HCNRoute doesn't implement modify functionality, remove operation is essentially delete and add +func (route *HostComputeRoute) RemoveEndpoint(endpoint *HostComputeEndpoint) (*HostComputeRoute, error) { + logrus.Debugf("hcn::HostComputeRoute::RemoveEndpoint route=%s endpoint=%s", route.ID, endpoint.Id) + + err := route.Delete() + if err != nil { + return nil, err + } + + // Create a list of all the endpoints besides the one being removed + i := 0 + for index, endpointReference := range route.HostComputeEndpoints { + if endpointReference == endpoint.Id { + i = index + break + } + } + + route.HostComputeEndpoints = append(route.HostComputeEndpoints[0:i], route.HostComputeEndpoints[i+1:]...) + return route.Create() +} + +// AddRoute for the specified endpoints and SDN Route setting +func AddRoute(endpoints []HostComputeEndpoint, destinationPrefix string, nextHop string, needEncapsulation bool) (*HostComputeRoute, error) { + logrus.Debugf("hcn::HostComputeRoute::AddRoute endpointId=%v, destinationPrefix=%v, nextHop=%v, needEncapsulation=%v", endpoints, destinationPrefix, nextHop, needEncapsulation) + + if len(endpoints) <= 0 { + return nil, errors.New("Missing endpoints") + } + + route := &HostComputeRoute{ + SchemaVersion: V2SchemaVersion(), + Setting: []SDNRoutePolicySetting{ + { + DestinationPrefix: destinationPrefix, + NextHop: nextHop, + NeedEncap: needEncapsulation, + }, + }, + } + + for _, endpoint := range endpoints { + route.HostComputeEndpoints = append(route.HostComputeEndpoints, endpoint.Id) + } + + return route.Create() +} + +func enumerateRoutes(query string) ([]HostComputeRoute, error) { + // Enumerate all routes Guids + var ( + resultBuffer *uint16 + routeBuffer *uint16 + ) + hr := hcnEnumerateRoutes(query, &routeBuffer, &resultBuffer) + if err := checkForErrors("hcnEnumerateRoutes", hr, resultBuffer); err != nil { + return nil, err + } + + routes := interop.ConvertAndFreeCoTaskMemString(routeBuffer) + var routeIds []guid.GUID + if err := json.Unmarshal([]byte(routes), &routeIds); err != nil { + return nil, err + } + + var outputRoutes []HostComputeRoute + for _, routeGUID := range routeIds { + route, err := getRoute(routeGUID, query) + if err != nil { + return nil, err + } + outputRoutes = append(outputRoutes, *route) + } + return outputRoutes, nil +} + +func getRoute(routeGUID guid.GUID, query string) (*HostComputeRoute, error) { + // Open routes. + var ( + routeHandle hcnRoute + resultBuffer *uint16 + propertiesBuffer *uint16 + ) + hr := hcnOpenRoute(&routeGUID, &routeHandle, &resultBuffer) + if err := checkForErrors("hcnOpenRoute", hr, resultBuffer); err != nil { + return nil, err + } + // Query routes. + hr = hcnQueryRouteProperties(routeHandle, query, &propertiesBuffer, &resultBuffer) + if err := checkForErrors("hcnQueryRouteProperties", hr, resultBuffer); err != nil { + return nil, err + } + properties := interop.ConvertAndFreeCoTaskMemString(propertiesBuffer) + // Close routes. + hr = hcnCloseRoute(routeHandle) + if err := checkForErrors("hcnCloseRoute", hr, nil); err != nil { + return nil, err + } + // Convert output to HostComputeRoute + var outputRoute HostComputeRoute + if err := json.Unmarshal([]byte(properties), &outputRoute); err != nil { + return nil, err + } + return &outputRoute, nil +} + +func createRoute(settings string) (*HostComputeRoute, error) { + // Create new route. + var ( + routeHandle hcnRoute + resultBuffer *uint16 + propertiesBuffer *uint16 + ) + routeGUID := guid.GUID{} + hr := hcnCreateRoute(&routeGUID, settings, &routeHandle, &resultBuffer) + if err := checkForErrors("hcnCreateRoute", hr, resultBuffer); err != nil { + return nil, err + } + // Query route. + hcnQuery := defaultQuery() + query, err := json.Marshal(hcnQuery) + if err != nil { + return nil, err + } + hr = hcnQueryRouteProperties(routeHandle, string(query), &propertiesBuffer, &resultBuffer) + if err := checkForErrors("hcnQueryRouteProperties", hr, resultBuffer); err != nil { + return nil, err + } + properties := interop.ConvertAndFreeCoTaskMemString(propertiesBuffer) + // Close Route. + hr = hcnCloseRoute(routeHandle) + if err := checkForErrors("hcnCloseRoute", hr, nil); err != nil { + return nil, err + } + // Convert output to HostComputeRoute + var outputRoute HostComputeRoute + if err := json.Unmarshal([]byte(properties), &outputRoute); err != nil { + return nil, err + } + return &outputRoute, nil +} + +func deleteRoute(routeID string) error { + routeGUID, err := guid.FromString(routeID) + if err != nil { + return errInvalidRouteID + } + var resultBuffer *uint16 + hr := hcnDeleteRoute(&routeGUID, &resultBuffer) + if err := checkForErrors("hcnDeleteRoute", hr, resultBuffer); err != nil { + return err + } + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/hcn/hcnsupport.go b/vendor/github.com/Microsoft/hcsshim/hcn/hcnsupport.go index 9b5df203..1096aebd 100644 --- a/vendor/github.com/Microsoft/hcsshim/hcn/hcnsupport.go +++ b/vendor/github.com/Microsoft/hcsshim/hcn/hcnsupport.go @@ -6,11 +6,19 @@ import ( // SupportedFeatures are the features provided by the Service. type SupportedFeatures struct { - Acl AclFeatures `json:"ACL"` - Api ApiSupport `json:"API"` - RemoteSubnet bool `json:"RemoteSubnet"` - HostRoute bool `json:"HostRoute"` - DSR bool `json:"DSR"` + Acl AclFeatures `json:"ACL"` + Api ApiSupport `json:"API"` + RemoteSubnet bool `json:"RemoteSubnet"` + HostRoute bool `json:"HostRoute"` + DSR bool `json:"DSR"` + Slash32EndpointPrefixes bool `json:"Slash32EndpointPrefixes"` + AclSupportForProtocol252 bool `json:"AclSupportForProtocol252"` + SessionAffinity bool `json:"SessionAffinity"` + IPv6DualStack bool `json:"IPv6DualStack"` + SetPolicy bool `json:"SetPolicy"` + VxlanPort bool `json:"VxlanPort"` + L4Proxy bool `json:"L4Proxy"` // network policy that applies VFP rules to all endpoints on the network to redirect traffic + L4WfpProxy bool `json:"L4WfpProxy"` // endpoint policy that applies WFP filters to redirect traffic to/from that endpoint } // AclFeatures are the supported ACL possibilities. @@ -53,18 +61,43 @@ func GetSupportedFeatures() SupportedFeatures { features.RemoteSubnet = isFeatureSupported(globals.Version, RemoteSubnetVersion) features.HostRoute = isFeatureSupported(globals.Version, HostRouteVersion) features.DSR = isFeatureSupported(globals.Version, DSRVersion) + features.Slash32EndpointPrefixes = isFeatureSupported(globals.Version, Slash32EndpointPrefixesVersion) + features.AclSupportForProtocol252 = isFeatureSupported(globals.Version, AclSupportForProtocol252Version) + features.SessionAffinity = isFeatureSupported(globals.Version, SessionAffinityVersion) + features.IPv6DualStack = isFeatureSupported(globals.Version, IPv6DualStackVersion) + features.SetPolicy = isFeatureSupported(globals.Version, SetPolicyVersion) + features.VxlanPort = isFeatureSupported(globals.Version, VxlanPortVersion) + features.L4Proxy = isFeatureSupported(globals.Version, L4ProxyPolicyVersion) + features.L4WfpProxy = isFeatureSupported(globals.Version, L4WfpProxyPolicyVersion) return features } -func isFeatureSupported(currentVersion Version, minVersionSupported Version) bool { - if currentVersion.Major < minVersionSupported.Major { +func isFeatureSupported(currentVersion Version, versionsSupported VersionRanges) bool { + isFeatureSupported := false + + for _, versionRange := range versionsSupported { + isFeatureSupported = isFeatureSupported || isFeatureInRange(currentVersion, versionRange) + } + + return isFeatureSupported +} + +func isFeatureInRange(currentVersion Version, versionRange VersionRange) bool { + if currentVersion.Major < versionRange.MinVersion.Major { + logrus.Infof("currentVersion.Major < versionRange.MinVersion.Major: %v, %v", currentVersion.Major, versionRange.MinVersion.Major) return false } - if currentVersion.Major > minVersionSupported.Major { - return true + if currentVersion.Major > versionRange.MaxVersion.Major { + logrus.Infof("currentVersion.Major > versionRange.MaxVersion.Major: %v, %v", currentVersion.Major, versionRange.MaxVersion.Major) + return false } - if currentVersion.Minor < minVersionSupported.Minor { + if currentVersion.Major == versionRange.MinVersion.Major && currentVersion.Minor < versionRange.MinVersion.Minor { + logrus.Infof("currentVersion.Minor < versionRange.MinVersion.Major: %v, %v", currentVersion.Minor, versionRange.MinVersion.Minor) + return false + } + if currentVersion.Major == versionRange.MaxVersion.Major && currentVersion.Minor > versionRange.MaxVersion.Minor { + logrus.Infof("currentVersion.Minor > versionRange.MaxVersion.Major: %v, %v", currentVersion.Minor, versionRange.MaxVersion.Minor) return false } return true diff --git a/vendor/github.com/Microsoft/hcsshim/hcn/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/hcn/zsyscall_windows.go index 856b2c14..7ec5b58b 100644 --- a/vendor/github.com/Microsoft/hcsshim/hcn/zsyscall_windows.go +++ b/vendor/github.com/Microsoft/hcsshim/hcn/zsyscall_windows.go @@ -71,10 +71,13 @@ var ( procHcnQueryLoadBalancerProperties = modcomputenetwork.NewProc("HcnQueryLoadBalancerProperties") procHcnDeleteLoadBalancer = modcomputenetwork.NewProc("HcnDeleteLoadBalancer") procHcnCloseLoadBalancer = modcomputenetwork.NewProc("HcnCloseLoadBalancer") - procHcnOpenService = modcomputenetwork.NewProc("HcnOpenService") - procHcnRegisterServiceCallback = modcomputenetwork.NewProc("HcnRegisterServiceCallback") - procHcnUnregisterServiceCallback = modcomputenetwork.NewProc("HcnUnregisterServiceCallback") - procHcnCloseService = modcomputenetwork.NewProc("HcnCloseService") + procHcnEnumerateSdnRoutes = modcomputenetwork.NewProc("HcnEnumerateSdnRoutes") + procHcnCreateSdnRoute = modcomputenetwork.NewProc("HcnCreateSdnRoute") + procHcnOpenSdnRoute = modcomputenetwork.NewProc("HcnOpenSdnRoute") + procHcnModifySdnRoute = modcomputenetwork.NewProc("HcnModifySdnRoute") + procHcnQuerySdnRouteProperties = modcomputenetwork.NewProc("HcnQuerySdnRouteProperties") + procHcnDeleteSdnRoute = modcomputenetwork.NewProc("HcnDeleteSdnRoute") + procHcnCloseSdnRoute = modcomputenetwork.NewProc("HcnCloseSdnRoute") ) func SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) { @@ -657,11 +660,20 @@ func hcnCloseLoadBalancer(loadBalancer hcnLoadBalancer) (hr error) { return } -func hcnOpenService(service *hcnService, result **uint16) (hr error) { - if hr = procHcnOpenService.Find(); hr != nil { +func hcnEnumerateRoutes(query string, routes **uint16, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(query) + if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcnOpenService.Addr(), 2, uintptr(unsafe.Pointer(service)), uintptr(unsafe.Pointer(result)), 0) + return _hcnEnumerateRoutes(_p0, routes, result) +} + +func _hcnEnumerateRoutes(query *uint16, routes **uint16, result **uint16) (hr error) { + if hr = procHcnEnumerateSdnRoutes.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcnEnumerateSdnRoutes.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(routes)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -671,11 +683,20 @@ func hcnOpenService(service *hcnService, result **uint16) (hr error) { return } -func hcnRegisterServiceCallback(service hcnService, callback int32, context int32, callbackHandle *hcnCallbackHandle) (hr error) { - if hr = procHcnRegisterServiceCallback.Find(); hr != nil { +func hcnCreateRoute(id *_guid, settings string, route *hcnRoute, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(settings) + if hr != nil { return } - r0, _, _ := syscall.Syscall6(procHcnRegisterServiceCallback.Addr(), 4, uintptr(service), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0) + return _hcnCreateRoute(id, _p0, route, result) +} + +func _hcnCreateRoute(id *_guid, settings *uint16, route *hcnRoute, result **uint16) (hr error) { + if hr = procHcnCreateSdnRoute.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcnCreateSdnRoute.Addr(), 4, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(route)), uintptr(unsafe.Pointer(result)), 0, 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -685,11 +706,11 @@ func hcnRegisterServiceCallback(service hcnService, callback int32, context int3 return } -func hcnUnregisterServiceCallback(callbackHandle hcnCallbackHandle) (hr error) { - if hr = procHcnUnregisterServiceCallback.Find(); hr != nil { +func hcnOpenRoute(id *_guid, route *hcnRoute, result **uint16) (hr error) { + if hr = procHcnOpenSdnRoute.Find(); hr != nil { return } - r0, _, _ := syscall.Syscall(procHcnUnregisterServiceCallback.Addr(), 1, uintptr(callbackHandle), 0, 0) + r0, _, _ := syscall.Syscall(procHcnOpenSdnRoute.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(route)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -699,11 +720,71 @@ func hcnUnregisterServiceCallback(callbackHandle hcnCallbackHandle) (hr error) { return } -func hcnCloseService(service hcnService) (hr error) { - if hr = procHcnCloseService.Find(); hr != nil { +func hcnModifyRoute(route hcnRoute, settings string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(settings) + if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcnCloseService.Addr(), 1, uintptr(service), 0, 0) + return _hcnModifyRoute(route, _p0, result) +} + +func _hcnModifyRoute(route hcnRoute, settings *uint16, result **uint16) (hr error) { + if hr = procHcnModifySdnRoute.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcnModifySdnRoute.Addr(), 3, uintptr(route), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcnQueryRouteProperties(route hcnRoute, query string, properties **uint16, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(query) + if hr != nil { + return + } + return _hcnQueryRouteProperties(route, _p0, properties, result) +} + +func _hcnQueryRouteProperties(route hcnRoute, query *uint16, properties **uint16, result **uint16) (hr error) { + if hr = procHcnQuerySdnRouteProperties.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcnQuerySdnRouteProperties.Addr(), 4, uintptr(route), uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcnDeleteRoute(id *_guid, result **uint16) (hr error) { + if hr = procHcnDeleteSdnRoute.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcnDeleteSdnRoute.Addr(), 2, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(result)), 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcnCloseRoute(route hcnRoute) (hr error) { + if hr = procHcnCloseSdnRoute.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcnCloseSdnRoute.Addr(), 1, uintptr(route), 0, 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff diff --git a/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go b/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go index eb013d2c..40831267 100644 --- a/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go +++ b/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go @@ -39,11 +39,27 @@ func HNSListEndpointRequest() ([]HNSEndpoint, error) { // HotAttachEndpoint makes a HCS Call to attach the endpoint to the container func HotAttachEndpoint(containerID string, endpointID string) error { + endpoint, err := GetHNSEndpointByID(endpointID) + if err != nil { + return err + } + isAttached, err := endpoint.IsAttached(containerID) + if isAttached { + return err + } return modifyNetworkEndpoint(containerID, endpointID, Add) } // HotDetachEndpoint makes a HCS Call to detach the endpoint from the container func HotDetachEndpoint(containerID string, endpointID string) error { + endpoint, err := GetHNSEndpointByID(endpointID) + if err != nil { + return err + } + isAttached, err := endpoint.IsAttached(containerID) + if !isAttached { + return err + } return modifyNetworkEndpoint(containerID, endpointID, Remove) } diff --git a/vendor/github.com/Microsoft/hcsshim/hnspolicy.go b/vendor/github.com/Microsoft/hcsshim/hnspolicy.go index a3e03ff8..00ab2636 100644 --- a/vendor/github.com/Microsoft/hcsshim/hnspolicy.go +++ b/vendor/github.com/Microsoft/hcsshim/hnspolicy.go @@ -21,8 +21,11 @@ const ( OutboundNat = hns.OutboundNat ExternalLoadBalancer = hns.ExternalLoadBalancer Route = hns.Route + Proxy = hns.Proxy ) +type ProxyPolicy = hns.ProxyPolicy + type NatPolicy = hns.NatPolicy type QosPolicy = hns.QosPolicy diff --git a/vendor/github.com/Microsoft/hcsshim/internal/cni/registry.go b/vendor/github.com/Microsoft/hcsshim/internal/cni/registry.go index 842ee1f7..4a4fcea8 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/cni/registry.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/cni/registry.go @@ -3,7 +3,7 @@ package cni import ( "errors" - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" "github.com/Microsoft/hcsshim/internal/regstate" ) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go b/vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go new file mode 100644 index 00000000..b8e2d4f3 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go @@ -0,0 +1,85 @@ +package cow + +import ( + "context" + "io" + + "github.com/Microsoft/hcsshim/internal/schema1" + hcsschema "github.com/Microsoft/hcsshim/internal/schema2" +) + +// Process is the interface for an OS process running in a container or utility VM. +type Process interface { + // Close releases resources associated with the process and closes the + // writer and readers returned by Stdio. Depending on the implementation, + // this may also terminate the process. + Close() error + // CloseStdin causes the process's stdin handle to receive EOF/EPIPE/whatever + // is appropriate to indicate that no more data is available. + CloseStdin(ctx context.Context) error + // Pid returns the process ID. + Pid() int + // Stdio returns the stdio streams for a process. These may be nil if a stream + // was not requested during CreateProcess. + Stdio() (_ io.Writer, _ io.Reader, _ io.Reader) + // ResizeConsole resizes the virtual terminal associated with the process. + ResizeConsole(ctx context.Context, width, height uint16) error + // Kill sends a SIGKILL or equivalent signal to the process and returns whether + // the signal was delivered. It does not wait for the process to terminate. + Kill(ctx context.Context) (bool, error) + // Signal sends a signal to the process and returns whether the signal was + // delivered. The input is OS specific (either + // guestrequest.SignalProcessOptionsWCOW or + // guestrequest.SignalProcessOptionsLCOW). It does not wait for the process + // to terminate. + Signal(ctx context.Context, options interface{}) (bool, error) + // Wait waits for the process to complete, or for a connection to the process to be + // terminated by some error condition (including calling Close). + Wait() error + // ExitCode returns the exit code of the process. Returns an error if the process is + // not running. + ExitCode() (int, error) +} + +// ProcessHost is the interface for creating processes. +type ProcessHost interface { + // CreateProcess creates a process. The configuration is host specific + // (either hcsschema.ProcessParameters or lcow.ProcessParameters). + CreateProcess(ctx context.Context, config interface{}) (Process, error) + // OS returns the host's operating system, "linux" or "windows". + OS() string + // IsOCI specifies whether this is an OCI-compliant process host. If true, + // then the configuration passed to CreateProcess should have an OCI process + // spec (or nil if this is the initial process in an OCI container). + // Otherwise, it should have the HCS-specific process parameters. + IsOCI() bool +} + +// Container is the interface for container objects, either running on the host or +// in a utility VM. +type Container interface { + ProcessHost + // Close releases the resources associated with the container. Depending on + // the implementation, this may also terminate the container. + Close() error + // ID returns the container ID. + ID() string + // Properties returns the requested container properties targeting a V1 schema container. + Properties(ctx context.Context, types ...schema1.PropertyType) (*schema1.ContainerProperties, error) + // PropertiesV2 returns the requested container properties targeting a V2 schema container. + PropertiesV2(ctx context.Context, types ...hcsschema.PropertyType) (*hcsschema.Properties, error) + // Start starts a container. + Start(ctx context.Context) error + // Shutdown sends a shutdown request to the container (but does not wait for + // the shutdown to complete). + Shutdown(ctx context.Context) error + // Terminate sends a terminate request to the container (but does not wait + // for the terminate to complete). + Terminate(ctx context.Context) error + // Wait waits for the container to terminate, or for the connection to the + // container to be terminated by some error condition (including calling + // Close). + Wait() error + // Modify sends a request to modify container resources + Modify(ctx context.Context, config interface{}) error +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go b/vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go deleted file mode 100644 index 5d3d0dfe..00000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go +++ /dev/null @@ -1,100 +0,0 @@ -package guestrequest - -import ( - "github.com/Microsoft/hcsshim/internal/schema2" -) - -// Arguably, many of these (at least CombinedLayers) should have been generated -// by swagger. -// -// This will also change package name due to an inbound breaking change. - -// This class is used by a modify request to add or remove a combined layers -// structure in the guest. For windows, the GCS applies a filter in ContainerRootPath -// using the specified layers as the parent content. Ignores property ScratchPath -// since the container path is already the scratch path. For linux, the GCS unions -// the specified layers and ScratchPath together, placing the resulting union -// filesystem at ContainerRootPath. -type CombinedLayers struct { - ContainerRootPath string `json:"ContainerRootPath,omitempty"` - Layers []hcsschema.Layer `json:"Layers,omitempty"` - ScratchPath string `json:"ScratchPath,omitempty"` -} - -// Defines the schema for hosted settings passed to GCS and/or OpenGCS - -// SCSI. Scratch space for remote file-system commands, or R/W layer for containers -type LCOWMappedVirtualDisk struct { - MountPath string `json:"MountPath,omitempty"` // /tmp/scratch for an LCOW utility VM being used as a service VM - Lun uint8 `json:"Lun,omitempty"` - Controller uint8 `json:"Controller,omitempty"` - ReadOnly bool `json:"ReadOnly,omitempty"` -} - -type WCOWMappedVirtualDisk struct { - ContainerPath string `json:"ContainerPath,omitempty"` - Lun int32 `json:"Lun,omitempty"` -} - -type LCOWMappedDirectory struct { - MountPath string `json:"MountPath,omitempty"` - Port int32 `json:"Port,omitempty"` - ShareName string `json:"ShareName,omitempty"` // If empty not using ANames (not currently supported) - ReadOnly bool `json:"ReadOnly,omitempty"` -} - -// Read-only layers over VPMem -type LCOWMappedVPMemDevice struct { - DeviceNumber uint32 `json:"DeviceNumber,omitempty"` - MountPath string `json:"MountPath,omitempty"` // /tmp/pN -} - -type LCOWNetworkAdapter struct { - NamespaceID string `json:",omitempty"` - ID string `json:",omitempty"` - MacAddress string `json:",omitempty"` - IPAddress string `json:",omitempty"` - PrefixLength uint8 `json:",omitempty"` - GatewayAddress string `json:",omitempty"` - DNSSuffix string `json:",omitempty"` - DNSServerList string `json:",omitempty"` - EnableLowMetric bool `json:",omitempty"` - EncapOverhead uint16 `json:",omitempty"` -} - -type ResourceType string - -const ( - // These are constants for v2 schema modify guest requests. - ResourceTypeMappedDirectory ResourceType = "MappedDirectory" - ResourceTypeMappedVirtualDisk ResourceType = "MappedVirtualDisk" - ResourceTypeNetwork ResourceType = "Network" - ResourceTypeNetworkNamespace ResourceType = "NetworkNamespace" - ResourceTypeCombinedLayers ResourceType = "CombinedLayers" - ResourceTypeVPMemDevice ResourceType = "VPMemDevice" -) - -// GuestRequest is for modify commands passed to the guest. -type GuestRequest struct { - RequestType string `json:"RequestType,omitempty"` - ResourceType ResourceType `json:"ResourceType,omitempty"` - Settings interface{} `json:"Settings,omitempty"` -} - -type NetworkModifyRequest struct { - AdapterId string `json:"AdapterId,omitempty"` - RequestType string `json:"RequestType,omitempty"` - Settings interface{} `json:"Settings,omitempty"` -} - -type RS4NetworkModifyRequest struct { - AdapterInstanceId string `json:"AdapterInstanceId,omitempty"` - RequestType string `json:"RequestType,omitempty"` - Settings interface{} `json:"Settings,omitempty"` -} - -// SignalProcessOptions is the options passed to either WCOW or LCOW -// to signal a given process. -type SignalProcessOptions struct { - Signal int `json:,omitempty` -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go b/vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go deleted file mode 100644 index e9e45c03..00000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go +++ /dev/null @@ -1,69 +0,0 @@ -package guid - -import ( - "crypto/rand" - "encoding/json" - "fmt" - "io" - "strconv" - "strings" -) - -var _ = (json.Marshaler)(&GUID{}) -var _ = (json.Unmarshaler)(&GUID{}) - -type GUID [16]byte - -func New() GUID { - g := GUID{} - _, err := io.ReadFull(rand.Reader, g[:]) - if err != nil { - panic(err) - } - return g -} - -func (g GUID) String() string { - return fmt.Sprintf("%02x%02x%02x%02x-%02x%02x-%02x%02x-%02x-%02x", g[3], g[2], g[1], g[0], g[5], g[4], g[7], g[6], g[8:10], g[10:]) -} - -func FromString(s string) GUID { - if len(s) != 36 { - panic(fmt.Sprintf("invalid GUID length: %d", len(s))) - } - if s[8] != '-' || s[13] != '-' || s[18] != '-' || s[23] != '-' { - panic("invalid GUID format") - } - indexOrder := [16]int{ - 0, 2, 4, 6, - 9, 11, - 14, 16, - 19, 21, - 24, 26, 28, 30, 32, 34, - } - byteOrder := [16]int{ - 3, 2, 1, 0, - 5, 4, - 7, 6, - 8, 9, - 10, 11, 12, 13, 14, 15, - } - var g GUID - for i, x := range indexOrder { - b, err := strconv.ParseInt(s[x:x+2], 16, 16) - if err != nil { - panic(err) - } - g[byteOrder[i]] = byte(b) - } - return g -} - -func (g GUID) MarshalJSON() ([]byte, error) { - return json.Marshal(g.String()) -} - -func (g *GUID) UnmarshalJSON(data []byte) error { - *g = FromString(strings.Trim(string(data), "\"")) - return nil -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go index f9a922a4..cebbe75a 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go @@ -1,10 +1,13 @@ package hcs import ( + "fmt" "sync" "syscall" "github.com/Microsoft/hcsshim/internal/interop" + "github.com/Microsoft/hcsshim/internal/logfields" + "github.com/Microsoft/hcsshim/internal/vmcompute" "github.com/sirupsen/logrus" ) @@ -40,35 +43,84 @@ var ( ) type hcsNotification uint32 + +func (hn hcsNotification) String() string { + switch hn { + case hcsNotificationSystemExited: + return "SystemExited" + case hcsNotificationSystemCreateCompleted: + return "SystemCreateCompleted" + case hcsNotificationSystemStartCompleted: + return "SystemStartCompleted" + case hcsNotificationSystemPauseCompleted: + return "SystemPauseCompleted" + case hcsNotificationSystemResumeCompleted: + return "SystemResumeCompleted" + case hcsNotificationSystemCrashReport: + return "SystemCrashReport" + case hcsNotificationSystemSiloJobCreated: + return "SystemSiloJobCreated" + case hcsNotificationSystemSaveCompleted: + return "SystemSaveCompleted" + case hcsNotificationSystemRdpEnhancedModeStateChanged: + return "SystemRdpEnhancedModeStateChanged" + case hcsNotificationSystemShutdownFailed: + return "SystemShutdownFailed" + case hcsNotificationSystemGetPropertiesCompleted: + return "SystemGetPropertiesCompleted" + case hcsNotificationSystemModifyCompleted: + return "SystemModifyCompleted" + case hcsNotificationSystemCrashInitiated: + return "SystemCrashInitiated" + case hcsNotificationSystemGuestConnectionClosed: + return "SystemGuestConnectionClosed" + case hcsNotificationProcessExited: + return "ProcessExited" + case hcsNotificationInvalid: + return "Invalid" + case hcsNotificationServiceDisconnect: + return "ServiceDisconnect" + default: + return fmt.Sprintf("Unknown: %d", hn) + } +} + type notificationChannel chan error type notifcationWatcherContext struct { channels notificationChannels - handle hcsCallback + handle vmcompute.HcsCallback + + systemID string + processID int } type notificationChannels map[hcsNotification]notificationChannel -func newChannels() notificationChannels { +func newSystemChannels() notificationChannels { channels := make(notificationChannels) + for _, notif := range []hcsNotification{ + hcsNotificationServiceDisconnect, + hcsNotificationSystemExited, + hcsNotificationSystemCreateCompleted, + hcsNotificationSystemStartCompleted, + hcsNotificationSystemPauseCompleted, + hcsNotificationSystemResumeCompleted, + hcsNotificationSystemSaveCompleted, + } { + channels[notif] = make(notificationChannel, 1) + } + return channels +} - channels[hcsNotificationSystemExited] = make(notificationChannel, 1) - channels[hcsNotificationSystemCreateCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemStartCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemPauseCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemResumeCompleted] = make(notificationChannel, 1) - channels[hcsNotificationProcessExited] = make(notificationChannel, 1) - channels[hcsNotificationServiceDisconnect] = make(notificationChannel, 1) - channels[hcsNotificationSystemCrashReport] = make(notificationChannel, 1) - channels[hcsNotificationSystemSiloJobCreated] = make(notificationChannel, 1) - channels[hcsNotificationSystemSaveCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemRdpEnhancedModeStateChanged] = make(notificationChannel, 1) - channels[hcsNotificationSystemShutdownFailed] = make(notificationChannel, 1) - channels[hcsNotificationSystemGetPropertiesCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemModifyCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemCrashInitiated] = make(notificationChannel, 1) - channels[hcsNotificationSystemGuestConnectionClosed] = make(notificationChannel, 1) - +func newProcessChannels() notificationChannels { + channels := make(notificationChannels) + for _, notif := range []hcsNotification{ + hcsNotificationServiceDisconnect, + hcsNotificationProcessExited, + } { + channels[notif] = make(notificationChannel, 1) + } return channels } @@ -92,12 +144,17 @@ func notificationWatcher(notificationType hcsNotification, callbackNumber uintpt return 0 } + log := logrus.WithFields(logrus.Fields{ + "notification-type": notificationType.String(), + "system-id": context.systemID, + }) + if context.processID != 0 { + log.Data[logfields.ProcessID] = context.processID + } + log.Debug("HCS notification") + if channel, ok := context.channels[notificationType]; ok { channel <- result - } else { - logrus.WithFields(logrus.Fields{ - "notification-type": notificationType, - }).Warn("Received a callback of an unsupported type") } return 0 diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/cgo.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/cgo.go deleted file mode 100644 index 3669c34a..00000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/cgo.go +++ /dev/null @@ -1,7 +0,0 @@ -package hcs - -import "C" - -// This import is needed to make the library compile as CGO because HCSSHIM -// only works with CGO due to callbacks from HCS comming back from a C thread -// which is not supported without CGO. See https://github.com/golang/go/issues/10973 diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go index 079b5653..7696e4b4 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go @@ -1,14 +1,14 @@ package hcs import ( + "context" "encoding/json" "errors" "fmt" + "net" "syscall" - "github.com/Microsoft/hcsshim/internal/interop" - "github.com/Microsoft/hcsshim/internal/logfields" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/log" ) var ( @@ -117,17 +117,11 @@ func (ev *ErrorEvent) String() string { return evs } -func processHcsResult(resultp *uint16) []ErrorEvent { - if resultp != nil { - resultj := interop.ConvertAndFreeCoTaskMemString(resultp) - logrus.WithField(logfields.JSON, resultj). - Debug("HCS Result") +func processHcsResult(ctx context.Context, resultJSON string) []ErrorEvent { + if resultJSON != "" { result := &hcsResult{} - if err := json.Unmarshal([]byte(resultj), result); err != nil { - logrus.WithFields(logrus.Fields{ - logfields.JSON: resultj, - logrus.ErrorKey: err, - }).Warning("Could not unmarshal HCS result") + if err := json.Unmarshal([]byte(resultJSON), result); err != nil { + log.G(ctx).WithError(err).Warning("Could not unmarshal HCS result") return nil } return result.ErrorEvents @@ -141,6 +135,8 @@ type HcsError struct { Events []ErrorEvent } +var _ net.Error = &HcsError{} + func (e *HcsError) Error() string { s := e.Op + ": " + e.Err.Error() for _, ev := range e.Events { @@ -149,6 +145,16 @@ func (e *HcsError) Error() string { return s } +func (e *HcsError) Temporary() bool { + err, ok := e.Err.(net.Error) + return ok && err.Temporary() +} + +func (e *HcsError) Timeout() bool { + err, ok := e.Err.(net.Error) + return ok && err.Timeout() +} + // ProcessError is an error encountered in HCS during an operation on a Process object type ProcessError struct { SystemID string @@ -158,27 +164,37 @@ type ProcessError struct { Events []ErrorEvent } +var _ net.Error = &ProcessError{} + // SystemError is an error encountered in HCS during an operation on a Container object type SystemError struct { ID string Op string Err error - Extra string Events []ErrorEvent } +var _ net.Error = &SystemError{} + func (e *SystemError) Error() string { s := e.Op + " " + e.ID + ": " + e.Err.Error() for _, ev := range e.Events { s += "\n" + ev.String() } - if e.Extra != "" { - s += "\n(extra info: " + e.Extra + ")" - } return s } -func makeSystemError(system *System, op string, extra string, err error, events []ErrorEvent) error { +func (e *SystemError) Temporary() bool { + err, ok := e.Err.(net.Error) + return ok && err.Temporary() +} + +func (e *SystemError) Timeout() bool { + err, ok := e.Err.(net.Error) + return ok && err.Timeout() +} + +func makeSystemError(system *System, op string, err error, events []ErrorEvent) error { // Don't double wrap errors if _, ok := err.(*SystemError); ok { return err @@ -186,7 +202,6 @@ func makeSystemError(system *System, op string, extra string, err error, events return &SystemError{ ID: system.ID(), Op: op, - Extra: extra, Err: err, Events: events, } @@ -200,6 +215,16 @@ func (e *ProcessError) Error() string { return s } +func (e *ProcessError) Temporary() bool { + err, ok := e.Err.(net.Error) + return ok && err.Temporary() +} + +func (e *ProcessError) Timeout() bool { + err, ok := e.Err.(net.Error) + return ok && err.Timeout() +} + func makeProcessError(process *Process, op string, err error, events []ErrorEvent) error { // Don't double wrap errors if _, ok := err.(*ProcessError); ok { @@ -242,6 +267,9 @@ func IsPending(err error) bool { // IsTimeout returns a boolean indicating whether the error is caused by // a timeout waiting for the operation to complete. func IsTimeout(err error) bool { + if err, ok := err.(net.Error); ok && err.Timeout() { + return true + } err = getInnerError(err) return err == ErrTimeout } @@ -272,6 +300,20 @@ func IsNotSupported(err error) bool { err == ErrVmcomputeUnknownMessage } +// IsOperationInvalidState returns true when err is caused by +// `ErrVmcomputeOperationInvalidState`. +func IsOperationInvalidState(err error) bool { + err = getInnerError(err) + return err == ErrVmcomputeOperationInvalidState +} + +// IsAccessIsDenied returns true when err is caused by +// `ErrVmcomputeOperationAccessIsDenied`. +func IsAccessIsDenied(err error) bool { + err = getInnerError(err) + return err == ErrVmcomputeOperationAccessIsDenied +} + func getInnerError(err error) error { switch pe := err.(type) { case nil: diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go deleted file mode 100644 index b0d49cbc..00000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go +++ /dev/null @@ -1,48 +0,0 @@ -// Shim for the Host Compute Service (HCS) to manage Windows Server -// containers and Hyper-V containers. - -package hcs - -import ( - "syscall" -) - -//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hcs.go - -//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems? -//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem? -//sys hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem? -//sys hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem? -//sys hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem? -//sys hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem? -//sys hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem? -//sys hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem? -//sys hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem? -//sys hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties? -//sys hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem? -//sys hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback? -//sys hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback? - -//sys hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess? -//sys hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess? -//sys hcsCloseProcess(process hcsProcess) (hr error) = vmcompute.HcsCloseProcess? -//sys hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess? -//sys hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) = vmcompute.HcsTerminateProcess? -//sys hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo? -//sys hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties? -//sys hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess? -//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties? -//sys hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback? -//sys hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback? - -type hcsSystem syscall.Handle -type hcsProcess syscall.Handle -type hcsCallback syscall.Handle - -type hcsProcessInformation struct { - ProcessId uint32 - Reserved uint32 - StdInput syscall.Handle - StdOutput syscall.Handle - StdError syscall.Handle -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go deleted file mode 100644 index 6d03b17a..00000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go +++ /dev/null @@ -1,20 +0,0 @@ -package hcs - -import "github.com/sirupsen/logrus" - -func logOperationBegin(ctx logrus.Fields, msg string) { - logrus.WithFields(ctx).Debug(msg) -} - -func logOperationEnd(ctx logrus.Fields, msg string, err error) { - // Copy the log and fields first. - log := logrus.WithFields(ctx) - if err == nil { - log.Debug(msg) - } else { - // Edit only the copied field data to avoid race conditions on the - // write. - log.Data[logrus.ErrorKey] = err - log.Error(msg) - } -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go index 41e20bbf..b74389ec 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go @@ -1,48 +1,47 @@ package hcs import ( + "context" "encoding/json" "io" "sync" "syscall" "time" - "github.com/Microsoft/hcsshim/internal/guestrequest" - "github.com/Microsoft/hcsshim/internal/interop" - "github.com/Microsoft/hcsshim/internal/logfields" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/log" + "github.com/Microsoft/hcsshim/internal/oc" + "github.com/Microsoft/hcsshim/internal/vmcompute" + "go.opencensus.io/trace" ) // ContainerError is an error encountered in HCS type Process struct { handleLock sync.RWMutex - handle hcsProcess + handle vmcompute.HcsProcess processID int system *System - cachedPipes *cachedPipes + hasCachedStdio bool + stdioLock sync.Mutex + stdin io.WriteCloser + stdout io.ReadCloser + stderr io.ReadCloser callbackNumber uintptr - logctx logrus.Fields + closedWaitOnce sync.Once + waitBlock chan struct{} + exitCode int + waitError error } -func newProcess(process hcsProcess, processID int, computeSystem *System) *Process { +func newProcess(process vmcompute.HcsProcess, processID int, computeSystem *System) *Process { return &Process{ handle: process, processID: processID, system: computeSystem, - logctx: logrus.Fields{ - logfields.ContainerID: computeSystem.ID(), - logfields.ProcessID: processID, - }, + waitBlock: make(chan struct{}), } } -type cachedPipes struct { - stdIn syscall.Handle - stdOut syscall.Handle - stdErr syscall.Handle -} - type processModifyRequest struct { Operation string ConsoleSize *consoleSize `json:",omitempty"` @@ -58,18 +57,14 @@ type closeHandle struct { Handle string } -type ProcessStatus struct { +type processStatus struct { ProcessID uint32 Exited bool ExitCode uint32 LastWaitResult int32 } -const ( - stdIn string = "StdIn" - stdOut string = "StdOut" - stdErr string = "StdErr" -) +const stdIn string = "StdIn" const ( modifyConsoleSize string = "ConsoleSize" @@ -86,120 +81,155 @@ func (process *Process) SystemID() string { return process.system.ID() } -func (process *Process) logOperationBegin(operation string) { - logOperationBegin( - process.logctx, - operation+" - Begin Operation") -} - -func (process *Process) logOperationEnd(operation string, err error) { - var result string - if err == nil { - result = "Success" - } else { - result = "Error" +func (process *Process) processSignalResult(ctx context.Context, err error) (bool, error) { + switch err { + case nil: + return true, nil + case ErrVmcomputeOperationInvalidState, ErrComputeSystemDoesNotExist, ErrElementNotFound: + select { + case <-process.waitBlock: + // The process exit notification has already arrived. + default: + // The process should be gone, but we have not received the notification. + // After a second, force unblock the process wait to work around a possible + // deadlock in the HCS. + go func() { + time.Sleep(time.Second) + process.closedWaitOnce.Do(func() { + log.G(ctx).WithError(err).Warn("force unblocking process waits") + process.exitCode = -1 + process.waitError = err + close(process.waitBlock) + }) + }() + } + return false, nil + default: + return false, err } - - logOperationEnd( - process.logctx, - operation+" - End Operation - "+result, - err) } // Signal signals the process with `options`. -func (process *Process) Signal(options guestrequest.SignalProcessOptions) (err error) { +// +// For LCOW `guestrequest.SignalProcessOptionsLCOW`. +// +// For WCOW `guestrequest.SignalProcessOptionsWCOW`. +func (process *Process) Signal(ctx context.Context, options interface{}) (bool, error) { process.handleLock.RLock() defer process.handleLock.RUnlock() operation := "hcsshim::Process::Signal" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() if process.handle == 0 { - return makeProcessError(process, operation, ErrAlreadyClosed, nil) + return false, makeProcessError(process, operation, ErrAlreadyClosed, nil) } optionsb, err := json.Marshal(options) if err != nil { - return err + return false, err } - optionsStr := string(optionsb) - - var resultp *uint16 - syscallWatcher(process.logctx, func() { - err = hcsSignalProcess(process.handle, optionsStr, &resultp) - }) - events := processHcsResult(resultp) + resultJSON, err := vmcompute.HcsSignalProcess(ctx, process.handle, string(optionsb)) + events := processHcsResult(ctx, resultJSON) + delivered, err := process.processSignalResult(ctx, err) if err != nil { - return makeProcessError(process, operation, err, events) + err = makeProcessError(process, operation, err, events) } - - return nil + return delivered, err } // Kill signals the process to terminate but does not wait for it to finish terminating. -func (process *Process) Kill() (err error) { +func (process *Process) Kill(ctx context.Context) (bool, error) { process.handleLock.RLock() defer process.handleLock.RUnlock() operation := "hcsshim::Process::Kill" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() if process.handle == 0 { - return makeProcessError(process, operation, ErrAlreadyClosed, nil) + return false, makeProcessError(process, operation, ErrAlreadyClosed, nil) } - var resultp *uint16 - syscallWatcher(process.logctx, func() { - err = hcsTerminateProcess(process.handle, &resultp) + resultJSON, err := vmcompute.HcsTerminateProcess(ctx, process.handle) + events := processHcsResult(ctx, resultJSON) + delivered, err := process.processSignalResult(ctx, err) + if err != nil { + err = makeProcessError(process, operation, err, events) + } + return delivered, err +} + +// waitBackground waits for the process exit notification. Once received sets +// `process.waitError` (if any) and unblocks all `Wait` calls. +// +// This MUST be called exactly once per `process.handle` but `Wait` is safe to +// call multiple times. +func (process *Process) waitBackground() { + operation := "hcsshim::Process::waitBackground" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + span.AddAttributes( + trace.StringAttribute("cid", process.SystemID()), + trace.Int64Attribute("pid", int64(process.processID))) + + var ( + err error + exitCode = -1 + propertiesJSON string + resultJSON string + ) + + err = waitForNotification(ctx, process.callbackNumber, hcsNotificationProcessExited, nil) + if err != nil { + err = makeProcessError(process, operation, err, nil) + log.G(ctx).WithError(err).Error("failed wait") + } else { + process.handleLock.RLock() + defer process.handleLock.RUnlock() + + // Make sure we didnt race with Close() here + if process.handle != 0 { + propertiesJSON, resultJSON, err = vmcompute.HcsGetProcessProperties(ctx, process.handle) + events := processHcsResult(ctx, resultJSON) + if err != nil { + err = makeProcessError(process, operation, err, events) //nolint:ineffassign + } else { + properties := &processStatus{} + err = json.Unmarshal([]byte(propertiesJSON), properties) + if err != nil { + err = makeProcessError(process, operation, err, nil) //nolint:ineffassign + } else { + if properties.LastWaitResult != 0 { + log.G(ctx).WithField("wait-result", properties.LastWaitResult).Warning("non-zero last wait result") + } else { + exitCode = int(properties.ExitCode) + } + } + } + } + } + log.G(ctx).WithField("exitCode", exitCode).Debug("process exited") + + process.closedWaitOnce.Do(func() { + process.exitCode = exitCode + process.waitError = err + close(process.waitBlock) }) - events := processHcsResult(resultp) - if err != nil { - return makeProcessError(process, operation, err, events) - } - - return nil + oc.SetSpanStatus(span, err) } -// Wait waits for the process to exit. -func (process *Process) Wait() (err error) { - operation := "hcsshim::Process::Wait" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - - err = waitForNotification(process.callbackNumber, hcsNotificationProcessExited, nil) - if err != nil { - return makeProcessError(process, operation, err, nil) - } - - return nil -} - -// WaitTimeout waits for the process to exit or the duration to elapse. It returns -// false if timeout occurs. -func (process *Process) WaitTimeout(timeout time.Duration) (err error) { - operation := "hcssshim::Process::WaitTimeout" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - - err = waitForNotification(process.callbackNumber, hcsNotificationProcessExited, &timeout) - if err != nil { - return makeProcessError(process, operation, err, nil) - } - - return nil +// Wait waits for the process to exit. If the process has already exited returns +// the pervious error (if any). +func (process *Process) Wait() error { + <-process.waitBlock + return process.waitError } // ResizeConsole resizes the console of the process. -func (process *Process) ResizeConsole(width, height uint16) (err error) { +func (process *Process) ResizeConsole(ctx context.Context, width, height uint16) error { process.handleLock.RLock() defer process.handleLock.RUnlock() operation := "hcsshim::Process::ResizeConsole" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() if process.handle == 0 { return makeProcessError(process, operation, ErrAlreadyClosed, nil) @@ -218,11 +248,8 @@ func (process *Process) ResizeConsole(width, height uint16) (err error) { return err } - modifyRequestStr := string(modifyRequestb) - - var resultp *uint16 - err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp) - events := processHcsResult(resultp) + resultJSON, err := vmcompute.HcsModifyProcess(ctx, process.handle, string(modifyRequestb)) + events := processHcsResult(ctx, resultJSON) if err != nil { return makeProcessError(process, operation, err, events) } @@ -230,104 +257,55 @@ func (process *Process) ResizeConsole(width, height uint16) (err error) { return nil } -func (process *Process) Properties() (_ *ProcessStatus, err error) { - process.handleLock.RLock() - defer process.handleLock.RUnlock() - - operation := "hcsshim::Process::Properties" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - - if process.handle == 0 { - return nil, makeProcessError(process, operation, ErrAlreadyClosed, nil) - } - - var ( - resultp *uint16 - propertiesp *uint16 - ) - syscallWatcher(process.logctx, func() { - err = hcsGetProcessProperties(process.handle, &propertiesp, &resultp) - }) - events := processHcsResult(resultp) - if err != nil { - return nil, makeProcessError(process, operation, err, events) - } - - if propertiesp == nil { - return nil, ErrUnexpectedValue - } - propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp) - - properties := &ProcessStatus{} - if err := json.Unmarshal(propertiesRaw, properties); err != nil { - return nil, makeProcessError(process, operation, err, nil) - } - - return properties, nil -} - // ExitCode returns the exit code of the process. The process must have // already terminated. -func (process *Process) ExitCode() (_ int, err error) { - operation := "hcsshim::Process::ExitCode" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - - properties, err := process.Properties() - if err != nil { - return 0, makeProcessError(process, operation, err, nil) +func (process *Process) ExitCode() (int, error) { + select { + case <-process.waitBlock: + if process.waitError != nil { + return -1, process.waitError + } + return process.exitCode, nil + default: + return -1, makeProcessError(process, "hcsshim::Process::ExitCode", ErrInvalidProcessState, nil) } - - if properties.Exited == false { - return 0, makeProcessError(process, operation, ErrInvalidProcessState, nil) - } - - if properties.LastWaitResult != 0 { - return 0, makeProcessError(process, operation, syscall.Errno(properties.LastWaitResult), nil) - } - - return int(properties.ExitCode), nil } -// Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing -// these pipes does not close the underlying pipes; it should be possible to -// call this multiple times to get multiple interfaces. -func (process *Process) Stdio() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadCloser, err error) { +// StdioLegacy returns the stdin, stdout, and stderr pipes, respectively. Closing +// these pipes does not close the underlying pipes. Once returned, these pipes +// are the responsibility of the caller to close. +func (process *Process) StdioLegacy() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadCloser, err error) { + operation := "hcsshim::Process::StdioLegacy" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("cid", process.SystemID()), + trace.Int64Attribute("pid", int64(process.processID))) + process.handleLock.RLock() defer process.handleLock.RUnlock() - operation := "hcsshim::Process::Stdio" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - if process.handle == 0 { return nil, nil, nil, makeProcessError(process, operation, ErrAlreadyClosed, nil) } - var stdIn, stdOut, stdErr syscall.Handle - - if process.cachedPipes == nil { - var ( - processInfo hcsProcessInformation - resultp *uint16 - ) - err = hcsGetProcessInfo(process.handle, &processInfo, &resultp) - events := processHcsResult(resultp) - if err != nil { - return nil, nil, nil, makeProcessError(process, operation, err, events) - } - - stdIn, stdOut, stdErr = processInfo.StdInput, processInfo.StdOutput, processInfo.StdError - } else { - // Use cached pipes - stdIn, stdOut, stdErr = process.cachedPipes.stdIn, process.cachedPipes.stdOut, process.cachedPipes.stdErr - - // Invalidate the cache - process.cachedPipes = nil + process.stdioLock.Lock() + defer process.stdioLock.Unlock() + if process.hasCachedStdio { + stdin, stdout, stderr := process.stdin, process.stdout, process.stderr + process.stdin, process.stdout, process.stderr = nil, nil, nil + process.hasCachedStdio = false + return stdin, stdout, stderr, nil } - pipes, err := makeOpenFiles([]syscall.Handle{stdIn, stdOut, stdErr}) + processInfo, resultJSON, err := vmcompute.HcsGetProcessInfo(ctx, process.handle) + events := processHcsResult(ctx, resultJSON) + if err != nil { + return nil, nil, nil, makeProcessError(process, operation, err, events) + } + + pipes, err := makeOpenFiles([]syscall.Handle{processInfo.StdInput, processInfo.StdOutput, processInfo.StdError}) if err != nil { return nil, nil, nil, makeProcessError(process, operation, err, nil) } @@ -335,15 +313,21 @@ func (process *Process) Stdio() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadClo return pipes[0], pipes[1], pipes[2], nil } +// Stdio returns the stdin, stdout, and stderr pipes, respectively. +// To close them, close the process handle. +func (process *Process) Stdio() (stdin io.Writer, stdout, stderr io.Reader) { + process.stdioLock.Lock() + defer process.stdioLock.Unlock() + return process.stdin, process.stdout, process.stderr +} + // CloseStdin closes the write side of the stdin pipe so that the process is // notified on the read side that there is no more data in stdin. -func (process *Process) CloseStdin() (err error) { +func (process *Process) CloseStdin(ctx context.Context) error { process.handleLock.RLock() defer process.handleLock.RUnlock() operation := "hcsshim::Process::CloseStdin" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() if process.handle == 0 { return makeProcessError(process, operation, ErrAlreadyClosed, nil) @@ -361,99 +345,128 @@ func (process *Process) CloseStdin() (err error) { return err } - modifyRequestStr := string(modifyRequestb) - - var resultp *uint16 - err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp) - events := processHcsResult(resultp) + resultJSON, err := vmcompute.HcsModifyProcess(ctx, process.handle, string(modifyRequestb)) + events := processHcsResult(ctx, resultJSON) if err != nil { return makeProcessError(process, operation, err, events) } + process.stdioLock.Lock() + if process.stdin != nil { + process.stdin.Close() + process.stdin = nil + } + process.stdioLock.Unlock() + return nil } // Close cleans up any state associated with the process but does not kill // or wait on it. func (process *Process) Close() (err error) { + operation := "hcsshim::Process::Close" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("cid", process.SystemID()), + trace.Int64Attribute("pid", int64(process.processID))) + process.handleLock.Lock() defer process.handleLock.Unlock() - operation := "hcsshim::Process::Close" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - // Don't double free this if process.handle == 0 { return nil } - if err = process.unregisterCallback(); err != nil { + process.stdioLock.Lock() + if process.stdin != nil { + process.stdin.Close() + process.stdin = nil + } + if process.stdout != nil { + process.stdout.Close() + process.stdout = nil + } + if process.stderr != nil { + process.stderr.Close() + process.stderr = nil + } + process.stdioLock.Unlock() + + if err = process.unregisterCallback(ctx); err != nil { return makeProcessError(process, operation, err, nil) } - if err = hcsCloseProcess(process.handle); err != nil { + if err = vmcompute.HcsCloseProcess(ctx, process.handle); err != nil { return makeProcessError(process, operation, err, nil) } process.handle = 0 + process.closedWaitOnce.Do(func() { + process.exitCode = -1 + process.waitError = ErrAlreadyClosed + close(process.waitBlock) + }) return nil } -func (process *Process) registerCallback() error { - context := ¬ifcationWatcherContext{ - channels: newChannels(), +func (process *Process) registerCallback(ctx context.Context) error { + callbackContext := ¬ifcationWatcherContext{ + channels: newProcessChannels(), + systemID: process.SystemID(), + processID: process.processID, } callbackMapLock.Lock() callbackNumber := nextCallback nextCallback++ - callbackMap[callbackNumber] = context + callbackMap[callbackNumber] = callbackContext callbackMapLock.Unlock() - var callbackHandle hcsCallback - err := hcsRegisterProcessCallback(process.handle, notificationWatcherCallback, callbackNumber, &callbackHandle) + callbackHandle, err := vmcompute.HcsRegisterProcessCallback(ctx, process.handle, notificationWatcherCallback, callbackNumber) if err != nil { return err } - context.handle = callbackHandle + callbackContext.handle = callbackHandle process.callbackNumber = callbackNumber return nil } -func (process *Process) unregisterCallback() error { +func (process *Process) unregisterCallback(ctx context.Context) error { callbackNumber := process.callbackNumber callbackMapLock.RLock() - context := callbackMap[callbackNumber] + callbackContext := callbackMap[callbackNumber] callbackMapLock.RUnlock() - if context == nil { + if callbackContext == nil { return nil } - handle := context.handle + handle := callbackContext.handle if handle == 0 { return nil } - // hcsUnregisterProcessCallback has its own syncronization - // to wait for all callbacks to complete. We must NOT hold the callbackMapLock. - err := hcsUnregisterProcessCallback(handle) + // vmcompute.HcsUnregisterProcessCallback has its own synchronization to + // wait for all callbacks to complete. We must NOT hold the callbackMapLock. + err := vmcompute.HcsUnregisterProcessCallback(ctx, handle) if err != nil { return err } - closeChannels(context.channels) + closeChannels(callbackContext.channels) callbackMapLock.Lock() - callbackMap[callbackNumber] = nil + delete(callbackMap, callbackNumber) callbackMapLock.Unlock() - handle = 0 + handle = 0 //nolint:ineffassign return nil } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/service.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/service.go new file mode 100644 index 00000000..3a5f0125 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/service.go @@ -0,0 +1,49 @@ +package hcs + +import ( + "context" + "encoding/json" + + hcsschema "github.com/Microsoft/hcsshim/internal/schema2" + "github.com/Microsoft/hcsshim/internal/vmcompute" +) + +// GetServiceProperties returns properties of the host compute service. +func GetServiceProperties(ctx context.Context, q hcsschema.PropertyQuery) (*hcsschema.ServiceProperties, error) { + operation := "hcsshim::GetServiceProperties" + + queryb, err := json.Marshal(q) + if err != nil { + return nil, err + } + propertiesJSON, resultJSON, err := vmcompute.HcsGetServiceProperties(ctx, string(queryb)) + events := processHcsResult(ctx, resultJSON) + if err != nil { + return nil, &HcsError{Op: operation, Err: err, Events: events} + } + + if propertiesJSON == "" { + return nil, ErrUnexpectedValue + } + properties := &hcsschema.ServiceProperties{} + if err := json.Unmarshal([]byte(propertiesJSON), properties); err != nil { + return nil, err + } + return properties, nil +} + +// ModifyServiceSettings modifies settings of the host compute service. +func ModifyServiceSettings(ctx context.Context, settings hcsschema.ModificationRequest) error { + operation := "hcsshim::ModifyServiceSettings" + + settingsJSON, err := json.Marshal(settings) + if err != nil { + return err + } + resultJSON, err := vmcompute.HcsModifyServiceSettings(ctx, string(settingsJSON)) + events := processHcsResult(ctx, resultJSON) + if err != nil { + return &HcsError{Op: operation, Err: err, Events: events} + } + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go index 20b24252..cea11dee 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go @@ -1,86 +1,55 @@ package hcs import ( + "context" "encoding/json" - "os" - "strconv" + "errors" + "strings" "sync" "syscall" - "time" - "github.com/Microsoft/hcsshim/internal/interop" - "github.com/Microsoft/hcsshim/internal/logfields" + "github.com/Microsoft/hcsshim/internal/cow" + "github.com/Microsoft/hcsshim/internal/log" + "github.com/Microsoft/hcsshim/internal/oc" "github.com/Microsoft/hcsshim/internal/schema1" + hcsschema "github.com/Microsoft/hcsshim/internal/schema2" "github.com/Microsoft/hcsshim/internal/timeout" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/vmcompute" + "go.opencensus.io/trace" ) -// currentContainerStarts is used to limit the number of concurrent container -// starts. -var currentContainerStarts containerStarts - -type containerStarts struct { - maxParallel int - inProgress int - sync.Mutex -} - -func init() { - mpsS := os.Getenv("HCSSHIM_MAX_PARALLEL_START") - if len(mpsS) > 0 { - mpsI, err := strconv.Atoi(mpsS) - if err != nil || mpsI < 0 { - return - } - currentContainerStarts.maxParallel = mpsI - } -} - type System struct { handleLock sync.RWMutex - handle hcsSystem + handle vmcompute.HcsSystem id string callbackNumber uintptr - logctx logrus.Fields + closedWaitOnce sync.Once + waitBlock chan struct{} + waitError error + exitError error + os, typ string } func newSystem(id string) *System { return &System{ - id: id, - logctx: logrus.Fields{ - logfields.ContainerID: id, - }, + id: id, + waitBlock: make(chan struct{}), } } -func (computeSystem *System) logOperationBegin(operation string) { - logOperationBegin( - computeSystem.logctx, - operation+" - Begin Operation") -} - -func (computeSystem *System) logOperationEnd(operation string, err error) { - var result string - if err == nil { - result = "Success" - } else { - result = "Error" - } - - logOperationEnd( - computeSystem.logctx, - operation+" - End Operation - "+result, - err) -} - // CreateComputeSystem creates a new compute system with the given configuration but does not start it. -func CreateComputeSystem(id string, hcsDocumentInterface interface{}) (_ *System, err error) { +func CreateComputeSystem(ctx context.Context, id string, hcsDocumentInterface interface{}) (_ *System, err error) { operation := "hcsshim::CreateComputeSystem" + // hcsCreateComputeSystemContext is an async operation. Start the outer span + // here to measure the full create time. + ctx, span := trace.StartSpan(ctx, operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", id)) + computeSystem := newSystem(id) - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() hcsDocumentB, err := json.Marshal(hcsDocumentInterface) if err != nil { @@ -89,126 +58,114 @@ func CreateComputeSystem(id string, hcsDocumentInterface interface{}) (_ *System hcsDocument := string(hcsDocumentB) - logrus.WithFields(computeSystem.logctx). - WithField(logfields.JSON, hcsDocument). - Debug("HCS ComputeSystem Document") - var ( - resultp *uint16 identity syscall.Handle + resultJSON string createError error ) - syscallWatcher(computeSystem.logctx, func() { - createError = hcsCreateComputeSystem(id, hcsDocument, identity, &computeSystem.handle, &resultp) - }) - + computeSystem.handle, resultJSON, createError = vmcompute.HcsCreateComputeSystem(ctx, id, hcsDocument, identity) if createError == nil || IsPending(createError) { - if err = computeSystem.registerCallback(); err != nil { + defer func() { + if err != nil { + computeSystem.Close() + } + }() + if err = computeSystem.registerCallback(ctx); err != nil { // Terminate the compute system if it still exists. We're okay to // ignore a failure here. - computeSystem.Terminate() - return nil, makeSystemError(computeSystem, operation, "", err, nil) + _ = computeSystem.Terminate(ctx) + return nil, makeSystemError(computeSystem, operation, err, nil) } } - events, err := processAsyncHcsResult(createError, resultp, computeSystem.callbackNumber, hcsNotificationSystemCreateCompleted, &timeout.SystemCreate) + events, err := processAsyncHcsResult(ctx, createError, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemCreateCompleted, &timeout.SystemCreate) if err != nil { if err == ErrTimeout { // Terminate the compute system if it still exists. We're okay to // ignore a failure here. - computeSystem.Terminate() + _ = computeSystem.Terminate(ctx) } - return nil, makeSystemError(computeSystem, operation, hcsDocument, err, events) + return nil, makeSystemError(computeSystem, operation, err, events) + } + go computeSystem.waitBackground() + if err = computeSystem.getCachedProperties(ctx); err != nil { + return nil, err } - return computeSystem, nil } // OpenComputeSystem opens an existing compute system by ID. -func OpenComputeSystem(id string) (_ *System, err error) { +func OpenComputeSystem(ctx context.Context, id string) (*System, error) { operation := "hcsshim::OpenComputeSystem" computeSystem := newSystem(id) - computeSystem.logOperationBegin(operation) + handle, resultJSON, err := vmcompute.HcsOpenComputeSystem(ctx, id) + events := processHcsResult(ctx, resultJSON) + if err != nil { + return nil, makeSystemError(computeSystem, operation, err, events) + } + computeSystem.handle = handle defer func() { - if IsNotExist(err) { - computeSystem.logOperationEnd(operation, nil) - } else { - computeSystem.logOperationEnd(operation, err) + if err != nil { + computeSystem.Close() } }() - - var ( - handle hcsSystem - resultp *uint16 - ) - err = hcsOpenComputeSystem(id, &handle, &resultp) - events := processHcsResult(resultp) - if err != nil { - return nil, makeSystemError(computeSystem, operation, "", err, events) + if err = computeSystem.registerCallback(ctx); err != nil { + return nil, makeSystemError(computeSystem, operation, err, nil) } - - computeSystem.handle = handle - - if err = computeSystem.registerCallback(); err != nil { - return nil, makeSystemError(computeSystem, operation, "", err, nil) + go computeSystem.waitBackground() + if err = computeSystem.getCachedProperties(ctx); err != nil { + return nil, err } - return computeSystem, nil } +func (computeSystem *System) getCachedProperties(ctx context.Context) error { + props, err := computeSystem.Properties(ctx) + if err != nil { + return err + } + computeSystem.typ = strings.ToLower(props.SystemType) + computeSystem.os = strings.ToLower(props.RuntimeOSType) + if computeSystem.os == "" && computeSystem.typ == "container" { + // Pre-RS5 HCS did not return the OS, but it only supported containers + // that ran Windows. + computeSystem.os = "windows" + } + return nil +} + +// OS returns the operating system of the compute system, "linux" or "windows". +func (computeSystem *System) OS() string { + return computeSystem.os +} + +// IsOCI returns whether processes in the compute system should be created via +// OCI. +func (computeSystem *System) IsOCI() bool { + return computeSystem.os == "linux" && computeSystem.typ == "container" +} + // GetComputeSystems gets a list of the compute systems on the system that match the query -func GetComputeSystems(q schema1.ComputeSystemQuery) (_ []schema1.ContainerProperties, err error) { +func GetComputeSystems(ctx context.Context, q schema1.ComputeSystemQuery) ([]schema1.ContainerProperties, error) { operation := "hcsshim::GetComputeSystems" - fields := logrus.Fields{} - logOperationBegin( - fields, - operation+" - Begin Operation") - - defer func() { - var result string - if err == nil { - result = "Success" - } else { - result = "Error" - } - - logOperationEnd( - fields, - operation+" - End Operation - "+result, - err) - }() queryb, err := json.Marshal(q) if err != nil { return nil, err } - query := string(queryb) - - logrus.WithFields(fields). - WithField(logfields.JSON, query). - Debug("HCS ComputeSystem Query") - - var ( - resultp *uint16 - computeSystemsp *uint16 - ) - - syscallWatcher(fields, func() { - err = hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp) - }) - events := processHcsResult(resultp) + computeSystemsJSON, resultJSON, err := vmcompute.HcsEnumerateComputeSystems(ctx, string(queryb)) + events := processHcsResult(ctx, resultJSON) if err != nil { return nil, &HcsError{Op: operation, Err: err, Events: events} } - if computeSystemsp == nil { + if computeSystemsJSON == "" { return nil, ErrUnexpectedValue } - computeSystemsRaw := interop.ConvertAndFreeCoTaskMemBytes(computeSystemsp) computeSystems := []schema1.ContainerProperties{} - if err = json.Unmarshal(computeSystemsRaw, &computeSystems); err != nil { + if err = json.Unmarshal([]byte(computeSystemsJSON), &computeSystems); err != nil { return nil, err } @@ -216,51 +173,27 @@ func GetComputeSystems(q schema1.ComputeSystemQuery) (_ []schema1.ContainerPrope } // Start synchronously starts the computeSystem. -func (computeSystem *System) Start() (err error) { +func (computeSystem *System) Start(ctx context.Context) (err error) { + operation := "hcsshim::System::Start" + + // hcsStartComputeSystemContext is an async operation. Start the outer span + // here to measure the full start time. + ctx, span := trace.StartSpan(ctx, operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Start" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Start", "", ErrAlreadyClosed, nil) + return makeSystemError(computeSystem, operation, ErrAlreadyClosed, nil) } - // This is a very simple backoff-retry loop to limit the number - // of parallel container starts if environment variable - // HCSSHIM_MAX_PARALLEL_START is set to a positive integer. - // It should generally only be used as a workaround to various - // platform issues that exist between RS1 and RS4 as of Aug 2018 - if currentContainerStarts.maxParallel > 0 { - for { - currentContainerStarts.Lock() - if currentContainerStarts.inProgress < currentContainerStarts.maxParallel { - currentContainerStarts.inProgress++ - currentContainerStarts.Unlock() - break - } - if currentContainerStarts.inProgress == currentContainerStarts.maxParallel { - currentContainerStarts.Unlock() - time.Sleep(100 * time.Millisecond) - } - } - // Make sure we decrement the count when we are done. - defer func() { - currentContainerStarts.Lock() - currentContainerStarts.inProgress-- - currentContainerStarts.Unlock() - }() - } - - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsStartComputeSystem(computeSystem.handle, "", &resultp) - }) - events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemStartCompleted, &timeout.SystemStart) + resultJSON, err := vmcompute.HcsStartComputeSystem(ctx, computeSystem.handle, "") + events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemStartCompleted, &timeout.SystemStart) if err != nil { - return makeSystemError(computeSystem, "Start", "", err, events) + return makeSystemError(computeSystem, operation, err, events) } return nil @@ -271,360 +204,389 @@ func (computeSystem *System) ID() string { return computeSystem.id } -// Shutdown requests a compute system shutdown, if IsPending() on the error returned is true, -// it may not actually be shut down until Wait() succeeds. -func (computeSystem *System) Shutdown() (err error) { +// Shutdown requests a compute system shutdown. +func (computeSystem *System) Shutdown(ctx context.Context) error { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Shutdown" - computeSystem.logOperationBegin(operation) - defer func() { - if IsAlreadyStopped(err) { - computeSystem.logOperationEnd(operation, nil) - } else { - computeSystem.logOperationEnd(operation, err) - } - }() + operation := "hcsshim::System::Shutdown" if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Shutdown", "", ErrAlreadyClosed, nil) + return nil } - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsShutdownComputeSystem(computeSystem.handle, "", &resultp) - }) - events := processHcsResult(resultp) - if err != nil { - return makeSystemError(computeSystem, "Shutdown", "", err, events) + resultJSON, err := vmcompute.HcsShutdownComputeSystem(ctx, computeSystem.handle, "") + events := processHcsResult(ctx, resultJSON) + switch err { + case nil, ErrVmcomputeAlreadyStopped, ErrComputeSystemDoesNotExist, ErrVmcomputeOperationPending: + default: + return makeSystemError(computeSystem, operation, err, events) } - return nil } -// Terminate requests a compute system terminate, if IsPending() on the error returned is true, -// it may not actually be shut down until Wait() succeeds. -func (computeSystem *System) Terminate() (err error) { +// Terminate requests a compute system terminate. +func (computeSystem *System) Terminate(ctx context.Context) error { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Terminate" - computeSystem.logOperationBegin(operation) - defer func() { - if IsPending(err) { - computeSystem.logOperationEnd(operation, nil) - } else { - computeSystem.logOperationEnd(operation, err) - } - }() + operation := "hcsshim::System::Terminate" if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Terminate", "", ErrAlreadyClosed, nil) + return nil } - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsTerminateComputeSystem(computeSystem.handle, "", &resultp) + resultJSON, err := vmcompute.HcsTerminateComputeSystem(ctx, computeSystem.handle, "") + events := processHcsResult(ctx, resultJSON) + switch err { + case nil, ErrVmcomputeAlreadyStopped, ErrComputeSystemDoesNotExist, ErrVmcomputeOperationPending: + default: + return makeSystemError(computeSystem, operation, err, events) + } + return nil +} + +// waitBackground waits for the compute system exit notification. Once received +// sets `computeSystem.waitError` (if any) and unblocks all `Wait` calls. +// +// This MUST be called exactly once per `computeSystem.handle` but `Wait` is +// safe to call multiple times. +func (computeSystem *System) waitBackground() { + operation := "hcsshim::System::waitBackground" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + + err := waitForNotification(ctx, computeSystem.callbackNumber, hcsNotificationSystemExited, nil) + switch err { + case nil: + log.G(ctx).Debug("system exited") + case ErrVmcomputeUnexpectedExit: + log.G(ctx).Debug("unexpected system exit") + computeSystem.exitError = makeSystemError(computeSystem, operation, err, nil) + err = nil + default: + err = makeSystemError(computeSystem, operation, err, nil) + } + computeSystem.closedWaitOnce.Do(func() { + computeSystem.waitError = err + close(computeSystem.waitBlock) }) - events := processHcsResult(resultp) - if err != nil && err != ErrVmcomputeAlreadyStopped { - return makeSystemError(computeSystem, "Terminate", "", err, events) - } - - return nil + oc.SetSpanStatus(span, err) } -// Wait synchronously waits for the compute system to shutdown or terminate. -func (computeSystem *System) Wait() (err error) { - operation := "hcsshim::ComputeSystem::Wait" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - - err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, nil) - if err != nil { - return makeSystemError(computeSystem, "Wait", "", err, nil) - } - - return nil +// Wait synchronously waits for the compute system to shutdown or terminate. If +// the compute system has already exited returns the previous error (if any). +func (computeSystem *System) Wait() error { + <-computeSystem.waitBlock + return computeSystem.waitError } -// WaitExpectedError synchronously waits for the compute system to shutdown or -// terminate, and ignores the passed error if it occurs. -func (computeSystem *System) WaitExpectedError(expected error) (err error) { - operation := "hcsshim::ComputeSystem::WaitExpectedError" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - - err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, nil) - if err != nil && getInnerError(err) != expected { - return makeSystemError(computeSystem, "WaitExpectedError", "", err, nil) +// ExitError returns an error describing the reason the compute system terminated. +func (computeSystem *System) ExitError() error { + select { + case <-computeSystem.waitBlock: + if computeSystem.waitError != nil { + return computeSystem.waitError + } + return computeSystem.exitError + default: + return errors.New("container not exited") } - - return nil } -// WaitTimeout synchronously waits for the compute system to terminate or the duration to elapse. -// If the timeout expires, IsTimeout(err) == true -func (computeSystem *System) WaitTimeout(timeout time.Duration) (err error) { - operation := "hcsshim::ComputeSystem::WaitTimeout" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - - err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, &timeout) - if err != nil { - return makeSystemError(computeSystem, "WaitTimeout", "", err, nil) - } - - return nil -} - -func (computeSystem *System) Properties(types ...schema1.PropertyType) (_ *schema1.ContainerProperties, err error) { +// Properties returns the requested container properties targeting a V1 schema container. +func (computeSystem *System) Properties(ctx context.Context, types ...schema1.PropertyType) (*schema1.ContainerProperties, error) { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Properties" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() + operation := "hcsshim::System::Properties" - queryj, err := json.Marshal(schema1.PropertyQuery{types}) + queryBytes, err := json.Marshal(schema1.PropertyQuery{PropertyTypes: types}) if err != nil { - return nil, makeSystemError(computeSystem, "Properties", "", err, nil) + return nil, makeSystemError(computeSystem, operation, err, nil) } - logrus.WithFields(computeSystem.logctx). - WithField(logfields.JSON, queryj). - Debug("HCS ComputeSystem Properties Query") - - var resultp, propertiesp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsGetComputeSystemProperties(computeSystem.handle, string(queryj), &propertiesp, &resultp) - }) - events := processHcsResult(resultp) + propertiesJSON, resultJSON, err := vmcompute.HcsGetComputeSystemProperties(ctx, computeSystem.handle, string(queryBytes)) + events := processHcsResult(ctx, resultJSON) if err != nil { - return nil, makeSystemError(computeSystem, "Properties", "", err, events) + return nil, makeSystemError(computeSystem, operation, err, events) } - if propertiesp == nil { + if propertiesJSON == "" { return nil, ErrUnexpectedValue } - propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp) properties := &schema1.ContainerProperties{} - if err := json.Unmarshal(propertiesRaw, properties); err != nil { - return nil, makeSystemError(computeSystem, "Properties", "", err, nil) + if err := json.Unmarshal([]byte(propertiesJSON), properties); err != nil { + return nil, makeSystemError(computeSystem, operation, err, nil) + } + + return properties, nil +} + +// PropertiesV2 returns the requested container properties targeting a V2 schema container. +func (computeSystem *System) PropertiesV2(ctx context.Context, types ...hcsschema.PropertyType) (*hcsschema.Properties, error) { + computeSystem.handleLock.RLock() + defer computeSystem.handleLock.RUnlock() + + operation := "hcsshim::System::PropertiesV2" + + queryBytes, err := json.Marshal(hcsschema.PropertyQuery{PropertyTypes: types}) + if err != nil { + return nil, makeSystemError(computeSystem, operation, err, nil) + } + + propertiesJSON, resultJSON, err := vmcompute.HcsGetComputeSystemProperties(ctx, computeSystem.handle, string(queryBytes)) + events := processHcsResult(ctx, resultJSON) + if err != nil { + return nil, makeSystemError(computeSystem, operation, err, events) + } + + if propertiesJSON == "" { + return nil, ErrUnexpectedValue + } + properties := &hcsschema.Properties{} + if err := json.Unmarshal([]byte(propertiesJSON), properties); err != nil { + return nil, makeSystemError(computeSystem, operation, err, nil) } return properties, nil } // Pause pauses the execution of the computeSystem. This feature is not enabled in TP5. -func (computeSystem *System) Pause() (err error) { +func (computeSystem *System) Pause(ctx context.Context) (err error) { + operation := "hcsshim::System::Pause" + + // hcsPauseComputeSystemContext is an async peration. Start the outer span + // here to measure the full pause time. + ctx, span := trace.StartSpan(ctx, operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Pause" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Pause", "", ErrAlreadyClosed, nil) + return makeSystemError(computeSystem, operation, ErrAlreadyClosed, nil) } - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsPauseComputeSystem(computeSystem.handle, "", &resultp) - }) - events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemPauseCompleted, &timeout.SystemPause) + resultJSON, err := vmcompute.HcsPauseComputeSystem(ctx, computeSystem.handle, "") + events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemPauseCompleted, &timeout.SystemPause) if err != nil { - return makeSystemError(computeSystem, "Pause", "", err, events) + return makeSystemError(computeSystem, operation, err, events) } return nil } // Resume resumes the execution of the computeSystem. This feature is not enabled in TP5. -func (computeSystem *System) Resume() (err error) { +func (computeSystem *System) Resume(ctx context.Context) (err error) { + operation := "hcsshim::System::Resume" + + // hcsResumeComputeSystemContext is an async operation. Start the outer span + // here to measure the full restore time. + ctx, span := trace.StartSpan(ctx, operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Resume" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Resume", "", ErrAlreadyClosed, nil) + return makeSystemError(computeSystem, operation, ErrAlreadyClosed, nil) } - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsResumeComputeSystem(computeSystem.handle, "", &resultp) - }) - events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemResumeCompleted, &timeout.SystemResume) + resultJSON, err := vmcompute.HcsResumeComputeSystem(ctx, computeSystem.handle, "") + events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemResumeCompleted, &timeout.SystemResume) if err != nil { - return makeSystemError(computeSystem, "Resume", "", err, events) + return makeSystemError(computeSystem, operation, err, events) } return nil } -// CreateProcess launches a new process within the computeSystem. -func (computeSystem *System) CreateProcess(c interface{}) (_ *Process, err error) { +// Save the compute system +func (computeSystem *System) Save(ctx context.Context, options interface{}) (err error) { + operation := "hcsshim::System::Save" + + // hcsSaveComputeSystemContext is an async peration. Start the outer span + // here to measure the full save time. + ctx, span := trace.StartSpan(ctx, operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + + saveOptions, err := json.Marshal(options) + if err != nil { + return err + } + computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::CreateProcess" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() + if computeSystem.handle == 0 { + return makeSystemError(computeSystem, operation, ErrAlreadyClosed, nil) + } - var ( - processInfo hcsProcessInformation - processHandle hcsProcess - resultp *uint16 - ) + result, err := vmcompute.HcsSaveComputeSystem(ctx, computeSystem.handle, string(saveOptions)) + events, err := processAsyncHcsResult(ctx, err, result, computeSystem.callbackNumber, hcsNotificationSystemSaveCompleted, &timeout.SystemSave) + if err != nil { + return makeSystemError(computeSystem, operation, err, events) + } + + return nil +} + +func (computeSystem *System) createProcess(ctx context.Context, operation string, c interface{}) (*Process, *vmcompute.HcsProcessInformation, error) { + computeSystem.handleLock.RLock() + defer computeSystem.handleLock.RUnlock() if computeSystem.handle == 0 { - return nil, makeSystemError(computeSystem, "CreateProcess", "", ErrAlreadyClosed, nil) + return nil, nil, makeSystemError(computeSystem, operation, ErrAlreadyClosed, nil) } configurationb, err := json.Marshal(c) if err != nil { - return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil) + return nil, nil, makeSystemError(computeSystem, operation, err, nil) } configuration := string(configurationb) - - logrus.WithFields(computeSystem.logctx). - WithField(logfields.JSON, configuration). - Debug("HCS ComputeSystem Process Document") - - syscallWatcher(computeSystem.logctx, func() { - err = hcsCreateProcess(computeSystem.handle, configuration, &processInfo, &processHandle, &resultp) - }) - events := processHcsResult(resultp) + processInfo, processHandle, resultJSON, err := vmcompute.HcsCreateProcess(ctx, computeSystem.handle, configuration) + events := processHcsResult(ctx, resultJSON) if err != nil { - return nil, makeSystemError(computeSystem, "CreateProcess", configuration, err, events) + return nil, nil, makeSystemError(computeSystem, operation, err, events) } - logrus.WithFields(computeSystem.logctx). - WithField(logfields.ProcessID, processInfo.ProcessId). - Debug("HCS ComputeSystem CreateProcess PID") + log.G(ctx).WithField("pid", processInfo.ProcessId).Debug("created process pid") + return newProcess(processHandle, int(processInfo.ProcessId), computeSystem), &processInfo, nil +} - process := newProcess(processHandle, int(processInfo.ProcessId), computeSystem) - process.cachedPipes = &cachedPipes{ - stdIn: processInfo.StdInput, - stdOut: processInfo.StdOutput, - stdErr: processInfo.StdError, +// CreateProcess launches a new process within the computeSystem. +func (computeSystem *System) CreateProcess(ctx context.Context, c interface{}) (cow.Process, error) { + operation := "hcsshim::System::CreateProcess" + process, processInfo, err := computeSystem.createProcess(ctx, operation, c) + if err != nil { + return nil, err } + defer func() { + if err != nil { + process.Close() + } + }() - if err = process.registerCallback(); err != nil { - return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil) + pipes, err := makeOpenFiles([]syscall.Handle{processInfo.StdInput, processInfo.StdOutput, processInfo.StdError}) + if err != nil { + return nil, makeSystemError(computeSystem, operation, err, nil) } + process.stdin = pipes[0] + process.stdout = pipes[1] + process.stderr = pipes[2] + process.hasCachedStdio = true + + if err = process.registerCallback(ctx); err != nil { + return nil, makeSystemError(computeSystem, operation, err, nil) + } + go process.waitBackground() return process, nil } // OpenProcess gets an interface to an existing process within the computeSystem. -func (computeSystem *System) OpenProcess(pid int) (_ *Process, err error) { +func (computeSystem *System) OpenProcess(ctx context.Context, pid int) (*Process, error) { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - // Add PID for the context of this operation - computeSystem.logctx[logfields.ProcessID] = pid - defer delete(computeSystem.logctx, logfields.ProcessID) - - operation := "hcsshim::ComputeSystem::OpenProcess" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - - var ( - processHandle hcsProcess - resultp *uint16 - ) + operation := "hcsshim::System::OpenProcess" if computeSystem.handle == 0 { - return nil, makeSystemError(computeSystem, "OpenProcess", "", ErrAlreadyClosed, nil) + return nil, makeSystemError(computeSystem, operation, ErrAlreadyClosed, nil) } - syscallWatcher(computeSystem.logctx, func() { - err = hcsOpenProcess(computeSystem.handle, uint32(pid), &processHandle, &resultp) - }) - events := processHcsResult(resultp) + processHandle, resultJSON, err := vmcompute.HcsOpenProcess(ctx, computeSystem.handle, uint32(pid)) + events := processHcsResult(ctx, resultJSON) if err != nil { - return nil, makeSystemError(computeSystem, "OpenProcess", "", err, events) + return nil, makeSystemError(computeSystem, operation, err, events) } process := newProcess(processHandle, pid, computeSystem) - if err = process.registerCallback(); err != nil { - return nil, makeSystemError(computeSystem, "OpenProcess", "", err, nil) + if err = process.registerCallback(ctx); err != nil { + return nil, makeSystemError(computeSystem, operation, err, nil) } + go process.waitBackground() return process, nil } // Close cleans up any state associated with the compute system but does not terminate or wait for it. func (computeSystem *System) Close() (err error) { + operation := "hcsshim::System::Close" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + computeSystem.handleLock.Lock() defer computeSystem.handleLock.Unlock() - operation := "hcsshim::ComputeSystem::Close" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - // Don't double free this if computeSystem.handle == 0 { return nil } - if err = computeSystem.unregisterCallback(); err != nil { - return makeSystemError(computeSystem, "Close", "", err, nil) + if err = computeSystem.unregisterCallback(ctx); err != nil { + return makeSystemError(computeSystem, operation, err, nil) } - syscallWatcher(computeSystem.logctx, func() { - err = hcsCloseComputeSystem(computeSystem.handle) - }) + err = vmcompute.HcsCloseComputeSystem(ctx, computeSystem.handle) if err != nil { - return makeSystemError(computeSystem, "Close", "", err, nil) + return makeSystemError(computeSystem, operation, err, nil) } computeSystem.handle = 0 + computeSystem.closedWaitOnce.Do(func() { + computeSystem.waitError = ErrAlreadyClosed + close(computeSystem.waitBlock) + }) return nil } -func (computeSystem *System) registerCallback() error { - context := ¬ifcationWatcherContext{ - channels: newChannels(), +func (computeSystem *System) registerCallback(ctx context.Context) error { + callbackContext := ¬ifcationWatcherContext{ + channels: newSystemChannels(), + systemID: computeSystem.id, } callbackMapLock.Lock() callbackNumber := nextCallback nextCallback++ - callbackMap[callbackNumber] = context + callbackMap[callbackNumber] = callbackContext callbackMapLock.Unlock() - var callbackHandle hcsCallback - err := hcsRegisterComputeSystemCallback(computeSystem.handle, notificationWatcherCallback, callbackNumber, &callbackHandle) + callbackHandle, err := vmcompute.HcsRegisterComputeSystemCallback(ctx, computeSystem.handle, notificationWatcherCallback, callbackNumber) if err != nil { return err } - context.handle = callbackHandle + callbackContext.handle = callbackHandle computeSystem.callbackNumber = callbackNumber return nil } -func (computeSystem *System) unregisterCallback() error { +func (computeSystem *System) unregisterCallback(ctx context.Context) error { callbackNumber := computeSystem.callbackNumber callbackMapLock.RLock() - context := callbackMap[callbackNumber] + callbackContext := callbackMap[callbackNumber] callbackMapLock.RUnlock() - if context == nil { + if callbackContext == nil { return nil } - handle := context.handle + handle := callbackContext.handle if handle == 0 { return nil @@ -632,53 +594,43 @@ func (computeSystem *System) unregisterCallback() error { // hcsUnregisterComputeSystemCallback has its own syncronization // to wait for all callbacks to complete. We must NOT hold the callbackMapLock. - err := hcsUnregisterComputeSystemCallback(handle) + err := vmcompute.HcsUnregisterComputeSystemCallback(ctx, handle) if err != nil { return err } - closeChannels(context.channels) + closeChannels(callbackContext.channels) callbackMapLock.Lock() - callbackMap[callbackNumber] = nil + delete(callbackMap, callbackNumber) callbackMapLock.Unlock() - handle = 0 + handle = 0 //nolint:ineffassign return nil } // Modify the System by sending a request to HCS -func (computeSystem *System) Modify(config interface{}) (err error) { +func (computeSystem *System) Modify(ctx context.Context, config interface{}) error { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Modify" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() + operation := "hcsshim::System::Modify" if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Modify", "", ErrAlreadyClosed, nil) + return makeSystemError(computeSystem, operation, ErrAlreadyClosed, nil) } - requestJSON, err := json.Marshal(config) + requestBytes, err := json.Marshal(config) if err != nil { return err } - requestString := string(requestJSON) - - logrus.WithFields(computeSystem.logctx). - WithField(logfields.JSON, requestString). - Debug("HCS ComputeSystem Modify Document") - - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsModifyComputeSystem(computeSystem.handle, requestString, &resultp) - }) - events := processHcsResult(resultp) + requestJSON := string(requestBytes) + resultJSON, err := vmcompute.HcsModifyComputeSystem(ctx, computeSystem.handle, requestJSON) + events := processHcsResult(ctx, resultJSON) if err != nil { - return makeSystemError(computeSystem, "Modify", requestString, err, events) + return makeSystemError(computeSystem, operation, err, events) } return nil diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/utils.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/utils.go index a638677e..3342e5bb 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/utils.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/utils.go @@ -1,10 +1,15 @@ package hcs import ( + "context" "io" "syscall" "github.com/Microsoft/go-winio" + diskutil "github.com/Microsoft/go-winio/vhd" + "github.com/Microsoft/hcsshim/computestorage" + "github.com/pkg/errors" + "golang.org/x/sys/windows" ) // makeOpenFiles calls winio.MakeOpenFile for each handle in a slice but closes all the handles @@ -31,3 +36,27 @@ func makeOpenFiles(hs []syscall.Handle) (_ []io.ReadWriteCloser, err error) { } return fs, nil } + +// CreateNTFSVHD creates a VHD formatted with NTFS of size `sizeGB` at the given `vhdPath`. +func CreateNTFSVHD(ctx context.Context, vhdPath string, sizeGB uint32) (err error) { + if err := diskutil.CreateVhdx(vhdPath, sizeGB, 1); err != nil { + return errors.Wrap(err, "failed to create VHD") + } + + vhd, err := diskutil.OpenVirtualDisk(vhdPath, diskutil.VirtualDiskAccessNone, diskutil.OpenVirtualDiskFlagNone) + if err != nil { + return errors.Wrap(err, "failed to open VHD") + } + defer func() { + err2 := windows.CloseHandle(windows.Handle(vhd)) + if err == nil { + err = errors.Wrap(err2, "failed to close VHD") + } + }() + + if err := computestorage.FormatWritableLayerVhd(ctx, windows.Handle(vhd)); err != nil { + return errors.Wrap(err, "failed to format VHD") + } + + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go index 91e212c5..db4e14fd 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go @@ -1,28 +1,34 @@ package hcs import ( + "context" "time" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/log" ) -func processAsyncHcsResult(err error, resultp *uint16, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) ([]ErrorEvent, error) { - events := processHcsResult(resultp) +func processAsyncHcsResult(ctx context.Context, err error, resultJSON string, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) ([]ErrorEvent, error) { + events := processHcsResult(ctx, resultJSON) if IsPending(err) { - return nil, waitForNotification(callbackNumber, expectedNotification, timeout) + return nil, waitForNotification(ctx, callbackNumber, expectedNotification, timeout) } return events, err } -func waitForNotification(callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error { +func waitForNotification(ctx context.Context, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error { callbackMapLock.RLock() + if _, ok := callbackMap[callbackNumber]; !ok { + callbackMapLock.RUnlock() + log.G(ctx).WithField("callbackNumber", callbackNumber).Error("failed to waitForNotification: callbackNumber does not exist in callbackMap") + return ErrHandleClose + } channels := callbackMap[callbackNumber].channels callbackMapLock.RUnlock() expectedChannel := channels[expectedNotification] if expectedChannel == nil { - logrus.Errorf("unknown notification type in waitForNotification %x", expectedNotification) + log.G(ctx).WithField("type", expectedNotification).Error("unknown notification type in waitForNotification") return ErrInvalidNotificationType } @@ -59,5 +65,4 @@ func waitForNotification(callbackNumber uintptr, expectedNotification hcsNotific case <-c: return ErrTimeout } - return nil } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go deleted file mode 100644 index f85ed318..00000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go +++ /dev/null @@ -1,41 +0,0 @@ -package hcs - -import ( - "context" - - "github.com/Microsoft/hcsshim/internal/logfields" - "github.com/Microsoft/hcsshim/internal/timeout" - "github.com/sirupsen/logrus" -) - -// syscallWatcher is used as a very simple goroutine around calls into -// the platform. In some cases, we have seen HCS APIs not returning due to -// various bugs, and the goroutine making the syscall ends up not returning, -// prior to its async callback. By spinning up a syscallWatcher, it allows -// us to at least log a warning if a syscall doesn't complete in a reasonable -// amount of time. -// -// Usage is: -// -// syscallWatcher(logContext, func() { -// err = (args...) -// }) -// - -func syscallWatcher(logContext logrus.Fields, syscallLambda func()) { - ctx, cancel := context.WithTimeout(context.Background(), timeout.SyscallWatcher) - defer cancel() - go watchFunc(ctx, logContext) - syscallLambda() -} - -func watchFunc(ctx context.Context, logContext logrus.Fields) { - select { - case <-ctx.Done(): - if ctx.Err() != context.Canceled { - logrus.WithFields(logContext). - WithField(logfields.Timeout, timeout.SyscallWatcher). - Warning("Syscall did not complete within operation timeout. This may indicate a platform issue. If it appears to be making no forward progress, obtain the stacks and see if there is a syscall stuck in the platform API for a significant length of time.") - } - } -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go index 59ec7004..b36315a3 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go @@ -3,6 +3,7 @@ package hns import ( "encoding/json" "net" + "strings" "github.com/sirupsen/logrus" ) @@ -16,12 +17,15 @@ type HNSEndpoint struct { Policies []json.RawMessage `json:",omitempty"` MacAddress string `json:",omitempty"` IPAddress net.IP `json:",omitempty"` + IPv6Address net.IP `json:",omitempty"` DNSSuffix string `json:",omitempty"` DNSServerList string `json:",omitempty"` GatewayAddress string `json:",omitempty"` + GatewayAddressV6 string `json:",omitempty"` EnableInternalDNS bool `json:",omitempty"` DisableICC bool `json:",omitempty"` PrefixLength uint8 `json:",omitempty"` + IPv6PrefixLength uint8 `json:",omitempty"` IsRemoteEndpoint bool `json:",omitempty"` EnableLowMetric bool `json:",omitempty"` Namespace *Namespace `json:",omitempty"` @@ -94,6 +98,27 @@ func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) { return nil, EndpointNotFoundError{EndpointName: endpointName} } +type endpointAttachInfo struct { + SharedContainers json.RawMessage `json:",omitempty"` +} + +func (endpoint *HNSEndpoint) IsAttached(vID string) (bool, error) { + attachInfo := endpointAttachInfo{} + err := hnsCall("GET", "/endpoints/"+endpoint.Id, "", &attachInfo) + + // Return false allows us to just return the err + if err != nil { + return false, err + } + + if strings.Contains(strings.ToLower(string(attachInfo.SharedContainers)), strings.ToLower(vID)) { + return true, nil + } + + return false, nil + +} + // Create Endpoint by sending EndpointRequest to HNS. TODO: Create a separate HNS interface to place all these methods func (endpoint *HNSEndpoint) Create() (*HNSEndpoint, error) { operation := "Create" @@ -151,6 +176,27 @@ func (endpoint *HNSEndpoint) ApplyACLPolicy(policies ...*ACLPolicy) error { return err } +// ApplyProxyPolicy applies a set of Proxy Policies on the Endpoint +func (endpoint *HNSEndpoint) ApplyProxyPolicy(policies ...*ProxyPolicy) error { + operation := "ApplyProxyPolicy" + title := "hcsshim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + + for _, policy := range policies { + if policy == nil { + continue + } + jsonString, err := json.Marshal(policy) + if err != nil { + return err + } + endpoint.Policies = append(endpoint.Policies, jsonString) + } + + _, err := endpoint.Update() + return err +} + // ContainerAttach attaches an endpoint to container func (endpoint *HNSEndpoint) ContainerAttach(containerID string, compartmentID uint16) error { operation := "ContainerAttach" diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go index 969d1b26..2df4a57f 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go @@ -9,23 +9,30 @@ import ( "github.com/sirupsen/logrus" ) -func hnsCall(method, path, request string, returnResponse interface{}) error { +func hnsCallRawResponse(method, path, request string) (*hnsResponse, error) { var responseBuffer *uint16 logrus.Debugf("[%s]=>[%s] Request : %s", method, path, request) err := _hnsCall(method, path, request, &responseBuffer) if err != nil { - return hcserror.New(err, "hnsCall ", "") + return nil, hcserror.New(err, "hnsCall ", "") } response := interop.ConvertAndFreeCoTaskMemString(responseBuffer) hnsresponse := &hnsResponse{} if err = json.Unmarshal([]byte(response), &hnsresponse); err != nil { - return err + return nil, err } + return hnsresponse, nil +} +func hnsCall(method, path, request string, returnResponse interface{}) error { + hnsresponse, err := hnsCallRawResponse(method, path, request) + if err != nil { + return fmt.Errorf("failed during hnsCallRawResponse: %v", err) + } if !hnsresponse.Success { - return fmt.Errorf("HNS failed with error : %s", hnsresponse.Error) + return fmt.Errorf("hns failed with error : %s", hnsresponse.Error) } if len(hnsresponse.Output) == 0 { diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go index 7e859de9..f12d3ab0 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go @@ -2,9 +2,9 @@ package hns import ( "encoding/json" - "net" - + "errors" "github.com/sirupsen/logrus" + "net" ) // Subnet is assoicated with a network and represents a list @@ -39,12 +39,6 @@ type HNSNetwork struct { AutomaticDNS bool `json:",omitempty"` } -type hnsNetworkResponse struct { - Success bool - Error string - Output HNSNetwork -} - type hnsResponse struct { Success bool Error string @@ -98,6 +92,12 @@ func (network *HNSNetwork) Create() (*HNSNetwork, error) { title := "hcsshim::HNSNetwork::" + operation logrus.Debugf(title+" id=%s", network.Id) + for _, subnet := range network.Subnets { + if (subnet.AddressPrefix != "") && (subnet.GatewayAddress == "") { + return nil, errors.New("network create error, subnet has address prefix but no gateway specified") + } + } + jsonString, err := json.Marshal(network) if err != nil { return nil, err diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go index 2318a4fc..6765aaea 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go @@ -17,6 +17,7 @@ const ( OutboundNat PolicyType = "OutBoundNAT" ExternalLoadBalancer PolicyType = "ELB" Route PolicyType = "ROUTE" + Proxy PolicyType = "PROXY" ) type NatPolicy struct { @@ -55,8 +56,18 @@ type PaPolicy struct { type OutboundNatPolicy struct { Policy - VIP string `json:"VIP,omitempty"` - Exceptions []string `json:"ExceptionList,omitempty"` + VIP string `json:"VIP,omitempty"` + Exceptions []string `json:"ExceptionList,omitempty"` + Destinations []string `json:",omitempty"` +} + +type ProxyPolicy struct { + Type PolicyType `json:"Type"` + IP string `json:",omitempty"` + Port string `json:",omitempty"` + ExceptionList []string `json:",omitempty"` + Destination string `json:",omitempty"` + OutboundNat bool `json:",omitempty"` } type ActionType string diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/namespace.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/namespace.go index 45e2281b..d3b04eef 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/namespace.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/namespace.go @@ -27,9 +27,10 @@ type namespaceResourceRequest struct { } type Namespace struct { - ID string - IsDefault bool `json:",omitempty"` - ResourceList []NamespaceResource `json:",omitempty"` + ID string + IsDefault bool `json:",omitempty"` + ResourceList []NamespaceResource `json:",omitempty"` + CompartmentId uint32 `json:",omitempty"` } func issueNamespaceRequest(id *string, method, subpath string, request interface{}) (*Namespace, error) { diff --git a/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go b/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go index 2f6ec029..922f7c67 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go @@ -15,10 +15,6 @@ func ConvertAndFreeCoTaskMemString(buffer *uint16) string { return str } -func ConvertAndFreeCoTaskMemBytes(buffer *uint16) []byte { - return []byte(ConvertAndFreeCoTaskMemString(buffer)) -} - func Win32FromHresult(hr uintptr) syscall.Errno { if hr&0x1fff0000 == 0x00070000 { return syscall.Errno(hr & 0xffff) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/log/g.go b/vendor/github.com/Microsoft/hcsshim/internal/log/g.go new file mode 100644 index 00000000..ba6b1a4a --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/log/g.go @@ -0,0 +1,23 @@ +package log + +import ( + "context" + + "github.com/sirupsen/logrus" + "go.opencensus.io/trace" +) + +// G returns a `logrus.Entry` with the `TraceID, SpanID` from `ctx` if `ctx` +// contains an OpenCensus `trace.Span`. +func G(ctx context.Context) *logrus.Entry { + span := trace.FromContext(ctx) + if span != nil { + sctx := span.SpanContext() + return logrus.WithFields(logrus.Fields{ + "traceID": sctx.TraceID.String(), + "spanID": sctx.SpanID.String(), + // "parentSpanID": TODO: JTERRY75 - Try to convince OC to export this? + }) + } + return logrus.NewEntry(logrus.StandardLogger()) +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/oc/exporter.go b/vendor/github.com/Microsoft/hcsshim/internal/oc/exporter.go new file mode 100644 index 00000000..f428bdaf --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/oc/exporter.go @@ -0,0 +1,43 @@ +package oc + +import ( + "github.com/sirupsen/logrus" + "go.opencensus.io/trace" +) + +var _ = (trace.Exporter)(&LogrusExporter{}) + +// LogrusExporter is an OpenCensus `trace.Exporter` that exports +// `trace.SpanData` to logrus output. +type LogrusExporter struct { +} + +// ExportSpan exports `s` based on the the following rules: +// +// 1. All output will contain `s.Attributes`, `s.TraceID`, `s.SpanID`, +// `s.ParentSpanID` for correlation +// +// 2. Any calls to .Annotate will not be supported. +// +// 3. The span itself will be written at `logrus.InfoLevel` unless +// `s.Status.Code != 0` in which case it will be written at `logrus.ErrorLevel` +// providing `s.Status.Message` as the error value. +func (le *LogrusExporter) ExportSpan(s *trace.SpanData) { + // Combine all span annotations with traceID, spanID, parentSpanID + baseEntry := logrus.WithFields(logrus.Fields(s.Attributes)) + baseEntry.Data["traceID"] = s.TraceID.String() + baseEntry.Data["spanID"] = s.SpanID.String() + baseEntry.Data["parentSpanID"] = s.ParentSpanID.String() + baseEntry.Data["startTime"] = s.StartTime + baseEntry.Data["endTime"] = s.EndTime + baseEntry.Data["duration"] = s.EndTime.Sub(s.StartTime).String() + baseEntry.Data["name"] = s.Name + baseEntry.Time = s.StartTime + + level := logrus.InfoLevel + if s.Status.Code != 0 { + level = logrus.ErrorLevel + baseEntry.Data[logrus.ErrorKey] = s.Status.Message + } + baseEntry.Log(level, "Span") +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/oc/span.go b/vendor/github.com/Microsoft/hcsshim/internal/oc/span.go new file mode 100644 index 00000000..fee4765c --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/oc/span.go @@ -0,0 +1,17 @@ +package oc + +import ( + "go.opencensus.io/trace" +) + +// SetSpanStatus sets `span.SetStatus` to the proper status depending on `err`. If +// `err` is `nil` assumes `trace.StatusCodeOk`. +func SetSpanStatus(span *trace.Span, err error) { + status := trace.Status{} + if err != nil { + // TODO: JTERRY75 - Handle errors in a non-generic way + status.Code = trace.StatusCodeUnknown + status.Message = err.Error() + } + span.SetStatus(status) +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/regstate/regstate.go b/vendor/github.com/Microsoft/hcsshim/internal/regstate/regstate.go index 6c4a6415..6086c1dc 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/regstate/regstate.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/regstate/regstate.go @@ -9,6 +9,7 @@ import ( "reflect" "syscall" + "golang.org/x/sys/windows" "golang.org/x/sys/windows/registry" ) @@ -19,7 +20,6 @@ import ( const ( _REG_OPTION_VOLATILE = 1 - _REG_CREATED_NEW_KEY = 1 _REG_OPENED_EXISTING_KEY = 2 ) @@ -61,7 +61,8 @@ func createVolatileKey(k *Key, path string, access uint32) (newk *Key, openedExi d uint32 ) fullpath := filepath.Join(k.Name, path) - err = regCreateKeyEx(syscall.Handle(k.Key), syscall.StringToUTF16Ptr(path), 0, nil, _REG_OPTION_VOLATILE, access, nil, &h, &d) + pathPtr, _ := windows.UTF16PtrFromString(path) + err = regCreateKeyEx(syscall.Handle(k.Key), pathPtr, 0, nil, _REG_OPTION_VOLATILE, access, nil, &h, &d) if err != nil { return nil, false, &os.PathError{Op: "RegCreateKeyEx", Path: fullpath, Err: err} } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/runhcs/container.go b/vendor/github.com/Microsoft/hcsshim/internal/runhcs/container.go index 3015c364..a161c204 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/runhcs/container.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/runhcs/container.go @@ -10,7 +10,7 @@ import ( "syscall" "time" - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" ) // ContainerState represents the platform agnostic pieces relating to a @@ -51,7 +51,7 @@ func GetErrorFromPipe(pipe io.Reader, p *os.Process) error { extra := "" if p != nil { - p.Kill() + _ = p.Kill() state, err := p.Wait() if err != nil { panic(err) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/safefile/safeopen.go b/vendor/github.com/Microsoft/hcsshim/internal/safefile/safeopen.go index f31edfaf..66b8d7e0 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/safefile/safeopen.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/safefile/safeopen.go @@ -11,72 +11,11 @@ import ( "unsafe" "github.com/Microsoft/hcsshim/internal/longpath" + "github.com/Microsoft/hcsshim/internal/winapi" winio "github.com/Microsoft/go-winio" ) -//go:generate go run $GOROOT\src\syscall\mksyscall_windows.go -output zsyscall_windows.go safeopen.go - -//sys ntCreateFile(handle *uintptr, accessMask uint32, oa *objectAttributes, iosb *ioStatusBlock, allocationSize *uint64, fileAttributes uint32, shareAccess uint32, createDisposition uint32, createOptions uint32, eaBuffer *byte, eaLength uint32) (status uint32) = ntdll.NtCreateFile -//sys ntSetInformationFile(handle uintptr, iosb *ioStatusBlock, information uintptr, length uint32, class uint32) (status uint32) = ntdll.NtSetInformationFile -//sys rtlNtStatusToDosError(status uint32) (winerr error) = ntdll.RtlNtStatusToDosErrorNoTeb -//sys localAlloc(flags uint32, size int) (ptr uintptr) = kernel32.LocalAlloc -//sys localFree(ptr uintptr) = kernel32.LocalFree - -type ioStatusBlock struct { - Status, Information uintptr -} - -type objectAttributes struct { - Length uintptr - RootDirectory uintptr - ObjectName uintptr - Attributes uintptr - SecurityDescriptor uintptr - SecurityQoS uintptr -} - -type unicodeString struct { - Length uint16 - MaximumLength uint16 - Buffer uintptr -} - -type fileLinkInformation struct { - ReplaceIfExists bool - RootDirectory uintptr - FileNameLength uint32 - FileName [1]uint16 -} - -type fileDispositionInformationEx struct { - Flags uintptr -} - -const ( - _FileLinkInformation = 11 - _FileDispositionInformationEx = 64 - - FILE_READ_ATTRIBUTES = 0x0080 - FILE_WRITE_ATTRIBUTES = 0x0100 - DELETE = 0x10000 - - FILE_OPEN = 1 - FILE_CREATE = 2 - - FILE_DIRECTORY_FILE = 0x00000001 - FILE_SYNCHRONOUS_IO_NONALERT = 0x00000020 - FILE_DELETE_ON_CLOSE = 0x00001000 - FILE_OPEN_FOR_BACKUP_INTENT = 0x00004000 - FILE_OPEN_REPARSE_POINT = 0x00200000 - - FILE_DISPOSITION_DELETE = 0x00000001 - - _OBJ_DONT_REPARSE = 0x1000 - - _STATUS_REPARSE_POINT_ENCOUNTERED = 0xC000050B -) - func OpenRoot(path string) (*os.File, error) { longpath, err := longpath.LongAbs(path) if err != nil { @@ -85,16 +24,24 @@ func OpenRoot(path string) (*os.File, error) { return winio.OpenForBackup(longpath, syscall.GENERIC_READ, syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, syscall.OPEN_EXISTING) } -func ntRelativePath(path string) ([]uint16, error) { +func cleanGoStringRelativePath(path string) (string, error) { path = filepath.Clean(path) if strings.Contains(path, ":") { // Since alternate data streams must follow the file they // are attached to, finding one here (out of order) is invalid. - return nil, errors.New("path contains invalid character `:`") + return "", errors.New("path contains invalid character `:`") } fspath := filepath.FromSlash(path) if len(fspath) > 0 && fspath[0] == '\\' { - return nil, errors.New("expected relative path") + return "", errors.New("expected relative path") + } + return fspath, nil +} + +func ntRelativePath(path string) ([]uint16, error) { + fspath, err := cleanGoStringRelativePath(path) + if err != nil { + return nil, err } path16 := utf16.Encode(([]rune)(fspath)) @@ -110,11 +57,11 @@ func ntRelativePath(path string) ([]uint16, error) { func openRelativeInternal(path string, root *os.File, accessMask uint32, shareFlags uint32, createDisposition uint32, flags uint32) (*os.File, error) { var ( h uintptr - iosb ioStatusBlock - oa objectAttributes + iosb winapi.IOStatusBlock + oa winapi.ObjectAttributes ) - path16, err := ntRelativePath(path) + cleanRelativePath, err := cleanGoStringRelativePath(path) if err != nil { return nil, err } @@ -123,20 +70,16 @@ func openRelativeInternal(path string, root *os.File, accessMask uint32, shareFl return nil, errors.New("missing root directory") } - upathBuffer := localAlloc(0, int(unsafe.Sizeof(unicodeString{}))+len(path16)*2) - defer localFree(upathBuffer) - - upath := (*unicodeString)(unsafe.Pointer(upathBuffer)) - upath.Length = uint16(len(path16) * 2) - upath.MaximumLength = upath.Length - upath.Buffer = upathBuffer + unsafe.Sizeof(*upath) - copy((*[32768]uint16)(unsafe.Pointer(upath.Buffer))[:], path16) + pathUnicode, err := winapi.NewUnicodeString(cleanRelativePath) + if err != nil { + return nil, err + } oa.Length = unsafe.Sizeof(oa) - oa.ObjectName = upathBuffer + oa.ObjectName = pathUnicode oa.RootDirectory = uintptr(root.Fd()) - oa.Attributes = _OBJ_DONT_REPARSE - status := ntCreateFile( + oa.Attributes = winapi.OBJ_DONT_REPARSE + status := winapi.NtCreateFile( &h, accessMask|syscall.SYNCHRONIZE, &oa, @@ -145,12 +88,12 @@ func openRelativeInternal(path string, root *os.File, accessMask uint32, shareFl 0, shareFlags, createDisposition, - FILE_OPEN_FOR_BACKUP_INTENT|FILE_SYNCHRONOUS_IO_NONALERT|flags, + winapi.FILE_OPEN_FOR_BACKUP_INTENT|winapi.FILE_SYNCHRONOUS_IO_NONALERT|flags, nil, 0, ) if status != 0 { - return nil, rtlNtStatusToDosError(status) + return nil, winapi.RtlNtStatusToDosError(status) } fullPath, err := longpath.LongAbs(filepath.Join(root.Name(), path)) @@ -182,7 +125,7 @@ func LinkRelative(oldname string, oldroot *os.File, newname string, newroot *os. oldroot, syscall.FILE_WRITE_ATTRIBUTES, syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, - FILE_OPEN, + winapi.FILE_OPEN, 0, ) if err != nil { @@ -199,8 +142,8 @@ func LinkRelative(oldname string, oldroot *os.File, newname string, newroot *os. newroot, syscall.GENERIC_READ, syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, - FILE_OPEN, - FILE_DIRECTORY_FILE) + winapi.FILE_OPEN, + winapi.FILE_DIRECTORY_FILE) if err != nil { return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(newroot.Name(), newname), Err: err} } @@ -211,7 +154,7 @@ func LinkRelative(oldname string, oldroot *os.File, newname string, newroot *os. return err } if (fi.FileAttributes & syscall.FILE_ATTRIBUTE_REPARSE_POINT) != 0 { - return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(newroot.Name(), newname), Err: rtlNtStatusToDosError(_STATUS_REPARSE_POINT_ENCOUNTERED)} + return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(newroot.Name(), newname), Err: winapi.RtlNtStatusToDosError(winapi.STATUS_REPARSE_POINT_ENCOUNTERED)} } } else { @@ -227,24 +170,25 @@ func LinkRelative(oldname string, oldroot *os.File, newname string, newroot *os. return err } - size := int(unsafe.Offsetof(fileLinkInformation{}.FileName)) + len(newbase16)*2 - linkinfoBuffer := localAlloc(0, size) - defer localFree(linkinfoBuffer) - linkinfo := (*fileLinkInformation)(unsafe.Pointer(linkinfoBuffer)) + size := int(unsafe.Offsetof(winapi.FileLinkInformation{}.FileName)) + len(newbase16)*2 + linkinfoBuffer := winapi.LocalAlloc(0, size) + defer winapi.LocalFree(linkinfoBuffer) + + linkinfo := (*winapi.FileLinkInformation)(unsafe.Pointer(linkinfoBuffer)) linkinfo.RootDirectory = parent.Fd() linkinfo.FileNameLength = uint32(len(newbase16) * 2) - copy((*[32768]uint16)(unsafe.Pointer(&linkinfo.FileName[0]))[:], newbase16) + copy(winapi.Uint16BufferToSlice(&linkinfo.FileName[0], len(newbase16)), newbase16) - var iosb ioStatusBlock - status := ntSetInformationFile( + var iosb winapi.IOStatusBlock + status := winapi.NtSetInformationFile( oldf.Fd(), &iosb, linkinfoBuffer, uint32(size), - _FileLinkInformation, + winapi.FileLinkInformationClass, ) if status != 0 { - return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(parent.Name(), newbase), Err: rtlNtStatusToDosError(status)} + return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(parent.Name(), newbase), Err: winapi.RtlNtStatusToDosError(status)} } return nil @@ -252,17 +196,17 @@ func LinkRelative(oldname string, oldroot *os.File, newname string, newroot *os. // deleteOnClose marks a file to be deleted when the handle is closed. func deleteOnClose(f *os.File) error { - disposition := fileDispositionInformationEx{Flags: FILE_DISPOSITION_DELETE} - var iosb ioStatusBlock - status := ntSetInformationFile( + disposition := winapi.FileDispositionInformationEx{Flags: winapi.FILE_DISPOSITION_DELETE} + var iosb winapi.IOStatusBlock + status := winapi.NtSetInformationFile( f.Fd(), &iosb, uintptr(unsafe.Pointer(&disposition)), uint32(unsafe.Sizeof(disposition)), - _FileDispositionInformationEx, + winapi.FileDispositionInformationExClass, ) if status != 0 { - return rtlNtStatusToDosError(status) + return winapi.RtlNtStatusToDosError(status) } return nil } @@ -291,16 +235,16 @@ func RemoveRelative(path string, root *os.File) error { f, err := openRelativeInternal( path, root, - FILE_READ_ATTRIBUTES|FILE_WRITE_ATTRIBUTES|DELETE, + winapi.FILE_READ_ATTRIBUTES|winapi.FILE_WRITE_ATTRIBUTES|winapi.DELETE, syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, - FILE_OPEN, - FILE_OPEN_REPARSE_POINT) + winapi.FILE_OPEN, + winapi.FILE_OPEN_REPARSE_POINT) if err == nil { defer f.Close() err = deleteOnClose(f) if err == syscall.ERROR_ACCESS_DENIED { // Maybe the file is marked readonly. Clear the bit and retry. - clearReadOnly(f) + _ = clearReadOnly(f) err = deleteOnClose(f) } } @@ -385,8 +329,8 @@ func MkdirRelative(path string, root *os.File) error { root, 0, syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, - FILE_CREATE, - FILE_DIRECTORY_FILE) + winapi.FILE_CREATE, + winapi.FILE_DIRECTORY_FILE) if err == nil { f.Close() } else { @@ -401,10 +345,10 @@ func LstatRelative(path string, root *os.File) (os.FileInfo, error) { f, err := openRelativeInternal( path, root, - FILE_READ_ATTRIBUTES, + winapi.FILE_READ_ATTRIBUTES, syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, - FILE_OPEN, - FILE_OPEN_REPARSE_POINT) + winapi.FILE_OPEN, + winapi.FILE_OPEN_REPARSE_POINT) if err != nil { return nil, &os.PathError{Op: "stat", Path: filepath.Join(root.Name(), path), Err: err} } @@ -421,7 +365,7 @@ func EnsureNotReparsePointRelative(path string, root *os.File) error { root, 0, syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, - FILE_OPEN, + winapi.FILE_OPEN, 0) if err != nil { return err diff --git a/vendor/github.com/Microsoft/hcsshim/internal/safefile/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/safefile/zsyscall_windows.go deleted file mode 100644 index 709b9d34..00000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/safefile/zsyscall_windows.go +++ /dev/null @@ -1,79 +0,0 @@ -// Code generated by 'go generate'; DO NOT EDIT. - -package safefile - -import ( - "syscall" - "unsafe" - - "golang.org/x/sys/windows" -) - -var _ unsafe.Pointer - -// Do the interface allocations only once for common -// Errno values. -const ( - errnoERROR_IO_PENDING = 997 -) - -var ( - errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) -) - -// errnoErr returns common boxed Errno values, to prevent -// allocations at runtime. -func errnoErr(e syscall.Errno) error { - switch e { - case 0: - return nil - case errnoERROR_IO_PENDING: - return errERROR_IO_PENDING - } - // TODO: add more here, after collecting data on the common - // error values see on Windows. (perhaps when running - // all.bat?) - return e -} - -var ( - modntdll = windows.NewLazySystemDLL("ntdll.dll") - modkernel32 = windows.NewLazySystemDLL("kernel32.dll") - - procNtCreateFile = modntdll.NewProc("NtCreateFile") - procNtSetInformationFile = modntdll.NewProc("NtSetInformationFile") - procRtlNtStatusToDosErrorNoTeb = modntdll.NewProc("RtlNtStatusToDosErrorNoTeb") - procLocalAlloc = modkernel32.NewProc("LocalAlloc") - procLocalFree = modkernel32.NewProc("LocalFree") -) - -func ntCreateFile(handle *uintptr, accessMask uint32, oa *objectAttributes, iosb *ioStatusBlock, allocationSize *uint64, fileAttributes uint32, shareAccess uint32, createDisposition uint32, createOptions uint32, eaBuffer *byte, eaLength uint32) (status uint32) { - r0, _, _ := syscall.Syscall12(procNtCreateFile.Addr(), 11, uintptr(unsafe.Pointer(handle)), uintptr(accessMask), uintptr(unsafe.Pointer(oa)), uintptr(unsafe.Pointer(iosb)), uintptr(unsafe.Pointer(allocationSize)), uintptr(fileAttributes), uintptr(shareAccess), uintptr(createDisposition), uintptr(createOptions), uintptr(unsafe.Pointer(eaBuffer)), uintptr(eaLength), 0) - status = uint32(r0) - return -} - -func ntSetInformationFile(handle uintptr, iosb *ioStatusBlock, information uintptr, length uint32, class uint32) (status uint32) { - r0, _, _ := syscall.Syscall6(procNtSetInformationFile.Addr(), 5, uintptr(handle), uintptr(unsafe.Pointer(iosb)), uintptr(information), uintptr(length), uintptr(class), 0) - status = uint32(r0) - return -} - -func rtlNtStatusToDosError(status uint32) (winerr error) { - r0, _, _ := syscall.Syscall(procRtlNtStatusToDosErrorNoTeb.Addr(), 1, uintptr(status), 0, 0) - if r0 != 0 { - winerr = syscall.Errno(r0) - } - return -} - -func localAlloc(flags uint32, size int) (ptr uintptr) { - r0, _, _ := syscall.Syscall(procLocalAlloc.Addr(), 2, uintptr(flags), uintptr(size), 0) - ptr = uintptr(r0) - return -} - -func localFree(ptr uintptr) { - syscall.Syscall(procLocalFree.Addr(), 1, uintptr(ptr), 0, 0) - return -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go b/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go index 995433ac..b468ad63 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go @@ -4,7 +4,8 @@ import ( "encoding/json" "time" - "github.com/Microsoft/hcsshim/internal/schema2" + "github.com/Microsoft/go-winio/pkg/guid" + hcsschema "github.com/Microsoft/hcsshim/internal/schema2" ) // ProcessConfig is used as both the input of Container.CreateProcess @@ -62,7 +63,7 @@ type MappedVirtualDisk struct { CreateInUtilityVM bool `json:",omitempty"` ReadOnly bool `json:",omitempty"` Cache string `json:",omitempty"` // "" (Unspecified); "Disabled"; "Enabled"; "Private"; "PrivateAllowSharing" - AttachOnly bool `json:",omitempty:` + AttachOnly bool `json:",omitempty"` } // AssignedDevice represents a device that has been directly assigned to a container @@ -118,9 +119,9 @@ type PropertyType string const ( PropertyTypeStatistics PropertyType = "Statistics" // V1 and V2 - PropertyTypeProcessList = "ProcessList" // V1 and V2 - PropertyTypeMappedVirtualDisk = "MappedVirtualDisk" // Not supported in V2 schema call - PropertyTypeGuestConnection = "GuestConnection" // V1 and V2. Nil return from HCS before RS5 + PropertyTypeProcessList PropertyType = "ProcessList" // V1 and V2 + PropertyTypeMappedVirtualDisk PropertyType = "MappedVirtualDisk" // Not supported in V2 schema call + PropertyTypeGuestConnection PropertyType = "GuestConnection" // V1 and V2. Nil return from HCS before RS5 ) type PropertyQuery struct { @@ -133,9 +134,10 @@ type ContainerProperties struct { State string Name string SystemType string + RuntimeOSType string `json:"RuntimeOsType,omitempty"` Owner string SiloGUID string `json:"SiloGuid,omitempty"` - RuntimeID string `json:"RuntimeId,omitempty"` + RuntimeID guid.GUID `json:"RuntimeId,omitempty"` IsRuntimeTemplate bool `json:",omitempty"` RuntimeImagePath string `json:",omitempty"` Stopped bool `json:",omitempty"` @@ -212,8 +214,11 @@ type MappedVirtualDiskController struct { // GuestDefinedCapabilities is part of the GuestConnectionInfo returned by a GuestConnection call on a utility VM type GuestDefinedCapabilities struct { - NamespaceAddRequestSupported bool `json:",omitempty"` - SignalProcessSupported bool `json:",omitempty"` + NamespaceAddRequestSupported bool `json:",omitempty"` + SignalProcessSupported bool `json:",omitempty"` + DumpStacksSupported bool `json:",omitempty"` + DeleteContainerStateSupported bool `json:",omitempty"` + UpdateContainerSupported bool `json:",omitempty"` } // GuestConnectionInfo is the structure of an iterm return by a GuestConnection call on a utility VM diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go index 09456cbc..bcfeb34d 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go @@ -10,7 +10,6 @@ package hcsschema type Attachment struct { - Type_ string `json:"Type,omitempty"` Path string `json:"Path,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go index 243779ea..c1ea3953 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go @@ -10,7 +10,6 @@ package hcsschema type CacheQueryStatsResponse struct { - L3OccupancyBytes int32 `json:"L3OccupancyBytes,omitempty"` L3TotalBwBytes int32 `json:"L3TotalBwBytes,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go index 88f01707..b4f9c315 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go @@ -10,6 +10,5 @@ package hcsschema type CloseHandle struct { - Handle string `json:"Handle,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go index c665be3d..8bf8cab6 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go @@ -11,7 +11,6 @@ package hcsschema // ComPort specifies the named pipe that will be used for the port, with empty string indicating a disconnected port. type ComPort struct { - NamedPipe string `json:"NamedPipe,omitempty"` OptimizeForDebugger bool `json:"OptimizeForDebugger,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go index 85785d28..10cea67e 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go @@ -10,14 +10,13 @@ package hcsschema type ComputeSystem struct { - Owner string `json:"Owner,omitempty"` SchemaVersion *Version `json:"SchemaVersion,omitempty"` HostingSystemId string `json:"HostingSystemId,omitempty"` - HostedSystem *HostedSystem `json:"HostedSystem,omitempty"` + HostedSystem interface{} `json:"HostedSystem,omitempty"` Container *Container `json:"Container,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go index 1a47db7d..1d5dfe68 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go @@ -25,37 +25,37 @@ func (c contextKey) String() string { var ( // ContextOAuth2 takes a oauth2.TokenSource as authentication for the request. - ContextOAuth2 = contextKey("token") + ContextOAuth2 = contextKey("token") // ContextBasicAuth takes BasicAuth as authentication for the request. - ContextBasicAuth = contextKey("basic") + ContextBasicAuth = contextKey("basic") // ContextAccessToken takes a string oauth2 access token as authentication for the request. - ContextAccessToken = contextKey("accesstoken") + ContextAccessToken = contextKey("accesstoken") // ContextAPIKey takes an APIKey as authentication for the request - ContextAPIKey = contextKey("apikey") + ContextAPIKey = contextKey("apikey") ) -// BasicAuth provides basic http authentication to a request passed via context using ContextBasicAuth +// BasicAuth provides basic http authentication to a request passed via context using ContextBasicAuth type BasicAuth struct { - UserName string `json:"userName,omitempty"` - Password string `json:"password,omitempty"` + UserName string `json:"userName,omitempty"` + Password string `json:"password,omitempty"` } // APIKey provides API key based authentication to a request passed via context using ContextAPIKey type APIKey struct { - Key string - Prefix string + Key string + Prefix string } type Configuration struct { - BasePath string `json:"basePath,omitempty"` - Host string `json:"host,omitempty"` - Scheme string `json:"scheme,omitempty"` - DefaultHeader map[string]string `json:"defaultHeader,omitempty"` - UserAgent string `json:"userAgent,omitempty"` - HTTPClient *http.Client + BasePath string `json:"basePath,omitempty"` + Host string `json:"host,omitempty"` + Scheme string `json:"scheme,omitempty"` + DefaultHeader map[string]string `json:"defaultHeader,omitempty"` + UserAgent string `json:"userAgent,omitempty"` + HTTPClient *http.Client } func NewConfiguration() *Configuration { @@ -69,4 +69,4 @@ func NewConfiguration() *Configuration { func (c *Configuration) AddDefaultHeader(key string, value string) { c.DefaultHeader[key] = value -} \ No newline at end of file +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go index adbe07fe..68aa04a5 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go @@ -10,7 +10,6 @@ package hcsschema type ConsoleSize struct { - Height int32 `json:"Height,omitempty"` Width int32 `json:"Width,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go index 17dce28b..4fb23107 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go @@ -10,7 +10,6 @@ package hcsschema type Container struct { - GuestOs *GuestOs `json:"GuestOs,omitempty"` Storage *Storage `json:"Storage,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_credential_guard_add_instance_request.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_credential_guard_add_instance_request.go new file mode 100644 index 00000000..495c6ebc --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_credential_guard_add_instance_request.go @@ -0,0 +1,16 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type ContainerCredentialGuardAddInstanceRequest struct { + Id string `json:"Id,omitempty"` + CredentialSpec string `json:"CredentialSpec,omitempty"` + Transport string `json:"Transport,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_credential_guard_hv_socket_service_config.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_credential_guard_hv_socket_service_config.go new file mode 100644 index 00000000..1ed4c008 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_credential_guard_hv_socket_service_config.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type ContainerCredentialGuardHvSocketServiceConfig struct { + ServiceId string `json:"ServiceId,omitempty"` + ServiceConfig *HvSocketServiceConfig `json:"ServiceConfig,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_credential_guard_instance.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_credential_guard_instance.go new file mode 100644 index 00000000..d7ebd0fc --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_credential_guard_instance.go @@ -0,0 +1,16 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type ContainerCredentialGuardInstance struct { + Id string `json:"Id,omitempty"` + CredentialGuard *ContainerCredentialGuardState `json:"CredentialGuard,omitempty"` + HvSocketConfig *ContainerCredentialGuardHvSocketServiceConfig `json:"HvSocketConfig,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_credential_guard_modify_operation.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_credential_guard_modify_operation.go new file mode 100644 index 00000000..71005b09 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_credential_guard_modify_operation.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type ContainerCredentialGuardModifyOperation string + +const ( + AddInstance ContainerCredentialGuardModifyOperation = "AddInstance" + RemoveInstance ContainerCredentialGuardModifyOperation = "RemoveInstance" +) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_credential_guard_operation_request.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_credential_guard_operation_request.go new file mode 100644 index 00000000..952cda49 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_credential_guard_operation_request.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type ContainerCredentialGuardOperationRequest struct { + Operation ContainerCredentialGuardModifyOperation `json:"Operation,omitempty"` + OperationDetails interface{} `json:"OperationDetails,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_credential_guard_remove_instance_request.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_credential_guard_remove_instance_request.go new file mode 100644 index 00000000..32e5a3be --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_credential_guard_remove_instance_request.go @@ -0,0 +1,14 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type ContainerCredentialGuardRemoveInstanceRequest struct { + Id string `json:"Id,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_credential_guard_system_info.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_credential_guard_system_info.go new file mode 100644 index 00000000..ea306fa2 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_credential_guard_system_info.go @@ -0,0 +1,14 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type ContainerCredentialGuardSystemInfo struct { + Instances []ContainerCredentialGuardInstance `json:"Instances,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go index 754797e2..1fd7ca5d 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go @@ -11,7 +11,6 @@ package hcsschema // memory usage as viewed from within the container type ContainerMemoryInformation struct { - TotalPhysicalBytes int32 `json:"TotalPhysicalBytes,omitempty"` TotalUsage int32 `json:"TotalUsage,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/cpu_group.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/cpu_group.go new file mode 100644 index 00000000..90332a51 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/cpu_group.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// CPU groups allow Hyper-V administrators to better manage and allocate the host's CPU resources across guest virtual machines +type CpuGroup struct { + Id string `json:"Id,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/cpu_group_affinity.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/cpu_group_affinity.go new file mode 100644 index 00000000..8794961b --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/cpu_group_affinity.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type CpuGroupAffinity struct { + LogicalProcessorCount int32 `json:"LogicalProcessorCount,omitempty"` + LogicalProcessors []int32 `json:"LogicalProcessors,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/cpu_group_config.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/cpu_group_config.go new file mode 100644 index 00000000..f1a28cd3 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/cpu_group_config.go @@ -0,0 +1,18 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type CpuGroupConfig struct { + GroupId string `json:"GroupId,omitempty"` + Affinity *CpuGroupAffinity `json:"Affinity,omitempty"` + GroupProperties []CpuGroupProperty `json:"GroupProperties,omitempty"` + // Hypervisor CPU group IDs exposed to clients + HypervisorGroupId int32 `json:"HypervisorGroupId,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/cpu_group_configurations.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/cpu_group_configurations.go new file mode 100644 index 00000000..3ace0ccc --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/cpu_group_configurations.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// Structure used to return cpu groups for a Service property query +type CpuGroupConfigurations struct { + CpuGroups []CpuGroupConfig `json:"CpuGroups,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/cpu_group_operations.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/cpu_group_operations.go new file mode 100644 index 00000000..7d897807 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/cpu_group_operations.go @@ -0,0 +1,18 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type CPUGroupOperation string + +const ( + CreateGroup CPUGroupOperation = "CreateGroup" + DeleteGroup CPUGroupOperation = "DeleteGroup" + SetProperty CPUGroupOperation = "SetProperty" +) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/cpu_group_property.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/cpu_group_property.go new file mode 100644 index 00000000..bbad6a2c --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/cpu_group_property.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type CpuGroupProperty struct { + PropertyCode uint32 `json:"PropertyCode,omitempty"` + PropertyValue uint32 `json:"PropertyValue,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/create_group_operation.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/create_group_operation.go new file mode 100644 index 00000000..91a8278f --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/create_group_operation.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// Create group operation settings +type CreateGroupOperation struct { + GroupId string `json:"GroupId,omitempty"` + LogicalProcessorCount uint32 `json:"LogicalProcessorCount,omitempty"` + LogicalProcessors []uint32 `json:"LogicalProcessors,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/delete_group_operation.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/delete_group_operation.go new file mode 100644 index 00000000..134bd988 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/delete_group_operation.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// Delete group operation settings +type DeleteGroupOperation struct { + GroupId string `json:"GroupId,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/device.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/device.go index ca319bbb..107cadda 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/device.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/device.go @@ -9,8 +9,19 @@ package hcsschema -type Device struct { +type DeviceType string - // The interface class guid of the device to assign to container. +const ( + ClassGUID DeviceType = "ClassGuid" + DeviceInstance DeviceType = "DeviceInstance" + GPUMirror DeviceType = "GpuMirror" +) + +type Device struct { + // The type of device to assign to the container. + Type DeviceType `json:"Type,omitempty"` + // The interface class guid of the device interfaces to assign to the container. Only used when Type is ClassGuid. InterfaceClassGuid string `json:"InterfaceClassGuid,omitempty"` + // The location path of the device to assign to the container. Only used when Type is DeviceInstance. + LocationPath string `json:"LocationPath,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go index b2191c57..e985d96d 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go @@ -10,7 +10,6 @@ package hcsschema type Devices struct { - ComPorts map[string]ComPort `json:"ComPorts,omitempty"` Scsi map[string]Scsi `json:"Scsi,omitempty"` @@ -40,4 +39,8 @@ type Devices struct { FlexibleIov map[string]FlexibleIoDevice `json:"FlexibleIov,omitempty"` SharedMemory *SharedMemoryConfiguration `json:"SharedMemory,omitempty"` + + // TODO: This is pre-release support in schema 2.3. Need to add build number + // docs when a public build with this is out. + VirtualPci map[string]VirtualPciDevice `json:",omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go index 4fe592f7..85450c41 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go @@ -10,6 +10,5 @@ package hcsschema type EnhancedModeVideo struct { - ConnectionOptions *RdpConnectionOptions `json:"ConnectionOptions,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go index 51011afe..fe86cab6 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go @@ -10,7 +10,6 @@ package hcsschema type FlexibleIoDevice struct { - EmulatorId string `json:"EmulatorId,omitempty"` HostingModel string `json:"HostingModel,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go index c5fa7673..af828004 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go @@ -10,6 +10,5 @@ package hcsschema type GuestCrashReporting struct { - WindowsCrashSettings *WindowsCrashReporting `json:"WindowsCrashSettings,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go index c708fc7c..8838519a 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go @@ -10,6 +10,5 @@ package hcsschema type GuestOs struct { - HostName string `json:"HostName,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/host_processor_modify_request.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/host_processor_modify_request.go new file mode 100644 index 00000000..2238ce53 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/host_processor_modify_request.go @@ -0,0 +1,16 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// Structure used to request a service processor modification +type HostProcessorModificationRequest struct { + Operation CPUGroupOperation `json:"Operation,omitempty"` + OperationDetails interface{} `json:"OperationDetails,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go index 0797584c..ea3084bc 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go @@ -10,7 +10,6 @@ package hcsschema type HostedSystem struct { - SchemaVersion *Version `json:"SchemaVersion,omitempty"` Container *Container `json:"Container,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go index ef9ffb8d..23b2ee9e 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go @@ -10,7 +10,6 @@ package hcsschema type HvSocket struct { - Config *HvSocketSystemConfig `json:"Config,omitempty"` EnablePowerShellDirect bool `json:"EnablePowerShellDirect,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go index a19ba15c..a017691f 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go @@ -11,6 +11,5 @@ package hcsschema // HvSocket configuration for a VM type HvSocket2 struct { - HvSocketConfig *HvSocketSystemConfig `json:"HvSocketConfig,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_address.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_address.go new file mode 100644 index 00000000..84c11b93 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_address.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// This class defines address settings applied to a VM +// by the GCS every time a VM starts or restores. +type HvSocketAddress struct { + LocalAddress string `json:"LocalAddress,omitempty"` + ParentAddress string `json:"ParentAddress,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_service_config.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_service_config.go index a848e91e..ecd9f7fb 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_service_config.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_service_config.go @@ -19,4 +19,10 @@ type HvSocketServiceConfig struct { // If true, HvSocket will process wildcard binds for this service/system combination. Wildcard binds are secured in the registry at SOFTWARE/Microsoft/Windows NT/CurrentVersion/Virtualization/HvSocket/WildcardDescriptors AllowWildcardBinds bool `json:"AllowWildcardBinds,omitempty"` + + // Disabled controls whether the HvSocket service is accepting connection requests. + // This set to true will make the service refuse all incoming connections as well as cancel + // any connections already established. The service itself will still be active however + // and can be re-enabled at a future time. + Disabled bool `json:"Disabled,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/interrupt_moderation_mode.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/interrupt_moderation_mode.go new file mode 100644 index 00000000..a614d63b --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/interrupt_moderation_mode.go @@ -0,0 +1,42 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type InterruptModerationName string + +// The valid interrupt moderation modes for I/O virtualization (IOV) offloading. +const ( + DefaultName InterruptModerationName = "Default" + AdaptiveName InterruptModerationName = "Adaptive" + OffName InterruptModerationName = "Off" + LowName InterruptModerationName = "Low" + MediumName InterruptModerationName = "Medium" + HighName InterruptModerationName = "High" +) + +type InterruptModerationValue uint32 + +const ( + DefaultValue InterruptModerationValue = iota + AdaptiveValue + OffValue + LowValue InterruptModerationValue = 100 + MediumValue InterruptModerationValue = 200 + HighValue InterruptModerationValue = 300 +) + +var InterruptModerationValueToName = map[InterruptModerationValue]InterruptModerationName{ + DefaultValue: DefaultName, + AdaptiveValue: AdaptiveName, + OffValue: OffName, + LowValue: LowName, + MediumValue: MediumName, + HighValue: HighName, +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/iov_settings.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/iov_settings.go new file mode 100644 index 00000000..2a55cc37 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/iov_settings.go @@ -0,0 +1,22 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type IovSettings struct { + // The weight assigned to this port for I/O virtualization (IOV) offloading. + // Setting this to 0 disables IOV offloading. + OffloadWeight *uint32 `json:"OffloadWeight,omitempty"` + + // The number of queue pairs requested for this port for I/O virtualization (IOV) offloading. + QueuePairsRequested *uint32 `json:"QueuePairsRequested,omitempty"` + + // The interrupt moderation mode for I/O virtualization (IOV) offloading. + InterruptModeration *InterruptModerationName `json:"InterruptModeration,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go index b63b8ef1..176c49d4 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go @@ -10,7 +10,6 @@ package hcsschema type Layer struct { - Id string `json:"Id,omitempty"` Path string `json:"Path,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/logical_processor.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/logical_processor.go new file mode 100644 index 00000000..2e3aa5e1 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/logical_processor.go @@ -0,0 +1,18 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type LogicalProcessor struct { + LpIndex uint32 `json:"LpIndex,omitempty"` + NodeNumber uint8 `json:"NodeNumber,omitempty"` + PackageId uint32 `json:"PackageId,omitempty"` + CoreId uint32 `json:"CoreId,omitempty"` + RootVpIndex int32 `json:"RootVpIndex,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go index a823a6d3..9b86a404 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go @@ -10,7 +10,6 @@ package hcsschema type MappedDirectory struct { - HostPath string `json:"HostPath,omitempty"` HostPathType string `json:"HostPathType,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go index 2d1d2604..208074e9 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go @@ -10,7 +10,6 @@ package hcsschema type MappedPipe struct { - ContainerPipeName string `json:"ContainerPipeName,omitempty"` HostPath string `json:"HostPath,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go index e1d135a3..30749c67 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go @@ -10,6 +10,5 @@ package hcsschema type Memory struct { - - SizeInMB int32 `json:"SizeInMB,omitempty"` + SizeInMB uint64 `json:"SizeInMB,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_2.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_2.go index 27d0b8c4..71224c75 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_2.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_2.go @@ -10,7 +10,7 @@ package hcsschema type Memory2 struct { - SizeInMB int32 `json:"SizeInMB,omitempty"` + SizeInMB uint64 `json:"SizeInMB,omitempty"` AllowOvercommit bool `json:"AllowOvercommit,omitempty"` @@ -22,4 +22,28 @@ type Memory2 struct { // EnableDeferredCommit is private in the schema. If regenerated need to add back. EnableDeferredCommit bool `json:"EnableDeferredCommit,omitempty"` + + // EnableColdDiscardHint if enabled, then the memory cold discard hint feature is exposed + // to the VM, allowing it to trim non-zeroed pages from the working set (if supported by + // the guest operating system). + EnableColdDiscardHint bool `json:"EnableColdDiscardHint,omitempty"` + + // LowMmioGapInMB is the low MMIO region allocated below 4GB. + // + // TODO: This is pre-release support in schema 2.3. Need to add build number + // docs when a public build with this is out. + LowMMIOGapInMB uint64 `json:"LowMmioGapInMB,omitempty"` + + // HighMmioBaseInMB is the high MMIO region allocated above 4GB (base and + // size). + // + // TODO: This is pre-release support in schema 2.3. Need to add build number + // docs when a public build with this is out. + HighMMIOBaseInMB uint64 `json:"HighMmioBaseInMB,omitempty"` + + // HighMmioGapInMB is the high MMIO region. + // + // TODO: This is pre-release support in schema 2.3. Need to add build number + // docs when a public build with this is out. + HighMMIOGapInMB uint64 `json:"HighMmioGapInMB,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go index bdd87dff..811779b0 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go @@ -10,8 +10,7 @@ package hcsschema type MemoryInformationForVm struct { - - VirtualNodeCount int32 `json:"VirtualNodeCount,omitempty"` + VirtualNodeCount uint32 `json:"VirtualNodeCount,omitempty"` VirtualMachineMemory *VmMemory `json:"VirtualMachineMemory,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go index 6214970f..906ba597 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go @@ -11,10 +11,9 @@ package hcsschema // Memory runtime statistics type MemoryStats struct { + MemoryUsageCommitBytes uint64 `json:"MemoryUsageCommitBytes,omitempty"` - MemoryUsageCommitBytes int32 `json:"MemoryUsageCommitBytes,omitempty"` + MemoryUsageCommitPeakBytes uint64 `json:"MemoryUsageCommitPeakBytes,omitempty"` - MemoryUsageCommitPeakBytes int32 `json:"MemoryUsageCommitPeakBytes,omitempty"` - - MemoryUsagePrivateWorkingSetBytes int32 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"` + MemoryUsagePrivateWorkingSetBytes uint64 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/modification_request.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/modification_request.go new file mode 100644 index 00000000..1384ed88 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/modification_request.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type ModificationRequest struct { + PropertyType PropertyType `json:"PropertyType,omitempty"` + Settings interface{} `json:"Settings,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go index c586f66c..7408abd3 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go @@ -10,8 +10,8 @@ package hcsschema type NetworkAdapter struct { - EndpointId string `json:"EndpointId,omitempty"` - MacAddress string `json:"MacAddress,omitempty"` + // The I/O virtualization (IOV) offloading configuration. + IovSettings *IovSettings `json:"IovSettings,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go index 12c47827..e5ea187a 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go @@ -10,7 +10,6 @@ package hcsschema type Networking struct { - AllowUnqualifiedDnsQuery bool `json:"AllowUnqualifiedDnsQuery,omitempty"` DnsSearchList string `json:"DnsSearchList,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go index 1cd70d17..d96c9501 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go @@ -11,6 +11,5 @@ package hcsschema // Notification data that is indicated to components running in the Virtual Machine. type PauseNotification struct { - Reason string `json:"Reason,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go index 780a5cae..21707a88 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go @@ -11,7 +11,6 @@ package hcsschema // Options for HcsPauseComputeSystem type PauseOptions struct { - SuspensionLevel string `json:"SuspensionLevel,omitempty"` HostedNotification *PauseNotification `json:"HostedNotification,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go index 705c677e..29d8c801 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go @@ -10,6 +10,5 @@ package hcsschema type Plan9 struct { - Shares []Plan9Share `json:"Shares,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9_share.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9_share.go index eb171817..41f8fdea 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9_share.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9_share.go @@ -10,7 +10,6 @@ package hcsschema type Plan9Share struct { - Name string `json:"Name,omitempty"` // The name by which the guest operation system can access this share, via the aname parameter in the Plan9 protocol. @@ -30,4 +29,6 @@ type Plan9Share struct { ReadOnly bool `json:"ReadOnly,omitempty"` UseShareRootIdentity bool `json:"UseShareRootIdentity,omitempty"` + + AllowedFiles []string `json:"AllowedFiles,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go index 63e0b7f8..e9a662dd 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go @@ -15,7 +15,6 @@ import ( // Information about a process running in a container type ProcessDetails struct { - ProcessId int32 `json:"ProcessId,omitempty"` ImageName string `json:"ImageName,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go index 29bc2e3d..e4ed095c 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go @@ -11,7 +11,6 @@ package hcsschema // Passed to HcsRpc_ModifyProcess type ProcessModifyRequest struct { - Operation string `json:"Operation,omitempty"` ConsoleSize *ConsoleSize `json:"ConsoleSize,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go index 470c5573..82b0d053 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go @@ -10,7 +10,6 @@ package hcsschema type ProcessParameters struct { - ApplicationName string `json:"ApplicationName,omitempty"` CommandLine string `json:"CommandLine,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go index 20793d15..ad9a4fa9 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go @@ -11,7 +11,6 @@ package hcsschema // Status of a process running in a container type ProcessStatus struct { - ProcessId int32 `json:"ProcessId,omitempty"` Exited bool `json:"Exited,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go index 7a60b024..bb24e88d 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go @@ -10,7 +10,6 @@ package hcsschema type Processor struct { - Count int32 `json:"Count,omitempty"` Maximum int32 `json:"Maximum,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go index 40d3e735..21fe4606 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go @@ -10,7 +10,6 @@ package hcsschema type Processor2 struct { - Count int32 `json:"Count,omitempty"` Limit int32 `json:"Limit,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go index 9d3b77e5..6157e252 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go @@ -11,10 +11,9 @@ package hcsschema // CPU runtime statistics type ProcessorStats struct { + TotalRuntime100ns uint64 `json:"TotalRuntime100ns,omitempty"` - TotalRuntime100ns int32 `json:"TotalRuntime100ns,omitempty"` + RuntimeUser100ns uint64 `json:"RuntimeUser100ns,omitempty"` - RuntimeUser100ns int32 `json:"RuntimeUser100ns,omitempty"` - - RuntimeKernel100ns int32 `json:"RuntimeKernel100ns,omitempty"` + RuntimeKernel100ns uint64 `json:"RuntimeKernel100ns,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_topology.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_topology.go new file mode 100644 index 00000000..885156e7 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_topology.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type ProcessorTopology struct { + LogicalProcessorCount uint32 `json:"LogicalProcessorCount,omitempty"` + LogicalProcessors []LogicalProcessor `json:"LogicalProcessors,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go index 6db2a48f..17558cba 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go @@ -9,8 +9,11 @@ package hcsschema -type Properties struct { +import ( + v1 "github.com/containerd/cgroups/stats/v1" +) +type Properties struct { Id string `json:"Id,omitempty"` SystemType string `json:"SystemType,omitempty"` @@ -44,4 +47,8 @@ type Properties struct { SharedMemoryRegionInfo []SharedMemoryRegionInfo `json:"SharedMemoryRegionInfo,omitempty"` GuestConnectionInfo *GuestConnectionInfo `json:"GuestConnectionInfo,omitempty"` + + // Metrics is not part of the API for HCS but this is used for LCOW v2 to + // return the full cgroup metrics from the guest. + Metrics *v1.Metrics `json:"LCOWMetrics,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go index 22b92ffd..d6d80df1 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go @@ -9,8 +9,7 @@ package hcsschema -// By default the basic properties will be returned. This query provides a way to request specific properties. +// By default the basic properties will be returned. This query provides a way to request specific properties. type PropertyQuery struct { - - PropertyTypes []string `json:"PropertyTypes,omitempty"` + PropertyTypes []PropertyType `json:"PropertyTypes,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_type.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_type.go new file mode 100644 index 00000000..98f2c96e --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_type.go @@ -0,0 +1,26 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type PropertyType string + +const ( + PTMemory PropertyType = "Memory" + PTGuestMemory PropertyType = "GuestMemory" + PTStatistics PropertyType = "Statistics" + PTProcessList PropertyType = "ProcessList" + PTTerminateOnLastHandleClosed PropertyType = "TerminateOnLastHandleClosed" + PTSharedMemoryRegion PropertyType = "SharedMemoryRegion" + PTContainerCredentialGuard PropertyType = "ContainerCredentialGuard" // This field is not generated by swagger. This was added manually. + PTGuestConnection PropertyType = "GuestConnection" + PTICHeartbeatStatus PropertyType = "ICHeartbeatStatus" + PTProcessorTopology PropertyType = "ProcessorTopology" + PTCPUGroup PropertyType = "CpuGroup" +) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go index 97e45312..8d5f5c17 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go @@ -10,7 +10,6 @@ package hcsschema type RdpConnectionOptions struct { - AccessSids []string `json:"AccessSids,omitempty"` NamedPipe string `json:"NamedPipe,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go index fa574ccc..006906f6 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go @@ -10,7 +10,6 @@ package hcsschema type RegistryChanges struct { - AddValues []RegistryValue `json:"AddValues,omitempty"` DeleteKeys []RegistryKey `json:"DeleteKeys,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go index fab03bc6..26fde99c 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go @@ -10,7 +10,6 @@ package hcsschema type RegistryKey struct { - Hive string `json:"Hive,omitempty"` Name string `json:"Name,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go index 1589f484..3f203176 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go @@ -10,7 +10,6 @@ package hcsschema type RegistryValue struct { - Key *RegistryKey `json:"Key,omitempty"` Name string `json:"Name,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/service_properties.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/service_properties.go new file mode 100644 index 00000000..b8142ca6 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/service_properties.go @@ -0,0 +1,18 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +import "encoding/json" + +type ServiceProperties struct { + // Changed Properties field to []json.RawMessage from []interface{} to avoid having to + // remarshal sp.Properties[n] and unmarshal into the type(s) we want. + Properties []json.RawMessage `json:"Properties,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go index bd573f6c..df9baa92 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go @@ -10,6 +10,5 @@ package hcsschema type SharedMemoryConfiguration struct { - Regions []SharedMemoryRegion `json:"Regions,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go index a57b2cba..825b7186 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go @@ -10,7 +10,6 @@ package hcsschema type SharedMemoryRegion struct { - SectionName string `json:"SectionName,omitempty"` StartOffset int32 `json:"StartOffset,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go index d9a50cc7..f67b08eb 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go @@ -10,7 +10,6 @@ package hcsschema type SharedMemoryRegionInfo struct { - SectionName string `json:"SectionName,omitempty"` GuestPhysicalAddress int32 `json:"GuestPhysicalAddress,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go index 599c06e8..5eaf6a7f 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go @@ -11,7 +11,6 @@ package hcsschema // Silo job information type SiloProperties struct { - Enabled bool `json:"Enabled,omitempty"` JobName string `json:"JobName,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go index 5cb3ed93..ba7a6b39 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go @@ -15,12 +15,11 @@ import ( // Runtime statistics for a container type Statistics struct { - Timestamp time.Time `json:"Timestamp,omitempty"` ContainerStartTime time.Time `json:"ContainerStartTime,omitempty"` - Uptime100ns int32 `json:"Uptime100ns,omitempty"` + Uptime100ns uint64 `json:"Uptime100ns,omitempty"` Processor *ProcessorStats `json:"Processor,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go index 8c5255df..9c5e6eb5 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go @@ -10,7 +10,6 @@ package hcsschema type StorageQoS struct { - IopsMaximum int32 `json:"IopsMaximum,omitempty"` BandwidthMaximum int32 `json:"BandwidthMaximum,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go index 198ea57d..4f042ffd 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go @@ -11,12 +11,11 @@ package hcsschema // Storage runtime statistics type StorageStats struct { + ReadCountNormalized uint64 `json:"ReadCountNormalized,omitempty"` - ReadCountNormalized int32 `json:"ReadCountNormalized,omitempty"` + ReadSizeBytes uint64 `json:"ReadSizeBytes,omitempty"` - ReadSizeBytes int32 `json:"ReadSizeBytes,omitempty"` + WriteCountNormalized uint64 `json:"WriteCountNormalized,omitempty"` - WriteCountNormalized int32 `json:"WriteCountNormalized,omitempty"` - - WriteSizeBytes int32 `json:"WriteSizeBytes,omitempty"` + WriteSizeBytes uint64 `json:"WriteSizeBytes,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go index af2e3c82..83486994 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go @@ -10,7 +10,6 @@ package hcsschema type Topology struct { - Memory *Memory2 `json:"Memory,omitempty"` Processor *Processor2 `json:"Processor,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go index ba91178f..0e48ece5 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go @@ -10,7 +10,6 @@ package hcsschema type Uefi struct { - EnableDebugger bool `json:"EnableDebugger,omitempty"` SecureBootTemplateId string `json:"SecureBootTemplateId,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go index 6620fb2b..3ab409d8 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go @@ -10,7 +10,6 @@ package hcsschema type UefiBootEntry struct { - DeviceType string `json:"DeviceType,omitempty"` DevicePath string `json:"DevicePath,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go index 62c0e4d1..2abfccca 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go @@ -10,7 +10,6 @@ package hcsschema type Version struct { - Major int32 `json:"Major,omitempty"` Minor int32 `json:"Minor,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go index 0958e560..ec5d0fb9 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go @@ -10,7 +10,6 @@ package hcsschema type VideoMonitor struct { - HorizontalResolution int32 `json:"HorizontalResolution,omitempty"` VerticalResolution int32 `json:"VerticalResolution,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go index 48402d8e..91a3c83d 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go @@ -10,7 +10,6 @@ package hcsschema type VirtualNodeInfo struct { - VirtualNodeIndex int32 `json:"VirtualNodeIndex,omitempty"` PhysicalNodeNumber int32 `json:"PhysicalNodeNumber,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go index 47714444..70cf2d90 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go @@ -10,7 +10,6 @@ package hcsschema type VirtualPMemDevice struct { - HostPath string `json:"HostPath,omitempty"` ReadOnly bool `json:"ReadOnly,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_pci_device.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_pci_device.go new file mode 100644 index 00000000..f5e05903 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_pci_device.go @@ -0,0 +1,16 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.3 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// TODO: This is pre-release support in schema 2.3. Need to add build number +// docs when a public build with this is out. +type VirtualPciDevice struct { + Functions []VirtualPciFunction `json:",omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_pci_function.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_pci_function.go new file mode 100644 index 00000000..cedb7d18 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_pci_function.go @@ -0,0 +1,18 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.3 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// TODO: This is pre-release support in schema 2.3. Need to add build number +// docs when a public build with this is out. +type VirtualPciFunction struct { + DeviceInstancePath string `json:",omitempty"` + + VirtualFunction uint16 `json:",omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go index 76131b3a..362df363 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go @@ -10,7 +10,6 @@ package hcsschema type VirtualSmb struct { - Shares []VirtualSmbShare `json:"Shares,omitempty"` DirectFileMappingInMB int64 `json:"DirectFileMappingInMB,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go index b50098a4..915e9b63 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go @@ -10,7 +10,6 @@ package hcsschema type VirtualSmbShare struct { - Name string `json:"Name,omitempty"` Path string `json:"Path,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go index c1894279..75196bd8 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go @@ -10,7 +10,6 @@ package hcsschema type VirtualSmbShareOptions struct { - ReadOnly bool `json:"ReadOnly,omitempty"` // convert exclusive access to shared read access diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go index 39f62866..8e1836dd 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go @@ -10,14 +10,13 @@ package hcsschema type VmMemory struct { - AvailableMemory int32 `json:"AvailableMemory,omitempty"` AvailableMemoryBuffer int32 `json:"AvailableMemoryBuffer,omitempty"` - ReservedMemory int32 `json:"ReservedMemory,omitempty"` + ReservedMemory uint64 `json:"ReservedMemory,omitempty"` - AssignedMemory int32 `json:"AssignedMemory,omitempty"` + AssignedMemory uint64 `json:"AssignedMemory,omitempty"` SlpActive bool `json:"SlpActive,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_processor_limits.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_processor_limits.go new file mode 100644 index 00000000..de1b9cf1 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_processor_limits.go @@ -0,0 +1,22 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// ProcessorLimits is used when modifying processor scheduling limits of a virtual machine. +type ProcessorLimits struct { + // Maximum amount of host CPU resources that the virtual machine can use. + Limit uint64 `json:"Limit,omitempty"` + // Value describing the relative priority of this virtual machine compared to other virtual machines. + Weight uint64 `json:"Weight,omitempty"` + // Minimum amount of host CPU resources that the virtual machine is guaranteed. + Reservation uint64 `json:"Reservation,omitempty"` + // Provides the target maximum CPU frequency, in MHz, for a virtual machine. + MaximumFrequencyMHz uint32 `json:"MaximumFrequencyMHz,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go index cf632bbc..8ed7e566 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go @@ -10,7 +10,6 @@ package hcsschema type WindowsCrashReporting struct { - DumpFileName string `json:"DumpFileName,omitempty"` MaxDumpSize int64 `json:"MaxDumpSize,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/timeout/timeout.go b/vendor/github.com/Microsoft/hcsshim/internal/timeout/timeout.go index ff3b6572..eaf39fa5 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/timeout/timeout.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/timeout/timeout.go @@ -29,6 +29,9 @@ var ( // SystemResume is the timeout for resuming a compute system SystemResume time.Duration = defaultTimeout + // SystemSave is the timeout for saving a compute system + SystemSave time.Duration = defaultTimeout + // SyscallWatcher is the timeout before warning of a potential stuck platform syscall. SyscallWatcher time.Duration = defaultTimeout @@ -51,6 +54,7 @@ func init() { SystemStart = durationFromEnvironment("HCSSHIM_TIMEOUT_SYSTEMSTART", SystemStart) SystemPause = durationFromEnvironment("HCSSHIM_TIMEOUT_SYSTEMPAUSE", SystemPause) SystemResume = durationFromEnvironment("HCSSHIM_TIMEOUT_SYSTEMRESUME", SystemResume) + SystemSave = durationFromEnvironment("HCSSHIM_TIMEOUT_SYSTEMSAVE", SystemSave) SyscallWatcher = durationFromEnvironment("HCSSHIM_TIMEOUT_SYSCALLWATCHER", SyscallWatcher) Tar2VHD = durationFromEnvironment("HCSSHIM_TIMEOUT_TAR2VHD", Tar2VHD) ExternalCommandToStart = durationFromEnvironment("HCSSHIM_TIMEOUT_EXTERNALCOMMANDSTART", ExternalCommandToStart) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go new file mode 100644 index 00000000..e7f114b6 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go @@ -0,0 +1,610 @@ +package vmcompute + +import ( + gcontext "context" + "syscall" + "time" + + "github.com/Microsoft/hcsshim/internal/interop" + "github.com/Microsoft/hcsshim/internal/log" + "github.com/Microsoft/hcsshim/internal/logfields" + "github.com/Microsoft/hcsshim/internal/oc" + "github.com/Microsoft/hcsshim/internal/timeout" + "go.opencensus.io/trace" +) + +//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go vmcompute.go + +//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems? +//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem? +//sys hcsOpenComputeSystem(id string, computeSystem *HcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem? +//sys hcsCloseComputeSystem(computeSystem HcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem? +//sys hcsStartComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem? +//sys hcsShutdownComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem? +//sys hcsTerminateComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem? +//sys hcsPauseComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem? +//sys hcsResumeComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem? +//sys hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties? +//sys hcsModifyComputeSystem(computeSystem HcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem? +//sys hcsModifyServiceSettings(settings string, result **uint16) (hr error) = vmcompute.HcsModifyServiceSettings? +//sys hcsRegisterComputeSystemCallback(computeSystem HcsSystem, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback? +//sys hcsUnregisterComputeSystemCallback(callbackHandle HcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback? +//sys hcsSaveComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsSaveComputeSystem? + +//sys hcsCreateProcess(computeSystem HcsSystem, processParameters string, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess? +//sys hcsOpenProcess(computeSystem HcsSystem, pid uint32, process *HcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess? +//sys hcsCloseProcess(process HcsProcess) (hr error) = vmcompute.HcsCloseProcess? +//sys hcsTerminateProcess(process HcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess? +//sys hcsSignalProcess(process HcsProcess, options string, result **uint16) (hr error) = vmcompute.HcsSignalProcess? +//sys hcsGetProcessInfo(process HcsProcess, processInformation *HcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo? +//sys hcsGetProcessProperties(process HcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties? +//sys hcsModifyProcess(process HcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess? +//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties? +//sys hcsRegisterProcessCallback(process HcsProcess, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback? +//sys hcsUnregisterProcessCallback(callbackHandle HcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback? + +// errVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously +const errVmcomputeOperationPending = syscall.Errno(0xC0370103) + +// HcsSystem is the handle associated with a created compute system. +type HcsSystem syscall.Handle + +// HcsProcess is the handle associated with a created process in a compute +// system. +type HcsProcess syscall.Handle + +// HcsCallback is the handle associated with the function to call when events +// occur. +type HcsCallback syscall.Handle + +// HcsProcessInformation is the structure used when creating or getting process +// info. +type HcsProcessInformation struct { + // ProcessId is the pid of the created process. + ProcessId uint32 + reserved uint32 //nolint:structcheck + // StdInput is the handle associated with the stdin of the process. + StdInput syscall.Handle + // StdOutput is the handle associated with the stdout of the process. + StdOutput syscall.Handle + // StdError is the handle associated with the stderr of the process. + StdError syscall.Handle +} + +func execute(ctx gcontext.Context, timeout time.Duration, f func() error) error { + if timeout > 0 { + var cancel gcontext.CancelFunc + ctx, cancel = gcontext.WithTimeout(ctx, timeout) + defer cancel() + } + + done := make(chan error, 1) + go func() { + done <- f() + }() + select { + case <-ctx.Done(): + if ctx.Err() == gcontext.DeadlineExceeded { + log.G(ctx).WithField(logfields.Timeout, timeout). + Warning("Syscall did not complete within operation timeout. This may indicate a platform issue. If it appears to be making no forward progress, obtain the stacks and see if there is a syscall stuck in the platform API for a significant length of time.") + } + return ctx.Err() + case err := <-done: + return err + } +} + +func HcsEnumerateComputeSystems(ctx gcontext.Context, query string) (computeSystems, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsEnumerateComputeSystems") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("query", query)) + + return computeSystems, result, execute(ctx, timeout.SyscallWatcher, func() error { + var ( + computeSystemsp *uint16 + resultp *uint16 + ) + err := hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp) + if computeSystemsp != nil { + computeSystems = interop.ConvertAndFreeCoTaskMemString(computeSystemsp) + } + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsCreateComputeSystem(ctx gcontext.Context, id string, configuration string, identity syscall.Handle) (computeSystem HcsSystem, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsCreateComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes( + trace.StringAttribute("id", id), + trace.StringAttribute("configuration", configuration)) + + return computeSystem, result, execute(ctx, timeout.SystemCreate, func() error { + var resultp *uint16 + err := hcsCreateComputeSystem(id, configuration, identity, &computeSystem, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsOpenComputeSystem(ctx gcontext.Context, id string) (computeSystem HcsSystem, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsOpenComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + + return computeSystem, result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsOpenComputeSystem(id, &computeSystem, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsCloseComputeSystem(ctx gcontext.Context, computeSystem HcsSystem) (hr error) { + ctx, span := trace.StartSpan(ctx, "HcsCloseComputeSystem") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return execute(ctx, timeout.SyscallWatcher, func() error { + return hcsCloseComputeSystem(computeSystem) + }) +} + +func HcsStartComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsStartComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SystemStart, func() error { + var resultp *uint16 + err := hcsStartComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsShutdownComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsShutdownComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsShutdownComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsTerminateComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsTerminateComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsTerminateComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsPauseComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsPauseComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SystemPause, func() error { + var resultp *uint16 + err := hcsPauseComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsResumeComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsResumeComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SystemResume, func() error { + var resultp *uint16 + err := hcsResumeComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsGetComputeSystemProperties(ctx gcontext.Context, computeSystem HcsSystem, propertyQuery string) (properties, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsGetComputeSystemProperties") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("propertyQuery", propertyQuery)) + + return properties, result, execute(ctx, timeout.SyscallWatcher, func() error { + var ( + propertiesp *uint16 + resultp *uint16 + ) + err := hcsGetComputeSystemProperties(computeSystem, propertyQuery, &propertiesp, &resultp) + if propertiesp != nil { + properties = interop.ConvertAndFreeCoTaskMemString(propertiesp) + } + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsModifyComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, configuration string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsModifyComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("configuration", configuration)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsModifyComputeSystem(computeSystem, configuration, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsModifyServiceSettings(ctx gcontext.Context, settings string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsModifyServiceSettings") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("settings", settings)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsModifyServiceSettings(settings, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsRegisterComputeSystemCallback(ctx gcontext.Context, computeSystem HcsSystem, callback uintptr, context uintptr) (callbackHandle HcsCallback, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsRegisterComputeSystemCallback") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return callbackHandle, execute(ctx, timeout.SyscallWatcher, func() error { + return hcsRegisterComputeSystemCallback(computeSystem, callback, context, &callbackHandle) + }) +} + +func HcsUnregisterComputeSystemCallback(ctx gcontext.Context, callbackHandle HcsCallback) (hr error) { + ctx, span := trace.StartSpan(ctx, "HcsUnregisterComputeSystemCallback") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return execute(ctx, timeout.SyscallWatcher, func() error { + return hcsUnregisterComputeSystemCallback(callbackHandle) + }) +} + +func HcsCreateProcess(ctx gcontext.Context, computeSystem HcsSystem, processParameters string) (processInformation HcsProcessInformation, process HcsProcess, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsCreateProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("processParameters", processParameters)) + + return processInformation, process, result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsCreateProcess(computeSystem, processParameters, &processInformation, &process, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsOpenProcess(ctx gcontext.Context, computeSystem HcsSystem, pid uint32) (process HcsProcess, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsOpenProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.Int64Attribute("pid", int64(pid))) + + return process, result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsOpenProcess(computeSystem, pid, &process, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsCloseProcess(ctx gcontext.Context, process HcsProcess) (hr error) { + ctx, span := trace.StartSpan(ctx, "HcsCloseProcess") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return execute(ctx, timeout.SyscallWatcher, func() error { + return hcsCloseProcess(process) + }) +} + +func HcsTerminateProcess(ctx gcontext.Context, process HcsProcess) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsTerminateProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsTerminateProcess(process, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsSignalProcess(ctx gcontext.Context, process HcsProcess, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsSignalProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsSignalProcess(process, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsGetProcessInfo(ctx gcontext.Context, process HcsProcess) (processInformation HcsProcessInformation, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsGetProcessInfo") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + + return processInformation, result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsGetProcessInfo(process, &processInformation, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsGetProcessProperties(ctx gcontext.Context, process HcsProcess) (processProperties, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsGetProcessProperties") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + + return processProperties, result, execute(ctx, timeout.SyscallWatcher, func() error { + var ( + processPropertiesp *uint16 + resultp *uint16 + ) + err := hcsGetProcessProperties(process, &processPropertiesp, &resultp) + if processPropertiesp != nil { + processProperties = interop.ConvertAndFreeCoTaskMemString(processPropertiesp) + } + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsModifyProcess(ctx gcontext.Context, process HcsProcess, settings string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsModifyProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("settings", settings)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsModifyProcess(process, settings, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsGetServiceProperties(ctx gcontext.Context, propertyQuery string) (properties, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsGetServiceProperties") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("propertyQuery", propertyQuery)) + + return properties, result, execute(ctx, timeout.SyscallWatcher, func() error { + var ( + propertiesp *uint16 + resultp *uint16 + ) + err := hcsGetServiceProperties(propertyQuery, &propertiesp, &resultp) + if propertiesp != nil { + properties = interop.ConvertAndFreeCoTaskMemString(propertiesp) + } + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsRegisterProcessCallback(ctx gcontext.Context, process HcsProcess, callback uintptr, context uintptr) (callbackHandle HcsCallback, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsRegisterProcessCallback") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return callbackHandle, execute(ctx, timeout.SyscallWatcher, func() error { + return hcsRegisterProcessCallback(process, callback, context, &callbackHandle) + }) +} + +func HcsUnregisterProcessCallback(ctx gcontext.Context, callbackHandle HcsCallback) (hr error) { + ctx, span := trace.StartSpan(ctx, "HcsUnregisterProcessCallback") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return execute(ctx, timeout.SyscallWatcher, func() error { + return hcsUnregisterProcessCallback(callbackHandle) + }) +} + +func HcsSaveComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsSaveComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsSaveComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/zsyscall_windows.go similarity index 74% rename from vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go rename to vendor/github.com/Microsoft/hcsshim/internal/vmcompute/zsyscall_windows.go index fcd5cdc8..cae55058 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/zsyscall_windows.go @@ -1,6 +1,6 @@ // Code generated mksyscall_windows.exe DO NOT EDIT -package hcs +package vmcompute import ( "syscall" @@ -50,19 +50,21 @@ var ( procHcsResumeComputeSystem = modvmcompute.NewProc("HcsResumeComputeSystem") procHcsGetComputeSystemProperties = modvmcompute.NewProc("HcsGetComputeSystemProperties") procHcsModifyComputeSystem = modvmcompute.NewProc("HcsModifyComputeSystem") + procHcsModifyServiceSettings = modvmcompute.NewProc("HcsModifyServiceSettings") procHcsRegisterComputeSystemCallback = modvmcompute.NewProc("HcsRegisterComputeSystemCallback") procHcsUnregisterComputeSystemCallback = modvmcompute.NewProc("HcsUnregisterComputeSystemCallback") + procHcsSaveComputeSystem = modvmcompute.NewProc("HcsSaveComputeSystem") procHcsCreateProcess = modvmcompute.NewProc("HcsCreateProcess") procHcsOpenProcess = modvmcompute.NewProc("HcsOpenProcess") procHcsCloseProcess = modvmcompute.NewProc("HcsCloseProcess") procHcsTerminateProcess = modvmcompute.NewProc("HcsTerminateProcess") - - procHcsGetProcessInfo = modvmcompute.NewProc("HcsGetProcessInfo") - procHcsGetProcessProperties = modvmcompute.NewProc("HcsGetProcessProperties") - procHcsModifyProcess = modvmcompute.NewProc("HcsModifyProcess") - procHcsGetServiceProperties = modvmcompute.NewProc("HcsGetServiceProperties") - procHcsRegisterProcessCallback = modvmcompute.NewProc("HcsRegisterProcessCallback") - procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback") + procHcsSignalProcess = modvmcompute.NewProc("HcsSignalProcess") + procHcsGetProcessInfo = modvmcompute.NewProc("HcsGetProcessInfo") + procHcsGetProcessProperties = modvmcompute.NewProc("HcsGetProcessProperties") + procHcsModifyProcess = modvmcompute.NewProc("HcsModifyProcess") + procHcsGetServiceProperties = modvmcompute.NewProc("HcsGetServiceProperties") + procHcsRegisterProcessCallback = modvmcompute.NewProc("HcsRegisterProcessCallback") + procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback") ) func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) { @@ -88,7 +90,7 @@ func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result return } -func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) { +func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(id) if hr != nil { @@ -102,7 +104,7 @@ func hcsCreateComputeSystem(id string, configuration string, identity syscall.Ha return _hcsCreateComputeSystem(_p0, _p1, identity, computeSystem, result) } -func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) { +func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) { if hr = procHcsCreateComputeSystem.Find(); hr != nil { return } @@ -116,7 +118,7 @@ func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall return } -func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) { +func hcsOpenComputeSystem(id string, computeSystem *HcsSystem, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(id) if hr != nil { @@ -125,7 +127,7 @@ func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) return _hcsOpenComputeSystem(_p0, computeSystem, result) } -func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16) (hr error) { +func _hcsOpenComputeSystem(id *uint16, computeSystem *HcsSystem, result **uint16) (hr error) { if hr = procHcsOpenComputeSystem.Find(); hr != nil { return } @@ -139,7 +141,7 @@ func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16 return } -func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) { +func hcsCloseComputeSystem(computeSystem HcsSystem) (hr error) { if hr = procHcsCloseComputeSystem.Find(); hr != nil { return } @@ -153,7 +155,7 @@ func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) { return } -func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { +func hcsStartComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -162,7 +164,7 @@ func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uin return _hcsStartComputeSystem(computeSystem, _p0, result) } -func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { +func _hcsStartComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsStartComputeSystem.Find(); hr != nil { return } @@ -176,7 +178,7 @@ func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **u return } -func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { +func hcsShutdownComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -185,7 +187,7 @@ func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result ** return _hcsShutdownComputeSystem(computeSystem, _p0, result) } -func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { +func _hcsShutdownComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsShutdownComputeSystem.Find(); hr != nil { return } @@ -199,7 +201,7 @@ func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result return } -func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { +func hcsTerminateComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -208,7 +210,7 @@ func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result * return _hcsTerminateComputeSystem(computeSystem, _p0, result) } -func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { +func _hcsTerminateComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsTerminateComputeSystem.Find(); hr != nil { return } @@ -222,7 +224,7 @@ func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result return } -func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { +func hcsPauseComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -231,7 +233,7 @@ func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uin return _hcsPauseComputeSystem(computeSystem, _p0, result) } -func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { +func _hcsPauseComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsPauseComputeSystem.Find(); hr != nil { return } @@ -245,7 +247,7 @@ func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **u return } -func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { +func hcsResumeComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -254,7 +256,7 @@ func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **ui return _hcsResumeComputeSystem(computeSystem, _p0, result) } -func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { +func _hcsResumeComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsResumeComputeSystem.Find(); hr != nil { return } @@ -268,7 +270,7 @@ func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result ** return } -func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) { +func hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(propertyQuery) if hr != nil { @@ -277,7 +279,7 @@ func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string return _hcsGetComputeSystemProperties(computeSystem, _p0, properties, result) } -func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { +func _hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { if hr = procHcsGetComputeSystemProperties.Find(); hr != nil { return } @@ -291,7 +293,7 @@ func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint return } -func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) { +func hcsModifyComputeSystem(computeSystem HcsSystem, configuration string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(configuration) if hr != nil { @@ -300,7 +302,7 @@ func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, resul return _hcsModifyComputeSystem(computeSystem, _p0, result) } -func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, result **uint16) (hr error) { +func _hcsModifyComputeSystem(computeSystem HcsSystem, configuration *uint16, result **uint16) (hr error) { if hr = procHcsModifyComputeSystem.Find(); hr != nil { return } @@ -314,7 +316,30 @@ func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, res return } -func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) { +func hcsModifyServiceSettings(settings string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(settings) + if hr != nil { + return + } + return _hcsModifyServiceSettings(_p0, result) +} + +func _hcsModifyServiceSettings(settings *uint16, result **uint16) (hr error) { + if hr = procHcsModifyServiceSettings.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsModifyServiceSettings.Addr(), 2, uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result)), 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsRegisterComputeSystemCallback(computeSystem HcsSystem, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) { if hr = procHcsRegisterComputeSystemCallback.Find(); hr != nil { return } @@ -328,7 +353,7 @@ func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, return } -func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) { +func hcsUnregisterComputeSystemCallback(callbackHandle HcsCallback) (hr error) { if hr = procHcsUnregisterComputeSystemCallback.Find(); hr != nil { return } @@ -342,7 +367,30 @@ func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) { return } -func hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) { +func hcsSaveComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsSaveComputeSystem(computeSystem, _p0, result) +} + +func _hcsSaveComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { + if hr = procHcsSaveComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsSaveComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsCreateProcess(computeSystem HcsSystem, processParameters string, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(processParameters) if hr != nil { @@ -351,7 +399,7 @@ func hcsCreateProcess(computeSystem hcsSystem, processParameters string, process return _hcsCreateProcess(computeSystem, _p0, processInformation, process, result) } -func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) { +func _hcsCreateProcess(computeSystem HcsSystem, processParameters *uint16, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) { if hr = procHcsCreateProcess.Find(); hr != nil { return } @@ -365,7 +413,7 @@ func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, proce return } -func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) { +func hcsOpenProcess(computeSystem HcsSystem, pid uint32, process *HcsProcess, result **uint16) (hr error) { if hr = procHcsOpenProcess.Find(); hr != nil { return } @@ -379,7 +427,7 @@ func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, re return } -func hcsCloseProcess(process hcsProcess) (hr error) { +func hcsCloseProcess(process HcsProcess) (hr error) { if hr = procHcsCloseProcess.Find(); hr != nil { return } @@ -393,7 +441,7 @@ func hcsCloseProcess(process hcsProcess) (hr error) { return } -func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) { +func hcsTerminateProcess(process HcsProcess, result **uint16) (hr error) { if hr = procHcsTerminateProcess.Find(); hr != nil { return } @@ -407,7 +455,7 @@ func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) { return } -func hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) { +func hcsSignalProcess(process HcsProcess, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -416,11 +464,11 @@ func hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr e return _hcsSignalProcess(process, _p0, result) } -func _hcsSignalProcess(process hcsProcess, options *uint16, result **uint16) (hr error) { - if hr = procHcsTerminateProcess.Find(); hr != nil { +func _hcsSignalProcess(process HcsProcess, options *uint16, result **uint16) (hr error) { + if hr = procHcsSignalProcess.Find(); hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + r0, _, _ := syscall.Syscall(procHcsSignalProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -430,7 +478,7 @@ func _hcsSignalProcess(process hcsProcess, options *uint16, result **uint16) (hr return } -func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) { +func hcsGetProcessInfo(process HcsProcess, processInformation *HcsProcessInformation, result **uint16) (hr error) { if hr = procHcsGetProcessInfo.Find(); hr != nil { return } @@ -444,7 +492,7 @@ func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInforma return } -func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) { +func hcsGetProcessProperties(process HcsProcess, processProperties **uint16, result **uint16) (hr error) { if hr = procHcsGetProcessProperties.Find(); hr != nil { return } @@ -458,7 +506,7 @@ func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, res return } -func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) { +func hcsModifyProcess(process HcsProcess, settings string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(settings) if hr != nil { @@ -467,7 +515,7 @@ func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr return _hcsModifyProcess(process, _p0, result) } -func _hcsModifyProcess(process hcsProcess, settings *uint16, result **uint16) (hr error) { +func _hcsModifyProcess(process HcsProcess, settings *uint16, result **uint16) (hr error) { if hr = procHcsModifyProcess.Find(); hr != nil { return } @@ -504,7 +552,7 @@ func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result return } -func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) { +func hcsRegisterProcessCallback(process HcsProcess, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) { if hr = procHcsRegisterProcessCallback.Find(); hr != nil { return } @@ -518,7 +566,7 @@ func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context ui return } -func hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) { +func hcsUnregisterProcessCallback(callbackHandle HcsCallback) (hr error) { if hr = procHcsUnregisterProcessCallback.Find(); hr != nil { return } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/activatelayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/activatelayer.go index dcb91926..ff81ac2c 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/activatelayer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/activatelayer.go @@ -1,28 +1,23 @@ package wclayer import ( + "context" + "github.com/Microsoft/hcsshim/internal/hcserror" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/oc" + "go.opencensus.io/trace" ) // ActivateLayer will find the layer with the given id and mount it's filesystem. // For a read/write layer, the mounted filesystem will appear as a volume on the // host, while a read-only layer is generally expected to be a no-op. // An activated layer must later be deactivated via DeactivateLayer. -func ActivateLayer(path string) (err error) { +func ActivateLayer(ctx context.Context, path string) (err error) { title := "hcsshim::ActivateLayer" - fields := logrus.Fields{ - "path": path, - } - logrus.WithFields(fields).Debug(title) - defer func() { - if err != nil { - fields[logrus.ErrorKey] = err - logrus.WithFields(fields).Error(err) - } else { - logrus.WithFields(fields).Debug(title + " - succeeded") - } - }() + ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("path", path)) err = activateLayer(&stdDriverInfo, path) if err != nil { diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/baselayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/baselayer.go index 5784241d..3ec708d1 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/baselayer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/baselayer.go @@ -1,6 +1,7 @@ package wclayer import ( + "context" "errors" "os" "path/filepath" @@ -8,10 +9,16 @@ import ( "github.com/Microsoft/go-winio" "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/Microsoft/hcsshim/internal/oc" "github.com/Microsoft/hcsshim/internal/safefile" + "github.com/Microsoft/hcsshim/internal/winapi" + "go.opencensus.io/trace" ) type baseLayerWriter struct { + ctx context.Context + s *trace.Span + root *os.File f *os.File bw *winio.BackupFileWriter @@ -31,7 +38,7 @@ type dirInfo struct { func reapplyDirectoryTimes(root *os.File, dis []dirInfo) error { for i := range dis { di := &dis[len(dis)-i-1] // reverse order: process child directories first - f, err := safefile.OpenRelative(di.path, root, syscall.GENERIC_READ|syscall.GENERIC_WRITE, syscall.FILE_SHARE_READ, safefile.FILE_OPEN, safefile.FILE_DIRECTORY_FILE) + f, err := safefile.OpenRelative(di.path, root, syscall.GENERIC_READ|syscall.GENERIC_WRITE, syscall.FILE_SHARE_READ, winapi.FILE_OPEN, winapi.FILE_DIRECTORY_FILE|syscall.FILE_FLAG_OPEN_REPARSE_POINT) if err != nil { return err } @@ -41,6 +48,7 @@ func reapplyDirectoryTimes(root *os.File, dis []dirInfo) error { if err != nil { return err } + } return nil } @@ -86,14 +94,12 @@ func (w *baseLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) (err e extraFlags := uint32(0) if fileInfo.FileAttributes&syscall.FILE_ATTRIBUTE_DIRECTORY != 0 { - extraFlags |= safefile.FILE_DIRECTORY_FILE - if fileInfo.FileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT == 0 { - w.dirInfo = append(w.dirInfo, dirInfo{name, *fileInfo}) - } + extraFlags |= winapi.FILE_DIRECTORY_FILE + w.dirInfo = append(w.dirInfo, dirInfo{name, *fileInfo}) } mode := uint32(syscall.GENERIC_READ | syscall.GENERIC_WRITE | winio.WRITE_DAC | winio.WRITE_OWNER | winio.ACCESS_SYSTEM_SECURITY) - f, err = safefile.OpenRelative(name, w.root, mode, syscall.FILE_SHARE_READ, safefile.FILE_CREATE, extraFlags) + f, err = safefile.OpenRelative(name, w.root, mode, syscall.FILE_SHARE_READ, winapi.FILE_CREATE, extraFlags) if err != nil { return hcserror.New(err, "Failed to safefile.OpenRelative", name) } @@ -136,12 +142,15 @@ func (w *baseLayerWriter) Write(b []byte) (int, error) { return n, err } -func (w *baseLayerWriter) Close() error { +func (w *baseLayerWriter) Close() (err error) { + defer w.s.End() + defer func() { oc.SetSpanStatus(w.s, err) }() defer func() { w.root.Close() w.root = nil }() - err := w.closeCurrentFile() + + err = w.closeCurrentFile() if err != nil { return err } @@ -153,7 +162,7 @@ func (w *baseLayerWriter) Close() error { return err } - err = ProcessBaseLayer(w.root.Name()) + err = ProcessBaseLayer(w.ctx, w.root.Name()) if err != nil { return err } @@ -163,7 +172,7 @@ func (w *baseLayerWriter) Close() error { if err != nil { return err } - err = ProcessUtilityVMImage(filepath.Join(w.root.Name(), "UtilityVM")) + err = ProcessUtilityVMImage(w.ctx, filepath.Join(w.root.Name(), "UtilityVM")) if err != nil { return err } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createlayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createlayer.go index be2bc3fd..ffee31ab 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createlayer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createlayer.go @@ -1,27 +1,23 @@ package wclayer import ( + "context" + "github.com/Microsoft/hcsshim/internal/hcserror" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/oc" + "go.opencensus.io/trace" ) // CreateLayer creates a new, empty, read-only layer on the filesystem based on // the parent layer provided. -func CreateLayer(path, parent string) (err error) { +func CreateLayer(ctx context.Context, path, parent string) (err error) { title := "hcsshim::CreateLayer" - fields := logrus.Fields{ - "parent": parent, - "path": path, - } - logrus.WithFields(fields).Debug(title) - defer func() { - if err != nil { - fields[logrus.ErrorKey] = err - logrus.WithFields(fields).Error(err) - } else { - logrus.WithFields(fields).Debug(title + " - succeeded") - } - }() + ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("path", path), + trace.StringAttribute("parent", parent)) err = createLayer(&stdDriverInfo, path, parent) if err != nil { diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createscratchlayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createscratchlayer.go index 7e335128..5a3809ae 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createscratchlayer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createscratchlayer.go @@ -1,31 +1,27 @@ package wclayer import ( + "context" + "strings" + "github.com/Microsoft/hcsshim/internal/hcserror" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/oc" + "go.opencensus.io/trace" ) // CreateScratchLayer creates and populates new read-write layer for use by a container. -// This requires both the id of the direct parent layer, as well as the full list -// of paths to all parent layers up to the base (and including the direct parent -// whose id was provided). -func CreateScratchLayer(path string, parentLayerPaths []string) (err error) { +// This requires the full list of paths to all parent layers up to the base +func CreateScratchLayer(ctx context.Context, path string, parentLayerPaths []string) (err error) { title := "hcsshim::CreateScratchLayer" - fields := logrus.Fields{ - "path": path, - } - logrus.WithFields(fields).Debug(title) - defer func() { - if err != nil { - fields[logrus.ErrorKey] = err - logrus.WithFields(fields).Error(err) - } else { - logrus.WithFields(fields).Debug(title + " - succeeded") - } - }() + ctx, span := trace.StartSpan(ctx, title) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("path", path), + trace.StringAttribute("parentLayerPaths", strings.Join(parentLayerPaths, ", "))) // Generate layer descriptors - layers, err := layerPathsToDescriptors(parentLayerPaths) + layers, err := layerPathsToDescriptors(ctx, parentLayerPaths) if err != nil { return err } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/deactivatelayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/deactivatelayer.go index 2dd5d571..d5bf2f5b 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/deactivatelayer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/deactivatelayer.go @@ -1,25 +1,20 @@ package wclayer import ( + "context" + "github.com/Microsoft/hcsshim/internal/hcserror" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/oc" + "go.opencensus.io/trace" ) // DeactivateLayer will dismount a layer that was mounted via ActivateLayer. -func DeactivateLayer(path string) (err error) { +func DeactivateLayer(ctx context.Context, path string) (err error) { title := "hcsshim::DeactivateLayer" - fields := logrus.Fields{ - "path": path, - } - logrus.WithFields(fields).Debug(title) - defer func() { - if err != nil { - fields[logrus.ErrorKey] = err - logrus.WithFields(fields).Error(err) - } else { - logrus.WithFields(fields).Debug(title + " - succeeded") - } - }() + ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("path", path)) err = deactivateLayer(&stdDriverInfo, path) if err != nil { diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/destroylayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/destroylayer.go index 4da690c2..787054e7 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/destroylayer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/destroylayer.go @@ -1,26 +1,21 @@ package wclayer import ( + "context" + "github.com/Microsoft/hcsshim/internal/hcserror" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/oc" + "go.opencensus.io/trace" ) // DestroyLayer will remove the on-disk files representing the layer with the given // path, including that layer's containing folder, if any. -func DestroyLayer(path string) (err error) { +func DestroyLayer(ctx context.Context, path string) (err error) { title := "hcsshim::DestroyLayer" - fields := logrus.Fields{ - "path": path, - } - logrus.WithFields(fields).Debug(title) - defer func() { - if err != nil { - fields[logrus.ErrorKey] = err - logrus.WithFields(fields).Error(err) - } else { - logrus.WithFields(fields).Debug(title + " - succeeded") - } - }() + ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("path", path)) err = destroyLayer(&stdDriverInfo, path) if err != nil { diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go index 651676fb..93f27da8 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go @@ -1,30 +1,140 @@ package wclayer import ( + "context" + "os" + "path/filepath" + "syscall" + "unsafe" + "github.com/Microsoft/hcsshim/internal/hcserror" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/oc" + "github.com/Microsoft/hcsshim/osversion" + "go.opencensus.io/trace" ) // ExpandScratchSize expands the size of a layer to at least size bytes. -func ExpandScratchSize(path string, size uint64) (err error) { +func ExpandScratchSize(ctx context.Context, path string, size uint64) (err error) { title := "hcsshim::ExpandScratchSize" - fields := logrus.Fields{ - "path": path, - "size": size, - } - logrus.WithFields(fields).Debug(title) - defer func() { - if err != nil { - fields[logrus.ErrorKey] = err - logrus.WithFields(fields).Error(err) - } else { - logrus.WithFields(fields).Debug(title + " - succeeded") - } - }() + ctx, span := trace.StartSpan(ctx, title) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("path", path), + trace.Int64Attribute("size", int64(size))) err = expandSandboxSize(&stdDriverInfo, path, size) if err != nil { return hcserror.New(err, title+" - failed", "") } + + // Manually expand the volume now in order to work around bugs in 19H1 and + // prerelease versions of Vb. Remove once this is fixed in Windows. + if build := osversion.Get().Build; build >= osversion.V19H1 && build < 19020 { + err = expandSandboxVolume(ctx, path) + if err != nil { + return err + } + } + return nil +} + +type virtualStorageType struct { + DeviceID uint32 + VendorID [16]byte +} + +type openVersion2 struct { + GetInfoOnly int32 // bool but 4-byte aligned + ReadOnly int32 // bool but 4-byte aligned + ResiliencyGUID [16]byte // GUID +} + +type openVirtualDiskParameters struct { + Version uint32 // Must always be set to 2 + Version2 openVersion2 +} + +func attachVhd(path string) (syscall.Handle, error) { + var ( + defaultType virtualStorageType + handle syscall.Handle + ) + parameters := openVirtualDiskParameters{Version: 2} + err := openVirtualDisk( + &defaultType, + path, + 0, + 0, + ¶meters, + &handle) + if err != nil { + return 0, &os.PathError{Op: "OpenVirtualDisk", Path: path, Err: err} + } + err = attachVirtualDisk(handle, 0, 0, 0, 0, 0) + if err != nil { + syscall.Close(handle) + return 0, &os.PathError{Op: "AttachVirtualDisk", Path: path, Err: err} + } + return handle, nil +} + +func expandSandboxVolume(ctx context.Context, path string) error { + // Mount the sandbox VHD temporarily. + vhdPath := filepath.Join(path, "sandbox.vhdx") + vhd, err := attachVhd(vhdPath) + if err != nil { + return &os.PathError{Op: "OpenVirtualDisk", Path: vhdPath, Err: err} + } + defer syscall.Close(vhd) + + // Open the volume. + volumePath, err := GetLayerMountPath(ctx, path) + if err != nil { + return err + } + if volumePath[len(volumePath)-1] == '\\' { + volumePath = volumePath[:len(volumePath)-1] + } + volume, err := os.OpenFile(volumePath, os.O_RDWR, 0) + if err != nil { + return err + } + defer volume.Close() + + // Get the volume's underlying partition size in NTFS clusters. + var ( + partitionSize int64 + bytes uint32 + ) + const _IOCTL_DISK_GET_LENGTH_INFO = 0x0007405C + err = syscall.DeviceIoControl(syscall.Handle(volume.Fd()), _IOCTL_DISK_GET_LENGTH_INFO, nil, 0, (*byte)(unsafe.Pointer(&partitionSize)), 8, &bytes, nil) + if err != nil { + return &os.PathError{Op: "IOCTL_DISK_GET_LENGTH_INFO", Path: volume.Name(), Err: err} + } + const ( + clusterSize = 4096 + sectorSize = 512 + ) + targetClusters := partitionSize / clusterSize + + // Get the volume's current size in NTFS clusters. + var volumeSize int64 + err = getDiskFreeSpaceEx(volume.Name()+"\\", nil, &volumeSize, nil) + if err != nil { + return &os.PathError{Op: "GetDiskFreeSpaceEx", Path: volume.Name(), Err: err} + } + volumeClusters := volumeSize / clusterSize + + // Only resize the volume if there is space to grow, otherwise this will + // fail with invalid parameter. NTFS reserves one cluster. + if volumeClusters+1 < targetClusters { + targetSectors := targetClusters * (clusterSize / sectorSize) + const _FSCTL_EXTEND_VOLUME = 0x000900F0 + err = syscall.DeviceIoControl(syscall.Handle(volume.Fd()), _FSCTL_EXTEND_VOLUME, (*byte)(unsafe.Pointer(&targetSectors)), 8, nil, 0, &bytes, nil) + if err != nil { + return &os.PathError{Op: "FSCTL_EXTEND_VOLUME", Path: volume.Name(), Err: err} + } + } return nil } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/exportlayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/exportlayer.go index 0425b339..09f0de1a 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/exportlayer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/exportlayer.go @@ -1,12 +1,15 @@ package wclayer import ( + "context" "io/ioutil" "os" + "strings" "github.com/Microsoft/go-winio" "github.com/Microsoft/hcsshim/internal/hcserror" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/oc" + "go.opencensus.io/trace" ) // ExportLayer will create a folder at exportFolderPath and fill that folder with @@ -14,24 +17,18 @@ import ( // format includes any metadata required for later importing the layer (using // ImportLayer), and requires the full list of parent layer paths in order to // perform the export. -func ExportLayer(path string, exportFolderPath string, parentLayerPaths []string) (err error) { +func ExportLayer(ctx context.Context, path string, exportFolderPath string, parentLayerPaths []string) (err error) { title := "hcsshim::ExportLayer" - fields := logrus.Fields{ - "path": path, - "exportFolderPath": exportFolderPath, - } - logrus.WithFields(fields).Debug(title) - defer func() { - if err != nil { - fields[logrus.ErrorKey] = err - logrus.WithFields(fields).Error(err) - } else { - logrus.WithFields(fields).Debug(title + " - succeeded") - } - }() + ctx, span := trace.StartSpan(ctx, title) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("path", path), + trace.StringAttribute("exportFolderPath", exportFolderPath), + trace.StringAttribute("parentLayerPaths", strings.Join(parentLayerPaths, ", "))) // Generate layer descriptors - layers, err := layerPathsToDescriptors(parentLayerPaths) + layers, err := layerPathsToDescriptors(ctx, parentLayerPaths) if err != nil { return err } @@ -52,25 +49,46 @@ type LayerReader interface { // NewLayerReader returns a new layer reader for reading the contents of an on-disk layer. // The caller must have taken the SeBackupPrivilege privilege // to call this and any methods on the resulting LayerReader. -func NewLayerReader(path string, parentLayerPaths []string) (LayerReader, error) { +func NewLayerReader(ctx context.Context, path string, parentLayerPaths []string) (_ LayerReader, err error) { + ctx, span := trace.StartSpan(ctx, "hcsshim::NewLayerReader") + defer func() { + if err != nil { + oc.SetSpanStatus(span, err) + span.End() + } + }() + span.AddAttributes( + trace.StringAttribute("path", path), + trace.StringAttribute("parentLayerPaths", strings.Join(parentLayerPaths, ", "))) + exportPath, err := ioutil.TempDir("", "hcs") if err != nil { return nil, err } - err = ExportLayer(path, exportPath, parentLayerPaths) + err = ExportLayer(ctx, path, exportPath, parentLayerPaths) if err != nil { os.RemoveAll(exportPath) return nil, err } - return &legacyLayerReaderWrapper{newLegacyLayerReader(exportPath)}, nil + return &legacyLayerReaderWrapper{ + ctx: ctx, + s: span, + legacyLayerReader: newLegacyLayerReader(exportPath), + }, nil } type legacyLayerReaderWrapper struct { + ctx context.Context + s *trace.Span + *legacyLayerReader } -func (r *legacyLayerReaderWrapper) Close() error { - err := r.legacyLayerReader.Close() +func (r *legacyLayerReaderWrapper) Close() (err error) { + defer r.s.End() + defer func() { oc.SetSpanStatus(r.s, err) }() + + err = r.legacyLayerReader.Close() os.RemoveAll(r.root) return err } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getlayermountpath.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getlayermountpath.go index d60b6ed5..4d22d0ec 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getlayermountpath.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getlayermountpath.go @@ -1,36 +1,30 @@ package wclayer import ( + "context" "syscall" "github.com/Microsoft/hcsshim/internal/hcserror" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/log" + "github.com/Microsoft/hcsshim/internal/oc" + "go.opencensus.io/trace" ) // GetLayerMountPath will look for a mounted layer with the given path and return // the path at which that layer can be accessed. This path may be a volume path // if the layer is a mounted read-write layer, otherwise it is expected to be the // folder path at which the layer is stored. -func GetLayerMountPath(path string) (_ string, err error) { +func GetLayerMountPath(ctx context.Context, path string) (_ string, err error) { title := "hcsshim::GetLayerMountPath" - fields := logrus.Fields{ - "path": path, - } - logrus.WithFields(fields).Debug(title) - defer func() { - if err != nil { - fields[logrus.ErrorKey] = err - logrus.WithFields(fields).Error(err) - } else { - logrus.WithFields(fields).Debug(title + " - succeeded") - } - }() + ctx, span := trace.StartSpan(ctx, title) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("path", path)) - var mountPathLength uintptr - mountPathLength = 0 + var mountPathLength uintptr = 0 // Call the procedure itself. - logrus.WithFields(fields).Debug("Calling proc (1)") + log.G(ctx).Debug("Calling proc (1)") err = getLayerMountPath(&stdDriverInfo, path, &mountPathLength, nil) if err != nil { return "", hcserror.New(err, title+" - failed", "(first call)") @@ -44,13 +38,13 @@ func GetLayerMountPath(path string) (_ string, err error) { mountPathp[0] = 0 // Call the procedure again - logrus.WithFields(fields).Debug("Calling proc (2)") + log.G(ctx).Debug("Calling proc (2)") err = getLayerMountPath(&stdDriverInfo, path, &mountPathLength, &mountPathp[0]) if err != nil { return "", hcserror.New(err, title+" - failed", "(second call)") } mountPath := syscall.UTF16ToString(mountPathp[0:]) - fields["mountPath"] = mountPath + span.AddAttributes(trace.StringAttribute("mountPath", mountPath)) return mountPath, nil } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getsharedbaseimages.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getsharedbaseimages.go index dbd83ef2..bcc8fbd4 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getsharedbaseimages.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getsharedbaseimages.go @@ -1,29 +1,29 @@ package wclayer import ( + "context" + "github.com/Microsoft/hcsshim/internal/hcserror" "github.com/Microsoft/hcsshim/internal/interop" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/oc" + "go.opencensus.io/trace" ) // GetSharedBaseImages will enumerate the images stored in the common central // image store and return descriptive info about those images for the purpose // of registering them with the graphdriver, graph, and tagstore. -func GetSharedBaseImages() (imageData string, err error) { +func GetSharedBaseImages(ctx context.Context) (_ string, err error) { title := "hcsshim::GetSharedBaseImages" - logrus.Debug(title) - defer func() { - if err != nil { - logrus.WithError(err).Error(err) - } else { - logrus.WithField("imageData", imageData).Debug(title + " - succeeded") - } - }() + ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() var buffer *uint16 err = getBaseImages(&buffer) if err != nil { return "", hcserror.New(err, title+" - failed", "") } - return interop.ConvertAndFreeCoTaskMemString(buffer), nil + imageData := interop.ConvertAndFreeCoTaskMemString(buffer) + span.AddAttributes(trace.StringAttribute("imageData", imageData)) + return imageData, nil } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/grantvmaccess.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/grantvmaccess.go index 05735df6..3eaca278 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/grantvmaccess.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/grantvmaccess.go @@ -1,26 +1,22 @@ package wclayer import ( + "context" + "github.com/Microsoft/hcsshim/internal/hcserror" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/oc" + "go.opencensus.io/trace" ) // GrantVmAccess adds access to a file for a given VM -func GrantVmAccess(vmid string, filepath string) (err error) { +func GrantVmAccess(ctx context.Context, vmid string, filepath string) (err error) { title := "hcsshim::GrantVmAccess" - fields := logrus.Fields{ - "vm-id": vmid, - "path": filepath, - } - logrus.WithFields(fields).Debug(title) - defer func() { - if err != nil { - fields[logrus.ErrorKey] = err - logrus.WithFields(fields).Error(err) - } else { - logrus.WithFields(fields).Debug(title + " - succeeded") - } - }() + ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("vm-id", vmid), + trace.StringAttribute("path", filepath)) err = grantVmAccess(vmid, filepath) if err != nil { diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/importlayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/importlayer.go index 76a804f2..b3c150d6 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/importlayer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/importlayer.go @@ -1,38 +1,35 @@ package wclayer import ( + "context" "io/ioutil" "os" "path/filepath" + "strings" "github.com/Microsoft/go-winio" "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/Microsoft/hcsshim/internal/oc" "github.com/Microsoft/hcsshim/internal/safefile" - "github.com/sirupsen/logrus" + "go.opencensus.io/trace" ) // ImportLayer will take the contents of the folder at importFolderPath and import // that into a layer with the id layerId. Note that in order to correctly populate // the layer and interperet the transport format, all parent layers must already // be present on the system at the paths provided in parentLayerPaths. -func ImportLayer(path string, importFolderPath string, parentLayerPaths []string) (err error) { +func ImportLayer(ctx context.Context, path string, importFolderPath string, parentLayerPaths []string) (err error) { title := "hcsshim::ImportLayer" - fields := logrus.Fields{ - "path": path, - "importFolderPath": importFolderPath, - } - logrus.WithFields(fields).Debug(title) - defer func() { - if err != nil { - fields[logrus.ErrorKey] = err - logrus.WithFields(fields).Error(err) - } else { - logrus.WithFields(fields).Debug(title + " - succeeded") - } - }() + ctx, span := trace.StartSpan(ctx, title) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("path", path), + trace.StringAttribute("importFolderPath", importFolderPath), + trace.StringAttribute("parentLayerPaths", strings.Join(parentLayerPaths, ", "))) // Generate layer descriptors - layers, err := layerPathsToDescriptors(parentLayerPaths) + layers, err := layerPathsToDescriptors(ctx, parentLayerPaths) if err != nil { return err } @@ -60,20 +57,26 @@ type LayerWriter interface { } type legacyLayerWriterWrapper struct { + ctx context.Context + s *trace.Span + *legacyLayerWriter path string parentLayerPaths []string } -func (r *legacyLayerWriterWrapper) Close() error { +func (r *legacyLayerWriterWrapper) Close() (err error) { + defer r.s.End() + defer func() { oc.SetSpanStatus(r.s, err) }() defer os.RemoveAll(r.root.Name()) defer r.legacyLayerWriter.CloseRoots() - err := r.legacyLayerWriter.Close() + + err = r.legacyLayerWriter.Close() if err != nil { return err } - if err = ImportLayer(r.destRoot.Name(), r.path, r.parentLayerPaths); err != nil { + if err = ImportLayer(r.ctx, r.destRoot.Name(), r.path, r.parentLayerPaths); err != nil { return err } for _, name := range r.Tombstones { @@ -90,13 +93,26 @@ func (r *legacyLayerWriterWrapper) Close() error { return err } } + + // The reapplyDirectoryTimes must be called AFTER we are done with Tombstone + // deletion and hard link creation. This is because Tombstone deletion and hard link + // creation updates the directory last write timestamps so that will change the + // timestamps added by the `Add` call. Some container applications depend on the + // correctness of these timestamps and so we should change the timestamps back to + // the original value (i.e the value provided in the Add call) after this + // processing is done. + err = reapplyDirectoryTimes(r.destRoot, r.changedDi) + if err != nil { + return err + } + // Prepare the utility VM for use if one is present in the layer. if r.HasUtilityVM { err := safefile.EnsureNotReparsePointRelative("UtilityVM", r.destRoot) if err != nil { return err } - err = ProcessUtilityVMImage(filepath.Join(r.destRoot.Name(), "UtilityVM")) + err = ProcessUtilityVMImage(r.ctx, filepath.Join(r.destRoot.Name(), "UtilityVM")) if err != nil { return err } @@ -107,7 +123,18 @@ func (r *legacyLayerWriterWrapper) Close() error { // NewLayerWriter returns a new layer writer for creating a layer on disk. // The caller must have taken the SeBackupPrivilege and SeRestorePrivilege privileges // to call this and any methods on the resulting LayerWriter. -func NewLayerWriter(path string, parentLayerPaths []string) (LayerWriter, error) { +func NewLayerWriter(ctx context.Context, path string, parentLayerPaths []string) (_ LayerWriter, err error) { + ctx, span := trace.StartSpan(ctx, "hcsshim::NewLayerWriter") + defer func() { + if err != nil { + oc.SetSpanStatus(span, err) + span.End() + } + }() + span.AddAttributes( + trace.StringAttribute("path", path), + trace.StringAttribute("parentLayerPaths", strings.Join(parentLayerPaths, ", "))) + if len(parentLayerPaths) == 0 { // This is a base layer. It gets imported differently. f, err := safefile.OpenRoot(path) @@ -115,6 +142,8 @@ func NewLayerWriter(path string, parentLayerPaths []string) (LayerWriter, error) return nil, err } return &baseLayerWriter{ + ctx: ctx, + s: span, root: f, }, nil } @@ -128,6 +157,8 @@ func NewLayerWriter(path string, parentLayerPaths []string) (LayerWriter, error) return nil, err } return &legacyLayerWriterWrapper{ + ctx: ctx, + s: span, legacyLayerWriter: w, path: importPath, parentLayerPaths: parentLayerPaths, diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerexists.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerexists.go index 258167a5..c6999973 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerexists.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerexists.go @@ -1,26 +1,21 @@ package wclayer import ( + "context" + "github.com/Microsoft/hcsshim/internal/hcserror" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/oc" + "go.opencensus.io/trace" ) // LayerExists will return true if a layer with the given id exists and is known // to the system. -func LayerExists(path string) (_ bool, err error) { +func LayerExists(ctx context.Context, path string) (_ bool, err error) { title := "hcsshim::LayerExists" - fields := logrus.Fields{ - "path": path, - } - logrus.WithFields(fields).Debug(title) - defer func() { - if err != nil { - fields[logrus.ErrorKey] = err - logrus.WithFields(fields).Error(err) - } else { - logrus.WithFields(fields).Debug(title + " - succeeded") - } - }() + ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("path", path)) // Call the procedure itself. var exists uint32 @@ -28,6 +23,6 @@ func LayerExists(path string) (_ bool, err error) { if err != nil { return false, hcserror.New(err, title+" - failed", "") } - fields["layer-exists"] = exists != 0 + span.AddAttributes(trace.BoolAttribute("layer-exists", exists != 0)) return exists != 0, nil } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go index 90df3bed..0ce34a30 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go @@ -1,13 +1,22 @@ package wclayer import ( + "context" "path/filepath" - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" + "github.com/Microsoft/hcsshim/internal/oc" + "go.opencensus.io/trace" ) // LayerID returns the layer ID of a layer on disk. -func LayerID(path string) (guid.GUID, error) { +func LayerID(ctx context.Context, path string) (_ guid.GUID, err error) { + title := "hcsshim::LayerID" + ctx, span := trace.StartSpan(ctx, title) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("path", path)) + _, file := filepath.Split(path) - return NameToGuid(file) + return NameToGuid(ctx, file) } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go index 6d0ae8a0..1ec893c6 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go @@ -4,9 +4,10 @@ package wclayer // functionality. import ( + "context" "syscall" - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" "github.com/sirupsen/logrus" ) @@ -68,12 +69,12 @@ type WC_LAYER_DESCRIPTOR struct { Pathp *uint16 } -func layerPathsToDescriptors(parentLayerPaths []string) ([]WC_LAYER_DESCRIPTOR, error) { +func layerPathsToDescriptors(ctx context.Context, parentLayerPaths []string) ([]WC_LAYER_DESCRIPTOR, error) { // Array of descriptors that gets constructed. var layers []WC_LAYER_DESCRIPTOR for i := 0; i < len(parentLayerPaths); i++ { - g, err := LayerID(parentLayerPaths[i]) + g, err := LayerID(ctx, parentLayerPaths[i]) if err != nil { logrus.WithError(err).Debug("Failed to convert name to guid") return nil, err diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/legacy.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/legacy.go index b8ea5d26..83ba72cf 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/legacy.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/legacy.go @@ -15,6 +15,7 @@ import ( "github.com/Microsoft/go-winio" "github.com/Microsoft/hcsshim/internal/longpath" "github.com/Microsoft/hcsshim/internal/safefile" + "github.com/Microsoft/hcsshim/internal/winapi" ) var errorIterationCanceled = errors.New("") @@ -341,7 +342,7 @@ type legacyLayerWriter struct { backupWriter *winio.BackupFileWriter Tombstones []string HasUtilityVM bool - uvmDi []dirInfo + changedDi []dirInfo addedFiles map[string]bool PendingLinks []pendingLink pendingDirs []pendingDir @@ -389,7 +390,7 @@ func (w *legacyLayerWriter) CloseRoots() { w.destRoot = nil } for i := range w.parentRoots { - w.parentRoots[i].Close() + _ = w.parentRoots[i].Close() } w.parentRoots = nil } @@ -472,8 +473,8 @@ func copyFileWithMetadata(srcRoot, destRoot *os.File, subPath string, isDir bool srcRoot, syscall.GENERIC_READ|winio.ACCESS_SYSTEM_SECURITY, syscall.FILE_SHARE_READ, - safefile.FILE_OPEN, - safefile.FILE_OPEN_REPARSE_POINT) + winapi.FILE_OPEN, + winapi.FILE_OPEN_REPARSE_POINT) if err != nil { return nil, err } @@ -488,14 +489,14 @@ func copyFileWithMetadata(srcRoot, destRoot *os.File, subPath string, isDir bool extraFlags := uint32(0) if isDir { - extraFlags |= safefile.FILE_DIRECTORY_FILE + extraFlags |= winapi.FILE_DIRECTORY_FILE } dest, err := safefile.OpenRelative( subPath, destRoot, syscall.GENERIC_READ|syscall.GENERIC_WRITE|winio.WRITE_DAC|winio.WRITE_OWNER|winio.ACCESS_SYSTEM_SECURITY, syscall.FILE_SHARE_READ, - safefile.FILE_CREATE, + winapi.FILE_CREATE, extraFlags) if err != nil { return nil, err @@ -555,7 +556,7 @@ func cloneTree(srcRoot *os.File, destRoot *os.File, subPath string, mutatedFiles if err != nil { return err } - if isDir && !isReparsePoint { + if isDir { di = append(di, dirInfo{path: relPath, fileInfo: *fi}) } } else { @@ -583,6 +584,10 @@ func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) erro return w.initUtilityVM() } + if (fileInfo.FileAttributes & syscall.FILE_ATTRIBUTE_DIRECTORY) != 0 { + w.changedDi = append(w.changedDi, dirInfo{path: name, fileInfo: *fileInfo}) + } + name = filepath.Clean(name) if hasPathPrefix(name, utilityVMPath) { if !w.HasUtilityVM { @@ -591,7 +596,7 @@ func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) erro if !hasPathPrefix(name, utilityVMFilesPath) && name != utilityVMFilesPath { return errors.New("invalid UtilityVM layer") } - createDisposition := uint32(safefile.FILE_OPEN) + createDisposition := uint32(winapi.FILE_OPEN) if (fileInfo.FileAttributes & syscall.FILE_ATTRIBUTE_DIRECTORY) != 0 { st, err := safefile.LstatRelative(name, w.destRoot) if err != nil && !os.IsNotExist(err) { @@ -612,16 +617,13 @@ func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) erro return err } } - if fileInfo.FileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT == 0 { - w.uvmDi = append(w.uvmDi, dirInfo{path: name, fileInfo: *fileInfo}) - } } else { // Overwrite any existing hard link. err := safefile.RemoveRelative(name, w.destRoot) if err != nil && !os.IsNotExist(err) { return err } - createDisposition = safefile.FILE_CREATE + createDisposition = winapi.FILE_CREATE } f, err := safefile.OpenRelative( @@ -630,7 +632,7 @@ func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) erro syscall.GENERIC_READ|syscall.GENERIC_WRITE|winio.WRITE_DAC|winio.WRITE_OWNER|winio.ACCESS_SYSTEM_SECURITY, syscall.FILE_SHARE_READ, createDisposition, - safefile.FILE_OPEN_REPARSE_POINT, + winapi.FILE_OPEN_REPARSE_POINT, ) if err != nil { return err @@ -638,7 +640,7 @@ func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) erro defer func() { if f != nil { f.Close() - safefile.RemoveRelative(name, w.destRoot) + _ = safefile.RemoveRelative(name, w.destRoot) } }() @@ -667,14 +669,14 @@ func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) erro w.currentIsDir = true } - f, err := safefile.OpenRelative(fname, w.root, syscall.GENERIC_READ|syscall.GENERIC_WRITE, syscall.FILE_SHARE_READ, safefile.FILE_CREATE, 0) + f, err := safefile.OpenRelative(fname, w.root, syscall.GENERIC_READ|syscall.GENERIC_WRITE, syscall.FILE_SHARE_READ, winapi.FILE_CREATE, 0) if err != nil { return err } defer func() { if f != nil { f.Close() - safefile.RemoveRelative(fname, w.root) + _ = safefile.RemoveRelative(fname, w.root) } }() @@ -805,11 +807,5 @@ func (w *legacyLayerWriter) Close() error { return err } } - if w.HasUtilityVM { - err := reapplyDirectoryTimes(w.destRoot, w.uvmDi) - if err != nil { - return err - } - } return nil } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go index 45a63cf6..bcf39c6b 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go @@ -1,34 +1,29 @@ package wclayer import ( - "github.com/Microsoft/hcsshim/internal/guid" + "context" + + "github.com/Microsoft/go-winio/pkg/guid" "github.com/Microsoft/hcsshim/internal/hcserror" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/oc" + "go.opencensus.io/trace" ) // NameToGuid converts the given string into a GUID using the algorithm in the // Host Compute Service, ensuring GUIDs generated with the same string are common // across all clients. -func NameToGuid(name string) (id guid.GUID, err error) { +func NameToGuid(ctx context.Context, name string) (_ guid.GUID, err error) { title := "hcsshim::NameToGuid" - fields := logrus.Fields{ - "name": name, - } - logrus.WithFields(fields).Debug(title) - defer func() { - if err != nil { - fields[logrus.ErrorKey] = err - logrus.WithFields(fields).Error(err) - } else { - logrus.WithFields(fields).Debug(title + " - succeeded") - } - }() + ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("name", name)) + var id guid.GUID err = nameToGuid(name, &id) if err != nil { - err = hcserror.New(err, title+" - failed", "") - return + return guid.GUID{}, hcserror.New(err, title+" - failed", "") } - fields["guid"] = id.String() - return + span.AddAttributes(trace.StringAttribute("guid", id.String())) + return id, nil } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/preparelayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/preparelayer.go index 2b65b018..55f7730d 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/preparelayer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/preparelayer.go @@ -1,10 +1,13 @@ package wclayer import ( + "context" + "strings" "sync" "github.com/Microsoft/hcsshim/internal/hcserror" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/oc" + "go.opencensus.io/trace" ) var prepareLayerLock sync.Mutex @@ -14,23 +17,17 @@ var prepareLayerLock sync.Mutex // parent layers, and is necessary in order to view or interact with the layer // as an actual filesystem (reading and writing files, creating directories, etc). // Disabling the filter must be done via UnprepareLayer. -func PrepareLayer(path string, parentLayerPaths []string) (err error) { +func PrepareLayer(ctx context.Context, path string, parentLayerPaths []string) (err error) { title := "hcsshim::PrepareLayer" - fields := logrus.Fields{ - "path": path, - } - logrus.WithFields(fields).Debug(title) - defer func() { - if err != nil { - fields[logrus.ErrorKey] = err - logrus.WithFields(fields).Error(err) - } else { - logrus.WithFields(fields).Debug(title + " - succeeded") - } - }() + ctx, span := trace.StartSpan(ctx, title) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("path", path), + trace.StringAttribute("parentLayerPaths", strings.Join(parentLayerPaths, ", "))) // Generate layer descriptors - layers, err := layerPathsToDescriptors(parentLayerPaths) + layers, err := layerPathsToDescriptors(ctx, parentLayerPaths) if err != nil { return err } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/processimage.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/processimage.go index 884207c3..30bcdff5 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/processimage.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/processimage.go @@ -1,23 +1,41 @@ package wclayer -import "os" +import ( + "context" + "os" + + "github.com/Microsoft/hcsshim/internal/oc" + "go.opencensus.io/trace" +) // ProcessBaseLayer post-processes a base layer that has had its files extracted. // The files should have been extracted to \Files. -func ProcessBaseLayer(path string) error { - err := processBaseImage(path) +func ProcessBaseLayer(ctx context.Context, path string) (err error) { + title := "hcsshim::ProcessBaseLayer" + ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("path", path)) + + err = processBaseImage(path) if err != nil { - return &os.PathError{Op: "ProcessBaseLayer", Path: path, Err: err} + return &os.PathError{Op: title, Path: path, Err: err} } return nil } // ProcessUtilityVMImage post-processes a utility VM image that has had its files extracted. // The files should have been extracted to \Files. -func ProcessUtilityVMImage(path string) error { - err := processUtilityImage(path) +func ProcessUtilityVMImage(ctx context.Context, path string) (err error) { + title := "hcsshim::ProcessUtilityVMImage" + ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("path", path)) + + err = processUtilityImage(path) if err != nil { - return &os.PathError{Op: "ProcessUtilityVMImage", Path: path, Err: err} + return &os.PathError{Op: title, Path: path, Err: err} } return nil } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/unpreparelayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/unpreparelayer.go index bccd4596..79fb9867 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/unpreparelayer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/unpreparelayer.go @@ -1,26 +1,21 @@ package wclayer import ( + "context" + "github.com/Microsoft/hcsshim/internal/hcserror" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/oc" + "go.opencensus.io/trace" ) // UnprepareLayer disables the filesystem filter for the read-write layer with // the given id. -func UnprepareLayer(path string) (err error) { +func UnprepareLayer(ctx context.Context, path string) (err error) { title := "hcsshim::UnprepareLayer" - fields := logrus.Fields{ - "path": path, - } - logrus.WithFields(fields).Debug(title) - defer func() { - if err != nil { - fields[logrus.ErrorKey] = err - logrus.WithFields(fields).Error(err) - } else { - logrus.WithFields(fields).Debug(title + " - succeeded") - } - }() + ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("path", path)) err = unprepareLayer(&stdDriverInfo, path) if err != nil { diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go index 78f2aacd..9b1e06d5 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go @@ -1,6 +1,9 @@ +// Package wclayer provides bindings to HCS's legacy layer management API and +// provides a higher level interface around these calls for container layer +// management. package wclayer -import "github.com/Microsoft/hcsshim/internal/guid" +import "github.com/Microsoft/go-winio/pkg/guid" //go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go wclayer.go @@ -24,4 +27,9 @@ import "github.com/Microsoft/hcsshim/internal/guid" //sys grantVmAccess(vmid string, filepath string) (hr error) = vmcompute.GrantVmAccess? +//sys openVirtualDisk(virtualStorageType *virtualStorageType, path string, virtualDiskAccessMask uint32, flags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (err error) [failretval != 0] = virtdisk.OpenVirtualDisk +//sys attachVirtualDisk(handle syscall.Handle, sd uintptr, flags uint32, providerFlags uint32, params uintptr, overlapped uintptr) (err error) [failretval != 0] = virtdisk.AttachVirtualDisk + +//sys getDiskFreeSpaceEx(directoryName string, freeBytesAvailableToCaller *int64, totalNumberOfBytes *int64, totalNumberOfFreeBytes *int64) (err error) = GetDiskFreeSpaceExW + type _guid = guid.GUID diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go index d853ab25..67f917f0 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go @@ -38,6 +38,8 @@ func errnoErr(e syscall.Errno) error { var ( modvmcompute = windows.NewLazySystemDLL("vmcompute.dll") + modvirtdisk = windows.NewLazySystemDLL("virtdisk.dll") + modkernel32 = windows.NewLazySystemDLL("kernel32.dll") procActivateLayer = modvmcompute.NewProc("ActivateLayer") procCopyLayer = modvmcompute.NewProc("CopyLayer") @@ -57,6 +59,9 @@ var ( procProcessBaseImage = modvmcompute.NewProc("ProcessBaseImage") procProcessUtilityImage = modvmcompute.NewProc("ProcessUtilityImage") procGrantVmAccess = modvmcompute.NewProc("GrantVmAccess") + procOpenVirtualDisk = modvirtdisk.NewProc("OpenVirtualDisk") + procAttachVirtualDisk = modvirtdisk.NewProc("AttachVirtualDisk") + procGetDiskFreeSpaceExW = modkernel32.NewProc("GetDiskFreeSpaceExW") ) func activateLayer(info *driverInfo, id string) (hr error) { @@ -508,3 +513,57 @@ func _grantVmAccess(vmid *uint16, filepath *uint16) (hr error) { } return } + +func openVirtualDisk(virtualStorageType *virtualStorageType, path string, virtualDiskAccessMask uint32, flags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (err error) { + var _p0 *uint16 + _p0, err = syscall.UTF16PtrFromString(path) + if err != nil { + return + } + return _openVirtualDisk(virtualStorageType, _p0, virtualDiskAccessMask, flags, parameters, handle) +} + +func _openVirtualDisk(virtualStorageType *virtualStorageType, path *uint16, virtualDiskAccessMask uint32, flags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (err error) { + r1, _, e1 := syscall.Syscall6(procOpenVirtualDisk.Addr(), 6, uintptr(unsafe.Pointer(virtualStorageType)), uintptr(unsafe.Pointer(path)), uintptr(virtualDiskAccessMask), uintptr(flags), uintptr(unsafe.Pointer(parameters)), uintptr(unsafe.Pointer(handle))) + if r1 != 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func attachVirtualDisk(handle syscall.Handle, sd uintptr, flags uint32, providerFlags uint32, params uintptr, overlapped uintptr) (err error) { + r1, _, e1 := syscall.Syscall6(procAttachVirtualDisk.Addr(), 6, uintptr(handle), uintptr(sd), uintptr(flags), uintptr(providerFlags), uintptr(params), uintptr(overlapped)) + if r1 != 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func getDiskFreeSpaceEx(directoryName string, freeBytesAvailableToCaller *int64, totalNumberOfBytes *int64, totalNumberOfFreeBytes *int64) (err error) { + var _p0 *uint16 + _p0, err = syscall.UTF16PtrFromString(directoryName) + if err != nil { + return + } + return _getDiskFreeSpaceEx(_p0, freeBytesAvailableToCaller, totalNumberOfBytes, totalNumberOfFreeBytes) +} + +func _getDiskFreeSpaceEx(directoryName *uint16, freeBytesAvailableToCaller *int64, totalNumberOfBytes *int64, totalNumberOfFreeBytes *int64) (err error) { + r1, _, e1 := syscall.Syscall6(procGetDiskFreeSpaceExW.Addr(), 4, uintptr(unsafe.Pointer(directoryName)), uintptr(unsafe.Pointer(freeBytesAvailableToCaller)), uintptr(unsafe.Pointer(totalNumberOfBytes)), uintptr(unsafe.Pointer(totalNumberOfFreeBytes)), 0, 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/devices.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/devices.go new file mode 100644 index 00000000..df28ea24 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/devices.go @@ -0,0 +1,13 @@ +package winapi + +import "github.com/Microsoft/go-winio/pkg/guid" + +//sys CMGetDeviceIDListSize(pulLen *uint32, pszFilter *byte, uFlags uint32) (hr error) = cfgmgr32.CM_Get_Device_ID_List_SizeA +//sys CMGetDeviceIDList(pszFilter *byte, buffer *byte, bufferLen uint32, uFlags uint32) (hr error)= cfgmgr32.CM_Get_Device_ID_ListA +//sys CMLocateDevNode(pdnDevInst *uint32, pDeviceID string, uFlags uint32) (hr error) = cfgmgr32.CM_Locate_DevNodeW +//sys CMGetDevNodeProperty(dnDevInst uint32, propertyKey *DevPropKey, propertyType *uint32, propertyBuffer *uint16, propertyBufferSize *uint32, uFlags uint32) (hr error) = cfgmgr32.CM_Get_DevNode_PropertyW + +type DevPropKey struct { + Fmtid guid.GUID + Pid uint32 +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/errors.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/errors.go new file mode 100644 index 00000000..4e80ef68 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/errors.go @@ -0,0 +1,15 @@ +package winapi + +import "syscall" + +//sys RtlNtStatusToDosError(status uint32) (winerr error) = ntdll.RtlNtStatusToDosError + +const ( + STATUS_REPARSE_POINT_ENCOUNTERED = 0xC000050B + ERROR_NO_MORE_ITEMS = 0x103 + ERROR_MORE_DATA syscall.Errno = 234 +) + +func NTSuccess(status uint32) bool { + return status == 0 +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/filesystem.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/filesystem.go new file mode 100644 index 00000000..7ce52afd --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/filesystem.go @@ -0,0 +1,110 @@ +package winapi + +//sys NtCreateFile(handle *uintptr, accessMask uint32, oa *ObjectAttributes, iosb *IOStatusBlock, allocationSize *uint64, fileAttributes uint32, shareAccess uint32, createDisposition uint32, createOptions uint32, eaBuffer *byte, eaLength uint32) (status uint32) = ntdll.NtCreateFile +//sys NtSetInformationFile(handle uintptr, iosb *IOStatusBlock, information uintptr, length uint32, class uint32) (status uint32) = ntdll.NtSetInformationFile + +//sys NtOpenDirectoryObject(handle *uintptr, accessMask uint32, oa *ObjectAttributes) (status uint32) = ntdll.NtOpenDirectoryObject +//sys NtQueryDirectoryObject(handle uintptr, buffer *byte, length uint32, singleEntry bool, restartScan bool, context *uint32, returnLength *uint32)(status uint32) = ntdll.NtQueryDirectoryObject + +const ( + FileLinkInformationClass = 11 + FileDispositionInformationExClass = 64 + + FILE_READ_ATTRIBUTES = 0x0080 + FILE_WRITE_ATTRIBUTES = 0x0100 + DELETE = 0x10000 + + FILE_OPEN = 1 + FILE_CREATE = 2 + + FILE_LIST_DIRECTORY = 0x00000001 + FILE_DIRECTORY_FILE = 0x00000001 + FILE_SYNCHRONOUS_IO_NONALERT = 0x00000020 + FILE_OPEN_FOR_BACKUP_INTENT = 0x00004000 + FILE_OPEN_REPARSE_POINT = 0x00200000 + + FILE_DISPOSITION_DELETE = 0x00000001 + + OBJ_DONT_REPARSE = 0x1000 + + STATUS_MORE_ENTRIES = 0x105 + STATUS_NO_MORE_ENTRIES = 0x8000001a +) + +// Select entries from FILE_INFO_BY_HANDLE_CLASS. +// +// C declaration: +// typedef enum _FILE_INFO_BY_HANDLE_CLASS { +// FileBasicInfo, +// FileStandardInfo, +// FileNameInfo, +// FileRenameInfo, +// FileDispositionInfo, +// FileAllocationInfo, +// FileEndOfFileInfo, +// FileStreamInfo, +// FileCompressionInfo, +// FileAttributeTagInfo, +// FileIdBothDirectoryInfo, +// FileIdBothDirectoryRestartInfo, +// FileIoPriorityHintInfo, +// FileRemoteProtocolInfo, +// FileFullDirectoryInfo, +// FileFullDirectoryRestartInfo, +// FileStorageInfo, +// FileAlignmentInfo, +// FileIdInfo, +// FileIdExtdDirectoryInfo, +// FileIdExtdDirectoryRestartInfo, +// FileDispositionInfoEx, +// FileRenameInfoEx, +// FileCaseSensitiveInfo, +// FileNormalizedNameInfo, +// MaximumFileInfoByHandleClass +// } FILE_INFO_BY_HANDLE_CLASS, *PFILE_INFO_BY_HANDLE_CLASS; +// +// Documentation: https://docs.microsoft.com/en-us/windows/win32/api/minwinbase/ne-minwinbase-file_info_by_handle_class +const ( + FileIdInfo = 18 +) + +type FileDispositionInformationEx struct { + Flags uintptr +} + +type IOStatusBlock struct { + Status, Information uintptr +} + +type ObjectAttributes struct { + Length uintptr + RootDirectory uintptr + ObjectName *UnicodeString + Attributes uintptr + SecurityDescriptor uintptr + SecurityQoS uintptr +} + +type ObjectDirectoryInformation struct { + Name UnicodeString + TypeName UnicodeString +} + +type FileLinkInformation struct { + ReplaceIfExists bool + RootDirectory uintptr + FileNameLength uint32 + FileName [1]uint16 +} + +// C declaration: +// typedef struct _FILE_ID_INFO { +// ULONGLONG VolumeSerialNumber; +// FILE_ID_128 FileId; +// } FILE_ID_INFO, *PFILE_ID_INFO; +// +// Documentation: https://docs.microsoft.com/en-us/windows/win32/api/winbase/ns-winbase-file_id_info +type FILE_ID_INFO struct { + VolumeSerialNumber uint64 + FileID [16]byte +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/iocp.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/iocp.go new file mode 100644 index 00000000..4e609cbf --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/iocp.go @@ -0,0 +1,3 @@ +package winapi + +//sys GetQueuedCompletionStatus(cphandle windows.Handle, qty *uint32, key *uintptr, overlapped **windows.Overlapped, timeout uint32) (err error) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/jobobject.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/jobobject.go new file mode 100644 index 00000000..ba12b1ad --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/jobobject.go @@ -0,0 +1,215 @@ +package winapi + +import ( + "unsafe" + + "golang.org/x/sys/windows" +) + +// Messages that can be received from an assigned io completion port. +// https://docs.microsoft.com/en-us/windows/win32/api/winnt/ns-winnt-jobobject_associate_completion_port +const ( + JOB_OBJECT_MSG_END_OF_JOB_TIME uint32 = 1 + JOB_OBJECT_MSG_END_OF_PROCESS_TIME uint32 = 2 + JOB_OBJECT_MSG_ACTIVE_PROCESS_LIMIT uint32 = 3 + JOB_OBJECT_MSG_ACTIVE_PROCESS_ZERO uint32 = 4 + JOB_OBJECT_MSG_NEW_PROCESS uint32 = 6 + JOB_OBJECT_MSG_EXIT_PROCESS uint32 = 7 + JOB_OBJECT_MSG_ABNORMAL_EXIT_PROCESS uint32 = 8 + JOB_OBJECT_MSG_PROCESS_MEMORY_LIMIT uint32 = 9 + JOB_OBJECT_MSG_JOB_MEMORY_LIMIT uint32 = 10 + JOB_OBJECT_MSG_NOTIFICATION_LIMIT uint32 = 11 +) + +// Access rights for creating or opening job objects. +// +// https://docs.microsoft.com/en-us/windows/win32/procthread/job-object-security-and-access-rights +const JOB_OBJECT_ALL_ACCESS = 0x1F001F + +// IO limit flags +// +// https://docs.microsoft.com/en-us/windows/win32/api/jobapi2/ns-jobapi2-jobobject_io_rate_control_information +const JOB_OBJECT_IO_RATE_CONTROL_ENABLE = 0x1 + +const JOBOBJECT_IO_ATTRIBUTION_CONTROL_ENABLE uint32 = 0x1 + +// https://docs.microsoft.com/en-us/windows/win32/api/winnt/ns-winnt-jobobject_cpu_rate_control_information +const ( + JOB_OBJECT_CPU_RATE_CONTROL_ENABLE uint32 = 1 << iota + JOB_OBJECT_CPU_RATE_CONTROL_WEIGHT_BASED + JOB_OBJECT_CPU_RATE_CONTROL_HARD_CAP + JOB_OBJECT_CPU_RATE_CONTROL_NOTIFY + JOB_OBJECT_CPU_RATE_CONTROL_MIN_MAX_RATE +) + +// JobObjectInformationClass values. Used for a call to QueryInformationJobObject +// +// https://docs.microsoft.com/en-us/windows/win32/api/jobapi2/nf-jobapi2-queryinformationjobobject +const ( + JobObjectBasicAccountingInformation uint32 = 1 + JobObjectBasicProcessIdList uint32 = 3 + JobObjectBasicAndIoAccountingInformation uint32 = 8 + JobObjectLimitViolationInformation uint32 = 13 + JobObjectMemoryUsageInformation uint32 = 28 + JobObjectNotificationLimitInformation2 uint32 = 33 + JobObjectIoAttribution uint32 = 42 +) + +// https://docs.microsoft.com/en-us/windows/win32/api/winnt/ns-winnt-jobobject_basic_limit_information +type JOBOBJECT_BASIC_LIMIT_INFORMATION struct { + PerProcessUserTimeLimit int64 + PerJobUserTimeLimit int64 + LimitFlags uint32 + MinimumWorkingSetSize uintptr + MaximumWorkingSetSize uintptr + ActiveProcessLimit uint32 + Affinity uintptr + PriorityClass uint32 + SchedulingClass uint32 +} + +// https://docs.microsoft.com/en-us/windows/win32/api/winnt/ns-winnt-jobobject_cpu_rate_control_information +type JOBOBJECT_CPU_RATE_CONTROL_INFORMATION struct { + ControlFlags uint32 + Value uint32 +} + +// https://docs.microsoft.com/en-us/windows/win32/api/jobapi2/ns-jobapi2-jobobject_io_rate_control_information +type JOBOBJECT_IO_RATE_CONTROL_INFORMATION struct { + MaxIops int64 + MaxBandwidth int64 + ReservationIops int64 + BaseIOSize uint32 + VolumeName string + ControlFlags uint32 +} + +// https://docs.microsoft.com/en-us/windows/win32/api/winnt/ns-winnt-jobobject_basic_process_id_list +type JOBOBJECT_BASIC_PROCESS_ID_LIST struct { + NumberOfAssignedProcesses uint32 + NumberOfProcessIdsInList uint32 + ProcessIdList [1]uintptr +} + +// AllPids returns all the process Ids in the job object. +func (p *JOBOBJECT_BASIC_PROCESS_ID_LIST) AllPids() []uintptr { + return (*[(1 << 27) - 1]uintptr)(unsafe.Pointer(&p.ProcessIdList[0]))[:p.NumberOfProcessIdsInList] +} + +// https://docs.microsoft.com/en-us/windows/win32/api/winnt/ns-winnt-jobobject_basic_accounting_information +type JOBOBJECT_BASIC_ACCOUNTING_INFORMATION struct { + TotalUserTime int64 + TotalKernelTime int64 + ThisPeriodTotalUserTime int64 + ThisPeriodTotalKernelTime int64 + TotalPageFaultCount uint32 + TotalProcesses uint32 + ActiveProcesses uint32 + TotalTerminateProcesses uint32 +} + +//https://docs.microsoft.com/en-us/windows/win32/api/winnt/ns-winnt-jobobject_basic_and_io_accounting_information +type JOBOBJECT_BASIC_AND_IO_ACCOUNTING_INFORMATION struct { + BasicInfo JOBOBJECT_BASIC_ACCOUNTING_INFORMATION + IoInfo windows.IO_COUNTERS +} + +// typedef struct _JOBOBJECT_MEMORY_USAGE_INFORMATION { +// ULONG64 JobMemory; +// ULONG64 PeakJobMemoryUsed; +// } JOBOBJECT_MEMORY_USAGE_INFORMATION, *PJOBOBJECT_MEMORY_USAGE_INFORMATION; +// +type JOBOBJECT_MEMORY_USAGE_INFORMATION struct { + JobMemory uint64 + PeakJobMemoryUsed uint64 +} + +// typedef struct _JOBOBJECT_IO_ATTRIBUTION_STATS { +// ULONG_PTR IoCount; +// ULONGLONG TotalNonOverlappedQueueTime; +// ULONGLONG TotalNonOverlappedServiceTime; +// ULONGLONG TotalSize; +// } JOBOBJECT_IO_ATTRIBUTION_STATS, *PJOBOBJECT_IO_ATTRIBUTION_STATS; +// +type JOBOBJECT_IO_ATTRIBUTION_STATS struct { + IoCount uintptr + TotalNonOverlappedQueueTime uint64 + TotalNonOverlappedServiceTime uint64 + TotalSize uint64 +} + +// typedef struct _JOBOBJECT_IO_ATTRIBUTION_INFORMATION { +// ULONG ControlFlags; +// JOBOBJECT_IO_ATTRIBUTION_STATS ReadStats; +// JOBOBJECT_IO_ATTRIBUTION_STATS WriteStats; +// } JOBOBJECT_IO_ATTRIBUTION_INFORMATION, *PJOBOBJECT_IO_ATTRIBUTION_INFORMATION; +// +type JOBOBJECT_IO_ATTRIBUTION_INFORMATION struct { + ControlFlags uint32 + ReadStats JOBOBJECT_IO_ATTRIBUTION_STATS + WriteStats JOBOBJECT_IO_ATTRIBUTION_STATS +} + +// https://docs.microsoft.com/en-us/windows/win32/api/winnt/ns-winnt-jobobject_associate_completion_port +type JOBOBJECT_ASSOCIATE_COMPLETION_PORT struct { + CompletionKey windows.Handle + CompletionPort windows.Handle +} + +// BOOL IsProcessInJob( +// HANDLE ProcessHandle, +// HANDLE JobHandle, +// PBOOL Result +// ); +// +//sys IsProcessInJob(procHandle windows.Handle, jobHandle windows.Handle, result *bool) (err error) = kernel32.IsProcessInJob + +// BOOL QueryInformationJobObject( +// HANDLE hJob, +// JOBOBJECTINFOCLASS JobObjectInformationClass, +// LPVOID lpJobObjectInformation, +// DWORD cbJobObjectInformationLength, +// LPDWORD lpReturnLength +// ); +// +//sys QueryInformationJobObject(jobHandle windows.Handle, infoClass uint32, jobObjectInfo uintptr, jobObjectInformationLength uint32, lpReturnLength *uint32) (err error) = kernel32.QueryInformationJobObject + +// HANDLE OpenJobObjectW( +// DWORD dwDesiredAccess, +// BOOL bInheritHandle, +// LPCWSTR lpName +// ); +// +//sys OpenJobObject(desiredAccess uint32, inheritHandle bool, lpName *uint16) (handle windows.Handle, err error) = kernel32.OpenJobObjectW + +// DWORD SetIoRateControlInformationJobObject( +// HANDLE hJob, +// JOBOBJECT_IO_RATE_CONTROL_INFORMATION *IoRateControlInfo +// ); +// +//sys SetIoRateControlInformationJobObject(jobHandle windows.Handle, ioRateControlInfo *JOBOBJECT_IO_RATE_CONTROL_INFORMATION) (ret uint32, err error) = kernel32.SetIoRateControlInformationJobObject + +// DWORD QueryIoRateControlInformationJobObject( +// HANDLE hJob, +// PCWSTR VolumeName, +// JOBOBJECT_IO_RATE_CONTROL_INFORMATION **InfoBlocks, +// ULONG *InfoBlockCount +// ); +//sys QueryIoRateControlInformationJobObject(jobHandle windows.Handle, volumeName *uint16, ioRateControlInfo **JOBOBJECT_IO_RATE_CONTROL_INFORMATION, infoBlockCount *uint32) (ret uint32, err error) = kernel32.QueryIoRateControlInformationJobObject + +// NTSTATUS +// NtOpenJobObject ( +// _Out_ PHANDLE JobHandle, +// _In_ ACCESS_MASK DesiredAccess, +// _In_ POBJECT_ATTRIBUTES ObjectAttributes +// ); +//sys NtOpenJobObject(jobHandle *windows.Handle, desiredAccess uint32, objAttributes *ObjectAttributes) (status uint32) = ntdll.NtOpenJobObject + +// NTSTATUS +// NTAPI +// NtCreateJobObject ( +// _Out_ PHANDLE JobHandle, +// _In_ ACCESS_MASK DesiredAccess, +// _In_opt_ POBJECT_ATTRIBUTES ObjectAttributes +// ); +//sys NtCreateJobObject(jobHandle *windows.Handle, desiredAccess uint32, objAttributes *ObjectAttributes) (status uint32) = ntdll.NtCreateJobObject diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/logon.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/logon.go new file mode 100644 index 00000000..b6e7cfd4 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/logon.go @@ -0,0 +1,30 @@ +package winapi + +// BOOL LogonUserA( +// LPCWSTR lpszUsername, +// LPCWSTR lpszDomain, +// LPCWSTR lpszPassword, +// DWORD dwLogonType, +// DWORD dwLogonProvider, +// PHANDLE phToken +// ); +// +//sys LogonUser(username *uint16, domain *uint16, password *uint16, logonType uint32, logonProvider uint32, token *windows.Token) (err error) = advapi32.LogonUserW + +// Logon types +const ( + LOGON32_LOGON_INTERACTIVE uint32 = 2 + LOGON32_LOGON_NETWORK uint32 = 3 + LOGON32_LOGON_BATCH uint32 = 4 + LOGON32_LOGON_SERVICE uint32 = 5 + LOGON32_LOGON_UNLOCK uint32 = 7 + LOGON32_LOGON_NETWORK_CLEARTEXT uint32 = 8 + LOGON32_LOGON_NEW_CREDENTIALS uint32 = 9 +) + +// Logon providers +const ( + LOGON32_PROVIDER_DEFAULT uint32 = 0 + LOGON32_PROVIDER_WINNT40 uint32 = 2 + LOGON32_PROVIDER_WINNT50 uint32 = 3 +) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/memory.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/memory.go new file mode 100644 index 00000000..83f70406 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/memory.go @@ -0,0 +1,27 @@ +package winapi + +// VOID RtlMoveMemory( +// _Out_ VOID UNALIGNED *Destination, +// _In_ const VOID UNALIGNED *Source, +// _In_ SIZE_T Length +// ); +//sys RtlMoveMemory(destination *byte, source *byte, length uintptr) (err error) = kernel32.RtlMoveMemory + +//sys LocalAlloc(flags uint32, size int) (ptr uintptr) = kernel32.LocalAlloc +//sys LocalFree(ptr uintptr) = kernel32.LocalFree + +// BOOL QueryWorkingSet( +// HANDLE hProcess, +// PVOID pv, +// DWORD cb +// ); +//sys QueryWorkingSet(handle windows.Handle, pv uintptr, cb uint32) (err error) = psapi.QueryWorkingSet + +type PSAPI_WORKING_SET_INFORMATION struct { + NumberOfEntries uintptr + WorkingSetInfo [1]PSAPI_WORKING_SET_BLOCK +} + +type PSAPI_WORKING_SET_BLOCK struct { + Flags uintptr +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/net.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/net.go new file mode 100644 index 00000000..f3791002 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/net.go @@ -0,0 +1,3 @@ +package winapi + +//sys SetJobCompartmentId(handle windows.Handle, compartmentId uint32) (win32Err error) = iphlpapi.SetJobCompartmentId diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/path.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/path.go new file mode 100644 index 00000000..908920e8 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/path.go @@ -0,0 +1,11 @@ +package winapi + +// DWORD SearchPathW( +// LPCWSTR lpPath, +// LPCWSTR lpFileName, +// LPCWSTR lpExtension, +// DWORD nBufferLength, +// LPWSTR lpBuffer, +// LPWSTR *lpFilePart +// ); +//sys SearchPath(lpPath *uint16, lpFileName *uint16, lpExtension *uint16, nBufferLength uint32, lpBuffer *uint16, lpFilePath *uint16) (size uint32, err error) = kernel32.SearchPathW diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/process.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/process.go new file mode 100644 index 00000000..b8706832 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/process.go @@ -0,0 +1,10 @@ +package winapi + +const PROCESS_ALL_ACCESS uint32 = 2097151 + +// DWORD GetProcessImageFileNameW( +// HANDLE hProcess, +// LPWSTR lpImageFileName, +// DWORD nSize +// ); +//sys GetProcessImageFileName(hProcess windows.Handle, imageFileName *uint16, nSize uint32) (size uint32, err error) = kernel32.GetProcessImageFileNameW diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/processor.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/processor.go new file mode 100644 index 00000000..ce79ac2c --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/processor.go @@ -0,0 +1,7 @@ +package winapi + +// Get count from all processor groups. +// https://docs.microsoft.com/en-us/windows/win32/procthread/processor-groups +const ALL_PROCESSOR_GROUPS = 0xFFFF + +//sys GetActiveProcessorCount(groupNumber uint16) (amount uint32) = kernel32.GetActiveProcessorCount diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/system.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/system.go new file mode 100644 index 00000000..327f57d7 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/system.go @@ -0,0 +1,52 @@ +package winapi + +import "golang.org/x/sys/windows" + +const SystemProcessInformation = 5 + +const STATUS_INFO_LENGTH_MISMATCH = 0xC0000004 + +// __kernel_entry NTSTATUS NtQuerySystemInformation( +// SYSTEM_INFORMATION_CLASS SystemInformationClass, +// PVOID SystemInformation, +// ULONG SystemInformationLength, +// PULONG ReturnLength +// ); +//sys NtQuerySystemInformation(systemInfoClass int, systemInformation uintptr, systemInfoLength uint32, returnLength *uint32) (status uint32) = ntdll.NtQuerySystemInformation + +type SYSTEM_PROCESS_INFORMATION struct { + NextEntryOffset uint32 // ULONG + NumberOfThreads uint32 // ULONG + WorkingSetPrivateSize int64 // LARGE_INTEGER + HardFaultCount uint32 // ULONG + NumberOfThreadsHighWatermark uint32 // ULONG + CycleTime uint64 // ULONGLONG + CreateTime int64 // LARGE_INTEGER + UserTime int64 // LARGE_INTEGER + KernelTime int64 // LARGE_INTEGER + ImageName UnicodeString // UNICODE_STRING + BasePriority int32 // KPRIORITY + UniqueProcessID windows.Handle // HANDLE + InheritedFromUniqueProcessID windows.Handle // HANDLE + HandleCount uint32 // ULONG + SessionID uint32 // ULONG + UniqueProcessKey *uint32 // ULONG_PTR + PeakVirtualSize uintptr // SIZE_T + VirtualSize uintptr // SIZE_T + PageFaultCount uint32 // ULONG + PeakWorkingSetSize uintptr // SIZE_T + WorkingSetSize uintptr // SIZE_T + QuotaPeakPagedPoolUsage uintptr // SIZE_T + QuotaPagedPoolUsage uintptr // SIZE_T + QuotaPeakNonPagedPoolUsage uintptr // SIZE_T + QuotaNonPagedPoolUsage uintptr // SIZE_T + PagefileUsage uintptr // SIZE_T + PeakPagefileUsage uintptr // SIZE_T + PrivatePageCount uintptr // SIZE_T + ReadOperationCount int64 // LARGE_INTEGER + WriteOperationCount int64 // LARGE_INTEGER + OtherOperationCount int64 // LARGE_INTEGER + ReadTransferCount int64 // LARGE_INTEGER + WriteTransferCount int64 // LARGE_INTEGER + OtherTransferCount int64 // LARGE_INTEGER +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/thread.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/thread.go new file mode 100644 index 00000000..4724713e --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/thread.go @@ -0,0 +1,12 @@ +package winapi + +// HANDLE CreateRemoteThread( +// HANDLE hProcess, +// LPSECURITY_ATTRIBUTES lpThreadAttributes, +// SIZE_T dwStackSize, +// LPTHREAD_START_ROUTINE lpStartAddress, +// LPVOID lpParameter, +// DWORD dwCreationFlags, +// LPDWORD lpThreadId +// ); +//sys CreateRemoteThread(process windows.Handle, sa *windows.SecurityAttributes, stackSize uint32, startAddr uintptr, parameter uintptr, creationFlags uint32, threadID *uint32) (handle windows.Handle, err error) = kernel32.CreateRemoteThread diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/utils.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/utils.go new file mode 100644 index 00000000..db59567d --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/utils.go @@ -0,0 +1,75 @@ +package winapi + +import ( + "errors" + "reflect" + "syscall" + "unsafe" + + "golang.org/x/sys/windows" +) + +// Uint16BufferToSlice wraps a uint16 pointer-and-length into a slice +// for easier interop with Go APIs +func Uint16BufferToSlice(buffer *uint16, bufferLength int) (result []uint16) { + hdr := (*reflect.SliceHeader)(unsafe.Pointer(&result)) + hdr.Data = uintptr(unsafe.Pointer(buffer)) + hdr.Cap = bufferLength + hdr.Len = bufferLength + + return +} + +type UnicodeString struct { + Length uint16 + MaximumLength uint16 + Buffer *uint16 +} + +//String converts a UnicodeString to a golang string +func (uni UnicodeString) String() string { + // UnicodeString is not guaranteed to be null terminated, therefore + // use the UnicodeString's Length field + return syscall.UTF16ToString(Uint16BufferToSlice(uni.Buffer, int(uni.Length/2))) +} + +// NewUnicodeString allocates a new UnicodeString and copies `s` into +// the buffer of the new UnicodeString. +func NewUnicodeString(s string) (*UnicodeString, error) { + // Get length of original `s` to use in the UnicodeString since the `buf` + // created later will have an additional trailing null character + length := len(s) + if length > 32767 { + return nil, syscall.ENAMETOOLONG + } + + buf, err := windows.UTF16FromString(s) + if err != nil { + return nil, err + } + uni := &UnicodeString{ + Length: uint16(length * 2), + MaximumLength: uint16(length * 2), + Buffer: &buf[0], + } + return uni, nil +} + +// ConvertStringSetToSlice is a helper function used to convert the contents of +// `buf` into a string slice. `buf` contains a set of null terminated strings +// with an additional null at the end to indicate the end of the set. +func ConvertStringSetToSlice(buf []byte) ([]string, error) { + var results []string + prev := 0 + for i := range buf { + if buf[i] == 0 { + if prev == i { + // found two null characters in a row, return result + return results, nil + } + results = append(results, string(buf[prev:i])) + prev = i + 1 + } + } + return nil, errors.New("string set malformed: missing null terminator at end of buffer") +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/winapi.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/winapi.go new file mode 100644 index 00000000..ec88c0d2 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/winapi.go @@ -0,0 +1,5 @@ +// Package winapi contains various low-level bindings to Windows APIs. It can +// be thought of as an extension to golang.org/x/sys/windows. +package winapi + +//go:generate go run ..\..\mksyscall_windows.go -output zsyscall_windows.go system.go net.go path.go thread.go iocp.go jobobject.go logon.go memory.go process.go processor.go devices.go filesystem.go errors.go diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/zsyscall_windows.go new file mode 100644 index 00000000..2941b0f9 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/zsyscall_windows.go @@ -0,0 +1,371 @@ +// Code generated mksyscall_windows.exe DO NOT EDIT + +package winapi + +import ( + "syscall" + "unsafe" + + "golang.org/x/sys/windows" +) + +var _ unsafe.Pointer + +// Do the interface allocations only once for common +// Errno values. +const ( + errnoERROR_IO_PENDING = 997 +) + +var ( + errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) +) + +// errnoErr returns common boxed Errno values, to prevent +// allocations at runtime. +func errnoErr(e syscall.Errno) error { + switch e { + case 0: + return nil + case errnoERROR_IO_PENDING: + return errERROR_IO_PENDING + } + // TODO: add more here, after collecting data on the common + // error values see on Windows. (perhaps when running + // all.bat?) + return e +} + +var ( + modntdll = windows.NewLazySystemDLL("ntdll.dll") + modiphlpapi = windows.NewLazySystemDLL("iphlpapi.dll") + modkernel32 = windows.NewLazySystemDLL("kernel32.dll") + modadvapi32 = windows.NewLazySystemDLL("advapi32.dll") + modpsapi = windows.NewLazySystemDLL("psapi.dll") + modcfgmgr32 = windows.NewLazySystemDLL("cfgmgr32.dll") + + procNtQuerySystemInformation = modntdll.NewProc("NtQuerySystemInformation") + procSetJobCompartmentId = modiphlpapi.NewProc("SetJobCompartmentId") + procSearchPathW = modkernel32.NewProc("SearchPathW") + procCreateRemoteThread = modkernel32.NewProc("CreateRemoteThread") + procGetQueuedCompletionStatus = modkernel32.NewProc("GetQueuedCompletionStatus") + procIsProcessInJob = modkernel32.NewProc("IsProcessInJob") + procQueryInformationJobObject = modkernel32.NewProc("QueryInformationJobObject") + procOpenJobObjectW = modkernel32.NewProc("OpenJobObjectW") + procSetIoRateControlInformationJobObject = modkernel32.NewProc("SetIoRateControlInformationJobObject") + procQueryIoRateControlInformationJobObject = modkernel32.NewProc("QueryIoRateControlInformationJobObject") + procNtOpenJobObject = modntdll.NewProc("NtOpenJobObject") + procNtCreateJobObject = modntdll.NewProc("NtCreateJobObject") + procLogonUserW = modadvapi32.NewProc("LogonUserW") + procRtlMoveMemory = modkernel32.NewProc("RtlMoveMemory") + procLocalAlloc = modkernel32.NewProc("LocalAlloc") + procLocalFree = modkernel32.NewProc("LocalFree") + procQueryWorkingSet = modpsapi.NewProc("QueryWorkingSet") + procGetProcessImageFileNameW = modkernel32.NewProc("GetProcessImageFileNameW") + procGetActiveProcessorCount = modkernel32.NewProc("GetActiveProcessorCount") + procCM_Get_Device_ID_List_SizeA = modcfgmgr32.NewProc("CM_Get_Device_ID_List_SizeA") + procCM_Get_Device_ID_ListA = modcfgmgr32.NewProc("CM_Get_Device_ID_ListA") + procCM_Locate_DevNodeW = modcfgmgr32.NewProc("CM_Locate_DevNodeW") + procCM_Get_DevNode_PropertyW = modcfgmgr32.NewProc("CM_Get_DevNode_PropertyW") + procNtCreateFile = modntdll.NewProc("NtCreateFile") + procNtSetInformationFile = modntdll.NewProc("NtSetInformationFile") + procNtOpenDirectoryObject = modntdll.NewProc("NtOpenDirectoryObject") + procNtQueryDirectoryObject = modntdll.NewProc("NtQueryDirectoryObject") + procRtlNtStatusToDosError = modntdll.NewProc("RtlNtStatusToDosError") +) + +func NtQuerySystemInformation(systemInfoClass int, systemInformation uintptr, systemInfoLength uint32, returnLength *uint32) (status uint32) { + r0, _, _ := syscall.Syscall6(procNtQuerySystemInformation.Addr(), 4, uintptr(systemInfoClass), uintptr(systemInformation), uintptr(systemInfoLength), uintptr(unsafe.Pointer(returnLength)), 0, 0) + status = uint32(r0) + return +} + +func SetJobCompartmentId(handle windows.Handle, compartmentId uint32) (win32Err error) { + r0, _, _ := syscall.Syscall(procSetJobCompartmentId.Addr(), 2, uintptr(handle), uintptr(compartmentId), 0) + if r0 != 0 { + win32Err = syscall.Errno(r0) + } + return +} + +func SearchPath(lpPath *uint16, lpFileName *uint16, lpExtension *uint16, nBufferLength uint32, lpBuffer *uint16, lpFilePath *uint16) (size uint32, err error) { + r0, _, e1 := syscall.Syscall6(procSearchPathW.Addr(), 6, uintptr(unsafe.Pointer(lpPath)), uintptr(unsafe.Pointer(lpFileName)), uintptr(unsafe.Pointer(lpExtension)), uintptr(nBufferLength), uintptr(unsafe.Pointer(lpBuffer)), uintptr(unsafe.Pointer(lpFilePath))) + size = uint32(r0) + if size == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func CreateRemoteThread(process windows.Handle, sa *windows.SecurityAttributes, stackSize uint32, startAddr uintptr, parameter uintptr, creationFlags uint32, threadID *uint32) (handle windows.Handle, err error) { + r0, _, e1 := syscall.Syscall9(procCreateRemoteThread.Addr(), 7, uintptr(process), uintptr(unsafe.Pointer(sa)), uintptr(stackSize), uintptr(startAddr), uintptr(parameter), uintptr(creationFlags), uintptr(unsafe.Pointer(threadID)), 0, 0) + handle = windows.Handle(r0) + if handle == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func GetQueuedCompletionStatus(cphandle windows.Handle, qty *uint32, key *uintptr, overlapped **windows.Overlapped, timeout uint32) (err error) { + r1, _, e1 := syscall.Syscall6(procGetQueuedCompletionStatus.Addr(), 5, uintptr(cphandle), uintptr(unsafe.Pointer(qty)), uintptr(unsafe.Pointer(key)), uintptr(unsafe.Pointer(overlapped)), uintptr(timeout), 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func IsProcessInJob(procHandle windows.Handle, jobHandle windows.Handle, result *bool) (err error) { + r1, _, e1 := syscall.Syscall(procIsProcessInJob.Addr(), 3, uintptr(procHandle), uintptr(jobHandle), uintptr(unsafe.Pointer(result))) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func QueryInformationJobObject(jobHandle windows.Handle, infoClass uint32, jobObjectInfo uintptr, jobObjectInformationLength uint32, lpReturnLength *uint32) (err error) { + r1, _, e1 := syscall.Syscall6(procQueryInformationJobObject.Addr(), 5, uintptr(jobHandle), uintptr(infoClass), uintptr(jobObjectInfo), uintptr(jobObjectInformationLength), uintptr(unsafe.Pointer(lpReturnLength)), 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func OpenJobObject(desiredAccess uint32, inheritHandle bool, lpName *uint16) (handle windows.Handle, err error) { + var _p0 uint32 + if inheritHandle { + _p0 = 1 + } else { + _p0 = 0 + } + r0, _, e1 := syscall.Syscall(procOpenJobObjectW.Addr(), 3, uintptr(desiredAccess), uintptr(_p0), uintptr(unsafe.Pointer(lpName))) + handle = windows.Handle(r0) + if handle == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func SetIoRateControlInformationJobObject(jobHandle windows.Handle, ioRateControlInfo *JOBOBJECT_IO_RATE_CONTROL_INFORMATION) (ret uint32, err error) { + r0, _, e1 := syscall.Syscall(procSetIoRateControlInformationJobObject.Addr(), 2, uintptr(jobHandle), uintptr(unsafe.Pointer(ioRateControlInfo)), 0) + ret = uint32(r0) + if ret == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func QueryIoRateControlInformationJobObject(jobHandle windows.Handle, volumeName *uint16, ioRateControlInfo **JOBOBJECT_IO_RATE_CONTROL_INFORMATION, infoBlockCount *uint32) (ret uint32, err error) { + r0, _, e1 := syscall.Syscall6(procQueryIoRateControlInformationJobObject.Addr(), 4, uintptr(jobHandle), uintptr(unsafe.Pointer(volumeName)), uintptr(unsafe.Pointer(ioRateControlInfo)), uintptr(unsafe.Pointer(infoBlockCount)), 0, 0) + ret = uint32(r0) + if ret == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func NtOpenJobObject(jobHandle *windows.Handle, desiredAccess uint32, objAttributes *ObjectAttributes) (status uint32) { + r0, _, _ := syscall.Syscall(procNtOpenJobObject.Addr(), 3, uintptr(unsafe.Pointer(jobHandle)), uintptr(desiredAccess), uintptr(unsafe.Pointer(objAttributes))) + status = uint32(r0) + return +} + +func NtCreateJobObject(jobHandle *windows.Handle, desiredAccess uint32, objAttributes *ObjectAttributes) (status uint32) { + r0, _, _ := syscall.Syscall(procNtCreateJobObject.Addr(), 3, uintptr(unsafe.Pointer(jobHandle)), uintptr(desiredAccess), uintptr(unsafe.Pointer(objAttributes))) + status = uint32(r0) + return +} + +func LogonUser(username *uint16, domain *uint16, password *uint16, logonType uint32, logonProvider uint32, token *windows.Token) (err error) { + r1, _, e1 := syscall.Syscall6(procLogonUserW.Addr(), 6, uintptr(unsafe.Pointer(username)), uintptr(unsafe.Pointer(domain)), uintptr(unsafe.Pointer(password)), uintptr(logonType), uintptr(logonProvider), uintptr(unsafe.Pointer(token))) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func RtlMoveMemory(destination *byte, source *byte, length uintptr) (err error) { + r1, _, e1 := syscall.Syscall(procRtlMoveMemory.Addr(), 3, uintptr(unsafe.Pointer(destination)), uintptr(unsafe.Pointer(source)), uintptr(length)) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func LocalAlloc(flags uint32, size int) (ptr uintptr) { + r0, _, _ := syscall.Syscall(procLocalAlloc.Addr(), 2, uintptr(flags), uintptr(size), 0) + ptr = uintptr(r0) + return +} + +func LocalFree(ptr uintptr) { + syscall.Syscall(procLocalFree.Addr(), 1, uintptr(ptr), 0, 0) + return +} + +func QueryWorkingSet(handle windows.Handle, pv uintptr, cb uint32) (err error) { + r1, _, e1 := syscall.Syscall(procQueryWorkingSet.Addr(), 3, uintptr(handle), uintptr(pv), uintptr(cb)) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func GetProcessImageFileName(hProcess windows.Handle, imageFileName *uint16, nSize uint32) (size uint32, err error) { + r0, _, e1 := syscall.Syscall(procGetProcessImageFileNameW.Addr(), 3, uintptr(hProcess), uintptr(unsafe.Pointer(imageFileName)), uintptr(nSize)) + size = uint32(r0) + if size == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func GetActiveProcessorCount(groupNumber uint16) (amount uint32) { + r0, _, _ := syscall.Syscall(procGetActiveProcessorCount.Addr(), 1, uintptr(groupNumber), 0, 0) + amount = uint32(r0) + return +} + +func CMGetDeviceIDListSize(pulLen *uint32, pszFilter *byte, uFlags uint32) (hr error) { + r0, _, _ := syscall.Syscall(procCM_Get_Device_ID_List_SizeA.Addr(), 3, uintptr(unsafe.Pointer(pulLen)), uintptr(unsafe.Pointer(pszFilter)), uintptr(uFlags)) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func CMGetDeviceIDList(pszFilter *byte, buffer *byte, bufferLen uint32, uFlags uint32) (hr error) { + r0, _, _ := syscall.Syscall6(procCM_Get_Device_ID_ListA.Addr(), 4, uintptr(unsafe.Pointer(pszFilter)), uintptr(unsafe.Pointer(buffer)), uintptr(bufferLen), uintptr(uFlags), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func CMLocateDevNode(pdnDevInst *uint32, pDeviceID string, uFlags uint32) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(pDeviceID) + if hr != nil { + return + } + return _CMLocateDevNode(pdnDevInst, _p0, uFlags) +} + +func _CMLocateDevNode(pdnDevInst *uint32, pDeviceID *uint16, uFlags uint32) (hr error) { + r0, _, _ := syscall.Syscall(procCM_Locate_DevNodeW.Addr(), 3, uintptr(unsafe.Pointer(pdnDevInst)), uintptr(unsafe.Pointer(pDeviceID)), uintptr(uFlags)) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func CMGetDevNodeProperty(dnDevInst uint32, propertyKey *DevPropKey, propertyType *uint32, propertyBuffer *uint16, propertyBufferSize *uint32, uFlags uint32) (hr error) { + r0, _, _ := syscall.Syscall6(procCM_Get_DevNode_PropertyW.Addr(), 6, uintptr(dnDevInst), uintptr(unsafe.Pointer(propertyKey)), uintptr(unsafe.Pointer(propertyType)), uintptr(unsafe.Pointer(propertyBuffer)), uintptr(unsafe.Pointer(propertyBufferSize)), uintptr(uFlags)) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func NtCreateFile(handle *uintptr, accessMask uint32, oa *ObjectAttributes, iosb *IOStatusBlock, allocationSize *uint64, fileAttributes uint32, shareAccess uint32, createDisposition uint32, createOptions uint32, eaBuffer *byte, eaLength uint32) (status uint32) { + r0, _, _ := syscall.Syscall12(procNtCreateFile.Addr(), 11, uintptr(unsafe.Pointer(handle)), uintptr(accessMask), uintptr(unsafe.Pointer(oa)), uintptr(unsafe.Pointer(iosb)), uintptr(unsafe.Pointer(allocationSize)), uintptr(fileAttributes), uintptr(shareAccess), uintptr(createDisposition), uintptr(createOptions), uintptr(unsafe.Pointer(eaBuffer)), uintptr(eaLength), 0) + status = uint32(r0) + return +} + +func NtSetInformationFile(handle uintptr, iosb *IOStatusBlock, information uintptr, length uint32, class uint32) (status uint32) { + r0, _, _ := syscall.Syscall6(procNtSetInformationFile.Addr(), 5, uintptr(handle), uintptr(unsafe.Pointer(iosb)), uintptr(information), uintptr(length), uintptr(class), 0) + status = uint32(r0) + return +} + +func NtOpenDirectoryObject(handle *uintptr, accessMask uint32, oa *ObjectAttributes) (status uint32) { + r0, _, _ := syscall.Syscall(procNtOpenDirectoryObject.Addr(), 3, uintptr(unsafe.Pointer(handle)), uintptr(accessMask), uintptr(unsafe.Pointer(oa))) + status = uint32(r0) + return +} + +func NtQueryDirectoryObject(handle uintptr, buffer *byte, length uint32, singleEntry bool, restartScan bool, context *uint32, returnLength *uint32) (status uint32) { + var _p0 uint32 + if singleEntry { + _p0 = 1 + } else { + _p0 = 0 + } + var _p1 uint32 + if restartScan { + _p1 = 1 + } else { + _p1 = 0 + } + r0, _, _ := syscall.Syscall9(procNtQueryDirectoryObject.Addr(), 7, uintptr(handle), uintptr(unsafe.Pointer(buffer)), uintptr(length), uintptr(_p0), uintptr(_p1), uintptr(unsafe.Pointer(context)), uintptr(unsafe.Pointer(returnLength)), 0, 0) + status = uint32(r0) + return +} + +func RtlNtStatusToDosError(status uint32) (winerr error) { + r0, _, _ := syscall.Syscall(procRtlNtStatusToDosError.Addr(), 1, uintptr(status), 0, 0) + if r0 != 0 { + winerr = syscall.Errno(r0) + } + return +} diff --git a/vendor/github.com/Microsoft/hcsshim/layer.go b/vendor/github.com/Microsoft/hcsshim/layer.go index df0e63bb..89161637 100644 --- a/vendor/github.com/Microsoft/hcsshim/layer.go +++ b/vendor/github.com/Microsoft/hcsshim/layer.go @@ -1,10 +1,11 @@ package hcsshim import ( + "context" "crypto/sha1" "path/filepath" - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" "github.com/Microsoft/hcsshim/internal/wclayer" ) @@ -13,59 +14,59 @@ func layerPath(info *DriverInfo, id string) string { } func ActivateLayer(info DriverInfo, id string) error { - return wclayer.ActivateLayer(layerPath(&info, id)) + return wclayer.ActivateLayer(context.Background(), layerPath(&info, id)) } func CreateLayer(info DriverInfo, id, parent string) error { - return wclayer.CreateLayer(layerPath(&info, id), parent) + return wclayer.CreateLayer(context.Background(), layerPath(&info, id), parent) } // New clients should use CreateScratchLayer instead. Kept in to preserve API compatibility. func CreateSandboxLayer(info DriverInfo, layerId, parentId string, parentLayerPaths []string) error { - return wclayer.CreateScratchLayer(layerPath(&info, layerId), parentLayerPaths) + return wclayer.CreateScratchLayer(context.Background(), layerPath(&info, layerId), parentLayerPaths) } func CreateScratchLayer(info DriverInfo, layerId, parentId string, parentLayerPaths []string) error { - return wclayer.CreateScratchLayer(layerPath(&info, layerId), parentLayerPaths) + return wclayer.CreateScratchLayer(context.Background(), layerPath(&info, layerId), parentLayerPaths) } func DeactivateLayer(info DriverInfo, id string) error { - return wclayer.DeactivateLayer(layerPath(&info, id)) + return wclayer.DeactivateLayer(context.Background(), layerPath(&info, id)) } func DestroyLayer(info DriverInfo, id string) error { - return wclayer.DestroyLayer(layerPath(&info, id)) + return wclayer.DestroyLayer(context.Background(), layerPath(&info, id)) } // New clients should use ExpandScratchSize instead. Kept in to preserve API compatibility. func ExpandSandboxSize(info DriverInfo, layerId string, size uint64) error { - return wclayer.ExpandScratchSize(layerPath(&info, layerId), size) + return wclayer.ExpandScratchSize(context.Background(), layerPath(&info, layerId), size) } func ExpandScratchSize(info DriverInfo, layerId string, size uint64) error { - return wclayer.ExpandScratchSize(layerPath(&info, layerId), size) + return wclayer.ExpandScratchSize(context.Background(), layerPath(&info, layerId), size) } func ExportLayer(info DriverInfo, layerId string, exportFolderPath string, parentLayerPaths []string) error { - return wclayer.ExportLayer(layerPath(&info, layerId), exportFolderPath, parentLayerPaths) + return wclayer.ExportLayer(context.Background(), layerPath(&info, layerId), exportFolderPath, parentLayerPaths) } func GetLayerMountPath(info DriverInfo, id string) (string, error) { - return wclayer.GetLayerMountPath(layerPath(&info, id)) + return wclayer.GetLayerMountPath(context.Background(), layerPath(&info, id)) } func GetSharedBaseImages() (imageData string, err error) { - return wclayer.GetSharedBaseImages() + return wclayer.GetSharedBaseImages(context.Background()) } func ImportLayer(info DriverInfo, layerID string, importFolderPath string, parentLayerPaths []string) error { - return wclayer.ImportLayer(layerPath(&info, layerID), importFolderPath, parentLayerPaths) + return wclayer.ImportLayer(context.Background(), layerPath(&info, layerID), importFolderPath, parentLayerPaths) } func LayerExists(info DriverInfo, id string) (bool, error) { - return wclayer.LayerExists(layerPath(&info, id)) + return wclayer.LayerExists(context.Background(), layerPath(&info, id)) } func PrepareLayer(info DriverInfo, layerId string, parentLayerPaths []string) error { - return wclayer.PrepareLayer(layerPath(&info, layerId), parentLayerPaths) + return wclayer.PrepareLayer(context.Background(), layerPath(&info, layerId), parentLayerPaths) } func ProcessBaseLayer(path string) error { - return wclayer.ProcessBaseLayer(path) + return wclayer.ProcessBaseLayer(context.Background(), path) } func ProcessUtilityVMImage(path string) error { - return wclayer.ProcessUtilityVMImage(path) + return wclayer.ProcessUtilityVMImage(context.Background(), path) } func UnprepareLayer(info DriverInfo, layerId string) error { - return wclayer.UnprepareLayer(layerPath(&info, layerId)) + return wclayer.UnprepareLayer(context.Background(), layerPath(&info, layerId)) } type DriverInfo struct { @@ -76,8 +77,8 @@ type DriverInfo struct { type GUID [16]byte func NameToGuid(name string) (id GUID, err error) { - g, err := wclayer.NameToGuid(name) - return GUID(g), err + g, err := wclayer.NameToGuid(context.Background(), name) + return g.ToWindowsArray(), err } func NewGUID(source string) *GUID { @@ -88,19 +89,19 @@ func NewGUID(source string) *GUID { } func (g *GUID) ToString() string { - return (guid.GUID)(*g).String() + return guid.FromWindowsArray(*g).String() } type LayerReader = wclayer.LayerReader func NewLayerReader(info DriverInfo, layerID string, parentLayerPaths []string) (LayerReader, error) { - return wclayer.NewLayerReader(layerPath(&info, layerID), parentLayerPaths) + return wclayer.NewLayerReader(context.Background(), layerPath(&info, layerID), parentLayerPaths) } type LayerWriter = wclayer.LayerWriter func NewLayerWriter(info DriverInfo, layerID string, parentLayerPaths []string) (LayerWriter, error) { - return wclayer.NewLayerWriter(layerPath(&info, layerID), parentLayerPaths) + return wclayer.NewLayerWriter(context.Background(), layerPath(&info, layerID), parentLayerPaths) } type WC_LAYER_DESCRIPTOR = wclayer.WC_LAYER_DESCRIPTOR diff --git a/vendor/github.com/Microsoft/hcsshim/osversion/osversion_windows.go b/vendor/github.com/Microsoft/hcsshim/osversion/osversion_windows.go new file mode 100644 index 00000000..42e58403 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/osversion/osversion_windows.go @@ -0,0 +1,42 @@ +package osversion + +import ( + "fmt" + + "golang.org/x/sys/windows" +) + +// OSVersion is a wrapper for Windows version information +// https://msdn.microsoft.com/en-us/library/windows/desktop/ms724439(v=vs.85).aspx +type OSVersion struct { + Version uint32 + MajorVersion uint8 + MinorVersion uint8 + Build uint16 +} + +// Get gets the operating system version on Windows. +// The calling application must be manifested to get the correct version information. +func Get() OSVersion { + var err error + osv := OSVersion{} + osv.Version, err = windows.GetVersion() + if err != nil { + // GetVersion never fails. + panic(err) + } + osv.MajorVersion = uint8(osv.Version & 0xFF) + osv.MinorVersion = uint8(osv.Version >> 8 & 0xFF) + osv.Build = uint16(osv.Version >> 16) + return osv +} + +// Build gets the build-number on Windows +// The calling application must be manifested to get the correct version information. +func Build() uint16 { + return Get().Build +} + +func (osv OSVersion) ToString() string { + return fmt.Sprintf("%d.%d.%d", osv.MajorVersion, osv.MinorVersion, osv.Build) +} diff --git a/vendor/github.com/Microsoft/hcsshim/osversion/windowsbuilds.go b/vendor/github.com/Microsoft/hcsshim/osversion/windowsbuilds.go new file mode 100644 index 00000000..e9267b95 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/osversion/windowsbuilds.go @@ -0,0 +1,38 @@ +package osversion + +const ( + // RS1 (version 1607, codename "Redstone 1") corresponds to Windows Server + // 2016 (ltsc2016) and Windows 10 (Anniversary Update). + RS1 = 14393 + + // RS2 (version 1703, codename "Redstone 2") was a client-only update, and + // corresponds to Windows 10 (Creators Update). + RS2 = 15063 + + // RS3 (version 1709, codename "Redstone 3") corresponds to Windows Server + // 1709 (Semi-Annual Channel (SAC)), and Windows 10 (Fall Creators Update). + RS3 = 16299 + + // RS4 (version 1803, codename "Redstone 4") corresponds to Windows Server + // 1803 (Semi-Annual Channel (SAC)), and Windows 10 (April 2018 Update). + RS4 = 17134 + + // RS5 (version 1809, codename "Redstone 5") corresponds to Windows Server + // 2019 (ltsc2019), and Windows 10 (October 2018 Update). + RS5 = 17763 + + // V19H1 (version 1903) corresponds to Windows Server 1903 (semi-annual + // channel). + V19H1 = 18362 + + // V19H2 (version 1909) corresponds to Windows Server 1909 (semi-annual + // channel). + V19H2 = 18363 + + // V20H1 (version 2004) corresponds to Windows Server 2004 (semi-annual + // channel). + V20H1 = 19041 + + // V20H2 corresponds to Windows Server 20H2 (semi-annual channel). + V20H2 = 19042 +) diff --git a/vendor/github.com/Microsoft/hcsshim/process.go b/vendor/github.com/Microsoft/hcsshim/process.go index ca8acbb7..3362c683 100644 --- a/vendor/github.com/Microsoft/hcsshim/process.go +++ b/vendor/github.com/Microsoft/hcsshim/process.go @@ -1,7 +1,9 @@ package hcsshim import ( + "context" "io" + "sync" "time" "github.com/Microsoft/hcsshim/internal/hcs" @@ -9,7 +11,10 @@ import ( // ContainerError is an error encountered in HCS type process struct { - p *hcs.Process + p *hcs.Process + waitOnce sync.Once + waitCh chan struct{} + waitErr error } // Pid returns the process ID of the process within the container. @@ -19,7 +24,14 @@ func (process *process) Pid() int { // Kill signals the process to terminate but does not wait for it to finish terminating. func (process *process) Kill() error { - return convertProcessError(process.p.Kill(), process) + found, err := process.p.Kill(context.Background()) + if err != nil { + return convertProcessError(err, process) + } + if !found { + return &ProcessError{Process: process, Err: ErrElementNotFound, Operation: "hcsshim::Process::Kill"} + } + return nil } // Wait waits for the process to exit. @@ -30,7 +42,21 @@ func (process *process) Wait() error { // WaitTimeout waits for the process to exit or the duration to elapse. It returns // false if timeout occurs. func (process *process) WaitTimeout(timeout time.Duration) error { - return convertProcessError(process.p.WaitTimeout(timeout), process) + process.waitOnce.Do(func() { + process.waitCh = make(chan struct{}) + go func() { + process.waitErr = process.Wait() + close(process.waitCh) + }() + }) + t := time.NewTimer(timeout) + defer t.Stop() + select { + case <-t.C: + return &ProcessError{Process: process, Err: ErrTimeout, Operation: "hcsshim::Process::Wait"} + case <-process.waitCh: + return process.waitErr + } } // ExitCode returns the exit code of the process. The process must have @@ -45,14 +71,14 @@ func (process *process) ExitCode() (int, error) { // ResizeConsole resizes the console of the process. func (process *process) ResizeConsole(width, height uint16) error { - return convertProcessError(process.p.ResizeConsole(width, height), process) + return convertProcessError(process.p.ResizeConsole(context.Background(), width, height), process) } // Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing // these pipes does not close the underlying pipes; it should be possible to // call this multiple times to get multiple interfaces. func (process *process) Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, error) { - stdin, stdout, stderr, err := process.p.Stdio() + stdin, stdout, stderr, err := process.p.StdioLegacy() if err != nil { err = convertProcessError(err, process) } @@ -62,7 +88,7 @@ func (process *process) Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, e // CloseStdin closes the write side of the stdin pipe so that the process is // notified on the read side that there is no more data in stdin. func (process *process) CloseStdin() error { - return convertProcessError(process.p.CloseStdin(), process) + return convertProcessError(process.p.CloseStdin(context.Background()), process) } // Close cleans up any state associated with the process but does not kill diff --git a/vendor/github.com/Microsoft/hcsshim/vendor.conf b/vendor/github.com/Microsoft/hcsshim/vendor.conf deleted file mode 100644 index 6e0ed156..00000000 --- a/vendor/github.com/Microsoft/hcsshim/vendor.conf +++ /dev/null @@ -1,21 +0,0 @@ -github.com/blang/semver v3.1.0 -github.com/containerd/console c12b1e7919c14469339a5d38f2f8ed9b64a9de23 -github.com/containerd/go-runc 5a6d9f37cfa36b15efba46dc7ea349fa9b7143c3 -github.com/hashicorp/errwrap 7554cd9344cec97297fa6649b055a8c98c2a1e55 -github.com/hashicorp/go-multierror ed905158d87462226a13fe39ddf685ea65f1c11f -github.com/konsorten/go-windows-terminal-sequences v1.0.1 -github.com/linuxkit/virtsock 8e79449dea0735c1c056d814934dd035734cc97c -github.com/Microsoft/go-winio 16cfc975803886a5e47c4257a24c8d8c52e178b2 -github.com/Microsoft/opengcs v0.3.9 -github.com/opencontainers/runtime-spec eba862dc2470385a233c7507392675cbeadf7353 -github.com/opencontainers/runtime-tools 1d69bd0f9c39677d0630e50664fbc3154ae61b88 -github.com/pkg/errors v0.8.1 -github.com/sirupsen/logrus v1.3.0 -github.com/syndtr/gocapability db04d3cc01c8b54962a58ec7e491717d06cfcc16 -github.com/urfave/cli 7bc6a0acffa589f415f88aca16cc1de5ffd66f9c -github.com/xeipuuv/gojsonpointer 4e3ac2762d5f479393488629ee9370b50873b3a6 -github.com/xeipuuv/gojsonreference bd5ef7bd5415a7ac448318e64f11a24cd21e594b -github.com/xeipuuv/gojsonschema 1d523034197ff1f222f6429836dd36a2457a1874 -golang.org/x/crypto ff983b9c42bc9fbf91556e191cc8efb585c16908 -golang.org/x/sync 37e7f081c4d4c64e13b10787722085407fe5d15f -golang.org/x/sys e5ecc2a6747ce8d4af18ed98b3de5ae30eb3a5bb \ No newline at end of file diff --git a/vendor/github.com/containerd/cgroups/LICENSE b/vendor/github.com/containerd/cgroups/LICENSE new file mode 100644 index 00000000..261eeb9e --- /dev/null +++ b/vendor/github.com/containerd/cgroups/LICENSE @@ -0,0 +1,201 @@ + Apache License + Version 2.0, January 2004 + http://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + APPENDIX: How to apply the Apache License to your work. + + To apply the Apache License to your work, attach the following + boilerplate notice, with the fields enclosed by brackets "[]" + replaced with your own identifying information. (Don't include + the brackets!) The text should be enclosed in the appropriate + comment syntax for the file format. We also recommend that a + file or class name and description of purpose be included on the + same "printed page" as the copyright notice for easier + identification within third-party archives. + + Copyright [yyyy] [name of copyright owner] + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. diff --git a/vendor/github.com/containerd/cgroups/stats/v1/doc.go b/vendor/github.com/containerd/cgroups/stats/v1/doc.go new file mode 100644 index 00000000..23f3cdd4 --- /dev/null +++ b/vendor/github.com/containerd/cgroups/stats/v1/doc.go @@ -0,0 +1,17 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package v1 diff --git a/vendor/github.com/containerd/cgroups/stats/v1/metrics.pb.go b/vendor/github.com/containerd/cgroups/stats/v1/metrics.pb.go new file mode 100644 index 00000000..a530f1d8 --- /dev/null +++ b/vendor/github.com/containerd/cgroups/stats/v1/metrics.pb.go @@ -0,0 +1,5985 @@ +// Code generated by protoc-gen-gogo. DO NOT EDIT. +// source: github.com/containerd/cgroups/stats/v1/metrics.proto + +package v1 + +import ( + fmt "fmt" + _ "github.com/gogo/protobuf/gogoproto" + proto "github.com/gogo/protobuf/proto" + io "io" + math "math" + reflect "reflect" + strings "strings" +) + +// Reference imports to suppress errors if they are not otherwise used. +var _ = proto.Marshal +var _ = fmt.Errorf +var _ = math.Inf + +// This is a compile-time assertion to ensure that this generated file +// is compatible with the proto package it is being compiled against. +// A compilation error at this line likely means your copy of the +// proto package needs to be updated. +const _ = proto.GoGoProtoPackageIsVersion2 // please upgrade the proto package + +type Metrics struct { + Hugetlb []*HugetlbStat `protobuf:"bytes,1,rep,name=hugetlb,proto3" json:"hugetlb,omitempty"` + Pids *PidsStat `protobuf:"bytes,2,opt,name=pids,proto3" json:"pids,omitempty"` + CPU *CPUStat `protobuf:"bytes,3,opt,name=cpu,proto3" json:"cpu,omitempty"` + Memory *MemoryStat `protobuf:"bytes,4,opt,name=memory,proto3" json:"memory,omitempty"` + Blkio *BlkIOStat `protobuf:"bytes,5,opt,name=blkio,proto3" json:"blkio,omitempty"` + Rdma *RdmaStat `protobuf:"bytes,6,opt,name=rdma,proto3" json:"rdma,omitempty"` + Network []*NetworkStat `protobuf:"bytes,7,rep,name=network,proto3" json:"network,omitempty"` + CgroupStats *CgroupStats `protobuf:"bytes,8,opt,name=cgroup_stats,json=cgroupStats,proto3" json:"cgroup_stats,omitempty"` + MemoryOomControl *MemoryOomControl `protobuf:"bytes,9,opt,name=memory_oom_control,json=MemoryOomControl,proto3" json:"memory_oom_control,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *Metrics) Reset() { *m = Metrics{} } +func (*Metrics) ProtoMessage() {} +func (*Metrics) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{0} +} +func (m *Metrics) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *Metrics) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_Metrics.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *Metrics) XXX_Merge(src proto.Message) { + xxx_messageInfo_Metrics.Merge(m, src) +} +func (m *Metrics) XXX_Size() int { + return m.Size() +} +func (m *Metrics) XXX_DiscardUnknown() { + xxx_messageInfo_Metrics.DiscardUnknown(m) +} + +var xxx_messageInfo_Metrics proto.InternalMessageInfo + +type HugetlbStat struct { + Usage uint64 `protobuf:"varint,1,opt,name=usage,proto3" json:"usage,omitempty"` + Max uint64 `protobuf:"varint,2,opt,name=max,proto3" json:"max,omitempty"` + Failcnt uint64 `protobuf:"varint,3,opt,name=failcnt,proto3" json:"failcnt,omitempty"` + Pagesize string `protobuf:"bytes,4,opt,name=pagesize,proto3" json:"pagesize,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *HugetlbStat) Reset() { *m = HugetlbStat{} } +func (*HugetlbStat) ProtoMessage() {} +func (*HugetlbStat) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{1} +} +func (m *HugetlbStat) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *HugetlbStat) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_HugetlbStat.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *HugetlbStat) XXX_Merge(src proto.Message) { + xxx_messageInfo_HugetlbStat.Merge(m, src) +} +func (m *HugetlbStat) XXX_Size() int { + return m.Size() +} +func (m *HugetlbStat) XXX_DiscardUnknown() { + xxx_messageInfo_HugetlbStat.DiscardUnknown(m) +} + +var xxx_messageInfo_HugetlbStat proto.InternalMessageInfo + +type PidsStat struct { + Current uint64 `protobuf:"varint,1,opt,name=current,proto3" json:"current,omitempty"` + Limit uint64 `protobuf:"varint,2,opt,name=limit,proto3" json:"limit,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *PidsStat) Reset() { *m = PidsStat{} } +func (*PidsStat) ProtoMessage() {} +func (*PidsStat) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{2} +} +func (m *PidsStat) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *PidsStat) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_PidsStat.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *PidsStat) XXX_Merge(src proto.Message) { + xxx_messageInfo_PidsStat.Merge(m, src) +} +func (m *PidsStat) XXX_Size() int { + return m.Size() +} +func (m *PidsStat) XXX_DiscardUnknown() { + xxx_messageInfo_PidsStat.DiscardUnknown(m) +} + +var xxx_messageInfo_PidsStat proto.InternalMessageInfo + +type CPUStat struct { + Usage *CPUUsage `protobuf:"bytes,1,opt,name=usage,proto3" json:"usage,omitempty"` + Throttling *Throttle `protobuf:"bytes,2,opt,name=throttling,proto3" json:"throttling,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *CPUStat) Reset() { *m = CPUStat{} } +func (*CPUStat) ProtoMessage() {} +func (*CPUStat) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{3} +} +func (m *CPUStat) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *CPUStat) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_CPUStat.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *CPUStat) XXX_Merge(src proto.Message) { + xxx_messageInfo_CPUStat.Merge(m, src) +} +func (m *CPUStat) XXX_Size() int { + return m.Size() +} +func (m *CPUStat) XXX_DiscardUnknown() { + xxx_messageInfo_CPUStat.DiscardUnknown(m) +} + +var xxx_messageInfo_CPUStat proto.InternalMessageInfo + +type CPUUsage struct { + // values in nanoseconds + Total uint64 `protobuf:"varint,1,opt,name=total,proto3" json:"total,omitempty"` + Kernel uint64 `protobuf:"varint,2,opt,name=kernel,proto3" json:"kernel,omitempty"` + User uint64 `protobuf:"varint,3,opt,name=user,proto3" json:"user,omitempty"` + PerCPU []uint64 `protobuf:"varint,4,rep,packed,name=per_cpu,json=perCpu,proto3" json:"per_cpu,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *CPUUsage) Reset() { *m = CPUUsage{} } +func (*CPUUsage) ProtoMessage() {} +func (*CPUUsage) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{4} +} +func (m *CPUUsage) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *CPUUsage) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_CPUUsage.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *CPUUsage) XXX_Merge(src proto.Message) { + xxx_messageInfo_CPUUsage.Merge(m, src) +} +func (m *CPUUsage) XXX_Size() int { + return m.Size() +} +func (m *CPUUsage) XXX_DiscardUnknown() { + xxx_messageInfo_CPUUsage.DiscardUnknown(m) +} + +var xxx_messageInfo_CPUUsage proto.InternalMessageInfo + +type Throttle struct { + Periods uint64 `protobuf:"varint,1,opt,name=periods,proto3" json:"periods,omitempty"` + ThrottledPeriods uint64 `protobuf:"varint,2,opt,name=throttled_periods,json=throttledPeriods,proto3" json:"throttled_periods,omitempty"` + ThrottledTime uint64 `protobuf:"varint,3,opt,name=throttled_time,json=throttledTime,proto3" json:"throttled_time,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *Throttle) Reset() { *m = Throttle{} } +func (*Throttle) ProtoMessage() {} +func (*Throttle) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{5} +} +func (m *Throttle) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *Throttle) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_Throttle.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *Throttle) XXX_Merge(src proto.Message) { + xxx_messageInfo_Throttle.Merge(m, src) +} +func (m *Throttle) XXX_Size() int { + return m.Size() +} +func (m *Throttle) XXX_DiscardUnknown() { + xxx_messageInfo_Throttle.DiscardUnknown(m) +} + +var xxx_messageInfo_Throttle proto.InternalMessageInfo + +type MemoryStat struct { + Cache uint64 `protobuf:"varint,1,opt,name=cache,proto3" json:"cache,omitempty"` + RSS uint64 `protobuf:"varint,2,opt,name=rss,proto3" json:"rss,omitempty"` + RSSHuge uint64 `protobuf:"varint,3,opt,name=rss_huge,json=rssHuge,proto3" json:"rss_huge,omitempty"` + MappedFile uint64 `protobuf:"varint,4,opt,name=mapped_file,json=mappedFile,proto3" json:"mapped_file,omitempty"` + Dirty uint64 `protobuf:"varint,5,opt,name=dirty,proto3" json:"dirty,omitempty"` + Writeback uint64 `protobuf:"varint,6,opt,name=writeback,proto3" json:"writeback,omitempty"` + PgPgIn uint64 `protobuf:"varint,7,opt,name=pg_pg_in,json=pgPgIn,proto3" json:"pg_pg_in,omitempty"` + PgPgOut uint64 `protobuf:"varint,8,opt,name=pg_pg_out,json=pgPgOut,proto3" json:"pg_pg_out,omitempty"` + PgFault uint64 `protobuf:"varint,9,opt,name=pg_fault,json=pgFault,proto3" json:"pg_fault,omitempty"` + PgMajFault uint64 `protobuf:"varint,10,opt,name=pg_maj_fault,json=pgMajFault,proto3" json:"pg_maj_fault,omitempty"` + InactiveAnon uint64 `protobuf:"varint,11,opt,name=inactive_anon,json=inactiveAnon,proto3" json:"inactive_anon,omitempty"` + ActiveAnon uint64 `protobuf:"varint,12,opt,name=active_anon,json=activeAnon,proto3" json:"active_anon,omitempty"` + InactiveFile uint64 `protobuf:"varint,13,opt,name=inactive_file,json=inactiveFile,proto3" json:"inactive_file,omitempty"` + ActiveFile uint64 `protobuf:"varint,14,opt,name=active_file,json=activeFile,proto3" json:"active_file,omitempty"` + Unevictable uint64 `protobuf:"varint,15,opt,name=unevictable,proto3" json:"unevictable,omitempty"` + HierarchicalMemoryLimit uint64 `protobuf:"varint,16,opt,name=hierarchical_memory_limit,json=hierarchicalMemoryLimit,proto3" json:"hierarchical_memory_limit,omitempty"` + HierarchicalSwapLimit uint64 `protobuf:"varint,17,opt,name=hierarchical_swap_limit,json=hierarchicalSwapLimit,proto3" json:"hierarchical_swap_limit,omitempty"` + TotalCache uint64 `protobuf:"varint,18,opt,name=total_cache,json=totalCache,proto3" json:"total_cache,omitempty"` + TotalRSS uint64 `protobuf:"varint,19,opt,name=total_rss,json=totalRss,proto3" json:"total_rss,omitempty"` + TotalRSSHuge uint64 `protobuf:"varint,20,opt,name=total_rss_huge,json=totalRssHuge,proto3" json:"total_rss_huge,omitempty"` + TotalMappedFile uint64 `protobuf:"varint,21,opt,name=total_mapped_file,json=totalMappedFile,proto3" json:"total_mapped_file,omitempty"` + TotalDirty uint64 `protobuf:"varint,22,opt,name=total_dirty,json=totalDirty,proto3" json:"total_dirty,omitempty"` + TotalWriteback uint64 `protobuf:"varint,23,opt,name=total_writeback,json=totalWriteback,proto3" json:"total_writeback,omitempty"` + TotalPgPgIn uint64 `protobuf:"varint,24,opt,name=total_pg_pg_in,json=totalPgPgIn,proto3" json:"total_pg_pg_in,omitempty"` + TotalPgPgOut uint64 `protobuf:"varint,25,opt,name=total_pg_pg_out,json=totalPgPgOut,proto3" json:"total_pg_pg_out,omitempty"` + TotalPgFault uint64 `protobuf:"varint,26,opt,name=total_pg_fault,json=totalPgFault,proto3" json:"total_pg_fault,omitempty"` + TotalPgMajFault uint64 `protobuf:"varint,27,opt,name=total_pg_maj_fault,json=totalPgMajFault,proto3" json:"total_pg_maj_fault,omitempty"` + TotalInactiveAnon uint64 `protobuf:"varint,28,opt,name=total_inactive_anon,json=totalInactiveAnon,proto3" json:"total_inactive_anon,omitempty"` + TotalActiveAnon uint64 `protobuf:"varint,29,opt,name=total_active_anon,json=totalActiveAnon,proto3" json:"total_active_anon,omitempty"` + TotalInactiveFile uint64 `protobuf:"varint,30,opt,name=total_inactive_file,json=totalInactiveFile,proto3" json:"total_inactive_file,omitempty"` + TotalActiveFile uint64 `protobuf:"varint,31,opt,name=total_active_file,json=totalActiveFile,proto3" json:"total_active_file,omitempty"` + TotalUnevictable uint64 `protobuf:"varint,32,opt,name=total_unevictable,json=totalUnevictable,proto3" json:"total_unevictable,omitempty"` + Usage *MemoryEntry `protobuf:"bytes,33,opt,name=usage,proto3" json:"usage,omitempty"` + Swap *MemoryEntry `protobuf:"bytes,34,opt,name=swap,proto3" json:"swap,omitempty"` + Kernel *MemoryEntry `protobuf:"bytes,35,opt,name=kernel,proto3" json:"kernel,omitempty"` + KernelTCP *MemoryEntry `protobuf:"bytes,36,opt,name=kernel_tcp,json=kernelTcp,proto3" json:"kernel_tcp,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *MemoryStat) Reset() { *m = MemoryStat{} } +func (*MemoryStat) ProtoMessage() {} +func (*MemoryStat) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{6} +} +func (m *MemoryStat) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *MemoryStat) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_MemoryStat.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *MemoryStat) XXX_Merge(src proto.Message) { + xxx_messageInfo_MemoryStat.Merge(m, src) +} +func (m *MemoryStat) XXX_Size() int { + return m.Size() +} +func (m *MemoryStat) XXX_DiscardUnknown() { + xxx_messageInfo_MemoryStat.DiscardUnknown(m) +} + +var xxx_messageInfo_MemoryStat proto.InternalMessageInfo + +type MemoryEntry struct { + Limit uint64 `protobuf:"varint,1,opt,name=limit,proto3" json:"limit,omitempty"` + Usage uint64 `protobuf:"varint,2,opt,name=usage,proto3" json:"usage,omitempty"` + Max uint64 `protobuf:"varint,3,opt,name=max,proto3" json:"max,omitempty"` + Failcnt uint64 `protobuf:"varint,4,opt,name=failcnt,proto3" json:"failcnt,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *MemoryEntry) Reset() { *m = MemoryEntry{} } +func (*MemoryEntry) ProtoMessage() {} +func (*MemoryEntry) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{7} +} +func (m *MemoryEntry) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *MemoryEntry) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_MemoryEntry.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *MemoryEntry) XXX_Merge(src proto.Message) { + xxx_messageInfo_MemoryEntry.Merge(m, src) +} +func (m *MemoryEntry) XXX_Size() int { + return m.Size() +} +func (m *MemoryEntry) XXX_DiscardUnknown() { + xxx_messageInfo_MemoryEntry.DiscardUnknown(m) +} + +var xxx_messageInfo_MemoryEntry proto.InternalMessageInfo + +type MemoryOomControl struct { + OomKillDisable uint64 `protobuf:"varint,1,opt,name=oom_kill_disable,proto3" json:oom_kill_disable",omitempty"` + UnderOom uint64 `protobuf:"varint,2,opt,name=under_oom,proto3" json:"under_oom,omitempty"` + OomKill uint64 `protobuf:"varint,3,opt,name=oom_kill,proto3" json:"oom_kill,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *MemoryOomControl) Reset() { *m = MemoryOomControl{} } +func (*MemoryOomControl) ProtoMessage() {} +func (*MemoryOomControl) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{8} +} +func (m *MemoryOomControl) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *MemoryOomControl) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_MemoryOomControl.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *MemoryOomControl) XXX_Merge(src proto.Message) { + xxx_messageInfo_MemoryOomControl.Merge(m, src) +} +func (m *MemoryOomControl) XXX_Size() int { + return m.Size() +} +func (m *MemoryOomControl) XXX_DiscardUnknown() { + xxx_messageInfo_MemoryOomControl.DiscardUnknown(m) +} + +var xxx_messageInfo_MemoryOomControl proto.InternalMessageInfo + +type BlkIOStat struct { + IoServiceBytesRecursive []*BlkIOEntry `protobuf:"bytes,1,rep,name=io_service_bytes_recursive,json=ioServiceBytesRecursive,proto3" json:"io_service_bytes_recursive,omitempty"` + IoServicedRecursive []*BlkIOEntry `protobuf:"bytes,2,rep,name=io_serviced_recursive,json=ioServicedRecursive,proto3" json:"io_serviced_recursive,omitempty"` + IoQueuedRecursive []*BlkIOEntry `protobuf:"bytes,3,rep,name=io_queued_recursive,json=ioQueuedRecursive,proto3" json:"io_queued_recursive,omitempty"` + IoServiceTimeRecursive []*BlkIOEntry `protobuf:"bytes,4,rep,name=io_service_time_recursive,json=ioServiceTimeRecursive,proto3" json:"io_service_time_recursive,omitempty"` + IoWaitTimeRecursive []*BlkIOEntry `protobuf:"bytes,5,rep,name=io_wait_time_recursive,json=ioWaitTimeRecursive,proto3" json:"io_wait_time_recursive,omitempty"` + IoMergedRecursive []*BlkIOEntry `protobuf:"bytes,6,rep,name=io_merged_recursive,json=ioMergedRecursive,proto3" json:"io_merged_recursive,omitempty"` + IoTimeRecursive []*BlkIOEntry `protobuf:"bytes,7,rep,name=io_time_recursive,json=ioTimeRecursive,proto3" json:"io_time_recursive,omitempty"` + SectorsRecursive []*BlkIOEntry `protobuf:"bytes,8,rep,name=sectors_recursive,json=sectorsRecursive,proto3" json:"sectors_recursive,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *BlkIOStat) Reset() { *m = BlkIOStat{} } +func (*BlkIOStat) ProtoMessage() {} +func (*BlkIOStat) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{9} +} +func (m *BlkIOStat) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *BlkIOStat) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_BlkIOStat.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *BlkIOStat) XXX_Merge(src proto.Message) { + xxx_messageInfo_BlkIOStat.Merge(m, src) +} +func (m *BlkIOStat) XXX_Size() int { + return m.Size() +} +func (m *BlkIOStat) XXX_DiscardUnknown() { + xxx_messageInfo_BlkIOStat.DiscardUnknown(m) +} + +var xxx_messageInfo_BlkIOStat proto.InternalMessageInfo + +type BlkIOEntry struct { + Op string `protobuf:"bytes,1,opt,name=op,proto3" json:"op,omitempty"` + Device string `protobuf:"bytes,2,opt,name=device,proto3" json:"device,omitempty"` + Major uint64 `protobuf:"varint,3,opt,name=major,proto3" json:"major,omitempty"` + Minor uint64 `protobuf:"varint,4,opt,name=minor,proto3" json:"minor,omitempty"` + Value uint64 `protobuf:"varint,5,opt,name=value,proto3" json:"value,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *BlkIOEntry) Reset() { *m = BlkIOEntry{} } +func (*BlkIOEntry) ProtoMessage() {} +func (*BlkIOEntry) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{10} +} +func (m *BlkIOEntry) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *BlkIOEntry) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_BlkIOEntry.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *BlkIOEntry) XXX_Merge(src proto.Message) { + xxx_messageInfo_BlkIOEntry.Merge(m, src) +} +func (m *BlkIOEntry) XXX_Size() int { + return m.Size() +} +func (m *BlkIOEntry) XXX_DiscardUnknown() { + xxx_messageInfo_BlkIOEntry.DiscardUnknown(m) +} + +var xxx_messageInfo_BlkIOEntry proto.InternalMessageInfo + +type RdmaStat struct { + Current []*RdmaEntry `protobuf:"bytes,1,rep,name=current,proto3" json:"current,omitempty"` + Limit []*RdmaEntry `protobuf:"bytes,2,rep,name=limit,proto3" json:"limit,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *RdmaStat) Reset() { *m = RdmaStat{} } +func (*RdmaStat) ProtoMessage() {} +func (*RdmaStat) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{11} +} +func (m *RdmaStat) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *RdmaStat) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_RdmaStat.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *RdmaStat) XXX_Merge(src proto.Message) { + xxx_messageInfo_RdmaStat.Merge(m, src) +} +func (m *RdmaStat) XXX_Size() int { + return m.Size() +} +func (m *RdmaStat) XXX_DiscardUnknown() { + xxx_messageInfo_RdmaStat.DiscardUnknown(m) +} + +var xxx_messageInfo_RdmaStat proto.InternalMessageInfo + +type RdmaEntry struct { + Device string `protobuf:"bytes,1,opt,name=device,proto3" json:"device,omitempty"` + HcaHandles uint32 `protobuf:"varint,2,opt,name=hca_handles,json=hcaHandles,proto3" json:"hca_handles,omitempty"` + HcaObjects uint32 `protobuf:"varint,3,opt,name=hca_objects,json=hcaObjects,proto3" json:"hca_objects,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *RdmaEntry) Reset() { *m = RdmaEntry{} } +func (*RdmaEntry) ProtoMessage() {} +func (*RdmaEntry) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{12} +} +func (m *RdmaEntry) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *RdmaEntry) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_RdmaEntry.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *RdmaEntry) XXX_Merge(src proto.Message) { + xxx_messageInfo_RdmaEntry.Merge(m, src) +} +func (m *RdmaEntry) XXX_Size() int { + return m.Size() +} +func (m *RdmaEntry) XXX_DiscardUnknown() { + xxx_messageInfo_RdmaEntry.DiscardUnknown(m) +} + +var xxx_messageInfo_RdmaEntry proto.InternalMessageInfo + +type NetworkStat struct { + Name string `protobuf:"bytes,1,opt,name=name,proto3" json:"name,omitempty"` + RxBytes uint64 `protobuf:"varint,2,opt,name=rx_bytes,json=rxBytes,proto3" json:"rx_bytes,omitempty"` + RxPackets uint64 `protobuf:"varint,3,opt,name=rx_packets,json=rxPackets,proto3" json:"rx_packets,omitempty"` + RxErrors uint64 `protobuf:"varint,4,opt,name=rx_errors,json=rxErrors,proto3" json:"rx_errors,omitempty"` + RxDropped uint64 `protobuf:"varint,5,opt,name=rx_dropped,json=rxDropped,proto3" json:"rx_dropped,omitempty"` + TxBytes uint64 `protobuf:"varint,6,opt,name=tx_bytes,json=txBytes,proto3" json:"tx_bytes,omitempty"` + TxPackets uint64 `protobuf:"varint,7,opt,name=tx_packets,json=txPackets,proto3" json:"tx_packets,omitempty"` + TxErrors uint64 `protobuf:"varint,8,opt,name=tx_errors,json=txErrors,proto3" json:"tx_errors,omitempty"` + TxDropped uint64 `protobuf:"varint,9,opt,name=tx_dropped,json=txDropped,proto3" json:"tx_dropped,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *NetworkStat) Reset() { *m = NetworkStat{} } +func (*NetworkStat) ProtoMessage() {} +func (*NetworkStat) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{13} +} +func (m *NetworkStat) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *NetworkStat) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_NetworkStat.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *NetworkStat) XXX_Merge(src proto.Message) { + xxx_messageInfo_NetworkStat.Merge(m, src) +} +func (m *NetworkStat) XXX_Size() int { + return m.Size() +} +func (m *NetworkStat) XXX_DiscardUnknown() { + xxx_messageInfo_NetworkStat.DiscardUnknown(m) +} + +var xxx_messageInfo_NetworkStat proto.InternalMessageInfo + +// CgroupStats exports per-cgroup statistics. +type CgroupStats struct { + // number of tasks sleeping + NrSleeping uint64 `protobuf:"varint,1,opt,name=nr_sleeping,json=nrSleeping,proto3" json:"nr_sleeping,omitempty"` + // number of tasks running + NrRunning uint64 `protobuf:"varint,2,opt,name=nr_running,json=nrRunning,proto3" json:"nr_running,omitempty"` + // number of tasks in stopped state + NrStopped uint64 `protobuf:"varint,3,opt,name=nr_stopped,json=nrStopped,proto3" json:"nr_stopped,omitempty"` + // number of tasks in uninterruptible state + NrUninterruptible uint64 `protobuf:"varint,4,opt,name=nr_uninterruptible,json=nrUninterruptible,proto3" json:"nr_uninterruptible,omitempty"` + // number of tasks waiting on IO + NrIoWait uint64 `protobuf:"varint,5,opt,name=nr_io_wait,json=nrIoWait,proto3" json:"nr_io_wait,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *CgroupStats) Reset() { *m = CgroupStats{} } +func (*CgroupStats) ProtoMessage() {} +func (*CgroupStats) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{14} +} +func (m *CgroupStats) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *CgroupStats) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_CgroupStats.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *CgroupStats) XXX_Merge(src proto.Message) { + xxx_messageInfo_CgroupStats.Merge(m, src) +} +func (m *CgroupStats) XXX_Size() int { + return m.Size() +} +func (m *CgroupStats) XXX_DiscardUnknown() { + xxx_messageInfo_CgroupStats.DiscardUnknown(m) +} + +var xxx_messageInfo_CgroupStats proto.InternalMessageInfo + +func init() { + proto.RegisterType((*Metrics)(nil), "io.containerd.cgroups.v1.Metrics") + proto.RegisterType((*HugetlbStat)(nil), "io.containerd.cgroups.v1.HugetlbStat") + proto.RegisterType((*PidsStat)(nil), "io.containerd.cgroups.v1.PidsStat") + proto.RegisterType((*CPUStat)(nil), "io.containerd.cgroups.v1.CPUStat") + proto.RegisterType((*CPUUsage)(nil), "io.containerd.cgroups.v1.CPUUsage") + proto.RegisterType((*Throttle)(nil), "io.containerd.cgroups.v1.Throttle") + proto.RegisterType((*MemoryStat)(nil), "io.containerd.cgroups.v1.MemoryStat") + proto.RegisterType((*MemoryEntry)(nil), "io.containerd.cgroups.v1.MemoryEntry") + proto.RegisterType((*MemoryOomControl)(nil), "io.containerd.cgroups.v1.MemoryOomControl") + proto.RegisterType((*BlkIOStat)(nil), "io.containerd.cgroups.v1.BlkIOStat") + proto.RegisterType((*BlkIOEntry)(nil), "io.containerd.cgroups.v1.BlkIOEntry") + proto.RegisterType((*RdmaStat)(nil), "io.containerd.cgroups.v1.RdmaStat") + proto.RegisterType((*RdmaEntry)(nil), "io.containerd.cgroups.v1.RdmaEntry") + proto.RegisterType((*NetworkStat)(nil), "io.containerd.cgroups.v1.NetworkStat") + proto.RegisterType((*CgroupStats)(nil), "io.containerd.cgroups.v1.CgroupStats") +} + +func init() { + proto.RegisterFile("github.com/containerd/cgroups/stats/v1/metrics.proto", fileDescriptor_a17b2d87c332bfaa) +} + +var fileDescriptor_a17b2d87c332bfaa = []byte{ + // 1669 bytes of a gzipped FileDescriptorProto + 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0x94, 0x58, 0x4f, 0x73, 0x1b, 0xb7, + 0x15, 0x0f, 0xc5, 0x95, 0xc8, 0x7d, 0x94, 0x6c, 0x09, 0xfe, 0xb7, 0x52, 0x1c, 0x51, 0xa1, 0xec, + 0xd6, 0xad, 0xa7, 0xd2, 0x24, 0xed, 0x78, 0xea, 0x34, 0x99, 0x4e, 0xa4, 0x24, 0x63, 0x4f, 0xab, + 0x9a, 0x59, 0x4a, 0x93, 0xf6, 0xb4, 0x03, 0x2e, 0xe1, 0x25, 0xac, 0xe5, 0x62, 0x83, 0xc5, 0x52, + 0x74, 0x4f, 0x3d, 0x74, 0xa6, 0xa7, 0x7e, 0xa0, 0x7e, 0x83, 0x1c, 0x7b, 0xe9, 0x4c, 0x7b, 0xd1, + 0x34, 0xfc, 0x1c, 0x3d, 0x74, 0x80, 0x87, 0xfd, 0x43, 0xc7, 0xb2, 0xc2, 0xdb, 0xe2, 0xe1, 0xf7, + 0x7e, 0xef, 0xe1, 0xe1, 0x07, 0xe0, 0x91, 0xf0, 0xab, 0x88, 0xab, 0x71, 0x3e, 0x3c, 0x08, 0xc5, + 0xe4, 0x30, 0x14, 0x89, 0xa2, 0x3c, 0x61, 0x72, 0x74, 0x18, 0x46, 0x52, 0xe4, 0x69, 0x76, 0x98, + 0x29, 0xaa, 0xb2, 0xc3, 0xe9, 0x47, 0x87, 0x13, 0xa6, 0x24, 0x0f, 0xb3, 0x83, 0x54, 0x0a, 0x25, + 0x88, 0xc7, 0xc5, 0x41, 0x85, 0x3e, 0xb0, 0xe8, 0x83, 0xe9, 0x47, 0x3b, 0xb7, 0x23, 0x11, 0x09, + 0x03, 0x3a, 0xd4, 0x5f, 0x88, 0xef, 0xfd, 0xaf, 0x09, 0xad, 0x13, 0x64, 0x20, 0xbf, 0x85, 0xd6, + 0x38, 0x8f, 0x98, 0x8a, 0x87, 0x5e, 0x63, 0xaf, 0xf9, 0xa8, 0xf3, 0xf1, 0xc3, 0x83, 0xab, 0xd8, + 0x0e, 0x9e, 0x21, 0x70, 0xa0, 0xa8, 0xf2, 0x0b, 0x2f, 0xf2, 0x04, 0x9c, 0x94, 0x8f, 0x32, 0x6f, + 0x65, 0xaf, 0xf1, 0xa8, 0xf3, 0x71, 0xef, 0x6a, 0xef, 0x3e, 0x1f, 0x65, 0xc6, 0xd5, 0xe0, 0xc9, + 0xa7, 0xd0, 0x0c, 0xd3, 0xdc, 0x6b, 0x1a, 0xb7, 0x0f, 0xaf, 0x76, 0x3b, 0xee, 0x9f, 0x69, 0xaf, + 0xa3, 0xd6, 0xfc, 0xb2, 0xdb, 0x3c, 0xee, 0x9f, 0xf9, 0xda, 0x8d, 0x7c, 0x0a, 0x6b, 0x13, 0x36, + 0x11, 0xf2, 0xb5, 0xe7, 0x18, 0x82, 0x07, 0x57, 0x13, 0x9c, 0x18, 0x9c, 0x89, 0x6c, 0x7d, 0xc8, + 0x53, 0x58, 0x1d, 0xc6, 0xe7, 0x5c, 0x78, 0xab, 0xc6, 0x79, 0xff, 0x6a, 0xe7, 0xa3, 0xf8, 0xfc, + 0xf9, 0x0b, 0xe3, 0x8b, 0x1e, 0x7a, 0xb9, 0x72, 0x34, 0xa1, 0xde, 0xda, 0x75, 0xcb, 0xf5, 0x47, + 0x13, 0x8a, 0xcb, 0xd5, 0x78, 0x5d, 0xe7, 0x84, 0xa9, 0x0b, 0x21, 0xcf, 0xbd, 0xd6, 0x75, 0x75, + 0xfe, 0x03, 0x02, 0xb1, 0xce, 0xd6, 0x8b, 0x3c, 0x83, 0x75, 0x84, 0x04, 0x46, 0x05, 0x5e, 0xdb, + 0x24, 0xf0, 0x0e, 0x96, 0x63, 0xf3, 0xa9, 0x49, 0x32, 0xbf, 0x13, 0x56, 0x83, 0xde, 0x39, 0x74, + 0x6a, 0x3b, 0x49, 0x6e, 0xc3, 0x6a, 0x9e, 0xd1, 0x88, 0x79, 0x8d, 0xbd, 0xc6, 0x23, 0xc7, 0xc7, + 0x01, 0xd9, 0x84, 0xe6, 0x84, 0xce, 0xcc, 0xae, 0x3a, 0xbe, 0xfe, 0x24, 0x1e, 0xb4, 0x5e, 0x52, + 0x1e, 0x87, 0x89, 0x32, 0x9b, 0xe6, 0xf8, 0xc5, 0x90, 0xec, 0x40, 0x3b, 0xa5, 0x11, 0xcb, 0xf8, + 0x9f, 0x99, 0xd9, 0x0e, 0xd7, 0x2f, 0xc7, 0xbd, 0x4f, 0xa0, 0x5d, 0x6c, 0xbc, 0x66, 0x08, 0x73, + 0x29, 0x59, 0xa2, 0x6c, 0xac, 0x62, 0xa8, 0x73, 0x88, 0xf9, 0x84, 0x2b, 0x1b, 0x0f, 0x07, 0xbd, + 0xbf, 0x35, 0xa0, 0x65, 0xb7, 0x9f, 0xfc, 0xba, 0x9e, 0xe5, 0x3b, 0x0b, 0x7f, 0xdc, 0x3f, 0x3b, + 0xd3, 0xc8, 0x62, 0x25, 0x47, 0x00, 0x6a, 0x2c, 0x85, 0x52, 0x31, 0x4f, 0xa2, 0xeb, 0x65, 0x7a, + 0x8a, 0x58, 0xe6, 0xd7, 0xbc, 0x7a, 0xdf, 0x42, 0xbb, 0xa0, 0xd5, 0xb9, 0x2a, 0xa1, 0x68, 0x5c, + 0xd4, 0xcb, 0x0c, 0xc8, 0x5d, 0x58, 0x3b, 0x67, 0x32, 0x61, 0xb1, 0x5d, 0x82, 0x1d, 0x11, 0x02, + 0x4e, 0x9e, 0x31, 0x69, 0x4b, 0x66, 0xbe, 0xc9, 0x3e, 0xb4, 0x52, 0x26, 0x03, 0x2d, 0x7f, 0x67, + 0xaf, 0xf9, 0xc8, 0x39, 0x82, 0xf9, 0x65, 0x77, 0xad, 0xcf, 0xa4, 0x96, 0xf7, 0x5a, 0xca, 0xe4, + 0x71, 0x9a, 0xf7, 0x66, 0xd0, 0x2e, 0x52, 0xd1, 0x85, 0x4b, 0x99, 0xe4, 0x62, 0x94, 0x15, 0x85, + 0xb3, 0x43, 0xf2, 0x18, 0xb6, 0x6c, 0x9a, 0x6c, 0x14, 0x14, 0x18, 0xcc, 0x60, 0xb3, 0x9c, 0xe8, + 0x5b, 0xf0, 0x43, 0xb8, 0x51, 0x81, 0x15, 0x9f, 0x30, 0x9b, 0xd5, 0x46, 0x69, 0x3d, 0xe5, 0x13, + 0xd6, 0xfb, 0x4f, 0x07, 0xa0, 0x3a, 0x34, 0x7a, 0xbd, 0x21, 0x0d, 0xc7, 0xa5, 0x3e, 0xcc, 0x80, + 0x6c, 0x43, 0x53, 0x66, 0x36, 0x14, 0x9e, 0x4d, 0x7f, 0x30, 0xf0, 0xb5, 0x8d, 0xfc, 0x04, 0xda, + 0x32, 0xcb, 0x02, 0x7d, 0x41, 0x60, 0x80, 0xa3, 0xce, 0xfc, 0xb2, 0xdb, 0xf2, 0x07, 0x03, 0x2d, + 0x3b, 0xbf, 0x25, 0xb3, 0x4c, 0x7f, 0x90, 0x2e, 0x74, 0x26, 0x34, 0x4d, 0xd9, 0x28, 0x78, 0xc9, + 0x63, 0x54, 0x8e, 0xe3, 0x03, 0x9a, 0xbe, 0xe2, 0xb1, 0xa9, 0xf4, 0x88, 0x4b, 0xf5, 0xda, 0x1c, + 0x53, 0xc7, 0xc7, 0x01, 0xb9, 0x0f, 0xee, 0x85, 0xe4, 0x8a, 0x0d, 0x69, 0x78, 0x6e, 0x8e, 0xa1, + 0xe3, 0x57, 0x06, 0xe2, 0x41, 0x3b, 0x8d, 0x82, 0x34, 0x0a, 0x78, 0xe2, 0xb5, 0x70, 0x27, 0xd2, + 0xa8, 0x1f, 0x3d, 0x4f, 0xc8, 0x0e, 0xb8, 0x38, 0x23, 0x72, 0x65, 0x4e, 0x8f, 0x2e, 0x63, 0xd4, + 0x8f, 0x5e, 0xe4, 0x8a, 0x6c, 0x1b, 0xaf, 0x97, 0x34, 0x8f, 0x95, 0xe7, 0x16, 0x53, 0x5f, 0xe9, + 0x21, 0xd9, 0x83, 0xf5, 0x34, 0x0a, 0x26, 0xf4, 0x95, 0x9d, 0x06, 0x4c, 0x33, 0x8d, 0x4e, 0xe8, + 0x2b, 0x44, 0xec, 0xc3, 0x06, 0x4f, 0x68, 0xa8, 0xf8, 0x94, 0x05, 0x34, 0x11, 0x89, 0xd7, 0x31, + 0x90, 0xf5, 0xc2, 0xf8, 0x79, 0x22, 0x12, 0xbd, 0xd8, 0x3a, 0x64, 0x1d, 0x59, 0x6a, 0x80, 0x3a, + 0x8b, 0xa9, 0xc7, 0xc6, 0x22, 0x8b, 0xa9, 0x48, 0xc5, 0x62, 0x20, 0x37, 0xea, 0x2c, 0x06, 0xb0, + 0x07, 0x9d, 0x3c, 0x61, 0x53, 0x1e, 0x2a, 0x3a, 0x8c, 0x99, 0x77, 0xd3, 0x00, 0xea, 0x26, 0xf2, + 0x09, 0x6c, 0x8f, 0x39, 0x93, 0x54, 0x86, 0x63, 0x1e, 0xd2, 0x38, 0xc0, 0x2b, 0x31, 0xc0, 0xe3, + 0xb7, 0x69, 0xf0, 0xf7, 0xea, 0x00, 0x54, 0xc2, 0xef, 0xf5, 0x34, 0x79, 0x02, 0x0b, 0x53, 0x41, + 0x76, 0x41, 0x53, 0xeb, 0xb9, 0x65, 0x3c, 0xef, 0xd4, 0xa7, 0x07, 0x17, 0x34, 0x45, 0xbf, 0x2e, + 0x74, 0xcc, 0x29, 0x09, 0x50, 0x48, 0x04, 0xd3, 0x36, 0xa6, 0x63, 0xa3, 0xa6, 0x9f, 0x81, 0x8b, + 0x00, 0xad, 0xa9, 0x5b, 0x46, 0x33, 0xeb, 0xf3, 0xcb, 0x6e, 0xfb, 0x54, 0x1b, 0xb5, 0xb0, 0xda, + 0x66, 0xda, 0xcf, 0x32, 0xf2, 0x04, 0x6e, 0x94, 0x50, 0xd4, 0xd8, 0x6d, 0x83, 0xdf, 0x9c, 0x5f, + 0x76, 0xd7, 0x0b, 0xbc, 0x11, 0xda, 0x7a, 0xe1, 0x63, 0xd4, 0xf6, 0x73, 0xd8, 0x42, 0xbf, 0xba, + 0xe6, 0xee, 0x98, 0x4c, 0x6e, 0x9a, 0x89, 0x93, 0x4a, 0x78, 0x65, 0xbe, 0x28, 0xbf, 0xbb, 0xb5, + 0x7c, 0xbf, 0x30, 0x1a, 0xfc, 0x29, 0xa0, 0x4f, 0x50, 0x29, 0xf1, 0x9e, 0x01, 0x61, 0x6e, 0xdf, + 0x94, 0x72, 0xdc, 0x2f, 0xb2, 0x2d, 0x45, 0xe9, 0xe1, 0x96, 0x18, 0x6b, 0x1f, 0x95, 0xf9, 0xb0, + 0x60, 0xab, 0xf4, 0xb9, 0x8d, 0x9b, 0x5f, 0xa2, 0xb4, 0x48, 0x1f, 0xd4, 0xb8, 0x50, 0x8b, 0x3b, + 0x0b, 0x28, 0x54, 0xe3, 0x63, 0x20, 0x25, 0xaa, 0x52, 0xed, 0xfb, 0xb5, 0x85, 0xf6, 0x2b, 0xe9, + 0x1e, 0xc0, 0x2d, 0x04, 0x2f, 0x0a, 0xf8, 0xbe, 0x41, 0x63, 0xbd, 0x9e, 0xd7, 0x55, 0x5c, 0x16, + 0xb1, 0x8e, 0xfe, 0xa0, 0xc6, 0xfd, 0x79, 0x85, 0xfd, 0x21, 0xb7, 0x29, 0xf9, 0xee, 0x5b, 0xb8, + 0x4d, 0xd1, 0xdf, 0xe4, 0x36, 0xe8, 0xee, 0x0f, 0xb8, 0x0d, 0xf6, 0x71, 0x81, 0xad, 0x8b, 0x7d, + 0xcf, 0x5e, 0x7b, 0x7a, 0xe2, 0xac, 0xa6, 0xf8, 0xdf, 0x14, 0x4f, 0xc7, 0x87, 0xd7, 0x3d, 0x99, + 0xa8, 0xf5, 0x2f, 0x13, 0x25, 0x5f, 0x17, 0xaf, 0xc7, 0x53, 0x70, 0xb4, 0xca, 0xbd, 0xde, 0x32, + 0xbe, 0xc6, 0x85, 0x7c, 0x56, 0x3e, 0x09, 0xfb, 0xcb, 0x38, 0x17, 0x2f, 0xc7, 0x00, 0x00, 0xbf, + 0x02, 0x15, 0xa6, 0xde, 0x83, 0x25, 0x28, 0x8e, 0x36, 0xe6, 0x97, 0x5d, 0xf7, 0x77, 0xc6, 0xf9, + 0xf4, 0xb8, 0xef, 0xbb, 0xc8, 0x73, 0x1a, 0xa6, 0x3d, 0x06, 0x9d, 0x1a, 0xb0, 0x7a, 0x77, 0x1b, + 0xb5, 0x77, 0xb7, 0xea, 0x08, 0x56, 0xde, 0xd2, 0x11, 0x34, 0xdf, 0xda, 0x11, 0x38, 0x0b, 0x1d, + 0x41, 0xef, 0x5f, 0xab, 0xe0, 0x96, 0xad, 0x13, 0xa1, 0xb0, 0xc3, 0x45, 0x90, 0x31, 0x39, 0xe5, + 0x21, 0x0b, 0x86, 0xaf, 0x15, 0xcb, 0x02, 0xc9, 0xc2, 0x5c, 0x66, 0x7c, 0xca, 0x6c, 0xdb, 0xf9, + 0xe0, 0x9a, 0x1e, 0x0c, 0x6b, 0x73, 0x8f, 0x8b, 0x01, 0xd2, 0x1c, 0x69, 0x16, 0xbf, 0x20, 0x21, + 0x7f, 0x84, 0x3b, 0x55, 0x88, 0x51, 0x8d, 0x7d, 0x65, 0x09, 0xf6, 0x5b, 0x25, 0xfb, 0xa8, 0x62, + 0x3e, 0x85, 0x5b, 0x5c, 0x04, 0xdf, 0xe6, 0x2c, 0x5f, 0xe0, 0x6d, 0x2e, 0xc1, 0xbb, 0xc5, 0xc5, + 0xd7, 0xc6, 0xbf, 0x62, 0x0d, 0x60, 0xbb, 0x56, 0x12, 0xfd, 0x16, 0xd7, 0xb8, 0x9d, 0x25, 0xb8, + 0xef, 0x96, 0x39, 0xeb, 0xb7, 0xbb, 0x0a, 0xf0, 0x27, 0xb8, 0xcb, 0x45, 0x70, 0x41, 0xb9, 0x7a, + 0x93, 0x7d, 0x75, 0xb9, 0x8a, 0x7c, 0x43, 0xb9, 0x5a, 0xa4, 0xc6, 0x8a, 0x4c, 0x98, 0x8c, 0x16, + 0x2a, 0xb2, 0xb6, 0x5c, 0x45, 0x4e, 0x8c, 0x7f, 0xc5, 0xda, 0x87, 0x2d, 0x2e, 0xde, 0xcc, 0xb5, + 0xb5, 0x04, 0xe7, 0x4d, 0x2e, 0x16, 0xf3, 0xfc, 0x1a, 0xb6, 0x32, 0x16, 0x2a, 0x21, 0xeb, 0x6a, + 0x6b, 0x2f, 0xc1, 0xb8, 0x69, 0xdd, 0x4b, 0xca, 0xde, 0x14, 0xa0, 0x9a, 0x27, 0x37, 0x60, 0x45, + 0xa4, 0xe6, 0xe8, 0xb8, 0xfe, 0x8a, 0x48, 0x75, 0x0f, 0x38, 0xd2, 0xd7, 0x0e, 0x1e, 0x1c, 0xd7, + 0xb7, 0x23, 0x7d, 0x9e, 0x26, 0xf4, 0x95, 0x28, 0x9a, 0x40, 0x1c, 0x18, 0x2b, 0x4f, 0x84, 0xb4, + 0x67, 0x07, 0x07, 0xda, 0x3a, 0xa5, 0x71, 0xce, 0x8a, 0x9e, 0xc7, 0x0c, 0x7a, 0x7f, 0x6d, 0x40, + 0xbb, 0xf8, 0x41, 0x41, 0x3e, 0xab, 0xb7, 0xd1, 0xcd, 0x77, 0xff, 0x7e, 0xd1, 0x4e, 0xb8, 0x98, + 0xb2, 0xd7, 0x7e, 0x5a, 0xf5, 0xda, 0x3f, 0xda, 0xd9, 0x36, 0xe4, 0x0c, 0xdc, 0xd2, 0x56, 0x5b, + 0x6d, 0x63, 0x61, 0xb5, 0x5d, 0xe8, 0x8c, 0x43, 0x1a, 0x8c, 0x69, 0x32, 0x8a, 0x19, 0x76, 0x88, + 0x1b, 0x3e, 0x8c, 0x43, 0xfa, 0x0c, 0x2d, 0x05, 0x40, 0x0c, 0x5f, 0xb1, 0x50, 0x65, 0xa6, 0x28, + 0x08, 0x78, 0x81, 0x96, 0xde, 0xdf, 0x57, 0xa0, 0x53, 0xfb, 0x0d, 0xa4, 0x7b, 0xe8, 0x84, 0x4e, + 0x8a, 0x38, 0xe6, 0x5b, 0x77, 0x6c, 0x72, 0x86, 0x77, 0x89, 0xbd, 0xa6, 0x5a, 0x72, 0x66, 0x2e, + 0x05, 0xf2, 0x01, 0x80, 0x9c, 0x05, 0x29, 0x0d, 0xcf, 0x99, 0xa5, 0x77, 0x7c, 0x57, 0xce, 0xfa, + 0x68, 0x20, 0xef, 0x83, 0x2b, 0x67, 0x01, 0x93, 0x52, 0xc8, 0xcc, 0xd6, 0xbe, 0x2d, 0x67, 0x5f, + 0x9a, 0xb1, 0xf5, 0x1d, 0x49, 0xa1, 0x7b, 0x01, 0xbb, 0x07, 0xae, 0x9c, 0x7d, 0x81, 0x06, 0x1d, + 0x55, 0x15, 0x51, 0xb1, 0xf5, 0x6c, 0xa9, 0x2a, 0xaa, 0xaa, 0xa2, 0x62, 0xeb, 0xe9, 0xaa, 0x7a, + 0x54, 0x55, 0x46, 0xc5, 0xee, 0xb3, 0xad, 0x6a, 0x51, 0x55, 0x15, 0xd5, 0x2d, 0x7c, 0x6d, 0xd4, + 0xde, 0x3f, 0x1a, 0xd0, 0xa9, 0xfd, 0x9a, 0xd3, 0x05, 0x4c, 0x64, 0x90, 0xc5, 0x8c, 0xa5, 0xfa, + 0x27, 0x0d, 0xde, 0xdd, 0x90, 0xc8, 0x81, 0xb5, 0x68, 0xbe, 0x44, 0x06, 0x32, 0x4f, 0x92, 0xe2, + 0x27, 0x8f, 0xe3, 0xbb, 0x89, 0xf4, 0xd1, 0x60, 0xa7, 0x33, 0x85, 0xe1, 0x9a, 0xc5, 0xf4, 0x00, + 0x0d, 0xe4, 0x17, 0x40, 0x12, 0x19, 0xe4, 0x09, 0x4f, 0x14, 0x93, 0x32, 0x4f, 0x15, 0x1f, 0x96, + 0xed, 0xf9, 0x56, 0x22, 0xcf, 0x16, 0x27, 0xc8, 0x7d, 0xc3, 0x66, 0x2f, 0x1b, 0x5b, 0xb2, 0x76, + 0x22, 0x9f, 0x9b, 0x9b, 0xe3, 0xc8, 0xfb, 0xee, 0xfb, 0xdd, 0xf7, 0xfe, 0xfd, 0xfd, 0xee, 0x7b, + 0x7f, 0x99, 0xef, 0x36, 0xbe, 0x9b, 0xef, 0x36, 0xfe, 0x39, 0xdf, 0x6d, 0xfc, 0x77, 0xbe, 0xdb, + 0x18, 0xae, 0x99, 0x3f, 0x23, 0x7e, 0xf9, 0xff, 0x00, 0x00, 0x00, 0xff, 0xff, 0xb9, 0x78, 0x66, + 0x06, 0xf4, 0x10, 0x00, 0x00, +} + +func (m *Metrics) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *Metrics) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.Hugetlb) > 0 { + for _, msg := range m.Hugetlb { + dAtA[i] = 0xa + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if m.Pids != nil { + dAtA[i] = 0x12 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Pids.Size())) + n1, err := m.Pids.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n1 + } + if m.CPU != nil { + dAtA[i] = 0x1a + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.CPU.Size())) + n2, err := m.CPU.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n2 + } + if m.Memory != nil { + dAtA[i] = 0x22 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Memory.Size())) + n3, err := m.Memory.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n3 + } + if m.Blkio != nil { + dAtA[i] = 0x2a + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Blkio.Size())) + n4, err := m.Blkio.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n4 + } + if m.Rdma != nil { + dAtA[i] = 0x32 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Rdma.Size())) + n5, err := m.Rdma.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n5 + } + if len(m.Network) > 0 { + for _, msg := range m.Network { + dAtA[i] = 0x3a + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if m.CgroupStats != nil { + dAtA[i] = 0x42 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.CgroupStats.Size())) + n6, err := m.CgroupStats.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n6 + } + if m.MemoryOomControl != nil { + dAtA[i] = 0x4a + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.MemoryOomControl.Size())) + n7, err := m.MemoryOomControl.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n7 + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *HugetlbStat) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *HugetlbStat) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if m.Usage != 0 { + dAtA[i] = 0x8 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Usage)) + } + if m.Max != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Max)) + } + if m.Failcnt != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Failcnt)) + } + if len(m.Pagesize) > 0 { + dAtA[i] = 0x22 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(len(m.Pagesize))) + i += copy(dAtA[i:], m.Pagesize) + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *PidsStat) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *PidsStat) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if m.Current != 0 { + dAtA[i] = 0x8 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Current)) + } + if m.Limit != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Limit)) + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *CPUStat) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *CPUStat) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if m.Usage != nil { + dAtA[i] = 0xa + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Usage.Size())) + n7, err := m.Usage.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n7 + } + if m.Throttling != nil { + dAtA[i] = 0x12 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Throttling.Size())) + n8, err := m.Throttling.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n8 + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *CPUUsage) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *CPUUsage) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if m.Total != 0 { + dAtA[i] = 0x8 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Total)) + } + if m.Kernel != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Kernel)) + } + if m.User != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.User)) + } + if len(m.PerCPU) > 0 { + dAtA10 := make([]byte, len(m.PerCPU)*10) + var j9 int + for _, num := range m.PerCPU { + for num >= 1<<7 { + dAtA10[j9] = uint8(uint64(num)&0x7f | 0x80) + num >>= 7 + j9++ + } + dAtA10[j9] = uint8(num) + j9++ + } + dAtA[i] = 0x22 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(j9)) + i += copy(dAtA[i:], dAtA10[:j9]) + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *Throttle) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *Throttle) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if m.Periods != 0 { + dAtA[i] = 0x8 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Periods)) + } + if m.ThrottledPeriods != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.ThrottledPeriods)) + } + if m.ThrottledTime != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.ThrottledTime)) + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *MemoryStat) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *MemoryStat) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if m.Cache != 0 { + dAtA[i] = 0x8 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Cache)) + } + if m.RSS != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.RSS)) + } + if m.RSSHuge != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.RSSHuge)) + } + if m.MappedFile != 0 { + dAtA[i] = 0x20 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.MappedFile)) + } + if m.Dirty != 0 { + dAtA[i] = 0x28 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Dirty)) + } + if m.Writeback != 0 { + dAtA[i] = 0x30 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Writeback)) + } + if m.PgPgIn != 0 { + dAtA[i] = 0x38 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.PgPgIn)) + } + if m.PgPgOut != 0 { + dAtA[i] = 0x40 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.PgPgOut)) + } + if m.PgFault != 0 { + dAtA[i] = 0x48 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.PgFault)) + } + if m.PgMajFault != 0 { + dAtA[i] = 0x50 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.PgMajFault)) + } + if m.InactiveAnon != 0 { + dAtA[i] = 0x58 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.InactiveAnon)) + } + if m.ActiveAnon != 0 { + dAtA[i] = 0x60 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.ActiveAnon)) + } + if m.InactiveFile != 0 { + dAtA[i] = 0x68 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.InactiveFile)) + } + if m.ActiveFile != 0 { + dAtA[i] = 0x70 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.ActiveFile)) + } + if m.Unevictable != 0 { + dAtA[i] = 0x78 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Unevictable)) + } + if m.HierarchicalMemoryLimit != 0 { + dAtA[i] = 0x80 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.HierarchicalMemoryLimit)) + } + if m.HierarchicalSwapLimit != 0 { + dAtA[i] = 0x88 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.HierarchicalSwapLimit)) + } + if m.TotalCache != 0 { + dAtA[i] = 0x90 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalCache)) + } + if m.TotalRSS != 0 { + dAtA[i] = 0x98 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalRSS)) + } + if m.TotalRSSHuge != 0 { + dAtA[i] = 0xa0 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalRSSHuge)) + } + if m.TotalMappedFile != 0 { + dAtA[i] = 0xa8 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalMappedFile)) + } + if m.TotalDirty != 0 { + dAtA[i] = 0xb0 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalDirty)) + } + if m.TotalWriteback != 0 { + dAtA[i] = 0xb8 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalWriteback)) + } + if m.TotalPgPgIn != 0 { + dAtA[i] = 0xc0 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalPgPgIn)) + } + if m.TotalPgPgOut != 0 { + dAtA[i] = 0xc8 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalPgPgOut)) + } + if m.TotalPgFault != 0 { + dAtA[i] = 0xd0 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalPgFault)) + } + if m.TotalPgMajFault != 0 { + dAtA[i] = 0xd8 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalPgMajFault)) + } + if m.TotalInactiveAnon != 0 { + dAtA[i] = 0xe0 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalInactiveAnon)) + } + if m.TotalActiveAnon != 0 { + dAtA[i] = 0xe8 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalActiveAnon)) + } + if m.TotalInactiveFile != 0 { + dAtA[i] = 0xf0 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalInactiveFile)) + } + if m.TotalActiveFile != 0 { + dAtA[i] = 0xf8 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalActiveFile)) + } + if m.TotalUnevictable != 0 { + dAtA[i] = 0x80 + i++ + dAtA[i] = 0x2 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalUnevictable)) + } + if m.Usage != nil { + dAtA[i] = 0x8a + i++ + dAtA[i] = 0x2 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Usage.Size())) + n11, err := m.Usage.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n11 + } + if m.Swap != nil { + dAtA[i] = 0x92 + i++ + dAtA[i] = 0x2 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Swap.Size())) + n12, err := m.Swap.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n12 + } + if m.Kernel != nil { + dAtA[i] = 0x9a + i++ + dAtA[i] = 0x2 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Kernel.Size())) + n13, err := m.Kernel.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n13 + } + if m.KernelTCP != nil { + dAtA[i] = 0xa2 + i++ + dAtA[i] = 0x2 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.KernelTCP.Size())) + n14, err := m.KernelTCP.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n14 + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *MemoryEntry) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *MemoryEntry) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if m.Limit != 0 { + dAtA[i] = 0x8 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Limit)) + } + if m.Usage != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Usage)) + } + if m.Max != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Max)) + } + if m.Failcnt != 0 { + dAtA[i] = 0x20 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Failcnt)) + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *MemoryOomControl) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *MemoryOomControl) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if m.OomKillDisable != 0 { + dAtA[i] = 0x8 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.OomKillDisable)) + } + if m.UnderOom != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.UnderOom)) + } + if m.OomKill != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.OomKill)) + } + return i, nil +} + +func (m *BlkIOStat) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *BlkIOStat) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.IoServiceBytesRecursive) > 0 { + for _, msg := range m.IoServiceBytesRecursive { + dAtA[i] = 0xa + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if len(m.IoServicedRecursive) > 0 { + for _, msg := range m.IoServicedRecursive { + dAtA[i] = 0x12 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if len(m.IoQueuedRecursive) > 0 { + for _, msg := range m.IoQueuedRecursive { + dAtA[i] = 0x1a + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if len(m.IoServiceTimeRecursive) > 0 { + for _, msg := range m.IoServiceTimeRecursive { + dAtA[i] = 0x22 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if len(m.IoWaitTimeRecursive) > 0 { + for _, msg := range m.IoWaitTimeRecursive { + dAtA[i] = 0x2a + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if len(m.IoMergedRecursive) > 0 { + for _, msg := range m.IoMergedRecursive { + dAtA[i] = 0x32 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if len(m.IoTimeRecursive) > 0 { + for _, msg := range m.IoTimeRecursive { + dAtA[i] = 0x3a + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if len(m.SectorsRecursive) > 0 { + for _, msg := range m.SectorsRecursive { + dAtA[i] = 0x42 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *BlkIOEntry) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *BlkIOEntry) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.Op) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintMetrics(dAtA, i, uint64(len(m.Op))) + i += copy(dAtA[i:], m.Op) + } + if len(m.Device) > 0 { + dAtA[i] = 0x12 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(len(m.Device))) + i += copy(dAtA[i:], m.Device) + } + if m.Major != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Major)) + } + if m.Minor != 0 { + dAtA[i] = 0x20 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Minor)) + } + if m.Value != 0 { + dAtA[i] = 0x28 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Value)) + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *RdmaStat) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *RdmaStat) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.Current) > 0 { + for _, msg := range m.Current { + dAtA[i] = 0xa + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if len(m.Limit) > 0 { + for _, msg := range m.Limit { + dAtA[i] = 0x12 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *RdmaEntry) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *RdmaEntry) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.Device) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintMetrics(dAtA, i, uint64(len(m.Device))) + i += copy(dAtA[i:], m.Device) + } + if m.HcaHandles != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.HcaHandles)) + } + if m.HcaObjects != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.HcaObjects)) + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *NetworkStat) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *NetworkStat) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.Name) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintMetrics(dAtA, i, uint64(len(m.Name))) + i += copy(dAtA[i:], m.Name) + } + if m.RxBytes != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.RxBytes)) + } + if m.RxPackets != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.RxPackets)) + } + if m.RxErrors != 0 { + dAtA[i] = 0x20 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.RxErrors)) + } + if m.RxDropped != 0 { + dAtA[i] = 0x28 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.RxDropped)) + } + if m.TxBytes != 0 { + dAtA[i] = 0x30 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TxBytes)) + } + if m.TxPackets != 0 { + dAtA[i] = 0x38 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TxPackets)) + } + if m.TxErrors != 0 { + dAtA[i] = 0x40 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TxErrors)) + } + if m.TxDropped != 0 { + dAtA[i] = 0x48 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TxDropped)) + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *CgroupStats) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *CgroupStats) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if m.NrSleeping != 0 { + dAtA[i] = 0x8 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.NrSleeping)) + } + if m.NrRunning != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.NrRunning)) + } + if m.NrStopped != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.NrStopped)) + } + if m.NrUninterruptible != 0 { + dAtA[i] = 0x20 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.NrUninterruptible)) + } + if m.NrIoWait != 0 { + dAtA[i] = 0x28 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.NrIoWait)) + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func encodeVarintMetrics(dAtA []byte, offset int, v uint64) int { + for v >= 1<<7 { + dAtA[offset] = uint8(v&0x7f | 0x80) + v >>= 7 + offset++ + } + dAtA[offset] = uint8(v) + return offset + 1 +} +func (m *Metrics) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if len(m.Hugetlb) > 0 { + for _, e := range m.Hugetlb { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if m.Pids != nil { + l = m.Pids.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + if m.CPU != nil { + l = m.CPU.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + if m.Memory != nil { + l = m.Memory.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + if m.Blkio != nil { + l = m.Blkio.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + if m.Rdma != nil { + l = m.Rdma.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + if len(m.Network) > 0 { + for _, e := range m.Network { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if m.CgroupStats != nil { + l = m.CgroupStats.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + if m.MemoryOomControl != nil { + l = m.MemoryOomControl.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *HugetlbStat) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.Usage != 0 { + n += 1 + sovMetrics(uint64(m.Usage)) + } + if m.Max != 0 { + n += 1 + sovMetrics(uint64(m.Max)) + } + if m.Failcnt != 0 { + n += 1 + sovMetrics(uint64(m.Failcnt)) + } + l = len(m.Pagesize) + if l > 0 { + n += 1 + l + sovMetrics(uint64(l)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *PidsStat) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.Current != 0 { + n += 1 + sovMetrics(uint64(m.Current)) + } + if m.Limit != 0 { + n += 1 + sovMetrics(uint64(m.Limit)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *CPUStat) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.Usage != nil { + l = m.Usage.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + if m.Throttling != nil { + l = m.Throttling.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *CPUUsage) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.Total != 0 { + n += 1 + sovMetrics(uint64(m.Total)) + } + if m.Kernel != 0 { + n += 1 + sovMetrics(uint64(m.Kernel)) + } + if m.User != 0 { + n += 1 + sovMetrics(uint64(m.User)) + } + if len(m.PerCPU) > 0 { + l = 0 + for _, e := range m.PerCPU { + l += sovMetrics(uint64(e)) + } + n += 1 + sovMetrics(uint64(l)) + l + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *Throttle) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.Periods != 0 { + n += 1 + sovMetrics(uint64(m.Periods)) + } + if m.ThrottledPeriods != 0 { + n += 1 + sovMetrics(uint64(m.ThrottledPeriods)) + } + if m.ThrottledTime != 0 { + n += 1 + sovMetrics(uint64(m.ThrottledTime)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *MemoryStat) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.Cache != 0 { + n += 1 + sovMetrics(uint64(m.Cache)) + } + if m.RSS != 0 { + n += 1 + sovMetrics(uint64(m.RSS)) + } + if m.RSSHuge != 0 { + n += 1 + sovMetrics(uint64(m.RSSHuge)) + } + if m.MappedFile != 0 { + n += 1 + sovMetrics(uint64(m.MappedFile)) + } + if m.Dirty != 0 { + n += 1 + sovMetrics(uint64(m.Dirty)) + } + if m.Writeback != 0 { + n += 1 + sovMetrics(uint64(m.Writeback)) + } + if m.PgPgIn != 0 { + n += 1 + sovMetrics(uint64(m.PgPgIn)) + } + if m.PgPgOut != 0 { + n += 1 + sovMetrics(uint64(m.PgPgOut)) + } + if m.PgFault != 0 { + n += 1 + sovMetrics(uint64(m.PgFault)) + } + if m.PgMajFault != 0 { + n += 1 + sovMetrics(uint64(m.PgMajFault)) + } + if m.InactiveAnon != 0 { + n += 1 + sovMetrics(uint64(m.InactiveAnon)) + } + if m.ActiveAnon != 0 { + n += 1 + sovMetrics(uint64(m.ActiveAnon)) + } + if m.InactiveFile != 0 { + n += 1 + sovMetrics(uint64(m.InactiveFile)) + } + if m.ActiveFile != 0 { + n += 1 + sovMetrics(uint64(m.ActiveFile)) + } + if m.Unevictable != 0 { + n += 1 + sovMetrics(uint64(m.Unevictable)) + } + if m.HierarchicalMemoryLimit != 0 { + n += 2 + sovMetrics(uint64(m.HierarchicalMemoryLimit)) + } + if m.HierarchicalSwapLimit != 0 { + n += 2 + sovMetrics(uint64(m.HierarchicalSwapLimit)) + } + if m.TotalCache != 0 { + n += 2 + sovMetrics(uint64(m.TotalCache)) + } + if m.TotalRSS != 0 { + n += 2 + sovMetrics(uint64(m.TotalRSS)) + } + if m.TotalRSSHuge != 0 { + n += 2 + sovMetrics(uint64(m.TotalRSSHuge)) + } + if m.TotalMappedFile != 0 { + n += 2 + sovMetrics(uint64(m.TotalMappedFile)) + } + if m.TotalDirty != 0 { + n += 2 + sovMetrics(uint64(m.TotalDirty)) + } + if m.TotalWriteback != 0 { + n += 2 + sovMetrics(uint64(m.TotalWriteback)) + } + if m.TotalPgPgIn != 0 { + n += 2 + sovMetrics(uint64(m.TotalPgPgIn)) + } + if m.TotalPgPgOut != 0 { + n += 2 + sovMetrics(uint64(m.TotalPgPgOut)) + } + if m.TotalPgFault != 0 { + n += 2 + sovMetrics(uint64(m.TotalPgFault)) + } + if m.TotalPgMajFault != 0 { + n += 2 + sovMetrics(uint64(m.TotalPgMajFault)) + } + if m.TotalInactiveAnon != 0 { + n += 2 + sovMetrics(uint64(m.TotalInactiveAnon)) + } + if m.TotalActiveAnon != 0 { + n += 2 + sovMetrics(uint64(m.TotalActiveAnon)) + } + if m.TotalInactiveFile != 0 { + n += 2 + sovMetrics(uint64(m.TotalInactiveFile)) + } + if m.TotalActiveFile != 0 { + n += 2 + sovMetrics(uint64(m.TotalActiveFile)) + } + if m.TotalUnevictable != 0 { + n += 2 + sovMetrics(uint64(m.TotalUnevictable)) + } + if m.Usage != nil { + l = m.Usage.Size() + n += 2 + l + sovMetrics(uint64(l)) + } + if m.Swap != nil { + l = m.Swap.Size() + n += 2 + l + sovMetrics(uint64(l)) + } + if m.Kernel != nil { + l = m.Kernel.Size() + n += 2 + l + sovMetrics(uint64(l)) + } + if m.KernelTCP != nil { + l = m.KernelTCP.Size() + n += 2 + l + sovMetrics(uint64(l)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *MemoryEntry) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.Limit != 0 { + n += 1 + sovMetrics(uint64(m.Limit)) + } + if m.Usage != 0 { + n += 1 + sovMetrics(uint64(m.Usage)) + } + if m.Max != 0 { + n += 1 + sovMetrics(uint64(m.Max)) + } + if m.Failcnt != 0 { + n += 1 + sovMetrics(uint64(m.Failcnt)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *MemoryOomControl) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.OomKillDisable != 0 { + n += 1 + sovMetrics(uint64(m.OomKillDisable)) + } + if m.UnderOom != 0 { + n += 1 + sovMetrics(uint64(m.UnderOom)) + } + if m.OomKill != 0 { + n += 1 + sovMetrics(uint64(m.OomKill)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *BlkIOStat) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if len(m.IoServiceBytesRecursive) > 0 { + for _, e := range m.IoServiceBytesRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.IoServicedRecursive) > 0 { + for _, e := range m.IoServicedRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.IoQueuedRecursive) > 0 { + for _, e := range m.IoQueuedRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.IoServiceTimeRecursive) > 0 { + for _, e := range m.IoServiceTimeRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.IoWaitTimeRecursive) > 0 { + for _, e := range m.IoWaitTimeRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.IoMergedRecursive) > 0 { + for _, e := range m.IoMergedRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.IoTimeRecursive) > 0 { + for _, e := range m.IoTimeRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.SectorsRecursive) > 0 { + for _, e := range m.SectorsRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *BlkIOEntry) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + l = len(m.Op) + if l > 0 { + n += 1 + l + sovMetrics(uint64(l)) + } + l = len(m.Device) + if l > 0 { + n += 1 + l + sovMetrics(uint64(l)) + } + if m.Major != 0 { + n += 1 + sovMetrics(uint64(m.Major)) + } + if m.Minor != 0 { + n += 1 + sovMetrics(uint64(m.Minor)) + } + if m.Value != 0 { + n += 1 + sovMetrics(uint64(m.Value)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *RdmaStat) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if len(m.Current) > 0 { + for _, e := range m.Current { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.Limit) > 0 { + for _, e := range m.Limit { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *RdmaEntry) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + l = len(m.Device) + if l > 0 { + n += 1 + l + sovMetrics(uint64(l)) + } + if m.HcaHandles != 0 { + n += 1 + sovMetrics(uint64(m.HcaHandles)) + } + if m.HcaObjects != 0 { + n += 1 + sovMetrics(uint64(m.HcaObjects)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *NetworkStat) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + l = len(m.Name) + if l > 0 { + n += 1 + l + sovMetrics(uint64(l)) + } + if m.RxBytes != 0 { + n += 1 + sovMetrics(uint64(m.RxBytes)) + } + if m.RxPackets != 0 { + n += 1 + sovMetrics(uint64(m.RxPackets)) + } + if m.RxErrors != 0 { + n += 1 + sovMetrics(uint64(m.RxErrors)) + } + if m.RxDropped != 0 { + n += 1 + sovMetrics(uint64(m.RxDropped)) + } + if m.TxBytes != 0 { + n += 1 + sovMetrics(uint64(m.TxBytes)) + } + if m.TxPackets != 0 { + n += 1 + sovMetrics(uint64(m.TxPackets)) + } + if m.TxErrors != 0 { + n += 1 + sovMetrics(uint64(m.TxErrors)) + } + if m.TxDropped != 0 { + n += 1 + sovMetrics(uint64(m.TxDropped)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *CgroupStats) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.NrSleeping != 0 { + n += 1 + sovMetrics(uint64(m.NrSleeping)) + } + if m.NrRunning != 0 { + n += 1 + sovMetrics(uint64(m.NrRunning)) + } + if m.NrStopped != 0 { + n += 1 + sovMetrics(uint64(m.NrStopped)) + } + if m.NrUninterruptible != 0 { + n += 1 + sovMetrics(uint64(m.NrUninterruptible)) + } + if m.NrIoWait != 0 { + n += 1 + sovMetrics(uint64(m.NrIoWait)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func sovMetrics(x uint64) (n int) { + for { + n++ + x >>= 7 + if x == 0 { + break + } + } + return n +} +func sozMetrics(x uint64) (n int) { + return sovMetrics(uint64((x << 1) ^ uint64((int64(x) >> 63)))) +} +func (this *Metrics) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&Metrics{`, + `Hugetlb:` + strings.Replace(fmt.Sprintf("%v", this.Hugetlb), "HugetlbStat", "HugetlbStat", 1) + `,`, + `Pids:` + strings.Replace(fmt.Sprintf("%v", this.Pids), "PidsStat", "PidsStat", 1) + `,`, + `CPU:` + strings.Replace(fmt.Sprintf("%v", this.CPU), "CPUStat", "CPUStat", 1) + `,`, + `Memory:` + strings.Replace(fmt.Sprintf("%v", this.Memory), "MemoryStat", "MemoryStat", 1) + `,`, + `MemoryOomControl:` + strings.Replace(fmt.Sprintf("%v", this.MemoryOomControl), "MemoryOomControl", "MemoryOomControl", 1) + `,`, + `Blkio:` + strings.Replace(fmt.Sprintf("%v", this.Blkio), "BlkIOStat", "BlkIOStat", 1) + `,`, + `Rdma:` + strings.Replace(fmt.Sprintf("%v", this.Rdma), "RdmaStat", "RdmaStat", 1) + `,`, + `Network:` + strings.Replace(fmt.Sprintf("%v", this.Network), "NetworkStat", "NetworkStat", 1) + `,`, + `CgroupStats:` + strings.Replace(fmt.Sprintf("%v", this.CgroupStats), "CgroupStats", "CgroupStats", 1) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *HugetlbStat) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&HugetlbStat{`, + `Usage:` + fmt.Sprintf("%v", this.Usage) + `,`, + `Max:` + fmt.Sprintf("%v", this.Max) + `,`, + `Failcnt:` + fmt.Sprintf("%v", this.Failcnt) + `,`, + `Pagesize:` + fmt.Sprintf("%v", this.Pagesize) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *PidsStat) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&PidsStat{`, + `Current:` + fmt.Sprintf("%v", this.Current) + `,`, + `Limit:` + fmt.Sprintf("%v", this.Limit) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *CPUStat) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&CPUStat{`, + `Usage:` + strings.Replace(fmt.Sprintf("%v", this.Usage), "CPUUsage", "CPUUsage", 1) + `,`, + `Throttling:` + strings.Replace(fmt.Sprintf("%v", this.Throttling), "Throttle", "Throttle", 1) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *CPUUsage) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&CPUUsage{`, + `Total:` + fmt.Sprintf("%v", this.Total) + `,`, + `Kernel:` + fmt.Sprintf("%v", this.Kernel) + `,`, + `User:` + fmt.Sprintf("%v", this.User) + `,`, + `PerCPU:` + fmt.Sprintf("%v", this.PerCPU) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *Throttle) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&Throttle{`, + `Periods:` + fmt.Sprintf("%v", this.Periods) + `,`, + `ThrottledPeriods:` + fmt.Sprintf("%v", this.ThrottledPeriods) + `,`, + `ThrottledTime:` + fmt.Sprintf("%v", this.ThrottledTime) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *MemoryStat) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&MemoryStat{`, + `Cache:` + fmt.Sprintf("%v", this.Cache) + `,`, + `RSS:` + fmt.Sprintf("%v", this.RSS) + `,`, + `RSSHuge:` + fmt.Sprintf("%v", this.RSSHuge) + `,`, + `MappedFile:` + fmt.Sprintf("%v", this.MappedFile) + `,`, + `Dirty:` + fmt.Sprintf("%v", this.Dirty) + `,`, + `Writeback:` + fmt.Sprintf("%v", this.Writeback) + `,`, + `PgPgIn:` + fmt.Sprintf("%v", this.PgPgIn) + `,`, + `PgPgOut:` + fmt.Sprintf("%v", this.PgPgOut) + `,`, + `PgFault:` + fmt.Sprintf("%v", this.PgFault) + `,`, + `PgMajFault:` + fmt.Sprintf("%v", this.PgMajFault) + `,`, + `InactiveAnon:` + fmt.Sprintf("%v", this.InactiveAnon) + `,`, + `ActiveAnon:` + fmt.Sprintf("%v", this.ActiveAnon) + `,`, + `InactiveFile:` + fmt.Sprintf("%v", this.InactiveFile) + `,`, + `ActiveFile:` + fmt.Sprintf("%v", this.ActiveFile) + `,`, + `Unevictable:` + fmt.Sprintf("%v", this.Unevictable) + `,`, + `HierarchicalMemoryLimit:` + fmt.Sprintf("%v", this.HierarchicalMemoryLimit) + `,`, + `HierarchicalSwapLimit:` + fmt.Sprintf("%v", this.HierarchicalSwapLimit) + `,`, + `TotalCache:` + fmt.Sprintf("%v", this.TotalCache) + `,`, + `TotalRSS:` + fmt.Sprintf("%v", this.TotalRSS) + `,`, + `TotalRSSHuge:` + fmt.Sprintf("%v", this.TotalRSSHuge) + `,`, + `TotalMappedFile:` + fmt.Sprintf("%v", this.TotalMappedFile) + `,`, + `TotalDirty:` + fmt.Sprintf("%v", this.TotalDirty) + `,`, + `TotalWriteback:` + fmt.Sprintf("%v", this.TotalWriteback) + `,`, + `TotalPgPgIn:` + fmt.Sprintf("%v", this.TotalPgPgIn) + `,`, + `TotalPgPgOut:` + fmt.Sprintf("%v", this.TotalPgPgOut) + `,`, + `TotalPgFault:` + fmt.Sprintf("%v", this.TotalPgFault) + `,`, + `TotalPgMajFault:` + fmt.Sprintf("%v", this.TotalPgMajFault) + `,`, + `TotalInactiveAnon:` + fmt.Sprintf("%v", this.TotalInactiveAnon) + `,`, + `TotalActiveAnon:` + fmt.Sprintf("%v", this.TotalActiveAnon) + `,`, + `TotalInactiveFile:` + fmt.Sprintf("%v", this.TotalInactiveFile) + `,`, + `TotalActiveFile:` + fmt.Sprintf("%v", this.TotalActiveFile) + `,`, + `TotalUnevictable:` + fmt.Sprintf("%v", this.TotalUnevictable) + `,`, + `Usage:` + strings.Replace(fmt.Sprintf("%v", this.Usage), "MemoryEntry", "MemoryEntry", 1) + `,`, + `Swap:` + strings.Replace(fmt.Sprintf("%v", this.Swap), "MemoryEntry", "MemoryEntry", 1) + `,`, + `Kernel:` + strings.Replace(fmt.Sprintf("%v", this.Kernel), "MemoryEntry", "MemoryEntry", 1) + `,`, + `KernelTCP:` + strings.Replace(fmt.Sprintf("%v", this.KernelTCP), "MemoryEntry", "MemoryEntry", 1) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *MemoryEntry) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&MemoryEntry{`, + `Limit:` + fmt.Sprintf("%v", this.Limit) + `,`, + `Usage:` + fmt.Sprintf("%v", this.Usage) + `,`, + `Max:` + fmt.Sprintf("%v", this.Max) + `,`, + `Failcnt:` + fmt.Sprintf("%v", this.Failcnt) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *MemoryOomControl) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&MemoryOomControl{`, + `OomKillDisable:` + fmt.Sprintf("%v", this.OomKillDisable) + `,`, + `UnderOom:` + fmt.Sprintf("%v", this.UnderOom) + `,`, + `OomKill:` + fmt.Sprintf("%v", this.OomKill) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *BlkIOStat) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&BlkIOStat{`, + `IoServiceBytesRecursive:` + strings.Replace(fmt.Sprintf("%v", this.IoServiceBytesRecursive), "BlkIOEntry", "BlkIOEntry", 1) + `,`, + `IoServicedRecursive:` + strings.Replace(fmt.Sprintf("%v", this.IoServicedRecursive), "BlkIOEntry", "BlkIOEntry", 1) + `,`, + `IoQueuedRecursive:` + strings.Replace(fmt.Sprintf("%v", this.IoQueuedRecursive), "BlkIOEntry", "BlkIOEntry", 1) + `,`, + `IoServiceTimeRecursive:` + strings.Replace(fmt.Sprintf("%v", this.IoServiceTimeRecursive), "BlkIOEntry", "BlkIOEntry", 1) + `,`, + `IoWaitTimeRecursive:` + strings.Replace(fmt.Sprintf("%v", this.IoWaitTimeRecursive), "BlkIOEntry", "BlkIOEntry", 1) + `,`, + `IoMergedRecursive:` + strings.Replace(fmt.Sprintf("%v", this.IoMergedRecursive), "BlkIOEntry", "BlkIOEntry", 1) + `,`, + `IoTimeRecursive:` + strings.Replace(fmt.Sprintf("%v", this.IoTimeRecursive), "BlkIOEntry", "BlkIOEntry", 1) + `,`, + `SectorsRecursive:` + strings.Replace(fmt.Sprintf("%v", this.SectorsRecursive), "BlkIOEntry", "BlkIOEntry", 1) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *BlkIOEntry) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&BlkIOEntry{`, + `Op:` + fmt.Sprintf("%v", this.Op) + `,`, + `Device:` + fmt.Sprintf("%v", this.Device) + `,`, + `Major:` + fmt.Sprintf("%v", this.Major) + `,`, + `Minor:` + fmt.Sprintf("%v", this.Minor) + `,`, + `Value:` + fmt.Sprintf("%v", this.Value) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *RdmaStat) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&RdmaStat{`, + `Current:` + strings.Replace(fmt.Sprintf("%v", this.Current), "RdmaEntry", "RdmaEntry", 1) + `,`, + `Limit:` + strings.Replace(fmt.Sprintf("%v", this.Limit), "RdmaEntry", "RdmaEntry", 1) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *RdmaEntry) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&RdmaEntry{`, + `Device:` + fmt.Sprintf("%v", this.Device) + `,`, + `HcaHandles:` + fmt.Sprintf("%v", this.HcaHandles) + `,`, + `HcaObjects:` + fmt.Sprintf("%v", this.HcaObjects) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *NetworkStat) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&NetworkStat{`, + `Name:` + fmt.Sprintf("%v", this.Name) + `,`, + `RxBytes:` + fmt.Sprintf("%v", this.RxBytes) + `,`, + `RxPackets:` + fmt.Sprintf("%v", this.RxPackets) + `,`, + `RxErrors:` + fmt.Sprintf("%v", this.RxErrors) + `,`, + `RxDropped:` + fmt.Sprintf("%v", this.RxDropped) + `,`, + `TxBytes:` + fmt.Sprintf("%v", this.TxBytes) + `,`, + `TxPackets:` + fmt.Sprintf("%v", this.TxPackets) + `,`, + `TxErrors:` + fmt.Sprintf("%v", this.TxErrors) + `,`, + `TxDropped:` + fmt.Sprintf("%v", this.TxDropped) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *CgroupStats) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&CgroupStats{`, + `NrSleeping:` + fmt.Sprintf("%v", this.NrSleeping) + `,`, + `NrRunning:` + fmt.Sprintf("%v", this.NrRunning) + `,`, + `NrStopped:` + fmt.Sprintf("%v", this.NrStopped) + `,`, + `NrUninterruptible:` + fmt.Sprintf("%v", this.NrUninterruptible) + `,`, + `NrIoWait:` + fmt.Sprintf("%v", this.NrIoWait) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func valueToStringMetrics(v interface{}) string { + rv := reflect.ValueOf(v) + if rv.IsNil() { + return "nil" + } + pv := reflect.Indirect(rv).Interface() + return fmt.Sprintf("*%v", pv) +} +func (m *Metrics) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: Metrics: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: Metrics: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Hugetlb", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Hugetlb = append(m.Hugetlb, &HugetlbStat{}) + if err := m.Hugetlb[len(m.Hugetlb)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Pids", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Pids == nil { + m.Pids = &PidsStat{} + } + if err := m.Pids.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 3: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field CPU", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.CPU == nil { + m.CPU = &CPUStat{} + } + if err := m.CPU.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 4: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Memory", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Memory == nil { + m.Memory = &MemoryStat{} + } + if err := m.Memory.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 5: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Blkio", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Blkio == nil { + m.Blkio = &BlkIOStat{} + } + if err := m.Blkio.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 6: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Rdma", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Rdma == nil { + m.Rdma = &RdmaStat{} + } + if err := m.Rdma.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 7: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Network", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Network = append(m.Network, &NetworkStat{}) + if err := m.Network[len(m.Network)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 8: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field CgroupStats", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.CgroupStats == nil { + m.CgroupStats = &CgroupStats{} + } + if err := m.CgroupStats.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 9: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field MemoryOomControl", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.MemoryOomControl == nil { + m.MemoryOomControl = &MemoryOomControl{} + } + if err := m.MemoryOomControl.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *HugetlbStat) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: HugetlbStat: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: HugetlbStat: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Usage", wireType) + } + m.Usage = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Usage |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Max", wireType) + } + m.Max = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Max |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Failcnt", wireType) + } + m.Failcnt = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Failcnt |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 4: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Pagesize", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Pagesize = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *PidsStat) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: PidsStat: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: PidsStat: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Current", wireType) + } + m.Current = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Current |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Limit", wireType) + } + m.Limit = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Limit |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *CPUStat) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: CPUStat: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: CPUStat: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Usage", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Usage == nil { + m.Usage = &CPUUsage{} + } + if err := m.Usage.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Throttling", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Throttling == nil { + m.Throttling = &Throttle{} + } + if err := m.Throttling.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *CPUUsage) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: CPUUsage: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: CPUUsage: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Total", wireType) + } + m.Total = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Total |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Kernel", wireType) + } + m.Kernel = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Kernel |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field User", wireType) + } + m.User = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.User |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 4: + if wireType == 0 { + var v uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + v |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + m.PerCPU = append(m.PerCPU, v) + } else if wireType == 2 { + var packedLen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + packedLen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if packedLen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + packedLen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + var elementCount int + var count int + for _, integer := range dAtA[iNdEx:postIndex] { + if integer < 128 { + count++ + } + } + elementCount = count + if elementCount != 0 && len(m.PerCPU) == 0 { + m.PerCPU = make([]uint64, 0, elementCount) + } + for iNdEx < postIndex { + var v uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + v |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + m.PerCPU = append(m.PerCPU, v) + } + } else { + return fmt.Errorf("proto: wrong wireType = %d for field PerCPU", wireType) + } + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *Throttle) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: Throttle: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: Throttle: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Periods", wireType) + } + m.Periods = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Periods |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field ThrottledPeriods", wireType) + } + m.ThrottledPeriods = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.ThrottledPeriods |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field ThrottledTime", wireType) + } + m.ThrottledTime = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.ThrottledTime |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *MemoryStat) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: MemoryStat: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: MemoryStat: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Cache", wireType) + } + m.Cache = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Cache |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field RSS", wireType) + } + m.RSS = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.RSS |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field RSSHuge", wireType) + } + m.RSSHuge = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.RSSHuge |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 4: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field MappedFile", wireType) + } + m.MappedFile = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.MappedFile |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 5: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Dirty", wireType) + } + m.Dirty = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Dirty |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 6: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Writeback", wireType) + } + m.Writeback = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Writeback |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 7: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field PgPgIn", wireType) + } + m.PgPgIn = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.PgPgIn |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 8: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field PgPgOut", wireType) + } + m.PgPgOut = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.PgPgOut |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 9: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field PgFault", wireType) + } + m.PgFault = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.PgFault |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 10: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field PgMajFault", wireType) + } + m.PgMajFault = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.PgMajFault |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 11: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field InactiveAnon", wireType) + } + m.InactiveAnon = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.InactiveAnon |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 12: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field ActiveAnon", wireType) + } + m.ActiveAnon = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.ActiveAnon |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 13: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field InactiveFile", wireType) + } + m.InactiveFile = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.InactiveFile |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 14: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field ActiveFile", wireType) + } + m.ActiveFile = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.ActiveFile |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 15: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Unevictable", wireType) + } + m.Unevictable = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Unevictable |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 16: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field HierarchicalMemoryLimit", wireType) + } + m.HierarchicalMemoryLimit = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.HierarchicalMemoryLimit |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 17: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field HierarchicalSwapLimit", wireType) + } + m.HierarchicalSwapLimit = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.HierarchicalSwapLimit |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 18: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalCache", wireType) + } + m.TotalCache = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalCache |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 19: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalRSS", wireType) + } + m.TotalRSS = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalRSS |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 20: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalRSSHuge", wireType) + } + m.TotalRSSHuge = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalRSSHuge |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 21: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalMappedFile", wireType) + } + m.TotalMappedFile = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalMappedFile |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 22: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalDirty", wireType) + } + m.TotalDirty = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalDirty |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 23: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalWriteback", wireType) + } + m.TotalWriteback = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalWriteback |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 24: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalPgPgIn", wireType) + } + m.TotalPgPgIn = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalPgPgIn |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 25: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalPgPgOut", wireType) + } + m.TotalPgPgOut = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalPgPgOut |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 26: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalPgFault", wireType) + } + m.TotalPgFault = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalPgFault |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 27: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalPgMajFault", wireType) + } + m.TotalPgMajFault = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalPgMajFault |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 28: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalInactiveAnon", wireType) + } + m.TotalInactiveAnon = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalInactiveAnon |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 29: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalActiveAnon", wireType) + } + m.TotalActiveAnon = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalActiveAnon |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 30: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalInactiveFile", wireType) + } + m.TotalInactiveFile = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalInactiveFile |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 31: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalActiveFile", wireType) + } + m.TotalActiveFile = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalActiveFile |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 32: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalUnevictable", wireType) + } + m.TotalUnevictable = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalUnevictable |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 33: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Usage", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Usage == nil { + m.Usage = &MemoryEntry{} + } + if err := m.Usage.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 34: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Swap", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Swap == nil { + m.Swap = &MemoryEntry{} + } + if err := m.Swap.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 35: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Kernel", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Kernel == nil { + m.Kernel = &MemoryEntry{} + } + if err := m.Kernel.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 36: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field KernelTCP", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.KernelTCP == nil { + m.KernelTCP = &MemoryEntry{} + } + if err := m.KernelTCP.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *MemoryEntry) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: MemoryEntry: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: MemoryEntry: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Limit", wireType) + } + m.Limit = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Limit |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Usage", wireType) + } + m.Usage = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Usage |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Max", wireType) + } + m.Max = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Max |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 4: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Failcnt", wireType) + } + m.Failcnt = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Failcnt |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *MemoryOomControl) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: MemoryOomControl: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: MemoryOomControl: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field OomKillDisable", wireType) + } + m.OomKillDisable = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.OomKillDisable |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field UnderOom", wireType) + } + m.UnderOom = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.UnderOom |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field OomKill", wireType) + } + m.OomKill = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.OomKill |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *BlkIOStat) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: BlkIOStat: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: BlkIOStat: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field IoServiceBytesRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.IoServiceBytesRecursive = append(m.IoServiceBytesRecursive, &BlkIOEntry{}) + if err := m.IoServiceBytesRecursive[len(m.IoServiceBytesRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field IoServicedRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.IoServicedRecursive = append(m.IoServicedRecursive, &BlkIOEntry{}) + if err := m.IoServicedRecursive[len(m.IoServicedRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 3: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field IoQueuedRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.IoQueuedRecursive = append(m.IoQueuedRecursive, &BlkIOEntry{}) + if err := m.IoQueuedRecursive[len(m.IoQueuedRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 4: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field IoServiceTimeRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.IoServiceTimeRecursive = append(m.IoServiceTimeRecursive, &BlkIOEntry{}) + if err := m.IoServiceTimeRecursive[len(m.IoServiceTimeRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 5: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field IoWaitTimeRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.IoWaitTimeRecursive = append(m.IoWaitTimeRecursive, &BlkIOEntry{}) + if err := m.IoWaitTimeRecursive[len(m.IoWaitTimeRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 6: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field IoMergedRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.IoMergedRecursive = append(m.IoMergedRecursive, &BlkIOEntry{}) + if err := m.IoMergedRecursive[len(m.IoMergedRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 7: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field IoTimeRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.IoTimeRecursive = append(m.IoTimeRecursive, &BlkIOEntry{}) + if err := m.IoTimeRecursive[len(m.IoTimeRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 8: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field SectorsRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.SectorsRecursive = append(m.SectorsRecursive, &BlkIOEntry{}) + if err := m.SectorsRecursive[len(m.SectorsRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *BlkIOEntry) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: BlkIOEntry: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: BlkIOEntry: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Op", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Op = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Device", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Device = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Major", wireType) + } + m.Major = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Major |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 4: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Minor", wireType) + } + m.Minor = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Minor |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 5: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Value", wireType) + } + m.Value = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Value |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *RdmaStat) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: RdmaStat: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: RdmaStat: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Current", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Current = append(m.Current, &RdmaEntry{}) + if err := m.Current[len(m.Current)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Limit", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Limit = append(m.Limit, &RdmaEntry{}) + if err := m.Limit[len(m.Limit)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *RdmaEntry) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: RdmaEntry: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: RdmaEntry: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Device", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Device = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field HcaHandles", wireType) + } + m.HcaHandles = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.HcaHandles |= uint32(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field HcaObjects", wireType) + } + m.HcaObjects = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.HcaObjects |= uint32(b&0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *NetworkStat) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: NetworkStat: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: NetworkStat: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Name", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Name = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field RxBytes", wireType) + } + m.RxBytes = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.RxBytes |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field RxPackets", wireType) + } + m.RxPackets = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.RxPackets |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 4: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field RxErrors", wireType) + } + m.RxErrors = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.RxErrors |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 5: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field RxDropped", wireType) + } + m.RxDropped = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.RxDropped |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 6: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TxBytes", wireType) + } + m.TxBytes = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TxBytes |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 7: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TxPackets", wireType) + } + m.TxPackets = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TxPackets |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 8: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TxErrors", wireType) + } + m.TxErrors = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TxErrors |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 9: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TxDropped", wireType) + } + m.TxDropped = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TxDropped |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *CgroupStats) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: CgroupStats: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: CgroupStats: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field NrSleeping", wireType) + } + m.NrSleeping = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.NrSleeping |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field NrRunning", wireType) + } + m.NrRunning = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.NrRunning |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field NrStopped", wireType) + } + m.NrStopped = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.NrStopped |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 4: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field NrUninterruptible", wireType) + } + m.NrUninterruptible = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.NrUninterruptible |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 5: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field NrIoWait", wireType) + } + m.NrIoWait = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.NrIoWait |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func skipMetrics(dAtA []byte) (n int, err error) { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowMetrics + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + wireType := int(wire & 0x7) + switch wireType { + case 0: + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowMetrics + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + iNdEx++ + if dAtA[iNdEx-1] < 0x80 { + break + } + } + return iNdEx, nil + case 1: + iNdEx += 8 + return iNdEx, nil + case 2: + var length int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowMetrics + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + length |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + if length < 0 { + return 0, ErrInvalidLengthMetrics + } + iNdEx += length + if iNdEx < 0 { + return 0, ErrInvalidLengthMetrics + } + return iNdEx, nil + case 3: + for { + var innerWire uint64 + var start int = iNdEx + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowMetrics + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + innerWire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + innerWireType := int(innerWire & 0x7) + if innerWireType == 4 { + break + } + next, err := skipMetrics(dAtA[start:]) + if err != nil { + return 0, err + } + iNdEx = start + next + if iNdEx < 0 { + return 0, ErrInvalidLengthMetrics + } + } + return iNdEx, nil + case 4: + return iNdEx, nil + case 5: + iNdEx += 4 + return iNdEx, nil + default: + return 0, fmt.Errorf("proto: illegal wireType %d", wireType) + } + } + panic("unreachable") +} + +var ( + ErrInvalidLengthMetrics = fmt.Errorf("proto: negative length found during unmarshaling") + ErrIntOverflowMetrics = fmt.Errorf("proto: integer overflow") +) diff --git a/vendor/github.com/containerd/cgroups/stats/v1/metrics.pb.txt b/vendor/github.com/containerd/cgroups/stats/v1/metrics.pb.txt new file mode 100644 index 00000000..3ed0898c --- /dev/null +++ b/vendor/github.com/containerd/cgroups/stats/v1/metrics.pb.txt @@ -0,0 +1,790 @@ +file { + name: "github.com/containerd/cgroups/stats/v1/metrics.proto" + package: "io.containerd.cgroups.v1" + dependency: "gogoproto/gogo.proto" + message_type { + name: "Metrics" + field { + name: "hugetlb" + number: 1 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.HugetlbStat" + json_name: "hugetlb" + } + field { + name: "pids" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.PidsStat" + json_name: "pids" + } + field { + name: "cpu" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.CPUStat" + options { + 65004: "CPU" + } + json_name: "cpu" + } + field { + name: "memory" + number: 4 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.MemoryStat" + json_name: "memory" + } + field { + name: "blkio" + number: 5 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOStat" + json_name: "blkio" + } + field { + name: "rdma" + number: 6 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.RdmaStat" + json_name: "rdma" + } + field { + name: "network" + number: 7 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.NetworkStat" + json_name: "network" + } + field { + name: "cgroup_stats" + number: 8 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.CgroupStats" + json_name: "cgroupStats" + } + field { + name: "memory_oom_control" + number: 9 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.MemoryOomControl" + json_name: "memoryOomControl" + } + } + message_type { + name: "HugetlbStat" + field { + name: "usage" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "usage" + } + field { + name: "max" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "max" + } + field { + name: "failcnt" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "failcnt" + } + field { + name: "pagesize" + number: 4 + label: LABEL_OPTIONAL + type: TYPE_STRING + json_name: "pagesize" + } + } + message_type { + name: "PidsStat" + field { + name: "current" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "current" + } + field { + name: "limit" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "limit" + } + } + message_type { + name: "CPUStat" + field { + name: "usage" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.CPUUsage" + json_name: "usage" + } + field { + name: "throttling" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.Throttle" + json_name: "throttling" + } + } + message_type { + name: "CPUUsage" + field { + name: "total" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "total" + } + field { + name: "kernel" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "kernel" + } + field { + name: "user" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "user" + } + field { + name: "per_cpu" + number: 4 + label: LABEL_REPEATED + type: TYPE_UINT64 + options { + 65004: "PerCPU" + } + json_name: "perCpu" + } + } + message_type { + name: "Throttle" + field { + name: "periods" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "periods" + } + field { + name: "throttled_periods" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "throttledPeriods" + } + field { + name: "throttled_time" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "throttledTime" + } + } + message_type { + name: "MemoryStat" + field { + name: "cache" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "cache" + } + field { + name: "rss" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + options { + 65004: "RSS" + } + json_name: "rss" + } + field { + name: "rss_huge" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + options { + 65004: "RSSHuge" + } + json_name: "rssHuge" + } + field { + name: "mapped_file" + number: 4 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "mappedFile" + } + field { + name: "dirty" + number: 5 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "dirty" + } + field { + name: "writeback" + number: 6 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "writeback" + } + field { + name: "pg_pg_in" + number: 7 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "pgPgIn" + } + field { + name: "pg_pg_out" + number: 8 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "pgPgOut" + } + field { + name: "pg_fault" + number: 9 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "pgFault" + } + field { + name: "pg_maj_fault" + number: 10 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "pgMajFault" + } + field { + name: "inactive_anon" + number: 11 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "inactiveAnon" + } + field { + name: "active_anon" + number: 12 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "activeAnon" + } + field { + name: "inactive_file" + number: 13 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "inactiveFile" + } + field { + name: "active_file" + number: 14 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "activeFile" + } + field { + name: "unevictable" + number: 15 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "unevictable" + } + field { + name: "hierarchical_memory_limit" + number: 16 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "hierarchicalMemoryLimit" + } + field { + name: "hierarchical_swap_limit" + number: 17 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "hierarchicalSwapLimit" + } + field { + name: "total_cache" + number: 18 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalCache" + } + field { + name: "total_rss" + number: 19 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + options { + 65004: "TotalRSS" + } + json_name: "totalRss" + } + field { + name: "total_rss_huge" + number: 20 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + options { + 65004: "TotalRSSHuge" + } + json_name: "totalRssHuge" + } + field { + name: "total_mapped_file" + number: 21 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalMappedFile" + } + field { + name: "total_dirty" + number: 22 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalDirty" + } + field { + name: "total_writeback" + number: 23 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalWriteback" + } + field { + name: "total_pg_pg_in" + number: 24 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalPgPgIn" + } + field { + name: "total_pg_pg_out" + number: 25 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalPgPgOut" + } + field { + name: "total_pg_fault" + number: 26 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalPgFault" + } + field { + name: "total_pg_maj_fault" + number: 27 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalPgMajFault" + } + field { + name: "total_inactive_anon" + number: 28 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalInactiveAnon" + } + field { + name: "total_active_anon" + number: 29 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalActiveAnon" + } + field { + name: "total_inactive_file" + number: 30 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalInactiveFile" + } + field { + name: "total_active_file" + number: 31 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalActiveFile" + } + field { + name: "total_unevictable" + number: 32 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalUnevictable" + } + field { + name: "usage" + number: 33 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.MemoryEntry" + json_name: "usage" + } + field { + name: "swap" + number: 34 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.MemoryEntry" + json_name: "swap" + } + field { + name: "kernel" + number: 35 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.MemoryEntry" + json_name: "kernel" + } + field { + name: "kernel_tcp" + number: 36 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.MemoryEntry" + options { + 65004: "KernelTCP" + } + json_name: "kernelTcp" + } + } + message_type { + name: "MemoryEntry" + field { + name: "limit" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "limit" + } + field { + name: "usage" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "usage" + } + field { + name: "max" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "max" + } + field { + name: "failcnt" + number: 4 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "failcnt" + } + } + message_type { + name: "MemoryOomControl" + field { + name: "oom_kill_disable" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "oom_kill_disable" + } + field { + name: "under_oom" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "under_oom" + } + field { + name: "oom_kill" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "oom_kill" + } + } + message_type { + name: "BlkIOStat" + field { + name: "io_service_bytes_recursive" + number: 1 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "ioServiceBytesRecursive" + } + field { + name: "io_serviced_recursive" + number: 2 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "ioServicedRecursive" + } + field { + name: "io_queued_recursive" + number: 3 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "ioQueuedRecursive" + } + field { + name: "io_service_time_recursive" + number: 4 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "ioServiceTimeRecursive" + } + field { + name: "io_wait_time_recursive" + number: 5 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "ioWaitTimeRecursive" + } + field { + name: "io_merged_recursive" + number: 6 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "ioMergedRecursive" + } + field { + name: "io_time_recursive" + number: 7 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "ioTimeRecursive" + } + field { + name: "sectors_recursive" + number: 8 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "sectorsRecursive" + } + } + message_type { + name: "BlkIOEntry" + field { + name: "op" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_STRING + json_name: "op" + } + field { + name: "device" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_STRING + json_name: "device" + } + field { + name: "major" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "major" + } + field { + name: "minor" + number: 4 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "minor" + } + field { + name: "value" + number: 5 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "value" + } + } + message_type { + name: "RdmaStat" + field { + name: "current" + number: 1 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.RdmaEntry" + json_name: "current" + } + field { + name: "limit" + number: 2 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.RdmaEntry" + json_name: "limit" + } + } + message_type { + name: "RdmaEntry" + field { + name: "device" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_STRING + json_name: "device" + } + field { + name: "hca_handles" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT32 + json_name: "hcaHandles" + } + field { + name: "hca_objects" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT32 + json_name: "hcaObjects" + } + } + message_type { + name: "NetworkStat" + field { + name: "name" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_STRING + json_name: "name" + } + field { + name: "rx_bytes" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "rxBytes" + } + field { + name: "rx_packets" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "rxPackets" + } + field { + name: "rx_errors" + number: 4 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "rxErrors" + } + field { + name: "rx_dropped" + number: 5 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "rxDropped" + } + field { + name: "tx_bytes" + number: 6 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "txBytes" + } + field { + name: "tx_packets" + number: 7 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "txPackets" + } + field { + name: "tx_errors" + number: 8 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "txErrors" + } + field { + name: "tx_dropped" + number: 9 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "txDropped" + } + } + message_type { + name: "CgroupStats" + field { + name: "nr_sleeping" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "nrSleeping" + } + field { + name: "nr_running" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "nrRunning" + } + field { + name: "nr_stopped" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "nrStopped" + } + field { + name: "nr_uninterruptible" + number: 4 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "nrUninterruptible" + } + field { + name: "nr_io_wait" + number: 5 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "nrIoWait" + } + } + syntax: "proto3" +} diff --git a/vendor/github.com/containerd/cgroups/stats/v1/metrics.proto b/vendor/github.com/containerd/cgroups/stats/v1/metrics.proto new file mode 100644 index 00000000..b3f6cc37 --- /dev/null +++ b/vendor/github.com/containerd/cgroups/stats/v1/metrics.proto @@ -0,0 +1,158 @@ +syntax = "proto3"; + +package io.containerd.cgroups.v1; + +import "gogoproto/gogo.proto"; + +message Metrics { + repeated HugetlbStat hugetlb = 1; + PidsStat pids = 2; + CPUStat cpu = 3 [(gogoproto.customname) = "CPU"]; + MemoryStat memory = 4; + BlkIOStat blkio = 5; + RdmaStat rdma = 6; + repeated NetworkStat network = 7; + CgroupStats cgroup_stats = 8; + MemoryOomControl memory_oom_control = 9; +} + +message HugetlbStat { + uint64 usage = 1; + uint64 max = 2; + uint64 failcnt = 3; + string pagesize = 4; +} + +message PidsStat { + uint64 current = 1; + uint64 limit = 2; +} + +message CPUStat { + CPUUsage usage = 1; + Throttle throttling = 2; +} + +message CPUUsage { + // values in nanoseconds + uint64 total = 1; + uint64 kernel = 2; + uint64 user = 3; + repeated uint64 per_cpu = 4 [(gogoproto.customname) = "PerCPU"]; + +} + +message Throttle { + uint64 periods = 1; + uint64 throttled_periods = 2; + uint64 throttled_time = 3; +} + +message MemoryStat { + uint64 cache = 1; + uint64 rss = 2 [(gogoproto.customname) = "RSS"]; + uint64 rss_huge = 3 [(gogoproto.customname) = "RSSHuge"]; + uint64 mapped_file = 4; + uint64 dirty = 5; + uint64 writeback = 6; + uint64 pg_pg_in = 7; + uint64 pg_pg_out = 8; + uint64 pg_fault = 9; + uint64 pg_maj_fault = 10; + uint64 inactive_anon = 11; + uint64 active_anon = 12; + uint64 inactive_file = 13; + uint64 active_file = 14; + uint64 unevictable = 15; + uint64 hierarchical_memory_limit = 16; + uint64 hierarchical_swap_limit = 17; + uint64 total_cache = 18; + uint64 total_rss = 19 [(gogoproto.customname) = "TotalRSS"]; + uint64 total_rss_huge = 20 [(gogoproto.customname) = "TotalRSSHuge"]; + uint64 total_mapped_file = 21; + uint64 total_dirty = 22; + uint64 total_writeback = 23; + uint64 total_pg_pg_in = 24; + uint64 total_pg_pg_out = 25; + uint64 total_pg_fault = 26; + uint64 total_pg_maj_fault = 27; + uint64 total_inactive_anon = 28; + uint64 total_active_anon = 29; + uint64 total_inactive_file = 30; + uint64 total_active_file = 31; + uint64 total_unevictable = 32; + MemoryEntry usage = 33; + MemoryEntry swap = 34; + MemoryEntry kernel = 35; + MemoryEntry kernel_tcp = 36 [(gogoproto.customname) = "KernelTCP"]; + +} + +message MemoryEntry { + uint64 limit = 1; + uint64 usage = 2; + uint64 max = 3; + uint64 failcnt = 4; +} + +message MemoryOomControl { + uint64 oom_kill_disable = 1; + uint64 under_oom = 2; + uint64 oom_kill = 3; +} + +message BlkIOStat { + repeated BlkIOEntry io_service_bytes_recursive = 1; + repeated BlkIOEntry io_serviced_recursive = 2; + repeated BlkIOEntry io_queued_recursive = 3; + repeated BlkIOEntry io_service_time_recursive = 4; + repeated BlkIOEntry io_wait_time_recursive = 5; + repeated BlkIOEntry io_merged_recursive = 6; + repeated BlkIOEntry io_time_recursive = 7; + repeated BlkIOEntry sectors_recursive = 8; +} + +message BlkIOEntry { + string op = 1; + string device = 2; + uint64 major = 3; + uint64 minor = 4; + uint64 value = 5; +} + +message RdmaStat { + repeated RdmaEntry current = 1; + repeated RdmaEntry limit = 2; +} + +message RdmaEntry { + string device = 1; + uint32 hca_handles = 2; + uint32 hca_objects = 3; +} + +message NetworkStat { + string name = 1; + uint64 rx_bytes = 2; + uint64 rx_packets = 3; + uint64 rx_errors = 4; + uint64 rx_dropped = 5; + uint64 tx_bytes = 6; + uint64 tx_packets = 7; + uint64 tx_errors = 8; + uint64 tx_dropped = 9; +} + +// CgroupStats exports per-cgroup statistics. +message CgroupStats { + // number of tasks sleeping + uint64 nr_sleeping = 1; + // number of tasks running + uint64 nr_running = 2; + // number of tasks in stopped state + uint64 nr_stopped = 3; + // number of tasks in uninterruptible state + uint64 nr_uninterruptible = 4; + // number of tasks waiting on IO + uint64 nr_io_wait = 5; +} diff --git a/vendor/github.com/gogo/protobuf/AUTHORS b/vendor/github.com/gogo/protobuf/AUTHORS new file mode 100644 index 00000000..3d97fc7a --- /dev/null +++ b/vendor/github.com/gogo/protobuf/AUTHORS @@ -0,0 +1,15 @@ +# This is the official list of GoGo authors for copyright purposes. +# This file is distinct from the CONTRIBUTORS file, which +# lists people. For example, employees are listed in CONTRIBUTORS, +# but not in AUTHORS, because the employer holds the copyright. + +# Names should be added to this file as one of +# Organization's name +# Individual's name +# Individual's name + +# Please keep the list sorted. + +Sendgrid, Inc +Vastech SA (PTY) LTD +Walter Schulze diff --git a/vendor/github.com/gogo/protobuf/CONTRIBUTORS b/vendor/github.com/gogo/protobuf/CONTRIBUTORS new file mode 100644 index 00000000..1b4f6c20 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/CONTRIBUTORS @@ -0,0 +1,23 @@ +Anton Povarov +Brian Goff +Clayton Coleman +Denis Smirnov +DongYun Kang +Dwayne Schultz +Georg Apitz +Gustav Paul +Johan Brandhorst +John Shahid +John Tuley +Laurent +Patrick Lee +Peter Edge +Roger Johansson +Sam Nguyen +Sergio Arbeo +Stephen J Day +Tamir Duberstein +Todd Eisenberger +Tormod Erevik Lea +Vyacheslav Kim +Walter Schulze diff --git a/vendor/github.com/gogo/protobuf/LICENSE b/vendor/github.com/gogo/protobuf/LICENSE new file mode 100644 index 00000000..f57de90d --- /dev/null +++ b/vendor/github.com/gogo/protobuf/LICENSE @@ -0,0 +1,35 @@ +Copyright (c) 2013, The GoGo Authors. All rights reserved. + +Protocol Buffers for Go with Gadgets + +Go support for Protocol Buffers - Google's data interchange format + +Copyright 2010 The Go Authors. All rights reserved. +https://github.com/golang/protobuf + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions are +met: + + * Redistributions of source code must retain the above copyright +notice, this list of conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above +copyright notice, this list of conditions and the following disclaimer +in the documentation and/or other materials provided with the +distribution. + * Neither the name of Google Inc. nor the names of its +contributors may be used to endorse or promote products derived from +this software without specific prior written permission. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +"AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + diff --git a/vendor/github.com/gogo/protobuf/gogoproto/Makefile b/vendor/github.com/gogo/protobuf/gogoproto/Makefile new file mode 100644 index 00000000..0b4659b7 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/gogoproto/Makefile @@ -0,0 +1,37 @@ +# Protocol Buffers for Go with Gadgets +# +# Copyright (c) 2013, The GoGo Authors. All rights reserved. +# http://github.com/gogo/protobuf +# +# Redistribution and use in source and binary forms, with or without +# modification, are permitted provided that the following conditions are +# met: +# +# * Redistributions of source code must retain the above copyright +# notice, this list of conditions and the following disclaimer. +# * Redistributions in binary form must reproduce the above +# copyright notice, this list of conditions and the following disclaimer +# in the documentation and/or other materials provided with the +# distribution. +# +# THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +# "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +# LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +# A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +# OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +# SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +# LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +# DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +# THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +# (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +# OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +regenerate: + go install github.com/gogo/protobuf/protoc-gen-gogo + protoc --gogo_out=Mgoogle/protobuf/descriptor.proto=github.com/gogo/protobuf/protoc-gen-gogo/descriptor:../../../../ --proto_path=../../../../:../protobuf/:. *.proto + +restore: + cp gogo.pb.golden gogo.pb.go + +preserve: + cp gogo.pb.go gogo.pb.golden diff --git a/vendor/github.com/gogo/protobuf/gogoproto/doc.go b/vendor/github.com/gogo/protobuf/gogoproto/doc.go new file mode 100644 index 00000000..081c86fa --- /dev/null +++ b/vendor/github.com/gogo/protobuf/gogoproto/doc.go @@ -0,0 +1,169 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2013, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +/* +Package gogoproto provides extensions for protocol buffers to achieve: + + - fast marshalling and unmarshalling. + - peace of mind by optionally generating test and benchmark code. + - more canonical Go structures. + - less typing by optionally generating extra helper code. + - goprotobuf compatibility + +More Canonical Go Structures + +A lot of time working with a goprotobuf struct will lead you to a place where you create another struct that is easier to work with and then have a function to copy the values between the two structs. +You might also find that basic structs that started their life as part of an API need to be sent over the wire. With gob, you could just send it. With goprotobuf, you need to make a parallel struct. +Gogoprotobuf tries to fix these problems with the nullable, embed, customtype and customname field extensions. + + - nullable, if false, a field is generated without a pointer (see warning below). + - embed, if true, the field is generated as an embedded field. + - customtype, It works with the Marshal and Unmarshal methods, to allow you to have your own types in your struct, but marshal to bytes. For example, custom.Uuid or custom.Fixed128 + - customname (beta), Changes the generated fieldname. This is especially useful when generated methods conflict with fieldnames. + - casttype (beta), Changes the generated fieldtype. All generated code assumes that this type is castable to the protocol buffer field type. It does not work for structs or enums. + - castkey (beta), Changes the generated fieldtype for a map key. All generated code assumes that this type is castable to the protocol buffer field type. Only supported on maps. + - castvalue (beta), Changes the generated fieldtype for a map value. All generated code assumes that this type is castable to the protocol buffer field type. Only supported on maps. + +Warning about nullable: According to the Protocol Buffer specification, you should be able to tell whether a field is set or unset. With the option nullable=false this feature is lost, since your non-nullable fields will always be set. It can be seen as a layer on top of Protocol Buffers, where before and after marshalling all non-nullable fields are set and they cannot be unset. + +Let us look at: + + github.com/gogo/protobuf/test/example/example.proto + +for a quicker overview. + +The following message: + + package test; + + import "github.com/gogo/protobuf/gogoproto/gogo.proto"; + + message A { + optional string Description = 1 [(gogoproto.nullable) = false]; + optional int64 Number = 2 [(gogoproto.nullable) = false]; + optional bytes Id = 3 [(gogoproto.customtype) = "github.com/gogo/protobuf/test/custom.Uuid", (gogoproto.nullable) = false]; + } + +Will generate a go struct which looks a lot like this: + + type A struct { + Description string + Number int64 + Id github_com_gogo_protobuf_test_custom.Uuid + } + +You will see there are no pointers, since all fields are non-nullable. +You will also see a custom type which marshals to a string. +Be warned it is your responsibility to test your custom types thoroughly. +You should think of every possible empty and nil case for your marshaling, unmarshaling and size methods. + +Next we will embed the message A in message B. + + message B { + optional A A = 1 [(gogoproto.nullable) = false, (gogoproto.embed) = true]; + repeated bytes G = 2 [(gogoproto.customtype) = "github.com/gogo/protobuf/test/custom.Uint128", (gogoproto.nullable) = false]; + } + +See below that A is embedded in B. + + type B struct { + A + G []github_com_gogo_protobuf_test_custom.Uint128 + } + +Also see the repeated custom type. + + type Uint128 [2]uint64 + +Next we will create a custom name for one of our fields. + + message C { + optional int64 size = 1 [(gogoproto.customname) = "MySize"]; + } + +See below that the field's name is MySize and not Size. + + type C struct { + MySize *int64 + } + +The is useful when having a protocol buffer message with a field name which conflicts with a generated method. +As an example, having a field name size and using the sizer plugin to generate a Size method will cause a go compiler error. +Using customname you can fix this error without changing the field name. +This is typically useful when working with a protocol buffer that was designed before these methods and/or the go language were avialable. + +Gogoprotobuf also has some more subtle changes, these could be changed back: + + - the generated package name for imports do not have the extra /filename.pb, + but are actually the imports specified in the .proto file. + +Gogoprotobuf also has lost some features which should be brought back with time: + + - Marshalling and unmarshalling with reflect and without the unsafe package, + this requires work in pointer_reflect.go + +Why does nullable break protocol buffer specifications: + +The protocol buffer specification states, somewhere, that you should be able to tell whether a +field is set or unset. With the option nullable=false this feature is lost, +since your non-nullable fields will always be set. It can be seen as a layer on top of +protocol buffers, where before and after marshalling all non-nullable fields are set +and they cannot be unset. + +Goprotobuf Compatibility: + +Gogoprotobuf is compatible with Goprotobuf, because it is compatible with protocol buffers. +Gogoprotobuf generates the same code as goprotobuf if no extensions are used. +The enumprefix, getters and stringer extensions can be used to remove some of the unnecessary code generated by goprotobuf: + + - gogoproto_import, if false, the generated code imports github.com/golang/protobuf/proto instead of github.com/gogo/protobuf/proto. + - goproto_enum_prefix, if false, generates the enum constant names without the messagetype prefix + - goproto_enum_stringer (experimental), if false, the enum is generated without the default string method, this is useful for rather using enum_stringer, or allowing you to write your own string method. + - goproto_getters, if false, the message is generated without get methods, this is useful when you would rather want to use face + - goproto_stringer, if false, the message is generated without the default string method, this is useful for rather using stringer, or allowing you to write your own string method. + - goproto_extensions_map (beta), if false, the extensions field is generated as type []byte instead of type map[int32]proto.Extension + - goproto_unrecognized (beta), if false, XXX_unrecognized field is not generated. This is useful in conjunction with gogoproto.nullable=false, to generate structures completely devoid of pointers and reduce GC pressure at the cost of losing information about unrecognized fields. + - goproto_registration (beta), if true, the generated files will register all messages and types against both gogo/protobuf and golang/protobuf. This is necessary when using third-party packages which read registrations from golang/protobuf (such as the grpc-gateway). + +Less Typing and Peace of Mind is explained in their specific plugin folders godoc: + + - github.com/gogo/protobuf/plugin/ + +If you do not use any of these extension the code that is generated +will be the same as if goprotobuf has generated it. + +The most complete way to see examples is to look at + + github.com/gogo/protobuf/test/thetest.proto + +Gogoprototest is a seperate project, +because we want to keep gogoprotobuf independent of goprotobuf, +but we still want to test it thoroughly. + +*/ +package gogoproto diff --git a/vendor/github.com/gogo/protobuf/gogoproto/gogo.pb.go b/vendor/github.com/gogo/protobuf/gogoproto/gogo.pb.go new file mode 100644 index 00000000..1e91766a --- /dev/null +++ b/vendor/github.com/gogo/protobuf/gogoproto/gogo.pb.go @@ -0,0 +1,874 @@ +// Code generated by protoc-gen-gogo. DO NOT EDIT. +// source: gogo.proto + +package gogoproto + +import ( + fmt "fmt" + proto "github.com/gogo/protobuf/proto" + descriptor "github.com/gogo/protobuf/protoc-gen-gogo/descriptor" + math "math" +) + +// Reference imports to suppress errors if they are not otherwise used. +var _ = proto.Marshal +var _ = fmt.Errorf +var _ = math.Inf + +// This is a compile-time assertion to ensure that this generated file +// is compatible with the proto package it is being compiled against. +// A compilation error at this line likely means your copy of the +// proto package needs to be updated. +const _ = proto.GoGoProtoPackageIsVersion3 // please upgrade the proto package + +var E_GoprotoEnumPrefix = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.EnumOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 62001, + Name: "gogoproto.goproto_enum_prefix", + Tag: "varint,62001,opt,name=goproto_enum_prefix", + Filename: "gogo.proto", +} + +var E_GoprotoEnumStringer = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.EnumOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 62021, + Name: "gogoproto.goproto_enum_stringer", + Tag: "varint,62021,opt,name=goproto_enum_stringer", + Filename: "gogo.proto", +} + +var E_EnumStringer = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.EnumOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 62022, + Name: "gogoproto.enum_stringer", + Tag: "varint,62022,opt,name=enum_stringer", + Filename: "gogo.proto", +} + +var E_EnumCustomname = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.EnumOptions)(nil), + ExtensionType: (*string)(nil), + Field: 62023, + Name: "gogoproto.enum_customname", + Tag: "bytes,62023,opt,name=enum_customname", + Filename: "gogo.proto", +} + +var E_Enumdecl = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.EnumOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 62024, + Name: "gogoproto.enumdecl", + Tag: "varint,62024,opt,name=enumdecl", + Filename: "gogo.proto", +} + +var E_EnumvalueCustomname = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.EnumValueOptions)(nil), + ExtensionType: (*string)(nil), + Field: 66001, + Name: "gogoproto.enumvalue_customname", + Tag: "bytes,66001,opt,name=enumvalue_customname", + Filename: "gogo.proto", +} + +var E_GoprotoGettersAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63001, + Name: "gogoproto.goproto_getters_all", + Tag: "varint,63001,opt,name=goproto_getters_all", + Filename: "gogo.proto", +} + +var E_GoprotoEnumPrefixAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63002, + Name: "gogoproto.goproto_enum_prefix_all", + Tag: "varint,63002,opt,name=goproto_enum_prefix_all", + Filename: "gogo.proto", +} + +var E_GoprotoStringerAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63003, + Name: "gogoproto.goproto_stringer_all", + Tag: "varint,63003,opt,name=goproto_stringer_all", + Filename: "gogo.proto", +} + +var E_VerboseEqualAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63004, + Name: "gogoproto.verbose_equal_all", + Tag: "varint,63004,opt,name=verbose_equal_all", + Filename: "gogo.proto", +} + +var E_FaceAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63005, + Name: "gogoproto.face_all", + Tag: "varint,63005,opt,name=face_all", + Filename: "gogo.proto", +} + +var E_GostringAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63006, + Name: "gogoproto.gostring_all", + Tag: "varint,63006,opt,name=gostring_all", + Filename: "gogo.proto", +} + +var E_PopulateAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63007, + Name: "gogoproto.populate_all", + Tag: "varint,63007,opt,name=populate_all", + Filename: "gogo.proto", +} + +var E_StringerAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63008, + Name: "gogoproto.stringer_all", + Tag: "varint,63008,opt,name=stringer_all", + Filename: "gogo.proto", +} + +var E_OnlyoneAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63009, + Name: "gogoproto.onlyone_all", + Tag: "varint,63009,opt,name=onlyone_all", + Filename: "gogo.proto", +} + +var E_EqualAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63013, + Name: "gogoproto.equal_all", + Tag: "varint,63013,opt,name=equal_all", + Filename: "gogo.proto", +} + +var E_DescriptionAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63014, + Name: "gogoproto.description_all", + Tag: "varint,63014,opt,name=description_all", + Filename: "gogo.proto", +} + +var E_TestgenAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63015, + Name: "gogoproto.testgen_all", + Tag: "varint,63015,opt,name=testgen_all", + Filename: "gogo.proto", +} + +var E_BenchgenAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63016, + Name: "gogoproto.benchgen_all", + Tag: "varint,63016,opt,name=benchgen_all", + Filename: "gogo.proto", +} + +var E_MarshalerAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63017, + Name: "gogoproto.marshaler_all", + Tag: "varint,63017,opt,name=marshaler_all", + Filename: "gogo.proto", +} + +var E_UnmarshalerAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63018, + Name: "gogoproto.unmarshaler_all", + Tag: "varint,63018,opt,name=unmarshaler_all", + Filename: "gogo.proto", +} + +var E_StableMarshalerAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63019, + Name: "gogoproto.stable_marshaler_all", + Tag: "varint,63019,opt,name=stable_marshaler_all", + Filename: "gogo.proto", +} + +var E_SizerAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63020, + Name: "gogoproto.sizer_all", + Tag: "varint,63020,opt,name=sizer_all", + Filename: "gogo.proto", +} + +var E_GoprotoEnumStringerAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63021, + Name: "gogoproto.goproto_enum_stringer_all", + Tag: "varint,63021,opt,name=goproto_enum_stringer_all", + Filename: "gogo.proto", +} + +var E_EnumStringerAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63022, + Name: "gogoproto.enum_stringer_all", + Tag: "varint,63022,opt,name=enum_stringer_all", + Filename: "gogo.proto", +} + +var E_UnsafeMarshalerAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63023, + Name: "gogoproto.unsafe_marshaler_all", + Tag: "varint,63023,opt,name=unsafe_marshaler_all", + Filename: "gogo.proto", +} + +var E_UnsafeUnmarshalerAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63024, + Name: "gogoproto.unsafe_unmarshaler_all", + Tag: "varint,63024,opt,name=unsafe_unmarshaler_all", + Filename: "gogo.proto", +} + +var E_GoprotoExtensionsMapAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63025, + Name: "gogoproto.goproto_extensions_map_all", + Tag: "varint,63025,opt,name=goproto_extensions_map_all", + Filename: "gogo.proto", +} + +var E_GoprotoUnrecognizedAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63026, + Name: "gogoproto.goproto_unrecognized_all", + Tag: "varint,63026,opt,name=goproto_unrecognized_all", + Filename: "gogo.proto", +} + +var E_GogoprotoImport = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63027, + Name: "gogoproto.gogoproto_import", + Tag: "varint,63027,opt,name=gogoproto_import", + Filename: "gogo.proto", +} + +var E_ProtosizerAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63028, + Name: "gogoproto.protosizer_all", + Tag: "varint,63028,opt,name=protosizer_all", + Filename: "gogo.proto", +} + +var E_CompareAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63029, + Name: "gogoproto.compare_all", + Tag: "varint,63029,opt,name=compare_all", + Filename: "gogo.proto", +} + +var E_TypedeclAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63030, + Name: "gogoproto.typedecl_all", + Tag: "varint,63030,opt,name=typedecl_all", + Filename: "gogo.proto", +} + +var E_EnumdeclAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63031, + Name: "gogoproto.enumdecl_all", + Tag: "varint,63031,opt,name=enumdecl_all", + Filename: "gogo.proto", +} + +var E_GoprotoRegistration = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63032, + Name: "gogoproto.goproto_registration", + Tag: "varint,63032,opt,name=goproto_registration", + Filename: "gogo.proto", +} + +var E_MessagenameAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63033, + Name: "gogoproto.messagename_all", + Tag: "varint,63033,opt,name=messagename_all", + Filename: "gogo.proto", +} + +var E_GoprotoSizecacheAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63034, + Name: "gogoproto.goproto_sizecache_all", + Tag: "varint,63034,opt,name=goproto_sizecache_all", + Filename: "gogo.proto", +} + +var E_GoprotoUnkeyedAll = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63035, + Name: "gogoproto.goproto_unkeyed_all", + Tag: "varint,63035,opt,name=goproto_unkeyed_all", + Filename: "gogo.proto", +} + +var E_GoprotoGetters = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64001, + Name: "gogoproto.goproto_getters", + Tag: "varint,64001,opt,name=goproto_getters", + Filename: "gogo.proto", +} + +var E_GoprotoStringer = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64003, + Name: "gogoproto.goproto_stringer", + Tag: "varint,64003,opt,name=goproto_stringer", + Filename: "gogo.proto", +} + +var E_VerboseEqual = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64004, + Name: "gogoproto.verbose_equal", + Tag: "varint,64004,opt,name=verbose_equal", + Filename: "gogo.proto", +} + +var E_Face = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64005, + Name: "gogoproto.face", + Tag: "varint,64005,opt,name=face", + Filename: "gogo.proto", +} + +var E_Gostring = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64006, + Name: "gogoproto.gostring", + Tag: "varint,64006,opt,name=gostring", + Filename: "gogo.proto", +} + +var E_Populate = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64007, + Name: "gogoproto.populate", + Tag: "varint,64007,opt,name=populate", + Filename: "gogo.proto", +} + +var E_Stringer = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 67008, + Name: "gogoproto.stringer", + Tag: "varint,67008,opt,name=stringer", + Filename: "gogo.proto", +} + +var E_Onlyone = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64009, + Name: "gogoproto.onlyone", + Tag: "varint,64009,opt,name=onlyone", + Filename: "gogo.proto", +} + +var E_Equal = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64013, + Name: "gogoproto.equal", + Tag: "varint,64013,opt,name=equal", + Filename: "gogo.proto", +} + +var E_Description = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64014, + Name: "gogoproto.description", + Tag: "varint,64014,opt,name=description", + Filename: "gogo.proto", +} + +var E_Testgen = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64015, + Name: "gogoproto.testgen", + Tag: "varint,64015,opt,name=testgen", + Filename: "gogo.proto", +} + +var E_Benchgen = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64016, + Name: "gogoproto.benchgen", + Tag: "varint,64016,opt,name=benchgen", + Filename: "gogo.proto", +} + +var E_Marshaler = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64017, + Name: "gogoproto.marshaler", + Tag: "varint,64017,opt,name=marshaler", + Filename: "gogo.proto", +} + +var E_Unmarshaler = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64018, + Name: "gogoproto.unmarshaler", + Tag: "varint,64018,opt,name=unmarshaler", + Filename: "gogo.proto", +} + +var E_StableMarshaler = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64019, + Name: "gogoproto.stable_marshaler", + Tag: "varint,64019,opt,name=stable_marshaler", + Filename: "gogo.proto", +} + +var E_Sizer = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64020, + Name: "gogoproto.sizer", + Tag: "varint,64020,opt,name=sizer", + Filename: "gogo.proto", +} + +var E_UnsafeMarshaler = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64023, + Name: "gogoproto.unsafe_marshaler", + Tag: "varint,64023,opt,name=unsafe_marshaler", + Filename: "gogo.proto", +} + +var E_UnsafeUnmarshaler = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64024, + Name: "gogoproto.unsafe_unmarshaler", + Tag: "varint,64024,opt,name=unsafe_unmarshaler", + Filename: "gogo.proto", +} + +var E_GoprotoExtensionsMap = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64025, + Name: "gogoproto.goproto_extensions_map", + Tag: "varint,64025,opt,name=goproto_extensions_map", + Filename: "gogo.proto", +} + +var E_GoprotoUnrecognized = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64026, + Name: "gogoproto.goproto_unrecognized", + Tag: "varint,64026,opt,name=goproto_unrecognized", + Filename: "gogo.proto", +} + +var E_Protosizer = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64028, + Name: "gogoproto.protosizer", + Tag: "varint,64028,opt,name=protosizer", + Filename: "gogo.proto", +} + +var E_Compare = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64029, + Name: "gogoproto.compare", + Tag: "varint,64029,opt,name=compare", + Filename: "gogo.proto", +} + +var E_Typedecl = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64030, + Name: "gogoproto.typedecl", + Tag: "varint,64030,opt,name=typedecl", + Filename: "gogo.proto", +} + +var E_Messagename = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64033, + Name: "gogoproto.messagename", + Tag: "varint,64033,opt,name=messagename", + Filename: "gogo.proto", +} + +var E_GoprotoSizecache = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64034, + Name: "gogoproto.goproto_sizecache", + Tag: "varint,64034,opt,name=goproto_sizecache", + Filename: "gogo.proto", +} + +var E_GoprotoUnkeyed = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64035, + Name: "gogoproto.goproto_unkeyed", + Tag: "varint,64035,opt,name=goproto_unkeyed", + Filename: "gogo.proto", +} + +var E_Nullable = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 65001, + Name: "gogoproto.nullable", + Tag: "varint,65001,opt,name=nullable", + Filename: "gogo.proto", +} + +var E_Embed = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 65002, + Name: "gogoproto.embed", + Tag: "varint,65002,opt,name=embed", + Filename: "gogo.proto", +} + +var E_Customtype = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*string)(nil), + Field: 65003, + Name: "gogoproto.customtype", + Tag: "bytes,65003,opt,name=customtype", + Filename: "gogo.proto", +} + +var E_Customname = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*string)(nil), + Field: 65004, + Name: "gogoproto.customname", + Tag: "bytes,65004,opt,name=customname", + Filename: "gogo.proto", +} + +var E_Jsontag = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*string)(nil), + Field: 65005, + Name: "gogoproto.jsontag", + Tag: "bytes,65005,opt,name=jsontag", + Filename: "gogo.proto", +} + +var E_Moretags = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*string)(nil), + Field: 65006, + Name: "gogoproto.moretags", + Tag: "bytes,65006,opt,name=moretags", + Filename: "gogo.proto", +} + +var E_Casttype = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*string)(nil), + Field: 65007, + Name: "gogoproto.casttype", + Tag: "bytes,65007,opt,name=casttype", + Filename: "gogo.proto", +} + +var E_Castkey = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*string)(nil), + Field: 65008, + Name: "gogoproto.castkey", + Tag: "bytes,65008,opt,name=castkey", + Filename: "gogo.proto", +} + +var E_Castvalue = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*string)(nil), + Field: 65009, + Name: "gogoproto.castvalue", + Tag: "bytes,65009,opt,name=castvalue", + Filename: "gogo.proto", +} + +var E_Stdtime = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 65010, + Name: "gogoproto.stdtime", + Tag: "varint,65010,opt,name=stdtime", + Filename: "gogo.proto", +} + +var E_Stdduration = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 65011, + Name: "gogoproto.stdduration", + Tag: "varint,65011,opt,name=stdduration", + Filename: "gogo.proto", +} + +var E_Wktpointer = &proto.ExtensionDesc{ + ExtendedType: (*descriptor.FieldOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 65012, + Name: "gogoproto.wktpointer", + Tag: "varint,65012,opt,name=wktpointer", + Filename: "gogo.proto", +} + +func init() { + proto.RegisterExtension(E_GoprotoEnumPrefix) + proto.RegisterExtension(E_GoprotoEnumStringer) + proto.RegisterExtension(E_EnumStringer) + proto.RegisterExtension(E_EnumCustomname) + proto.RegisterExtension(E_Enumdecl) + proto.RegisterExtension(E_EnumvalueCustomname) + proto.RegisterExtension(E_GoprotoGettersAll) + proto.RegisterExtension(E_GoprotoEnumPrefixAll) + proto.RegisterExtension(E_GoprotoStringerAll) + proto.RegisterExtension(E_VerboseEqualAll) + proto.RegisterExtension(E_FaceAll) + proto.RegisterExtension(E_GostringAll) + proto.RegisterExtension(E_PopulateAll) + proto.RegisterExtension(E_StringerAll) + proto.RegisterExtension(E_OnlyoneAll) + proto.RegisterExtension(E_EqualAll) + proto.RegisterExtension(E_DescriptionAll) + proto.RegisterExtension(E_TestgenAll) + proto.RegisterExtension(E_BenchgenAll) + proto.RegisterExtension(E_MarshalerAll) + proto.RegisterExtension(E_UnmarshalerAll) + proto.RegisterExtension(E_StableMarshalerAll) + proto.RegisterExtension(E_SizerAll) + proto.RegisterExtension(E_GoprotoEnumStringerAll) + proto.RegisterExtension(E_EnumStringerAll) + proto.RegisterExtension(E_UnsafeMarshalerAll) + proto.RegisterExtension(E_UnsafeUnmarshalerAll) + proto.RegisterExtension(E_GoprotoExtensionsMapAll) + proto.RegisterExtension(E_GoprotoUnrecognizedAll) + proto.RegisterExtension(E_GogoprotoImport) + proto.RegisterExtension(E_ProtosizerAll) + proto.RegisterExtension(E_CompareAll) + proto.RegisterExtension(E_TypedeclAll) + proto.RegisterExtension(E_EnumdeclAll) + proto.RegisterExtension(E_GoprotoRegistration) + proto.RegisterExtension(E_MessagenameAll) + proto.RegisterExtension(E_GoprotoSizecacheAll) + proto.RegisterExtension(E_GoprotoUnkeyedAll) + proto.RegisterExtension(E_GoprotoGetters) + proto.RegisterExtension(E_GoprotoStringer) + proto.RegisterExtension(E_VerboseEqual) + proto.RegisterExtension(E_Face) + proto.RegisterExtension(E_Gostring) + proto.RegisterExtension(E_Populate) + proto.RegisterExtension(E_Stringer) + proto.RegisterExtension(E_Onlyone) + proto.RegisterExtension(E_Equal) + proto.RegisterExtension(E_Description) + proto.RegisterExtension(E_Testgen) + proto.RegisterExtension(E_Benchgen) + proto.RegisterExtension(E_Marshaler) + proto.RegisterExtension(E_Unmarshaler) + proto.RegisterExtension(E_StableMarshaler) + proto.RegisterExtension(E_Sizer) + proto.RegisterExtension(E_UnsafeMarshaler) + proto.RegisterExtension(E_UnsafeUnmarshaler) + proto.RegisterExtension(E_GoprotoExtensionsMap) + proto.RegisterExtension(E_GoprotoUnrecognized) + proto.RegisterExtension(E_Protosizer) + proto.RegisterExtension(E_Compare) + proto.RegisterExtension(E_Typedecl) + proto.RegisterExtension(E_Messagename) + proto.RegisterExtension(E_GoprotoSizecache) + proto.RegisterExtension(E_GoprotoUnkeyed) + proto.RegisterExtension(E_Nullable) + proto.RegisterExtension(E_Embed) + proto.RegisterExtension(E_Customtype) + proto.RegisterExtension(E_Customname) + proto.RegisterExtension(E_Jsontag) + proto.RegisterExtension(E_Moretags) + proto.RegisterExtension(E_Casttype) + proto.RegisterExtension(E_Castkey) + proto.RegisterExtension(E_Castvalue) + proto.RegisterExtension(E_Stdtime) + proto.RegisterExtension(E_Stdduration) + proto.RegisterExtension(E_Wktpointer) +} + +func init() { proto.RegisterFile("gogo.proto", fileDescriptor_592445b5231bc2b9) } + +var fileDescriptor_592445b5231bc2b9 = []byte{ + // 1328 bytes of a gzipped FileDescriptorProto + 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0x94, 0x98, 0x49, 0x6f, 0x1c, 0x45, + 0x14, 0x80, 0x85, 0x48, 0x64, 0x4f, 0x79, 0x8b, 0xc7, 0xc6, 0x84, 0x08, 0x44, 0xe0, 0xc4, 0xc9, + 0x3e, 0x45, 0x28, 0x65, 0x45, 0x96, 0x63, 0x39, 0x56, 0x10, 0x0e, 0xc6, 0x89, 0xc3, 0x76, 0x18, + 0xf5, 0xf4, 0x94, 0xdb, 0x8d, 0xbb, 0xbb, 0x9a, 0xee, 0xea, 0x10, 0xe7, 0x86, 0xc2, 0x22, 0x84, + 0xd8, 0x91, 0x20, 0x21, 0x09, 0x04, 0xc4, 0xbe, 0x86, 0x7d, 0xb9, 0x70, 0x61, 0xb9, 0xf2, 0x1f, + 0xb8, 0x00, 0x66, 0xf7, 0xcd, 0x17, 0xf4, 0xba, 0xdf, 0xeb, 0xa9, 0x69, 0x8f, 0x54, 0x35, 0xb7, + 0xf6, 0xb8, 0xbe, 0x6f, 0xaa, 0xdf, 0xeb, 0x7a, 0xef, 0x4d, 0x33, 0xe6, 0x49, 0x4f, 0x4e, 0xc6, + 0x89, 0x54, 0xb2, 0x5e, 0x83, 0xeb, 0xfc, 0x72, 0xdf, 0x7e, 0x4f, 0x4a, 0x2f, 0x10, 0x53, 0xf9, + 0x5f, 0xcd, 0x6c, 0x75, 0xaa, 0x25, 0x52, 0x37, 0xf1, 0x63, 0x25, 0x93, 0x62, 0x31, 0x3f, 0xc6, + 0xc6, 0x70, 0x71, 0x43, 0x44, 0x59, 0xd8, 0x88, 0x13, 0xb1, 0xea, 0x9f, 0xae, 0x5f, 0x3f, 0x59, + 0x90, 0x93, 0x44, 0x4e, 0xce, 0x47, 0x59, 0x78, 0x47, 0xac, 0x7c, 0x19, 0xa5, 0x7b, 0xaf, 0xfc, + 0x72, 0xf5, 0xfe, 0xab, 0x6e, 0xe9, 0x5f, 0x1e, 0x45, 0x14, 0xfe, 0xb7, 0x94, 0x83, 0x7c, 0x99, + 0x5d, 0xd3, 0xe1, 0x4b, 0x55, 0xe2, 0x47, 0x9e, 0x48, 0x0c, 0xc6, 0xef, 0xd1, 0x38, 0xa6, 0x19, + 0x8f, 0x23, 0xca, 0xe7, 0xd8, 0x50, 0x2f, 0xae, 0x1f, 0xd0, 0x35, 0x28, 0x74, 0xc9, 0x02, 0x1b, + 0xc9, 0x25, 0x6e, 0x96, 0x2a, 0x19, 0x46, 0x4e, 0x28, 0x0c, 0x9a, 0x1f, 0x73, 0x4d, 0x6d, 0x79, + 0x18, 0xb0, 0xb9, 0x92, 0xe2, 0x9c, 0xf5, 0xc3, 0x27, 0x2d, 0xe1, 0x06, 0x06, 0xc3, 0x4f, 0xb8, + 0x91, 0x72, 0x3d, 0x3f, 0xc9, 0xc6, 0xe1, 0xfa, 0x94, 0x13, 0x64, 0x42, 0xdf, 0xc9, 0x4d, 0x5d, + 0x3d, 0x27, 0x61, 0x19, 0xc9, 0x7e, 0x3e, 0xbb, 0x2b, 0xdf, 0xce, 0x58, 0x29, 0xd0, 0xf6, 0xa4, + 0x65, 0xd1, 0x13, 0x4a, 0x89, 0x24, 0x6d, 0x38, 0x41, 0xb7, 0xed, 0x1d, 0xf1, 0x83, 0xd2, 0x78, + 0x6e, 0xb3, 0x33, 0x8b, 0x0b, 0x05, 0x39, 0x1b, 0x04, 0x7c, 0x85, 0x5d, 0xdb, 0xe5, 0xa9, 0xb0, + 0x70, 0x9e, 0x47, 0xe7, 0xf8, 0x8e, 0x27, 0x03, 0xb4, 0x4b, 0x8c, 0x3e, 0x2f, 0x73, 0x69, 0xe1, + 0x7c, 0x19, 0x9d, 0x75, 0x64, 0x29, 0xa5, 0x60, 0xbc, 0x8d, 0x8d, 0x9e, 0x12, 0x49, 0x53, 0xa6, + 0xa2, 0x21, 0x1e, 0xc8, 0x9c, 0xc0, 0x42, 0x77, 0x01, 0x75, 0x23, 0x08, 0xce, 0x03, 0x07, 0xae, + 0x83, 0xac, 0x7f, 0xd5, 0x71, 0x85, 0x85, 0xe2, 0x22, 0x2a, 0xfa, 0x60, 0x3d, 0xa0, 0xb3, 0x6c, + 0xd0, 0x93, 0xc5, 0x2d, 0x59, 0xe0, 0x97, 0x10, 0x1f, 0x20, 0x06, 0x15, 0xb1, 0x8c, 0xb3, 0xc0, + 0x51, 0x36, 0x3b, 0x78, 0x85, 0x14, 0xc4, 0xa0, 0xa2, 0x87, 0xb0, 0xbe, 0x4a, 0x8a, 0x54, 0x8b, + 0xe7, 0x0c, 0x1b, 0x90, 0x51, 0xb0, 0x21, 0x23, 0x9b, 0x4d, 0x5c, 0x46, 0x03, 0x43, 0x04, 0x04, + 0xd3, 0xac, 0x66, 0x9b, 0x88, 0x37, 0x36, 0xe9, 0x78, 0x50, 0x06, 0x16, 0xd8, 0x08, 0x15, 0x28, + 0x5f, 0x46, 0x16, 0x8a, 0x37, 0x51, 0x31, 0xac, 0x61, 0x78, 0x1b, 0x4a, 0xa4, 0xca, 0x13, 0x36, + 0x92, 0xb7, 0xe8, 0x36, 0x10, 0xc1, 0x50, 0x36, 0x45, 0xe4, 0xae, 0xd9, 0x19, 0xde, 0xa6, 0x50, + 0x12, 0x03, 0x8a, 0x39, 0x36, 0x14, 0x3a, 0x49, 0xba, 0xe6, 0x04, 0x56, 0xe9, 0x78, 0x07, 0x1d, + 0x83, 0x25, 0x84, 0x11, 0xc9, 0xa2, 0x5e, 0x34, 0xef, 0x52, 0x44, 0x34, 0x0c, 0x8f, 0x5e, 0xaa, + 0x9c, 0x66, 0x20, 0x1a, 0xbd, 0xd8, 0xde, 0xa3, 0xa3, 0x57, 0xb0, 0x8b, 0xba, 0x71, 0x9a, 0xd5, + 0x52, 0xff, 0x8c, 0x95, 0xe6, 0x7d, 0xca, 0x74, 0x0e, 0x00, 0x7c, 0x0f, 0xbb, 0xae, 0x6b, 0x9b, + 0xb0, 0x90, 0x7d, 0x80, 0xb2, 0x89, 0x2e, 0xad, 0x02, 0x4b, 0x42, 0xaf, 0xca, 0x0f, 0xa9, 0x24, + 0x88, 0x8a, 0x6b, 0x89, 0x8d, 0x67, 0x51, 0xea, 0xac, 0xf6, 0x16, 0xb5, 0x8f, 0x28, 0x6a, 0x05, + 0xdb, 0x11, 0xb5, 0x13, 0x6c, 0x02, 0x8d, 0xbd, 0xe5, 0xf5, 0x63, 0x2a, 0xac, 0x05, 0xbd, 0xd2, + 0x99, 0xdd, 0xfb, 0xd8, 0xbe, 0x32, 0x9c, 0xa7, 0x95, 0x88, 0x52, 0x60, 0x1a, 0xa1, 0x13, 0x5b, + 0x98, 0xaf, 0xa0, 0x99, 0x2a, 0xfe, 0x7c, 0x29, 0x58, 0x74, 0x62, 0x90, 0xdf, 0xcd, 0xf6, 0x92, + 0x3c, 0x8b, 0x12, 0xe1, 0x4a, 0x2f, 0xf2, 0xcf, 0x88, 0x96, 0x85, 0xfa, 0x93, 0x4a, 0xaa, 0x56, + 0x34, 0x1c, 0xcc, 0x47, 0xd9, 0x9e, 0x72, 0x56, 0x69, 0xf8, 0x61, 0x2c, 0x13, 0x65, 0x30, 0x7e, + 0x4a, 0x99, 0x2a, 0xb9, 0xa3, 0x39, 0xc6, 0xe7, 0xd9, 0x70, 0xfe, 0xa7, 0xed, 0x23, 0xf9, 0x19, + 0x8a, 0x86, 0xda, 0x14, 0x16, 0x0e, 0x57, 0x86, 0xb1, 0x93, 0xd8, 0xd4, 0xbf, 0xcf, 0xa9, 0x70, + 0x20, 0x82, 0x85, 0x43, 0x6d, 0xc4, 0x02, 0xba, 0xbd, 0x85, 0xe1, 0x0b, 0x2a, 0x1c, 0xc4, 0xa0, + 0x82, 0x06, 0x06, 0x0b, 0xc5, 0x97, 0xa4, 0x20, 0x06, 0x14, 0x77, 0xb6, 0x1b, 0x6d, 0x22, 0x3c, + 0x3f, 0x55, 0x89, 0x03, 0xab, 0x0d, 0xaa, 0xaf, 0x36, 0x3b, 0x87, 0xb0, 0x65, 0x0d, 0x85, 0x4a, + 0x14, 0x8a, 0x34, 0x75, 0x3c, 0x01, 0x13, 0x87, 0xc5, 0xc6, 0xbe, 0xa6, 0x4a, 0xa4, 0x61, 0xb0, + 0x37, 0x6d, 0x42, 0x84, 0xb0, 0xbb, 0x8e, 0xbb, 0x66, 0xa3, 0xfb, 0xa6, 0xb2, 0xb9, 0xe3, 0xc4, + 0x82, 0x53, 0x9b, 0x7f, 0xb2, 0x68, 0x5d, 0x6c, 0x58, 0x3d, 0x9d, 0xdf, 0x56, 0xe6, 0x9f, 0x95, + 0x82, 0x2c, 0x6a, 0xc8, 0x48, 0x65, 0x9e, 0xaa, 0xdf, 0xb8, 0xc3, 0xb5, 0x58, 0xdc, 0x17, 0xe9, + 0x1e, 0xda, 0xc2, 0xfb, 0xed, 0x1c, 0xa7, 0xf8, 0xed, 0xf0, 0x90, 0x77, 0x0e, 0x3d, 0x66, 0xd9, + 0xd9, 0xad, 0xf2, 0x39, 0xef, 0x98, 0x79, 0xf8, 0x11, 0x36, 0xd4, 0x31, 0xf0, 0x98, 0x55, 0x0f, + 0xa3, 0x6a, 0x50, 0x9f, 0x77, 0xf8, 0x01, 0xb6, 0x0b, 0x86, 0x17, 0x33, 0xfe, 0x08, 0xe2, 0xf9, + 0x72, 0x7e, 0x88, 0xf5, 0xd3, 0xd0, 0x62, 0x46, 0x1f, 0x45, 0xb4, 0x44, 0x00, 0xa7, 0x81, 0xc5, + 0x8c, 0x3f, 0x46, 0x38, 0x21, 0x80, 0xdb, 0x87, 0xf0, 0xbb, 0x27, 0x76, 0x61, 0xd3, 0xa1, 0xd8, + 0x4d, 0xb3, 0x3e, 0x9c, 0x54, 0xcc, 0xf4, 0xe3, 0xf8, 0xe5, 0x44, 0xf0, 0x5b, 0xd9, 0x6e, 0xcb, + 0x80, 0x3f, 0x89, 0x68, 0xb1, 0x9e, 0xcf, 0xb1, 0x01, 0x6d, 0x3a, 0x31, 0xe3, 0x4f, 0x21, 0xae, + 0x53, 0xb0, 0x75, 0x9c, 0x4e, 0xcc, 0x82, 0xa7, 0x69, 0xeb, 0x48, 0x40, 0xd8, 0x68, 0x30, 0x31, + 0xd3, 0xcf, 0x50, 0xd4, 0x09, 0xe1, 0x33, 0xac, 0x56, 0x36, 0x1b, 0x33, 0xff, 0x2c, 0xf2, 0x6d, + 0x06, 0x22, 0xa0, 0x35, 0x3b, 0xb3, 0xe2, 0x39, 0x8a, 0x80, 0x46, 0xc1, 0x31, 0xaa, 0x0e, 0x30, + 0x66, 0xd3, 0xf3, 0x74, 0x8c, 0x2a, 0xf3, 0x0b, 0x64, 0x33, 0xaf, 0xf9, 0x66, 0xc5, 0x0b, 0x94, + 0xcd, 0x7c, 0x3d, 0x6c, 0xa3, 0x3a, 0x11, 0x98, 0x1d, 0x2f, 0xd2, 0x36, 0x2a, 0x03, 0x01, 0x5f, + 0x62, 0xf5, 0x9d, 0xd3, 0x80, 0xd9, 0xf7, 0x12, 0xfa, 0x46, 0x77, 0x0c, 0x03, 0xfc, 0x2e, 0x36, + 0xd1, 0x7d, 0x12, 0x30, 0x5b, 0xcf, 0x6d, 0x55, 0x7e, 0xbb, 0xe9, 0x83, 0x00, 0x3f, 0xd1, 0x6e, + 0x29, 0xfa, 0x14, 0x60, 0xd6, 0x9e, 0xdf, 0xea, 0x2c, 0xdc, 0xfa, 0x10, 0xc0, 0x67, 0x19, 0x6b, + 0x37, 0x60, 0xb3, 0xeb, 0x02, 0xba, 0x34, 0x08, 0x8e, 0x06, 0xf6, 0x5f, 0x33, 0x7f, 0x91, 0x8e, + 0x06, 0x12, 0x70, 0x34, 0xa8, 0xf5, 0x9a, 0xe9, 0x4b, 0x74, 0x34, 0x08, 0x81, 0x27, 0x5b, 0xeb, + 0x6e, 0x66, 0xc3, 0x65, 0x7a, 0xb2, 0x35, 0x8a, 0x1f, 0x63, 0xa3, 0x3b, 0x1a, 0xa2, 0x59, 0xf5, + 0x1a, 0xaa, 0xf6, 0x54, 0xfb, 0xa1, 0xde, 0xbc, 0xb0, 0x19, 0x9a, 0x6d, 0xaf, 0x57, 0x9a, 0x17, + 0xf6, 0x42, 0x3e, 0xcd, 0xfa, 0xa3, 0x2c, 0x08, 0xe0, 0xf0, 0xd4, 0x6f, 0xe8, 0xd2, 0x4d, 0x45, + 0xd0, 0x22, 0xc5, 0xaf, 0xdb, 0x18, 0x1d, 0x02, 0xf8, 0x01, 0xb6, 0x5b, 0x84, 0x4d, 0xd1, 0x32, + 0x91, 0xbf, 0x6d, 0x53, 0xc1, 0x84, 0xd5, 0x7c, 0x86, 0xb1, 0xe2, 0xd5, 0x08, 0x84, 0xd9, 0xc4, + 0xfe, 0xbe, 0x5d, 0xbc, 0xa5, 0xd1, 0x90, 0xb6, 0x20, 0x4f, 0x8a, 0x41, 0xb0, 0xd9, 0x29, 0xc8, + 0x33, 0x72, 0x90, 0xf5, 0xdd, 0x9f, 0xca, 0x48, 0x39, 0x9e, 0x89, 0xfe, 0x03, 0x69, 0x5a, 0x0f, + 0x01, 0x0b, 0x65, 0x22, 0x94, 0xe3, 0xa5, 0x26, 0xf6, 0x4f, 0x64, 0x4b, 0x00, 0x60, 0xd7, 0x49, + 0x95, 0xcd, 0x7d, 0xff, 0x45, 0x30, 0x01, 0xb0, 0x69, 0xb8, 0x5e, 0x17, 0x1b, 0x26, 0xf6, 0x6f, + 0xda, 0x34, 0xae, 0xe7, 0x87, 0x58, 0x0d, 0x2e, 0xf3, 0xb7, 0x4a, 0x26, 0xf8, 0x1f, 0x84, 0xdb, + 0x04, 0x7c, 0x73, 0xaa, 0x5a, 0xca, 0x37, 0x07, 0xfb, 0x5f, 0xcc, 0x34, 0xad, 0xe7, 0xb3, 0x6c, + 0x20, 0x55, 0xad, 0x56, 0x86, 0xf3, 0xa9, 0x01, 0xff, 0x6f, 0xbb, 0x7c, 0x65, 0x51, 0x32, 0x90, + 0xed, 0x07, 0xd7, 0x55, 0x2c, 0xfd, 0x48, 0x89, 0xc4, 0x64, 0xd8, 0x42, 0x83, 0x86, 0x1c, 0x9e, + 0x67, 0x63, 0xae, 0x0c, 0xab, 0xdc, 0x61, 0xb6, 0x20, 0x17, 0xe4, 0x52, 0x5e, 0x67, 0xee, 0xbd, + 0xd9, 0xf3, 0xd5, 0x5a, 0xd6, 0x9c, 0x74, 0x65, 0x38, 0x05, 0xbf, 0x3c, 0xda, 0x2f, 0x54, 0xcb, + 0xdf, 0x21, 0xff, 0x07, 0x00, 0x00, 0xff, 0xff, 0x9c, 0xaf, 0x70, 0x4e, 0x83, 0x15, 0x00, 0x00, +} diff --git a/vendor/github.com/gogo/protobuf/gogoproto/gogo.pb.golden b/vendor/github.com/gogo/protobuf/gogoproto/gogo.pb.golden new file mode 100644 index 00000000..f6502e4b --- /dev/null +++ b/vendor/github.com/gogo/protobuf/gogoproto/gogo.pb.golden @@ -0,0 +1,45 @@ +// Code generated by protoc-gen-go. +// source: gogo.proto +// DO NOT EDIT! + +package gogoproto + +import proto "github.com/gogo/protobuf/proto" +import json "encoding/json" +import math "math" +import google_protobuf "github.com/gogo/protobuf/protoc-gen-gogo/descriptor" + +// Reference proto, json, and math imports to suppress error if they are not otherwise used. +var _ = proto.Marshal +var _ = &json.SyntaxError{} +var _ = math.Inf + +var E_Nullable = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FieldOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 51235, + Name: "gogoproto.nullable", + Tag: "varint,51235,opt,name=nullable", +} + +var E_Embed = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FieldOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 51236, + Name: "gogoproto.embed", + Tag: "varint,51236,opt,name=embed", +} + +var E_Customtype = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FieldOptions)(nil), + ExtensionType: (*string)(nil), + Field: 51237, + Name: "gogoproto.customtype", + Tag: "bytes,51237,opt,name=customtype", +} + +func init() { + proto.RegisterExtension(E_Nullable) + proto.RegisterExtension(E_Embed) + proto.RegisterExtension(E_Customtype) +} diff --git a/vendor/github.com/gogo/protobuf/gogoproto/gogo.proto b/vendor/github.com/gogo/protobuf/gogoproto/gogo.proto new file mode 100644 index 00000000..b80c8565 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/gogoproto/gogo.proto @@ -0,0 +1,144 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2013, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +syntax = "proto2"; +package gogoproto; + +import "google/protobuf/descriptor.proto"; + +option java_package = "com.google.protobuf"; +option java_outer_classname = "GoGoProtos"; +option go_package = "github.com/gogo/protobuf/gogoproto"; + +extend google.protobuf.EnumOptions { + optional bool goproto_enum_prefix = 62001; + optional bool goproto_enum_stringer = 62021; + optional bool enum_stringer = 62022; + optional string enum_customname = 62023; + optional bool enumdecl = 62024; +} + +extend google.protobuf.EnumValueOptions { + optional string enumvalue_customname = 66001; +} + +extend google.protobuf.FileOptions { + optional bool goproto_getters_all = 63001; + optional bool goproto_enum_prefix_all = 63002; + optional bool goproto_stringer_all = 63003; + optional bool verbose_equal_all = 63004; + optional bool face_all = 63005; + optional bool gostring_all = 63006; + optional bool populate_all = 63007; + optional bool stringer_all = 63008; + optional bool onlyone_all = 63009; + + optional bool equal_all = 63013; + optional bool description_all = 63014; + optional bool testgen_all = 63015; + optional bool benchgen_all = 63016; + optional bool marshaler_all = 63017; + optional bool unmarshaler_all = 63018; + optional bool stable_marshaler_all = 63019; + + optional bool sizer_all = 63020; + + optional bool goproto_enum_stringer_all = 63021; + optional bool enum_stringer_all = 63022; + + optional bool unsafe_marshaler_all = 63023; + optional bool unsafe_unmarshaler_all = 63024; + + optional bool goproto_extensions_map_all = 63025; + optional bool goproto_unrecognized_all = 63026; + optional bool gogoproto_import = 63027; + optional bool protosizer_all = 63028; + optional bool compare_all = 63029; + optional bool typedecl_all = 63030; + optional bool enumdecl_all = 63031; + + optional bool goproto_registration = 63032; + optional bool messagename_all = 63033; + + optional bool goproto_sizecache_all = 63034; + optional bool goproto_unkeyed_all = 63035; +} + +extend google.protobuf.MessageOptions { + optional bool goproto_getters = 64001; + optional bool goproto_stringer = 64003; + optional bool verbose_equal = 64004; + optional bool face = 64005; + optional bool gostring = 64006; + optional bool populate = 64007; + optional bool stringer = 67008; + optional bool onlyone = 64009; + + optional bool equal = 64013; + optional bool description = 64014; + optional bool testgen = 64015; + optional bool benchgen = 64016; + optional bool marshaler = 64017; + optional bool unmarshaler = 64018; + optional bool stable_marshaler = 64019; + + optional bool sizer = 64020; + + optional bool unsafe_marshaler = 64023; + optional bool unsafe_unmarshaler = 64024; + + optional bool goproto_extensions_map = 64025; + optional bool goproto_unrecognized = 64026; + + optional bool protosizer = 64028; + optional bool compare = 64029; + + optional bool typedecl = 64030; + + optional bool messagename = 64033; + + optional bool goproto_sizecache = 64034; + optional bool goproto_unkeyed = 64035; +} + +extend google.protobuf.FieldOptions { + optional bool nullable = 65001; + optional bool embed = 65002; + optional string customtype = 65003; + optional string customname = 65004; + optional string jsontag = 65005; + optional string moretags = 65006; + optional string casttype = 65007; + optional string castkey = 65008; + optional string castvalue = 65009; + + optional bool stdtime = 65010; + optional bool stdduration = 65011; + optional bool wktpointer = 65012; + +} diff --git a/vendor/github.com/gogo/protobuf/gogoproto/helper.go b/vendor/github.com/gogo/protobuf/gogoproto/helper.go new file mode 100644 index 00000000..390d4e4b --- /dev/null +++ b/vendor/github.com/gogo/protobuf/gogoproto/helper.go @@ -0,0 +1,415 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2013, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package gogoproto + +import google_protobuf "github.com/gogo/protobuf/protoc-gen-gogo/descriptor" +import proto "github.com/gogo/protobuf/proto" + +func IsEmbed(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Embed, false) +} + +func IsNullable(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Nullable, true) +} + +func IsStdTime(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Stdtime, false) +} + +func IsStdDuration(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Stdduration, false) +} + +func IsStdDouble(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Wktpointer, false) && *field.TypeName == ".google.protobuf.DoubleValue" +} + +func IsStdFloat(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Wktpointer, false) && *field.TypeName == ".google.protobuf.FloatValue" +} + +func IsStdInt64(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Wktpointer, false) && *field.TypeName == ".google.protobuf.Int64Value" +} + +func IsStdUInt64(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Wktpointer, false) && *field.TypeName == ".google.protobuf.UInt64Value" +} + +func IsStdInt32(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Wktpointer, false) && *field.TypeName == ".google.protobuf.Int32Value" +} + +func IsStdUInt32(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Wktpointer, false) && *field.TypeName == ".google.protobuf.UInt32Value" +} + +func IsStdBool(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Wktpointer, false) && *field.TypeName == ".google.protobuf.BoolValue" +} + +func IsStdString(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Wktpointer, false) && *field.TypeName == ".google.protobuf.StringValue" +} + +func IsStdBytes(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Wktpointer, false) && *field.TypeName == ".google.protobuf.BytesValue" +} + +func IsStdType(field *google_protobuf.FieldDescriptorProto) bool { + return (IsStdTime(field) || IsStdDuration(field) || + IsStdDouble(field) || IsStdFloat(field) || + IsStdInt64(field) || IsStdUInt64(field) || + IsStdInt32(field) || IsStdUInt32(field) || + IsStdBool(field) || + IsStdString(field) || IsStdBytes(field)) +} + +func IsWktPtr(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Wktpointer, false) +} + +func NeedsNilCheck(proto3 bool, field *google_protobuf.FieldDescriptorProto) bool { + nullable := IsNullable(field) + if field.IsMessage() || IsCustomType(field) { + return nullable + } + if proto3 { + return false + } + return nullable || *field.Type == google_protobuf.FieldDescriptorProto_TYPE_BYTES +} + +func IsCustomType(field *google_protobuf.FieldDescriptorProto) bool { + typ := GetCustomType(field) + if len(typ) > 0 { + return true + } + return false +} + +func IsCastType(field *google_protobuf.FieldDescriptorProto) bool { + typ := GetCastType(field) + if len(typ) > 0 { + return true + } + return false +} + +func IsCastKey(field *google_protobuf.FieldDescriptorProto) bool { + typ := GetCastKey(field) + if len(typ) > 0 { + return true + } + return false +} + +func IsCastValue(field *google_protobuf.FieldDescriptorProto) bool { + typ := GetCastValue(field) + if len(typ) > 0 { + return true + } + return false +} + +func HasEnumDecl(file *google_protobuf.FileDescriptorProto, enum *google_protobuf.EnumDescriptorProto) bool { + return proto.GetBoolExtension(enum.Options, E_Enumdecl, proto.GetBoolExtension(file.Options, E_EnumdeclAll, true)) +} + +func HasTypeDecl(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Typedecl, proto.GetBoolExtension(file.Options, E_TypedeclAll, true)) +} + +func GetCustomType(field *google_protobuf.FieldDescriptorProto) string { + if field == nil { + return "" + } + if field.Options != nil { + v, err := proto.GetExtension(field.Options, E_Customtype) + if err == nil && v.(*string) != nil { + return *(v.(*string)) + } + } + return "" +} + +func GetCastType(field *google_protobuf.FieldDescriptorProto) string { + if field == nil { + return "" + } + if field.Options != nil { + v, err := proto.GetExtension(field.Options, E_Casttype) + if err == nil && v.(*string) != nil { + return *(v.(*string)) + } + } + return "" +} + +func GetCastKey(field *google_protobuf.FieldDescriptorProto) string { + if field == nil { + return "" + } + if field.Options != nil { + v, err := proto.GetExtension(field.Options, E_Castkey) + if err == nil && v.(*string) != nil { + return *(v.(*string)) + } + } + return "" +} + +func GetCastValue(field *google_protobuf.FieldDescriptorProto) string { + if field == nil { + return "" + } + if field.Options != nil { + v, err := proto.GetExtension(field.Options, E_Castvalue) + if err == nil && v.(*string) != nil { + return *(v.(*string)) + } + } + return "" +} + +func IsCustomName(field *google_protobuf.FieldDescriptorProto) bool { + name := GetCustomName(field) + if len(name) > 0 { + return true + } + return false +} + +func IsEnumCustomName(field *google_protobuf.EnumDescriptorProto) bool { + name := GetEnumCustomName(field) + if len(name) > 0 { + return true + } + return false +} + +func IsEnumValueCustomName(field *google_protobuf.EnumValueDescriptorProto) bool { + name := GetEnumValueCustomName(field) + if len(name) > 0 { + return true + } + return false +} + +func GetCustomName(field *google_protobuf.FieldDescriptorProto) string { + if field == nil { + return "" + } + if field.Options != nil { + v, err := proto.GetExtension(field.Options, E_Customname) + if err == nil && v.(*string) != nil { + return *(v.(*string)) + } + } + return "" +} + +func GetEnumCustomName(field *google_protobuf.EnumDescriptorProto) string { + if field == nil { + return "" + } + if field.Options != nil { + v, err := proto.GetExtension(field.Options, E_EnumCustomname) + if err == nil && v.(*string) != nil { + return *(v.(*string)) + } + } + return "" +} + +func GetEnumValueCustomName(field *google_protobuf.EnumValueDescriptorProto) string { + if field == nil { + return "" + } + if field.Options != nil { + v, err := proto.GetExtension(field.Options, E_EnumvalueCustomname) + if err == nil && v.(*string) != nil { + return *(v.(*string)) + } + } + return "" +} + +func GetJsonTag(field *google_protobuf.FieldDescriptorProto) *string { + if field == nil { + return nil + } + if field.Options != nil { + v, err := proto.GetExtension(field.Options, E_Jsontag) + if err == nil && v.(*string) != nil { + return (v.(*string)) + } + } + return nil +} + +func GetMoreTags(field *google_protobuf.FieldDescriptorProto) *string { + if field == nil { + return nil + } + if field.Options != nil { + v, err := proto.GetExtension(field.Options, E_Moretags) + if err == nil && v.(*string) != nil { + return (v.(*string)) + } + } + return nil +} + +type EnableFunc func(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool + +func EnabledGoEnumPrefix(file *google_protobuf.FileDescriptorProto, enum *google_protobuf.EnumDescriptorProto) bool { + return proto.GetBoolExtension(enum.Options, E_GoprotoEnumPrefix, proto.GetBoolExtension(file.Options, E_GoprotoEnumPrefixAll, true)) +} + +func EnabledGoStringer(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_GoprotoStringer, proto.GetBoolExtension(file.Options, E_GoprotoStringerAll, true)) +} + +func HasGoGetters(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_GoprotoGetters, proto.GetBoolExtension(file.Options, E_GoprotoGettersAll, true)) +} + +func IsUnion(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Onlyone, proto.GetBoolExtension(file.Options, E_OnlyoneAll, false)) +} + +func HasGoString(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Gostring, proto.GetBoolExtension(file.Options, E_GostringAll, false)) +} + +func HasEqual(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Equal, proto.GetBoolExtension(file.Options, E_EqualAll, false)) +} + +func HasVerboseEqual(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_VerboseEqual, proto.GetBoolExtension(file.Options, E_VerboseEqualAll, false)) +} + +func IsStringer(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Stringer, proto.GetBoolExtension(file.Options, E_StringerAll, false)) +} + +func IsFace(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Face, proto.GetBoolExtension(file.Options, E_FaceAll, false)) +} + +func HasDescription(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Description, proto.GetBoolExtension(file.Options, E_DescriptionAll, false)) +} + +func HasPopulate(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Populate, proto.GetBoolExtension(file.Options, E_PopulateAll, false)) +} + +func HasTestGen(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Testgen, proto.GetBoolExtension(file.Options, E_TestgenAll, false)) +} + +func HasBenchGen(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Benchgen, proto.GetBoolExtension(file.Options, E_BenchgenAll, false)) +} + +func IsMarshaler(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Marshaler, proto.GetBoolExtension(file.Options, E_MarshalerAll, false)) +} + +func IsUnmarshaler(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Unmarshaler, proto.GetBoolExtension(file.Options, E_UnmarshalerAll, false)) +} + +func IsStableMarshaler(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_StableMarshaler, proto.GetBoolExtension(file.Options, E_StableMarshalerAll, false)) +} + +func IsSizer(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Sizer, proto.GetBoolExtension(file.Options, E_SizerAll, false)) +} + +func IsProtoSizer(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Protosizer, proto.GetBoolExtension(file.Options, E_ProtosizerAll, false)) +} + +func IsGoEnumStringer(file *google_protobuf.FileDescriptorProto, enum *google_protobuf.EnumDescriptorProto) bool { + return proto.GetBoolExtension(enum.Options, E_GoprotoEnumStringer, proto.GetBoolExtension(file.Options, E_GoprotoEnumStringerAll, true)) +} + +func IsEnumStringer(file *google_protobuf.FileDescriptorProto, enum *google_protobuf.EnumDescriptorProto) bool { + return proto.GetBoolExtension(enum.Options, E_EnumStringer, proto.GetBoolExtension(file.Options, E_EnumStringerAll, false)) +} + +func IsUnsafeMarshaler(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_UnsafeMarshaler, proto.GetBoolExtension(file.Options, E_UnsafeMarshalerAll, false)) +} + +func IsUnsafeUnmarshaler(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_UnsafeUnmarshaler, proto.GetBoolExtension(file.Options, E_UnsafeUnmarshalerAll, false)) +} + +func HasExtensionsMap(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_GoprotoExtensionsMap, proto.GetBoolExtension(file.Options, E_GoprotoExtensionsMapAll, true)) +} + +func HasUnrecognized(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_GoprotoUnrecognized, proto.GetBoolExtension(file.Options, E_GoprotoUnrecognizedAll, true)) +} + +func IsProto3(file *google_protobuf.FileDescriptorProto) bool { + return file.GetSyntax() == "proto3" +} + +func ImportsGoGoProto(file *google_protobuf.FileDescriptorProto) bool { + return proto.GetBoolExtension(file.Options, E_GogoprotoImport, true) +} + +func HasCompare(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Compare, proto.GetBoolExtension(file.Options, E_CompareAll, false)) +} + +func RegistersGolangProto(file *google_protobuf.FileDescriptorProto) bool { + return proto.GetBoolExtension(file.Options, E_GoprotoRegistration, false) +} + +func HasMessageName(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Messagename, proto.GetBoolExtension(file.Options, E_MessagenameAll, false)) +} + +func HasSizecache(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_GoprotoSizecache, proto.GetBoolExtension(file.Options, E_GoprotoSizecacheAll, true)) +} + +func HasUnkeyed(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_GoprotoUnkeyed, proto.GetBoolExtension(file.Options, E_GoprotoUnkeyedAll, true)) +} diff --git a/vendor/github.com/gogo/protobuf/proto/Makefile b/vendor/github.com/gogo/protobuf/proto/Makefile new file mode 100644 index 00000000..00d65f32 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/Makefile @@ -0,0 +1,43 @@ +# Go support for Protocol Buffers - Google's data interchange format +# +# Copyright 2010 The Go Authors. All rights reserved. +# https://github.com/golang/protobuf +# +# Redistribution and use in source and binary forms, with or without +# modification, are permitted provided that the following conditions are +# met: +# +# * Redistributions of source code must retain the above copyright +# notice, this list of conditions and the following disclaimer. +# * Redistributions in binary form must reproduce the above +# copyright notice, this list of conditions and the following disclaimer +# in the documentation and/or other materials provided with the +# distribution. +# * Neither the name of Google Inc. nor the names of its +# contributors may be used to endorse or promote products derived from +# this software without specific prior written permission. +# +# THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +# "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +# LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +# A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +# OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +# SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +# LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +# DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +# THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +# (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +# OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +install: + go install + +test: install generate-test-pbs + go test + + +generate-test-pbs: + make install + make -C test_proto + make -C proto3_proto + make diff --git a/vendor/github.com/gogo/protobuf/proto/clone.go b/vendor/github.com/gogo/protobuf/proto/clone.go new file mode 100644 index 00000000..a26b046d --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/clone.go @@ -0,0 +1,258 @@ +// Go support for Protocol Buffers - Google's data interchange format +// +// Copyright 2011 The Go Authors. All rights reserved. +// https://github.com/golang/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// * Neither the name of Google Inc. nor the names of its +// contributors may be used to endorse or promote products derived from +// this software without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +// Protocol buffer deep copy and merge. +// TODO: RawMessage. + +package proto + +import ( + "fmt" + "log" + "reflect" + "strings" +) + +// Clone returns a deep copy of a protocol buffer. +func Clone(src Message) Message { + in := reflect.ValueOf(src) + if in.IsNil() { + return src + } + out := reflect.New(in.Type().Elem()) + dst := out.Interface().(Message) + Merge(dst, src) + return dst +} + +// Merger is the interface representing objects that can merge messages of the same type. +type Merger interface { + // Merge merges src into this message. + // Required and optional fields that are set in src will be set to that value in dst. + // Elements of repeated fields will be appended. + // + // Merge may panic if called with a different argument type than the receiver. + Merge(src Message) +} + +// generatedMerger is the custom merge method that generated protos will have. +// We must add this method since a generate Merge method will conflict with +// many existing protos that have a Merge data field already defined. +type generatedMerger interface { + XXX_Merge(src Message) +} + +// Merge merges src into dst. +// Required and optional fields that are set in src will be set to that value in dst. +// Elements of repeated fields will be appended. +// Merge panics if src and dst are not the same type, or if dst is nil. +func Merge(dst, src Message) { + if m, ok := dst.(Merger); ok { + m.Merge(src) + return + } + + in := reflect.ValueOf(src) + out := reflect.ValueOf(dst) + if out.IsNil() { + panic("proto: nil destination") + } + if in.Type() != out.Type() { + panic(fmt.Sprintf("proto.Merge(%T, %T) type mismatch", dst, src)) + } + if in.IsNil() { + return // Merge from nil src is a noop + } + if m, ok := dst.(generatedMerger); ok { + m.XXX_Merge(src) + return + } + mergeStruct(out.Elem(), in.Elem()) +} + +func mergeStruct(out, in reflect.Value) { + sprop := GetProperties(in.Type()) + for i := 0; i < in.NumField(); i++ { + f := in.Type().Field(i) + if strings.HasPrefix(f.Name, "XXX_") { + continue + } + mergeAny(out.Field(i), in.Field(i), false, sprop.Prop[i]) + } + + if emIn, ok := in.Addr().Interface().(extensionsBytes); ok { + emOut := out.Addr().Interface().(extensionsBytes) + bIn := emIn.GetExtensions() + bOut := emOut.GetExtensions() + *bOut = append(*bOut, *bIn...) + } else if emIn, err := extendable(in.Addr().Interface()); err == nil { + emOut, _ := extendable(out.Addr().Interface()) + mIn, muIn := emIn.extensionsRead() + if mIn != nil { + mOut := emOut.extensionsWrite() + muIn.Lock() + mergeExtension(mOut, mIn) + muIn.Unlock() + } + } + + uf := in.FieldByName("XXX_unrecognized") + if !uf.IsValid() { + return + } + uin := uf.Bytes() + if len(uin) > 0 { + out.FieldByName("XXX_unrecognized").SetBytes(append([]byte(nil), uin...)) + } +} + +// mergeAny performs a merge between two values of the same type. +// viaPtr indicates whether the values were indirected through a pointer (implying proto2). +// prop is set if this is a struct field (it may be nil). +func mergeAny(out, in reflect.Value, viaPtr bool, prop *Properties) { + if in.Type() == protoMessageType { + if !in.IsNil() { + if out.IsNil() { + out.Set(reflect.ValueOf(Clone(in.Interface().(Message)))) + } else { + Merge(out.Interface().(Message), in.Interface().(Message)) + } + } + return + } + switch in.Kind() { + case reflect.Bool, reflect.Float32, reflect.Float64, reflect.Int32, reflect.Int64, + reflect.String, reflect.Uint32, reflect.Uint64: + if !viaPtr && isProto3Zero(in) { + return + } + out.Set(in) + case reflect.Interface: + // Probably a oneof field; copy non-nil values. + if in.IsNil() { + return + } + // Allocate destination if it is not set, or set to a different type. + // Otherwise we will merge as normal. + if out.IsNil() || out.Elem().Type() != in.Elem().Type() { + out.Set(reflect.New(in.Elem().Elem().Type())) // interface -> *T -> T -> new(T) + } + mergeAny(out.Elem(), in.Elem(), false, nil) + case reflect.Map: + if in.Len() == 0 { + return + } + if out.IsNil() { + out.Set(reflect.MakeMap(in.Type())) + } + // For maps with value types of *T or []byte we need to deep copy each value. + elemKind := in.Type().Elem().Kind() + for _, key := range in.MapKeys() { + var val reflect.Value + switch elemKind { + case reflect.Ptr: + val = reflect.New(in.Type().Elem().Elem()) + mergeAny(val, in.MapIndex(key), false, nil) + case reflect.Slice: + val = in.MapIndex(key) + val = reflect.ValueOf(append([]byte{}, val.Bytes()...)) + default: + val = in.MapIndex(key) + } + out.SetMapIndex(key, val) + } + case reflect.Ptr: + if in.IsNil() { + return + } + if out.IsNil() { + out.Set(reflect.New(in.Elem().Type())) + } + mergeAny(out.Elem(), in.Elem(), true, nil) + case reflect.Slice: + if in.IsNil() { + return + } + if in.Type().Elem().Kind() == reflect.Uint8 { + // []byte is a scalar bytes field, not a repeated field. + + // Edge case: if this is in a proto3 message, a zero length + // bytes field is considered the zero value, and should not + // be merged. + if prop != nil && prop.proto3 && in.Len() == 0 { + return + } + + // Make a deep copy. + // Append to []byte{} instead of []byte(nil) so that we never end up + // with a nil result. + out.SetBytes(append([]byte{}, in.Bytes()...)) + return + } + n := in.Len() + if out.IsNil() { + out.Set(reflect.MakeSlice(in.Type(), 0, n)) + } + switch in.Type().Elem().Kind() { + case reflect.Bool, reflect.Float32, reflect.Float64, reflect.Int32, reflect.Int64, + reflect.String, reflect.Uint32, reflect.Uint64: + out.Set(reflect.AppendSlice(out, in)) + default: + for i := 0; i < n; i++ { + x := reflect.Indirect(reflect.New(in.Type().Elem())) + mergeAny(x, in.Index(i), false, nil) + out.Set(reflect.Append(out, x)) + } + } + case reflect.Struct: + mergeStruct(out, in) + default: + // unknown type, so not a protocol buffer + log.Printf("proto: don't know how to copy %v", in) + } +} + +func mergeExtension(out, in map[int32]Extension) { + for extNum, eIn := range in { + eOut := Extension{desc: eIn.desc} + if eIn.value != nil { + v := reflect.New(reflect.TypeOf(eIn.value)).Elem() + mergeAny(v, reflect.ValueOf(eIn.value), false, nil) + eOut.value = v.Interface() + } + if eIn.enc != nil { + eOut.enc = make([]byte, len(eIn.enc)) + copy(eOut.enc, eIn.enc) + } + + out[extNum] = eOut + } +} diff --git a/vendor/github.com/gogo/protobuf/proto/custom_gogo.go b/vendor/github.com/gogo/protobuf/proto/custom_gogo.go new file mode 100644 index 00000000..24552483 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/custom_gogo.go @@ -0,0 +1,39 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2018, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package proto + +import "reflect" + +type custom interface { + Marshal() ([]byte, error) + Unmarshal(data []byte) error + Size() int +} + +var customType = reflect.TypeOf((*custom)(nil)).Elem() diff --git a/vendor/github.com/gogo/protobuf/proto/decode.go b/vendor/github.com/gogo/protobuf/proto/decode.go new file mode 100644 index 00000000..63b0f08b --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/decode.go @@ -0,0 +1,427 @@ +// Go support for Protocol Buffers - Google's data interchange format +// +// Copyright 2010 The Go Authors. All rights reserved. +// https://github.com/golang/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// * Neither the name of Google Inc. nor the names of its +// contributors may be used to endorse or promote products derived from +// this software without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package proto + +/* + * Routines for decoding protocol buffer data to construct in-memory representations. + */ + +import ( + "errors" + "fmt" + "io" +) + +// errOverflow is returned when an integer is too large to be represented. +var errOverflow = errors.New("proto: integer overflow") + +// ErrInternalBadWireType is returned by generated code when an incorrect +// wire type is encountered. It does not get returned to user code. +var ErrInternalBadWireType = errors.New("proto: internal error: bad wiretype for oneof") + +// DecodeVarint reads a varint-encoded integer from the slice. +// It returns the integer and the number of bytes consumed, or +// zero if there is not enough. +// This is the format for the +// int32, int64, uint32, uint64, bool, and enum +// protocol buffer types. +func DecodeVarint(buf []byte) (x uint64, n int) { + for shift := uint(0); shift < 64; shift += 7 { + if n >= len(buf) { + return 0, 0 + } + b := uint64(buf[n]) + n++ + x |= (b & 0x7F) << shift + if (b & 0x80) == 0 { + return x, n + } + } + + // The number is too large to represent in a 64-bit value. + return 0, 0 +} + +func (p *Buffer) decodeVarintSlow() (x uint64, err error) { + i := p.index + l := len(p.buf) + + for shift := uint(0); shift < 64; shift += 7 { + if i >= l { + err = io.ErrUnexpectedEOF + return + } + b := p.buf[i] + i++ + x |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + p.index = i + return + } + } + + // The number is too large to represent in a 64-bit value. + err = errOverflow + return +} + +// DecodeVarint reads a varint-encoded integer from the Buffer. +// This is the format for the +// int32, int64, uint32, uint64, bool, and enum +// protocol buffer types. +func (p *Buffer) DecodeVarint() (x uint64, err error) { + i := p.index + buf := p.buf + + if i >= len(buf) { + return 0, io.ErrUnexpectedEOF + } else if buf[i] < 0x80 { + p.index++ + return uint64(buf[i]), nil + } else if len(buf)-i < 10 { + return p.decodeVarintSlow() + } + + var b uint64 + // we already checked the first byte + x = uint64(buf[i]) - 0x80 + i++ + + b = uint64(buf[i]) + i++ + x += b << 7 + if b&0x80 == 0 { + goto done + } + x -= 0x80 << 7 + + b = uint64(buf[i]) + i++ + x += b << 14 + if b&0x80 == 0 { + goto done + } + x -= 0x80 << 14 + + b = uint64(buf[i]) + i++ + x += b << 21 + if b&0x80 == 0 { + goto done + } + x -= 0x80 << 21 + + b = uint64(buf[i]) + i++ + x += b << 28 + if b&0x80 == 0 { + goto done + } + x -= 0x80 << 28 + + b = uint64(buf[i]) + i++ + x += b << 35 + if b&0x80 == 0 { + goto done + } + x -= 0x80 << 35 + + b = uint64(buf[i]) + i++ + x += b << 42 + if b&0x80 == 0 { + goto done + } + x -= 0x80 << 42 + + b = uint64(buf[i]) + i++ + x += b << 49 + if b&0x80 == 0 { + goto done + } + x -= 0x80 << 49 + + b = uint64(buf[i]) + i++ + x += b << 56 + if b&0x80 == 0 { + goto done + } + x -= 0x80 << 56 + + b = uint64(buf[i]) + i++ + x += b << 63 + if b&0x80 == 0 { + goto done + } + + return 0, errOverflow + +done: + p.index = i + return x, nil +} + +// DecodeFixed64 reads a 64-bit integer from the Buffer. +// This is the format for the +// fixed64, sfixed64, and double protocol buffer types. +func (p *Buffer) DecodeFixed64() (x uint64, err error) { + // x, err already 0 + i := p.index + 8 + if i < 0 || i > len(p.buf) { + err = io.ErrUnexpectedEOF + return + } + p.index = i + + x = uint64(p.buf[i-8]) + x |= uint64(p.buf[i-7]) << 8 + x |= uint64(p.buf[i-6]) << 16 + x |= uint64(p.buf[i-5]) << 24 + x |= uint64(p.buf[i-4]) << 32 + x |= uint64(p.buf[i-3]) << 40 + x |= uint64(p.buf[i-2]) << 48 + x |= uint64(p.buf[i-1]) << 56 + return +} + +// DecodeFixed32 reads a 32-bit integer from the Buffer. +// This is the format for the +// fixed32, sfixed32, and float protocol buffer types. +func (p *Buffer) DecodeFixed32() (x uint64, err error) { + // x, err already 0 + i := p.index + 4 + if i < 0 || i > len(p.buf) { + err = io.ErrUnexpectedEOF + return + } + p.index = i + + x = uint64(p.buf[i-4]) + x |= uint64(p.buf[i-3]) << 8 + x |= uint64(p.buf[i-2]) << 16 + x |= uint64(p.buf[i-1]) << 24 + return +} + +// DecodeZigzag64 reads a zigzag-encoded 64-bit integer +// from the Buffer. +// This is the format used for the sint64 protocol buffer type. +func (p *Buffer) DecodeZigzag64() (x uint64, err error) { + x, err = p.DecodeVarint() + if err != nil { + return + } + x = (x >> 1) ^ uint64((int64(x&1)<<63)>>63) + return +} + +// DecodeZigzag32 reads a zigzag-encoded 32-bit integer +// from the Buffer. +// This is the format used for the sint32 protocol buffer type. +func (p *Buffer) DecodeZigzag32() (x uint64, err error) { + x, err = p.DecodeVarint() + if err != nil { + return + } + x = uint64((uint32(x) >> 1) ^ uint32((int32(x&1)<<31)>>31)) + return +} + +// DecodeRawBytes reads a count-delimited byte buffer from the Buffer. +// This is the format used for the bytes protocol buffer +// type and for embedded messages. +func (p *Buffer) DecodeRawBytes(alloc bool) (buf []byte, err error) { + n, err := p.DecodeVarint() + if err != nil { + return nil, err + } + + nb := int(n) + if nb < 0 { + return nil, fmt.Errorf("proto: bad byte length %d", nb) + } + end := p.index + nb + if end < p.index || end > len(p.buf) { + return nil, io.ErrUnexpectedEOF + } + + if !alloc { + // todo: check if can get more uses of alloc=false + buf = p.buf[p.index:end] + p.index += nb + return + } + + buf = make([]byte, nb) + copy(buf, p.buf[p.index:]) + p.index += nb + return +} + +// DecodeStringBytes reads an encoded string from the Buffer. +// This is the format used for the proto2 string type. +func (p *Buffer) DecodeStringBytes() (s string, err error) { + buf, err := p.DecodeRawBytes(false) + if err != nil { + return + } + return string(buf), nil +} + +// Unmarshaler is the interface representing objects that can +// unmarshal themselves. The argument points to data that may be +// overwritten, so implementations should not keep references to the +// buffer. +// Unmarshal implementations should not clear the receiver. +// Any unmarshaled data should be merged into the receiver. +// Callers of Unmarshal that do not want to retain existing data +// should Reset the receiver before calling Unmarshal. +type Unmarshaler interface { + Unmarshal([]byte) error +} + +// newUnmarshaler is the interface representing objects that can +// unmarshal themselves. The semantics are identical to Unmarshaler. +// +// This exists to support protoc-gen-go generated messages. +// The proto package will stop type-asserting to this interface in the future. +// +// DO NOT DEPEND ON THIS. +type newUnmarshaler interface { + XXX_Unmarshal([]byte) error +} + +// Unmarshal parses the protocol buffer representation in buf and places the +// decoded result in pb. If the struct underlying pb does not match +// the data in buf, the results can be unpredictable. +// +// Unmarshal resets pb before starting to unmarshal, so any +// existing data in pb is always removed. Use UnmarshalMerge +// to preserve and append to existing data. +func Unmarshal(buf []byte, pb Message) error { + pb.Reset() + if u, ok := pb.(newUnmarshaler); ok { + return u.XXX_Unmarshal(buf) + } + if u, ok := pb.(Unmarshaler); ok { + return u.Unmarshal(buf) + } + return NewBuffer(buf).Unmarshal(pb) +} + +// UnmarshalMerge parses the protocol buffer representation in buf and +// writes the decoded result to pb. If the struct underlying pb does not match +// the data in buf, the results can be unpredictable. +// +// UnmarshalMerge merges into existing data in pb. +// Most code should use Unmarshal instead. +func UnmarshalMerge(buf []byte, pb Message) error { + if u, ok := pb.(newUnmarshaler); ok { + return u.XXX_Unmarshal(buf) + } + if u, ok := pb.(Unmarshaler); ok { + // NOTE: The history of proto have unfortunately been inconsistent + // whether Unmarshaler should or should not implicitly clear itself. + // Some implementations do, most do not. + // Thus, calling this here may or may not do what people want. + // + // See https://github.com/golang/protobuf/issues/424 + return u.Unmarshal(buf) + } + return NewBuffer(buf).Unmarshal(pb) +} + +// DecodeMessage reads a count-delimited message from the Buffer. +func (p *Buffer) DecodeMessage(pb Message) error { + enc, err := p.DecodeRawBytes(false) + if err != nil { + return err + } + return NewBuffer(enc).Unmarshal(pb) +} + +// DecodeGroup reads a tag-delimited group from the Buffer. +// StartGroup tag is already consumed. This function consumes +// EndGroup tag. +func (p *Buffer) DecodeGroup(pb Message) error { + b := p.buf[p.index:] + x, y := findEndGroup(b) + if x < 0 { + return io.ErrUnexpectedEOF + } + err := Unmarshal(b[:x], pb) + p.index += y + return err +} + +// Unmarshal parses the protocol buffer representation in the +// Buffer and places the decoded result in pb. If the struct +// underlying pb does not match the data in the buffer, the results can be +// unpredictable. +// +// Unlike proto.Unmarshal, this does not reset pb before starting to unmarshal. +func (p *Buffer) Unmarshal(pb Message) error { + // If the object can unmarshal itself, let it. + if u, ok := pb.(newUnmarshaler); ok { + err := u.XXX_Unmarshal(p.buf[p.index:]) + p.index = len(p.buf) + return err + } + if u, ok := pb.(Unmarshaler); ok { + // NOTE: The history of proto have unfortunately been inconsistent + // whether Unmarshaler should or should not implicitly clear itself. + // Some implementations do, most do not. + // Thus, calling this here may or may not do what people want. + // + // See https://github.com/golang/protobuf/issues/424 + err := u.Unmarshal(p.buf[p.index:]) + p.index = len(p.buf) + return err + } + + // Slow workaround for messages that aren't Unmarshalers. + // This includes some hand-coded .pb.go files and + // bootstrap protos. + // TODO: fix all of those and then add Unmarshal to + // the Message interface. Then: + // The cast above and code below can be deleted. + // The old unmarshaler can be deleted. + // Clients can call Unmarshal directly (can already do that, actually). + var info InternalMessageInfo + err := info.Unmarshal(pb, p.buf[p.index:]) + p.index = len(p.buf) + return err +} diff --git a/vendor/github.com/gogo/protobuf/proto/deprecated.go b/vendor/github.com/gogo/protobuf/proto/deprecated.go new file mode 100644 index 00000000..35b882c0 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/deprecated.go @@ -0,0 +1,63 @@ +// Go support for Protocol Buffers - Google's data interchange format +// +// Copyright 2018 The Go Authors. All rights reserved. +// https://github.com/golang/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// * Neither the name of Google Inc. nor the names of its +// contributors may be used to endorse or promote products derived from +// this software without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package proto + +import "errors" + +// Deprecated: do not use. +type Stats struct{ Emalloc, Dmalloc, Encode, Decode, Chit, Cmiss, Size uint64 } + +// Deprecated: do not use. +func GetStats() Stats { return Stats{} } + +// Deprecated: do not use. +func MarshalMessageSet(interface{}) ([]byte, error) { + return nil, errors.New("proto: not implemented") +} + +// Deprecated: do not use. +func UnmarshalMessageSet([]byte, interface{}) error { + return errors.New("proto: not implemented") +} + +// Deprecated: do not use. +func MarshalMessageSetJSON(interface{}) ([]byte, error) { + return nil, errors.New("proto: not implemented") +} + +// Deprecated: do not use. +func UnmarshalMessageSetJSON([]byte, interface{}) error { + return errors.New("proto: not implemented") +} + +// Deprecated: do not use. +func RegisterMessageSetType(Message, int32, string) {} diff --git a/vendor/github.com/gogo/protobuf/proto/discard.go b/vendor/github.com/gogo/protobuf/proto/discard.go new file mode 100644 index 00000000..fe1bd7d9 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/discard.go @@ -0,0 +1,350 @@ +// Go support for Protocol Buffers - Google's data interchange format +// +// Copyright 2017 The Go Authors. All rights reserved. +// https://github.com/golang/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// * Neither the name of Google Inc. nor the names of its +// contributors may be used to endorse or promote products derived from +// this software without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package proto + +import ( + "fmt" + "reflect" + "strings" + "sync" + "sync/atomic" +) + +type generatedDiscarder interface { + XXX_DiscardUnknown() +} + +// DiscardUnknown recursively discards all unknown fields from this message +// and all embedded messages. +// +// When unmarshaling a message with unrecognized fields, the tags and values +// of such fields are preserved in the Message. This allows a later call to +// marshal to be able to produce a message that continues to have those +// unrecognized fields. To avoid this, DiscardUnknown is used to +// explicitly clear the unknown fields after unmarshaling. +// +// For proto2 messages, the unknown fields of message extensions are only +// discarded from messages that have been accessed via GetExtension. +func DiscardUnknown(m Message) { + if m, ok := m.(generatedDiscarder); ok { + m.XXX_DiscardUnknown() + return + } + // TODO: Dynamically populate a InternalMessageInfo for legacy messages, + // but the master branch has no implementation for InternalMessageInfo, + // so it would be more work to replicate that approach. + discardLegacy(m) +} + +// DiscardUnknown recursively discards all unknown fields. +func (a *InternalMessageInfo) DiscardUnknown(m Message) { + di := atomicLoadDiscardInfo(&a.discard) + if di == nil { + di = getDiscardInfo(reflect.TypeOf(m).Elem()) + atomicStoreDiscardInfo(&a.discard, di) + } + di.discard(toPointer(&m)) +} + +type discardInfo struct { + typ reflect.Type + + initialized int32 // 0: only typ is valid, 1: everything is valid + lock sync.Mutex + + fields []discardFieldInfo + unrecognized field +} + +type discardFieldInfo struct { + field field // Offset of field, guaranteed to be valid + discard func(src pointer) +} + +var ( + discardInfoMap = map[reflect.Type]*discardInfo{} + discardInfoLock sync.Mutex +) + +func getDiscardInfo(t reflect.Type) *discardInfo { + discardInfoLock.Lock() + defer discardInfoLock.Unlock() + di := discardInfoMap[t] + if di == nil { + di = &discardInfo{typ: t} + discardInfoMap[t] = di + } + return di +} + +func (di *discardInfo) discard(src pointer) { + if src.isNil() { + return // Nothing to do. + } + + if atomic.LoadInt32(&di.initialized) == 0 { + di.computeDiscardInfo() + } + + for _, fi := range di.fields { + sfp := src.offset(fi.field) + fi.discard(sfp) + } + + // For proto2 messages, only discard unknown fields in message extensions + // that have been accessed via GetExtension. + if em, err := extendable(src.asPointerTo(di.typ).Interface()); err == nil { + // Ignore lock since DiscardUnknown is not concurrency safe. + emm, _ := em.extensionsRead() + for _, mx := range emm { + if m, ok := mx.value.(Message); ok { + DiscardUnknown(m) + } + } + } + + if di.unrecognized.IsValid() { + *src.offset(di.unrecognized).toBytes() = nil + } +} + +func (di *discardInfo) computeDiscardInfo() { + di.lock.Lock() + defer di.lock.Unlock() + if di.initialized != 0 { + return + } + t := di.typ + n := t.NumField() + + for i := 0; i < n; i++ { + f := t.Field(i) + if strings.HasPrefix(f.Name, "XXX_") { + continue + } + + dfi := discardFieldInfo{field: toField(&f)} + tf := f.Type + + // Unwrap tf to get its most basic type. + var isPointer, isSlice bool + if tf.Kind() == reflect.Slice && tf.Elem().Kind() != reflect.Uint8 { + isSlice = true + tf = tf.Elem() + } + if tf.Kind() == reflect.Ptr { + isPointer = true + tf = tf.Elem() + } + if isPointer && isSlice && tf.Kind() != reflect.Struct { + panic(fmt.Sprintf("%v.%s cannot be a slice of pointers to primitive types", t, f.Name)) + } + + switch tf.Kind() { + case reflect.Struct: + switch { + case !isPointer: + panic(fmt.Sprintf("%v.%s cannot be a direct struct value", t, f.Name)) + case isSlice: // E.g., []*pb.T + discardInfo := getDiscardInfo(tf) + dfi.discard = func(src pointer) { + sps := src.getPointerSlice() + for _, sp := range sps { + if !sp.isNil() { + discardInfo.discard(sp) + } + } + } + default: // E.g., *pb.T + discardInfo := getDiscardInfo(tf) + dfi.discard = func(src pointer) { + sp := src.getPointer() + if !sp.isNil() { + discardInfo.discard(sp) + } + } + } + case reflect.Map: + switch { + case isPointer || isSlice: + panic(fmt.Sprintf("%v.%s cannot be a pointer to a map or a slice of map values", t, f.Name)) + default: // E.g., map[K]V + if tf.Elem().Kind() == reflect.Ptr { // Proto struct (e.g., *T) + dfi.discard = func(src pointer) { + sm := src.asPointerTo(tf).Elem() + if sm.Len() == 0 { + return + } + for _, key := range sm.MapKeys() { + val := sm.MapIndex(key) + DiscardUnknown(val.Interface().(Message)) + } + } + } else { + dfi.discard = func(pointer) {} // Noop + } + } + case reflect.Interface: + // Must be oneof field. + switch { + case isPointer || isSlice: + panic(fmt.Sprintf("%v.%s cannot be a pointer to a interface or a slice of interface values", t, f.Name)) + default: // E.g., interface{} + // TODO: Make this faster? + dfi.discard = func(src pointer) { + su := src.asPointerTo(tf).Elem() + if !su.IsNil() { + sv := su.Elem().Elem().Field(0) + if sv.Kind() == reflect.Ptr && sv.IsNil() { + return + } + switch sv.Type().Kind() { + case reflect.Ptr: // Proto struct (e.g., *T) + DiscardUnknown(sv.Interface().(Message)) + } + } + } + } + default: + continue + } + di.fields = append(di.fields, dfi) + } + + di.unrecognized = invalidField + if f, ok := t.FieldByName("XXX_unrecognized"); ok { + if f.Type != reflect.TypeOf([]byte{}) { + panic("expected XXX_unrecognized to be of type []byte") + } + di.unrecognized = toField(&f) + } + + atomic.StoreInt32(&di.initialized, 1) +} + +func discardLegacy(m Message) { + v := reflect.ValueOf(m) + if v.Kind() != reflect.Ptr || v.IsNil() { + return + } + v = v.Elem() + if v.Kind() != reflect.Struct { + return + } + t := v.Type() + + for i := 0; i < v.NumField(); i++ { + f := t.Field(i) + if strings.HasPrefix(f.Name, "XXX_") { + continue + } + vf := v.Field(i) + tf := f.Type + + // Unwrap tf to get its most basic type. + var isPointer, isSlice bool + if tf.Kind() == reflect.Slice && tf.Elem().Kind() != reflect.Uint8 { + isSlice = true + tf = tf.Elem() + } + if tf.Kind() == reflect.Ptr { + isPointer = true + tf = tf.Elem() + } + if isPointer && isSlice && tf.Kind() != reflect.Struct { + panic(fmt.Sprintf("%T.%s cannot be a slice of pointers to primitive types", m, f.Name)) + } + + switch tf.Kind() { + case reflect.Struct: + switch { + case !isPointer: + panic(fmt.Sprintf("%T.%s cannot be a direct struct value", m, f.Name)) + case isSlice: // E.g., []*pb.T + for j := 0; j < vf.Len(); j++ { + discardLegacy(vf.Index(j).Interface().(Message)) + } + default: // E.g., *pb.T + discardLegacy(vf.Interface().(Message)) + } + case reflect.Map: + switch { + case isPointer || isSlice: + panic(fmt.Sprintf("%T.%s cannot be a pointer to a map or a slice of map values", m, f.Name)) + default: // E.g., map[K]V + tv := vf.Type().Elem() + if tv.Kind() == reflect.Ptr && tv.Implements(protoMessageType) { // Proto struct (e.g., *T) + for _, key := range vf.MapKeys() { + val := vf.MapIndex(key) + discardLegacy(val.Interface().(Message)) + } + } + } + case reflect.Interface: + // Must be oneof field. + switch { + case isPointer || isSlice: + panic(fmt.Sprintf("%T.%s cannot be a pointer to a interface or a slice of interface values", m, f.Name)) + default: // E.g., test_proto.isCommunique_Union interface + if !vf.IsNil() && f.Tag.Get("protobuf_oneof") != "" { + vf = vf.Elem() // E.g., *test_proto.Communique_Msg + if !vf.IsNil() { + vf = vf.Elem() // E.g., test_proto.Communique_Msg + vf = vf.Field(0) // E.g., Proto struct (e.g., *T) or primitive value + if vf.Kind() == reflect.Ptr { + discardLegacy(vf.Interface().(Message)) + } + } + } + } + } + } + + if vf := v.FieldByName("XXX_unrecognized"); vf.IsValid() { + if vf.Type() != reflect.TypeOf([]byte{}) { + panic("expected XXX_unrecognized to be of type []byte") + } + vf.Set(reflect.ValueOf([]byte(nil))) + } + + // For proto2 messages, only discard unknown fields in message extensions + // that have been accessed via GetExtension. + if em, err := extendable(m); err == nil { + // Ignore lock since discardLegacy is not concurrency safe. + emm, _ := em.extensionsRead() + for _, mx := range emm { + if m, ok := mx.value.(Message); ok { + discardLegacy(m) + } + } + } +} diff --git a/vendor/github.com/gogo/protobuf/proto/duration.go b/vendor/github.com/gogo/protobuf/proto/duration.go new file mode 100644 index 00000000..93464c91 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/duration.go @@ -0,0 +1,100 @@ +// Go support for Protocol Buffers - Google's data interchange format +// +// Copyright 2016 The Go Authors. All rights reserved. +// https://github.com/golang/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// * Neither the name of Google Inc. nor the names of its +// contributors may be used to endorse or promote products derived from +// this software without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package proto + +// This file implements conversions between google.protobuf.Duration +// and time.Duration. + +import ( + "errors" + "fmt" + "time" +) + +const ( + // Range of a Duration in seconds, as specified in + // google/protobuf/duration.proto. This is about 10,000 years in seconds. + maxSeconds = int64(10000 * 365.25 * 24 * 60 * 60) + minSeconds = -maxSeconds +) + +// validateDuration determines whether the Duration is valid according to the +// definition in google/protobuf/duration.proto. A valid Duration +// may still be too large to fit into a time.Duration (the range of Duration +// is about 10,000 years, and the range of time.Duration is about 290). +func validateDuration(d *duration) error { + if d == nil { + return errors.New("duration: nil Duration") + } + if d.Seconds < minSeconds || d.Seconds > maxSeconds { + return fmt.Errorf("duration: %#v: seconds out of range", d) + } + if d.Nanos <= -1e9 || d.Nanos >= 1e9 { + return fmt.Errorf("duration: %#v: nanos out of range", d) + } + // Seconds and Nanos must have the same sign, unless d.Nanos is zero. + if (d.Seconds < 0 && d.Nanos > 0) || (d.Seconds > 0 && d.Nanos < 0) { + return fmt.Errorf("duration: %#v: seconds and nanos have different signs", d) + } + return nil +} + +// DurationFromProto converts a Duration to a time.Duration. DurationFromProto +// returns an error if the Duration is invalid or is too large to be +// represented in a time.Duration. +func durationFromProto(p *duration) (time.Duration, error) { + if err := validateDuration(p); err != nil { + return 0, err + } + d := time.Duration(p.Seconds) * time.Second + if int64(d/time.Second) != p.Seconds { + return 0, fmt.Errorf("duration: %#v is out of range for time.Duration", p) + } + if p.Nanos != 0 { + d += time.Duration(p.Nanos) + if (d < 0) != (p.Nanos < 0) { + return 0, fmt.Errorf("duration: %#v is out of range for time.Duration", p) + } + } + return d, nil +} + +// DurationProto converts a time.Duration to a Duration. +func durationProto(d time.Duration) *duration { + nanos := d.Nanoseconds() + secs := nanos / 1e9 + nanos -= secs * 1e9 + return &duration{ + Seconds: secs, + Nanos: int32(nanos), + } +} diff --git a/vendor/github.com/gogo/protobuf/proto/duration_gogo.go b/vendor/github.com/gogo/protobuf/proto/duration_gogo.go new file mode 100644 index 00000000..e748e173 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/duration_gogo.go @@ -0,0 +1,49 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2016, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package proto + +import ( + "reflect" + "time" +) + +var durationType = reflect.TypeOf((*time.Duration)(nil)).Elem() + +type duration struct { + Seconds int64 `protobuf:"varint,1,opt,name=seconds,proto3" json:"seconds,omitempty"` + Nanos int32 `protobuf:"varint,2,opt,name=nanos,proto3" json:"nanos,omitempty"` +} + +func (m *duration) Reset() { *m = duration{} } +func (*duration) ProtoMessage() {} +func (*duration) String() string { return "duration" } + +func init() { + RegisterType((*duration)(nil), "gogo.protobuf.proto.duration") +} diff --git a/vendor/github.com/gogo/protobuf/proto/encode.go b/vendor/github.com/gogo/protobuf/proto/encode.go new file mode 100644 index 00000000..9581ccd3 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/encode.go @@ -0,0 +1,205 @@ +// Go support for Protocol Buffers - Google's data interchange format +// +// Copyright 2010 The Go Authors. All rights reserved. +// https://github.com/golang/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// * Neither the name of Google Inc. nor the names of its +// contributors may be used to endorse or promote products derived from +// this software without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package proto + +/* + * Routines for encoding data into the wire format for protocol buffers. + */ + +import ( + "errors" + "reflect" +) + +var ( + // errRepeatedHasNil is the error returned if Marshal is called with + // a struct with a repeated field containing a nil element. + errRepeatedHasNil = errors.New("proto: repeated field has nil element") + + // errOneofHasNil is the error returned if Marshal is called with + // a struct with a oneof field containing a nil element. + errOneofHasNil = errors.New("proto: oneof field has nil value") + + // ErrNil is the error returned if Marshal is called with nil. + ErrNil = errors.New("proto: Marshal called with nil") + + // ErrTooLarge is the error returned if Marshal is called with a + // message that encodes to >2GB. + ErrTooLarge = errors.New("proto: message encodes to over 2 GB") +) + +// The fundamental encoders that put bytes on the wire. +// Those that take integer types all accept uint64 and are +// therefore of type valueEncoder. + +const maxVarintBytes = 10 // maximum length of a varint + +// EncodeVarint returns the varint encoding of x. +// This is the format for the +// int32, int64, uint32, uint64, bool, and enum +// protocol buffer types. +// Not used by the package itself, but helpful to clients +// wishing to use the same encoding. +func EncodeVarint(x uint64) []byte { + var buf [maxVarintBytes]byte + var n int + for n = 0; x > 127; n++ { + buf[n] = 0x80 | uint8(x&0x7F) + x >>= 7 + } + buf[n] = uint8(x) + n++ + return buf[0:n] +} + +// EncodeVarint writes a varint-encoded integer to the Buffer. +// This is the format for the +// int32, int64, uint32, uint64, bool, and enum +// protocol buffer types. +func (p *Buffer) EncodeVarint(x uint64) error { + for x >= 1<<7 { + p.buf = append(p.buf, uint8(x&0x7f|0x80)) + x >>= 7 + } + p.buf = append(p.buf, uint8(x)) + return nil +} + +// SizeVarint returns the varint encoding size of an integer. +func SizeVarint(x uint64) int { + switch { + case x < 1<<7: + return 1 + case x < 1<<14: + return 2 + case x < 1<<21: + return 3 + case x < 1<<28: + return 4 + case x < 1<<35: + return 5 + case x < 1<<42: + return 6 + case x < 1<<49: + return 7 + case x < 1<<56: + return 8 + case x < 1<<63: + return 9 + } + return 10 +} + +// EncodeFixed64 writes a 64-bit integer to the Buffer. +// This is the format for the +// fixed64, sfixed64, and double protocol buffer types. +func (p *Buffer) EncodeFixed64(x uint64) error { + p.buf = append(p.buf, + uint8(x), + uint8(x>>8), + uint8(x>>16), + uint8(x>>24), + uint8(x>>32), + uint8(x>>40), + uint8(x>>48), + uint8(x>>56)) + return nil +} + +// EncodeFixed32 writes a 32-bit integer to the Buffer. +// This is the format for the +// fixed32, sfixed32, and float protocol buffer types. +func (p *Buffer) EncodeFixed32(x uint64) error { + p.buf = append(p.buf, + uint8(x), + uint8(x>>8), + uint8(x>>16), + uint8(x>>24)) + return nil +} + +// EncodeZigzag64 writes a zigzag-encoded 64-bit integer +// to the Buffer. +// This is the format used for the sint64 protocol buffer type. +func (p *Buffer) EncodeZigzag64(x uint64) error { + // use signed number to get arithmetic right shift. + return p.EncodeVarint(uint64((x << 1) ^ uint64((int64(x) >> 63)))) +} + +// EncodeZigzag32 writes a zigzag-encoded 32-bit integer +// to the Buffer. +// This is the format used for the sint32 protocol buffer type. +func (p *Buffer) EncodeZigzag32(x uint64) error { + // use signed number to get arithmetic right shift. + return p.EncodeVarint(uint64((uint32(x) << 1) ^ uint32((int32(x) >> 31)))) +} + +// EncodeRawBytes writes a count-delimited byte buffer to the Buffer. +// This is the format used for the bytes protocol buffer +// type and for embedded messages. +func (p *Buffer) EncodeRawBytes(b []byte) error { + p.EncodeVarint(uint64(len(b))) + p.buf = append(p.buf, b...) + return nil +} + +// EncodeStringBytes writes an encoded string to the Buffer. +// This is the format used for the proto2 string type. +func (p *Buffer) EncodeStringBytes(s string) error { + p.EncodeVarint(uint64(len(s))) + p.buf = append(p.buf, s...) + return nil +} + +// Marshaler is the interface representing objects that can marshal themselves. +type Marshaler interface { + Marshal() ([]byte, error) +} + +// EncodeMessage writes the protocol buffer to the Buffer, +// prefixed by a varint-encoded length. +func (p *Buffer) EncodeMessage(pb Message) error { + siz := Size(pb) + sizVar := SizeVarint(uint64(siz)) + p.grow(siz + sizVar) + p.EncodeVarint(uint64(siz)) + return p.Marshal(pb) +} + +// All protocol buffer fields are nillable, but be careful. +func isNil(v reflect.Value) bool { + switch v.Kind() { + case reflect.Interface, reflect.Map, reflect.Ptr, reflect.Slice: + return v.IsNil() + } + return false +} diff --git a/vendor/github.com/gogo/protobuf/proto/encode_gogo.go b/vendor/github.com/gogo/protobuf/proto/encode_gogo.go new file mode 100644 index 00000000..0f5fb173 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/encode_gogo.go @@ -0,0 +1,33 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2013, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package proto + +func NewRequiredNotSetError(field string) *RequiredNotSetError { + return &RequiredNotSetError{field} +} diff --git a/vendor/github.com/gogo/protobuf/proto/equal.go b/vendor/github.com/gogo/protobuf/proto/equal.go new file mode 100644 index 00000000..d4db5a1c --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/equal.go @@ -0,0 +1,300 @@ +// Go support for Protocol Buffers - Google's data interchange format +// +// Copyright 2011 The Go Authors. All rights reserved. +// https://github.com/golang/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// * Neither the name of Google Inc. nor the names of its +// contributors may be used to endorse or promote products derived from +// this software without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +// Protocol buffer comparison. + +package proto + +import ( + "bytes" + "log" + "reflect" + "strings" +) + +/* +Equal returns true iff protocol buffers a and b are equal. +The arguments must both be pointers to protocol buffer structs. + +Equality is defined in this way: + - Two messages are equal iff they are the same type, + corresponding fields are equal, unknown field sets + are equal, and extensions sets are equal. + - Two set scalar fields are equal iff their values are equal. + If the fields are of a floating-point type, remember that + NaN != x for all x, including NaN. If the message is defined + in a proto3 .proto file, fields are not "set"; specifically, + zero length proto3 "bytes" fields are equal (nil == {}). + - Two repeated fields are equal iff their lengths are the same, + and their corresponding elements are equal. Note a "bytes" field, + although represented by []byte, is not a repeated field and the + rule for the scalar fields described above applies. + - Two unset fields are equal. + - Two unknown field sets are equal if their current + encoded state is equal. + - Two extension sets are equal iff they have corresponding + elements that are pairwise equal. + - Two map fields are equal iff their lengths are the same, + and they contain the same set of elements. Zero-length map + fields are equal. + - Every other combination of things are not equal. + +The return value is undefined if a and b are not protocol buffers. +*/ +func Equal(a, b Message) bool { + if a == nil || b == nil { + return a == b + } + v1, v2 := reflect.ValueOf(a), reflect.ValueOf(b) + if v1.Type() != v2.Type() { + return false + } + if v1.Kind() == reflect.Ptr { + if v1.IsNil() { + return v2.IsNil() + } + if v2.IsNil() { + return false + } + v1, v2 = v1.Elem(), v2.Elem() + } + if v1.Kind() != reflect.Struct { + return false + } + return equalStruct(v1, v2) +} + +// v1 and v2 are known to have the same type. +func equalStruct(v1, v2 reflect.Value) bool { + sprop := GetProperties(v1.Type()) + for i := 0; i < v1.NumField(); i++ { + f := v1.Type().Field(i) + if strings.HasPrefix(f.Name, "XXX_") { + continue + } + f1, f2 := v1.Field(i), v2.Field(i) + if f.Type.Kind() == reflect.Ptr { + if n1, n2 := f1.IsNil(), f2.IsNil(); n1 && n2 { + // both unset + continue + } else if n1 != n2 { + // set/unset mismatch + return false + } + f1, f2 = f1.Elem(), f2.Elem() + } + if !equalAny(f1, f2, sprop.Prop[i]) { + return false + } + } + + if em1 := v1.FieldByName("XXX_InternalExtensions"); em1.IsValid() { + em2 := v2.FieldByName("XXX_InternalExtensions") + if !equalExtensions(v1.Type(), em1.Interface().(XXX_InternalExtensions), em2.Interface().(XXX_InternalExtensions)) { + return false + } + } + + if em1 := v1.FieldByName("XXX_extensions"); em1.IsValid() { + em2 := v2.FieldByName("XXX_extensions") + if !equalExtMap(v1.Type(), em1.Interface().(map[int32]Extension), em2.Interface().(map[int32]Extension)) { + return false + } + } + + uf := v1.FieldByName("XXX_unrecognized") + if !uf.IsValid() { + return true + } + + u1 := uf.Bytes() + u2 := v2.FieldByName("XXX_unrecognized").Bytes() + return bytes.Equal(u1, u2) +} + +// v1 and v2 are known to have the same type. +// prop may be nil. +func equalAny(v1, v2 reflect.Value, prop *Properties) bool { + if v1.Type() == protoMessageType { + m1, _ := v1.Interface().(Message) + m2, _ := v2.Interface().(Message) + return Equal(m1, m2) + } + switch v1.Kind() { + case reflect.Bool: + return v1.Bool() == v2.Bool() + case reflect.Float32, reflect.Float64: + return v1.Float() == v2.Float() + case reflect.Int32, reflect.Int64: + return v1.Int() == v2.Int() + case reflect.Interface: + // Probably a oneof field; compare the inner values. + n1, n2 := v1.IsNil(), v2.IsNil() + if n1 || n2 { + return n1 == n2 + } + e1, e2 := v1.Elem(), v2.Elem() + if e1.Type() != e2.Type() { + return false + } + return equalAny(e1, e2, nil) + case reflect.Map: + if v1.Len() != v2.Len() { + return false + } + for _, key := range v1.MapKeys() { + val2 := v2.MapIndex(key) + if !val2.IsValid() { + // This key was not found in the second map. + return false + } + if !equalAny(v1.MapIndex(key), val2, nil) { + return false + } + } + return true + case reflect.Ptr: + // Maps may have nil values in them, so check for nil. + if v1.IsNil() && v2.IsNil() { + return true + } + if v1.IsNil() != v2.IsNil() { + return false + } + return equalAny(v1.Elem(), v2.Elem(), prop) + case reflect.Slice: + if v1.Type().Elem().Kind() == reflect.Uint8 { + // short circuit: []byte + + // Edge case: if this is in a proto3 message, a zero length + // bytes field is considered the zero value. + if prop != nil && prop.proto3 && v1.Len() == 0 && v2.Len() == 0 { + return true + } + if v1.IsNil() != v2.IsNil() { + return false + } + return bytes.Equal(v1.Interface().([]byte), v2.Interface().([]byte)) + } + + if v1.Len() != v2.Len() { + return false + } + for i := 0; i < v1.Len(); i++ { + if !equalAny(v1.Index(i), v2.Index(i), prop) { + return false + } + } + return true + case reflect.String: + return v1.Interface().(string) == v2.Interface().(string) + case reflect.Struct: + return equalStruct(v1, v2) + case reflect.Uint32, reflect.Uint64: + return v1.Uint() == v2.Uint() + } + + // unknown type, so not a protocol buffer + log.Printf("proto: don't know how to compare %v", v1) + return false +} + +// base is the struct type that the extensions are based on. +// x1 and x2 are InternalExtensions. +func equalExtensions(base reflect.Type, x1, x2 XXX_InternalExtensions) bool { + em1, _ := x1.extensionsRead() + em2, _ := x2.extensionsRead() + return equalExtMap(base, em1, em2) +} + +func equalExtMap(base reflect.Type, em1, em2 map[int32]Extension) bool { + if len(em1) != len(em2) { + return false + } + + for extNum, e1 := range em1 { + e2, ok := em2[extNum] + if !ok { + return false + } + + m1, m2 := e1.value, e2.value + + if m1 == nil && m2 == nil { + // Both have only encoded form. + if bytes.Equal(e1.enc, e2.enc) { + continue + } + // The bytes are different, but the extensions might still be + // equal. We need to decode them to compare. + } + + if m1 != nil && m2 != nil { + // Both are unencoded. + if !equalAny(reflect.ValueOf(m1), reflect.ValueOf(m2), nil) { + return false + } + continue + } + + // At least one is encoded. To do a semantically correct comparison + // we need to unmarshal them first. + var desc *ExtensionDesc + if m := extensionMaps[base]; m != nil { + desc = m[extNum] + } + if desc == nil { + // If both have only encoded form and the bytes are the same, + // it is handled above. We get here when the bytes are different. + // We don't know how to decode it, so just compare them as byte + // slices. + log.Printf("proto: don't know how to compare extension %d of %v", extNum, base) + return false + } + var err error + if m1 == nil { + m1, err = decodeExtension(e1.enc, desc) + } + if m2 == nil && err == nil { + m2, err = decodeExtension(e2.enc, desc) + } + if err != nil { + // The encoded form is invalid. + log.Printf("proto: badly encoded extension %d of %v: %v", extNum, base, err) + return false + } + if !equalAny(reflect.ValueOf(m1), reflect.ValueOf(m2), nil) { + return false + } + } + + return true +} diff --git a/vendor/github.com/gogo/protobuf/proto/extensions.go b/vendor/github.com/gogo/protobuf/proto/extensions.go new file mode 100644 index 00000000..341c6f57 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/extensions.go @@ -0,0 +1,605 @@ +// Go support for Protocol Buffers - Google's data interchange format +// +// Copyright 2010 The Go Authors. All rights reserved. +// https://github.com/golang/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// * Neither the name of Google Inc. nor the names of its +// contributors may be used to endorse or promote products derived from +// this software without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package proto + +/* + * Types and routines for supporting protocol buffer extensions. + */ + +import ( + "errors" + "fmt" + "io" + "reflect" + "strconv" + "sync" +) + +// ErrMissingExtension is the error returned by GetExtension if the named extension is not in the message. +var ErrMissingExtension = errors.New("proto: missing extension") + +// ExtensionRange represents a range of message extensions for a protocol buffer. +// Used in code generated by the protocol compiler. +type ExtensionRange struct { + Start, End int32 // both inclusive +} + +// extendableProto is an interface implemented by any protocol buffer generated by the current +// proto compiler that may be extended. +type extendableProto interface { + Message + ExtensionRangeArray() []ExtensionRange + extensionsWrite() map[int32]Extension + extensionsRead() (map[int32]Extension, sync.Locker) +} + +// extendableProtoV1 is an interface implemented by a protocol buffer generated by the previous +// version of the proto compiler that may be extended. +type extendableProtoV1 interface { + Message + ExtensionRangeArray() []ExtensionRange + ExtensionMap() map[int32]Extension +} + +// extensionAdapter is a wrapper around extendableProtoV1 that implements extendableProto. +type extensionAdapter struct { + extendableProtoV1 +} + +func (e extensionAdapter) extensionsWrite() map[int32]Extension { + return e.ExtensionMap() +} + +func (e extensionAdapter) extensionsRead() (map[int32]Extension, sync.Locker) { + return e.ExtensionMap(), notLocker{} +} + +// notLocker is a sync.Locker whose Lock and Unlock methods are nops. +type notLocker struct{} + +func (n notLocker) Lock() {} +func (n notLocker) Unlock() {} + +// extendable returns the extendableProto interface for the given generated proto message. +// If the proto message has the old extension format, it returns a wrapper that implements +// the extendableProto interface. +func extendable(p interface{}) (extendableProto, error) { + switch p := p.(type) { + case extendableProto: + if isNilPtr(p) { + return nil, fmt.Errorf("proto: nil %T is not extendable", p) + } + return p, nil + case extendableProtoV1: + if isNilPtr(p) { + return nil, fmt.Errorf("proto: nil %T is not extendable", p) + } + return extensionAdapter{p}, nil + case extensionsBytes: + return slowExtensionAdapter{p}, nil + } + // Don't allocate a specific error containing %T: + // this is the hot path for Clone and MarshalText. + return nil, errNotExtendable +} + +var errNotExtendable = errors.New("proto: not an extendable proto.Message") + +func isNilPtr(x interface{}) bool { + v := reflect.ValueOf(x) + return v.Kind() == reflect.Ptr && v.IsNil() +} + +// XXX_InternalExtensions is an internal representation of proto extensions. +// +// Each generated message struct type embeds an anonymous XXX_InternalExtensions field, +// thus gaining the unexported 'extensions' method, which can be called only from the proto package. +// +// The methods of XXX_InternalExtensions are not concurrency safe in general, +// but calls to logically read-only methods such as has and get may be executed concurrently. +type XXX_InternalExtensions struct { + // The struct must be indirect so that if a user inadvertently copies a + // generated message and its embedded XXX_InternalExtensions, they + // avoid the mayhem of a copied mutex. + // + // The mutex serializes all logically read-only operations to p.extensionMap. + // It is up to the client to ensure that write operations to p.extensionMap are + // mutually exclusive with other accesses. + p *struct { + mu sync.Mutex + extensionMap map[int32]Extension + } +} + +// extensionsWrite returns the extension map, creating it on first use. +func (e *XXX_InternalExtensions) extensionsWrite() map[int32]Extension { + if e.p == nil { + e.p = new(struct { + mu sync.Mutex + extensionMap map[int32]Extension + }) + e.p.extensionMap = make(map[int32]Extension) + } + return e.p.extensionMap +} + +// extensionsRead returns the extensions map for read-only use. It may be nil. +// The caller must hold the returned mutex's lock when accessing Elements within the map. +func (e *XXX_InternalExtensions) extensionsRead() (map[int32]Extension, sync.Locker) { + if e.p == nil { + return nil, nil + } + return e.p.extensionMap, &e.p.mu +} + +// ExtensionDesc represents an extension specification. +// Used in generated code from the protocol compiler. +type ExtensionDesc struct { + ExtendedType Message // nil pointer to the type that is being extended + ExtensionType interface{} // nil pointer to the extension type + Field int32 // field number + Name string // fully-qualified name of extension, for text formatting + Tag string // protobuf tag style + Filename string // name of the file in which the extension is defined +} + +func (ed *ExtensionDesc) repeated() bool { + t := reflect.TypeOf(ed.ExtensionType) + return t.Kind() == reflect.Slice && t.Elem().Kind() != reflect.Uint8 +} + +// Extension represents an extension in a message. +type Extension struct { + // When an extension is stored in a message using SetExtension + // only desc and value are set. When the message is marshaled + // enc will be set to the encoded form of the message. + // + // When a message is unmarshaled and contains extensions, each + // extension will have only enc set. When such an extension is + // accessed using GetExtension (or GetExtensions) desc and value + // will be set. + desc *ExtensionDesc + value interface{} + enc []byte +} + +// SetRawExtension is for testing only. +func SetRawExtension(base Message, id int32, b []byte) { + if ebase, ok := base.(extensionsBytes); ok { + clearExtension(base, id) + ext := ebase.GetExtensions() + *ext = append(*ext, b...) + return + } + epb, err := extendable(base) + if err != nil { + return + } + extmap := epb.extensionsWrite() + extmap[id] = Extension{enc: b} +} + +// isExtensionField returns true iff the given field number is in an extension range. +func isExtensionField(pb extendableProto, field int32) bool { + for _, er := range pb.ExtensionRangeArray() { + if er.Start <= field && field <= er.End { + return true + } + } + return false +} + +// checkExtensionTypes checks that the given extension is valid for pb. +func checkExtensionTypes(pb extendableProto, extension *ExtensionDesc) error { + var pbi interface{} = pb + // Check the extended type. + if ea, ok := pbi.(extensionAdapter); ok { + pbi = ea.extendableProtoV1 + } + if ea, ok := pbi.(slowExtensionAdapter); ok { + pbi = ea.extensionsBytes + } + if a, b := reflect.TypeOf(pbi), reflect.TypeOf(extension.ExtendedType); a != b { + return fmt.Errorf("proto: bad extended type; %v does not extend %v", b, a) + } + // Check the range. + if !isExtensionField(pb, extension.Field) { + return errors.New("proto: bad extension number; not in declared ranges") + } + return nil +} + +// extPropKey is sufficient to uniquely identify an extension. +type extPropKey struct { + base reflect.Type + field int32 +} + +var extProp = struct { + sync.RWMutex + m map[extPropKey]*Properties +}{ + m: make(map[extPropKey]*Properties), +} + +func extensionProperties(ed *ExtensionDesc) *Properties { + key := extPropKey{base: reflect.TypeOf(ed.ExtendedType), field: ed.Field} + + extProp.RLock() + if prop, ok := extProp.m[key]; ok { + extProp.RUnlock() + return prop + } + extProp.RUnlock() + + extProp.Lock() + defer extProp.Unlock() + // Check again. + if prop, ok := extProp.m[key]; ok { + return prop + } + + prop := new(Properties) + prop.Init(reflect.TypeOf(ed.ExtensionType), "unknown_name", ed.Tag, nil) + extProp.m[key] = prop + return prop +} + +// HasExtension returns whether the given extension is present in pb. +func HasExtension(pb Message, extension *ExtensionDesc) bool { + if epb, doki := pb.(extensionsBytes); doki { + ext := epb.GetExtensions() + buf := *ext + o := 0 + for o < len(buf) { + tag, n := DecodeVarint(buf[o:]) + fieldNum := int32(tag >> 3) + if int32(fieldNum) == extension.Field { + return true + } + wireType := int(tag & 0x7) + o += n + l, err := size(buf[o:], wireType) + if err != nil { + return false + } + o += l + } + return false + } + // TODO: Check types, field numbers, etc.? + epb, err := extendable(pb) + if err != nil { + return false + } + extmap, mu := epb.extensionsRead() + if extmap == nil { + return false + } + mu.Lock() + _, ok := extmap[extension.Field] + mu.Unlock() + return ok +} + +// ClearExtension removes the given extension from pb. +func ClearExtension(pb Message, extension *ExtensionDesc) { + clearExtension(pb, extension.Field) +} + +func clearExtension(pb Message, fieldNum int32) { + if epb, ok := pb.(extensionsBytes); ok { + offset := 0 + for offset != -1 { + offset = deleteExtension(epb, fieldNum, offset) + } + return + } + epb, err := extendable(pb) + if err != nil { + return + } + // TODO: Check types, field numbers, etc.? + extmap := epb.extensionsWrite() + delete(extmap, fieldNum) +} + +// GetExtension retrieves a proto2 extended field from pb. +// +// If the descriptor is type complete (i.e., ExtensionDesc.ExtensionType is non-nil), +// then GetExtension parses the encoded field and returns a Go value of the specified type. +// If the field is not present, then the default value is returned (if one is specified), +// otherwise ErrMissingExtension is reported. +// +// If the descriptor is not type complete (i.e., ExtensionDesc.ExtensionType is nil), +// then GetExtension returns the raw encoded bytes of the field extension. +func GetExtension(pb Message, extension *ExtensionDesc) (interface{}, error) { + if epb, doki := pb.(extensionsBytes); doki { + ext := epb.GetExtensions() + return decodeExtensionFromBytes(extension, *ext) + } + + epb, err := extendable(pb) + if err != nil { + return nil, err + } + + if extension.ExtendedType != nil { + // can only check type if this is a complete descriptor + if cerr := checkExtensionTypes(epb, extension); cerr != nil { + return nil, cerr + } + } + + emap, mu := epb.extensionsRead() + if emap == nil { + return defaultExtensionValue(extension) + } + mu.Lock() + defer mu.Unlock() + e, ok := emap[extension.Field] + if !ok { + // defaultExtensionValue returns the default value or + // ErrMissingExtension if there is no default. + return defaultExtensionValue(extension) + } + + if e.value != nil { + // Already decoded. Check the descriptor, though. + if e.desc != extension { + // This shouldn't happen. If it does, it means that + // GetExtension was called twice with two different + // descriptors with the same field number. + return nil, errors.New("proto: descriptor conflict") + } + return e.value, nil + } + + if extension.ExtensionType == nil { + // incomplete descriptor + return e.enc, nil + } + + v, err := decodeExtension(e.enc, extension) + if err != nil { + return nil, err + } + + // Remember the decoded version and drop the encoded version. + // That way it is safe to mutate what we return. + e.value = v + e.desc = extension + e.enc = nil + emap[extension.Field] = e + return e.value, nil +} + +// defaultExtensionValue returns the default value for extension. +// If no default for an extension is defined ErrMissingExtension is returned. +func defaultExtensionValue(extension *ExtensionDesc) (interface{}, error) { + if extension.ExtensionType == nil { + // incomplete descriptor, so no default + return nil, ErrMissingExtension + } + + t := reflect.TypeOf(extension.ExtensionType) + props := extensionProperties(extension) + + sf, _, err := fieldDefault(t, props) + if err != nil { + return nil, err + } + + if sf == nil || sf.value == nil { + // There is no default value. + return nil, ErrMissingExtension + } + + if t.Kind() != reflect.Ptr { + // We do not need to return a Ptr, we can directly return sf.value. + return sf.value, nil + } + + // We need to return an interface{} that is a pointer to sf.value. + value := reflect.New(t).Elem() + value.Set(reflect.New(value.Type().Elem())) + if sf.kind == reflect.Int32 { + // We may have an int32 or an enum, but the underlying data is int32. + // Since we can't set an int32 into a non int32 reflect.value directly + // set it as a int32. + value.Elem().SetInt(int64(sf.value.(int32))) + } else { + value.Elem().Set(reflect.ValueOf(sf.value)) + } + return value.Interface(), nil +} + +// decodeExtension decodes an extension encoded in b. +func decodeExtension(b []byte, extension *ExtensionDesc) (interface{}, error) { + t := reflect.TypeOf(extension.ExtensionType) + unmarshal := typeUnmarshaler(t, extension.Tag) + + // t is a pointer to a struct, pointer to basic type or a slice. + // Allocate space to store the pointer/slice. + value := reflect.New(t).Elem() + + var err error + for { + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + wire := int(x) & 7 + + b, err = unmarshal(b, valToPointer(value.Addr()), wire) + if err != nil { + return nil, err + } + + if len(b) == 0 { + break + } + } + return value.Interface(), nil +} + +// GetExtensions returns a slice of the extensions present in pb that are also listed in es. +// The returned slice has the same length as es; missing extensions will appear as nil elements. +func GetExtensions(pb Message, es []*ExtensionDesc) (extensions []interface{}, err error) { + epb, err := extendable(pb) + if err != nil { + return nil, err + } + extensions = make([]interface{}, len(es)) + for i, e := range es { + extensions[i], err = GetExtension(epb, e) + if err == ErrMissingExtension { + err = nil + } + if err != nil { + return + } + } + return +} + +// ExtensionDescs returns a new slice containing pb's extension descriptors, in undefined order. +// For non-registered extensions, ExtensionDescs returns an incomplete descriptor containing +// just the Field field, which defines the extension's field number. +func ExtensionDescs(pb Message) ([]*ExtensionDesc, error) { + epb, err := extendable(pb) + if err != nil { + return nil, err + } + registeredExtensions := RegisteredExtensions(pb) + + emap, mu := epb.extensionsRead() + if emap == nil { + return nil, nil + } + mu.Lock() + defer mu.Unlock() + extensions := make([]*ExtensionDesc, 0, len(emap)) + for extid, e := range emap { + desc := e.desc + if desc == nil { + desc = registeredExtensions[extid] + if desc == nil { + desc = &ExtensionDesc{Field: extid} + } + } + + extensions = append(extensions, desc) + } + return extensions, nil +} + +// SetExtension sets the specified extension of pb to the specified value. +func SetExtension(pb Message, extension *ExtensionDesc, value interface{}) error { + if epb, ok := pb.(extensionsBytes); ok { + ClearExtension(pb, extension) + newb, err := encodeExtension(extension, value) + if err != nil { + return err + } + bb := epb.GetExtensions() + *bb = append(*bb, newb...) + return nil + } + epb, err := extendable(pb) + if err != nil { + return err + } + if err := checkExtensionTypes(epb, extension); err != nil { + return err + } + typ := reflect.TypeOf(extension.ExtensionType) + if typ != reflect.TypeOf(value) { + return fmt.Errorf("proto: bad extension value type. got: %T, want: %T", value, extension.ExtensionType) + } + // nil extension values need to be caught early, because the + // encoder can't distinguish an ErrNil due to a nil extension + // from an ErrNil due to a missing field. Extensions are + // always optional, so the encoder would just swallow the error + // and drop all the extensions from the encoded message. + if reflect.ValueOf(value).IsNil() { + return fmt.Errorf("proto: SetExtension called with nil value of type %T", value) + } + + extmap := epb.extensionsWrite() + extmap[extension.Field] = Extension{desc: extension, value: value} + return nil +} + +// ClearAllExtensions clears all extensions from pb. +func ClearAllExtensions(pb Message) { + if epb, doki := pb.(extensionsBytes); doki { + ext := epb.GetExtensions() + *ext = []byte{} + return + } + epb, err := extendable(pb) + if err != nil { + return + } + m := epb.extensionsWrite() + for k := range m { + delete(m, k) + } +} + +// A global registry of extensions. +// The generated code will register the generated descriptors by calling RegisterExtension. + +var extensionMaps = make(map[reflect.Type]map[int32]*ExtensionDesc) + +// RegisterExtension is called from the generated code. +func RegisterExtension(desc *ExtensionDesc) { + st := reflect.TypeOf(desc.ExtendedType).Elem() + m := extensionMaps[st] + if m == nil { + m = make(map[int32]*ExtensionDesc) + extensionMaps[st] = m + } + if _, ok := m[desc.Field]; ok { + panic("proto: duplicate extension registered: " + st.String() + " " + strconv.Itoa(int(desc.Field))) + } + m[desc.Field] = desc +} + +// RegisteredExtensions returns a map of the registered extensions of a +// protocol buffer struct, indexed by the extension number. +// The argument pb should be a nil pointer to the struct type. +func RegisteredExtensions(pb Message) map[int32]*ExtensionDesc { + return extensionMaps[reflect.TypeOf(pb).Elem()] +} diff --git a/vendor/github.com/gogo/protobuf/proto/extensions_gogo.go b/vendor/github.com/gogo/protobuf/proto/extensions_gogo.go new file mode 100644 index 00000000..6f1ae120 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/extensions_gogo.go @@ -0,0 +1,389 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2013, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package proto + +import ( + "bytes" + "errors" + "fmt" + "io" + "reflect" + "sort" + "strings" + "sync" +) + +type extensionsBytes interface { + Message + ExtensionRangeArray() []ExtensionRange + GetExtensions() *[]byte +} + +type slowExtensionAdapter struct { + extensionsBytes +} + +func (s slowExtensionAdapter) extensionsWrite() map[int32]Extension { + panic("Please report a bug to github.com/gogo/protobuf if you see this message: Writing extensions is not supported for extensions stored in a byte slice field.") +} + +func (s slowExtensionAdapter) extensionsRead() (map[int32]Extension, sync.Locker) { + b := s.GetExtensions() + m, err := BytesToExtensionsMap(*b) + if err != nil { + panic(err) + } + return m, notLocker{} +} + +func GetBoolExtension(pb Message, extension *ExtensionDesc, ifnotset bool) bool { + if reflect.ValueOf(pb).IsNil() { + return ifnotset + } + value, err := GetExtension(pb, extension) + if err != nil { + return ifnotset + } + if value == nil { + return ifnotset + } + if value.(*bool) == nil { + return ifnotset + } + return *(value.(*bool)) +} + +func (this *Extension) Equal(that *Extension) bool { + if err := this.Encode(); err != nil { + return false + } + if err := that.Encode(); err != nil { + return false + } + return bytes.Equal(this.enc, that.enc) +} + +func (this *Extension) Compare(that *Extension) int { + if err := this.Encode(); err != nil { + return 1 + } + if err := that.Encode(); err != nil { + return -1 + } + return bytes.Compare(this.enc, that.enc) +} + +func SizeOfInternalExtension(m extendableProto) (n int) { + info := getMarshalInfo(reflect.TypeOf(m)) + return info.sizeV1Extensions(m.extensionsWrite()) +} + +type sortableMapElem struct { + field int32 + ext Extension +} + +func newSortableExtensionsFromMap(m map[int32]Extension) sortableExtensions { + s := make(sortableExtensions, 0, len(m)) + for k, v := range m { + s = append(s, &sortableMapElem{field: k, ext: v}) + } + return s +} + +type sortableExtensions []*sortableMapElem + +func (this sortableExtensions) Len() int { return len(this) } + +func (this sortableExtensions) Swap(i, j int) { this[i], this[j] = this[j], this[i] } + +func (this sortableExtensions) Less(i, j int) bool { return this[i].field < this[j].field } + +func (this sortableExtensions) String() string { + sort.Sort(this) + ss := make([]string, len(this)) + for i := range this { + ss[i] = fmt.Sprintf("%d: %v", this[i].field, this[i].ext) + } + return "map[" + strings.Join(ss, ",") + "]" +} + +func StringFromInternalExtension(m extendableProto) string { + return StringFromExtensionsMap(m.extensionsWrite()) +} + +func StringFromExtensionsMap(m map[int32]Extension) string { + return newSortableExtensionsFromMap(m).String() +} + +func StringFromExtensionsBytes(ext []byte) string { + m, err := BytesToExtensionsMap(ext) + if err != nil { + panic(err) + } + return StringFromExtensionsMap(m) +} + +func EncodeInternalExtension(m extendableProto, data []byte) (n int, err error) { + return EncodeExtensionMap(m.extensionsWrite(), data) +} + +func EncodeInternalExtensionBackwards(m extendableProto, data []byte) (n int, err error) { + return EncodeExtensionMapBackwards(m.extensionsWrite(), data) +} + +func EncodeExtensionMap(m map[int32]Extension, data []byte) (n int, err error) { + o := 0 + for _, e := range m { + if err := e.Encode(); err != nil { + return 0, err + } + n := copy(data[o:], e.enc) + if n != len(e.enc) { + return 0, io.ErrShortBuffer + } + o += n + } + return o, nil +} + +func EncodeExtensionMapBackwards(m map[int32]Extension, data []byte) (n int, err error) { + o := 0 + end := len(data) + for _, e := range m { + if err := e.Encode(); err != nil { + return 0, err + } + n := copy(data[end-len(e.enc):], e.enc) + if n != len(e.enc) { + return 0, io.ErrShortBuffer + } + end -= n + o += n + } + return o, nil +} + +func GetRawExtension(m map[int32]Extension, id int32) ([]byte, error) { + e := m[id] + if err := e.Encode(); err != nil { + return nil, err + } + return e.enc, nil +} + +func size(buf []byte, wire int) (int, error) { + switch wire { + case WireVarint: + _, n := DecodeVarint(buf) + return n, nil + case WireFixed64: + return 8, nil + case WireBytes: + v, n := DecodeVarint(buf) + return int(v) + n, nil + case WireFixed32: + return 4, nil + case WireStartGroup: + offset := 0 + for { + u, n := DecodeVarint(buf[offset:]) + fwire := int(u & 0x7) + offset += n + if fwire == WireEndGroup { + return offset, nil + } + s, err := size(buf[offset:], wire) + if err != nil { + return 0, err + } + offset += s + } + } + return 0, fmt.Errorf("proto: can't get size for unknown wire type %d", wire) +} + +func BytesToExtensionsMap(buf []byte) (map[int32]Extension, error) { + m := make(map[int32]Extension) + i := 0 + for i < len(buf) { + tag, n := DecodeVarint(buf[i:]) + if n <= 0 { + return nil, fmt.Errorf("unable to decode varint") + } + fieldNum := int32(tag >> 3) + wireType := int(tag & 0x7) + l, err := size(buf[i+n:], wireType) + if err != nil { + return nil, err + } + end := i + int(l) + n + m[int32(fieldNum)] = Extension{enc: buf[i:end]} + i = end + } + return m, nil +} + +func NewExtension(e []byte) Extension { + ee := Extension{enc: make([]byte, len(e))} + copy(ee.enc, e) + return ee +} + +func AppendExtension(e Message, tag int32, buf []byte) { + if ee, eok := e.(extensionsBytes); eok { + ext := ee.GetExtensions() + *ext = append(*ext, buf...) + return + } + if ee, eok := e.(extendableProto); eok { + m := ee.extensionsWrite() + ext := m[int32(tag)] // may be missing + ext.enc = append(ext.enc, buf...) + m[int32(tag)] = ext + } +} + +func encodeExtension(extension *ExtensionDesc, value interface{}) ([]byte, error) { + u := getMarshalInfo(reflect.TypeOf(extension.ExtendedType)) + ei := u.getExtElemInfo(extension) + v := value + p := toAddrPointer(&v, ei.isptr) + siz := ei.sizer(p, SizeVarint(ei.wiretag)) + buf := make([]byte, 0, siz) + return ei.marshaler(buf, p, ei.wiretag, false) +} + +func decodeExtensionFromBytes(extension *ExtensionDesc, buf []byte) (interface{}, error) { + o := 0 + for o < len(buf) { + tag, n := DecodeVarint((buf)[o:]) + fieldNum := int32(tag >> 3) + wireType := int(tag & 0x7) + if o+n > len(buf) { + return nil, fmt.Errorf("unable to decode extension") + } + l, err := size((buf)[o+n:], wireType) + if err != nil { + return nil, err + } + if int32(fieldNum) == extension.Field { + if o+n+l > len(buf) { + return nil, fmt.Errorf("unable to decode extension") + } + v, err := decodeExtension((buf)[o:o+n+l], extension) + if err != nil { + return nil, err + } + return v, nil + } + o += n + l + } + return defaultExtensionValue(extension) +} + +func (this *Extension) Encode() error { + if this.enc == nil { + var err error + this.enc, err = encodeExtension(this.desc, this.value) + if err != nil { + return err + } + } + return nil +} + +func (this Extension) GoString() string { + if err := this.Encode(); err != nil { + return fmt.Sprintf("error encoding extension: %v", err) + } + return fmt.Sprintf("proto.NewExtension(%#v)", this.enc) +} + +func SetUnsafeExtension(pb Message, fieldNum int32, value interface{}) error { + typ := reflect.TypeOf(pb).Elem() + ext, ok := extensionMaps[typ] + if !ok { + return fmt.Errorf("proto: bad extended type; %s is not extendable", typ.String()) + } + desc, ok := ext[fieldNum] + if !ok { + return errors.New("proto: bad extension number; not in declared ranges") + } + return SetExtension(pb, desc, value) +} + +func GetUnsafeExtension(pb Message, fieldNum int32) (interface{}, error) { + typ := reflect.TypeOf(pb).Elem() + ext, ok := extensionMaps[typ] + if !ok { + return nil, fmt.Errorf("proto: bad extended type; %s is not extendable", typ.String()) + } + desc, ok := ext[fieldNum] + if !ok { + return nil, fmt.Errorf("unregistered field number %d", fieldNum) + } + return GetExtension(pb, desc) +} + +func NewUnsafeXXX_InternalExtensions(m map[int32]Extension) XXX_InternalExtensions { + x := &XXX_InternalExtensions{ + p: new(struct { + mu sync.Mutex + extensionMap map[int32]Extension + }), + } + x.p.extensionMap = m + return *x +} + +func GetUnsafeExtensionsMap(extendable Message) map[int32]Extension { + pb := extendable.(extendableProto) + return pb.extensionsWrite() +} + +func deleteExtension(pb extensionsBytes, theFieldNum int32, offset int) int { + ext := pb.GetExtensions() + for offset < len(*ext) { + tag, n1 := DecodeVarint((*ext)[offset:]) + fieldNum := int32(tag >> 3) + wireType := int(tag & 0x7) + n2, err := size((*ext)[offset+n1:], wireType) + if err != nil { + panic(err) + } + newOffset := offset + n1 + n2 + if fieldNum == theFieldNum { + *ext = append((*ext)[:offset], (*ext)[newOffset:]...) + return offset + } + offset = newOffset + } + return -1 +} diff --git a/vendor/github.com/gogo/protobuf/proto/lib.go b/vendor/github.com/gogo/protobuf/proto/lib.go new file mode 100644 index 00000000..80db1c15 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/lib.go @@ -0,0 +1,973 @@ +// Go support for Protocol Buffers - Google's data interchange format +// +// Copyright 2010 The Go Authors. All rights reserved. +// https://github.com/golang/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// * Neither the name of Google Inc. nor the names of its +// contributors may be used to endorse or promote products derived from +// this software without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +/* +Package proto converts data structures to and from the wire format of +protocol buffers. It works in concert with the Go source code generated +for .proto files by the protocol compiler. + +A summary of the properties of the protocol buffer interface +for a protocol buffer variable v: + + - Names are turned from camel_case to CamelCase for export. + - There are no methods on v to set fields; just treat + them as structure fields. + - There are getters that return a field's value if set, + and return the field's default value if unset. + The getters work even if the receiver is a nil message. + - The zero value for a struct is its correct initialization state. + All desired fields must be set before marshaling. + - A Reset() method will restore a protobuf struct to its zero state. + - Non-repeated fields are pointers to the values; nil means unset. + That is, optional or required field int32 f becomes F *int32. + - Repeated fields are slices. + - Helper functions are available to aid the setting of fields. + msg.Foo = proto.String("hello") // set field + - Constants are defined to hold the default values of all fields that + have them. They have the form Default_StructName_FieldName. + Because the getter methods handle defaulted values, + direct use of these constants should be rare. + - Enums are given type names and maps from names to values. + Enum values are prefixed by the enclosing message's name, or by the + enum's type name if it is a top-level enum. Enum types have a String + method, and a Enum method to assist in message construction. + - Nested messages, groups and enums have type names prefixed with the name of + the surrounding message type. + - Extensions are given descriptor names that start with E_, + followed by an underscore-delimited list of the nested messages + that contain it (if any) followed by the CamelCased name of the + extension field itself. HasExtension, ClearExtension, GetExtension + and SetExtension are functions for manipulating extensions. + - Oneof field sets are given a single field in their message, + with distinguished wrapper types for each possible field value. + - Marshal and Unmarshal are functions to encode and decode the wire format. + +When the .proto file specifies `syntax="proto3"`, there are some differences: + + - Non-repeated fields of non-message type are values instead of pointers. + - Enum types do not get an Enum method. + +The simplest way to describe this is to see an example. +Given file test.proto, containing + + package example; + + enum FOO { X = 17; } + + message Test { + required string label = 1; + optional int32 type = 2 [default=77]; + repeated int64 reps = 3; + optional group OptionalGroup = 4 { + required string RequiredField = 5; + } + oneof union { + int32 number = 6; + string name = 7; + } + } + +The resulting file, test.pb.go, is: + + package example + + import proto "github.com/gogo/protobuf/proto" + import math "math" + + type FOO int32 + const ( + FOO_X FOO = 17 + ) + var FOO_name = map[int32]string{ + 17: "X", + } + var FOO_value = map[string]int32{ + "X": 17, + } + + func (x FOO) Enum() *FOO { + p := new(FOO) + *p = x + return p + } + func (x FOO) String() string { + return proto.EnumName(FOO_name, int32(x)) + } + func (x *FOO) UnmarshalJSON(data []byte) error { + value, err := proto.UnmarshalJSONEnum(FOO_value, data) + if err != nil { + return err + } + *x = FOO(value) + return nil + } + + type Test struct { + Label *string `protobuf:"bytes,1,req,name=label" json:"label,omitempty"` + Type *int32 `protobuf:"varint,2,opt,name=type,def=77" json:"type,omitempty"` + Reps []int64 `protobuf:"varint,3,rep,name=reps" json:"reps,omitempty"` + Optionalgroup *Test_OptionalGroup `protobuf:"group,4,opt,name=OptionalGroup" json:"optionalgroup,omitempty"` + // Types that are valid to be assigned to Union: + // *Test_Number + // *Test_Name + Union isTest_Union `protobuf_oneof:"union"` + XXX_unrecognized []byte `json:"-"` + } + func (m *Test) Reset() { *m = Test{} } + func (m *Test) String() string { return proto.CompactTextString(m) } + func (*Test) ProtoMessage() {} + + type isTest_Union interface { + isTest_Union() + } + + type Test_Number struct { + Number int32 `protobuf:"varint,6,opt,name=number"` + } + type Test_Name struct { + Name string `protobuf:"bytes,7,opt,name=name"` + } + + func (*Test_Number) isTest_Union() {} + func (*Test_Name) isTest_Union() {} + + func (m *Test) GetUnion() isTest_Union { + if m != nil { + return m.Union + } + return nil + } + const Default_Test_Type int32 = 77 + + func (m *Test) GetLabel() string { + if m != nil && m.Label != nil { + return *m.Label + } + return "" + } + + func (m *Test) GetType() int32 { + if m != nil && m.Type != nil { + return *m.Type + } + return Default_Test_Type + } + + func (m *Test) GetOptionalgroup() *Test_OptionalGroup { + if m != nil { + return m.Optionalgroup + } + return nil + } + + type Test_OptionalGroup struct { + RequiredField *string `protobuf:"bytes,5,req" json:"RequiredField,omitempty"` + } + func (m *Test_OptionalGroup) Reset() { *m = Test_OptionalGroup{} } + func (m *Test_OptionalGroup) String() string { return proto.CompactTextString(m) } + + func (m *Test_OptionalGroup) GetRequiredField() string { + if m != nil && m.RequiredField != nil { + return *m.RequiredField + } + return "" + } + + func (m *Test) GetNumber() int32 { + if x, ok := m.GetUnion().(*Test_Number); ok { + return x.Number + } + return 0 + } + + func (m *Test) GetName() string { + if x, ok := m.GetUnion().(*Test_Name); ok { + return x.Name + } + return "" + } + + func init() { + proto.RegisterEnum("example.FOO", FOO_name, FOO_value) + } + +To create and play with a Test object: + + package main + + import ( + "log" + + "github.com/gogo/protobuf/proto" + pb "./example.pb" + ) + + func main() { + test := &pb.Test{ + Label: proto.String("hello"), + Type: proto.Int32(17), + Reps: []int64{1, 2, 3}, + Optionalgroup: &pb.Test_OptionalGroup{ + RequiredField: proto.String("good bye"), + }, + Union: &pb.Test_Name{"fred"}, + } + data, err := proto.Marshal(test) + if err != nil { + log.Fatal("marshaling error: ", err) + } + newTest := &pb.Test{} + err = proto.Unmarshal(data, newTest) + if err != nil { + log.Fatal("unmarshaling error: ", err) + } + // Now test and newTest contain the same data. + if test.GetLabel() != newTest.GetLabel() { + log.Fatalf("data mismatch %q != %q", test.GetLabel(), newTest.GetLabel()) + } + // Use a type switch to determine which oneof was set. + switch u := test.Union.(type) { + case *pb.Test_Number: // u.Number contains the number. + case *pb.Test_Name: // u.Name contains the string. + } + // etc. + } +*/ +package proto + +import ( + "encoding/json" + "fmt" + "log" + "reflect" + "sort" + "strconv" + "sync" +) + +// RequiredNotSetError is an error type returned by either Marshal or Unmarshal. +// Marshal reports this when a required field is not initialized. +// Unmarshal reports this when a required field is missing from the wire data. +type RequiredNotSetError struct{ field string } + +func (e *RequiredNotSetError) Error() string { + if e.field == "" { + return fmt.Sprintf("proto: required field not set") + } + return fmt.Sprintf("proto: required field %q not set", e.field) +} +func (e *RequiredNotSetError) RequiredNotSet() bool { + return true +} + +type invalidUTF8Error struct{ field string } + +func (e *invalidUTF8Error) Error() string { + if e.field == "" { + return "proto: invalid UTF-8 detected" + } + return fmt.Sprintf("proto: field %q contains invalid UTF-8", e.field) +} +func (e *invalidUTF8Error) InvalidUTF8() bool { + return true +} + +// errInvalidUTF8 is a sentinel error to identify fields with invalid UTF-8. +// This error should not be exposed to the external API as such errors should +// be recreated with the field information. +var errInvalidUTF8 = &invalidUTF8Error{} + +// isNonFatal reports whether the error is either a RequiredNotSet error +// or a InvalidUTF8 error. +func isNonFatal(err error) bool { + if re, ok := err.(interface{ RequiredNotSet() bool }); ok && re.RequiredNotSet() { + return true + } + if re, ok := err.(interface{ InvalidUTF8() bool }); ok && re.InvalidUTF8() { + return true + } + return false +} + +type nonFatal struct{ E error } + +// Merge merges err into nf and reports whether it was successful. +// Otherwise it returns false for any fatal non-nil errors. +func (nf *nonFatal) Merge(err error) (ok bool) { + if err == nil { + return true // not an error + } + if !isNonFatal(err) { + return false // fatal error + } + if nf.E == nil { + nf.E = err // store first instance of non-fatal error + } + return true +} + +// Message is implemented by generated protocol buffer messages. +type Message interface { + Reset() + String() string + ProtoMessage() +} + +// A Buffer is a buffer manager for marshaling and unmarshaling +// protocol buffers. It may be reused between invocations to +// reduce memory usage. It is not necessary to use a Buffer; +// the global functions Marshal and Unmarshal create a +// temporary Buffer and are fine for most applications. +type Buffer struct { + buf []byte // encode/decode byte stream + index int // read point + + deterministic bool +} + +// NewBuffer allocates a new Buffer and initializes its internal data to +// the contents of the argument slice. +func NewBuffer(e []byte) *Buffer { + return &Buffer{buf: e} +} + +// Reset resets the Buffer, ready for marshaling a new protocol buffer. +func (p *Buffer) Reset() { + p.buf = p.buf[0:0] // for reading/writing + p.index = 0 // for reading +} + +// SetBuf replaces the internal buffer with the slice, +// ready for unmarshaling the contents of the slice. +func (p *Buffer) SetBuf(s []byte) { + p.buf = s + p.index = 0 +} + +// Bytes returns the contents of the Buffer. +func (p *Buffer) Bytes() []byte { return p.buf } + +// SetDeterministic sets whether to use deterministic serialization. +// +// Deterministic serialization guarantees that for a given binary, equal +// messages will always be serialized to the same bytes. This implies: +// +// - Repeated serialization of a message will return the same bytes. +// - Different processes of the same binary (which may be executing on +// different machines) will serialize equal messages to the same bytes. +// +// Note that the deterministic serialization is NOT canonical across +// languages. It is not guaranteed to remain stable over time. It is unstable +// across different builds with schema changes due to unknown fields. +// Users who need canonical serialization (e.g., persistent storage in a +// canonical form, fingerprinting, etc.) should define their own +// canonicalization specification and implement their own serializer rather +// than relying on this API. +// +// If deterministic serialization is requested, map entries will be sorted +// by keys in lexographical order. This is an implementation detail and +// subject to change. +func (p *Buffer) SetDeterministic(deterministic bool) { + p.deterministic = deterministic +} + +/* + * Helper routines for simplifying the creation of optional fields of basic type. + */ + +// Bool is a helper routine that allocates a new bool value +// to store v and returns a pointer to it. +func Bool(v bool) *bool { + return &v +} + +// Int32 is a helper routine that allocates a new int32 value +// to store v and returns a pointer to it. +func Int32(v int32) *int32 { + return &v +} + +// Int is a helper routine that allocates a new int32 value +// to store v and returns a pointer to it, but unlike Int32 +// its argument value is an int. +func Int(v int) *int32 { + p := new(int32) + *p = int32(v) + return p +} + +// Int64 is a helper routine that allocates a new int64 value +// to store v and returns a pointer to it. +func Int64(v int64) *int64 { + return &v +} + +// Float32 is a helper routine that allocates a new float32 value +// to store v and returns a pointer to it. +func Float32(v float32) *float32 { + return &v +} + +// Float64 is a helper routine that allocates a new float64 value +// to store v and returns a pointer to it. +func Float64(v float64) *float64 { + return &v +} + +// Uint32 is a helper routine that allocates a new uint32 value +// to store v and returns a pointer to it. +func Uint32(v uint32) *uint32 { + return &v +} + +// Uint64 is a helper routine that allocates a new uint64 value +// to store v and returns a pointer to it. +func Uint64(v uint64) *uint64 { + return &v +} + +// String is a helper routine that allocates a new string value +// to store v and returns a pointer to it. +func String(v string) *string { + return &v +} + +// EnumName is a helper function to simplify printing protocol buffer enums +// by name. Given an enum map and a value, it returns a useful string. +func EnumName(m map[int32]string, v int32) string { + s, ok := m[v] + if ok { + return s + } + return strconv.Itoa(int(v)) +} + +// UnmarshalJSONEnum is a helper function to simplify recovering enum int values +// from their JSON-encoded representation. Given a map from the enum's symbolic +// names to its int values, and a byte buffer containing the JSON-encoded +// value, it returns an int32 that can be cast to the enum type by the caller. +// +// The function can deal with both JSON representations, numeric and symbolic. +func UnmarshalJSONEnum(m map[string]int32, data []byte, enumName string) (int32, error) { + if data[0] == '"' { + // New style: enums are strings. + var repr string + if err := json.Unmarshal(data, &repr); err != nil { + return -1, err + } + val, ok := m[repr] + if !ok { + return 0, fmt.Errorf("unrecognized enum %s value %q", enumName, repr) + } + return val, nil + } + // Old style: enums are ints. + var val int32 + if err := json.Unmarshal(data, &val); err != nil { + return 0, fmt.Errorf("cannot unmarshal %#q into enum %s", data, enumName) + } + return val, nil +} + +// DebugPrint dumps the encoded data in b in a debugging format with a header +// including the string s. Used in testing but made available for general debugging. +func (p *Buffer) DebugPrint(s string, b []byte) { + var u uint64 + + obuf := p.buf + sindex := p.index + p.buf = b + p.index = 0 + depth := 0 + + fmt.Printf("\n--- %s ---\n", s) + +out: + for { + for i := 0; i < depth; i++ { + fmt.Print(" ") + } + + index := p.index + if index == len(p.buf) { + break + } + + op, err := p.DecodeVarint() + if err != nil { + fmt.Printf("%3d: fetching op err %v\n", index, err) + break out + } + tag := op >> 3 + wire := op & 7 + + switch wire { + default: + fmt.Printf("%3d: t=%3d unknown wire=%d\n", + index, tag, wire) + break out + + case WireBytes: + var r []byte + + r, err = p.DecodeRawBytes(false) + if err != nil { + break out + } + fmt.Printf("%3d: t=%3d bytes [%d]", index, tag, len(r)) + if len(r) <= 6 { + for i := 0; i < len(r); i++ { + fmt.Printf(" %.2x", r[i]) + } + } else { + for i := 0; i < 3; i++ { + fmt.Printf(" %.2x", r[i]) + } + fmt.Printf(" ..") + for i := len(r) - 3; i < len(r); i++ { + fmt.Printf(" %.2x", r[i]) + } + } + fmt.Printf("\n") + + case WireFixed32: + u, err = p.DecodeFixed32() + if err != nil { + fmt.Printf("%3d: t=%3d fix32 err %v\n", index, tag, err) + break out + } + fmt.Printf("%3d: t=%3d fix32 %d\n", index, tag, u) + + case WireFixed64: + u, err = p.DecodeFixed64() + if err != nil { + fmt.Printf("%3d: t=%3d fix64 err %v\n", index, tag, err) + break out + } + fmt.Printf("%3d: t=%3d fix64 %d\n", index, tag, u) + + case WireVarint: + u, err = p.DecodeVarint() + if err != nil { + fmt.Printf("%3d: t=%3d varint err %v\n", index, tag, err) + break out + } + fmt.Printf("%3d: t=%3d varint %d\n", index, tag, u) + + case WireStartGroup: + fmt.Printf("%3d: t=%3d start\n", index, tag) + depth++ + + case WireEndGroup: + depth-- + fmt.Printf("%3d: t=%3d end\n", index, tag) + } + } + + if depth != 0 { + fmt.Printf("%3d: start-end not balanced %d\n", p.index, depth) + } + fmt.Printf("\n") + + p.buf = obuf + p.index = sindex +} + +// SetDefaults sets unset protocol buffer fields to their default values. +// It only modifies fields that are both unset and have defined defaults. +// It recursively sets default values in any non-nil sub-messages. +func SetDefaults(pb Message) { + setDefaults(reflect.ValueOf(pb), true, false) +} + +// v is a struct. +func setDefaults(v reflect.Value, recur, zeros bool) { + if v.Kind() == reflect.Ptr { + v = v.Elem() + } + + defaultMu.RLock() + dm, ok := defaults[v.Type()] + defaultMu.RUnlock() + if !ok { + dm = buildDefaultMessage(v.Type()) + defaultMu.Lock() + defaults[v.Type()] = dm + defaultMu.Unlock() + } + + for _, sf := range dm.scalars { + f := v.Field(sf.index) + if !f.IsNil() { + // field already set + continue + } + dv := sf.value + if dv == nil && !zeros { + // no explicit default, and don't want to set zeros + continue + } + fptr := f.Addr().Interface() // **T + // TODO: Consider batching the allocations we do here. + switch sf.kind { + case reflect.Bool: + b := new(bool) + if dv != nil { + *b = dv.(bool) + } + *(fptr.(**bool)) = b + case reflect.Float32: + f := new(float32) + if dv != nil { + *f = dv.(float32) + } + *(fptr.(**float32)) = f + case reflect.Float64: + f := new(float64) + if dv != nil { + *f = dv.(float64) + } + *(fptr.(**float64)) = f + case reflect.Int32: + // might be an enum + if ft := f.Type(); ft != int32PtrType { + // enum + f.Set(reflect.New(ft.Elem())) + if dv != nil { + f.Elem().SetInt(int64(dv.(int32))) + } + } else { + // int32 field + i := new(int32) + if dv != nil { + *i = dv.(int32) + } + *(fptr.(**int32)) = i + } + case reflect.Int64: + i := new(int64) + if dv != nil { + *i = dv.(int64) + } + *(fptr.(**int64)) = i + case reflect.String: + s := new(string) + if dv != nil { + *s = dv.(string) + } + *(fptr.(**string)) = s + case reflect.Uint8: + // exceptional case: []byte + var b []byte + if dv != nil { + db := dv.([]byte) + b = make([]byte, len(db)) + copy(b, db) + } else { + b = []byte{} + } + *(fptr.(*[]byte)) = b + case reflect.Uint32: + u := new(uint32) + if dv != nil { + *u = dv.(uint32) + } + *(fptr.(**uint32)) = u + case reflect.Uint64: + u := new(uint64) + if dv != nil { + *u = dv.(uint64) + } + *(fptr.(**uint64)) = u + default: + log.Printf("proto: can't set default for field %v (sf.kind=%v)", f, sf.kind) + } + } + + for _, ni := range dm.nested { + f := v.Field(ni) + // f is *T or T or []*T or []T + switch f.Kind() { + case reflect.Struct: + setDefaults(f, recur, zeros) + + case reflect.Ptr: + if f.IsNil() { + continue + } + setDefaults(f, recur, zeros) + + case reflect.Slice: + for i := 0; i < f.Len(); i++ { + e := f.Index(i) + if e.Kind() == reflect.Ptr && e.IsNil() { + continue + } + setDefaults(e, recur, zeros) + } + + case reflect.Map: + for _, k := range f.MapKeys() { + e := f.MapIndex(k) + if e.IsNil() { + continue + } + setDefaults(e, recur, zeros) + } + } + } +} + +var ( + // defaults maps a protocol buffer struct type to a slice of the fields, + // with its scalar fields set to their proto-declared non-zero default values. + defaultMu sync.RWMutex + defaults = make(map[reflect.Type]defaultMessage) + + int32PtrType = reflect.TypeOf((*int32)(nil)) +) + +// defaultMessage represents information about the default values of a message. +type defaultMessage struct { + scalars []scalarField + nested []int // struct field index of nested messages +} + +type scalarField struct { + index int // struct field index + kind reflect.Kind // element type (the T in *T or []T) + value interface{} // the proto-declared default value, or nil +} + +// t is a struct type. +func buildDefaultMessage(t reflect.Type) (dm defaultMessage) { + sprop := GetProperties(t) + for _, prop := range sprop.Prop { + fi, ok := sprop.decoderTags.get(prop.Tag) + if !ok { + // XXX_unrecognized + continue + } + ft := t.Field(fi).Type + + sf, nested, err := fieldDefault(ft, prop) + switch { + case err != nil: + log.Print(err) + case nested: + dm.nested = append(dm.nested, fi) + case sf != nil: + sf.index = fi + dm.scalars = append(dm.scalars, *sf) + } + } + + return dm +} + +// fieldDefault returns the scalarField for field type ft. +// sf will be nil if the field can not have a default. +// nestedMessage will be true if this is a nested message. +// Note that sf.index is not set on return. +func fieldDefault(ft reflect.Type, prop *Properties) (sf *scalarField, nestedMessage bool, err error) { + var canHaveDefault bool + switch ft.Kind() { + case reflect.Struct: + nestedMessage = true // non-nullable + + case reflect.Ptr: + if ft.Elem().Kind() == reflect.Struct { + nestedMessage = true + } else { + canHaveDefault = true // proto2 scalar field + } + + case reflect.Slice: + switch ft.Elem().Kind() { + case reflect.Ptr, reflect.Struct: + nestedMessage = true // repeated message + case reflect.Uint8: + canHaveDefault = true // bytes field + } + + case reflect.Map: + if ft.Elem().Kind() == reflect.Ptr { + nestedMessage = true // map with message values + } + } + + if !canHaveDefault { + if nestedMessage { + return nil, true, nil + } + return nil, false, nil + } + + // We now know that ft is a pointer or slice. + sf = &scalarField{kind: ft.Elem().Kind()} + + // scalar fields without defaults + if !prop.HasDefault { + return sf, false, nil + } + + // a scalar field: either *T or []byte + switch ft.Elem().Kind() { + case reflect.Bool: + x, err := strconv.ParseBool(prop.Default) + if err != nil { + return nil, false, fmt.Errorf("proto: bad default bool %q: %v", prop.Default, err) + } + sf.value = x + case reflect.Float32: + x, err := strconv.ParseFloat(prop.Default, 32) + if err != nil { + return nil, false, fmt.Errorf("proto: bad default float32 %q: %v", prop.Default, err) + } + sf.value = float32(x) + case reflect.Float64: + x, err := strconv.ParseFloat(prop.Default, 64) + if err != nil { + return nil, false, fmt.Errorf("proto: bad default float64 %q: %v", prop.Default, err) + } + sf.value = x + case reflect.Int32: + x, err := strconv.ParseInt(prop.Default, 10, 32) + if err != nil { + return nil, false, fmt.Errorf("proto: bad default int32 %q: %v", prop.Default, err) + } + sf.value = int32(x) + case reflect.Int64: + x, err := strconv.ParseInt(prop.Default, 10, 64) + if err != nil { + return nil, false, fmt.Errorf("proto: bad default int64 %q: %v", prop.Default, err) + } + sf.value = x + case reflect.String: + sf.value = prop.Default + case reflect.Uint8: + // []byte (not *uint8) + sf.value = []byte(prop.Default) + case reflect.Uint32: + x, err := strconv.ParseUint(prop.Default, 10, 32) + if err != nil { + return nil, false, fmt.Errorf("proto: bad default uint32 %q: %v", prop.Default, err) + } + sf.value = uint32(x) + case reflect.Uint64: + x, err := strconv.ParseUint(prop.Default, 10, 64) + if err != nil { + return nil, false, fmt.Errorf("proto: bad default uint64 %q: %v", prop.Default, err) + } + sf.value = x + default: + return nil, false, fmt.Errorf("proto: unhandled def kind %v", ft.Elem().Kind()) + } + + return sf, false, nil +} + +// mapKeys returns a sort.Interface to be used for sorting the map keys. +// Map fields may have key types of non-float scalars, strings and enums. +func mapKeys(vs []reflect.Value) sort.Interface { + s := mapKeySorter{vs: vs} + + // Type specialization per https://developers.google.com/protocol-buffers/docs/proto#maps. + if len(vs) == 0 { + return s + } + switch vs[0].Kind() { + case reflect.Int32, reflect.Int64: + s.less = func(a, b reflect.Value) bool { return a.Int() < b.Int() } + case reflect.Uint32, reflect.Uint64: + s.less = func(a, b reflect.Value) bool { return a.Uint() < b.Uint() } + case reflect.Bool: + s.less = func(a, b reflect.Value) bool { return !a.Bool() && b.Bool() } // false < true + case reflect.String: + s.less = func(a, b reflect.Value) bool { return a.String() < b.String() } + default: + panic(fmt.Sprintf("unsupported map key type: %v", vs[0].Kind())) + } + + return s +} + +type mapKeySorter struct { + vs []reflect.Value + less func(a, b reflect.Value) bool +} + +func (s mapKeySorter) Len() int { return len(s.vs) } +func (s mapKeySorter) Swap(i, j int) { s.vs[i], s.vs[j] = s.vs[j], s.vs[i] } +func (s mapKeySorter) Less(i, j int) bool { + return s.less(s.vs[i], s.vs[j]) +} + +// isProto3Zero reports whether v is a zero proto3 value. +func isProto3Zero(v reflect.Value) bool { + switch v.Kind() { + case reflect.Bool: + return !v.Bool() + case reflect.Int32, reflect.Int64: + return v.Int() == 0 + case reflect.Uint32, reflect.Uint64: + return v.Uint() == 0 + case reflect.Float32, reflect.Float64: + return v.Float() == 0 + case reflect.String: + return v.String() == "" + } + return false +} + +const ( + // ProtoPackageIsVersion3 is referenced from generated protocol buffer files + // to assert that that code is compatible with this version of the proto package. + GoGoProtoPackageIsVersion3 = true + + // ProtoPackageIsVersion2 is referenced from generated protocol buffer files + // to assert that that code is compatible with this version of the proto package. + GoGoProtoPackageIsVersion2 = true + + // ProtoPackageIsVersion1 is referenced from generated protocol buffer files + // to assert that that code is compatible with this version of the proto package. + GoGoProtoPackageIsVersion1 = true +) + +// InternalMessageInfo is a type used internally by generated .pb.go files. +// This type is not intended to be used by non-generated code. +// This type is not subject to any compatibility guarantee. +type InternalMessageInfo struct { + marshal *marshalInfo + unmarshal *unmarshalInfo + merge *mergeInfo + discard *discardInfo +} diff --git a/vendor/github.com/gogo/protobuf/proto/lib_gogo.go b/vendor/github.com/gogo/protobuf/proto/lib_gogo.go new file mode 100644 index 00000000..b3aa3919 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/lib_gogo.go @@ -0,0 +1,50 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2013, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package proto + +import ( + "encoding/json" + "strconv" +) + +type Sizer interface { + Size() int +} + +type ProtoSizer interface { + ProtoSize() int +} + +func MarshalJSONEnum(m map[int32]string, value int32) ([]byte, error) { + s, ok := m[value] + if !ok { + s = strconv.Itoa(int(value)) + } + return json.Marshal(s) +} diff --git a/vendor/github.com/gogo/protobuf/proto/message_set.go b/vendor/github.com/gogo/protobuf/proto/message_set.go new file mode 100644 index 00000000..f48a7567 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/message_set.go @@ -0,0 +1,181 @@ +// Go support for Protocol Buffers - Google's data interchange format +// +// Copyright 2010 The Go Authors. All rights reserved. +// https://github.com/golang/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// * Neither the name of Google Inc. nor the names of its +// contributors may be used to endorse or promote products derived from +// this software without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package proto + +/* + * Support for message sets. + */ + +import ( + "errors" +) + +// errNoMessageTypeID occurs when a protocol buffer does not have a message type ID. +// A message type ID is required for storing a protocol buffer in a message set. +var errNoMessageTypeID = errors.New("proto does not have a message type ID") + +// The first two types (_MessageSet_Item and messageSet) +// model what the protocol compiler produces for the following protocol message: +// message MessageSet { +// repeated group Item = 1 { +// required int32 type_id = 2; +// required string message = 3; +// }; +// } +// That is the MessageSet wire format. We can't use a proto to generate these +// because that would introduce a circular dependency between it and this package. + +type _MessageSet_Item struct { + TypeId *int32 `protobuf:"varint,2,req,name=type_id"` + Message []byte `protobuf:"bytes,3,req,name=message"` +} + +type messageSet struct { + Item []*_MessageSet_Item `protobuf:"group,1,rep"` + XXX_unrecognized []byte + // TODO: caching? +} + +// Make sure messageSet is a Message. +var _ Message = (*messageSet)(nil) + +// messageTypeIder is an interface satisfied by a protocol buffer type +// that may be stored in a MessageSet. +type messageTypeIder interface { + MessageTypeId() int32 +} + +func (ms *messageSet) find(pb Message) *_MessageSet_Item { + mti, ok := pb.(messageTypeIder) + if !ok { + return nil + } + id := mti.MessageTypeId() + for _, item := range ms.Item { + if *item.TypeId == id { + return item + } + } + return nil +} + +func (ms *messageSet) Has(pb Message) bool { + return ms.find(pb) != nil +} + +func (ms *messageSet) Unmarshal(pb Message) error { + if item := ms.find(pb); item != nil { + return Unmarshal(item.Message, pb) + } + if _, ok := pb.(messageTypeIder); !ok { + return errNoMessageTypeID + } + return nil // TODO: return error instead? +} + +func (ms *messageSet) Marshal(pb Message) error { + msg, err := Marshal(pb) + if err != nil { + return err + } + if item := ms.find(pb); item != nil { + // reuse existing item + item.Message = msg + return nil + } + + mti, ok := pb.(messageTypeIder) + if !ok { + return errNoMessageTypeID + } + + mtid := mti.MessageTypeId() + ms.Item = append(ms.Item, &_MessageSet_Item{ + TypeId: &mtid, + Message: msg, + }) + return nil +} + +func (ms *messageSet) Reset() { *ms = messageSet{} } +func (ms *messageSet) String() string { return CompactTextString(ms) } +func (*messageSet) ProtoMessage() {} + +// Support for the message_set_wire_format message option. + +func skipVarint(buf []byte) []byte { + i := 0 + for ; buf[i]&0x80 != 0; i++ { + } + return buf[i+1:] +} + +// unmarshalMessageSet decodes the extension map encoded in buf in the message set wire format. +// It is called by Unmarshal methods on protocol buffer messages with the message_set_wire_format option. +func unmarshalMessageSet(buf []byte, exts interface{}) error { + var m map[int32]Extension + switch exts := exts.(type) { + case *XXX_InternalExtensions: + m = exts.extensionsWrite() + case map[int32]Extension: + m = exts + default: + return errors.New("proto: not an extension map") + } + + ms := new(messageSet) + if err := Unmarshal(buf, ms); err != nil { + return err + } + for _, item := range ms.Item { + id := *item.TypeId + msg := item.Message + + // Restore wire type and field number varint, plus length varint. + // Be careful to preserve duplicate items. + b := EncodeVarint(uint64(id)<<3 | WireBytes) + if ext, ok := m[id]; ok { + // Existing data; rip off the tag and length varint + // so we join the new data correctly. + // We can assume that ext.enc is set because we are unmarshaling. + o := ext.enc[len(b):] // skip wire type and field number + _, n := DecodeVarint(o) // calculate length of length varint + o = o[n:] // skip length varint + msg = append(o, msg...) // join old data and new data + } + b = append(b, EncodeVarint(uint64(len(msg)))...) + b = append(b, msg...) + + m[id] = Extension{enc: b} + } + return nil +} diff --git a/vendor/github.com/gogo/protobuf/proto/pointer_reflect.go b/vendor/github.com/gogo/protobuf/proto/pointer_reflect.go new file mode 100644 index 00000000..b6cad908 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/pointer_reflect.go @@ -0,0 +1,357 @@ +// Go support for Protocol Buffers - Google's data interchange format +// +// Copyright 2012 The Go Authors. All rights reserved. +// https://github.com/golang/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// * Neither the name of Google Inc. nor the names of its +// contributors may be used to endorse or promote products derived from +// this software without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +// +build purego appengine js + +// This file contains an implementation of proto field accesses using package reflect. +// It is slower than the code in pointer_unsafe.go but it avoids package unsafe and can +// be used on App Engine. + +package proto + +import ( + "reflect" + "sync" +) + +const unsafeAllowed = false + +// A field identifies a field in a struct, accessible from a pointer. +// In this implementation, a field is identified by the sequence of field indices +// passed to reflect's FieldByIndex. +type field []int + +// toField returns a field equivalent to the given reflect field. +func toField(f *reflect.StructField) field { + return f.Index +} + +// invalidField is an invalid field identifier. +var invalidField = field(nil) + +// zeroField is a noop when calling pointer.offset. +var zeroField = field([]int{}) + +// IsValid reports whether the field identifier is valid. +func (f field) IsValid() bool { return f != nil } + +// The pointer type is for the table-driven decoder. +// The implementation here uses a reflect.Value of pointer type to +// create a generic pointer. In pointer_unsafe.go we use unsafe +// instead of reflect to implement the same (but faster) interface. +type pointer struct { + v reflect.Value +} + +// toPointer converts an interface of pointer type to a pointer +// that points to the same target. +func toPointer(i *Message) pointer { + return pointer{v: reflect.ValueOf(*i)} +} + +// toAddrPointer converts an interface to a pointer that points to +// the interface data. +func toAddrPointer(i *interface{}, isptr bool) pointer { + v := reflect.ValueOf(*i) + u := reflect.New(v.Type()) + u.Elem().Set(v) + return pointer{v: u} +} + +// valToPointer converts v to a pointer. v must be of pointer type. +func valToPointer(v reflect.Value) pointer { + return pointer{v: v} +} + +// offset converts from a pointer to a structure to a pointer to +// one of its fields. +func (p pointer) offset(f field) pointer { + return pointer{v: p.v.Elem().FieldByIndex(f).Addr()} +} + +func (p pointer) isNil() bool { + return p.v.IsNil() +} + +// grow updates the slice s in place to make it one element longer. +// s must be addressable. +// Returns the (addressable) new element. +func grow(s reflect.Value) reflect.Value { + n, m := s.Len(), s.Cap() + if n < m { + s.SetLen(n + 1) + } else { + s.Set(reflect.Append(s, reflect.Zero(s.Type().Elem()))) + } + return s.Index(n) +} + +func (p pointer) toInt64() *int64 { + return p.v.Interface().(*int64) +} +func (p pointer) toInt64Ptr() **int64 { + return p.v.Interface().(**int64) +} +func (p pointer) toInt64Slice() *[]int64 { + return p.v.Interface().(*[]int64) +} + +var int32ptr = reflect.TypeOf((*int32)(nil)) + +func (p pointer) toInt32() *int32 { + return p.v.Convert(int32ptr).Interface().(*int32) +} + +// The toInt32Ptr/Slice methods don't work because of enums. +// Instead, we must use set/get methods for the int32ptr/slice case. +/* + func (p pointer) toInt32Ptr() **int32 { + return p.v.Interface().(**int32) +} + func (p pointer) toInt32Slice() *[]int32 { + return p.v.Interface().(*[]int32) +} +*/ +func (p pointer) getInt32Ptr() *int32 { + if p.v.Type().Elem().Elem() == reflect.TypeOf(int32(0)) { + // raw int32 type + return p.v.Elem().Interface().(*int32) + } + // an enum + return p.v.Elem().Convert(int32PtrType).Interface().(*int32) +} +func (p pointer) setInt32Ptr(v int32) { + // Allocate value in a *int32. Possibly convert that to a *enum. + // Then assign it to a **int32 or **enum. + // Note: we can convert *int32 to *enum, but we can't convert + // **int32 to **enum! + p.v.Elem().Set(reflect.ValueOf(&v).Convert(p.v.Type().Elem())) +} + +// getInt32Slice copies []int32 from p as a new slice. +// This behavior differs from the implementation in pointer_unsafe.go. +func (p pointer) getInt32Slice() []int32 { + if p.v.Type().Elem().Elem() == reflect.TypeOf(int32(0)) { + // raw int32 type + return p.v.Elem().Interface().([]int32) + } + // an enum + // Allocate a []int32, then assign []enum's values into it. + // Note: we can't convert []enum to []int32. + slice := p.v.Elem() + s := make([]int32, slice.Len()) + for i := 0; i < slice.Len(); i++ { + s[i] = int32(slice.Index(i).Int()) + } + return s +} + +// setInt32Slice copies []int32 into p as a new slice. +// This behavior differs from the implementation in pointer_unsafe.go. +func (p pointer) setInt32Slice(v []int32) { + if p.v.Type().Elem().Elem() == reflect.TypeOf(int32(0)) { + // raw int32 type + p.v.Elem().Set(reflect.ValueOf(v)) + return + } + // an enum + // Allocate a []enum, then assign []int32's values into it. + // Note: we can't convert []enum to []int32. + slice := reflect.MakeSlice(p.v.Type().Elem(), len(v), cap(v)) + for i, x := range v { + slice.Index(i).SetInt(int64(x)) + } + p.v.Elem().Set(slice) +} +func (p pointer) appendInt32Slice(v int32) { + grow(p.v.Elem()).SetInt(int64(v)) +} + +func (p pointer) toUint64() *uint64 { + return p.v.Interface().(*uint64) +} +func (p pointer) toUint64Ptr() **uint64 { + return p.v.Interface().(**uint64) +} +func (p pointer) toUint64Slice() *[]uint64 { + return p.v.Interface().(*[]uint64) +} +func (p pointer) toUint32() *uint32 { + return p.v.Interface().(*uint32) +} +func (p pointer) toUint32Ptr() **uint32 { + return p.v.Interface().(**uint32) +} +func (p pointer) toUint32Slice() *[]uint32 { + return p.v.Interface().(*[]uint32) +} +func (p pointer) toBool() *bool { + return p.v.Interface().(*bool) +} +func (p pointer) toBoolPtr() **bool { + return p.v.Interface().(**bool) +} +func (p pointer) toBoolSlice() *[]bool { + return p.v.Interface().(*[]bool) +} +func (p pointer) toFloat64() *float64 { + return p.v.Interface().(*float64) +} +func (p pointer) toFloat64Ptr() **float64 { + return p.v.Interface().(**float64) +} +func (p pointer) toFloat64Slice() *[]float64 { + return p.v.Interface().(*[]float64) +} +func (p pointer) toFloat32() *float32 { + return p.v.Interface().(*float32) +} +func (p pointer) toFloat32Ptr() **float32 { + return p.v.Interface().(**float32) +} +func (p pointer) toFloat32Slice() *[]float32 { + return p.v.Interface().(*[]float32) +} +func (p pointer) toString() *string { + return p.v.Interface().(*string) +} +func (p pointer) toStringPtr() **string { + return p.v.Interface().(**string) +} +func (p pointer) toStringSlice() *[]string { + return p.v.Interface().(*[]string) +} +func (p pointer) toBytes() *[]byte { + return p.v.Interface().(*[]byte) +} +func (p pointer) toBytesSlice() *[][]byte { + return p.v.Interface().(*[][]byte) +} +func (p pointer) toExtensions() *XXX_InternalExtensions { + return p.v.Interface().(*XXX_InternalExtensions) +} +func (p pointer) toOldExtensions() *map[int32]Extension { + return p.v.Interface().(*map[int32]Extension) +} +func (p pointer) getPointer() pointer { + return pointer{v: p.v.Elem()} +} +func (p pointer) setPointer(q pointer) { + p.v.Elem().Set(q.v) +} +func (p pointer) appendPointer(q pointer) { + grow(p.v.Elem()).Set(q.v) +} + +// getPointerSlice copies []*T from p as a new []pointer. +// This behavior differs from the implementation in pointer_unsafe.go. +func (p pointer) getPointerSlice() []pointer { + if p.v.IsNil() { + return nil + } + n := p.v.Elem().Len() + s := make([]pointer, n) + for i := 0; i < n; i++ { + s[i] = pointer{v: p.v.Elem().Index(i)} + } + return s +} + +// setPointerSlice copies []pointer into p as a new []*T. +// This behavior differs from the implementation in pointer_unsafe.go. +func (p pointer) setPointerSlice(v []pointer) { + if v == nil { + p.v.Elem().Set(reflect.New(p.v.Elem().Type()).Elem()) + return + } + s := reflect.MakeSlice(p.v.Elem().Type(), 0, len(v)) + for _, p := range v { + s = reflect.Append(s, p.v) + } + p.v.Elem().Set(s) +} + +// getInterfacePointer returns a pointer that points to the +// interface data of the interface pointed by p. +func (p pointer) getInterfacePointer() pointer { + if p.v.Elem().IsNil() { + return pointer{v: p.v.Elem()} + } + return pointer{v: p.v.Elem().Elem().Elem().Field(0).Addr()} // *interface -> interface -> *struct -> struct +} + +func (p pointer) asPointerTo(t reflect.Type) reflect.Value { + // TODO: check that p.v.Type().Elem() == t? + return p.v +} + +func atomicLoadUnmarshalInfo(p **unmarshalInfo) *unmarshalInfo { + atomicLock.Lock() + defer atomicLock.Unlock() + return *p +} +func atomicStoreUnmarshalInfo(p **unmarshalInfo, v *unmarshalInfo) { + atomicLock.Lock() + defer atomicLock.Unlock() + *p = v +} +func atomicLoadMarshalInfo(p **marshalInfo) *marshalInfo { + atomicLock.Lock() + defer atomicLock.Unlock() + return *p +} +func atomicStoreMarshalInfo(p **marshalInfo, v *marshalInfo) { + atomicLock.Lock() + defer atomicLock.Unlock() + *p = v +} +func atomicLoadMergeInfo(p **mergeInfo) *mergeInfo { + atomicLock.Lock() + defer atomicLock.Unlock() + return *p +} +func atomicStoreMergeInfo(p **mergeInfo, v *mergeInfo) { + atomicLock.Lock() + defer atomicLock.Unlock() + *p = v +} +func atomicLoadDiscardInfo(p **discardInfo) *discardInfo { + atomicLock.Lock() + defer atomicLock.Unlock() + return *p +} +func atomicStoreDiscardInfo(p **discardInfo, v *discardInfo) { + atomicLock.Lock() + defer atomicLock.Unlock() + *p = v +} + +var atomicLock sync.Mutex diff --git a/vendor/github.com/gogo/protobuf/proto/pointer_reflect_gogo.go b/vendor/github.com/gogo/protobuf/proto/pointer_reflect_gogo.go new file mode 100644 index 00000000..7ffd3c29 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/pointer_reflect_gogo.go @@ -0,0 +1,59 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2018, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +// +build purego appengine js + +// This file contains an implementation of proto field accesses using package reflect. +// It is slower than the code in pointer_unsafe.go but it avoids package unsafe and can +// be used on App Engine. + +package proto + +import ( + "reflect" +) + +// TODO: untested, so probably incorrect. + +func (p pointer) getRef() pointer { + return pointer{v: p.v.Addr()} +} + +func (p pointer) appendRef(v pointer, typ reflect.Type) { + slice := p.getSlice(typ) + elem := v.asPointerTo(typ).Elem() + newSlice := reflect.Append(slice, elem) + slice.Set(newSlice) +} + +func (p pointer) getSlice(typ reflect.Type) reflect.Value { + sliceTyp := reflect.SliceOf(typ) + slice := p.asPointerTo(sliceTyp) + slice = slice.Elem() + return slice +} diff --git a/vendor/github.com/gogo/protobuf/proto/pointer_unsafe.go b/vendor/github.com/gogo/protobuf/proto/pointer_unsafe.go new file mode 100644 index 00000000..d55a335d --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/pointer_unsafe.go @@ -0,0 +1,308 @@ +// Go support for Protocol Buffers - Google's data interchange format +// +// Copyright 2012 The Go Authors. All rights reserved. +// https://github.com/golang/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// * Neither the name of Google Inc. nor the names of its +// contributors may be used to endorse or promote products derived from +// this software without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +// +build !purego,!appengine,!js + +// This file contains the implementation of the proto field accesses using package unsafe. + +package proto + +import ( + "reflect" + "sync/atomic" + "unsafe" +) + +const unsafeAllowed = true + +// A field identifies a field in a struct, accessible from a pointer. +// In this implementation, a field is identified by its byte offset from the start of the struct. +type field uintptr + +// toField returns a field equivalent to the given reflect field. +func toField(f *reflect.StructField) field { + return field(f.Offset) +} + +// invalidField is an invalid field identifier. +const invalidField = ^field(0) + +// zeroField is a noop when calling pointer.offset. +const zeroField = field(0) + +// IsValid reports whether the field identifier is valid. +func (f field) IsValid() bool { + return f != invalidField +} + +// The pointer type below is for the new table-driven encoder/decoder. +// The implementation here uses unsafe.Pointer to create a generic pointer. +// In pointer_reflect.go we use reflect instead of unsafe to implement +// the same (but slower) interface. +type pointer struct { + p unsafe.Pointer +} + +// size of pointer +var ptrSize = unsafe.Sizeof(uintptr(0)) + +// toPointer converts an interface of pointer type to a pointer +// that points to the same target. +func toPointer(i *Message) pointer { + // Super-tricky - read pointer out of data word of interface value. + // Saves ~25ns over the equivalent: + // return valToPointer(reflect.ValueOf(*i)) + return pointer{p: (*[2]unsafe.Pointer)(unsafe.Pointer(i))[1]} +} + +// toAddrPointer converts an interface to a pointer that points to +// the interface data. +func toAddrPointer(i *interface{}, isptr bool) pointer { + // Super-tricky - read or get the address of data word of interface value. + if isptr { + // The interface is of pointer type, thus it is a direct interface. + // The data word is the pointer data itself. We take its address. + return pointer{p: unsafe.Pointer(uintptr(unsafe.Pointer(i)) + ptrSize)} + } + // The interface is not of pointer type. The data word is the pointer + // to the data. + return pointer{p: (*[2]unsafe.Pointer)(unsafe.Pointer(i))[1]} +} + +// valToPointer converts v to a pointer. v must be of pointer type. +func valToPointer(v reflect.Value) pointer { + return pointer{p: unsafe.Pointer(v.Pointer())} +} + +// offset converts from a pointer to a structure to a pointer to +// one of its fields. +func (p pointer) offset(f field) pointer { + // For safety, we should panic if !f.IsValid, however calling panic causes + // this to no longer be inlineable, which is a serious performance cost. + /* + if !f.IsValid() { + panic("invalid field") + } + */ + return pointer{p: unsafe.Pointer(uintptr(p.p) + uintptr(f))} +} + +func (p pointer) isNil() bool { + return p.p == nil +} + +func (p pointer) toInt64() *int64 { + return (*int64)(p.p) +} +func (p pointer) toInt64Ptr() **int64 { + return (**int64)(p.p) +} +func (p pointer) toInt64Slice() *[]int64 { + return (*[]int64)(p.p) +} +func (p pointer) toInt32() *int32 { + return (*int32)(p.p) +} + +// See pointer_reflect.go for why toInt32Ptr/Slice doesn't exist. +/* + func (p pointer) toInt32Ptr() **int32 { + return (**int32)(p.p) + } + func (p pointer) toInt32Slice() *[]int32 { + return (*[]int32)(p.p) + } +*/ +func (p pointer) getInt32Ptr() *int32 { + return *(**int32)(p.p) +} +func (p pointer) setInt32Ptr(v int32) { + *(**int32)(p.p) = &v +} + +// getInt32Slice loads a []int32 from p. +// The value returned is aliased with the original slice. +// This behavior differs from the implementation in pointer_reflect.go. +func (p pointer) getInt32Slice() []int32 { + return *(*[]int32)(p.p) +} + +// setInt32Slice stores a []int32 to p. +// The value set is aliased with the input slice. +// This behavior differs from the implementation in pointer_reflect.go. +func (p pointer) setInt32Slice(v []int32) { + *(*[]int32)(p.p) = v +} + +// TODO: Can we get rid of appendInt32Slice and use setInt32Slice instead? +func (p pointer) appendInt32Slice(v int32) { + s := (*[]int32)(p.p) + *s = append(*s, v) +} + +func (p pointer) toUint64() *uint64 { + return (*uint64)(p.p) +} +func (p pointer) toUint64Ptr() **uint64 { + return (**uint64)(p.p) +} +func (p pointer) toUint64Slice() *[]uint64 { + return (*[]uint64)(p.p) +} +func (p pointer) toUint32() *uint32 { + return (*uint32)(p.p) +} +func (p pointer) toUint32Ptr() **uint32 { + return (**uint32)(p.p) +} +func (p pointer) toUint32Slice() *[]uint32 { + return (*[]uint32)(p.p) +} +func (p pointer) toBool() *bool { + return (*bool)(p.p) +} +func (p pointer) toBoolPtr() **bool { + return (**bool)(p.p) +} +func (p pointer) toBoolSlice() *[]bool { + return (*[]bool)(p.p) +} +func (p pointer) toFloat64() *float64 { + return (*float64)(p.p) +} +func (p pointer) toFloat64Ptr() **float64 { + return (**float64)(p.p) +} +func (p pointer) toFloat64Slice() *[]float64 { + return (*[]float64)(p.p) +} +func (p pointer) toFloat32() *float32 { + return (*float32)(p.p) +} +func (p pointer) toFloat32Ptr() **float32 { + return (**float32)(p.p) +} +func (p pointer) toFloat32Slice() *[]float32 { + return (*[]float32)(p.p) +} +func (p pointer) toString() *string { + return (*string)(p.p) +} +func (p pointer) toStringPtr() **string { + return (**string)(p.p) +} +func (p pointer) toStringSlice() *[]string { + return (*[]string)(p.p) +} +func (p pointer) toBytes() *[]byte { + return (*[]byte)(p.p) +} +func (p pointer) toBytesSlice() *[][]byte { + return (*[][]byte)(p.p) +} +func (p pointer) toExtensions() *XXX_InternalExtensions { + return (*XXX_InternalExtensions)(p.p) +} +func (p pointer) toOldExtensions() *map[int32]Extension { + return (*map[int32]Extension)(p.p) +} + +// getPointerSlice loads []*T from p as a []pointer. +// The value returned is aliased with the original slice. +// This behavior differs from the implementation in pointer_reflect.go. +func (p pointer) getPointerSlice() []pointer { + // Super-tricky - p should point to a []*T where T is a + // message type. We load it as []pointer. + return *(*[]pointer)(p.p) +} + +// setPointerSlice stores []pointer into p as a []*T. +// The value set is aliased with the input slice. +// This behavior differs from the implementation in pointer_reflect.go. +func (p pointer) setPointerSlice(v []pointer) { + // Super-tricky - p should point to a []*T where T is a + // message type. We store it as []pointer. + *(*[]pointer)(p.p) = v +} + +// getPointer loads the pointer at p and returns it. +func (p pointer) getPointer() pointer { + return pointer{p: *(*unsafe.Pointer)(p.p)} +} + +// setPointer stores the pointer q at p. +func (p pointer) setPointer(q pointer) { + *(*unsafe.Pointer)(p.p) = q.p +} + +// append q to the slice pointed to by p. +func (p pointer) appendPointer(q pointer) { + s := (*[]unsafe.Pointer)(p.p) + *s = append(*s, q.p) +} + +// getInterfacePointer returns a pointer that points to the +// interface data of the interface pointed by p. +func (p pointer) getInterfacePointer() pointer { + // Super-tricky - read pointer out of data word of interface value. + return pointer{p: (*(*[2]unsafe.Pointer)(p.p))[1]} +} + +// asPointerTo returns a reflect.Value that is a pointer to an +// object of type t stored at p. +func (p pointer) asPointerTo(t reflect.Type) reflect.Value { + return reflect.NewAt(t, p.p) +} + +func atomicLoadUnmarshalInfo(p **unmarshalInfo) *unmarshalInfo { + return (*unmarshalInfo)(atomic.LoadPointer((*unsafe.Pointer)(unsafe.Pointer(p)))) +} +func atomicStoreUnmarshalInfo(p **unmarshalInfo, v *unmarshalInfo) { + atomic.StorePointer((*unsafe.Pointer)(unsafe.Pointer(p)), unsafe.Pointer(v)) +} +func atomicLoadMarshalInfo(p **marshalInfo) *marshalInfo { + return (*marshalInfo)(atomic.LoadPointer((*unsafe.Pointer)(unsafe.Pointer(p)))) +} +func atomicStoreMarshalInfo(p **marshalInfo, v *marshalInfo) { + atomic.StorePointer((*unsafe.Pointer)(unsafe.Pointer(p)), unsafe.Pointer(v)) +} +func atomicLoadMergeInfo(p **mergeInfo) *mergeInfo { + return (*mergeInfo)(atomic.LoadPointer((*unsafe.Pointer)(unsafe.Pointer(p)))) +} +func atomicStoreMergeInfo(p **mergeInfo, v *mergeInfo) { + atomic.StorePointer((*unsafe.Pointer)(unsafe.Pointer(p)), unsafe.Pointer(v)) +} +func atomicLoadDiscardInfo(p **discardInfo) *discardInfo { + return (*discardInfo)(atomic.LoadPointer((*unsafe.Pointer)(unsafe.Pointer(p)))) +} +func atomicStoreDiscardInfo(p **discardInfo, v *discardInfo) { + atomic.StorePointer((*unsafe.Pointer)(unsafe.Pointer(p)), unsafe.Pointer(v)) +} diff --git a/vendor/github.com/gogo/protobuf/proto/pointer_unsafe_gogo.go b/vendor/github.com/gogo/protobuf/proto/pointer_unsafe_gogo.go new file mode 100644 index 00000000..aca8eed0 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/pointer_unsafe_gogo.go @@ -0,0 +1,56 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2018, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +// +build !purego,!appengine,!js + +// This file contains the implementation of the proto field accesses using package unsafe. + +package proto + +import ( + "reflect" + "unsafe" +) + +func (p pointer) getRef() pointer { + return pointer{p: (unsafe.Pointer)(&p.p)} +} + +func (p pointer) appendRef(v pointer, typ reflect.Type) { + slice := p.getSlice(typ) + elem := v.asPointerTo(typ).Elem() + newSlice := reflect.Append(slice, elem) + slice.Set(newSlice) +} + +func (p pointer) getSlice(typ reflect.Type) reflect.Value { + sliceTyp := reflect.SliceOf(typ) + slice := p.asPointerTo(sliceTyp) + slice = slice.Elem() + return slice +} diff --git a/vendor/github.com/gogo/protobuf/proto/properties.go b/vendor/github.com/gogo/protobuf/proto/properties.go new file mode 100644 index 00000000..28da1475 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/properties.go @@ -0,0 +1,610 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2013, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Go support for Protocol Buffers - Google's data interchange format +// +// Copyright 2010 The Go Authors. All rights reserved. +// https://github.com/golang/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// * Neither the name of Google Inc. nor the names of its +// contributors may be used to endorse or promote products derived from +// this software without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package proto + +/* + * Routines for encoding data into the wire format for protocol buffers. + */ + +import ( + "fmt" + "log" + "reflect" + "sort" + "strconv" + "strings" + "sync" +) + +const debug bool = false + +// Constants that identify the encoding of a value on the wire. +const ( + WireVarint = 0 + WireFixed64 = 1 + WireBytes = 2 + WireStartGroup = 3 + WireEndGroup = 4 + WireFixed32 = 5 +) + +// tagMap is an optimization over map[int]int for typical protocol buffer +// use-cases. Encoded protocol buffers are often in tag order with small tag +// numbers. +type tagMap struct { + fastTags []int + slowTags map[int]int +} + +// tagMapFastLimit is the upper bound on the tag number that will be stored in +// the tagMap slice rather than its map. +const tagMapFastLimit = 1024 + +func (p *tagMap) get(t int) (int, bool) { + if t > 0 && t < tagMapFastLimit { + if t >= len(p.fastTags) { + return 0, false + } + fi := p.fastTags[t] + return fi, fi >= 0 + } + fi, ok := p.slowTags[t] + return fi, ok +} + +func (p *tagMap) put(t int, fi int) { + if t > 0 && t < tagMapFastLimit { + for len(p.fastTags) < t+1 { + p.fastTags = append(p.fastTags, -1) + } + p.fastTags[t] = fi + return + } + if p.slowTags == nil { + p.slowTags = make(map[int]int) + } + p.slowTags[t] = fi +} + +// StructProperties represents properties for all the fields of a struct. +// decoderTags and decoderOrigNames should only be used by the decoder. +type StructProperties struct { + Prop []*Properties // properties for each field + reqCount int // required count + decoderTags tagMap // map from proto tag to struct field number + decoderOrigNames map[string]int // map from original name to struct field number + order []int // list of struct field numbers in tag order + + // OneofTypes contains information about the oneof fields in this message. + // It is keyed by the original name of a field. + OneofTypes map[string]*OneofProperties +} + +// OneofProperties represents information about a specific field in a oneof. +type OneofProperties struct { + Type reflect.Type // pointer to generated struct type for this oneof field + Field int // struct field number of the containing oneof in the message + Prop *Properties +} + +// Implement the sorting interface so we can sort the fields in tag order, as recommended by the spec. +// See encode.go, (*Buffer).enc_struct. + +func (sp *StructProperties) Len() int { return len(sp.order) } +func (sp *StructProperties) Less(i, j int) bool { + return sp.Prop[sp.order[i]].Tag < sp.Prop[sp.order[j]].Tag +} +func (sp *StructProperties) Swap(i, j int) { sp.order[i], sp.order[j] = sp.order[j], sp.order[i] } + +// Properties represents the protocol-specific behavior of a single struct field. +type Properties struct { + Name string // name of the field, for error messages + OrigName string // original name before protocol compiler (always set) + JSONName string // name to use for JSON; determined by protoc + Wire string + WireType int + Tag int + Required bool + Optional bool + Repeated bool + Packed bool // relevant for repeated primitives only + Enum string // set for enum types only + proto3 bool // whether this is known to be a proto3 field + oneof bool // whether this is a oneof field + + Default string // default value + HasDefault bool // whether an explicit default was provided + CustomType string + CastType string + StdTime bool + StdDuration bool + WktPointer bool + + stype reflect.Type // set for struct types only + ctype reflect.Type // set for custom types only + sprop *StructProperties // set for struct types only + + mtype reflect.Type // set for map types only + MapKeyProp *Properties // set for map types only + MapValProp *Properties // set for map types only +} + +// String formats the properties in the protobuf struct field tag style. +func (p *Properties) String() string { + s := p.Wire + s += "," + s += strconv.Itoa(p.Tag) + if p.Required { + s += ",req" + } + if p.Optional { + s += ",opt" + } + if p.Repeated { + s += ",rep" + } + if p.Packed { + s += ",packed" + } + s += ",name=" + p.OrigName + if p.JSONName != p.OrigName { + s += ",json=" + p.JSONName + } + if p.proto3 { + s += ",proto3" + } + if p.oneof { + s += ",oneof" + } + if len(p.Enum) > 0 { + s += ",enum=" + p.Enum + } + if p.HasDefault { + s += ",def=" + p.Default + } + return s +} + +// Parse populates p by parsing a string in the protobuf struct field tag style. +func (p *Properties) Parse(s string) { + // "bytes,49,opt,name=foo,def=hello!" + fields := strings.Split(s, ",") // breaks def=, but handled below. + if len(fields) < 2 { + log.Printf("proto: tag has too few fields: %q", s) + return + } + + p.Wire = fields[0] + switch p.Wire { + case "varint": + p.WireType = WireVarint + case "fixed32": + p.WireType = WireFixed32 + case "fixed64": + p.WireType = WireFixed64 + case "zigzag32": + p.WireType = WireVarint + case "zigzag64": + p.WireType = WireVarint + case "bytes", "group": + p.WireType = WireBytes + // no numeric converter for non-numeric types + default: + log.Printf("proto: tag has unknown wire type: %q", s) + return + } + + var err error + p.Tag, err = strconv.Atoi(fields[1]) + if err != nil { + return + } + +outer: + for i := 2; i < len(fields); i++ { + f := fields[i] + switch { + case f == "req": + p.Required = true + case f == "opt": + p.Optional = true + case f == "rep": + p.Repeated = true + case f == "packed": + p.Packed = true + case strings.HasPrefix(f, "name="): + p.OrigName = f[5:] + case strings.HasPrefix(f, "json="): + p.JSONName = f[5:] + case strings.HasPrefix(f, "enum="): + p.Enum = f[5:] + case f == "proto3": + p.proto3 = true + case f == "oneof": + p.oneof = true + case strings.HasPrefix(f, "def="): + p.HasDefault = true + p.Default = f[4:] // rest of string + if i+1 < len(fields) { + // Commas aren't escaped, and def is always last. + p.Default += "," + strings.Join(fields[i+1:], ",") + break outer + } + case strings.HasPrefix(f, "embedded="): + p.OrigName = strings.Split(f, "=")[1] + case strings.HasPrefix(f, "customtype="): + p.CustomType = strings.Split(f, "=")[1] + case strings.HasPrefix(f, "casttype="): + p.CastType = strings.Split(f, "=")[1] + case f == "stdtime": + p.StdTime = true + case f == "stdduration": + p.StdDuration = true + case f == "wktptr": + p.WktPointer = true + } + } +} + +var protoMessageType = reflect.TypeOf((*Message)(nil)).Elem() + +// setFieldProps initializes the field properties for submessages and maps. +func (p *Properties) setFieldProps(typ reflect.Type, f *reflect.StructField, lockGetProp bool) { + isMap := typ.Kind() == reflect.Map + if len(p.CustomType) > 0 && !isMap { + p.ctype = typ + p.setTag(lockGetProp) + return + } + if p.StdTime && !isMap { + p.setTag(lockGetProp) + return + } + if p.StdDuration && !isMap { + p.setTag(lockGetProp) + return + } + if p.WktPointer && !isMap { + p.setTag(lockGetProp) + return + } + switch t1 := typ; t1.Kind() { + case reflect.Struct: + p.stype = typ + case reflect.Ptr: + if t1.Elem().Kind() == reflect.Struct { + p.stype = t1.Elem() + } + case reflect.Slice: + switch t2 := t1.Elem(); t2.Kind() { + case reflect.Ptr: + switch t3 := t2.Elem(); t3.Kind() { + case reflect.Struct: + p.stype = t3 + } + case reflect.Struct: + p.stype = t2 + } + + case reflect.Map: + + p.mtype = t1 + p.MapKeyProp = &Properties{} + p.MapKeyProp.init(reflect.PtrTo(p.mtype.Key()), "Key", f.Tag.Get("protobuf_key"), nil, lockGetProp) + p.MapValProp = &Properties{} + vtype := p.mtype.Elem() + if vtype.Kind() != reflect.Ptr && vtype.Kind() != reflect.Slice { + // The value type is not a message (*T) or bytes ([]byte), + // so we need encoders for the pointer to this type. + vtype = reflect.PtrTo(vtype) + } + + p.MapValProp.CustomType = p.CustomType + p.MapValProp.StdDuration = p.StdDuration + p.MapValProp.StdTime = p.StdTime + p.MapValProp.WktPointer = p.WktPointer + p.MapValProp.init(vtype, "Value", f.Tag.Get("protobuf_val"), nil, lockGetProp) + } + p.setTag(lockGetProp) +} + +func (p *Properties) setTag(lockGetProp bool) { + if p.stype != nil { + if lockGetProp { + p.sprop = GetProperties(p.stype) + } else { + p.sprop = getPropertiesLocked(p.stype) + } + } +} + +var ( + marshalerType = reflect.TypeOf((*Marshaler)(nil)).Elem() +) + +// Init populates the properties from a protocol buffer struct tag. +func (p *Properties) Init(typ reflect.Type, name, tag string, f *reflect.StructField) { + p.init(typ, name, tag, f, true) +} + +func (p *Properties) init(typ reflect.Type, name, tag string, f *reflect.StructField, lockGetProp bool) { + // "bytes,49,opt,def=hello!" + p.Name = name + p.OrigName = name + if tag == "" { + return + } + p.Parse(tag) + p.setFieldProps(typ, f, lockGetProp) +} + +var ( + propertiesMu sync.RWMutex + propertiesMap = make(map[reflect.Type]*StructProperties) +) + +// GetProperties returns the list of properties for the type represented by t. +// t must represent a generated struct type of a protocol message. +func GetProperties(t reflect.Type) *StructProperties { + if t.Kind() != reflect.Struct { + panic("proto: type must have kind struct") + } + + // Most calls to GetProperties in a long-running program will be + // retrieving details for types we have seen before. + propertiesMu.RLock() + sprop, ok := propertiesMap[t] + propertiesMu.RUnlock() + if ok { + return sprop + } + + propertiesMu.Lock() + sprop = getPropertiesLocked(t) + propertiesMu.Unlock() + return sprop +} + +type ( + oneofFuncsIface interface { + XXX_OneofFuncs() (func(Message, *Buffer) error, func(Message, int, int, *Buffer) (bool, error), func(Message) int, []interface{}) + } + oneofWrappersIface interface { + XXX_OneofWrappers() []interface{} + } +) + +// getPropertiesLocked requires that propertiesMu is held. +func getPropertiesLocked(t reflect.Type) *StructProperties { + if prop, ok := propertiesMap[t]; ok { + return prop + } + + prop := new(StructProperties) + // in case of recursive protos, fill this in now. + propertiesMap[t] = prop + + // build properties + prop.Prop = make([]*Properties, t.NumField()) + prop.order = make([]int, t.NumField()) + + isOneofMessage := false + for i := 0; i < t.NumField(); i++ { + f := t.Field(i) + p := new(Properties) + name := f.Name + p.init(f.Type, name, f.Tag.Get("protobuf"), &f, false) + + oneof := f.Tag.Get("protobuf_oneof") // special case + if oneof != "" { + isOneofMessage = true + // Oneof fields don't use the traditional protobuf tag. + p.OrigName = oneof + } + prop.Prop[i] = p + prop.order[i] = i + if debug { + print(i, " ", f.Name, " ", t.String(), " ") + if p.Tag > 0 { + print(p.String()) + } + print("\n") + } + } + + // Re-order prop.order. + sort.Sort(prop) + + if isOneofMessage { + var oots []interface{} + switch m := reflect.Zero(reflect.PtrTo(t)).Interface().(type) { + case oneofFuncsIface: + _, _, _, oots = m.XXX_OneofFuncs() + case oneofWrappersIface: + oots = m.XXX_OneofWrappers() + } + if len(oots) > 0 { + // Interpret oneof metadata. + prop.OneofTypes = make(map[string]*OneofProperties) + for _, oot := range oots { + oop := &OneofProperties{ + Type: reflect.ValueOf(oot).Type(), // *T + Prop: new(Properties), + } + sft := oop.Type.Elem().Field(0) + oop.Prop.Name = sft.Name + oop.Prop.Parse(sft.Tag.Get("protobuf")) + // There will be exactly one interface field that + // this new value is assignable to. + for i := 0; i < t.NumField(); i++ { + f := t.Field(i) + if f.Type.Kind() != reflect.Interface { + continue + } + if !oop.Type.AssignableTo(f.Type) { + continue + } + oop.Field = i + break + } + prop.OneofTypes[oop.Prop.OrigName] = oop + } + } + } + + // build required counts + // build tags + reqCount := 0 + prop.decoderOrigNames = make(map[string]int) + for i, p := range prop.Prop { + if strings.HasPrefix(p.Name, "XXX_") { + // Internal fields should not appear in tags/origNames maps. + // They are handled specially when encoding and decoding. + continue + } + if p.Required { + reqCount++ + } + prop.decoderTags.put(p.Tag, i) + prop.decoderOrigNames[p.OrigName] = i + } + prop.reqCount = reqCount + + return prop +} + +// A global registry of enum types. +// The generated code will register the generated maps by calling RegisterEnum. + +var enumValueMaps = make(map[string]map[string]int32) +var enumStringMaps = make(map[string]map[int32]string) + +// RegisterEnum is called from the generated code to install the enum descriptor +// maps into the global table to aid parsing text format protocol buffers. +func RegisterEnum(typeName string, unusedNameMap map[int32]string, valueMap map[string]int32) { + if _, ok := enumValueMaps[typeName]; ok { + panic("proto: duplicate enum registered: " + typeName) + } + enumValueMaps[typeName] = valueMap + if _, ok := enumStringMaps[typeName]; ok { + panic("proto: duplicate enum registered: " + typeName) + } + enumStringMaps[typeName] = unusedNameMap +} + +// EnumValueMap returns the mapping from names to integers of the +// enum type enumType, or a nil if not found. +func EnumValueMap(enumType string) map[string]int32 { + return enumValueMaps[enumType] +} + +// A registry of all linked message types. +// The string is a fully-qualified proto name ("pkg.Message"). +var ( + protoTypedNils = make(map[string]Message) // a map from proto names to typed nil pointers + protoMapTypes = make(map[string]reflect.Type) // a map from proto names to map types + revProtoTypes = make(map[reflect.Type]string) +) + +// RegisterType is called from generated code and maps from the fully qualified +// proto name to the type (pointer to struct) of the protocol buffer. +func RegisterType(x Message, name string) { + if _, ok := protoTypedNils[name]; ok { + // TODO: Some day, make this a panic. + log.Printf("proto: duplicate proto type registered: %s", name) + return + } + t := reflect.TypeOf(x) + if v := reflect.ValueOf(x); v.Kind() == reflect.Ptr && v.Pointer() == 0 { + // Generated code always calls RegisterType with nil x. + // This check is just for extra safety. + protoTypedNils[name] = x + } else { + protoTypedNils[name] = reflect.Zero(t).Interface().(Message) + } + revProtoTypes[t] = name +} + +// RegisterMapType is called from generated code and maps from the fully qualified +// proto name to the native map type of the proto map definition. +func RegisterMapType(x interface{}, name string) { + if reflect.TypeOf(x).Kind() != reflect.Map { + panic(fmt.Sprintf("RegisterMapType(%T, %q); want map", x, name)) + } + if _, ok := protoMapTypes[name]; ok { + log.Printf("proto: duplicate proto type registered: %s", name) + return + } + t := reflect.TypeOf(x) + protoMapTypes[name] = t + revProtoTypes[t] = name +} + +// MessageName returns the fully-qualified proto name for the given message type. +func MessageName(x Message) string { + type xname interface { + XXX_MessageName() string + } + if m, ok := x.(xname); ok { + return m.XXX_MessageName() + } + return revProtoTypes[reflect.TypeOf(x)] +} + +// MessageType returns the message type (pointer to struct) for a named message. +// The type is not guaranteed to implement proto.Message if the name refers to a +// map entry. +func MessageType(name string) reflect.Type { + if t, ok := protoTypedNils[name]; ok { + return reflect.TypeOf(t) + } + return protoMapTypes[name] +} + +// A registry of all linked proto files. +var ( + protoFiles = make(map[string][]byte) // file name => fileDescriptor +) + +// RegisterFile is called from generated code and maps from the +// full file name of a .proto file to its compressed FileDescriptorProto. +func RegisterFile(filename string, fileDescriptor []byte) { + protoFiles[filename] = fileDescriptor +} + +// FileDescriptor returns the compressed FileDescriptorProto for a .proto file. +func FileDescriptor(filename string) []byte { return protoFiles[filename] } diff --git a/vendor/github.com/gogo/protobuf/proto/properties_gogo.go b/vendor/github.com/gogo/protobuf/proto/properties_gogo.go new file mode 100644 index 00000000..40ea3dd9 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/properties_gogo.go @@ -0,0 +1,36 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2018, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package proto + +import ( + "reflect" +) + +var sizerType = reflect.TypeOf((*Sizer)(nil)).Elem() +var protosizerType = reflect.TypeOf((*ProtoSizer)(nil)).Elem() diff --git a/vendor/github.com/gogo/protobuf/proto/skip_gogo.go b/vendor/github.com/gogo/protobuf/proto/skip_gogo.go new file mode 100644 index 00000000..5a5fd93f --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/skip_gogo.go @@ -0,0 +1,119 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2013, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package proto + +import ( + "fmt" + "io" +) + +func Skip(data []byte) (n int, err error) { + l := len(data) + index := 0 + for index < l { + var wire uint64 + for shift := uint(0); ; shift += 7 { + if index >= l { + return 0, io.ErrUnexpectedEOF + } + b := data[index] + index++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + wireType := int(wire & 0x7) + switch wireType { + case 0: + for { + if index >= l { + return 0, io.ErrUnexpectedEOF + } + index++ + if data[index-1] < 0x80 { + break + } + } + return index, nil + case 1: + index += 8 + return index, nil + case 2: + var length int + for shift := uint(0); ; shift += 7 { + if index >= l { + return 0, io.ErrUnexpectedEOF + } + b := data[index] + index++ + length |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + index += length + return index, nil + case 3: + for { + var innerWire uint64 + var start int = index + for shift := uint(0); ; shift += 7 { + if index >= l { + return 0, io.ErrUnexpectedEOF + } + b := data[index] + index++ + innerWire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + innerWireType := int(innerWire & 0x7) + if innerWireType == 4 { + break + } + next, err := Skip(data[start:]) + if err != nil { + return 0, err + } + index = start + next + } + return index, nil + case 4: + return index, nil + case 5: + index += 4 + return index, nil + default: + return 0, fmt.Errorf("proto: illegal wireType %d", wireType) + } + } + panic("unreachable") +} diff --git a/vendor/github.com/gogo/protobuf/proto/table_marshal.go b/vendor/github.com/gogo/protobuf/proto/table_marshal.go new file mode 100644 index 00000000..f8babdef --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/table_marshal.go @@ -0,0 +1,3009 @@ +// Go support for Protocol Buffers - Google's data interchange format +// +// Copyright 2016 The Go Authors. All rights reserved. +// https://github.com/golang/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// * Neither the name of Google Inc. nor the names of its +// contributors may be used to endorse or promote products derived from +// this software without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package proto + +import ( + "errors" + "fmt" + "math" + "reflect" + "sort" + "strconv" + "strings" + "sync" + "sync/atomic" + "unicode/utf8" +) + +// a sizer takes a pointer to a field and the size of its tag, computes the size of +// the encoded data. +type sizer func(pointer, int) int + +// a marshaler takes a byte slice, a pointer to a field, and its tag (in wire format), +// marshals the field to the end of the slice, returns the slice and error (if any). +type marshaler func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) + +// marshalInfo is the information used for marshaling a message. +type marshalInfo struct { + typ reflect.Type + fields []*marshalFieldInfo + unrecognized field // offset of XXX_unrecognized + extensions field // offset of XXX_InternalExtensions + v1extensions field // offset of XXX_extensions + sizecache field // offset of XXX_sizecache + initialized int32 // 0 -- only typ is set, 1 -- fully initialized + messageset bool // uses message set wire format + hasmarshaler bool // has custom marshaler + sync.RWMutex // protect extElems map, also for initialization + extElems map[int32]*marshalElemInfo // info of extension elements + + hassizer bool // has custom sizer + hasprotosizer bool // has custom protosizer + + bytesExtensions field // offset of XXX_extensions where the field type is []byte +} + +// marshalFieldInfo is the information used for marshaling a field of a message. +type marshalFieldInfo struct { + field field + wiretag uint64 // tag in wire format + tagsize int // size of tag in wire format + sizer sizer + marshaler marshaler + isPointer bool + required bool // field is required + name string // name of the field, for error reporting + oneofElems map[reflect.Type]*marshalElemInfo // info of oneof elements +} + +// marshalElemInfo is the information used for marshaling an extension or oneof element. +type marshalElemInfo struct { + wiretag uint64 // tag in wire format + tagsize int // size of tag in wire format + sizer sizer + marshaler marshaler + isptr bool // elem is pointer typed, thus interface of this type is a direct interface (extension only) +} + +var ( + marshalInfoMap = map[reflect.Type]*marshalInfo{} + marshalInfoLock sync.Mutex + + uint8SliceType = reflect.TypeOf(([]uint8)(nil)).Kind() +) + +// getMarshalInfo returns the information to marshal a given type of message. +// The info it returns may not necessarily initialized. +// t is the type of the message (NOT the pointer to it). +func getMarshalInfo(t reflect.Type) *marshalInfo { + marshalInfoLock.Lock() + u, ok := marshalInfoMap[t] + if !ok { + u = &marshalInfo{typ: t} + marshalInfoMap[t] = u + } + marshalInfoLock.Unlock() + return u +} + +// Size is the entry point from generated code, +// and should be ONLY called by generated code. +// It computes the size of encoded data of msg. +// a is a pointer to a place to store cached marshal info. +func (a *InternalMessageInfo) Size(msg Message) int { + u := getMessageMarshalInfo(msg, a) + ptr := toPointer(&msg) + if ptr.isNil() { + // We get here if msg is a typed nil ((*SomeMessage)(nil)), + // so it satisfies the interface, and msg == nil wouldn't + // catch it. We don't want crash in this case. + return 0 + } + return u.size(ptr) +} + +// Marshal is the entry point from generated code, +// and should be ONLY called by generated code. +// It marshals msg to the end of b. +// a is a pointer to a place to store cached marshal info. +func (a *InternalMessageInfo) Marshal(b []byte, msg Message, deterministic bool) ([]byte, error) { + u := getMessageMarshalInfo(msg, a) + ptr := toPointer(&msg) + if ptr.isNil() { + // We get here if msg is a typed nil ((*SomeMessage)(nil)), + // so it satisfies the interface, and msg == nil wouldn't + // catch it. We don't want crash in this case. + return b, ErrNil + } + return u.marshal(b, ptr, deterministic) +} + +func getMessageMarshalInfo(msg interface{}, a *InternalMessageInfo) *marshalInfo { + // u := a.marshal, but atomically. + // We use an atomic here to ensure memory consistency. + u := atomicLoadMarshalInfo(&a.marshal) + if u == nil { + // Get marshal information from type of message. + t := reflect.ValueOf(msg).Type() + if t.Kind() != reflect.Ptr { + panic(fmt.Sprintf("cannot handle non-pointer message type %v", t)) + } + u = getMarshalInfo(t.Elem()) + // Store it in the cache for later users. + // a.marshal = u, but atomically. + atomicStoreMarshalInfo(&a.marshal, u) + } + return u +} + +// size is the main function to compute the size of the encoded data of a message. +// ptr is the pointer to the message. +func (u *marshalInfo) size(ptr pointer) int { + if atomic.LoadInt32(&u.initialized) == 0 { + u.computeMarshalInfo() + } + + // If the message can marshal itself, let it do it, for compatibility. + // NOTE: This is not efficient. + if u.hasmarshaler { + // Uses the message's Size method if available + if u.hassizer { + s := ptr.asPointerTo(u.typ).Interface().(Sizer) + return s.Size() + } + // Uses the message's ProtoSize method if available + if u.hasprotosizer { + s := ptr.asPointerTo(u.typ).Interface().(ProtoSizer) + return s.ProtoSize() + } + + m := ptr.asPointerTo(u.typ).Interface().(Marshaler) + b, _ := m.Marshal() + return len(b) + } + + n := 0 + for _, f := range u.fields { + if f.isPointer && ptr.offset(f.field).getPointer().isNil() { + // nil pointer always marshals to nothing + continue + } + n += f.sizer(ptr.offset(f.field), f.tagsize) + } + if u.extensions.IsValid() { + e := ptr.offset(u.extensions).toExtensions() + if u.messageset { + n += u.sizeMessageSet(e) + } else { + n += u.sizeExtensions(e) + } + } + if u.v1extensions.IsValid() { + m := *ptr.offset(u.v1extensions).toOldExtensions() + n += u.sizeV1Extensions(m) + } + if u.bytesExtensions.IsValid() { + s := *ptr.offset(u.bytesExtensions).toBytes() + n += len(s) + } + if u.unrecognized.IsValid() { + s := *ptr.offset(u.unrecognized).toBytes() + n += len(s) + } + + // cache the result for use in marshal + if u.sizecache.IsValid() { + atomic.StoreInt32(ptr.offset(u.sizecache).toInt32(), int32(n)) + } + return n +} + +// cachedsize gets the size from cache. If there is no cache (i.e. message is not generated), +// fall back to compute the size. +func (u *marshalInfo) cachedsize(ptr pointer) int { + if u.sizecache.IsValid() { + return int(atomic.LoadInt32(ptr.offset(u.sizecache).toInt32())) + } + return u.size(ptr) +} + +// marshal is the main function to marshal a message. It takes a byte slice and appends +// the encoded data to the end of the slice, returns the slice and error (if any). +// ptr is the pointer to the message. +// If deterministic is true, map is marshaled in deterministic order. +func (u *marshalInfo) marshal(b []byte, ptr pointer, deterministic bool) ([]byte, error) { + if atomic.LoadInt32(&u.initialized) == 0 { + u.computeMarshalInfo() + } + + // If the message can marshal itself, let it do it, for compatibility. + // NOTE: This is not efficient. + if u.hasmarshaler { + m := ptr.asPointerTo(u.typ).Interface().(Marshaler) + b1, err := m.Marshal() + b = append(b, b1...) + return b, err + } + + var err, errLater error + // The old marshaler encodes extensions at beginning. + if u.extensions.IsValid() { + e := ptr.offset(u.extensions).toExtensions() + if u.messageset { + b, err = u.appendMessageSet(b, e, deterministic) + } else { + b, err = u.appendExtensions(b, e, deterministic) + } + if err != nil { + return b, err + } + } + if u.v1extensions.IsValid() { + m := *ptr.offset(u.v1extensions).toOldExtensions() + b, err = u.appendV1Extensions(b, m, deterministic) + if err != nil { + return b, err + } + } + if u.bytesExtensions.IsValid() { + s := *ptr.offset(u.bytesExtensions).toBytes() + b = append(b, s...) + } + for _, f := range u.fields { + if f.required { + if f.isPointer && ptr.offset(f.field).getPointer().isNil() { + // Required field is not set. + // We record the error but keep going, to give a complete marshaling. + if errLater == nil { + errLater = &RequiredNotSetError{f.name} + } + continue + } + } + if f.isPointer && ptr.offset(f.field).getPointer().isNil() { + // nil pointer always marshals to nothing + continue + } + b, err = f.marshaler(b, ptr.offset(f.field), f.wiretag, deterministic) + if err != nil { + if err1, ok := err.(*RequiredNotSetError); ok { + // Required field in submessage is not set. + // We record the error but keep going, to give a complete marshaling. + if errLater == nil { + errLater = &RequiredNotSetError{f.name + "." + err1.field} + } + continue + } + if err == errRepeatedHasNil { + err = errors.New("proto: repeated field " + f.name + " has nil element") + } + if err == errInvalidUTF8 { + if errLater == nil { + fullName := revProtoTypes[reflect.PtrTo(u.typ)] + "." + f.name + errLater = &invalidUTF8Error{fullName} + } + continue + } + return b, err + } + } + if u.unrecognized.IsValid() { + s := *ptr.offset(u.unrecognized).toBytes() + b = append(b, s...) + } + return b, errLater +} + +// computeMarshalInfo initializes the marshal info. +func (u *marshalInfo) computeMarshalInfo() { + u.Lock() + defer u.Unlock() + if u.initialized != 0 { // non-atomic read is ok as it is protected by the lock + return + } + + t := u.typ + u.unrecognized = invalidField + u.extensions = invalidField + u.v1extensions = invalidField + u.bytesExtensions = invalidField + u.sizecache = invalidField + isOneofMessage := false + + if reflect.PtrTo(t).Implements(sizerType) { + u.hassizer = true + } + if reflect.PtrTo(t).Implements(protosizerType) { + u.hasprotosizer = true + } + // If the message can marshal itself, let it do it, for compatibility. + // NOTE: This is not efficient. + if reflect.PtrTo(t).Implements(marshalerType) { + u.hasmarshaler = true + atomic.StoreInt32(&u.initialized, 1) + return + } + + n := t.NumField() + + // deal with XXX fields first + for i := 0; i < t.NumField(); i++ { + f := t.Field(i) + if f.Tag.Get("protobuf_oneof") != "" { + isOneofMessage = true + } + if !strings.HasPrefix(f.Name, "XXX_") { + continue + } + switch f.Name { + case "XXX_sizecache": + u.sizecache = toField(&f) + case "XXX_unrecognized": + u.unrecognized = toField(&f) + case "XXX_InternalExtensions": + u.extensions = toField(&f) + u.messageset = f.Tag.Get("protobuf_messageset") == "1" + case "XXX_extensions": + if f.Type.Kind() == reflect.Map { + u.v1extensions = toField(&f) + } else { + u.bytesExtensions = toField(&f) + } + case "XXX_NoUnkeyedLiteral": + // nothing to do + default: + panic("unknown XXX field: " + f.Name) + } + n-- + } + + // get oneof implementers + var oneofImplementers []interface{} + // gogo: isOneofMessage is needed for embedded oneof messages, without a marshaler and unmarshaler + if isOneofMessage { + switch m := reflect.Zero(reflect.PtrTo(t)).Interface().(type) { + case oneofFuncsIface: + _, _, _, oneofImplementers = m.XXX_OneofFuncs() + case oneofWrappersIface: + oneofImplementers = m.XXX_OneofWrappers() + } + } + + // normal fields + fields := make([]marshalFieldInfo, n) // batch allocation + u.fields = make([]*marshalFieldInfo, 0, n) + for i, j := 0, 0; i < t.NumField(); i++ { + f := t.Field(i) + + if strings.HasPrefix(f.Name, "XXX_") { + continue + } + field := &fields[j] + j++ + field.name = f.Name + u.fields = append(u.fields, field) + if f.Tag.Get("protobuf_oneof") != "" { + field.computeOneofFieldInfo(&f, oneofImplementers) + continue + } + if f.Tag.Get("protobuf") == "" { + // field has no tag (not in generated message), ignore it + u.fields = u.fields[:len(u.fields)-1] + j-- + continue + } + field.computeMarshalFieldInfo(&f) + } + + // fields are marshaled in tag order on the wire. + sort.Sort(byTag(u.fields)) + + atomic.StoreInt32(&u.initialized, 1) +} + +// helper for sorting fields by tag +type byTag []*marshalFieldInfo + +func (a byTag) Len() int { return len(a) } +func (a byTag) Swap(i, j int) { a[i], a[j] = a[j], a[i] } +func (a byTag) Less(i, j int) bool { return a[i].wiretag < a[j].wiretag } + +// getExtElemInfo returns the information to marshal an extension element. +// The info it returns is initialized. +func (u *marshalInfo) getExtElemInfo(desc *ExtensionDesc) *marshalElemInfo { + // get from cache first + u.RLock() + e, ok := u.extElems[desc.Field] + u.RUnlock() + if ok { + return e + } + + t := reflect.TypeOf(desc.ExtensionType) // pointer or slice to basic type or struct + tags := strings.Split(desc.Tag, ",") + tag, err := strconv.Atoi(tags[1]) + if err != nil { + panic("tag is not an integer") + } + wt := wiretype(tags[0]) + sizr, marshalr := typeMarshaler(t, tags, false, false) + e = &marshalElemInfo{ + wiretag: uint64(tag)<<3 | wt, + tagsize: SizeVarint(uint64(tag) << 3), + sizer: sizr, + marshaler: marshalr, + isptr: t.Kind() == reflect.Ptr, + } + + // update cache + u.Lock() + if u.extElems == nil { + u.extElems = make(map[int32]*marshalElemInfo) + } + u.extElems[desc.Field] = e + u.Unlock() + return e +} + +// computeMarshalFieldInfo fills up the information to marshal a field. +func (fi *marshalFieldInfo) computeMarshalFieldInfo(f *reflect.StructField) { + // parse protobuf tag of the field. + // tag has format of "bytes,49,opt,name=foo,def=hello!" + tags := strings.Split(f.Tag.Get("protobuf"), ",") + if tags[0] == "" { + return + } + tag, err := strconv.Atoi(tags[1]) + if err != nil { + panic("tag is not an integer") + } + wt := wiretype(tags[0]) + if tags[2] == "req" { + fi.required = true + } + fi.setTag(f, tag, wt) + fi.setMarshaler(f, tags) +} + +func (fi *marshalFieldInfo) computeOneofFieldInfo(f *reflect.StructField, oneofImplementers []interface{}) { + fi.field = toField(f) + fi.wiretag = math.MaxInt32 // Use a large tag number, make oneofs sorted at the end. This tag will not appear on the wire. + fi.isPointer = true + fi.sizer, fi.marshaler = makeOneOfMarshaler(fi, f) + fi.oneofElems = make(map[reflect.Type]*marshalElemInfo) + + ityp := f.Type // interface type + for _, o := range oneofImplementers { + t := reflect.TypeOf(o) + if !t.Implements(ityp) { + continue + } + sf := t.Elem().Field(0) // oneof implementer is a struct with a single field + tags := strings.Split(sf.Tag.Get("protobuf"), ",") + tag, err := strconv.Atoi(tags[1]) + if err != nil { + panic("tag is not an integer") + } + wt := wiretype(tags[0]) + sizr, marshalr := typeMarshaler(sf.Type, tags, false, true) // oneof should not omit any zero value + fi.oneofElems[t.Elem()] = &marshalElemInfo{ + wiretag: uint64(tag)<<3 | wt, + tagsize: SizeVarint(uint64(tag) << 3), + sizer: sizr, + marshaler: marshalr, + } + } +} + +// wiretype returns the wire encoding of the type. +func wiretype(encoding string) uint64 { + switch encoding { + case "fixed32": + return WireFixed32 + case "fixed64": + return WireFixed64 + case "varint", "zigzag32", "zigzag64": + return WireVarint + case "bytes": + return WireBytes + case "group": + return WireStartGroup + } + panic("unknown wire type " + encoding) +} + +// setTag fills up the tag (in wire format) and its size in the info of a field. +func (fi *marshalFieldInfo) setTag(f *reflect.StructField, tag int, wt uint64) { + fi.field = toField(f) + fi.wiretag = uint64(tag)<<3 | wt + fi.tagsize = SizeVarint(uint64(tag) << 3) +} + +// setMarshaler fills up the sizer and marshaler in the info of a field. +func (fi *marshalFieldInfo) setMarshaler(f *reflect.StructField, tags []string) { + switch f.Type.Kind() { + case reflect.Map: + // map field + fi.isPointer = true + fi.sizer, fi.marshaler = makeMapMarshaler(f) + return + case reflect.Ptr, reflect.Slice: + fi.isPointer = true + } + fi.sizer, fi.marshaler = typeMarshaler(f.Type, tags, true, false) +} + +// typeMarshaler returns the sizer and marshaler of a given field. +// t is the type of the field. +// tags is the generated "protobuf" tag of the field. +// If nozero is true, zero value is not marshaled to the wire. +// If oneof is true, it is a oneof field. +func typeMarshaler(t reflect.Type, tags []string, nozero, oneof bool) (sizer, marshaler) { + encoding := tags[0] + + pointer := false + slice := false + if t.Kind() == reflect.Slice && t.Elem().Kind() != reflect.Uint8 { + slice = true + t = t.Elem() + } + if t.Kind() == reflect.Ptr { + pointer = true + t = t.Elem() + } + + packed := false + proto3 := false + ctype := false + isTime := false + isDuration := false + isWktPointer := false + validateUTF8 := true + for i := 2; i < len(tags); i++ { + if tags[i] == "packed" { + packed = true + } + if tags[i] == "proto3" { + proto3 = true + } + if strings.HasPrefix(tags[i], "customtype=") { + ctype = true + } + if tags[i] == "stdtime" { + isTime = true + } + if tags[i] == "stdduration" { + isDuration = true + } + if tags[i] == "wktptr" { + isWktPointer = true + } + } + validateUTF8 = validateUTF8 && proto3 + if !proto3 && !pointer && !slice { + nozero = false + } + + if ctype { + if reflect.PtrTo(t).Implements(customType) { + if slice { + return makeMessageRefSliceMarshaler(getMarshalInfo(t)) + } + if pointer { + return makeCustomPtrMarshaler(getMarshalInfo(t)) + } + return makeCustomMarshaler(getMarshalInfo(t)) + } else { + panic(fmt.Sprintf("custom type: type: %v, does not implement the proto.custom interface", t)) + } + } + + if isTime { + if pointer { + if slice { + return makeTimePtrSliceMarshaler(getMarshalInfo(t)) + } + return makeTimePtrMarshaler(getMarshalInfo(t)) + } + if slice { + return makeTimeSliceMarshaler(getMarshalInfo(t)) + } + return makeTimeMarshaler(getMarshalInfo(t)) + } + + if isDuration { + if pointer { + if slice { + return makeDurationPtrSliceMarshaler(getMarshalInfo(t)) + } + return makeDurationPtrMarshaler(getMarshalInfo(t)) + } + if slice { + return makeDurationSliceMarshaler(getMarshalInfo(t)) + } + return makeDurationMarshaler(getMarshalInfo(t)) + } + + if isWktPointer { + switch t.Kind() { + case reflect.Float64: + if pointer { + if slice { + return makeStdDoubleValuePtrSliceMarshaler(getMarshalInfo(t)) + } + return makeStdDoubleValuePtrMarshaler(getMarshalInfo(t)) + } + if slice { + return makeStdDoubleValueSliceMarshaler(getMarshalInfo(t)) + } + return makeStdDoubleValueMarshaler(getMarshalInfo(t)) + case reflect.Float32: + if pointer { + if slice { + return makeStdFloatValuePtrSliceMarshaler(getMarshalInfo(t)) + } + return makeStdFloatValuePtrMarshaler(getMarshalInfo(t)) + } + if slice { + return makeStdFloatValueSliceMarshaler(getMarshalInfo(t)) + } + return makeStdFloatValueMarshaler(getMarshalInfo(t)) + case reflect.Int64: + if pointer { + if slice { + return makeStdInt64ValuePtrSliceMarshaler(getMarshalInfo(t)) + } + return makeStdInt64ValuePtrMarshaler(getMarshalInfo(t)) + } + if slice { + return makeStdInt64ValueSliceMarshaler(getMarshalInfo(t)) + } + return makeStdInt64ValueMarshaler(getMarshalInfo(t)) + case reflect.Uint64: + if pointer { + if slice { + return makeStdUInt64ValuePtrSliceMarshaler(getMarshalInfo(t)) + } + return makeStdUInt64ValuePtrMarshaler(getMarshalInfo(t)) + } + if slice { + return makeStdUInt64ValueSliceMarshaler(getMarshalInfo(t)) + } + return makeStdUInt64ValueMarshaler(getMarshalInfo(t)) + case reflect.Int32: + if pointer { + if slice { + return makeStdInt32ValuePtrSliceMarshaler(getMarshalInfo(t)) + } + return makeStdInt32ValuePtrMarshaler(getMarshalInfo(t)) + } + if slice { + return makeStdInt32ValueSliceMarshaler(getMarshalInfo(t)) + } + return makeStdInt32ValueMarshaler(getMarshalInfo(t)) + case reflect.Uint32: + if pointer { + if slice { + return makeStdUInt32ValuePtrSliceMarshaler(getMarshalInfo(t)) + } + return makeStdUInt32ValuePtrMarshaler(getMarshalInfo(t)) + } + if slice { + return makeStdUInt32ValueSliceMarshaler(getMarshalInfo(t)) + } + return makeStdUInt32ValueMarshaler(getMarshalInfo(t)) + case reflect.Bool: + if pointer { + if slice { + return makeStdBoolValuePtrSliceMarshaler(getMarshalInfo(t)) + } + return makeStdBoolValuePtrMarshaler(getMarshalInfo(t)) + } + if slice { + return makeStdBoolValueSliceMarshaler(getMarshalInfo(t)) + } + return makeStdBoolValueMarshaler(getMarshalInfo(t)) + case reflect.String: + if pointer { + if slice { + return makeStdStringValuePtrSliceMarshaler(getMarshalInfo(t)) + } + return makeStdStringValuePtrMarshaler(getMarshalInfo(t)) + } + if slice { + return makeStdStringValueSliceMarshaler(getMarshalInfo(t)) + } + return makeStdStringValueMarshaler(getMarshalInfo(t)) + case uint8SliceType: + if pointer { + if slice { + return makeStdBytesValuePtrSliceMarshaler(getMarshalInfo(t)) + } + return makeStdBytesValuePtrMarshaler(getMarshalInfo(t)) + } + if slice { + return makeStdBytesValueSliceMarshaler(getMarshalInfo(t)) + } + return makeStdBytesValueMarshaler(getMarshalInfo(t)) + default: + panic(fmt.Sprintf("unknown wktpointer type %#v", t)) + } + } + + switch t.Kind() { + case reflect.Bool: + if pointer { + return sizeBoolPtr, appendBoolPtr + } + if slice { + if packed { + return sizeBoolPackedSlice, appendBoolPackedSlice + } + return sizeBoolSlice, appendBoolSlice + } + if nozero { + return sizeBoolValueNoZero, appendBoolValueNoZero + } + return sizeBoolValue, appendBoolValue + case reflect.Uint32: + switch encoding { + case "fixed32": + if pointer { + return sizeFixed32Ptr, appendFixed32Ptr + } + if slice { + if packed { + return sizeFixed32PackedSlice, appendFixed32PackedSlice + } + return sizeFixed32Slice, appendFixed32Slice + } + if nozero { + return sizeFixed32ValueNoZero, appendFixed32ValueNoZero + } + return sizeFixed32Value, appendFixed32Value + case "varint": + if pointer { + return sizeVarint32Ptr, appendVarint32Ptr + } + if slice { + if packed { + return sizeVarint32PackedSlice, appendVarint32PackedSlice + } + return sizeVarint32Slice, appendVarint32Slice + } + if nozero { + return sizeVarint32ValueNoZero, appendVarint32ValueNoZero + } + return sizeVarint32Value, appendVarint32Value + } + case reflect.Int32: + switch encoding { + case "fixed32": + if pointer { + return sizeFixedS32Ptr, appendFixedS32Ptr + } + if slice { + if packed { + return sizeFixedS32PackedSlice, appendFixedS32PackedSlice + } + return sizeFixedS32Slice, appendFixedS32Slice + } + if nozero { + return sizeFixedS32ValueNoZero, appendFixedS32ValueNoZero + } + return sizeFixedS32Value, appendFixedS32Value + case "varint": + if pointer { + return sizeVarintS32Ptr, appendVarintS32Ptr + } + if slice { + if packed { + return sizeVarintS32PackedSlice, appendVarintS32PackedSlice + } + return sizeVarintS32Slice, appendVarintS32Slice + } + if nozero { + return sizeVarintS32ValueNoZero, appendVarintS32ValueNoZero + } + return sizeVarintS32Value, appendVarintS32Value + case "zigzag32": + if pointer { + return sizeZigzag32Ptr, appendZigzag32Ptr + } + if slice { + if packed { + return sizeZigzag32PackedSlice, appendZigzag32PackedSlice + } + return sizeZigzag32Slice, appendZigzag32Slice + } + if nozero { + return sizeZigzag32ValueNoZero, appendZigzag32ValueNoZero + } + return sizeZigzag32Value, appendZigzag32Value + } + case reflect.Uint64: + switch encoding { + case "fixed64": + if pointer { + return sizeFixed64Ptr, appendFixed64Ptr + } + if slice { + if packed { + return sizeFixed64PackedSlice, appendFixed64PackedSlice + } + return sizeFixed64Slice, appendFixed64Slice + } + if nozero { + return sizeFixed64ValueNoZero, appendFixed64ValueNoZero + } + return sizeFixed64Value, appendFixed64Value + case "varint": + if pointer { + return sizeVarint64Ptr, appendVarint64Ptr + } + if slice { + if packed { + return sizeVarint64PackedSlice, appendVarint64PackedSlice + } + return sizeVarint64Slice, appendVarint64Slice + } + if nozero { + return sizeVarint64ValueNoZero, appendVarint64ValueNoZero + } + return sizeVarint64Value, appendVarint64Value + } + case reflect.Int64: + switch encoding { + case "fixed64": + if pointer { + return sizeFixedS64Ptr, appendFixedS64Ptr + } + if slice { + if packed { + return sizeFixedS64PackedSlice, appendFixedS64PackedSlice + } + return sizeFixedS64Slice, appendFixedS64Slice + } + if nozero { + return sizeFixedS64ValueNoZero, appendFixedS64ValueNoZero + } + return sizeFixedS64Value, appendFixedS64Value + case "varint": + if pointer { + return sizeVarintS64Ptr, appendVarintS64Ptr + } + if slice { + if packed { + return sizeVarintS64PackedSlice, appendVarintS64PackedSlice + } + return sizeVarintS64Slice, appendVarintS64Slice + } + if nozero { + return sizeVarintS64ValueNoZero, appendVarintS64ValueNoZero + } + return sizeVarintS64Value, appendVarintS64Value + case "zigzag64": + if pointer { + return sizeZigzag64Ptr, appendZigzag64Ptr + } + if slice { + if packed { + return sizeZigzag64PackedSlice, appendZigzag64PackedSlice + } + return sizeZigzag64Slice, appendZigzag64Slice + } + if nozero { + return sizeZigzag64ValueNoZero, appendZigzag64ValueNoZero + } + return sizeZigzag64Value, appendZigzag64Value + } + case reflect.Float32: + if pointer { + return sizeFloat32Ptr, appendFloat32Ptr + } + if slice { + if packed { + return sizeFloat32PackedSlice, appendFloat32PackedSlice + } + return sizeFloat32Slice, appendFloat32Slice + } + if nozero { + return sizeFloat32ValueNoZero, appendFloat32ValueNoZero + } + return sizeFloat32Value, appendFloat32Value + case reflect.Float64: + if pointer { + return sizeFloat64Ptr, appendFloat64Ptr + } + if slice { + if packed { + return sizeFloat64PackedSlice, appendFloat64PackedSlice + } + return sizeFloat64Slice, appendFloat64Slice + } + if nozero { + return sizeFloat64ValueNoZero, appendFloat64ValueNoZero + } + return sizeFloat64Value, appendFloat64Value + case reflect.String: + if validateUTF8 { + if pointer { + return sizeStringPtr, appendUTF8StringPtr + } + if slice { + return sizeStringSlice, appendUTF8StringSlice + } + if nozero { + return sizeStringValueNoZero, appendUTF8StringValueNoZero + } + return sizeStringValue, appendUTF8StringValue + } + if pointer { + return sizeStringPtr, appendStringPtr + } + if slice { + return sizeStringSlice, appendStringSlice + } + if nozero { + return sizeStringValueNoZero, appendStringValueNoZero + } + return sizeStringValue, appendStringValue + case reflect.Slice: + if slice { + return sizeBytesSlice, appendBytesSlice + } + if oneof { + // Oneof bytes field may also have "proto3" tag. + // We want to marshal it as a oneof field. Do this + // check before the proto3 check. + return sizeBytesOneof, appendBytesOneof + } + if proto3 { + return sizeBytes3, appendBytes3 + } + return sizeBytes, appendBytes + case reflect.Struct: + switch encoding { + case "group": + if slice { + return makeGroupSliceMarshaler(getMarshalInfo(t)) + } + return makeGroupMarshaler(getMarshalInfo(t)) + case "bytes": + if pointer { + if slice { + return makeMessageSliceMarshaler(getMarshalInfo(t)) + } + return makeMessageMarshaler(getMarshalInfo(t)) + } else { + if slice { + return makeMessageRefSliceMarshaler(getMarshalInfo(t)) + } + return makeMessageRefMarshaler(getMarshalInfo(t)) + } + } + } + panic(fmt.Sprintf("unknown or mismatched type: type: %v, wire type: %v", t, encoding)) +} + +// Below are functions to size/marshal a specific type of a field. +// They are stored in the field's info, and called by function pointers. +// They have type sizer or marshaler. + +func sizeFixed32Value(_ pointer, tagsize int) int { + return 4 + tagsize +} +func sizeFixed32ValueNoZero(ptr pointer, tagsize int) int { + v := *ptr.toUint32() + if v == 0 { + return 0 + } + return 4 + tagsize +} +func sizeFixed32Ptr(ptr pointer, tagsize int) int { + p := *ptr.toUint32Ptr() + if p == nil { + return 0 + } + return 4 + tagsize +} +func sizeFixed32Slice(ptr pointer, tagsize int) int { + s := *ptr.toUint32Slice() + return (4 + tagsize) * len(s) +} +func sizeFixed32PackedSlice(ptr pointer, tagsize int) int { + s := *ptr.toUint32Slice() + if len(s) == 0 { + return 0 + } + return 4*len(s) + SizeVarint(uint64(4*len(s))) + tagsize +} +func sizeFixedS32Value(_ pointer, tagsize int) int { + return 4 + tagsize +} +func sizeFixedS32ValueNoZero(ptr pointer, tagsize int) int { + v := *ptr.toInt32() + if v == 0 { + return 0 + } + return 4 + tagsize +} +func sizeFixedS32Ptr(ptr pointer, tagsize int) int { + p := ptr.getInt32Ptr() + if p == nil { + return 0 + } + return 4 + tagsize +} +func sizeFixedS32Slice(ptr pointer, tagsize int) int { + s := ptr.getInt32Slice() + return (4 + tagsize) * len(s) +} +func sizeFixedS32PackedSlice(ptr pointer, tagsize int) int { + s := ptr.getInt32Slice() + if len(s) == 0 { + return 0 + } + return 4*len(s) + SizeVarint(uint64(4*len(s))) + tagsize +} +func sizeFloat32Value(_ pointer, tagsize int) int { + return 4 + tagsize +} +func sizeFloat32ValueNoZero(ptr pointer, tagsize int) int { + v := math.Float32bits(*ptr.toFloat32()) + if v == 0 { + return 0 + } + return 4 + tagsize +} +func sizeFloat32Ptr(ptr pointer, tagsize int) int { + p := *ptr.toFloat32Ptr() + if p == nil { + return 0 + } + return 4 + tagsize +} +func sizeFloat32Slice(ptr pointer, tagsize int) int { + s := *ptr.toFloat32Slice() + return (4 + tagsize) * len(s) +} +func sizeFloat32PackedSlice(ptr pointer, tagsize int) int { + s := *ptr.toFloat32Slice() + if len(s) == 0 { + return 0 + } + return 4*len(s) + SizeVarint(uint64(4*len(s))) + tagsize +} +func sizeFixed64Value(_ pointer, tagsize int) int { + return 8 + tagsize +} +func sizeFixed64ValueNoZero(ptr pointer, tagsize int) int { + v := *ptr.toUint64() + if v == 0 { + return 0 + } + return 8 + tagsize +} +func sizeFixed64Ptr(ptr pointer, tagsize int) int { + p := *ptr.toUint64Ptr() + if p == nil { + return 0 + } + return 8 + tagsize +} +func sizeFixed64Slice(ptr pointer, tagsize int) int { + s := *ptr.toUint64Slice() + return (8 + tagsize) * len(s) +} +func sizeFixed64PackedSlice(ptr pointer, tagsize int) int { + s := *ptr.toUint64Slice() + if len(s) == 0 { + return 0 + } + return 8*len(s) + SizeVarint(uint64(8*len(s))) + tagsize +} +func sizeFixedS64Value(_ pointer, tagsize int) int { + return 8 + tagsize +} +func sizeFixedS64ValueNoZero(ptr pointer, tagsize int) int { + v := *ptr.toInt64() + if v == 0 { + return 0 + } + return 8 + tagsize +} +func sizeFixedS64Ptr(ptr pointer, tagsize int) int { + p := *ptr.toInt64Ptr() + if p == nil { + return 0 + } + return 8 + tagsize +} +func sizeFixedS64Slice(ptr pointer, tagsize int) int { + s := *ptr.toInt64Slice() + return (8 + tagsize) * len(s) +} +func sizeFixedS64PackedSlice(ptr pointer, tagsize int) int { + s := *ptr.toInt64Slice() + if len(s) == 0 { + return 0 + } + return 8*len(s) + SizeVarint(uint64(8*len(s))) + tagsize +} +func sizeFloat64Value(_ pointer, tagsize int) int { + return 8 + tagsize +} +func sizeFloat64ValueNoZero(ptr pointer, tagsize int) int { + v := math.Float64bits(*ptr.toFloat64()) + if v == 0 { + return 0 + } + return 8 + tagsize +} +func sizeFloat64Ptr(ptr pointer, tagsize int) int { + p := *ptr.toFloat64Ptr() + if p == nil { + return 0 + } + return 8 + tagsize +} +func sizeFloat64Slice(ptr pointer, tagsize int) int { + s := *ptr.toFloat64Slice() + return (8 + tagsize) * len(s) +} +func sizeFloat64PackedSlice(ptr pointer, tagsize int) int { + s := *ptr.toFloat64Slice() + if len(s) == 0 { + return 0 + } + return 8*len(s) + SizeVarint(uint64(8*len(s))) + tagsize +} +func sizeVarint32Value(ptr pointer, tagsize int) int { + v := *ptr.toUint32() + return SizeVarint(uint64(v)) + tagsize +} +func sizeVarint32ValueNoZero(ptr pointer, tagsize int) int { + v := *ptr.toUint32() + if v == 0 { + return 0 + } + return SizeVarint(uint64(v)) + tagsize +} +func sizeVarint32Ptr(ptr pointer, tagsize int) int { + p := *ptr.toUint32Ptr() + if p == nil { + return 0 + } + return SizeVarint(uint64(*p)) + tagsize +} +func sizeVarint32Slice(ptr pointer, tagsize int) int { + s := *ptr.toUint32Slice() + n := 0 + for _, v := range s { + n += SizeVarint(uint64(v)) + tagsize + } + return n +} +func sizeVarint32PackedSlice(ptr pointer, tagsize int) int { + s := *ptr.toUint32Slice() + if len(s) == 0 { + return 0 + } + n := 0 + for _, v := range s { + n += SizeVarint(uint64(v)) + } + return n + SizeVarint(uint64(n)) + tagsize +} +func sizeVarintS32Value(ptr pointer, tagsize int) int { + v := *ptr.toInt32() + return SizeVarint(uint64(v)) + tagsize +} +func sizeVarintS32ValueNoZero(ptr pointer, tagsize int) int { + v := *ptr.toInt32() + if v == 0 { + return 0 + } + return SizeVarint(uint64(v)) + tagsize +} +func sizeVarintS32Ptr(ptr pointer, tagsize int) int { + p := ptr.getInt32Ptr() + if p == nil { + return 0 + } + return SizeVarint(uint64(*p)) + tagsize +} +func sizeVarintS32Slice(ptr pointer, tagsize int) int { + s := ptr.getInt32Slice() + n := 0 + for _, v := range s { + n += SizeVarint(uint64(v)) + tagsize + } + return n +} +func sizeVarintS32PackedSlice(ptr pointer, tagsize int) int { + s := ptr.getInt32Slice() + if len(s) == 0 { + return 0 + } + n := 0 + for _, v := range s { + n += SizeVarint(uint64(v)) + } + return n + SizeVarint(uint64(n)) + tagsize +} +func sizeVarint64Value(ptr pointer, tagsize int) int { + v := *ptr.toUint64() + return SizeVarint(v) + tagsize +} +func sizeVarint64ValueNoZero(ptr pointer, tagsize int) int { + v := *ptr.toUint64() + if v == 0 { + return 0 + } + return SizeVarint(v) + tagsize +} +func sizeVarint64Ptr(ptr pointer, tagsize int) int { + p := *ptr.toUint64Ptr() + if p == nil { + return 0 + } + return SizeVarint(*p) + tagsize +} +func sizeVarint64Slice(ptr pointer, tagsize int) int { + s := *ptr.toUint64Slice() + n := 0 + for _, v := range s { + n += SizeVarint(v) + tagsize + } + return n +} +func sizeVarint64PackedSlice(ptr pointer, tagsize int) int { + s := *ptr.toUint64Slice() + if len(s) == 0 { + return 0 + } + n := 0 + for _, v := range s { + n += SizeVarint(v) + } + return n + SizeVarint(uint64(n)) + tagsize +} +func sizeVarintS64Value(ptr pointer, tagsize int) int { + v := *ptr.toInt64() + return SizeVarint(uint64(v)) + tagsize +} +func sizeVarintS64ValueNoZero(ptr pointer, tagsize int) int { + v := *ptr.toInt64() + if v == 0 { + return 0 + } + return SizeVarint(uint64(v)) + tagsize +} +func sizeVarintS64Ptr(ptr pointer, tagsize int) int { + p := *ptr.toInt64Ptr() + if p == nil { + return 0 + } + return SizeVarint(uint64(*p)) + tagsize +} +func sizeVarintS64Slice(ptr pointer, tagsize int) int { + s := *ptr.toInt64Slice() + n := 0 + for _, v := range s { + n += SizeVarint(uint64(v)) + tagsize + } + return n +} +func sizeVarintS64PackedSlice(ptr pointer, tagsize int) int { + s := *ptr.toInt64Slice() + if len(s) == 0 { + return 0 + } + n := 0 + for _, v := range s { + n += SizeVarint(uint64(v)) + } + return n + SizeVarint(uint64(n)) + tagsize +} +func sizeZigzag32Value(ptr pointer, tagsize int) int { + v := *ptr.toInt32() + return SizeVarint(uint64((uint32(v)<<1)^uint32((int32(v)>>31)))) + tagsize +} +func sizeZigzag32ValueNoZero(ptr pointer, tagsize int) int { + v := *ptr.toInt32() + if v == 0 { + return 0 + } + return SizeVarint(uint64((uint32(v)<<1)^uint32((int32(v)>>31)))) + tagsize +} +func sizeZigzag32Ptr(ptr pointer, tagsize int) int { + p := ptr.getInt32Ptr() + if p == nil { + return 0 + } + v := *p + return SizeVarint(uint64((uint32(v)<<1)^uint32((int32(v)>>31)))) + tagsize +} +func sizeZigzag32Slice(ptr pointer, tagsize int) int { + s := ptr.getInt32Slice() + n := 0 + for _, v := range s { + n += SizeVarint(uint64((uint32(v)<<1)^uint32((int32(v)>>31)))) + tagsize + } + return n +} +func sizeZigzag32PackedSlice(ptr pointer, tagsize int) int { + s := ptr.getInt32Slice() + if len(s) == 0 { + return 0 + } + n := 0 + for _, v := range s { + n += SizeVarint(uint64((uint32(v) << 1) ^ uint32((int32(v) >> 31)))) + } + return n + SizeVarint(uint64(n)) + tagsize +} +func sizeZigzag64Value(ptr pointer, tagsize int) int { + v := *ptr.toInt64() + return SizeVarint(uint64(v<<1)^uint64((int64(v)>>63))) + tagsize +} +func sizeZigzag64ValueNoZero(ptr pointer, tagsize int) int { + v := *ptr.toInt64() + if v == 0 { + return 0 + } + return SizeVarint(uint64(v<<1)^uint64((int64(v)>>63))) + tagsize +} +func sizeZigzag64Ptr(ptr pointer, tagsize int) int { + p := *ptr.toInt64Ptr() + if p == nil { + return 0 + } + v := *p + return SizeVarint(uint64(v<<1)^uint64((int64(v)>>63))) + tagsize +} +func sizeZigzag64Slice(ptr pointer, tagsize int) int { + s := *ptr.toInt64Slice() + n := 0 + for _, v := range s { + n += SizeVarint(uint64(v<<1)^uint64((int64(v)>>63))) + tagsize + } + return n +} +func sizeZigzag64PackedSlice(ptr pointer, tagsize int) int { + s := *ptr.toInt64Slice() + if len(s) == 0 { + return 0 + } + n := 0 + for _, v := range s { + n += SizeVarint(uint64(v<<1) ^ uint64((int64(v) >> 63))) + } + return n + SizeVarint(uint64(n)) + tagsize +} +func sizeBoolValue(_ pointer, tagsize int) int { + return 1 + tagsize +} +func sizeBoolValueNoZero(ptr pointer, tagsize int) int { + v := *ptr.toBool() + if !v { + return 0 + } + return 1 + tagsize +} +func sizeBoolPtr(ptr pointer, tagsize int) int { + p := *ptr.toBoolPtr() + if p == nil { + return 0 + } + return 1 + tagsize +} +func sizeBoolSlice(ptr pointer, tagsize int) int { + s := *ptr.toBoolSlice() + return (1 + tagsize) * len(s) +} +func sizeBoolPackedSlice(ptr pointer, tagsize int) int { + s := *ptr.toBoolSlice() + if len(s) == 0 { + return 0 + } + return len(s) + SizeVarint(uint64(len(s))) + tagsize +} +func sizeStringValue(ptr pointer, tagsize int) int { + v := *ptr.toString() + return len(v) + SizeVarint(uint64(len(v))) + tagsize +} +func sizeStringValueNoZero(ptr pointer, tagsize int) int { + v := *ptr.toString() + if v == "" { + return 0 + } + return len(v) + SizeVarint(uint64(len(v))) + tagsize +} +func sizeStringPtr(ptr pointer, tagsize int) int { + p := *ptr.toStringPtr() + if p == nil { + return 0 + } + v := *p + return len(v) + SizeVarint(uint64(len(v))) + tagsize +} +func sizeStringSlice(ptr pointer, tagsize int) int { + s := *ptr.toStringSlice() + n := 0 + for _, v := range s { + n += len(v) + SizeVarint(uint64(len(v))) + tagsize + } + return n +} +func sizeBytes(ptr pointer, tagsize int) int { + v := *ptr.toBytes() + if v == nil { + return 0 + } + return len(v) + SizeVarint(uint64(len(v))) + tagsize +} +func sizeBytes3(ptr pointer, tagsize int) int { + v := *ptr.toBytes() + if len(v) == 0 { + return 0 + } + return len(v) + SizeVarint(uint64(len(v))) + tagsize +} +func sizeBytesOneof(ptr pointer, tagsize int) int { + v := *ptr.toBytes() + return len(v) + SizeVarint(uint64(len(v))) + tagsize +} +func sizeBytesSlice(ptr pointer, tagsize int) int { + s := *ptr.toBytesSlice() + n := 0 + for _, v := range s { + n += len(v) + SizeVarint(uint64(len(v))) + tagsize + } + return n +} + +// appendFixed32 appends an encoded fixed32 to b. +func appendFixed32(b []byte, v uint32) []byte { + b = append(b, + byte(v), + byte(v>>8), + byte(v>>16), + byte(v>>24)) + return b +} + +// appendFixed64 appends an encoded fixed64 to b. +func appendFixed64(b []byte, v uint64) []byte { + b = append(b, + byte(v), + byte(v>>8), + byte(v>>16), + byte(v>>24), + byte(v>>32), + byte(v>>40), + byte(v>>48), + byte(v>>56)) + return b +} + +// appendVarint appends an encoded varint to b. +func appendVarint(b []byte, v uint64) []byte { + // TODO: make 1-byte (maybe 2-byte) case inline-able, once we + // have non-leaf inliner. + switch { + case v < 1<<7: + b = append(b, byte(v)) + case v < 1<<14: + b = append(b, + byte(v&0x7f|0x80), + byte(v>>7)) + case v < 1<<21: + b = append(b, + byte(v&0x7f|0x80), + byte((v>>7)&0x7f|0x80), + byte(v>>14)) + case v < 1<<28: + b = append(b, + byte(v&0x7f|0x80), + byte((v>>7)&0x7f|0x80), + byte((v>>14)&0x7f|0x80), + byte(v>>21)) + case v < 1<<35: + b = append(b, + byte(v&0x7f|0x80), + byte((v>>7)&0x7f|0x80), + byte((v>>14)&0x7f|0x80), + byte((v>>21)&0x7f|0x80), + byte(v>>28)) + case v < 1<<42: + b = append(b, + byte(v&0x7f|0x80), + byte((v>>7)&0x7f|0x80), + byte((v>>14)&0x7f|0x80), + byte((v>>21)&0x7f|0x80), + byte((v>>28)&0x7f|0x80), + byte(v>>35)) + case v < 1<<49: + b = append(b, + byte(v&0x7f|0x80), + byte((v>>7)&0x7f|0x80), + byte((v>>14)&0x7f|0x80), + byte((v>>21)&0x7f|0x80), + byte((v>>28)&0x7f|0x80), + byte((v>>35)&0x7f|0x80), + byte(v>>42)) + case v < 1<<56: + b = append(b, + byte(v&0x7f|0x80), + byte((v>>7)&0x7f|0x80), + byte((v>>14)&0x7f|0x80), + byte((v>>21)&0x7f|0x80), + byte((v>>28)&0x7f|0x80), + byte((v>>35)&0x7f|0x80), + byte((v>>42)&0x7f|0x80), + byte(v>>49)) + case v < 1<<63: + b = append(b, + byte(v&0x7f|0x80), + byte((v>>7)&0x7f|0x80), + byte((v>>14)&0x7f|0x80), + byte((v>>21)&0x7f|0x80), + byte((v>>28)&0x7f|0x80), + byte((v>>35)&0x7f|0x80), + byte((v>>42)&0x7f|0x80), + byte((v>>49)&0x7f|0x80), + byte(v>>56)) + default: + b = append(b, + byte(v&0x7f|0x80), + byte((v>>7)&0x7f|0x80), + byte((v>>14)&0x7f|0x80), + byte((v>>21)&0x7f|0x80), + byte((v>>28)&0x7f|0x80), + byte((v>>35)&0x7f|0x80), + byte((v>>42)&0x7f|0x80), + byte((v>>49)&0x7f|0x80), + byte((v>>56)&0x7f|0x80), + 1) + } + return b +} + +func appendFixed32Value(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + v := *ptr.toUint32() + b = appendVarint(b, wiretag) + b = appendFixed32(b, v) + return b, nil +} +func appendFixed32ValueNoZero(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + v := *ptr.toUint32() + if v == 0 { + return b, nil + } + b = appendVarint(b, wiretag) + b = appendFixed32(b, v) + return b, nil +} +func appendFixed32Ptr(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + p := *ptr.toUint32Ptr() + if p == nil { + return b, nil + } + b = appendVarint(b, wiretag) + b = appendFixed32(b, *p) + return b, nil +} +func appendFixed32Slice(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + s := *ptr.toUint32Slice() + for _, v := range s { + b = appendVarint(b, wiretag) + b = appendFixed32(b, v) + } + return b, nil +} +func appendFixed32PackedSlice(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + s := *ptr.toUint32Slice() + if len(s) == 0 { + return b, nil + } + b = appendVarint(b, wiretag&^7|WireBytes) + b = appendVarint(b, uint64(4*len(s))) + for _, v := range s { + b = appendFixed32(b, v) + } + return b, nil +} +func appendFixedS32Value(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + v := *ptr.toInt32() + b = appendVarint(b, wiretag) + b = appendFixed32(b, uint32(v)) + return b, nil +} +func appendFixedS32ValueNoZero(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + v := *ptr.toInt32() + if v == 0 { + return b, nil + } + b = appendVarint(b, wiretag) + b = appendFixed32(b, uint32(v)) + return b, nil +} +func appendFixedS32Ptr(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + p := ptr.getInt32Ptr() + if p == nil { + return b, nil + } + b = appendVarint(b, wiretag) + b = appendFixed32(b, uint32(*p)) + return b, nil +} +func appendFixedS32Slice(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + s := ptr.getInt32Slice() + for _, v := range s { + b = appendVarint(b, wiretag) + b = appendFixed32(b, uint32(v)) + } + return b, nil +} +func appendFixedS32PackedSlice(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + s := ptr.getInt32Slice() + if len(s) == 0 { + return b, nil + } + b = appendVarint(b, wiretag&^7|WireBytes) + b = appendVarint(b, uint64(4*len(s))) + for _, v := range s { + b = appendFixed32(b, uint32(v)) + } + return b, nil +} +func appendFloat32Value(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + v := math.Float32bits(*ptr.toFloat32()) + b = appendVarint(b, wiretag) + b = appendFixed32(b, v) + return b, nil +} +func appendFloat32ValueNoZero(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + v := math.Float32bits(*ptr.toFloat32()) + if v == 0 { + return b, nil + } + b = appendVarint(b, wiretag) + b = appendFixed32(b, v) + return b, nil +} +func appendFloat32Ptr(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + p := *ptr.toFloat32Ptr() + if p == nil { + return b, nil + } + b = appendVarint(b, wiretag) + b = appendFixed32(b, math.Float32bits(*p)) + return b, nil +} +func appendFloat32Slice(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + s := *ptr.toFloat32Slice() + for _, v := range s { + b = appendVarint(b, wiretag) + b = appendFixed32(b, math.Float32bits(v)) + } + return b, nil +} +func appendFloat32PackedSlice(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + s := *ptr.toFloat32Slice() + if len(s) == 0 { + return b, nil + } + b = appendVarint(b, wiretag&^7|WireBytes) + b = appendVarint(b, uint64(4*len(s))) + for _, v := range s { + b = appendFixed32(b, math.Float32bits(v)) + } + return b, nil +} +func appendFixed64Value(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + v := *ptr.toUint64() + b = appendVarint(b, wiretag) + b = appendFixed64(b, v) + return b, nil +} +func appendFixed64ValueNoZero(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + v := *ptr.toUint64() + if v == 0 { + return b, nil + } + b = appendVarint(b, wiretag) + b = appendFixed64(b, v) + return b, nil +} +func appendFixed64Ptr(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + p := *ptr.toUint64Ptr() + if p == nil { + return b, nil + } + b = appendVarint(b, wiretag) + b = appendFixed64(b, *p) + return b, nil +} +func appendFixed64Slice(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + s := *ptr.toUint64Slice() + for _, v := range s { + b = appendVarint(b, wiretag) + b = appendFixed64(b, v) + } + return b, nil +} +func appendFixed64PackedSlice(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + s := *ptr.toUint64Slice() + if len(s) == 0 { + return b, nil + } + b = appendVarint(b, wiretag&^7|WireBytes) + b = appendVarint(b, uint64(8*len(s))) + for _, v := range s { + b = appendFixed64(b, v) + } + return b, nil +} +func appendFixedS64Value(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + v := *ptr.toInt64() + b = appendVarint(b, wiretag) + b = appendFixed64(b, uint64(v)) + return b, nil +} +func appendFixedS64ValueNoZero(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + v := *ptr.toInt64() + if v == 0 { + return b, nil + } + b = appendVarint(b, wiretag) + b = appendFixed64(b, uint64(v)) + return b, nil +} +func appendFixedS64Ptr(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + p := *ptr.toInt64Ptr() + if p == nil { + return b, nil + } + b = appendVarint(b, wiretag) + b = appendFixed64(b, uint64(*p)) + return b, nil +} +func appendFixedS64Slice(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + s := *ptr.toInt64Slice() + for _, v := range s { + b = appendVarint(b, wiretag) + b = appendFixed64(b, uint64(v)) + } + return b, nil +} +func appendFixedS64PackedSlice(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + s := *ptr.toInt64Slice() + if len(s) == 0 { + return b, nil + } + b = appendVarint(b, wiretag&^7|WireBytes) + b = appendVarint(b, uint64(8*len(s))) + for _, v := range s { + b = appendFixed64(b, uint64(v)) + } + return b, nil +} +func appendFloat64Value(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + v := math.Float64bits(*ptr.toFloat64()) + b = appendVarint(b, wiretag) + b = appendFixed64(b, v) + return b, nil +} +func appendFloat64ValueNoZero(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + v := math.Float64bits(*ptr.toFloat64()) + if v == 0 { + return b, nil + } + b = appendVarint(b, wiretag) + b = appendFixed64(b, v) + return b, nil +} +func appendFloat64Ptr(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + p := *ptr.toFloat64Ptr() + if p == nil { + return b, nil + } + b = appendVarint(b, wiretag) + b = appendFixed64(b, math.Float64bits(*p)) + return b, nil +} +func appendFloat64Slice(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + s := *ptr.toFloat64Slice() + for _, v := range s { + b = appendVarint(b, wiretag) + b = appendFixed64(b, math.Float64bits(v)) + } + return b, nil +} +func appendFloat64PackedSlice(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + s := *ptr.toFloat64Slice() + if len(s) == 0 { + return b, nil + } + b = appendVarint(b, wiretag&^7|WireBytes) + b = appendVarint(b, uint64(8*len(s))) + for _, v := range s { + b = appendFixed64(b, math.Float64bits(v)) + } + return b, nil +} +func appendVarint32Value(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + v := *ptr.toUint32() + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(v)) + return b, nil +} +func appendVarint32ValueNoZero(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + v := *ptr.toUint32() + if v == 0 { + return b, nil + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(v)) + return b, nil +} +func appendVarint32Ptr(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + p := *ptr.toUint32Ptr() + if p == nil { + return b, nil + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(*p)) + return b, nil +} +func appendVarint32Slice(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + s := *ptr.toUint32Slice() + for _, v := range s { + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(v)) + } + return b, nil +} +func appendVarint32PackedSlice(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + s := *ptr.toUint32Slice() + if len(s) == 0 { + return b, nil + } + b = appendVarint(b, wiretag&^7|WireBytes) + // compute size + n := 0 + for _, v := range s { + n += SizeVarint(uint64(v)) + } + b = appendVarint(b, uint64(n)) + for _, v := range s { + b = appendVarint(b, uint64(v)) + } + return b, nil +} +func appendVarintS32Value(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + v := *ptr.toInt32() + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(v)) + return b, nil +} +func appendVarintS32ValueNoZero(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + v := *ptr.toInt32() + if v == 0 { + return b, nil + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(v)) + return b, nil +} +func appendVarintS32Ptr(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + p := ptr.getInt32Ptr() + if p == nil { + return b, nil + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(*p)) + return b, nil +} +func appendVarintS32Slice(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + s := ptr.getInt32Slice() + for _, v := range s { + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(v)) + } + return b, nil +} +func appendVarintS32PackedSlice(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + s := ptr.getInt32Slice() + if len(s) == 0 { + return b, nil + } + b = appendVarint(b, wiretag&^7|WireBytes) + // compute size + n := 0 + for _, v := range s { + n += SizeVarint(uint64(v)) + } + b = appendVarint(b, uint64(n)) + for _, v := range s { + b = appendVarint(b, uint64(v)) + } + return b, nil +} +func appendVarint64Value(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + v := *ptr.toUint64() + b = appendVarint(b, wiretag) + b = appendVarint(b, v) + return b, nil +} +func appendVarint64ValueNoZero(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + v := *ptr.toUint64() + if v == 0 { + return b, nil + } + b = appendVarint(b, wiretag) + b = appendVarint(b, v) + return b, nil +} +func appendVarint64Ptr(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + p := *ptr.toUint64Ptr() + if p == nil { + return b, nil + } + b = appendVarint(b, wiretag) + b = appendVarint(b, *p) + return b, nil +} +func appendVarint64Slice(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + s := *ptr.toUint64Slice() + for _, v := range s { + b = appendVarint(b, wiretag) + b = appendVarint(b, v) + } + return b, nil +} +func appendVarint64PackedSlice(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + s := *ptr.toUint64Slice() + if len(s) == 0 { + return b, nil + } + b = appendVarint(b, wiretag&^7|WireBytes) + // compute size + n := 0 + for _, v := range s { + n += SizeVarint(v) + } + b = appendVarint(b, uint64(n)) + for _, v := range s { + b = appendVarint(b, v) + } + return b, nil +} +func appendVarintS64Value(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + v := *ptr.toInt64() + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(v)) + return b, nil +} +func appendVarintS64ValueNoZero(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + v := *ptr.toInt64() + if v == 0 { + return b, nil + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(v)) + return b, nil +} +func appendVarintS64Ptr(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + p := *ptr.toInt64Ptr() + if p == nil { + return b, nil + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(*p)) + return b, nil +} +func appendVarintS64Slice(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + s := *ptr.toInt64Slice() + for _, v := range s { + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(v)) + } + return b, nil +} +func appendVarintS64PackedSlice(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + s := *ptr.toInt64Slice() + if len(s) == 0 { + return b, nil + } + b = appendVarint(b, wiretag&^7|WireBytes) + // compute size + n := 0 + for _, v := range s { + n += SizeVarint(uint64(v)) + } + b = appendVarint(b, uint64(n)) + for _, v := range s { + b = appendVarint(b, uint64(v)) + } + return b, nil +} +func appendZigzag32Value(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + v := *ptr.toInt32() + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64((uint32(v)<<1)^uint32((int32(v)>>31)))) + return b, nil +} +func appendZigzag32ValueNoZero(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + v := *ptr.toInt32() + if v == 0 { + return b, nil + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64((uint32(v)<<1)^uint32((int32(v)>>31)))) + return b, nil +} +func appendZigzag32Ptr(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + p := ptr.getInt32Ptr() + if p == nil { + return b, nil + } + b = appendVarint(b, wiretag) + v := *p + b = appendVarint(b, uint64((uint32(v)<<1)^uint32((int32(v)>>31)))) + return b, nil +} +func appendZigzag32Slice(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + s := ptr.getInt32Slice() + for _, v := range s { + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64((uint32(v)<<1)^uint32((int32(v)>>31)))) + } + return b, nil +} +func appendZigzag32PackedSlice(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + s := ptr.getInt32Slice() + if len(s) == 0 { + return b, nil + } + b = appendVarint(b, wiretag&^7|WireBytes) + // compute size + n := 0 + for _, v := range s { + n += SizeVarint(uint64((uint32(v) << 1) ^ uint32((int32(v) >> 31)))) + } + b = appendVarint(b, uint64(n)) + for _, v := range s { + b = appendVarint(b, uint64((uint32(v)<<1)^uint32((int32(v)>>31)))) + } + return b, nil +} +func appendZigzag64Value(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + v := *ptr.toInt64() + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(v<<1)^uint64((int64(v)>>63))) + return b, nil +} +func appendZigzag64ValueNoZero(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + v := *ptr.toInt64() + if v == 0 { + return b, nil + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(v<<1)^uint64((int64(v)>>63))) + return b, nil +} +func appendZigzag64Ptr(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + p := *ptr.toInt64Ptr() + if p == nil { + return b, nil + } + b = appendVarint(b, wiretag) + v := *p + b = appendVarint(b, uint64(v<<1)^uint64((int64(v)>>63))) + return b, nil +} +func appendZigzag64Slice(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + s := *ptr.toInt64Slice() + for _, v := range s { + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(v<<1)^uint64((int64(v)>>63))) + } + return b, nil +} +func appendZigzag64PackedSlice(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + s := *ptr.toInt64Slice() + if len(s) == 0 { + return b, nil + } + b = appendVarint(b, wiretag&^7|WireBytes) + // compute size + n := 0 + for _, v := range s { + n += SizeVarint(uint64(v<<1) ^ uint64((int64(v) >> 63))) + } + b = appendVarint(b, uint64(n)) + for _, v := range s { + b = appendVarint(b, uint64(v<<1)^uint64((int64(v)>>63))) + } + return b, nil +} +func appendBoolValue(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + v := *ptr.toBool() + b = appendVarint(b, wiretag) + if v { + b = append(b, 1) + } else { + b = append(b, 0) + } + return b, nil +} +func appendBoolValueNoZero(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + v := *ptr.toBool() + if !v { + return b, nil + } + b = appendVarint(b, wiretag) + b = append(b, 1) + return b, nil +} + +func appendBoolPtr(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + p := *ptr.toBoolPtr() + if p == nil { + return b, nil + } + b = appendVarint(b, wiretag) + if *p { + b = append(b, 1) + } else { + b = append(b, 0) + } + return b, nil +} +func appendBoolSlice(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + s := *ptr.toBoolSlice() + for _, v := range s { + b = appendVarint(b, wiretag) + if v { + b = append(b, 1) + } else { + b = append(b, 0) + } + } + return b, nil +} +func appendBoolPackedSlice(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + s := *ptr.toBoolSlice() + if len(s) == 0 { + return b, nil + } + b = appendVarint(b, wiretag&^7|WireBytes) + b = appendVarint(b, uint64(len(s))) + for _, v := range s { + if v { + b = append(b, 1) + } else { + b = append(b, 0) + } + } + return b, nil +} +func appendStringValue(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + v := *ptr.toString() + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(len(v))) + b = append(b, v...) + return b, nil +} +func appendStringValueNoZero(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + v := *ptr.toString() + if v == "" { + return b, nil + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(len(v))) + b = append(b, v...) + return b, nil +} +func appendStringPtr(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + p := *ptr.toStringPtr() + if p == nil { + return b, nil + } + v := *p + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(len(v))) + b = append(b, v...) + return b, nil +} +func appendStringSlice(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + s := *ptr.toStringSlice() + for _, v := range s { + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(len(v))) + b = append(b, v...) + } + return b, nil +} +func appendUTF8StringValue(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + var invalidUTF8 bool + v := *ptr.toString() + if !utf8.ValidString(v) { + invalidUTF8 = true + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(len(v))) + b = append(b, v...) + if invalidUTF8 { + return b, errInvalidUTF8 + } + return b, nil +} +func appendUTF8StringValueNoZero(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + var invalidUTF8 bool + v := *ptr.toString() + if v == "" { + return b, nil + } + if !utf8.ValidString(v) { + invalidUTF8 = true + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(len(v))) + b = append(b, v...) + if invalidUTF8 { + return b, errInvalidUTF8 + } + return b, nil +} +func appendUTF8StringPtr(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + var invalidUTF8 bool + p := *ptr.toStringPtr() + if p == nil { + return b, nil + } + v := *p + if !utf8.ValidString(v) { + invalidUTF8 = true + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(len(v))) + b = append(b, v...) + if invalidUTF8 { + return b, errInvalidUTF8 + } + return b, nil +} +func appendUTF8StringSlice(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + var invalidUTF8 bool + s := *ptr.toStringSlice() + for _, v := range s { + if !utf8.ValidString(v) { + invalidUTF8 = true + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(len(v))) + b = append(b, v...) + } + if invalidUTF8 { + return b, errInvalidUTF8 + } + return b, nil +} +func appendBytes(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + v := *ptr.toBytes() + if v == nil { + return b, nil + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(len(v))) + b = append(b, v...) + return b, nil +} +func appendBytes3(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + v := *ptr.toBytes() + if len(v) == 0 { + return b, nil + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(len(v))) + b = append(b, v...) + return b, nil +} +func appendBytesOneof(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + v := *ptr.toBytes() + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(len(v))) + b = append(b, v...) + return b, nil +} +func appendBytesSlice(b []byte, ptr pointer, wiretag uint64, _ bool) ([]byte, error) { + s := *ptr.toBytesSlice() + for _, v := range s { + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(len(v))) + b = append(b, v...) + } + return b, nil +} + +// makeGroupMarshaler returns the sizer and marshaler for a group. +// u is the marshal info of the underlying message. +func makeGroupMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + p := ptr.getPointer() + if p.isNil() { + return 0 + } + return u.size(p) + 2*tagsize + }, + func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + p := ptr.getPointer() + if p.isNil() { + return b, nil + } + var err error + b = appendVarint(b, wiretag) // start group + b, err = u.marshal(b, p, deterministic) + b = appendVarint(b, wiretag+(WireEndGroup-WireStartGroup)) // end group + return b, err + } +} + +// makeGroupSliceMarshaler returns the sizer and marshaler for a group slice. +// u is the marshal info of the underlying message. +func makeGroupSliceMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + s := ptr.getPointerSlice() + n := 0 + for _, v := range s { + if v.isNil() { + continue + } + n += u.size(v) + 2*tagsize + } + return n + }, + func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + s := ptr.getPointerSlice() + var err error + var nerr nonFatal + for _, v := range s { + if v.isNil() { + return b, errRepeatedHasNil + } + b = appendVarint(b, wiretag) // start group + b, err = u.marshal(b, v, deterministic) + b = appendVarint(b, wiretag+(WireEndGroup-WireStartGroup)) // end group + if !nerr.Merge(err) { + if err == ErrNil { + err = errRepeatedHasNil + } + return b, err + } + } + return b, nerr.E + } +} + +// makeMessageMarshaler returns the sizer and marshaler for a message field. +// u is the marshal info of the message. +func makeMessageMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + p := ptr.getPointer() + if p.isNil() { + return 0 + } + siz := u.size(p) + return siz + SizeVarint(uint64(siz)) + tagsize + }, + func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + p := ptr.getPointer() + if p.isNil() { + return b, nil + } + b = appendVarint(b, wiretag) + siz := u.cachedsize(p) + b = appendVarint(b, uint64(siz)) + return u.marshal(b, p, deterministic) + } +} + +// makeMessageSliceMarshaler returns the sizer and marshaler for a message slice. +// u is the marshal info of the message. +func makeMessageSliceMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + s := ptr.getPointerSlice() + n := 0 + for _, v := range s { + if v.isNil() { + continue + } + siz := u.size(v) + n += siz + SizeVarint(uint64(siz)) + tagsize + } + return n + }, + func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + s := ptr.getPointerSlice() + var err error + var nerr nonFatal + for _, v := range s { + if v.isNil() { + return b, errRepeatedHasNil + } + b = appendVarint(b, wiretag) + siz := u.cachedsize(v) + b = appendVarint(b, uint64(siz)) + b, err = u.marshal(b, v, deterministic) + + if !nerr.Merge(err) { + if err == ErrNil { + err = errRepeatedHasNil + } + return b, err + } + } + return b, nerr.E + } +} + +// makeMapMarshaler returns the sizer and marshaler for a map field. +// f is the pointer to the reflect data structure of the field. +func makeMapMarshaler(f *reflect.StructField) (sizer, marshaler) { + // figure out key and value type + t := f.Type + keyType := t.Key() + valType := t.Elem() + tags := strings.Split(f.Tag.Get("protobuf"), ",") + keyTags := strings.Split(f.Tag.Get("protobuf_key"), ",") + valTags := strings.Split(f.Tag.Get("protobuf_val"), ",") + stdOptions := false + for _, t := range tags { + if strings.HasPrefix(t, "customtype=") { + valTags = append(valTags, t) + } + if t == "stdtime" { + valTags = append(valTags, t) + stdOptions = true + } + if t == "stdduration" { + valTags = append(valTags, t) + stdOptions = true + } + if t == "wktptr" { + valTags = append(valTags, t) + } + } + keySizer, keyMarshaler := typeMarshaler(keyType, keyTags, false, false) // don't omit zero value in map + valSizer, valMarshaler := typeMarshaler(valType, valTags, false, false) // don't omit zero value in map + keyWireTag := 1<<3 | wiretype(keyTags[0]) + valWireTag := 2<<3 | wiretype(valTags[0]) + + // We create an interface to get the addresses of the map key and value. + // If value is pointer-typed, the interface is a direct interface, the + // idata itself is the value. Otherwise, the idata is the pointer to the + // value. + // Key cannot be pointer-typed. + valIsPtr := valType.Kind() == reflect.Ptr + + // If value is a message with nested maps, calling + // valSizer in marshal may be quadratic. We should use + // cached version in marshal (but not in size). + // If value is not message type, we don't have size cache, + // but it cannot be nested either. Just use valSizer. + valCachedSizer := valSizer + if valIsPtr && !stdOptions && valType.Elem().Kind() == reflect.Struct { + u := getMarshalInfo(valType.Elem()) + valCachedSizer = func(ptr pointer, tagsize int) int { + // Same as message sizer, but use cache. + p := ptr.getPointer() + if p.isNil() { + return 0 + } + siz := u.cachedsize(p) + return siz + SizeVarint(uint64(siz)) + tagsize + } + } + return func(ptr pointer, tagsize int) int { + m := ptr.asPointerTo(t).Elem() // the map + n := 0 + for _, k := range m.MapKeys() { + ki := k.Interface() + vi := m.MapIndex(k).Interface() + kaddr := toAddrPointer(&ki, false) // pointer to key + vaddr := toAddrPointer(&vi, valIsPtr) // pointer to value + siz := keySizer(kaddr, 1) + valSizer(vaddr, 1) // tag of key = 1 (size=1), tag of val = 2 (size=1) + n += siz + SizeVarint(uint64(siz)) + tagsize + } + return n + }, + func(b []byte, ptr pointer, tag uint64, deterministic bool) ([]byte, error) { + m := ptr.asPointerTo(t).Elem() // the map + var err error + keys := m.MapKeys() + if len(keys) > 1 && deterministic { + sort.Sort(mapKeys(keys)) + } + + var nerr nonFatal + for _, k := range keys { + ki := k.Interface() + vi := m.MapIndex(k).Interface() + kaddr := toAddrPointer(&ki, false) // pointer to key + vaddr := toAddrPointer(&vi, valIsPtr) // pointer to value + b = appendVarint(b, tag) + siz := keySizer(kaddr, 1) + valCachedSizer(vaddr, 1) // tag of key = 1 (size=1), tag of val = 2 (size=1) + b = appendVarint(b, uint64(siz)) + b, err = keyMarshaler(b, kaddr, keyWireTag, deterministic) + if !nerr.Merge(err) { + return b, err + } + b, err = valMarshaler(b, vaddr, valWireTag, deterministic) + if err != ErrNil && !nerr.Merge(err) { // allow nil value in map + return b, err + } + } + return b, nerr.E + } +} + +// makeOneOfMarshaler returns the sizer and marshaler for a oneof field. +// fi is the marshal info of the field. +// f is the pointer to the reflect data structure of the field. +func makeOneOfMarshaler(fi *marshalFieldInfo, f *reflect.StructField) (sizer, marshaler) { + // Oneof field is an interface. We need to get the actual data type on the fly. + t := f.Type + return func(ptr pointer, _ int) int { + p := ptr.getInterfacePointer() + if p.isNil() { + return 0 + } + v := ptr.asPointerTo(t).Elem().Elem().Elem() // *interface -> interface -> *struct -> struct + telem := v.Type() + e := fi.oneofElems[telem] + return e.sizer(p, e.tagsize) + }, + func(b []byte, ptr pointer, _ uint64, deterministic bool) ([]byte, error) { + p := ptr.getInterfacePointer() + if p.isNil() { + return b, nil + } + v := ptr.asPointerTo(t).Elem().Elem().Elem() // *interface -> interface -> *struct -> struct + telem := v.Type() + if telem.Field(0).Type.Kind() == reflect.Ptr && p.getPointer().isNil() { + return b, errOneofHasNil + } + e := fi.oneofElems[telem] + return e.marshaler(b, p, e.wiretag, deterministic) + } +} + +// sizeExtensions computes the size of encoded data for a XXX_InternalExtensions field. +func (u *marshalInfo) sizeExtensions(ext *XXX_InternalExtensions) int { + m, mu := ext.extensionsRead() + if m == nil { + return 0 + } + mu.Lock() + + n := 0 + for _, e := range m { + if e.value == nil || e.desc == nil { + // Extension is only in its encoded form. + n += len(e.enc) + continue + } + + // We don't skip extensions that have an encoded form set, + // because the extension value may have been mutated after + // the last time this function was called. + ei := u.getExtElemInfo(e.desc) + v := e.value + p := toAddrPointer(&v, ei.isptr) + n += ei.sizer(p, ei.tagsize) + } + mu.Unlock() + return n +} + +// appendExtensions marshals a XXX_InternalExtensions field to the end of byte slice b. +func (u *marshalInfo) appendExtensions(b []byte, ext *XXX_InternalExtensions, deterministic bool) ([]byte, error) { + m, mu := ext.extensionsRead() + if m == nil { + return b, nil + } + mu.Lock() + defer mu.Unlock() + + var err error + var nerr nonFatal + + // Fast-path for common cases: zero or one extensions. + // Don't bother sorting the keys. + if len(m) <= 1 { + for _, e := range m { + if e.value == nil || e.desc == nil { + // Extension is only in its encoded form. + b = append(b, e.enc...) + continue + } + + // We don't skip extensions that have an encoded form set, + // because the extension value may have been mutated after + // the last time this function was called. + + ei := u.getExtElemInfo(e.desc) + v := e.value + p := toAddrPointer(&v, ei.isptr) + b, err = ei.marshaler(b, p, ei.wiretag, deterministic) + if !nerr.Merge(err) { + return b, err + } + } + return b, nerr.E + } + + // Sort the keys to provide a deterministic encoding. + // Not sure this is required, but the old code does it. + keys := make([]int, 0, len(m)) + for k := range m { + keys = append(keys, int(k)) + } + sort.Ints(keys) + + for _, k := range keys { + e := m[int32(k)] + if e.value == nil || e.desc == nil { + // Extension is only in its encoded form. + b = append(b, e.enc...) + continue + } + + // We don't skip extensions that have an encoded form set, + // because the extension value may have been mutated after + // the last time this function was called. + + ei := u.getExtElemInfo(e.desc) + v := e.value + p := toAddrPointer(&v, ei.isptr) + b, err = ei.marshaler(b, p, ei.wiretag, deterministic) + if !nerr.Merge(err) { + return b, err + } + } + return b, nerr.E +} + +// message set format is: +// message MessageSet { +// repeated group Item = 1 { +// required int32 type_id = 2; +// required string message = 3; +// }; +// } + +// sizeMessageSet computes the size of encoded data for a XXX_InternalExtensions field +// in message set format (above). +func (u *marshalInfo) sizeMessageSet(ext *XXX_InternalExtensions) int { + m, mu := ext.extensionsRead() + if m == nil { + return 0 + } + mu.Lock() + + n := 0 + for id, e := range m { + n += 2 // start group, end group. tag = 1 (size=1) + n += SizeVarint(uint64(id)) + 1 // type_id, tag = 2 (size=1) + + if e.value == nil || e.desc == nil { + // Extension is only in its encoded form. + msgWithLen := skipVarint(e.enc) // skip old tag, but leave the length varint + siz := len(msgWithLen) + n += siz + 1 // message, tag = 3 (size=1) + continue + } + + // We don't skip extensions that have an encoded form set, + // because the extension value may have been mutated after + // the last time this function was called. + + ei := u.getExtElemInfo(e.desc) + v := e.value + p := toAddrPointer(&v, ei.isptr) + n += ei.sizer(p, 1) // message, tag = 3 (size=1) + } + mu.Unlock() + return n +} + +// appendMessageSet marshals a XXX_InternalExtensions field in message set format (above) +// to the end of byte slice b. +func (u *marshalInfo) appendMessageSet(b []byte, ext *XXX_InternalExtensions, deterministic bool) ([]byte, error) { + m, mu := ext.extensionsRead() + if m == nil { + return b, nil + } + mu.Lock() + defer mu.Unlock() + + var err error + var nerr nonFatal + + // Fast-path for common cases: zero or one extensions. + // Don't bother sorting the keys. + if len(m) <= 1 { + for id, e := range m { + b = append(b, 1<<3|WireStartGroup) + b = append(b, 2<<3|WireVarint) + b = appendVarint(b, uint64(id)) + + if e.value == nil || e.desc == nil { + // Extension is only in its encoded form. + msgWithLen := skipVarint(e.enc) // skip old tag, but leave the length varint + b = append(b, 3<<3|WireBytes) + b = append(b, msgWithLen...) + b = append(b, 1<<3|WireEndGroup) + continue + } + + // We don't skip extensions that have an encoded form set, + // because the extension value may have been mutated after + // the last time this function was called. + + ei := u.getExtElemInfo(e.desc) + v := e.value + p := toAddrPointer(&v, ei.isptr) + b, err = ei.marshaler(b, p, 3<<3|WireBytes, deterministic) + if !nerr.Merge(err) { + return b, err + } + b = append(b, 1<<3|WireEndGroup) + } + return b, nerr.E + } + + // Sort the keys to provide a deterministic encoding. + keys := make([]int, 0, len(m)) + for k := range m { + keys = append(keys, int(k)) + } + sort.Ints(keys) + + for _, id := range keys { + e := m[int32(id)] + b = append(b, 1<<3|WireStartGroup) + b = append(b, 2<<3|WireVarint) + b = appendVarint(b, uint64(id)) + + if e.value == nil || e.desc == nil { + // Extension is only in its encoded form. + msgWithLen := skipVarint(e.enc) // skip old tag, but leave the length varint + b = append(b, 3<<3|WireBytes) + b = append(b, msgWithLen...) + b = append(b, 1<<3|WireEndGroup) + continue + } + + // We don't skip extensions that have an encoded form set, + // because the extension value may have been mutated after + // the last time this function was called. + + ei := u.getExtElemInfo(e.desc) + v := e.value + p := toAddrPointer(&v, ei.isptr) + b, err = ei.marshaler(b, p, 3<<3|WireBytes, deterministic) + b = append(b, 1<<3|WireEndGroup) + if !nerr.Merge(err) { + return b, err + } + } + return b, nerr.E +} + +// sizeV1Extensions computes the size of encoded data for a V1-API extension field. +func (u *marshalInfo) sizeV1Extensions(m map[int32]Extension) int { + if m == nil { + return 0 + } + + n := 0 + for _, e := range m { + if e.value == nil || e.desc == nil { + // Extension is only in its encoded form. + n += len(e.enc) + continue + } + + // We don't skip extensions that have an encoded form set, + // because the extension value may have been mutated after + // the last time this function was called. + + ei := u.getExtElemInfo(e.desc) + v := e.value + p := toAddrPointer(&v, ei.isptr) + n += ei.sizer(p, ei.tagsize) + } + return n +} + +// appendV1Extensions marshals a V1-API extension field to the end of byte slice b. +func (u *marshalInfo) appendV1Extensions(b []byte, m map[int32]Extension, deterministic bool) ([]byte, error) { + if m == nil { + return b, nil + } + + // Sort the keys to provide a deterministic encoding. + keys := make([]int, 0, len(m)) + for k := range m { + keys = append(keys, int(k)) + } + sort.Ints(keys) + + var err error + var nerr nonFatal + for _, k := range keys { + e := m[int32(k)] + if e.value == nil || e.desc == nil { + // Extension is only in its encoded form. + b = append(b, e.enc...) + continue + } + + // We don't skip extensions that have an encoded form set, + // because the extension value may have been mutated after + // the last time this function was called. + + ei := u.getExtElemInfo(e.desc) + v := e.value + p := toAddrPointer(&v, ei.isptr) + b, err = ei.marshaler(b, p, ei.wiretag, deterministic) + if !nerr.Merge(err) { + return b, err + } + } + return b, nerr.E +} + +// newMarshaler is the interface representing objects that can marshal themselves. +// +// This exists to support protoc-gen-go generated messages. +// The proto package will stop type-asserting to this interface in the future. +// +// DO NOT DEPEND ON THIS. +type newMarshaler interface { + XXX_Size() int + XXX_Marshal(b []byte, deterministic bool) ([]byte, error) +} + +// Size returns the encoded size of a protocol buffer message. +// This is the main entry point. +func Size(pb Message) int { + if m, ok := pb.(newMarshaler); ok { + return m.XXX_Size() + } + if m, ok := pb.(Marshaler); ok { + // If the message can marshal itself, let it do it, for compatibility. + // NOTE: This is not efficient. + b, _ := m.Marshal() + return len(b) + } + // in case somehow we didn't generate the wrapper + if pb == nil { + return 0 + } + var info InternalMessageInfo + return info.Size(pb) +} + +// Marshal takes a protocol buffer message +// and encodes it into the wire format, returning the data. +// This is the main entry point. +func Marshal(pb Message) ([]byte, error) { + if m, ok := pb.(newMarshaler); ok { + siz := m.XXX_Size() + b := make([]byte, 0, siz) + return m.XXX_Marshal(b, false) + } + if m, ok := pb.(Marshaler); ok { + // If the message can marshal itself, let it do it, for compatibility. + // NOTE: This is not efficient. + return m.Marshal() + } + // in case somehow we didn't generate the wrapper + if pb == nil { + return nil, ErrNil + } + var info InternalMessageInfo + siz := info.Size(pb) + b := make([]byte, 0, siz) + return info.Marshal(b, pb, false) +} + +// Marshal takes a protocol buffer message +// and encodes it into the wire format, writing the result to the +// Buffer. +// This is an alternative entry point. It is not necessary to use +// a Buffer for most applications. +func (p *Buffer) Marshal(pb Message) error { + var err error + if p.deterministic { + if _, ok := pb.(Marshaler); ok { + return fmt.Errorf("proto: deterministic not supported by the Marshal method of %T", pb) + } + } + if m, ok := pb.(newMarshaler); ok { + siz := m.XXX_Size() + p.grow(siz) // make sure buf has enough capacity + pp := p.buf[len(p.buf) : len(p.buf) : len(p.buf)+siz] + pp, err = m.XXX_Marshal(pp, p.deterministic) + p.buf = append(p.buf, pp...) + return err + } + if m, ok := pb.(Marshaler); ok { + // If the message can marshal itself, let it do it, for compatibility. + // NOTE: This is not efficient. + var b []byte + b, err = m.Marshal() + p.buf = append(p.buf, b...) + return err + } + // in case somehow we didn't generate the wrapper + if pb == nil { + return ErrNil + } + var info InternalMessageInfo + siz := info.Size(pb) + p.grow(siz) // make sure buf has enough capacity + p.buf, err = info.Marshal(p.buf, pb, p.deterministic) + return err +} + +// grow grows the buffer's capacity, if necessary, to guarantee space for +// another n bytes. After grow(n), at least n bytes can be written to the +// buffer without another allocation. +func (p *Buffer) grow(n int) { + need := len(p.buf) + n + if need <= cap(p.buf) { + return + } + newCap := len(p.buf) * 2 + if newCap < need { + newCap = need + } + p.buf = append(make([]byte, 0, newCap), p.buf...) +} diff --git a/vendor/github.com/gogo/protobuf/proto/table_marshal_gogo.go b/vendor/github.com/gogo/protobuf/proto/table_marshal_gogo.go new file mode 100644 index 00000000..997f57c1 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/table_marshal_gogo.go @@ -0,0 +1,388 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2018, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package proto + +import ( + "reflect" + "time" +) + +// makeMessageRefMarshaler differs a bit from makeMessageMarshaler +// It marshal a message T instead of a *T +func makeMessageRefMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + siz := u.size(ptr) + return siz + SizeVarint(uint64(siz)) + tagsize + }, + func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + b = appendVarint(b, wiretag) + siz := u.cachedsize(ptr) + b = appendVarint(b, uint64(siz)) + return u.marshal(b, ptr, deterministic) + } +} + +// makeMessageRefSliceMarshaler differs quite a lot from makeMessageSliceMarshaler +// It marshals a slice of messages []T instead of []*T +func makeMessageRefSliceMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + s := ptr.getSlice(u.typ) + n := 0 + for i := 0; i < s.Len(); i++ { + elem := s.Index(i) + e := elem.Interface() + v := toAddrPointer(&e, false) + siz := u.size(v) + n += siz + SizeVarint(uint64(siz)) + tagsize + } + return n + }, + func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + s := ptr.getSlice(u.typ) + var err, errreq error + for i := 0; i < s.Len(); i++ { + elem := s.Index(i) + e := elem.Interface() + v := toAddrPointer(&e, false) + b = appendVarint(b, wiretag) + siz := u.size(v) + b = appendVarint(b, uint64(siz)) + b, err = u.marshal(b, v, deterministic) + + if err != nil { + if _, ok := err.(*RequiredNotSetError); ok { + // Required field in submessage is not set. + // We record the error but keep going, to give a complete marshaling. + if errreq == nil { + errreq = err + } + continue + } + if err == ErrNil { + err = errRepeatedHasNil + } + return b, err + } + } + + return b, errreq + } +} + +func makeCustomPtrMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + if ptr.isNil() { + return 0 + } + m := ptr.asPointerTo(reflect.PtrTo(u.typ)).Elem().Interface().(custom) + siz := m.Size() + return tagsize + SizeVarint(uint64(siz)) + siz + }, func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + if ptr.isNil() { + return b, nil + } + m := ptr.asPointerTo(reflect.PtrTo(u.typ)).Elem().Interface().(custom) + siz := m.Size() + buf, err := m.Marshal() + if err != nil { + return nil, err + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(siz)) + b = append(b, buf...) + return b, nil + } +} + +func makeCustomMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + m := ptr.asPointerTo(u.typ).Interface().(custom) + siz := m.Size() + return tagsize + SizeVarint(uint64(siz)) + siz + }, func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + m := ptr.asPointerTo(u.typ).Interface().(custom) + siz := m.Size() + buf, err := m.Marshal() + if err != nil { + return nil, err + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(siz)) + b = append(b, buf...) + return b, nil + } +} + +func makeTimeMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + t := ptr.asPointerTo(u.typ).Interface().(*time.Time) + ts, err := timestampProto(*t) + if err != nil { + return 0 + } + siz := Size(ts) + return tagsize + SizeVarint(uint64(siz)) + siz + }, func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + t := ptr.asPointerTo(u.typ).Interface().(*time.Time) + ts, err := timestampProto(*t) + if err != nil { + return nil, err + } + buf, err := Marshal(ts) + if err != nil { + return nil, err + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(len(buf))) + b = append(b, buf...) + return b, nil + } +} + +func makeTimePtrMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + if ptr.isNil() { + return 0 + } + t := ptr.asPointerTo(reflect.PtrTo(u.typ)).Elem().Interface().(*time.Time) + ts, err := timestampProto(*t) + if err != nil { + return 0 + } + siz := Size(ts) + return tagsize + SizeVarint(uint64(siz)) + siz + }, func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + if ptr.isNil() { + return b, nil + } + t := ptr.asPointerTo(reflect.PtrTo(u.typ)).Elem().Interface().(*time.Time) + ts, err := timestampProto(*t) + if err != nil { + return nil, err + } + buf, err := Marshal(ts) + if err != nil { + return nil, err + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(len(buf))) + b = append(b, buf...) + return b, nil + } +} + +func makeTimeSliceMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + s := ptr.getSlice(u.typ) + n := 0 + for i := 0; i < s.Len(); i++ { + elem := s.Index(i) + t := elem.Interface().(time.Time) + ts, err := timestampProto(t) + if err != nil { + return 0 + } + siz := Size(ts) + n += siz + SizeVarint(uint64(siz)) + tagsize + } + return n + }, + func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + s := ptr.getSlice(u.typ) + for i := 0; i < s.Len(); i++ { + elem := s.Index(i) + t := elem.Interface().(time.Time) + ts, err := timestampProto(t) + if err != nil { + return nil, err + } + siz := Size(ts) + buf, err := Marshal(ts) + if err != nil { + return nil, err + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(siz)) + b = append(b, buf...) + } + + return b, nil + } +} + +func makeTimePtrSliceMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + s := ptr.getSlice(reflect.PtrTo(u.typ)) + n := 0 + for i := 0; i < s.Len(); i++ { + elem := s.Index(i) + t := elem.Interface().(*time.Time) + ts, err := timestampProto(*t) + if err != nil { + return 0 + } + siz := Size(ts) + n += siz + SizeVarint(uint64(siz)) + tagsize + } + return n + }, + func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + s := ptr.getSlice(reflect.PtrTo(u.typ)) + for i := 0; i < s.Len(); i++ { + elem := s.Index(i) + t := elem.Interface().(*time.Time) + ts, err := timestampProto(*t) + if err != nil { + return nil, err + } + siz := Size(ts) + buf, err := Marshal(ts) + if err != nil { + return nil, err + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(siz)) + b = append(b, buf...) + } + + return b, nil + } +} + +func makeDurationMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + d := ptr.asPointerTo(u.typ).Interface().(*time.Duration) + dur := durationProto(*d) + siz := Size(dur) + return tagsize + SizeVarint(uint64(siz)) + siz + }, func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + d := ptr.asPointerTo(u.typ).Interface().(*time.Duration) + dur := durationProto(*d) + buf, err := Marshal(dur) + if err != nil { + return nil, err + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(len(buf))) + b = append(b, buf...) + return b, nil + } +} + +func makeDurationPtrMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + if ptr.isNil() { + return 0 + } + d := ptr.asPointerTo(reflect.PtrTo(u.typ)).Elem().Interface().(*time.Duration) + dur := durationProto(*d) + siz := Size(dur) + return tagsize + SizeVarint(uint64(siz)) + siz + }, func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + if ptr.isNil() { + return b, nil + } + d := ptr.asPointerTo(reflect.PtrTo(u.typ)).Elem().Interface().(*time.Duration) + dur := durationProto(*d) + buf, err := Marshal(dur) + if err != nil { + return nil, err + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(len(buf))) + b = append(b, buf...) + return b, nil + } +} + +func makeDurationSliceMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + s := ptr.getSlice(u.typ) + n := 0 + for i := 0; i < s.Len(); i++ { + elem := s.Index(i) + d := elem.Interface().(time.Duration) + dur := durationProto(d) + siz := Size(dur) + n += siz + SizeVarint(uint64(siz)) + tagsize + } + return n + }, + func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + s := ptr.getSlice(u.typ) + for i := 0; i < s.Len(); i++ { + elem := s.Index(i) + d := elem.Interface().(time.Duration) + dur := durationProto(d) + siz := Size(dur) + buf, err := Marshal(dur) + if err != nil { + return nil, err + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(siz)) + b = append(b, buf...) + } + + return b, nil + } +} + +func makeDurationPtrSliceMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + s := ptr.getSlice(reflect.PtrTo(u.typ)) + n := 0 + for i := 0; i < s.Len(); i++ { + elem := s.Index(i) + d := elem.Interface().(*time.Duration) + dur := durationProto(*d) + siz := Size(dur) + n += siz + SizeVarint(uint64(siz)) + tagsize + } + return n + }, + func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + s := ptr.getSlice(reflect.PtrTo(u.typ)) + for i := 0; i < s.Len(); i++ { + elem := s.Index(i) + d := elem.Interface().(*time.Duration) + dur := durationProto(*d) + siz := Size(dur) + buf, err := Marshal(dur) + if err != nil { + return nil, err + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(siz)) + b = append(b, buf...) + } + + return b, nil + } +} diff --git a/vendor/github.com/gogo/protobuf/proto/table_merge.go b/vendor/github.com/gogo/protobuf/proto/table_merge.go new file mode 100644 index 00000000..60dcf70d --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/table_merge.go @@ -0,0 +1,676 @@ +// Go support for Protocol Buffers - Google's data interchange format +// +// Copyright 2016 The Go Authors. All rights reserved. +// https://github.com/golang/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// * Neither the name of Google Inc. nor the names of its +// contributors may be used to endorse or promote products derived from +// this software without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package proto + +import ( + "fmt" + "reflect" + "strings" + "sync" + "sync/atomic" +) + +// Merge merges the src message into dst. +// This assumes that dst and src of the same type and are non-nil. +func (a *InternalMessageInfo) Merge(dst, src Message) { + mi := atomicLoadMergeInfo(&a.merge) + if mi == nil { + mi = getMergeInfo(reflect.TypeOf(dst).Elem()) + atomicStoreMergeInfo(&a.merge, mi) + } + mi.merge(toPointer(&dst), toPointer(&src)) +} + +type mergeInfo struct { + typ reflect.Type + + initialized int32 // 0: only typ is valid, 1: everything is valid + lock sync.Mutex + + fields []mergeFieldInfo + unrecognized field // Offset of XXX_unrecognized +} + +type mergeFieldInfo struct { + field field // Offset of field, guaranteed to be valid + + // isPointer reports whether the value in the field is a pointer. + // This is true for the following situations: + // * Pointer to struct + // * Pointer to basic type (proto2 only) + // * Slice (first value in slice header is a pointer) + // * String (first value in string header is a pointer) + isPointer bool + + // basicWidth reports the width of the field assuming that it is directly + // embedded in the struct (as is the case for basic types in proto3). + // The possible values are: + // 0: invalid + // 1: bool + // 4: int32, uint32, float32 + // 8: int64, uint64, float64 + basicWidth int + + // Where dst and src are pointers to the types being merged. + merge func(dst, src pointer) +} + +var ( + mergeInfoMap = map[reflect.Type]*mergeInfo{} + mergeInfoLock sync.Mutex +) + +func getMergeInfo(t reflect.Type) *mergeInfo { + mergeInfoLock.Lock() + defer mergeInfoLock.Unlock() + mi := mergeInfoMap[t] + if mi == nil { + mi = &mergeInfo{typ: t} + mergeInfoMap[t] = mi + } + return mi +} + +// merge merges src into dst assuming they are both of type *mi.typ. +func (mi *mergeInfo) merge(dst, src pointer) { + if dst.isNil() { + panic("proto: nil destination") + } + if src.isNil() { + return // Nothing to do. + } + + if atomic.LoadInt32(&mi.initialized) == 0 { + mi.computeMergeInfo() + } + + for _, fi := range mi.fields { + sfp := src.offset(fi.field) + + // As an optimization, we can avoid the merge function call cost + // if we know for sure that the source will have no effect + // by checking if it is the zero value. + if unsafeAllowed { + if fi.isPointer && sfp.getPointer().isNil() { // Could be slice or string + continue + } + if fi.basicWidth > 0 { + switch { + case fi.basicWidth == 1 && !*sfp.toBool(): + continue + case fi.basicWidth == 4 && *sfp.toUint32() == 0: + continue + case fi.basicWidth == 8 && *sfp.toUint64() == 0: + continue + } + } + } + + dfp := dst.offset(fi.field) + fi.merge(dfp, sfp) + } + + // TODO: Make this faster? + out := dst.asPointerTo(mi.typ).Elem() + in := src.asPointerTo(mi.typ).Elem() + if emIn, err := extendable(in.Addr().Interface()); err == nil { + emOut, _ := extendable(out.Addr().Interface()) + mIn, muIn := emIn.extensionsRead() + if mIn != nil { + mOut := emOut.extensionsWrite() + muIn.Lock() + mergeExtension(mOut, mIn) + muIn.Unlock() + } + } + + if mi.unrecognized.IsValid() { + if b := *src.offset(mi.unrecognized).toBytes(); len(b) > 0 { + *dst.offset(mi.unrecognized).toBytes() = append([]byte(nil), b...) + } + } +} + +func (mi *mergeInfo) computeMergeInfo() { + mi.lock.Lock() + defer mi.lock.Unlock() + if mi.initialized != 0 { + return + } + t := mi.typ + n := t.NumField() + + props := GetProperties(t) + for i := 0; i < n; i++ { + f := t.Field(i) + if strings.HasPrefix(f.Name, "XXX_") { + continue + } + + mfi := mergeFieldInfo{field: toField(&f)} + tf := f.Type + + // As an optimization, we can avoid the merge function call cost + // if we know for sure that the source will have no effect + // by checking if it is the zero value. + if unsafeAllowed { + switch tf.Kind() { + case reflect.Ptr, reflect.Slice, reflect.String: + // As a special case, we assume slices and strings are pointers + // since we know that the first field in the SliceSlice or + // StringHeader is a data pointer. + mfi.isPointer = true + case reflect.Bool: + mfi.basicWidth = 1 + case reflect.Int32, reflect.Uint32, reflect.Float32: + mfi.basicWidth = 4 + case reflect.Int64, reflect.Uint64, reflect.Float64: + mfi.basicWidth = 8 + } + } + + // Unwrap tf to get at its most basic type. + var isPointer, isSlice bool + if tf.Kind() == reflect.Slice && tf.Elem().Kind() != reflect.Uint8 { + isSlice = true + tf = tf.Elem() + } + if tf.Kind() == reflect.Ptr { + isPointer = true + tf = tf.Elem() + } + if isPointer && isSlice && tf.Kind() != reflect.Struct { + panic("both pointer and slice for basic type in " + tf.Name()) + } + + switch tf.Kind() { + case reflect.Int32: + switch { + case isSlice: // E.g., []int32 + mfi.merge = func(dst, src pointer) { + // NOTE: toInt32Slice is not defined (see pointer_reflect.go). + /* + sfsp := src.toInt32Slice() + if *sfsp != nil { + dfsp := dst.toInt32Slice() + *dfsp = append(*dfsp, *sfsp...) + if *dfsp == nil { + *dfsp = []int64{} + } + } + */ + sfs := src.getInt32Slice() + if sfs != nil { + dfs := dst.getInt32Slice() + dfs = append(dfs, sfs...) + if dfs == nil { + dfs = []int32{} + } + dst.setInt32Slice(dfs) + } + } + case isPointer: // E.g., *int32 + mfi.merge = func(dst, src pointer) { + // NOTE: toInt32Ptr is not defined (see pointer_reflect.go). + /* + sfpp := src.toInt32Ptr() + if *sfpp != nil { + dfpp := dst.toInt32Ptr() + if *dfpp == nil { + *dfpp = Int32(**sfpp) + } else { + **dfpp = **sfpp + } + } + */ + sfp := src.getInt32Ptr() + if sfp != nil { + dfp := dst.getInt32Ptr() + if dfp == nil { + dst.setInt32Ptr(*sfp) + } else { + *dfp = *sfp + } + } + } + default: // E.g., int32 + mfi.merge = func(dst, src pointer) { + if v := *src.toInt32(); v != 0 { + *dst.toInt32() = v + } + } + } + case reflect.Int64: + switch { + case isSlice: // E.g., []int64 + mfi.merge = func(dst, src pointer) { + sfsp := src.toInt64Slice() + if *sfsp != nil { + dfsp := dst.toInt64Slice() + *dfsp = append(*dfsp, *sfsp...) + if *dfsp == nil { + *dfsp = []int64{} + } + } + } + case isPointer: // E.g., *int64 + mfi.merge = func(dst, src pointer) { + sfpp := src.toInt64Ptr() + if *sfpp != nil { + dfpp := dst.toInt64Ptr() + if *dfpp == nil { + *dfpp = Int64(**sfpp) + } else { + **dfpp = **sfpp + } + } + } + default: // E.g., int64 + mfi.merge = func(dst, src pointer) { + if v := *src.toInt64(); v != 0 { + *dst.toInt64() = v + } + } + } + case reflect.Uint32: + switch { + case isSlice: // E.g., []uint32 + mfi.merge = func(dst, src pointer) { + sfsp := src.toUint32Slice() + if *sfsp != nil { + dfsp := dst.toUint32Slice() + *dfsp = append(*dfsp, *sfsp...) + if *dfsp == nil { + *dfsp = []uint32{} + } + } + } + case isPointer: // E.g., *uint32 + mfi.merge = func(dst, src pointer) { + sfpp := src.toUint32Ptr() + if *sfpp != nil { + dfpp := dst.toUint32Ptr() + if *dfpp == nil { + *dfpp = Uint32(**sfpp) + } else { + **dfpp = **sfpp + } + } + } + default: // E.g., uint32 + mfi.merge = func(dst, src pointer) { + if v := *src.toUint32(); v != 0 { + *dst.toUint32() = v + } + } + } + case reflect.Uint64: + switch { + case isSlice: // E.g., []uint64 + mfi.merge = func(dst, src pointer) { + sfsp := src.toUint64Slice() + if *sfsp != nil { + dfsp := dst.toUint64Slice() + *dfsp = append(*dfsp, *sfsp...) + if *dfsp == nil { + *dfsp = []uint64{} + } + } + } + case isPointer: // E.g., *uint64 + mfi.merge = func(dst, src pointer) { + sfpp := src.toUint64Ptr() + if *sfpp != nil { + dfpp := dst.toUint64Ptr() + if *dfpp == nil { + *dfpp = Uint64(**sfpp) + } else { + **dfpp = **sfpp + } + } + } + default: // E.g., uint64 + mfi.merge = func(dst, src pointer) { + if v := *src.toUint64(); v != 0 { + *dst.toUint64() = v + } + } + } + case reflect.Float32: + switch { + case isSlice: // E.g., []float32 + mfi.merge = func(dst, src pointer) { + sfsp := src.toFloat32Slice() + if *sfsp != nil { + dfsp := dst.toFloat32Slice() + *dfsp = append(*dfsp, *sfsp...) + if *dfsp == nil { + *dfsp = []float32{} + } + } + } + case isPointer: // E.g., *float32 + mfi.merge = func(dst, src pointer) { + sfpp := src.toFloat32Ptr() + if *sfpp != nil { + dfpp := dst.toFloat32Ptr() + if *dfpp == nil { + *dfpp = Float32(**sfpp) + } else { + **dfpp = **sfpp + } + } + } + default: // E.g., float32 + mfi.merge = func(dst, src pointer) { + if v := *src.toFloat32(); v != 0 { + *dst.toFloat32() = v + } + } + } + case reflect.Float64: + switch { + case isSlice: // E.g., []float64 + mfi.merge = func(dst, src pointer) { + sfsp := src.toFloat64Slice() + if *sfsp != nil { + dfsp := dst.toFloat64Slice() + *dfsp = append(*dfsp, *sfsp...) + if *dfsp == nil { + *dfsp = []float64{} + } + } + } + case isPointer: // E.g., *float64 + mfi.merge = func(dst, src pointer) { + sfpp := src.toFloat64Ptr() + if *sfpp != nil { + dfpp := dst.toFloat64Ptr() + if *dfpp == nil { + *dfpp = Float64(**sfpp) + } else { + **dfpp = **sfpp + } + } + } + default: // E.g., float64 + mfi.merge = func(dst, src pointer) { + if v := *src.toFloat64(); v != 0 { + *dst.toFloat64() = v + } + } + } + case reflect.Bool: + switch { + case isSlice: // E.g., []bool + mfi.merge = func(dst, src pointer) { + sfsp := src.toBoolSlice() + if *sfsp != nil { + dfsp := dst.toBoolSlice() + *dfsp = append(*dfsp, *sfsp...) + if *dfsp == nil { + *dfsp = []bool{} + } + } + } + case isPointer: // E.g., *bool + mfi.merge = func(dst, src pointer) { + sfpp := src.toBoolPtr() + if *sfpp != nil { + dfpp := dst.toBoolPtr() + if *dfpp == nil { + *dfpp = Bool(**sfpp) + } else { + **dfpp = **sfpp + } + } + } + default: // E.g., bool + mfi.merge = func(dst, src pointer) { + if v := *src.toBool(); v { + *dst.toBool() = v + } + } + } + case reflect.String: + switch { + case isSlice: // E.g., []string + mfi.merge = func(dst, src pointer) { + sfsp := src.toStringSlice() + if *sfsp != nil { + dfsp := dst.toStringSlice() + *dfsp = append(*dfsp, *sfsp...) + if *dfsp == nil { + *dfsp = []string{} + } + } + } + case isPointer: // E.g., *string + mfi.merge = func(dst, src pointer) { + sfpp := src.toStringPtr() + if *sfpp != nil { + dfpp := dst.toStringPtr() + if *dfpp == nil { + *dfpp = String(**sfpp) + } else { + **dfpp = **sfpp + } + } + } + default: // E.g., string + mfi.merge = func(dst, src pointer) { + if v := *src.toString(); v != "" { + *dst.toString() = v + } + } + } + case reflect.Slice: + isProto3 := props.Prop[i].proto3 + switch { + case isPointer: + panic("bad pointer in byte slice case in " + tf.Name()) + case tf.Elem().Kind() != reflect.Uint8: + panic("bad element kind in byte slice case in " + tf.Name()) + case isSlice: // E.g., [][]byte + mfi.merge = func(dst, src pointer) { + sbsp := src.toBytesSlice() + if *sbsp != nil { + dbsp := dst.toBytesSlice() + for _, sb := range *sbsp { + if sb == nil { + *dbsp = append(*dbsp, nil) + } else { + *dbsp = append(*dbsp, append([]byte{}, sb...)) + } + } + if *dbsp == nil { + *dbsp = [][]byte{} + } + } + } + default: // E.g., []byte + mfi.merge = func(dst, src pointer) { + sbp := src.toBytes() + if *sbp != nil { + dbp := dst.toBytes() + if !isProto3 || len(*sbp) > 0 { + *dbp = append([]byte{}, *sbp...) + } + } + } + } + case reflect.Struct: + switch { + case isSlice && !isPointer: // E.g. []pb.T + mergeInfo := getMergeInfo(tf) + zero := reflect.Zero(tf) + mfi.merge = func(dst, src pointer) { + // TODO: Make this faster? + dstsp := dst.asPointerTo(f.Type) + dsts := dstsp.Elem() + srcs := src.asPointerTo(f.Type).Elem() + for i := 0; i < srcs.Len(); i++ { + dsts = reflect.Append(dsts, zero) + srcElement := srcs.Index(i).Addr() + dstElement := dsts.Index(dsts.Len() - 1).Addr() + mergeInfo.merge(valToPointer(dstElement), valToPointer(srcElement)) + } + if dsts.IsNil() { + dsts = reflect.MakeSlice(f.Type, 0, 0) + } + dstsp.Elem().Set(dsts) + } + case !isPointer: + mergeInfo := getMergeInfo(tf) + mfi.merge = func(dst, src pointer) { + mergeInfo.merge(dst, src) + } + case isSlice: // E.g., []*pb.T + mergeInfo := getMergeInfo(tf) + mfi.merge = func(dst, src pointer) { + sps := src.getPointerSlice() + if sps != nil { + dps := dst.getPointerSlice() + for _, sp := range sps { + var dp pointer + if !sp.isNil() { + dp = valToPointer(reflect.New(tf)) + mergeInfo.merge(dp, sp) + } + dps = append(dps, dp) + } + if dps == nil { + dps = []pointer{} + } + dst.setPointerSlice(dps) + } + } + default: // E.g., *pb.T + mergeInfo := getMergeInfo(tf) + mfi.merge = func(dst, src pointer) { + sp := src.getPointer() + if !sp.isNil() { + dp := dst.getPointer() + if dp.isNil() { + dp = valToPointer(reflect.New(tf)) + dst.setPointer(dp) + } + mergeInfo.merge(dp, sp) + } + } + } + case reflect.Map: + switch { + case isPointer || isSlice: + panic("bad pointer or slice in map case in " + tf.Name()) + default: // E.g., map[K]V + mfi.merge = func(dst, src pointer) { + sm := src.asPointerTo(tf).Elem() + if sm.Len() == 0 { + return + } + dm := dst.asPointerTo(tf).Elem() + if dm.IsNil() { + dm.Set(reflect.MakeMap(tf)) + } + + switch tf.Elem().Kind() { + case reflect.Ptr: // Proto struct (e.g., *T) + for _, key := range sm.MapKeys() { + val := sm.MapIndex(key) + val = reflect.ValueOf(Clone(val.Interface().(Message))) + dm.SetMapIndex(key, val) + } + case reflect.Slice: // E.g. Bytes type (e.g., []byte) + for _, key := range sm.MapKeys() { + val := sm.MapIndex(key) + val = reflect.ValueOf(append([]byte{}, val.Bytes()...)) + dm.SetMapIndex(key, val) + } + default: // Basic type (e.g., string) + for _, key := range sm.MapKeys() { + val := sm.MapIndex(key) + dm.SetMapIndex(key, val) + } + } + } + } + case reflect.Interface: + // Must be oneof field. + switch { + case isPointer || isSlice: + panic("bad pointer or slice in interface case in " + tf.Name()) + default: // E.g., interface{} + // TODO: Make this faster? + mfi.merge = func(dst, src pointer) { + su := src.asPointerTo(tf).Elem() + if !su.IsNil() { + du := dst.asPointerTo(tf).Elem() + typ := su.Elem().Type() + if du.IsNil() || du.Elem().Type() != typ { + du.Set(reflect.New(typ.Elem())) // Initialize interface if empty + } + sv := su.Elem().Elem().Field(0) + if sv.Kind() == reflect.Ptr && sv.IsNil() { + return + } + dv := du.Elem().Elem().Field(0) + if dv.Kind() == reflect.Ptr && dv.IsNil() { + dv.Set(reflect.New(sv.Type().Elem())) // Initialize proto message if empty + } + switch sv.Type().Kind() { + case reflect.Ptr: // Proto struct (e.g., *T) + Merge(dv.Interface().(Message), sv.Interface().(Message)) + case reflect.Slice: // E.g. Bytes type (e.g., []byte) + dv.Set(reflect.ValueOf(append([]byte{}, sv.Bytes()...))) + default: // Basic type (e.g., string) + dv.Set(sv) + } + } + } + } + default: + panic(fmt.Sprintf("merger not found for type:%s", tf)) + } + mi.fields = append(mi.fields, mfi) + } + + mi.unrecognized = invalidField + if f, ok := t.FieldByName("XXX_unrecognized"); ok { + if f.Type != reflect.TypeOf([]byte{}) { + panic("expected XXX_unrecognized to be of type []byte") + } + mi.unrecognized = toField(&f) + } + + atomic.StoreInt32(&mi.initialized, 1) +} diff --git a/vendor/github.com/gogo/protobuf/proto/table_unmarshal.go b/vendor/github.com/gogo/protobuf/proto/table_unmarshal.go new file mode 100644 index 00000000..93722938 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/table_unmarshal.go @@ -0,0 +1,2249 @@ +// Go support for Protocol Buffers - Google's data interchange format +// +// Copyright 2016 The Go Authors. All rights reserved. +// https://github.com/golang/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// * Neither the name of Google Inc. nor the names of its +// contributors may be used to endorse or promote products derived from +// this software without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package proto + +import ( + "errors" + "fmt" + "io" + "math" + "reflect" + "strconv" + "strings" + "sync" + "sync/atomic" + "unicode/utf8" +) + +// Unmarshal is the entry point from the generated .pb.go files. +// This function is not intended to be used by non-generated code. +// This function is not subject to any compatibility guarantee. +// msg contains a pointer to a protocol buffer struct. +// b is the data to be unmarshaled into the protocol buffer. +// a is a pointer to a place to store cached unmarshal information. +func (a *InternalMessageInfo) Unmarshal(msg Message, b []byte) error { + // Load the unmarshal information for this message type. + // The atomic load ensures memory consistency. + u := atomicLoadUnmarshalInfo(&a.unmarshal) + if u == nil { + // Slow path: find unmarshal info for msg, update a with it. + u = getUnmarshalInfo(reflect.TypeOf(msg).Elem()) + atomicStoreUnmarshalInfo(&a.unmarshal, u) + } + // Then do the unmarshaling. + err := u.unmarshal(toPointer(&msg), b) + return err +} + +type unmarshalInfo struct { + typ reflect.Type // type of the protobuf struct + + // 0 = only typ field is initialized + // 1 = completely initialized + initialized int32 + lock sync.Mutex // prevents double initialization + dense []unmarshalFieldInfo // fields indexed by tag # + sparse map[uint64]unmarshalFieldInfo // fields indexed by tag # + reqFields []string // names of required fields + reqMask uint64 // 1< 0 { + // Read tag and wire type. + // Special case 1 and 2 byte varints. + var x uint64 + if b[0] < 128 { + x = uint64(b[0]) + b = b[1:] + } else if len(b) >= 2 && b[1] < 128 { + x = uint64(b[0]&0x7f) + uint64(b[1])<<7 + b = b[2:] + } else { + var n int + x, n = decodeVarint(b) + if n == 0 { + return io.ErrUnexpectedEOF + } + b = b[n:] + } + tag := x >> 3 + wire := int(x) & 7 + + // Dispatch on the tag to one of the unmarshal* functions below. + var f unmarshalFieldInfo + if tag < uint64(len(u.dense)) { + f = u.dense[tag] + } else { + f = u.sparse[tag] + } + if fn := f.unmarshal; fn != nil { + var err error + b, err = fn(b, m.offset(f.field), wire) + if err == nil { + reqMask |= f.reqMask + continue + } + if r, ok := err.(*RequiredNotSetError); ok { + // Remember this error, but keep parsing. We need to produce + // a full parse even if a required field is missing. + if errLater == nil { + errLater = r + } + reqMask |= f.reqMask + continue + } + if err != errInternalBadWireType { + if err == errInvalidUTF8 { + if errLater == nil { + fullName := revProtoTypes[reflect.PtrTo(u.typ)] + "." + f.name + errLater = &invalidUTF8Error{fullName} + } + continue + } + return err + } + // Fragments with bad wire type are treated as unknown fields. + } + + // Unknown tag. + if !u.unrecognized.IsValid() { + // Don't keep unrecognized data; just skip it. + var err error + b, err = skipField(b, wire) + if err != nil { + return err + } + continue + } + // Keep unrecognized data around. + // maybe in extensions, maybe in the unrecognized field. + z := m.offset(u.unrecognized).toBytes() + var emap map[int32]Extension + var e Extension + for _, r := range u.extensionRanges { + if uint64(r.Start) <= tag && tag <= uint64(r.End) { + if u.extensions.IsValid() { + mp := m.offset(u.extensions).toExtensions() + emap = mp.extensionsWrite() + e = emap[int32(tag)] + z = &e.enc + break + } + if u.oldExtensions.IsValid() { + p := m.offset(u.oldExtensions).toOldExtensions() + emap = *p + if emap == nil { + emap = map[int32]Extension{} + *p = emap + } + e = emap[int32(tag)] + z = &e.enc + break + } + if u.bytesExtensions.IsValid() { + z = m.offset(u.bytesExtensions).toBytes() + break + } + panic("no extensions field available") + } + } + // Use wire type to skip data. + var err error + b0 := b + b, err = skipField(b, wire) + if err != nil { + return err + } + *z = encodeVarint(*z, tag<<3|uint64(wire)) + *z = append(*z, b0[:len(b0)-len(b)]...) + + if emap != nil { + emap[int32(tag)] = e + } + } + if reqMask != u.reqMask && errLater == nil { + // A required field of this message is missing. + for _, n := range u.reqFields { + if reqMask&1 == 0 { + errLater = &RequiredNotSetError{n} + } + reqMask >>= 1 + } + } + return errLater +} + +// computeUnmarshalInfo fills in u with information for use +// in unmarshaling protocol buffers of type u.typ. +func (u *unmarshalInfo) computeUnmarshalInfo() { + u.lock.Lock() + defer u.lock.Unlock() + if u.initialized != 0 { + return + } + t := u.typ + n := t.NumField() + + // Set up the "not found" value for the unrecognized byte buffer. + // This is the default for proto3. + u.unrecognized = invalidField + u.extensions = invalidField + u.oldExtensions = invalidField + u.bytesExtensions = invalidField + + // List of the generated type and offset for each oneof field. + type oneofField struct { + ityp reflect.Type // interface type of oneof field + field field // offset in containing message + } + var oneofFields []oneofField + + for i := 0; i < n; i++ { + f := t.Field(i) + if f.Name == "XXX_unrecognized" { + // The byte slice used to hold unrecognized input is special. + if f.Type != reflect.TypeOf(([]byte)(nil)) { + panic("bad type for XXX_unrecognized field: " + f.Type.Name()) + } + u.unrecognized = toField(&f) + continue + } + if f.Name == "XXX_InternalExtensions" { + // Ditto here. + if f.Type != reflect.TypeOf(XXX_InternalExtensions{}) { + panic("bad type for XXX_InternalExtensions field: " + f.Type.Name()) + } + u.extensions = toField(&f) + if f.Tag.Get("protobuf_messageset") == "1" { + u.isMessageSet = true + } + continue + } + if f.Name == "XXX_extensions" { + // An older form of the extensions field. + if f.Type == reflect.TypeOf((map[int32]Extension)(nil)) { + u.oldExtensions = toField(&f) + continue + } else if f.Type == reflect.TypeOf(([]byte)(nil)) { + u.bytesExtensions = toField(&f) + continue + } + panic("bad type for XXX_extensions field: " + f.Type.Name()) + } + if f.Name == "XXX_NoUnkeyedLiteral" || f.Name == "XXX_sizecache" { + continue + } + + oneof := f.Tag.Get("protobuf_oneof") + if oneof != "" { + oneofFields = append(oneofFields, oneofField{f.Type, toField(&f)}) + // The rest of oneof processing happens below. + continue + } + + tags := f.Tag.Get("protobuf") + tagArray := strings.Split(tags, ",") + if len(tagArray) < 2 { + panic("protobuf tag not enough fields in " + t.Name() + "." + f.Name + ": " + tags) + } + tag, err := strconv.Atoi(tagArray[1]) + if err != nil { + panic("protobuf tag field not an integer: " + tagArray[1]) + } + + name := "" + for _, tag := range tagArray[3:] { + if strings.HasPrefix(tag, "name=") { + name = tag[5:] + } + } + + // Extract unmarshaling function from the field (its type and tags). + unmarshal := fieldUnmarshaler(&f) + + // Required field? + var reqMask uint64 + if tagArray[2] == "req" { + bit := len(u.reqFields) + u.reqFields = append(u.reqFields, name) + reqMask = uint64(1) << uint(bit) + // TODO: if we have more than 64 required fields, we end up + // not verifying that all required fields are present. + // Fix this, perhaps using a count of required fields? + } + + // Store the info in the correct slot in the message. + u.setTag(tag, toField(&f), unmarshal, reqMask, name) + } + + // Find any types associated with oneof fields. + // gogo: len(oneofFields) > 0 is needed for embedded oneof messages, without a marshaler and unmarshaler + if len(oneofFields) > 0 { + var oneofImplementers []interface{} + switch m := reflect.Zero(reflect.PtrTo(t)).Interface().(type) { + case oneofFuncsIface: + _, _, _, oneofImplementers = m.XXX_OneofFuncs() + case oneofWrappersIface: + oneofImplementers = m.XXX_OneofWrappers() + } + for _, v := range oneofImplementers { + tptr := reflect.TypeOf(v) // *Msg_X + typ := tptr.Elem() // Msg_X + + f := typ.Field(0) // oneof implementers have one field + baseUnmarshal := fieldUnmarshaler(&f) + tags := strings.Split(f.Tag.Get("protobuf"), ",") + fieldNum, err := strconv.Atoi(tags[1]) + if err != nil { + panic("protobuf tag field not an integer: " + tags[1]) + } + var name string + for _, tag := range tags { + if strings.HasPrefix(tag, "name=") { + name = strings.TrimPrefix(tag, "name=") + break + } + } + + // Find the oneof field that this struct implements. + // Might take O(n^2) to process all of the oneofs, but who cares. + for _, of := range oneofFields { + if tptr.Implements(of.ityp) { + // We have found the corresponding interface for this struct. + // That lets us know where this struct should be stored + // when we encounter it during unmarshaling. + unmarshal := makeUnmarshalOneof(typ, of.ityp, baseUnmarshal) + u.setTag(fieldNum, of.field, unmarshal, 0, name) + } + } + + } + } + + // Get extension ranges, if any. + fn := reflect.Zero(reflect.PtrTo(t)).MethodByName("ExtensionRangeArray") + if fn.IsValid() { + if !u.extensions.IsValid() && !u.oldExtensions.IsValid() && !u.bytesExtensions.IsValid() { + panic("a message with extensions, but no extensions field in " + t.Name()) + } + u.extensionRanges = fn.Call(nil)[0].Interface().([]ExtensionRange) + } + + // Explicitly disallow tag 0. This will ensure we flag an error + // when decoding a buffer of all zeros. Without this code, we + // would decode and skip an all-zero buffer of even length. + // [0 0] is [tag=0/wiretype=varint varint-encoded-0]. + u.setTag(0, zeroField, func(b []byte, f pointer, w int) ([]byte, error) { + return nil, fmt.Errorf("proto: %s: illegal tag 0 (wire type %d)", t, w) + }, 0, "") + + // Set mask for required field check. + u.reqMask = uint64(1)<= 0 && (tag < 16 || tag < 2*n) { // TODO: what are the right numbers here? + for len(u.dense) <= tag { + u.dense = append(u.dense, unmarshalFieldInfo{}) + } + u.dense[tag] = i + return + } + if u.sparse == nil { + u.sparse = map[uint64]unmarshalFieldInfo{} + } + u.sparse[uint64(tag)] = i +} + +// fieldUnmarshaler returns an unmarshaler for the given field. +func fieldUnmarshaler(f *reflect.StructField) unmarshaler { + if f.Type.Kind() == reflect.Map { + return makeUnmarshalMap(f) + } + return typeUnmarshaler(f.Type, f.Tag.Get("protobuf")) +} + +// typeUnmarshaler returns an unmarshaler for the given field type / field tag pair. +func typeUnmarshaler(t reflect.Type, tags string) unmarshaler { + tagArray := strings.Split(tags, ",") + encoding := tagArray[0] + name := "unknown" + ctype := false + isTime := false + isDuration := false + isWktPointer := false + proto3 := false + validateUTF8 := true + for _, tag := range tagArray[3:] { + if strings.HasPrefix(tag, "name=") { + name = tag[5:] + } + if tag == "proto3" { + proto3 = true + } + if strings.HasPrefix(tag, "customtype=") { + ctype = true + } + if tag == "stdtime" { + isTime = true + } + if tag == "stdduration" { + isDuration = true + } + if tag == "wktptr" { + isWktPointer = true + } + } + validateUTF8 = validateUTF8 && proto3 + + // Figure out packaging (pointer, slice, or both) + slice := false + pointer := false + if t.Kind() == reflect.Slice && t.Elem().Kind() != reflect.Uint8 { + slice = true + t = t.Elem() + } + if t.Kind() == reflect.Ptr { + pointer = true + t = t.Elem() + } + + if ctype { + if reflect.PtrTo(t).Implements(customType) { + if slice { + return makeUnmarshalCustomSlice(getUnmarshalInfo(t), name) + } + if pointer { + return makeUnmarshalCustomPtr(getUnmarshalInfo(t), name) + } + return makeUnmarshalCustom(getUnmarshalInfo(t), name) + } else { + panic(fmt.Sprintf("custom type: type: %v, does not implement the proto.custom interface", t)) + } + } + + if isTime { + if pointer { + if slice { + return makeUnmarshalTimePtrSlice(getUnmarshalInfo(t), name) + } + return makeUnmarshalTimePtr(getUnmarshalInfo(t), name) + } + if slice { + return makeUnmarshalTimeSlice(getUnmarshalInfo(t), name) + } + return makeUnmarshalTime(getUnmarshalInfo(t), name) + } + + if isDuration { + if pointer { + if slice { + return makeUnmarshalDurationPtrSlice(getUnmarshalInfo(t), name) + } + return makeUnmarshalDurationPtr(getUnmarshalInfo(t), name) + } + if slice { + return makeUnmarshalDurationSlice(getUnmarshalInfo(t), name) + } + return makeUnmarshalDuration(getUnmarshalInfo(t), name) + } + + if isWktPointer { + switch t.Kind() { + case reflect.Float64: + if pointer { + if slice { + return makeStdDoubleValuePtrSliceUnmarshaler(getUnmarshalInfo(t), name) + } + return makeStdDoubleValuePtrUnmarshaler(getUnmarshalInfo(t), name) + } + if slice { + return makeStdDoubleValueSliceUnmarshaler(getUnmarshalInfo(t), name) + } + return makeStdDoubleValueUnmarshaler(getUnmarshalInfo(t), name) + case reflect.Float32: + if pointer { + if slice { + return makeStdFloatValuePtrSliceUnmarshaler(getUnmarshalInfo(t), name) + } + return makeStdFloatValuePtrUnmarshaler(getUnmarshalInfo(t), name) + } + if slice { + return makeStdFloatValueSliceUnmarshaler(getUnmarshalInfo(t), name) + } + return makeStdFloatValueUnmarshaler(getUnmarshalInfo(t), name) + case reflect.Int64: + if pointer { + if slice { + return makeStdInt64ValuePtrSliceUnmarshaler(getUnmarshalInfo(t), name) + } + return makeStdInt64ValuePtrUnmarshaler(getUnmarshalInfo(t), name) + } + if slice { + return makeStdInt64ValueSliceUnmarshaler(getUnmarshalInfo(t), name) + } + return makeStdInt64ValueUnmarshaler(getUnmarshalInfo(t), name) + case reflect.Uint64: + if pointer { + if slice { + return makeStdUInt64ValuePtrSliceUnmarshaler(getUnmarshalInfo(t), name) + } + return makeStdUInt64ValuePtrUnmarshaler(getUnmarshalInfo(t), name) + } + if slice { + return makeStdUInt64ValueSliceUnmarshaler(getUnmarshalInfo(t), name) + } + return makeStdUInt64ValueUnmarshaler(getUnmarshalInfo(t), name) + case reflect.Int32: + if pointer { + if slice { + return makeStdInt32ValuePtrSliceUnmarshaler(getUnmarshalInfo(t), name) + } + return makeStdInt32ValuePtrUnmarshaler(getUnmarshalInfo(t), name) + } + if slice { + return makeStdInt32ValueSliceUnmarshaler(getUnmarshalInfo(t), name) + } + return makeStdInt32ValueUnmarshaler(getUnmarshalInfo(t), name) + case reflect.Uint32: + if pointer { + if slice { + return makeStdUInt32ValuePtrSliceUnmarshaler(getUnmarshalInfo(t), name) + } + return makeStdUInt32ValuePtrUnmarshaler(getUnmarshalInfo(t), name) + } + if slice { + return makeStdUInt32ValueSliceUnmarshaler(getUnmarshalInfo(t), name) + } + return makeStdUInt32ValueUnmarshaler(getUnmarshalInfo(t), name) + case reflect.Bool: + if pointer { + if slice { + return makeStdBoolValuePtrSliceUnmarshaler(getUnmarshalInfo(t), name) + } + return makeStdBoolValuePtrUnmarshaler(getUnmarshalInfo(t), name) + } + if slice { + return makeStdBoolValueSliceUnmarshaler(getUnmarshalInfo(t), name) + } + return makeStdBoolValueUnmarshaler(getUnmarshalInfo(t), name) + case reflect.String: + if pointer { + if slice { + return makeStdStringValuePtrSliceUnmarshaler(getUnmarshalInfo(t), name) + } + return makeStdStringValuePtrUnmarshaler(getUnmarshalInfo(t), name) + } + if slice { + return makeStdStringValueSliceUnmarshaler(getUnmarshalInfo(t), name) + } + return makeStdStringValueUnmarshaler(getUnmarshalInfo(t), name) + case uint8SliceType: + if pointer { + if slice { + return makeStdBytesValuePtrSliceUnmarshaler(getUnmarshalInfo(t), name) + } + return makeStdBytesValuePtrUnmarshaler(getUnmarshalInfo(t), name) + } + if slice { + return makeStdBytesValueSliceUnmarshaler(getUnmarshalInfo(t), name) + } + return makeStdBytesValueUnmarshaler(getUnmarshalInfo(t), name) + default: + panic(fmt.Sprintf("unknown wktpointer type %#v", t)) + } + } + + // We'll never have both pointer and slice for basic types. + if pointer && slice && t.Kind() != reflect.Struct { + panic("both pointer and slice for basic type in " + t.Name()) + } + + switch t.Kind() { + case reflect.Bool: + if pointer { + return unmarshalBoolPtr + } + if slice { + return unmarshalBoolSlice + } + return unmarshalBoolValue + case reflect.Int32: + switch encoding { + case "fixed32": + if pointer { + return unmarshalFixedS32Ptr + } + if slice { + return unmarshalFixedS32Slice + } + return unmarshalFixedS32Value + case "varint": + // this could be int32 or enum + if pointer { + return unmarshalInt32Ptr + } + if slice { + return unmarshalInt32Slice + } + return unmarshalInt32Value + case "zigzag32": + if pointer { + return unmarshalSint32Ptr + } + if slice { + return unmarshalSint32Slice + } + return unmarshalSint32Value + } + case reflect.Int64: + switch encoding { + case "fixed64": + if pointer { + return unmarshalFixedS64Ptr + } + if slice { + return unmarshalFixedS64Slice + } + return unmarshalFixedS64Value + case "varint": + if pointer { + return unmarshalInt64Ptr + } + if slice { + return unmarshalInt64Slice + } + return unmarshalInt64Value + case "zigzag64": + if pointer { + return unmarshalSint64Ptr + } + if slice { + return unmarshalSint64Slice + } + return unmarshalSint64Value + } + case reflect.Uint32: + switch encoding { + case "fixed32": + if pointer { + return unmarshalFixed32Ptr + } + if slice { + return unmarshalFixed32Slice + } + return unmarshalFixed32Value + case "varint": + if pointer { + return unmarshalUint32Ptr + } + if slice { + return unmarshalUint32Slice + } + return unmarshalUint32Value + } + case reflect.Uint64: + switch encoding { + case "fixed64": + if pointer { + return unmarshalFixed64Ptr + } + if slice { + return unmarshalFixed64Slice + } + return unmarshalFixed64Value + case "varint": + if pointer { + return unmarshalUint64Ptr + } + if slice { + return unmarshalUint64Slice + } + return unmarshalUint64Value + } + case reflect.Float32: + if pointer { + return unmarshalFloat32Ptr + } + if slice { + return unmarshalFloat32Slice + } + return unmarshalFloat32Value + case reflect.Float64: + if pointer { + return unmarshalFloat64Ptr + } + if slice { + return unmarshalFloat64Slice + } + return unmarshalFloat64Value + case reflect.Map: + panic("map type in typeUnmarshaler in " + t.Name()) + case reflect.Slice: + if pointer { + panic("bad pointer in slice case in " + t.Name()) + } + if slice { + return unmarshalBytesSlice + } + return unmarshalBytesValue + case reflect.String: + if validateUTF8 { + if pointer { + return unmarshalUTF8StringPtr + } + if slice { + return unmarshalUTF8StringSlice + } + return unmarshalUTF8StringValue + } + if pointer { + return unmarshalStringPtr + } + if slice { + return unmarshalStringSlice + } + return unmarshalStringValue + case reflect.Struct: + // message or group field + if !pointer { + switch encoding { + case "bytes": + if slice { + return makeUnmarshalMessageSlice(getUnmarshalInfo(t), name) + } + return makeUnmarshalMessage(getUnmarshalInfo(t), name) + } + } + switch encoding { + case "bytes": + if slice { + return makeUnmarshalMessageSlicePtr(getUnmarshalInfo(t), name) + } + return makeUnmarshalMessagePtr(getUnmarshalInfo(t), name) + case "group": + if slice { + return makeUnmarshalGroupSlicePtr(getUnmarshalInfo(t), name) + } + return makeUnmarshalGroupPtr(getUnmarshalInfo(t), name) + } + } + panic(fmt.Sprintf("unmarshaler not found type:%s encoding:%s", t, encoding)) +} + +// Below are all the unmarshalers for individual fields of various types. + +func unmarshalInt64Value(b []byte, f pointer, w int) ([]byte, error) { + if w != WireVarint { + return b, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + v := int64(x) + *f.toInt64() = v + return b, nil +} + +func unmarshalInt64Ptr(b []byte, f pointer, w int) ([]byte, error) { + if w != WireVarint { + return b, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + v := int64(x) + *f.toInt64Ptr() = &v + return b, nil +} + +func unmarshalInt64Slice(b []byte, f pointer, w int) ([]byte, error) { + if w == WireBytes { // packed + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + res := b[x:] + b = b[:x] + for len(b) > 0 { + x, n = decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + v := int64(x) + s := f.toInt64Slice() + *s = append(*s, v) + } + return res, nil + } + if w != WireVarint { + return b, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + v := int64(x) + s := f.toInt64Slice() + *s = append(*s, v) + return b, nil +} + +func unmarshalSint64Value(b []byte, f pointer, w int) ([]byte, error) { + if w != WireVarint { + return b, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + v := int64(x>>1) ^ int64(x)<<63>>63 + *f.toInt64() = v + return b, nil +} + +func unmarshalSint64Ptr(b []byte, f pointer, w int) ([]byte, error) { + if w != WireVarint { + return b, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + v := int64(x>>1) ^ int64(x)<<63>>63 + *f.toInt64Ptr() = &v + return b, nil +} + +func unmarshalSint64Slice(b []byte, f pointer, w int) ([]byte, error) { + if w == WireBytes { // packed + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + res := b[x:] + b = b[:x] + for len(b) > 0 { + x, n = decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + v := int64(x>>1) ^ int64(x)<<63>>63 + s := f.toInt64Slice() + *s = append(*s, v) + } + return res, nil + } + if w != WireVarint { + return b, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + v := int64(x>>1) ^ int64(x)<<63>>63 + s := f.toInt64Slice() + *s = append(*s, v) + return b, nil +} + +func unmarshalUint64Value(b []byte, f pointer, w int) ([]byte, error) { + if w != WireVarint { + return b, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + v := uint64(x) + *f.toUint64() = v + return b, nil +} + +func unmarshalUint64Ptr(b []byte, f pointer, w int) ([]byte, error) { + if w != WireVarint { + return b, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + v := uint64(x) + *f.toUint64Ptr() = &v + return b, nil +} + +func unmarshalUint64Slice(b []byte, f pointer, w int) ([]byte, error) { + if w == WireBytes { // packed + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + res := b[x:] + b = b[:x] + for len(b) > 0 { + x, n = decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + v := uint64(x) + s := f.toUint64Slice() + *s = append(*s, v) + } + return res, nil + } + if w != WireVarint { + return b, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + v := uint64(x) + s := f.toUint64Slice() + *s = append(*s, v) + return b, nil +} + +func unmarshalInt32Value(b []byte, f pointer, w int) ([]byte, error) { + if w != WireVarint { + return b, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + v := int32(x) + *f.toInt32() = v + return b, nil +} + +func unmarshalInt32Ptr(b []byte, f pointer, w int) ([]byte, error) { + if w != WireVarint { + return b, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + v := int32(x) + f.setInt32Ptr(v) + return b, nil +} + +func unmarshalInt32Slice(b []byte, f pointer, w int) ([]byte, error) { + if w == WireBytes { // packed + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + res := b[x:] + b = b[:x] + for len(b) > 0 { + x, n = decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + v := int32(x) + f.appendInt32Slice(v) + } + return res, nil + } + if w != WireVarint { + return b, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + v := int32(x) + f.appendInt32Slice(v) + return b, nil +} + +func unmarshalSint32Value(b []byte, f pointer, w int) ([]byte, error) { + if w != WireVarint { + return b, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + v := int32(x>>1) ^ int32(x)<<31>>31 + *f.toInt32() = v + return b, nil +} + +func unmarshalSint32Ptr(b []byte, f pointer, w int) ([]byte, error) { + if w != WireVarint { + return b, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + v := int32(x>>1) ^ int32(x)<<31>>31 + f.setInt32Ptr(v) + return b, nil +} + +func unmarshalSint32Slice(b []byte, f pointer, w int) ([]byte, error) { + if w == WireBytes { // packed + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + res := b[x:] + b = b[:x] + for len(b) > 0 { + x, n = decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + v := int32(x>>1) ^ int32(x)<<31>>31 + f.appendInt32Slice(v) + } + return res, nil + } + if w != WireVarint { + return b, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + v := int32(x>>1) ^ int32(x)<<31>>31 + f.appendInt32Slice(v) + return b, nil +} + +func unmarshalUint32Value(b []byte, f pointer, w int) ([]byte, error) { + if w != WireVarint { + return b, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + v := uint32(x) + *f.toUint32() = v + return b, nil +} + +func unmarshalUint32Ptr(b []byte, f pointer, w int) ([]byte, error) { + if w != WireVarint { + return b, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + v := uint32(x) + *f.toUint32Ptr() = &v + return b, nil +} + +func unmarshalUint32Slice(b []byte, f pointer, w int) ([]byte, error) { + if w == WireBytes { // packed + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + res := b[x:] + b = b[:x] + for len(b) > 0 { + x, n = decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + v := uint32(x) + s := f.toUint32Slice() + *s = append(*s, v) + } + return res, nil + } + if w != WireVarint { + return b, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + v := uint32(x) + s := f.toUint32Slice() + *s = append(*s, v) + return b, nil +} + +func unmarshalFixed64Value(b []byte, f pointer, w int) ([]byte, error) { + if w != WireFixed64 { + return b, errInternalBadWireType + } + if len(b) < 8 { + return nil, io.ErrUnexpectedEOF + } + v := uint64(b[0]) | uint64(b[1])<<8 | uint64(b[2])<<16 | uint64(b[3])<<24 | uint64(b[4])<<32 | uint64(b[5])<<40 | uint64(b[6])<<48 | uint64(b[7])<<56 + *f.toUint64() = v + return b[8:], nil +} + +func unmarshalFixed64Ptr(b []byte, f pointer, w int) ([]byte, error) { + if w != WireFixed64 { + return b, errInternalBadWireType + } + if len(b) < 8 { + return nil, io.ErrUnexpectedEOF + } + v := uint64(b[0]) | uint64(b[1])<<8 | uint64(b[2])<<16 | uint64(b[3])<<24 | uint64(b[4])<<32 | uint64(b[5])<<40 | uint64(b[6])<<48 | uint64(b[7])<<56 + *f.toUint64Ptr() = &v + return b[8:], nil +} + +func unmarshalFixed64Slice(b []byte, f pointer, w int) ([]byte, error) { + if w == WireBytes { // packed + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + res := b[x:] + b = b[:x] + for len(b) > 0 { + if len(b) < 8 { + return nil, io.ErrUnexpectedEOF + } + v := uint64(b[0]) | uint64(b[1])<<8 | uint64(b[2])<<16 | uint64(b[3])<<24 | uint64(b[4])<<32 | uint64(b[5])<<40 | uint64(b[6])<<48 | uint64(b[7])<<56 + s := f.toUint64Slice() + *s = append(*s, v) + b = b[8:] + } + return res, nil + } + if w != WireFixed64 { + return b, errInternalBadWireType + } + if len(b) < 8 { + return nil, io.ErrUnexpectedEOF + } + v := uint64(b[0]) | uint64(b[1])<<8 | uint64(b[2])<<16 | uint64(b[3])<<24 | uint64(b[4])<<32 | uint64(b[5])<<40 | uint64(b[6])<<48 | uint64(b[7])<<56 + s := f.toUint64Slice() + *s = append(*s, v) + return b[8:], nil +} + +func unmarshalFixedS64Value(b []byte, f pointer, w int) ([]byte, error) { + if w != WireFixed64 { + return b, errInternalBadWireType + } + if len(b) < 8 { + return nil, io.ErrUnexpectedEOF + } + v := int64(b[0]) | int64(b[1])<<8 | int64(b[2])<<16 | int64(b[3])<<24 | int64(b[4])<<32 | int64(b[5])<<40 | int64(b[6])<<48 | int64(b[7])<<56 + *f.toInt64() = v + return b[8:], nil +} + +func unmarshalFixedS64Ptr(b []byte, f pointer, w int) ([]byte, error) { + if w != WireFixed64 { + return b, errInternalBadWireType + } + if len(b) < 8 { + return nil, io.ErrUnexpectedEOF + } + v := int64(b[0]) | int64(b[1])<<8 | int64(b[2])<<16 | int64(b[3])<<24 | int64(b[4])<<32 | int64(b[5])<<40 | int64(b[6])<<48 | int64(b[7])<<56 + *f.toInt64Ptr() = &v + return b[8:], nil +} + +func unmarshalFixedS64Slice(b []byte, f pointer, w int) ([]byte, error) { + if w == WireBytes { // packed + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + res := b[x:] + b = b[:x] + for len(b) > 0 { + if len(b) < 8 { + return nil, io.ErrUnexpectedEOF + } + v := int64(b[0]) | int64(b[1])<<8 | int64(b[2])<<16 | int64(b[3])<<24 | int64(b[4])<<32 | int64(b[5])<<40 | int64(b[6])<<48 | int64(b[7])<<56 + s := f.toInt64Slice() + *s = append(*s, v) + b = b[8:] + } + return res, nil + } + if w != WireFixed64 { + return b, errInternalBadWireType + } + if len(b) < 8 { + return nil, io.ErrUnexpectedEOF + } + v := int64(b[0]) | int64(b[1])<<8 | int64(b[2])<<16 | int64(b[3])<<24 | int64(b[4])<<32 | int64(b[5])<<40 | int64(b[6])<<48 | int64(b[7])<<56 + s := f.toInt64Slice() + *s = append(*s, v) + return b[8:], nil +} + +func unmarshalFixed32Value(b []byte, f pointer, w int) ([]byte, error) { + if w != WireFixed32 { + return b, errInternalBadWireType + } + if len(b) < 4 { + return nil, io.ErrUnexpectedEOF + } + v := uint32(b[0]) | uint32(b[1])<<8 | uint32(b[2])<<16 | uint32(b[3])<<24 + *f.toUint32() = v + return b[4:], nil +} + +func unmarshalFixed32Ptr(b []byte, f pointer, w int) ([]byte, error) { + if w != WireFixed32 { + return b, errInternalBadWireType + } + if len(b) < 4 { + return nil, io.ErrUnexpectedEOF + } + v := uint32(b[0]) | uint32(b[1])<<8 | uint32(b[2])<<16 | uint32(b[3])<<24 + *f.toUint32Ptr() = &v + return b[4:], nil +} + +func unmarshalFixed32Slice(b []byte, f pointer, w int) ([]byte, error) { + if w == WireBytes { // packed + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + res := b[x:] + b = b[:x] + for len(b) > 0 { + if len(b) < 4 { + return nil, io.ErrUnexpectedEOF + } + v := uint32(b[0]) | uint32(b[1])<<8 | uint32(b[2])<<16 | uint32(b[3])<<24 + s := f.toUint32Slice() + *s = append(*s, v) + b = b[4:] + } + return res, nil + } + if w != WireFixed32 { + return b, errInternalBadWireType + } + if len(b) < 4 { + return nil, io.ErrUnexpectedEOF + } + v := uint32(b[0]) | uint32(b[1])<<8 | uint32(b[2])<<16 | uint32(b[3])<<24 + s := f.toUint32Slice() + *s = append(*s, v) + return b[4:], nil +} + +func unmarshalFixedS32Value(b []byte, f pointer, w int) ([]byte, error) { + if w != WireFixed32 { + return b, errInternalBadWireType + } + if len(b) < 4 { + return nil, io.ErrUnexpectedEOF + } + v := int32(b[0]) | int32(b[1])<<8 | int32(b[2])<<16 | int32(b[3])<<24 + *f.toInt32() = v + return b[4:], nil +} + +func unmarshalFixedS32Ptr(b []byte, f pointer, w int) ([]byte, error) { + if w != WireFixed32 { + return b, errInternalBadWireType + } + if len(b) < 4 { + return nil, io.ErrUnexpectedEOF + } + v := int32(b[0]) | int32(b[1])<<8 | int32(b[2])<<16 | int32(b[3])<<24 + f.setInt32Ptr(v) + return b[4:], nil +} + +func unmarshalFixedS32Slice(b []byte, f pointer, w int) ([]byte, error) { + if w == WireBytes { // packed + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + res := b[x:] + b = b[:x] + for len(b) > 0 { + if len(b) < 4 { + return nil, io.ErrUnexpectedEOF + } + v := int32(b[0]) | int32(b[1])<<8 | int32(b[2])<<16 | int32(b[3])<<24 + f.appendInt32Slice(v) + b = b[4:] + } + return res, nil + } + if w != WireFixed32 { + return b, errInternalBadWireType + } + if len(b) < 4 { + return nil, io.ErrUnexpectedEOF + } + v := int32(b[0]) | int32(b[1])<<8 | int32(b[2])<<16 | int32(b[3])<<24 + f.appendInt32Slice(v) + return b[4:], nil +} + +func unmarshalBoolValue(b []byte, f pointer, w int) ([]byte, error) { + if w != WireVarint { + return b, errInternalBadWireType + } + // Note: any length varint is allowed, even though any sane + // encoder will use one byte. + // See https://github.com/golang/protobuf/issues/76 + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + // TODO: check if x>1? Tests seem to indicate no. + v := x != 0 + *f.toBool() = v + return b[n:], nil +} + +func unmarshalBoolPtr(b []byte, f pointer, w int) ([]byte, error) { + if w != WireVarint { + return b, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + v := x != 0 + *f.toBoolPtr() = &v + return b[n:], nil +} + +func unmarshalBoolSlice(b []byte, f pointer, w int) ([]byte, error) { + if w == WireBytes { // packed + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + res := b[x:] + b = b[:x] + for len(b) > 0 { + x, n = decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + v := x != 0 + s := f.toBoolSlice() + *s = append(*s, v) + b = b[n:] + } + return res, nil + } + if w != WireVarint { + return b, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + v := x != 0 + s := f.toBoolSlice() + *s = append(*s, v) + return b[n:], nil +} + +func unmarshalFloat64Value(b []byte, f pointer, w int) ([]byte, error) { + if w != WireFixed64 { + return b, errInternalBadWireType + } + if len(b) < 8 { + return nil, io.ErrUnexpectedEOF + } + v := math.Float64frombits(uint64(b[0]) | uint64(b[1])<<8 | uint64(b[2])<<16 | uint64(b[3])<<24 | uint64(b[4])<<32 | uint64(b[5])<<40 | uint64(b[6])<<48 | uint64(b[7])<<56) + *f.toFloat64() = v + return b[8:], nil +} + +func unmarshalFloat64Ptr(b []byte, f pointer, w int) ([]byte, error) { + if w != WireFixed64 { + return b, errInternalBadWireType + } + if len(b) < 8 { + return nil, io.ErrUnexpectedEOF + } + v := math.Float64frombits(uint64(b[0]) | uint64(b[1])<<8 | uint64(b[2])<<16 | uint64(b[3])<<24 | uint64(b[4])<<32 | uint64(b[5])<<40 | uint64(b[6])<<48 | uint64(b[7])<<56) + *f.toFloat64Ptr() = &v + return b[8:], nil +} + +func unmarshalFloat64Slice(b []byte, f pointer, w int) ([]byte, error) { + if w == WireBytes { // packed + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + res := b[x:] + b = b[:x] + for len(b) > 0 { + if len(b) < 8 { + return nil, io.ErrUnexpectedEOF + } + v := math.Float64frombits(uint64(b[0]) | uint64(b[1])<<8 | uint64(b[2])<<16 | uint64(b[3])<<24 | uint64(b[4])<<32 | uint64(b[5])<<40 | uint64(b[6])<<48 | uint64(b[7])<<56) + s := f.toFloat64Slice() + *s = append(*s, v) + b = b[8:] + } + return res, nil + } + if w != WireFixed64 { + return b, errInternalBadWireType + } + if len(b) < 8 { + return nil, io.ErrUnexpectedEOF + } + v := math.Float64frombits(uint64(b[0]) | uint64(b[1])<<8 | uint64(b[2])<<16 | uint64(b[3])<<24 | uint64(b[4])<<32 | uint64(b[5])<<40 | uint64(b[6])<<48 | uint64(b[7])<<56) + s := f.toFloat64Slice() + *s = append(*s, v) + return b[8:], nil +} + +func unmarshalFloat32Value(b []byte, f pointer, w int) ([]byte, error) { + if w != WireFixed32 { + return b, errInternalBadWireType + } + if len(b) < 4 { + return nil, io.ErrUnexpectedEOF + } + v := math.Float32frombits(uint32(b[0]) | uint32(b[1])<<8 | uint32(b[2])<<16 | uint32(b[3])<<24) + *f.toFloat32() = v + return b[4:], nil +} + +func unmarshalFloat32Ptr(b []byte, f pointer, w int) ([]byte, error) { + if w != WireFixed32 { + return b, errInternalBadWireType + } + if len(b) < 4 { + return nil, io.ErrUnexpectedEOF + } + v := math.Float32frombits(uint32(b[0]) | uint32(b[1])<<8 | uint32(b[2])<<16 | uint32(b[3])<<24) + *f.toFloat32Ptr() = &v + return b[4:], nil +} + +func unmarshalFloat32Slice(b []byte, f pointer, w int) ([]byte, error) { + if w == WireBytes { // packed + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + res := b[x:] + b = b[:x] + for len(b) > 0 { + if len(b) < 4 { + return nil, io.ErrUnexpectedEOF + } + v := math.Float32frombits(uint32(b[0]) | uint32(b[1])<<8 | uint32(b[2])<<16 | uint32(b[3])<<24) + s := f.toFloat32Slice() + *s = append(*s, v) + b = b[4:] + } + return res, nil + } + if w != WireFixed32 { + return b, errInternalBadWireType + } + if len(b) < 4 { + return nil, io.ErrUnexpectedEOF + } + v := math.Float32frombits(uint32(b[0]) | uint32(b[1])<<8 | uint32(b[2])<<16 | uint32(b[3])<<24) + s := f.toFloat32Slice() + *s = append(*s, v) + return b[4:], nil +} + +func unmarshalStringValue(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return b, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + v := string(b[:x]) + *f.toString() = v + return b[x:], nil +} + +func unmarshalStringPtr(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return b, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + v := string(b[:x]) + *f.toStringPtr() = &v + return b[x:], nil +} + +func unmarshalStringSlice(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return b, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + v := string(b[:x]) + s := f.toStringSlice() + *s = append(*s, v) + return b[x:], nil +} + +func unmarshalUTF8StringValue(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return b, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + v := string(b[:x]) + *f.toString() = v + if !utf8.ValidString(v) { + return b[x:], errInvalidUTF8 + } + return b[x:], nil +} + +func unmarshalUTF8StringPtr(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return b, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + v := string(b[:x]) + *f.toStringPtr() = &v + if !utf8.ValidString(v) { + return b[x:], errInvalidUTF8 + } + return b[x:], nil +} + +func unmarshalUTF8StringSlice(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return b, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + v := string(b[:x]) + s := f.toStringSlice() + *s = append(*s, v) + if !utf8.ValidString(v) { + return b[x:], errInvalidUTF8 + } + return b[x:], nil +} + +var emptyBuf [0]byte + +func unmarshalBytesValue(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return b, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + // The use of append here is a trick which avoids the zeroing + // that would be required if we used a make/copy pair. + // We append to emptyBuf instead of nil because we want + // a non-nil result even when the length is 0. + v := append(emptyBuf[:], b[:x]...) + *f.toBytes() = v + return b[x:], nil +} + +func unmarshalBytesSlice(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return b, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + v := append(emptyBuf[:], b[:x]...) + s := f.toBytesSlice() + *s = append(*s, v) + return b[x:], nil +} + +func makeUnmarshalMessagePtr(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return b, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + // First read the message field to see if something is there. + // The semantics of multiple submessages are weird. Instead of + // the last one winning (as it is for all other fields), multiple + // submessages are merged. + v := f.getPointer() + if v.isNil() { + v = valToPointer(reflect.New(sub.typ)) + f.setPointer(v) + } + err := sub.unmarshal(v, b[:x]) + if err != nil { + if r, ok := err.(*RequiredNotSetError); ok { + r.field = name + "." + r.field + } else { + return nil, err + } + } + return b[x:], err + } +} + +func makeUnmarshalMessageSlicePtr(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return b, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + v := valToPointer(reflect.New(sub.typ)) + err := sub.unmarshal(v, b[:x]) + if err != nil { + if r, ok := err.(*RequiredNotSetError); ok { + r.field = name + "." + r.field + } else { + return nil, err + } + } + f.appendPointer(v) + return b[x:], err + } +} + +func makeUnmarshalGroupPtr(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireStartGroup { + return b, errInternalBadWireType + } + x, y := findEndGroup(b) + if x < 0 { + return nil, io.ErrUnexpectedEOF + } + v := f.getPointer() + if v.isNil() { + v = valToPointer(reflect.New(sub.typ)) + f.setPointer(v) + } + err := sub.unmarshal(v, b[:x]) + if err != nil { + if r, ok := err.(*RequiredNotSetError); ok { + r.field = name + "." + r.field + } else { + return nil, err + } + } + return b[y:], err + } +} + +func makeUnmarshalGroupSlicePtr(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireStartGroup { + return b, errInternalBadWireType + } + x, y := findEndGroup(b) + if x < 0 { + return nil, io.ErrUnexpectedEOF + } + v := valToPointer(reflect.New(sub.typ)) + err := sub.unmarshal(v, b[:x]) + if err != nil { + if r, ok := err.(*RequiredNotSetError); ok { + r.field = name + "." + r.field + } else { + return nil, err + } + } + f.appendPointer(v) + return b[y:], err + } +} + +func makeUnmarshalMap(f *reflect.StructField) unmarshaler { + t := f.Type + kt := t.Key() + vt := t.Elem() + tagArray := strings.Split(f.Tag.Get("protobuf"), ",") + valTags := strings.Split(f.Tag.Get("protobuf_val"), ",") + for _, t := range tagArray { + if strings.HasPrefix(t, "customtype=") { + valTags = append(valTags, t) + } + if t == "stdtime" { + valTags = append(valTags, t) + } + if t == "stdduration" { + valTags = append(valTags, t) + } + if t == "wktptr" { + valTags = append(valTags, t) + } + } + unmarshalKey := typeUnmarshaler(kt, f.Tag.Get("protobuf_key")) + unmarshalVal := typeUnmarshaler(vt, strings.Join(valTags, ",")) + return func(b []byte, f pointer, w int) ([]byte, error) { + // The map entry is a submessage. Figure out how big it is. + if w != WireBytes { + return nil, fmt.Errorf("proto: bad wiretype for map field: got %d want %d", w, WireBytes) + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + r := b[x:] // unused data to return + b = b[:x] // data for map entry + + // Note: we could use #keys * #values ~= 200 functions + // to do map decoding without reflection. Probably not worth it. + // Maps will be somewhat slow. Oh well. + + // Read key and value from data. + var nerr nonFatal + k := reflect.New(kt) + v := reflect.New(vt) + for len(b) > 0 { + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + wire := int(x) & 7 + b = b[n:] + + var err error + switch x >> 3 { + case 1: + b, err = unmarshalKey(b, valToPointer(k), wire) + case 2: + b, err = unmarshalVal(b, valToPointer(v), wire) + default: + err = errInternalBadWireType // skip unknown tag + } + + if nerr.Merge(err) { + continue + } + if err != errInternalBadWireType { + return nil, err + } + + // Skip past unknown fields. + b, err = skipField(b, wire) + if err != nil { + return nil, err + } + } + + // Get map, allocate if needed. + m := f.asPointerTo(t).Elem() // an addressable map[K]T + if m.IsNil() { + m.Set(reflect.MakeMap(t)) + } + + // Insert into map. + m.SetMapIndex(k.Elem(), v.Elem()) + + return r, nerr.E + } +} + +// makeUnmarshalOneof makes an unmarshaler for oneof fields. +// for: +// message Msg { +// oneof F { +// int64 X = 1; +// float64 Y = 2; +// } +// } +// typ is the type of the concrete entry for a oneof case (e.g. Msg_X). +// ityp is the interface type of the oneof field (e.g. isMsg_F). +// unmarshal is the unmarshaler for the base type of the oneof case (e.g. int64). +// Note that this function will be called once for each case in the oneof. +func makeUnmarshalOneof(typ, ityp reflect.Type, unmarshal unmarshaler) unmarshaler { + sf := typ.Field(0) + field0 := toField(&sf) + return func(b []byte, f pointer, w int) ([]byte, error) { + // Allocate holder for value. + v := reflect.New(typ) + + // Unmarshal data into holder. + // We unmarshal into the first field of the holder object. + var err error + var nerr nonFatal + b, err = unmarshal(b, valToPointer(v).offset(field0), w) + if !nerr.Merge(err) { + return nil, err + } + + // Write pointer to holder into target field. + f.asPointerTo(ityp).Elem().Set(v) + + return b, nerr.E + } +} + +// Error used by decode internally. +var errInternalBadWireType = errors.New("proto: internal error: bad wiretype") + +// skipField skips past a field of type wire and returns the remaining bytes. +func skipField(b []byte, wire int) ([]byte, error) { + switch wire { + case WireVarint: + _, k := decodeVarint(b) + if k == 0 { + return b, io.ErrUnexpectedEOF + } + b = b[k:] + case WireFixed32: + if len(b) < 4 { + return b, io.ErrUnexpectedEOF + } + b = b[4:] + case WireFixed64: + if len(b) < 8 { + return b, io.ErrUnexpectedEOF + } + b = b[8:] + case WireBytes: + m, k := decodeVarint(b) + if k == 0 || uint64(len(b)-k) < m { + return b, io.ErrUnexpectedEOF + } + b = b[uint64(k)+m:] + case WireStartGroup: + _, i := findEndGroup(b) + if i == -1 { + return b, io.ErrUnexpectedEOF + } + b = b[i:] + default: + return b, fmt.Errorf("proto: can't skip unknown wire type %d", wire) + } + return b, nil +} + +// findEndGroup finds the index of the next EndGroup tag. +// Groups may be nested, so the "next" EndGroup tag is the first +// unpaired EndGroup. +// findEndGroup returns the indexes of the start and end of the EndGroup tag. +// Returns (-1,-1) if it can't find one. +func findEndGroup(b []byte) (int, int) { + depth := 1 + i := 0 + for { + x, n := decodeVarint(b[i:]) + if n == 0 { + return -1, -1 + } + j := i + i += n + switch x & 7 { + case WireVarint: + _, k := decodeVarint(b[i:]) + if k == 0 { + return -1, -1 + } + i += k + case WireFixed32: + if len(b)-4 < i { + return -1, -1 + } + i += 4 + case WireFixed64: + if len(b)-8 < i { + return -1, -1 + } + i += 8 + case WireBytes: + m, k := decodeVarint(b[i:]) + if k == 0 { + return -1, -1 + } + i += k + if uint64(len(b)-i) < m { + return -1, -1 + } + i += int(m) + case WireStartGroup: + depth++ + case WireEndGroup: + depth-- + if depth == 0 { + return j, i + } + default: + return -1, -1 + } + } +} + +// encodeVarint appends a varint-encoded integer to b and returns the result. +func encodeVarint(b []byte, x uint64) []byte { + for x >= 1<<7 { + b = append(b, byte(x&0x7f|0x80)) + x >>= 7 + } + return append(b, byte(x)) +} + +// decodeVarint reads a varint-encoded integer from b. +// Returns the decoded integer and the number of bytes read. +// If there is an error, it returns 0,0. +func decodeVarint(b []byte) (uint64, int) { + var x, y uint64 + if len(b) == 0 { + goto bad + } + x = uint64(b[0]) + if x < 0x80 { + return x, 1 + } + x -= 0x80 + + if len(b) <= 1 { + goto bad + } + y = uint64(b[1]) + x += y << 7 + if y < 0x80 { + return x, 2 + } + x -= 0x80 << 7 + + if len(b) <= 2 { + goto bad + } + y = uint64(b[2]) + x += y << 14 + if y < 0x80 { + return x, 3 + } + x -= 0x80 << 14 + + if len(b) <= 3 { + goto bad + } + y = uint64(b[3]) + x += y << 21 + if y < 0x80 { + return x, 4 + } + x -= 0x80 << 21 + + if len(b) <= 4 { + goto bad + } + y = uint64(b[4]) + x += y << 28 + if y < 0x80 { + return x, 5 + } + x -= 0x80 << 28 + + if len(b) <= 5 { + goto bad + } + y = uint64(b[5]) + x += y << 35 + if y < 0x80 { + return x, 6 + } + x -= 0x80 << 35 + + if len(b) <= 6 { + goto bad + } + y = uint64(b[6]) + x += y << 42 + if y < 0x80 { + return x, 7 + } + x -= 0x80 << 42 + + if len(b) <= 7 { + goto bad + } + y = uint64(b[7]) + x += y << 49 + if y < 0x80 { + return x, 8 + } + x -= 0x80 << 49 + + if len(b) <= 8 { + goto bad + } + y = uint64(b[8]) + x += y << 56 + if y < 0x80 { + return x, 9 + } + x -= 0x80 << 56 + + if len(b) <= 9 { + goto bad + } + y = uint64(b[9]) + x += y << 63 + if y < 2 { + return x, 10 + } + +bad: + return 0, 0 +} diff --git a/vendor/github.com/gogo/protobuf/proto/table_unmarshal_gogo.go b/vendor/github.com/gogo/protobuf/proto/table_unmarshal_gogo.go new file mode 100644 index 00000000..00d6c7ad --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/table_unmarshal_gogo.go @@ -0,0 +1,385 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2018, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package proto + +import ( + "io" + "reflect" +) + +func makeUnmarshalMessage(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + // First read the message field to see if something is there. + // The semantics of multiple submessages are weird. Instead of + // the last one winning (as it is for all other fields), multiple + // submessages are merged. + v := f // gogo: changed from v := f.getPointer() + if v.isNil() { + v = valToPointer(reflect.New(sub.typ)) + f.setPointer(v) + } + err := sub.unmarshal(v, b[:x]) + if err != nil { + if r, ok := err.(*RequiredNotSetError); ok { + r.field = name + "." + r.field + } else { + return nil, err + } + } + return b[x:], err + } +} + +func makeUnmarshalMessageSlice(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + v := valToPointer(reflect.New(sub.typ)) + err := sub.unmarshal(v, b[:x]) + if err != nil { + if r, ok := err.(*RequiredNotSetError); ok { + r.field = name + "." + r.field + } else { + return nil, err + } + } + f.appendRef(v, sub.typ) // gogo: changed from f.appendPointer(v) + return b[x:], err + } +} + +func makeUnmarshalCustomPtr(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + + s := f.asPointerTo(reflect.PtrTo(sub.typ)).Elem() + s.Set(reflect.New(sub.typ)) + m := s.Interface().(custom) + if err := m.Unmarshal(b[:x]); err != nil { + return nil, err + } + return b[x:], nil + } +} + +func makeUnmarshalCustomSlice(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + m := reflect.New(sub.typ) + c := m.Interface().(custom) + if err := c.Unmarshal(b[:x]); err != nil { + return nil, err + } + v := valToPointer(m) + f.appendRef(v, sub.typ) + return b[x:], nil + } +} + +func makeUnmarshalCustom(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + + m := f.asPointerTo(sub.typ).Interface().(custom) + if err := m.Unmarshal(b[:x]); err != nil { + return nil, err + } + return b[x:], nil + } +} + +func makeUnmarshalTime(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + m := ×tamp{} + if err := Unmarshal(b[:x], m); err != nil { + return nil, err + } + t, err := timestampFromProto(m) + if err != nil { + return nil, err + } + s := f.asPointerTo(sub.typ).Elem() + s.Set(reflect.ValueOf(t)) + return b[x:], nil + } +} + +func makeUnmarshalTimePtr(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + m := ×tamp{} + if err := Unmarshal(b[:x], m); err != nil { + return nil, err + } + t, err := timestampFromProto(m) + if err != nil { + return nil, err + } + s := f.asPointerTo(reflect.PtrTo(sub.typ)).Elem() + s.Set(reflect.ValueOf(&t)) + return b[x:], nil + } +} + +func makeUnmarshalTimePtrSlice(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + m := ×tamp{} + if err := Unmarshal(b[:x], m); err != nil { + return nil, err + } + t, err := timestampFromProto(m) + if err != nil { + return nil, err + } + slice := f.getSlice(reflect.PtrTo(sub.typ)) + newSlice := reflect.Append(slice, reflect.ValueOf(&t)) + slice.Set(newSlice) + return b[x:], nil + } +} + +func makeUnmarshalTimeSlice(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + m := ×tamp{} + if err := Unmarshal(b[:x], m); err != nil { + return nil, err + } + t, err := timestampFromProto(m) + if err != nil { + return nil, err + } + slice := f.getSlice(sub.typ) + newSlice := reflect.Append(slice, reflect.ValueOf(t)) + slice.Set(newSlice) + return b[x:], nil + } +} + +func makeUnmarshalDurationPtr(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + m := &duration{} + if err := Unmarshal(b[:x], m); err != nil { + return nil, err + } + d, err := durationFromProto(m) + if err != nil { + return nil, err + } + s := f.asPointerTo(reflect.PtrTo(sub.typ)).Elem() + s.Set(reflect.ValueOf(&d)) + return b[x:], nil + } +} + +func makeUnmarshalDuration(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + m := &duration{} + if err := Unmarshal(b[:x], m); err != nil { + return nil, err + } + d, err := durationFromProto(m) + if err != nil { + return nil, err + } + s := f.asPointerTo(sub.typ).Elem() + s.Set(reflect.ValueOf(d)) + return b[x:], nil + } +} + +func makeUnmarshalDurationPtrSlice(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + m := &duration{} + if err := Unmarshal(b[:x], m); err != nil { + return nil, err + } + d, err := durationFromProto(m) + if err != nil { + return nil, err + } + slice := f.getSlice(reflect.PtrTo(sub.typ)) + newSlice := reflect.Append(slice, reflect.ValueOf(&d)) + slice.Set(newSlice) + return b[x:], nil + } +} + +func makeUnmarshalDurationSlice(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + m := &duration{} + if err := Unmarshal(b[:x], m); err != nil { + return nil, err + } + d, err := durationFromProto(m) + if err != nil { + return nil, err + } + slice := f.getSlice(sub.typ) + newSlice := reflect.Append(slice, reflect.ValueOf(d)) + slice.Set(newSlice) + return b[x:], nil + } +} diff --git a/vendor/github.com/gogo/protobuf/proto/text.go b/vendor/github.com/gogo/protobuf/proto/text.go new file mode 100644 index 00000000..87416afe --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/text.go @@ -0,0 +1,930 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2013, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Go support for Protocol Buffers - Google's data interchange format +// +// Copyright 2010 The Go Authors. All rights reserved. +// https://github.com/golang/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// * Neither the name of Google Inc. nor the names of its +// contributors may be used to endorse or promote products derived from +// this software without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package proto + +// Functions for writing the text protocol buffer format. + +import ( + "bufio" + "bytes" + "encoding" + "errors" + "fmt" + "io" + "log" + "math" + "reflect" + "sort" + "strings" + "sync" + "time" +) + +var ( + newline = []byte("\n") + spaces = []byte(" ") + endBraceNewline = []byte("}\n") + backslashN = []byte{'\\', 'n'} + backslashR = []byte{'\\', 'r'} + backslashT = []byte{'\\', 't'} + backslashDQ = []byte{'\\', '"'} + backslashBS = []byte{'\\', '\\'} + posInf = []byte("inf") + negInf = []byte("-inf") + nan = []byte("nan") +) + +type writer interface { + io.Writer + WriteByte(byte) error +} + +// textWriter is an io.Writer that tracks its indentation level. +type textWriter struct { + ind int + complete bool // if the current position is a complete line + compact bool // whether to write out as a one-liner + w writer +} + +func (w *textWriter) WriteString(s string) (n int, err error) { + if !strings.Contains(s, "\n") { + if !w.compact && w.complete { + w.writeIndent() + } + w.complete = false + return io.WriteString(w.w, s) + } + // WriteString is typically called without newlines, so this + // codepath and its copy are rare. We copy to avoid + // duplicating all of Write's logic here. + return w.Write([]byte(s)) +} + +func (w *textWriter) Write(p []byte) (n int, err error) { + newlines := bytes.Count(p, newline) + if newlines == 0 { + if !w.compact && w.complete { + w.writeIndent() + } + n, err = w.w.Write(p) + w.complete = false + return n, err + } + + frags := bytes.SplitN(p, newline, newlines+1) + if w.compact { + for i, frag := range frags { + if i > 0 { + if err := w.w.WriteByte(' '); err != nil { + return n, err + } + n++ + } + nn, err := w.w.Write(frag) + n += nn + if err != nil { + return n, err + } + } + return n, nil + } + + for i, frag := range frags { + if w.complete { + w.writeIndent() + } + nn, err := w.w.Write(frag) + n += nn + if err != nil { + return n, err + } + if i+1 < len(frags) { + if err := w.w.WriteByte('\n'); err != nil { + return n, err + } + n++ + } + } + w.complete = len(frags[len(frags)-1]) == 0 + return n, nil +} + +func (w *textWriter) WriteByte(c byte) error { + if w.compact && c == '\n' { + c = ' ' + } + if !w.compact && w.complete { + w.writeIndent() + } + err := w.w.WriteByte(c) + w.complete = c == '\n' + return err +} + +func (w *textWriter) indent() { w.ind++ } + +func (w *textWriter) unindent() { + if w.ind == 0 { + log.Print("proto: textWriter unindented too far") + return + } + w.ind-- +} + +func writeName(w *textWriter, props *Properties) error { + if _, err := w.WriteString(props.OrigName); err != nil { + return err + } + if props.Wire != "group" { + return w.WriteByte(':') + } + return nil +} + +func requiresQuotes(u string) bool { + // When type URL contains any characters except [0-9A-Za-z./\-]*, it must be quoted. + for _, ch := range u { + switch { + case ch == '.' || ch == '/' || ch == '_': + continue + case '0' <= ch && ch <= '9': + continue + case 'A' <= ch && ch <= 'Z': + continue + case 'a' <= ch && ch <= 'z': + continue + default: + return true + } + } + return false +} + +// isAny reports whether sv is a google.protobuf.Any message +func isAny(sv reflect.Value) bool { + type wkt interface { + XXX_WellKnownType() string + } + t, ok := sv.Addr().Interface().(wkt) + return ok && t.XXX_WellKnownType() == "Any" +} + +// writeProto3Any writes an expanded google.protobuf.Any message. +// +// It returns (false, nil) if sv value can't be unmarshaled (e.g. because +// required messages are not linked in). +// +// It returns (true, error) when sv was written in expanded format or an error +// was encountered. +func (tm *TextMarshaler) writeProto3Any(w *textWriter, sv reflect.Value) (bool, error) { + turl := sv.FieldByName("TypeUrl") + val := sv.FieldByName("Value") + if !turl.IsValid() || !val.IsValid() { + return true, errors.New("proto: invalid google.protobuf.Any message") + } + + b, ok := val.Interface().([]byte) + if !ok { + return true, errors.New("proto: invalid google.protobuf.Any message") + } + + parts := strings.Split(turl.String(), "/") + mt := MessageType(parts[len(parts)-1]) + if mt == nil { + return false, nil + } + m := reflect.New(mt.Elem()) + if err := Unmarshal(b, m.Interface().(Message)); err != nil { + return false, nil + } + w.Write([]byte("[")) + u := turl.String() + if requiresQuotes(u) { + writeString(w, u) + } else { + w.Write([]byte(u)) + } + if w.compact { + w.Write([]byte("]:<")) + } else { + w.Write([]byte("]: <\n")) + w.ind++ + } + if err := tm.writeStruct(w, m.Elem()); err != nil { + return true, err + } + if w.compact { + w.Write([]byte("> ")) + } else { + w.ind-- + w.Write([]byte(">\n")) + } + return true, nil +} + +func (tm *TextMarshaler) writeStruct(w *textWriter, sv reflect.Value) error { + if tm.ExpandAny && isAny(sv) { + if canExpand, err := tm.writeProto3Any(w, sv); canExpand { + return err + } + } + st := sv.Type() + sprops := GetProperties(st) + for i := 0; i < sv.NumField(); i++ { + fv := sv.Field(i) + props := sprops.Prop[i] + name := st.Field(i).Name + + if name == "XXX_NoUnkeyedLiteral" { + continue + } + + if strings.HasPrefix(name, "XXX_") { + // There are two XXX_ fields: + // XXX_unrecognized []byte + // XXX_extensions map[int32]proto.Extension + // The first is handled here; + // the second is handled at the bottom of this function. + if name == "XXX_unrecognized" && !fv.IsNil() { + if err := writeUnknownStruct(w, fv.Interface().([]byte)); err != nil { + return err + } + } + continue + } + if fv.Kind() == reflect.Ptr && fv.IsNil() { + // Field not filled in. This could be an optional field or + // a required field that wasn't filled in. Either way, there + // isn't anything we can show for it. + continue + } + if fv.Kind() == reflect.Slice && fv.IsNil() { + // Repeated field that is empty, or a bytes field that is unused. + continue + } + + if props.Repeated && fv.Kind() == reflect.Slice { + // Repeated field. + for j := 0; j < fv.Len(); j++ { + if err := writeName(w, props); err != nil { + return err + } + if !w.compact { + if err := w.WriteByte(' '); err != nil { + return err + } + } + v := fv.Index(j) + if v.Kind() == reflect.Ptr && v.IsNil() { + // A nil message in a repeated field is not valid, + // but we can handle that more gracefully than panicking. + if _, err := w.Write([]byte("\n")); err != nil { + return err + } + continue + } + if len(props.Enum) > 0 { + if err := tm.writeEnum(w, v, props); err != nil { + return err + } + } else if err := tm.writeAny(w, v, props); err != nil { + return err + } + if err := w.WriteByte('\n'); err != nil { + return err + } + } + continue + } + if fv.Kind() == reflect.Map { + // Map fields are rendered as a repeated struct with key/value fields. + keys := fv.MapKeys() + sort.Sort(mapKeys(keys)) + for _, key := range keys { + val := fv.MapIndex(key) + if err := writeName(w, props); err != nil { + return err + } + if !w.compact { + if err := w.WriteByte(' '); err != nil { + return err + } + } + // open struct + if err := w.WriteByte('<'); err != nil { + return err + } + if !w.compact { + if err := w.WriteByte('\n'); err != nil { + return err + } + } + w.indent() + // key + if _, err := w.WriteString("key:"); err != nil { + return err + } + if !w.compact { + if err := w.WriteByte(' '); err != nil { + return err + } + } + if err := tm.writeAny(w, key, props.MapKeyProp); err != nil { + return err + } + if err := w.WriteByte('\n'); err != nil { + return err + } + // nil values aren't legal, but we can avoid panicking because of them. + if val.Kind() != reflect.Ptr || !val.IsNil() { + // value + if _, err := w.WriteString("value:"); err != nil { + return err + } + if !w.compact { + if err := w.WriteByte(' '); err != nil { + return err + } + } + if err := tm.writeAny(w, val, props.MapValProp); err != nil { + return err + } + if err := w.WriteByte('\n'); err != nil { + return err + } + } + // close struct + w.unindent() + if err := w.WriteByte('>'); err != nil { + return err + } + if err := w.WriteByte('\n'); err != nil { + return err + } + } + continue + } + if props.proto3 && fv.Kind() == reflect.Slice && fv.Len() == 0 { + // empty bytes field + continue + } + if props.proto3 && fv.Kind() != reflect.Ptr && fv.Kind() != reflect.Slice { + // proto3 non-repeated scalar field; skip if zero value + if isProto3Zero(fv) { + continue + } + } + + if fv.Kind() == reflect.Interface { + // Check if it is a oneof. + if st.Field(i).Tag.Get("protobuf_oneof") != "" { + // fv is nil, or holds a pointer to generated struct. + // That generated struct has exactly one field, + // which has a protobuf struct tag. + if fv.IsNil() { + continue + } + inner := fv.Elem().Elem() // interface -> *T -> T + tag := inner.Type().Field(0).Tag.Get("protobuf") + props = new(Properties) // Overwrite the outer props var, but not its pointee. + props.Parse(tag) + // Write the value in the oneof, not the oneof itself. + fv = inner.Field(0) + + // Special case to cope with malformed messages gracefully: + // If the value in the oneof is a nil pointer, don't panic + // in writeAny. + if fv.Kind() == reflect.Ptr && fv.IsNil() { + // Use errors.New so writeAny won't render quotes. + msg := errors.New("/* nil */") + fv = reflect.ValueOf(&msg).Elem() + } + } + } + + if err := writeName(w, props); err != nil { + return err + } + if !w.compact { + if err := w.WriteByte(' '); err != nil { + return err + } + } + + if len(props.Enum) > 0 { + if err := tm.writeEnum(w, fv, props); err != nil { + return err + } + } else if err := tm.writeAny(w, fv, props); err != nil { + return err + } + + if err := w.WriteByte('\n'); err != nil { + return err + } + } + + // Extensions (the XXX_extensions field). + pv := sv + if pv.CanAddr() { + pv = sv.Addr() + } else { + pv = reflect.New(sv.Type()) + pv.Elem().Set(sv) + } + if _, err := extendable(pv.Interface()); err == nil { + if err := tm.writeExtensions(w, pv); err != nil { + return err + } + } + + return nil +} + +var textMarshalerType = reflect.TypeOf((*encoding.TextMarshaler)(nil)).Elem() + +// writeAny writes an arbitrary field. +func (tm *TextMarshaler) writeAny(w *textWriter, v reflect.Value, props *Properties) error { + v = reflect.Indirect(v) + + if props != nil { + if len(props.CustomType) > 0 { + custom, ok := v.Interface().(Marshaler) + if ok { + data, err := custom.Marshal() + if err != nil { + return err + } + if err := writeString(w, string(data)); err != nil { + return err + } + return nil + } + } else if len(props.CastType) > 0 { + if _, ok := v.Interface().(interface { + String() string + }); ok { + switch v.Kind() { + case reflect.Int, reflect.Int8, reflect.Int16, reflect.Int32, reflect.Int64, + reflect.Uint, reflect.Uint8, reflect.Uint16, reflect.Uint32, reflect.Uint64: + _, err := fmt.Fprintf(w, "%d", v.Interface()) + return err + } + } + } else if props.StdTime { + t, ok := v.Interface().(time.Time) + if !ok { + return fmt.Errorf("stdtime is not time.Time, but %T", v.Interface()) + } + tproto, err := timestampProto(t) + if err != nil { + return err + } + propsCopy := *props // Make a copy so that this is goroutine-safe + propsCopy.StdTime = false + err = tm.writeAny(w, reflect.ValueOf(tproto), &propsCopy) + return err + } else if props.StdDuration { + d, ok := v.Interface().(time.Duration) + if !ok { + return fmt.Errorf("stdtime is not time.Duration, but %T", v.Interface()) + } + dproto := durationProto(d) + propsCopy := *props // Make a copy so that this is goroutine-safe + propsCopy.StdDuration = false + err := tm.writeAny(w, reflect.ValueOf(dproto), &propsCopy) + return err + } + } + + // Floats have special cases. + if v.Kind() == reflect.Float32 || v.Kind() == reflect.Float64 { + x := v.Float() + var b []byte + switch { + case math.IsInf(x, 1): + b = posInf + case math.IsInf(x, -1): + b = negInf + case math.IsNaN(x): + b = nan + } + if b != nil { + _, err := w.Write(b) + return err + } + // Other values are handled below. + } + + // We don't attempt to serialise every possible value type; only those + // that can occur in protocol buffers. + switch v.Kind() { + case reflect.Slice: + // Should only be a []byte; repeated fields are handled in writeStruct. + if err := writeString(w, string(v.Bytes())); err != nil { + return err + } + case reflect.String: + if err := writeString(w, v.String()); err != nil { + return err + } + case reflect.Struct: + // Required/optional group/message. + var bra, ket byte = '<', '>' + if props != nil && props.Wire == "group" { + bra, ket = '{', '}' + } + if err := w.WriteByte(bra); err != nil { + return err + } + if !w.compact { + if err := w.WriteByte('\n'); err != nil { + return err + } + } + w.indent() + if v.CanAddr() { + // Calling v.Interface on a struct causes the reflect package to + // copy the entire struct. This is racy with the new Marshaler + // since we atomically update the XXX_sizecache. + // + // Thus, we retrieve a pointer to the struct if possible to avoid + // a race since v.Interface on the pointer doesn't copy the struct. + // + // If v is not addressable, then we are not worried about a race + // since it implies that the binary Marshaler cannot possibly be + // mutating this value. + v = v.Addr() + } + if v.Type().Implements(textMarshalerType) { + text, err := v.Interface().(encoding.TextMarshaler).MarshalText() + if err != nil { + return err + } + if _, err = w.Write(text); err != nil { + return err + } + } else { + if v.Kind() == reflect.Ptr { + v = v.Elem() + } + if err := tm.writeStruct(w, v); err != nil { + return err + } + } + w.unindent() + if err := w.WriteByte(ket); err != nil { + return err + } + default: + _, err := fmt.Fprint(w, v.Interface()) + return err + } + return nil +} + +// equivalent to C's isprint. +func isprint(c byte) bool { + return c >= 0x20 && c < 0x7f +} + +// writeString writes a string in the protocol buffer text format. +// It is similar to strconv.Quote except we don't use Go escape sequences, +// we treat the string as a byte sequence, and we use octal escapes. +// These differences are to maintain interoperability with the other +// languages' implementations of the text format. +func writeString(w *textWriter, s string) error { + // use WriteByte here to get any needed indent + if err := w.WriteByte('"'); err != nil { + return err + } + // Loop over the bytes, not the runes. + for i := 0; i < len(s); i++ { + var err error + // Divergence from C++: we don't escape apostrophes. + // There's no need to escape them, and the C++ parser + // copes with a naked apostrophe. + switch c := s[i]; c { + case '\n': + _, err = w.w.Write(backslashN) + case '\r': + _, err = w.w.Write(backslashR) + case '\t': + _, err = w.w.Write(backslashT) + case '"': + _, err = w.w.Write(backslashDQ) + case '\\': + _, err = w.w.Write(backslashBS) + default: + if isprint(c) { + err = w.w.WriteByte(c) + } else { + _, err = fmt.Fprintf(w.w, "\\%03o", c) + } + } + if err != nil { + return err + } + } + return w.WriteByte('"') +} + +func writeUnknownStruct(w *textWriter, data []byte) (err error) { + if !w.compact { + if _, err := fmt.Fprintf(w, "/* %d unknown bytes */\n", len(data)); err != nil { + return err + } + } + b := NewBuffer(data) + for b.index < len(b.buf) { + x, err := b.DecodeVarint() + if err != nil { + _, ferr := fmt.Fprintf(w, "/* %v */\n", err) + return ferr + } + wire, tag := x&7, x>>3 + if wire == WireEndGroup { + w.unindent() + if _, werr := w.Write(endBraceNewline); werr != nil { + return werr + } + continue + } + if _, ferr := fmt.Fprint(w, tag); ferr != nil { + return ferr + } + if wire != WireStartGroup { + if err = w.WriteByte(':'); err != nil { + return err + } + } + if !w.compact || wire == WireStartGroup { + if err = w.WriteByte(' '); err != nil { + return err + } + } + switch wire { + case WireBytes: + buf, e := b.DecodeRawBytes(false) + if e == nil { + _, err = fmt.Fprintf(w, "%q", buf) + } else { + _, err = fmt.Fprintf(w, "/* %v */", e) + } + case WireFixed32: + x, err = b.DecodeFixed32() + err = writeUnknownInt(w, x, err) + case WireFixed64: + x, err = b.DecodeFixed64() + err = writeUnknownInt(w, x, err) + case WireStartGroup: + err = w.WriteByte('{') + w.indent() + case WireVarint: + x, err = b.DecodeVarint() + err = writeUnknownInt(w, x, err) + default: + _, err = fmt.Fprintf(w, "/* unknown wire type %d */", wire) + } + if err != nil { + return err + } + if err := w.WriteByte('\n'); err != nil { + return err + } + } + return nil +} + +func writeUnknownInt(w *textWriter, x uint64, err error) error { + if err == nil { + _, err = fmt.Fprint(w, x) + } else { + _, err = fmt.Fprintf(w, "/* %v */", err) + } + return err +} + +type int32Slice []int32 + +func (s int32Slice) Len() int { return len(s) } +func (s int32Slice) Less(i, j int) bool { return s[i] < s[j] } +func (s int32Slice) Swap(i, j int) { s[i], s[j] = s[j], s[i] } + +// writeExtensions writes all the extensions in pv. +// pv is assumed to be a pointer to a protocol message struct that is extendable. +func (tm *TextMarshaler) writeExtensions(w *textWriter, pv reflect.Value) error { + emap := extensionMaps[pv.Type().Elem()] + e := pv.Interface().(Message) + + var m map[int32]Extension + var mu sync.Locker + if em, ok := e.(extensionsBytes); ok { + eb := em.GetExtensions() + var err error + m, err = BytesToExtensionsMap(*eb) + if err != nil { + return err + } + mu = notLocker{} + } else if _, ok := e.(extendableProto); ok { + ep, _ := extendable(e) + m, mu = ep.extensionsRead() + if m == nil { + return nil + } + } + + // Order the extensions by ID. + // This isn't strictly necessary, but it will give us + // canonical output, which will also make testing easier. + + mu.Lock() + ids := make([]int32, 0, len(m)) + for id := range m { + ids = append(ids, id) + } + sort.Sort(int32Slice(ids)) + mu.Unlock() + + for _, extNum := range ids { + ext := m[extNum] + var desc *ExtensionDesc + if emap != nil { + desc = emap[extNum] + } + if desc == nil { + // Unknown extension. + if err := writeUnknownStruct(w, ext.enc); err != nil { + return err + } + continue + } + + pb, err := GetExtension(e, desc) + if err != nil { + return fmt.Errorf("failed getting extension: %v", err) + } + + // Repeated extensions will appear as a slice. + if !desc.repeated() { + if err := tm.writeExtension(w, desc.Name, pb); err != nil { + return err + } + } else { + v := reflect.ValueOf(pb) + for i := 0; i < v.Len(); i++ { + if err := tm.writeExtension(w, desc.Name, v.Index(i).Interface()); err != nil { + return err + } + } + } + } + return nil +} + +func (tm *TextMarshaler) writeExtension(w *textWriter, name string, pb interface{}) error { + if _, err := fmt.Fprintf(w, "[%s]:", name); err != nil { + return err + } + if !w.compact { + if err := w.WriteByte(' '); err != nil { + return err + } + } + if err := tm.writeAny(w, reflect.ValueOf(pb), nil); err != nil { + return err + } + if err := w.WriteByte('\n'); err != nil { + return err + } + return nil +} + +func (w *textWriter) writeIndent() { + if !w.complete { + return + } + remain := w.ind * 2 + for remain > 0 { + n := remain + if n > len(spaces) { + n = len(spaces) + } + w.w.Write(spaces[:n]) + remain -= n + } + w.complete = false +} + +// TextMarshaler is a configurable text format marshaler. +type TextMarshaler struct { + Compact bool // use compact text format (one line). + ExpandAny bool // expand google.protobuf.Any messages of known types +} + +// Marshal writes a given protocol buffer in text format. +// The only errors returned are from w. +func (tm *TextMarshaler) Marshal(w io.Writer, pb Message) error { + val := reflect.ValueOf(pb) + if pb == nil || val.IsNil() { + w.Write([]byte("")) + return nil + } + var bw *bufio.Writer + ww, ok := w.(writer) + if !ok { + bw = bufio.NewWriter(w) + ww = bw + } + aw := &textWriter{ + w: ww, + complete: true, + compact: tm.Compact, + } + + if etm, ok := pb.(encoding.TextMarshaler); ok { + text, err := etm.MarshalText() + if err != nil { + return err + } + if _, err = aw.Write(text); err != nil { + return err + } + if bw != nil { + return bw.Flush() + } + return nil + } + // Dereference the received pointer so we don't have outer < and >. + v := reflect.Indirect(val) + if err := tm.writeStruct(aw, v); err != nil { + return err + } + if bw != nil { + return bw.Flush() + } + return nil +} + +// Text is the same as Marshal, but returns the string directly. +func (tm *TextMarshaler) Text(pb Message) string { + var buf bytes.Buffer + tm.Marshal(&buf, pb) + return buf.String() +} + +var ( + defaultTextMarshaler = TextMarshaler{} + compactTextMarshaler = TextMarshaler{Compact: true} +) + +// TODO: consider removing some of the Marshal functions below. + +// MarshalText writes a given protocol buffer in text format. +// The only errors returned are from w. +func MarshalText(w io.Writer, pb Message) error { return defaultTextMarshaler.Marshal(w, pb) } + +// MarshalTextString is the same as MarshalText, but returns the string directly. +func MarshalTextString(pb Message) string { return defaultTextMarshaler.Text(pb) } + +// CompactText writes a given protocol buffer in compact text format (one line). +func CompactText(w io.Writer, pb Message) error { return compactTextMarshaler.Marshal(w, pb) } + +// CompactTextString is the same as CompactText, but returns the string directly. +func CompactTextString(pb Message) string { return compactTextMarshaler.Text(pb) } diff --git a/vendor/github.com/gogo/protobuf/proto/text_gogo.go b/vendor/github.com/gogo/protobuf/proto/text_gogo.go new file mode 100644 index 00000000..1d6c6aa0 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/text_gogo.go @@ -0,0 +1,57 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2013, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package proto + +import ( + "fmt" + "reflect" +) + +func (tm *TextMarshaler) writeEnum(w *textWriter, v reflect.Value, props *Properties) error { + m, ok := enumStringMaps[props.Enum] + if !ok { + if err := tm.writeAny(w, v, props); err != nil { + return err + } + } + key := int32(0) + if v.Kind() == reflect.Ptr { + key = int32(v.Elem().Int()) + } else { + key = int32(v.Int()) + } + s, ok := m[key] + if !ok { + if err := tm.writeAny(w, v, props); err != nil { + return err + } + } + _, err := fmt.Fprint(w, s) + return err +} diff --git a/vendor/github.com/gogo/protobuf/proto/text_parser.go b/vendor/github.com/gogo/protobuf/proto/text_parser.go new file mode 100644 index 00000000..f85c0cc8 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/text_parser.go @@ -0,0 +1,1018 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2013, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Go support for Protocol Buffers - Google's data interchange format +// +// Copyright 2010 The Go Authors. All rights reserved. +// https://github.com/golang/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// * Neither the name of Google Inc. nor the names of its +// contributors may be used to endorse or promote products derived from +// this software without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package proto + +// Functions for parsing the Text protocol buffer format. +// TODO: message sets. + +import ( + "encoding" + "errors" + "fmt" + "reflect" + "strconv" + "strings" + "time" + "unicode/utf8" +) + +// Error string emitted when deserializing Any and fields are already set +const anyRepeatedlyUnpacked = "Any message unpacked multiple times, or %q already set" + +type ParseError struct { + Message string + Line int // 1-based line number + Offset int // 0-based byte offset from start of input +} + +func (p *ParseError) Error() string { + if p.Line == 1 { + // show offset only for first line + return fmt.Sprintf("line 1.%d: %v", p.Offset, p.Message) + } + return fmt.Sprintf("line %d: %v", p.Line, p.Message) +} + +type token struct { + value string + err *ParseError + line int // line number + offset int // byte number from start of input, not start of line + unquoted string // the unquoted version of value, if it was a quoted string +} + +func (t *token) String() string { + if t.err == nil { + return fmt.Sprintf("%q (line=%d, offset=%d)", t.value, t.line, t.offset) + } + return fmt.Sprintf("parse error: %v", t.err) +} + +type textParser struct { + s string // remaining input + done bool // whether the parsing is finished (success or error) + backed bool // whether back() was called + offset, line int + cur token +} + +func newTextParser(s string) *textParser { + p := new(textParser) + p.s = s + p.line = 1 + p.cur.line = 1 + return p +} + +func (p *textParser) errorf(format string, a ...interface{}) *ParseError { + pe := &ParseError{fmt.Sprintf(format, a...), p.cur.line, p.cur.offset} + p.cur.err = pe + p.done = true + return pe +} + +// Numbers and identifiers are matched by [-+._A-Za-z0-9] +func isIdentOrNumberChar(c byte) bool { + switch { + case 'A' <= c && c <= 'Z', 'a' <= c && c <= 'z': + return true + case '0' <= c && c <= '9': + return true + } + switch c { + case '-', '+', '.', '_': + return true + } + return false +} + +func isWhitespace(c byte) bool { + switch c { + case ' ', '\t', '\n', '\r': + return true + } + return false +} + +func isQuote(c byte) bool { + switch c { + case '"', '\'': + return true + } + return false +} + +func (p *textParser) skipWhitespace() { + i := 0 + for i < len(p.s) && (isWhitespace(p.s[i]) || p.s[i] == '#') { + if p.s[i] == '#' { + // comment; skip to end of line or input + for i < len(p.s) && p.s[i] != '\n' { + i++ + } + if i == len(p.s) { + break + } + } + if p.s[i] == '\n' { + p.line++ + } + i++ + } + p.offset += i + p.s = p.s[i:len(p.s)] + if len(p.s) == 0 { + p.done = true + } +} + +func (p *textParser) advance() { + // Skip whitespace + p.skipWhitespace() + if p.done { + return + } + + // Start of non-whitespace + p.cur.err = nil + p.cur.offset, p.cur.line = p.offset, p.line + p.cur.unquoted = "" + switch p.s[0] { + case '<', '>', '{', '}', ':', '[', ']', ';', ',', '/': + // Single symbol + p.cur.value, p.s = p.s[0:1], p.s[1:len(p.s)] + case '"', '\'': + // Quoted string + i := 1 + for i < len(p.s) && p.s[i] != p.s[0] && p.s[i] != '\n' { + if p.s[i] == '\\' && i+1 < len(p.s) { + // skip escaped char + i++ + } + i++ + } + if i >= len(p.s) || p.s[i] != p.s[0] { + p.errorf("unmatched quote") + return + } + unq, err := unquoteC(p.s[1:i], rune(p.s[0])) + if err != nil { + p.errorf("invalid quoted string %s: %v", p.s[0:i+1], err) + return + } + p.cur.value, p.s = p.s[0:i+1], p.s[i+1:len(p.s)] + p.cur.unquoted = unq + default: + i := 0 + for i < len(p.s) && isIdentOrNumberChar(p.s[i]) { + i++ + } + if i == 0 { + p.errorf("unexpected byte %#x", p.s[0]) + return + } + p.cur.value, p.s = p.s[0:i], p.s[i:len(p.s)] + } + p.offset += len(p.cur.value) +} + +var ( + errBadUTF8 = errors.New("proto: bad UTF-8") +) + +func unquoteC(s string, quote rune) (string, error) { + // This is based on C++'s tokenizer.cc. + // Despite its name, this is *not* parsing C syntax. + // For instance, "\0" is an invalid quoted string. + + // Avoid allocation in trivial cases. + simple := true + for _, r := range s { + if r == '\\' || r == quote { + simple = false + break + } + } + if simple { + return s, nil + } + + buf := make([]byte, 0, 3*len(s)/2) + for len(s) > 0 { + r, n := utf8.DecodeRuneInString(s) + if r == utf8.RuneError && n == 1 { + return "", errBadUTF8 + } + s = s[n:] + if r != '\\' { + if r < utf8.RuneSelf { + buf = append(buf, byte(r)) + } else { + buf = append(buf, string(r)...) + } + continue + } + + ch, tail, err := unescape(s) + if err != nil { + return "", err + } + buf = append(buf, ch...) + s = tail + } + return string(buf), nil +} + +func unescape(s string) (ch string, tail string, err error) { + r, n := utf8.DecodeRuneInString(s) + if r == utf8.RuneError && n == 1 { + return "", "", errBadUTF8 + } + s = s[n:] + switch r { + case 'a': + return "\a", s, nil + case 'b': + return "\b", s, nil + case 'f': + return "\f", s, nil + case 'n': + return "\n", s, nil + case 'r': + return "\r", s, nil + case 't': + return "\t", s, nil + case 'v': + return "\v", s, nil + case '?': + return "?", s, nil // trigraph workaround + case '\'', '"', '\\': + return string(r), s, nil + case '0', '1', '2', '3', '4', '5', '6', '7': + if len(s) < 2 { + return "", "", fmt.Errorf(`\%c requires 2 following digits`, r) + } + ss := string(r) + s[:2] + s = s[2:] + i, err := strconv.ParseUint(ss, 8, 8) + if err != nil { + return "", "", fmt.Errorf(`\%s contains non-octal digits`, ss) + } + return string([]byte{byte(i)}), s, nil + case 'x', 'X', 'u', 'U': + var n int + switch r { + case 'x', 'X': + n = 2 + case 'u': + n = 4 + case 'U': + n = 8 + } + if len(s) < n { + return "", "", fmt.Errorf(`\%c requires %d following digits`, r, n) + } + ss := s[:n] + s = s[n:] + i, err := strconv.ParseUint(ss, 16, 64) + if err != nil { + return "", "", fmt.Errorf(`\%c%s contains non-hexadecimal digits`, r, ss) + } + if r == 'x' || r == 'X' { + return string([]byte{byte(i)}), s, nil + } + if i > utf8.MaxRune { + return "", "", fmt.Errorf(`\%c%s is not a valid Unicode code point`, r, ss) + } + return string(rune(i)), s, nil + } + return "", "", fmt.Errorf(`unknown escape \%c`, r) +} + +// Back off the parser by one token. Can only be done between calls to next(). +// It makes the next advance() a no-op. +func (p *textParser) back() { p.backed = true } + +// Advances the parser and returns the new current token. +func (p *textParser) next() *token { + if p.backed || p.done { + p.backed = false + return &p.cur + } + p.advance() + if p.done { + p.cur.value = "" + } else if len(p.cur.value) > 0 && isQuote(p.cur.value[0]) { + // Look for multiple quoted strings separated by whitespace, + // and concatenate them. + cat := p.cur + for { + p.skipWhitespace() + if p.done || !isQuote(p.s[0]) { + break + } + p.advance() + if p.cur.err != nil { + return &p.cur + } + cat.value += " " + p.cur.value + cat.unquoted += p.cur.unquoted + } + p.done = false // parser may have seen EOF, but we want to return cat + p.cur = cat + } + return &p.cur +} + +func (p *textParser) consumeToken(s string) error { + tok := p.next() + if tok.err != nil { + return tok.err + } + if tok.value != s { + p.back() + return p.errorf("expected %q, found %q", s, tok.value) + } + return nil +} + +// Return a RequiredNotSetError indicating which required field was not set. +func (p *textParser) missingRequiredFieldError(sv reflect.Value) *RequiredNotSetError { + st := sv.Type() + sprops := GetProperties(st) + for i := 0; i < st.NumField(); i++ { + if !isNil(sv.Field(i)) { + continue + } + + props := sprops.Prop[i] + if props.Required { + return &RequiredNotSetError{fmt.Sprintf("%v.%v", st, props.OrigName)} + } + } + return &RequiredNotSetError{fmt.Sprintf("%v.", st)} // should not happen +} + +// Returns the index in the struct for the named field, as well as the parsed tag properties. +func structFieldByName(sprops *StructProperties, name string) (int, *Properties, bool) { + i, ok := sprops.decoderOrigNames[name] + if ok { + return i, sprops.Prop[i], true + } + return -1, nil, false +} + +// Consume a ':' from the input stream (if the next token is a colon), +// returning an error if a colon is needed but not present. +func (p *textParser) checkForColon(props *Properties, typ reflect.Type) *ParseError { + tok := p.next() + if tok.err != nil { + return tok.err + } + if tok.value != ":" { + // Colon is optional when the field is a group or message. + needColon := true + switch props.Wire { + case "group": + needColon = false + case "bytes": + // A "bytes" field is either a message, a string, or a repeated field; + // those three become *T, *string and []T respectively, so we can check for + // this field being a pointer to a non-string. + if typ.Kind() == reflect.Ptr { + // *T or *string + if typ.Elem().Kind() == reflect.String { + break + } + } else if typ.Kind() == reflect.Slice { + // []T or []*T + if typ.Elem().Kind() != reflect.Ptr { + break + } + } else if typ.Kind() == reflect.String { + // The proto3 exception is for a string field, + // which requires a colon. + break + } + needColon = false + } + if needColon { + return p.errorf("expected ':', found %q", tok.value) + } + p.back() + } + return nil +} + +func (p *textParser) readStruct(sv reflect.Value, terminator string) error { + st := sv.Type() + sprops := GetProperties(st) + reqCount := sprops.reqCount + var reqFieldErr error + fieldSet := make(map[string]bool) + // A struct is a sequence of "name: value", terminated by one of + // '>' or '}', or the end of the input. A name may also be + // "[extension]" or "[type/url]". + // + // The whole struct can also be an expanded Any message, like: + // [type/url] < ... struct contents ... > + for { + tok := p.next() + if tok.err != nil { + return tok.err + } + if tok.value == terminator { + break + } + if tok.value == "[" { + // Looks like an extension or an Any. + // + // TODO: Check whether we need to handle + // namespace rooted names (e.g. ".something.Foo"). + extName, err := p.consumeExtName() + if err != nil { + return err + } + + if s := strings.LastIndex(extName, "/"); s >= 0 { + // If it contains a slash, it's an Any type URL. + messageName := extName[s+1:] + mt := MessageType(messageName) + if mt == nil { + return p.errorf("unrecognized message %q in google.protobuf.Any", messageName) + } + tok = p.next() + if tok.err != nil { + return tok.err + } + // consume an optional colon + if tok.value == ":" { + tok = p.next() + if tok.err != nil { + return tok.err + } + } + var terminator string + switch tok.value { + case "<": + terminator = ">" + case "{": + terminator = "}" + default: + return p.errorf("expected '{' or '<', found %q", tok.value) + } + v := reflect.New(mt.Elem()) + if pe := p.readStruct(v.Elem(), terminator); pe != nil { + return pe + } + b, err := Marshal(v.Interface().(Message)) + if err != nil { + return p.errorf("failed to marshal message of type %q: %v", messageName, err) + } + if fieldSet["type_url"] { + return p.errorf(anyRepeatedlyUnpacked, "type_url") + } + if fieldSet["value"] { + return p.errorf(anyRepeatedlyUnpacked, "value") + } + sv.FieldByName("TypeUrl").SetString(extName) + sv.FieldByName("Value").SetBytes(b) + fieldSet["type_url"] = true + fieldSet["value"] = true + continue + } + + var desc *ExtensionDesc + // This could be faster, but it's functional. + // TODO: Do something smarter than a linear scan. + for _, d := range RegisteredExtensions(reflect.New(st).Interface().(Message)) { + if d.Name == extName { + desc = d + break + } + } + if desc == nil { + return p.errorf("unrecognized extension %q", extName) + } + + props := &Properties{} + props.Parse(desc.Tag) + + typ := reflect.TypeOf(desc.ExtensionType) + if err := p.checkForColon(props, typ); err != nil { + return err + } + + rep := desc.repeated() + + // Read the extension structure, and set it in + // the value we're constructing. + var ext reflect.Value + if !rep { + ext = reflect.New(typ).Elem() + } else { + ext = reflect.New(typ.Elem()).Elem() + } + if err := p.readAny(ext, props); err != nil { + if _, ok := err.(*RequiredNotSetError); !ok { + return err + } + reqFieldErr = err + } + ep := sv.Addr().Interface().(Message) + if !rep { + SetExtension(ep, desc, ext.Interface()) + } else { + old, err := GetExtension(ep, desc) + var sl reflect.Value + if err == nil { + sl = reflect.ValueOf(old) // existing slice + } else { + sl = reflect.MakeSlice(typ, 0, 1) + } + sl = reflect.Append(sl, ext) + SetExtension(ep, desc, sl.Interface()) + } + if err := p.consumeOptionalSeparator(); err != nil { + return err + } + continue + } + + // This is a normal, non-extension field. + name := tok.value + var dst reflect.Value + fi, props, ok := structFieldByName(sprops, name) + if ok { + dst = sv.Field(fi) + } else if oop, ok := sprops.OneofTypes[name]; ok { + // It is a oneof. + props = oop.Prop + nv := reflect.New(oop.Type.Elem()) + dst = nv.Elem().Field(0) + field := sv.Field(oop.Field) + if !field.IsNil() { + return p.errorf("field '%s' would overwrite already parsed oneof '%s'", name, sv.Type().Field(oop.Field).Name) + } + field.Set(nv) + } + if !dst.IsValid() { + return p.errorf("unknown field name %q in %v", name, st) + } + + if dst.Kind() == reflect.Map { + // Consume any colon. + if err := p.checkForColon(props, dst.Type()); err != nil { + return err + } + + // Construct the map if it doesn't already exist. + if dst.IsNil() { + dst.Set(reflect.MakeMap(dst.Type())) + } + key := reflect.New(dst.Type().Key()).Elem() + val := reflect.New(dst.Type().Elem()).Elem() + + // The map entry should be this sequence of tokens: + // < key : KEY value : VALUE > + // However, implementations may omit key or value, and technically + // we should support them in any order. See b/28924776 for a time + // this went wrong. + + tok := p.next() + var terminator string + switch tok.value { + case "<": + terminator = ">" + case "{": + terminator = "}" + default: + return p.errorf("expected '{' or '<', found %q", tok.value) + } + for { + tok := p.next() + if tok.err != nil { + return tok.err + } + if tok.value == terminator { + break + } + switch tok.value { + case "key": + if err := p.consumeToken(":"); err != nil { + return err + } + if err := p.readAny(key, props.MapKeyProp); err != nil { + return err + } + if err := p.consumeOptionalSeparator(); err != nil { + return err + } + case "value": + if err := p.checkForColon(props.MapValProp, dst.Type().Elem()); err != nil { + return err + } + if err := p.readAny(val, props.MapValProp); err != nil { + return err + } + if err := p.consumeOptionalSeparator(); err != nil { + return err + } + default: + p.back() + return p.errorf(`expected "key", "value", or %q, found %q`, terminator, tok.value) + } + } + + dst.SetMapIndex(key, val) + continue + } + + // Check that it's not already set if it's not a repeated field. + if !props.Repeated && fieldSet[name] { + return p.errorf("non-repeated field %q was repeated", name) + } + + if err := p.checkForColon(props, dst.Type()); err != nil { + return err + } + + // Parse into the field. + fieldSet[name] = true + if err := p.readAny(dst, props); err != nil { + if _, ok := err.(*RequiredNotSetError); !ok { + return err + } + reqFieldErr = err + } + if props.Required { + reqCount-- + } + + if err := p.consumeOptionalSeparator(); err != nil { + return err + } + + } + + if reqCount > 0 { + return p.missingRequiredFieldError(sv) + } + return reqFieldErr +} + +// consumeExtName consumes extension name or expanded Any type URL and the +// following ']'. It returns the name or URL consumed. +func (p *textParser) consumeExtName() (string, error) { + tok := p.next() + if tok.err != nil { + return "", tok.err + } + + // If extension name or type url is quoted, it's a single token. + if len(tok.value) > 2 && isQuote(tok.value[0]) && tok.value[len(tok.value)-1] == tok.value[0] { + name, err := unquoteC(tok.value[1:len(tok.value)-1], rune(tok.value[0])) + if err != nil { + return "", err + } + return name, p.consumeToken("]") + } + + // Consume everything up to "]" + var parts []string + for tok.value != "]" { + parts = append(parts, tok.value) + tok = p.next() + if tok.err != nil { + return "", p.errorf("unrecognized type_url or extension name: %s", tok.err) + } + if p.done && tok.value != "]" { + return "", p.errorf("unclosed type_url or extension name") + } + } + return strings.Join(parts, ""), nil +} + +// consumeOptionalSeparator consumes an optional semicolon or comma. +// It is used in readStruct to provide backward compatibility. +func (p *textParser) consumeOptionalSeparator() error { + tok := p.next() + if tok.err != nil { + return tok.err + } + if tok.value != ";" && tok.value != "," { + p.back() + } + return nil +} + +func (p *textParser) readAny(v reflect.Value, props *Properties) error { + tok := p.next() + if tok.err != nil { + return tok.err + } + if tok.value == "" { + return p.errorf("unexpected EOF") + } + if len(props.CustomType) > 0 { + if props.Repeated { + t := reflect.TypeOf(v.Interface()) + if t.Kind() == reflect.Slice { + tc := reflect.TypeOf(new(Marshaler)) + ok := t.Elem().Implements(tc.Elem()) + if ok { + fv := v + flen := fv.Len() + if flen == fv.Cap() { + nav := reflect.MakeSlice(v.Type(), flen, 2*flen+1) + reflect.Copy(nav, fv) + fv.Set(nav) + } + fv.SetLen(flen + 1) + + // Read one. + p.back() + return p.readAny(fv.Index(flen), props) + } + } + } + if reflect.TypeOf(v.Interface()).Kind() == reflect.Ptr { + custom := reflect.New(props.ctype.Elem()).Interface().(Unmarshaler) + err := custom.Unmarshal([]byte(tok.unquoted)) + if err != nil { + return p.errorf("%v %v: %v", err, v.Type(), tok.value) + } + v.Set(reflect.ValueOf(custom)) + } else { + custom := reflect.New(reflect.TypeOf(v.Interface())).Interface().(Unmarshaler) + err := custom.Unmarshal([]byte(tok.unquoted)) + if err != nil { + return p.errorf("%v %v: %v", err, v.Type(), tok.value) + } + v.Set(reflect.Indirect(reflect.ValueOf(custom))) + } + return nil + } + if props.StdTime { + fv := v + p.back() + props.StdTime = false + tproto := ×tamp{} + err := p.readAny(reflect.ValueOf(tproto).Elem(), props) + props.StdTime = true + if err != nil { + return err + } + tim, err := timestampFromProto(tproto) + if err != nil { + return err + } + if props.Repeated { + t := reflect.TypeOf(v.Interface()) + if t.Kind() == reflect.Slice { + if t.Elem().Kind() == reflect.Ptr { + ts := fv.Interface().([]*time.Time) + ts = append(ts, &tim) + fv.Set(reflect.ValueOf(ts)) + return nil + } else { + ts := fv.Interface().([]time.Time) + ts = append(ts, tim) + fv.Set(reflect.ValueOf(ts)) + return nil + } + } + } + if reflect.TypeOf(v.Interface()).Kind() == reflect.Ptr { + v.Set(reflect.ValueOf(&tim)) + } else { + v.Set(reflect.Indirect(reflect.ValueOf(&tim))) + } + return nil + } + if props.StdDuration { + fv := v + p.back() + props.StdDuration = false + dproto := &duration{} + err := p.readAny(reflect.ValueOf(dproto).Elem(), props) + props.StdDuration = true + if err != nil { + return err + } + dur, err := durationFromProto(dproto) + if err != nil { + return err + } + if props.Repeated { + t := reflect.TypeOf(v.Interface()) + if t.Kind() == reflect.Slice { + if t.Elem().Kind() == reflect.Ptr { + ds := fv.Interface().([]*time.Duration) + ds = append(ds, &dur) + fv.Set(reflect.ValueOf(ds)) + return nil + } else { + ds := fv.Interface().([]time.Duration) + ds = append(ds, dur) + fv.Set(reflect.ValueOf(ds)) + return nil + } + } + } + if reflect.TypeOf(v.Interface()).Kind() == reflect.Ptr { + v.Set(reflect.ValueOf(&dur)) + } else { + v.Set(reflect.Indirect(reflect.ValueOf(&dur))) + } + return nil + } + switch fv := v; fv.Kind() { + case reflect.Slice: + at := v.Type() + if at.Elem().Kind() == reflect.Uint8 { + // Special case for []byte + if tok.value[0] != '"' && tok.value[0] != '\'' { + // Deliberately written out here, as the error after + // this switch statement would write "invalid []byte: ...", + // which is not as user-friendly. + return p.errorf("invalid string: %v", tok.value) + } + bytes := []byte(tok.unquoted) + fv.Set(reflect.ValueOf(bytes)) + return nil + } + // Repeated field. + if tok.value == "[" { + // Repeated field with list notation, like [1,2,3]. + for { + fv.Set(reflect.Append(fv, reflect.New(at.Elem()).Elem())) + err := p.readAny(fv.Index(fv.Len()-1), props) + if err != nil { + return err + } + ntok := p.next() + if ntok.err != nil { + return ntok.err + } + if ntok.value == "]" { + break + } + if ntok.value != "," { + return p.errorf("Expected ']' or ',' found %q", ntok.value) + } + } + return nil + } + // One value of the repeated field. + p.back() + fv.Set(reflect.Append(fv, reflect.New(at.Elem()).Elem())) + return p.readAny(fv.Index(fv.Len()-1), props) + case reflect.Bool: + // true/1/t/True or false/f/0/False. + switch tok.value { + case "true", "1", "t", "True": + fv.SetBool(true) + return nil + case "false", "0", "f", "False": + fv.SetBool(false) + return nil + } + case reflect.Float32, reflect.Float64: + v := tok.value + // Ignore 'f' for compatibility with output generated by C++, but don't + // remove 'f' when the value is "-inf" or "inf". + if strings.HasSuffix(v, "f") && tok.value != "-inf" && tok.value != "inf" { + v = v[:len(v)-1] + } + if f, err := strconv.ParseFloat(v, fv.Type().Bits()); err == nil { + fv.SetFloat(f) + return nil + } + case reflect.Int8: + if x, err := strconv.ParseInt(tok.value, 0, 8); err == nil { + fv.SetInt(x) + return nil + } + case reflect.Int16: + if x, err := strconv.ParseInt(tok.value, 0, 16); err == nil { + fv.SetInt(x) + return nil + } + case reflect.Int32: + if x, err := strconv.ParseInt(tok.value, 0, 32); err == nil { + fv.SetInt(x) + return nil + } + + if len(props.Enum) == 0 { + break + } + m, ok := enumValueMaps[props.Enum] + if !ok { + break + } + x, ok := m[tok.value] + if !ok { + break + } + fv.SetInt(int64(x)) + return nil + case reflect.Int64: + if x, err := strconv.ParseInt(tok.value, 0, 64); err == nil { + fv.SetInt(x) + return nil + } + + case reflect.Ptr: + // A basic field (indirected through pointer), or a repeated message/group + p.back() + fv.Set(reflect.New(fv.Type().Elem())) + return p.readAny(fv.Elem(), props) + case reflect.String: + if tok.value[0] == '"' || tok.value[0] == '\'' { + fv.SetString(tok.unquoted) + return nil + } + case reflect.Struct: + var terminator string + switch tok.value { + case "{": + terminator = "}" + case "<": + terminator = ">" + default: + return p.errorf("expected '{' or '<', found %q", tok.value) + } + // TODO: Handle nested messages which implement encoding.TextUnmarshaler. + return p.readStruct(fv, terminator) + case reflect.Uint8: + if x, err := strconv.ParseUint(tok.value, 0, 8); err == nil { + fv.SetUint(x) + return nil + } + case reflect.Uint16: + if x, err := strconv.ParseUint(tok.value, 0, 16); err == nil { + fv.SetUint(x) + return nil + } + case reflect.Uint32: + if x, err := strconv.ParseUint(tok.value, 0, 32); err == nil { + fv.SetUint(uint64(x)) + return nil + } + case reflect.Uint64: + if x, err := strconv.ParseUint(tok.value, 0, 64); err == nil { + fv.SetUint(x) + return nil + } + } + return p.errorf("invalid %v: %v", v.Type(), tok.value) +} + +// UnmarshalText reads a protocol buffer in Text format. UnmarshalText resets pb +// before starting to unmarshal, so any existing data in pb is always removed. +// If a required field is not set and no other error occurs, +// UnmarshalText returns *RequiredNotSetError. +func UnmarshalText(s string, pb Message) error { + if um, ok := pb.(encoding.TextUnmarshaler); ok { + return um.UnmarshalText([]byte(s)) + } + pb.Reset() + v := reflect.ValueOf(pb) + return newTextParser(s).readStruct(v.Elem(), "") +} diff --git a/vendor/github.com/gogo/protobuf/proto/timestamp.go b/vendor/github.com/gogo/protobuf/proto/timestamp.go new file mode 100644 index 00000000..9324f654 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/timestamp.go @@ -0,0 +1,113 @@ +// Go support for Protocol Buffers - Google's data interchange format +// +// Copyright 2016 The Go Authors. All rights reserved. +// https://github.com/golang/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// * Neither the name of Google Inc. nor the names of its +// contributors may be used to endorse or promote products derived from +// this software without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package proto + +// This file implements operations on google.protobuf.Timestamp. + +import ( + "errors" + "fmt" + "time" +) + +const ( + // Seconds field of the earliest valid Timestamp. + // This is time.Date(1, 1, 1, 0, 0, 0, 0, time.UTC).Unix(). + minValidSeconds = -62135596800 + // Seconds field just after the latest valid Timestamp. + // This is time.Date(10000, 1, 1, 0, 0, 0, 0, time.UTC).Unix(). + maxValidSeconds = 253402300800 +) + +// validateTimestamp determines whether a Timestamp is valid. +// A valid timestamp represents a time in the range +// [0001-01-01, 10000-01-01) and has a Nanos field +// in the range [0, 1e9). +// +// If the Timestamp is valid, validateTimestamp returns nil. +// Otherwise, it returns an error that describes +// the problem. +// +// Every valid Timestamp can be represented by a time.Time, but the converse is not true. +func validateTimestamp(ts *timestamp) error { + if ts == nil { + return errors.New("timestamp: nil Timestamp") + } + if ts.Seconds < minValidSeconds { + return fmt.Errorf("timestamp: %#v before 0001-01-01", ts) + } + if ts.Seconds >= maxValidSeconds { + return fmt.Errorf("timestamp: %#v after 10000-01-01", ts) + } + if ts.Nanos < 0 || ts.Nanos >= 1e9 { + return fmt.Errorf("timestamp: %#v: nanos not in range [0, 1e9)", ts) + } + return nil +} + +// TimestampFromProto converts a google.protobuf.Timestamp proto to a time.Time. +// It returns an error if the argument is invalid. +// +// Unlike most Go functions, if Timestamp returns an error, the first return value +// is not the zero time.Time. Instead, it is the value obtained from the +// time.Unix function when passed the contents of the Timestamp, in the UTC +// locale. This may or may not be a meaningful time; many invalid Timestamps +// do map to valid time.Times. +// +// A nil Timestamp returns an error. The first return value in that case is +// undefined. +func timestampFromProto(ts *timestamp) (time.Time, error) { + // Don't return the zero value on error, because corresponds to a valid + // timestamp. Instead return whatever time.Unix gives us. + var t time.Time + if ts == nil { + t = time.Unix(0, 0).UTC() // treat nil like the empty Timestamp + } else { + t = time.Unix(ts.Seconds, int64(ts.Nanos)).UTC() + } + return t, validateTimestamp(ts) +} + +// TimestampProto converts the time.Time to a google.protobuf.Timestamp proto. +// It returns an error if the resulting Timestamp is invalid. +func timestampProto(t time.Time) (*timestamp, error) { + seconds := t.Unix() + nanos := int32(t.Sub(time.Unix(seconds, 0))) + ts := ×tamp{ + Seconds: seconds, + Nanos: nanos, + } + if err := validateTimestamp(ts); err != nil { + return nil, err + } + return ts, nil +} diff --git a/vendor/github.com/gogo/protobuf/proto/timestamp_gogo.go b/vendor/github.com/gogo/protobuf/proto/timestamp_gogo.go new file mode 100644 index 00000000..38439fa9 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/timestamp_gogo.go @@ -0,0 +1,49 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2016, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package proto + +import ( + "reflect" + "time" +) + +var timeType = reflect.TypeOf((*time.Time)(nil)).Elem() + +type timestamp struct { + Seconds int64 `protobuf:"varint,1,opt,name=seconds,proto3" json:"seconds,omitempty"` + Nanos int32 `protobuf:"varint,2,opt,name=nanos,proto3" json:"nanos,omitempty"` +} + +func (m *timestamp) Reset() { *m = timestamp{} } +func (*timestamp) ProtoMessage() {} +func (*timestamp) String() string { return "timestamp" } + +func init() { + RegisterType((*timestamp)(nil), "gogo.protobuf.proto.timestamp") +} diff --git a/vendor/github.com/gogo/protobuf/proto/wrappers.go b/vendor/github.com/gogo/protobuf/proto/wrappers.go new file mode 100644 index 00000000..b175d1b6 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/wrappers.go @@ -0,0 +1,1888 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2018, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package proto + +import ( + "io" + "reflect" +) + +func makeStdDoubleValueMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + t := ptr.asPointerTo(u.typ).Interface().(*float64) + v := &float64Value{*t} + siz := Size(v) + return tagsize + SizeVarint(uint64(siz)) + siz + }, func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + t := ptr.asPointerTo(u.typ).Interface().(*float64) + v := &float64Value{*t} + buf, err := Marshal(v) + if err != nil { + return nil, err + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(len(buf))) + b = append(b, buf...) + return b, nil + } +} + +func makeStdDoubleValuePtrMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + if ptr.isNil() { + return 0 + } + t := ptr.asPointerTo(reflect.PtrTo(u.typ)).Elem().Interface().(*float64) + v := &float64Value{*t} + siz := Size(v) + return tagsize + SizeVarint(uint64(siz)) + siz + }, func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + if ptr.isNil() { + return b, nil + } + t := ptr.asPointerTo(reflect.PtrTo(u.typ)).Elem().Interface().(*float64) + v := &float64Value{*t} + buf, err := Marshal(v) + if err != nil { + return nil, err + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(len(buf))) + b = append(b, buf...) + return b, nil + } +} + +func makeStdDoubleValueSliceMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + s := ptr.getSlice(u.typ) + n := 0 + for i := 0; i < s.Len(); i++ { + elem := s.Index(i) + t := elem.Interface().(float64) + v := &float64Value{t} + siz := Size(v) + n += siz + SizeVarint(uint64(siz)) + tagsize + } + return n + }, + func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + s := ptr.getSlice(u.typ) + for i := 0; i < s.Len(); i++ { + elem := s.Index(i) + t := elem.Interface().(float64) + v := &float64Value{t} + siz := Size(v) + buf, err := Marshal(v) + if err != nil { + return nil, err + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(siz)) + b = append(b, buf...) + } + + return b, nil + } +} + +func makeStdDoubleValuePtrSliceMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + s := ptr.getSlice(reflect.PtrTo(u.typ)) + n := 0 + for i := 0; i < s.Len(); i++ { + elem := s.Index(i) + t := elem.Interface().(*float64) + v := &float64Value{*t} + siz := Size(v) + n += siz + SizeVarint(uint64(siz)) + tagsize + } + return n + }, + func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + s := ptr.getSlice(reflect.PtrTo(u.typ)) + for i := 0; i < s.Len(); i++ { + elem := s.Index(i) + t := elem.Interface().(*float64) + v := &float64Value{*t} + siz := Size(v) + buf, err := Marshal(v) + if err != nil { + return nil, err + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(siz)) + b = append(b, buf...) + } + + return b, nil + } +} + +func makeStdDoubleValueUnmarshaler(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + m := &float64Value{} + if err := Unmarshal(b[:x], m); err != nil { + return nil, err + } + s := f.asPointerTo(sub.typ).Elem() + s.Set(reflect.ValueOf(m.Value)) + return b[x:], nil + } +} + +func makeStdDoubleValuePtrUnmarshaler(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + m := &float64Value{} + if err := Unmarshal(b[:x], m); err != nil { + return nil, err + } + s := f.asPointerTo(reflect.PtrTo(sub.typ)).Elem() + s.Set(reflect.ValueOf(&m.Value)) + return b[x:], nil + } +} + +func makeStdDoubleValuePtrSliceUnmarshaler(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + m := &float64Value{} + if err := Unmarshal(b[:x], m); err != nil { + return nil, err + } + slice := f.getSlice(reflect.PtrTo(sub.typ)) + newSlice := reflect.Append(slice, reflect.ValueOf(&m.Value)) + slice.Set(newSlice) + return b[x:], nil + } +} + +func makeStdDoubleValueSliceUnmarshaler(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + m := &float64Value{} + if err := Unmarshal(b[:x], m); err != nil { + return nil, err + } + slice := f.getSlice(sub.typ) + newSlice := reflect.Append(slice, reflect.ValueOf(m.Value)) + slice.Set(newSlice) + return b[x:], nil + } +} + +func makeStdFloatValueMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + t := ptr.asPointerTo(u.typ).Interface().(*float32) + v := &float32Value{*t} + siz := Size(v) + return tagsize + SizeVarint(uint64(siz)) + siz + }, func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + t := ptr.asPointerTo(u.typ).Interface().(*float32) + v := &float32Value{*t} + buf, err := Marshal(v) + if err != nil { + return nil, err + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(len(buf))) + b = append(b, buf...) + return b, nil + } +} + +func makeStdFloatValuePtrMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + if ptr.isNil() { + return 0 + } + t := ptr.asPointerTo(reflect.PtrTo(u.typ)).Elem().Interface().(*float32) + v := &float32Value{*t} + siz := Size(v) + return tagsize + SizeVarint(uint64(siz)) + siz + }, func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + if ptr.isNil() { + return b, nil + } + t := ptr.asPointerTo(reflect.PtrTo(u.typ)).Elem().Interface().(*float32) + v := &float32Value{*t} + buf, err := Marshal(v) + if err != nil { + return nil, err + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(len(buf))) + b = append(b, buf...) + return b, nil + } +} + +func makeStdFloatValueSliceMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + s := ptr.getSlice(u.typ) + n := 0 + for i := 0; i < s.Len(); i++ { + elem := s.Index(i) + t := elem.Interface().(float32) + v := &float32Value{t} + siz := Size(v) + n += siz + SizeVarint(uint64(siz)) + tagsize + } + return n + }, + func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + s := ptr.getSlice(u.typ) + for i := 0; i < s.Len(); i++ { + elem := s.Index(i) + t := elem.Interface().(float32) + v := &float32Value{t} + siz := Size(v) + buf, err := Marshal(v) + if err != nil { + return nil, err + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(siz)) + b = append(b, buf...) + } + + return b, nil + } +} + +func makeStdFloatValuePtrSliceMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + s := ptr.getSlice(reflect.PtrTo(u.typ)) + n := 0 + for i := 0; i < s.Len(); i++ { + elem := s.Index(i) + t := elem.Interface().(*float32) + v := &float32Value{*t} + siz := Size(v) + n += siz + SizeVarint(uint64(siz)) + tagsize + } + return n + }, + func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + s := ptr.getSlice(reflect.PtrTo(u.typ)) + for i := 0; i < s.Len(); i++ { + elem := s.Index(i) + t := elem.Interface().(*float32) + v := &float32Value{*t} + siz := Size(v) + buf, err := Marshal(v) + if err != nil { + return nil, err + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(siz)) + b = append(b, buf...) + } + + return b, nil + } +} + +func makeStdFloatValueUnmarshaler(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + m := &float32Value{} + if err := Unmarshal(b[:x], m); err != nil { + return nil, err + } + s := f.asPointerTo(sub.typ).Elem() + s.Set(reflect.ValueOf(m.Value)) + return b[x:], nil + } +} + +func makeStdFloatValuePtrUnmarshaler(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + m := &float32Value{} + if err := Unmarshal(b[:x], m); err != nil { + return nil, err + } + s := f.asPointerTo(reflect.PtrTo(sub.typ)).Elem() + s.Set(reflect.ValueOf(&m.Value)) + return b[x:], nil + } +} + +func makeStdFloatValuePtrSliceUnmarshaler(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + m := &float32Value{} + if err := Unmarshal(b[:x], m); err != nil { + return nil, err + } + slice := f.getSlice(reflect.PtrTo(sub.typ)) + newSlice := reflect.Append(slice, reflect.ValueOf(&m.Value)) + slice.Set(newSlice) + return b[x:], nil + } +} + +func makeStdFloatValueSliceUnmarshaler(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + m := &float32Value{} + if err := Unmarshal(b[:x], m); err != nil { + return nil, err + } + slice := f.getSlice(sub.typ) + newSlice := reflect.Append(slice, reflect.ValueOf(m.Value)) + slice.Set(newSlice) + return b[x:], nil + } +} + +func makeStdInt64ValueMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + t := ptr.asPointerTo(u.typ).Interface().(*int64) + v := &int64Value{*t} + siz := Size(v) + return tagsize + SizeVarint(uint64(siz)) + siz + }, func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + t := ptr.asPointerTo(u.typ).Interface().(*int64) + v := &int64Value{*t} + buf, err := Marshal(v) + if err != nil { + return nil, err + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(len(buf))) + b = append(b, buf...) + return b, nil + } +} + +func makeStdInt64ValuePtrMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + if ptr.isNil() { + return 0 + } + t := ptr.asPointerTo(reflect.PtrTo(u.typ)).Elem().Interface().(*int64) + v := &int64Value{*t} + siz := Size(v) + return tagsize + SizeVarint(uint64(siz)) + siz + }, func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + if ptr.isNil() { + return b, nil + } + t := ptr.asPointerTo(reflect.PtrTo(u.typ)).Elem().Interface().(*int64) + v := &int64Value{*t} + buf, err := Marshal(v) + if err != nil { + return nil, err + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(len(buf))) + b = append(b, buf...) + return b, nil + } +} + +func makeStdInt64ValueSliceMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + s := ptr.getSlice(u.typ) + n := 0 + for i := 0; i < s.Len(); i++ { + elem := s.Index(i) + t := elem.Interface().(int64) + v := &int64Value{t} + siz := Size(v) + n += siz + SizeVarint(uint64(siz)) + tagsize + } + return n + }, + func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + s := ptr.getSlice(u.typ) + for i := 0; i < s.Len(); i++ { + elem := s.Index(i) + t := elem.Interface().(int64) + v := &int64Value{t} + siz := Size(v) + buf, err := Marshal(v) + if err != nil { + return nil, err + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(siz)) + b = append(b, buf...) + } + + return b, nil + } +} + +func makeStdInt64ValuePtrSliceMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + s := ptr.getSlice(reflect.PtrTo(u.typ)) + n := 0 + for i := 0; i < s.Len(); i++ { + elem := s.Index(i) + t := elem.Interface().(*int64) + v := &int64Value{*t} + siz := Size(v) + n += siz + SizeVarint(uint64(siz)) + tagsize + } + return n + }, + func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + s := ptr.getSlice(reflect.PtrTo(u.typ)) + for i := 0; i < s.Len(); i++ { + elem := s.Index(i) + t := elem.Interface().(*int64) + v := &int64Value{*t} + siz := Size(v) + buf, err := Marshal(v) + if err != nil { + return nil, err + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(siz)) + b = append(b, buf...) + } + + return b, nil + } +} + +func makeStdInt64ValueUnmarshaler(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + m := &int64Value{} + if err := Unmarshal(b[:x], m); err != nil { + return nil, err + } + s := f.asPointerTo(sub.typ).Elem() + s.Set(reflect.ValueOf(m.Value)) + return b[x:], nil + } +} + +func makeStdInt64ValuePtrUnmarshaler(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + m := &int64Value{} + if err := Unmarshal(b[:x], m); err != nil { + return nil, err + } + s := f.asPointerTo(reflect.PtrTo(sub.typ)).Elem() + s.Set(reflect.ValueOf(&m.Value)) + return b[x:], nil + } +} + +func makeStdInt64ValuePtrSliceUnmarshaler(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + m := &int64Value{} + if err := Unmarshal(b[:x], m); err != nil { + return nil, err + } + slice := f.getSlice(reflect.PtrTo(sub.typ)) + newSlice := reflect.Append(slice, reflect.ValueOf(&m.Value)) + slice.Set(newSlice) + return b[x:], nil + } +} + +func makeStdInt64ValueSliceUnmarshaler(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + m := &int64Value{} + if err := Unmarshal(b[:x], m); err != nil { + return nil, err + } + slice := f.getSlice(sub.typ) + newSlice := reflect.Append(slice, reflect.ValueOf(m.Value)) + slice.Set(newSlice) + return b[x:], nil + } +} + +func makeStdUInt64ValueMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + t := ptr.asPointerTo(u.typ).Interface().(*uint64) + v := &uint64Value{*t} + siz := Size(v) + return tagsize + SizeVarint(uint64(siz)) + siz + }, func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + t := ptr.asPointerTo(u.typ).Interface().(*uint64) + v := &uint64Value{*t} + buf, err := Marshal(v) + if err != nil { + return nil, err + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(len(buf))) + b = append(b, buf...) + return b, nil + } +} + +func makeStdUInt64ValuePtrMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + if ptr.isNil() { + return 0 + } + t := ptr.asPointerTo(reflect.PtrTo(u.typ)).Elem().Interface().(*uint64) + v := &uint64Value{*t} + siz := Size(v) + return tagsize + SizeVarint(uint64(siz)) + siz + }, func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + if ptr.isNil() { + return b, nil + } + t := ptr.asPointerTo(reflect.PtrTo(u.typ)).Elem().Interface().(*uint64) + v := &uint64Value{*t} + buf, err := Marshal(v) + if err != nil { + return nil, err + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(len(buf))) + b = append(b, buf...) + return b, nil + } +} + +func makeStdUInt64ValueSliceMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + s := ptr.getSlice(u.typ) + n := 0 + for i := 0; i < s.Len(); i++ { + elem := s.Index(i) + t := elem.Interface().(uint64) + v := &uint64Value{t} + siz := Size(v) + n += siz + SizeVarint(uint64(siz)) + tagsize + } + return n + }, + func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + s := ptr.getSlice(u.typ) + for i := 0; i < s.Len(); i++ { + elem := s.Index(i) + t := elem.Interface().(uint64) + v := &uint64Value{t} + siz := Size(v) + buf, err := Marshal(v) + if err != nil { + return nil, err + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(siz)) + b = append(b, buf...) + } + + return b, nil + } +} + +func makeStdUInt64ValuePtrSliceMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + s := ptr.getSlice(reflect.PtrTo(u.typ)) + n := 0 + for i := 0; i < s.Len(); i++ { + elem := s.Index(i) + t := elem.Interface().(*uint64) + v := &uint64Value{*t} + siz := Size(v) + n += siz + SizeVarint(uint64(siz)) + tagsize + } + return n + }, + func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + s := ptr.getSlice(reflect.PtrTo(u.typ)) + for i := 0; i < s.Len(); i++ { + elem := s.Index(i) + t := elem.Interface().(*uint64) + v := &uint64Value{*t} + siz := Size(v) + buf, err := Marshal(v) + if err != nil { + return nil, err + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(siz)) + b = append(b, buf...) + } + + return b, nil + } +} + +func makeStdUInt64ValueUnmarshaler(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + m := &uint64Value{} + if err := Unmarshal(b[:x], m); err != nil { + return nil, err + } + s := f.asPointerTo(sub.typ).Elem() + s.Set(reflect.ValueOf(m.Value)) + return b[x:], nil + } +} + +func makeStdUInt64ValuePtrUnmarshaler(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + m := &uint64Value{} + if err := Unmarshal(b[:x], m); err != nil { + return nil, err + } + s := f.asPointerTo(reflect.PtrTo(sub.typ)).Elem() + s.Set(reflect.ValueOf(&m.Value)) + return b[x:], nil + } +} + +func makeStdUInt64ValuePtrSliceUnmarshaler(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + m := &uint64Value{} + if err := Unmarshal(b[:x], m); err != nil { + return nil, err + } + slice := f.getSlice(reflect.PtrTo(sub.typ)) + newSlice := reflect.Append(slice, reflect.ValueOf(&m.Value)) + slice.Set(newSlice) + return b[x:], nil + } +} + +func makeStdUInt64ValueSliceUnmarshaler(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + m := &uint64Value{} + if err := Unmarshal(b[:x], m); err != nil { + return nil, err + } + slice := f.getSlice(sub.typ) + newSlice := reflect.Append(slice, reflect.ValueOf(m.Value)) + slice.Set(newSlice) + return b[x:], nil + } +} + +func makeStdInt32ValueMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + t := ptr.asPointerTo(u.typ).Interface().(*int32) + v := &int32Value{*t} + siz := Size(v) + return tagsize + SizeVarint(uint64(siz)) + siz + }, func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + t := ptr.asPointerTo(u.typ).Interface().(*int32) + v := &int32Value{*t} + buf, err := Marshal(v) + if err != nil { + return nil, err + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(len(buf))) + b = append(b, buf...) + return b, nil + } +} + +func makeStdInt32ValuePtrMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + if ptr.isNil() { + return 0 + } + t := ptr.asPointerTo(reflect.PtrTo(u.typ)).Elem().Interface().(*int32) + v := &int32Value{*t} + siz := Size(v) + return tagsize + SizeVarint(uint64(siz)) + siz + }, func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + if ptr.isNil() { + return b, nil + } + t := ptr.asPointerTo(reflect.PtrTo(u.typ)).Elem().Interface().(*int32) + v := &int32Value{*t} + buf, err := Marshal(v) + if err != nil { + return nil, err + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(len(buf))) + b = append(b, buf...) + return b, nil + } +} + +func makeStdInt32ValueSliceMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + s := ptr.getSlice(u.typ) + n := 0 + for i := 0; i < s.Len(); i++ { + elem := s.Index(i) + t := elem.Interface().(int32) + v := &int32Value{t} + siz := Size(v) + n += siz + SizeVarint(uint64(siz)) + tagsize + } + return n + }, + func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + s := ptr.getSlice(u.typ) + for i := 0; i < s.Len(); i++ { + elem := s.Index(i) + t := elem.Interface().(int32) + v := &int32Value{t} + siz := Size(v) + buf, err := Marshal(v) + if err != nil { + return nil, err + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(siz)) + b = append(b, buf...) + } + + return b, nil + } +} + +func makeStdInt32ValuePtrSliceMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + s := ptr.getSlice(reflect.PtrTo(u.typ)) + n := 0 + for i := 0; i < s.Len(); i++ { + elem := s.Index(i) + t := elem.Interface().(*int32) + v := &int32Value{*t} + siz := Size(v) + n += siz + SizeVarint(uint64(siz)) + tagsize + } + return n + }, + func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + s := ptr.getSlice(reflect.PtrTo(u.typ)) + for i := 0; i < s.Len(); i++ { + elem := s.Index(i) + t := elem.Interface().(*int32) + v := &int32Value{*t} + siz := Size(v) + buf, err := Marshal(v) + if err != nil { + return nil, err + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(siz)) + b = append(b, buf...) + } + + return b, nil + } +} + +func makeStdInt32ValueUnmarshaler(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + m := &int32Value{} + if err := Unmarshal(b[:x], m); err != nil { + return nil, err + } + s := f.asPointerTo(sub.typ).Elem() + s.Set(reflect.ValueOf(m.Value)) + return b[x:], nil + } +} + +func makeStdInt32ValuePtrUnmarshaler(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + m := &int32Value{} + if err := Unmarshal(b[:x], m); err != nil { + return nil, err + } + s := f.asPointerTo(reflect.PtrTo(sub.typ)).Elem() + s.Set(reflect.ValueOf(&m.Value)) + return b[x:], nil + } +} + +func makeStdInt32ValuePtrSliceUnmarshaler(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + m := &int32Value{} + if err := Unmarshal(b[:x], m); err != nil { + return nil, err + } + slice := f.getSlice(reflect.PtrTo(sub.typ)) + newSlice := reflect.Append(slice, reflect.ValueOf(&m.Value)) + slice.Set(newSlice) + return b[x:], nil + } +} + +func makeStdInt32ValueSliceUnmarshaler(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + m := &int32Value{} + if err := Unmarshal(b[:x], m); err != nil { + return nil, err + } + slice := f.getSlice(sub.typ) + newSlice := reflect.Append(slice, reflect.ValueOf(m.Value)) + slice.Set(newSlice) + return b[x:], nil + } +} + +func makeStdUInt32ValueMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + t := ptr.asPointerTo(u.typ).Interface().(*uint32) + v := &uint32Value{*t} + siz := Size(v) + return tagsize + SizeVarint(uint64(siz)) + siz + }, func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + t := ptr.asPointerTo(u.typ).Interface().(*uint32) + v := &uint32Value{*t} + buf, err := Marshal(v) + if err != nil { + return nil, err + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(len(buf))) + b = append(b, buf...) + return b, nil + } +} + +func makeStdUInt32ValuePtrMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + if ptr.isNil() { + return 0 + } + t := ptr.asPointerTo(reflect.PtrTo(u.typ)).Elem().Interface().(*uint32) + v := &uint32Value{*t} + siz := Size(v) + return tagsize + SizeVarint(uint64(siz)) + siz + }, func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + if ptr.isNil() { + return b, nil + } + t := ptr.asPointerTo(reflect.PtrTo(u.typ)).Elem().Interface().(*uint32) + v := &uint32Value{*t} + buf, err := Marshal(v) + if err != nil { + return nil, err + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(len(buf))) + b = append(b, buf...) + return b, nil + } +} + +func makeStdUInt32ValueSliceMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + s := ptr.getSlice(u.typ) + n := 0 + for i := 0; i < s.Len(); i++ { + elem := s.Index(i) + t := elem.Interface().(uint32) + v := &uint32Value{t} + siz := Size(v) + n += siz + SizeVarint(uint64(siz)) + tagsize + } + return n + }, + func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + s := ptr.getSlice(u.typ) + for i := 0; i < s.Len(); i++ { + elem := s.Index(i) + t := elem.Interface().(uint32) + v := &uint32Value{t} + siz := Size(v) + buf, err := Marshal(v) + if err != nil { + return nil, err + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(siz)) + b = append(b, buf...) + } + + return b, nil + } +} + +func makeStdUInt32ValuePtrSliceMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + s := ptr.getSlice(reflect.PtrTo(u.typ)) + n := 0 + for i := 0; i < s.Len(); i++ { + elem := s.Index(i) + t := elem.Interface().(*uint32) + v := &uint32Value{*t} + siz := Size(v) + n += siz + SizeVarint(uint64(siz)) + tagsize + } + return n + }, + func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + s := ptr.getSlice(reflect.PtrTo(u.typ)) + for i := 0; i < s.Len(); i++ { + elem := s.Index(i) + t := elem.Interface().(*uint32) + v := &uint32Value{*t} + siz := Size(v) + buf, err := Marshal(v) + if err != nil { + return nil, err + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(siz)) + b = append(b, buf...) + } + + return b, nil + } +} + +func makeStdUInt32ValueUnmarshaler(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + m := &uint32Value{} + if err := Unmarshal(b[:x], m); err != nil { + return nil, err + } + s := f.asPointerTo(sub.typ).Elem() + s.Set(reflect.ValueOf(m.Value)) + return b[x:], nil + } +} + +func makeStdUInt32ValuePtrUnmarshaler(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + m := &uint32Value{} + if err := Unmarshal(b[:x], m); err != nil { + return nil, err + } + s := f.asPointerTo(reflect.PtrTo(sub.typ)).Elem() + s.Set(reflect.ValueOf(&m.Value)) + return b[x:], nil + } +} + +func makeStdUInt32ValuePtrSliceUnmarshaler(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + m := &uint32Value{} + if err := Unmarshal(b[:x], m); err != nil { + return nil, err + } + slice := f.getSlice(reflect.PtrTo(sub.typ)) + newSlice := reflect.Append(slice, reflect.ValueOf(&m.Value)) + slice.Set(newSlice) + return b[x:], nil + } +} + +func makeStdUInt32ValueSliceUnmarshaler(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + m := &uint32Value{} + if err := Unmarshal(b[:x], m); err != nil { + return nil, err + } + slice := f.getSlice(sub.typ) + newSlice := reflect.Append(slice, reflect.ValueOf(m.Value)) + slice.Set(newSlice) + return b[x:], nil + } +} + +func makeStdBoolValueMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + t := ptr.asPointerTo(u.typ).Interface().(*bool) + v := &boolValue{*t} + siz := Size(v) + return tagsize + SizeVarint(uint64(siz)) + siz + }, func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + t := ptr.asPointerTo(u.typ).Interface().(*bool) + v := &boolValue{*t} + buf, err := Marshal(v) + if err != nil { + return nil, err + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(len(buf))) + b = append(b, buf...) + return b, nil + } +} + +func makeStdBoolValuePtrMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + if ptr.isNil() { + return 0 + } + t := ptr.asPointerTo(reflect.PtrTo(u.typ)).Elem().Interface().(*bool) + v := &boolValue{*t} + siz := Size(v) + return tagsize + SizeVarint(uint64(siz)) + siz + }, func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + if ptr.isNil() { + return b, nil + } + t := ptr.asPointerTo(reflect.PtrTo(u.typ)).Elem().Interface().(*bool) + v := &boolValue{*t} + buf, err := Marshal(v) + if err != nil { + return nil, err + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(len(buf))) + b = append(b, buf...) + return b, nil + } +} + +func makeStdBoolValueSliceMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + s := ptr.getSlice(u.typ) + n := 0 + for i := 0; i < s.Len(); i++ { + elem := s.Index(i) + t := elem.Interface().(bool) + v := &boolValue{t} + siz := Size(v) + n += siz + SizeVarint(uint64(siz)) + tagsize + } + return n + }, + func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + s := ptr.getSlice(u.typ) + for i := 0; i < s.Len(); i++ { + elem := s.Index(i) + t := elem.Interface().(bool) + v := &boolValue{t} + siz := Size(v) + buf, err := Marshal(v) + if err != nil { + return nil, err + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(siz)) + b = append(b, buf...) + } + + return b, nil + } +} + +func makeStdBoolValuePtrSliceMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + s := ptr.getSlice(reflect.PtrTo(u.typ)) + n := 0 + for i := 0; i < s.Len(); i++ { + elem := s.Index(i) + t := elem.Interface().(*bool) + v := &boolValue{*t} + siz := Size(v) + n += siz + SizeVarint(uint64(siz)) + tagsize + } + return n + }, + func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + s := ptr.getSlice(reflect.PtrTo(u.typ)) + for i := 0; i < s.Len(); i++ { + elem := s.Index(i) + t := elem.Interface().(*bool) + v := &boolValue{*t} + siz := Size(v) + buf, err := Marshal(v) + if err != nil { + return nil, err + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(siz)) + b = append(b, buf...) + } + + return b, nil + } +} + +func makeStdBoolValueUnmarshaler(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + m := &boolValue{} + if err := Unmarshal(b[:x], m); err != nil { + return nil, err + } + s := f.asPointerTo(sub.typ).Elem() + s.Set(reflect.ValueOf(m.Value)) + return b[x:], nil + } +} + +func makeStdBoolValuePtrUnmarshaler(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + m := &boolValue{} + if err := Unmarshal(b[:x], m); err != nil { + return nil, err + } + s := f.asPointerTo(reflect.PtrTo(sub.typ)).Elem() + s.Set(reflect.ValueOf(&m.Value)) + return b[x:], nil + } +} + +func makeStdBoolValuePtrSliceUnmarshaler(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + m := &boolValue{} + if err := Unmarshal(b[:x], m); err != nil { + return nil, err + } + slice := f.getSlice(reflect.PtrTo(sub.typ)) + newSlice := reflect.Append(slice, reflect.ValueOf(&m.Value)) + slice.Set(newSlice) + return b[x:], nil + } +} + +func makeStdBoolValueSliceUnmarshaler(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + m := &boolValue{} + if err := Unmarshal(b[:x], m); err != nil { + return nil, err + } + slice := f.getSlice(sub.typ) + newSlice := reflect.Append(slice, reflect.ValueOf(m.Value)) + slice.Set(newSlice) + return b[x:], nil + } +} + +func makeStdStringValueMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + t := ptr.asPointerTo(u.typ).Interface().(*string) + v := &stringValue{*t} + siz := Size(v) + return tagsize + SizeVarint(uint64(siz)) + siz + }, func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + t := ptr.asPointerTo(u.typ).Interface().(*string) + v := &stringValue{*t} + buf, err := Marshal(v) + if err != nil { + return nil, err + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(len(buf))) + b = append(b, buf...) + return b, nil + } +} + +func makeStdStringValuePtrMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + if ptr.isNil() { + return 0 + } + t := ptr.asPointerTo(reflect.PtrTo(u.typ)).Elem().Interface().(*string) + v := &stringValue{*t} + siz := Size(v) + return tagsize + SizeVarint(uint64(siz)) + siz + }, func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + if ptr.isNil() { + return b, nil + } + t := ptr.asPointerTo(reflect.PtrTo(u.typ)).Elem().Interface().(*string) + v := &stringValue{*t} + buf, err := Marshal(v) + if err != nil { + return nil, err + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(len(buf))) + b = append(b, buf...) + return b, nil + } +} + +func makeStdStringValueSliceMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + s := ptr.getSlice(u.typ) + n := 0 + for i := 0; i < s.Len(); i++ { + elem := s.Index(i) + t := elem.Interface().(string) + v := &stringValue{t} + siz := Size(v) + n += siz + SizeVarint(uint64(siz)) + tagsize + } + return n + }, + func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + s := ptr.getSlice(u.typ) + for i := 0; i < s.Len(); i++ { + elem := s.Index(i) + t := elem.Interface().(string) + v := &stringValue{t} + siz := Size(v) + buf, err := Marshal(v) + if err != nil { + return nil, err + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(siz)) + b = append(b, buf...) + } + + return b, nil + } +} + +func makeStdStringValuePtrSliceMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + s := ptr.getSlice(reflect.PtrTo(u.typ)) + n := 0 + for i := 0; i < s.Len(); i++ { + elem := s.Index(i) + t := elem.Interface().(*string) + v := &stringValue{*t} + siz := Size(v) + n += siz + SizeVarint(uint64(siz)) + tagsize + } + return n + }, + func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + s := ptr.getSlice(reflect.PtrTo(u.typ)) + for i := 0; i < s.Len(); i++ { + elem := s.Index(i) + t := elem.Interface().(*string) + v := &stringValue{*t} + siz := Size(v) + buf, err := Marshal(v) + if err != nil { + return nil, err + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(siz)) + b = append(b, buf...) + } + + return b, nil + } +} + +func makeStdStringValueUnmarshaler(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + m := &stringValue{} + if err := Unmarshal(b[:x], m); err != nil { + return nil, err + } + s := f.asPointerTo(sub.typ).Elem() + s.Set(reflect.ValueOf(m.Value)) + return b[x:], nil + } +} + +func makeStdStringValuePtrUnmarshaler(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + m := &stringValue{} + if err := Unmarshal(b[:x], m); err != nil { + return nil, err + } + s := f.asPointerTo(reflect.PtrTo(sub.typ)).Elem() + s.Set(reflect.ValueOf(&m.Value)) + return b[x:], nil + } +} + +func makeStdStringValuePtrSliceUnmarshaler(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + m := &stringValue{} + if err := Unmarshal(b[:x], m); err != nil { + return nil, err + } + slice := f.getSlice(reflect.PtrTo(sub.typ)) + newSlice := reflect.Append(slice, reflect.ValueOf(&m.Value)) + slice.Set(newSlice) + return b[x:], nil + } +} + +func makeStdStringValueSliceUnmarshaler(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + m := &stringValue{} + if err := Unmarshal(b[:x], m); err != nil { + return nil, err + } + slice := f.getSlice(sub.typ) + newSlice := reflect.Append(slice, reflect.ValueOf(m.Value)) + slice.Set(newSlice) + return b[x:], nil + } +} + +func makeStdBytesValueMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + t := ptr.asPointerTo(u.typ).Interface().(*[]byte) + v := &bytesValue{*t} + siz := Size(v) + return tagsize + SizeVarint(uint64(siz)) + siz + }, func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + t := ptr.asPointerTo(u.typ).Interface().(*[]byte) + v := &bytesValue{*t} + buf, err := Marshal(v) + if err != nil { + return nil, err + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(len(buf))) + b = append(b, buf...) + return b, nil + } +} + +func makeStdBytesValuePtrMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + if ptr.isNil() { + return 0 + } + t := ptr.asPointerTo(reflect.PtrTo(u.typ)).Elem().Interface().(*[]byte) + v := &bytesValue{*t} + siz := Size(v) + return tagsize + SizeVarint(uint64(siz)) + siz + }, func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + if ptr.isNil() { + return b, nil + } + t := ptr.asPointerTo(reflect.PtrTo(u.typ)).Elem().Interface().(*[]byte) + v := &bytesValue{*t} + buf, err := Marshal(v) + if err != nil { + return nil, err + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(len(buf))) + b = append(b, buf...) + return b, nil + } +} + +func makeStdBytesValueSliceMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + s := ptr.getSlice(u.typ) + n := 0 + for i := 0; i < s.Len(); i++ { + elem := s.Index(i) + t := elem.Interface().([]byte) + v := &bytesValue{t} + siz := Size(v) + n += siz + SizeVarint(uint64(siz)) + tagsize + } + return n + }, + func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + s := ptr.getSlice(u.typ) + for i := 0; i < s.Len(); i++ { + elem := s.Index(i) + t := elem.Interface().([]byte) + v := &bytesValue{t} + siz := Size(v) + buf, err := Marshal(v) + if err != nil { + return nil, err + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(siz)) + b = append(b, buf...) + } + + return b, nil + } +} + +func makeStdBytesValuePtrSliceMarshaler(u *marshalInfo) (sizer, marshaler) { + return func(ptr pointer, tagsize int) int { + s := ptr.getSlice(reflect.PtrTo(u.typ)) + n := 0 + for i := 0; i < s.Len(); i++ { + elem := s.Index(i) + t := elem.Interface().(*[]byte) + v := &bytesValue{*t} + siz := Size(v) + n += siz + SizeVarint(uint64(siz)) + tagsize + } + return n + }, + func(b []byte, ptr pointer, wiretag uint64, deterministic bool) ([]byte, error) { + s := ptr.getSlice(reflect.PtrTo(u.typ)) + for i := 0; i < s.Len(); i++ { + elem := s.Index(i) + t := elem.Interface().(*[]byte) + v := &bytesValue{*t} + siz := Size(v) + buf, err := Marshal(v) + if err != nil { + return nil, err + } + b = appendVarint(b, wiretag) + b = appendVarint(b, uint64(siz)) + b = append(b, buf...) + } + + return b, nil + } +} + +func makeStdBytesValueUnmarshaler(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + m := &bytesValue{} + if err := Unmarshal(b[:x], m); err != nil { + return nil, err + } + s := f.asPointerTo(sub.typ).Elem() + s.Set(reflect.ValueOf(m.Value)) + return b[x:], nil + } +} + +func makeStdBytesValuePtrUnmarshaler(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + m := &bytesValue{} + if err := Unmarshal(b[:x], m); err != nil { + return nil, err + } + s := f.asPointerTo(reflect.PtrTo(sub.typ)).Elem() + s.Set(reflect.ValueOf(&m.Value)) + return b[x:], nil + } +} + +func makeStdBytesValuePtrSliceUnmarshaler(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + m := &bytesValue{} + if err := Unmarshal(b[:x], m); err != nil { + return nil, err + } + slice := f.getSlice(reflect.PtrTo(sub.typ)) + newSlice := reflect.Append(slice, reflect.ValueOf(&m.Value)) + slice.Set(newSlice) + return b[x:], nil + } +} + +func makeStdBytesValueSliceUnmarshaler(sub *unmarshalInfo, name string) unmarshaler { + return func(b []byte, f pointer, w int) ([]byte, error) { + if w != WireBytes { + return nil, errInternalBadWireType + } + x, n := decodeVarint(b) + if n == 0 { + return nil, io.ErrUnexpectedEOF + } + b = b[n:] + if x > uint64(len(b)) { + return nil, io.ErrUnexpectedEOF + } + m := &bytesValue{} + if err := Unmarshal(b[:x], m); err != nil { + return nil, err + } + slice := f.getSlice(sub.typ) + newSlice := reflect.Append(slice, reflect.ValueOf(m.Value)) + slice.Set(newSlice) + return b[x:], nil + } +} diff --git a/vendor/github.com/gogo/protobuf/proto/wrappers_gogo.go b/vendor/github.com/gogo/protobuf/proto/wrappers_gogo.go new file mode 100644 index 00000000..c1cf7bf8 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/wrappers_gogo.go @@ -0,0 +1,113 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2018, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package proto + +type float64Value struct { + Value float64 `protobuf:"fixed64,1,opt,name=value,proto3" json:"value,omitempty"` +} + +func (m *float64Value) Reset() { *m = float64Value{} } +func (*float64Value) ProtoMessage() {} +func (*float64Value) String() string { return "float64" } + +type float32Value struct { + Value float32 `protobuf:"fixed32,1,opt,name=value,proto3" json:"value,omitempty"` +} + +func (m *float32Value) Reset() { *m = float32Value{} } +func (*float32Value) ProtoMessage() {} +func (*float32Value) String() string { return "float32" } + +type int64Value struct { + Value int64 `protobuf:"varint,1,opt,name=value,proto3" json:"value,omitempty"` +} + +func (m *int64Value) Reset() { *m = int64Value{} } +func (*int64Value) ProtoMessage() {} +func (*int64Value) String() string { return "int64" } + +type uint64Value struct { + Value uint64 `protobuf:"varint,1,opt,name=value,proto3" json:"value,omitempty"` +} + +func (m *uint64Value) Reset() { *m = uint64Value{} } +func (*uint64Value) ProtoMessage() {} +func (*uint64Value) String() string { return "uint64" } + +type int32Value struct { + Value int32 `protobuf:"varint,1,opt,name=value,proto3" json:"value,omitempty"` +} + +func (m *int32Value) Reset() { *m = int32Value{} } +func (*int32Value) ProtoMessage() {} +func (*int32Value) String() string { return "int32" } + +type uint32Value struct { + Value uint32 `protobuf:"varint,1,opt,name=value,proto3" json:"value,omitempty"` +} + +func (m *uint32Value) Reset() { *m = uint32Value{} } +func (*uint32Value) ProtoMessage() {} +func (*uint32Value) String() string { return "uint32" } + +type boolValue struct { + Value bool `protobuf:"varint,1,opt,name=value,proto3" json:"value,omitempty"` +} + +func (m *boolValue) Reset() { *m = boolValue{} } +func (*boolValue) ProtoMessage() {} +func (*boolValue) String() string { return "bool" } + +type stringValue struct { + Value string `protobuf:"bytes,1,opt,name=value,proto3" json:"value,omitempty"` +} + +func (m *stringValue) Reset() { *m = stringValue{} } +func (*stringValue) ProtoMessage() {} +func (*stringValue) String() string { return "string" } + +type bytesValue struct { + Value []byte `protobuf:"bytes,1,opt,name=value,proto3" json:"value,omitempty"` +} + +func (m *bytesValue) Reset() { *m = bytesValue{} } +func (*bytesValue) ProtoMessage() {} +func (*bytesValue) String() string { return "[]byte" } + +func init() { + RegisterType((*float64Value)(nil), "gogo.protobuf.proto.DoubleValue") + RegisterType((*float32Value)(nil), "gogo.protobuf.proto.FloatValue") + RegisterType((*int64Value)(nil), "gogo.protobuf.proto.Int64Value") + RegisterType((*uint64Value)(nil), "gogo.protobuf.proto.UInt64Value") + RegisterType((*int32Value)(nil), "gogo.protobuf.proto.Int32Value") + RegisterType((*uint32Value)(nil), "gogo.protobuf.proto.UInt32Value") + RegisterType((*boolValue)(nil), "gogo.protobuf.proto.BoolValue") + RegisterType((*stringValue)(nil), "gogo.protobuf.proto.StringValue") + RegisterType((*bytesValue)(nil), "gogo.protobuf.proto.BytesValue") +} diff --git a/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/Makefile b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/Makefile new file mode 100644 index 00000000..3496dc99 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/Makefile @@ -0,0 +1,36 @@ +# Go support for Protocol Buffers - Google's data interchange format +# +# Copyright 2010 The Go Authors. All rights reserved. +# https://github.com/golang/protobuf +# +# Redistribution and use in source and binary forms, with or without +# modification, are permitted provided that the following conditions are +# met: +# +# * Redistributions of source code must retain the above copyright +# notice, this list of conditions and the following disclaimer. +# * Redistributions in binary form must reproduce the above +# copyright notice, this list of conditions and the following disclaimer +# in the documentation and/or other materials provided with the +# distribution. +# * Neither the name of Google Inc. nor the names of its +# contributors may be used to endorse or promote products derived from +# this software without specific prior written permission. +# +# THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +# "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +# LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +# A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +# OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +# SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +# LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +# DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +# THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +# (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +# OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +regenerate: + go install github.com/gogo/protobuf/protoc-gen-gogo + go install github.com/gogo/protobuf/protoc-gen-gostring + protoc --gogo_out=. -I=../../protobuf/google/protobuf ../../protobuf/google/protobuf/descriptor.proto + protoc --gostring_out=. -I=../../protobuf/google/protobuf ../../protobuf/google/protobuf/descriptor.proto diff --git a/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor.go b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor.go new file mode 100644 index 00000000..a85bf198 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor.go @@ -0,0 +1,118 @@ +// Go support for Protocol Buffers - Google's data interchange format +// +// Copyright 2016 The Go Authors. All rights reserved. +// https://github.com/golang/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// * Neither the name of Google Inc. nor the names of its +// contributors may be used to endorse or promote products derived from +// this software without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +// Package descriptor provides functions for obtaining protocol buffer +// descriptors for generated Go types. +// +// These functions cannot go in package proto because they depend on the +// generated protobuf descriptor messages, which themselves depend on proto. +package descriptor + +import ( + "bytes" + "compress/gzip" + "fmt" + "io/ioutil" + + "github.com/gogo/protobuf/proto" +) + +// extractFile extracts a FileDescriptorProto from a gzip'd buffer. +func extractFile(gz []byte) (*FileDescriptorProto, error) { + r, err := gzip.NewReader(bytes.NewReader(gz)) + if err != nil { + return nil, fmt.Errorf("failed to open gzip reader: %v", err) + } + defer r.Close() + + b, err := ioutil.ReadAll(r) + if err != nil { + return nil, fmt.Errorf("failed to uncompress descriptor: %v", err) + } + + fd := new(FileDescriptorProto) + if err := proto.Unmarshal(b, fd); err != nil { + return nil, fmt.Errorf("malformed FileDescriptorProto: %v", err) + } + + return fd, nil +} + +// Message is a proto.Message with a method to return its descriptor. +// +// Message types generated by the protocol compiler always satisfy +// the Message interface. +type Message interface { + proto.Message + Descriptor() ([]byte, []int) +} + +// ForMessage returns a FileDescriptorProto and a DescriptorProto from within it +// describing the given message. +func ForMessage(msg Message) (fd *FileDescriptorProto, md *DescriptorProto) { + gz, path := msg.Descriptor() + fd, err := extractFile(gz) + if err != nil { + panic(fmt.Sprintf("invalid FileDescriptorProto for %T: %v", msg, err)) + } + + md = fd.MessageType[path[0]] + for _, i := range path[1:] { + md = md.NestedType[i] + } + return fd, md +} + +// Is this field a scalar numeric type? +func (field *FieldDescriptorProto) IsScalar() bool { + if field.Type == nil { + return false + } + switch *field.Type { + case FieldDescriptorProto_TYPE_DOUBLE, + FieldDescriptorProto_TYPE_FLOAT, + FieldDescriptorProto_TYPE_INT64, + FieldDescriptorProto_TYPE_UINT64, + FieldDescriptorProto_TYPE_INT32, + FieldDescriptorProto_TYPE_FIXED64, + FieldDescriptorProto_TYPE_FIXED32, + FieldDescriptorProto_TYPE_BOOL, + FieldDescriptorProto_TYPE_UINT32, + FieldDescriptorProto_TYPE_ENUM, + FieldDescriptorProto_TYPE_SFIXED32, + FieldDescriptorProto_TYPE_SFIXED64, + FieldDescriptorProto_TYPE_SINT32, + FieldDescriptorProto_TYPE_SINT64: + return true + default: + return false + } +} diff --git a/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor.pb.go b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor.pb.go new file mode 100644 index 00000000..18b2a331 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor.pb.go @@ -0,0 +1,2865 @@ +// Code generated by protoc-gen-gogo. DO NOT EDIT. +// source: descriptor.proto + +package descriptor + +import ( + fmt "fmt" + proto "github.com/gogo/protobuf/proto" + math "math" +) + +// Reference imports to suppress errors if they are not otherwise used. +var _ = proto.Marshal +var _ = fmt.Errorf +var _ = math.Inf + +// This is a compile-time assertion to ensure that this generated file +// is compatible with the proto package it is being compiled against. +// A compilation error at this line likely means your copy of the +// proto package needs to be updated. +const _ = proto.GoGoProtoPackageIsVersion3 // please upgrade the proto package + +type FieldDescriptorProto_Type int32 + +const ( + // 0 is reserved for errors. + // Order is weird for historical reasons. + FieldDescriptorProto_TYPE_DOUBLE FieldDescriptorProto_Type = 1 + FieldDescriptorProto_TYPE_FLOAT FieldDescriptorProto_Type = 2 + // Not ZigZag encoded. Negative numbers take 10 bytes. Use TYPE_SINT64 if + // negative values are likely. + FieldDescriptorProto_TYPE_INT64 FieldDescriptorProto_Type = 3 + FieldDescriptorProto_TYPE_UINT64 FieldDescriptorProto_Type = 4 + // Not ZigZag encoded. Negative numbers take 10 bytes. Use TYPE_SINT32 if + // negative values are likely. + FieldDescriptorProto_TYPE_INT32 FieldDescriptorProto_Type = 5 + FieldDescriptorProto_TYPE_FIXED64 FieldDescriptorProto_Type = 6 + FieldDescriptorProto_TYPE_FIXED32 FieldDescriptorProto_Type = 7 + FieldDescriptorProto_TYPE_BOOL FieldDescriptorProto_Type = 8 + FieldDescriptorProto_TYPE_STRING FieldDescriptorProto_Type = 9 + // Tag-delimited aggregate. + // Group type is deprecated and not supported in proto3. However, Proto3 + // implementations should still be able to parse the group wire format and + // treat group fields as unknown fields. + FieldDescriptorProto_TYPE_GROUP FieldDescriptorProto_Type = 10 + FieldDescriptorProto_TYPE_MESSAGE FieldDescriptorProto_Type = 11 + // New in version 2. + FieldDescriptorProto_TYPE_BYTES FieldDescriptorProto_Type = 12 + FieldDescriptorProto_TYPE_UINT32 FieldDescriptorProto_Type = 13 + FieldDescriptorProto_TYPE_ENUM FieldDescriptorProto_Type = 14 + FieldDescriptorProto_TYPE_SFIXED32 FieldDescriptorProto_Type = 15 + FieldDescriptorProto_TYPE_SFIXED64 FieldDescriptorProto_Type = 16 + FieldDescriptorProto_TYPE_SINT32 FieldDescriptorProto_Type = 17 + FieldDescriptorProto_TYPE_SINT64 FieldDescriptorProto_Type = 18 +) + +var FieldDescriptorProto_Type_name = map[int32]string{ + 1: "TYPE_DOUBLE", + 2: "TYPE_FLOAT", + 3: "TYPE_INT64", + 4: "TYPE_UINT64", + 5: "TYPE_INT32", + 6: "TYPE_FIXED64", + 7: "TYPE_FIXED32", + 8: "TYPE_BOOL", + 9: "TYPE_STRING", + 10: "TYPE_GROUP", + 11: "TYPE_MESSAGE", + 12: "TYPE_BYTES", + 13: "TYPE_UINT32", + 14: "TYPE_ENUM", + 15: "TYPE_SFIXED32", + 16: "TYPE_SFIXED64", + 17: "TYPE_SINT32", + 18: "TYPE_SINT64", +} + +var FieldDescriptorProto_Type_value = map[string]int32{ + "TYPE_DOUBLE": 1, + "TYPE_FLOAT": 2, + "TYPE_INT64": 3, + "TYPE_UINT64": 4, + "TYPE_INT32": 5, + "TYPE_FIXED64": 6, + "TYPE_FIXED32": 7, + "TYPE_BOOL": 8, + "TYPE_STRING": 9, + "TYPE_GROUP": 10, + "TYPE_MESSAGE": 11, + "TYPE_BYTES": 12, + "TYPE_UINT32": 13, + "TYPE_ENUM": 14, + "TYPE_SFIXED32": 15, + "TYPE_SFIXED64": 16, + "TYPE_SINT32": 17, + "TYPE_SINT64": 18, +} + +func (x FieldDescriptorProto_Type) Enum() *FieldDescriptorProto_Type { + p := new(FieldDescriptorProto_Type) + *p = x + return p +} + +func (x FieldDescriptorProto_Type) String() string { + return proto.EnumName(FieldDescriptorProto_Type_name, int32(x)) +} + +func (x *FieldDescriptorProto_Type) UnmarshalJSON(data []byte) error { + value, err := proto.UnmarshalJSONEnum(FieldDescriptorProto_Type_value, data, "FieldDescriptorProto_Type") + if err != nil { + return err + } + *x = FieldDescriptorProto_Type(value) + return nil +} + +func (FieldDescriptorProto_Type) EnumDescriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{4, 0} +} + +type FieldDescriptorProto_Label int32 + +const ( + // 0 is reserved for errors + FieldDescriptorProto_LABEL_OPTIONAL FieldDescriptorProto_Label = 1 + FieldDescriptorProto_LABEL_REQUIRED FieldDescriptorProto_Label = 2 + FieldDescriptorProto_LABEL_REPEATED FieldDescriptorProto_Label = 3 +) + +var FieldDescriptorProto_Label_name = map[int32]string{ + 1: "LABEL_OPTIONAL", + 2: "LABEL_REQUIRED", + 3: "LABEL_REPEATED", +} + +var FieldDescriptorProto_Label_value = map[string]int32{ + "LABEL_OPTIONAL": 1, + "LABEL_REQUIRED": 2, + "LABEL_REPEATED": 3, +} + +func (x FieldDescriptorProto_Label) Enum() *FieldDescriptorProto_Label { + p := new(FieldDescriptorProto_Label) + *p = x + return p +} + +func (x FieldDescriptorProto_Label) String() string { + return proto.EnumName(FieldDescriptorProto_Label_name, int32(x)) +} + +func (x *FieldDescriptorProto_Label) UnmarshalJSON(data []byte) error { + value, err := proto.UnmarshalJSONEnum(FieldDescriptorProto_Label_value, data, "FieldDescriptorProto_Label") + if err != nil { + return err + } + *x = FieldDescriptorProto_Label(value) + return nil +} + +func (FieldDescriptorProto_Label) EnumDescriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{4, 1} +} + +// Generated classes can be optimized for speed or code size. +type FileOptions_OptimizeMode int32 + +const ( + FileOptions_SPEED FileOptions_OptimizeMode = 1 + // etc. + FileOptions_CODE_SIZE FileOptions_OptimizeMode = 2 + FileOptions_LITE_RUNTIME FileOptions_OptimizeMode = 3 +) + +var FileOptions_OptimizeMode_name = map[int32]string{ + 1: "SPEED", + 2: "CODE_SIZE", + 3: "LITE_RUNTIME", +} + +var FileOptions_OptimizeMode_value = map[string]int32{ + "SPEED": 1, + "CODE_SIZE": 2, + "LITE_RUNTIME": 3, +} + +func (x FileOptions_OptimizeMode) Enum() *FileOptions_OptimizeMode { + p := new(FileOptions_OptimizeMode) + *p = x + return p +} + +func (x FileOptions_OptimizeMode) String() string { + return proto.EnumName(FileOptions_OptimizeMode_name, int32(x)) +} + +func (x *FileOptions_OptimizeMode) UnmarshalJSON(data []byte) error { + value, err := proto.UnmarshalJSONEnum(FileOptions_OptimizeMode_value, data, "FileOptions_OptimizeMode") + if err != nil { + return err + } + *x = FileOptions_OptimizeMode(value) + return nil +} + +func (FileOptions_OptimizeMode) EnumDescriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{10, 0} +} + +type FieldOptions_CType int32 + +const ( + // Default mode. + FieldOptions_STRING FieldOptions_CType = 0 + FieldOptions_CORD FieldOptions_CType = 1 + FieldOptions_STRING_PIECE FieldOptions_CType = 2 +) + +var FieldOptions_CType_name = map[int32]string{ + 0: "STRING", + 1: "CORD", + 2: "STRING_PIECE", +} + +var FieldOptions_CType_value = map[string]int32{ + "STRING": 0, + "CORD": 1, + "STRING_PIECE": 2, +} + +func (x FieldOptions_CType) Enum() *FieldOptions_CType { + p := new(FieldOptions_CType) + *p = x + return p +} + +func (x FieldOptions_CType) String() string { + return proto.EnumName(FieldOptions_CType_name, int32(x)) +} + +func (x *FieldOptions_CType) UnmarshalJSON(data []byte) error { + value, err := proto.UnmarshalJSONEnum(FieldOptions_CType_value, data, "FieldOptions_CType") + if err != nil { + return err + } + *x = FieldOptions_CType(value) + return nil +} + +func (FieldOptions_CType) EnumDescriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{12, 0} +} + +type FieldOptions_JSType int32 + +const ( + // Use the default type. + FieldOptions_JS_NORMAL FieldOptions_JSType = 0 + // Use JavaScript strings. + FieldOptions_JS_STRING FieldOptions_JSType = 1 + // Use JavaScript numbers. + FieldOptions_JS_NUMBER FieldOptions_JSType = 2 +) + +var FieldOptions_JSType_name = map[int32]string{ + 0: "JS_NORMAL", + 1: "JS_STRING", + 2: "JS_NUMBER", +} + +var FieldOptions_JSType_value = map[string]int32{ + "JS_NORMAL": 0, + "JS_STRING": 1, + "JS_NUMBER": 2, +} + +func (x FieldOptions_JSType) Enum() *FieldOptions_JSType { + p := new(FieldOptions_JSType) + *p = x + return p +} + +func (x FieldOptions_JSType) String() string { + return proto.EnumName(FieldOptions_JSType_name, int32(x)) +} + +func (x *FieldOptions_JSType) UnmarshalJSON(data []byte) error { + value, err := proto.UnmarshalJSONEnum(FieldOptions_JSType_value, data, "FieldOptions_JSType") + if err != nil { + return err + } + *x = FieldOptions_JSType(value) + return nil +} + +func (FieldOptions_JSType) EnumDescriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{12, 1} +} + +// Is this method side-effect-free (or safe in HTTP parlance), or idempotent, +// or neither? HTTP based RPC implementation may choose GET verb for safe +// methods, and PUT verb for idempotent methods instead of the default POST. +type MethodOptions_IdempotencyLevel int32 + +const ( + MethodOptions_IDEMPOTENCY_UNKNOWN MethodOptions_IdempotencyLevel = 0 + MethodOptions_NO_SIDE_EFFECTS MethodOptions_IdempotencyLevel = 1 + MethodOptions_IDEMPOTENT MethodOptions_IdempotencyLevel = 2 +) + +var MethodOptions_IdempotencyLevel_name = map[int32]string{ + 0: "IDEMPOTENCY_UNKNOWN", + 1: "NO_SIDE_EFFECTS", + 2: "IDEMPOTENT", +} + +var MethodOptions_IdempotencyLevel_value = map[string]int32{ + "IDEMPOTENCY_UNKNOWN": 0, + "NO_SIDE_EFFECTS": 1, + "IDEMPOTENT": 2, +} + +func (x MethodOptions_IdempotencyLevel) Enum() *MethodOptions_IdempotencyLevel { + p := new(MethodOptions_IdempotencyLevel) + *p = x + return p +} + +func (x MethodOptions_IdempotencyLevel) String() string { + return proto.EnumName(MethodOptions_IdempotencyLevel_name, int32(x)) +} + +func (x *MethodOptions_IdempotencyLevel) UnmarshalJSON(data []byte) error { + value, err := proto.UnmarshalJSONEnum(MethodOptions_IdempotencyLevel_value, data, "MethodOptions_IdempotencyLevel") + if err != nil { + return err + } + *x = MethodOptions_IdempotencyLevel(value) + return nil +} + +func (MethodOptions_IdempotencyLevel) EnumDescriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{17, 0} +} + +// The protocol compiler can output a FileDescriptorSet containing the .proto +// files it parses. +type FileDescriptorSet struct { + File []*FileDescriptorProto `protobuf:"bytes,1,rep,name=file" json:"file,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *FileDescriptorSet) Reset() { *m = FileDescriptorSet{} } +func (m *FileDescriptorSet) String() string { return proto.CompactTextString(m) } +func (*FileDescriptorSet) ProtoMessage() {} +func (*FileDescriptorSet) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{0} +} +func (m *FileDescriptorSet) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_FileDescriptorSet.Unmarshal(m, b) +} +func (m *FileDescriptorSet) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_FileDescriptorSet.Marshal(b, m, deterministic) +} +func (m *FileDescriptorSet) XXX_Merge(src proto.Message) { + xxx_messageInfo_FileDescriptorSet.Merge(m, src) +} +func (m *FileDescriptorSet) XXX_Size() int { + return xxx_messageInfo_FileDescriptorSet.Size(m) +} +func (m *FileDescriptorSet) XXX_DiscardUnknown() { + xxx_messageInfo_FileDescriptorSet.DiscardUnknown(m) +} + +var xxx_messageInfo_FileDescriptorSet proto.InternalMessageInfo + +func (m *FileDescriptorSet) GetFile() []*FileDescriptorProto { + if m != nil { + return m.File + } + return nil +} + +// Describes a complete .proto file. +type FileDescriptorProto struct { + Name *string `protobuf:"bytes,1,opt,name=name" json:"name,omitempty"` + Package *string `protobuf:"bytes,2,opt,name=package" json:"package,omitempty"` + // Names of files imported by this file. + Dependency []string `protobuf:"bytes,3,rep,name=dependency" json:"dependency,omitempty"` + // Indexes of the public imported files in the dependency list above. + PublicDependency []int32 `protobuf:"varint,10,rep,name=public_dependency,json=publicDependency" json:"public_dependency,omitempty"` + // Indexes of the weak imported files in the dependency list. + // For Google-internal migration only. Do not use. + WeakDependency []int32 `protobuf:"varint,11,rep,name=weak_dependency,json=weakDependency" json:"weak_dependency,omitempty"` + // All top-level definitions in this file. + MessageType []*DescriptorProto `protobuf:"bytes,4,rep,name=message_type,json=messageType" json:"message_type,omitempty"` + EnumType []*EnumDescriptorProto `protobuf:"bytes,5,rep,name=enum_type,json=enumType" json:"enum_type,omitempty"` + Service []*ServiceDescriptorProto `protobuf:"bytes,6,rep,name=service" json:"service,omitempty"` + Extension []*FieldDescriptorProto `protobuf:"bytes,7,rep,name=extension" json:"extension,omitempty"` + Options *FileOptions `protobuf:"bytes,8,opt,name=options" json:"options,omitempty"` + // This field contains optional information about the original source code. + // You may safely remove this entire field without harming runtime + // functionality of the descriptors -- the information is needed only by + // development tools. + SourceCodeInfo *SourceCodeInfo `protobuf:"bytes,9,opt,name=source_code_info,json=sourceCodeInfo" json:"source_code_info,omitempty"` + // The syntax of the proto file. + // The supported values are "proto2" and "proto3". + Syntax *string `protobuf:"bytes,12,opt,name=syntax" json:"syntax,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *FileDescriptorProto) Reset() { *m = FileDescriptorProto{} } +func (m *FileDescriptorProto) String() string { return proto.CompactTextString(m) } +func (*FileDescriptorProto) ProtoMessage() {} +func (*FileDescriptorProto) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{1} +} +func (m *FileDescriptorProto) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_FileDescriptorProto.Unmarshal(m, b) +} +func (m *FileDescriptorProto) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_FileDescriptorProto.Marshal(b, m, deterministic) +} +func (m *FileDescriptorProto) XXX_Merge(src proto.Message) { + xxx_messageInfo_FileDescriptorProto.Merge(m, src) +} +func (m *FileDescriptorProto) XXX_Size() int { + return xxx_messageInfo_FileDescriptorProto.Size(m) +} +func (m *FileDescriptorProto) XXX_DiscardUnknown() { + xxx_messageInfo_FileDescriptorProto.DiscardUnknown(m) +} + +var xxx_messageInfo_FileDescriptorProto proto.InternalMessageInfo + +func (m *FileDescriptorProto) GetName() string { + if m != nil && m.Name != nil { + return *m.Name + } + return "" +} + +func (m *FileDescriptorProto) GetPackage() string { + if m != nil && m.Package != nil { + return *m.Package + } + return "" +} + +func (m *FileDescriptorProto) GetDependency() []string { + if m != nil { + return m.Dependency + } + return nil +} + +func (m *FileDescriptorProto) GetPublicDependency() []int32 { + if m != nil { + return m.PublicDependency + } + return nil +} + +func (m *FileDescriptorProto) GetWeakDependency() []int32 { + if m != nil { + return m.WeakDependency + } + return nil +} + +func (m *FileDescriptorProto) GetMessageType() []*DescriptorProto { + if m != nil { + return m.MessageType + } + return nil +} + +func (m *FileDescriptorProto) GetEnumType() []*EnumDescriptorProto { + if m != nil { + return m.EnumType + } + return nil +} + +func (m *FileDescriptorProto) GetService() []*ServiceDescriptorProto { + if m != nil { + return m.Service + } + return nil +} + +func (m *FileDescriptorProto) GetExtension() []*FieldDescriptorProto { + if m != nil { + return m.Extension + } + return nil +} + +func (m *FileDescriptorProto) GetOptions() *FileOptions { + if m != nil { + return m.Options + } + return nil +} + +func (m *FileDescriptorProto) GetSourceCodeInfo() *SourceCodeInfo { + if m != nil { + return m.SourceCodeInfo + } + return nil +} + +func (m *FileDescriptorProto) GetSyntax() string { + if m != nil && m.Syntax != nil { + return *m.Syntax + } + return "" +} + +// Describes a message type. +type DescriptorProto struct { + Name *string `protobuf:"bytes,1,opt,name=name" json:"name,omitempty"` + Field []*FieldDescriptorProto `protobuf:"bytes,2,rep,name=field" json:"field,omitempty"` + Extension []*FieldDescriptorProto `protobuf:"bytes,6,rep,name=extension" json:"extension,omitempty"` + NestedType []*DescriptorProto `protobuf:"bytes,3,rep,name=nested_type,json=nestedType" json:"nested_type,omitempty"` + EnumType []*EnumDescriptorProto `protobuf:"bytes,4,rep,name=enum_type,json=enumType" json:"enum_type,omitempty"` + ExtensionRange []*DescriptorProto_ExtensionRange `protobuf:"bytes,5,rep,name=extension_range,json=extensionRange" json:"extension_range,omitempty"` + OneofDecl []*OneofDescriptorProto `protobuf:"bytes,8,rep,name=oneof_decl,json=oneofDecl" json:"oneof_decl,omitempty"` + Options *MessageOptions `protobuf:"bytes,7,opt,name=options" json:"options,omitempty"` + ReservedRange []*DescriptorProto_ReservedRange `protobuf:"bytes,9,rep,name=reserved_range,json=reservedRange" json:"reserved_range,omitempty"` + // Reserved field names, which may not be used by fields in the same message. + // A given name may only be reserved once. + ReservedName []string `protobuf:"bytes,10,rep,name=reserved_name,json=reservedName" json:"reserved_name,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *DescriptorProto) Reset() { *m = DescriptorProto{} } +func (m *DescriptorProto) String() string { return proto.CompactTextString(m) } +func (*DescriptorProto) ProtoMessage() {} +func (*DescriptorProto) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{2} +} +func (m *DescriptorProto) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_DescriptorProto.Unmarshal(m, b) +} +func (m *DescriptorProto) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_DescriptorProto.Marshal(b, m, deterministic) +} +func (m *DescriptorProto) XXX_Merge(src proto.Message) { + xxx_messageInfo_DescriptorProto.Merge(m, src) +} +func (m *DescriptorProto) XXX_Size() int { + return xxx_messageInfo_DescriptorProto.Size(m) +} +func (m *DescriptorProto) XXX_DiscardUnknown() { + xxx_messageInfo_DescriptorProto.DiscardUnknown(m) +} + +var xxx_messageInfo_DescriptorProto proto.InternalMessageInfo + +func (m *DescriptorProto) GetName() string { + if m != nil && m.Name != nil { + return *m.Name + } + return "" +} + +func (m *DescriptorProto) GetField() []*FieldDescriptorProto { + if m != nil { + return m.Field + } + return nil +} + +func (m *DescriptorProto) GetExtension() []*FieldDescriptorProto { + if m != nil { + return m.Extension + } + return nil +} + +func (m *DescriptorProto) GetNestedType() []*DescriptorProto { + if m != nil { + return m.NestedType + } + return nil +} + +func (m *DescriptorProto) GetEnumType() []*EnumDescriptorProto { + if m != nil { + return m.EnumType + } + return nil +} + +func (m *DescriptorProto) GetExtensionRange() []*DescriptorProto_ExtensionRange { + if m != nil { + return m.ExtensionRange + } + return nil +} + +func (m *DescriptorProto) GetOneofDecl() []*OneofDescriptorProto { + if m != nil { + return m.OneofDecl + } + return nil +} + +func (m *DescriptorProto) GetOptions() *MessageOptions { + if m != nil { + return m.Options + } + return nil +} + +func (m *DescriptorProto) GetReservedRange() []*DescriptorProto_ReservedRange { + if m != nil { + return m.ReservedRange + } + return nil +} + +func (m *DescriptorProto) GetReservedName() []string { + if m != nil { + return m.ReservedName + } + return nil +} + +type DescriptorProto_ExtensionRange struct { + Start *int32 `protobuf:"varint,1,opt,name=start" json:"start,omitempty"` + End *int32 `protobuf:"varint,2,opt,name=end" json:"end,omitempty"` + Options *ExtensionRangeOptions `protobuf:"bytes,3,opt,name=options" json:"options,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *DescriptorProto_ExtensionRange) Reset() { *m = DescriptorProto_ExtensionRange{} } +func (m *DescriptorProto_ExtensionRange) String() string { return proto.CompactTextString(m) } +func (*DescriptorProto_ExtensionRange) ProtoMessage() {} +func (*DescriptorProto_ExtensionRange) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{2, 0} +} +func (m *DescriptorProto_ExtensionRange) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_DescriptorProto_ExtensionRange.Unmarshal(m, b) +} +func (m *DescriptorProto_ExtensionRange) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_DescriptorProto_ExtensionRange.Marshal(b, m, deterministic) +} +func (m *DescriptorProto_ExtensionRange) XXX_Merge(src proto.Message) { + xxx_messageInfo_DescriptorProto_ExtensionRange.Merge(m, src) +} +func (m *DescriptorProto_ExtensionRange) XXX_Size() int { + return xxx_messageInfo_DescriptorProto_ExtensionRange.Size(m) +} +func (m *DescriptorProto_ExtensionRange) XXX_DiscardUnknown() { + xxx_messageInfo_DescriptorProto_ExtensionRange.DiscardUnknown(m) +} + +var xxx_messageInfo_DescriptorProto_ExtensionRange proto.InternalMessageInfo + +func (m *DescriptorProto_ExtensionRange) GetStart() int32 { + if m != nil && m.Start != nil { + return *m.Start + } + return 0 +} + +func (m *DescriptorProto_ExtensionRange) GetEnd() int32 { + if m != nil && m.End != nil { + return *m.End + } + return 0 +} + +func (m *DescriptorProto_ExtensionRange) GetOptions() *ExtensionRangeOptions { + if m != nil { + return m.Options + } + return nil +} + +// Range of reserved tag numbers. Reserved tag numbers may not be used by +// fields or extension ranges in the same message. Reserved ranges may +// not overlap. +type DescriptorProto_ReservedRange struct { + Start *int32 `protobuf:"varint,1,opt,name=start" json:"start,omitempty"` + End *int32 `protobuf:"varint,2,opt,name=end" json:"end,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *DescriptorProto_ReservedRange) Reset() { *m = DescriptorProto_ReservedRange{} } +func (m *DescriptorProto_ReservedRange) String() string { return proto.CompactTextString(m) } +func (*DescriptorProto_ReservedRange) ProtoMessage() {} +func (*DescriptorProto_ReservedRange) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{2, 1} +} +func (m *DescriptorProto_ReservedRange) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_DescriptorProto_ReservedRange.Unmarshal(m, b) +} +func (m *DescriptorProto_ReservedRange) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_DescriptorProto_ReservedRange.Marshal(b, m, deterministic) +} +func (m *DescriptorProto_ReservedRange) XXX_Merge(src proto.Message) { + xxx_messageInfo_DescriptorProto_ReservedRange.Merge(m, src) +} +func (m *DescriptorProto_ReservedRange) XXX_Size() int { + return xxx_messageInfo_DescriptorProto_ReservedRange.Size(m) +} +func (m *DescriptorProto_ReservedRange) XXX_DiscardUnknown() { + xxx_messageInfo_DescriptorProto_ReservedRange.DiscardUnknown(m) +} + +var xxx_messageInfo_DescriptorProto_ReservedRange proto.InternalMessageInfo + +func (m *DescriptorProto_ReservedRange) GetStart() int32 { + if m != nil && m.Start != nil { + return *m.Start + } + return 0 +} + +func (m *DescriptorProto_ReservedRange) GetEnd() int32 { + if m != nil && m.End != nil { + return *m.End + } + return 0 +} + +type ExtensionRangeOptions struct { + // The parser stores options it doesn't recognize here. See above. + UninterpretedOption []*UninterpretedOption `protobuf:"bytes,999,rep,name=uninterpreted_option,json=uninterpretedOption" json:"uninterpreted_option,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + proto.XXX_InternalExtensions `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *ExtensionRangeOptions) Reset() { *m = ExtensionRangeOptions{} } +func (m *ExtensionRangeOptions) String() string { return proto.CompactTextString(m) } +func (*ExtensionRangeOptions) ProtoMessage() {} +func (*ExtensionRangeOptions) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{3} +} + +var extRange_ExtensionRangeOptions = []proto.ExtensionRange{ + {Start: 1000, End: 536870911}, +} + +func (*ExtensionRangeOptions) ExtensionRangeArray() []proto.ExtensionRange { + return extRange_ExtensionRangeOptions +} + +func (m *ExtensionRangeOptions) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_ExtensionRangeOptions.Unmarshal(m, b) +} +func (m *ExtensionRangeOptions) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_ExtensionRangeOptions.Marshal(b, m, deterministic) +} +func (m *ExtensionRangeOptions) XXX_Merge(src proto.Message) { + xxx_messageInfo_ExtensionRangeOptions.Merge(m, src) +} +func (m *ExtensionRangeOptions) XXX_Size() int { + return xxx_messageInfo_ExtensionRangeOptions.Size(m) +} +func (m *ExtensionRangeOptions) XXX_DiscardUnknown() { + xxx_messageInfo_ExtensionRangeOptions.DiscardUnknown(m) +} + +var xxx_messageInfo_ExtensionRangeOptions proto.InternalMessageInfo + +func (m *ExtensionRangeOptions) GetUninterpretedOption() []*UninterpretedOption { + if m != nil { + return m.UninterpretedOption + } + return nil +} + +// Describes a field within a message. +type FieldDescriptorProto struct { + Name *string `protobuf:"bytes,1,opt,name=name" json:"name,omitempty"` + Number *int32 `protobuf:"varint,3,opt,name=number" json:"number,omitempty"` + Label *FieldDescriptorProto_Label `protobuf:"varint,4,opt,name=label,enum=google.protobuf.FieldDescriptorProto_Label" json:"label,omitempty"` + // If type_name is set, this need not be set. If both this and type_name + // are set, this must be one of TYPE_ENUM, TYPE_MESSAGE or TYPE_GROUP. + Type *FieldDescriptorProto_Type `protobuf:"varint,5,opt,name=type,enum=google.protobuf.FieldDescriptorProto_Type" json:"type,omitempty"` + // For message and enum types, this is the name of the type. If the name + // starts with a '.', it is fully-qualified. Otherwise, C++-like scoping + // rules are used to find the type (i.e. first the nested types within this + // message are searched, then within the parent, on up to the root + // namespace). + TypeName *string `protobuf:"bytes,6,opt,name=type_name,json=typeName" json:"type_name,omitempty"` + // For extensions, this is the name of the type being extended. It is + // resolved in the same manner as type_name. + Extendee *string `protobuf:"bytes,2,opt,name=extendee" json:"extendee,omitempty"` + // For numeric types, contains the original text representation of the value. + // For booleans, "true" or "false". + // For strings, contains the default text contents (not escaped in any way). + // For bytes, contains the C escaped value. All bytes >= 128 are escaped. + // TODO(kenton): Base-64 encode? + DefaultValue *string `protobuf:"bytes,7,opt,name=default_value,json=defaultValue" json:"default_value,omitempty"` + // If set, gives the index of a oneof in the containing type's oneof_decl + // list. This field is a member of that oneof. + OneofIndex *int32 `protobuf:"varint,9,opt,name=oneof_index,json=oneofIndex" json:"oneof_index,omitempty"` + // JSON name of this field. The value is set by protocol compiler. If the + // user has set a "json_name" option on this field, that option's value + // will be used. Otherwise, it's deduced from the field's name by converting + // it to camelCase. + JsonName *string `protobuf:"bytes,10,opt,name=json_name,json=jsonName" json:"json_name,omitempty"` + Options *FieldOptions `protobuf:"bytes,8,opt,name=options" json:"options,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *FieldDescriptorProto) Reset() { *m = FieldDescriptorProto{} } +func (m *FieldDescriptorProto) String() string { return proto.CompactTextString(m) } +func (*FieldDescriptorProto) ProtoMessage() {} +func (*FieldDescriptorProto) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{4} +} +func (m *FieldDescriptorProto) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_FieldDescriptorProto.Unmarshal(m, b) +} +func (m *FieldDescriptorProto) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_FieldDescriptorProto.Marshal(b, m, deterministic) +} +func (m *FieldDescriptorProto) XXX_Merge(src proto.Message) { + xxx_messageInfo_FieldDescriptorProto.Merge(m, src) +} +func (m *FieldDescriptorProto) XXX_Size() int { + return xxx_messageInfo_FieldDescriptorProto.Size(m) +} +func (m *FieldDescriptorProto) XXX_DiscardUnknown() { + xxx_messageInfo_FieldDescriptorProto.DiscardUnknown(m) +} + +var xxx_messageInfo_FieldDescriptorProto proto.InternalMessageInfo + +func (m *FieldDescriptorProto) GetName() string { + if m != nil && m.Name != nil { + return *m.Name + } + return "" +} + +func (m *FieldDescriptorProto) GetNumber() int32 { + if m != nil && m.Number != nil { + return *m.Number + } + return 0 +} + +func (m *FieldDescriptorProto) GetLabel() FieldDescriptorProto_Label { + if m != nil && m.Label != nil { + return *m.Label + } + return FieldDescriptorProto_LABEL_OPTIONAL +} + +func (m *FieldDescriptorProto) GetType() FieldDescriptorProto_Type { + if m != nil && m.Type != nil { + return *m.Type + } + return FieldDescriptorProto_TYPE_DOUBLE +} + +func (m *FieldDescriptorProto) GetTypeName() string { + if m != nil && m.TypeName != nil { + return *m.TypeName + } + return "" +} + +func (m *FieldDescriptorProto) GetExtendee() string { + if m != nil && m.Extendee != nil { + return *m.Extendee + } + return "" +} + +func (m *FieldDescriptorProto) GetDefaultValue() string { + if m != nil && m.DefaultValue != nil { + return *m.DefaultValue + } + return "" +} + +func (m *FieldDescriptorProto) GetOneofIndex() int32 { + if m != nil && m.OneofIndex != nil { + return *m.OneofIndex + } + return 0 +} + +func (m *FieldDescriptorProto) GetJsonName() string { + if m != nil && m.JsonName != nil { + return *m.JsonName + } + return "" +} + +func (m *FieldDescriptorProto) GetOptions() *FieldOptions { + if m != nil { + return m.Options + } + return nil +} + +// Describes a oneof. +type OneofDescriptorProto struct { + Name *string `protobuf:"bytes,1,opt,name=name" json:"name,omitempty"` + Options *OneofOptions `protobuf:"bytes,2,opt,name=options" json:"options,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *OneofDescriptorProto) Reset() { *m = OneofDescriptorProto{} } +func (m *OneofDescriptorProto) String() string { return proto.CompactTextString(m) } +func (*OneofDescriptorProto) ProtoMessage() {} +func (*OneofDescriptorProto) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{5} +} +func (m *OneofDescriptorProto) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_OneofDescriptorProto.Unmarshal(m, b) +} +func (m *OneofDescriptorProto) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_OneofDescriptorProto.Marshal(b, m, deterministic) +} +func (m *OneofDescriptorProto) XXX_Merge(src proto.Message) { + xxx_messageInfo_OneofDescriptorProto.Merge(m, src) +} +func (m *OneofDescriptorProto) XXX_Size() int { + return xxx_messageInfo_OneofDescriptorProto.Size(m) +} +func (m *OneofDescriptorProto) XXX_DiscardUnknown() { + xxx_messageInfo_OneofDescriptorProto.DiscardUnknown(m) +} + +var xxx_messageInfo_OneofDescriptorProto proto.InternalMessageInfo + +func (m *OneofDescriptorProto) GetName() string { + if m != nil && m.Name != nil { + return *m.Name + } + return "" +} + +func (m *OneofDescriptorProto) GetOptions() *OneofOptions { + if m != nil { + return m.Options + } + return nil +} + +// Describes an enum type. +type EnumDescriptorProto struct { + Name *string `protobuf:"bytes,1,opt,name=name" json:"name,omitempty"` + Value []*EnumValueDescriptorProto `protobuf:"bytes,2,rep,name=value" json:"value,omitempty"` + Options *EnumOptions `protobuf:"bytes,3,opt,name=options" json:"options,omitempty"` + // Range of reserved numeric values. Reserved numeric values may not be used + // by enum values in the same enum declaration. Reserved ranges may not + // overlap. + ReservedRange []*EnumDescriptorProto_EnumReservedRange `protobuf:"bytes,4,rep,name=reserved_range,json=reservedRange" json:"reserved_range,omitempty"` + // Reserved enum value names, which may not be reused. A given name may only + // be reserved once. + ReservedName []string `protobuf:"bytes,5,rep,name=reserved_name,json=reservedName" json:"reserved_name,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *EnumDescriptorProto) Reset() { *m = EnumDescriptorProto{} } +func (m *EnumDescriptorProto) String() string { return proto.CompactTextString(m) } +func (*EnumDescriptorProto) ProtoMessage() {} +func (*EnumDescriptorProto) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{6} +} +func (m *EnumDescriptorProto) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_EnumDescriptorProto.Unmarshal(m, b) +} +func (m *EnumDescriptorProto) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_EnumDescriptorProto.Marshal(b, m, deterministic) +} +func (m *EnumDescriptorProto) XXX_Merge(src proto.Message) { + xxx_messageInfo_EnumDescriptorProto.Merge(m, src) +} +func (m *EnumDescriptorProto) XXX_Size() int { + return xxx_messageInfo_EnumDescriptorProto.Size(m) +} +func (m *EnumDescriptorProto) XXX_DiscardUnknown() { + xxx_messageInfo_EnumDescriptorProto.DiscardUnknown(m) +} + +var xxx_messageInfo_EnumDescriptorProto proto.InternalMessageInfo + +func (m *EnumDescriptorProto) GetName() string { + if m != nil && m.Name != nil { + return *m.Name + } + return "" +} + +func (m *EnumDescriptorProto) GetValue() []*EnumValueDescriptorProto { + if m != nil { + return m.Value + } + return nil +} + +func (m *EnumDescriptorProto) GetOptions() *EnumOptions { + if m != nil { + return m.Options + } + return nil +} + +func (m *EnumDescriptorProto) GetReservedRange() []*EnumDescriptorProto_EnumReservedRange { + if m != nil { + return m.ReservedRange + } + return nil +} + +func (m *EnumDescriptorProto) GetReservedName() []string { + if m != nil { + return m.ReservedName + } + return nil +} + +// Range of reserved numeric values. Reserved values may not be used by +// entries in the same enum. Reserved ranges may not overlap. +// +// Note that this is distinct from DescriptorProto.ReservedRange in that it +// is inclusive such that it can appropriately represent the entire int32 +// domain. +type EnumDescriptorProto_EnumReservedRange struct { + Start *int32 `protobuf:"varint,1,opt,name=start" json:"start,omitempty"` + End *int32 `protobuf:"varint,2,opt,name=end" json:"end,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *EnumDescriptorProto_EnumReservedRange) Reset() { *m = EnumDescriptorProto_EnumReservedRange{} } +func (m *EnumDescriptorProto_EnumReservedRange) String() string { return proto.CompactTextString(m) } +func (*EnumDescriptorProto_EnumReservedRange) ProtoMessage() {} +func (*EnumDescriptorProto_EnumReservedRange) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{6, 0} +} +func (m *EnumDescriptorProto_EnumReservedRange) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_EnumDescriptorProto_EnumReservedRange.Unmarshal(m, b) +} +func (m *EnumDescriptorProto_EnumReservedRange) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_EnumDescriptorProto_EnumReservedRange.Marshal(b, m, deterministic) +} +func (m *EnumDescriptorProto_EnumReservedRange) XXX_Merge(src proto.Message) { + xxx_messageInfo_EnumDescriptorProto_EnumReservedRange.Merge(m, src) +} +func (m *EnumDescriptorProto_EnumReservedRange) XXX_Size() int { + return xxx_messageInfo_EnumDescriptorProto_EnumReservedRange.Size(m) +} +func (m *EnumDescriptorProto_EnumReservedRange) XXX_DiscardUnknown() { + xxx_messageInfo_EnumDescriptorProto_EnumReservedRange.DiscardUnknown(m) +} + +var xxx_messageInfo_EnumDescriptorProto_EnumReservedRange proto.InternalMessageInfo + +func (m *EnumDescriptorProto_EnumReservedRange) GetStart() int32 { + if m != nil && m.Start != nil { + return *m.Start + } + return 0 +} + +func (m *EnumDescriptorProto_EnumReservedRange) GetEnd() int32 { + if m != nil && m.End != nil { + return *m.End + } + return 0 +} + +// Describes a value within an enum. +type EnumValueDescriptorProto struct { + Name *string `protobuf:"bytes,1,opt,name=name" json:"name,omitempty"` + Number *int32 `protobuf:"varint,2,opt,name=number" json:"number,omitempty"` + Options *EnumValueOptions `protobuf:"bytes,3,opt,name=options" json:"options,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *EnumValueDescriptorProto) Reset() { *m = EnumValueDescriptorProto{} } +func (m *EnumValueDescriptorProto) String() string { return proto.CompactTextString(m) } +func (*EnumValueDescriptorProto) ProtoMessage() {} +func (*EnumValueDescriptorProto) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{7} +} +func (m *EnumValueDescriptorProto) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_EnumValueDescriptorProto.Unmarshal(m, b) +} +func (m *EnumValueDescriptorProto) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_EnumValueDescriptorProto.Marshal(b, m, deterministic) +} +func (m *EnumValueDescriptorProto) XXX_Merge(src proto.Message) { + xxx_messageInfo_EnumValueDescriptorProto.Merge(m, src) +} +func (m *EnumValueDescriptorProto) XXX_Size() int { + return xxx_messageInfo_EnumValueDescriptorProto.Size(m) +} +func (m *EnumValueDescriptorProto) XXX_DiscardUnknown() { + xxx_messageInfo_EnumValueDescriptorProto.DiscardUnknown(m) +} + +var xxx_messageInfo_EnumValueDescriptorProto proto.InternalMessageInfo + +func (m *EnumValueDescriptorProto) GetName() string { + if m != nil && m.Name != nil { + return *m.Name + } + return "" +} + +func (m *EnumValueDescriptorProto) GetNumber() int32 { + if m != nil && m.Number != nil { + return *m.Number + } + return 0 +} + +func (m *EnumValueDescriptorProto) GetOptions() *EnumValueOptions { + if m != nil { + return m.Options + } + return nil +} + +// Describes a service. +type ServiceDescriptorProto struct { + Name *string `protobuf:"bytes,1,opt,name=name" json:"name,omitempty"` + Method []*MethodDescriptorProto `protobuf:"bytes,2,rep,name=method" json:"method,omitempty"` + Options *ServiceOptions `protobuf:"bytes,3,opt,name=options" json:"options,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *ServiceDescriptorProto) Reset() { *m = ServiceDescriptorProto{} } +func (m *ServiceDescriptorProto) String() string { return proto.CompactTextString(m) } +func (*ServiceDescriptorProto) ProtoMessage() {} +func (*ServiceDescriptorProto) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{8} +} +func (m *ServiceDescriptorProto) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_ServiceDescriptorProto.Unmarshal(m, b) +} +func (m *ServiceDescriptorProto) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_ServiceDescriptorProto.Marshal(b, m, deterministic) +} +func (m *ServiceDescriptorProto) XXX_Merge(src proto.Message) { + xxx_messageInfo_ServiceDescriptorProto.Merge(m, src) +} +func (m *ServiceDescriptorProto) XXX_Size() int { + return xxx_messageInfo_ServiceDescriptorProto.Size(m) +} +func (m *ServiceDescriptorProto) XXX_DiscardUnknown() { + xxx_messageInfo_ServiceDescriptorProto.DiscardUnknown(m) +} + +var xxx_messageInfo_ServiceDescriptorProto proto.InternalMessageInfo + +func (m *ServiceDescriptorProto) GetName() string { + if m != nil && m.Name != nil { + return *m.Name + } + return "" +} + +func (m *ServiceDescriptorProto) GetMethod() []*MethodDescriptorProto { + if m != nil { + return m.Method + } + return nil +} + +func (m *ServiceDescriptorProto) GetOptions() *ServiceOptions { + if m != nil { + return m.Options + } + return nil +} + +// Describes a method of a service. +type MethodDescriptorProto struct { + Name *string `protobuf:"bytes,1,opt,name=name" json:"name,omitempty"` + // Input and output type names. These are resolved in the same way as + // FieldDescriptorProto.type_name, but must refer to a message type. + InputType *string `protobuf:"bytes,2,opt,name=input_type,json=inputType" json:"input_type,omitempty"` + OutputType *string `protobuf:"bytes,3,opt,name=output_type,json=outputType" json:"output_type,omitempty"` + Options *MethodOptions `protobuf:"bytes,4,opt,name=options" json:"options,omitempty"` + // Identifies if client streams multiple client messages + ClientStreaming *bool `protobuf:"varint,5,opt,name=client_streaming,json=clientStreaming,def=0" json:"client_streaming,omitempty"` + // Identifies if server streams multiple server messages + ServerStreaming *bool `protobuf:"varint,6,opt,name=server_streaming,json=serverStreaming,def=0" json:"server_streaming,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *MethodDescriptorProto) Reset() { *m = MethodDescriptorProto{} } +func (m *MethodDescriptorProto) String() string { return proto.CompactTextString(m) } +func (*MethodDescriptorProto) ProtoMessage() {} +func (*MethodDescriptorProto) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{9} +} +func (m *MethodDescriptorProto) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_MethodDescriptorProto.Unmarshal(m, b) +} +func (m *MethodDescriptorProto) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_MethodDescriptorProto.Marshal(b, m, deterministic) +} +func (m *MethodDescriptorProto) XXX_Merge(src proto.Message) { + xxx_messageInfo_MethodDescriptorProto.Merge(m, src) +} +func (m *MethodDescriptorProto) XXX_Size() int { + return xxx_messageInfo_MethodDescriptorProto.Size(m) +} +func (m *MethodDescriptorProto) XXX_DiscardUnknown() { + xxx_messageInfo_MethodDescriptorProto.DiscardUnknown(m) +} + +var xxx_messageInfo_MethodDescriptorProto proto.InternalMessageInfo + +const Default_MethodDescriptorProto_ClientStreaming bool = false +const Default_MethodDescriptorProto_ServerStreaming bool = false + +func (m *MethodDescriptorProto) GetName() string { + if m != nil && m.Name != nil { + return *m.Name + } + return "" +} + +func (m *MethodDescriptorProto) GetInputType() string { + if m != nil && m.InputType != nil { + return *m.InputType + } + return "" +} + +func (m *MethodDescriptorProto) GetOutputType() string { + if m != nil && m.OutputType != nil { + return *m.OutputType + } + return "" +} + +func (m *MethodDescriptorProto) GetOptions() *MethodOptions { + if m != nil { + return m.Options + } + return nil +} + +func (m *MethodDescriptorProto) GetClientStreaming() bool { + if m != nil && m.ClientStreaming != nil { + return *m.ClientStreaming + } + return Default_MethodDescriptorProto_ClientStreaming +} + +func (m *MethodDescriptorProto) GetServerStreaming() bool { + if m != nil && m.ServerStreaming != nil { + return *m.ServerStreaming + } + return Default_MethodDescriptorProto_ServerStreaming +} + +type FileOptions struct { + // Sets the Java package where classes generated from this .proto will be + // placed. By default, the proto package is used, but this is often + // inappropriate because proto packages do not normally start with backwards + // domain names. + JavaPackage *string `protobuf:"bytes,1,opt,name=java_package,json=javaPackage" json:"java_package,omitempty"` + // If set, all the classes from the .proto file are wrapped in a single + // outer class with the given name. This applies to both Proto1 + // (equivalent to the old "--one_java_file" option) and Proto2 (where + // a .proto always translates to a single class, but you may want to + // explicitly choose the class name). + JavaOuterClassname *string `protobuf:"bytes,8,opt,name=java_outer_classname,json=javaOuterClassname" json:"java_outer_classname,omitempty"` + // If set true, then the Java code generator will generate a separate .java + // file for each top-level message, enum, and service defined in the .proto + // file. Thus, these types will *not* be nested inside the outer class + // named by java_outer_classname. However, the outer class will still be + // generated to contain the file's getDescriptor() method as well as any + // top-level extensions defined in the file. + JavaMultipleFiles *bool `protobuf:"varint,10,opt,name=java_multiple_files,json=javaMultipleFiles,def=0" json:"java_multiple_files,omitempty"` + // This option does nothing. + JavaGenerateEqualsAndHash *bool `protobuf:"varint,20,opt,name=java_generate_equals_and_hash,json=javaGenerateEqualsAndHash" json:"java_generate_equals_and_hash,omitempty"` // Deprecated: Do not use. + // If set true, then the Java2 code generator will generate code that + // throws an exception whenever an attempt is made to assign a non-UTF-8 + // byte sequence to a string field. + // Message reflection will do the same. + // However, an extension field still accepts non-UTF-8 byte sequences. + // This option has no effect on when used with the lite runtime. + JavaStringCheckUtf8 *bool `protobuf:"varint,27,opt,name=java_string_check_utf8,json=javaStringCheckUtf8,def=0" json:"java_string_check_utf8,omitempty"` + OptimizeFor *FileOptions_OptimizeMode `protobuf:"varint,9,opt,name=optimize_for,json=optimizeFor,enum=google.protobuf.FileOptions_OptimizeMode,def=1" json:"optimize_for,omitempty"` + // Sets the Go package where structs generated from this .proto will be + // placed. If omitted, the Go package will be derived from the following: + // - The basename of the package import path, if provided. + // - Otherwise, the package statement in the .proto file, if present. + // - Otherwise, the basename of the .proto file, without extension. + GoPackage *string `protobuf:"bytes,11,opt,name=go_package,json=goPackage" json:"go_package,omitempty"` + // Should generic services be generated in each language? "Generic" services + // are not specific to any particular RPC system. They are generated by the + // main code generators in each language (without additional plugins). + // Generic services were the only kind of service generation supported by + // early versions of google.protobuf. + // + // Generic services are now considered deprecated in favor of using plugins + // that generate code specific to your particular RPC system. Therefore, + // these default to false. Old code which depends on generic services should + // explicitly set them to true. + CcGenericServices *bool `protobuf:"varint,16,opt,name=cc_generic_services,json=ccGenericServices,def=0" json:"cc_generic_services,omitempty"` + JavaGenericServices *bool `protobuf:"varint,17,opt,name=java_generic_services,json=javaGenericServices,def=0" json:"java_generic_services,omitempty"` + PyGenericServices *bool `protobuf:"varint,18,opt,name=py_generic_services,json=pyGenericServices,def=0" json:"py_generic_services,omitempty"` + PhpGenericServices *bool `protobuf:"varint,42,opt,name=php_generic_services,json=phpGenericServices,def=0" json:"php_generic_services,omitempty"` + // Is this file deprecated? + // Depending on the target platform, this can emit Deprecated annotations + // for everything in the file, or it will be completely ignored; in the very + // least, this is a formalization for deprecating files. + Deprecated *bool `protobuf:"varint,23,opt,name=deprecated,def=0" json:"deprecated,omitempty"` + // Enables the use of arenas for the proto messages in this file. This applies + // only to generated classes for C++. + CcEnableArenas *bool `protobuf:"varint,31,opt,name=cc_enable_arenas,json=ccEnableArenas,def=0" json:"cc_enable_arenas,omitempty"` + // Sets the objective c class prefix which is prepended to all objective c + // generated classes from this .proto. There is no default. + ObjcClassPrefix *string `protobuf:"bytes,36,opt,name=objc_class_prefix,json=objcClassPrefix" json:"objc_class_prefix,omitempty"` + // Namespace for generated classes; defaults to the package. + CsharpNamespace *string `protobuf:"bytes,37,opt,name=csharp_namespace,json=csharpNamespace" json:"csharp_namespace,omitempty"` + // By default Swift generators will take the proto package and CamelCase it + // replacing '.' with underscore and use that to prefix the types/symbols + // defined. When this options is provided, they will use this value instead + // to prefix the types/symbols defined. + SwiftPrefix *string `protobuf:"bytes,39,opt,name=swift_prefix,json=swiftPrefix" json:"swift_prefix,omitempty"` + // Sets the php class prefix which is prepended to all php generated classes + // from this .proto. Default is empty. + PhpClassPrefix *string `protobuf:"bytes,40,opt,name=php_class_prefix,json=phpClassPrefix" json:"php_class_prefix,omitempty"` + // Use this option to change the namespace of php generated classes. Default + // is empty. When this option is empty, the package name will be used for + // determining the namespace. + PhpNamespace *string `protobuf:"bytes,41,opt,name=php_namespace,json=phpNamespace" json:"php_namespace,omitempty"` + // Use this option to change the namespace of php generated metadata classes. + // Default is empty. When this option is empty, the proto file name will be + // used for determining the namespace. + PhpMetadataNamespace *string `protobuf:"bytes,44,opt,name=php_metadata_namespace,json=phpMetadataNamespace" json:"php_metadata_namespace,omitempty"` + // Use this option to change the package of ruby generated classes. Default + // is empty. When this option is not set, the package name will be used for + // determining the ruby package. + RubyPackage *string `protobuf:"bytes,45,opt,name=ruby_package,json=rubyPackage" json:"ruby_package,omitempty"` + // The parser stores options it doesn't recognize here. + // See the documentation for the "Options" section above. + UninterpretedOption []*UninterpretedOption `protobuf:"bytes,999,rep,name=uninterpreted_option,json=uninterpretedOption" json:"uninterpreted_option,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + proto.XXX_InternalExtensions `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *FileOptions) Reset() { *m = FileOptions{} } +func (m *FileOptions) String() string { return proto.CompactTextString(m) } +func (*FileOptions) ProtoMessage() {} +func (*FileOptions) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{10} +} + +var extRange_FileOptions = []proto.ExtensionRange{ + {Start: 1000, End: 536870911}, +} + +func (*FileOptions) ExtensionRangeArray() []proto.ExtensionRange { + return extRange_FileOptions +} + +func (m *FileOptions) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_FileOptions.Unmarshal(m, b) +} +func (m *FileOptions) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_FileOptions.Marshal(b, m, deterministic) +} +func (m *FileOptions) XXX_Merge(src proto.Message) { + xxx_messageInfo_FileOptions.Merge(m, src) +} +func (m *FileOptions) XXX_Size() int { + return xxx_messageInfo_FileOptions.Size(m) +} +func (m *FileOptions) XXX_DiscardUnknown() { + xxx_messageInfo_FileOptions.DiscardUnknown(m) +} + +var xxx_messageInfo_FileOptions proto.InternalMessageInfo + +const Default_FileOptions_JavaMultipleFiles bool = false +const Default_FileOptions_JavaStringCheckUtf8 bool = false +const Default_FileOptions_OptimizeFor FileOptions_OptimizeMode = FileOptions_SPEED +const Default_FileOptions_CcGenericServices bool = false +const Default_FileOptions_JavaGenericServices bool = false +const Default_FileOptions_PyGenericServices bool = false +const Default_FileOptions_PhpGenericServices bool = false +const Default_FileOptions_Deprecated bool = false +const Default_FileOptions_CcEnableArenas bool = false + +func (m *FileOptions) GetJavaPackage() string { + if m != nil && m.JavaPackage != nil { + return *m.JavaPackage + } + return "" +} + +func (m *FileOptions) GetJavaOuterClassname() string { + if m != nil && m.JavaOuterClassname != nil { + return *m.JavaOuterClassname + } + return "" +} + +func (m *FileOptions) GetJavaMultipleFiles() bool { + if m != nil && m.JavaMultipleFiles != nil { + return *m.JavaMultipleFiles + } + return Default_FileOptions_JavaMultipleFiles +} + +// Deprecated: Do not use. +func (m *FileOptions) GetJavaGenerateEqualsAndHash() bool { + if m != nil && m.JavaGenerateEqualsAndHash != nil { + return *m.JavaGenerateEqualsAndHash + } + return false +} + +func (m *FileOptions) GetJavaStringCheckUtf8() bool { + if m != nil && m.JavaStringCheckUtf8 != nil { + return *m.JavaStringCheckUtf8 + } + return Default_FileOptions_JavaStringCheckUtf8 +} + +func (m *FileOptions) GetOptimizeFor() FileOptions_OptimizeMode { + if m != nil && m.OptimizeFor != nil { + return *m.OptimizeFor + } + return Default_FileOptions_OptimizeFor +} + +func (m *FileOptions) GetGoPackage() string { + if m != nil && m.GoPackage != nil { + return *m.GoPackage + } + return "" +} + +func (m *FileOptions) GetCcGenericServices() bool { + if m != nil && m.CcGenericServices != nil { + return *m.CcGenericServices + } + return Default_FileOptions_CcGenericServices +} + +func (m *FileOptions) GetJavaGenericServices() bool { + if m != nil && m.JavaGenericServices != nil { + return *m.JavaGenericServices + } + return Default_FileOptions_JavaGenericServices +} + +func (m *FileOptions) GetPyGenericServices() bool { + if m != nil && m.PyGenericServices != nil { + return *m.PyGenericServices + } + return Default_FileOptions_PyGenericServices +} + +func (m *FileOptions) GetPhpGenericServices() bool { + if m != nil && m.PhpGenericServices != nil { + return *m.PhpGenericServices + } + return Default_FileOptions_PhpGenericServices +} + +func (m *FileOptions) GetDeprecated() bool { + if m != nil && m.Deprecated != nil { + return *m.Deprecated + } + return Default_FileOptions_Deprecated +} + +func (m *FileOptions) GetCcEnableArenas() bool { + if m != nil && m.CcEnableArenas != nil { + return *m.CcEnableArenas + } + return Default_FileOptions_CcEnableArenas +} + +func (m *FileOptions) GetObjcClassPrefix() string { + if m != nil && m.ObjcClassPrefix != nil { + return *m.ObjcClassPrefix + } + return "" +} + +func (m *FileOptions) GetCsharpNamespace() string { + if m != nil && m.CsharpNamespace != nil { + return *m.CsharpNamespace + } + return "" +} + +func (m *FileOptions) GetSwiftPrefix() string { + if m != nil && m.SwiftPrefix != nil { + return *m.SwiftPrefix + } + return "" +} + +func (m *FileOptions) GetPhpClassPrefix() string { + if m != nil && m.PhpClassPrefix != nil { + return *m.PhpClassPrefix + } + return "" +} + +func (m *FileOptions) GetPhpNamespace() string { + if m != nil && m.PhpNamespace != nil { + return *m.PhpNamespace + } + return "" +} + +func (m *FileOptions) GetPhpMetadataNamespace() string { + if m != nil && m.PhpMetadataNamespace != nil { + return *m.PhpMetadataNamespace + } + return "" +} + +func (m *FileOptions) GetRubyPackage() string { + if m != nil && m.RubyPackage != nil { + return *m.RubyPackage + } + return "" +} + +func (m *FileOptions) GetUninterpretedOption() []*UninterpretedOption { + if m != nil { + return m.UninterpretedOption + } + return nil +} + +type MessageOptions struct { + // Set true to use the old proto1 MessageSet wire format for extensions. + // This is provided for backwards-compatibility with the MessageSet wire + // format. You should not use this for any other reason: It's less + // efficient, has fewer features, and is more complicated. + // + // The message must be defined exactly as follows: + // message Foo { + // option message_set_wire_format = true; + // extensions 4 to max; + // } + // Note that the message cannot have any defined fields; MessageSets only + // have extensions. + // + // All extensions of your type must be singular messages; e.g. they cannot + // be int32s, enums, or repeated messages. + // + // Because this is an option, the above two restrictions are not enforced by + // the protocol compiler. + MessageSetWireFormat *bool `protobuf:"varint,1,opt,name=message_set_wire_format,json=messageSetWireFormat,def=0" json:"message_set_wire_format,omitempty"` + // Disables the generation of the standard "descriptor()" accessor, which can + // conflict with a field of the same name. This is meant to make migration + // from proto1 easier; new code should avoid fields named "descriptor". + NoStandardDescriptorAccessor *bool `protobuf:"varint,2,opt,name=no_standard_descriptor_accessor,json=noStandardDescriptorAccessor,def=0" json:"no_standard_descriptor_accessor,omitempty"` + // Is this message deprecated? + // Depending on the target platform, this can emit Deprecated annotations + // for the message, or it will be completely ignored; in the very least, + // this is a formalization for deprecating messages. + Deprecated *bool `protobuf:"varint,3,opt,name=deprecated,def=0" json:"deprecated,omitempty"` + // Whether the message is an automatically generated map entry type for the + // maps field. + // + // For maps fields: + // map map_field = 1; + // The parsed descriptor looks like: + // message MapFieldEntry { + // option map_entry = true; + // optional KeyType key = 1; + // optional ValueType value = 2; + // } + // repeated MapFieldEntry map_field = 1; + // + // Implementations may choose not to generate the map_entry=true message, but + // use a native map in the target language to hold the keys and values. + // The reflection APIs in such implementations still need to work as + // if the field is a repeated message field. + // + // NOTE: Do not set the option in .proto files. Always use the maps syntax + // instead. The option should only be implicitly set by the proto compiler + // parser. + MapEntry *bool `protobuf:"varint,7,opt,name=map_entry,json=mapEntry" json:"map_entry,omitempty"` + // The parser stores options it doesn't recognize here. See above. + UninterpretedOption []*UninterpretedOption `protobuf:"bytes,999,rep,name=uninterpreted_option,json=uninterpretedOption" json:"uninterpreted_option,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + proto.XXX_InternalExtensions `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *MessageOptions) Reset() { *m = MessageOptions{} } +func (m *MessageOptions) String() string { return proto.CompactTextString(m) } +func (*MessageOptions) ProtoMessage() {} +func (*MessageOptions) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{11} +} + +var extRange_MessageOptions = []proto.ExtensionRange{ + {Start: 1000, End: 536870911}, +} + +func (*MessageOptions) ExtensionRangeArray() []proto.ExtensionRange { + return extRange_MessageOptions +} + +func (m *MessageOptions) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_MessageOptions.Unmarshal(m, b) +} +func (m *MessageOptions) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_MessageOptions.Marshal(b, m, deterministic) +} +func (m *MessageOptions) XXX_Merge(src proto.Message) { + xxx_messageInfo_MessageOptions.Merge(m, src) +} +func (m *MessageOptions) XXX_Size() int { + return xxx_messageInfo_MessageOptions.Size(m) +} +func (m *MessageOptions) XXX_DiscardUnknown() { + xxx_messageInfo_MessageOptions.DiscardUnknown(m) +} + +var xxx_messageInfo_MessageOptions proto.InternalMessageInfo + +const Default_MessageOptions_MessageSetWireFormat bool = false +const Default_MessageOptions_NoStandardDescriptorAccessor bool = false +const Default_MessageOptions_Deprecated bool = false + +func (m *MessageOptions) GetMessageSetWireFormat() bool { + if m != nil && m.MessageSetWireFormat != nil { + return *m.MessageSetWireFormat + } + return Default_MessageOptions_MessageSetWireFormat +} + +func (m *MessageOptions) GetNoStandardDescriptorAccessor() bool { + if m != nil && m.NoStandardDescriptorAccessor != nil { + return *m.NoStandardDescriptorAccessor + } + return Default_MessageOptions_NoStandardDescriptorAccessor +} + +func (m *MessageOptions) GetDeprecated() bool { + if m != nil && m.Deprecated != nil { + return *m.Deprecated + } + return Default_MessageOptions_Deprecated +} + +func (m *MessageOptions) GetMapEntry() bool { + if m != nil && m.MapEntry != nil { + return *m.MapEntry + } + return false +} + +func (m *MessageOptions) GetUninterpretedOption() []*UninterpretedOption { + if m != nil { + return m.UninterpretedOption + } + return nil +} + +type FieldOptions struct { + // The ctype option instructs the C++ code generator to use a different + // representation of the field than it normally would. See the specific + // options below. This option is not yet implemented in the open source + // release -- sorry, we'll try to include it in a future version! + Ctype *FieldOptions_CType `protobuf:"varint,1,opt,name=ctype,enum=google.protobuf.FieldOptions_CType,def=0" json:"ctype,omitempty"` + // The packed option can be enabled for repeated primitive fields to enable + // a more efficient representation on the wire. Rather than repeatedly + // writing the tag and type for each element, the entire array is encoded as + // a single length-delimited blob. In proto3, only explicit setting it to + // false will avoid using packed encoding. + Packed *bool `protobuf:"varint,2,opt,name=packed" json:"packed,omitempty"` + // The jstype option determines the JavaScript type used for values of the + // field. The option is permitted only for 64 bit integral and fixed types + // (int64, uint64, sint64, fixed64, sfixed64). A field with jstype JS_STRING + // is represented as JavaScript string, which avoids loss of precision that + // can happen when a large value is converted to a floating point JavaScript. + // Specifying JS_NUMBER for the jstype causes the generated JavaScript code to + // use the JavaScript "number" type. The behavior of the default option + // JS_NORMAL is implementation dependent. + // + // This option is an enum to permit additional types to be added, e.g. + // goog.math.Integer. + Jstype *FieldOptions_JSType `protobuf:"varint,6,opt,name=jstype,enum=google.protobuf.FieldOptions_JSType,def=0" json:"jstype,omitempty"` + // Should this field be parsed lazily? Lazy applies only to message-type + // fields. It means that when the outer message is initially parsed, the + // inner message's contents will not be parsed but instead stored in encoded + // form. The inner message will actually be parsed when it is first accessed. + // + // This is only a hint. Implementations are free to choose whether to use + // eager or lazy parsing regardless of the value of this option. However, + // setting this option true suggests that the protocol author believes that + // using lazy parsing on this field is worth the additional bookkeeping + // overhead typically needed to implement it. + // + // This option does not affect the public interface of any generated code; + // all method signatures remain the same. Furthermore, thread-safety of the + // interface is not affected by this option; const methods remain safe to + // call from multiple threads concurrently, while non-const methods continue + // to require exclusive access. + // + // + // Note that implementations may choose not to check required fields within + // a lazy sub-message. That is, calling IsInitialized() on the outer message + // may return true even if the inner message has missing required fields. + // This is necessary because otherwise the inner message would have to be + // parsed in order to perform the check, defeating the purpose of lazy + // parsing. An implementation which chooses not to check required fields + // must be consistent about it. That is, for any particular sub-message, the + // implementation must either *always* check its required fields, or *never* + // check its required fields, regardless of whether or not the message has + // been parsed. + Lazy *bool `protobuf:"varint,5,opt,name=lazy,def=0" json:"lazy,omitempty"` + // Is this field deprecated? + // Depending on the target platform, this can emit Deprecated annotations + // for accessors, or it will be completely ignored; in the very least, this + // is a formalization for deprecating fields. + Deprecated *bool `protobuf:"varint,3,opt,name=deprecated,def=0" json:"deprecated,omitempty"` + // For Google-internal migration only. Do not use. + Weak *bool `protobuf:"varint,10,opt,name=weak,def=0" json:"weak,omitempty"` + // The parser stores options it doesn't recognize here. See above. + UninterpretedOption []*UninterpretedOption `protobuf:"bytes,999,rep,name=uninterpreted_option,json=uninterpretedOption" json:"uninterpreted_option,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + proto.XXX_InternalExtensions `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *FieldOptions) Reset() { *m = FieldOptions{} } +func (m *FieldOptions) String() string { return proto.CompactTextString(m) } +func (*FieldOptions) ProtoMessage() {} +func (*FieldOptions) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{12} +} + +var extRange_FieldOptions = []proto.ExtensionRange{ + {Start: 1000, End: 536870911}, +} + +func (*FieldOptions) ExtensionRangeArray() []proto.ExtensionRange { + return extRange_FieldOptions +} + +func (m *FieldOptions) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_FieldOptions.Unmarshal(m, b) +} +func (m *FieldOptions) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_FieldOptions.Marshal(b, m, deterministic) +} +func (m *FieldOptions) XXX_Merge(src proto.Message) { + xxx_messageInfo_FieldOptions.Merge(m, src) +} +func (m *FieldOptions) XXX_Size() int { + return xxx_messageInfo_FieldOptions.Size(m) +} +func (m *FieldOptions) XXX_DiscardUnknown() { + xxx_messageInfo_FieldOptions.DiscardUnknown(m) +} + +var xxx_messageInfo_FieldOptions proto.InternalMessageInfo + +const Default_FieldOptions_Ctype FieldOptions_CType = FieldOptions_STRING +const Default_FieldOptions_Jstype FieldOptions_JSType = FieldOptions_JS_NORMAL +const Default_FieldOptions_Lazy bool = false +const Default_FieldOptions_Deprecated bool = false +const Default_FieldOptions_Weak bool = false + +func (m *FieldOptions) GetCtype() FieldOptions_CType { + if m != nil && m.Ctype != nil { + return *m.Ctype + } + return Default_FieldOptions_Ctype +} + +func (m *FieldOptions) GetPacked() bool { + if m != nil && m.Packed != nil { + return *m.Packed + } + return false +} + +func (m *FieldOptions) GetJstype() FieldOptions_JSType { + if m != nil && m.Jstype != nil { + return *m.Jstype + } + return Default_FieldOptions_Jstype +} + +func (m *FieldOptions) GetLazy() bool { + if m != nil && m.Lazy != nil { + return *m.Lazy + } + return Default_FieldOptions_Lazy +} + +func (m *FieldOptions) GetDeprecated() bool { + if m != nil && m.Deprecated != nil { + return *m.Deprecated + } + return Default_FieldOptions_Deprecated +} + +func (m *FieldOptions) GetWeak() bool { + if m != nil && m.Weak != nil { + return *m.Weak + } + return Default_FieldOptions_Weak +} + +func (m *FieldOptions) GetUninterpretedOption() []*UninterpretedOption { + if m != nil { + return m.UninterpretedOption + } + return nil +} + +type OneofOptions struct { + // The parser stores options it doesn't recognize here. See above. + UninterpretedOption []*UninterpretedOption `protobuf:"bytes,999,rep,name=uninterpreted_option,json=uninterpretedOption" json:"uninterpreted_option,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + proto.XXX_InternalExtensions `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *OneofOptions) Reset() { *m = OneofOptions{} } +func (m *OneofOptions) String() string { return proto.CompactTextString(m) } +func (*OneofOptions) ProtoMessage() {} +func (*OneofOptions) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{13} +} + +var extRange_OneofOptions = []proto.ExtensionRange{ + {Start: 1000, End: 536870911}, +} + +func (*OneofOptions) ExtensionRangeArray() []proto.ExtensionRange { + return extRange_OneofOptions +} + +func (m *OneofOptions) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_OneofOptions.Unmarshal(m, b) +} +func (m *OneofOptions) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_OneofOptions.Marshal(b, m, deterministic) +} +func (m *OneofOptions) XXX_Merge(src proto.Message) { + xxx_messageInfo_OneofOptions.Merge(m, src) +} +func (m *OneofOptions) XXX_Size() int { + return xxx_messageInfo_OneofOptions.Size(m) +} +func (m *OneofOptions) XXX_DiscardUnknown() { + xxx_messageInfo_OneofOptions.DiscardUnknown(m) +} + +var xxx_messageInfo_OneofOptions proto.InternalMessageInfo + +func (m *OneofOptions) GetUninterpretedOption() []*UninterpretedOption { + if m != nil { + return m.UninterpretedOption + } + return nil +} + +type EnumOptions struct { + // Set this option to true to allow mapping different tag names to the same + // value. + AllowAlias *bool `protobuf:"varint,2,opt,name=allow_alias,json=allowAlias" json:"allow_alias,omitempty"` + // Is this enum deprecated? + // Depending on the target platform, this can emit Deprecated annotations + // for the enum, or it will be completely ignored; in the very least, this + // is a formalization for deprecating enums. + Deprecated *bool `protobuf:"varint,3,opt,name=deprecated,def=0" json:"deprecated,omitempty"` + // The parser stores options it doesn't recognize here. See above. + UninterpretedOption []*UninterpretedOption `protobuf:"bytes,999,rep,name=uninterpreted_option,json=uninterpretedOption" json:"uninterpreted_option,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + proto.XXX_InternalExtensions `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *EnumOptions) Reset() { *m = EnumOptions{} } +func (m *EnumOptions) String() string { return proto.CompactTextString(m) } +func (*EnumOptions) ProtoMessage() {} +func (*EnumOptions) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{14} +} + +var extRange_EnumOptions = []proto.ExtensionRange{ + {Start: 1000, End: 536870911}, +} + +func (*EnumOptions) ExtensionRangeArray() []proto.ExtensionRange { + return extRange_EnumOptions +} + +func (m *EnumOptions) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_EnumOptions.Unmarshal(m, b) +} +func (m *EnumOptions) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_EnumOptions.Marshal(b, m, deterministic) +} +func (m *EnumOptions) XXX_Merge(src proto.Message) { + xxx_messageInfo_EnumOptions.Merge(m, src) +} +func (m *EnumOptions) XXX_Size() int { + return xxx_messageInfo_EnumOptions.Size(m) +} +func (m *EnumOptions) XXX_DiscardUnknown() { + xxx_messageInfo_EnumOptions.DiscardUnknown(m) +} + +var xxx_messageInfo_EnumOptions proto.InternalMessageInfo + +const Default_EnumOptions_Deprecated bool = false + +func (m *EnumOptions) GetAllowAlias() bool { + if m != nil && m.AllowAlias != nil { + return *m.AllowAlias + } + return false +} + +func (m *EnumOptions) GetDeprecated() bool { + if m != nil && m.Deprecated != nil { + return *m.Deprecated + } + return Default_EnumOptions_Deprecated +} + +func (m *EnumOptions) GetUninterpretedOption() []*UninterpretedOption { + if m != nil { + return m.UninterpretedOption + } + return nil +} + +type EnumValueOptions struct { + // Is this enum value deprecated? + // Depending on the target platform, this can emit Deprecated annotations + // for the enum value, or it will be completely ignored; in the very least, + // this is a formalization for deprecating enum values. + Deprecated *bool `protobuf:"varint,1,opt,name=deprecated,def=0" json:"deprecated,omitempty"` + // The parser stores options it doesn't recognize here. See above. + UninterpretedOption []*UninterpretedOption `protobuf:"bytes,999,rep,name=uninterpreted_option,json=uninterpretedOption" json:"uninterpreted_option,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + proto.XXX_InternalExtensions `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *EnumValueOptions) Reset() { *m = EnumValueOptions{} } +func (m *EnumValueOptions) String() string { return proto.CompactTextString(m) } +func (*EnumValueOptions) ProtoMessage() {} +func (*EnumValueOptions) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{15} +} + +var extRange_EnumValueOptions = []proto.ExtensionRange{ + {Start: 1000, End: 536870911}, +} + +func (*EnumValueOptions) ExtensionRangeArray() []proto.ExtensionRange { + return extRange_EnumValueOptions +} + +func (m *EnumValueOptions) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_EnumValueOptions.Unmarshal(m, b) +} +func (m *EnumValueOptions) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_EnumValueOptions.Marshal(b, m, deterministic) +} +func (m *EnumValueOptions) XXX_Merge(src proto.Message) { + xxx_messageInfo_EnumValueOptions.Merge(m, src) +} +func (m *EnumValueOptions) XXX_Size() int { + return xxx_messageInfo_EnumValueOptions.Size(m) +} +func (m *EnumValueOptions) XXX_DiscardUnknown() { + xxx_messageInfo_EnumValueOptions.DiscardUnknown(m) +} + +var xxx_messageInfo_EnumValueOptions proto.InternalMessageInfo + +const Default_EnumValueOptions_Deprecated bool = false + +func (m *EnumValueOptions) GetDeprecated() bool { + if m != nil && m.Deprecated != nil { + return *m.Deprecated + } + return Default_EnumValueOptions_Deprecated +} + +func (m *EnumValueOptions) GetUninterpretedOption() []*UninterpretedOption { + if m != nil { + return m.UninterpretedOption + } + return nil +} + +type ServiceOptions struct { + // Is this service deprecated? + // Depending on the target platform, this can emit Deprecated annotations + // for the service, or it will be completely ignored; in the very least, + // this is a formalization for deprecating services. + Deprecated *bool `protobuf:"varint,33,opt,name=deprecated,def=0" json:"deprecated,omitempty"` + // The parser stores options it doesn't recognize here. See above. + UninterpretedOption []*UninterpretedOption `protobuf:"bytes,999,rep,name=uninterpreted_option,json=uninterpretedOption" json:"uninterpreted_option,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + proto.XXX_InternalExtensions `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *ServiceOptions) Reset() { *m = ServiceOptions{} } +func (m *ServiceOptions) String() string { return proto.CompactTextString(m) } +func (*ServiceOptions) ProtoMessage() {} +func (*ServiceOptions) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{16} +} + +var extRange_ServiceOptions = []proto.ExtensionRange{ + {Start: 1000, End: 536870911}, +} + +func (*ServiceOptions) ExtensionRangeArray() []proto.ExtensionRange { + return extRange_ServiceOptions +} + +func (m *ServiceOptions) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_ServiceOptions.Unmarshal(m, b) +} +func (m *ServiceOptions) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_ServiceOptions.Marshal(b, m, deterministic) +} +func (m *ServiceOptions) XXX_Merge(src proto.Message) { + xxx_messageInfo_ServiceOptions.Merge(m, src) +} +func (m *ServiceOptions) XXX_Size() int { + return xxx_messageInfo_ServiceOptions.Size(m) +} +func (m *ServiceOptions) XXX_DiscardUnknown() { + xxx_messageInfo_ServiceOptions.DiscardUnknown(m) +} + +var xxx_messageInfo_ServiceOptions proto.InternalMessageInfo + +const Default_ServiceOptions_Deprecated bool = false + +func (m *ServiceOptions) GetDeprecated() bool { + if m != nil && m.Deprecated != nil { + return *m.Deprecated + } + return Default_ServiceOptions_Deprecated +} + +func (m *ServiceOptions) GetUninterpretedOption() []*UninterpretedOption { + if m != nil { + return m.UninterpretedOption + } + return nil +} + +type MethodOptions struct { + // Is this method deprecated? + // Depending on the target platform, this can emit Deprecated annotations + // for the method, or it will be completely ignored; in the very least, + // this is a formalization for deprecating methods. + Deprecated *bool `protobuf:"varint,33,opt,name=deprecated,def=0" json:"deprecated,omitempty"` + IdempotencyLevel *MethodOptions_IdempotencyLevel `protobuf:"varint,34,opt,name=idempotency_level,json=idempotencyLevel,enum=google.protobuf.MethodOptions_IdempotencyLevel,def=0" json:"idempotency_level,omitempty"` + // The parser stores options it doesn't recognize here. See above. + UninterpretedOption []*UninterpretedOption `protobuf:"bytes,999,rep,name=uninterpreted_option,json=uninterpretedOption" json:"uninterpreted_option,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + proto.XXX_InternalExtensions `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *MethodOptions) Reset() { *m = MethodOptions{} } +func (m *MethodOptions) String() string { return proto.CompactTextString(m) } +func (*MethodOptions) ProtoMessage() {} +func (*MethodOptions) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{17} +} + +var extRange_MethodOptions = []proto.ExtensionRange{ + {Start: 1000, End: 536870911}, +} + +func (*MethodOptions) ExtensionRangeArray() []proto.ExtensionRange { + return extRange_MethodOptions +} + +func (m *MethodOptions) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_MethodOptions.Unmarshal(m, b) +} +func (m *MethodOptions) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_MethodOptions.Marshal(b, m, deterministic) +} +func (m *MethodOptions) XXX_Merge(src proto.Message) { + xxx_messageInfo_MethodOptions.Merge(m, src) +} +func (m *MethodOptions) XXX_Size() int { + return xxx_messageInfo_MethodOptions.Size(m) +} +func (m *MethodOptions) XXX_DiscardUnknown() { + xxx_messageInfo_MethodOptions.DiscardUnknown(m) +} + +var xxx_messageInfo_MethodOptions proto.InternalMessageInfo + +const Default_MethodOptions_Deprecated bool = false +const Default_MethodOptions_IdempotencyLevel MethodOptions_IdempotencyLevel = MethodOptions_IDEMPOTENCY_UNKNOWN + +func (m *MethodOptions) GetDeprecated() bool { + if m != nil && m.Deprecated != nil { + return *m.Deprecated + } + return Default_MethodOptions_Deprecated +} + +func (m *MethodOptions) GetIdempotencyLevel() MethodOptions_IdempotencyLevel { + if m != nil && m.IdempotencyLevel != nil { + return *m.IdempotencyLevel + } + return Default_MethodOptions_IdempotencyLevel +} + +func (m *MethodOptions) GetUninterpretedOption() []*UninterpretedOption { + if m != nil { + return m.UninterpretedOption + } + return nil +} + +// A message representing a option the parser does not recognize. This only +// appears in options protos created by the compiler::Parser class. +// DescriptorPool resolves these when building Descriptor objects. Therefore, +// options protos in descriptor objects (e.g. returned by Descriptor::options(), +// or produced by Descriptor::CopyTo()) will never have UninterpretedOptions +// in them. +type UninterpretedOption struct { + Name []*UninterpretedOption_NamePart `protobuf:"bytes,2,rep,name=name" json:"name,omitempty"` + // The value of the uninterpreted option, in whatever type the tokenizer + // identified it as during parsing. Exactly one of these should be set. + IdentifierValue *string `protobuf:"bytes,3,opt,name=identifier_value,json=identifierValue" json:"identifier_value,omitempty"` + PositiveIntValue *uint64 `protobuf:"varint,4,opt,name=positive_int_value,json=positiveIntValue" json:"positive_int_value,omitempty"` + NegativeIntValue *int64 `protobuf:"varint,5,opt,name=negative_int_value,json=negativeIntValue" json:"negative_int_value,omitempty"` + DoubleValue *float64 `protobuf:"fixed64,6,opt,name=double_value,json=doubleValue" json:"double_value,omitempty"` + StringValue []byte `protobuf:"bytes,7,opt,name=string_value,json=stringValue" json:"string_value,omitempty"` + AggregateValue *string `protobuf:"bytes,8,opt,name=aggregate_value,json=aggregateValue" json:"aggregate_value,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *UninterpretedOption) Reset() { *m = UninterpretedOption{} } +func (m *UninterpretedOption) String() string { return proto.CompactTextString(m) } +func (*UninterpretedOption) ProtoMessage() {} +func (*UninterpretedOption) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{18} +} +func (m *UninterpretedOption) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_UninterpretedOption.Unmarshal(m, b) +} +func (m *UninterpretedOption) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_UninterpretedOption.Marshal(b, m, deterministic) +} +func (m *UninterpretedOption) XXX_Merge(src proto.Message) { + xxx_messageInfo_UninterpretedOption.Merge(m, src) +} +func (m *UninterpretedOption) XXX_Size() int { + return xxx_messageInfo_UninterpretedOption.Size(m) +} +func (m *UninterpretedOption) XXX_DiscardUnknown() { + xxx_messageInfo_UninterpretedOption.DiscardUnknown(m) +} + +var xxx_messageInfo_UninterpretedOption proto.InternalMessageInfo + +func (m *UninterpretedOption) GetName() []*UninterpretedOption_NamePart { + if m != nil { + return m.Name + } + return nil +} + +func (m *UninterpretedOption) GetIdentifierValue() string { + if m != nil && m.IdentifierValue != nil { + return *m.IdentifierValue + } + return "" +} + +func (m *UninterpretedOption) GetPositiveIntValue() uint64 { + if m != nil && m.PositiveIntValue != nil { + return *m.PositiveIntValue + } + return 0 +} + +func (m *UninterpretedOption) GetNegativeIntValue() int64 { + if m != nil && m.NegativeIntValue != nil { + return *m.NegativeIntValue + } + return 0 +} + +func (m *UninterpretedOption) GetDoubleValue() float64 { + if m != nil && m.DoubleValue != nil { + return *m.DoubleValue + } + return 0 +} + +func (m *UninterpretedOption) GetStringValue() []byte { + if m != nil { + return m.StringValue + } + return nil +} + +func (m *UninterpretedOption) GetAggregateValue() string { + if m != nil && m.AggregateValue != nil { + return *m.AggregateValue + } + return "" +} + +// The name of the uninterpreted option. Each string represents a segment in +// a dot-separated name. is_extension is true iff a segment represents an +// extension (denoted with parentheses in options specs in .proto files). +// E.g.,{ ["foo", false], ["bar.baz", true], ["qux", false] } represents +// "foo.(bar.baz).qux". +type UninterpretedOption_NamePart struct { + NamePart *string `protobuf:"bytes,1,req,name=name_part,json=namePart" json:"name_part,omitempty"` + IsExtension *bool `protobuf:"varint,2,req,name=is_extension,json=isExtension" json:"is_extension,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *UninterpretedOption_NamePart) Reset() { *m = UninterpretedOption_NamePart{} } +func (m *UninterpretedOption_NamePart) String() string { return proto.CompactTextString(m) } +func (*UninterpretedOption_NamePart) ProtoMessage() {} +func (*UninterpretedOption_NamePart) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{18, 0} +} +func (m *UninterpretedOption_NamePart) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_UninterpretedOption_NamePart.Unmarshal(m, b) +} +func (m *UninterpretedOption_NamePart) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_UninterpretedOption_NamePart.Marshal(b, m, deterministic) +} +func (m *UninterpretedOption_NamePart) XXX_Merge(src proto.Message) { + xxx_messageInfo_UninterpretedOption_NamePart.Merge(m, src) +} +func (m *UninterpretedOption_NamePart) XXX_Size() int { + return xxx_messageInfo_UninterpretedOption_NamePart.Size(m) +} +func (m *UninterpretedOption_NamePart) XXX_DiscardUnknown() { + xxx_messageInfo_UninterpretedOption_NamePart.DiscardUnknown(m) +} + +var xxx_messageInfo_UninterpretedOption_NamePart proto.InternalMessageInfo + +func (m *UninterpretedOption_NamePart) GetNamePart() string { + if m != nil && m.NamePart != nil { + return *m.NamePart + } + return "" +} + +func (m *UninterpretedOption_NamePart) GetIsExtension() bool { + if m != nil && m.IsExtension != nil { + return *m.IsExtension + } + return false +} + +// Encapsulates information about the original source file from which a +// FileDescriptorProto was generated. +type SourceCodeInfo struct { + // A Location identifies a piece of source code in a .proto file which + // corresponds to a particular definition. This information is intended + // to be useful to IDEs, code indexers, documentation generators, and similar + // tools. + // + // For example, say we have a file like: + // message Foo { + // optional string foo = 1; + // } + // Let's look at just the field definition: + // optional string foo = 1; + // ^ ^^ ^^ ^ ^^^ + // a bc de f ghi + // We have the following locations: + // span path represents + // [a,i) [ 4, 0, 2, 0 ] The whole field definition. + // [a,b) [ 4, 0, 2, 0, 4 ] The label (optional). + // [c,d) [ 4, 0, 2, 0, 5 ] The type (string). + // [e,f) [ 4, 0, 2, 0, 1 ] The name (foo). + // [g,h) [ 4, 0, 2, 0, 3 ] The number (1). + // + // Notes: + // - A location may refer to a repeated field itself (i.e. not to any + // particular index within it). This is used whenever a set of elements are + // logically enclosed in a single code segment. For example, an entire + // extend block (possibly containing multiple extension definitions) will + // have an outer location whose path refers to the "extensions" repeated + // field without an index. + // - Multiple locations may have the same path. This happens when a single + // logical declaration is spread out across multiple places. The most + // obvious example is the "extend" block again -- there may be multiple + // extend blocks in the same scope, each of which will have the same path. + // - A location's span is not always a subset of its parent's span. For + // example, the "extendee" of an extension declaration appears at the + // beginning of the "extend" block and is shared by all extensions within + // the block. + // - Just because a location's span is a subset of some other location's span + // does not mean that it is a descendant. For example, a "group" defines + // both a type and a field in a single declaration. Thus, the locations + // corresponding to the type and field and their components will overlap. + // - Code which tries to interpret locations should probably be designed to + // ignore those that it doesn't understand, as more types of locations could + // be recorded in the future. + Location []*SourceCodeInfo_Location `protobuf:"bytes,1,rep,name=location" json:"location,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *SourceCodeInfo) Reset() { *m = SourceCodeInfo{} } +func (m *SourceCodeInfo) String() string { return proto.CompactTextString(m) } +func (*SourceCodeInfo) ProtoMessage() {} +func (*SourceCodeInfo) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{19} +} +func (m *SourceCodeInfo) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_SourceCodeInfo.Unmarshal(m, b) +} +func (m *SourceCodeInfo) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_SourceCodeInfo.Marshal(b, m, deterministic) +} +func (m *SourceCodeInfo) XXX_Merge(src proto.Message) { + xxx_messageInfo_SourceCodeInfo.Merge(m, src) +} +func (m *SourceCodeInfo) XXX_Size() int { + return xxx_messageInfo_SourceCodeInfo.Size(m) +} +func (m *SourceCodeInfo) XXX_DiscardUnknown() { + xxx_messageInfo_SourceCodeInfo.DiscardUnknown(m) +} + +var xxx_messageInfo_SourceCodeInfo proto.InternalMessageInfo + +func (m *SourceCodeInfo) GetLocation() []*SourceCodeInfo_Location { + if m != nil { + return m.Location + } + return nil +} + +type SourceCodeInfo_Location struct { + // Identifies which part of the FileDescriptorProto was defined at this + // location. + // + // Each element is a field number or an index. They form a path from + // the root FileDescriptorProto to the place where the definition. For + // example, this path: + // [ 4, 3, 2, 7, 1 ] + // refers to: + // file.message_type(3) // 4, 3 + // .field(7) // 2, 7 + // .name() // 1 + // This is because FileDescriptorProto.message_type has field number 4: + // repeated DescriptorProto message_type = 4; + // and DescriptorProto.field has field number 2: + // repeated FieldDescriptorProto field = 2; + // and FieldDescriptorProto.name has field number 1: + // optional string name = 1; + // + // Thus, the above path gives the location of a field name. If we removed + // the last element: + // [ 4, 3, 2, 7 ] + // this path refers to the whole field declaration (from the beginning + // of the label to the terminating semicolon). + Path []int32 `protobuf:"varint,1,rep,packed,name=path" json:"path,omitempty"` + // Always has exactly three or four elements: start line, start column, + // end line (optional, otherwise assumed same as start line), end column. + // These are packed into a single field for efficiency. Note that line + // and column numbers are zero-based -- typically you will want to add + // 1 to each before displaying to a user. + Span []int32 `protobuf:"varint,2,rep,packed,name=span" json:"span,omitempty"` + // If this SourceCodeInfo represents a complete declaration, these are any + // comments appearing before and after the declaration which appear to be + // attached to the declaration. + // + // A series of line comments appearing on consecutive lines, with no other + // tokens appearing on those lines, will be treated as a single comment. + // + // leading_detached_comments will keep paragraphs of comments that appear + // before (but not connected to) the current element. Each paragraph, + // separated by empty lines, will be one comment element in the repeated + // field. + // + // Only the comment content is provided; comment markers (e.g. //) are + // stripped out. For block comments, leading whitespace and an asterisk + // will be stripped from the beginning of each line other than the first. + // Newlines are included in the output. + // + // Examples: + // + // optional int32 foo = 1; // Comment attached to foo. + // // Comment attached to bar. + // optional int32 bar = 2; + // + // optional string baz = 3; + // // Comment attached to baz. + // // Another line attached to baz. + // + // // Comment attached to qux. + // // + // // Another line attached to qux. + // optional double qux = 4; + // + // // Detached comment for corge. This is not leading or trailing comments + // // to qux or corge because there are blank lines separating it from + // // both. + // + // // Detached comment for corge paragraph 2. + // + // optional string corge = 5; + // /* Block comment attached + // * to corge. Leading asterisks + // * will be removed. */ + // /* Block comment attached to + // * grault. */ + // optional int32 grault = 6; + // + // // ignored detached comments. + LeadingComments *string `protobuf:"bytes,3,opt,name=leading_comments,json=leadingComments" json:"leading_comments,omitempty"` + TrailingComments *string `protobuf:"bytes,4,opt,name=trailing_comments,json=trailingComments" json:"trailing_comments,omitempty"` + LeadingDetachedComments []string `protobuf:"bytes,6,rep,name=leading_detached_comments,json=leadingDetachedComments" json:"leading_detached_comments,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *SourceCodeInfo_Location) Reset() { *m = SourceCodeInfo_Location{} } +func (m *SourceCodeInfo_Location) String() string { return proto.CompactTextString(m) } +func (*SourceCodeInfo_Location) ProtoMessage() {} +func (*SourceCodeInfo_Location) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{19, 0} +} +func (m *SourceCodeInfo_Location) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_SourceCodeInfo_Location.Unmarshal(m, b) +} +func (m *SourceCodeInfo_Location) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_SourceCodeInfo_Location.Marshal(b, m, deterministic) +} +func (m *SourceCodeInfo_Location) XXX_Merge(src proto.Message) { + xxx_messageInfo_SourceCodeInfo_Location.Merge(m, src) +} +func (m *SourceCodeInfo_Location) XXX_Size() int { + return xxx_messageInfo_SourceCodeInfo_Location.Size(m) +} +func (m *SourceCodeInfo_Location) XXX_DiscardUnknown() { + xxx_messageInfo_SourceCodeInfo_Location.DiscardUnknown(m) +} + +var xxx_messageInfo_SourceCodeInfo_Location proto.InternalMessageInfo + +func (m *SourceCodeInfo_Location) GetPath() []int32 { + if m != nil { + return m.Path + } + return nil +} + +func (m *SourceCodeInfo_Location) GetSpan() []int32 { + if m != nil { + return m.Span + } + return nil +} + +func (m *SourceCodeInfo_Location) GetLeadingComments() string { + if m != nil && m.LeadingComments != nil { + return *m.LeadingComments + } + return "" +} + +func (m *SourceCodeInfo_Location) GetTrailingComments() string { + if m != nil && m.TrailingComments != nil { + return *m.TrailingComments + } + return "" +} + +func (m *SourceCodeInfo_Location) GetLeadingDetachedComments() []string { + if m != nil { + return m.LeadingDetachedComments + } + return nil +} + +// Describes the relationship between generated code and its original source +// file. A GeneratedCodeInfo message is associated with only one generated +// source file, but may contain references to different source .proto files. +type GeneratedCodeInfo struct { + // An Annotation connects some span of text in generated code to an element + // of its generating .proto file. + Annotation []*GeneratedCodeInfo_Annotation `protobuf:"bytes,1,rep,name=annotation" json:"annotation,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *GeneratedCodeInfo) Reset() { *m = GeneratedCodeInfo{} } +func (m *GeneratedCodeInfo) String() string { return proto.CompactTextString(m) } +func (*GeneratedCodeInfo) ProtoMessage() {} +func (*GeneratedCodeInfo) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{20} +} +func (m *GeneratedCodeInfo) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_GeneratedCodeInfo.Unmarshal(m, b) +} +func (m *GeneratedCodeInfo) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_GeneratedCodeInfo.Marshal(b, m, deterministic) +} +func (m *GeneratedCodeInfo) XXX_Merge(src proto.Message) { + xxx_messageInfo_GeneratedCodeInfo.Merge(m, src) +} +func (m *GeneratedCodeInfo) XXX_Size() int { + return xxx_messageInfo_GeneratedCodeInfo.Size(m) +} +func (m *GeneratedCodeInfo) XXX_DiscardUnknown() { + xxx_messageInfo_GeneratedCodeInfo.DiscardUnknown(m) +} + +var xxx_messageInfo_GeneratedCodeInfo proto.InternalMessageInfo + +func (m *GeneratedCodeInfo) GetAnnotation() []*GeneratedCodeInfo_Annotation { + if m != nil { + return m.Annotation + } + return nil +} + +type GeneratedCodeInfo_Annotation struct { + // Identifies the element in the original source .proto file. This field + // is formatted the same as SourceCodeInfo.Location.path. + Path []int32 `protobuf:"varint,1,rep,packed,name=path" json:"path,omitempty"` + // Identifies the filesystem path to the original source .proto. + SourceFile *string `protobuf:"bytes,2,opt,name=source_file,json=sourceFile" json:"source_file,omitempty"` + // Identifies the starting offset in bytes in the generated code + // that relates to the identified object. + Begin *int32 `protobuf:"varint,3,opt,name=begin" json:"begin,omitempty"` + // Identifies the ending offset in bytes in the generated code that + // relates to the identified offset. The end offset should be one past + // the last relevant byte (so the length of the text = end - begin). + End *int32 `protobuf:"varint,4,opt,name=end" json:"end,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *GeneratedCodeInfo_Annotation) Reset() { *m = GeneratedCodeInfo_Annotation{} } +func (m *GeneratedCodeInfo_Annotation) String() string { return proto.CompactTextString(m) } +func (*GeneratedCodeInfo_Annotation) ProtoMessage() {} +func (*GeneratedCodeInfo_Annotation) Descriptor() ([]byte, []int) { + return fileDescriptor_308767df5ffe18af, []int{20, 0} +} +func (m *GeneratedCodeInfo_Annotation) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_GeneratedCodeInfo_Annotation.Unmarshal(m, b) +} +func (m *GeneratedCodeInfo_Annotation) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_GeneratedCodeInfo_Annotation.Marshal(b, m, deterministic) +} +func (m *GeneratedCodeInfo_Annotation) XXX_Merge(src proto.Message) { + xxx_messageInfo_GeneratedCodeInfo_Annotation.Merge(m, src) +} +func (m *GeneratedCodeInfo_Annotation) XXX_Size() int { + return xxx_messageInfo_GeneratedCodeInfo_Annotation.Size(m) +} +func (m *GeneratedCodeInfo_Annotation) XXX_DiscardUnknown() { + xxx_messageInfo_GeneratedCodeInfo_Annotation.DiscardUnknown(m) +} + +var xxx_messageInfo_GeneratedCodeInfo_Annotation proto.InternalMessageInfo + +func (m *GeneratedCodeInfo_Annotation) GetPath() []int32 { + if m != nil { + return m.Path + } + return nil +} + +func (m *GeneratedCodeInfo_Annotation) GetSourceFile() string { + if m != nil && m.SourceFile != nil { + return *m.SourceFile + } + return "" +} + +func (m *GeneratedCodeInfo_Annotation) GetBegin() int32 { + if m != nil && m.Begin != nil { + return *m.Begin + } + return 0 +} + +func (m *GeneratedCodeInfo_Annotation) GetEnd() int32 { + if m != nil && m.End != nil { + return *m.End + } + return 0 +} + +func init() { + proto.RegisterEnum("google.protobuf.FieldDescriptorProto_Type", FieldDescriptorProto_Type_name, FieldDescriptorProto_Type_value) + proto.RegisterEnum("google.protobuf.FieldDescriptorProto_Label", FieldDescriptorProto_Label_name, FieldDescriptorProto_Label_value) + proto.RegisterEnum("google.protobuf.FileOptions_OptimizeMode", FileOptions_OptimizeMode_name, FileOptions_OptimizeMode_value) + proto.RegisterEnum("google.protobuf.FieldOptions_CType", FieldOptions_CType_name, FieldOptions_CType_value) + proto.RegisterEnum("google.protobuf.FieldOptions_JSType", FieldOptions_JSType_name, FieldOptions_JSType_value) + proto.RegisterEnum("google.protobuf.MethodOptions_IdempotencyLevel", MethodOptions_IdempotencyLevel_name, MethodOptions_IdempotencyLevel_value) + proto.RegisterType((*FileDescriptorSet)(nil), "google.protobuf.FileDescriptorSet") + proto.RegisterType((*FileDescriptorProto)(nil), "google.protobuf.FileDescriptorProto") + proto.RegisterType((*DescriptorProto)(nil), "google.protobuf.DescriptorProto") + proto.RegisterType((*DescriptorProto_ExtensionRange)(nil), "google.protobuf.DescriptorProto.ExtensionRange") + proto.RegisterType((*DescriptorProto_ReservedRange)(nil), "google.protobuf.DescriptorProto.ReservedRange") + proto.RegisterType((*ExtensionRangeOptions)(nil), "google.protobuf.ExtensionRangeOptions") + proto.RegisterType((*FieldDescriptorProto)(nil), "google.protobuf.FieldDescriptorProto") + proto.RegisterType((*OneofDescriptorProto)(nil), "google.protobuf.OneofDescriptorProto") + proto.RegisterType((*EnumDescriptorProto)(nil), "google.protobuf.EnumDescriptorProto") + proto.RegisterType((*EnumDescriptorProto_EnumReservedRange)(nil), "google.protobuf.EnumDescriptorProto.EnumReservedRange") + proto.RegisterType((*EnumValueDescriptorProto)(nil), "google.protobuf.EnumValueDescriptorProto") + proto.RegisterType((*ServiceDescriptorProto)(nil), "google.protobuf.ServiceDescriptorProto") + proto.RegisterType((*MethodDescriptorProto)(nil), "google.protobuf.MethodDescriptorProto") + proto.RegisterType((*FileOptions)(nil), "google.protobuf.FileOptions") + proto.RegisterType((*MessageOptions)(nil), "google.protobuf.MessageOptions") + proto.RegisterType((*FieldOptions)(nil), "google.protobuf.FieldOptions") + proto.RegisterType((*OneofOptions)(nil), "google.protobuf.OneofOptions") + proto.RegisterType((*EnumOptions)(nil), "google.protobuf.EnumOptions") + proto.RegisterType((*EnumValueOptions)(nil), "google.protobuf.EnumValueOptions") + proto.RegisterType((*ServiceOptions)(nil), "google.protobuf.ServiceOptions") + proto.RegisterType((*MethodOptions)(nil), "google.protobuf.MethodOptions") + proto.RegisterType((*UninterpretedOption)(nil), "google.protobuf.UninterpretedOption") + proto.RegisterType((*UninterpretedOption_NamePart)(nil), "google.protobuf.UninterpretedOption.NamePart") + proto.RegisterType((*SourceCodeInfo)(nil), "google.protobuf.SourceCodeInfo") + proto.RegisterType((*SourceCodeInfo_Location)(nil), "google.protobuf.SourceCodeInfo.Location") + proto.RegisterType((*GeneratedCodeInfo)(nil), "google.protobuf.GeneratedCodeInfo") + proto.RegisterType((*GeneratedCodeInfo_Annotation)(nil), "google.protobuf.GeneratedCodeInfo.Annotation") +} + +func init() { proto.RegisterFile("descriptor.proto", fileDescriptor_308767df5ffe18af) } + +var fileDescriptor_308767df5ffe18af = []byte{ + // 2522 bytes of a gzipped FileDescriptorProto + 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0xc4, 0x59, 0xcd, 0x6f, 0xdb, 0xc8, + 0x15, 0x5f, 0x7d, 0x5a, 0x7a, 0x92, 0x65, 0x7a, 0xec, 0x75, 0x18, 0xef, 0x47, 0x1c, 0xed, 0x66, + 0xe3, 0x24, 0xbb, 0xca, 0xc2, 0x49, 0x9c, 0xac, 0x53, 0x6c, 0x2b, 0x4b, 0x8c, 0x57, 0xa9, 0xbe, + 0x4a, 0xc9, 0xdd, 0x64, 0x8b, 0x82, 0x18, 0x93, 0x23, 0x89, 0x09, 0x45, 0x72, 0x49, 0x2a, 0x89, + 0x83, 0x1e, 0x02, 0xf4, 0x54, 0xa0, 0x7f, 0x40, 0x51, 0x14, 0x3d, 0xf4, 0xb2, 0x40, 0xff, 0x80, + 0x02, 0xed, 0xbd, 0xd7, 0x02, 0xbd, 0xf7, 0x50, 0xa0, 0x05, 0xda, 0x3f, 0xa1, 0xc7, 0x62, 0x66, + 0x48, 0x8a, 0xd4, 0x47, 0xe2, 0x5d, 0x20, 0xd9, 0x93, 0x3d, 0xef, 0xfd, 0xde, 0x9b, 0x37, 0x8f, + 0xbf, 0x79, 0xf3, 0x66, 0x04, 0x82, 0x46, 0x5c, 0xd5, 0xd1, 0x6d, 0xcf, 0x72, 0x2a, 0xb6, 0x63, + 0x79, 0x16, 0x5a, 0x1b, 0x5a, 0xd6, 0xd0, 0x20, 0x7c, 0x74, 0x32, 0x19, 0x94, 0x5b, 0xb0, 0x7e, + 0x4f, 0x37, 0x48, 0x3d, 0x04, 0xf6, 0x88, 0x87, 0xee, 0x40, 0x7a, 0xa0, 0x1b, 0x44, 0x4c, 0xec, + 0xa4, 0x76, 0x0b, 0x7b, 0x1f, 0x56, 0x66, 0x8c, 0x2a, 0x71, 0x8b, 0x2e, 0x15, 0xcb, 0xcc, 0xa2, + 0xfc, 0xef, 0x34, 0x6c, 0x2c, 0xd0, 0x22, 0x04, 0x69, 0x13, 0x8f, 0xa9, 0xc7, 0xc4, 0x6e, 0x5e, + 0x66, 0xff, 0x23, 0x11, 0x56, 0x6c, 0xac, 0x3e, 0xc6, 0x43, 0x22, 0x26, 0x99, 0x38, 0x18, 0xa2, + 0xf7, 0x01, 0x34, 0x62, 0x13, 0x53, 0x23, 0xa6, 0x7a, 0x2a, 0xa6, 0x76, 0x52, 0xbb, 0x79, 0x39, + 0x22, 0x41, 0xd7, 0x60, 0xdd, 0x9e, 0x9c, 0x18, 0xba, 0xaa, 0x44, 0x60, 0xb0, 0x93, 0xda, 0xcd, + 0xc8, 0x02, 0x57, 0xd4, 0xa7, 0xe0, 0xcb, 0xb0, 0xf6, 0x94, 0xe0, 0xc7, 0x51, 0x68, 0x81, 0x41, + 0x4b, 0x54, 0x1c, 0x01, 0xd6, 0xa0, 0x38, 0x26, 0xae, 0x8b, 0x87, 0x44, 0xf1, 0x4e, 0x6d, 0x22, + 0xa6, 0xd9, 0xea, 0x77, 0xe6, 0x56, 0x3f, 0xbb, 0xf2, 0x82, 0x6f, 0xd5, 0x3f, 0xb5, 0x09, 0xaa, + 0x42, 0x9e, 0x98, 0x93, 0x31, 0xf7, 0x90, 0x59, 0x92, 0x3f, 0xc9, 0x9c, 0x8c, 0x67, 0xbd, 0xe4, + 0xa8, 0x99, 0xef, 0x62, 0xc5, 0x25, 0xce, 0x13, 0x5d, 0x25, 0x62, 0x96, 0x39, 0xb8, 0x3c, 0xe7, + 0xa0, 0xc7, 0xf5, 0xb3, 0x3e, 0x02, 0x3b, 0x54, 0x83, 0x3c, 0x79, 0xe6, 0x11, 0xd3, 0xd5, 0x2d, + 0x53, 0x5c, 0x61, 0x4e, 0x2e, 0x2d, 0xf8, 0x8a, 0xc4, 0xd0, 0x66, 0x5d, 0x4c, 0xed, 0xd0, 0x3e, + 0xac, 0x58, 0xb6, 0xa7, 0x5b, 0xa6, 0x2b, 0xe6, 0x76, 0x12, 0xbb, 0x85, 0xbd, 0x77, 0x17, 0x12, + 0xa1, 0xc3, 0x31, 0x72, 0x00, 0x46, 0x0d, 0x10, 0x5c, 0x6b, 0xe2, 0xa8, 0x44, 0x51, 0x2d, 0x8d, + 0x28, 0xba, 0x39, 0xb0, 0xc4, 0x3c, 0x73, 0x70, 0x61, 0x7e, 0x21, 0x0c, 0x58, 0xb3, 0x34, 0xd2, + 0x30, 0x07, 0x96, 0x5c, 0x72, 0x63, 0x63, 0xb4, 0x05, 0x59, 0xf7, 0xd4, 0xf4, 0xf0, 0x33, 0xb1, + 0xc8, 0x18, 0xe2, 0x8f, 0xca, 0x7f, 0xce, 0xc2, 0xda, 0x59, 0x28, 0x76, 0x17, 0x32, 0x03, 0xba, + 0x4a, 0x31, 0xf9, 0x6d, 0x72, 0xc0, 0x6d, 0xe2, 0x49, 0xcc, 0x7e, 0xc7, 0x24, 0x56, 0xa1, 0x60, + 0x12, 0xd7, 0x23, 0x1a, 0x67, 0x44, 0xea, 0x8c, 0x9c, 0x02, 0x6e, 0x34, 0x4f, 0xa9, 0xf4, 0x77, + 0xa2, 0xd4, 0x03, 0x58, 0x0b, 0x43, 0x52, 0x1c, 0x6c, 0x0e, 0x03, 0x6e, 0x5e, 0x7f, 0x55, 0x24, + 0x15, 0x29, 0xb0, 0x93, 0xa9, 0x99, 0x5c, 0x22, 0xb1, 0x31, 0xaa, 0x03, 0x58, 0x26, 0xb1, 0x06, + 0x8a, 0x46, 0x54, 0x43, 0xcc, 0x2d, 0xc9, 0x52, 0x87, 0x42, 0xe6, 0xb2, 0x64, 0x71, 0xa9, 0x6a, + 0xa0, 0xcf, 0xa6, 0x54, 0x5b, 0x59, 0xc2, 0x94, 0x16, 0xdf, 0x64, 0x73, 0x6c, 0x3b, 0x86, 0x92, + 0x43, 0x28, 0xef, 0x89, 0xe6, 0xaf, 0x2c, 0xcf, 0x82, 0xa8, 0xbc, 0x72, 0x65, 0xb2, 0x6f, 0xc6, + 0x17, 0xb6, 0xea, 0x44, 0x87, 0xe8, 0x03, 0x08, 0x05, 0x0a, 0xa3, 0x15, 0xb0, 0x2a, 0x54, 0x0c, + 0x84, 0x6d, 0x3c, 0x26, 0xdb, 0xcf, 0xa1, 0x14, 0x4f, 0x0f, 0xda, 0x84, 0x8c, 0xeb, 0x61, 0xc7, + 0x63, 0x2c, 0xcc, 0xc8, 0x7c, 0x80, 0x04, 0x48, 0x11, 0x53, 0x63, 0x55, 0x2e, 0x23, 0xd3, 0x7f, + 0xd1, 0x8f, 0xa6, 0x0b, 0x4e, 0xb1, 0x05, 0x7f, 0x34, 0xff, 0x45, 0x63, 0x9e, 0x67, 0xd7, 0xbd, + 0x7d, 0x1b, 0x56, 0x63, 0x0b, 0x38, 0xeb, 0xd4, 0xe5, 0x5f, 0xc0, 0xdb, 0x0b, 0x5d, 0xa3, 0x07, + 0xb0, 0x39, 0x31, 0x75, 0xd3, 0x23, 0x8e, 0xed, 0x10, 0xca, 0x58, 0x3e, 0x95, 0xf8, 0x9f, 0x95, + 0x25, 0x9c, 0x3b, 0x8e, 0xa2, 0xb9, 0x17, 0x79, 0x63, 0x32, 0x2f, 0xbc, 0x9a, 0xcf, 0xfd, 0x77, + 0x45, 0x78, 0xf1, 0xe2, 0xc5, 0x8b, 0x64, 0xf9, 0x37, 0x59, 0xd8, 0x5c, 0xb4, 0x67, 0x16, 0x6e, + 0xdf, 0x2d, 0xc8, 0x9a, 0x93, 0xf1, 0x09, 0x71, 0x58, 0x92, 0x32, 0xb2, 0x3f, 0x42, 0x55, 0xc8, + 0x18, 0xf8, 0x84, 0x18, 0x62, 0x7a, 0x27, 0xb1, 0x5b, 0xda, 0xbb, 0x76, 0xa6, 0x5d, 0x59, 0x69, + 0x52, 0x13, 0x99, 0x5b, 0xa2, 0xcf, 0x21, 0xed, 0x97, 0x68, 0xea, 0xe1, 0xea, 0xd9, 0x3c, 0xd0, + 0xbd, 0x24, 0x33, 0x3b, 0xf4, 0x0e, 0xe4, 0xe9, 0x5f, 0xce, 0x8d, 0x2c, 0x8b, 0x39, 0x47, 0x05, + 0x94, 0x17, 0x68, 0x1b, 0x72, 0x6c, 0x9b, 0x68, 0x24, 0x38, 0xda, 0xc2, 0x31, 0x25, 0x96, 0x46, + 0x06, 0x78, 0x62, 0x78, 0xca, 0x13, 0x6c, 0x4c, 0x08, 0x23, 0x7c, 0x5e, 0x2e, 0xfa, 0xc2, 0x9f, + 0x52, 0x19, 0xba, 0x00, 0x05, 0xbe, 0xab, 0x74, 0x53, 0x23, 0xcf, 0x58, 0xf5, 0xcc, 0xc8, 0x7c, + 0xa3, 0x35, 0xa8, 0x84, 0x4e, 0xff, 0xc8, 0xb5, 0xcc, 0x80, 0x9a, 0x6c, 0x0a, 0x2a, 0x60, 0xd3, + 0xdf, 0x9e, 0x2d, 0xdc, 0xef, 0x2d, 0x5e, 0xde, 0x2c, 0xa7, 0xca, 0x7f, 0x4a, 0x42, 0x9a, 0xd5, + 0x8b, 0x35, 0x28, 0xf4, 0x1f, 0x76, 0x25, 0xa5, 0xde, 0x39, 0x3e, 0x6c, 0x4a, 0x42, 0x02, 0x95, + 0x00, 0x98, 0xe0, 0x5e, 0xb3, 0x53, 0xed, 0x0b, 0xc9, 0x70, 0xdc, 0x68, 0xf7, 0xf7, 0x6f, 0x0a, + 0xa9, 0xd0, 0xe0, 0x98, 0x0b, 0xd2, 0x51, 0xc0, 0x8d, 0x3d, 0x21, 0x83, 0x04, 0x28, 0x72, 0x07, + 0x8d, 0x07, 0x52, 0x7d, 0xff, 0xa6, 0x90, 0x8d, 0x4b, 0x6e, 0xec, 0x09, 0x2b, 0x68, 0x15, 0xf2, + 0x4c, 0x72, 0xd8, 0xe9, 0x34, 0x85, 0x5c, 0xe8, 0xb3, 0xd7, 0x97, 0x1b, 0xed, 0x23, 0x21, 0x1f, + 0xfa, 0x3c, 0x92, 0x3b, 0xc7, 0x5d, 0x01, 0x42, 0x0f, 0x2d, 0xa9, 0xd7, 0xab, 0x1e, 0x49, 0x42, + 0x21, 0x44, 0x1c, 0x3e, 0xec, 0x4b, 0x3d, 0xa1, 0x18, 0x0b, 0xeb, 0xc6, 0x9e, 0xb0, 0x1a, 0x4e, + 0x21, 0xb5, 0x8f, 0x5b, 0x42, 0x09, 0xad, 0xc3, 0x2a, 0x9f, 0x22, 0x08, 0x62, 0x6d, 0x46, 0xb4, + 0x7f, 0x53, 0x10, 0xa6, 0x81, 0x70, 0x2f, 0xeb, 0x31, 0xc1, 0xfe, 0x4d, 0x01, 0x95, 0x6b, 0x90, + 0x61, 0xec, 0x42, 0x08, 0x4a, 0xcd, 0xea, 0xa1, 0xd4, 0x54, 0x3a, 0xdd, 0x7e, 0xa3, 0xd3, 0xae, + 0x36, 0x85, 0xc4, 0x54, 0x26, 0x4b, 0x3f, 0x39, 0x6e, 0xc8, 0x52, 0x5d, 0x48, 0x46, 0x65, 0x5d, + 0xa9, 0xda, 0x97, 0xea, 0x42, 0xaa, 0xac, 0xc2, 0xe6, 0xa2, 0x3a, 0xb9, 0x70, 0x67, 0x44, 0x3e, + 0x71, 0x72, 0xc9, 0x27, 0x66, 0xbe, 0xe6, 0x3e, 0xf1, 0xbf, 0x92, 0xb0, 0xb1, 0xe0, 0xac, 0x58, + 0x38, 0xc9, 0x0f, 0x21, 0xc3, 0x29, 0xca, 0x4f, 0xcf, 0x2b, 0x0b, 0x0f, 0x1d, 0x46, 0xd8, 0xb9, + 0x13, 0x94, 0xd9, 0x45, 0x3b, 0x88, 0xd4, 0x92, 0x0e, 0x82, 0xba, 0x98, 0xab, 0xe9, 0x3f, 0x9f, + 0xab, 0xe9, 0xfc, 0xd8, 0xdb, 0x3f, 0xcb, 0xb1, 0xc7, 0x64, 0xdf, 0xae, 0xb6, 0x67, 0x16, 0xd4, + 0xf6, 0xbb, 0xb0, 0x3e, 0xe7, 0xe8, 0xcc, 0x35, 0xf6, 0x97, 0x09, 0x10, 0x97, 0x25, 0xe7, 0x15, + 0x95, 0x2e, 0x19, 0xab, 0x74, 0x77, 0x67, 0x33, 0x78, 0x71, 0xf9, 0x47, 0x98, 0xfb, 0xd6, 0xdf, + 0x24, 0x60, 0x6b, 0x71, 0xa7, 0xb8, 0x30, 0x86, 0xcf, 0x21, 0x3b, 0x26, 0xde, 0xc8, 0x0a, 0xba, + 0xa5, 0x8f, 0x16, 0x9c, 0xc1, 0x54, 0x3d, 0xfb, 0xb1, 0x7d, 0xab, 0xe8, 0x21, 0x9e, 0x5a, 0xd6, + 0xee, 0xf1, 0x68, 0xe6, 0x22, 0xfd, 0x55, 0x12, 0xde, 0x5e, 0xe8, 0x7c, 0x61, 0xa0, 0xef, 0x01, + 0xe8, 0xa6, 0x3d, 0xf1, 0x78, 0x47, 0xc4, 0x0b, 0x6c, 0x9e, 0x49, 0x58, 0xf1, 0xa2, 0xc5, 0x73, + 0xe2, 0x85, 0xfa, 0x14, 0xd3, 0x03, 0x17, 0x31, 0xc0, 0x9d, 0x69, 0xa0, 0x69, 0x16, 0xe8, 0xfb, + 0x4b, 0x56, 0x3a, 0x47, 0xcc, 0x4f, 0x41, 0x50, 0x0d, 0x9d, 0x98, 0x9e, 0xe2, 0x7a, 0x0e, 0xc1, + 0x63, 0xdd, 0x1c, 0xb2, 0x13, 0x24, 0x77, 0x90, 0x19, 0x60, 0xc3, 0x25, 0xf2, 0x1a, 0x57, 0xf7, + 0x02, 0x2d, 0xb5, 0x60, 0x04, 0x72, 0x22, 0x16, 0xd9, 0x98, 0x05, 0x57, 0x87, 0x16, 0xe5, 0x5f, + 0xe7, 0xa1, 0x10, 0xe9, 0xab, 0xd1, 0x45, 0x28, 0x3e, 0xc2, 0x4f, 0xb0, 0x12, 0xdc, 0x95, 0x78, + 0x26, 0x0a, 0x54, 0xd6, 0xf5, 0xef, 0x4b, 0x9f, 0xc2, 0x26, 0x83, 0x58, 0x13, 0x8f, 0x38, 0x8a, + 0x6a, 0x60, 0xd7, 0x65, 0x49, 0xcb, 0x31, 0x28, 0xa2, 0xba, 0x0e, 0x55, 0xd5, 0x02, 0x0d, 0xba, + 0x05, 0x1b, 0xcc, 0x62, 0x3c, 0x31, 0x3c, 0xdd, 0x36, 0x88, 0x42, 0x6f, 0x6f, 0x2e, 0x3b, 0x49, + 0xc2, 0xc8, 0xd6, 0x29, 0xa2, 0xe5, 0x03, 0x68, 0x44, 0x2e, 0xaa, 0xc3, 0x7b, 0xcc, 0x6c, 0x48, + 0x4c, 0xe2, 0x60, 0x8f, 0x28, 0xe4, 0xeb, 0x09, 0x36, 0x5c, 0x05, 0x9b, 0x9a, 0x32, 0xc2, 0xee, + 0x48, 0xdc, 0xa4, 0x0e, 0x0e, 0x93, 0x62, 0x42, 0x3e, 0x4f, 0x81, 0x47, 0x3e, 0x4e, 0x62, 0xb0, + 0xaa, 0xa9, 0x7d, 0x81, 0xdd, 0x11, 0x3a, 0x80, 0x2d, 0xe6, 0xc5, 0xf5, 0x1c, 0xdd, 0x1c, 0x2a, + 0xea, 0x88, 0xa8, 0x8f, 0x95, 0x89, 0x37, 0xb8, 0x23, 0xbe, 0x13, 0x9d, 0x9f, 0x45, 0xd8, 0x63, + 0x98, 0x1a, 0x85, 0x1c, 0x7b, 0x83, 0x3b, 0xa8, 0x07, 0x45, 0xfa, 0x31, 0xc6, 0xfa, 0x73, 0xa2, + 0x0c, 0x2c, 0x87, 0x1d, 0x8d, 0xa5, 0x05, 0xa5, 0x29, 0x92, 0xc1, 0x4a, 0xc7, 0x37, 0x68, 0x59, + 0x1a, 0x39, 0xc8, 0xf4, 0xba, 0x92, 0x54, 0x97, 0x0b, 0x81, 0x97, 0x7b, 0x96, 0x43, 0x09, 0x35, + 0xb4, 0xc2, 0x04, 0x17, 0x38, 0xa1, 0x86, 0x56, 0x90, 0xde, 0x5b, 0xb0, 0xa1, 0xaa, 0x7c, 0xcd, + 0xba, 0xaa, 0xf8, 0x77, 0x2c, 0x57, 0x14, 0x62, 0xc9, 0x52, 0xd5, 0x23, 0x0e, 0xf0, 0x39, 0xee, + 0xa2, 0xcf, 0xe0, 0xed, 0x69, 0xb2, 0xa2, 0x86, 0xeb, 0x73, 0xab, 0x9c, 0x35, 0xbd, 0x05, 0x1b, + 0xf6, 0xe9, 0xbc, 0x21, 0x8a, 0xcd, 0x68, 0x9f, 0xce, 0x9a, 0xdd, 0x86, 0x4d, 0x7b, 0x64, 0xcf, + 0xdb, 0x5d, 0x8d, 0xda, 0x21, 0x7b, 0x64, 0xcf, 0x1a, 0x5e, 0x62, 0x17, 0x6e, 0x87, 0xa8, 0xd8, + 0x23, 0x9a, 0x78, 0x2e, 0x0a, 0x8f, 0x28, 0xd0, 0x75, 0x10, 0x54, 0x55, 0x21, 0x26, 0x3e, 0x31, + 0x88, 0x82, 0x1d, 0x62, 0x62, 0x57, 0xbc, 0x10, 0x05, 0x97, 0x54, 0x55, 0x62, 0xda, 0x2a, 0x53, + 0xa2, 0xab, 0xb0, 0x6e, 0x9d, 0x3c, 0x52, 0x39, 0x25, 0x15, 0xdb, 0x21, 0x03, 0xfd, 0x99, 0xf8, + 0x21, 0xcb, 0xef, 0x1a, 0x55, 0x30, 0x42, 0x76, 0x99, 0x18, 0x5d, 0x01, 0x41, 0x75, 0x47, 0xd8, + 0xb1, 0x59, 0x4d, 0x76, 0x6d, 0xac, 0x12, 0xf1, 0x12, 0x87, 0x72, 0x79, 0x3b, 0x10, 0xd3, 0x2d, + 0xe1, 0x3e, 0xd5, 0x07, 0x5e, 0xe0, 0xf1, 0x32, 0xdf, 0x12, 0x4c, 0xe6, 0x7b, 0xdb, 0x05, 0x81, + 0xa6, 0x22, 0x36, 0xf1, 0x2e, 0x83, 0x95, 0xec, 0x91, 0x1d, 0x9d, 0xf7, 0x03, 0x58, 0xa5, 0xc8, + 0xe9, 0xa4, 0x57, 0x78, 0x43, 0x66, 0x8f, 0x22, 0x33, 0xde, 0x84, 0x2d, 0x0a, 0x1a, 0x13, 0x0f, + 0x6b, 0xd8, 0xc3, 0x11, 0xf4, 0xc7, 0x0c, 0x4d, 0xf3, 0xde, 0xf2, 0x95, 0xb1, 0x38, 0x9d, 0xc9, + 0xc9, 0x69, 0xc8, 0xac, 0x4f, 0x78, 0x9c, 0x54, 0x16, 0x70, 0xeb, 0xb5, 0x35, 0xdd, 0xe5, 0x03, + 0x28, 0x46, 0x89, 0x8f, 0xf2, 0xc0, 0xa9, 0x2f, 0x24, 0x68, 0x17, 0x54, 0xeb, 0xd4, 0x69, 0xff, + 0xf2, 0x95, 0x24, 0x24, 0x69, 0x1f, 0xd5, 0x6c, 0xf4, 0x25, 0x45, 0x3e, 0x6e, 0xf7, 0x1b, 0x2d, + 0x49, 0x48, 0x45, 0x1b, 0xf6, 0xbf, 0x26, 0xa1, 0x14, 0xbf, 0x7b, 0xa1, 0x1f, 0xc0, 0xb9, 0xe0, + 0xa1, 0xc4, 0x25, 0x9e, 0xf2, 0x54, 0x77, 0xd8, 0x5e, 0x1c, 0x63, 0x7e, 0x2e, 0x86, 0x6c, 0xd8, + 0xf4, 0x51, 0x3d, 0xe2, 0x7d, 0xa9, 0x3b, 0x74, 0xa7, 0x8d, 0xb1, 0x87, 0x9a, 0x70, 0xc1, 0xb4, + 0x14, 0xd7, 0xc3, 0xa6, 0x86, 0x1d, 0x4d, 0x99, 0x3e, 0x51, 0x29, 0x58, 0x55, 0x89, 0xeb, 0x5a, + 0xfc, 0x0c, 0x0c, 0xbd, 0xbc, 0x6b, 0x5a, 0x3d, 0x1f, 0x3c, 0x3d, 0x1c, 0xaa, 0x3e, 0x74, 0x86, + 0xb9, 0xa9, 0x65, 0xcc, 0x7d, 0x07, 0xf2, 0x63, 0x6c, 0x2b, 0xc4, 0xf4, 0x9c, 0x53, 0xd6, 0x71, + 0xe7, 0xe4, 0xdc, 0x18, 0xdb, 0x12, 0x1d, 0xbf, 0x99, 0x8b, 0xcf, 0x3f, 0x52, 0x50, 0x8c, 0x76, + 0xdd, 0xf4, 0x12, 0xa3, 0xb2, 0x03, 0x2a, 0xc1, 0x4a, 0xd8, 0x07, 0x2f, 0xed, 0xd1, 0x2b, 0x35, + 0x7a, 0x72, 0x1d, 0x64, 0x79, 0x2f, 0x2c, 0x73, 0x4b, 0xda, 0x35, 0x50, 0x6a, 0x11, 0xde, 0x7b, + 0xe4, 0x64, 0x7f, 0x84, 0x8e, 0x20, 0xfb, 0xc8, 0x65, 0xbe, 0xb3, 0xcc, 0xf7, 0x87, 0x2f, 0xf7, + 0x7d, 0xbf, 0xc7, 0x9c, 0xe7, 0xef, 0xf7, 0x94, 0x76, 0x47, 0x6e, 0x55, 0x9b, 0xb2, 0x6f, 0x8e, + 0xce, 0x43, 0xda, 0xc0, 0xcf, 0x4f, 0xe3, 0x67, 0x1c, 0x13, 0x9d, 0x35, 0xf1, 0xe7, 0x21, 0xfd, + 0x94, 0xe0, 0xc7, 0xf1, 0x93, 0x85, 0x89, 0x5e, 0x23, 0xf5, 0xaf, 0x43, 0x86, 0xe5, 0x0b, 0x01, + 0xf8, 0x19, 0x13, 0xde, 0x42, 0x39, 0x48, 0xd7, 0x3a, 0x32, 0xa5, 0xbf, 0x00, 0x45, 0x2e, 0x55, + 0xba, 0x0d, 0xa9, 0x26, 0x09, 0xc9, 0xf2, 0x2d, 0xc8, 0xf2, 0x24, 0xd0, 0xad, 0x11, 0xa6, 0x41, + 0x78, 0xcb, 0x1f, 0xfa, 0x3e, 0x12, 0x81, 0xf6, 0xb8, 0x75, 0x28, 0xc9, 0x42, 0x32, 0xfa, 0x79, + 0x5d, 0x28, 0x46, 0x1b, 0xee, 0x37, 0xc3, 0xa9, 0xbf, 0x24, 0xa0, 0x10, 0x69, 0xa0, 0x69, 0xe7, + 0x83, 0x0d, 0xc3, 0x7a, 0xaa, 0x60, 0x43, 0xc7, 0xae, 0x4f, 0x0a, 0x60, 0xa2, 0x2a, 0x95, 0x9c, + 0xf5, 0xa3, 0xbd, 0x91, 0xe0, 0x7f, 0x9f, 0x00, 0x61, 0xb6, 0x77, 0x9d, 0x09, 0x30, 0xf1, 0xbd, + 0x06, 0xf8, 0xbb, 0x04, 0x94, 0xe2, 0x0d, 0xeb, 0x4c, 0x78, 0x17, 0xbf, 0xd7, 0xf0, 0xfe, 0x99, + 0x84, 0xd5, 0x58, 0x9b, 0x7a, 0xd6, 0xe8, 0xbe, 0x86, 0x75, 0x5d, 0x23, 0x63, 0xdb, 0xf2, 0x88, + 0xa9, 0x9e, 0x2a, 0x06, 0x79, 0x42, 0x0c, 0xb1, 0xcc, 0x0a, 0xc5, 0xf5, 0x97, 0x37, 0xc2, 0x95, + 0xc6, 0xd4, 0xae, 0x49, 0xcd, 0x0e, 0x36, 0x1a, 0x75, 0xa9, 0xd5, 0xed, 0xf4, 0xa5, 0x76, 0xed, + 0xa1, 0x72, 0xdc, 0xfe, 0x71, 0xbb, 0xf3, 0x65, 0x5b, 0x16, 0xf4, 0x19, 0xd8, 0x6b, 0xdc, 0xea, + 0x5d, 0x10, 0x66, 0x83, 0x42, 0xe7, 0x60, 0x51, 0x58, 0xc2, 0x5b, 0x68, 0x03, 0xd6, 0xda, 0x1d, + 0xa5, 0xd7, 0xa8, 0x4b, 0x8a, 0x74, 0xef, 0x9e, 0x54, 0xeb, 0xf7, 0xf8, 0xd3, 0x46, 0x88, 0xee, + 0xc7, 0x37, 0xf5, 0x6f, 0x53, 0xb0, 0xb1, 0x20, 0x12, 0x54, 0xf5, 0x2f, 0x25, 0xfc, 0x9e, 0xf4, + 0xc9, 0x59, 0xa2, 0xaf, 0xd0, 0xae, 0xa0, 0x8b, 0x1d, 0xcf, 0xbf, 0xc3, 0x5c, 0x01, 0x9a, 0x25, + 0xd3, 0xd3, 0x07, 0x3a, 0x71, 0xfc, 0x97, 0x20, 0x7e, 0x53, 0x59, 0x9b, 0xca, 0xf9, 0x63, 0xd0, + 0xc7, 0x80, 0x6c, 0xcb, 0xd5, 0x3d, 0xfd, 0x09, 0x51, 0x74, 0x33, 0x78, 0x36, 0xa2, 0x37, 0x97, + 0xb4, 0x2c, 0x04, 0x9a, 0x86, 0xe9, 0x85, 0x68, 0x93, 0x0c, 0xf1, 0x0c, 0x9a, 0x16, 0xf0, 0x94, + 0x2c, 0x04, 0x9a, 0x10, 0x7d, 0x11, 0x8a, 0x9a, 0x35, 0xa1, 0xed, 0x1c, 0xc7, 0xd1, 0xf3, 0x22, + 0x21, 0x17, 0xb8, 0x2c, 0x84, 0xf8, 0x8d, 0xfa, 0xf4, 0xbd, 0xaa, 0x28, 0x17, 0xb8, 0x8c, 0x43, + 0x2e, 0xc3, 0x1a, 0x1e, 0x0e, 0x1d, 0xea, 0x3c, 0x70, 0xc4, 0xaf, 0x1e, 0xa5, 0x50, 0xcc, 0x80, + 0xdb, 0xf7, 0x21, 0x17, 0xe4, 0x81, 0x1e, 0xc9, 0x34, 0x13, 0x8a, 0xcd, 0xef, 0xd3, 0xc9, 0xdd, + 0xbc, 0x9c, 0x33, 0x03, 0xe5, 0x45, 0x28, 0xea, 0xae, 0x32, 0x7d, 0x7e, 0x4f, 0xee, 0x24, 0x77, + 0x73, 0x72, 0x41, 0x77, 0xc3, 0xa7, 0xcb, 0xf2, 0x37, 0x49, 0x28, 0xc5, 0x7f, 0x3e, 0x40, 0x75, + 0xc8, 0x19, 0x96, 0x8a, 0x19, 0xb5, 0xf8, 0x6f, 0x57, 0xbb, 0xaf, 0xf8, 0xc5, 0xa1, 0xd2, 0xf4, + 0xf1, 0x72, 0x68, 0xb9, 0xfd, 0xb7, 0x04, 0xe4, 0x02, 0x31, 0xda, 0x82, 0xb4, 0x8d, 0xbd, 0x11, + 0x73, 0x97, 0x39, 0x4c, 0x0a, 0x09, 0x99, 0x8d, 0xa9, 0xdc, 0xb5, 0xb1, 0xc9, 0x28, 0xe0, 0xcb, + 0xe9, 0x98, 0x7e, 0x57, 0x83, 0x60, 0x8d, 0xdd, 0x6b, 0xac, 0xf1, 0x98, 0x98, 0x9e, 0x1b, 0x7c, + 0x57, 0x5f, 0x5e, 0xf3, 0xc5, 0xe8, 0x1a, 0xac, 0x7b, 0x0e, 0xd6, 0x8d, 0x18, 0x36, 0xcd, 0xb0, + 0x42, 0xa0, 0x08, 0xc1, 0x07, 0x70, 0x3e, 0xf0, 0xab, 0x11, 0x0f, 0xab, 0x23, 0xa2, 0x4d, 0x8d, + 0xb2, 0xec, 0xfd, 0xe2, 0x9c, 0x0f, 0xa8, 0xfb, 0xfa, 0xc0, 0xb6, 0xfc, 0xf7, 0x04, 0xac, 0x07, + 0x37, 0x31, 0x2d, 0x4c, 0x56, 0x0b, 0x00, 0x9b, 0xa6, 0xe5, 0x45, 0xd3, 0x35, 0x4f, 0xe5, 0x39, + 0xbb, 0x4a, 0x35, 0x34, 0x92, 0x23, 0x0e, 0xb6, 0xc7, 0x00, 0x53, 0xcd, 0xd2, 0xb4, 0x5d, 0x80, + 0x82, 0xff, 0xdb, 0x10, 0xfb, 0x81, 0x91, 0xdf, 0xdd, 0x81, 0x8b, 0xe8, 0x95, 0x0d, 0x6d, 0x42, + 0xe6, 0x84, 0x0c, 0x75, 0xd3, 0x7f, 0xf1, 0xe5, 0x83, 0xe0, 0x85, 0x25, 0x1d, 0xbe, 0xb0, 0x1c, + 0xfe, 0x0c, 0x36, 0x54, 0x6b, 0x3c, 0x1b, 0xee, 0xa1, 0x30, 0xf3, 0x7e, 0xe0, 0x7e, 0x91, 0xf8, + 0x0a, 0xa6, 0x2d, 0xe6, 0xff, 0x12, 0x89, 0x3f, 0x24, 0x53, 0x47, 0xdd, 0xc3, 0x3f, 0x26, 0xb7, + 0x8f, 0xb8, 0x69, 0x37, 0x58, 0xa9, 0x4c, 0x06, 0x06, 0x51, 0x69, 0xf4, 0xff, 0x0f, 0x00, 0x00, + 0xff, 0xff, 0x88, 0x17, 0xc1, 0xbe, 0x38, 0x1d, 0x00, 0x00, +} diff --git a/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor_gostring.gen.go b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor_gostring.gen.go new file mode 100644 index 00000000..165b2110 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor_gostring.gen.go @@ -0,0 +1,752 @@ +// Code generated by protoc-gen-gogo. DO NOT EDIT. +// source: descriptor.proto + +package descriptor + +import ( + fmt "fmt" + github_com_gogo_protobuf_proto "github.com/gogo/protobuf/proto" + proto "github.com/gogo/protobuf/proto" + math "math" + reflect "reflect" + sort "sort" + strconv "strconv" + strings "strings" +) + +// Reference imports to suppress errors if they are not otherwise used. +var _ = proto.Marshal +var _ = fmt.Errorf +var _ = math.Inf + +func (this *FileDescriptorSet) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 5) + s = append(s, "&descriptor.FileDescriptorSet{") + if this.File != nil { + s = append(s, "File: "+fmt.Sprintf("%#v", this.File)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *FileDescriptorProto) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 16) + s = append(s, "&descriptor.FileDescriptorProto{") + if this.Name != nil { + s = append(s, "Name: "+valueToGoStringDescriptor(this.Name, "string")+",\n") + } + if this.Package != nil { + s = append(s, "Package: "+valueToGoStringDescriptor(this.Package, "string")+",\n") + } + if this.Dependency != nil { + s = append(s, "Dependency: "+fmt.Sprintf("%#v", this.Dependency)+",\n") + } + if this.PublicDependency != nil { + s = append(s, "PublicDependency: "+fmt.Sprintf("%#v", this.PublicDependency)+",\n") + } + if this.WeakDependency != nil { + s = append(s, "WeakDependency: "+fmt.Sprintf("%#v", this.WeakDependency)+",\n") + } + if this.MessageType != nil { + s = append(s, "MessageType: "+fmt.Sprintf("%#v", this.MessageType)+",\n") + } + if this.EnumType != nil { + s = append(s, "EnumType: "+fmt.Sprintf("%#v", this.EnumType)+",\n") + } + if this.Service != nil { + s = append(s, "Service: "+fmt.Sprintf("%#v", this.Service)+",\n") + } + if this.Extension != nil { + s = append(s, "Extension: "+fmt.Sprintf("%#v", this.Extension)+",\n") + } + if this.Options != nil { + s = append(s, "Options: "+fmt.Sprintf("%#v", this.Options)+",\n") + } + if this.SourceCodeInfo != nil { + s = append(s, "SourceCodeInfo: "+fmt.Sprintf("%#v", this.SourceCodeInfo)+",\n") + } + if this.Syntax != nil { + s = append(s, "Syntax: "+valueToGoStringDescriptor(this.Syntax, "string")+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *DescriptorProto) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 14) + s = append(s, "&descriptor.DescriptorProto{") + if this.Name != nil { + s = append(s, "Name: "+valueToGoStringDescriptor(this.Name, "string")+",\n") + } + if this.Field != nil { + s = append(s, "Field: "+fmt.Sprintf("%#v", this.Field)+",\n") + } + if this.Extension != nil { + s = append(s, "Extension: "+fmt.Sprintf("%#v", this.Extension)+",\n") + } + if this.NestedType != nil { + s = append(s, "NestedType: "+fmt.Sprintf("%#v", this.NestedType)+",\n") + } + if this.EnumType != nil { + s = append(s, "EnumType: "+fmt.Sprintf("%#v", this.EnumType)+",\n") + } + if this.ExtensionRange != nil { + s = append(s, "ExtensionRange: "+fmt.Sprintf("%#v", this.ExtensionRange)+",\n") + } + if this.OneofDecl != nil { + s = append(s, "OneofDecl: "+fmt.Sprintf("%#v", this.OneofDecl)+",\n") + } + if this.Options != nil { + s = append(s, "Options: "+fmt.Sprintf("%#v", this.Options)+",\n") + } + if this.ReservedRange != nil { + s = append(s, "ReservedRange: "+fmt.Sprintf("%#v", this.ReservedRange)+",\n") + } + if this.ReservedName != nil { + s = append(s, "ReservedName: "+fmt.Sprintf("%#v", this.ReservedName)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *DescriptorProto_ExtensionRange) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 7) + s = append(s, "&descriptor.DescriptorProto_ExtensionRange{") + if this.Start != nil { + s = append(s, "Start: "+valueToGoStringDescriptor(this.Start, "int32")+",\n") + } + if this.End != nil { + s = append(s, "End: "+valueToGoStringDescriptor(this.End, "int32")+",\n") + } + if this.Options != nil { + s = append(s, "Options: "+fmt.Sprintf("%#v", this.Options)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *DescriptorProto_ReservedRange) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 6) + s = append(s, "&descriptor.DescriptorProto_ReservedRange{") + if this.Start != nil { + s = append(s, "Start: "+valueToGoStringDescriptor(this.Start, "int32")+",\n") + } + if this.End != nil { + s = append(s, "End: "+valueToGoStringDescriptor(this.End, "int32")+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *ExtensionRangeOptions) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 5) + s = append(s, "&descriptor.ExtensionRangeOptions{") + if this.UninterpretedOption != nil { + s = append(s, "UninterpretedOption: "+fmt.Sprintf("%#v", this.UninterpretedOption)+",\n") + } + s = append(s, "XXX_InternalExtensions: "+extensionToGoStringDescriptor(this)+",\n") + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *FieldDescriptorProto) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 14) + s = append(s, "&descriptor.FieldDescriptorProto{") + if this.Name != nil { + s = append(s, "Name: "+valueToGoStringDescriptor(this.Name, "string")+",\n") + } + if this.Number != nil { + s = append(s, "Number: "+valueToGoStringDescriptor(this.Number, "int32")+",\n") + } + if this.Label != nil { + s = append(s, "Label: "+valueToGoStringDescriptor(this.Label, "FieldDescriptorProto_Label")+",\n") + } + if this.Type != nil { + s = append(s, "Type: "+valueToGoStringDescriptor(this.Type, "FieldDescriptorProto_Type")+",\n") + } + if this.TypeName != nil { + s = append(s, "TypeName: "+valueToGoStringDescriptor(this.TypeName, "string")+",\n") + } + if this.Extendee != nil { + s = append(s, "Extendee: "+valueToGoStringDescriptor(this.Extendee, "string")+",\n") + } + if this.DefaultValue != nil { + s = append(s, "DefaultValue: "+valueToGoStringDescriptor(this.DefaultValue, "string")+",\n") + } + if this.OneofIndex != nil { + s = append(s, "OneofIndex: "+valueToGoStringDescriptor(this.OneofIndex, "int32")+",\n") + } + if this.JsonName != nil { + s = append(s, "JsonName: "+valueToGoStringDescriptor(this.JsonName, "string")+",\n") + } + if this.Options != nil { + s = append(s, "Options: "+fmt.Sprintf("%#v", this.Options)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *OneofDescriptorProto) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 6) + s = append(s, "&descriptor.OneofDescriptorProto{") + if this.Name != nil { + s = append(s, "Name: "+valueToGoStringDescriptor(this.Name, "string")+",\n") + } + if this.Options != nil { + s = append(s, "Options: "+fmt.Sprintf("%#v", this.Options)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *EnumDescriptorProto) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 9) + s = append(s, "&descriptor.EnumDescriptorProto{") + if this.Name != nil { + s = append(s, "Name: "+valueToGoStringDescriptor(this.Name, "string")+",\n") + } + if this.Value != nil { + s = append(s, "Value: "+fmt.Sprintf("%#v", this.Value)+",\n") + } + if this.Options != nil { + s = append(s, "Options: "+fmt.Sprintf("%#v", this.Options)+",\n") + } + if this.ReservedRange != nil { + s = append(s, "ReservedRange: "+fmt.Sprintf("%#v", this.ReservedRange)+",\n") + } + if this.ReservedName != nil { + s = append(s, "ReservedName: "+fmt.Sprintf("%#v", this.ReservedName)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *EnumDescriptorProto_EnumReservedRange) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 6) + s = append(s, "&descriptor.EnumDescriptorProto_EnumReservedRange{") + if this.Start != nil { + s = append(s, "Start: "+valueToGoStringDescriptor(this.Start, "int32")+",\n") + } + if this.End != nil { + s = append(s, "End: "+valueToGoStringDescriptor(this.End, "int32")+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *EnumValueDescriptorProto) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 7) + s = append(s, "&descriptor.EnumValueDescriptorProto{") + if this.Name != nil { + s = append(s, "Name: "+valueToGoStringDescriptor(this.Name, "string")+",\n") + } + if this.Number != nil { + s = append(s, "Number: "+valueToGoStringDescriptor(this.Number, "int32")+",\n") + } + if this.Options != nil { + s = append(s, "Options: "+fmt.Sprintf("%#v", this.Options)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *ServiceDescriptorProto) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 7) + s = append(s, "&descriptor.ServiceDescriptorProto{") + if this.Name != nil { + s = append(s, "Name: "+valueToGoStringDescriptor(this.Name, "string")+",\n") + } + if this.Method != nil { + s = append(s, "Method: "+fmt.Sprintf("%#v", this.Method)+",\n") + } + if this.Options != nil { + s = append(s, "Options: "+fmt.Sprintf("%#v", this.Options)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *MethodDescriptorProto) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 10) + s = append(s, "&descriptor.MethodDescriptorProto{") + if this.Name != nil { + s = append(s, "Name: "+valueToGoStringDescriptor(this.Name, "string")+",\n") + } + if this.InputType != nil { + s = append(s, "InputType: "+valueToGoStringDescriptor(this.InputType, "string")+",\n") + } + if this.OutputType != nil { + s = append(s, "OutputType: "+valueToGoStringDescriptor(this.OutputType, "string")+",\n") + } + if this.Options != nil { + s = append(s, "Options: "+fmt.Sprintf("%#v", this.Options)+",\n") + } + if this.ClientStreaming != nil { + s = append(s, "ClientStreaming: "+valueToGoStringDescriptor(this.ClientStreaming, "bool")+",\n") + } + if this.ServerStreaming != nil { + s = append(s, "ServerStreaming: "+valueToGoStringDescriptor(this.ServerStreaming, "bool")+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *FileOptions) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 25) + s = append(s, "&descriptor.FileOptions{") + if this.JavaPackage != nil { + s = append(s, "JavaPackage: "+valueToGoStringDescriptor(this.JavaPackage, "string")+",\n") + } + if this.JavaOuterClassname != nil { + s = append(s, "JavaOuterClassname: "+valueToGoStringDescriptor(this.JavaOuterClassname, "string")+",\n") + } + if this.JavaMultipleFiles != nil { + s = append(s, "JavaMultipleFiles: "+valueToGoStringDescriptor(this.JavaMultipleFiles, "bool")+",\n") + } + if this.JavaGenerateEqualsAndHash != nil { + s = append(s, "JavaGenerateEqualsAndHash: "+valueToGoStringDescriptor(this.JavaGenerateEqualsAndHash, "bool")+",\n") + } + if this.JavaStringCheckUtf8 != nil { + s = append(s, "JavaStringCheckUtf8: "+valueToGoStringDescriptor(this.JavaStringCheckUtf8, "bool")+",\n") + } + if this.OptimizeFor != nil { + s = append(s, "OptimizeFor: "+valueToGoStringDescriptor(this.OptimizeFor, "FileOptions_OptimizeMode")+",\n") + } + if this.GoPackage != nil { + s = append(s, "GoPackage: "+valueToGoStringDescriptor(this.GoPackage, "string")+",\n") + } + if this.CcGenericServices != nil { + s = append(s, "CcGenericServices: "+valueToGoStringDescriptor(this.CcGenericServices, "bool")+",\n") + } + if this.JavaGenericServices != nil { + s = append(s, "JavaGenericServices: "+valueToGoStringDescriptor(this.JavaGenericServices, "bool")+",\n") + } + if this.PyGenericServices != nil { + s = append(s, "PyGenericServices: "+valueToGoStringDescriptor(this.PyGenericServices, "bool")+",\n") + } + if this.PhpGenericServices != nil { + s = append(s, "PhpGenericServices: "+valueToGoStringDescriptor(this.PhpGenericServices, "bool")+",\n") + } + if this.Deprecated != nil { + s = append(s, "Deprecated: "+valueToGoStringDescriptor(this.Deprecated, "bool")+",\n") + } + if this.CcEnableArenas != nil { + s = append(s, "CcEnableArenas: "+valueToGoStringDescriptor(this.CcEnableArenas, "bool")+",\n") + } + if this.ObjcClassPrefix != nil { + s = append(s, "ObjcClassPrefix: "+valueToGoStringDescriptor(this.ObjcClassPrefix, "string")+",\n") + } + if this.CsharpNamespace != nil { + s = append(s, "CsharpNamespace: "+valueToGoStringDescriptor(this.CsharpNamespace, "string")+",\n") + } + if this.SwiftPrefix != nil { + s = append(s, "SwiftPrefix: "+valueToGoStringDescriptor(this.SwiftPrefix, "string")+",\n") + } + if this.PhpClassPrefix != nil { + s = append(s, "PhpClassPrefix: "+valueToGoStringDescriptor(this.PhpClassPrefix, "string")+",\n") + } + if this.PhpNamespace != nil { + s = append(s, "PhpNamespace: "+valueToGoStringDescriptor(this.PhpNamespace, "string")+",\n") + } + if this.PhpMetadataNamespace != nil { + s = append(s, "PhpMetadataNamespace: "+valueToGoStringDescriptor(this.PhpMetadataNamespace, "string")+",\n") + } + if this.RubyPackage != nil { + s = append(s, "RubyPackage: "+valueToGoStringDescriptor(this.RubyPackage, "string")+",\n") + } + if this.UninterpretedOption != nil { + s = append(s, "UninterpretedOption: "+fmt.Sprintf("%#v", this.UninterpretedOption)+",\n") + } + s = append(s, "XXX_InternalExtensions: "+extensionToGoStringDescriptor(this)+",\n") + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *MessageOptions) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 9) + s = append(s, "&descriptor.MessageOptions{") + if this.MessageSetWireFormat != nil { + s = append(s, "MessageSetWireFormat: "+valueToGoStringDescriptor(this.MessageSetWireFormat, "bool")+",\n") + } + if this.NoStandardDescriptorAccessor != nil { + s = append(s, "NoStandardDescriptorAccessor: "+valueToGoStringDescriptor(this.NoStandardDescriptorAccessor, "bool")+",\n") + } + if this.Deprecated != nil { + s = append(s, "Deprecated: "+valueToGoStringDescriptor(this.Deprecated, "bool")+",\n") + } + if this.MapEntry != nil { + s = append(s, "MapEntry: "+valueToGoStringDescriptor(this.MapEntry, "bool")+",\n") + } + if this.UninterpretedOption != nil { + s = append(s, "UninterpretedOption: "+fmt.Sprintf("%#v", this.UninterpretedOption)+",\n") + } + s = append(s, "XXX_InternalExtensions: "+extensionToGoStringDescriptor(this)+",\n") + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *FieldOptions) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 11) + s = append(s, "&descriptor.FieldOptions{") + if this.Ctype != nil { + s = append(s, "Ctype: "+valueToGoStringDescriptor(this.Ctype, "FieldOptions_CType")+",\n") + } + if this.Packed != nil { + s = append(s, "Packed: "+valueToGoStringDescriptor(this.Packed, "bool")+",\n") + } + if this.Jstype != nil { + s = append(s, "Jstype: "+valueToGoStringDescriptor(this.Jstype, "FieldOptions_JSType")+",\n") + } + if this.Lazy != nil { + s = append(s, "Lazy: "+valueToGoStringDescriptor(this.Lazy, "bool")+",\n") + } + if this.Deprecated != nil { + s = append(s, "Deprecated: "+valueToGoStringDescriptor(this.Deprecated, "bool")+",\n") + } + if this.Weak != nil { + s = append(s, "Weak: "+valueToGoStringDescriptor(this.Weak, "bool")+",\n") + } + if this.UninterpretedOption != nil { + s = append(s, "UninterpretedOption: "+fmt.Sprintf("%#v", this.UninterpretedOption)+",\n") + } + s = append(s, "XXX_InternalExtensions: "+extensionToGoStringDescriptor(this)+",\n") + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *OneofOptions) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 5) + s = append(s, "&descriptor.OneofOptions{") + if this.UninterpretedOption != nil { + s = append(s, "UninterpretedOption: "+fmt.Sprintf("%#v", this.UninterpretedOption)+",\n") + } + s = append(s, "XXX_InternalExtensions: "+extensionToGoStringDescriptor(this)+",\n") + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *EnumOptions) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 7) + s = append(s, "&descriptor.EnumOptions{") + if this.AllowAlias != nil { + s = append(s, "AllowAlias: "+valueToGoStringDescriptor(this.AllowAlias, "bool")+",\n") + } + if this.Deprecated != nil { + s = append(s, "Deprecated: "+valueToGoStringDescriptor(this.Deprecated, "bool")+",\n") + } + if this.UninterpretedOption != nil { + s = append(s, "UninterpretedOption: "+fmt.Sprintf("%#v", this.UninterpretedOption)+",\n") + } + s = append(s, "XXX_InternalExtensions: "+extensionToGoStringDescriptor(this)+",\n") + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *EnumValueOptions) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 6) + s = append(s, "&descriptor.EnumValueOptions{") + if this.Deprecated != nil { + s = append(s, "Deprecated: "+valueToGoStringDescriptor(this.Deprecated, "bool")+",\n") + } + if this.UninterpretedOption != nil { + s = append(s, "UninterpretedOption: "+fmt.Sprintf("%#v", this.UninterpretedOption)+",\n") + } + s = append(s, "XXX_InternalExtensions: "+extensionToGoStringDescriptor(this)+",\n") + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *ServiceOptions) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 6) + s = append(s, "&descriptor.ServiceOptions{") + if this.Deprecated != nil { + s = append(s, "Deprecated: "+valueToGoStringDescriptor(this.Deprecated, "bool")+",\n") + } + if this.UninterpretedOption != nil { + s = append(s, "UninterpretedOption: "+fmt.Sprintf("%#v", this.UninterpretedOption)+",\n") + } + s = append(s, "XXX_InternalExtensions: "+extensionToGoStringDescriptor(this)+",\n") + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *MethodOptions) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 7) + s = append(s, "&descriptor.MethodOptions{") + if this.Deprecated != nil { + s = append(s, "Deprecated: "+valueToGoStringDescriptor(this.Deprecated, "bool")+",\n") + } + if this.IdempotencyLevel != nil { + s = append(s, "IdempotencyLevel: "+valueToGoStringDescriptor(this.IdempotencyLevel, "MethodOptions_IdempotencyLevel")+",\n") + } + if this.UninterpretedOption != nil { + s = append(s, "UninterpretedOption: "+fmt.Sprintf("%#v", this.UninterpretedOption)+",\n") + } + s = append(s, "XXX_InternalExtensions: "+extensionToGoStringDescriptor(this)+",\n") + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *UninterpretedOption) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 11) + s = append(s, "&descriptor.UninterpretedOption{") + if this.Name != nil { + s = append(s, "Name: "+fmt.Sprintf("%#v", this.Name)+",\n") + } + if this.IdentifierValue != nil { + s = append(s, "IdentifierValue: "+valueToGoStringDescriptor(this.IdentifierValue, "string")+",\n") + } + if this.PositiveIntValue != nil { + s = append(s, "PositiveIntValue: "+valueToGoStringDescriptor(this.PositiveIntValue, "uint64")+",\n") + } + if this.NegativeIntValue != nil { + s = append(s, "NegativeIntValue: "+valueToGoStringDescriptor(this.NegativeIntValue, "int64")+",\n") + } + if this.DoubleValue != nil { + s = append(s, "DoubleValue: "+valueToGoStringDescriptor(this.DoubleValue, "float64")+",\n") + } + if this.StringValue != nil { + s = append(s, "StringValue: "+valueToGoStringDescriptor(this.StringValue, "byte")+",\n") + } + if this.AggregateValue != nil { + s = append(s, "AggregateValue: "+valueToGoStringDescriptor(this.AggregateValue, "string")+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *UninterpretedOption_NamePart) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 6) + s = append(s, "&descriptor.UninterpretedOption_NamePart{") + if this.NamePart != nil { + s = append(s, "NamePart: "+valueToGoStringDescriptor(this.NamePart, "string")+",\n") + } + if this.IsExtension != nil { + s = append(s, "IsExtension: "+valueToGoStringDescriptor(this.IsExtension, "bool")+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *SourceCodeInfo) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 5) + s = append(s, "&descriptor.SourceCodeInfo{") + if this.Location != nil { + s = append(s, "Location: "+fmt.Sprintf("%#v", this.Location)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *SourceCodeInfo_Location) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 9) + s = append(s, "&descriptor.SourceCodeInfo_Location{") + if this.Path != nil { + s = append(s, "Path: "+fmt.Sprintf("%#v", this.Path)+",\n") + } + if this.Span != nil { + s = append(s, "Span: "+fmt.Sprintf("%#v", this.Span)+",\n") + } + if this.LeadingComments != nil { + s = append(s, "LeadingComments: "+valueToGoStringDescriptor(this.LeadingComments, "string")+",\n") + } + if this.TrailingComments != nil { + s = append(s, "TrailingComments: "+valueToGoStringDescriptor(this.TrailingComments, "string")+",\n") + } + if this.LeadingDetachedComments != nil { + s = append(s, "LeadingDetachedComments: "+fmt.Sprintf("%#v", this.LeadingDetachedComments)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *GeneratedCodeInfo) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 5) + s = append(s, "&descriptor.GeneratedCodeInfo{") + if this.Annotation != nil { + s = append(s, "Annotation: "+fmt.Sprintf("%#v", this.Annotation)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *GeneratedCodeInfo_Annotation) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 8) + s = append(s, "&descriptor.GeneratedCodeInfo_Annotation{") + if this.Path != nil { + s = append(s, "Path: "+fmt.Sprintf("%#v", this.Path)+",\n") + } + if this.SourceFile != nil { + s = append(s, "SourceFile: "+valueToGoStringDescriptor(this.SourceFile, "string")+",\n") + } + if this.Begin != nil { + s = append(s, "Begin: "+valueToGoStringDescriptor(this.Begin, "int32")+",\n") + } + if this.End != nil { + s = append(s, "End: "+valueToGoStringDescriptor(this.End, "int32")+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func valueToGoStringDescriptor(v interface{}, typ string) string { + rv := reflect.ValueOf(v) + if rv.IsNil() { + return "nil" + } + pv := reflect.Indirect(rv).Interface() + return fmt.Sprintf("func(v %v) *%v { return &v } ( %#v )", typ, typ, pv) +} +func extensionToGoStringDescriptor(m github_com_gogo_protobuf_proto.Message) string { + e := github_com_gogo_protobuf_proto.GetUnsafeExtensionsMap(m) + if e == nil { + return "nil" + } + s := "proto.NewUnsafeXXX_InternalExtensions(map[int32]proto.Extension{" + keys := make([]int, 0, len(e)) + for k := range e { + keys = append(keys, int(k)) + } + sort.Ints(keys) + ss := []string{} + for _, k := range keys { + ss = append(ss, strconv.Itoa(k)+": "+e[int32(k)].GoString()) + } + s += strings.Join(ss, ",") + "})" + return s +} diff --git a/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/helper.go b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/helper.go new file mode 100644 index 00000000..e0846a35 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/helper.go @@ -0,0 +1,390 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2013, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package descriptor + +import ( + "strings" +) + +func (msg *DescriptorProto) GetMapFields() (*FieldDescriptorProto, *FieldDescriptorProto) { + if !msg.GetOptions().GetMapEntry() { + return nil, nil + } + return msg.GetField()[0], msg.GetField()[1] +} + +func dotToUnderscore(r rune) rune { + if r == '.' { + return '_' + } + return r +} + +func (field *FieldDescriptorProto) WireType() (wire int) { + switch *field.Type { + case FieldDescriptorProto_TYPE_DOUBLE: + return 1 + case FieldDescriptorProto_TYPE_FLOAT: + return 5 + case FieldDescriptorProto_TYPE_INT64: + return 0 + case FieldDescriptorProto_TYPE_UINT64: + return 0 + case FieldDescriptorProto_TYPE_INT32: + return 0 + case FieldDescriptorProto_TYPE_UINT32: + return 0 + case FieldDescriptorProto_TYPE_FIXED64: + return 1 + case FieldDescriptorProto_TYPE_FIXED32: + return 5 + case FieldDescriptorProto_TYPE_BOOL: + return 0 + case FieldDescriptorProto_TYPE_STRING: + return 2 + case FieldDescriptorProto_TYPE_GROUP: + return 2 + case FieldDescriptorProto_TYPE_MESSAGE: + return 2 + case FieldDescriptorProto_TYPE_BYTES: + return 2 + case FieldDescriptorProto_TYPE_ENUM: + return 0 + case FieldDescriptorProto_TYPE_SFIXED32: + return 5 + case FieldDescriptorProto_TYPE_SFIXED64: + return 1 + case FieldDescriptorProto_TYPE_SINT32: + return 0 + case FieldDescriptorProto_TYPE_SINT64: + return 0 + } + panic("unreachable") +} + +func (field *FieldDescriptorProto) GetKeyUint64() (x uint64) { + packed := field.IsPacked() + wireType := field.WireType() + fieldNumber := field.GetNumber() + if packed { + wireType = 2 + } + x = uint64(uint32(fieldNumber)<<3 | uint32(wireType)) + return x +} + +func (field *FieldDescriptorProto) GetKey3Uint64() (x uint64) { + packed := field.IsPacked3() + wireType := field.WireType() + fieldNumber := field.GetNumber() + if packed { + wireType = 2 + } + x = uint64(uint32(fieldNumber)<<3 | uint32(wireType)) + return x +} + +func (field *FieldDescriptorProto) GetKey() []byte { + x := field.GetKeyUint64() + i := 0 + keybuf := make([]byte, 0) + for i = 0; x > 127; i++ { + keybuf = append(keybuf, 0x80|uint8(x&0x7F)) + x >>= 7 + } + keybuf = append(keybuf, uint8(x)) + return keybuf +} + +func (field *FieldDescriptorProto) GetKey3() []byte { + x := field.GetKey3Uint64() + i := 0 + keybuf := make([]byte, 0) + for i = 0; x > 127; i++ { + keybuf = append(keybuf, 0x80|uint8(x&0x7F)) + x >>= 7 + } + keybuf = append(keybuf, uint8(x)) + return keybuf +} + +func (desc *FileDescriptorSet) GetField(packageName, messageName, fieldName string) *FieldDescriptorProto { + msg := desc.GetMessage(packageName, messageName) + if msg == nil { + return nil + } + for _, field := range msg.GetField() { + if field.GetName() == fieldName { + return field + } + } + return nil +} + +func (file *FileDescriptorProto) GetMessage(typeName string) *DescriptorProto { + for _, msg := range file.GetMessageType() { + if msg.GetName() == typeName { + return msg + } + nes := file.GetNestedMessage(msg, strings.TrimPrefix(typeName, msg.GetName()+".")) + if nes != nil { + return nes + } + } + return nil +} + +func (file *FileDescriptorProto) GetNestedMessage(msg *DescriptorProto, typeName string) *DescriptorProto { + for _, nes := range msg.GetNestedType() { + if nes.GetName() == typeName { + return nes + } + res := file.GetNestedMessage(nes, strings.TrimPrefix(typeName, nes.GetName()+".")) + if res != nil { + return res + } + } + return nil +} + +func (desc *FileDescriptorSet) GetMessage(packageName string, typeName string) *DescriptorProto { + for _, file := range desc.GetFile() { + if strings.Map(dotToUnderscore, file.GetPackage()) != strings.Map(dotToUnderscore, packageName) { + continue + } + for _, msg := range file.GetMessageType() { + if msg.GetName() == typeName { + return msg + } + } + for _, msg := range file.GetMessageType() { + for _, nes := range msg.GetNestedType() { + if nes.GetName() == typeName { + return nes + } + if msg.GetName()+"."+nes.GetName() == typeName { + return nes + } + } + } + } + return nil +} + +func (desc *FileDescriptorSet) IsProto3(packageName string, typeName string) bool { + for _, file := range desc.GetFile() { + if strings.Map(dotToUnderscore, file.GetPackage()) != strings.Map(dotToUnderscore, packageName) { + continue + } + for _, msg := range file.GetMessageType() { + if msg.GetName() == typeName { + return file.GetSyntax() == "proto3" + } + } + for _, msg := range file.GetMessageType() { + for _, nes := range msg.GetNestedType() { + if nes.GetName() == typeName { + return file.GetSyntax() == "proto3" + } + if msg.GetName()+"."+nes.GetName() == typeName { + return file.GetSyntax() == "proto3" + } + } + } + } + return false +} + +func (msg *DescriptorProto) IsExtendable() bool { + return len(msg.GetExtensionRange()) > 0 +} + +func (desc *FileDescriptorSet) FindExtension(packageName string, typeName string, fieldName string) (extPackageName string, field *FieldDescriptorProto) { + parent := desc.GetMessage(packageName, typeName) + if parent == nil { + return "", nil + } + if !parent.IsExtendable() { + return "", nil + } + extendee := "." + packageName + "." + typeName + for _, file := range desc.GetFile() { + for _, ext := range file.GetExtension() { + if strings.Map(dotToUnderscore, file.GetPackage()) == strings.Map(dotToUnderscore, packageName) { + if !(ext.GetExtendee() == typeName || ext.GetExtendee() == extendee) { + continue + } + } else { + if ext.GetExtendee() != extendee { + continue + } + } + if ext.GetName() == fieldName { + return file.GetPackage(), ext + } + } + } + return "", nil +} + +func (desc *FileDescriptorSet) FindExtensionByFieldNumber(packageName string, typeName string, fieldNum int32) (extPackageName string, field *FieldDescriptorProto) { + parent := desc.GetMessage(packageName, typeName) + if parent == nil { + return "", nil + } + if !parent.IsExtendable() { + return "", nil + } + extendee := "." + packageName + "." + typeName + for _, file := range desc.GetFile() { + for _, ext := range file.GetExtension() { + if strings.Map(dotToUnderscore, file.GetPackage()) == strings.Map(dotToUnderscore, packageName) { + if !(ext.GetExtendee() == typeName || ext.GetExtendee() == extendee) { + continue + } + } else { + if ext.GetExtendee() != extendee { + continue + } + } + if ext.GetNumber() == fieldNum { + return file.GetPackage(), ext + } + } + } + return "", nil +} + +func (desc *FileDescriptorSet) FindMessage(packageName string, typeName string, fieldName string) (msgPackageName string, msgName string) { + parent := desc.GetMessage(packageName, typeName) + if parent == nil { + return "", "" + } + field := parent.GetFieldDescriptor(fieldName) + if field == nil { + var extPackageName string + extPackageName, field = desc.FindExtension(packageName, typeName, fieldName) + if field == nil { + return "", "" + } + packageName = extPackageName + } + typeNames := strings.Split(field.GetTypeName(), ".") + if len(typeNames) == 1 { + msg := desc.GetMessage(packageName, typeName) + if msg == nil { + return "", "" + } + return packageName, msg.GetName() + } + if len(typeNames) > 2 { + for i := 1; i < len(typeNames)-1; i++ { + packageName = strings.Join(typeNames[1:len(typeNames)-i], ".") + typeName = strings.Join(typeNames[len(typeNames)-i:], ".") + msg := desc.GetMessage(packageName, typeName) + if msg != nil { + typeNames := strings.Split(msg.GetName(), ".") + if len(typeNames) == 1 { + return packageName, msg.GetName() + } + return strings.Join(typeNames[1:len(typeNames)-1], "."), typeNames[len(typeNames)-1] + } + } + } + return "", "" +} + +func (msg *DescriptorProto) GetFieldDescriptor(fieldName string) *FieldDescriptorProto { + for _, field := range msg.GetField() { + if field.GetName() == fieldName { + return field + } + } + return nil +} + +func (desc *FileDescriptorSet) GetEnum(packageName string, typeName string) *EnumDescriptorProto { + for _, file := range desc.GetFile() { + if strings.Map(dotToUnderscore, file.GetPackage()) != strings.Map(dotToUnderscore, packageName) { + continue + } + for _, enum := range file.GetEnumType() { + if enum.GetName() == typeName { + return enum + } + } + } + return nil +} + +func (f *FieldDescriptorProto) IsEnum() bool { + return *f.Type == FieldDescriptorProto_TYPE_ENUM +} + +func (f *FieldDescriptorProto) IsMessage() bool { + return *f.Type == FieldDescriptorProto_TYPE_MESSAGE +} + +func (f *FieldDescriptorProto) IsBytes() bool { + return *f.Type == FieldDescriptorProto_TYPE_BYTES +} + +func (f *FieldDescriptorProto) IsRepeated() bool { + return f.Label != nil && *f.Label == FieldDescriptorProto_LABEL_REPEATED +} + +func (f *FieldDescriptorProto) IsString() bool { + return *f.Type == FieldDescriptorProto_TYPE_STRING +} + +func (f *FieldDescriptorProto) IsBool() bool { + return *f.Type == FieldDescriptorProto_TYPE_BOOL +} + +func (f *FieldDescriptorProto) IsRequired() bool { + return f.Label != nil && *f.Label == FieldDescriptorProto_LABEL_REQUIRED +} + +func (f *FieldDescriptorProto) IsPacked() bool { + return f.Options != nil && f.GetOptions().GetPacked() +} + +func (f *FieldDescriptorProto) IsPacked3() bool { + if f.IsRepeated() && f.IsScalar() { + if f.Options == nil || f.GetOptions().Packed == nil { + return true + } + return f.Options != nil && f.GetOptions().GetPacked() + } + return false +} + +func (m *DescriptorProto) HasExtension() bool { + return len(m.ExtensionRange) > 0 +} diff --git a/vendor/github.com/golang/groupcache/LICENSE b/vendor/github.com/golang/groupcache/LICENSE new file mode 100644 index 00000000..37ec93a1 --- /dev/null +++ b/vendor/github.com/golang/groupcache/LICENSE @@ -0,0 +1,191 @@ +Apache License +Version 2.0, January 2004 +http://www.apache.org/licenses/ + +TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + +1. Definitions. + +"License" shall mean the terms and conditions for use, reproduction, and +distribution as defined by Sections 1 through 9 of this document. + +"Licensor" shall mean the copyright owner or entity authorized by the copyright +owner that is granting the License. + +"Legal Entity" shall mean the union of the acting entity and all other entities +that control, are controlled by, or are under common control with that entity. +For the purposes of this definition, "control" means (i) the power, direct or +indirect, to cause the direction or management of such entity, whether by +contract or otherwise, or (ii) ownership of fifty percent (50%) or more of the +outstanding shares, or (iii) beneficial ownership of such entity. + +"You" (or "Your") shall mean an individual or Legal Entity exercising +permissions granted by this License. + +"Source" form shall mean the preferred form for making modifications, including +but not limited to software source code, documentation source, and configuration +files. + +"Object" form shall mean any form resulting from mechanical transformation or +translation of a Source form, including but not limited to compiled object code, +generated documentation, and conversions to other media types. + +"Work" shall mean the work of authorship, whether in Source or Object form, made +available under the License, as indicated by a copyright notice that is included +in or attached to the work (an example is provided in the Appendix below). + +"Derivative Works" shall mean any work, whether in Source or Object form, that +is based on (or derived from) the Work and for which the editorial revisions, +annotations, elaborations, or other modifications represent, as a whole, an +original work of authorship. For the purposes of this License, Derivative Works +shall not include works that remain separable from, or merely link (or bind by +name) to the interfaces of, the Work and Derivative Works thereof. + +"Contribution" shall mean any work of authorship, including the original version +of the Work and any modifications or additions to that Work or Derivative Works +thereof, that is intentionally submitted to Licensor for inclusion in the Work +by the copyright owner or by an individual or Legal Entity authorized to submit +on behalf of the copyright owner. For the purposes of this definition, +"submitted" means any form of electronic, verbal, or written communication sent +to the Licensor or its representatives, including but not limited to +communication on electronic mailing lists, source code control systems, and +issue tracking systems that are managed by, or on behalf of, the Licensor for +the purpose of discussing and improving the Work, but excluding communication +that is conspicuously marked or otherwise designated in writing by the copyright +owner as "Not a Contribution." + +"Contributor" shall mean Licensor and any individual or Legal Entity on behalf +of whom a Contribution has been received by Licensor and subsequently +incorporated within the Work. + +2. Grant of Copyright License. + +Subject to the terms and conditions of this License, each Contributor hereby +grants to You a perpetual, worldwide, non-exclusive, no-charge, royalty-free, +irrevocable copyright license to reproduce, prepare Derivative Works of, +publicly display, publicly perform, sublicense, and distribute the Work and such +Derivative Works in Source or Object form. + +3. Grant of Patent License. + +Subject to the terms and conditions of this License, each Contributor hereby +grants to You a perpetual, worldwide, non-exclusive, no-charge, royalty-free, +irrevocable (except as stated in this section) patent license to make, have +made, use, offer to sell, sell, import, and otherwise transfer the Work, where +such license applies only to those patent claims licensable by such Contributor +that are necessarily infringed by their Contribution(s) alone or by combination +of their Contribution(s) with the Work to which such Contribution(s) was +submitted. If You institute patent litigation against any entity (including a +cross-claim or counterclaim in a lawsuit) alleging that the Work or a +Contribution incorporated within the Work constitutes direct or contributory +patent infringement, then any patent licenses granted to You under this License +for that Work shall terminate as of the date such litigation is filed. + +4. Redistribution. + +You may reproduce and distribute copies of the Work or Derivative Works thereof +in any medium, with or without modifications, and in Source or Object form, +provided that You meet the following conditions: + +You must give any other recipients of the Work or Derivative Works a copy of +this License; and +You must cause any modified files to carry prominent notices stating that You +changed the files; and +You must retain, in the Source form of any Derivative Works that You distribute, +all copyright, patent, trademark, and attribution notices from the Source form +of the Work, excluding those notices that do not pertain to any part of the +Derivative Works; and +If the Work includes a "NOTICE" text file as part of its distribution, then any +Derivative Works that You distribute must include a readable copy of the +attribution notices contained within such NOTICE file, excluding those notices +that do not pertain to any part of the Derivative Works, in at least one of the +following places: within a NOTICE text file distributed as part of the +Derivative Works; within the Source form or documentation, if provided along +with the Derivative Works; or, within a display generated by the Derivative +Works, if and wherever such third-party notices normally appear. The contents of +the NOTICE file are for informational purposes only and do not modify the +License. You may add Your own attribution notices within Derivative Works that +You distribute, alongside or as an addendum to the NOTICE text from the Work, +provided that such additional attribution notices cannot be construed as +modifying the License. +You may add Your own copyright statement to Your modifications and may provide +additional or different license terms and conditions for use, reproduction, or +distribution of Your modifications, or for any such Derivative Works as a whole, +provided Your use, reproduction, and distribution of the Work otherwise complies +with the conditions stated in this License. + +5. Submission of Contributions. + +Unless You explicitly state otherwise, any Contribution intentionally submitted +for inclusion in the Work by You to the Licensor shall be under the terms and +conditions of this License, without any additional terms or conditions. +Notwithstanding the above, nothing herein shall supersede or modify the terms of +any separate license agreement you may have executed with Licensor regarding +such Contributions. + +6. Trademarks. + +This License does not grant permission to use the trade names, trademarks, +service marks, or product names of the Licensor, except as required for +reasonable and customary use in describing the origin of the Work and +reproducing the content of the NOTICE file. + +7. Disclaimer of Warranty. + +Unless required by applicable law or agreed to in writing, Licensor provides the +Work (and each Contributor provides its Contributions) on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied, +including, without limitation, any warranties or conditions of TITLE, +NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A PARTICULAR PURPOSE. You are +solely responsible for determining the appropriateness of using or +redistributing the Work and assume any risks associated with Your exercise of +permissions under this License. + +8. Limitation of Liability. + +In no event and under no legal theory, whether in tort (including negligence), +contract, or otherwise, unless required by applicable law (such as deliberate +and grossly negligent acts) or agreed to in writing, shall any Contributor be +liable to You for damages, including any direct, indirect, special, incidental, +or consequential damages of any character arising as a result of this License or +out of the use or inability to use the Work (including but not limited to +damages for loss of goodwill, work stoppage, computer failure or malfunction, or +any and all other commercial damages or losses), even if such Contributor has +been advised of the possibility of such damages. + +9. Accepting Warranty or Additional Liability. + +While redistributing the Work or Derivative Works thereof, You may choose to +offer, and charge a fee for, acceptance of support, warranty, indemnity, or +other liability obligations and/or rights consistent with this License. However, +in accepting such obligations, You may act only on Your own behalf and on Your +sole responsibility, not on behalf of any other Contributor, and only if You +agree to indemnify, defend, and hold each Contributor harmless for any liability +incurred by, or claims asserted against, such Contributor by reason of your +accepting any such warranty or additional liability. + +END OF TERMS AND CONDITIONS + +APPENDIX: How to apply the Apache License to your work + +To apply the Apache License to your work, attach the following boilerplate +notice, with the fields enclosed by brackets "[]" replaced with your own +identifying information. (Don't include the brackets!) The text should be +enclosed in the appropriate comment syntax for the file format. We also +recommend that a file or class name and description of purpose be included on +the same "printed page" as the copyright notice for easier identification within +third-party archives. + + Copyright [yyyy] [name of copyright owner] + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. diff --git a/vendor/github.com/golang/groupcache/lru/lru.go b/vendor/github.com/golang/groupcache/lru/lru.go new file mode 100644 index 00000000..eac1c766 --- /dev/null +++ b/vendor/github.com/golang/groupcache/lru/lru.go @@ -0,0 +1,133 @@ +/* +Copyright 2013 Google Inc. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Package lru implements an LRU cache. +package lru + +import "container/list" + +// Cache is an LRU cache. It is not safe for concurrent access. +type Cache struct { + // MaxEntries is the maximum number of cache entries before + // an item is evicted. Zero means no limit. + MaxEntries int + + // OnEvicted optionally specifies a callback function to be + // executed when an entry is purged from the cache. + OnEvicted func(key Key, value interface{}) + + ll *list.List + cache map[interface{}]*list.Element +} + +// A Key may be any value that is comparable. See http://golang.org/ref/spec#Comparison_operators +type Key interface{} + +type entry struct { + key Key + value interface{} +} + +// New creates a new Cache. +// If maxEntries is zero, the cache has no limit and it's assumed +// that eviction is done by the caller. +func New(maxEntries int) *Cache { + return &Cache{ + MaxEntries: maxEntries, + ll: list.New(), + cache: make(map[interface{}]*list.Element), + } +} + +// Add adds a value to the cache. +func (c *Cache) Add(key Key, value interface{}) { + if c.cache == nil { + c.cache = make(map[interface{}]*list.Element) + c.ll = list.New() + } + if ee, ok := c.cache[key]; ok { + c.ll.MoveToFront(ee) + ee.Value.(*entry).value = value + return + } + ele := c.ll.PushFront(&entry{key, value}) + c.cache[key] = ele + if c.MaxEntries != 0 && c.ll.Len() > c.MaxEntries { + c.RemoveOldest() + } +} + +// Get looks up a key's value from the cache. +func (c *Cache) Get(key Key) (value interface{}, ok bool) { + if c.cache == nil { + return + } + if ele, hit := c.cache[key]; hit { + c.ll.MoveToFront(ele) + return ele.Value.(*entry).value, true + } + return +} + +// Remove removes the provided key from the cache. +func (c *Cache) Remove(key Key) { + if c.cache == nil { + return + } + if ele, hit := c.cache[key]; hit { + c.removeElement(ele) + } +} + +// RemoveOldest removes the oldest item from the cache. +func (c *Cache) RemoveOldest() { + if c.cache == nil { + return + } + ele := c.ll.Back() + if ele != nil { + c.removeElement(ele) + } +} + +func (c *Cache) removeElement(e *list.Element) { + c.ll.Remove(e) + kv := e.Value.(*entry) + delete(c.cache, kv.key) + if c.OnEvicted != nil { + c.OnEvicted(kv.key, kv.value) + } +} + +// Len returns the number of items in the cache. +func (c *Cache) Len() int { + if c.cache == nil { + return 0 + } + return c.ll.Len() +} + +// Clear purges all stored items from the cache. +func (c *Cache) Clear() { + if c.OnEvicted != nil { + for _, e := range c.cache { + kv := e.Value.(*entry) + c.OnEvicted(kv.key, kv.value) + } + } + c.ll = nil + c.cache = nil +} diff --git a/vendor/github.com/pkg/errors/.gitignore b/vendor/github.com/pkg/errors/.gitignore new file mode 100644 index 00000000..daf913b1 --- /dev/null +++ b/vendor/github.com/pkg/errors/.gitignore @@ -0,0 +1,24 @@ +# Compiled Object files, Static and Dynamic libs (Shared Objects) +*.o +*.a +*.so + +# Folders +_obj +_test + +# Architecture specific extensions/prefixes +*.[568vq] +[568vq].out + +*.cgo1.go +*.cgo2.c +_cgo_defun.c +_cgo_gotypes.go +_cgo_export.* + +_testmain.go + +*.exe +*.test +*.prof diff --git a/vendor/github.com/pkg/errors/.travis.yml b/vendor/github.com/pkg/errors/.travis.yml new file mode 100644 index 00000000..9159de03 --- /dev/null +++ b/vendor/github.com/pkg/errors/.travis.yml @@ -0,0 +1,10 @@ +language: go +go_import_path: github.com/pkg/errors +go: + - 1.11.x + - 1.12.x + - 1.13.x + - tip + +script: + - make check diff --git a/vendor/github.com/pkg/errors/LICENSE b/vendor/github.com/pkg/errors/LICENSE new file mode 100644 index 00000000..835ba3e7 --- /dev/null +++ b/vendor/github.com/pkg/errors/LICENSE @@ -0,0 +1,23 @@ +Copyright (c) 2015, Dave Cheney +All rights reserved. + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions are met: + +* Redistributions of source code must retain the above copyright notice, this + list of conditions and the following disclaimer. + +* Redistributions in binary form must reproduce the above copyright notice, + this list of conditions and the following disclaimer in the documentation + and/or other materials provided with the distribution. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" +AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE +IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE +DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE +FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL +DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR +SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER +CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, +OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/vendor/github.com/pkg/errors/Makefile b/vendor/github.com/pkg/errors/Makefile new file mode 100644 index 00000000..ce9d7cde --- /dev/null +++ b/vendor/github.com/pkg/errors/Makefile @@ -0,0 +1,44 @@ +PKGS := github.com/pkg/errors +SRCDIRS := $(shell go list -f '{{.Dir}}' $(PKGS)) +GO := go + +check: test vet gofmt misspell unconvert staticcheck ineffassign unparam + +test: + $(GO) test $(PKGS) + +vet: | test + $(GO) vet $(PKGS) + +staticcheck: + $(GO) get honnef.co/go/tools/cmd/staticcheck + staticcheck -checks all $(PKGS) + +misspell: + $(GO) get github.com/client9/misspell/cmd/misspell + misspell \ + -locale GB \ + -error \ + *.md *.go + +unconvert: + $(GO) get github.com/mdempsky/unconvert + unconvert -v $(PKGS) + +ineffassign: + $(GO) get github.com/gordonklaus/ineffassign + find $(SRCDIRS) -name '*.go' | xargs ineffassign + +pedantic: check errcheck + +unparam: + $(GO) get mvdan.cc/unparam + unparam ./... + +errcheck: + $(GO) get github.com/kisielk/errcheck + errcheck $(PKGS) + +gofmt: + @echo Checking code is gofmted + @test -z "$(shell gofmt -s -l -d -e $(SRCDIRS) | tee /dev/stderr)" diff --git a/vendor/github.com/pkg/errors/README.md b/vendor/github.com/pkg/errors/README.md new file mode 100644 index 00000000..54dfdcb1 --- /dev/null +++ b/vendor/github.com/pkg/errors/README.md @@ -0,0 +1,59 @@ +# errors [![Travis-CI](https://travis-ci.org/pkg/errors.svg)](https://travis-ci.org/pkg/errors) [![AppVeyor](https://ci.appveyor.com/api/projects/status/b98mptawhudj53ep/branch/master?svg=true)](https://ci.appveyor.com/project/davecheney/errors/branch/master) [![GoDoc](https://godoc.org/github.com/pkg/errors?status.svg)](http://godoc.org/github.com/pkg/errors) [![Report card](https://goreportcard.com/badge/github.com/pkg/errors)](https://goreportcard.com/report/github.com/pkg/errors) [![Sourcegraph](https://sourcegraph.com/github.com/pkg/errors/-/badge.svg)](https://sourcegraph.com/github.com/pkg/errors?badge) + +Package errors provides simple error handling primitives. + +`go get github.com/pkg/errors` + +The traditional error handling idiom in Go is roughly akin to +```go +if err != nil { + return err +} +``` +which applied recursively up the call stack results in error reports without context or debugging information. The errors package allows programmers to add context to the failure path in their code in a way that does not destroy the original value of the error. + +## Adding context to an error + +The errors.Wrap function returns a new error that adds context to the original error. For example +```go +_, err := ioutil.ReadAll(r) +if err != nil { + return errors.Wrap(err, "read failed") +} +``` +## Retrieving the cause of an error + +Using `errors.Wrap` constructs a stack of errors, adding context to the preceding error. Depending on the nature of the error it may be necessary to reverse the operation of errors.Wrap to retrieve the original error for inspection. Any error value which implements this interface can be inspected by `errors.Cause`. +```go +type causer interface { + Cause() error +} +``` +`errors.Cause` will recursively retrieve the topmost error which does not implement `causer`, which is assumed to be the original cause. For example: +```go +switch err := errors.Cause(err).(type) { +case *MyError: + // handle specifically +default: + // unknown error +} +``` + +[Read the package documentation for more information](https://godoc.org/github.com/pkg/errors). + +## Roadmap + +With the upcoming [Go2 error proposals](https://go.googlesource.com/proposal/+/master/design/go2draft.md) this package is moving into maintenance mode. The roadmap for a 1.0 release is as follows: + +- 0.9. Remove pre Go 1.9 and Go 1.10 support, address outstanding pull requests (if possible) +- 1.0. Final release. + +## Contributing + +Because of the Go2 errors changes, this package is not accepting proposals for new functionality. With that said, we welcome pull requests, bug fixes and issue reports. + +Before sending a PR, please discuss your change by raising an issue. + +## License + +BSD-2-Clause diff --git a/vendor/github.com/pkg/errors/appveyor.yml b/vendor/github.com/pkg/errors/appveyor.yml new file mode 100644 index 00000000..a932eade --- /dev/null +++ b/vendor/github.com/pkg/errors/appveyor.yml @@ -0,0 +1,32 @@ +version: build-{build}.{branch} + +clone_folder: C:\gopath\src\github.com\pkg\errors +shallow_clone: true # for startup speed + +environment: + GOPATH: C:\gopath + +platform: + - x64 + +# http://www.appveyor.com/docs/installed-software +install: + # some helpful output for debugging builds + - go version + - go env + # pre-installed MinGW at C:\MinGW is 32bit only + # but MSYS2 at C:\msys64 has mingw64 + - set PATH=C:\msys64\mingw64\bin;%PATH% + - gcc --version + - g++ --version + +build_script: + - go install -v ./... + +test_script: + - set PATH=C:\gopath\bin;%PATH% + - go test -v ./... + +#artifacts: +# - path: '%GOPATH%\bin\*.exe' +deploy: off diff --git a/vendor/github.com/pkg/errors/errors.go b/vendor/github.com/pkg/errors/errors.go new file mode 100644 index 00000000..161aea25 --- /dev/null +++ b/vendor/github.com/pkg/errors/errors.go @@ -0,0 +1,288 @@ +// Package errors provides simple error handling primitives. +// +// The traditional error handling idiom in Go is roughly akin to +// +// if err != nil { +// return err +// } +// +// which when applied recursively up the call stack results in error reports +// without context or debugging information. The errors package allows +// programmers to add context to the failure path in their code in a way +// that does not destroy the original value of the error. +// +// Adding context to an error +// +// The errors.Wrap function returns a new error that adds context to the +// original error by recording a stack trace at the point Wrap is called, +// together with the supplied message. For example +// +// _, err := ioutil.ReadAll(r) +// if err != nil { +// return errors.Wrap(err, "read failed") +// } +// +// If additional control is required, the errors.WithStack and +// errors.WithMessage functions destructure errors.Wrap into its component +// operations: annotating an error with a stack trace and with a message, +// respectively. +// +// Retrieving the cause of an error +// +// Using errors.Wrap constructs a stack of errors, adding context to the +// preceding error. Depending on the nature of the error it may be necessary +// to reverse the operation of errors.Wrap to retrieve the original error +// for inspection. Any error value which implements this interface +// +// type causer interface { +// Cause() error +// } +// +// can be inspected by errors.Cause. errors.Cause will recursively retrieve +// the topmost error that does not implement causer, which is assumed to be +// the original cause. For example: +// +// switch err := errors.Cause(err).(type) { +// case *MyError: +// // handle specifically +// default: +// // unknown error +// } +// +// Although the causer interface is not exported by this package, it is +// considered a part of its stable public interface. +// +// Formatted printing of errors +// +// All error values returned from this package implement fmt.Formatter and can +// be formatted by the fmt package. The following verbs are supported: +// +// %s print the error. If the error has a Cause it will be +// printed recursively. +// %v see %s +// %+v extended format. Each Frame of the error's StackTrace will +// be printed in detail. +// +// Retrieving the stack trace of an error or wrapper +// +// New, Errorf, Wrap, and Wrapf record a stack trace at the point they are +// invoked. This information can be retrieved with the following interface: +// +// type stackTracer interface { +// StackTrace() errors.StackTrace +// } +// +// The returned errors.StackTrace type is defined as +// +// type StackTrace []Frame +// +// The Frame type represents a call site in the stack trace. Frame supports +// the fmt.Formatter interface that can be used for printing information about +// the stack trace of this error. For example: +// +// if err, ok := err.(stackTracer); ok { +// for _, f := range err.StackTrace() { +// fmt.Printf("%+s:%d\n", f, f) +// } +// } +// +// Although the stackTracer interface is not exported by this package, it is +// considered a part of its stable public interface. +// +// See the documentation for Frame.Format for more details. +package errors + +import ( + "fmt" + "io" +) + +// New returns an error with the supplied message. +// New also records the stack trace at the point it was called. +func New(message string) error { + return &fundamental{ + msg: message, + stack: callers(), + } +} + +// Errorf formats according to a format specifier and returns the string +// as a value that satisfies error. +// Errorf also records the stack trace at the point it was called. +func Errorf(format string, args ...interface{}) error { + return &fundamental{ + msg: fmt.Sprintf(format, args...), + stack: callers(), + } +} + +// fundamental is an error that has a message and a stack, but no caller. +type fundamental struct { + msg string + *stack +} + +func (f *fundamental) Error() string { return f.msg } + +func (f *fundamental) Format(s fmt.State, verb rune) { + switch verb { + case 'v': + if s.Flag('+') { + io.WriteString(s, f.msg) + f.stack.Format(s, verb) + return + } + fallthrough + case 's': + io.WriteString(s, f.msg) + case 'q': + fmt.Fprintf(s, "%q", f.msg) + } +} + +// WithStack annotates err with a stack trace at the point WithStack was called. +// If err is nil, WithStack returns nil. +func WithStack(err error) error { + if err == nil { + return nil + } + return &withStack{ + err, + callers(), + } +} + +type withStack struct { + error + *stack +} + +func (w *withStack) Cause() error { return w.error } + +// Unwrap provides compatibility for Go 1.13 error chains. +func (w *withStack) Unwrap() error { return w.error } + +func (w *withStack) Format(s fmt.State, verb rune) { + switch verb { + case 'v': + if s.Flag('+') { + fmt.Fprintf(s, "%+v", w.Cause()) + w.stack.Format(s, verb) + return + } + fallthrough + case 's': + io.WriteString(s, w.Error()) + case 'q': + fmt.Fprintf(s, "%q", w.Error()) + } +} + +// Wrap returns an error annotating err with a stack trace +// at the point Wrap is called, and the supplied message. +// If err is nil, Wrap returns nil. +func Wrap(err error, message string) error { + if err == nil { + return nil + } + err = &withMessage{ + cause: err, + msg: message, + } + return &withStack{ + err, + callers(), + } +} + +// Wrapf returns an error annotating err with a stack trace +// at the point Wrapf is called, and the format specifier. +// If err is nil, Wrapf returns nil. +func Wrapf(err error, format string, args ...interface{}) error { + if err == nil { + return nil + } + err = &withMessage{ + cause: err, + msg: fmt.Sprintf(format, args...), + } + return &withStack{ + err, + callers(), + } +} + +// WithMessage annotates err with a new message. +// If err is nil, WithMessage returns nil. +func WithMessage(err error, message string) error { + if err == nil { + return nil + } + return &withMessage{ + cause: err, + msg: message, + } +} + +// WithMessagef annotates err with the format specifier. +// If err is nil, WithMessagef returns nil. +func WithMessagef(err error, format string, args ...interface{}) error { + if err == nil { + return nil + } + return &withMessage{ + cause: err, + msg: fmt.Sprintf(format, args...), + } +} + +type withMessage struct { + cause error + msg string +} + +func (w *withMessage) Error() string { return w.msg + ": " + w.cause.Error() } +func (w *withMessage) Cause() error { return w.cause } + +// Unwrap provides compatibility for Go 1.13 error chains. +func (w *withMessage) Unwrap() error { return w.cause } + +func (w *withMessage) Format(s fmt.State, verb rune) { + switch verb { + case 'v': + if s.Flag('+') { + fmt.Fprintf(s, "%+v\n", w.Cause()) + io.WriteString(s, w.msg) + return + } + fallthrough + case 's', 'q': + io.WriteString(s, w.Error()) + } +} + +// Cause returns the underlying cause of the error, if possible. +// An error value has a cause if it implements the following +// interface: +// +// type causer interface { +// Cause() error +// } +// +// If the error does not implement Cause, the original error will +// be returned. If the error is nil, nil will be returned without further +// investigation. +func Cause(err error) error { + type causer interface { + Cause() error + } + + for err != nil { + cause, ok := err.(causer) + if !ok { + break + } + err = cause.Cause() + } + return err +} diff --git a/vendor/github.com/pkg/errors/go113.go b/vendor/github.com/pkg/errors/go113.go new file mode 100644 index 00000000..be0d10d0 --- /dev/null +++ b/vendor/github.com/pkg/errors/go113.go @@ -0,0 +1,38 @@ +// +build go1.13 + +package errors + +import ( + stderrors "errors" +) + +// Is reports whether any error in err's chain matches target. +// +// The chain consists of err itself followed by the sequence of errors obtained by +// repeatedly calling Unwrap. +// +// An error is considered to match a target if it is equal to that target or if +// it implements a method Is(error) bool such that Is(target) returns true. +func Is(err, target error) bool { return stderrors.Is(err, target) } + +// As finds the first error in err's chain that matches target, and if so, sets +// target to that error value and returns true. +// +// The chain consists of err itself followed by the sequence of errors obtained by +// repeatedly calling Unwrap. +// +// An error matches target if the error's concrete value is assignable to the value +// pointed to by target, or if the error has a method As(interface{}) bool such that +// As(target) returns true. In the latter case, the As method is responsible for +// setting target. +// +// As will panic if target is not a non-nil pointer to either a type that implements +// error, or to any interface type. As returns false if err is nil. +func As(err error, target interface{}) bool { return stderrors.As(err, target) } + +// Unwrap returns the result of calling the Unwrap method on err, if err's +// type contains an Unwrap method returning error. +// Otherwise, Unwrap returns nil. +func Unwrap(err error) error { + return stderrors.Unwrap(err) +} diff --git a/vendor/github.com/pkg/errors/stack.go b/vendor/github.com/pkg/errors/stack.go new file mode 100644 index 00000000..779a8348 --- /dev/null +++ b/vendor/github.com/pkg/errors/stack.go @@ -0,0 +1,177 @@ +package errors + +import ( + "fmt" + "io" + "path" + "runtime" + "strconv" + "strings" +) + +// Frame represents a program counter inside a stack frame. +// For historical reasons if Frame is interpreted as a uintptr +// its value represents the program counter + 1. +type Frame uintptr + +// pc returns the program counter for this frame; +// multiple frames may have the same PC value. +func (f Frame) pc() uintptr { return uintptr(f) - 1 } + +// file returns the full path to the file that contains the +// function for this Frame's pc. +func (f Frame) file() string { + fn := runtime.FuncForPC(f.pc()) + if fn == nil { + return "unknown" + } + file, _ := fn.FileLine(f.pc()) + return file +} + +// line returns the line number of source code of the +// function for this Frame's pc. +func (f Frame) line() int { + fn := runtime.FuncForPC(f.pc()) + if fn == nil { + return 0 + } + _, line := fn.FileLine(f.pc()) + return line +} + +// name returns the name of this function, if known. +func (f Frame) name() string { + fn := runtime.FuncForPC(f.pc()) + if fn == nil { + return "unknown" + } + return fn.Name() +} + +// Format formats the frame according to the fmt.Formatter interface. +// +// %s source file +// %d source line +// %n function name +// %v equivalent to %s:%d +// +// Format accepts flags that alter the printing of some verbs, as follows: +// +// %+s function name and path of source file relative to the compile time +// GOPATH separated by \n\t (\n\t) +// %+v equivalent to %+s:%d +func (f Frame) Format(s fmt.State, verb rune) { + switch verb { + case 's': + switch { + case s.Flag('+'): + io.WriteString(s, f.name()) + io.WriteString(s, "\n\t") + io.WriteString(s, f.file()) + default: + io.WriteString(s, path.Base(f.file())) + } + case 'd': + io.WriteString(s, strconv.Itoa(f.line())) + case 'n': + io.WriteString(s, funcname(f.name())) + case 'v': + f.Format(s, 's') + io.WriteString(s, ":") + f.Format(s, 'd') + } +} + +// MarshalText formats a stacktrace Frame as a text string. The output is the +// same as that of fmt.Sprintf("%+v", f), but without newlines or tabs. +func (f Frame) MarshalText() ([]byte, error) { + name := f.name() + if name == "unknown" { + return []byte(name), nil + } + return []byte(fmt.Sprintf("%s %s:%d", name, f.file(), f.line())), nil +} + +// StackTrace is stack of Frames from innermost (newest) to outermost (oldest). +type StackTrace []Frame + +// Format formats the stack of Frames according to the fmt.Formatter interface. +// +// %s lists source files for each Frame in the stack +// %v lists the source file and line number for each Frame in the stack +// +// Format accepts flags that alter the printing of some verbs, as follows: +// +// %+v Prints filename, function, and line number for each Frame in the stack. +func (st StackTrace) Format(s fmt.State, verb rune) { + switch verb { + case 'v': + switch { + case s.Flag('+'): + for _, f := range st { + io.WriteString(s, "\n") + f.Format(s, verb) + } + case s.Flag('#'): + fmt.Fprintf(s, "%#v", []Frame(st)) + default: + st.formatSlice(s, verb) + } + case 's': + st.formatSlice(s, verb) + } +} + +// formatSlice will format this StackTrace into the given buffer as a slice of +// Frame, only valid when called with '%s' or '%v'. +func (st StackTrace) formatSlice(s fmt.State, verb rune) { + io.WriteString(s, "[") + for i, f := range st { + if i > 0 { + io.WriteString(s, " ") + } + f.Format(s, verb) + } + io.WriteString(s, "]") +} + +// stack represents a stack of program counters. +type stack []uintptr + +func (s *stack) Format(st fmt.State, verb rune) { + switch verb { + case 'v': + switch { + case st.Flag('+'): + for _, pc := range *s { + f := Frame(pc) + fmt.Fprintf(st, "\n%+v", f) + } + } + } +} + +func (s *stack) StackTrace() StackTrace { + f := make([]Frame, len(*s)) + for i := 0; i < len(f); i++ { + f[i] = Frame((*s)[i]) + } + return f +} + +func callers() *stack { + const depth = 32 + var pcs [depth]uintptr + n := runtime.Callers(3, pcs[:]) + var st stack = pcs[0:n] + return &st +} + +// funcname removes the path prefix component of a function's name reported by func.Name(). +func funcname(name string) string { + i := strings.LastIndex(name, "/") + name = name[i+1:] + i = strings.Index(name, ".") + return name[i+1:] +} diff --git a/vendor/go.opencensus.io/.gitignore b/vendor/go.opencensus.io/.gitignore new file mode 100644 index 00000000..74a6db47 --- /dev/null +++ b/vendor/go.opencensus.io/.gitignore @@ -0,0 +1,9 @@ +/.idea/ + +# go.opencensus.io/exporter/aws +/exporter/aws/ + +# Exclude vendor, use dep ensure after checkout: +/vendor/github.com/ +/vendor/golang.org/ +/vendor/google.golang.org/ diff --git a/vendor/go.opencensus.io/.travis.yml b/vendor/go.opencensus.io/.travis.yml new file mode 100644 index 00000000..bd6b66ee --- /dev/null +++ b/vendor/go.opencensus.io/.travis.yml @@ -0,0 +1,17 @@ +language: go + +go_import_path: go.opencensus.io + +go: + - 1.11.x + +env: + global: + GO111MODULE=on + +before_script: + - make install-tools + +script: + - make travis-ci + - go run internal/check/version.go # TODO move this to makefile diff --git a/vendor/go.opencensus.io/AUTHORS b/vendor/go.opencensus.io/AUTHORS new file mode 100644 index 00000000..e491a9e7 --- /dev/null +++ b/vendor/go.opencensus.io/AUTHORS @@ -0,0 +1 @@ +Google Inc. diff --git a/vendor/go.opencensus.io/CONTRIBUTING.md b/vendor/go.opencensus.io/CONTRIBUTING.md new file mode 100644 index 00000000..1ba3962c --- /dev/null +++ b/vendor/go.opencensus.io/CONTRIBUTING.md @@ -0,0 +1,63 @@ +# How to contribute + +We'd love to accept your patches and contributions to this project. There are +just a few small guidelines you need to follow. + +## Contributor License Agreement + +Contributions to this project must be accompanied by a Contributor License +Agreement. You (or your employer) retain the copyright to your contribution, +this simply gives us permission to use and redistribute your contributions as +part of the project. Head over to to see +your current agreements on file or to sign a new one. + +You generally only need to submit a CLA once, so if you've already submitted one +(even if it was for a different project), you probably don't need to do it +again. + +## Code reviews + +All submissions, including submissions by project members, require review. We +use GitHub pull requests for this purpose. Consult [GitHub Help] for more +information on using pull requests. + +[GitHub Help]: https://help.github.com/articles/about-pull-requests/ + +## Instructions + +Fork the repo, checkout the upstream repo to your GOPATH by: + +``` +$ go get -d go.opencensus.io +``` + +Add your fork as an origin: + +``` +cd $(go env GOPATH)/src/go.opencensus.io +git remote add fork git@github.com:YOUR_GITHUB_USERNAME/opencensus-go.git +``` + +Run tests: + +``` +$ make install-tools # Only first time. +$ make +``` + +Checkout a new branch, make modifications and push the branch to your fork: + +``` +$ git checkout -b feature +# edit files +$ git commit +$ git push fork feature +``` + +Open a pull request against the main opencensus-go repo. + +## General Notes +This project uses Appveyor and Travis for CI. + +The dependencies are managed with `go mod` if you work with the sources under your +`$GOPATH` you need to set the environment variable `GO111MODULE=on`. \ No newline at end of file diff --git a/vendor/go.opencensus.io/LICENSE b/vendor/go.opencensus.io/LICENSE new file mode 100644 index 00000000..7a4a3ea2 --- /dev/null +++ b/vendor/go.opencensus.io/LICENSE @@ -0,0 +1,202 @@ + + Apache License + Version 2.0, January 2004 + http://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + APPENDIX: How to apply the Apache License to your work. + + To apply the Apache License to your work, attach the following + boilerplate notice, with the fields enclosed by brackets "[]" + replaced with your own identifying information. (Don't include + the brackets!) The text should be enclosed in the appropriate + comment syntax for the file format. We also recommend that a + file or class name and description of purpose be included on the + same "printed page" as the copyright notice for easier + identification within third-party archives. + + Copyright [yyyy] [name of copyright owner] + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. \ No newline at end of file diff --git a/vendor/go.opencensus.io/Makefile b/vendor/go.opencensus.io/Makefile new file mode 100644 index 00000000..457866cb --- /dev/null +++ b/vendor/go.opencensus.io/Makefile @@ -0,0 +1,96 @@ +# TODO: Fix this on windows. +ALL_SRC := $(shell find . -name '*.go' \ + -not -path './vendor/*' \ + -not -path '*/gen-go/*' \ + -type f | sort) +ALL_PKGS := $(shell go list $(sort $(dir $(ALL_SRC)))) + +GOTEST_OPT?=-v -race -timeout 30s +GOTEST_OPT_WITH_COVERAGE = $(GOTEST_OPT) -coverprofile=coverage.txt -covermode=atomic +GOTEST=go test +GOFMT=gofmt +GOLINT=golint +GOVET=go vet +EMBEDMD=embedmd +# TODO decide if we need to change these names. +TRACE_ID_LINT_EXCEPTION="type name will be used as trace.TraceID by other packages" +TRACE_OPTION_LINT_EXCEPTION="type name will be used as trace.TraceOptions by other packages" +README_FILES := $(shell find . -name '*README.md' | sort | tr '\n' ' ') + +.DEFAULT_GOAL := fmt-lint-vet-embedmd-test + +.PHONY: fmt-lint-vet-embedmd-test +fmt-lint-vet-embedmd-test: fmt lint vet embedmd test + +# TODO enable test-with-coverage in tavis +.PHONY: travis-ci +travis-ci: fmt lint vet embedmd test test-386 + +all-pkgs: + @echo $(ALL_PKGS) | tr ' ' '\n' | sort + +all-srcs: + @echo $(ALL_SRC) | tr ' ' '\n' | sort + +.PHONY: test +test: + $(GOTEST) $(GOTEST_OPT) $(ALL_PKGS) + +.PHONY: test-386 +test-386: + GOARCH=386 $(GOTEST) -v -timeout 30s $(ALL_PKGS) + +.PHONY: test-with-coverage +test-with-coverage: + $(GOTEST) $(GOTEST_OPT_WITH_COVERAGE) $(ALL_PKGS) + +.PHONY: fmt +fmt: + @FMTOUT=`$(GOFMT) -s -l $(ALL_SRC) 2>&1`; \ + if [ "$$FMTOUT" ]; then \ + echo "$(GOFMT) FAILED => gofmt the following files:\n"; \ + echo "$$FMTOUT\n"; \ + exit 1; \ + else \ + echo "Fmt finished successfully"; \ + fi + +.PHONY: lint +lint: + @LINTOUT=`$(GOLINT) $(ALL_PKGS) | grep -v $(TRACE_ID_LINT_EXCEPTION) | grep -v $(TRACE_OPTION_LINT_EXCEPTION) 2>&1`; \ + if [ "$$LINTOUT" ]; then \ + echo "$(GOLINT) FAILED => clean the following lint errors:\n"; \ + echo "$$LINTOUT\n"; \ + exit 1; \ + else \ + echo "Lint finished successfully"; \ + fi + +.PHONY: vet +vet: + # TODO: Understand why go vet downloads "github.com/google/go-cmp v0.2.0" + @VETOUT=`$(GOVET) ./... | grep -v "go: downloading" 2>&1`; \ + if [ "$$VETOUT" ]; then \ + echo "$(GOVET) FAILED => go vet the following files:\n"; \ + echo "$$VETOUT\n"; \ + exit 1; \ + else \ + echo "Vet finished successfully"; \ + fi + +.PHONY: embedmd +embedmd: + @EMBEDMDOUT=`$(EMBEDMD) -d $(README_FILES) 2>&1`; \ + if [ "$$EMBEDMDOUT" ]; then \ + echo "$(EMBEDMD) FAILED => embedmd the following files:\n"; \ + echo "$$EMBEDMDOUT\n"; \ + exit 1; \ + else \ + echo "Embedmd finished successfully"; \ + fi + +.PHONY: install-tools +install-tools: + go get -u golang.org/x/tools/cmd/cover + go get -u golang.org/x/lint/golint + go get -u github.com/rakyll/embedmd diff --git a/vendor/go.opencensus.io/README.md b/vendor/go.opencensus.io/README.md new file mode 100644 index 00000000..1d7e8371 --- /dev/null +++ b/vendor/go.opencensus.io/README.md @@ -0,0 +1,267 @@ +# OpenCensus Libraries for Go + +[![Build Status][travis-image]][travis-url] +[![Windows Build Status][appveyor-image]][appveyor-url] +[![GoDoc][godoc-image]][godoc-url] +[![Gitter chat][gitter-image]][gitter-url] + +OpenCensus Go is a Go implementation of OpenCensus, a toolkit for +collecting application performance and behavior monitoring data. +Currently it consists of three major components: tags, stats and tracing. + +#### OpenCensus and OpenTracing have merged to form OpenTelemetry, which serves as the next major version of OpenCensus and OpenTracing. OpenTelemetry will offer backwards compatibility with existing OpenCensus integrations, and we will continue to make security patches to existing OpenCensus libraries for two years. Read more about the merger [here](https://medium.com/opentracing/a-roadmap-to-convergence-b074e5815289). + +## Installation + +``` +$ go get -u go.opencensus.io +``` + +The API of this project is still evolving, see: [Deprecation Policy](#deprecation-policy). +The use of vendoring or a dependency management tool is recommended. + +## Prerequisites + +OpenCensus Go libraries require Go 1.8 or later. + +## Getting Started + +The easiest way to get started using OpenCensus in your application is to use an existing +integration with your RPC framework: + +* [net/http](https://godoc.org/go.opencensus.io/plugin/ochttp) +* [gRPC](https://godoc.org/go.opencensus.io/plugin/ocgrpc) +* [database/sql](https://godoc.org/github.com/opencensus-integrations/ocsql) +* [Go kit](https://godoc.org/github.com/go-kit/kit/tracing/opencensus) +* [Groupcache](https://godoc.org/github.com/orijtech/groupcache) +* [Caddy webserver](https://godoc.org/github.com/orijtech/caddy) +* [MongoDB](https://godoc.org/github.com/orijtech/mongo-go-driver) +* [Redis gomodule/redigo](https://godoc.org/github.com/orijtech/redigo) +* [Redis goredis/redis](https://godoc.org/github.com/orijtech/redis) +* [Memcache](https://godoc.org/github.com/orijtech/gomemcache) + +If you're using a framework not listed here, you could either implement your own middleware for your +framework or use [custom stats](#stats) and [spans](#spans) directly in your application. + +## Exporters + +OpenCensus can export instrumentation data to various backends. +OpenCensus has exporter implementations for the following, users +can implement their own exporters by implementing the exporter interfaces +([stats](https://godoc.org/go.opencensus.io/stats/view#Exporter), +[trace](https://godoc.org/go.opencensus.io/trace#Exporter)): + +* [Prometheus][exporter-prom] for stats +* [OpenZipkin][exporter-zipkin] for traces +* [Stackdriver][exporter-stackdriver] Monitoring for stats and Trace for traces +* [Jaeger][exporter-jaeger] for traces +* [AWS X-Ray][exporter-xray] for traces +* [Datadog][exporter-datadog] for stats and traces +* [Graphite][exporter-graphite] for stats +* [Honeycomb][exporter-honeycomb] for traces +* [New Relic][exporter-newrelic] for stats and traces + +## Overview + +![OpenCensus Overview](https://i.imgur.com/cf4ElHE.jpg) + +In a microservices environment, a user request may go through +multiple services until there is a response. OpenCensus allows +you to instrument your services and collect diagnostics data all +through your services end-to-end. + +## Tags + +Tags represent propagated key-value pairs. They are propagated using `context.Context` +in the same process or can be encoded to be transmitted on the wire. Usually, this will +be handled by an integration plugin, e.g. `ocgrpc.ServerHandler` and `ocgrpc.ClientHandler` +for gRPC. + +Package `tag` allows adding or modifying tags in the current context. + +[embedmd]:# (internal/readme/tags.go new) +```go +ctx, err := tag.New(ctx, + tag.Insert(osKey, "macOS-10.12.5"), + tag.Upsert(userIDKey, "cde36753ed"), +) +if err != nil { + log.Fatal(err) +} +``` + +## Stats + +OpenCensus is a low-overhead framework even if instrumentation is always enabled. +In order to be so, it is optimized to make recording of data points fast +and separate from the data aggregation. + +OpenCensus stats collection happens in two stages: + +* Definition of measures and recording of data points +* Definition of views and aggregation of the recorded data + +### Recording + +Measurements are data points associated with a measure. +Recording implicitly tags the set of Measurements with the tags from the +provided context: + +[embedmd]:# (internal/readme/stats.go record) +```go +stats.Record(ctx, videoSize.M(102478)) +``` + +### Views + +Views are how Measures are aggregated. You can think of them as queries over the +set of recorded data points (measurements). + +Views have two parts: the tags to group by and the aggregation type used. + +Currently three types of aggregations are supported: +* CountAggregation is used to count the number of times a sample was recorded. +* DistributionAggregation is used to provide a histogram of the values of the samples. +* SumAggregation is used to sum up all sample values. + +[embedmd]:# (internal/readme/stats.go aggs) +```go +distAgg := view.Distribution(1<<32, 2<<32, 3<<32) +countAgg := view.Count() +sumAgg := view.Sum() +``` + +Here we create a view with the DistributionAggregation over our measure. + +[embedmd]:# (internal/readme/stats.go view) +```go +if err := view.Register(&view.View{ + Name: "example.com/video_size_distribution", + Description: "distribution of processed video size over time", + Measure: videoSize, + Aggregation: view.Distribution(1<<32, 2<<32, 3<<32), +}); err != nil { + log.Fatalf("Failed to register view: %v", err) +} +``` + +Register begins collecting data for the view. Registered views' data will be +exported via the registered exporters. + +## Traces + +A distributed trace tracks the progression of a single user request as +it is handled by the services and processes that make up an application. +Each step is called a span in the trace. Spans include metadata about the step, +including especially the time spent in the step, called the span’s latency. + +Below you see a trace and several spans underneath it. + +![Traces and spans](https://i.imgur.com/7hZwRVj.png) + +### Spans + +Span is the unit step in a trace. Each span has a name, latency, status and +additional metadata. + +Below we are starting a span for a cache read and ending it +when we are done: + +[embedmd]:# (internal/readme/trace.go startend) +```go +ctx, span := trace.StartSpan(ctx, "cache.Get") +defer span.End() + +// Do work to get from cache. +``` + +### Propagation + +Spans can have parents or can be root spans if they don't have any parents. +The current span is propagated in-process and across the network to allow associating +new child spans with the parent. + +In the same process, `context.Context` is used to propagate spans. +`trace.StartSpan` creates a new span as a root if the current context +doesn't contain a span. Or, it creates a child of the span that is +already in current context. The returned context can be used to keep +propagating the newly created span in the current context. + +[embedmd]:# (internal/readme/trace.go startend) +```go +ctx, span := trace.StartSpan(ctx, "cache.Get") +defer span.End() + +// Do work to get from cache. +``` + +Across the network, OpenCensus provides different propagation +methods for different protocols. + +* gRPC integrations use the OpenCensus' [binary propagation format](https://godoc.org/go.opencensus.io/trace/propagation). +* HTTP integrations use Zipkin's [B3](https://github.com/openzipkin/b3-propagation) + by default but can be configured to use a custom propagation method by setting another + [propagation.HTTPFormat](https://godoc.org/go.opencensus.io/trace/propagation#HTTPFormat). + +## Execution Tracer + +With Go 1.11, OpenCensus Go will support integration with the Go execution tracer. +See [Debugging Latency in Go](https://medium.com/observability/debugging-latency-in-go-1-11-9f97a7910d68) +for an example of their mutual use. + +## Profiles + +OpenCensus tags can be applied as profiler labels +for users who are on Go 1.9 and above. + +[embedmd]:# (internal/readme/tags.go profiler) +```go +ctx, err = tag.New(ctx, + tag.Insert(osKey, "macOS-10.12.5"), + tag.Insert(userIDKey, "fff0989878"), +) +if err != nil { + log.Fatal(err) +} +tag.Do(ctx, func(ctx context.Context) { + // Do work. + // When profiling is on, samples will be + // recorded with the key/values from the tag map. +}) +``` + +A screenshot of the CPU profile from the program above: + +![CPU profile](https://i.imgur.com/jBKjlkw.png) + +## Deprecation Policy + +Before version 1.0.0, the following deprecation policy will be observed: + +No backwards-incompatible changes will be made except for the removal of symbols that have +been marked as *Deprecated* for at least one minor release (e.g. 0.9.0 to 0.10.0). A release +removing the *Deprecated* functionality will be made no sooner than 28 days after the first +release in which the functionality was marked *Deprecated*. + +[travis-image]: https://travis-ci.org/census-instrumentation/opencensus-go.svg?branch=master +[travis-url]: https://travis-ci.org/census-instrumentation/opencensus-go +[appveyor-image]: https://ci.appveyor.com/api/projects/status/vgtt29ps1783ig38?svg=true +[appveyor-url]: https://ci.appveyor.com/project/opencensusgoteam/opencensus-go/branch/master +[godoc-image]: https://godoc.org/go.opencensus.io?status.svg +[godoc-url]: https://godoc.org/go.opencensus.io +[gitter-image]: https://badges.gitter.im/census-instrumentation/lobby.svg +[gitter-url]: https://gitter.im/census-instrumentation/lobby?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge + + +[new-ex]: https://godoc.org/go.opencensus.io/tag#example-NewMap +[new-replace-ex]: https://godoc.org/go.opencensus.io/tag#example-NewMap--Replace + +[exporter-prom]: https://godoc.org/contrib.go.opencensus.io/exporter/prometheus +[exporter-stackdriver]: https://godoc.org/contrib.go.opencensus.io/exporter/stackdriver +[exporter-zipkin]: https://godoc.org/contrib.go.opencensus.io/exporter/zipkin +[exporter-jaeger]: https://godoc.org/contrib.go.opencensus.io/exporter/jaeger +[exporter-xray]: https://github.com/census-ecosystem/opencensus-go-exporter-aws +[exporter-datadog]: https://github.com/DataDog/opencensus-go-exporter-datadog +[exporter-graphite]: https://github.com/census-ecosystem/opencensus-go-exporter-graphite +[exporter-honeycomb]: https://github.com/honeycombio/opencensus-exporter +[exporter-newrelic]: https://github.com/newrelic/newrelic-opencensus-exporter-go diff --git a/vendor/go.opencensus.io/appveyor.yml b/vendor/go.opencensus.io/appveyor.yml new file mode 100644 index 00000000..d08f0eda --- /dev/null +++ b/vendor/go.opencensus.io/appveyor.yml @@ -0,0 +1,24 @@ +version: "{build}" + +platform: x64 + +clone_folder: c:\gopath\src\go.opencensus.io + +environment: + GOPATH: 'c:\gopath' + GO111MODULE: 'on' + CGO_ENABLED: '0' # See: https://github.com/appveyor/ci/issues/2613 + +stack: go 1.11 + +before_test: + - go version + - go env + +build: false +deploy: false + +test_script: + - cd %APPVEYOR_BUILD_FOLDER% + - go build -v .\... + - go test -v .\... # No -race because cgo is disabled diff --git a/vendor/go.opencensus.io/go.mod b/vendor/go.opencensus.io/go.mod new file mode 100644 index 00000000..c867df5f --- /dev/null +++ b/vendor/go.opencensus.io/go.mod @@ -0,0 +1,15 @@ +module go.opencensus.io + +require ( + github.com/golang/groupcache v0.0.0-20190702054246-869f871628b6 + github.com/golang/protobuf v1.3.1 + github.com/google/go-cmp v0.3.0 + github.com/stretchr/testify v1.4.0 + golang.org/x/net v0.0.0-20190620200207-3b0461eec859 + golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd // indirect + golang.org/x/text v0.3.2 // indirect + google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb // indirect + google.golang.org/grpc v1.20.1 +) + +go 1.13 diff --git a/vendor/go.opencensus.io/go.sum b/vendor/go.opencensus.io/go.sum new file mode 100644 index 00000000..01c02972 --- /dev/null +++ b/vendor/go.opencensus.io/go.sum @@ -0,0 +1,74 @@ +cloud.google.com/go v0.26.0/go.mod h1:aQUYkXzVsufM+DwF1aE+0xfcU+56JwCaLick0ClmMTw= +github.com/BurntSushi/toml v0.3.1/go.mod h1:xHWCNGjB5oqiDr8zfno3MHue2Ht5sIBksp03qcyfWMU= +github.com/client9/misspell v0.3.4/go.mod h1:qj6jICC3Q7zFZvVWo7KLAzC3yx5G7kyvSDkc90ppPyw= +github.com/davecgh/go-spew v1.1.0 h1:ZDRjVQ15GmhC3fiQ8ni8+OwkZQO4DARzQgrnXU1Liz8= +github.com/davecgh/go-spew v1.1.0/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38= +github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b h1:VKtxabqXZkF25pY9ekfRL6a582T4P37/31XEstQ5p58= +github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b/go.mod h1:SBH7ygxi8pfUlaOkMMuAQtPIUF8ecWP5IEl/CR7VP2Q= +github.com/golang/groupcache v0.0.0-20190702054246-869f871628b6 h1:ZgQEtGgCBiWRM39fZuwSd1LwSqqSW0hOdXCYYDX0R3I= +github.com/golang/groupcache v0.0.0-20190702054246-869f871628b6/go.mod h1:cIg4eruTrX1D+g88fzRXU5OdNfaM+9IcxsU14FzY7Hc= +github.com/golang/mock v1.1.1/go.mod h1:oTYuIxOrZwtPieC+H1uAHpcLFnEyAGVDL/k47Jfbm0A= +github.com/golang/protobuf v1.2.0 h1:P3YflyNX/ehuJFLhxviNdFxQPkGK5cDcApsge1SqnvM= +github.com/golang/protobuf v1.2.0/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= +github.com/golang/protobuf v1.3.1 h1:YF8+flBXS5eO826T4nzqPrxfhQThhXl0YzfuUPu4SBg= +github.com/golang/protobuf v1.3.1/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= +github.com/google/go-cmp v0.3.0 h1:crn/baboCvb5fXaQ0IJ1SGTsTVrWpDsCWC8EGETZijY= +github.com/google/go-cmp v0.3.0/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU= +github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM= +github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4= +github.com/stretchr/objx v0.1.0/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME= +github.com/stretchr/testify v1.4.0 h1:2E4SXV/wtOkTonXsotYi4li6zVWxYlZuYNCXe9XRJyk= +github.com/stretchr/testify v1.4.0/go.mod h1:j7eGeouHqKxXV5pUuKE4zz7dFj8WfuZ+81PSLYec5m4= +golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACkg1iLfiJU5Ep61QUkGW8qpdssI0+w= +golang.org/x/exp v0.0.0-20190121172915-509febef88a4/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA= +golang.org/x/lint v0.0.0-20181026193005-c67002cb31c3/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE= +golang.org/x/lint v0.0.0-20190227174305-5b3e6a55c961/go.mod h1:wehouNa3lNwaWXcvxsM5YxQ5yQlVC4a0KAMCusXpPoU= +golang.org/x/lint v0.0.0-20190313153728-d0100b6bd8b3 h1:XQyxROzUlZH+WIQwySDgnISgOivlhjIEwaQaJEJrrN0= +golang.org/x/lint v0.0.0-20190313153728-d0100b6bd8b3/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc= +golang.org/x/net v0.0.0-20180724234803-3673e40ba225/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20180826012351-8a410e7b638d/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20190213061140-3a22650c66bd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20190311183353-d8887717615a h1:oWX7TPOiFAMXLq8o0ikBYfCJVlRHBcsciT5bXOrH628= +golang.org/x/net v0.0.0-20190311183353-d8887717615a/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= +golang.org/x/net v0.0.0-20190620200207-3b0461eec859 h1:R/3boaszxrf1GEUWTVDzSKVwLmSJpwZ1yqXm8j0v2QI= +golang.org/x/net v0.0.0-20190620200207-3b0461eec859/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= +golang.org/x/oauth2 v0.0.0-20180821212333-d2e6202438be/go.mod h1:N/0e6XlmueqKjAGxoOufVs8QHGRruUQn6yWY3a++T0U= +golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f h1:wMNYb4v58l5UBM7MYRLPG6ZhfOqbKu7X5eyFl8ZhKvA= +golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20181108010431-42b317875d0f h1:Bl/8QSvNqXvPGPGXa2z5xUTmV7VDcZyvRZ+QQXkXTZQ= +golang.org/x/sync v0.0.0-20181108010431-42b317875d0f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6 h1:bjcUS9ztw9kFmmIxJInhon/0Is3p+EHBKNgquIzo1OI= +golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sys v0.0.0-20180830151530-49385e6e1522/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a h1:1BGLXjeY4akVXGgbC9HugT3Jv3hCI0z56oJR5vAMgBU= +golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd h1:r7DufRZuZbWB7j439YfAzP8RPDa9unLkpwQKUYbIMPI= +golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/text v0.3.0 h1:g61tztE5qeGQ89tm6NTjjM9VPIm088od1l6aSorWRWg= +golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= +golang.org/x/text v0.3.2 h1:tW2bmiBqwgJj/UpqtC8EpXEZVYOwU0yG4iWbprSVAcs= +golang.org/x/text v0.3.2/go.mod h1:bEr9sfX3Q8Zfm5fL9x+3itogRgK3+ptLWKqgva+5dAk= +golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20190114222345-bf090417da8b/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20190114222345-bf090417da8b/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20190226205152-f727befe758c/go.mod h1:9Yl7xja0Znq3iFh3HoIrodX9oNMXvdceNzlUR8zjMvY= +golang.org/x/tools v0.0.0-20190226205152-f727befe758c/go.mod h1:9Yl7xja0Znq3iFh3HoIrodX9oNMXvdceNzlUR8zjMvY= +golang.org/x/tools v0.0.0-20190311212946-11955173bddd h1:/e+gpKk9r3dJobndpTytxS2gOy6m5uvpg+ISQoEcusQ= +golang.org/x/tools v0.0.0-20190311212946-11955173bddd/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs= +google.golang.org/appengine v1.1.0/go.mod h1:EbEs0AVv82hx2wNQdGPgUI5lhzA/G0D9YwlJXL52JkM= +google.golang.org/appengine v1.4.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4= +google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8 h1:Nw54tB0rB7hY/N0NQvRW8DG4Yk3Q6T9cu9RcFQDu1tc= +google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8/go.mod h1:JiN7NxoALGmiZfu7CAH4rXhgtRTLTxftemlI0sWmxmc= +google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb h1:i1Ppqkc3WQXikh8bXiwHqAN5Rv3/qDCcRk0/Otx73BY= +google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE= +google.golang.org/grpc v1.19.0 h1:cfg4PD8YEdSFnm7qLV4++93WcmhH2nIUhMjhdCvl3j8= +google.golang.org/grpc v1.19.0 h1:cfg4PD8YEdSFnm7qLV4++93WcmhH2nIUhMjhdCvl3j8= +google.golang.org/grpc v1.19.0/go.mod h1:mqu4LbDTu4XGKhr4mRzUsmM4RtVoemTSY81AxZiDr8c= +google.golang.org/grpc v1.19.0/go.mod h1:mqu4LbDTu4XGKhr4mRzUsmM4RtVoemTSY81AxZiDr8c= +google.golang.org/grpc v1.20.1 h1:Hz2g2wirWK7H0qIIhGIqRGTuMwTE8HEKFnDZZ7lm9NU= +google.golang.org/grpc v1.20.1/go.mod h1:10oTOabMzJvdu6/UiuZezV6QK5dSlG84ov/aaiqXj38= +gopkg.in/check.v1 v0.0.0-20161208181325-20d25e280405 h1:yhCVgyC4o1eVCa2tZl7eS0r+SDo693bJlVdllGtEeKM= +gopkg.in/check.v1 v0.0.0-20161208181325-20d25e280405/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0= +gopkg.in/yaml.v2 v2.2.2 h1:ZCJp+EgiOT7lHqUV2J862kp8Qj64Jo6az82+3Td9dZw= +gopkg.in/yaml.v2 v2.2.2/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI= +honnef.co/go/tools v0.0.0-20190102054323-c2f93a96b099/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4= diff --git a/vendor/go.opencensus.io/internal/internal.go b/vendor/go.opencensus.io/internal/internal.go new file mode 100644 index 00000000..81dc7183 --- /dev/null +++ b/vendor/go.opencensus.io/internal/internal.go @@ -0,0 +1,37 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package internal // import "go.opencensus.io/internal" + +import ( + "fmt" + "time" + + opencensus "go.opencensus.io" +) + +// UserAgent is the user agent to be added to the outgoing +// requests from the exporters. +var UserAgent = fmt.Sprintf("opencensus-go/%s", opencensus.Version()) + +// MonotonicEndTime returns the end time at present +// but offset from start, monotonically. +// +// The monotonic clock is used in subtractions hence +// the duration since start added back to start gives +// end as a monotonic time. +// See https://golang.org/pkg/time/#hdr-Monotonic_Clocks +func MonotonicEndTime(start time.Time) time.Time { + return start.Add(time.Since(start)) +} diff --git a/vendor/go.opencensus.io/internal/sanitize.go b/vendor/go.opencensus.io/internal/sanitize.go new file mode 100644 index 00000000..de8ccf23 --- /dev/null +++ b/vendor/go.opencensus.io/internal/sanitize.go @@ -0,0 +1,50 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package internal + +import ( + "strings" + "unicode" +) + +const labelKeySizeLimit = 100 + +// Sanitize returns a string that is trunacated to 100 characters if it's too +// long, and replaces non-alphanumeric characters to underscores. +func Sanitize(s string) string { + if len(s) == 0 { + return s + } + if len(s) > labelKeySizeLimit { + s = s[:labelKeySizeLimit] + } + s = strings.Map(sanitizeRune, s) + if unicode.IsDigit(rune(s[0])) { + s = "key_" + s + } + if s[0] == '_' { + s = "key" + s + } + return s +} + +// converts anything that is not a letter or digit to an underscore +func sanitizeRune(r rune) rune { + if unicode.IsLetter(r) || unicode.IsDigit(r) { + return r + } + // Everything else turns into an underscore + return '_' +} diff --git a/vendor/go.opencensus.io/internal/traceinternals.go b/vendor/go.opencensus.io/internal/traceinternals.go new file mode 100644 index 00000000..073af7b4 --- /dev/null +++ b/vendor/go.opencensus.io/internal/traceinternals.go @@ -0,0 +1,53 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package internal + +import ( + "time" +) + +// Trace allows internal access to some trace functionality. +// TODO(#412): remove this +var Trace interface{} + +// LocalSpanStoreEnabled true if the local span store is enabled. +var LocalSpanStoreEnabled bool + +// BucketConfiguration stores the number of samples to store for span buckets +// for successful and failed spans for a particular span name. +type BucketConfiguration struct { + Name string + MaxRequestsSucceeded int + MaxRequestsErrors int +} + +// PerMethodSummary is a summary of the spans stored for a single span name. +type PerMethodSummary struct { + Active int + LatencyBuckets []LatencyBucketSummary + ErrorBuckets []ErrorBucketSummary +} + +// LatencyBucketSummary is a summary of a latency bucket. +type LatencyBucketSummary struct { + MinLatency, MaxLatency time.Duration + Size int +} + +// ErrorBucketSummary is a summary of an error bucket. +type ErrorBucketSummary struct { + ErrorCode int32 + Size int +} diff --git a/vendor/go.opencensus.io/opencensus.go b/vendor/go.opencensus.io/opencensus.go new file mode 100644 index 00000000..e5e4b436 --- /dev/null +++ b/vendor/go.opencensus.io/opencensus.go @@ -0,0 +1,21 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// Package opencensus contains Go support for OpenCensus. +package opencensus // import "go.opencensus.io" + +// Version is the current release version of OpenCensus in use. +func Version() string { + return "0.23.0" +} diff --git a/vendor/go.opencensus.io/trace/basetypes.go b/vendor/go.opencensus.io/trace/basetypes.go new file mode 100644 index 00000000..0c54492a --- /dev/null +++ b/vendor/go.opencensus.io/trace/basetypes.go @@ -0,0 +1,119 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "fmt" + "time" +) + +type ( + // TraceID is a 16-byte identifier for a set of spans. + TraceID [16]byte + + // SpanID is an 8-byte identifier for a single span. + SpanID [8]byte +) + +func (t TraceID) String() string { + return fmt.Sprintf("%02x", t[:]) +} + +func (s SpanID) String() string { + return fmt.Sprintf("%02x", s[:]) +} + +// Annotation represents a text annotation with a set of attributes and a timestamp. +type Annotation struct { + Time time.Time + Message string + Attributes map[string]interface{} +} + +// Attribute represents a key-value pair on a span, link or annotation. +// Construct with one of: BoolAttribute, Int64Attribute, or StringAttribute. +type Attribute struct { + key string + value interface{} +} + +// BoolAttribute returns a bool-valued attribute. +func BoolAttribute(key string, value bool) Attribute { + return Attribute{key: key, value: value} +} + +// Int64Attribute returns an int64-valued attribute. +func Int64Attribute(key string, value int64) Attribute { + return Attribute{key: key, value: value} +} + +// Float64Attribute returns a float64-valued attribute. +func Float64Attribute(key string, value float64) Attribute { + return Attribute{key: key, value: value} +} + +// StringAttribute returns a string-valued attribute. +func StringAttribute(key string, value string) Attribute { + return Attribute{key: key, value: value} +} + +// LinkType specifies the relationship between the span that had the link +// added, and the linked span. +type LinkType int32 + +// LinkType values. +const ( + LinkTypeUnspecified LinkType = iota // The relationship of the two spans is unknown. + LinkTypeChild // The linked span is a child of the current span. + LinkTypeParent // The linked span is the parent of the current span. +) + +// Link represents a reference from one span to another span. +type Link struct { + TraceID TraceID + SpanID SpanID + Type LinkType + // Attributes is a set of attributes on the link. + Attributes map[string]interface{} +} + +// MessageEventType specifies the type of message event. +type MessageEventType int32 + +// MessageEventType values. +const ( + MessageEventTypeUnspecified MessageEventType = iota // Unknown event type. + MessageEventTypeSent // Indicates a sent RPC message. + MessageEventTypeRecv // Indicates a received RPC message. +) + +// MessageEvent represents an event describing a message sent or received on the network. +type MessageEvent struct { + Time time.Time + EventType MessageEventType + MessageID int64 + UncompressedByteSize int64 + CompressedByteSize int64 +} + +// Status is the status of a Span. +type Status struct { + // Code is a status code. Zero indicates success. + // + // If Code will be propagated to Google APIs, it ideally should be a value from + // https://github.com/googleapis/googleapis/blob/master/google/rpc/code.proto . + Code int32 + Message string +} diff --git a/vendor/go.opencensus.io/trace/config.go b/vendor/go.opencensus.io/trace/config.go new file mode 100644 index 00000000..775f8274 --- /dev/null +++ b/vendor/go.opencensus.io/trace/config.go @@ -0,0 +1,86 @@ +// Copyright 2018, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "sync" + + "go.opencensus.io/trace/internal" +) + +// Config represents the global tracing configuration. +type Config struct { + // DefaultSampler is the default sampler used when creating new spans. + DefaultSampler Sampler + + // IDGenerator is for internal use only. + IDGenerator internal.IDGenerator + + // MaxAnnotationEventsPerSpan is max number of annotation events per span + MaxAnnotationEventsPerSpan int + + // MaxMessageEventsPerSpan is max number of message events per span + MaxMessageEventsPerSpan int + + // MaxAnnotationEventsPerSpan is max number of attributes per span + MaxAttributesPerSpan int + + // MaxLinksPerSpan is max number of links per span + MaxLinksPerSpan int +} + +var configWriteMu sync.Mutex + +const ( + // DefaultMaxAnnotationEventsPerSpan is default max number of annotation events per span + DefaultMaxAnnotationEventsPerSpan = 32 + + // DefaultMaxMessageEventsPerSpan is default max number of message events per span + DefaultMaxMessageEventsPerSpan = 128 + + // DefaultMaxAttributesPerSpan is default max number of attributes per span + DefaultMaxAttributesPerSpan = 32 + + // DefaultMaxLinksPerSpan is default max number of links per span + DefaultMaxLinksPerSpan = 32 +) + +// ApplyConfig applies changes to the global tracing configuration. +// +// Fields not provided in the given config are going to be preserved. +func ApplyConfig(cfg Config) { + configWriteMu.Lock() + defer configWriteMu.Unlock() + c := *config.Load().(*Config) + if cfg.DefaultSampler != nil { + c.DefaultSampler = cfg.DefaultSampler + } + if cfg.IDGenerator != nil { + c.IDGenerator = cfg.IDGenerator + } + if cfg.MaxAnnotationEventsPerSpan > 0 { + c.MaxAnnotationEventsPerSpan = cfg.MaxAnnotationEventsPerSpan + } + if cfg.MaxMessageEventsPerSpan > 0 { + c.MaxMessageEventsPerSpan = cfg.MaxMessageEventsPerSpan + } + if cfg.MaxAttributesPerSpan > 0 { + c.MaxAttributesPerSpan = cfg.MaxAttributesPerSpan + } + if cfg.MaxLinksPerSpan > 0 { + c.MaxLinksPerSpan = cfg.MaxLinksPerSpan + } + config.Store(&c) +} diff --git a/vendor/go.opencensus.io/trace/doc.go b/vendor/go.opencensus.io/trace/doc.go new file mode 100644 index 00000000..04b1ee4f --- /dev/null +++ b/vendor/go.opencensus.io/trace/doc.go @@ -0,0 +1,53 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +/* +Package trace contains support for OpenCensus distributed tracing. + +The following assumes a basic familiarity with OpenCensus concepts. +See http://opencensus.io + + +Exporting Traces + +To export collected tracing data, register at least one exporter. You can use +one of the provided exporters or write your own. + + trace.RegisterExporter(exporter) + +By default, traces will be sampled relatively rarely. To change the sampling +frequency for your entire program, call ApplyConfig. Use a ProbabilitySampler +to sample a subset of traces, or use AlwaysSample to collect a trace on every run: + + trace.ApplyConfig(trace.Config{DefaultSampler: trace.AlwaysSample()}) + +Be careful about using trace.AlwaysSample in a production application with +significant traffic: a new trace will be started and exported for every request. + +Adding Spans to a Trace + +A trace consists of a tree of spans. In Go, the current span is carried in a +context.Context. + +It is common to want to capture all the activity of a function call in a span. For +this to work, the function must take a context.Context as a parameter. Add these two +lines to the top of the function: + + ctx, span := trace.StartSpan(ctx, "example.com/Run") + defer span.End() + +StartSpan will create a new top-level span if the context +doesn't contain another span, otherwise it will create a child span. +*/ +package trace // import "go.opencensus.io/trace" diff --git a/vendor/go.opencensus.io/trace/evictedqueue.go b/vendor/go.opencensus.io/trace/evictedqueue.go new file mode 100644 index 00000000..ffc264f2 --- /dev/null +++ b/vendor/go.opencensus.io/trace/evictedqueue.go @@ -0,0 +1,38 @@ +// Copyright 2019, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +type evictedQueue struct { + queue []interface{} + capacity int + droppedCount int +} + +func newEvictedQueue(capacity int) *evictedQueue { + eq := &evictedQueue{ + capacity: capacity, + queue: make([]interface{}, 0), + } + + return eq +} + +func (eq *evictedQueue) add(value interface{}) { + if len(eq.queue) == eq.capacity { + eq.queue = eq.queue[1:] + eq.droppedCount++ + } + eq.queue = append(eq.queue, value) +} diff --git a/vendor/go.opencensus.io/trace/export.go b/vendor/go.opencensus.io/trace/export.go new file mode 100644 index 00000000..e0d9a4b9 --- /dev/null +++ b/vendor/go.opencensus.io/trace/export.go @@ -0,0 +1,97 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "sync" + "sync/atomic" + "time" +) + +// Exporter is a type for functions that receive sampled trace spans. +// +// The ExportSpan method should be safe for concurrent use and should return +// quickly; if an Exporter takes a significant amount of time to process a +// SpanData, that work should be done on another goroutine. +// +// The SpanData should not be modified, but a pointer to it can be kept. +type Exporter interface { + ExportSpan(s *SpanData) +} + +type exportersMap map[Exporter]struct{} + +var ( + exporterMu sync.Mutex + exporters atomic.Value +) + +// RegisterExporter adds to the list of Exporters that will receive sampled +// trace spans. +// +// Binaries can register exporters, libraries shouldn't register exporters. +func RegisterExporter(e Exporter) { + exporterMu.Lock() + new := make(exportersMap) + if old, ok := exporters.Load().(exportersMap); ok { + for k, v := range old { + new[k] = v + } + } + new[e] = struct{}{} + exporters.Store(new) + exporterMu.Unlock() +} + +// UnregisterExporter removes from the list of Exporters the Exporter that was +// registered with the given name. +func UnregisterExporter(e Exporter) { + exporterMu.Lock() + new := make(exportersMap) + if old, ok := exporters.Load().(exportersMap); ok { + for k, v := range old { + new[k] = v + } + } + delete(new, e) + exporters.Store(new) + exporterMu.Unlock() +} + +// SpanData contains all the information collected by a Span. +type SpanData struct { + SpanContext + ParentSpanID SpanID + SpanKind int + Name string + StartTime time.Time + // The wall clock time of EndTime will be adjusted to always be offset + // from StartTime by the duration of the span. + EndTime time.Time + // The values of Attributes each have type string, bool, or int64. + Attributes map[string]interface{} + Annotations []Annotation + MessageEvents []MessageEvent + Status + Links []Link + HasRemoteParent bool + DroppedAttributeCount int + DroppedAnnotationCount int + DroppedMessageEventCount int + DroppedLinkCount int + + // ChildSpanCount holds the number of child span created for this span. + ChildSpanCount int +} diff --git a/vendor/go.opencensus.io/trace/internal/internal.go b/vendor/go.opencensus.io/trace/internal/internal.go new file mode 100644 index 00000000..7e808d8f --- /dev/null +++ b/vendor/go.opencensus.io/trace/internal/internal.go @@ -0,0 +1,22 @@ +// Copyright 2018, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// Package internal provides trace internals. +package internal + +// IDGenerator allows custom generators for TraceId and SpanId. +type IDGenerator interface { + NewTraceID() [16]byte + NewSpanID() [8]byte +} diff --git a/vendor/go.opencensus.io/trace/lrumap.go b/vendor/go.opencensus.io/trace/lrumap.go new file mode 100644 index 00000000..dc7a295c --- /dev/null +++ b/vendor/go.opencensus.io/trace/lrumap.go @@ -0,0 +1,61 @@ +// Copyright 2019, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "github.com/golang/groupcache/lru" +) + +// A simple lru.Cache wrapper that tracks the keys of the current contents and +// the cumulative number of evicted items. +type lruMap struct { + cacheKeys map[lru.Key]bool + cache *lru.Cache + droppedCount int +} + +func newLruMap(size int) *lruMap { + lm := &lruMap{ + cacheKeys: make(map[lru.Key]bool), + cache: lru.New(size), + droppedCount: 0, + } + lm.cache.OnEvicted = func(key lru.Key, value interface{}) { + delete(lm.cacheKeys, key) + lm.droppedCount++ + } + return lm +} + +func (lm lruMap) len() int { + return lm.cache.Len() +} + +func (lm lruMap) keys() []interface{} { + keys := []interface{}{} + for k := range lm.cacheKeys { + keys = append(keys, k) + } + return keys +} + +func (lm *lruMap) add(key, value interface{}) { + lm.cacheKeys[lru.Key(key)] = true + lm.cache.Add(lru.Key(key), value) +} + +func (lm *lruMap) get(key interface{}) (interface{}, bool) { + return lm.cache.Get(key) +} diff --git a/vendor/go.opencensus.io/trace/sampling.go b/vendor/go.opencensus.io/trace/sampling.go new file mode 100644 index 00000000..71c10f9e --- /dev/null +++ b/vendor/go.opencensus.io/trace/sampling.go @@ -0,0 +1,75 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "encoding/binary" +) + +const defaultSamplingProbability = 1e-4 + +// Sampler decides whether a trace should be sampled and exported. +type Sampler func(SamplingParameters) SamplingDecision + +// SamplingParameters contains the values passed to a Sampler. +type SamplingParameters struct { + ParentContext SpanContext + TraceID TraceID + SpanID SpanID + Name string + HasRemoteParent bool +} + +// SamplingDecision is the value returned by a Sampler. +type SamplingDecision struct { + Sample bool +} + +// ProbabilitySampler returns a Sampler that samples a given fraction of traces. +// +// It also samples spans whose parents are sampled. +func ProbabilitySampler(fraction float64) Sampler { + if !(fraction >= 0) { + fraction = 0 + } else if fraction >= 1 { + return AlwaysSample() + } + + traceIDUpperBound := uint64(fraction * (1 << 63)) + return Sampler(func(p SamplingParameters) SamplingDecision { + if p.ParentContext.IsSampled() { + return SamplingDecision{Sample: true} + } + x := binary.BigEndian.Uint64(p.TraceID[0:8]) >> 1 + return SamplingDecision{Sample: x < traceIDUpperBound} + }) +} + +// AlwaysSample returns a Sampler that samples every trace. +// Be careful about using this sampler in a production application with +// significant traffic: a new trace will be started and exported for every +// request. +func AlwaysSample() Sampler { + return func(p SamplingParameters) SamplingDecision { + return SamplingDecision{Sample: true} + } +} + +// NeverSample returns a Sampler that samples no traces. +func NeverSample() Sampler { + return func(p SamplingParameters) SamplingDecision { + return SamplingDecision{Sample: false} + } +} diff --git a/vendor/go.opencensus.io/trace/spanbucket.go b/vendor/go.opencensus.io/trace/spanbucket.go new file mode 100644 index 00000000..fbabad34 --- /dev/null +++ b/vendor/go.opencensus.io/trace/spanbucket.go @@ -0,0 +1,130 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "time" +) + +// samplePeriod is the minimum time between accepting spans in a single bucket. +const samplePeriod = time.Second + +// defaultLatencies contains the default latency bucket bounds. +// TODO: consider defaults, make configurable +var defaultLatencies = [...]time.Duration{ + 10 * time.Microsecond, + 100 * time.Microsecond, + time.Millisecond, + 10 * time.Millisecond, + 100 * time.Millisecond, + time.Second, + 10 * time.Second, + time.Minute, +} + +// bucket is a container for a set of spans for a particular error code or latency range. +type bucket struct { + nextTime time.Time // next time we can accept a span + buffer []*SpanData // circular buffer of spans + nextIndex int // location next SpanData should be placed in buffer + overflow bool // whether the circular buffer has wrapped around +} + +func makeBucket(bufferSize int) bucket { + return bucket{ + buffer: make([]*SpanData, bufferSize), + } +} + +// add adds a span to the bucket, if nextTime has been reached. +func (b *bucket) add(s *SpanData) { + if s.EndTime.Before(b.nextTime) { + return + } + if len(b.buffer) == 0 { + return + } + b.nextTime = s.EndTime.Add(samplePeriod) + b.buffer[b.nextIndex] = s + b.nextIndex++ + if b.nextIndex == len(b.buffer) { + b.nextIndex = 0 + b.overflow = true + } +} + +// size returns the number of spans in the bucket. +func (b *bucket) size() int { + if b.overflow { + return len(b.buffer) + } + return b.nextIndex +} + +// span returns the ith span in the bucket. +func (b *bucket) span(i int) *SpanData { + if !b.overflow { + return b.buffer[i] + } + if i < len(b.buffer)-b.nextIndex { + return b.buffer[b.nextIndex+i] + } + return b.buffer[b.nextIndex+i-len(b.buffer)] +} + +// resize changes the size of the bucket to n, keeping up to n existing spans. +func (b *bucket) resize(n int) { + cur := b.size() + newBuffer := make([]*SpanData, n) + if cur < n { + for i := 0; i < cur; i++ { + newBuffer[i] = b.span(i) + } + b.buffer = newBuffer + b.nextIndex = cur + b.overflow = false + return + } + for i := 0; i < n; i++ { + newBuffer[i] = b.span(i + cur - n) + } + b.buffer = newBuffer + b.nextIndex = 0 + b.overflow = true +} + +// latencyBucket returns the appropriate bucket number for a given latency. +func latencyBucket(latency time.Duration) int { + i := 0 + for i < len(defaultLatencies) && latency >= defaultLatencies[i] { + i++ + } + return i +} + +// latencyBucketBounds returns the lower and upper bounds for a latency bucket +// number. +// +// The lower bound is inclusive, the upper bound is exclusive (except for the +// last bucket.) +func latencyBucketBounds(index int) (lower time.Duration, upper time.Duration) { + if index == 0 { + return 0, defaultLatencies[index] + } + if index == len(defaultLatencies) { + return defaultLatencies[index-1], 1<<63 - 1 + } + return defaultLatencies[index-1], defaultLatencies[index] +} diff --git a/vendor/go.opencensus.io/trace/spanstore.go b/vendor/go.opencensus.io/trace/spanstore.go new file mode 100644 index 00000000..c442d990 --- /dev/null +++ b/vendor/go.opencensus.io/trace/spanstore.go @@ -0,0 +1,306 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "sync" + "time" + + "go.opencensus.io/internal" +) + +const ( + maxBucketSize = 100000 + defaultBucketSize = 10 +) + +var ( + ssmu sync.RWMutex // protects spanStores + spanStores = make(map[string]*spanStore) +) + +// This exists purely to avoid exposing internal methods used by z-Pages externally. +type internalOnly struct{} + +func init() { + //TODO(#412): remove + internal.Trace = &internalOnly{} +} + +// ReportActiveSpans returns the active spans for the given name. +func (i internalOnly) ReportActiveSpans(name string) []*SpanData { + s := spanStoreForName(name) + if s == nil { + return nil + } + var out []*SpanData + s.mu.Lock() + defer s.mu.Unlock() + for span := range s.active { + out = append(out, span.makeSpanData()) + } + return out +} + +// ReportSpansByError returns a sample of error spans. +// +// If code is nonzero, only spans with that status code are returned. +func (i internalOnly) ReportSpansByError(name string, code int32) []*SpanData { + s := spanStoreForName(name) + if s == nil { + return nil + } + var out []*SpanData + s.mu.Lock() + defer s.mu.Unlock() + if code != 0 { + if b, ok := s.errors[code]; ok { + for _, sd := range b.buffer { + if sd == nil { + break + } + out = append(out, sd) + } + } + } else { + for _, b := range s.errors { + for _, sd := range b.buffer { + if sd == nil { + break + } + out = append(out, sd) + } + } + } + return out +} + +// ConfigureBucketSizes sets the number of spans to keep per latency and error +// bucket for different span names. +func (i internalOnly) ConfigureBucketSizes(bcs []internal.BucketConfiguration) { + for _, bc := range bcs { + latencyBucketSize := bc.MaxRequestsSucceeded + if latencyBucketSize < 0 { + latencyBucketSize = 0 + } + if latencyBucketSize > maxBucketSize { + latencyBucketSize = maxBucketSize + } + errorBucketSize := bc.MaxRequestsErrors + if errorBucketSize < 0 { + errorBucketSize = 0 + } + if errorBucketSize > maxBucketSize { + errorBucketSize = maxBucketSize + } + spanStoreSetSize(bc.Name, latencyBucketSize, errorBucketSize) + } +} + +// ReportSpansPerMethod returns a summary of what spans are being stored for each span name. +func (i internalOnly) ReportSpansPerMethod() map[string]internal.PerMethodSummary { + out := make(map[string]internal.PerMethodSummary) + ssmu.RLock() + defer ssmu.RUnlock() + for name, s := range spanStores { + s.mu.Lock() + p := internal.PerMethodSummary{ + Active: len(s.active), + } + for code, b := range s.errors { + p.ErrorBuckets = append(p.ErrorBuckets, internal.ErrorBucketSummary{ + ErrorCode: code, + Size: b.size(), + }) + } + for i, b := range s.latency { + min, max := latencyBucketBounds(i) + p.LatencyBuckets = append(p.LatencyBuckets, internal.LatencyBucketSummary{ + MinLatency: min, + MaxLatency: max, + Size: b.size(), + }) + } + s.mu.Unlock() + out[name] = p + } + return out +} + +// ReportSpansByLatency returns a sample of successful spans. +// +// minLatency is the minimum latency of spans to be returned. +// maxLatency, if nonzero, is the maximum latency of spans to be returned. +func (i internalOnly) ReportSpansByLatency(name string, minLatency, maxLatency time.Duration) []*SpanData { + s := spanStoreForName(name) + if s == nil { + return nil + } + var out []*SpanData + s.mu.Lock() + defer s.mu.Unlock() + for i, b := range s.latency { + min, max := latencyBucketBounds(i) + if i+1 != len(s.latency) && max <= minLatency { + continue + } + if maxLatency != 0 && maxLatency < min { + continue + } + for _, sd := range b.buffer { + if sd == nil { + break + } + if minLatency != 0 || maxLatency != 0 { + d := sd.EndTime.Sub(sd.StartTime) + if d < minLatency { + continue + } + if maxLatency != 0 && d > maxLatency { + continue + } + } + out = append(out, sd) + } + } + return out +} + +// spanStore keeps track of spans stored for a particular span name. +// +// It contains all active spans; a sample of spans for failed requests, +// categorized by error code; and a sample of spans for successful requests, +// bucketed by latency. +type spanStore struct { + mu sync.Mutex // protects everything below. + active map[*Span]struct{} + errors map[int32]*bucket + latency []bucket + maxSpansPerErrorBucket int +} + +// newSpanStore creates a span store. +func newSpanStore(name string, latencyBucketSize int, errorBucketSize int) *spanStore { + s := &spanStore{ + active: make(map[*Span]struct{}), + latency: make([]bucket, len(defaultLatencies)+1), + maxSpansPerErrorBucket: errorBucketSize, + } + for i := range s.latency { + s.latency[i] = makeBucket(latencyBucketSize) + } + return s +} + +// spanStoreForName returns the spanStore for the given name. +// +// It returns nil if it doesn't exist. +func spanStoreForName(name string) *spanStore { + var s *spanStore + ssmu.RLock() + s, _ = spanStores[name] + ssmu.RUnlock() + return s +} + +// spanStoreForNameCreateIfNew returns the spanStore for the given name. +// +// It creates it if it didn't exist. +func spanStoreForNameCreateIfNew(name string) *spanStore { + ssmu.RLock() + s, ok := spanStores[name] + ssmu.RUnlock() + if ok { + return s + } + ssmu.Lock() + defer ssmu.Unlock() + s, ok = spanStores[name] + if ok { + return s + } + s = newSpanStore(name, defaultBucketSize, defaultBucketSize) + spanStores[name] = s + return s +} + +// spanStoreSetSize resizes the spanStore for the given name. +// +// It creates it if it didn't exist. +func spanStoreSetSize(name string, latencyBucketSize int, errorBucketSize int) { + ssmu.RLock() + s, ok := spanStores[name] + ssmu.RUnlock() + if ok { + s.resize(latencyBucketSize, errorBucketSize) + return + } + ssmu.Lock() + defer ssmu.Unlock() + s, ok = spanStores[name] + if ok { + s.resize(latencyBucketSize, errorBucketSize) + return + } + s = newSpanStore(name, latencyBucketSize, errorBucketSize) + spanStores[name] = s +} + +func (s *spanStore) resize(latencyBucketSize int, errorBucketSize int) { + s.mu.Lock() + for i := range s.latency { + s.latency[i].resize(latencyBucketSize) + } + for _, b := range s.errors { + b.resize(errorBucketSize) + } + s.maxSpansPerErrorBucket = errorBucketSize + s.mu.Unlock() +} + +// add adds a span to the active bucket of the spanStore. +func (s *spanStore) add(span *Span) { + s.mu.Lock() + s.active[span] = struct{}{} + s.mu.Unlock() +} + +// finished removes a span from the active set, and adds a corresponding +// SpanData to a latency or error bucket. +func (s *spanStore) finished(span *Span, sd *SpanData) { + latency := sd.EndTime.Sub(sd.StartTime) + if latency < 0 { + latency = 0 + } + code := sd.Status.Code + + s.mu.Lock() + delete(s.active, span) + if code == 0 { + s.latency[latencyBucket(latency)].add(sd) + } else { + if s.errors == nil { + s.errors = make(map[int32]*bucket) + } + if b := s.errors[code]; b != nil { + b.add(sd) + } else { + b := makeBucket(s.maxSpansPerErrorBucket) + s.errors[code] = &b + b.add(sd) + } + } + s.mu.Unlock() +} diff --git a/vendor/go.opencensus.io/trace/status_codes.go b/vendor/go.opencensus.io/trace/status_codes.go new file mode 100644 index 00000000..ec60effd --- /dev/null +++ b/vendor/go.opencensus.io/trace/status_codes.go @@ -0,0 +1,37 @@ +// Copyright 2018, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +// Status codes for use with Span.SetStatus. These correspond to the status +// codes used by gRPC defined here: https://github.com/googleapis/googleapis/blob/master/google/rpc/code.proto +const ( + StatusCodeOK = 0 + StatusCodeCancelled = 1 + StatusCodeUnknown = 2 + StatusCodeInvalidArgument = 3 + StatusCodeDeadlineExceeded = 4 + StatusCodeNotFound = 5 + StatusCodeAlreadyExists = 6 + StatusCodePermissionDenied = 7 + StatusCodeResourceExhausted = 8 + StatusCodeFailedPrecondition = 9 + StatusCodeAborted = 10 + StatusCodeOutOfRange = 11 + StatusCodeUnimplemented = 12 + StatusCodeInternal = 13 + StatusCodeUnavailable = 14 + StatusCodeDataLoss = 15 + StatusCodeUnauthenticated = 16 +) diff --git a/vendor/go.opencensus.io/trace/trace.go b/vendor/go.opencensus.io/trace/trace.go new file mode 100644 index 00000000..3f8977b4 --- /dev/null +++ b/vendor/go.opencensus.io/trace/trace.go @@ -0,0 +1,598 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "context" + crand "crypto/rand" + "encoding/binary" + "fmt" + "math/rand" + "sync" + "sync/atomic" + "time" + + "go.opencensus.io/internal" + "go.opencensus.io/trace/tracestate" +) + +// Span represents a span of a trace. It has an associated SpanContext, and +// stores data accumulated while the span is active. +// +// Ideally users should interact with Spans by calling the functions in this +// package that take a Context parameter. +type Span struct { + // data contains information recorded about the span. + // + // It will be non-nil if we are exporting the span or recording events for it. + // Otherwise, data is nil, and the Span is simply a carrier for the + // SpanContext, so that the trace ID is propagated. + data *SpanData + mu sync.Mutex // protects the contents of *data (but not the pointer value.) + spanContext SpanContext + + // lruAttributes are capped at configured limit. When the capacity is reached an oldest entry + // is removed to create room for a new entry. + lruAttributes *lruMap + + // annotations are stored in FIFO queue capped by configured limit. + annotations *evictedQueue + + // messageEvents are stored in FIFO queue capped by configured limit. + messageEvents *evictedQueue + + // links are stored in FIFO queue capped by configured limit. + links *evictedQueue + + // spanStore is the spanStore this span belongs to, if any, otherwise it is nil. + *spanStore + endOnce sync.Once + + executionTracerTaskEnd func() // ends the execution tracer span +} + +// IsRecordingEvents returns true if events are being recorded for this span. +// Use this check to avoid computing expensive annotations when they will never +// be used. +func (s *Span) IsRecordingEvents() bool { + if s == nil { + return false + } + return s.data != nil +} + +// TraceOptions contains options associated with a trace span. +type TraceOptions uint32 + +// IsSampled returns true if the span will be exported. +func (sc SpanContext) IsSampled() bool { + return sc.TraceOptions.IsSampled() +} + +// setIsSampled sets the TraceOptions bit that determines whether the span will be exported. +func (sc *SpanContext) setIsSampled(sampled bool) { + if sampled { + sc.TraceOptions |= 1 + } else { + sc.TraceOptions &= ^TraceOptions(1) + } +} + +// IsSampled returns true if the span will be exported. +func (t TraceOptions) IsSampled() bool { + return t&1 == 1 +} + +// SpanContext contains the state that must propagate across process boundaries. +// +// SpanContext is not an implementation of context.Context. +// TODO: add reference to external Census docs for SpanContext. +type SpanContext struct { + TraceID TraceID + SpanID SpanID + TraceOptions TraceOptions + Tracestate *tracestate.Tracestate +} + +type contextKey struct{} + +// FromContext returns the Span stored in a context, or nil if there isn't one. +func FromContext(ctx context.Context) *Span { + s, _ := ctx.Value(contextKey{}).(*Span) + return s +} + +// NewContext returns a new context with the given Span attached. +func NewContext(parent context.Context, s *Span) context.Context { + return context.WithValue(parent, contextKey{}, s) +} + +// All available span kinds. Span kind must be either one of these values. +const ( + SpanKindUnspecified = iota + SpanKindServer + SpanKindClient +) + +// StartOptions contains options concerning how a span is started. +type StartOptions struct { + // Sampler to consult for this Span. If provided, it is always consulted. + // + // If not provided, then the behavior differs based on whether + // the parent of this Span is remote, local, or there is no parent. + // In the case of a remote parent or no parent, the + // default sampler (see Config) will be consulted. Otherwise, + // when there is a non-remote parent, no new sampling decision will be made: + // we will preserve the sampling of the parent. + Sampler Sampler + + // SpanKind represents the kind of a span. If none is set, + // SpanKindUnspecified is used. + SpanKind int +} + +// StartOption apply changes to StartOptions. +type StartOption func(*StartOptions) + +// WithSpanKind makes new spans to be created with the given kind. +func WithSpanKind(spanKind int) StartOption { + return func(o *StartOptions) { + o.SpanKind = spanKind + } +} + +// WithSampler makes new spans to be be created with a custom sampler. +// Otherwise, the global sampler is used. +func WithSampler(sampler Sampler) StartOption { + return func(o *StartOptions) { + o.Sampler = sampler + } +} + +// StartSpan starts a new child span of the current span in the context. If +// there is no span in the context, creates a new trace and span. +// +// Returned context contains the newly created span. You can use it to +// propagate the returned span in process. +func StartSpan(ctx context.Context, name string, o ...StartOption) (context.Context, *Span) { + var opts StartOptions + var parent SpanContext + if p := FromContext(ctx); p != nil { + p.addChild() + parent = p.spanContext + } + for _, op := range o { + op(&opts) + } + span := startSpanInternal(name, parent != SpanContext{}, parent, false, opts) + + ctx, end := startExecutionTracerTask(ctx, name) + span.executionTracerTaskEnd = end + return NewContext(ctx, span), span +} + +// StartSpanWithRemoteParent starts a new child span of the span from the given parent. +// +// If the incoming context contains a parent, it ignores. StartSpanWithRemoteParent is +// preferred for cases where the parent is propagated via an incoming request. +// +// Returned context contains the newly created span. You can use it to +// propagate the returned span in process. +func StartSpanWithRemoteParent(ctx context.Context, name string, parent SpanContext, o ...StartOption) (context.Context, *Span) { + var opts StartOptions + for _, op := range o { + op(&opts) + } + span := startSpanInternal(name, parent != SpanContext{}, parent, true, opts) + ctx, end := startExecutionTracerTask(ctx, name) + span.executionTracerTaskEnd = end + return NewContext(ctx, span), span +} + +func startSpanInternal(name string, hasParent bool, parent SpanContext, remoteParent bool, o StartOptions) *Span { + span := &Span{} + span.spanContext = parent + + cfg := config.Load().(*Config) + + if !hasParent { + span.spanContext.TraceID = cfg.IDGenerator.NewTraceID() + } + span.spanContext.SpanID = cfg.IDGenerator.NewSpanID() + sampler := cfg.DefaultSampler + + if !hasParent || remoteParent || o.Sampler != nil { + // If this span is the child of a local span and no Sampler is set in the + // options, keep the parent's TraceOptions. + // + // Otherwise, consult the Sampler in the options if it is non-nil, otherwise + // the default sampler. + if o.Sampler != nil { + sampler = o.Sampler + } + span.spanContext.setIsSampled(sampler(SamplingParameters{ + ParentContext: parent, + TraceID: span.spanContext.TraceID, + SpanID: span.spanContext.SpanID, + Name: name, + HasRemoteParent: remoteParent}).Sample) + } + + if !internal.LocalSpanStoreEnabled && !span.spanContext.IsSampled() { + return span + } + + span.data = &SpanData{ + SpanContext: span.spanContext, + StartTime: time.Now(), + SpanKind: o.SpanKind, + Name: name, + HasRemoteParent: remoteParent, + } + span.lruAttributes = newLruMap(cfg.MaxAttributesPerSpan) + span.annotations = newEvictedQueue(cfg.MaxAnnotationEventsPerSpan) + span.messageEvents = newEvictedQueue(cfg.MaxMessageEventsPerSpan) + span.links = newEvictedQueue(cfg.MaxLinksPerSpan) + + if hasParent { + span.data.ParentSpanID = parent.SpanID + } + if internal.LocalSpanStoreEnabled { + var ss *spanStore + ss = spanStoreForNameCreateIfNew(name) + if ss != nil { + span.spanStore = ss + ss.add(span) + } + } + + return span +} + +// End ends the span. +func (s *Span) End() { + if s == nil { + return + } + if s.executionTracerTaskEnd != nil { + s.executionTracerTaskEnd() + } + if !s.IsRecordingEvents() { + return + } + s.endOnce.Do(func() { + exp, _ := exporters.Load().(exportersMap) + mustExport := s.spanContext.IsSampled() && len(exp) > 0 + if s.spanStore != nil || mustExport { + sd := s.makeSpanData() + sd.EndTime = internal.MonotonicEndTime(sd.StartTime) + if s.spanStore != nil { + s.spanStore.finished(s, sd) + } + if mustExport { + for e := range exp { + e.ExportSpan(sd) + } + } + } + }) +} + +// makeSpanData produces a SpanData representing the current state of the Span. +// It requires that s.data is non-nil. +func (s *Span) makeSpanData() *SpanData { + var sd SpanData + s.mu.Lock() + sd = *s.data + if s.lruAttributes.len() > 0 { + sd.Attributes = s.lruAttributesToAttributeMap() + sd.DroppedAttributeCount = s.lruAttributes.droppedCount + } + if len(s.annotations.queue) > 0 { + sd.Annotations = s.interfaceArrayToAnnotationArray() + sd.DroppedAnnotationCount = s.annotations.droppedCount + } + if len(s.messageEvents.queue) > 0 { + sd.MessageEvents = s.interfaceArrayToMessageEventArray() + sd.DroppedMessageEventCount = s.messageEvents.droppedCount + } + if len(s.links.queue) > 0 { + sd.Links = s.interfaceArrayToLinksArray() + sd.DroppedLinkCount = s.links.droppedCount + } + s.mu.Unlock() + return &sd +} + +// SpanContext returns the SpanContext of the span. +func (s *Span) SpanContext() SpanContext { + if s == nil { + return SpanContext{} + } + return s.spanContext +} + +// SetName sets the name of the span, if it is recording events. +func (s *Span) SetName(name string) { + if !s.IsRecordingEvents() { + return + } + s.mu.Lock() + s.data.Name = name + s.mu.Unlock() +} + +// SetStatus sets the status of the span, if it is recording events. +func (s *Span) SetStatus(status Status) { + if !s.IsRecordingEvents() { + return + } + s.mu.Lock() + s.data.Status = status + s.mu.Unlock() +} + +func (s *Span) interfaceArrayToLinksArray() []Link { + linksArr := make([]Link, 0) + for _, value := range s.links.queue { + linksArr = append(linksArr, value.(Link)) + } + return linksArr +} + +func (s *Span) interfaceArrayToMessageEventArray() []MessageEvent { + messageEventArr := make([]MessageEvent, 0) + for _, value := range s.messageEvents.queue { + messageEventArr = append(messageEventArr, value.(MessageEvent)) + } + return messageEventArr +} + +func (s *Span) interfaceArrayToAnnotationArray() []Annotation { + annotationArr := make([]Annotation, 0) + for _, value := range s.annotations.queue { + annotationArr = append(annotationArr, value.(Annotation)) + } + return annotationArr +} + +func (s *Span) lruAttributesToAttributeMap() map[string]interface{} { + attributes := make(map[string]interface{}) + for _, key := range s.lruAttributes.keys() { + value, ok := s.lruAttributes.get(key) + if ok { + keyStr := key.(string) + attributes[keyStr] = value + } + } + return attributes +} + +func (s *Span) copyToCappedAttributes(attributes []Attribute) { + for _, a := range attributes { + s.lruAttributes.add(a.key, a.value) + } +} + +func (s *Span) addChild() { + if !s.IsRecordingEvents() { + return + } + s.mu.Lock() + s.data.ChildSpanCount++ + s.mu.Unlock() +} + +// AddAttributes sets attributes in the span. +// +// Existing attributes whose keys appear in the attributes parameter are overwritten. +func (s *Span) AddAttributes(attributes ...Attribute) { + if !s.IsRecordingEvents() { + return + } + s.mu.Lock() + s.copyToCappedAttributes(attributes) + s.mu.Unlock() +} + +// copyAttributes copies a slice of Attributes into a map. +func copyAttributes(m map[string]interface{}, attributes []Attribute) { + for _, a := range attributes { + m[a.key] = a.value + } +} + +func (s *Span) lazyPrintfInternal(attributes []Attribute, format string, a ...interface{}) { + now := time.Now() + msg := fmt.Sprintf(format, a...) + var m map[string]interface{} + s.mu.Lock() + if len(attributes) != 0 { + m = make(map[string]interface{}) + copyAttributes(m, attributes) + } + s.annotations.add(Annotation{ + Time: now, + Message: msg, + Attributes: m, + }) + s.mu.Unlock() +} + +func (s *Span) printStringInternal(attributes []Attribute, str string) { + now := time.Now() + var a map[string]interface{} + s.mu.Lock() + if len(attributes) != 0 { + a = make(map[string]interface{}) + copyAttributes(a, attributes) + } + s.annotations.add(Annotation{ + Time: now, + Message: str, + Attributes: a, + }) + s.mu.Unlock() +} + +// Annotate adds an annotation with attributes. +// Attributes can be nil. +func (s *Span) Annotate(attributes []Attribute, str string) { + if !s.IsRecordingEvents() { + return + } + s.printStringInternal(attributes, str) +} + +// Annotatef adds an annotation with attributes. +func (s *Span) Annotatef(attributes []Attribute, format string, a ...interface{}) { + if !s.IsRecordingEvents() { + return + } + s.lazyPrintfInternal(attributes, format, a...) +} + +// AddMessageSendEvent adds a message send event to the span. +// +// messageID is an identifier for the message, which is recommended to be +// unique in this span and the same between the send event and the receive +// event (this allows to identify a message between the sender and receiver). +// For example, this could be a sequence id. +func (s *Span) AddMessageSendEvent(messageID, uncompressedByteSize, compressedByteSize int64) { + if !s.IsRecordingEvents() { + return + } + now := time.Now() + s.mu.Lock() + s.messageEvents.add(MessageEvent{ + Time: now, + EventType: MessageEventTypeSent, + MessageID: messageID, + UncompressedByteSize: uncompressedByteSize, + CompressedByteSize: compressedByteSize, + }) + s.mu.Unlock() +} + +// AddMessageReceiveEvent adds a message receive event to the span. +// +// messageID is an identifier for the message, which is recommended to be +// unique in this span and the same between the send event and the receive +// event (this allows to identify a message between the sender and receiver). +// For example, this could be a sequence id. +func (s *Span) AddMessageReceiveEvent(messageID, uncompressedByteSize, compressedByteSize int64) { + if !s.IsRecordingEvents() { + return + } + now := time.Now() + s.mu.Lock() + s.messageEvents.add(MessageEvent{ + Time: now, + EventType: MessageEventTypeRecv, + MessageID: messageID, + UncompressedByteSize: uncompressedByteSize, + CompressedByteSize: compressedByteSize, + }) + s.mu.Unlock() +} + +// AddLink adds a link to the span. +func (s *Span) AddLink(l Link) { + if !s.IsRecordingEvents() { + return + } + s.mu.Lock() + s.links.add(l) + s.mu.Unlock() +} + +func (s *Span) String() string { + if s == nil { + return "" + } + if s.data == nil { + return fmt.Sprintf("span %s", s.spanContext.SpanID) + } + s.mu.Lock() + str := fmt.Sprintf("span %s %q", s.spanContext.SpanID, s.data.Name) + s.mu.Unlock() + return str +} + +var config atomic.Value // access atomically + +func init() { + gen := &defaultIDGenerator{} + // initialize traceID and spanID generators. + var rngSeed int64 + for _, p := range []interface{}{ + &rngSeed, &gen.traceIDAdd, &gen.nextSpanID, &gen.spanIDInc, + } { + binary.Read(crand.Reader, binary.LittleEndian, p) + } + gen.traceIDRand = rand.New(rand.NewSource(rngSeed)) + gen.spanIDInc |= 1 + + config.Store(&Config{ + DefaultSampler: ProbabilitySampler(defaultSamplingProbability), + IDGenerator: gen, + MaxAttributesPerSpan: DefaultMaxAttributesPerSpan, + MaxAnnotationEventsPerSpan: DefaultMaxAnnotationEventsPerSpan, + MaxMessageEventsPerSpan: DefaultMaxMessageEventsPerSpan, + MaxLinksPerSpan: DefaultMaxLinksPerSpan, + }) +} + +type defaultIDGenerator struct { + sync.Mutex + + // Please keep these as the first fields + // so that these 8 byte fields will be aligned on addresses + // divisible by 8, on both 32-bit and 64-bit machines when + // performing atomic increments and accesses. + // See: + // * https://github.com/census-instrumentation/opencensus-go/issues/587 + // * https://github.com/census-instrumentation/opencensus-go/issues/865 + // * https://golang.org/pkg/sync/atomic/#pkg-note-BUG + nextSpanID uint64 + spanIDInc uint64 + + traceIDAdd [2]uint64 + traceIDRand *rand.Rand +} + +// NewSpanID returns a non-zero span ID from a randomly-chosen sequence. +func (gen *defaultIDGenerator) NewSpanID() [8]byte { + var id uint64 + for id == 0 { + id = atomic.AddUint64(&gen.nextSpanID, gen.spanIDInc) + } + var sid [8]byte + binary.LittleEndian.PutUint64(sid[:], id) + return sid +} + +// NewTraceID returns a non-zero trace ID from a randomly-chosen sequence. +// mu should be held while this function is called. +func (gen *defaultIDGenerator) NewTraceID() [16]byte { + var tid [16]byte + // Construct the trace ID from two outputs of traceIDRand, with a constant + // added to each half for additional entropy. + gen.Lock() + binary.LittleEndian.PutUint64(tid[0:8], gen.traceIDRand.Uint64()+gen.traceIDAdd[0]) + binary.LittleEndian.PutUint64(tid[8:16], gen.traceIDRand.Uint64()+gen.traceIDAdd[1]) + gen.Unlock() + return tid +} diff --git a/vendor/go.opencensus.io/trace/trace_go11.go b/vendor/go.opencensus.io/trace/trace_go11.go new file mode 100644 index 00000000..b7d8aaf2 --- /dev/null +++ b/vendor/go.opencensus.io/trace/trace_go11.go @@ -0,0 +1,32 @@ +// Copyright 2018, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// +build go1.11 + +package trace + +import ( + "context" + t "runtime/trace" +) + +func startExecutionTracerTask(ctx context.Context, name string) (context.Context, func()) { + if !t.IsEnabled() { + // Avoid additional overhead if + // runtime/trace is not enabled. + return ctx, func() {} + } + nctx, task := t.NewTask(ctx, name) + return nctx, task.End +} diff --git a/vendor/go.opencensus.io/trace/trace_nongo11.go b/vendor/go.opencensus.io/trace/trace_nongo11.go new file mode 100644 index 00000000..e2541985 --- /dev/null +++ b/vendor/go.opencensus.io/trace/trace_nongo11.go @@ -0,0 +1,25 @@ +// Copyright 2018, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// +build !go1.11 + +package trace + +import ( + "context" +) + +func startExecutionTracerTask(ctx context.Context, name string) (context.Context, func()) { + return ctx, func() {} +} diff --git a/vendor/go.opencensus.io/trace/tracestate/tracestate.go b/vendor/go.opencensus.io/trace/tracestate/tracestate.go new file mode 100644 index 00000000..2d6c713e --- /dev/null +++ b/vendor/go.opencensus.io/trace/tracestate/tracestate.go @@ -0,0 +1,147 @@ +// Copyright 2018, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// Package tracestate implements support for the Tracestate header of the +// W3C TraceContext propagation format. +package tracestate + +import ( + "fmt" + "regexp" +) + +const ( + keyMaxSize = 256 + valueMaxSize = 256 + maxKeyValuePairs = 32 +) + +const ( + keyWithoutVendorFormat = `[a-z][_0-9a-z\-\*\/]{0,255}` + keyWithVendorFormat = `[a-z][_0-9a-z\-\*\/]{0,240}@[a-z][_0-9a-z\-\*\/]{0,13}` + keyFormat = `(` + keyWithoutVendorFormat + `)|(` + keyWithVendorFormat + `)` + valueFormat = `[\x20-\x2b\x2d-\x3c\x3e-\x7e]{0,255}[\x21-\x2b\x2d-\x3c\x3e-\x7e]` +) + +var keyValidationRegExp = regexp.MustCompile(`^(` + keyFormat + `)$`) +var valueValidationRegExp = regexp.MustCompile(`^(` + valueFormat + `)$`) + +// Tracestate represents tracing-system specific context in a list of key-value pairs. Tracestate allows different +// vendors propagate additional information and inter-operate with their legacy Id formats. +type Tracestate struct { + entries []Entry +} + +// Entry represents one key-value pair in a list of key-value pair of Tracestate. +type Entry struct { + // Key is an opaque string up to 256 characters printable. It MUST begin with a lowercase letter, + // and can only contain lowercase letters a-z, digits 0-9, underscores _, dashes -, asterisks *, and + // forward slashes /. + Key string + + // Value is an opaque string up to 256 characters printable ASCII RFC0020 characters (i.e., the + // range 0x20 to 0x7E) except comma , and =. + Value string +} + +// Entries returns a slice of Entry. +func (ts *Tracestate) Entries() []Entry { + if ts == nil { + return nil + } + return ts.entries +} + +func (ts *Tracestate) remove(key string) *Entry { + for index, entry := range ts.entries { + if entry.Key == key { + ts.entries = append(ts.entries[:index], ts.entries[index+1:]...) + return &entry + } + } + return nil +} + +func (ts *Tracestate) add(entries []Entry) error { + for _, entry := range entries { + ts.remove(entry.Key) + } + if len(ts.entries)+len(entries) > maxKeyValuePairs { + return fmt.Errorf("adding %d key-value pairs to current %d pairs exceeds the limit of %d", + len(entries), len(ts.entries), maxKeyValuePairs) + } + ts.entries = append(entries, ts.entries...) + return nil +} + +func isValid(entry Entry) bool { + return keyValidationRegExp.MatchString(entry.Key) && + valueValidationRegExp.MatchString(entry.Value) +} + +func containsDuplicateKey(entries ...Entry) (string, bool) { + keyMap := make(map[string]int) + for _, entry := range entries { + if _, ok := keyMap[entry.Key]; ok { + return entry.Key, true + } + keyMap[entry.Key] = 1 + } + return "", false +} + +func areEntriesValid(entries ...Entry) (*Entry, bool) { + for _, entry := range entries { + if !isValid(entry) { + return &entry, false + } + } + return nil, true +} + +// New creates a Tracestate object from a parent and/or entries (key-value pair). +// Entries from the parent are copied if present. The entries passed to this function +// are inserted in front of those copied from the parent. If an entry copied from the +// parent contains the same key as one of the entry in entries then the entry copied +// from the parent is removed. See add func. +// +// An error is returned with nil Tracestate if +// 1. one or more entry in entries is invalid. +// 2. two or more entries in the input entries have the same key. +// 3. the number of entries combined from the parent and the input entries exceeds maxKeyValuePairs. +// (duplicate entry is counted only once). +func New(parent *Tracestate, entries ...Entry) (*Tracestate, error) { + if parent == nil && len(entries) == 0 { + return nil, nil + } + if entry, ok := areEntriesValid(entries...); !ok { + return nil, fmt.Errorf("key-value pair {%s, %s} is invalid", entry.Key, entry.Value) + } + + if key, duplicate := containsDuplicateKey(entries...); duplicate { + return nil, fmt.Errorf("contains duplicate keys (%s)", key) + } + + tracestate := Tracestate{} + + if parent != nil && len(parent.entries) > 0 { + tracestate.entries = append([]Entry{}, parent.entries...) + } + + err := tracestate.add(entries) + if err != nil { + return nil, err + } + return &tracestate, nil +} diff --git a/vendor/golang.org/x/net/html/const.go b/vendor/golang.org/x/net/html/const.go index 73804d34..ff7acf2d 100644 --- a/vendor/golang.org/x/net/html/const.go +++ b/vendor/golang.org/x/net/html/const.go @@ -52,7 +52,7 @@ var isSpecialElementMap = map[string]bool{ "iframe": true, "img": true, "input": true, - "keygen": true, + "keygen": true, // "keygen" has been removed from the spec, but are kept here for backwards compatibility. "li": true, "link": true, "listing": true, diff --git a/vendor/golang.org/x/net/html/foreign.go b/vendor/golang.org/x/net/html/foreign.go index 74774c45..9da9e9dc 100644 --- a/vendor/golang.org/x/net/html/foreign.go +++ b/vendor/golang.org/x/net/html/foreign.go @@ -161,65 +161,62 @@ var mathMLAttributeAdjustments = map[string]string{ } var svgAttributeAdjustments = map[string]string{ - "attributename": "attributeName", - "attributetype": "attributeType", - "basefrequency": "baseFrequency", - "baseprofile": "baseProfile", - "calcmode": "calcMode", - "clippathunits": "clipPathUnits", - "contentscripttype": "contentScriptType", - "contentstyletype": "contentStyleType", - "diffuseconstant": "diffuseConstant", - "edgemode": "edgeMode", - "externalresourcesrequired": "externalResourcesRequired", - "filterunits": "filterUnits", - "glyphref": "glyphRef", - "gradienttransform": "gradientTransform", - "gradientunits": "gradientUnits", - "kernelmatrix": "kernelMatrix", - "kernelunitlength": "kernelUnitLength", - "keypoints": "keyPoints", - "keysplines": "keySplines", - "keytimes": "keyTimes", - "lengthadjust": "lengthAdjust", - "limitingconeangle": "limitingConeAngle", - "markerheight": "markerHeight", - "markerunits": "markerUnits", - "markerwidth": "markerWidth", - "maskcontentunits": "maskContentUnits", - "maskunits": "maskUnits", - "numoctaves": "numOctaves", - "pathlength": "pathLength", - "patterncontentunits": "patternContentUnits", - "patterntransform": "patternTransform", - "patternunits": "patternUnits", - "pointsatx": "pointsAtX", - "pointsaty": "pointsAtY", - "pointsatz": "pointsAtZ", - "preservealpha": "preserveAlpha", - "preserveaspectratio": "preserveAspectRatio", - "primitiveunits": "primitiveUnits", - "refx": "refX", - "refy": "refY", - "repeatcount": "repeatCount", - "repeatdur": "repeatDur", - "requiredextensions": "requiredExtensions", - "requiredfeatures": "requiredFeatures", - "specularconstant": "specularConstant", - "specularexponent": "specularExponent", - "spreadmethod": "spreadMethod", - "startoffset": "startOffset", - "stddeviation": "stdDeviation", - "stitchtiles": "stitchTiles", - "surfacescale": "surfaceScale", - "systemlanguage": "systemLanguage", - "tablevalues": "tableValues", - "targetx": "targetX", - "targety": "targetY", - "textlength": "textLength", - "viewbox": "viewBox", - "viewtarget": "viewTarget", - "xchannelselector": "xChannelSelector", - "ychannelselector": "yChannelSelector", - "zoomandpan": "zoomAndPan", + "attributename": "attributeName", + "attributetype": "attributeType", + "basefrequency": "baseFrequency", + "baseprofile": "baseProfile", + "calcmode": "calcMode", + "clippathunits": "clipPathUnits", + "diffuseconstant": "diffuseConstant", + "edgemode": "edgeMode", + "filterunits": "filterUnits", + "glyphref": "glyphRef", + "gradienttransform": "gradientTransform", + "gradientunits": "gradientUnits", + "kernelmatrix": "kernelMatrix", + "kernelunitlength": "kernelUnitLength", + "keypoints": "keyPoints", + "keysplines": "keySplines", + "keytimes": "keyTimes", + "lengthadjust": "lengthAdjust", + "limitingconeangle": "limitingConeAngle", + "markerheight": "markerHeight", + "markerunits": "markerUnits", + "markerwidth": "markerWidth", + "maskcontentunits": "maskContentUnits", + "maskunits": "maskUnits", + "numoctaves": "numOctaves", + "pathlength": "pathLength", + "patterncontentunits": "patternContentUnits", + "patterntransform": "patternTransform", + "patternunits": "patternUnits", + "pointsatx": "pointsAtX", + "pointsaty": "pointsAtY", + "pointsatz": "pointsAtZ", + "preservealpha": "preserveAlpha", + "preserveaspectratio": "preserveAspectRatio", + "primitiveunits": "primitiveUnits", + "refx": "refX", + "refy": "refY", + "repeatcount": "repeatCount", + "repeatdur": "repeatDur", + "requiredextensions": "requiredExtensions", + "requiredfeatures": "requiredFeatures", + "specularconstant": "specularConstant", + "specularexponent": "specularExponent", + "spreadmethod": "spreadMethod", + "startoffset": "startOffset", + "stddeviation": "stdDeviation", + "stitchtiles": "stitchTiles", + "surfacescale": "surfaceScale", + "systemlanguage": "systemLanguage", + "tablevalues": "tableValues", + "targetx": "targetX", + "targety": "targetY", + "textlength": "textLength", + "viewbox": "viewBox", + "viewtarget": "viewTarget", + "xchannelselector": "xChannelSelector", + "ychannelselector": "yChannelSelector", + "zoomandpan": "zoomAndPan", } diff --git a/vendor/golang.org/x/net/html/parse.go b/vendor/golang.org/x/net/html/parse.go index 2cd12fc8..f91466f7 100644 --- a/vendor/golang.org/x/net/html/parse.go +++ b/vendor/golang.org/x/net/html/parse.go @@ -728,7 +728,13 @@ func inHeadNoscriptIM(p *parser) bool { return inBodyIM(p) case a.Basefont, a.Bgsound, a.Link, a.Meta, a.Noframes, a.Style: return inHeadIM(p) - case a.Head, a.Noscript: + case a.Head: + // Ignore the token. + return true + case a.Noscript: + // Don't let the tokenizer go into raw text mode even when a