mirror of
https://github.com/containers/skopeo.git
synced 2026-01-31 06:19:20 +00:00
Compare commits
249 Commits
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
bd162028cd | ||
|
|
a214a305fd | ||
|
|
5093d5b5f6 | ||
|
|
0d9939dcd4 | ||
|
|
1b2de8ec5d | ||
|
|
ab2300500a | ||
|
|
fbf061260c | ||
|
|
4244d68240 | ||
|
|
dda31b3d4b | ||
|
|
2af172653c | ||
|
|
3247c0d229 | ||
|
|
eb024319de | ||
|
|
4ca9b139bb | ||
|
|
b79a37ead9 | ||
|
|
0ec2610f04 | ||
|
|
71a14d7df6 | ||
|
|
8936e76316 | ||
|
|
e21d6b3687 | ||
|
|
a6ab2291ba | ||
|
|
8f845aac23 | ||
|
|
439ea83081 | ||
|
|
42f68c1c76 | ||
|
|
8d252f82fd | ||
|
|
1ddb736b5a | ||
|
|
46fbbbd282 | ||
|
|
e7a7f018bd | ||
|
|
311fc89548 | ||
|
|
a6abdb8547 | ||
|
|
02407d98a5 | ||
|
|
b230a507e7 | ||
|
|
116add9d00 | ||
|
|
2415f3fa4d | ||
|
|
5f8d3fc639 | ||
|
|
1119299c4b | ||
|
|
2d91b93ad0 | ||
|
|
cf4dff471c | ||
|
|
101901ab40 | ||
|
|
17848a1868 | ||
|
|
9d21b48f8b | ||
|
|
2873d8ec91 | ||
|
|
9d63c7cd54 | ||
|
|
1f321dfc69 | ||
|
|
702165af46 | ||
|
|
8c8d9bd23f | ||
|
|
6ac3dce04e | ||
|
|
5b479b1090 | ||
|
|
b2033f3f9d | ||
|
|
f68b53afcd | ||
|
|
71a8ff0122 | ||
|
|
6569236642 | ||
|
|
8fa332618b | ||
|
|
0eef946e55 | ||
|
|
5d512e265a | ||
|
|
82e79e3f43 | ||
|
|
3e9d8ae731 | ||
|
|
325327dc3f | ||
|
|
bd20786c38 | ||
|
|
6e3f4c99be | ||
|
|
6db5626c3b | ||
|
|
eb199dce9c | ||
|
|
27b330f6f1 | ||
|
|
f231b7776b | ||
|
|
018a0108b1 | ||
|
|
55044627cc | ||
|
|
aa20fbfdf5 | ||
|
|
a6f5ef18c5 | ||
|
|
274efdf28f | ||
|
|
501452a500 | ||
|
|
336164246b | ||
|
|
e31d5a0e8f | ||
|
|
ed883c5230 | ||
|
|
7fee7d5019 | ||
|
|
970af7d1b4 | ||
|
|
12865fdfb8 | ||
|
|
1e7fe55be0 | ||
|
|
7170702ee4 | ||
|
|
081e4834d5 | ||
|
|
b541fef300 | ||
|
|
bd59677a84 | ||
|
|
7a0a8c25a2 | ||
|
|
a7ff66f09e | ||
|
|
dda59750e6 | ||
|
|
a99450c002 | ||
|
|
ebeb1c3f59 | ||
|
|
cd1ffbdb90 | ||
|
|
33ebce0880 | ||
|
|
cc43fd50d7 | ||
|
|
0752e837e5 | ||
|
|
2e9a426a78 | ||
|
|
406d3eb134 | ||
|
|
14e9834d55 | ||
|
|
bae3378171 | ||
|
|
71c382c043 | ||
|
|
7dcfc18309 | ||
|
|
9b984e8eba | ||
|
|
4e45fcc584 | ||
|
|
0d84f81305 | ||
|
|
2e65e64c06 | ||
|
|
4c4a4b611e | ||
|
|
ef1b005c95 | ||
|
|
fcbc889abf | ||
|
|
7be2a1bf3b | ||
|
|
c05fbf4573 | ||
|
|
d7a2bd7230 | ||
|
|
f489ba7bfc | ||
|
|
0a91c00ebe | ||
|
|
df2966b766 | ||
|
|
7c29094b51 | ||
|
|
88f6057eaa | ||
|
|
c2fa78096b | ||
|
|
8d1a4649f2 | ||
|
|
377ba25c6b | ||
|
|
1d136f0541 | ||
|
|
7b9629d6dc | ||
|
|
07c89b49ff | ||
|
|
a9854e1173 | ||
|
|
36fdc062ba | ||
|
|
5554964a8f | ||
|
|
b0cfab1d45 | ||
|
|
cce44c45d5 | ||
|
|
c8e0250903 | ||
|
|
f830265034 | ||
|
|
fea7ada700 | ||
|
|
ba8417edf3 | ||
|
|
2eb86a3be7 | ||
|
|
759dc98b32 | ||
|
|
7d080caaa3 | ||
|
|
b6e7fbdfdf | ||
|
|
9d10912ced | ||
|
|
dd8275528a | ||
|
|
b59c018afd | ||
|
|
e3f9f55c56 | ||
|
|
97aae7a7e4 | ||
|
|
2c0a4c9c17 | ||
|
|
9a0dba940d | ||
|
|
a7297d4db7 | ||
|
|
7cbb8ad3ba | ||
|
|
4489ddd8a5 | ||
|
|
c6a731bb2e | ||
|
|
222beaf4c7 | ||
|
|
763e48858b | ||
|
|
6c7dc9b7c9 | ||
|
|
e955849f0a | ||
|
|
27b3e21842 | ||
|
|
8652b650b6 | ||
|
|
17b921cbbc | ||
|
|
c3e6b4f917 | ||
|
|
2f2dc64681 | ||
|
|
5291aac96b | ||
|
|
b0da085857 | ||
|
|
407f2e95e0 | ||
|
|
7d3c3ce561 | ||
|
|
e8d49d60ff | ||
|
|
21613f194f | ||
|
|
afaa9e7f00 | ||
|
|
9c402f3799 | ||
|
|
8ccd7b994d | ||
|
|
3ed6e83c4a | ||
|
|
04bc64f593 | ||
|
|
73248bd639 | ||
|
|
2bfa89532d | ||
|
|
c6bc236769 | ||
|
|
ce6ec7720e | ||
|
|
39ff039b3b | ||
|
|
912b7e1e09 | ||
|
|
88fd117257 | ||
|
|
34ab4c4f32 | ||
|
|
5f3219a854 | ||
|
|
23d9383a36 | ||
|
|
39540db170 | ||
|
|
af0734832b | ||
|
|
81caa0fa5d | ||
|
|
dd66c1d342 | ||
|
|
6991ba8563 | ||
|
|
db877dca36 | ||
|
|
8eba94f271 | ||
|
|
24f4f82c09 | ||
|
|
05ae513b18 | ||
|
|
332bb459e6 | ||
|
|
307d9c2252 | ||
|
|
1094c7d61d | ||
|
|
876595e634 | ||
|
|
140b47e8e9 | ||
|
|
cd8c0085b1 | ||
|
|
75b7d1e2af | ||
|
|
10d0ebb9fe | ||
|
|
a18ec3f693 | ||
|
|
02432cf063 | ||
|
|
d83d081942 | ||
|
|
ce2db02200 | ||
|
|
df92a33ca9 | ||
|
|
153520e20e | ||
|
|
b21a59705f | ||
|
|
a263b353a1 | ||
|
|
a18a5eaecd | ||
|
|
be6146b0a8 | ||
|
|
8057da700c | ||
|
|
8f24d28130 | ||
|
|
2553a230d0 | ||
|
|
4b6a5da86a | ||
|
|
7d251f5a74 | ||
|
|
5f9a6ea621 | ||
|
|
58248412bd | ||
|
|
5b0a7890ea | ||
|
|
4962559e5c | ||
|
|
f72e39fc10 | ||
|
|
7922028d7c | ||
|
|
881edbf122 | ||
|
|
51b54191a8 | ||
|
|
fa6e58074d | ||
|
|
1c243a5b12 | ||
|
|
7eb5f39255 | ||
|
|
8d1bb15075 | ||
|
|
5ae6b16c0f | ||
|
|
8c96dca362 | ||
|
|
1d8f5f29a5 | ||
|
|
b31f0da5c6 | ||
|
|
a02e57dde8 | ||
|
|
a000c1943d | ||
|
|
86e3564356 | ||
|
|
c61a5ea2c4 | ||
|
|
89bb6158eb | ||
|
|
646e197eed | ||
|
|
699c25568c | ||
|
|
0c579aca9c | ||
|
|
bc8281c016 | ||
|
|
91510e39ab | ||
|
|
7b0db25a74 | ||
|
|
18f0e1e20c | ||
|
|
a36d81c55c | ||
|
|
976dd83a62 | ||
|
|
9019e27ec5 | ||
|
|
a1c5a1f4d2 | ||
|
|
c4b0c7ce05 | ||
|
|
43b014c82a | ||
|
|
1e2d6f619b | ||
|
|
f1d8451b09 | ||
|
|
481bb94c5f | ||
|
|
a778e595b3 | ||
|
|
ee9e9dfc89 | ||
|
|
0f1ded2ac8 | ||
|
|
44bc4a9eb7 | ||
|
|
89d6d0c70f | ||
|
|
1cf1e06582 | ||
|
|
700b3102af | ||
|
|
c040b28fb8 | ||
|
|
af54437b44 | ||
|
|
202c1ea2ac | ||
|
|
5348d246ba |
3
.gitignore
vendored
3
.gitignore
vendored
@@ -1,3 +1,6 @@
|
||||
*.1
|
||||
/layers-*
|
||||
/skopeo
|
||||
|
||||
# ignore JetBrains IDEs (GoLand) config folder
|
||||
.idea
|
||||
@@ -8,6 +8,9 @@ matrix:
|
||||
- docker
|
||||
- os: osx
|
||||
|
||||
go:
|
||||
- 1.13.x
|
||||
|
||||
notifications:
|
||||
email: false
|
||||
|
||||
|
||||
3
CODE-OF-CONDUCT.md
Normal file
3
CODE-OF-CONDUCT.md
Normal file
@@ -0,0 +1,3 @@
|
||||
## The skopeo Project Community Code of Conduct
|
||||
|
||||
The skopeo project follows the [Containers Community Code of Conduct](https://github.com/containers/common/blob/master/CODE-OF-CONDUCT.md).
|
||||
@@ -1,16 +1,15 @@
|
||||
FROM fedora
|
||||
|
||||
RUN dnf -y update && dnf install -y make git golang golang-github-cpuguy83-go-md2man \
|
||||
RUN dnf -y update && dnf install -y make git golang golang-github-cpuguy83-md2man \
|
||||
# storage deps
|
||||
btrfs-progs-devel \
|
||||
device-mapper-devel \
|
||||
# gpgme bindings deps
|
||||
libassuan-devel gpgme-devel \
|
||||
ostree-devel \
|
||||
gnupg \
|
||||
# OpenShift deps
|
||||
which tar wget hostname util-linux bsdtar socat ethtool device-mapper iptables tree findutils nmap-ncat e2fsprogs xfsprogs lsof docker iproute \
|
||||
bats jq podman \
|
||||
bats jq podman runc \
|
||||
golint \
|
||||
&& dnf clean all
|
||||
|
||||
|
||||
@@ -1,4 +1,4 @@
|
||||
FROM ubuntu:18.10
|
||||
FROM ubuntu:19.10
|
||||
|
||||
RUN apt-get update && apt-get install -y \
|
||||
golang \
|
||||
@@ -7,8 +7,7 @@ RUN apt-get update && apt-get install -y \
|
||||
libdevmapper-dev \
|
||||
libgpgme11-dev \
|
||||
go-md2man \
|
||||
libglib2.0-dev \
|
||||
libostree-dev
|
||||
libglib2.0-dev
|
||||
|
||||
ENV GOPATH=/
|
||||
WORKDIR /src/github.com/containers/skopeo
|
||||
|
||||
46
Makefile
46
Makefile
@@ -1,8 +1,10 @@
|
||||
.PHONY: all binary build-container docs docs-in-container build-local clean install install-binary install-completions shell test-integration .install.vndr vendor
|
||||
.PHONY: all binary build-container docs docs-in-container build-local clean install install-binary install-completions shell test-integration .install.vndr vendor vendor-in-container
|
||||
|
||||
export GOPROXY=https://proxy.golang.org
|
||||
|
||||
ifeq ($(shell uname),Darwin)
|
||||
PREFIX ?= ${DESTDIR}/usr/local
|
||||
DARWIN_BUILD_TAG=containers_image_ostree_stub
|
||||
DARWIN_BUILD_TAG=
|
||||
# On macOS, (brew install gpgme) installs it within /usr/local, but /usr/local/include is not in the default search path.
|
||||
# Rather than hard-code this directory, use gpgme-config. Sadly that must be done at the top-level user
|
||||
# instead of locally in the gpgme subpackage, because cgo supports only pkg-config, not general shell scripts,
|
||||
@@ -18,16 +20,23 @@ INSTALLDIR=${PREFIX}/bin
|
||||
MANINSTALLDIR=${PREFIX}/share/man
|
||||
CONTAINERSSYSCONFIGDIR=${DESTDIR}/etc/containers
|
||||
REGISTRIESDDIR=${CONTAINERSSYSCONFIGDIR}/registries.d
|
||||
SIGSTOREDIR=${DESTDIR}/var/lib/atomic/sigstore
|
||||
SIGSTOREDIR=${DESTDIR}/var/lib/containers/sigstore
|
||||
BASHINSTALLDIR=${PREFIX}/share/bash-completion/completions
|
||||
|
||||
GO ?= go
|
||||
GOBIN := $(shell $(GO) env GOBIN)
|
||||
ifeq ($(GOBIN),)
|
||||
GOBIN := $(GOPATH)/bin
|
||||
endif
|
||||
|
||||
CONTAINER_RUNTIME := $(shell command -v podman 2> /dev/null || echo docker)
|
||||
GOMD2MAN ?= $(shell command -v go-md2man || echo '$(GOBIN)/go-md2man')
|
||||
|
||||
GO_BUILD=$(GO) build
|
||||
# Go module support: set `-mod=vendor` to use the vendored sources
|
||||
# Go module support: set `-mod=vendor` to use the vendored sources.
|
||||
# See also hack/make.sh.
|
||||
ifeq ($(shell go help mod >/dev/null 2>&1 && echo true), true)
|
||||
GO_BUILD=GO111MODULE=on $(GO) build -mod=vendor
|
||||
GO:=GO111MODULE=on $(GO)
|
||||
MOD_VENDOR=-mod=vendor
|
||||
endif
|
||||
|
||||
ifeq ($(DEBUG), 1)
|
||||
@@ -58,12 +67,11 @@ MANPAGES ?= $(MANPAGES_MD:%.md=%)
|
||||
|
||||
BTRFS_BUILD_TAG = $(shell hack/btrfs_tag.sh) $(shell hack/btrfs_installed_tag.sh)
|
||||
LIBDM_BUILD_TAG = $(shell hack/libdm_tag.sh)
|
||||
OSTREE_BUILD_TAG = $(shell hack/ostree_tag.sh)
|
||||
LOCAL_BUILD_TAGS = $(BTRFS_BUILD_TAG) $(LIBDM_BUILD_TAG) $(OSTREE_BUILD_TAG) $(DARWIN_BUILD_TAG)
|
||||
LOCAL_BUILD_TAGS = $(BTRFS_BUILD_TAG) $(LIBDM_BUILD_TAG) $(DARWIN_BUILD_TAG)
|
||||
BUILDTAGS += $(LOCAL_BUILD_TAGS)
|
||||
|
||||
ifeq ($(DISABLE_CGO), 1)
|
||||
override BUILDTAGS = containers_image_ostree_stub exclude_graphdriver_devicemapper exclude_graphdriver_btrfs containers_image_openpgp
|
||||
override BUILDTAGS = exclude_graphdriver_devicemapper exclude_graphdriver_btrfs containers_image_openpgp
|
||||
endif
|
||||
|
||||
# make all DEBUG=1
|
||||
@@ -99,10 +107,10 @@ binary-static: cmd/skopeo
|
||||
|
||||
# Build w/o using containers
|
||||
binary-local:
|
||||
$(GPGME_ENV) $(GO_BUILD) ${GO_DYN_FLAGS} -ldflags "-X main.gitCommit=${GIT_COMMIT}" -gcflags "$(GOGCFLAGS)" -tags "$(BUILDTAGS)" -o skopeo ./cmd/skopeo
|
||||
$(GPGME_ENV) $(GO) build $(MOD_VENDOR) ${GO_DYN_FLAGS} -ldflags "-X main.gitCommit=${GIT_COMMIT}" -gcflags "$(GOGCFLAGS)" -tags "$(BUILDTAGS)" -o skopeo ./cmd/skopeo
|
||||
|
||||
binary-local-static:
|
||||
$(GPGME_ENV) $(GO_BUILD) -ldflags "-extldflags \"-static\" -X main.gitCommit=${GIT_COMMIT}" -gcflags "$(GOGCFLAGS)" -tags "$(BUILDTAGS)" -o skopeo ./cmd/skopeo
|
||||
$(GPGME_ENV) $(GO) build $(MOD_VENDOR) -ldflags "-extldflags \"-static\" -X main.gitCommit=${GIT_COMMIT}" -gcflags "$(GOGCFLAGS)" -tags "$(BUILDTAGS)" -o skopeo ./cmd/skopeo
|
||||
|
||||
build-container:
|
||||
${CONTAINER_RUNTIME} build ${BUILD_ARGS} -t "$(IMAGE)" .
|
||||
@@ -151,8 +159,8 @@ test-integration: build-container
|
||||
# complicated set of options needed to run podman-in-podman
|
||||
test-system: build-container
|
||||
DTEMP=$(shell mktemp -d --tmpdir=/var/tmp podman-tmp.XXXXXX); \
|
||||
$(CONTAINER_CMD) --privileged --net=host \
|
||||
-v $$DTEMP:/var/lib/containers:Z \
|
||||
$(CONTAINER_CMD) --privileged \
|
||||
-v $$DTEMP:/var/lib/containers:Z -v /run/systemd/journal/socket:/run/systemd/journal/socket \
|
||||
"$(IMAGE)" \
|
||||
bash -c 'BUILDTAGS="$(BUILDTAGS)" hack/make.sh test-system'; \
|
||||
rc=$$?; \
|
||||
@@ -173,10 +181,12 @@ validate-local:
|
||||
hack/make.sh validate-git-marks validate-gofmt validate-lint validate-vet
|
||||
|
||||
test-unit-local:
|
||||
$(GPGME_ENV) $(GO) test -tags "$(BUILDTAGS)" $$($(GO) list -tags "$(BUILDTAGS)" -e ./... | grep -v '^github\.com/containers/skopeo/\(integration\|vendor/.*\)$$')
|
||||
$(GPGME_ENV) $(GO) test $(MOD_VENDOR) -tags "$(BUILDTAGS)" $$($(GO) list $(MOD_VENDOR) -tags "$(BUILDTAGS)" -e ./... | grep -v '^github\.com/containers/skopeo/\(integration\|vendor/.*\)$$')
|
||||
|
||||
vendor:
|
||||
export GO111MODULE=on \
|
||||
$(GO) mod tidy && \
|
||||
$(GO) mod vendor && \
|
||||
$(GO) mod verify
|
||||
$(GO) mod tidy
|
||||
$(GO) mod vendor
|
||||
$(GO) mod verify
|
||||
|
||||
vendor-in-container:
|
||||
podman run --privileged --rm --env HOME=/root -v `pwd`:/src -w /src docker.io/library/golang:1.13 make vendor
|
||||
|
||||
267
README.md
267
README.md
@@ -7,9 +7,13 @@ skopeo [ as well as the original Docker v2 images.
|
||||
|
||||
Skopeo works with API V2 registries such as Docker registries, the Atomic registry, private registries, local directories and local OCI-layout directories. Skopeo does not require a daemon to be running to perform these operations which consist of:
|
||||
Skopeo works with API V2 container image registries such as [docker.io](https://docker.io) and [quay.io](https://quay.io) registries, private registries, local directories and local OCI-layout directories. Skopeo can perform operations which consist of:
|
||||
|
||||
* Copying an image from and to various storage mechanisms.
|
||||
For example you can copy images from one registry to another, without requiring privilege.
|
||||
@@ -20,16 +24,16 @@ Skopeo works with API V2 registries such as Docker registries, the Atomic regist
|
||||
Skopeo operates on the following image and repository types:
|
||||
|
||||
* containers-storage:docker-reference
|
||||
An image located in a local containers/storage image store. Location and image store specified in /etc/containers/storage.conf
|
||||
An image located in a local containers/storage image store. Both the location and image store are specified in /etc/containers/storage.conf. (This is the backend for [Podman](https://podman.io), [CRI-O](https://cri-o.io), [Buildah](https://buildah.io) and friends)
|
||||
|
||||
* dir:path
|
||||
An existing local directory path storing the manifest, layer tarballs and signatures as individual files. This is a non-standardized format, primarily useful for debugging or noninvasive container inspection.
|
||||
|
||||
* docker://docker-reference
|
||||
An image in a registry implementing the "Docker Registry HTTP API V2". By default, uses the authorization state in $HOME/.docker/config.json, which is set e.g. using (docker login).
|
||||
An image in a registry implementing the "Docker Registry HTTP API V2". By default, uses the authorization state in `$XDG_RUNTIME_DIR/containers/auth.json`, which is set using `skopeo login`.
|
||||
|
||||
* docker-archive:path[:docker-reference]
|
||||
An image is stored in the `docker save` formated file. docker-reference is only used when creating such a file, and it must not contain a digest.
|
||||
An image is stored in a `docker save`-formatted file. docker-reference is only used when creating such a file, and it must not contain a digest.
|
||||
|
||||
* docker-daemon:docker-reference
|
||||
An image docker-reference stored in the docker daemon internal storage. docker-reference must contain either a tag or a digest. Alternatively, when reading images, the format can also be docker-daemon:algo:digest (an image ID).
|
||||
@@ -37,209 +41,150 @@ Skopeo works with API V2 registries such as Docker registries, the Atomic regist
|
||||
* oci:path:tag
|
||||
An image tag in a directory compliant with "Open Container Image Layout Specification" at path.
|
||||
|
||||
* ostree:image[@/absolute/repo/path]
|
||||
An image in local OSTree repository. /absolute/repo/path defaults to /ostree/repo.
|
||||
|
||||
Inspecting a repository
|
||||
-
|
||||
`skopeo` is able to _inspect_ a repository on a Docker registry and fetch images layers.
|
||||
## Inspecting a repository
|
||||
`skopeo` is able to _inspect_ a repository on a container registry and fetch images layers.
|
||||
The _inspect_ command fetches the repository's manifest and it is able to show you a `docker inspect`-like
|
||||
json output about a whole repository or a tag. This tool, in contrast to `docker inspect`, helps you gather useful information about
|
||||
a repository or a tag before pulling it (using disk space). The inspect command can show you which tags are available for the given
|
||||
repository, the labels the image has, the creation date and operating system of the image and more.
|
||||
|
||||
|
||||
Examples:
|
||||
```sh
|
||||
# show properties of fedora:latest
|
||||
$ skopeo inspect docker://docker.io/fedora
|
||||
|
||||
#### Show properties of fedora:latest
|
||||
```console
|
||||
$ skopeo inspect docker://registry.fedoraproject.org/fedora:latest
|
||||
{
|
||||
"Name": "docker.io/library/fedora",
|
||||
"Tag": "latest",
|
||||
"Digest": "sha256:cfd8f071bf8da7a466748f522406f7ae5908d002af1b1a1c0dcf893e183e5b32",
|
||||
"Name": "registry.fedoraproject.org/fedora",
|
||||
"Digest": "sha256:655721ff613ee766a4126cb5e0d5ae81598e1b0c3bcf7017c36c4d72cb092fe9",
|
||||
"RepoTags": [
|
||||
"20",
|
||||
"21",
|
||||
"22",
|
||||
"23",
|
||||
"heisenbug",
|
||||
"latest",
|
||||
"rawhide"
|
||||
"24",
|
||||
"25",
|
||||
"26-modular",
|
||||
...
|
||||
],
|
||||
"Created": "2016-03-04T18:40:02.92155334Z",
|
||||
"DockerVersion": "1.9.1",
|
||||
"Labels": {},
|
||||
"Created": "2020-04-29T06:48:16Z",
|
||||
"DockerVersion": "1.10.1",
|
||||
"Labels": {
|
||||
"license": "MIT",
|
||||
"name": "fedora",
|
||||
"vendor": "Fedora Project",
|
||||
"version": "32"
|
||||
},
|
||||
"Architecture": "amd64",
|
||||
"Os": "linux",
|
||||
"Layers": [
|
||||
"sha256:236608c7b546e2f4e7223526c74fc71470ba06d46ec82aeb402e704bfdee02a2",
|
||||
"sha256:a3ed95caeb02ffe68cdd9fd84406680ae93d633cb16422d00e8a7c22955b46d4"
|
||||
"sha256:3088721d7dbf674fc0be64cd3cf00c25aab921cacf35fa0e7b1578500a3e1653"
|
||||
],
|
||||
"Env": [
|
||||
"DISTTAG=f32container",
|
||||
"FGC=f32",
|
||||
"container=oci"
|
||||
]
|
||||
}
|
||||
|
||||
# show unverifed image's digest
|
||||
$ skopeo inspect docker://docker.io/fedora:rawhide | jq '.Digest'
|
||||
"sha256:905b4846938c8aef94f52f3e41a11398ae5b40f5855fb0e40ed9c157e721d7f8"
|
||||
```
|
||||
|
||||
Copying images
|
||||
-
|
||||
`skopeo` can copy container images between various storage mechanisms, including:
|
||||
* Docker distribution based registries
|
||||
#### Show container configuration from `fedora:latest`
|
||||
|
||||
- The Docker Hub, OpenShift, GCR, Artifactory, Quay ...
|
||||
```console
|
||||
$ skopeo inspect --config docker://registry.fedoraproject.org/fedora:latest | jq
|
||||
{
|
||||
"created": "2020-04-29T06:48:16Z",
|
||||
"architecture": "amd64",
|
||||
"os": "linux",
|
||||
"config": {
|
||||
"Env": [
|
||||
"DISTTAG=f32container",
|
||||
"FGC=f32",
|
||||
"container=oci"
|
||||
],
|
||||
"Cmd": [
|
||||
"/bin/bash"
|
||||
],
|
||||
"Labels": {
|
||||
"license": "MIT",
|
||||
"name": "fedora",
|
||||
"vendor": "Fedora Project",
|
||||
"version": "32"
|
||||
}
|
||||
},
|
||||
"rootfs": {
|
||||
"type": "layers",
|
||||
"diff_ids": [
|
||||
"sha256:a4c0fa2b217d3fd63d51e55a6fd59432e543d499c0df2b1acd48fbe424f2ddd1"
|
||||
]
|
||||
},
|
||||
"history": [
|
||||
{
|
||||
"created": "2020-04-29T06:48:16Z",
|
||||
"comment": "Created by Image Factory"
|
||||
}
|
||||
]
|
||||
}
|
||||
```
|
||||
#### Show unverifed image's digest
|
||||
```console
|
||||
$ skopeo inspect docker://registry.fedoraproject.org/fedora:latest | jq '.Digest'
|
||||
"sha256:655721ff613ee766a4126cb5e0d5ae81598e1b0c3bcf7017c36c4d72cb092fe9"
|
||||
```
|
||||
|
||||
## Copying images
|
||||
|
||||
`skopeo` can copy container images between various storage mechanisms, including:
|
||||
* Container registries
|
||||
|
||||
- The Quay, Docker Hub, OpenShift, GCR, Artifactory ...
|
||||
|
||||
* Container Storage backends
|
||||
|
||||
- Docker daemon storage
|
||||
- github.com/containers/storage (Backend for [Podman](https://podman.io), [CRI-O](https://cri-o.io), [Buildah](https://buildah.io) and friends)
|
||||
|
||||
- github.com/containers/storage (Backend for CRI-O, Buildah and friends)
|
||||
- Docker daemon storage
|
||||
|
||||
* Local directories
|
||||
|
||||
* Local OCI-layout directories
|
||||
|
||||
```sh
|
||||
$ skopeo copy docker://busybox:1-glibc atomic:myns/unsigned:streaming
|
||||
$ skopeo copy docker://busybox:latest dir:existingemptydirectory
|
||||
$ skopeo copy docker://busybox:latest oci:busybox_ocilayout:latest
|
||||
```console
|
||||
$ skopeo copy docker://quay.io/buildah/stable docker://registry.internal.company.com/buildah
|
||||
$ skopeo copy oci:busybox_ocilayout:latest dir:existingemptydirectory
|
||||
```
|
||||
|
||||
Deleting images
|
||||
-
|
||||
For example,
|
||||
```sh
|
||||
## Deleting images
|
||||
```console
|
||||
$ skopeo delete docker://localhost:5000/imagename:latest
|
||||
```
|
||||
|
||||
Private registries with authentication
|
||||
-
|
||||
When interacting with private registries, `skopeo` first looks for `--creds` (for `skopeo inspect|delete`) or `--src-creds|--dest-creds` (for `skopeo copy`) flags. If those aren't provided, it looks for the Docker's cli config file (usually located at `$HOME/.docker/config.json`) to get the credentials needed to authenticate. The ultimate fallback, as Docker does, is to provide an empty authentication when interacting with those registries.
|
||||
## Authenticating to a registry
|
||||
|
||||
Examples:
|
||||
```sh
|
||||
$ cat /home/runcom/.docker/config.json
|
||||
{
|
||||
"auths": {
|
||||
"myregistrydomain.com:5000": {
|
||||
"auth": "dGVzdHVzZXI6dGVzdHBhc3N3b3Jk",
|
||||
"email": "stuf@ex.cm"
|
||||
}
|
||||
}
|
||||
}
|
||||
#### Private registries with authentication
|
||||
skopeo uses credentials from the --creds (for skopeo inspect|delete) or --src-creds|--dest-creds (for skopeo copy) flags, if set; otherwise it uses configuration set by skopeo login, podman login, buildah login, or docker login.
|
||||
|
||||
# we can see I'm already authenticated via docker login so everything will be fine
|
||||
```console
|
||||
$ skopeo login --user USER docker://myregistrydomain.com:5000
|
||||
Password:
|
||||
$ skopeo inspect docker://myregistrydomain.com:5000/busybox
|
||||
{"Tag":"latest","Digest":"sha256:473bb2189d7b913ed7187a33d11e743fdc2f88931122a44d91a301b64419f092","RepoTags":["latest"],"Comment":"","Created":"2016-01-15T18:06:41.282540103Z","ContainerConfig":{"Hostname":"aded96b43f48","Domainname":"","User":"","AttachStdin":false,"AttachStdout":false,"AttachStderr":false,"Tty":false,"OpenStdin":false,"StdinOnce":false,"Env":null,"Cmd":["/bin/sh","-c","#(nop) CMD [\"sh\"]"],"Image":"9e77fef7a1c9f989988c06620dabc4020c607885b959a2cbd7c2283c91da3e33","Volumes":null,"WorkingDir":"","Entrypoint":null,"OnBuild":null,"Labels":null},"DockerVersion":"1.8.3","Author":"","Config":{"Hostname":"aded96b43f48","Domainname":"","User":"","AttachStdin":false,"AttachStdout":false,"AttachStderr":false,"Tty":false,"OpenStdin":false,"StdinOnce":false,"Env":null,"Cmd":["sh"],"Image":"9e77fef7a1c9f989988c06620dabc4020c607885b959a2cbd7c2283c91da3e33","Volumes":null,"WorkingDir":"","Entrypoint":null,"OnBuild":null,"Labels":null},"Architecture":"amd64","Os":"linux"}
|
||||
$ skopeo logout docker://myregistrydomain.com:5000
|
||||
```
|
||||
|
||||
# let's try now to fake a non existent Docker's config file
|
||||
$ cat /home/runcom/.docker/config.json
|
||||
{}
|
||||
#### Using --creds directly
|
||||
|
||||
$ skopeo inspect docker://myregistrydomain.com:5000/busybox
|
||||
FATA[0000] unauthorized: authentication required
|
||||
|
||||
# passing --creds - we can see that everything goes fine
|
||||
```console
|
||||
$ skopeo inspect --creds=testuser:testpassword docker://myregistrydomain.com:5000/busybox
|
||||
{"Tag":"latest","Digest":"sha256:473bb2189d7b913ed7187a33d11e743fdc2f88931122a44d91a301b64419f092","RepoTags":["latest"],"Comment":"","Created":"2016-01-15T18:06:41.282540103Z","ContainerConfig":{"Hostname":"aded96b43f48","Domainname":"","User":"","AttachStdin":false,"AttachStdout":false,"AttachStderr":false,"Tty":false,"OpenStdin":false,"StdinOnce":false,"Env":null,"Cmd":["/bin/sh","-c","#(nop) CMD [\"sh\"]"],"Image":"9e77fef7a1c9f989988c06620dabc4020c607885b959a2cbd7c2283c91da3e33","Volumes":null,"WorkingDir":"","Entrypoint":null,"OnBuild":null,"Labels":null},"DockerVersion":"1.8.3","Author":"","Config":{"Hostname":"aded96b43f48","Domainname":"","User":"","AttachStdin":false,"AttachStdout":false,"AttachStderr":false,"Tty":false,"OpenStdin":false,"StdinOnce":false,"Env":null,"Cmd":["sh"],"Image":"9e77fef7a1c9f989988c06620dabc4020c607885b959a2cbd7c2283c91da3e33","Volumes":null,"WorkingDir":"","Entrypoint":null,"OnBuild":null,"Labels":null},"Architecture":"amd64","Os":"linux"}
|
||||
```
|
||||
|
||||
# skopeo copy example:
|
||||
```console
|
||||
$ skopeo copy --src-creds=testuser:testpassword docker://myregistrydomain.com:5000/private oci:local_oci_image
|
||||
```
|
||||
If your cli config is found but it doesn't contain the necessary credentials for the queried registry
|
||||
you'll get an error. You can fix this by either logging in (via `docker login`) or providing `--creds` or `--src-creds|--dest-creds`.
|
||||
|
||||
|
||||
Obtaining skopeo
|
||||
[Obtaining skopeo](./install.md)
|
||||
-
|
||||
`skopeo` may already be packaged in your distribution, for example on Fedora 23 and later you can install it using
|
||||
```sh
|
||||
$ sudo dnf install skopeo
|
||||
```
|
||||
for openSUSE:
|
||||
```sh
|
||||
$ sudo zypper install skopeo
|
||||
```
|
||||
|
||||
For a detailed description how to install or build skopeo, see
|
||||
[install.md](./install.md).
|
||||
|
||||
Otherwise, read on for building and installing it from source:
|
||||
|
||||
To build the `skopeo` binary you need at least Go 1.9.
|
||||
|
||||
There are two ways to build skopeo: in a container, or locally without a container. Choose the one which better matches your needs and environment.
|
||||
|
||||
### Building without a container
|
||||
Building without a container requires a bit more manual work and setup in your environment, but it is more flexible:
|
||||
- It should work in more environments (e.g. for native macOS builds)
|
||||
- It does not require root privileges (after dependencies are installed)
|
||||
- It is faster, therefore more convenient for developing `skopeo`.
|
||||
|
||||
Install the necessary dependencies:
|
||||
```sh
|
||||
# Fedora:
|
||||
sudo dnf install gpgme-devel libassuan-devel btrfs-progs-devel device-mapper-devel ostree-devel
|
||||
|
||||
# Ubuntu (`libbtrfs-dev` requires Ubuntu 18.10 and above):
|
||||
sudo apt install libgpgme-dev libassuan-dev libbtrfs-dev libdevmapper-dev libostree-dev
|
||||
|
||||
# macOS:
|
||||
brew install gpgme
|
||||
|
||||
# openSUSE
|
||||
sudo zypper install libgpgme-devel device-mapper-devel libbtrfs-devel glib2-devel
|
||||
```
|
||||
|
||||
Make sure to clone this repository in your `GOPATH` - otherwise compilation fails.
|
||||
|
||||
```sh
|
||||
$ git clone https://github.com/containers/skopeo $GOPATH/src/github.com/containers/skopeo
|
||||
$ cd $GOPATH/src/github.com/containers/skopeo && make binary-local
|
||||
```
|
||||
|
||||
### Building in a container
|
||||
Building in a container is simpler, but more restrictive:
|
||||
- It requires the `docker` command and the ability to run Linux containers
|
||||
- The created executable is a Linux executable, and depends on dynamic libraries which may only be available only in a container of a similar Linux distribution.
|
||||
|
||||
```sh
|
||||
$ make binary # Or (make all) to also build documentation, see below.
|
||||
```
|
||||
|
||||
To build a pure-Go static binary (disables ostree, devicemapper, btrfs, and gpgme):
|
||||
|
||||
```sh
|
||||
$ make binary-static DISABLE_CGO=1
|
||||
```
|
||||
|
||||
### Building documentation
|
||||
To build the manual you will need go-md2man.
|
||||
```sh
|
||||
Debian$ sudo apt-get install go-md2man
|
||||
Fedora$ sudo dnf install go-md2man
|
||||
```
|
||||
Then
|
||||
```sh
|
||||
$ make docs
|
||||
```
|
||||
|
||||
### Installation
|
||||
Finally, after the binary and documentation is built:
|
||||
```sh
|
||||
$ sudo make install
|
||||
```
|
||||
|
||||
TODO
|
||||
-
|
||||
- list all images on registry?
|
||||
- registry v2 search?
|
||||
- show repo tags via flag or when reference isn't tagged or digested
|
||||
- support rkt/appc image spec
|
||||
|
||||
NOT TODO
|
||||
-
|
||||
- provide a _format_ flag - just use the awesome [jq](https://stedolan.github.io/jq/)
|
||||
|
||||
CONTRIBUTING
|
||||
Contributing
|
||||
-
|
||||
|
||||
Please read the [contribution guide](CONTRIBUTING.md) if you want to collaborate in the project.
|
||||
|
||||
3
SECURITY.md
Normal file
3
SECURITY.md
Normal file
@@ -0,0 +1,3 @@
|
||||
## Security and Disclosure Information Policy for the skopeo Project
|
||||
|
||||
The skopeo Project follows the [Security and Disclosure Information Policy](https://github.com/containers/common/blob/master/SECURITY.md) for the Containers Projects.
|
||||
@@ -6,28 +6,34 @@ import (
|
||||
"io"
|
||||
"strings"
|
||||
|
||||
"github.com/containers/image/copy"
|
||||
"github.com/containers/image/docker/reference"
|
||||
"github.com/containers/image/manifest"
|
||||
"github.com/containers/image/transports"
|
||||
"github.com/containers/image/transports/alltransports"
|
||||
"github.com/containers/image/v5/copy"
|
||||
"github.com/containers/image/v5/docker/reference"
|
||||
"github.com/containers/image/v5/manifest"
|
||||
"github.com/containers/image/v5/transports"
|
||||
"github.com/containers/image/v5/transports/alltransports"
|
||||
"github.com/spf13/cobra"
|
||||
|
||||
encconfig "github.com/containers/ocicrypt/config"
|
||||
enchelpers "github.com/containers/ocicrypt/helpers"
|
||||
imgspecv1 "github.com/opencontainers/image-spec/specs-go/v1"
|
||||
"github.com/urfave/cli"
|
||||
)
|
||||
|
||||
type copyOptions struct {
|
||||
global *globalOptions
|
||||
srcImage *imageOptions
|
||||
destImage *imageDestOptions
|
||||
additionalTags cli.StringSlice // For docker-archive: destinations, in addition to the name:tag specified as destination, also add these
|
||||
removeSignatures bool // Do not copy signatures from the source image
|
||||
signByFingerprint string // Sign the image using a GPG key with the specified fingerprint
|
||||
format optionalString // Force conversion of the image to a specified format
|
||||
quiet bool // Suppress output information when copying images
|
||||
|
||||
additionalTags []string // For docker-archive: destinations, in addition to the name:tag specified as destination, also add these
|
||||
removeSignatures bool // Do not copy signatures from the source image
|
||||
signByFingerprint string // Sign the image using a GPG key with the specified fingerprint
|
||||
format optionalString // Force conversion of the image to a specified format
|
||||
quiet bool // Suppress output information when copying images
|
||||
all bool // Copy all of the images if the source is a list
|
||||
encryptLayer []int // The list of layers to encrypt
|
||||
encryptionKeys []string // Keys needed to encrypt the image
|
||||
decryptionKeys []string // Keys needed to decrypt the image
|
||||
}
|
||||
|
||||
func copyCmd(global *globalOptions) cli.Command {
|
||||
func copyCmd(global *globalOptions) *cobra.Command {
|
||||
sharedFlags, sharedOpts := sharedImageFlags()
|
||||
srcFlags, srcOpts := imageFlags(global, sharedOpts, "src-", "screds")
|
||||
destFlags, destOpts := imageDestFlags(global, sharedOpts, "dest-", "dcreds")
|
||||
@@ -35,50 +41,34 @@ func copyCmd(global *globalOptions) cli.Command {
|
||||
srcImage: srcOpts,
|
||||
destImage: destOpts,
|
||||
}
|
||||
cmd := &cobra.Command{
|
||||
Use: "copy [command options] SOURCE-IMAGE DESTINATION-IMAGE",
|
||||
Short: "Copy an IMAGE-NAME from one location to another",
|
||||
Long: fmt.Sprintf(`Container "IMAGE-NAME" uses a "transport":"details" format.
|
||||
|
||||
return cli.Command{
|
||||
Name: "copy",
|
||||
Usage: "Copy an IMAGE-NAME from one location to another",
|
||||
Description: fmt.Sprintf(`
|
||||
Supported transports:
|
||||
%s
|
||||
|
||||
Container "IMAGE-NAME" uses a "transport":"details" format.
|
||||
|
||||
Supported transports:
|
||||
%s
|
||||
|
||||
See skopeo(1) section "IMAGE NAMES" for the expected format
|
||||
`, strings.Join(transports.ListNames(), ", ")),
|
||||
ArgsUsage: "SOURCE-IMAGE DESTINATION-IMAGE",
|
||||
Action: commandAction(opts.run),
|
||||
// FIXME: Do we need to namespace the GPG aspect?
|
||||
Flags: append(append(append([]cli.Flag{
|
||||
cli.StringSliceFlag{
|
||||
Name: "additional-tag",
|
||||
Usage: "additional tags (supports docker-archive)",
|
||||
Value: &opts.additionalTags, // Surprisingly StringSliceFlag does not support Destination:, but modifies Value: in place.
|
||||
},
|
||||
cli.BoolFlag{
|
||||
Name: "quiet, q",
|
||||
Usage: "Suppress output information when copying images",
|
||||
Destination: &opts.quiet,
|
||||
},
|
||||
cli.BoolFlag{
|
||||
Name: "remove-signatures",
|
||||
Usage: "Do not copy signatures from SOURCE-IMAGE",
|
||||
Destination: &opts.removeSignatures,
|
||||
},
|
||||
cli.StringFlag{
|
||||
Name: "sign-by",
|
||||
Usage: "Sign the image using a GPG key with the specified `FINGERPRINT`",
|
||||
Destination: &opts.signByFingerprint,
|
||||
},
|
||||
cli.GenericFlag{
|
||||
Name: "format, f",
|
||||
Usage: "`MANIFEST TYPE` (oci, v2s1, or v2s2) to use when saving image to directory using the 'dir:' transport (default is manifest type of source)",
|
||||
Value: newOptionalStringValue(&opts.format),
|
||||
},
|
||||
}, sharedFlags...), srcFlags...), destFlags...),
|
||||
See skopeo(1) section "IMAGE NAMES" for the expected format
|
||||
`, strings.Join(transports.ListNames(), ", ")),
|
||||
RunE: commandAction(opts.run),
|
||||
Example: `skopeo copy --sign-by dev@example.com container-storage:example/busybox:streaming docker://example/busybox:gold`,
|
||||
}
|
||||
adjustUsage(cmd)
|
||||
flags := cmd.Flags()
|
||||
flags.AddFlagSet(&sharedFlags)
|
||||
flags.AddFlagSet(&srcFlags)
|
||||
flags.AddFlagSet(&destFlags)
|
||||
flags.StringSliceVar(&opts.additionalTags, "additional-tag", []string{}, "additional tags (supports docker-archive)")
|
||||
flags.BoolVarP(&opts.quiet, "quiet", "q", false, "Suppress output information when copying images")
|
||||
flags.BoolVarP(&opts.all, "all", "a", false, "Copy all images if SOURCE-IMAGE is a list")
|
||||
flags.BoolVar(&opts.removeSignatures, "remove-signatures", false, "Do not copy signatures from SOURCE-IMAGE")
|
||||
flags.StringVar(&opts.signByFingerprint, "sign-by", "", "Sign the image using a GPG key with the specified `FINGERPRINT`")
|
||||
flags.VarP(newOptionalStringValue(&opts.format), "format", "f", `MANIFEST TYPE (oci, v2s1, or v2s2) to use when saving image to directory using the 'dir:' transport (default is manifest type of source)`)
|
||||
flags.StringSliceVar(&opts.encryptionKeys, "encryption-key", []string{}, "*Experimental* key with the encryption protocol to use needed to encrypt the image (e.g. jwe:/path/to/key.pem)")
|
||||
flags.IntSliceVar(&opts.encryptLayer, "encrypt-layer", []int{}, "*Experimental* the 0-indexed layer indices, with support for negative indexing (e.g. 0 is the first layer, -1 is the last layer)")
|
||||
flags.StringSliceVar(&opts.decryptionKeys, "decryption-key", []string{}, "*Experimental* key needed to decrypt the image")
|
||||
return cmd
|
||||
}
|
||||
|
||||
func (opts *copyOptions) run(args []string, stdout io.Writer) error {
|
||||
@@ -147,6 +137,47 @@ func (opts *copyOptions) run(args []string, stdout io.Writer) error {
|
||||
if opts.quiet {
|
||||
stdout = nil
|
||||
}
|
||||
imageListSelection := copy.CopySystemImage
|
||||
if opts.all {
|
||||
imageListSelection = copy.CopyAllImages
|
||||
}
|
||||
|
||||
if len(opts.encryptionKeys) > 0 && len(opts.decryptionKeys) > 0 {
|
||||
return fmt.Errorf("--encryption-key and --decryption-key cannot be specified together")
|
||||
}
|
||||
|
||||
var encLayers *[]int
|
||||
var encConfig *encconfig.EncryptConfig
|
||||
var decConfig *encconfig.DecryptConfig
|
||||
|
||||
if len(opts.encryptLayer) > 0 && len(opts.encryptionKeys) == 0 {
|
||||
return fmt.Errorf("--encrypt-layer can only be used with --encryption-key")
|
||||
}
|
||||
|
||||
if len(opts.encryptionKeys) > 0 {
|
||||
// encryption
|
||||
p := opts.encryptLayer
|
||||
encLayers = &p
|
||||
encryptionKeys := opts.encryptionKeys
|
||||
ecc, err := enchelpers.CreateCryptoConfig(encryptionKeys, []string{})
|
||||
if err != nil {
|
||||
return fmt.Errorf("Invalid encryption keys: %v", err)
|
||||
}
|
||||
cc := encconfig.CombineCryptoConfigs([]encconfig.CryptoConfig{ecc})
|
||||
encConfig = cc.EncryptConfig
|
||||
}
|
||||
|
||||
if len(opts.decryptionKeys) > 0 {
|
||||
// decryption
|
||||
decryptionKeys := opts.decryptionKeys
|
||||
dcc, err := enchelpers.CreateCryptoConfig([]string{}, decryptionKeys)
|
||||
if err != nil {
|
||||
return fmt.Errorf("Invalid decryption keys: %v", err)
|
||||
}
|
||||
cc := encconfig.CombineCryptoConfigs([]encconfig.CryptoConfig{dcc})
|
||||
decConfig = cc.DecryptConfig
|
||||
}
|
||||
|
||||
_, err = copy.Image(ctx, policyContext, destRef, srcRef, ©.Options{
|
||||
RemoveSignatures: opts.removeSignatures,
|
||||
SignBy: opts.signByFingerprint,
|
||||
@@ -154,6 +185,10 @@ func (opts *copyOptions) run(args []string, stdout io.Writer) error {
|
||||
SourceCtx: sourceCtx,
|
||||
DestinationCtx: destinationCtx,
|
||||
ForceManifestMIMEType: manifestType,
|
||||
ImageListSelection: imageListSelection,
|
||||
OciDecryptConfig: decConfig,
|
||||
OciEncryptLayers: encLayers,
|
||||
OciEncryptConfig: encConfig,
|
||||
})
|
||||
return err
|
||||
}
|
||||
|
||||
@@ -6,9 +6,9 @@ import (
|
||||
"io"
|
||||
"strings"
|
||||
|
||||
"github.com/containers/image/transports"
|
||||
"github.com/containers/image/transports/alltransports"
|
||||
"github.com/urfave/cli"
|
||||
"github.com/containers/image/v5/transports"
|
||||
"github.com/containers/image/v5/transports/alltransports"
|
||||
"github.com/spf13/cobra"
|
||||
)
|
||||
|
||||
type deleteOptions struct {
|
||||
@@ -16,28 +16,29 @@ type deleteOptions struct {
|
||||
image *imageOptions
|
||||
}
|
||||
|
||||
func deleteCmd(global *globalOptions) cli.Command {
|
||||
func deleteCmd(global *globalOptions) *cobra.Command {
|
||||
sharedFlags, sharedOpts := sharedImageFlags()
|
||||
imageFlags, imageOpts := imageFlags(global, sharedOpts, "", "")
|
||||
opts := deleteOptions{
|
||||
global: global,
|
||||
image: imageOpts,
|
||||
}
|
||||
return cli.Command{
|
||||
Name: "delete",
|
||||
Usage: "Delete image IMAGE-NAME",
|
||||
Description: fmt.Sprintf(`
|
||||
Delete an "IMAGE_NAME" from a transport
|
||||
|
||||
Supported transports:
|
||||
%s
|
||||
|
||||
See skopeo(1) section "IMAGE NAMES" for the expected format
|
||||
`, strings.Join(transports.ListNames(), ", ")),
|
||||
ArgsUsage: "IMAGE-NAME",
|
||||
Action: commandAction(opts.run),
|
||||
Flags: append(sharedFlags, imageFlags...),
|
||||
cmd := &cobra.Command{
|
||||
Use: "delete [command options] IMAGE-NAME",
|
||||
Short: "Delete image IMAGE-NAME",
|
||||
Long: fmt.Sprintf(`Delete an "IMAGE_NAME" from a transport
|
||||
Supported transports:
|
||||
%s
|
||||
See skopeo(1) section "IMAGE NAMES" for the expected format
|
||||
`, strings.Join(transports.ListNames(), ", ")),
|
||||
RunE: commandAction(opts.run),
|
||||
Example: `skopeo delete docker://registry.example.com/example/pause:latest`,
|
||||
}
|
||||
adjustUsage(cmd)
|
||||
flags := cmd.Flags()
|
||||
flags.AddFlagSet(&sharedFlags)
|
||||
flags.AddFlagSet(&imageFlags)
|
||||
return cmd
|
||||
}
|
||||
|
||||
func (opts *deleteOptions) run(args []string, stdout io.Writer) error {
|
||||
|
||||
@@ -3,7 +3,7 @@ package main
|
||||
import (
|
||||
"strconv"
|
||||
|
||||
"github.com/urfave/cli"
|
||||
"github.com/spf13/pflag"
|
||||
)
|
||||
|
||||
// optionalBool is a boolean with a separate presence flag.
|
||||
@@ -15,10 +15,18 @@ type optionalBool struct {
|
||||
// optionalBool is a cli.Generic == flag.Value implementation equivalent to
|
||||
// the one underlying flag.Bool, except that it records whether the flag has been set.
|
||||
// This is distinct from optionalBool to (pretend to) force callers to use
|
||||
// newOptionalBool
|
||||
// optionalBoolFlag
|
||||
type optionalBoolValue optionalBool
|
||||
|
||||
func newOptionalBoolValue(p *optionalBool) cli.Generic {
|
||||
func optionalBoolFlag(fs *pflag.FlagSet, p *optionalBool, name, usage string) *pflag.Flag {
|
||||
flag := fs.VarPF(internalNewOptionalBoolValue(p), name, "", usage)
|
||||
flag.NoOptDefVal = "true"
|
||||
return flag
|
||||
}
|
||||
|
||||
// WARNING: Do not directly use this method to define optionalBool flag.
|
||||
// Caller should use optionalBoolFlag
|
||||
func internalNewOptionalBoolValue(p *optionalBool) pflag.Value {
|
||||
p.present = false
|
||||
return (*optionalBoolValue)(p)
|
||||
}
|
||||
@@ -40,6 +48,10 @@ func (ob *optionalBoolValue) String() string {
|
||||
return strconv.FormatBool(ob.value)
|
||||
}
|
||||
|
||||
func (ob *optionalBoolValue) Type() string {
|
||||
return "bool"
|
||||
}
|
||||
|
||||
func (ob *optionalBoolValue) IsBoolFlag() bool {
|
||||
return true
|
||||
}
|
||||
@@ -56,7 +68,7 @@ type optionalString struct {
|
||||
// newoptionalString
|
||||
type optionalStringValue optionalString
|
||||
|
||||
func newOptionalStringValue(p *optionalString) cli.Generic {
|
||||
func newOptionalStringValue(p *optionalString) pflag.Value {
|
||||
p.present = false
|
||||
return (*optionalStringValue)(p)
|
||||
}
|
||||
@@ -73,3 +85,45 @@ func (ob *optionalStringValue) String() string {
|
||||
}
|
||||
return ob.value
|
||||
}
|
||||
|
||||
func (ob *optionalStringValue) Type() string {
|
||||
return "string"
|
||||
}
|
||||
|
||||
// optionalInt is a int with a separate presence flag.
|
||||
type optionalInt struct {
|
||||
present bool
|
||||
value int
|
||||
}
|
||||
|
||||
// optionalInt is a cli.Generic == flag.Value implementation equivalent to
|
||||
// the one underlying flag.Int, except that it records whether the flag has been set.
|
||||
// This is distinct from optionalInt to (pretend to) force callers to use
|
||||
// newoptionalIntValue
|
||||
type optionalIntValue optionalInt
|
||||
|
||||
func newOptionalIntValue(p *optionalInt) pflag.Value {
|
||||
p.present = false
|
||||
return (*optionalIntValue)(p)
|
||||
}
|
||||
|
||||
func (ob *optionalIntValue) Set(s string) error {
|
||||
v, err := strconv.ParseInt(s, 0, strconv.IntSize)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
ob.value = int(v)
|
||||
ob.present = true
|
||||
return nil
|
||||
}
|
||||
|
||||
func (ob *optionalIntValue) String() string {
|
||||
if !ob.present {
|
||||
return "" // If the value is not present, just return an empty string, any other value wouldn't make sense.
|
||||
}
|
||||
return strconv.Itoa(int(ob.value))
|
||||
}
|
||||
|
||||
func (ob *optionalIntValue) Type() string {
|
||||
return "int"
|
||||
}
|
||||
|
||||
@@ -3,9 +3,9 @@ package main
|
||||
import (
|
||||
"testing"
|
||||
|
||||
"github.com/spf13/cobra"
|
||||
"github.com/stretchr/testify/assert"
|
||||
"github.com/stretchr/testify/require"
|
||||
"github.com/urfave/cli"
|
||||
)
|
||||
|
||||
func TestOptionalBoolSet(t *testing.T) {
|
||||
@@ -34,7 +34,7 @@ func TestOptionalBoolSet(t *testing.T) {
|
||||
{"2", false, false},
|
||||
} {
|
||||
var ob optionalBool
|
||||
v := newOptionalBoolValue(&ob)
|
||||
v := internalNewOptionalBoolValue(&ob)
|
||||
require.False(t, ob.present)
|
||||
err := v.Set(c.input)
|
||||
if c.accepted {
|
||||
@@ -51,30 +51,23 @@ func TestOptionalBoolSet(t *testing.T) {
|
||||
// is not called in any possible situation).
|
||||
var globalOB, commandOB optionalBool
|
||||
actionRun := false
|
||||
app := cli.NewApp()
|
||||
app.EnableBashCompletion = true
|
||||
app.Flags = []cli.Flag{
|
||||
cli.GenericFlag{
|
||||
Name: "global-OB",
|
||||
Value: newOptionalBoolValue(&globalOB),
|
||||
},
|
||||
app := &cobra.Command{
|
||||
Use: "app",
|
||||
}
|
||||
app.Commands = []cli.Command{{
|
||||
Name: "cmd",
|
||||
Flags: []cli.Flag{
|
||||
cli.GenericFlag{
|
||||
Name: "command-OB",
|
||||
Value: newOptionalBoolValue(&commandOB),
|
||||
},
|
||||
},
|
||||
Action: func(*cli.Context) error {
|
||||
optionalBoolFlag(app.PersistentFlags(), &globalOB, "global-OB", "")
|
||||
cmd := &cobra.Command{
|
||||
Use: "cmd",
|
||||
RunE: func(cmd *cobra.Command, args []string) error {
|
||||
assert.False(t, globalOB.present)
|
||||
assert.False(t, commandOB.present)
|
||||
actionRun = true
|
||||
return nil
|
||||
},
|
||||
}}
|
||||
err := app.Run([]string{"app", "cmd"})
|
||||
}
|
||||
optionalBoolFlag(cmd.Flags(), &commandOB, "command-OB", "")
|
||||
app.AddCommand(cmd)
|
||||
app.SetArgs([]string{"cmd"})
|
||||
err := app.Execute()
|
||||
require.NoError(t, err)
|
||||
assert.True(t, actionRun)
|
||||
}
|
||||
@@ -90,7 +83,7 @@ func TestOptionalBoolString(t *testing.T) {
|
||||
{optionalBool{present: false, value: false}, ""},
|
||||
} {
|
||||
var ob optionalBool
|
||||
v := newOptionalBoolValue(&ob)
|
||||
v := internalNewOptionalBoolValue(&ob)
|
||||
ob = c.input
|
||||
res := v.String()
|
||||
assert.Equal(t, c.expected, res)
|
||||
@@ -114,23 +107,21 @@ func TestOptionalBoolIsBoolFlag(t *testing.T) {
|
||||
} {
|
||||
var ob optionalBool
|
||||
actionRun := false
|
||||
app := cli.NewApp()
|
||||
app.Commands = []cli.Command{{
|
||||
Name: "cmd",
|
||||
Flags: []cli.Flag{
|
||||
cli.GenericFlag{
|
||||
Name: "OB",
|
||||
Value: newOptionalBoolValue(&ob),
|
||||
},
|
||||
},
|
||||
Action: func(ctx *cli.Context) error {
|
||||
app := &cobra.Command{Use: "app"}
|
||||
cmd := &cobra.Command{
|
||||
Use: "cmd",
|
||||
RunE: func(cmd *cobra.Command, args []string) error {
|
||||
assert.Equal(t, c.expectedOB, ob)
|
||||
assert.Equal(t, c.expectedArgs, ([]string)(ctx.Args()))
|
||||
assert.Equal(t, c.expectedArgs, args)
|
||||
actionRun = true
|
||||
return nil
|
||||
},
|
||||
}}
|
||||
err := app.Run(append([]string{"app", "cmd"}, c.input...))
|
||||
}
|
||||
optionalBoolFlag(cmd.Flags(), &ob, "OB", "")
|
||||
app.AddCommand(cmd)
|
||||
|
||||
app.SetArgs(append([]string{"cmd"}, c.input...))
|
||||
err := app.Execute()
|
||||
require.NoError(t, err)
|
||||
assert.True(t, actionRun)
|
||||
}
|
||||
@@ -152,30 +143,23 @@ func TestOptionalStringSet(t *testing.T) {
|
||||
// is not called in any possible situation).
|
||||
var globalOS, commandOS optionalString
|
||||
actionRun := false
|
||||
app := cli.NewApp()
|
||||
app.EnableBashCompletion = true
|
||||
app.Flags = []cli.Flag{
|
||||
cli.GenericFlag{
|
||||
Name: "global-OS",
|
||||
Value: newOptionalStringValue(&globalOS),
|
||||
},
|
||||
app := &cobra.Command{
|
||||
Use: "app",
|
||||
}
|
||||
app.Commands = []cli.Command{{
|
||||
Name: "cmd",
|
||||
Flags: []cli.Flag{
|
||||
cli.GenericFlag{
|
||||
Name: "command-OS",
|
||||
Value: newOptionalStringValue(&commandOS),
|
||||
},
|
||||
},
|
||||
Action: func(*cli.Context) error {
|
||||
app.PersistentFlags().Var(newOptionalStringValue(&globalOS), "global-OS", "")
|
||||
cmd := &cobra.Command{
|
||||
Use: "cmd",
|
||||
RunE: func(cmd *cobra.Command, args []string) error {
|
||||
assert.False(t, globalOS.present)
|
||||
assert.False(t, commandOS.present)
|
||||
actionRun = true
|
||||
return nil
|
||||
},
|
||||
}}
|
||||
err := app.Run([]string{"app", "cmd"})
|
||||
}
|
||||
cmd.Flags().Var(newOptionalStringValue(&commandOS), "command-OS", "")
|
||||
app.AddCommand(cmd)
|
||||
app.SetArgs([]string{"cmd"})
|
||||
err := app.Execute()
|
||||
require.NoError(t, err)
|
||||
assert.True(t, actionRun)
|
||||
}
|
||||
@@ -216,23 +200,22 @@ func TestOptionalStringIsBoolFlag(t *testing.T) {
|
||||
} {
|
||||
var os optionalString
|
||||
actionRun := false
|
||||
app := cli.NewApp()
|
||||
app.Commands = []cli.Command{{
|
||||
Name: "cmd",
|
||||
Flags: []cli.Flag{
|
||||
cli.GenericFlag{
|
||||
Name: "OS",
|
||||
Value: newOptionalStringValue(&os),
|
||||
},
|
||||
},
|
||||
Action: func(ctx *cli.Context) error {
|
||||
app := &cobra.Command{
|
||||
Use: "app",
|
||||
}
|
||||
cmd := &cobra.Command{
|
||||
Use: "cmd",
|
||||
RunE: func(cmd *cobra.Command, args []string) error {
|
||||
assert.Equal(t, c.expectedOS, os)
|
||||
assert.Equal(t, c.expectedArgs, ([]string)(ctx.Args()))
|
||||
assert.Equal(t, c.expectedArgs, args)
|
||||
actionRun = true
|
||||
return nil
|
||||
},
|
||||
}}
|
||||
err := app.Run(append([]string{"app", "cmd"}, c.input...))
|
||||
}
|
||||
cmd.Flags().Var(newOptionalStringValue(&os), "OS", "")
|
||||
app.AddCommand(cmd)
|
||||
app.SetArgs(append([]string{"cmd"}, c.input...))
|
||||
err := app.Execute()
|
||||
require.NoError(t, err)
|
||||
assert.True(t, actionRun)
|
||||
}
|
||||
|
||||
@@ -7,13 +7,14 @@ import (
|
||||
"strings"
|
||||
"time"
|
||||
|
||||
"github.com/containers/image/docker"
|
||||
"github.com/containers/image/manifest"
|
||||
"github.com/containers/image/transports"
|
||||
"github.com/opencontainers/go-digest"
|
||||
"github.com/containers/image/v5/docker"
|
||||
"github.com/containers/image/v5/image"
|
||||
"github.com/containers/image/v5/manifest"
|
||||
"github.com/containers/image/v5/transports"
|
||||
digest "github.com/opencontainers/go-digest"
|
||||
"github.com/pkg/errors"
|
||||
"github.com/sirupsen/logrus"
|
||||
"github.com/urfave/cli"
|
||||
"github.com/spf13/cobra"
|
||||
)
|
||||
|
||||
// inspectOutput is the output format of (skopeo inspect), primarily so that we can format it with a simple json.MarshalIndent.
|
||||
@@ -28,6 +29,7 @@ type inspectOutput struct {
|
||||
Architecture string
|
||||
Os string
|
||||
Layers []string
|
||||
Env []string
|
||||
}
|
||||
|
||||
type inspectOptions struct {
|
||||
@@ -37,39 +39,32 @@ type inspectOptions struct {
|
||||
config bool // Output the raw config blob instead of parsing information about the image
|
||||
}
|
||||
|
||||
func inspectCmd(global *globalOptions) cli.Command {
|
||||
func inspectCmd(global *globalOptions) *cobra.Command {
|
||||
sharedFlags, sharedOpts := sharedImageFlags()
|
||||
imageFlags, imageOpts := imageFlags(global, sharedOpts, "", "")
|
||||
opts := inspectOptions{
|
||||
global: global,
|
||||
image: imageOpts,
|
||||
}
|
||||
return cli.Command{
|
||||
Name: "inspect",
|
||||
Usage: "Inspect image IMAGE-NAME",
|
||||
Description: fmt.Sprintf(`
|
||||
Return low-level information about "IMAGE-NAME" in a registry/transport
|
||||
cmd := &cobra.Command{
|
||||
Use: "inspect [command options] IMAGE-NAME",
|
||||
Short: "Inspect image IMAGE-NAME",
|
||||
Long: fmt.Sprintf(`Return low-level information about "IMAGE-NAME" in a registry/transport
|
||||
Supported transports:
|
||||
%s
|
||||
|
||||
Supported transports:
|
||||
%s
|
||||
|
||||
See skopeo(1) section "IMAGE NAMES" for the expected format
|
||||
`, strings.Join(transports.ListNames(), ", ")),
|
||||
ArgsUsage: "IMAGE-NAME",
|
||||
Flags: append(append([]cli.Flag{
|
||||
cli.BoolFlag{
|
||||
Name: "raw",
|
||||
Usage: "output raw manifest or configuration",
|
||||
Destination: &opts.raw,
|
||||
},
|
||||
cli.BoolFlag{
|
||||
Name: "config",
|
||||
Usage: "output configuration",
|
||||
Destination: &opts.config,
|
||||
},
|
||||
}, sharedFlags...), imageFlags...),
|
||||
Action: commandAction(opts.run),
|
||||
See skopeo(1) section "IMAGE NAMES" for the expected format
|
||||
`, strings.Join(transports.ListNames(), ", ")),
|
||||
RunE: commandAction(opts.run),
|
||||
Example: `skopeo inspect docker://docker.io/fedora`,
|
||||
}
|
||||
adjustUsage(cmd)
|
||||
flags := cmd.Flags()
|
||||
flags.BoolVar(&opts.raw, "raw", false, "output raw manifest or configuration")
|
||||
flags.BoolVar(&opts.config, "config", false, "output configuration")
|
||||
flags.AddFlagSet(&sharedFlags)
|
||||
flags.AddFlagSet(&imageFlags)
|
||||
return cmd
|
||||
}
|
||||
|
||||
func (opts *inspectOptions) run(args []string, stdout io.Writer) (retErr error) {
|
||||
@@ -85,21 +80,40 @@ func (opts *inspectOptions) run(args []string, stdout io.Writer) (retErr error)
|
||||
return err
|
||||
}
|
||||
|
||||
img, err := parseImage(ctx, opts.image, imageName)
|
||||
sys, err := opts.image.newSystemContext()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
src, err := parseImageSource(ctx, opts.image, imageName)
|
||||
if err != nil {
|
||||
return fmt.Errorf("Error parsing image name %q: %v", imageName, err)
|
||||
}
|
||||
|
||||
defer func() {
|
||||
if err := img.Close(); err != nil {
|
||||
if err := src.Close(); err != nil {
|
||||
retErr = errors.Wrapf(retErr, fmt.Sprintf("(could not close image: %v) ", err))
|
||||
}
|
||||
}()
|
||||
|
||||
rawManifest, _, err := img.Manifest(ctx)
|
||||
rawManifest, _, err := src.GetManifest(ctx, nil)
|
||||
if err != nil {
|
||||
return err
|
||||
return fmt.Errorf("Error retrieving manifest for image: %v", err)
|
||||
}
|
||||
|
||||
if opts.raw && !opts.config {
|
||||
_, err := stdout.Write(rawManifest)
|
||||
if err != nil {
|
||||
return fmt.Errorf("Error writing manifest to standard output: %v", err)
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
img, err := image.FromUnparsedImage(ctx, sys, image.UnparsedInstance(src, nil))
|
||||
if err != nil {
|
||||
return fmt.Errorf("Error parsing manifest for image: %v", err)
|
||||
}
|
||||
|
||||
if opts.config && opts.raw {
|
||||
configBlob, err := img.ConfigBlob(ctx)
|
||||
if err != nil {
|
||||
@@ -110,12 +124,6 @@ func (opts *inspectOptions) run(args []string, stdout io.Writer) (retErr error)
|
||||
return fmt.Errorf("Error writing configuration blob to standard output: %v", err)
|
||||
}
|
||||
return nil
|
||||
} else if opts.raw {
|
||||
_, err := stdout.Write(rawManifest)
|
||||
if err != nil {
|
||||
return fmt.Errorf("Error writing manifest to standard output: %v", err)
|
||||
}
|
||||
return nil
|
||||
} else if opts.config {
|
||||
config, err := img.OCIConfig(ctx)
|
||||
if err != nil {
|
||||
@@ -127,6 +135,7 @@ func (opts *inspectOptions) run(args []string, stdout io.Writer) (retErr error)
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
imgInspect, err := img.Inspect(ctx)
|
||||
if err != nil {
|
||||
return err
|
||||
@@ -142,6 +151,7 @@ func (opts *inspectOptions) run(args []string, stdout io.Writer) (retErr error)
|
||||
Architecture: imgInspect.Architecture,
|
||||
Os: imgInspect.Os,
|
||||
Layers: imgInspect.Layers,
|
||||
Env: imgInspect.Env,
|
||||
}
|
||||
outputData.Digest, err = manifest.Digest(rawManifest)
|
||||
if err != nil {
|
||||
@@ -160,7 +170,9 @@ func (opts *inspectOptions) run(args []string, stdout io.Writer) (retErr error)
|
||||
// some registries may decide to block the "list all tags" endpoint
|
||||
// gracefully allow the inspect to continue in this case. Currently
|
||||
// the IBM Bluemix container registry has this restriction.
|
||||
if !strings.Contains(err.Error(), "401") {
|
||||
// In addition, AWS ECR rejects it with 403 (Forbidden) if the "ecr:ListImages"
|
||||
// action is not allowed.
|
||||
if !strings.Contains(err.Error(), "401") && !strings.Contains(err.Error(), "403") {
|
||||
return fmt.Errorf("Error determining repository tags: %v", err)
|
||||
}
|
||||
logrus.Warnf("Registry disallows tag list retrieval; skipping")
|
||||
|
||||
@@ -7,13 +7,13 @@ import (
|
||||
"os"
|
||||
"strings"
|
||||
|
||||
"github.com/containers/image/directory"
|
||||
"github.com/containers/image/image"
|
||||
"github.com/containers/image/pkg/blobinfocache"
|
||||
"github.com/containers/image/types"
|
||||
"github.com/containers/image/v5/directory"
|
||||
"github.com/containers/image/v5/image"
|
||||
"github.com/containers/image/v5/pkg/blobinfocache"
|
||||
"github.com/containers/image/v5/types"
|
||||
"github.com/opencontainers/go-digest"
|
||||
"github.com/pkg/errors"
|
||||
"github.com/urfave/cli"
|
||||
"github.com/spf13/cobra"
|
||||
)
|
||||
|
||||
type layersOptions struct {
|
||||
@@ -21,21 +21,24 @@ type layersOptions struct {
|
||||
image *imageOptions
|
||||
}
|
||||
|
||||
func layersCmd(global *globalOptions) cli.Command {
|
||||
func layersCmd(global *globalOptions) *cobra.Command {
|
||||
sharedFlags, sharedOpts := sharedImageFlags()
|
||||
imageFlags, imageOpts := imageFlags(global, sharedOpts, "", "")
|
||||
opts := layersOptions{
|
||||
global: global,
|
||||
image: imageOpts,
|
||||
}
|
||||
return cli.Command{
|
||||
Name: "layers",
|
||||
Usage: "Get layers of IMAGE-NAME",
|
||||
ArgsUsage: "IMAGE-NAME [LAYER...]",
|
||||
Hidden: true,
|
||||
Action: commandAction(opts.run),
|
||||
Flags: append(sharedFlags, imageFlags...),
|
||||
cmd := &cobra.Command{
|
||||
Hidden: true,
|
||||
Use: "layers [command options] IMAGE-NAME [LAYER...]",
|
||||
Short: "Get layers of IMAGE-NAME",
|
||||
RunE: commandAction(opts.run),
|
||||
}
|
||||
adjustUsage(cmd)
|
||||
flags := cmd.Flags()
|
||||
flags.AddFlagSet(&sharedFlags)
|
||||
flags.AddFlagSet(&imageFlags)
|
||||
return cmd
|
||||
}
|
||||
|
||||
func (opts *layersOptions) run(args []string, stdout io.Writer) (retErr error) {
|
||||
@@ -142,9 +145,9 @@ func (opts *layersOptions) run(args []string, stdout io.Writer) (retErr error) {
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
if err := dest.PutManifest(ctx, manifest); err != nil {
|
||||
if err := dest.PutManifest(ctx, manifest, nil); err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
return dest.Commit(ctx)
|
||||
return dest.Commit(ctx, image.UnparsedInstance(rawSource, nil))
|
||||
}
|
||||
|
||||
138
cmd/skopeo/list_tags.go
Normal file
138
cmd/skopeo/list_tags.go
Normal file
@@ -0,0 +1,138 @@
|
||||
package main
|
||||
|
||||
import (
|
||||
"context"
|
||||
"encoding/json"
|
||||
"fmt"
|
||||
"io"
|
||||
"strings"
|
||||
|
||||
"github.com/containers/image/v5/docker"
|
||||
"github.com/containers/image/v5/docker/reference"
|
||||
"github.com/containers/image/v5/transports/alltransports"
|
||||
"github.com/containers/image/v5/types"
|
||||
"github.com/pkg/errors"
|
||||
"github.com/spf13/cobra"
|
||||
)
|
||||
|
||||
// tagListOutput is the output format of (skopeo list-tags), primarily so that we can format it with a simple json.MarshalIndent.
|
||||
type tagListOutput struct {
|
||||
Repository string
|
||||
Tags []string
|
||||
}
|
||||
|
||||
type tagsOptions struct {
|
||||
global *globalOptions
|
||||
image *imageOptions
|
||||
}
|
||||
|
||||
func tagsCmd(global *globalOptions) *cobra.Command {
|
||||
sharedFlags, sharedOpts := sharedImageFlags()
|
||||
imageFlags, imageOpts := dockerImageFlags(global, sharedOpts, "", "")
|
||||
|
||||
opts := tagsOptions{
|
||||
global: global,
|
||||
image: imageOpts,
|
||||
}
|
||||
cmd := &cobra.Command{
|
||||
Use: "list-tags [command options] REPOSITORY-NAME",
|
||||
Short: "List tags in the transport/repository specified by the REPOSITORY-NAME",
|
||||
Long: `Return the list of tags from the transport/repository "REPOSITORY-NAME"
|
||||
|
||||
Supported transports:
|
||||
docker
|
||||
|
||||
See skopeo-list-tags(1) section "REPOSITORY NAMES" for the expected format
|
||||
`,
|
||||
RunE: commandAction(opts.run),
|
||||
Example: `skopeo list-tags docker://docker.io/fedora`,
|
||||
}
|
||||
adjustUsage(cmd)
|
||||
flags := cmd.Flags()
|
||||
flags.AddFlagSet(&sharedFlags)
|
||||
flags.AddFlagSet(&imageFlags)
|
||||
return cmd
|
||||
}
|
||||
|
||||
// Customized version of the alltransports.ParseImageName and docker.ParseReference that does not place a default tag in the reference
|
||||
// Would really love to not have this, but needed to enforce tag-less and digest-less names
|
||||
func parseDockerRepositoryReference(refString string) (types.ImageReference, error) {
|
||||
if !strings.HasPrefix(refString, docker.Transport.Name()+"://") {
|
||||
return nil, errors.Errorf("docker: image reference %s does not start with %s://", refString, docker.Transport.Name())
|
||||
}
|
||||
|
||||
parts := strings.SplitN(refString, ":", 2)
|
||||
if len(parts) != 2 {
|
||||
return nil, errors.Errorf(`Invalid image name "%s", expected colon-separated transport:reference`, refString)
|
||||
}
|
||||
|
||||
ref, err := reference.ParseNormalizedNamed(strings.TrimPrefix(parts[1], "//"))
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
if !reference.IsNameOnly(ref) {
|
||||
return nil, errors.New(`No tag or digest allowed in reference`)
|
||||
}
|
||||
|
||||
// Checks ok, now return a reference. This is a hack because the tag listing code expects a full image reference even though the tag is ignored
|
||||
return docker.NewReference(reference.TagNameOnly(ref))
|
||||
}
|
||||
|
||||
// List the tags from a repository contained in the imgRef reference. Any tag value in the reference is ignored
|
||||
func listDockerTags(ctx context.Context, sys *types.SystemContext, imgRef types.ImageReference) (string, []string, error) {
|
||||
repositoryName := imgRef.DockerReference().Name()
|
||||
|
||||
tags, err := docker.GetRepositoryTags(ctx, sys, imgRef)
|
||||
if err != nil {
|
||||
return ``, nil, fmt.Errorf("Error listing repository tags: %v", err)
|
||||
}
|
||||
return repositoryName, tags, nil
|
||||
}
|
||||
|
||||
func (opts *tagsOptions) run(args []string, stdout io.Writer) (retErr error) {
|
||||
ctx, cancel := opts.global.commandTimeoutContext()
|
||||
defer cancel()
|
||||
|
||||
if len(args) != 1 {
|
||||
return errorShouldDisplayUsage{errors.New("Exactly one non-option argument expected")}
|
||||
}
|
||||
|
||||
sys, err := opts.image.newSystemContext()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
transport := alltransports.TransportFromImageName(args[0])
|
||||
if transport == nil {
|
||||
return fmt.Errorf("Invalid %q: does not specify a transport", args[0])
|
||||
}
|
||||
|
||||
if transport.Name() != docker.Transport.Name() {
|
||||
return fmt.Errorf("Unsupported transport '%v' for tag listing. Only '%v' currently supported", transport.Name(), docker.Transport.Name())
|
||||
}
|
||||
|
||||
// Do transport-specific parsing and validation to get an image reference
|
||||
imgRef, err := parseDockerRepositoryReference(args[0])
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
repositoryName, tagListing, err := listDockerTags(ctx, sys, imgRef)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
outputData := tagListOutput{
|
||||
Repository: repositoryName,
|
||||
Tags: tagListing,
|
||||
}
|
||||
|
||||
out, err := json.MarshalIndent(outputData, "", " ")
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
_, err = fmt.Fprintf(stdout, "%s\n", string(out))
|
||||
|
||||
return err
|
||||
}
|
||||
57
cmd/skopeo/list_tags_test.go
Normal file
57
cmd/skopeo/list_tags_test.go
Normal file
@@ -0,0 +1,57 @@
|
||||
package main
|
||||
|
||||
import (
|
||||
"testing"
|
||||
|
||||
"github.com/containers/image/v5/transports/alltransports"
|
||||
"github.com/stretchr/testify/assert"
|
||||
)
|
||||
|
||||
// Tests the kinds of inputs allowed and expected to the command
|
||||
func TestDockerRepositoryReferenceParser(t *testing.T) {
|
||||
for _, test := range [][]string{
|
||||
{"docker://myhost.com:1000/nginx"}, //no tag
|
||||
{"docker://myhost.com/nginx"}, //no port or tag
|
||||
{"docker://somehost.com"}, // Valid default expansion
|
||||
{"docker://nginx"}, // Valid default expansion
|
||||
} {
|
||||
|
||||
ref, err := parseDockerRepositoryReference(test[0])
|
||||
expected, err := alltransports.ParseImageName(test[0])
|
||||
if assert.NoError(t, err, "Could not parse, got error on %v", test[0]) {
|
||||
assert.Equal(t, expected.DockerReference().Name(), ref.DockerReference().Name(), "Mismatched parse result for input %v", test[0])
|
||||
}
|
||||
}
|
||||
|
||||
for _, test := range [][]string{
|
||||
{"oci://somedir"},
|
||||
{"dir:/somepath"},
|
||||
{"docker-archive:/tmp/dir"},
|
||||
{"container-storage:myhost.com/someimage"},
|
||||
{"docker-daemon:myhost.com/someimage"},
|
||||
{"docker://myhost.com:1000/nginx:foobar:foobar"}, // Invalid repository ref
|
||||
{"docker://somehost.com:5000/"}, // no repo
|
||||
{"docker://myhost.com:1000/nginx:latest"}, //tag not allowed
|
||||
{"docker://myhost.com:1000/nginx@sha256:abcdef1234567890"}, //digest not allowed
|
||||
} {
|
||||
_, err := parseDockerRepositoryReference(test[0])
|
||||
assert.Error(t, err, test[0])
|
||||
}
|
||||
}
|
||||
|
||||
func TestDockerRepositoryReferenceParserDrift(t *testing.T) {
|
||||
for _, test := range [][]string{
|
||||
{"docker://myhost.com:1000/nginx", "myhost.com:1000/nginx"}, //no tag
|
||||
{"docker://myhost.com/nginx", "myhost.com/nginx"}, //no port or tag
|
||||
{"docker://somehost.com", "docker.io/library/somehost.com"}, // Valid default expansion
|
||||
{"docker://nginx", "docker.io/library/nginx"}, // Valid default expansion
|
||||
} {
|
||||
|
||||
ref, err := parseDockerRepositoryReference(test[0])
|
||||
ref2, err2 := alltransports.ParseImageName(test[0])
|
||||
|
||||
if assert.NoError(t, err, "Could not parse, got error on %v", test[0]) && assert.NoError(t, err2, "Could not parse with regular parser, got error on %v", test[0]) {
|
||||
assert.Equal(t, ref.DockerReference().String(), ref2.DockerReference().String(), "Different parsing output for input %v. Repo parse = %v, regular parser = %v", test[0], ref, ref2)
|
||||
}
|
||||
}
|
||||
}
|
||||
47
cmd/skopeo/login.go
Normal file
47
cmd/skopeo/login.go
Normal file
@@ -0,0 +1,47 @@
|
||||
package main
|
||||
|
||||
import (
|
||||
"io"
|
||||
"os"
|
||||
|
||||
"github.com/containers/common/pkg/auth"
|
||||
"github.com/containers/image/v5/types"
|
||||
"github.com/spf13/cobra"
|
||||
)
|
||||
|
||||
type loginOptions struct {
|
||||
global *globalOptions
|
||||
loginOpts auth.LoginOptions
|
||||
getLogin optionalBool
|
||||
tlsVerify optionalBool
|
||||
}
|
||||
|
||||
func loginCmd(global *globalOptions) *cobra.Command {
|
||||
opts := loginOptions{
|
||||
global: global,
|
||||
}
|
||||
cmd := &cobra.Command{
|
||||
Use: "login",
|
||||
Short: "Login to a container registry",
|
||||
Long: "Login to a container registry on a specified server.",
|
||||
RunE: commandAction(opts.run),
|
||||
Example: `skopeo login quay.io`,
|
||||
}
|
||||
adjustUsage(cmd)
|
||||
flags := cmd.Flags()
|
||||
optionalBoolFlag(flags, &opts.tlsVerify, "tls-verify", "require HTTPS and verify certificates when accessing the registry")
|
||||
flags.AddFlagSet(auth.GetLoginFlags(&opts.loginOpts))
|
||||
return cmd
|
||||
}
|
||||
|
||||
func (opts *loginOptions) run(args []string, stdout io.Writer) error {
|
||||
ctx, cancel := opts.global.commandTimeoutContext()
|
||||
defer cancel()
|
||||
opts.loginOpts.Stdout = stdout
|
||||
opts.loginOpts.Stdin = os.Stdin
|
||||
sys := opts.global.newSystemContext()
|
||||
if opts.tlsVerify.present {
|
||||
sys.DockerInsecureSkipTLSVerify = types.NewOptionalBool(!opts.tlsVerify.value)
|
||||
}
|
||||
return auth.Login(ctx, sys, &opts.loginOpts, args)
|
||||
}
|
||||
35
cmd/skopeo/logout.go
Normal file
35
cmd/skopeo/logout.go
Normal file
@@ -0,0 +1,35 @@
|
||||
package main
|
||||
|
||||
import (
|
||||
"io"
|
||||
|
||||
"github.com/containers/common/pkg/auth"
|
||||
"github.com/spf13/cobra"
|
||||
)
|
||||
|
||||
type logoutOptions struct {
|
||||
global *globalOptions
|
||||
logoutOpts auth.LogoutOptions
|
||||
}
|
||||
|
||||
func logoutCmd(global *globalOptions) *cobra.Command {
|
||||
opts := logoutOptions{
|
||||
global: global,
|
||||
}
|
||||
cmd := &cobra.Command{
|
||||
Use: "logout",
|
||||
Short: "Logout of a container registry",
|
||||
Long: "Logout of a container registry on a specified server.",
|
||||
RunE: commandAction(opts.run),
|
||||
Example: `skopeo logout quay.io`,
|
||||
}
|
||||
adjustUsage(cmd)
|
||||
cmd.Flags().AddFlagSet(auth.GetLogoutFlags(&opts.logoutOpts))
|
||||
return cmd
|
||||
}
|
||||
|
||||
func (opts *logoutOptions) run(args []string, stdout io.Writer) error {
|
||||
opts.logoutOpts.Stdout = stdout
|
||||
sys := opts.global.newSystemContext()
|
||||
return auth.Logout(sys, &opts.logoutOpts, args)
|
||||
}
|
||||
@@ -3,14 +3,14 @@ package main
|
||||
import (
|
||||
"context"
|
||||
"fmt"
|
||||
"os"
|
||||
"time"
|
||||
|
||||
"github.com/containers/image/signature"
|
||||
"github.com/containers/image/v5/signature"
|
||||
"github.com/containers/image/v5/types"
|
||||
"github.com/containers/skopeo/version"
|
||||
"github.com/containers/storage/pkg/reexec"
|
||||
"github.com/sirupsen/logrus"
|
||||
"github.com/urfave/cli"
|
||||
"github.com/spf13/cobra"
|
||||
)
|
||||
|
||||
// gitCommit will be the hash that the binary was built from
|
||||
@@ -22,91 +22,70 @@ type globalOptions struct {
|
||||
tlsVerify optionalBool // Require HTTPS and verify certificates (for docker: and docker-daemon:)
|
||||
policyPath string // Path to a signature verification policy file
|
||||
insecurePolicy bool // Use an "allow everything" signature verification policy
|
||||
registriesDirPath string // Path to a "registries.d" registry configuratio directory
|
||||
registriesDirPath string // Path to a "registries.d" registry configuration directory
|
||||
overrideArch string // Architecture to use for choosing images, instead of the runtime one
|
||||
overrideOS string // OS to use for choosing images, instead of the runtime one
|
||||
overrideVariant string // Architecture variant to use for choosing images, instead of the runtime one
|
||||
commandTimeout time.Duration // Timeout for the command execution
|
||||
registriesConfPath string // Path to the "registries.conf" file
|
||||
tmpDir string // Path to use for big temporary files
|
||||
}
|
||||
|
||||
// createApp returns a cli.App, and the underlying globalOptions object, to be run or tested.
|
||||
func createApp() (*cli.App, *globalOptions) {
|
||||
// createApp returns a cobra.Command, and the underlying globalOptions object, to be run or tested.
|
||||
func createApp() (*cobra.Command, *globalOptions) {
|
||||
opts := globalOptions{}
|
||||
|
||||
app := cli.NewApp()
|
||||
app.EnableBashCompletion = true
|
||||
app.Name = "skopeo"
|
||||
rootCommand := &cobra.Command{
|
||||
Use: "skopeo",
|
||||
Long: "Various operations with container images and container image registries",
|
||||
PersistentPreRunE: func(cmd *cobra.Command, args []string) error {
|
||||
return opts.before(cmd)
|
||||
},
|
||||
SilenceUsage: true,
|
||||
SilenceErrors: true,
|
||||
}
|
||||
if gitCommit != "" {
|
||||
app.Version = fmt.Sprintf("%s commit: %s", version.Version, gitCommit)
|
||||
rootCommand.Version = fmt.Sprintf("%s commit: %s", version.Version, gitCommit)
|
||||
} else {
|
||||
app.Version = version.Version
|
||||
rootCommand.Version = version.Version
|
||||
}
|
||||
app.Usage = "Various operations with container images and container image registries"
|
||||
app.Flags = []cli.Flag{
|
||||
cli.BoolFlag{
|
||||
Name: "debug",
|
||||
Usage: "enable debug output",
|
||||
Destination: &opts.debug,
|
||||
},
|
||||
cli.GenericFlag{
|
||||
Name: "tls-verify",
|
||||
Usage: "require HTTPS and verify certificates when talking to container registries (defaults to true)",
|
||||
Hidden: true,
|
||||
Value: newOptionalBoolValue(&opts.tlsVerify),
|
||||
},
|
||||
cli.StringFlag{
|
||||
Name: "policy",
|
||||
Usage: "Path to a trust policy file",
|
||||
Destination: &opts.policyPath,
|
||||
},
|
||||
cli.BoolFlag{
|
||||
Name: "insecure-policy",
|
||||
Usage: "run the tool without any policy check",
|
||||
Destination: &opts.insecurePolicy,
|
||||
},
|
||||
cli.StringFlag{
|
||||
Name: "registries.d",
|
||||
Usage: "use registry configuration files in `DIR` (e.g. for container signature storage)",
|
||||
Destination: &opts.registriesDirPath,
|
||||
},
|
||||
cli.StringFlag{
|
||||
Name: "override-arch",
|
||||
Usage: "use `ARCH` instead of the architecture of the machine for choosing images",
|
||||
Destination: &opts.overrideArch,
|
||||
},
|
||||
cli.StringFlag{
|
||||
Name: "override-os",
|
||||
Usage: "use `OS` instead of the running OS for choosing images",
|
||||
Destination: &opts.overrideOS,
|
||||
},
|
||||
cli.DurationFlag{
|
||||
Name: "command-timeout",
|
||||
Usage: "timeout for the command execution",
|
||||
Destination: &opts.commandTimeout,
|
||||
},
|
||||
cli.StringFlag{
|
||||
Name: "registries-conf",
|
||||
Usage: "path to the registries.conf file",
|
||||
Destination: &opts.registriesConfPath,
|
||||
Hidden: true,
|
||||
},
|
||||
// Override default `--version` global flag to enable `-v` shorthand
|
||||
var dummyVersion bool
|
||||
rootCommand.Flags().BoolVarP(&dummyVersion, "version", "v", false, "Version for Skopeo")
|
||||
rootCommand.PersistentFlags().BoolVar(&opts.debug, "debug", false, "enable debug output")
|
||||
flag := optionalBoolFlag(rootCommand.PersistentFlags(), &opts.tlsVerify, "tls-verify", "Require HTTPS and verify certificates when accessing the registry")
|
||||
flag.Hidden = true
|
||||
rootCommand.PersistentFlags().StringVar(&opts.policyPath, "policy", "", "Path to a trust policy file")
|
||||
rootCommand.PersistentFlags().BoolVar(&opts.insecurePolicy, "insecure-policy", false, "run the tool without any policy check")
|
||||
rootCommand.PersistentFlags().StringVar(&opts.registriesDirPath, "registries.d", "", "use registry configuration files in `DIR` (e.g. for container signature storage)")
|
||||
rootCommand.PersistentFlags().StringVar(&opts.overrideArch, "override-arch", "", "use `ARCH` instead of the architecture of the machine for choosing images")
|
||||
rootCommand.PersistentFlags().StringVar(&opts.overrideOS, "override-os", "", "use `OS` instead of the running OS for choosing images")
|
||||
rootCommand.PersistentFlags().StringVar(&opts.overrideVariant, "override-variant", "", "use `VARIANT` instead of the running architecture variant for choosing images")
|
||||
rootCommand.PersistentFlags().DurationVar(&opts.commandTimeout, "command-timeout", 0, "timeout for the command execution")
|
||||
rootCommand.PersistentFlags().StringVar(&opts.registriesConfPath, "registries-conf", "", "path to the registries.conf file")
|
||||
if err := rootCommand.PersistentFlags().MarkHidden("registries-conf"); err != nil {
|
||||
logrus.Fatal("unable to mark registries-conf flag as hidden")
|
||||
}
|
||||
app.Before = opts.before
|
||||
app.Commands = []cli.Command{
|
||||
rootCommand.PersistentFlags().StringVar(&opts.tmpDir, "tmpdir", "", "directory used to store temporary files")
|
||||
rootCommand.AddCommand(
|
||||
copyCmd(&opts),
|
||||
deleteCmd(&opts),
|
||||
inspectCmd(&opts),
|
||||
layersCmd(&opts),
|
||||
deleteCmd(&opts),
|
||||
loginCmd(&opts),
|
||||
logoutCmd(&opts),
|
||||
manifestDigestCmd(),
|
||||
syncCmd(&opts),
|
||||
standaloneSignCmd(),
|
||||
standaloneVerifyCmd(),
|
||||
tagsCmd(&opts),
|
||||
untrustedSignatureDumpCmd(),
|
||||
}
|
||||
return app, &opts
|
||||
)
|
||||
return rootCommand, &opts
|
||||
}
|
||||
|
||||
// before is run by the cli package for any command, before running the command-specific handler.
|
||||
func (opts *globalOptions) before(ctx *cli.Context) error {
|
||||
func (opts *globalOptions) before(cmd *cobra.Command) error {
|
||||
if opts.debug {
|
||||
logrus.SetLevel(logrus.DebugLevel)
|
||||
}
|
||||
@@ -120,8 +99,8 @@ func main() {
|
||||
if reexec.Init() {
|
||||
return
|
||||
}
|
||||
app, _ := createApp()
|
||||
if err := app.Run(os.Args); err != nil {
|
||||
rootCmd, _ := createApp()
|
||||
if err := rootCmd.Execute(); err != nil {
|
||||
logrus.Fatal(err)
|
||||
}
|
||||
}
|
||||
@@ -153,3 +132,21 @@ func (opts *globalOptions) commandTimeoutContext() (context.Context, context.Can
|
||||
}
|
||||
return ctx, cancel
|
||||
}
|
||||
|
||||
// newSystemContext returns a *types.SystemContext corresponding to opts.
|
||||
// It is guaranteed to return a fresh instance, so it is safe to make additional updates to it.
|
||||
func (opts *globalOptions) newSystemContext() *types.SystemContext {
|
||||
ctx := &types.SystemContext{
|
||||
RegistriesDirPath: opts.registriesDirPath,
|
||||
ArchitectureChoice: opts.overrideArch,
|
||||
OSChoice: opts.overrideOS,
|
||||
VariantChoice: opts.overrideVariant,
|
||||
SystemRegistriesConfPath: opts.registriesConfPath,
|
||||
BigFilesTemporaryDir: opts.tmpDir,
|
||||
}
|
||||
// DEPRECATED: We support this for backward compatibility, but override it if a per-image flag is provided.
|
||||
if opts.tlsVerify.present {
|
||||
ctx.DockerInsecureSkipTLSVerify = types.NewOptionalBool(!opts.tlsVerify.value)
|
||||
}
|
||||
return ctx
|
||||
}
|
||||
|
||||
@@ -1,14 +1,47 @@
|
||||
package main
|
||||
|
||||
import "bytes"
|
||||
import (
|
||||
"bytes"
|
||||
"testing"
|
||||
|
||||
"github.com/containers/image/v5/types"
|
||||
"github.com/stretchr/testify/assert"
|
||||
)
|
||||
|
||||
// runSkopeo creates an app object and runs it with args, with an implied first "skopeo".
|
||||
// Returns output intended for stdout and the returned error, if any.
|
||||
func runSkopeo(args ...string) (string, error) {
|
||||
app, _ := createApp()
|
||||
stdout := bytes.Buffer{}
|
||||
app.Writer = &stdout
|
||||
args = append([]string{"skopeo"}, args...)
|
||||
err := app.Run(args)
|
||||
app.SetOut(&stdout)
|
||||
app.SetArgs(args)
|
||||
err := app.Execute()
|
||||
return stdout.String(), err
|
||||
}
|
||||
|
||||
func TestGlobalOptionsNewSystemContext(t *testing.T) {
|
||||
// Default state
|
||||
opts, _ := fakeGlobalOptions(t, []string{})
|
||||
res := opts.newSystemContext()
|
||||
assert.Equal(t, &types.SystemContext{}, res)
|
||||
// Set everything to non-default values.
|
||||
opts, _ = fakeGlobalOptions(t, []string{
|
||||
"--registries.d", "/srv/registries.d",
|
||||
"--override-arch", "overridden-arch",
|
||||
"--override-os", "overridden-os",
|
||||
"--override-variant", "overridden-variant",
|
||||
"--tmpdir", "/srv",
|
||||
"--registries-conf", "/srv/registries.conf",
|
||||
"--tls-verify=false",
|
||||
})
|
||||
res = opts.newSystemContext()
|
||||
assert.Equal(t, &types.SystemContext{
|
||||
RegistriesDirPath: "/srv/registries.d",
|
||||
ArchitectureChoice: "overridden-arch",
|
||||
OSChoice: "overridden-os",
|
||||
VariantChoice: "overridden-variant",
|
||||
BigFilesTemporaryDir: "/srv",
|
||||
SystemRegistriesConfPath: "/srv/registries.conf",
|
||||
DockerInsecureSkipTLSVerify: types.OptionalBoolTrue,
|
||||
}, res)
|
||||
}
|
||||
|
||||
@@ -6,21 +6,23 @@ import (
|
||||
"io"
|
||||
"io/ioutil"
|
||||
|
||||
"github.com/containers/image/manifest"
|
||||
"github.com/urfave/cli"
|
||||
"github.com/containers/image/v5/manifest"
|
||||
"github.com/spf13/cobra"
|
||||
)
|
||||
|
||||
type manifestDigestOptions struct {
|
||||
}
|
||||
|
||||
func manifestDigestCmd() cli.Command {
|
||||
opts := manifestDigestOptions{}
|
||||
return cli.Command{
|
||||
Name: "manifest-digest",
|
||||
Usage: "Compute a manifest digest of a file",
|
||||
ArgsUsage: "MANIFEST",
|
||||
Action: commandAction(opts.run),
|
||||
func manifestDigestCmd() *cobra.Command {
|
||||
var opts manifestDigestOptions
|
||||
cmd := &cobra.Command{
|
||||
Use: "manifest-digest MANIFEST",
|
||||
Short: "Compute a manifest digest of a file",
|
||||
RunE: commandAction(opts.run),
|
||||
Example: "skopeo manifest-digest manifest.json",
|
||||
}
|
||||
adjustUsage(cmd)
|
||||
return cmd
|
||||
}
|
||||
|
||||
func (opts *manifestDigestOptions) run(args []string, stdout io.Writer) error {
|
||||
|
||||
@@ -7,29 +7,25 @@ import (
|
||||
"io"
|
||||
"io/ioutil"
|
||||
|
||||
"github.com/containers/image/signature"
|
||||
"github.com/urfave/cli"
|
||||
"github.com/containers/image/v5/signature"
|
||||
"github.com/spf13/cobra"
|
||||
)
|
||||
|
||||
type standaloneSignOptions struct {
|
||||
output string // Output file path
|
||||
}
|
||||
|
||||
func standaloneSignCmd() cli.Command {
|
||||
func standaloneSignCmd() *cobra.Command {
|
||||
opts := standaloneSignOptions{}
|
||||
return cli.Command{
|
||||
Name: "standalone-sign",
|
||||
Usage: "Create a signature using local files",
|
||||
ArgsUsage: "MANIFEST DOCKER-REFERENCE KEY-FINGERPRINT",
|
||||
Action: commandAction(opts.run),
|
||||
Flags: []cli.Flag{
|
||||
cli.StringFlag{
|
||||
Name: "output, o",
|
||||
Usage: "output the signature to `SIGNATURE`",
|
||||
Destination: &opts.output,
|
||||
},
|
||||
},
|
||||
cmd := &cobra.Command{
|
||||
Use: "standalone-sign [command options] MANIFEST DOCKER-REFERENCE KEY-FINGERPRINT",
|
||||
Short: "Create a signature using local files",
|
||||
RunE: commandAction(opts.run),
|
||||
}
|
||||
adjustUsage(cmd)
|
||||
flags := cmd.Flags()
|
||||
flags.StringVarP(&opts.output, "output", "o", "", "output the signature to `SIGNATURE`")
|
||||
return cmd
|
||||
}
|
||||
|
||||
func (opts *standaloneSignOptions) run(args []string, stdout io.Writer) error {
|
||||
@@ -64,14 +60,15 @@ func (opts *standaloneSignOptions) run(args []string, stdout io.Writer) error {
|
||||
type standaloneVerifyOptions struct {
|
||||
}
|
||||
|
||||
func standaloneVerifyCmd() cli.Command {
|
||||
func standaloneVerifyCmd() *cobra.Command {
|
||||
opts := standaloneVerifyOptions{}
|
||||
return cli.Command{
|
||||
Name: "standalone-verify",
|
||||
Usage: "Verify a signature using local files",
|
||||
ArgsUsage: "MANIFEST DOCKER-REFERENCE KEY-FINGERPRINT SIGNATURE",
|
||||
Action: commandAction(opts.run),
|
||||
cmd := &cobra.Command{
|
||||
Use: "standalone-verify MANIFEST DOCKER-REFERENCE KEY-FINGERPRINT SIGNATURE",
|
||||
Short: "Verify a signature using local files",
|
||||
RunE: commandAction(opts.run),
|
||||
}
|
||||
adjustUsage(cmd)
|
||||
return cmd
|
||||
}
|
||||
|
||||
func (opts *standaloneVerifyOptions) run(args []string, stdout io.Writer) error {
|
||||
@@ -115,15 +112,16 @@ func (opts *standaloneVerifyOptions) run(args []string, stdout io.Writer) error
|
||||
type untrustedSignatureDumpOptions struct {
|
||||
}
|
||||
|
||||
func untrustedSignatureDumpCmd() cli.Command {
|
||||
func untrustedSignatureDumpCmd() *cobra.Command {
|
||||
opts := untrustedSignatureDumpOptions{}
|
||||
return cli.Command{
|
||||
Name: "untrusted-signature-dump-without-verification",
|
||||
Usage: "Dump contents of a signature WITHOUT VERIFYING IT",
|
||||
ArgsUsage: "SIGNATURE",
|
||||
Hidden: true,
|
||||
Action: commandAction(opts.run),
|
||||
cmd := &cobra.Command{
|
||||
Use: "untrusted-signature-dump-without-verification SIGNATURE",
|
||||
Short: "Dump contents of a signature WITHOUT VERIFYING IT",
|
||||
RunE: commandAction(opts.run),
|
||||
Hidden: true,
|
||||
}
|
||||
adjustUsage(cmd)
|
||||
return cmd
|
||||
}
|
||||
|
||||
func (opts *untrustedSignatureDumpOptions) run(args []string, stdout io.Writer) error {
|
||||
|
||||
@@ -7,7 +7,7 @@ import (
|
||||
"testing"
|
||||
"time"
|
||||
|
||||
"github.com/containers/image/signature"
|
||||
"github.com/containers/image/v5/signature"
|
||||
"github.com/opencontainers/go-digest"
|
||||
"github.com/stretchr/testify/assert"
|
||||
"github.com/stretchr/testify/require"
|
||||
|
||||
530
cmd/skopeo/sync.go
Normal file
530
cmd/skopeo/sync.go
Normal file
@@ -0,0 +1,530 @@
|
||||
package main
|
||||
|
||||
import (
|
||||
"context"
|
||||
"fmt"
|
||||
"io"
|
||||
"io/ioutil"
|
||||
"os"
|
||||
"path"
|
||||
"path/filepath"
|
||||
"strings"
|
||||
|
||||
"github.com/containers/image/v5/copy"
|
||||
"github.com/containers/image/v5/directory"
|
||||
"github.com/containers/image/v5/docker"
|
||||
"github.com/containers/image/v5/docker/reference"
|
||||
"github.com/containers/image/v5/transports"
|
||||
"github.com/containers/image/v5/types"
|
||||
"github.com/pkg/errors"
|
||||
"github.com/sirupsen/logrus"
|
||||
"github.com/spf13/cobra"
|
||||
"gopkg.in/yaml.v2"
|
||||
)
|
||||
|
||||
// syncOptions contains information retrieved from the skopeo sync command line.
|
||||
type syncOptions struct {
|
||||
global *globalOptions // Global (not command dependant) skopeo options
|
||||
srcImage *imageOptions // Source image options
|
||||
destImage *imageDestOptions // Destination image options
|
||||
removeSignatures bool // Do not copy signatures from the source image
|
||||
signByFingerprint string // Sign the image using a GPG key with the specified fingerprint
|
||||
source string // Source repository name
|
||||
destination string // Destination registry name
|
||||
scoped bool // When true, namespace copied images at destination using the source repository name
|
||||
}
|
||||
|
||||
// repoDescriptor contains information of a single repository used as a sync source.
|
||||
type repoDescriptor struct {
|
||||
DirBasePath string // base path when source is 'dir'
|
||||
TaggedImages []types.ImageReference // List of tagged image found for the repository
|
||||
Context *types.SystemContext // SystemContext for the sync command
|
||||
}
|
||||
|
||||
// tlsVerify is an implementation of the Unmarshaler interface, used to
|
||||
// customize the unmarshaling behaviour of the tls-verify YAML key.
|
||||
type tlsVerifyConfig struct {
|
||||
skip types.OptionalBool // skip TLS verification check (false by default)
|
||||
}
|
||||
|
||||
// registrySyncConfig contains information about a single registry, read from
|
||||
// the source YAML file
|
||||
type registrySyncConfig struct {
|
||||
Images map[string][]string // Images map images name to slices with the images' tags
|
||||
Credentials types.DockerAuthConfig // Username and password used to authenticate with the registry
|
||||
TLSVerify tlsVerifyConfig `yaml:"tls-verify"` // TLS verification mode (enabled by default)
|
||||
CertDir string `yaml:"cert-dir"` // Path to the TLS certificates of the registry
|
||||
}
|
||||
|
||||
// sourceConfig contains all registries information read from the source YAML file
|
||||
type sourceConfig map[string]registrySyncConfig
|
||||
|
||||
func syncCmd(global *globalOptions) *cobra.Command {
|
||||
sharedFlags, sharedOpts := sharedImageFlags()
|
||||
srcFlags, srcOpts := dockerImageFlags(global, sharedOpts, "src-", "screds")
|
||||
destFlags, destOpts := dockerImageFlags(global, sharedOpts, "dest-", "dcreds")
|
||||
|
||||
opts := syncOptions{
|
||||
global: global,
|
||||
srcImage: srcOpts,
|
||||
destImage: &imageDestOptions{imageOptions: destOpts},
|
||||
}
|
||||
|
||||
cmd := &cobra.Command{
|
||||
Use: "sync [command options] --src SOURCE-LOCATION --dest DESTINATION-LOCATION SOURCE DESTINATION",
|
||||
Short: "Synchronize one or more images from one location to another",
|
||||
Long: fmt.Sprint(`Copy all the images from a SOURCE to a DESTINATION.
|
||||
|
||||
Allowed SOURCE transports (specified with --src): docker, dir, yaml.
|
||||
Allowed DESTINATION transports (specified with --dest): docker, dir.
|
||||
|
||||
See skopeo-sync(1) for details.
|
||||
`),
|
||||
RunE: commandAction(opts.run),
|
||||
Example: `skopeo sync --src docker --dest dir --scoped registry.example.com/busybox /media/usb`,
|
||||
}
|
||||
adjustUsage(cmd)
|
||||
flags := cmd.Flags()
|
||||
flags.BoolVar(&opts.removeSignatures, "remove-signatures", false, "Do not copy signatures from SOURCE images")
|
||||
flags.StringVar(&opts.signByFingerprint, "sign-by", "", "Sign the image using a GPG key with the specified `FINGERPRINT`")
|
||||
flags.StringVarP(&opts.source, "src", "s", "", "SOURCE transport type")
|
||||
flags.StringVarP(&opts.destination, "dest", "d", "", "DESTINATION transport type")
|
||||
flags.BoolVar(&opts.scoped, "scoped", false, "Images at DESTINATION are prefix using the full source image path as scope")
|
||||
flags.AddFlagSet(&sharedFlags)
|
||||
flags.AddFlagSet(&srcFlags)
|
||||
flags.AddFlagSet(&destFlags)
|
||||
return cmd
|
||||
}
|
||||
|
||||
// unmarshalYAML is the implementation of the Unmarshaler interface method
|
||||
// method for the tlsVerifyConfig type.
|
||||
// It unmarshals the 'tls-verify' YAML key so that, when they key is not
|
||||
// specified, tls verification is enforced.
|
||||
func (tls *tlsVerifyConfig) UnmarshalYAML(unmarshal func(interface{}) error) error {
|
||||
var verify bool
|
||||
if err := unmarshal(&verify); err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
tls.skip = types.NewOptionalBool(!verify)
|
||||
return nil
|
||||
}
|
||||
|
||||
// newSourceConfig unmarshals the provided YAML file path to the sourceConfig type.
|
||||
// It returns a new unmarshaled sourceConfig object and any error encountered.
|
||||
func newSourceConfig(yamlFile string) (sourceConfig, error) {
|
||||
var cfg sourceConfig
|
||||
source, err := ioutil.ReadFile(yamlFile)
|
||||
if err != nil {
|
||||
return cfg, err
|
||||
}
|
||||
err = yaml.Unmarshal(source, &cfg)
|
||||
if err != nil {
|
||||
return cfg, errors.Wrapf(err, "Failed to unmarshal %q", yamlFile)
|
||||
}
|
||||
return cfg, nil
|
||||
}
|
||||
|
||||
// destinationReference creates an image reference using the provided transport.
|
||||
// It returns a image reference to be used as destination of an image copy and
|
||||
// any error encountered.
|
||||
func destinationReference(destination string, transport string) (types.ImageReference, error) {
|
||||
var imageTransport types.ImageTransport
|
||||
|
||||
switch transport {
|
||||
case docker.Transport.Name():
|
||||
destination = fmt.Sprintf("//%s", destination)
|
||||
imageTransport = docker.Transport
|
||||
case directory.Transport.Name():
|
||||
_, err := os.Stat(destination)
|
||||
if err == nil {
|
||||
return nil, errors.Errorf(fmt.Sprintf("Refusing to overwrite destination directory %q", destination))
|
||||
}
|
||||
if !os.IsNotExist(err) {
|
||||
return nil, errors.Wrap(err, "Destination directory could not be used")
|
||||
}
|
||||
// the directory holding the image must be created here
|
||||
if err = os.MkdirAll(destination, 0755); err != nil {
|
||||
return nil, errors.Wrapf(err, fmt.Sprintf("Error creating directory for image %s",
|
||||
destination))
|
||||
}
|
||||
imageTransport = directory.Transport
|
||||
default:
|
||||
return nil, errors.Errorf("%q is not a valid destination transport", transport)
|
||||
}
|
||||
logrus.Debugf("Destination for transport %q: %s", transport, destination)
|
||||
|
||||
destRef, err := imageTransport.ParseReference(destination)
|
||||
if err != nil {
|
||||
return nil, errors.Wrapf(err, fmt.Sprintf("Cannot obtain a valid image reference for transport %q and reference %q", imageTransport.Name(), destination))
|
||||
}
|
||||
|
||||
return destRef, nil
|
||||
}
|
||||
|
||||
// getImageTags retrieves all the tags associated to an image hosted on a
|
||||
// container registry.
|
||||
// It returns a string slice of tags and any error encountered.
|
||||
func getImageTags(ctx context.Context, sysCtx *types.SystemContext, imgRef types.ImageReference) ([]string, error) {
|
||||
name := imgRef.DockerReference().Name()
|
||||
logrus.WithFields(logrus.Fields{
|
||||
"image": name,
|
||||
}).Info("Getting tags")
|
||||
tags, err := docker.GetRepositoryTags(ctx, sysCtx, imgRef)
|
||||
|
||||
switch err := err.(type) {
|
||||
case nil:
|
||||
break
|
||||
case docker.ErrUnauthorizedForCredentials:
|
||||
// Some registries may decide to block the "list all tags" endpoint.
|
||||
// Gracefully allow the sync to continue in this case.
|
||||
logrus.Warnf("Registry disallows tag list retrieval: %s", err)
|
||||
break
|
||||
default:
|
||||
return tags, errors.Wrapf(err, fmt.Sprintf("Error determining repository tags for image %s", name))
|
||||
}
|
||||
|
||||
return tags, nil
|
||||
}
|
||||
|
||||
// isTagSpecified checks if an image name includes a tag and returns any errors
|
||||
// encountered.
|
||||
func isTagSpecified(imageName string) (bool, error) {
|
||||
normNamed, err := reference.ParseNormalizedNamed(imageName)
|
||||
if err != nil {
|
||||
return false, err
|
||||
}
|
||||
|
||||
tagged := !reference.IsNameOnly(normNamed)
|
||||
logrus.WithFields(logrus.Fields{
|
||||
"imagename": imageName,
|
||||
"tagged": tagged,
|
||||
}).Info("Tag presence check")
|
||||
return tagged, nil
|
||||
}
|
||||
|
||||
// imagesTopCopyFromRepo builds a list of image references from the tags
|
||||
// found in the source repository.
|
||||
// It returns an image reference slice with as many elements as the tags found
|
||||
// and any error encountered.
|
||||
func imagesToCopyFromRepo(repoReference types.ImageReference, repoName string, sourceCtx *types.SystemContext) ([]types.ImageReference, error) {
|
||||
var sourceReferences []types.ImageReference
|
||||
tags, err := getImageTags(context.Background(), sourceCtx, repoReference)
|
||||
if err != nil {
|
||||
return sourceReferences, err
|
||||
}
|
||||
|
||||
for _, tag := range tags {
|
||||
imageAndTag := fmt.Sprintf("%s:%s", repoName, tag)
|
||||
ref, err := docker.ParseReference(imageAndTag)
|
||||
if err != nil {
|
||||
return nil, errors.Wrapf(err, fmt.Sprintf("Cannot obtain a valid image reference for transport %q and reference %q", docker.Transport.Name(), imageAndTag))
|
||||
}
|
||||
sourceReferences = append(sourceReferences, ref)
|
||||
}
|
||||
return sourceReferences, nil
|
||||
}
|
||||
|
||||
// imagesTopCopyFromDir builds a list of image references from the images found
|
||||
// in the source directory.
|
||||
// It returns an image reference slice with as many elements as the images found
|
||||
// and any error encountered.
|
||||
func imagesToCopyFromDir(dirPath string) ([]types.ImageReference, error) {
|
||||
var sourceReferences []types.ImageReference
|
||||
err := filepath.Walk(dirPath, func(path string, info os.FileInfo, err error) error {
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
if !info.IsDir() && info.Name() == "manifest.json" {
|
||||
dirname := filepath.Dir(path)
|
||||
ref, err := directory.Transport.ParseReference(dirname)
|
||||
if err != nil {
|
||||
return errors.Wrapf(err, fmt.Sprintf("Cannot obtain a valid image reference for transport %q and reference %q", directory.Transport.Name(), dirname))
|
||||
}
|
||||
sourceReferences = append(sourceReferences, ref)
|
||||
return filepath.SkipDir
|
||||
}
|
||||
return nil
|
||||
})
|
||||
|
||||
if err != nil {
|
||||
return sourceReferences,
|
||||
errors.Wrapf(err, fmt.Sprintf("Error walking the path %q", dirPath))
|
||||
}
|
||||
|
||||
return sourceReferences, nil
|
||||
}
|
||||
|
||||
// imagesTopCopyFromDir builds a list of repository descriptors from the images
|
||||
// in a registry configuration.
|
||||
// It returns a repository descriptors slice with as many elements as the images
|
||||
// found and any error encountered. Each element of the slice is a list of
|
||||
// tagged image references, to be used as sync source.
|
||||
func imagesToCopyFromRegistry(registryName string, cfg registrySyncConfig, sourceCtx types.SystemContext) ([]repoDescriptor, error) {
|
||||
var repoDescList []repoDescriptor
|
||||
for imageName, tags := range cfg.Images {
|
||||
repoName := fmt.Sprintf("//%s", path.Join(registryName, imageName))
|
||||
logrus.WithFields(logrus.Fields{
|
||||
"repo": imageName,
|
||||
"registry": registryName,
|
||||
}).Info("Processing repo")
|
||||
|
||||
serverCtx := &sourceCtx
|
||||
// override ctx with per-registryName options
|
||||
serverCtx.DockerCertPath = cfg.CertDir
|
||||
serverCtx.DockerDaemonCertPath = cfg.CertDir
|
||||
serverCtx.DockerDaemonInsecureSkipTLSVerify = (cfg.TLSVerify.skip == types.OptionalBoolTrue)
|
||||
serverCtx.DockerInsecureSkipTLSVerify = cfg.TLSVerify.skip
|
||||
serverCtx.DockerAuthConfig = &cfg.Credentials
|
||||
|
||||
var sourceReferences []types.ImageReference
|
||||
for _, tag := range tags {
|
||||
source := fmt.Sprintf("%s:%s", repoName, tag)
|
||||
|
||||
imageRef, err := docker.ParseReference(source)
|
||||
if err != nil {
|
||||
logrus.WithFields(logrus.Fields{
|
||||
"tag": source,
|
||||
}).Error("Error processing tag, skipping")
|
||||
logrus.Errorf("Error getting image reference: %s", err)
|
||||
continue
|
||||
}
|
||||
sourceReferences = append(sourceReferences, imageRef)
|
||||
}
|
||||
|
||||
if len(tags) == 0 {
|
||||
logrus.WithFields(logrus.Fields{
|
||||
"repo": imageName,
|
||||
"registry": registryName,
|
||||
}).Info("Querying registry for image tags")
|
||||
|
||||
imageRef, err := docker.ParseReference(repoName)
|
||||
if err != nil {
|
||||
logrus.WithFields(logrus.Fields{
|
||||
"repo": imageName,
|
||||
"registry": registryName,
|
||||
}).Error("Error processing repo, skipping")
|
||||
logrus.Error(err)
|
||||
continue
|
||||
}
|
||||
|
||||
sourceReferences, err = imagesToCopyFromRepo(imageRef, repoName, serverCtx)
|
||||
if err != nil {
|
||||
logrus.WithFields(logrus.Fields{
|
||||
"repo": imageName,
|
||||
"registry": registryName,
|
||||
}).Error("Error processing repo, skipping")
|
||||
logrus.Error(err)
|
||||
continue
|
||||
}
|
||||
}
|
||||
|
||||
if len(sourceReferences) == 0 {
|
||||
logrus.WithFields(logrus.Fields{
|
||||
"repo": imageName,
|
||||
"registry": registryName,
|
||||
}).Warnf("No tags to sync found")
|
||||
continue
|
||||
}
|
||||
repoDescList = append(repoDescList, repoDescriptor{
|
||||
TaggedImages: sourceReferences,
|
||||
Context: serverCtx})
|
||||
}
|
||||
|
||||
return repoDescList, nil
|
||||
}
|
||||
|
||||
// imagesToCopy retrieves all the images to copy from a specified sync source
|
||||
// and transport.
|
||||
// It returns a slice of repository descriptors, where each descriptor is a
|
||||
// list of tagged image references to be used as sync source, and any error
|
||||
// encountered.
|
||||
func imagesToCopy(source string, transport string, sourceCtx *types.SystemContext) ([]repoDescriptor, error) {
|
||||
var descriptors []repoDescriptor
|
||||
|
||||
switch transport {
|
||||
case docker.Transport.Name():
|
||||
desc := repoDescriptor{
|
||||
Context: sourceCtx,
|
||||
}
|
||||
refName := fmt.Sprintf("//%s", source)
|
||||
srcRef, err := docker.ParseReference(refName)
|
||||
if err != nil {
|
||||
return nil, errors.Wrapf(err, fmt.Sprintf("Cannot obtain a valid image reference for transport %q and reference %q", docker.Transport.Name(), refName))
|
||||
}
|
||||
imageTagged, err := isTagSpecified(source)
|
||||
if err != nil {
|
||||
return descriptors, err
|
||||
}
|
||||
|
||||
if imageTagged {
|
||||
desc.TaggedImages = append(desc.TaggedImages, srcRef)
|
||||
descriptors = append(descriptors, desc)
|
||||
break
|
||||
}
|
||||
|
||||
desc.TaggedImages, err = imagesToCopyFromRepo(
|
||||
srcRef,
|
||||
fmt.Sprintf("//%s", source),
|
||||
sourceCtx)
|
||||
|
||||
if err != nil {
|
||||
return descriptors, err
|
||||
}
|
||||
if len(desc.TaggedImages) == 0 {
|
||||
return descriptors, errors.Errorf("No images to sync found in %q", source)
|
||||
}
|
||||
descriptors = append(descriptors, desc)
|
||||
|
||||
case directory.Transport.Name():
|
||||
desc := repoDescriptor{
|
||||
Context: sourceCtx,
|
||||
}
|
||||
|
||||
if _, err := os.Stat(source); err != nil {
|
||||
return descriptors, errors.Wrap(err, "Invalid source directory specified")
|
||||
}
|
||||
desc.DirBasePath = source
|
||||
var err error
|
||||
desc.TaggedImages, err = imagesToCopyFromDir(source)
|
||||
if err != nil {
|
||||
return descriptors, err
|
||||
}
|
||||
if len(desc.TaggedImages) == 0 {
|
||||
return descriptors, errors.Errorf("No images to sync found in %q", source)
|
||||
}
|
||||
descriptors = append(descriptors, desc)
|
||||
|
||||
case "yaml":
|
||||
cfg, err := newSourceConfig(source)
|
||||
if err != nil {
|
||||
return descriptors, err
|
||||
}
|
||||
for registryName, registryConfig := range cfg {
|
||||
if len(registryConfig.Images) == 0 {
|
||||
logrus.WithFields(logrus.Fields{
|
||||
"registry": registryName,
|
||||
}).Warn("No images specified for registry")
|
||||
continue
|
||||
}
|
||||
|
||||
descs, err := imagesToCopyFromRegistry(registryName, registryConfig, *sourceCtx)
|
||||
if err != nil {
|
||||
return descriptors, errors.Wrapf(err, "Failed to retrieve list of images from registry %q", registryName)
|
||||
}
|
||||
descriptors = append(descriptors, descs...)
|
||||
}
|
||||
}
|
||||
|
||||
return descriptors, nil
|
||||
}
|
||||
|
||||
func (opts *syncOptions) run(args []string, stdout io.Writer) error {
|
||||
if len(args) != 2 {
|
||||
return errorShouldDisplayUsage{errors.New("Exactly two arguments expected")}
|
||||
}
|
||||
|
||||
policyContext, err := opts.global.getPolicyContext()
|
||||
if err != nil {
|
||||
return errors.Wrapf(err, "Error loading trust policy")
|
||||
}
|
||||
defer policyContext.Destroy()
|
||||
|
||||
// validate source and destination options
|
||||
contains := func(val string, list []string) (_ bool) {
|
||||
for _, l := range list {
|
||||
if l == val {
|
||||
return true
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
if len(opts.source) == 0 {
|
||||
return errors.New("A source transport must be specified")
|
||||
}
|
||||
if !contains(opts.source, []string{docker.Transport.Name(), directory.Transport.Name(), "yaml"}) {
|
||||
return errors.Errorf("%q is not a valid source transport", opts.source)
|
||||
}
|
||||
|
||||
if len(opts.destination) == 0 {
|
||||
return errors.New("A destination transport must be specified")
|
||||
}
|
||||
if !contains(opts.destination, []string{docker.Transport.Name(), directory.Transport.Name()}) {
|
||||
return errors.Errorf("%q is not a valid destination transport", opts.destination)
|
||||
}
|
||||
|
||||
if opts.source == opts.destination && opts.source == directory.Transport.Name() {
|
||||
return errors.New("sync from 'dir' to 'dir' not implemented, consider using rsync instead")
|
||||
}
|
||||
|
||||
sourceCtx, err := opts.srcImage.newSystemContext()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
sourceArg := args[0]
|
||||
srcRepoList, err := imagesToCopy(sourceArg, opts.source, sourceCtx)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
destination := args[1]
|
||||
destinationCtx, err := opts.destImage.newSystemContext()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
ctx, cancel := opts.global.commandTimeoutContext()
|
||||
defer cancel()
|
||||
|
||||
imagesNumber := 0
|
||||
options := copy.Options{
|
||||
RemoveSignatures: opts.removeSignatures,
|
||||
SignBy: opts.signByFingerprint,
|
||||
ReportWriter: os.Stdout,
|
||||
DestinationCtx: destinationCtx,
|
||||
}
|
||||
|
||||
for _, srcRepo := range srcRepoList {
|
||||
options.SourceCtx = srcRepo.Context
|
||||
for counter, ref := range srcRepo.TaggedImages {
|
||||
var destSuffix string
|
||||
switch ref.Transport() {
|
||||
case docker.Transport:
|
||||
// docker -> dir or docker -> docker
|
||||
destSuffix = ref.DockerReference().String()
|
||||
case directory.Transport:
|
||||
// dir -> docker (we don't allow `dir` -> `dir` sync operations)
|
||||
destSuffix = strings.TrimPrefix(ref.StringWithinTransport(), srcRepo.DirBasePath)
|
||||
if destSuffix == "" {
|
||||
// if source is a full path to an image, have destPath scoped to repo:tag
|
||||
destSuffix = path.Base(srcRepo.DirBasePath)
|
||||
}
|
||||
}
|
||||
|
||||
if !opts.scoped {
|
||||
destSuffix = path.Base(destSuffix)
|
||||
}
|
||||
|
||||
destRef, err := destinationReference(path.Join(destination, destSuffix), opts.destination)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
logrus.WithFields(logrus.Fields{
|
||||
"from": transports.ImageName(ref),
|
||||
"to": transports.ImageName(destRef),
|
||||
}).Infof("Copying image tag %d/%d", counter+1, len(srcRepo.TaggedImages))
|
||||
|
||||
_, err = copy.Image(ctx, policyContext, destRef, ref, &options)
|
||||
if err != nil {
|
||||
return errors.Wrapf(err, fmt.Sprintf("Error copying tag %q", transports.ImageName(ref)))
|
||||
}
|
||||
imagesNumber++
|
||||
}
|
||||
}
|
||||
|
||||
logrus.Infof("Synced %d images from %d sources", imagesNumber, len(srcRepoList))
|
||||
return nil
|
||||
}
|
||||
@@ -1,9 +1,8 @@
|
||||
package main
|
||||
|
||||
import (
|
||||
"github.com/containers/buildah/pkg/unshare"
|
||||
"github.com/containers/image/storage"
|
||||
"github.com/containers/image/transports/alltransports"
|
||||
"github.com/containers/image/v5/transports/alltransports"
|
||||
"github.com/containers/storage/pkg/unshare"
|
||||
"github.com/pkg/errors"
|
||||
"github.com/syndtr/gocapability/capability"
|
||||
)
|
||||
@@ -36,10 +35,12 @@ func maybeReexec() error {
|
||||
}
|
||||
|
||||
func reexecIfNecessaryForImages(imageNames ...string) error {
|
||||
// Check if container-storage are used before doing unshare
|
||||
// Check if container-storage is used before doing unshare
|
||||
for _, imageName := range imageNames {
|
||||
transport := alltransports.TransportFromImageName(imageName)
|
||||
if transport != nil && transport.Name() == storage.Transport.Name() {
|
||||
// Hard-code the storage name to avoid a reference on c/image/storage.
|
||||
// See https://github.com/containers/skopeo/issues/771#issuecomment-563125006.
|
||||
if transport != nil && transport.Name() == "containers-storage" {
|
||||
return maybeReexec()
|
||||
}
|
||||
}
|
||||
|
||||
@@ -2,13 +2,16 @@ package main
|
||||
|
||||
import (
|
||||
"context"
|
||||
"errors"
|
||||
"io"
|
||||
"os"
|
||||
"strings"
|
||||
|
||||
"github.com/containers/image/transports/alltransports"
|
||||
"github.com/containers/image/types"
|
||||
"github.com/urfave/cli"
|
||||
"github.com/containers/image/v5/pkg/compression"
|
||||
"github.com/containers/image/v5/transports/alltransports"
|
||||
"github.com/containers/image/v5/types"
|
||||
"github.com/pkg/errors"
|
||||
"github.com/spf13/cobra"
|
||||
"github.com/spf13/pflag"
|
||||
)
|
||||
|
||||
// errorShouldDisplayUsage is a subtype of error used by command handlers to indicate that cli.ShowSubcommandHelp should be called.
|
||||
@@ -16,16 +19,16 @@ type errorShouldDisplayUsage struct {
|
||||
error
|
||||
}
|
||||
|
||||
// commandAction intermediates between the cli.ActionFunc interface and the real handler,
|
||||
// primarily to ensure that cli.Context is not available to the handler, which in turn
|
||||
// makes sure that the cli.String() etc. flag access functions are not used,
|
||||
// and everything is done using the *Options structures and the Destination: members of cli.Flag.
|
||||
// handler may return errorShouldDisplayUsage to cause cli.ShowSubcommandHelp to be called.
|
||||
func commandAction(handler func(args []string, stdout io.Writer) error) cli.ActionFunc {
|
||||
return func(c *cli.Context) error {
|
||||
err := handler(([]string)(c.Args()), c.App.Writer)
|
||||
// commandAction intermediates between the RunE interface and the real handler,
|
||||
// primarily to ensure that cobra.Command is not available to the handler, which in turn
|
||||
// makes sure that the cmd.Flags() etc. flag access functions are not used,
|
||||
// and everything is done using the *Options structures and the *Var() methods of cmd.Flag().
|
||||
// handler may return errorShouldDisplayUsage to cause c.Help to be called.
|
||||
func commandAction(handler func(args []string, stdout io.Writer) error) func(cmd *cobra.Command, args []string) error {
|
||||
return func(c *cobra.Command, args []string) error {
|
||||
err := handler(args, c.OutOrStdout())
|
||||
if _, ok := err.(errorShouldDisplayUsage); ok {
|
||||
cli.ShowSubcommandHelp(c)
|
||||
c.Help()
|
||||
}
|
||||
return err
|
||||
}
|
||||
@@ -37,100 +40,91 @@ type sharedImageOptions struct {
|
||||
authFilePath string // Path to a */containers/auth.json
|
||||
}
|
||||
|
||||
// imageFlags prepares a collection of CLI flags writing into sharedImageOptions, and the managed sharedImageOptions structure.
|
||||
func sharedImageFlags() ([]cli.Flag, *sharedImageOptions) {
|
||||
// sharedImageFlags prepares a collection of CLI flags writing into sharedImageOptions, and the managed sharedImageOptions structure.
|
||||
func sharedImageFlags() (pflag.FlagSet, *sharedImageOptions) {
|
||||
opts := sharedImageOptions{}
|
||||
return []cli.Flag{
|
||||
cli.StringFlag{
|
||||
Name: "authfile",
|
||||
Usage: "path of the authentication file. Default is ${XDG_RUNTIME_DIR}/containers/auth.json",
|
||||
Destination: &opts.authFilePath,
|
||||
},
|
||||
}, &opts
|
||||
fs := pflag.FlagSet{}
|
||||
fs.StringVar(&opts.authFilePath, "authfile", os.Getenv("REGISTRY_AUTH_FILE"), "path of the authentication file. Default is ${XDG_RUNTIME_DIR}/containers/auth.json")
|
||||
return fs, &opts
|
||||
}
|
||||
|
||||
// dockerImageOptions collects CLI flags specific to the "docker" transport, which are
|
||||
// the same across subcommands, but may be different for each image
|
||||
// (e.g. may differ between the source and destination of a copy)
|
||||
type dockerImageOptions struct {
|
||||
global *globalOptions // May be shared across several imageOptions instances.
|
||||
shared *sharedImageOptions // May be shared across several imageOptions instances.
|
||||
authFilePath optionalString // Path to a */containers/auth.json (prefixed version to override shared image option).
|
||||
credsOption optionalString // username[:password] for accessing a registry
|
||||
dockerCertPath string // A directory using Docker-like *.{crt,cert,key} files for connecting to a registry or a daemon
|
||||
tlsVerify optionalBool // Require HTTPS and verify certificates (for docker: and docker-daemon:)
|
||||
noCreds bool // Access the registry anonymously
|
||||
}
|
||||
|
||||
// imageOptions collects CLI flags which are the same across subcommands, but may be different for each image
|
||||
// (e.g. may differ between the source and destination of a copy)
|
||||
type imageOptions struct {
|
||||
global *globalOptions // May be shared across several imageOptions instances.
|
||||
shared *sharedImageOptions // May be shared across several imageOptions instances.
|
||||
credsOption optionalString // username[:password] for accessing a registry
|
||||
dockerCertPath string // A directory using Docker-like *.{crt,cert,key} files for connecting to a registry or a daemon
|
||||
tlsVerify optionalBool // Require HTTPS and verify certificates (for docker: and docker-daemon:)
|
||||
sharedBlobDir string // A directory to use for OCI blobs, shared across repositories
|
||||
dockerDaemonHost string // docker-daemon: host to connect to
|
||||
noCreds bool // Access the registry anonymously
|
||||
dockerImageOptions
|
||||
sharedBlobDir string // A directory to use for OCI blobs, shared across repositories
|
||||
dockerDaemonHost string // docker-daemon: host to connect to
|
||||
}
|
||||
|
||||
// dockerImageFlags prepares a collection of docker-transport specific CLI flags
|
||||
// writing into imageOptions, and the managed imageOptions structure.
|
||||
func dockerImageFlags(global *globalOptions, shared *sharedImageOptions, flagPrefix, credsOptionAlias string) (pflag.FlagSet, *imageOptions) {
|
||||
flags := imageOptions{
|
||||
dockerImageOptions: dockerImageOptions{
|
||||
global: global,
|
||||
shared: shared,
|
||||
},
|
||||
}
|
||||
|
||||
fs := pflag.FlagSet{}
|
||||
if flagPrefix != "" {
|
||||
// the non-prefixed flag is handled by a shared flag.
|
||||
fs.Var(newOptionalStringValue(&flags.authFilePath), flagPrefix+"authfile", "path of the authentication file. Default is ${XDG_RUNTIME_DIR}/containers/auth.json")
|
||||
}
|
||||
fs.Var(newOptionalStringValue(&flags.credsOption), flagPrefix+"creds", "Use `USERNAME[:PASSWORD]` for accessing the registry")
|
||||
if credsOptionAlias != "" {
|
||||
// This is horribly ugly, but we need to support the old option forms of (skopeo copy) for compatibility.
|
||||
// Don't add any more cases like this.
|
||||
f := fs.VarPF(newOptionalStringValue(&flags.credsOption), credsOptionAlias, "", "Use `USERNAME[:PASSWORD]` for accessing the registry")
|
||||
f.Hidden = true
|
||||
}
|
||||
fs.StringVar(&flags.dockerCertPath, flagPrefix+"cert-dir", "", "use certificates at `PATH` (*.crt, *.cert, *.key) to connect to the registry or daemon")
|
||||
optionalBoolFlag(&fs, &flags.tlsVerify, flagPrefix+"tls-verify", "require HTTPS and verify certificates when talking to the container registry or daemon (defaults to true)")
|
||||
fs.BoolVar(&flags.noCreds, flagPrefix+"no-creds", false, "Access the registry anonymously")
|
||||
return fs, &flags
|
||||
}
|
||||
|
||||
// imageFlags prepares a collection of CLI flags writing into imageOptions, and the managed imageOptions structure.
|
||||
func imageFlags(global *globalOptions, shared *sharedImageOptions, flagPrefix, credsOptionAlias string) ([]cli.Flag, *imageOptions) {
|
||||
opts := imageOptions{
|
||||
global: global,
|
||||
shared: shared,
|
||||
}
|
||||
func imageFlags(global *globalOptions, shared *sharedImageOptions, flagPrefix, credsOptionAlias string) (pflag.FlagSet, *imageOptions) {
|
||||
dockerFlags, opts := dockerImageFlags(global, shared, flagPrefix, credsOptionAlias)
|
||||
|
||||
// This is horribly ugly, but we need to support the old option forms of (skopeo copy) for compatibility.
|
||||
// Don't add any more cases like this.
|
||||
credsOptionExtra := ""
|
||||
if credsOptionAlias != "" {
|
||||
credsOptionExtra += "," + credsOptionAlias
|
||||
}
|
||||
|
||||
return []cli.Flag{
|
||||
cli.GenericFlag{
|
||||
Name: flagPrefix + "creds" + credsOptionExtra,
|
||||
Usage: "Use `USERNAME[:PASSWORD]` for accessing the registry",
|
||||
Value: newOptionalStringValue(&opts.credsOption),
|
||||
},
|
||||
cli.StringFlag{
|
||||
Name: flagPrefix + "cert-dir",
|
||||
Usage: "use certificates at `PATH` (*.crt, *.cert, *.key) to connect to the registry or daemon",
|
||||
Destination: &opts.dockerCertPath,
|
||||
},
|
||||
cli.GenericFlag{
|
||||
Name: flagPrefix + "tls-verify",
|
||||
Usage: "require HTTPS and verify certificates when talking to the container registry or daemon (defaults to true)",
|
||||
Value: newOptionalBoolValue(&opts.tlsVerify),
|
||||
},
|
||||
cli.StringFlag{
|
||||
Name: flagPrefix + "shared-blob-dir",
|
||||
Usage: "`DIRECTORY` to use to share blobs across OCI repositories",
|
||||
Destination: &opts.sharedBlobDir,
|
||||
},
|
||||
cli.StringFlag{
|
||||
Name: flagPrefix + "daemon-host",
|
||||
Usage: "use docker daemon host at `HOST` (docker-daemon: only)",
|
||||
Destination: &opts.dockerDaemonHost,
|
||||
},
|
||||
cli.BoolFlag{
|
||||
Name: flagPrefix + "no-creds",
|
||||
Usage: "Access the registry anonymously",
|
||||
Destination: &opts.noCreds,
|
||||
},
|
||||
}, &opts
|
||||
fs := pflag.FlagSet{}
|
||||
fs.StringVar(&opts.sharedBlobDir, flagPrefix+"shared-blob-dir", "", "`DIRECTORY` to use to share blobs across OCI repositories")
|
||||
fs.StringVar(&opts.dockerDaemonHost, flagPrefix+"daemon-host", "", "use docker daemon host at `HOST` (docker-daemon: only)")
|
||||
fs.AddFlagSet(&dockerFlags)
|
||||
return fs, opts
|
||||
}
|
||||
|
||||
// newSystemContext returns a *types.SystemContext corresponding to opts.
|
||||
// It is guaranteed to return a fresh instance, so it is safe to make additional updates to it.
|
||||
func (opts *imageOptions) newSystemContext() (*types.SystemContext, error) {
|
||||
ctx := &types.SystemContext{
|
||||
RegistriesDirPath: opts.global.registriesDirPath,
|
||||
ArchitectureChoice: opts.global.overrideArch,
|
||||
OSChoice: opts.global.overrideOS,
|
||||
DockerCertPath: opts.dockerCertPath,
|
||||
OCISharedBlobDirPath: opts.sharedBlobDir,
|
||||
AuthFilePath: opts.shared.authFilePath,
|
||||
DockerDaemonHost: opts.dockerDaemonHost,
|
||||
DockerDaemonCertPath: opts.dockerCertPath,
|
||||
SystemRegistriesConfPath: opts.global.registriesConfPath,
|
||||
// *types.SystemContext instance from globalOptions
|
||||
// imageOptions option overrides the instance if both are present.
|
||||
ctx := opts.global.newSystemContext()
|
||||
ctx.DockerCertPath = opts.dockerCertPath
|
||||
ctx.OCISharedBlobDirPath = opts.sharedBlobDir
|
||||
ctx.AuthFilePath = opts.shared.authFilePath
|
||||
ctx.DockerDaemonHost = opts.dockerDaemonHost
|
||||
ctx.DockerDaemonCertPath = opts.dockerCertPath
|
||||
if opts.dockerImageOptions.authFilePath.present {
|
||||
ctx.AuthFilePath = opts.dockerImageOptions.authFilePath.value
|
||||
}
|
||||
if opts.tlsVerify.present {
|
||||
ctx.DockerDaemonInsecureSkipTLSVerify = !opts.tlsVerify.value
|
||||
}
|
||||
// DEPRECATED: We support this for backward compatibility, but override it if a per-image flag is provided.
|
||||
if opts.global.tlsVerify.present {
|
||||
ctx.DockerInsecureSkipTLSVerify = types.NewOptionalBool(!opts.global.tlsVerify.value)
|
||||
}
|
||||
if opts.tlsVerify.present {
|
||||
ctx.DockerInsecureSkipTLSVerify = types.NewOptionalBool(!opts.tlsVerify.value)
|
||||
}
|
||||
@@ -147,39 +141,30 @@ func (opts *imageOptions) newSystemContext() (*types.SystemContext, error) {
|
||||
if opts.noCreds {
|
||||
ctx.DockerAuthConfig = &types.DockerAuthConfig{}
|
||||
}
|
||||
|
||||
return ctx, nil
|
||||
}
|
||||
|
||||
// imageDestOptions is a superset of imageOptions specialized for iamge destinations.
|
||||
type imageDestOptions struct {
|
||||
*imageOptions
|
||||
osTreeTmpDir string // A directory to use for OSTree temporary files
|
||||
dirForceCompression bool // Compress layers when saving to the dir: transport
|
||||
ociAcceptUncompressedLayers bool // Whether to accept uncompressed layers in the oci: transport
|
||||
dirForceCompression bool // Compress layers when saving to the dir: transport
|
||||
ociAcceptUncompressedLayers bool // Whether to accept uncompressed layers in the oci: transport
|
||||
compressionFormat string // Format to use for the compression
|
||||
compressionLevel optionalInt // Level to use for the compression
|
||||
}
|
||||
|
||||
// imageDestFlags prepares a collection of CLI flags writing into imageDestOptions, and the managed imageDestOptions structure.
|
||||
func imageDestFlags(global *globalOptions, shared *sharedImageOptions, flagPrefix, credsOptionAlias string) ([]cli.Flag, *imageDestOptions) {
|
||||
func imageDestFlags(global *globalOptions, shared *sharedImageOptions, flagPrefix, credsOptionAlias string) (pflag.FlagSet, *imageDestOptions) {
|
||||
genericFlags, genericOptions := imageFlags(global, shared, flagPrefix, credsOptionAlias)
|
||||
opts := imageDestOptions{imageOptions: genericOptions}
|
||||
|
||||
return append(genericFlags, []cli.Flag{
|
||||
cli.StringFlag{
|
||||
Name: flagPrefix + "ostree-tmp-dir",
|
||||
Usage: "`DIRECTORY` to use for OSTree temporary files",
|
||||
Destination: &opts.osTreeTmpDir,
|
||||
},
|
||||
cli.BoolFlag{
|
||||
Name: flagPrefix + "compress",
|
||||
Usage: "Compress tarball image layers when saving to directory using the 'dir' transport. (default is same compression type as source)",
|
||||
Destination: &opts.dirForceCompression,
|
||||
},
|
||||
cli.BoolFlag{
|
||||
Name: flagPrefix + "oci-accept-uncompressed-layers",
|
||||
Usage: "Allow uncompressed image layers when saving to an OCI image using the 'oci' transport. (default is to compress things that aren't compressed)",
|
||||
Destination: &opts.ociAcceptUncompressedLayers,
|
||||
},
|
||||
}...), &opts
|
||||
fs := pflag.FlagSet{}
|
||||
fs.AddFlagSet(&genericFlags)
|
||||
fs.BoolVar(&opts.dirForceCompression, flagPrefix+"compress", false, "Compress tarball image layers when saving to directory using the 'dir' transport. (default is same compression type as source)")
|
||||
fs.BoolVar(&opts.ociAcceptUncompressedLayers, flagPrefix+"oci-accept-uncompressed-layers", false, "Allow uncompressed image layers when saving to an OCI image using the 'oci' transport. (default is to compress things that aren't compressed)")
|
||||
fs.StringVar(&opts.compressionFormat, flagPrefix+"compress-format", "", "`FORMAT` to use for the compression")
|
||||
fs.Var(newOptionalIntValue(&opts.compressionLevel), flagPrefix+"compress-level", "`LEVEL` to use for the compression")
|
||||
return fs, &opts
|
||||
}
|
||||
|
||||
// newSystemContext returns a *types.SystemContext corresponding to opts.
|
||||
@@ -190,9 +175,18 @@ func (opts *imageDestOptions) newSystemContext() (*types.SystemContext, error) {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
ctx.OSTreeTmpDirPath = opts.osTreeTmpDir
|
||||
ctx.DirForceCompress = opts.dirForceCompression
|
||||
ctx.OCIAcceptUncompressedLayers = opts.ociAcceptUncompressedLayers
|
||||
if opts.compressionFormat != "" {
|
||||
cf, err := compression.AlgorithmByName(opts.compressionFormat)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
ctx.CompressionFormat = &cf
|
||||
}
|
||||
if opts.compressionLevel.present {
|
||||
ctx.CompressionLevel = &opts.compressionLevel.value
|
||||
}
|
||||
return ctx, err
|
||||
}
|
||||
|
||||
@@ -221,20 +215,6 @@ func getDockerAuth(creds string) (*types.DockerAuthConfig, error) {
|
||||
}, nil
|
||||
}
|
||||
|
||||
// parseImage converts image URL-like string to an initialized handler for that image.
|
||||
// The caller must call .Close() on the returned ImageCloser.
|
||||
func parseImage(ctx context.Context, opts *imageOptions, name string) (types.ImageCloser, error) {
|
||||
ref, err := alltransports.ParseImageName(name)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
sys, err := opts.newSystemContext()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return ref.NewImage(ctx, sys)
|
||||
}
|
||||
|
||||
// parseImageSource converts image URL-like string to an ImageSource.
|
||||
// The caller must call .Close() on the returned ImageSource.
|
||||
func parseImageSource(ctx context.Context, opts *imageOptions, name string) (types.ImageSource, error) {
|
||||
@@ -248,3 +228,32 @@ func parseImageSource(ctx context.Context, opts *imageOptions, name string) (typ
|
||||
}
|
||||
return ref.NewImageSource(ctx, sys)
|
||||
}
|
||||
|
||||
// usageTemplate returns the usage template for skopeo commands
|
||||
// This blocks the displaying of the global options. The main skopeo
|
||||
// command should not use this.
|
||||
const usageTemplate = `Usage:{{if .Runnable}}
|
||||
{{.UseLine}}{{end}}{{if .HasAvailableSubCommands}}
|
||||
|
||||
{{.CommandPath}} [command]{{end}}{{if gt (len .Aliases) 0}}
|
||||
|
||||
Aliases:
|
||||
{{.NameAndAliases}}{{end}}{{if .HasExample}}
|
||||
|
||||
Examples:
|
||||
{{.Example}}{{end}}{{if .HasAvailableSubCommands}}
|
||||
|
||||
Available Commands:{{range .Commands}}{{if (or .IsAvailableCommand (eq .Name "help"))}}
|
||||
{{rpad .Name .NamePadding }} {{.Short}}{{end}}{{end}}{{end}}{{if .HasAvailableLocalFlags}}
|
||||
|
||||
Flags:
|
||||
{{.LocalFlags.FlagUsages | trimTrailingWhitespaces}}{{end}}{{if .HasAvailableInheritedFlags}}
|
||||
{{end}}
|
||||
`
|
||||
|
||||
// adjustUsage uses usageTemplate template to get rid the GlobalOption from usage
|
||||
// and disable [flag] at the end of command usage
|
||||
func adjustUsage(c *cobra.Command) {
|
||||
c.SetUsageTemplate(usageTemplate)
|
||||
c.DisableFlagsInUseLine = true
|
||||
}
|
||||
|
||||
@@ -1,41 +1,33 @@
|
||||
package main
|
||||
|
||||
import (
|
||||
"flag"
|
||||
"os"
|
||||
"testing"
|
||||
|
||||
"github.com/containers/image/types"
|
||||
"github.com/containers/image/v5/types"
|
||||
"github.com/spf13/cobra"
|
||||
"github.com/stretchr/testify/assert"
|
||||
"github.com/stretchr/testify/require"
|
||||
)
|
||||
|
||||
// fakeGlobalOptions creates globalOptions and sets it according to flags.
|
||||
// NOTE: This is QUITE FAKE; none of the urfave/cli normalization and the like happens.
|
||||
func fakeGlobalOptions(t *testing.T, flags []string) *globalOptions {
|
||||
func fakeGlobalOptions(t *testing.T, flags []string) (*globalOptions, *cobra.Command) {
|
||||
app, opts := createApp()
|
||||
|
||||
flagSet := flag.NewFlagSet(app.Name, flag.ContinueOnError)
|
||||
for _, f := range app.Flags {
|
||||
f.Apply(flagSet)
|
||||
}
|
||||
err := flagSet.Parse(flags)
|
||||
cmd := &cobra.Command{}
|
||||
app.AddCommand(cmd)
|
||||
err := cmd.ParseFlags(flags)
|
||||
require.NoError(t, err)
|
||||
|
||||
return opts
|
||||
return opts, cmd
|
||||
}
|
||||
|
||||
// fakeImageOptions creates imageOptions and sets it according to globalFlags/cmdFlags.
|
||||
// NOTE: This is QUITE FAKE; none of the urfave/cli normalization and the like happens.
|
||||
func fakeImageOptions(t *testing.T, flagPrefix string, globalFlags []string, cmdFlags []string) *imageOptions {
|
||||
globalOpts := fakeGlobalOptions(t, globalFlags)
|
||||
|
||||
globalOpts, cmd := fakeGlobalOptions(t, globalFlags)
|
||||
sharedFlags, sharedOpts := sharedImageFlags()
|
||||
imageFlags, imageOpts := imageFlags(globalOpts, sharedOpts, flagPrefix, "")
|
||||
flagSet := flag.NewFlagSet("fakeImageOptions", flag.ContinueOnError)
|
||||
for _, f := range append(sharedFlags, imageFlags...) {
|
||||
f.Apply(flagSet)
|
||||
}
|
||||
err := flagSet.Parse(cmdFlags)
|
||||
cmd.Flags().AddFlagSet(&sharedFlags)
|
||||
cmd.Flags().AddFlagSet(&imageFlags)
|
||||
err := cmd.ParseFlags(cmdFlags)
|
||||
require.NoError(t, err)
|
||||
return imageOpts
|
||||
}
|
||||
@@ -52,8 +44,11 @@ func TestImageOptionsNewSystemContext(t *testing.T) {
|
||||
"--registries.d", "/srv/registries.d",
|
||||
"--override-arch", "overridden-arch",
|
||||
"--override-os", "overridden-os",
|
||||
"--override-variant", "overridden-variant",
|
||||
"--tmpdir", "/srv",
|
||||
}, []string{
|
||||
"--authfile", "/srv/authfile",
|
||||
"--dest-authfile", "/srv/dest-authfile",
|
||||
"--dest-cert-dir", "/srv/cert-dir",
|
||||
"--dest-shared-blob-dir", "/srv/shared-blob-dir",
|
||||
"--dest-daemon-host", "daemon-host.example.com",
|
||||
@@ -64,9 +59,10 @@ func TestImageOptionsNewSystemContext(t *testing.T) {
|
||||
require.NoError(t, err)
|
||||
assert.Equal(t, &types.SystemContext{
|
||||
RegistriesDirPath: "/srv/registries.d",
|
||||
AuthFilePath: "/srv/authfile",
|
||||
AuthFilePath: "/srv/dest-authfile",
|
||||
ArchitectureChoice: "overridden-arch",
|
||||
OSChoice: "overridden-os",
|
||||
VariantChoice: "overridden-variant",
|
||||
OCISharedBlobDirPath: "/srv/shared-blob-dir",
|
||||
DockerCertPath: "/srv/cert-dir",
|
||||
DockerInsecureSkipTLSVerify: types.OptionalBoolTrue,
|
||||
@@ -74,6 +70,7 @@ func TestImageOptionsNewSystemContext(t *testing.T) {
|
||||
DockerDaemonCertPath: "/srv/cert-dir",
|
||||
DockerDaemonHost: "daemon-host.example.com",
|
||||
DockerDaemonInsecureSkipTLSVerify: true,
|
||||
BigFilesTemporaryDir: "/srv",
|
||||
}, res)
|
||||
|
||||
// Global/per-command tlsVerify behavior
|
||||
@@ -114,17 +111,13 @@ func TestImageOptionsNewSystemContext(t *testing.T) {
|
||||
}
|
||||
|
||||
// fakeImageDestOptions creates imageDestOptions and sets it according to globalFlags/cmdFlags.
|
||||
// NOTE: This is QUITE FAKE; none of the urfave/cli normalization and the like happens.
|
||||
func fakeImageDestOptions(t *testing.T, flagPrefix string, globalFlags []string, cmdFlags []string) *imageDestOptions {
|
||||
globalOpts := fakeGlobalOptions(t, globalFlags)
|
||||
|
||||
globalOpts, cmd := fakeGlobalOptions(t, globalFlags)
|
||||
sharedFlags, sharedOpts := sharedImageFlags()
|
||||
imageFlags, imageOpts := imageDestFlags(globalOpts, sharedOpts, flagPrefix, "")
|
||||
flagSet := flag.NewFlagSet("fakeImageDestOptions", flag.ContinueOnError)
|
||||
for _, f := range append(sharedFlags, imageFlags...) {
|
||||
f.Apply(flagSet)
|
||||
}
|
||||
err := flagSet.Parse(cmdFlags)
|
||||
cmd.Flags().AddFlagSet(&sharedFlags)
|
||||
cmd.Flags().AddFlagSet(&imageFlags)
|
||||
err := cmd.ParseFlags(cmdFlags)
|
||||
require.NoError(t, err)
|
||||
return imageOpts
|
||||
}
|
||||
@@ -136,23 +129,36 @@ func TestImageDestOptionsNewSystemContext(t *testing.T) {
|
||||
require.NoError(t, err)
|
||||
assert.Equal(t, &types.SystemContext{}, res)
|
||||
|
||||
oldXRD, hasXRD := os.LookupEnv("REGISTRY_AUTH_FILE")
|
||||
defer func() {
|
||||
if hasXRD {
|
||||
os.Setenv("REGISTRY_AUTH_FILE", oldXRD)
|
||||
} else {
|
||||
os.Unsetenv("REGISTRY_AUTH_FILE")
|
||||
}
|
||||
}()
|
||||
authFile := "/tmp/auth.json"
|
||||
// Make sure when REGISTRY_AUTH_FILE is set the auth file is used
|
||||
os.Setenv("REGISTRY_AUTH_FILE", authFile)
|
||||
|
||||
// Explicitly set everything to default, except for when the default is “not present”
|
||||
opts = fakeImageDestOptions(t, "dest-", []string{}, []string{
|
||||
"--dest-compress=false",
|
||||
})
|
||||
res, err = opts.newSystemContext()
|
||||
require.NoError(t, err)
|
||||
assert.Equal(t, &types.SystemContext{}, res)
|
||||
assert.Equal(t, &types.SystemContext{AuthFilePath: authFile}, res)
|
||||
|
||||
// Set everything to non-default values.
|
||||
opts = fakeImageDestOptions(t, "dest-", []string{
|
||||
"--registries.d", "/srv/registries.d",
|
||||
"--override-arch", "overridden-arch",
|
||||
"--override-os", "overridden-os",
|
||||
"--override-variant", "overridden-variant",
|
||||
"--tmpdir", "/srv",
|
||||
}, []string{
|
||||
"--authfile", "/srv/authfile",
|
||||
"--dest-cert-dir", "/srv/cert-dir",
|
||||
"--dest-ostree-tmp-dir", "/srv/ostree-tmp-dir",
|
||||
"--dest-shared-blob-dir", "/srv/shared-blob-dir",
|
||||
"--dest-compress=true",
|
||||
"--dest-daemon-host", "daemon-host.example.com",
|
||||
@@ -166,15 +172,16 @@ func TestImageDestOptionsNewSystemContext(t *testing.T) {
|
||||
AuthFilePath: "/srv/authfile",
|
||||
ArchitectureChoice: "overridden-arch",
|
||||
OSChoice: "overridden-os",
|
||||
VariantChoice: "overridden-variant",
|
||||
OCISharedBlobDirPath: "/srv/shared-blob-dir",
|
||||
DockerCertPath: "/srv/cert-dir",
|
||||
DockerInsecureSkipTLSVerify: types.OptionalBoolTrue,
|
||||
DockerAuthConfig: &types.DockerAuthConfig{Username: "creds-user", Password: "creds-password"},
|
||||
OSTreeTmpDirPath: "/srv/ostree-tmp-dir",
|
||||
DockerDaemonCertPath: "/srv/cert-dir",
|
||||
DockerDaemonHost: "daemon-host.example.com",
|
||||
DockerDaemonInsecureSkipTLSVerify: true,
|
||||
DirForceCompress: true,
|
||||
BigFilesTemporaryDir: "/srv",
|
||||
}, res)
|
||||
|
||||
// Invalid option values in imageOptions
|
||||
@@ -182,3 +189,47 @@ func TestImageDestOptionsNewSystemContext(t *testing.T) {
|
||||
_, err = opts.newSystemContext()
|
||||
assert.Error(t, err)
|
||||
}
|
||||
|
||||
// since there is a shared authfile image option and a non-shared (prefixed) one, make sure the override logic
|
||||
// works correctly.
|
||||
func TestImageOptionsAuthfileOverride(t *testing.T) {
|
||||
|
||||
for _, testCase := range []struct {
|
||||
flagPrefix string
|
||||
cmdFlags []string
|
||||
expectedAuthfilePath string
|
||||
}{
|
||||
// if there is no prefix, only authfile is allowed.
|
||||
{"",
|
||||
[]string{
|
||||
"--authfile", "/srv/authfile",
|
||||
}, "/srv/authfile"},
|
||||
// if authfile and dest-authfile is provided, dest-authfile wins
|
||||
{"dest-",
|
||||
[]string{
|
||||
"--authfile", "/srv/authfile",
|
||||
"--dest-authfile", "/srv/dest-authfile",
|
||||
}, "/srv/dest-authfile",
|
||||
},
|
||||
// if only the shared authfile is provided, authfile must be present in system context
|
||||
{"dest-",
|
||||
[]string{
|
||||
"--authfile", "/srv/authfile",
|
||||
}, "/srv/authfile",
|
||||
},
|
||||
// if only the dest authfile is provided, dest-authfile must be present in system context
|
||||
{"dest-",
|
||||
[]string{
|
||||
"--dest-authfile", "/srv/dest-authfile",
|
||||
}, "/srv/dest-authfile",
|
||||
},
|
||||
} {
|
||||
opts := fakeImageOptions(t, testCase.flagPrefix, []string{}, testCase.cmdFlags)
|
||||
res, err := opts.newSystemContext()
|
||||
require.NoError(t, err)
|
||||
|
||||
assert.Equal(t, &types.SystemContext{
|
||||
AuthFilePath: testCase.expectedAuthfilePath,
|
||||
}, res)
|
||||
}
|
||||
}
|
||||
|
||||
@@ -1,7 +1,5 @@
|
||||
#! /bin/bash
|
||||
|
||||
: ${PROG:=$(basename ${BASH_SOURCE})}
|
||||
|
||||
_complete_() {
|
||||
local options_with_args=$1
|
||||
local boolean_options="$2 -h --help"
|
||||
@@ -10,7 +8,7 @@ _complete_() {
|
||||
local option_with_args
|
||||
for option_with_args in $options_with_args $transports
|
||||
do
|
||||
if [ "$option_with_args" == "$prev" -o "$option_with_args" == "$cur" ]
|
||||
if [ "$option_with_args" == "$prev" ] || [ "$option_with_args" == "$cur" ]
|
||||
then
|
||||
return
|
||||
fi
|
||||
@@ -18,13 +16,13 @@ _complete_() {
|
||||
|
||||
case "$cur" in
|
||||
-*)
|
||||
COMPREPLY=( $( compgen -W "$boolean_options $options_with_args" -- "$cur" ) )
|
||||
while IFS='' read -r line; do COMPREPLY+=("$line"); done < <(compgen -W "$boolean_options $options_with_args" -- "$cur")
|
||||
;;
|
||||
*)
|
||||
if [ -n "$transports" ]
|
||||
then
|
||||
compopt -o nospace
|
||||
COMPREPLY=( $( compgen -W "$transports" -- "$cur" ) )
|
||||
while IFS='' read -r line; do COMPREPLY+=("$line"); done < <(compgen -W "$transports" -- "$cur")
|
||||
fi
|
||||
;;
|
||||
esac
|
||||
@@ -33,12 +31,14 @@ _complete_() {
|
||||
_skopeo_supported_transports() {
|
||||
local subcommand=$1
|
||||
|
||||
${PROG} $subcommand --help | grep "Supported transports" -A 1 | tail -n 1 | sed -e 's/,/:/g' -e 's/$/:/'
|
||||
skopeo "$subcommand" --help | grep "Supported transports" -A 1 | tail -n 1 | sed -e 's/,/:/g' -e 's/$/:/'
|
||||
}
|
||||
|
||||
_skopeo_copy() {
|
||||
local options_with_args="
|
||||
--authfile
|
||||
--src-authfile
|
||||
--dest-authfile
|
||||
--format -f
|
||||
--sign-by
|
||||
--src-creds --screds
|
||||
@@ -46,13 +46,13 @@ _skopeo_copy() {
|
||||
--src-tls-verify
|
||||
--dest-creds --dcreds
|
||||
--dest-cert-dir
|
||||
--dest-ostree-tmp-dir
|
||||
--dest-tls-verify
|
||||
--src-daemon-host
|
||||
--dest-daemon-host
|
||||
"
|
||||
|
||||
local boolean_options="
|
||||
--all
|
||||
--dest-compress
|
||||
--remove-signatures
|
||||
--src-no-creds
|
||||
@@ -60,8 +60,9 @@ _skopeo_copy() {
|
||||
--dest-oci-accept-uncompressed-layers
|
||||
"
|
||||
|
||||
local transports="
|
||||
$(_skopeo_supported_transports $(echo $FUNCNAME | sed 's/_skopeo_//'))
|
||||
local transports
|
||||
transports="
|
||||
$(_skopeo_supported_transports "${FUNCNAME//"_skopeo_"/}")
|
||||
"
|
||||
|
||||
_complete_ "$options_with_args" "$boolean_options" "$transports"
|
||||
@@ -80,8 +81,9 @@ _skopeo_inspect() {
|
||||
--no-creds
|
||||
"
|
||||
|
||||
local transports="
|
||||
$(_skopeo_supported_transports $(echo $FUNCNAME | sed 's/_skopeo_//'))
|
||||
local transports
|
||||
transports="
|
||||
$(_skopeo_supported_transports "${FUNCNAME//"_skopeo_"/}")
|
||||
"
|
||||
|
||||
_complete_ "$options_with_args" "$boolean_options" "$transports"
|
||||
@@ -123,8 +125,9 @@ _skopeo_delete() {
|
||||
--no-creds
|
||||
"
|
||||
|
||||
local transports="
|
||||
$(_skopeo_supported_transports $(echo $FUNCNAME | sed 's/_skopeo_//'))
|
||||
local transports
|
||||
transports="
|
||||
$(_skopeo_supported_transports "${FUNCNAME//"_skopeo_"/}")
|
||||
"
|
||||
|
||||
_complete_ "$options_with_args" "$boolean_options" "$transports"
|
||||
@@ -141,13 +144,58 @@ _skopeo_layers() {
|
||||
_complete_ "$options_with_args" "$boolean_options"
|
||||
}
|
||||
|
||||
_skopeo_list_repository_tags() {
|
||||
local options_with_args="
|
||||
--authfile
|
||||
--creds
|
||||
--cert-dir
|
||||
"
|
||||
|
||||
local boolean_options="
|
||||
--tls-verify
|
||||
--no-creds
|
||||
"
|
||||
_complete_ "$options_with_args" "$boolean_options"
|
||||
}
|
||||
|
||||
_skopeo_login() {
|
||||
local options_with_args="
|
||||
--authfile
|
||||
--cert-dir
|
||||
--password -p
|
||||
--username -u
|
||||
"
|
||||
|
||||
local boolean_options="
|
||||
--get-login
|
||||
--tls-verify
|
||||
--password-stdin
|
||||
"
|
||||
_complete_ "$options_with_args" "$boolean_options"
|
||||
}
|
||||
|
||||
_skopeo_logout() {
|
||||
local options_with_args="
|
||||
--authfile
|
||||
"
|
||||
|
||||
local boolean_options="
|
||||
--all -a
|
||||
"
|
||||
_complete_ "$options_with_args" "$boolean_options"
|
||||
}
|
||||
|
||||
_skopeo_skopeo() {
|
||||
# XXX: Changes here need to be refleceted in the manually expanded
|
||||
# string in the `case` statement below as well.
|
||||
local options_with_args="
|
||||
--policy
|
||||
--registries.d
|
||||
--override-arch
|
||||
--override-os
|
||||
--override-variant
|
||||
--command-timeout
|
||||
--tmpdir
|
||||
"
|
||||
local boolean_options="
|
||||
--insecure-policy
|
||||
@@ -155,26 +203,41 @@ _skopeo_skopeo() {
|
||||
--version -v
|
||||
--help -h
|
||||
"
|
||||
commands=$( ${COMP_WORDS[@]:0:$COMP_CWORD} --generate-bash-completion )
|
||||
|
||||
local commands=(
|
||||
copy
|
||||
delete
|
||||
inspect
|
||||
list-tags
|
||||
login
|
||||
logout
|
||||
manifest-digest
|
||||
standalone-sign
|
||||
standalone-verify
|
||||
sync
|
||||
help
|
||||
h
|
||||
)
|
||||
|
||||
case "$prev" in
|
||||
$main_options_with_args_glob )
|
||||
# XXX: Changes here need to be refleceted in $options_with_args as well.
|
||||
--policy|--registries.d|--override-arch|--override-os|--override-variant|--command-timeout)
|
||||
return
|
||||
;;
|
||||
esac
|
||||
|
||||
case "$cur" in
|
||||
-*)
|
||||
COMPREPLY=( $( compgen -W "$boolean_options $options_with_args" -- "$cur" ) )
|
||||
while IFS='' read -r line; do COMPREPLY+=("$line"); done < <(compgen -W "$boolean_options $options_with_args" -- "$cur")
|
||||
;;
|
||||
*)
|
||||
COMPREPLY=( $( compgen -W "${commands[*]} help" -- "$cur" ) )
|
||||
while IFS='' read -r line; do COMPREPLY+=("$line"); done < <(compgen -W "${commands[*]} help" -- "$cur")
|
||||
;;
|
||||
esac
|
||||
}
|
||||
|
||||
_cli_bash_autocomplete() {
|
||||
local cur opts base
|
||||
local cur
|
||||
|
||||
COMPREPLY=()
|
||||
cur="${COMP_WORDS[COMP_CWORD]}"
|
||||
@@ -183,15 +246,12 @@ _cli_bash_autocomplete() {
|
||||
|
||||
_get_comp_words_by_ref -n : cur prev words cword
|
||||
|
||||
local command=${PROG} cpos=0
|
||||
local command="skopeo" cpos=0
|
||||
local counter=1
|
||||
counter=1
|
||||
while [ $counter -lt $cword ]; do
|
||||
while [ $counter -lt "$cword" ]; do
|
||||
case "${words[$counter]}" in
|
||||
-*)
|
||||
;;
|
||||
*)
|
||||
command=$(echo "${words[$counter]}" | sed 's/-/_/g')
|
||||
skopeo|copy|inspect|delete|manifest-digest|standalone-sign|standalone-verify|help|h|list-repository-tags)
|
||||
command="${words[$counter]//-/_}"
|
||||
cpos=$counter
|
||||
(( cpos++ ))
|
||||
break
|
||||
@@ -201,10 +261,9 @@ _cli_bash_autocomplete() {
|
||||
done
|
||||
|
||||
local completions_func=_skopeo_${command}
|
||||
declare -F $completions_func >/dev/null && $completions_func
|
||||
declare -F "$completions_func" >/dev/null && $completions_func
|
||||
|
||||
eval "$previous_extglob_setting"
|
||||
return 0
|
||||
}
|
||||
|
||||
complete -F _cli_bash_autocomplete $PROG
|
||||
complete -F _cli_bash_autocomplete skopeo
|
||||
|
||||
@@ -1,60 +0,0 @@
|
||||
% storage.conf(5) Container Storage Configuration File
|
||||
% Dan Walsh
|
||||
% May 2017
|
||||
|
||||
# NAME
|
||||
storage.conf - Syntax of Container Storage configuration file
|
||||
|
||||
# DESCRIPTION
|
||||
The STORAGE configuration file specifies all of the available container storage options
|
||||
for tools using shared container storage.
|
||||
|
||||
# FORMAT
|
||||
The [TOML format][toml] is used as the encoding of the configuration file.
|
||||
Every option and subtable listed here is nested under a global "storage" table.
|
||||
No bare options are used. The format of TOML can be simplified to:
|
||||
|
||||
[table]
|
||||
option = value
|
||||
|
||||
[table.subtable1]
|
||||
option = value
|
||||
|
||||
[table.subtable2]
|
||||
option = value
|
||||
|
||||
## STORAGE TABLE
|
||||
|
||||
The `storage` table supports the following options:
|
||||
|
||||
**graphroot**=""
|
||||
container storage graph dir (default: "/var/lib/containers/storage")
|
||||
Default directory to store all writable content created by container storage programs.
|
||||
|
||||
**runroot**=""
|
||||
container storage run dir (default: "/var/run/containers/storage")
|
||||
Default directory to store all temporary writable content created by container storage programs.
|
||||
|
||||
**driver**=""
|
||||
container storage driver (default is "overlay")
|
||||
Default Copy On Write (COW) container storage driver.
|
||||
|
||||
### STORAGE OPTIONS TABLE
|
||||
|
||||
The `storage.options` table supports the following options:
|
||||
|
||||
**additionalimagestores**=[]
|
||||
Paths to additional container image stores. Usually these are read-only and stored on remote network shares.
|
||||
|
||||
**size**=""
|
||||
Maximum size of a container image. Default is 10GB. This flag can be used to set quota
|
||||
on the size of container images.
|
||||
|
||||
**override_kernel_check**=""
|
||||
Tell storage drivers to ignore kernel version checks. Some storage drivers assume that if a kernel is too
|
||||
old, the driver is not supported. But for kernels that have had the drivers backported, this flag
|
||||
allows users to override the checks.
|
||||
|
||||
# HISTORY
|
||||
May 2017, Originally compiled by Dan Walsh <dwalsh@redhat.com>
|
||||
Format copied from crio.conf man page created by Aleksa Sarai <asarai@suse.de>
|
||||
@@ -1,28 +0,0 @@
|
||||
# storage.conf is the configuration file for all tools
|
||||
# that share the containers/storage libraries
|
||||
# See man 5 containers-storage.conf for more information
|
||||
|
||||
# The "container storage" table contains all of the server options.
|
||||
[storage]
|
||||
|
||||
# Default Storage Driver
|
||||
driver = "overlay"
|
||||
|
||||
# Temporary storage location
|
||||
runroot = "/var/run/containers/storage"
|
||||
|
||||
# Primary read-write location of container storage
|
||||
graphroot = "/var/lib/containers/storage"
|
||||
|
||||
[storage.options]
|
||||
# AdditionalImageStores is used to pass paths to additional read-only image stores
|
||||
# Must be comma separated list.
|
||||
additionalimagestores = [
|
||||
]
|
||||
|
||||
# Size is used to set a maximum size of the container image. Only supported by
|
||||
# certain container storage drivers (currently overlay, zfs, vfs, btrfs)
|
||||
size = ""
|
||||
|
||||
# OverrideKernelCheck tells the driver to ignore kernel checks based on kernel version
|
||||
override_kernel_check = "true"
|
||||
@@ -12,8 +12,8 @@
|
||||
|
||||
# This is the default signature write location for docker registries.
|
||||
default-docker:
|
||||
# sigstore: file:///var/lib/atomic/sigstore
|
||||
sigstore-staging: file:///var/lib/atomic/sigstore
|
||||
# sigstore: file:///var/lib/containers/sigstore
|
||||
sigstore-staging: file:///var/lib/containers/sigstore
|
||||
|
||||
# The 'docker' indicator here is the start of the configuration
|
||||
# for docker registries.
|
||||
|
||||
@@ -17,11 +17,28 @@ Uses the system's trust policy to validate images, rejects images not trusted by
|
||||
|
||||
## OPTIONS
|
||||
|
||||
**--all**
|
||||
|
||||
If _source-image_ refers to a list of images, instead of copying just the image which matches the current OS and
|
||||
architecture (subject to the use of the global --override-os, --override-arch and --override-variant options), attempt to copy all of
|
||||
the images in the list, and the list itself.
|
||||
|
||||
**--authfile** _path_
|
||||
|
||||
Path of the authentication file. Default is ${XDG_RUNTIME\_DIR}/containers/auth.json, which is set using `podman login`.
|
||||
Path of the authentication file. Default is ${XDG_RUNTIME\_DIR}/containers/auth.json, which is set using `skopeo login`.
|
||||
If the authorization state is not found there, $HOME/.docker/config.json is checked, which is set using `docker login`.
|
||||
|
||||
Note: You can also override the default path of the authentication file by setting the REGISTRY\_AUTH\_FILE
|
||||
environment variable. `export REGISTRY_AUTH_FILE=path`
|
||||
|
||||
**--src-authfile** _path_
|
||||
|
||||
Path of the authentication file for the source registry. Uses path given by `--authfile`, if not provided.
|
||||
|
||||
**--dest-authfile** _path_
|
||||
|
||||
Path of the authentication file for the destination registry. Uses path given by `--authfile`, if not provided.
|
||||
|
||||
**--format, -f** _manifest-type_ Manifest type (oci, v2s1, or v2s2) to use when saving image to directory using the 'dir:' transport (default is manifest type of source)
|
||||
|
||||
**--quiet, -q** suppress output information when copying images
|
||||
@@ -30,6 +47,10 @@ If the authorization state is not found there, $HOME/.docker/config.json is chec
|
||||
|
||||
**--sign-by=**_key-id_ add a signature using that key ID for an image name corresponding to _destination-image_
|
||||
|
||||
**--encryption-key** _Key_ a reference prefixed with the encryption protocol to use. The supported protocols are JWE, PGP and PKCS7. For instance, jwe:/path/to/key.pem or pgp:admin@example.com or pkcs7:/path/to/x509-file. This feature is still *experimental*.
|
||||
|
||||
**--decryption-key** _Key_ a reference required to perform decryption of container images. This should point to files which represent keys and/or certificates that can be used for decryption. Decryption will be tried with all keys. This feature is still *experimental*.
|
||||
|
||||
**--src-creds** _username[:password]_ for accessing the source registry
|
||||
|
||||
**--dest-compress** _bool-value_ Compress tarball image layers when saving to directory using the 'dir' transport. (default is same compression type as source)
|
||||
@@ -48,8 +69,6 @@ If the authorization state is not found there, $HOME/.docker/config.json is chec
|
||||
|
||||
**--dest-no-creds** _bool-value_ Access the registry anonymously.
|
||||
|
||||
**--dest-ostree-tmp-dir** _path_ Directory to use for OSTree temporary files.
|
||||
|
||||
**--dest-tls-verify** _bool-value_ Require HTTPS and verify certificates when talking to container destination registry or daemon (defaults to true)
|
||||
|
||||
**--src-daemon-host** _host_ Copy from docker daemon at _host_. If _host_ starts with `tcp://`, HTTPS is enabled by default. To use plain HTTP, use the form `http://` (default is `unix:///var/run/docker.sock`).
|
||||
@@ -58,6 +77,10 @@ If the authorization state is not found there, $HOME/.docker/config.json is chec
|
||||
|
||||
Existing signatures, if any, are preserved as well.
|
||||
|
||||
**--dest-compress-format** _format_ Specifies the compression format to use. Supported values are: `gzip` and `zstd`.
|
||||
|
||||
**--dest-compress-level** _format_ Specifies the compression level to use. The value is specific to the compression algorithm used, e.g. for zstd the accepted values are in the range 1-20 (inclusive), while for gzip it is 1-9 (inclusive).
|
||||
|
||||
## EXAMPLES
|
||||
|
||||
To copy the layers of the docker.io busybox image to a local directory:
|
||||
@@ -73,11 +96,43 @@ $ ls /var/lib/images/busybox/*
|
||||
To copy and sign an image:
|
||||
|
||||
```sh
|
||||
$ skopeo copy --sign-by dev@example.com atomic:example/busybox:streaming atomic:example/busybox:gold
|
||||
# skopeo copy --sign-by dev@example.com containers-storage:example/busybox:streaming docker://example/busybox:gold
|
||||
```
|
||||
|
||||
To encrypt an image:
|
||||
```sh
|
||||
skopeo copy docker://docker.io/library/nginx:1.17.8 oci:local_nginx:1.17.8
|
||||
|
||||
openssl genrsa -out private.key 1024
|
||||
openssl rsa -in private.key -pubout > public.key
|
||||
|
||||
skopeo copy --encryption-key jwe:./public.key oci:local_nginx:1.17.8 oci:try-encrypt:encrypted
|
||||
```
|
||||
|
||||
To decrypt an image:
|
||||
```sh
|
||||
skopeo copy --decryption-key ./private.key oci:try-encrypt:encrypted oci:try-decrypt:decrypted
|
||||
```
|
||||
|
||||
To copy encrypted image without decryption:
|
||||
```sh
|
||||
skopeo copy oci:try-encrypt:encrypted oci:try-encrypt-copy:encrypted
|
||||
```
|
||||
|
||||
To decrypt an image that requires more than one key:
|
||||
```sh
|
||||
skopeo copy --decryption-key ./private1.key --decryption-key ./private2.key --decryption-key ./private3.key oci:try-encrypt:encrypted oci:try-decrypt:decrypted
|
||||
```
|
||||
|
||||
Container images can also be partially encrypted by specifying the index of the layer. Layers are 0-indexed indices, with support for negative indexing. i.e. 0 is the first layer, -1 is the last layer.
|
||||
|
||||
Let's say out of 3 layers that the image `docker.io/library/nginx:1.17.8` is made up of, we only want to encrypt the 2nd layer,
|
||||
```sh
|
||||
skopeo copy --encryption-key jwe:./public.key --encrypt-layer 1 oci:local_nginx:1.17.8 oci:try-encrypt:encrypted
|
||||
```
|
||||
|
||||
## SEE ALSO
|
||||
skopeo(1), podman-login(1), docker-login(1)
|
||||
skopeo(1), skopeo-login(1), docker-login(1), containers-auth.json(5), containers-policy.json(5), containers-transports(5)
|
||||
|
||||
## AUTHORS
|
||||
|
||||
|
||||
@@ -21,7 +21,7 @@ $ docker exec -it registry /usr/bin/registry garbage-collect /etc/docker-distrib
|
||||
|
||||
**--authfile** _path_
|
||||
|
||||
Path of the authentication file. Default is ${XDG_RUNTIME\_DIR}/containers/auth.json, which is set using `podman login`.
|
||||
Path of the authentication file. Default is ${XDG_RUNTIME\_DIR}/containers/auth.json, which is set using `skopeo login`.
|
||||
If the authorization state is not found there, $HOME/.docker/config.json is checked, which is set using `docker login`.
|
||||
|
||||
**--creds** _username[:password]_ for accessing the registry
|
||||
@@ -44,7 +44,7 @@ See above for additional details on using the command **delete**.
|
||||
|
||||
|
||||
## SEE ALSO
|
||||
skopeo(1), podman-login(1), docker-login(1)
|
||||
skopeo(1), skopeo-login(1), docker-login(1), containers-auth.json(5)
|
||||
|
||||
## AUTHORS
|
||||
|
||||
|
||||
@@ -22,7 +22,7 @@ Return low-level information about _image-name_ in a registry
|
||||
|
||||
**--authfile** _path_
|
||||
|
||||
Path of the authentication file. Default is ${XDG\_RUNTIME\_DIR}/containers/auth.json, which is set using `podman login`.
|
||||
Path of the authentication file. Default is ${XDG\_RUNTIME\_DIR}/containers/auth.json, which is set using `skopeo login`.
|
||||
If the authorization state is not found there, $HOME/.docker/config.json is checked, which is set using `docker login`.
|
||||
|
||||
**--creds** _username[:password]_ for accessing the registry
|
||||
@@ -63,7 +63,7 @@ $ skopeo inspect docker://docker.io/fedora
|
||||
```
|
||||
|
||||
# SEE ALSO
|
||||
skopeo(1), podman-login(1), docker-login(1)
|
||||
skopeo(1), skopeo-login(1), docker-login(1), containers-auth.json(5)
|
||||
|
||||
## AUTHORS
|
||||
|
||||
|
||||
102
docs/skopeo-list-tags.1.md
Normal file
102
docs/skopeo-list-tags.1.md
Normal file
@@ -0,0 +1,102 @@
|
||||
% skopeo-list-tags(1)
|
||||
|
||||
## NAME
|
||||
skopeo\-list\-tags - Return a list of tags the transport-specific image repository
|
||||
|
||||
## SYNOPSIS
|
||||
**skopeo list-tags** _repository-name_
|
||||
|
||||
Return a list of tags from _repository-name_ in a registry.
|
||||
|
||||
_repository-name_ name of repository to retrieve tag listing from
|
||||
|
||||
**--authfile** _path_
|
||||
|
||||
Path of the authentication file. Default is ${XDG\_RUNTIME\_DIR}/containers/auth.json, which is set using `skopeo login`.
|
||||
If the authorization state is not found there, $HOME/.docker/config.json is checked, which is set using `docker login`.
|
||||
|
||||
**--creds** _username[:password]_ for accessing the registry
|
||||
|
||||
**--cert-dir** _path_ Use certificates at _path_ (\*.crt, \*.cert, \*.key) to connect to the registry
|
||||
|
||||
**--tls-verify** _bool-value_ Require HTTPS and verify certificates when talking to container registries (defaults to true)
|
||||
|
||||
**--no-creds** _bool-value_ Access the registry anonymously.
|
||||
|
||||
## REPOSITORY NAMES
|
||||
|
||||
Repository names are transport-specific references as each transport may have its own concept of a "repository" and "tags". Currently, only the Docker transport is supported.
|
||||
|
||||
This commands refers to repositories using a _transport_`:`_details_ format. The following formats are supported:
|
||||
|
||||
**docker://**_docker-repository-reference_
|
||||
A repository in a registry implementing the "Docker Registry HTTP API V2". By default, uses the authorization state in either `$XDG_RUNTIME_DIR/containers/auth.json`, which is set using `(skopeo login)`. If the authorization state is not found there, `$HOME/.docker/config.json` is checked, which is set using `(docker login)`.
|
||||
A _docker-repository-reference_ is of the form: **registryhost:port/repositoryname** which is similar to an _image-reference_ but with no tag or digest allowed as the last component (e.g no `:latest` or `@sha256:xyz`)
|
||||
|
||||
Examples of valid docker-repository-references:
|
||||
"docker.io/myuser/myrepo"
|
||||
"docker.io/nginx"
|
||||
"docker.io/library/fedora"
|
||||
"localhost:5000/myrepository"
|
||||
|
||||
Examples of invalid references:
|
||||
"docker.io/nginx:latest"
|
||||
"docker.io/myuser/myimage:v1.0"
|
||||
"docker.io/myuser/myimage@sha256:f48c4cc192f4c3c6a069cb5cca6d0a9e34d6076ba7c214fd0cc3ca60e0af76bb"
|
||||
|
||||
|
||||
## EXAMPLES
|
||||
|
||||
### Docker Transport
|
||||
To get the list of tags in the "fedora" repository from the docker.io registry (the repository name expands to "library/fedora" per docker transport canonical form):
|
||||
```sh
|
||||
$ skopeo list-tags docker://docker.io/fedora
|
||||
{
|
||||
"Repository": "docker.io/library/fedora",
|
||||
"Tags": [
|
||||
"20",
|
||||
"21",
|
||||
"22",
|
||||
"23",
|
||||
"24",
|
||||
"25",
|
||||
"26-modular",
|
||||
"26",
|
||||
"27",
|
||||
"28",
|
||||
"29",
|
||||
"30",
|
||||
"31",
|
||||
"32",
|
||||
"branched",
|
||||
"heisenbug",
|
||||
"latest",
|
||||
"modular",
|
||||
"rawhide"
|
||||
]
|
||||
}
|
||||
|
||||
```
|
||||
|
||||
To list the tags in a local host docker/distribution registry on port 5000, in this case for the "fedora" repository:
|
||||
|
||||
```sh
|
||||
$ skopeo list-tags docker://localhost:5000/fedora
|
||||
{
|
||||
"Repository": "localhost:5000/fedora",
|
||||
"Tags": [
|
||||
"latest",
|
||||
"30",
|
||||
"31"
|
||||
]
|
||||
}
|
||||
|
||||
```
|
||||
|
||||
# SEE ALSO
|
||||
skopeo(1), skopeo-login(1), docker-login(1), containers-auth.json(5)
|
||||
|
||||
## AUTHORS
|
||||
|
||||
Zach Hill <zach@anchore.com>
|
||||
|
||||
101
docs/skopeo-login.1.md
Normal file
101
docs/skopeo-login.1.md
Normal file
@@ -0,0 +1,101 @@
|
||||
% skopeo-login(1)
|
||||
|
||||
## NAME
|
||||
skopeo\-login - Login to a container registry
|
||||
|
||||
## SYNOPSIS
|
||||
**skoepo login** [*options*] *registry*
|
||||
|
||||
## DESCRIPTION
|
||||
**skopeo login** logs into a specified registry server with the correct username
|
||||
and password. **skopeo login** reads in the username and password from STDIN.
|
||||
The username and password can also be set using the **username** and **password** flags.
|
||||
The path of the authentication file can be specified by the user by setting the **authfile**
|
||||
flag. The default path used is **${XDG\_RUNTIME\_DIR}/containers/auth.json**.
|
||||
|
||||
## OPTIONS
|
||||
|
||||
**--password**, **-p**=*password*
|
||||
|
||||
Password for registry
|
||||
|
||||
**--password-stdin**
|
||||
|
||||
Take the password from stdin
|
||||
|
||||
**--username**, **-u**=*username*
|
||||
|
||||
Username for registry
|
||||
|
||||
**--authfile**=*path*
|
||||
|
||||
Path of the authentication file. Default is ${XDG\_RUNTIME\_DIR}/containers/auth.json
|
||||
|
||||
Note: You can also override the default path of the authentication file by setting the REGISTRY\_AUTH\_FILE
|
||||
environment variable. `export REGISTRY_AUTH_FILE=path`
|
||||
|
||||
**--get-login**
|
||||
|
||||
Return the logged-in user for the registry. Return error if no login is found.
|
||||
|
||||
**--cert-dir**=*path*
|
||||
|
||||
Use certificates at *path* (\*.crt, \*.cert, \*.key) to connect to the registry.
|
||||
Default certificates directory is _/etc/containers/certs.d_.
|
||||
|
||||
**--tls-verify**=*true|false*
|
||||
|
||||
Require HTTPS and verify certificates when contacting registries (default: true). If explicitly set to true,
|
||||
then TLS verification will be used. If set to false, then TLS verification will not be used. If not specified,
|
||||
TLS verification will be used unless the target registry is listed as an insecure registry in registries.conf.
|
||||
|
||||
**--help**, **-h**
|
||||
|
||||
Print usage statement
|
||||
|
||||
## EXAMPLES
|
||||
|
||||
```
|
||||
$ skopeo login docker.io
|
||||
Username: testuser
|
||||
Password:
|
||||
Login Succeeded!
|
||||
```
|
||||
|
||||
```
|
||||
$ skopeo login -u testuser -p testpassword localhost:5000
|
||||
Login Succeeded!
|
||||
```
|
||||
|
||||
```
|
||||
$ skopeo login --authfile authdir/myauths.json docker.io
|
||||
Username: testuser
|
||||
Password:
|
||||
Login Succeeded!
|
||||
```
|
||||
|
||||
```
|
||||
$ skopeo login --tls-verify=false -u test -p test localhost:5000
|
||||
Login Succeeded!
|
||||
```
|
||||
|
||||
```
|
||||
$ skopeo login --cert-dir /etc/containers/certs.d/ -u foo -p bar localhost:5000
|
||||
Login Succeeded!
|
||||
```
|
||||
|
||||
```
|
||||
$ skopeo login -u testuser --password-stdin < testpassword.txt docker.io
|
||||
Login Succeeded!
|
||||
```
|
||||
|
||||
```
|
||||
$ echo $testpassword | skopeo login -u testuser --password-stdin docker.io
|
||||
Login Succeeded!
|
||||
```
|
||||
|
||||
## SEE ALSO
|
||||
skopeo(1), skopeo-logout(1), containers-auth.json(5), containers-registries.conf(5), containers-certs.d.5.md
|
||||
|
||||
## HISTORY
|
||||
May 2020, Originally compiled by Qi Wang <qiwan@redhat.com>
|
||||
53
docs/skopeo-logout.1.md
Normal file
53
docs/skopeo-logout.1.md
Normal file
@@ -0,0 +1,53 @@
|
||||
% skopeo-logout(1)
|
||||
|
||||
## NAME
|
||||
skopeo\-logout - Logout of a container registry
|
||||
|
||||
## SYNOPSIS
|
||||
**skopeo logout** [*options*] *registry*
|
||||
|
||||
## DESCRIPTION
|
||||
**skopeo logout** logs out of a specified registry server by deleting the cached credentials
|
||||
stored in the **auth.json** file. The path of the authentication file can be overridden by the user by setting the **authfile** flag.
|
||||
The default path used is **${XDG\_RUNTIME\_DIR}/containers/auth.json**.
|
||||
All the cached credentials can be removed by setting the **all** flag.
|
||||
|
||||
## OPTIONS
|
||||
|
||||
**--authfile**=*path*
|
||||
|
||||
Path of the authentication file. Default is ${XDG\_RUNTIME\_DIR}/containers/auth.json
|
||||
|
||||
Note: You can also override the default path of the authentication file by setting the REGISTRY\_AUTH\_FILE
|
||||
environment variable. `export REGISTRY_AUTH_FILE=path`
|
||||
|
||||
**--all**, **-a**
|
||||
|
||||
Remove the cached credentials for all registries in the auth file
|
||||
|
||||
**--help**, **-h**
|
||||
|
||||
Print usage statement
|
||||
|
||||
## EXAMPLES
|
||||
|
||||
```
|
||||
$ skopeo logout docker.io
|
||||
Remove login credentials for docker.io
|
||||
```
|
||||
|
||||
```
|
||||
$ skopeo logout --authfile authdir/myauths.json docker.io
|
||||
Remove login credentials for docker.io
|
||||
```
|
||||
|
||||
```
|
||||
$ skopeo logout --all
|
||||
Remove login credentials for all registries
|
||||
```
|
||||
|
||||
## SEE ALSO
|
||||
skopeo(1), skopeo-login(1), containers-auth.json(5)
|
||||
|
||||
## HISTORY
|
||||
May 2020, Originally compiled by Qi Wang <qiwan@redhat.com>
|
||||
@@ -26,7 +26,7 @@ $
|
||||
```
|
||||
|
||||
## SEE ALSO
|
||||
skopeo(1), skopeo-copy(1)
|
||||
skopeo(1), skopeo-copy(1), containers-signature(5)
|
||||
|
||||
## AUTHORS
|
||||
|
||||
|
||||
@@ -28,7 +28,7 @@ Signature verified, digest sha256:20bf21ed457b390829cdbeec8795a7bea1626991fda603
|
||||
```
|
||||
|
||||
## SEE ALSO
|
||||
skopeo(1)
|
||||
skopeo(1), containers-signature(5)
|
||||
|
||||
## AUTHORS
|
||||
|
||||
|
||||
159
docs/skopeo-sync.1.md
Normal file
159
docs/skopeo-sync.1.md
Normal file
@@ -0,0 +1,159 @@
|
||||
% skopeo-sync(1)
|
||||
|
||||
## NAME
|
||||
skopeo\-sync - Synchronize images between container registries and local directories.
|
||||
|
||||
|
||||
## SYNOPSIS
|
||||
**skopeo sync** --src _transport_ --dest _transport_ _source_ _destination_
|
||||
|
||||
## DESCRIPTION
|
||||
Synchronize images between container registries and local directories.
|
||||
The synchronization is achieved by copying all the images found at _source_ to _destination_.
|
||||
|
||||
Useful to synchronize a local container registry mirror, and to to populate registries running inside of air-gapped environments.
|
||||
|
||||
Differently from other skopeo commands, skopeo sync requires both source and destination transports to be specified separately from _source_ and _destination_.
|
||||
One of the problems of prefixing a destination with its transport is that, the registry `docker://hostname:port` would be wrongly interpreted as an image reference at a non-fully qualified registry, with `hostname` and `port` the image name and tag.
|
||||
|
||||
Available _source_ transports:
|
||||
- _docker_ (i.e. `--src docker`): _source_ is a repository hosted on a container registry (e.g.: `registry.example.com/busybox`).
|
||||
If no image tag is specified, skopeo sync copies all the tags found in that repository.
|
||||
- _dir_ (i.e. `--src dir`): _source_ is a local directory path (e.g.: `/media/usb/`). Refer to skopeo(1) **dir:**_path_ for the local image format.
|
||||
- _yaml_ (i.e. `--src yaml`): _source_ is local YAML file path.
|
||||
The YAML file should specify the list of images copied from different container registries (local directories are not supported). Refer to EXAMPLES for the file format.
|
||||
|
||||
Available _destination_ transports:
|
||||
- _docker_ (i.e. `--dest docker`): _destination_ is a container registry (e.g.: `my-registry.local.lan`).
|
||||
- _dir_ (i.e. `--dest dir`): _destination_ is a local directory path (e.g.: `/media/usb/`).
|
||||
One directory per source 'image:tag' is created for each copied image.
|
||||
|
||||
When the `--scoped` option is specified, images are prefixed with the source image path so that multiple images with the same
|
||||
name can be stored at _destination_.
|
||||
|
||||
## OPTIONS
|
||||
**--authfile** _path_
|
||||
|
||||
Path of the authentication file. Default is ${XDG\_RUNTIME\_DIR}/containers/auth.json, which is set using `skopeo login`.
|
||||
If the authorization state is not found there, $HOME/.docker/config.json is checked, which is set using `docker login`.
|
||||
|
||||
**--src-authfile** _path_
|
||||
|
||||
Path of the authentication file for the source registry. Uses path given by `--authfile`, if not provided.
|
||||
|
||||
**--dest-authfile** _path_
|
||||
|
||||
Path of the authentication file for the destination registry. Uses path given by `--authfile`, if not provided.
|
||||
|
||||
**--src** _transport_ Transport for the source repository.
|
||||
|
||||
**--dest** _transport_ Destination transport.
|
||||
|
||||
**--scoped** Prefix images with the source image path, so that multiple images with the same name can be stored at _destination_.
|
||||
|
||||
**--remove-signatures** Do not copy signatures, if any, from _source-image_. This is necessary when copying a signed image to a destination which does not support signatures.
|
||||
|
||||
**--sign-by=**_key-id_ Add a signature using that key ID for an image name corresponding to _destination-image_.
|
||||
|
||||
**--src-creds** _username[:password]_ for accessing the source registry.
|
||||
|
||||
**--dest-creds** _username[:password]_ for accessing the destination registry.
|
||||
|
||||
**--src-cert-dir** _path_ Use certificates (*.crt, *.cert, *.key) at _path_ to connect to the source registry or daemon.
|
||||
|
||||
**--src-no-creds** _bool-value_ Access the registry anonymously.
|
||||
|
||||
**--src-tls-verify** _bool-value_ Require HTTPS and verify certificates when talking to a container source registry or daemon (defaults to true).
|
||||
|
||||
**--dest-cert-dir** _path_ Use certificates (*.crt, *.cert, *.key) at _path_ to connect to the destination registry or daemon.
|
||||
|
||||
**--dest-no-creds** _bool-value_ Access the registry anonymously.
|
||||
|
||||
**--dest-tls-verify** _bool-value_ Require HTTPS and verify certificates when talking to a container destination registry or daemon (defaults to true).
|
||||
|
||||
## EXAMPLES
|
||||
|
||||
### Synchronizing to a local directory
|
||||
```
|
||||
$ skopeo sync --src docker --dest dir registry.example.com/busybox /media/usb
|
||||
```
|
||||
Images are located at:
|
||||
```
|
||||
/media/usb/busybox:1-glibc
|
||||
/media/usb/busybox:1-musl
|
||||
/media/usb/busybox:1-ubuntu
|
||||
...
|
||||
/media/usb/busybox:latest
|
||||
```
|
||||
|
||||
### Synchronizing to a local directory, scoped
|
||||
```
|
||||
$ skopeo sync --src docker --dest dir --scoped registry.example.com/busybox /media/usb
|
||||
```
|
||||
Images are located at:
|
||||
```
|
||||
/media/usb/registry.example.com/busybox:1-glibc
|
||||
/media/usb/registry.example.com/busybox:1-musl
|
||||
/media/usb/registry.example.com/busybox:1-ubuntu
|
||||
...
|
||||
/media/usb/registry.example.com/busybox:latest
|
||||
```
|
||||
|
||||
### Synchronizing to a container registry
|
||||
```
|
||||
skopeo sync --src docker --dest docker registry.example.com/busybox my-registry.local.lan
|
||||
```
|
||||
Destination registry content:
|
||||
```
|
||||
REPO TAGS
|
||||
registry.local.lan/busybox 1-glibc, 1-musl, 1-ubuntu, ..., latest
|
||||
```
|
||||
|
||||
### Synchronizing to a container registry keeping the repository
|
||||
```
|
||||
skopeo sync --src docker --dest docker registry.example.com/repo/busybox my-registry.local.lan/repo
|
||||
```
|
||||
Destination registry content:
|
||||
```
|
||||
REPO TAGS
|
||||
registry.local.lan/repo/busybox 1-glibc, 1-musl, 1-ubuntu, ..., latest
|
||||
```
|
||||
|
||||
### YAML file content (used _source_ for `**--src yaml**`)
|
||||
|
||||
```yaml
|
||||
registry.example.com:
|
||||
images:
|
||||
busybox: []
|
||||
redis:
|
||||
- "1.0"
|
||||
- "2.0"
|
||||
credentials:
|
||||
username: john
|
||||
password: this is a secret
|
||||
tls-verify: true
|
||||
cert-dir: /home/john/certs
|
||||
quay.io:
|
||||
tls-verify: false
|
||||
images:
|
||||
coreos/etcd:
|
||||
- latest
|
||||
```
|
||||
|
||||
This will copy the following images:
|
||||
- Repository `registry.example.com/busybox`: all images, as no tags are specified.
|
||||
- Repository `registry.example.com/redis`: images tagged "1.0" and "2.0".
|
||||
- Repository `quay.io/coreos/etcd`: images tagged "latest".
|
||||
|
||||
For the registry `registry.example.com`, the "john"/"this is a secret" credentials are used, with server TLS certificates located at `/home/john/certs`.
|
||||
|
||||
TLS verification is normally enabled, and it can be disabled setting `tls-verify` to `true`.
|
||||
In the above example, TLS verification is enabled for `reigstry.example.com`, while is
|
||||
disabled for `quay.io`.
|
||||
|
||||
## SEE ALSO
|
||||
skopeo(1), skopeo-login(1), docker-login(1), containers-auth.json(5), containers-policy.json(5), containers-transports(5)
|
||||
|
||||
## AUTHORS
|
||||
|
||||
Flavio Castelli <fcastelli@suse.com>, Marco Vedovati <mvedovati@suse.com>
|
||||
@@ -27,13 +27,13 @@ its functionality. It also does not require root, unless you are copying images
|
||||
Most commands refer to container images, using a _transport_`:`_details_ format. The following formats are supported:
|
||||
|
||||
**containers-storage:**_docker-reference_
|
||||
An image located in a local containers/storage image store. Location and image store specified in /etc/containers/storage.conf
|
||||
An image located in a local containers/storage image store. Both the location and image store are specified in /etc/containers/storage.conf. (Backend for Podman, CRI-O, Buildah and friends)
|
||||
|
||||
**dir:**_path_
|
||||
An existing local directory _path_ storing the manifest, layer tarballs and signatures as individual files. This is a non-standardized format, primarily useful for debugging or noninvasive container inspection.
|
||||
|
||||
**docker://**_docker-reference_
|
||||
An image in a registry implementing the "Docker Registry HTTP API V2". By default, uses the authorization state in either `$XDG_RUNTIME_DIR/containers/auth.json`, which is set using `(podman login)`. If the authorization state is not found there, `$HOME/.docker/config.json` is checked, which is set using `(docker login)`.
|
||||
An image in a registry implementing the "Docker Registry HTTP API V2". By default, uses the authorization state in either `$XDG_RUNTIME_DIR/containers/auth.json`, which is set using `(skopeo login)`. If the authorization state is not found there, `$HOME/.docker/config.json` is checked, which is set using `(docker login)`.
|
||||
|
||||
**docker-archive:**_path_[**:**_docker-reference_]
|
||||
An image is stored in the `docker save` formatted file. _docker-reference_ is only used when creating such a file, and it must not contain a digest.
|
||||
@@ -44,26 +44,27 @@ Most commands refer to container images, using a _transport_`:`_details_ format.
|
||||
**oci:**_path_**:**_tag_
|
||||
An image _tag_ in a directory compliant with "Open Container Image Layout Specification" at _path_.
|
||||
|
||||
**ostree:**_image_[**@**_/absolute/repo/path_]
|
||||
An image in local OSTree repository. _/absolute/repo/path_ defaults to _/ostree/repo_.
|
||||
|
||||
## OPTIONS
|
||||
|
||||
**--command-timeout** _duration_ Timeout for the command execution.
|
||||
|
||||
**--debug** enable debug output
|
||||
|
||||
**--policy** _path-to-policy_ Path to a policy.json file to use for verifying signatures and deciding whether an image is trusted, overriding the default trust policy file.
|
||||
**--help**|**-h** Show help
|
||||
|
||||
**--insecure-policy** Adopt an insecure, permissive policy that allows anything. This obviates the need for a policy file.
|
||||
|
||||
**--registries.d** _dir_ use registry configuration files in _dir_ (e.g. for container signature storage), overriding the default path.
|
||||
|
||||
**--override-arch** _arch_ Use _arch_ instead of the architecture of the machine for choosing images.
|
||||
|
||||
**--override-os** _OS_ Use _OS_ instead of the running OS for choosing images.
|
||||
|
||||
**--command-timeout** _duration_ Timeout for the command execution.
|
||||
**--override-variant** _VARIANT_ Use _VARIANT_ instead of the running architecture variant for choosing images.
|
||||
|
||||
**--help**|**-h** Show help
|
||||
**--policy** _path-to-policy_ Path to a policy.json file to use for verifying signatures and deciding whether an image is trusted, overriding the default trust policy file.
|
||||
|
||||
**--registries.d** _dir_ use registry configuration files in _dir_ (e.g. for container signature storage), overriding the default path.
|
||||
|
||||
**--tmpdir** _dir_ used to store temporary files. Defaults to /var/tmp.
|
||||
|
||||
**--version**|**-v** print the version number
|
||||
|
||||
@@ -74,21 +75,25 @@ Most commands refer to container images, using a _transport_`:`_details_ format.
|
||||
| [skopeo-copy(1)](skopeo-copy.1.md) | Copy an image (manifest, filesystem layers, signatures) from one location to another. |
|
||||
| [skopeo-delete(1)](skopeo-delete.1.md) | Mark image-name for deletion. |
|
||||
| [skopeo-inspect(1)](skopeo-inspect.1.md) | Return low-level information about image-name in a registry. |
|
||||
| [skopeo-list-tags(1)](skopeo-list-tags.1.md) | List the tags for the given transport/repository. |
|
||||
| [skopeo-login(1)](skopeo-login.1.md) | Login to a container registry. |
|
||||
| [skopeo-logout(1)](skopeo-logout.1.md) | Logout of a container registry. |
|
||||
| [skopeo-manifest-digest(1)](skopeo-manifest-digest.1.md) | Compute a manifest digest of manifest-file and write it to standard output.|
|
||||
| [skopeo-standalone-sign(1)](skopeo-standalone-sign.1.md) | Sign an image. |
|
||||
| [skopeo-standalone-verify(1)](skopeo-standalone-verify.1.md)| Verify an image. |
|
||||
| [skopeo-sync(1)](skopeo-sync.1.md)| Copy images from one or more repositories to a user specified destination. |
|
||||
|
||||
## FILES
|
||||
**/etc/containers/policy.json**
|
||||
Default trust policy file, if **--policy** is not specified.
|
||||
The policy format is documented in https://github.com/containers/image/blob/master/docs/containers-policy.json.5.md .
|
||||
The policy format is documented in [containers-policy.json(5)](https://github.com/containers/image/blob/master/docs/containers-policy.json.5.md) .
|
||||
|
||||
**/etc/containers/registries.d**
|
||||
Default directory containing registry configuration, if **--registries.d** is not specified.
|
||||
The contents of this directory are documented in https://github.com/containers/image/blob/master/docs/containers-policy.json.5.md .
|
||||
The contents of this directory are documented in [containers-policy.json(5)](https://github.com/containers/image/blob/master/docs/containers-policy.json.5.md).
|
||||
|
||||
## SEE ALSO
|
||||
podman-login(1), docker-login(1)
|
||||
skopeo-login(1), docker-login(1), containers-auth.json(5), containers-storage.conf(5), containers-policy.json(5), containers-transports(5)
|
||||
|
||||
## AUTHORS
|
||||
|
||||
|
||||
71
go.mod
71
go.mod
@@ -3,64 +3,25 @@ module github.com/containers/skopeo
|
||||
go 1.12
|
||||
|
||||
require (
|
||||
github.com/BurntSushi/toml v0.3.1 // indirect
|
||||
github.com/Microsoft/go-winio v0.4.12 // indirect
|
||||
github.com/Microsoft/hcsshim v0.8.6 // indirect
|
||||
github.com/VividCortex/ewma v1.1.1 // indirect
|
||||
github.com/containerd/continuity v0.0.0-20180216233310-d8fb8589b0e8 // indirect
|
||||
github.com/containers/buildah v1.8.4
|
||||
github.com/containers/image v3.0.0+incompatible
|
||||
github.com/containers/storage v1.12.10
|
||||
github.com/davecgh/go-spew v1.1.1 // indirect
|
||||
github.com/docker/distribution v0.0.0-20170817175659-5f6282db7d65 // indirect
|
||||
github.com/docker/docker v0.0.0-20180522102801-da99009bbb11
|
||||
github.com/docker/docker-credential-helpers v0.6.0 // indirect
|
||||
github.com/docker/go-connections v0.0.0-20180212134524-7beb39f0b969 // indirect
|
||||
github.com/docker/go-units v0.0.0-20161020213227-8a7beacffa30 // indirect
|
||||
github.com/docker/libtrust v0.0.0-20160708172513-aabc10ec26b7 // indirect
|
||||
github.com/etcd-io/bbolt v1.3.2 // indirect
|
||||
github.com/ghodss/yaml v0.0.0-20150909031657-73d445a93680 // indirect
|
||||
github.com/containers/common v0.11.2
|
||||
github.com/containers/image/v5 v5.4.4
|
||||
github.com/containers/ocicrypt v1.0.2
|
||||
github.com/containers/storage v1.19.2
|
||||
github.com/docker/docker v1.4.2-0.20191219165747-a9416c67da9f
|
||||
github.com/dsnet/compress v0.0.1 // indirect
|
||||
github.com/go-check/check v0.0.0-20180628173108-788fd7840127
|
||||
github.com/gogo/protobuf v0.0.0-20170815085658-fcdc5011193f // indirect
|
||||
github.com/gorilla/context v0.0.0-20140604161150-14f550f51af5 // indirect
|
||||
github.com/gorilla/mux v0.0.0-20140926153814-e444e69cbd2e // indirect
|
||||
github.com/imdario/mergo v0.0.0-20141206190957-6633656539c1 // indirect
|
||||
github.com/klauspost/compress v1.4.1 // indirect
|
||||
github.com/klauspost/cpuid v1.2.0 // indirect
|
||||
github.com/klauspost/pgzip v1.2.1 // indirect
|
||||
github.com/kr/pretty v0.1.0 // indirect
|
||||
github.com/mattn/go-isatty v0.0.4 // indirect
|
||||
github.com/mattn/go-shellwords v1.0.5 // indirect
|
||||
github.com/mistifyio/go-zfs v0.0.0-20160425201758-22c9b32c84eb // indirect
|
||||
github.com/mtrmac/gpgme v0.0.0-20170102180018-b2432428689c // indirect
|
||||
github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2
|
||||
github.com/opencontainers/image-spec v0.0.0-20180918080442-7b1e489870ac
|
||||
github.com/google/go-cmp v0.3.1 // indirect
|
||||
github.com/opencontainers/go-digest v1.0.0
|
||||
github.com/opencontainers/image-spec v1.0.2-0.20190823105129-775207bd45b6
|
||||
github.com/opencontainers/image-tools v0.0.0-20170926011501-6d941547fa1d
|
||||
github.com/opencontainers/runc v1.0.0-rc6 // indirect
|
||||
github.com/opencontainers/runtime-spec v1.0.0 // indirect
|
||||
github.com/opencontainers/selinux v0.0.0-20190118194635-b707dfcb00a1 // indirect
|
||||
github.com/ostreedev/ostree-go v0.0.0-20181204105935-56f3a639dbc0 // indirect
|
||||
github.com/pborman/uuid v0.0.0-20160209185913-a97ce2ca70fa // indirect
|
||||
github.com/pkg/errors v0.8.1
|
||||
github.com/pmezard/go-difflib v0.0.0-20181226105442-5d4384ee4fb2 // indirect
|
||||
github.com/pquerna/ffjson v0.0.0-20171002144729-d49c2bc1aa13 // indirect
|
||||
github.com/sirupsen/logrus v1.0.0
|
||||
github.com/stretchr/testify v1.1.3
|
||||
github.com/pkg/errors v0.9.1
|
||||
github.com/russross/blackfriday v2.0.0+incompatible // indirect
|
||||
github.com/sirupsen/logrus v1.6.0
|
||||
github.com/spf13/cobra v1.0.0
|
||||
github.com/spf13/pflag v1.0.5
|
||||
github.com/stretchr/testify v1.5.1
|
||||
github.com/syndtr/gocapability v0.0.0-20180916011248-d98352740cb2
|
||||
github.com/tchap/go-patricia v2.2.6+incompatible // indirect
|
||||
github.com/ulikunitz/xz v0.5.4 // indirect
|
||||
github.com/urfave/cli v1.20.0
|
||||
github.com/vbatts/tar-split v0.10.2 // indirect
|
||||
github.com/vbauerster/mpb v3.4.0+incompatible // indirect
|
||||
github.com/xeipuuv/gojsonpointer v0.0.0-20180127040702-4e3ac2762d5f // indirect
|
||||
github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415 // indirect
|
||||
github.com/xeipuuv/gojsonschema v1.1.0 // indirect
|
||||
go4.org v0.0.0-20190218023631-ce4c26f7be8e // indirect
|
||||
golang.org/x/crypto v0.0.0-20190219172222-a4c6cb3142f2 // indirect
|
||||
golang.org/x/net v0.0.0-20190107210223-45ffb0cd1ba0 // indirect
|
||||
golang.org/x/sync v0.0.0-20181108010431-42b317875d0f // indirect
|
||||
golang.org/x/sys v0.0.0-20170817234608-43e60d72a8e2 // indirect
|
||||
golang.org/x/text v0.0.0-20181227161524-e6919f6577db // indirect
|
||||
gopkg.in/yaml.v2 v2.0.0-20141029210843-d466437aa4ad // indirect
|
||||
k8s.io/client-go v0.0.0-20181219152756-3dd551c0f083 // indirect
|
||||
gopkg.in/yaml.v2 v2.3.0
|
||||
)
|
||||
|
||||
479
go.sum
479
go.sum
@@ -1,138 +1,405 @@
|
||||
cloud.google.com/go v0.26.0/go.mod h1:aQUYkXzVsufM+DwF1aE+0xfcU+56JwCaLick0ClmMTw=
|
||||
github.com/14rcole/gopopulate v0.0.0-20180821133914-b175b219e774 h1:SCbEWT58NSt7d2mcFdvxC9uyrdcTfvBbPLThhkDmXzg=
|
||||
github.com/14rcole/gopopulate v0.0.0-20180821133914-b175b219e774/go.mod h1:6/0dYRLLXyJjbkIPeeGyoJ/eKOSI0eU6eTlCBYibgd0=
|
||||
github.com/Azure/go-ansiterm v0.0.0-20170929234023-d6e3b3328b78 h1:w+iIsaOQNcT7OZ575w+acHgRric5iCyQh+xv+KJ4HB8=
|
||||
github.com/Azure/go-ansiterm v0.0.0-20170929234023-d6e3b3328b78/go.mod h1:LmzpDX56iTiv29bbRTIsUNlaFfuhWRQBWjQdVyAevI8=
|
||||
github.com/BurntSushi/toml v0.3.1 h1:WXkYYl6Yr3qBf1K79EBnL4mak0OimBfB0XUf9Vl28OQ=
|
||||
github.com/BurntSushi/toml v0.3.1/go.mod h1:xHWCNGjB5oqiDr8zfno3MHue2Ht5sIBksp03qcyfWMU=
|
||||
github.com/Microsoft/go-winio v0.4.12 h1:xAfWHN1IrQ0NJ9TBC0KBZoqLjzDTr1ML+4MywiUOryc=
|
||||
github.com/Microsoft/go-winio v0.4.12/go.mod h1:VhR8bwka0BXejwEJY73c50VrPtXAaKcyvVC4A4RozmA=
|
||||
github.com/Microsoft/hcsshim v0.8.6 h1:ZfF0+zZeYdzMIVMZHKtDKJvLHj76XCuVae/jNkjj0IA=
|
||||
github.com/Microsoft/hcsshim v0.8.6/go.mod h1:Op3hHsoHPAvb6lceZHDtd9OkTew38wNoXnJs8iY7rUg=
|
||||
github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5 h1:ygIc8M6trr62pF5DucadTWGdEB4mEyvzi0e2nbcmcyA=
|
||||
github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5/go.mod h1:tTuCMEN+UleMWgg9dVx4Hu52b1bJo+59jBh3ajtinzw=
|
||||
github.com/Microsoft/hcsshim v0.8.7 h1:ptnOoufxGSzauVTsdE+wMYnCWA301PdoN4xg5oRdZpg=
|
||||
github.com/Microsoft/hcsshim v0.8.7/go.mod h1:OHd7sQqRFrYd3RmSgbgji+ctCwkbq2wbEYNSzOYtcBQ=
|
||||
github.com/Microsoft/hcsshim v0.8.9 h1:VrfodqvztU8YSOvygU+DN1BGaSGxmrNfqOv5oOuX2Bk=
|
||||
github.com/Microsoft/hcsshim v0.8.9/go.mod h1:5692vkUqntj1idxauYlpoINNKeqCiG6Sg38RRsjT5y8=
|
||||
github.com/OneOfOne/xxhash v1.2.2/go.mod h1:HSdplMjZKSmBqAxg5vPj2TmRDmfkzw+cTzAElWljhcU=
|
||||
github.com/VividCortex/ewma v1.1.1 h1:MnEK4VOv6n0RSY4vtRe3h11qjxL3+t0B8yOL8iMXdcM=
|
||||
github.com/VividCortex/ewma v1.1.1/go.mod h1:2Tkkvm3sRDVXaiyucHiACn4cqf7DpdyLvmxzcbUokwA=
|
||||
github.com/containerd/continuity v0.0.0-20180216233310-d8fb8589b0e8 h1:ZZOFPzvZO3N0f4LIQvZi68F2XDAMl/gqBfFMVjY6B3Y=
|
||||
github.com/containerd/continuity v0.0.0-20180216233310-d8fb8589b0e8/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y=
|
||||
github.com/containers/buildah v1.8.4 h1:06c+UNeEWMa2wA1Z7muZ0ZqUzE91sDuZJbB0BiZaeYQ=
|
||||
github.com/containers/buildah v1.8.4/go.mod h1:1CsiLJvyU+h+wOjnqJJOWuJCVcMxZOr5HN/gHGdzJxY=
|
||||
github.com/containers/image v1.5.2-0.20190620105408-93b1deece293 h1:EalCgZ875kDCN2HcOch50q48GKerWGc5eV0BllCvln8=
|
||||
github.com/containers/image v1.5.2-0.20190620105408-93b1deece293/go.mod h1:8Vtij257IWSanUQKe1tAeNOm2sRVkSqQTVQ1IlwI3+M=
|
||||
github.com/containers/image v1.5.2-0.20190717062552-2178abd5f9b1 h1:RGlzwWSoGBbc5fgGysRrGAPLn8xQwihzRVPVDW5yQlo=
|
||||
github.com/containers/image v1.5.2-0.20190717062552-2178abd5f9b1/go.mod h1:8Vtij257IWSanUQKe1tAeNOm2sRVkSqQTVQ1IlwI3+M=
|
||||
github.com/containers/image v1.5.2-0.20190725091050-48acc3dcbb76 h1:+9unAKrV92Jvifb06UK8H4xTKf7h7XQDOsn4EC9eqH4=
|
||||
github.com/containers/image v1.5.2-0.20190725091050-48acc3dcbb76/go.mod h1:8Vtij257IWSanUQKe1tAeNOm2sRVkSqQTVQ1IlwI3+M=
|
||||
github.com/containers/image v2.0.0+incompatible h1:FTr6Br7jlIKNCKMjSOMbAxKp2keQ0//jzJaYNTVhauk=
|
||||
github.com/containers/image v2.0.0+incompatible/go.mod h1:8Vtij257IWSanUQKe1tAeNOm2sRVkSqQTVQ1IlwI3+M=
|
||||
github.com/containers/image v3.0.0+incompatible h1:pdUHY//H+3jYNnoTt+rqY8NsStX4ZBLKzPTlMC+XvnU=
|
||||
github.com/containers/image v3.0.0+incompatible/go.mod h1:8Vtij257IWSanUQKe1tAeNOm2sRVkSqQTVQ1IlwI3+M=
|
||||
github.com/containers/storage v1.12.10 h1:vw1aiLsZ1LvO09ELMxVBTe35tThRiMftI2cPeH+G5ow=
|
||||
github.com/containers/storage v1.12.10/go.mod h1:+RirK6VQAqskQlaTBrOG6ulDvn4si2QjFE1NZCn06MM=
|
||||
github.com/acarl005/stripansi v0.0.0-20180116102854-5a71ef0e047d h1:licZJFw2RwpHMqeKTCYkitsPqHNxTmd4SNR5r94FGM8=
|
||||
github.com/acarl005/stripansi v0.0.0-20180116102854-5a71ef0e047d/go.mod h1:asat636LX7Bqt5lYEZ27JNDcqxfjdBQuJ/MM4CN/Lzo=
|
||||
github.com/alecthomas/template v0.0.0-20160405071501-a0175ee3bccc/go.mod h1:LOuyumcjzFXgccqObfd/Ljyb9UuFJ6TxHnclSeseNhc=
|
||||
github.com/alecthomas/units v0.0.0-20151022065526-2efee857e7cf/go.mod h1:ybxpYRFXyAe+OPACYpWeL0wqObRcbAqCMya13uyzqw0=
|
||||
github.com/armon/consul-api v0.0.0-20180202201655-eb2c6b5be1b6/go.mod h1:grANhF5doyWs3UAsr3K4I6qtAmlQcZDesFNEHPZAzj8=
|
||||
github.com/beorn7/perks v0.0.0-20180321164747-3a771d992973/go.mod h1:Dwedo/Wpr24TaqPxmxbtue+5NUziq4I4S80YR8gNf3Q=
|
||||
github.com/beorn7/perks v1.0.0/go.mod h1:KWe93zE9D1o94FZ5RNwFwVgaQK1VOXiVxmqh+CedLV8=
|
||||
github.com/beorn7/perks v1.0.1 h1:VlbKKnNfV8bJzeqoa4cOKqO6bYr3WgKZxO8Z16+hsOM=
|
||||
github.com/beorn7/perks v1.0.1/go.mod h1:G2ZrVWU2WbWT9wwq4/hrbKbnv/1ERSJQ0ibhJ6rlkpw=
|
||||
github.com/blang/semver v3.1.0+incompatible/go.mod h1:kRBLl5iJ+tD4TcOOxsy/0fnwebNt5EWlYSAyrTnjyyk=
|
||||
github.com/cespare/xxhash v1.1.0/go.mod h1:XrSqR1VqqWfGrhpAt58auRo0WTKS1nRRg3ghfAqPWnc=
|
||||
github.com/client9/misspell v0.3.4/go.mod h1:qj6jICC3Q7zFZvVWo7KLAzC3yx5G7kyvSDkc90ppPyw=
|
||||
github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f h1:tSNMc+rJDfmYntojat8lljbt1mgKNpTxUZJsSzJ9Y1s=
|
||||
github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f/go.mod h1:OApqhQ4XNSNC13gXIwDjhOQxjWa/NxkwZXJ1EvqT0ko=
|
||||
github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1/go.mod h1:Tj/on1eG8kiEhd0+fhSDzsPAFESxzBBvdyEgyryXffw=
|
||||
github.com/containerd/containerd v1.2.10/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA=
|
||||
github.com/containerd/containerd v1.3.0-beta.2.0.20190828155532-0293cbd26c69 h1:rG1clvJbgsUcmb50J82YUJhUMopWNtZvyMZjb+4fqGw=
|
||||
github.com/containerd/containerd v1.3.0-beta.2.0.20190828155532-0293cbd26c69/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA=
|
||||
github.com/containerd/containerd v1.3.2 h1:ForxmXkA6tPIvffbrDAcPUIB32QgXkt2XFj+F0UxetA=
|
||||
github.com/containerd/containerd v1.3.2/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA=
|
||||
github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc h1:TP+534wVlf61smEIq1nwLLAjQVEK2EADoW3CX9AuT+8=
|
||||
github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y=
|
||||
github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448/go.mod h1:ODA38xgv3Kuk8dQz2ZQXpnv/UZZUHUCL7pnLehbXgQI=
|
||||
github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3/go.mod h1:IV7qH3hrUgRmyYrtgEeGWJfWbgcHL9CSRruz2Vqcph0=
|
||||
github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de/go.mod h1:PvCDdDGpgqzQIzDW1TphrGLssLDZp2GuS+X5DkEJB8o=
|
||||
github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd/go.mod h1:Cm3kwCdlkCfMSHURc+r6fwoGH6/F1hH3S4sg0rLFWPc=
|
||||
github.com/containers/common v0.11.2 h1:e4477fCE3qSA+Z2vT+uUMUTn8s8CyIM++qNm3PCSl68=
|
||||
github.com/containers/common v0.11.2/go.mod h1:2w3QE6VUmhltGYW4wV00h4okq1Crs7hNI1ZD2I0QRUY=
|
||||
github.com/containers/image/v5 v5.4.3/go.mod h1:pN0tvp3YbDd7BWavK2aE0mvJUqVd2HmhPjekyWSFm0U=
|
||||
github.com/containers/image/v5 v5.4.4 h1:JSanNn3v/BMd3o0MEvO4R4OKNuoJUSzVGQAI1+0FMXE=
|
||||
github.com/containers/image/v5 v5.4.4/go.mod h1:g7cxNXitiLi6pEr9/L9n/0wfazRuhDKXU15kV86N8h8=
|
||||
github.com/containers/libtrust v0.0.0-20190913040956-14b96171aa3b h1:Q8ePgVfHDplZ7U33NwHZkrVELsZP5fYj9pM5WBZB2GE=
|
||||
github.com/containers/libtrust v0.0.0-20190913040956-14b96171aa3b/go.mod h1:9rfv8iPl1ZP7aqh9YA68wnZv2NUDbXdcdPHVz0pFbPY=
|
||||
github.com/containers/ocicrypt v1.0.2 h1:Q0/IPs8ohfbXNxEfyJ2pFVmvJu5BhqJUAmc6ES9NKbo=
|
||||
github.com/containers/ocicrypt v1.0.2/go.mod h1:nsOhbP19flrX6rE7ieGFvBlr7modwmNjsqWarIUce4M=
|
||||
github.com/containers/storage v1.18.2/go.mod h1:WTBMf+a9ZZ/LbmEVeLHH2TX4CikWbO1Bt+/m58ZHVPg=
|
||||
github.com/containers/storage v1.19.1 h1:YKIzOO12iaD5Ra0PKFS6emcygbHLmwmQOCQRU/19YAQ=
|
||||
github.com/containers/storage v1.19.1/go.mod h1:KbXjSwKnx17ejOsjFcCXSf78mCgZkQSLPBNTMRc3XrQ=
|
||||
github.com/containers/storage v1.19.2 h1:vhcUwEjDZiPJxaLPFsjvyavnEjFw6qQi9HAkVz1amfI=
|
||||
github.com/containers/storage v1.19.2/go.mod h1:gYCp3jzgXkvubO0rI14QAjz5Mxm/qKJgLmHFyqayDnw=
|
||||
github.com/coreos/bbolt v1.3.2/go.mod h1:iRUV2dpdMOn7Bo10OQBFzIJO9kkE559Wcmn+qkEiiKk=
|
||||
github.com/coreos/etcd v3.3.10+incompatible/go.mod h1:uF7uidLiAD3TWHmW31ZFd/JWoc32PjwdhPthX9715RE=
|
||||
github.com/coreos/go-semver v0.2.0/go.mod h1:nnelYz7RCh+5ahJtPPxZlU+153eP4D4r3EedlOD2RNk=
|
||||
github.com/coreos/go-systemd v0.0.0-20190321100706-95778dfbb74e/go.mod h1:F5haX7vjVVG0kc13fIWeqUViNPyEJxv/OmvnBo0Yme4=
|
||||
github.com/coreos/pkg v0.0.0-20180928190104-399ea9e2e55f/go.mod h1:E3G3o1h8I7cfcXa63jLwjI0eiQQMgzzUDFVpN/nH/eA=
|
||||
github.com/cpuguy83/go-md2man/v2 v2.0.0/go.mod h1:maD7wRr/U5Z6m/iR4s+kqSMx2CaBsrgA7czyZG/E6dU=
|
||||
github.com/davecgh/go-spew v1.1.0/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
|
||||
github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c=
|
||||
github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
|
||||
github.com/docker/distribution v0.0.0-20170817175659-5f6282db7d65 h1:4zlOyrJUbYnrvlzChJ+jP2J3i77Jbhm336NEuCv7kZo=
|
||||
github.com/docker/distribution v0.0.0-20170817175659-5f6282db7d65/go.mod h1:J2gT2udsDAN96Uj4KfcMRqY0/ypR+oyYUYmja8H+y+w=
|
||||
github.com/docker/docker v0.0.0-20180522102801-da99009bbb11 h1:p8hSDXZgVhyh/C9bPlG8QMY64VeXtVfjmjIlzaQok5Q=
|
||||
github.com/docker/docker v0.0.0-20180522102801-da99009bbb11/go.mod h1:eEKB0N0r5NX/I1kEveEz05bcu8tLC/8azJZsviup8Sk=
|
||||
github.com/docker/docker-credential-helpers v0.6.0 h1:5bhDRLn1roGiNjz8IezRngHxMfoeaXGyr0BeMHq4rD8=
|
||||
github.com/docker/docker-credential-helpers v0.6.0/go.mod h1:WRaJzqw3CTB9bk10avuGsjVBZsD05qeibJ1/TYlvc0Y=
|
||||
github.com/docker/go-connections v0.0.0-20180212134524-7beb39f0b969 h1:p2WzwcFof6KwsloLgCiAKkU5DJSVgOKGdevswAmskvY=
|
||||
github.com/docker/go-connections v0.0.0-20180212134524-7beb39f0b969/go.mod h1:Gbd7IOopHjR8Iph03tsViu4nIes5XhDvyHbTtUxmeec=
|
||||
github.com/docker/go-units v0.0.0-20161020213227-8a7beacffa30 h1:dDGntbHn0CUgKCyVvmHcD+spha+/4+8hJv5nbZVS6R8=
|
||||
github.com/docker/go-units v0.0.0-20161020213227-8a7beacffa30/go.mod h1:fgPhTUdO+D/Jk86RDLlptpiXQzgHJF7gydDDbaIK4Dk=
|
||||
github.com/dgrijalva/jwt-go v3.2.0+incompatible/go.mod h1:E3ru+11k8xSBh+hMPgOLZmtrrCbhqsmaPHjLKYnJCaQ=
|
||||
github.com/dgryski/go-sip13 v0.0.0-20181026042036-e10d5fee7954/go.mod h1:vAd38F8PWV+bWy6jNmig1y/TA+kYO4g3RSRF0IAv0no=
|
||||
github.com/docker/distribution v2.7.1+incompatible h1:a5mlkVzth6W5A4fOsS3D2EO5BUmsJpcB+cRlLU7cSug=
|
||||
github.com/docker/distribution v2.7.1+incompatible/go.mod h1:J2gT2udsDAN96Uj4KfcMRqY0/ypR+oyYUYmja8H+y+w=
|
||||
github.com/docker/docker v1.4.2-0.20191219165747-a9416c67da9f h1:Sm8iD2lifO31DwXfkGzq8VgA7rwxPjRsYmeo0K/dF9Y=
|
||||
github.com/docker/docker v1.4.2-0.20191219165747-a9416c67da9f/go.mod h1:eEKB0N0r5NX/I1kEveEz05bcu8tLC/8azJZsviup8Sk=
|
||||
github.com/docker/docker-credential-helpers v0.6.3 h1:zI2p9+1NQYdnG6sMU26EX4aVGlqbInSQxQXLvzJ4RPQ=
|
||||
github.com/docker/docker-credential-helpers v0.6.3/go.mod h1:WRaJzqw3CTB9bk10avuGsjVBZsD05qeibJ1/TYlvc0Y=
|
||||
github.com/docker/go-connections v0.4.0 h1:El9xVISelRB7BuFusrZozjnkIM5YnzCViNKohAFqRJQ=
|
||||
github.com/docker/go-connections v0.4.0/go.mod h1:Gbd7IOopHjR8Iph03tsViu4nIes5XhDvyHbTtUxmeec=
|
||||
github.com/docker/go-metrics v0.0.1 h1:AgB/0SvBxihN0X8OR4SjsblXkbMvalQ8cjmtKQ2rQV8=
|
||||
github.com/docker/go-metrics v0.0.1/go.mod h1:cG1hvH2utMXtqgqqYE9plW6lDxS3/5ayHzueweSI3Vw=
|
||||
github.com/docker/go-units v0.4.0 h1:3uh0PgVws3nIA0Q+MwDC8yjEPf9zjRfZZWXZYDct3Tw=
|
||||
github.com/docker/go-units v0.4.0/go.mod h1:fgPhTUdO+D/Jk86RDLlptpiXQzgHJF7gydDDbaIK4Dk=
|
||||
github.com/docker/libtrust v0.0.0-20160708172513-aabc10ec26b7 h1:UhxFibDNY/bfvqU5CAUmr9zpesgbU6SWc8/B4mflAE4=
|
||||
github.com/docker/libtrust v0.0.0-20160708172513-aabc10ec26b7/go.mod h1:cyGadeNEkKy96OOhEzfZl+yxihPEzKnqJwvfuSUqbZE=
|
||||
github.com/etcd-io/bbolt v1.3.2 h1:RLRQ0TKLX7DlBRXAJHvbmXL17Q3KNnTBtZ9B6Qo+/Y0=
|
||||
github.com/etcd-io/bbolt v1.3.2/go.mod h1:ZF2nL25h33cCyBtcyWeZ2/I3HQOfTP+0PIEvHjkjCrw=
|
||||
github.com/ghodss/yaml v0.0.0-20150909031657-73d445a93680 h1:ZktWZesgun21uEDrwW7iEV1zPCGQldM2atlJZ3TdvVM=
|
||||
github.com/ghodss/yaml v0.0.0-20150909031657-73d445a93680/go.mod h1:4dBDuWmgqj2HViK6kFavaiC9ZROes6MMH2rRYeMEF04=
|
||||
github.com/dsnet/compress v0.0.1 h1:PlZu0n3Tuv04TzpfPbrnI0HW/YwodEXDS+oPKahKF0Q=
|
||||
github.com/dsnet/compress v0.0.1/go.mod h1:Aw8dCMJ7RioblQeTqt88akK31OvO8Dhf5JflhBbQEHo=
|
||||
github.com/dsnet/golib v0.0.0-20171103203638-1ea166775780/go.mod h1:Lj+Z9rebOhdfkVLjJ8T6VcRQv3SXugXy999NBtR9aFY=
|
||||
github.com/fsnotify/fsnotify v1.4.7/go.mod h1:jwhsz4b93w/PPRr/qN1Yymfu8t87LnFCMoQvtojpjFo=
|
||||
github.com/fullsailor/pkcs7 v0.0.0-20190404230743-d7302db945fa h1:RDBNVkRviHZtvDvId8XSGPu3rmpmSe+wKRcEWNgsfWU=
|
||||
github.com/fullsailor/pkcs7 v0.0.0-20190404230743-d7302db945fa/go.mod h1:KnogPXtdwXqoenmZCw6S+25EAm2MkxbG0deNDu4cbSA=
|
||||
github.com/ghodss/yaml v1.0.0 h1:wQHKEahhL6wmXdzwWG11gIVCkOv05bNOh+Rxn0yngAk=
|
||||
github.com/ghodss/yaml v1.0.0/go.mod h1:4dBDuWmgqj2HViK6kFavaiC9ZROes6MMH2rRYeMEF04=
|
||||
github.com/go-check/check v0.0.0-20180628173108-788fd7840127 h1:0gkP6mzaMqkmpcJYCFOLkIBwI7xFExG03bbkOkCvUPI=
|
||||
github.com/go-check/check v0.0.0-20180628173108-788fd7840127/go.mod h1:9ES+weclKsC9YodN5RgxqK/VD9HM9JsCSh7rNhMZE98=
|
||||
github.com/gogo/protobuf v0.0.0-20170815085658-fcdc5011193f h1:r/AdTzqktq9nQpFlFePWcp+scVi+oFRajfjRJ3UnETg=
|
||||
github.com/gogo/protobuf v0.0.0-20170815085658-fcdc5011193f/go.mod h1:r8qH/GZQm5c6nD/R0oafs1akxWv10x8SbQlK7atdtwQ=
|
||||
github.com/gorilla/context v0.0.0-20140604161150-14f550f51af5 h1:yCHB2BCyFu0V6ChUHb8sF2VodD5B0PAgPDoCxBE7ICQ=
|
||||
github.com/gorilla/context v0.0.0-20140604161150-14f550f51af5/go.mod h1:kBGZzfjB9CEq2AlWe17Uuf7NDRt0dE0s8S51q0aT7Yg=
|
||||
github.com/gorilla/mux v0.0.0-20140926153814-e444e69cbd2e h1:nH09qCdJVZxw0nRVfm14xjXkw2puLyLPN56n4u+vTC0=
|
||||
github.com/gorilla/mux v0.0.0-20140926153814-e444e69cbd2e/go.mod h1:1lud6UwP+6orDFRuTfBEV8e9/aOM/c4fVVCaMa2zaAs=
|
||||
github.com/imdario/mergo v0.0.0-20141206190957-6633656539c1 h1:FeeCi0I2Fu8kA8IXrdVPtGzym+mW9bzfj9f26EaES9k=
|
||||
github.com/imdario/mergo v0.0.0-20141206190957-6633656539c1/go.mod h1:2EnlNZ0deacrJVfApfmtdGgDfMuh/nq6Ok1EcJh5FfA=
|
||||
github.com/klauspost/compress v1.4.1 h1:8VMb5+0wMgdBykOV96DwNwKFQ+WTI4pzYURP99CcB9E=
|
||||
github.com/go-kit/kit v0.8.0/go.mod h1:xBxKIO96dXMWWy0MnWVtmwkA9/13aqxPnvrjFYMA2as=
|
||||
github.com/go-logfmt/logfmt v0.3.0/go.mod h1:Qt1PoO58o5twSAckw1HlFXLmHsOX5/0LbT9GBnD5lWE=
|
||||
github.com/go-logfmt/logfmt v0.4.0/go.mod h1:3RMwSq7FuexP4Kalkev3ejPJsZTpXXBr9+V4qmtdjCk=
|
||||
github.com/go-stack/stack v1.8.0/go.mod h1:v0f6uXyyMGvRgIKkXu+yp6POWl0qKG85gN/melR3HDY=
|
||||
github.com/godbus/dbus v0.0.0-20190422162347-ade71ed3457e/go.mod h1:bBOAhwG1umN6/6ZUMtDFBMQR8jRg9O75tm9K00oMsK4=
|
||||
github.com/gogo/protobuf v1.1.1/go.mod h1:r8qH/GZQm5c6nD/R0oafs1akxWv10x8SbQlK7atdtwQ=
|
||||
github.com/gogo/protobuf v1.2.1/go.mod h1:hp+jE20tsWTFYpLwKvXlhS1hjn+gTNwPg2I6zVXpSg4=
|
||||
github.com/gogo/protobuf v1.3.1 h1:DqDEcV5aeaTmdFBePNpYsp3FlcVH/2ISVVM9Qf8PSls=
|
||||
github.com/gogo/protobuf v1.3.1/go.mod h1:SlYgWuQ5SjCEi6WLHjHCa1yvBfUnHcTbrrZtXPKa29o=
|
||||
github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b h1:VKtxabqXZkF25pY9ekfRL6a582T4P37/31XEstQ5p58=
|
||||
github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b/go.mod h1:SBH7ygxi8pfUlaOkMMuAQtPIUF8ecWP5IEl/CR7VP2Q=
|
||||
github.com/golang/groupcache v0.0.0-20190129154638-5b532d6fd5ef/go.mod h1:cIg4eruTrX1D+g88fzRXU5OdNfaM+9IcxsU14FzY7Hc=
|
||||
github.com/golang/mock v1.1.1/go.mod h1:oTYuIxOrZwtPieC+H1uAHpcLFnEyAGVDL/k47Jfbm0A=
|
||||
github.com/golang/protobuf v1.2.0/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U=
|
||||
github.com/golang/protobuf v1.3.1/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U=
|
||||
github.com/golang/protobuf v1.3.2 h1:6nsPYzhq5kReh6QImI3k5qWzO4PEbvbIW2cwSfR/6xs=
|
||||
github.com/golang/protobuf v1.3.2/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U=
|
||||
github.com/google/btree v1.0.0/go.mod h1:lNA+9X1NB3Zf8V7Ke586lFgjr2dZNuvo3lPJSGZ5JPQ=
|
||||
github.com/google/go-cmp v0.2.0/go.mod h1:oXzfMopK8JAjlY9xF4vHSVASa0yLyX7SntLO5aqRK0M=
|
||||
github.com/google/go-cmp v0.3.0/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU=
|
||||
github.com/google/go-cmp v0.3.1 h1:Xye71clBPdm5HgqGwUkwhbynsUJZhDbS20FvLhQ2izg=
|
||||
github.com/google/go-cmp v0.3.1/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU=
|
||||
github.com/google/gofuzz v1.0.0/go.mod h1:dBl0BpW6vV/+mYPU4Po3pmUjxk6FQPldtuIdl/M65Eg=
|
||||
github.com/gorilla/mux v1.7.4 h1:VuZ8uybHlWmqV03+zRzdwKL4tUnIp1MAQtp1mIFE1bc=
|
||||
github.com/gorilla/mux v1.7.4/go.mod h1:DVbg23sWSpFRCP0SfiEN6jmj59UnW/n46BH5rLB71So=
|
||||
github.com/gorilla/websocket v1.4.0/go.mod h1:E7qHFY5m1UJ88s3WnNqhKjPHQ0heANvMoAMk2YaljkQ=
|
||||
github.com/grpc-ecosystem/go-grpc-middleware v1.0.0/go.mod h1:FiyG127CGDf3tlThmgyCl78X/SZQqEOJBCDaAfeWzPs=
|
||||
github.com/grpc-ecosystem/go-grpc-prometheus v1.2.0/go.mod h1:8NvIoxWQoOIhqOTXgfV/d3M/q6VIi02HzZEHgUlZvzk=
|
||||
github.com/grpc-ecosystem/grpc-gateway v1.9.0/go.mod h1:vNeuVxBJEsws4ogUvrchl83t/GYV9WGTSLVdBhOQFDY=
|
||||
github.com/hashicorp/errwrap v0.0.0-20141028054710-7554cd9344ce/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4=
|
||||
github.com/hashicorp/errwrap v1.0.0 h1:hLrqtEDnRye3+sgx6z4qVLNuviH3MR5aQ0ykNJa/UYA=
|
||||
github.com/hashicorp/errwrap v1.0.0/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4=
|
||||
github.com/hashicorp/go-multierror v0.0.0-20161216184304-ed905158d874/go.mod h1:JMRHfdO9jKNzS/+BTlxCjKNQHg/jZAft8U7LloJvN7I=
|
||||
github.com/hashicorp/go-multierror v1.0.0 h1:iVjPR7a6H0tWELX5NxNe7bYopibicUzc7uPribsnS6o=
|
||||
github.com/hashicorp/go-multierror v1.0.0/go.mod h1:dHtQlpGsu+cZNNAkkCN/P3hoUDHhCYQXV3UM06sGGrk=
|
||||
github.com/hashicorp/golang-lru v0.5.1 h1:0hERBMJE1eitiLkihrMvRVBYAkpHzc/J3QdDN+dAcgU=
|
||||
github.com/hashicorp/golang-lru v0.5.1/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8=
|
||||
github.com/hashicorp/hcl v1.0.0/go.mod h1:E5yfLk+7swimpb2L/Alb/PJmXilQ/rhwaUYs4T20WEQ=
|
||||
github.com/hpcloud/tail v1.0.0/go.mod h1:ab1qPbhIpdTxEkNHXyeSf5vhxWSCs/tWer42PpOxQnU=
|
||||
github.com/imdario/mergo v0.3.9 h1:UauaLniWCFHWd+Jp9oCEkTBj8VO/9DKg3PV3VCNMDIg=
|
||||
github.com/imdario/mergo v0.3.9/go.mod h1:2EnlNZ0deacrJVfApfmtdGgDfMuh/nq6Ok1EcJh5FfA=
|
||||
github.com/inconshreveable/mousetrap v1.0.0 h1:Z8tu5sraLXCXIcARxBp/8cbvlwVa7Z1NHg9XEKhtSvM=
|
||||
github.com/inconshreveable/mousetrap v1.0.0/go.mod h1:PxqpIevigyE2G7u3NXJIT2ANytuPF1OarO4DADm73n8=
|
||||
github.com/jonboulle/clockwork v0.1.0/go.mod h1:Ii8DK3G1RaLaWxj9trq07+26W01tbo22gdxWY5EU2bo=
|
||||
github.com/json-iterator/go v1.1.6/go.mod h1:+SdeFBvtyEkXs7REEP0seUULqWtbJapLOCVDaaPEHmU=
|
||||
github.com/json-iterator/go v1.1.7/go.mod h1:KdQUCv79m/52Kvf8AW2vK1V8akMuk1QjK/uOdHXbAo4=
|
||||
github.com/julienschmidt/httprouter v1.2.0/go.mod h1:SYymIcj16QtmaHHD7aYtjjsJG7VTCxuUUipMqKk8s4w=
|
||||
github.com/kisielk/errcheck v1.1.0/go.mod h1:EZBBE59ingxPouuu3KfxchcWSUPOHkagtvWXihfKN4Q=
|
||||
github.com/kisielk/errcheck v1.2.0/go.mod h1:/BMXB+zMLi60iA8Vv6Ksmxu/1UDYcXs4uQLJ+jE2L00=
|
||||
github.com/kisielk/gotool v1.0.0/go.mod h1:XhKaO+MFFWcvkIS/tQcRk01m1F5IRFswLeQ+oQHNcck=
|
||||
github.com/klauspost/compress v1.4.1/go.mod h1:RyIbtBH6LamlWaDj8nUwkbUhJ87Yi3uG0guNDohfE1A=
|
||||
github.com/klauspost/cpuid v1.2.0 h1:NMpwD2G9JSFOE1/TJjGSo5zG7Yb2bTe7eq1jH+irmeE=
|
||||
github.com/klauspost/compress v1.10.3/go.mod h1:aoV0uJVorq1K+umq18yTdKaF57EivdYsUV+/s2qKfXs=
|
||||
github.com/klauspost/compress v1.10.5 h1:7q6vHIqubShURwQz8cQK6yIe/xC3IF0Vm7TGfqjewrc=
|
||||
github.com/klauspost/compress v1.10.5/go.mod h1:aoV0uJVorq1K+umq18yTdKaF57EivdYsUV+/s2qKfXs=
|
||||
github.com/klauspost/cpuid v1.2.0/go.mod h1:Pj4uuM528wm8OyEC2QMXAi2YiTZ96dNQPGgoMS4s3ek=
|
||||
github.com/klauspost/pgzip v1.2.1 h1:oIPZROsWuPHpOdMVWLuJZXwgjhrW8r1yEX8UqMyeNHM=
|
||||
github.com/klauspost/pgzip v1.2.1/go.mod h1:Ch1tH69qFZu15pkjo5kYi6mth2Zzwzt50oCQKQE9RUs=
|
||||
github.com/klauspost/pgzip v1.2.3 h1:Ce2to9wvs/cuJ2b86/CKQoTYr9VHfpanYosZ0UBJqdw=
|
||||
github.com/klauspost/pgzip v1.2.3/go.mod h1:Ch1tH69qFZu15pkjo5kYi6mth2Zzwzt50oCQKQE9RUs=
|
||||
github.com/konsorten/go-windows-terminal-sequences v1.0.1/go.mod h1:T0+1ngSBFLxvqU3pZ+m/2kptfBszLMUkC4ZK/EgS/cQ=
|
||||
github.com/konsorten/go-windows-terminal-sequences v1.0.2/go.mod h1:T0+1ngSBFLxvqU3pZ+m/2kptfBszLMUkC4ZK/EgS/cQ=
|
||||
github.com/konsorten/go-windows-terminal-sequences v1.0.3 h1:CE8S1cTafDpPvMhIxNJKvHsGVBgn1xWYf1NbHQhywc8=
|
||||
github.com/konsorten/go-windows-terminal-sequences v1.0.3/go.mod h1:T0+1ngSBFLxvqU3pZ+m/2kptfBszLMUkC4ZK/EgS/cQ=
|
||||
github.com/kr/logfmt v0.0.0-20140226030751-b84e30acd515/go.mod h1:+0opPa2QZZtGFBFZlji/RkVcI2GknAs/DXo4wKdlNEc=
|
||||
github.com/kr/pretty v0.1.0 h1:L/CwN0zerZDmRFUapSPitk6f+Q3+0za1rQkzVuMiMFI=
|
||||
github.com/kr/pretty v0.1.0/go.mod h1:dAy3ld7l9f0ibDNOQOHHMYYIIbhfbHSm3C4ZsoJORNo=
|
||||
github.com/kr/pty v1.1.1/go.mod h1:pFQYn66WHrOpPYNljwOMqo10TkYh1fy3cYio2l3bCsQ=
|
||||
github.com/kr/text v0.1.0 h1:45sCR5RtlFHMR4UwH9sdQ5TC8v0qDQCHnXt+kaKSTVE=
|
||||
github.com/kr/text v0.1.0/go.mod h1:4Jbv+DJW3UT/LiOwJeYQe1efqtUx/iVham/4vfdArNI=
|
||||
github.com/mattn/go-isatty v0.0.4 h1:bnP0vzxcAdeI1zdubAl5PjU6zsERjGZb7raWodagDYs=
|
||||
github.com/mattn/go-isatty v0.0.4/go.mod h1:M+lRXTBqGeGNdLjl/ufCoiOlB5xdOkqRJdNxMWT7Zi4=
|
||||
github.com/mattn/go-shellwords v1.0.5 h1:JhhFTIOslh5ZsPrpa3Wdg8bF0WI3b44EMblmU9wIsXc=
|
||||
github.com/mattn/go-shellwords v1.0.5/go.mod h1:3xCvwCdWdlDJUrvuMn7Wuy9eWs4pE8vqg+NOMyg4B2o=
|
||||
github.com/mistifyio/go-zfs v0.0.0-20160425201758-22c9b32c84eb h1:iTqJ2fjDnaldY7BXhfc15HkT769kWAstiz2bCmUrKAw=
|
||||
github.com/mistifyio/go-zfs v0.0.0-20160425201758-22c9b32c84eb/go.mod h1:8AuVvqP/mXw1px98n46wfvcGfQ4ci2FwoAjKYxuo3Z4=
|
||||
github.com/mtrmac/gpgme v0.0.0-20170102180018-b2432428689c h1:xa+eQWKuJ9MbB9FBL/eoNvDFvveAkz2LQoz8PzX7Q/4=
|
||||
github.com/mtrmac/gpgme v0.0.0-20170102180018-b2432428689c/go.mod h1:GhAqVMEWnTcW2dxoD/SO3n2enrgWl3y6Dnx4m59GvcA=
|
||||
github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2 h1:QhPf3A2AZW3tTGvHPg0TA+CR3oHbVLlXUhlghqISp1I=
|
||||
github.com/magiconair/properties v1.8.0/go.mod h1:PppfXfuXeibc/6YijjN8zIbojt8czPbwD3XqdrwzmxQ=
|
||||
github.com/mattn/go-shellwords v1.0.10 h1:Y7Xqm8piKOO3v10Thp7Z36h4FYFjt5xB//6XvOrs2Gw=
|
||||
github.com/mattn/go-shellwords v1.0.10/go.mod h1:EZzvwXDESEeg03EKmM+RmDnNOPKG4lLtQsUlTZDWQ8Y=
|
||||
github.com/matttproud/golang_protobuf_extensions v1.0.1 h1:4hp9jkHxhMHkqkrB3Ix0jegS5sx/RkqARlsWZ6pIwiU=
|
||||
github.com/matttproud/golang_protobuf_extensions v1.0.1/go.mod h1:D8He9yQNgCq6Z5Ld7szi9bcBfOoFv/3dc6xSMkL2PC0=
|
||||
github.com/mistifyio/go-zfs v2.1.1+incompatible h1:gAMO1HM9xBRONLHHYnu5iFsOJUiJdNZo6oqSENd4eW8=
|
||||
github.com/mistifyio/go-zfs v2.1.1+incompatible/go.mod h1:8AuVvqP/mXw1px98n46wfvcGfQ4ci2FwoAjKYxuo3Z4=
|
||||
github.com/mitchellh/go-homedir v1.1.0/go.mod h1:SfyaCUpYCn1Vlf4IUYiD9fPX4A5wJrkLzIz1N1q0pr0=
|
||||
github.com/mitchellh/mapstructure v1.1.2/go.mod h1:FVVH3fgwuzCH5S8UJGiWEs2h04kUh9fWfEaFds41c1Y=
|
||||
github.com/modern-go/concurrent v0.0.0-20180228061459-e0a39a4cb421/go.mod h1:6dJC0mAP4ikYIbvyc7fijjWJddQyLn8Ig3JB5CqoB9Q=
|
||||
github.com/modern-go/concurrent v0.0.0-20180306012644-bacd9c7ef1dd/go.mod h1:6dJC0mAP4ikYIbvyc7fijjWJddQyLn8Ig3JB5CqoB9Q=
|
||||
github.com/modern-go/reflect2 v0.0.0-20180701023420-4b7aa43c6742/go.mod h1:bx2lNnkwVCuqBIxFjflWJWanXIb3RllmbCylyMrvgv0=
|
||||
github.com/modern-go/reflect2 v1.0.1/go.mod h1:bx2lNnkwVCuqBIxFjflWJWanXIb3RllmbCylyMrvgv0=
|
||||
github.com/morikuni/aec v1.0.0 h1:nP9CBfwrvYnBRgY6qfDQkygYDmYwOilePFkwzv4dU8A=
|
||||
github.com/morikuni/aec v1.0.0/go.mod h1:BbKIizmSmc5MMPqRYbxO4ZU0S0+P200+tUnFx7PXmsc=
|
||||
github.com/mtrmac/gpgme v0.1.2 h1:dNOmvYmsrakgW7LcgiprD0yfRuQQe8/C8F6Z+zogO3s=
|
||||
github.com/mtrmac/gpgme v0.1.2/go.mod h1:GYYHnGSuS7HK3zVS2n3y73y0okK/BeKzwnn5jgiVFNI=
|
||||
github.com/mwitkow/go-conntrack v0.0.0-20161129095857-cc309e4a2223/go.mod h1:qRWi+5nqEBWmkhHvq77mSJWrCKwh8bxhgT7d/eI7P4U=
|
||||
github.com/oklog/ulid v1.3.1/go.mod h1:CirwcVhetQ6Lv90oh/F+FBtV6XMibvdAFo93nm5qn4U=
|
||||
github.com/onsi/ginkgo v1.6.0/go.mod h1:lLunBs/Ym6LB5Z9jYTR76FiuTmxDTDusOGeTQH+WWjE=
|
||||
github.com/onsi/ginkgo v1.12.0/go.mod h1:oUhWkIvk5aDxtKvDDuw8gItl8pKl42LzjC9KZE0HfGg=
|
||||
github.com/onsi/gomega v1.7.1/go.mod h1:XdKZgCCFLUoM/7CFJVPcG8C1xQ1AJ0vpAezJrB7JYyY=
|
||||
github.com/onsi/gomega v1.10.0/go.mod h1:Ho0h+IUsWyvy1OpqCwxlQ/21gkhVunqlU8fDGcoTdcA=
|
||||
github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s=
|
||||
github.com/opencontainers/image-spec v0.0.0-20180918080442-7b1e489870ac h1:Y0AqP4onEqgQST60GE172L61SAFMZMHQgXbwLMyj418=
|
||||
github.com/opencontainers/image-spec v0.0.0-20180918080442-7b1e489870ac/go.mod h1:BtxoFyWECRxE4U/7sNtV5W15zMzWCbyJoFRP3s7yZA0=
|
||||
github.com/opencontainers/go-digest v1.0.0-rc1 h1:WzifXhOVOEOuFYOJAW6aQqW0TooG2iki3E3Ii+WN7gQ=
|
||||
github.com/opencontainers/go-digest v1.0.0-rc1/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s=
|
||||
github.com/opencontainers/go-digest v1.0.0 h1:apOUWs51W5PlhuyGyz9FCeeBIOUDA/6nW8Oi/yOhh5U=
|
||||
github.com/opencontainers/go-digest v1.0.0/go.mod h1:0JzlMkj0TRzQZfJkVvzbP0HBR3IKzErnv2BNG4W4MAM=
|
||||
github.com/opencontainers/image-spec v1.0.1/go.mod h1:BtxoFyWECRxE4U/7sNtV5W15zMzWCbyJoFRP3s7yZA0=
|
||||
github.com/opencontainers/image-spec v1.0.2-0.20190823105129-775207bd45b6 h1:yN8BPXVwMBAm3Cuvh1L5XE8XpvYRMdsVLd82ILprhUU=
|
||||
github.com/opencontainers/image-spec v1.0.2-0.20190823105129-775207bd45b6/go.mod h1:BtxoFyWECRxE4U/7sNtV5W15zMzWCbyJoFRP3s7yZA0=
|
||||
github.com/opencontainers/image-tools v0.0.0-20170926011501-6d941547fa1d h1:X9WSFjjZNqYRqO2MenUgqE2nj/oydcfIzXJ0R/SVnnA=
|
||||
github.com/opencontainers/image-tools v0.0.0-20170926011501-6d941547fa1d/go.mod h1:A9btVpZLzttF4iFaKNychhPyrhfOjJ1OF5KrA8GcLj4=
|
||||
github.com/opencontainers/runc v1.0.0-rc6 h1:7AoN22rYxxkmsJS48wFaziH/n0OvrZVqL/TglgHKbKQ=
|
||||
github.com/opencontainers/runc v1.0.0-rc6/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U=
|
||||
github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U=
|
||||
github.com/opencontainers/runc v1.0.0-rc9 h1:/k06BMULKF5hidyoZymkoDCzdJzltZpz/UU4LguQVtc=
|
||||
github.com/opencontainers/runc v1.0.0-rc9/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U=
|
||||
github.com/opencontainers/runtime-spec v0.1.2-0.20190507144316-5b71a03e2700/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0=
|
||||
github.com/opencontainers/runtime-spec v0.1.2-0.20190618234442-a950415649c7/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0=
|
||||
github.com/opencontainers/runtime-spec v1.0.0 h1:O6L965K88AilqnxeYPks/75HLpp4IG+FjeSCI3cVdRg=
|
||||
github.com/opencontainers/runtime-spec v1.0.0/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0=
|
||||
github.com/opencontainers/selinux v0.0.0-20190118194635-b707dfcb00a1 h1:V8Icxoi2vzXvXaH0wuUZR+oyDvyRISW/1fXiK69le8E=
|
||||
github.com/opencontainers/selinux v0.0.0-20190118194635-b707dfcb00a1/go.mod h1:+BLncwf63G4dgOzykXAxcmnFlUaOlkDdmw/CqsW6pjs=
|
||||
github.com/ostreedev/ostree-go v0.0.0-20181204105935-56f3a639dbc0 h1:l8oDb3Ln30sysfGafRZJ9zNnzYfNyWy+w4fGZjii5rQ=
|
||||
github.com/ostreedev/ostree-go v0.0.0-20181204105935-56f3a639dbc0/go.mod h1:J6OG6YJVEWopen4avK3VNQSnALmmjvniMmni/YFYAwc=
|
||||
github.com/pborman/uuid v0.0.0-20160209185913-a97ce2ca70fa h1:l8VQbMdmwFH37kOOaWQ/cw24/u8AuBz5lUym13Wcu0Y=
|
||||
github.com/pborman/uuid v0.0.0-20160209185913-a97ce2ca70fa/go.mod h1:VyrYX9gd7irzKovcSS6BIIEwPRkP2Wm2m9ufcdFSJ34=
|
||||
github.com/pkg/errors v0.8.1 h1:iURUrRGxPUNPdy5/HRSm+Yj6okJ6UtLINN0Q9M4+h3I=
|
||||
github.com/opencontainers/runtime-tools v0.0.0-20181011054405-1d69bd0f9c39/go.mod h1:r3f7wjNzSs2extwzU3Y+6pKfobzPh+kKFJ3ofN+3nfs=
|
||||
github.com/opencontainers/selinux v1.4.0/go.mod h1:yTcKuYAh6R95iDpefGLQaPaRwJFwyzAJufJyiTt7s0g=
|
||||
github.com/opencontainers/selinux v1.5.1 h1:jskKwSMFYqyTrHEuJgQoUlTcId0av64S6EWObrIfn5Y=
|
||||
github.com/opencontainers/selinux v1.5.1/go.mod h1:yTcKuYAh6R95iDpefGLQaPaRwJFwyzAJufJyiTt7s0g=
|
||||
github.com/ostreedev/ostree-go v0.0.0-20190702140239-759a8c1ac913 h1:TnbXhKzrTOyuvWrjI8W6pcoI9XPbLHFXCdN2dtUw7Rw=
|
||||
github.com/ostreedev/ostree-go v0.0.0-20190702140239-759a8c1ac913/go.mod h1:J6OG6YJVEWopen4avK3VNQSnALmmjvniMmni/YFYAwc=
|
||||
github.com/pelletier/go-toml v1.2.0/go.mod h1:5z9KED0ma1S8pY6P1sdut58dfprrGBbd/94hg7ilaic=
|
||||
github.com/pkg/errors v0.8.0/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0=
|
||||
github.com/pkg/errors v0.8.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0=
|
||||
github.com/pmezard/go-difflib v0.0.0-20181226105442-5d4384ee4fb2 h1:Dp6WLvjytJLgEEknBM9ie5JffieQzzdv2pNpwCJ6lQQ=
|
||||
github.com/pmezard/go-difflib v0.0.0-20181226105442-5d4384ee4fb2/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4=
|
||||
github.com/pquerna/ffjson v0.0.0-20171002144729-d49c2bc1aa13 h1:AUK/hm/tPsiNNASdb3J8fySVRZoI7fnK5mlOvdFD43o=
|
||||
github.com/pquerna/ffjson v0.0.0-20171002144729-d49c2bc1aa13/go.mod h1:YARuvh7BUWHNhzDq2OM5tzR2RiCcN2D7sapiKyCel/M=
|
||||
github.com/sirupsen/logrus v1.0.0 h1:XM8X4m/9ACaclZMs946FQNEZBZafvToJLTR4007drwo=
|
||||
github.com/sirupsen/logrus v1.0.0/go.mod h1:pMByvHTf9Beacp5x1UXfOR9xyW/9antXMhjMPG0dEzc=
|
||||
github.com/stretchr/testify v1.1.3 h1:76sIvNG1I8oBerx/MvuVHh5HBWBW7oxfsi3snKIsz5w=
|
||||
github.com/stretchr/testify v1.1.3/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXfy6kDkUVs=
|
||||
github.com/pkg/errors v0.9.1 h1:FEBLx1zS214owpjy7qsBeixbURkuhQAwrK5UwLGTwt4=
|
||||
github.com/pkg/errors v0.9.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0=
|
||||
github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM=
|
||||
github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4=
|
||||
github.com/pquerna/ffjson v0.0.0-20181028064349-e517b90714f7/go.mod h1:YARuvh7BUWHNhzDq2OM5tzR2RiCcN2D7sapiKyCel/M=
|
||||
github.com/pquerna/ffjson v0.0.0-20190813045741-dac163c6c0a9 h1:kyf9snWXHvQc+yxE9imhdI8YAm4oKeZISlaAR+x73zs=
|
||||
github.com/pquerna/ffjson v0.0.0-20190813045741-dac163c6c0a9/go.mod h1:YARuvh7BUWHNhzDq2OM5tzR2RiCcN2D7sapiKyCel/M=
|
||||
github.com/prometheus/client_golang v0.9.1/go.mod h1:7SWBe2y4D6OKWSNQJUaRYU/AaXPKyh/dDVn+NZz0KFw=
|
||||
github.com/prometheus/client_golang v0.9.3/go.mod h1:/TN21ttK/J9q6uSwhBd54HahCDft0ttaMvbicHlPoso=
|
||||
github.com/prometheus/client_golang v1.0.0/go.mod h1:db9x61etRT2tGnBNRi70OPL5FsnadC4Ky3P0J6CfImo=
|
||||
github.com/prometheus/client_golang v1.1.0 h1:BQ53HtBmfOitExawJ6LokA4x8ov/z0SYYb0+HxJfRI8=
|
||||
github.com/prometheus/client_golang v1.1.0/go.mod h1:I1FGZT9+L76gKKOs5djB6ezCbFQP1xR9D75/vuwEF3g=
|
||||
github.com/prometheus/client_model v0.0.0-20180712105110-5c3871d89910/go.mod h1:MbSGuTsp3dbXC40dX6PRTWyKYBIrTGTE9sqQNg2J8bo=
|
||||
github.com/prometheus/client_model v0.0.0-20190129233127-fd36f4220a90 h1:S/YWwWx/RA8rT8tKFRuGUZhuA90OyIBpPCXkcbwU8DE=
|
||||
github.com/prometheus/client_model v0.0.0-20190129233127-fd36f4220a90/go.mod h1:xMI15A0UPsDsEKsMN9yxemIoYk6Tm2C1GtYGdfGttqA=
|
||||
github.com/prometheus/common v0.0.0-20181113130724-41aa239b4cce/go.mod h1:daVV7qP5qjZbuso7PdcryaAu0sAZbrN9i7WWcTMWvro=
|
||||
github.com/prometheus/common v0.4.0/go.mod h1:TNfzLD0ON7rHzMJeJkieUDPYmFC7Snx/y86RQel1bk4=
|
||||
github.com/prometheus/common v0.4.1/go.mod h1:TNfzLD0ON7rHzMJeJkieUDPYmFC7Snx/y86RQel1bk4=
|
||||
github.com/prometheus/common v0.6.0 h1:kRhiuYSXR3+uv2IbVbZhUxK5zVD/2pp3Gd2PpvPkpEo=
|
||||
github.com/prometheus/common v0.6.0/go.mod h1:eBmuwkDJBwy6iBfxCBob6t6dR6ENT/y+J+Zk0j9GMYc=
|
||||
github.com/prometheus/procfs v0.0.0-20180125133057-cb4147076ac7/go.mod h1:c3At6R/oaqEKCNdg8wHV1ftS6bRYblBhIjjI8uT2IGk=
|
||||
github.com/prometheus/procfs v0.0.0-20181005140218-185b4288413d/go.mod h1:c3At6R/oaqEKCNdg8wHV1ftS6bRYblBhIjjI8uT2IGk=
|
||||
github.com/prometheus/procfs v0.0.0-20190507164030-5867b95ac084/go.mod h1:TjEm7ze935MbeOT/UhFTIMYKhuLP4wbCsTZCD3I8kEA=
|
||||
github.com/prometheus/procfs v0.0.2/go.mod h1:TjEm7ze935MbeOT/UhFTIMYKhuLP4wbCsTZCD3I8kEA=
|
||||
github.com/prometheus/procfs v0.0.3/go.mod h1:4A/X28fw3Fc593LaREMrKMqOKvUAntwMDaekg4FpcdQ=
|
||||
github.com/prometheus/procfs v0.0.5 h1:3+auTFlqw+ZaQYJARz6ArODtkaIwtvBTx3N2NehQlL8=
|
||||
github.com/prometheus/procfs v0.0.5/go.mod h1:4A/X28fw3Fc593LaREMrKMqOKvUAntwMDaekg4FpcdQ=
|
||||
github.com/prometheus/tsdb v0.7.1/go.mod h1:qhTCs0VvXwvX/y3TZrWD7rabWM+ijKTux40TwIPHuXU=
|
||||
github.com/rogpeppe/fastuuid v0.0.0-20150106093220-6724a57986af/go.mod h1:XWv6SoW27p1b0cqNHllgS5HIMJraePCO15w5zCzIWYg=
|
||||
github.com/russross/blackfriday v2.0.0+incompatible h1:cBXrhZNUf9C+La9/YpS+UHpUT8YD6Td9ZMSU9APFcsk=
|
||||
github.com/russross/blackfriday v2.0.0+incompatible/go.mod h1:JO/DiYxRf+HjHt06OyowR9PTA263kcR/rfWxYHBV53g=
|
||||
github.com/russross/blackfriday/v2 v2.0.1/go.mod h1:+Rmxgy9KzJVeS9/2gXHxylqXiyQDYRxCVz55jmeOWTM=
|
||||
github.com/shurcooL/sanitized_anchor_name v1.0.0 h1:PdmoCO6wvbs+7yrJyMORt4/BmY5IYyJwS/kOiWx8mHo=
|
||||
github.com/shurcooL/sanitized_anchor_name v1.0.0/go.mod h1:1NzhyTcUVG4SuEtjjoZeVRXNmyL/1OwPU0+IJeTBvfc=
|
||||
github.com/sirupsen/logrus v1.2.0/go.mod h1:LxeOpSwHxABJmUn/MG1IvRgCAasNZTLOkJPxbbu5VWo=
|
||||
github.com/sirupsen/logrus v1.4.1/go.mod h1:ni0Sbl8bgC9z8RoU9G6nDWqqs/fq4eDPysMBDgk/93Q=
|
||||
github.com/sirupsen/logrus v1.4.2/go.mod h1:tLMulIdttU9McNUspp0xgXVQah82FyeX6MwdIuYE2rE=
|
||||
github.com/sirupsen/logrus v1.6.0 h1:UBcNElsrwanuuMsnGSlYmtmgbb23qDR5dG+6X6Oo89I=
|
||||
github.com/sirupsen/logrus v1.6.0/go.mod h1:7uNnSEd1DgxDLC74fIahvMZmmYsHGZGEOFrfsX/uA88=
|
||||
github.com/soheilhy/cmux v0.1.4/go.mod h1:IM3LyeVVIOuxMH7sFAkER9+bJ4dT7Ms6E4xg4kGIyLM=
|
||||
github.com/spaolacci/murmur3 v0.0.0-20180118202830-f09979ecbc72/go.mod h1:JwIasOWyU6f++ZhiEuf87xNszmSA2myDM2Kzu9HwQUA=
|
||||
github.com/spf13/afero v1.1.2/go.mod h1:j4pytiNVoe2o6bmDsKpLACNPDBIoEAkihy7loJ1B0CQ=
|
||||
github.com/spf13/cast v1.3.0/go.mod h1:Qx5cxh0v+4UWYiBimWS+eyWzqEqokIECu5etghLkUJE=
|
||||
github.com/spf13/cobra v1.0.0 h1:6m/oheQuQ13N9ks4hubMG6BnvwOeaJrqSPLahSnczz8=
|
||||
github.com/spf13/cobra v1.0.0/go.mod h1:/6GTrnGXV9HjY+aR4k0oJ5tcvakLuG6EuKReYlHNrgE=
|
||||
github.com/spf13/jwalterweatherman v1.0.0/go.mod h1:cQK4TGJAtQXfYWX+Ddv3mKDzgVb68N+wFjFa4jdeBTo=
|
||||
github.com/spf13/pflag v1.0.3/go.mod h1:DYY7MBk1bdzusC3SYhjObp+wFpr4gzcvqqNjLnInEg4=
|
||||
github.com/spf13/pflag v1.0.5 h1:iy+VFUOCP1a+8yFto/drg2CJ5u0yRoB7fZw3DKv/JXA=
|
||||
github.com/spf13/pflag v1.0.5/go.mod h1:McXfInJRrz4CZXVZOBLb0bTZqETkiAhM9Iw0y3An2Bg=
|
||||
github.com/spf13/viper v1.4.0/go.mod h1:PTJ7Z/lr49W6bUbkmS1V3by4uWynFiR9p7+dSq/yZzE=
|
||||
github.com/stretchr/objx v0.1.0/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME=
|
||||
github.com/stretchr/objx v0.1.1/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME=
|
||||
github.com/stretchr/testify v1.2.2/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXfy6kDkUVs=
|
||||
github.com/stretchr/testify v1.3.0/go.mod h1:M5WIy9Dh21IEIfnGCwXGc5bZfKNJtfHm1UVUgZn+9EI=
|
||||
github.com/stretchr/testify v1.4.0/go.mod h1:j7eGeouHqKxXV5pUuKE4zz7dFj8WfuZ+81PSLYec5m4=
|
||||
github.com/stretchr/testify v1.5.1 h1:nOGnQDM7FYENwehXlg/kFVnos3rEvtKTjRvOWSzb6H4=
|
||||
github.com/stretchr/testify v1.5.1/go.mod h1:5W2xD1RspED5o8YsWQXVCued0rvSQ+mT+I5cxcmMvtA=
|
||||
github.com/syndtr/gocapability v0.0.0-20170704070218-db04d3cc01c8/go.mod h1:hkRG7XYTFWNJGYcbNJQlaLq0fg1yr4J4t/NcTQtrfww=
|
||||
github.com/syndtr/gocapability v0.0.0-20180916011248-d98352740cb2 h1:b6uOv7YOFK0TYG7HtkIgExQo+2RdLuwRft63jn2HWj8=
|
||||
github.com/syndtr/gocapability v0.0.0-20180916011248-d98352740cb2/go.mod h1:hkRG7XYTFWNJGYcbNJQlaLq0fg1yr4J4t/NcTQtrfww=
|
||||
github.com/tchap/go-patricia v2.2.6+incompatible h1:JvoDL7JSoIP2HDE8AbDH3zC8QBPxmzYe32HHy5yQ+Ck=
|
||||
github.com/tchap/go-patricia v2.2.6+incompatible/go.mod h1:bmLyhP68RS6kStMGxByiQ23RP/odRBOTVjwp2cDyi6I=
|
||||
github.com/ulikunitz/xz v0.5.4 h1:zATC2OoZ8H1TZll3FpbX+ikwmadbO699PE06cIkm9oU=
|
||||
github.com/ulikunitz/xz v0.5.4/go.mod h1:2bypXElzHzzJZwzH67Y6wb67pO62Rzfn7BSiF4ABRW8=
|
||||
github.com/urfave/cli v1.20.0 h1:fDqGv3UG/4jbVl/QkFwEdddtEDjh/5Ov6X+0B/3bPaw=
|
||||
github.com/urfave/cli v1.20.0/go.mod h1:70zkFmudgCuE/ngEzBv17Jvp/497gISqfk5gWijbERA=
|
||||
github.com/vbatts/tar-split v0.10.2 h1:CXd7HEKGkTLjBMinpObcJZU5Hm8EKlor2a1JtX6msXQ=
|
||||
github.com/vbatts/tar-split v0.10.2/go.mod h1:LEuURwDEiWjRjwu46yU3KVGuUdVv/dcnpcEPSzR8z6g=
|
||||
github.com/vbauerster/mpb v3.3.4+incompatible h1:DDIhnwmgTQIDZo+SWlEr5d6mJBxkOLBwCXPzunhEfJ4=
|
||||
github.com/vbauerster/mpb v3.3.4+incompatible/go.mod h1:zAHG26FUhVKETRu+MWqYXcI70POlC6N8up9p1dID7SU=
|
||||
github.com/vbauerster/mpb v3.4.0+incompatible h1:mfiiYw87ARaeRW6x5gWwYRUawxaW1tLAD8IceomUCNw=
|
||||
github.com/vbauerster/mpb v3.4.0+incompatible/go.mod h1:zAHG26FUhVKETRu+MWqYXcI70POlC6N8up9p1dID7SU=
|
||||
github.com/vrothberg/image v0.0.0-20190717060034-cd5ce8239f51 h1:u4Hw4D3PLODtsZJ1FKi7j8bkd+zyJOc28dRSiVTOgyE=
|
||||
github.com/vrothberg/image v0.0.0-20190717060034-cd5ce8239f51/go.mod h1:/hIyjuUvIY6X2wGj/fbsA9zwlfAize8B2DLPishEHHg=
|
||||
github.com/vrothberg/image v0.0.0-20190718162835-cdafe647d2d8 h1:LpqO8V+oaT3eXrvKSminmqKWo2vhOdLgu1kp2/+fHAI=
|
||||
github.com/vrothberg/image v0.0.0-20190718162835-cdafe647d2d8/go.mod h1:/hIyjuUvIY6X2wGj/fbsA9zwlfAize8B2DLPishEHHg=
|
||||
github.com/xeipuuv/gojsonpointer v0.0.0-20180127040702-4e3ac2762d5f h1:J9EGpcZtP0E/raorCMxlFGSTBrsSlaDGf3jU/qvAE2c=
|
||||
github.com/tchap/go-patricia v2.3.0+incompatible h1:GkY4dP3cEfEASBPPkWd+AmjYxhmDkqO9/zg7R0lSQRs=
|
||||
github.com/tchap/go-patricia v2.3.0+incompatible/go.mod h1:bmLyhP68RS6kStMGxByiQ23RP/odRBOTVjwp2cDyi6I=
|
||||
github.com/tmc/grpc-websocket-proxy v0.0.0-20190109142713-0ad062ec5ee5/go.mod h1:ncp9v5uamzpCO7NfCPTXjqaC+bZgJeR0sMTm6dMHP7U=
|
||||
github.com/ugorji/go v1.1.4/go.mod h1:uQMGLiO92mf5W77hV/PUCpI3pbzQx3CRekS0kk+RGrc=
|
||||
github.com/ulikunitz/xz v0.5.6/go.mod h1:2bypXElzHzzJZwzH67Y6wb67pO62Rzfn7BSiF4ABRW8=
|
||||
github.com/ulikunitz/xz v0.5.7 h1:YvTNdFzX6+W5m9msiYg/zpkSURPPtOlzbqYjrFn7Yt4=
|
||||
github.com/ulikunitz/xz v0.5.7/go.mod h1:nbz6k7qbPmH4IRqmfOplQw/tblSgqTqBwxkY0oWt/14=
|
||||
github.com/urfave/cli v0.0.0-20171014202726-7bc6a0acffa5/go.mod h1:70zkFmudgCuE/ngEzBv17Jvp/497gISqfk5gWijbERA=
|
||||
github.com/vbatts/tar-split v0.11.1 h1:0Odu65rhcZ3JZaPHxl7tCI3V/C/Q9Zf82UFravl02dE=
|
||||
github.com/vbatts/tar-split v0.11.1/go.mod h1:LEuURwDEiWjRjwu46yU3KVGuUdVv/dcnpcEPSzR8z6g=
|
||||
github.com/vbauerster/mpb/v5 v5.0.3/go.mod h1:h3YxU5CSr8rZP4Q3xZPVB3jJLhWPou63lHEdr9ytH4Y=
|
||||
github.com/vbauerster/mpb/v5 v5.0.4 h1:w7l/tJfHmtIOKZkU+bhbDZOUxj1kln9jy4DUOp3Tl14=
|
||||
github.com/vbauerster/mpb/v5 v5.0.4/go.mod h1:fvzasBUyuo35UyuA6sSOlVhpLoNQsp2nBdHw7OiSUU8=
|
||||
github.com/xeipuuv/gojsonpointer v0.0.0-20180127040702-4e3ac2762d5f/go.mod h1:N2zxlSyiKSe5eX1tZViRH5QA0qijqEDrYZiPEAiq3wU=
|
||||
github.com/xeipuuv/gojsonpointer v0.0.0-20190809123943-df4f5c81cb3b h1:6cLsL+2FW6dRAdl5iMtHgRogVCff0QpRi9653YmdcJA=
|
||||
github.com/xeipuuv/gojsonpointer v0.0.0-20190809123943-df4f5c81cb3b/go.mod h1:N2zxlSyiKSe5eX1tZViRH5QA0qijqEDrYZiPEAiq3wU=
|
||||
github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415 h1:EzJWgHovont7NscjpAxXsDA8S8BMYve8Y5+7cuRE7R0=
|
||||
github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415/go.mod h1:GwrjFmJcFw6At/Gs6z4yjiIwzuJ1/+UwLxMQDVQXShQ=
|
||||
github.com/xeipuuv/gojsonschema v1.1.0 h1:ngVtJC9TY/lg0AA/1k48FYhBrhRoFlEmWzsehpNAaZg=
|
||||
github.com/xeipuuv/gojsonschema v1.1.0/go.mod h1:5yf86TLmAcydyeJq5YvxkGPE2fm/u4myDekKRoLuqhs=
|
||||
github.com/xeipuuv/gojsonschema v0.0.0-20180618132009-1d523034197f/go.mod h1:5yf86TLmAcydyeJq5YvxkGPE2fm/u4myDekKRoLuqhs=
|
||||
github.com/xeipuuv/gojsonschema v1.2.0 h1:LhYJRs+L4fBtjZUfuSZIKGeVu0QRy8e5Xi7D17UxZ74=
|
||||
github.com/xeipuuv/gojsonschema v1.2.0/go.mod h1:anYRn/JVcOK2ZgGU+IjEV4nwlhoK5sQluxsYJ78Id3Y=
|
||||
github.com/xiang90/probing v0.0.0-20190116061207-43a291ad63a2/go.mod h1:UETIi67q53MR2AWcXfiuqkDkRtnGDLqkBTpCHuJHxtU=
|
||||
github.com/xordataexchange/crypt v0.0.3-0.20170626215501-b2862e3d0a77/go.mod h1:aYKd//L2LvnjZzWKhF00oedf4jCCReLcmhLdhm1A27Q=
|
||||
go.etcd.io/bbolt v1.3.2/go.mod h1:IbVyRI1SCnLcuJnV2u8VeU0CEYM7e686BmAb1XKL+uU=
|
||||
go.etcd.io/bbolt v1.3.4 h1:hi1bXHMVrlQh6WwxAy+qZCV/SYIlqo+Ushwdpa4tAKg=
|
||||
go.etcd.io/bbolt v1.3.4/go.mod h1:G5EMThwa9y8QZGBClrRx5EY+Yw9kAhnjy3bSjsnlVTQ=
|
||||
go.opencensus.io v0.22.0 h1:C9hSCOW830chIVkdja34wa6Ky+IzWllkUinR+BtRZd4=
|
||||
go.opencensus.io v0.22.0/go.mod h1:+kGneAE2xo2IficOXnaByMWTGM9T73dGwxeWcUqIpI8=
|
||||
go.uber.org/atomic v1.4.0/go.mod h1:gD2HeocX3+yG+ygLZcrzQJaqmWj9AIm7n08wl/qW/PE=
|
||||
go.uber.org/multierr v1.1.0/go.mod h1:wR5kodmAFQ0UK8QlbwjlSNy0Z68gJhDJUG5sjR94q/0=
|
||||
go.uber.org/zap v1.10.0/go.mod h1:vwi/ZaCAaUcBkycHslxD9B2zi4UTXhF60s6SWpuDF0Q=
|
||||
go4.org v0.0.0-20190218023631-ce4c26f7be8e h1:m9LfARr2VIOW0vsV19kEKp/sWQvZnGobA8JHui/XJoY=
|
||||
go4.org v0.0.0-20190218023631-ce4c26f7be8e/go.mod h1:MkTOUMDaeVYJUOUsaDXIhWPZYa1yOyC1qaOBpL57BhE=
|
||||
golang.org/x/crypto v0.0.0-20190219172222-a4c6cb3142f2 h1:NwxKRvbkH5MsNkvOtPZi3/3kmI8CAzs3mtv+GLQMkNo=
|
||||
golang.org/x/crypto v0.0.0-20190219172222-a4c6cb3142f2/go.mod h1:6SG95UA2DQfeDnfUPMdvaQW0Q7yPrPDi9nlGo2tz2b4=
|
||||
golang.org/x/net v0.0.0-20190107210223-45ffb0cd1ba0 h1:1DW40AJQ7AP4nY6ORUGUdkpXyEC9W2GAXcOPaMZK0K8=
|
||||
golang.org/x/net v0.0.0-20190107210223-45ffb0cd1ba0/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
|
||||
golang.org/x/sync v0.0.0-20181108010431-42b317875d0f h1:Bl/8QSvNqXvPGPGXa2z5xUTmV7VDcZyvRZ+QQXkXTZQ=
|
||||
golang.org/x/crypto v0.0.0-20180904163835-0709b304e793/go.mod h1:6SG95UA2DQfeDnfUPMdvaQW0Q7yPrPDi9nlGo2tz2b4=
|
||||
golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACkg1iLfiJU5Ep61QUkGW8qpdssI0+w=
|
||||
golang.org/x/crypto v0.0.0-20190701094942-4def268fd1a4/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI=
|
||||
golang.org/x/crypto v0.0.0-20200311171314-f7b00557c8c4/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto=
|
||||
golang.org/x/crypto v0.0.0-20200323165209-0ec3e9974c59/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto=
|
||||
golang.org/x/crypto v0.0.0-20200423211502-4bdfaf469ed5 h1:Q7tZBpemrlsc2I7IyODzhtallWRSm4Q0d09pL6XbQtU=
|
||||
golang.org/x/crypto v0.0.0-20200423211502-4bdfaf469ed5/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto=
|
||||
golang.org/x/exp v0.0.0-20190121172915-509febef88a4/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA=
|
||||
golang.org/x/lint v0.0.0-20181026193005-c67002cb31c3/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE=
|
||||
golang.org/x/lint v0.0.0-20190227174305-5b3e6a55c961/go.mod h1:wehouNa3lNwaWXcvxsM5YxQ5yQlVC4a0KAMCusXpPoU=
|
||||
golang.org/x/lint v0.0.0-20190313153728-d0100b6bd8b3/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc=
|
||||
golang.org/x/net v0.0.0-20180724234803-3673e40ba225/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
|
||||
golang.org/x/net v0.0.0-20180826012351-8a410e7b638d/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
|
||||
golang.org/x/net v0.0.0-20180906233101-161cd47e91fd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
|
||||
golang.org/x/net v0.0.0-20181114220301-adae6a3d119a/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
|
||||
golang.org/x/net v0.0.0-20181220203305-927f97764cc3/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
|
||||
golang.org/x/net v0.0.0-20190213061140-3a22650c66bd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
|
||||
golang.org/x/net v0.0.0-20190311183353-d8887717615a/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg=
|
||||
golang.org/x/net v0.0.0-20190404232315-eb5bcb51f2a3/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg=
|
||||
golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg=
|
||||
golang.org/x/net v0.0.0-20190522155817-f3200d17e092/go.mod h1:HSz+uSET+XFnRR8LxR5pz3Of3rY3CfYBVs4xY44aLks=
|
||||
golang.org/x/net v0.0.0-20190613194153-d28f0bde5980/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s=
|
||||
golang.org/x/net v0.0.0-20190628185345-da137c7871d7/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s=
|
||||
golang.org/x/net v0.0.0-20191004110552-13f9640d40b9/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s=
|
||||
golang.org/x/net v0.0.0-20200324143707-d3edc9973b7e h1:3G+cUijn7XD+S4eJFddp53Pv7+slrESplyjG25HgL+k=
|
||||
golang.org/x/net v0.0.0-20200324143707-d3edc9973b7e/go.mod h1:qpuaurCH72eLCgpAm/N6yyVIVM9cpaDIP3A8BGJEC5A=
|
||||
golang.org/x/oauth2 v0.0.0-20180821212333-d2e6202438be/go.mod h1:N/0e6XlmueqKjAGxoOufVs8QHGRruUQn6yWY3a++T0U=
|
||||
golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
|
||||
golang.org/x/sync v0.0.0-20181108010431-42b317875d0f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
|
||||
golang.org/x/sys v0.0.0-20170817234608-43e60d72a8e2 h1:90z1vgEVOG718nzy69KGhEtYepBetip3OSWJjMnI8Bw=
|
||||
golang.org/x/sys v0.0.0-20170817234608-43e60d72a8e2/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
|
||||
golang.org/x/text v0.0.0-20181227161524-e6919f6577db h1:ERgn/rMlavvbd/tNSkNoiKxiwdqWKnOfIB/X6qFxWsM=
|
||||
golang.org/x/text v0.0.0-20181227161524-e6919f6577db/go.mod h1:bEr9sfX3Q8Zfm5fL9x+3itogRgK3+ptLWKqgva+5dAk=
|
||||
golang.org/x/sync v0.0.0-20181221193216-37e7f081c4d4/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
|
||||
golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
|
||||
golang.org/x/sync v0.0.0-20190423024810-112230192c58/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
|
||||
golang.org/x/sync v0.0.0-20200317015054-43a5402ce75a h1:WXEvlFVvvGxCJLG6REjsT03iWnKLEWinaScsxF2Vm2o=
|
||||
golang.org/x/sync v0.0.0-20200317015054-43a5402ce75a/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
|
||||
golang.org/x/sys v0.0.0-20180830151530-49385e6e1522/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
|
||||
golang.org/x/sys v0.0.0-20180905080454-ebe1bf3edb33/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
|
||||
golang.org/x/sys v0.0.0-20180909124046-d0be0721c37e/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
|
||||
golang.org/x/sys v0.0.0-20181107165924-66b7b1311ac8/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
|
||||
golang.org/x/sys v0.0.0-20181116152217-5ac8a444bdc5/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
|
||||
golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
|
||||
golang.org/x/sys v0.0.0-20190412213103-97732733099d/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20190422165155-953cdadca894/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20190514135907-3a4b5fb9f71f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20190801041406-cbf593c0f2f3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20191115151921-52ab43148777/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20191120155948-bd437916bb0e/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20191127021746-63cb32ae39b2/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20200202164722-d101bd2416d5/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20200302150141-5c8b2ff67527/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20200323222414-85ca7c5b95cd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20200327173247-9dae0f8f5775/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20200420163511-1957bb5e6d1f h1:gWF768j/LaZugp8dyS4UwsslYCYz9XgFxvlgsn0n9H8=
|
||||
golang.org/x/sys v0.0.0-20200420163511-1957bb5e6d1f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ=
|
||||
golang.org/x/text v0.3.2 h1:tW2bmiBqwgJj/UpqtC8EpXEZVYOwU0yG4iWbprSVAcs=
|
||||
golang.org/x/text v0.3.2/go.mod h1:bEr9sfX3Q8Zfm5fL9x+3itogRgK3+ptLWKqgva+5dAk=
|
||||
golang.org/x/time v0.0.0-20190308202827-9d24e82272b4/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ=
|
||||
golang.org/x/time v0.0.0-20191024005414-555d28b269f0 h1:/5xXl8Y5W96D+TtHSlonuFqGHIWVuyCkGJLwGh9JJFs=
|
||||
golang.org/x/time v0.0.0-20191024005414-555d28b269f0/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ=
|
||||
golang.org/x/tools v0.0.0-20180221164845-07fd8470d635/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ=
|
||||
golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ=
|
||||
gopkg.in/yaml.v2 v2.0.0-20141029210843-d466437aa4ad h1:3SOi6w/NEma/Ir04qIGumn/RZwbXRhJSM7gN9YN8Ajc=
|
||||
gopkg.in/yaml.v2 v2.0.0-20141029210843-d466437aa4ad/go.mod h1:JAlM8MvJe8wmxCU4Bli9HhUf9+ttbYbLASfIpnQbh74=
|
||||
k8s.io/client-go v0.0.0-20181219152756-3dd551c0f083 h1:+Qf/nITucAbm09aIdxvoA+7X0BwaXmQGVoR8k7Ynk9o=
|
||||
k8s.io/client-go v0.0.0-20181219152756-3dd551c0f083/go.mod h1:7vJpHMYJwNQCWgzmNV+VYUl1zCObLyodBc8nIyt8L5s=
|
||||
golang.org/x/tools v0.0.0-20181030221726-6c7e314b6563/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ=
|
||||
golang.org/x/tools v0.0.0-20190114222345-bf090417da8b/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ=
|
||||
golang.org/x/tools v0.0.0-20190226205152-f727befe758c/go.mod h1:9Yl7xja0Znq3iFh3HoIrodX9oNMXvdceNzlUR8zjMvY=
|
||||
golang.org/x/tools v0.0.0-20190311212946-11955173bddd/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs=
|
||||
golang.org/x/tools v0.0.0-20190524140312-2c0ae7006135/go.mod h1:RgjU9mgBXZiqYHBnxXauZ1Gv1EHHAz9KjViQ78xBX0Q=
|
||||
golang.org/x/xerrors v0.0.0-20190717185122-a985d3407aa7/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0=
|
||||
google.golang.org/appengine v1.1.0/go.mod h1:EbEs0AVv82hx2wNQdGPgUI5lhzA/G0D9YwlJXL52JkM=
|
||||
google.golang.org/appengine v1.4.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4=
|
||||
google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8/go.mod h1:JiN7NxoALGmiZfu7CAH4rXhgtRTLTxftemlI0sWmxmc=
|
||||
google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb h1:i1Ppqkc3WQXikh8bXiwHqAN5Rv3/qDCcRk0/Otx73BY=
|
||||
google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE=
|
||||
google.golang.org/genproto v0.0.0-20190502173448-54afdca5d873 h1:nfPFGzJkUDX6uBmpN/pSw7MbOAWegH5QDQuoXFHedLg=
|
||||
google.golang.org/genproto v0.0.0-20190502173448-54afdca5d873/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE=
|
||||
google.golang.org/grpc v1.19.0/go.mod h1:mqu4LbDTu4XGKhr4mRzUsmM4RtVoemTSY81AxZiDr8c=
|
||||
google.golang.org/grpc v1.20.1/go.mod h1:10oTOabMzJvdu6/UiuZezV6QK5dSlG84ov/aaiqXj38=
|
||||
google.golang.org/grpc v1.21.0/go.mod h1:oYelfM1adQP15Ek0mdvEgi9Df8B9CZIaU1084ijfRaM=
|
||||
google.golang.org/grpc v1.23.1/go.mod h1:Y5yQAOtifL1yxbo5wqy6BxZv8vAUGQwXBOALyacEbxg=
|
||||
google.golang.org/grpc v1.24.0 h1:vb/1TCsVn3DcJlQ0Gs1yB1pKI6Do2/QNwxdKqmc/b0s=
|
||||
google.golang.org/grpc v1.24.0/go.mod h1:XDChyiUovWa60DnaeDeZmSW86xtLtjtZbwvSiRnRtcA=
|
||||
gopkg.in/alecthomas/kingpin.v2 v2.2.6/go.mod h1:FMv+mEhP44yOT+4EoQTLFTRgOQ1FBLkstjWtayDeSgw=
|
||||
gopkg.in/check.v1 v0.0.0-20161208181325-20d25e280405/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0=
|
||||
gopkg.in/check.v1 v1.0.0-20180628173108-788fd7840127/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0=
|
||||
gopkg.in/check.v1 v1.0.0-20190902080502-41f04d3bba15 h1:YR8cESwS4TdDjEe65xsg0ogRM/Nc3DYOhEAlW+xobZo=
|
||||
gopkg.in/check.v1 v1.0.0-20190902080502-41f04d3bba15/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0=
|
||||
gopkg.in/fsnotify.v1 v1.4.7/go.mod h1:Tz8NjZHkW78fSQdbUxIjBTcgA1z1m8ZHf0WmKUhAMys=
|
||||
gopkg.in/resty.v1 v1.12.0/go.mod h1:mDo4pnntr5jdWRML875a/NmxYqAlA73dVijT2AXvQQo=
|
||||
gopkg.in/square/go-jose.v2 v2.3.1 h1:SK5KegNXmKmqE342YYN2qPHEnUYeoMiXXl1poUlI+o4=
|
||||
gopkg.in/square/go-jose.v2 v2.3.1/go.mod h1:M9dMgbHiYLoDGQrXy7OpJDJWiKiU//h+vD76mk0e1AI=
|
||||
gopkg.in/tomb.v1 v1.0.0-20141024135613-dd632973f1e7/go.mod h1:dt/ZhP58zS4L8KSrWDmTeBkI65Dw0HsyUHuEVlX15mw=
|
||||
gopkg.in/yaml.v2 v2.0.0-20170812160011-eb3733d160e7/go.mod h1:JAlM8MvJe8wmxCU4Bli9HhUf9+ttbYbLASfIpnQbh74=
|
||||
gopkg.in/yaml.v2 v2.2.1/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
|
||||
gopkg.in/yaml.v2 v2.2.2/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
|
||||
gopkg.in/yaml.v2 v2.2.4/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
|
||||
gopkg.in/yaml.v2 v2.2.8 h1:obN1ZagJSUGI0Ek/LBmuj4SNLPfIny3KsKFopxRdj10=
|
||||
gopkg.in/yaml.v2 v2.2.8/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
|
||||
gopkg.in/yaml.v2 v2.3.0 h1:clyUAQHOM3G0M3f5vQj7LuJrETvjVot3Z5el9nffUtU=
|
||||
gopkg.in/yaml.v2 v2.3.0/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
|
||||
gotest.tools v2.2.0+incompatible h1:VsBPFP1AI068pPrMxtb/S8Zkgf9xEmTLJjfM+P5UIEo=
|
||||
gotest.tools v2.2.0+incompatible/go.mod h1:DsYFclhRJ6vuDpmuTbkuFWG+y2sxOXAzmJt81HFBacw=
|
||||
honnef.co/go/tools v0.0.0-20190102054323-c2f93a96b099/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4=
|
||||
honnef.co/go/tools v0.0.0-20190523083050-ea95bdfd59fc/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4=
|
||||
k8s.io/kubernetes v1.13.0/go.mod h1:ocZa8+6APFNC2tX1DZASIbocyYT5jHzqFVsY5aoB7Jk=
|
||||
|
||||
14
hack/make.sh
14
hack/make.sh
@@ -57,7 +57,15 @@ DEFAULT_BUNDLES=(
|
||||
test-integration
|
||||
)
|
||||
|
||||
TESTFLAGS+=" -test.timeout=10m"
|
||||
TESTFLAGS+=" -test.timeout=15m"
|
||||
|
||||
# Go module support: set `-mod=vendor` to use the vendored sources
|
||||
# See also the top-level Makefile.
|
||||
mod_vendor=
|
||||
if go help mod >/dev/null 2>&1; then
|
||||
export GO111MODULE=on
|
||||
mod_vendor='-mod=vendor'
|
||||
fi
|
||||
|
||||
# If $TESTFLAGS is set in the environment, it is passed as extra arguments to 'go test'.
|
||||
# You can use this to select certain tests to run, eg.
|
||||
@@ -72,10 +80,10 @@ TESTFLAGS+=" -test.timeout=10m"
|
||||
go_test_dir() {
|
||||
dir=$1
|
||||
(
|
||||
echo '+ go test' $TESTFLAGS ${BUILDTAGS:+-tags "$BUILDTAGS"} "${SKOPEO_PKG}${dir#.}"
|
||||
echo '+ go test' $mod_vendor $TESTFLAGS ${BUILDTAGS:+-tags "$BUILDTAGS"} "${SKOPEO_PKG}${dir#.}"
|
||||
cd "$dir"
|
||||
export DEST="$ABS_DEST" # we're in a subshell, so this is safe -- our integration-cli tests need DEST, and "cd" screws it up
|
||||
go test $TESTFLAGS ${BUILDTAGS:+-tags "$BUILDTAGS"}
|
||||
go test $mod_vendor $TESTFLAGS ${BUILDTAGS:+-tags "$BUILDTAGS"}
|
||||
)
|
||||
}
|
||||
|
||||
|
||||
@@ -1,6 +1,6 @@
|
||||
#!/bin/bash
|
||||
|
||||
errors=$(go vet $(go list -e ./... | grep -v "$SKOPEO_PKG"/vendor))
|
||||
errors=$(go vet $mod_vendor $(go list $mod_vendor -e ./...))
|
||||
|
||||
if [ -z "$errors" ]; then
|
||||
echo 'Congratulations! All Go source files have been vetted.'
|
||||
|
||||
@@ -1,6 +0,0 @@
|
||||
#!/bin/bash
|
||||
if pkg-config ostree-1 2> /dev/null ; then
|
||||
echo ostree
|
||||
else
|
||||
echo containers_image_ostree_stub
|
||||
fi
|
||||
159
install.md
Normal file
159
install.md
Normal file
@@ -0,0 +1,159 @@
|
||||
# Installing from packages
|
||||
|
||||
`skopeo` may already be packaged in your distribution, for example on
|
||||
RHEL/CentOS ≥ 8 or Fedora you can install it using:
|
||||
|
||||
```sh
|
||||
$ sudo dnf install skopeo
|
||||
```
|
||||
|
||||
on RHEL/CentOS ≤ 7.x:
|
||||
|
||||
```sh
|
||||
$ sudo yum install skopeo
|
||||
```
|
||||
|
||||
for openSUSE:
|
||||
|
||||
```sh
|
||||
$ sudo zypper install skopeo
|
||||
```
|
||||
|
||||
on alpine:
|
||||
|
||||
```sh
|
||||
$ sudo apk add skopeo
|
||||
```
|
||||
|
||||
Debian (10 and newer including Raspbian) and Ubuntu (18.04 and newer): Packages
|
||||
are available via the [Kubic][0] project repositories:
|
||||
|
||||
[0]: https://build.opensuse.org/project/show/devel:kubic:libcontainers:stable
|
||||
|
||||
```bash
|
||||
# Debian Unstable/Sid:
|
||||
$ echo 'deb http://download.opensuse.org/repositories/devel:/kubic:/libcontainers:/stable/Debian_Unstable/ /' > /etc/apt/sources.list.d/devel:kubic:libcontainers:stable.list
|
||||
$ wget -nv https://download.opensuse.org/repositories/devel:kubic:libcontainers:stable/Debian_Unstable/Release.key -O- | sudo apt-key add -
|
||||
```
|
||||
|
||||
```bash
|
||||
# Debian Testing:
|
||||
$ echo 'deb http://download.opensuse.org/repositories/devel:/kubic:/libcontainers:/stable/Debian_Testing/ /' > /etc/apt/sources.list.d/devel:kubic:libcontainers:stable.list
|
||||
$ wget -nv https://download.opensuse.org/repositories/devel:kubic:libcontainers:stable/Debian_Testing/Release.key -O- | sudo apt-key add -
|
||||
```
|
||||
|
||||
```bash
|
||||
# Debian 10:
|
||||
$ echo 'deb http://download.opensuse.org/repositories/devel:/kubic:/libcontainers:/stable/Debian_10/ /' > /etc/apt/sources.list.d/devel:kubic:libcontainers:stable.list
|
||||
$ wget -nv https://download.opensuse.org/repositories/devel:kubic:libcontainers:stable/Debian_10/Release.key -O- | sudo apt-key add -
|
||||
```
|
||||
|
||||
```bash
|
||||
# Raspbian 10:
|
||||
$ echo 'deb http://download.opensuse.org/repositories/devel:/kubic:/libcontainers:/stable/Raspbian_10/ /' > /etc/apt/sources.list.d/devel:kubic:libcontainers:stable.list
|
||||
$ wget -nv https://download.opensuse.org/repositories/devel:kubic:libcontainers:stable/Raspbian_10/Release.key -O- | sudo apt-key add -
|
||||
```
|
||||
|
||||
```bash
|
||||
# Ubuntu (18.04, 19.04 and 19.10):
|
||||
$ . /etc/os-release
|
||||
$ sudo sh -c "echo 'deb http://download.opensuse.org/repositories/devel:/kubic:/libcontainers:/stable/x${NAME}_${VERSION_ID}/ /' > /etc/apt/sources.list.d/devel:kubic:libcontainers:stable.list"
|
||||
$ wget -nv https://download.opensuse.org/repositories/devel:kubic:libcontainers:stable/x${NAME}_${VERSION_ID}/Release.key -O- | sudo apt-key add -
|
||||
```
|
||||
|
||||
```bash
|
||||
$ sudo apt-get update -qq
|
||||
$ sudo apt-get install skopeo
|
||||
```
|
||||
|
||||
Otherwise, read on for building and installing it from source:
|
||||
|
||||
To build the `skopeo` binary you need at least Go 1.12.
|
||||
|
||||
There are two ways to build skopeo: in a container, or locally without a
|
||||
container. Choose the one which better matches your needs and environment.
|
||||
|
||||
### Building without a container
|
||||
|
||||
Building without a container requires a bit more manual work and setup in your
|
||||
environment, but it is more flexible:
|
||||
|
||||
- It should work in more environments (e.g. for native macOS builds)
|
||||
- It does not require root privileges (after dependencies are installed)
|
||||
- It is faster, therefore more convenient for developing `skopeo`.
|
||||
|
||||
Install the necessary dependencies:
|
||||
|
||||
```bash
|
||||
# Fedora:
|
||||
$ sudo dnf install gpgme-devel libassuan-devel btrfs-progs-devel device-mapper-devel
|
||||
```
|
||||
|
||||
```bash
|
||||
# Ubuntu (`libbtrfs-dev` requires Ubuntu 18.10 and above):
|
||||
$ sudo apt install libgpgme-dev libassuan-dev libbtrfs-dev libdevmapper-dev
|
||||
```
|
||||
|
||||
```bash
|
||||
# macOS:
|
||||
$ brew install gpgme
|
||||
```
|
||||
|
||||
```bash
|
||||
# openSUSE:
|
||||
$ sudo zypper install libgpgme-devel device-mapper-devel libbtrfs-devel glib2-devel
|
||||
```
|
||||
|
||||
Make sure to clone this repository in your `GOPATH` - otherwise compilation fails.
|
||||
|
||||
```bash
|
||||
$ git clone https://github.com/containers/skopeo $GOPATH/src/github.com/containers/skopeo
|
||||
$ cd $GOPATH/src/github.com/containers/skopeo && make binary-local
|
||||
```
|
||||
|
||||
### Building in a container
|
||||
|
||||
Building in a container is simpler, but more restrictive:
|
||||
|
||||
- It requires the `podman` command and the ability to run Linux containers
|
||||
- The created executable is a Linux executable, and depends on dynamic libraries
|
||||
which may only be available only in a container of a similar Linux
|
||||
distribution.
|
||||
|
||||
```bash
|
||||
$ make binary # Or (make all) to also build documentation, see below.
|
||||
```
|
||||
|
||||
To build a pure-Go static binary (disables devicemapper, btrfs, and gpgme):
|
||||
|
||||
```bash
|
||||
$ make binary-static DISABLE_CGO=1
|
||||
```
|
||||
|
||||
### Building documentation
|
||||
|
||||
To build the manual you will need go-md2man.
|
||||
|
||||
```bash
|
||||
# Debian:
|
||||
$ sudo apt-get install go-md2man
|
||||
```
|
||||
|
||||
```
|
||||
# Fedora:
|
||||
$ sudo dnf install go-md2man
|
||||
```
|
||||
|
||||
Then
|
||||
|
||||
```bash
|
||||
$ make docs
|
||||
```
|
||||
|
||||
### Installation
|
||||
|
||||
Finally, after the binary and documentation is built:
|
||||
|
||||
```bash
|
||||
$ sudo make install
|
||||
```
|
||||
@@ -30,18 +30,11 @@ type SkopeoSuite struct {
|
||||
func (s *SkopeoSuite) SetUpSuite(c *check.C) {
|
||||
_, err := exec.LookPath(skopeoBinary)
|
||||
c.Assert(err, check.IsNil)
|
||||
}
|
||||
|
||||
func (s *SkopeoSuite) TearDownSuite(c *check.C) {
|
||||
|
||||
}
|
||||
|
||||
func (s *SkopeoSuite) SetUpTest(c *check.C) {
|
||||
s.regV2 = setupRegistryV2At(c, privateRegistryURL0, false, false)
|
||||
s.regV2WithAuth = setupRegistryV2At(c, privateRegistryURL1, true, false)
|
||||
}
|
||||
|
||||
func (s *SkopeoSuite) TearDownTest(c *check.C) {
|
||||
func (s *SkopeoSuite) TearDownSuite(c *check.C) {
|
||||
if s.regV2 != nil {
|
||||
s.regV2.Close()
|
||||
}
|
||||
@@ -71,7 +64,7 @@ func (s *SkopeoSuite) TestNeedAuthToPrivateRegistryV2WithoutDockerCfg(c *check.C
|
||||
}
|
||||
|
||||
func (s *SkopeoSuite) TestCertDirInsteadOfCertPath(c *check.C) {
|
||||
wanted := ".*flag provided but not defined: -cert-path.*"
|
||||
wanted := ".*unknown flag: --cert-path.*"
|
||||
assertSkopeoFails(c, wanted, "--tls-verify=false", "inspect", fmt.Sprintf("docker://%s/busybox:latest", s.regV2WithAuth.url), "--cert-path=/")
|
||||
wanted = ".*unauthorized: authentication required.*"
|
||||
assertSkopeoFails(c, wanted, "--tls-verify=false", "inspect", fmt.Sprintf("docker://%s/busybox:latest", s.regV2WithAuth.url), "--cert-dir=/etc/docker/certs.d/")
|
||||
@@ -91,3 +84,30 @@ func (s *SkopeoSuite) TestNoNeedAuthToPrivateRegistryV2ImageNotFound(c *check.C)
|
||||
func (s *SkopeoSuite) TestInspectFailsWhenReferenceIsInvalid(c *check.C) {
|
||||
assertSkopeoFails(c, `.*Invalid image name.*`, "inspect", "unknown")
|
||||
}
|
||||
|
||||
func (s *SkopeoSuite) TestLoginLogout(c *check.C) {
|
||||
wanted := "^Login Succeeded!\n$"
|
||||
assertSkopeoSucceeds(c, wanted, "login", "--tls-verify=false", "--username="+s.regV2WithAuth.username, "--password="+s.regV2WithAuth.password, s.regV2WithAuth.url)
|
||||
// test --get-login returns username
|
||||
wanted = fmt.Sprintf("^%s\n$", s.regV2WithAuth.username)
|
||||
assertSkopeoSucceeds(c, wanted, "login", "--tls-verify=false", "--get-login", s.regV2WithAuth.url)
|
||||
// test logout
|
||||
wanted = fmt.Sprintf("^Removed login credentials for %s\n$", s.regV2WithAuth.url)
|
||||
assertSkopeoSucceeds(c, wanted, "logout", s.regV2WithAuth.url)
|
||||
}
|
||||
|
||||
func (s *SkopeoSuite) TestCopyWithLocalAuth(c *check.C) {
|
||||
wanted := "^Login Succeeded!\n$"
|
||||
assertSkopeoSucceeds(c, wanted, "login", "--tls-verify=false", "--username="+s.regV2WithAuth.username, "--password="+s.regV2WithAuth.password, s.regV2WithAuth.url)
|
||||
// copy to private registry using local authentication
|
||||
imageName := fmt.Sprintf("docker://%s/busybox:mine", s.regV2WithAuth.url)
|
||||
assertSkopeoSucceeds(c, "", "copy", "--dest-tls-verify=false", "docker://docker.io/library/busybox:latest", imageName)
|
||||
// inspec from private registry
|
||||
assertSkopeoSucceeds(c, "", "inspect", "--tls-verify=false", imageName)
|
||||
// logout from the registry
|
||||
wanted = fmt.Sprintf("^Removed login credentials for %s\n$", s.regV2WithAuth.url)
|
||||
assertSkopeoSucceeds(c, wanted, "logout", s.regV2WithAuth.url)
|
||||
// inspect from private registry should fail after logout
|
||||
wanted = ".*unauthorized: authentication required.*"
|
||||
assertSkopeoFails(c, wanted, "inspect", "--tls-verify=false", imageName)
|
||||
}
|
||||
|
||||
@@ -1,6 +1,9 @@
|
||||
package main
|
||||
|
||||
import (
|
||||
"crypto/rand"
|
||||
"crypto/rsa"
|
||||
"crypto/x509"
|
||||
"encoding/json"
|
||||
"fmt"
|
||||
"io/ioutil"
|
||||
@@ -11,8 +14,9 @@ import (
|
||||
"path/filepath"
|
||||
"strings"
|
||||
|
||||
"github.com/containers/image/manifest"
|
||||
"github.com/containers/image/signature"
|
||||
"github.com/containers/image/v5/manifest"
|
||||
"github.com/containers/image/v5/signature"
|
||||
"github.com/containers/image/v5/types"
|
||||
"github.com/go-check/check"
|
||||
digest "github.com/opencontainers/go-digest"
|
||||
imgspecv1 "github.com/opencontainers/image-spec/specs-go/v1"
|
||||
@@ -26,6 +30,7 @@ func init() {
|
||||
const (
|
||||
v2DockerRegistryURL = "localhost:5555" // Update also policy.json
|
||||
v2s1DockerRegistryURL = "localhost:5556"
|
||||
knownWindowsOnlyImage = "docker://mcr.microsoft.com/windows/nanoserver:1909"
|
||||
)
|
||||
|
||||
type CopySuite struct {
|
||||
@@ -97,9 +102,382 @@ func (s *CopySuite) TestCopyWithManifestList(c *check.C) {
|
||||
assertSkopeoSucceeds(c, "", "copy", "docker://estesp/busybox:latest", "dir:"+dir)
|
||||
}
|
||||
|
||||
func (s *CopySuite) TestCopyAllWithManifestList(c *check.C) {
|
||||
dir, err := ioutil.TempDir("", "copy-all-manifest-list")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(dir)
|
||||
assertSkopeoSucceeds(c, "", "copy", "--all", "docker://estesp/busybox:latest", "dir:"+dir)
|
||||
}
|
||||
|
||||
func (s *CopySuite) TestCopyAllWithManifestListRoundTrip(c *check.C) {
|
||||
oci1, err := ioutil.TempDir("", "copy-all-manifest-list-oci")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(oci1)
|
||||
oci2, err := ioutil.TempDir("", "copy-all-manifest-list-oci")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(oci2)
|
||||
dir1, err := ioutil.TempDir("", "copy-all-manifest-list-dir")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(dir1)
|
||||
dir2, err := ioutil.TempDir("", "copy-all-manifest-list-dir")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(dir2)
|
||||
assertSkopeoSucceeds(c, "", "copy", "--all", "docker://estesp/busybox:latest", "oci:"+oci1)
|
||||
assertSkopeoSucceeds(c, "", "copy", "--all", "oci:"+oci1, "dir:"+dir1)
|
||||
assertSkopeoSucceeds(c, "", "copy", "--all", "dir:"+dir1, "oci:"+oci2)
|
||||
assertSkopeoSucceeds(c, "", "copy", "--all", "oci:"+oci2, "dir:"+dir2)
|
||||
assertDirImagesAreEqual(c, dir1, dir2)
|
||||
out := combinedOutputOfCommand(c, "diff", "-urN", oci1, oci2)
|
||||
c.Assert(out, check.Equals, "")
|
||||
}
|
||||
|
||||
func (s *CopySuite) TestCopyAllWithManifestListConverge(c *check.C) {
|
||||
oci1, err := ioutil.TempDir("", "copy-all-manifest-list-oci")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(oci1)
|
||||
oci2, err := ioutil.TempDir("", "copy-all-manifest-list-oci")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(oci2)
|
||||
dir1, err := ioutil.TempDir("", "copy-all-manifest-list-dir")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(dir1)
|
||||
dir2, err := ioutil.TempDir("", "copy-all-manifest-list-dir")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(dir2)
|
||||
assertSkopeoSucceeds(c, "", "copy", "--all", "docker://estesp/busybox:latest", "oci:"+oci1)
|
||||
assertSkopeoSucceeds(c, "", "copy", "--all", "oci:"+oci1, "dir:"+dir1)
|
||||
assertSkopeoSucceeds(c, "", "copy", "--all", "--format", "oci", "docker://estesp/busybox:latest", "dir:"+dir2)
|
||||
assertSkopeoSucceeds(c, "", "copy", "--all", "dir:"+dir2, "oci:"+oci2)
|
||||
assertDirImagesAreEqual(c, dir1, dir2)
|
||||
out := combinedOutputOfCommand(c, "diff", "-urN", oci1, oci2)
|
||||
c.Assert(out, check.Equals, "")
|
||||
}
|
||||
|
||||
func (s *CopySuite) TestCopyWithManifestListConverge(c *check.C) {
|
||||
oci1, err := ioutil.TempDir("", "copy-all-manifest-list-oci")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(oci1)
|
||||
oci2, err := ioutil.TempDir("", "copy-all-manifest-list-oci")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(oci2)
|
||||
dir1, err := ioutil.TempDir("", "copy-all-manifest-list-dir")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(dir1)
|
||||
dir2, err := ioutil.TempDir("", "copy-all-manifest-list-dir")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(dir2)
|
||||
assertSkopeoSucceeds(c, "", "copy", "docker://estesp/busybox:latest", "oci:"+oci1)
|
||||
assertSkopeoSucceeds(c, "", "copy", "--all", "oci:"+oci1, "dir:"+dir1)
|
||||
assertSkopeoSucceeds(c, "", "copy", "--format", "oci", "docker://estesp/busybox:latest", "dir:"+dir2)
|
||||
assertSkopeoSucceeds(c, "", "copy", "--all", "dir:"+dir2, "oci:"+oci2)
|
||||
assertDirImagesAreEqual(c, dir1, dir2)
|
||||
out := combinedOutputOfCommand(c, "diff", "-urN", oci1, oci2)
|
||||
c.Assert(out, check.Equals, "")
|
||||
}
|
||||
|
||||
func (s *CopySuite) TestCopyAllWithManifestListStorageFails(c *check.C) {
|
||||
storage, err := ioutil.TempDir("", "copy-storage")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(storage)
|
||||
storage = fmt.Sprintf("[vfs@%s/root+%s/runroot]", storage, storage)
|
||||
assertSkopeoFails(c, `.*destination transport .* does not support copying multiple images as a group.*`, "copy", "--all", "docker://estesp/busybox:latest", "containers-storage:"+storage+"test")
|
||||
}
|
||||
|
||||
func (s *CopySuite) TestCopyWithManifestListStorage(c *check.C) {
|
||||
storage, err := ioutil.TempDir("", "copy-manifest-list-storage")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(storage)
|
||||
storage = fmt.Sprintf("[vfs@%s/root+%s/runroot]", storage, storage)
|
||||
dir1, err := ioutil.TempDir("", "copy-manifest-list-storage-dir")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(dir1)
|
||||
dir2, err := ioutil.TempDir("", "copy-manifest-list-storage-dir")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(dir2)
|
||||
assertSkopeoSucceeds(c, "", "copy", "docker://estesp/busybox:latest", "containers-storage:"+storage+"test")
|
||||
assertSkopeoSucceeds(c, "", "copy", "docker://estesp/busybox:latest", "dir:"+dir1)
|
||||
assertSkopeoSucceeds(c, "", "copy", "containers-storage:"+storage+"test", "dir:"+dir2)
|
||||
runDecompressDirs(c, "", dir1, dir2)
|
||||
assertDirImagesAreEqual(c, dir1, dir2)
|
||||
}
|
||||
|
||||
func (s *CopySuite) TestCopyWithManifestListStorageMultiple(c *check.C) {
|
||||
storage, err := ioutil.TempDir("", "copy-manifest-list-storage-multiple")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(storage)
|
||||
storage = fmt.Sprintf("[vfs@%s/root+%s/runroot]", storage, storage)
|
||||
dir1, err := ioutil.TempDir("", "copy-manifest-list-storage-multiple-dir")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(dir1)
|
||||
dir2, err := ioutil.TempDir("", "copy-manifest-list-storage-multiple-dir")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(dir2)
|
||||
assertSkopeoSucceeds(c, "", "--override-arch", "amd64", "copy", "docker://estesp/busybox:latest", "containers-storage:"+storage+"test")
|
||||
assertSkopeoSucceeds(c, "", "--override-arch", "arm64", "copy", "docker://estesp/busybox:latest", "containers-storage:"+storage+"test")
|
||||
assertSkopeoSucceeds(c, "", "--override-arch", "arm64", "copy", "docker://estesp/busybox:latest", "dir:"+dir1)
|
||||
assertSkopeoSucceeds(c, "", "copy", "containers-storage:"+storage+"test", "dir:"+dir2)
|
||||
runDecompressDirs(c, "", dir1, dir2)
|
||||
assertDirImagesAreEqual(c, dir1, dir2)
|
||||
}
|
||||
|
||||
func (s *CopySuite) TestCopyWithManifestListDigest(c *check.C) {
|
||||
dir1, err := ioutil.TempDir("", "copy-manifest-list-digest-dir")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(dir1)
|
||||
dir2, err := ioutil.TempDir("", "copy-manifest-list-digest-dir")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(dir2)
|
||||
oci1, err := ioutil.TempDir("", "copy-manifest-list-digest-oci")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(oci1)
|
||||
oci2, err := ioutil.TempDir("", "copy-manifest-list-digest-oci")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(oci2)
|
||||
m := combinedOutputOfCommand(c, skopeoBinary, "inspect", "--raw", "docker://estesp/busybox:latest")
|
||||
manifestDigest, err := manifest.Digest([]byte(m))
|
||||
c.Assert(err, check.IsNil)
|
||||
digest := manifestDigest.String()
|
||||
assertSkopeoSucceeds(c, "", "copy", "docker://estesp/busybox@"+digest, "dir:"+dir1)
|
||||
assertSkopeoSucceeds(c, "", "copy", "--all", "docker://estesp/busybox@"+digest, "dir:"+dir2)
|
||||
assertSkopeoSucceeds(c, "", "copy", "dir:"+dir1, "oci:"+oci1)
|
||||
assertSkopeoSucceeds(c, "", "copy", "dir:"+dir2, "oci:"+oci2)
|
||||
out := combinedOutputOfCommand(c, "diff", "-urN", oci1, oci2)
|
||||
c.Assert(out, check.Equals, "")
|
||||
}
|
||||
|
||||
func (s *CopySuite) TestCopyWithManifestListStorageDigest(c *check.C) {
|
||||
storage, err := ioutil.TempDir("", "copy-manifest-list-storage-digest")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(storage)
|
||||
storage = fmt.Sprintf("[vfs@%s/root+%s/runroot]", storage, storage)
|
||||
dir1, err := ioutil.TempDir("", "copy-manifest-list-storage-digest-dir")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(dir1)
|
||||
dir2, err := ioutil.TempDir("", "copy-manifest-list-storage-digest-dir")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(dir2)
|
||||
m := combinedOutputOfCommand(c, skopeoBinary, "inspect", "--raw", "docker://estesp/busybox:latest")
|
||||
manifestDigest, err := manifest.Digest([]byte(m))
|
||||
c.Assert(err, check.IsNil)
|
||||
digest := manifestDigest.String()
|
||||
assertSkopeoSucceeds(c, "", "copy", "docker://estesp/busybox@"+digest, "containers-storage:"+storage+"test@"+digest)
|
||||
assertSkopeoSucceeds(c, "", "copy", "containers-storage:"+storage+"test@"+digest, "dir:"+dir1)
|
||||
assertSkopeoSucceeds(c, "", "copy", "docker://estesp/busybox@"+digest, "dir:"+dir2)
|
||||
runDecompressDirs(c, "", dir1, dir2)
|
||||
assertDirImagesAreEqual(c, dir1, dir2)
|
||||
}
|
||||
|
||||
func (s *CopySuite) TestCopyWithManifestListStorageDigestMultipleArches(c *check.C) {
|
||||
storage, err := ioutil.TempDir("", "copy-manifest-list-storage-digest")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(storage)
|
||||
storage = fmt.Sprintf("[vfs@%s/root+%s/runroot]", storage, storage)
|
||||
dir1, err := ioutil.TempDir("", "copy-manifest-list-storage-digest-dir")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(dir1)
|
||||
dir2, err := ioutil.TempDir("", "copy-manifest-list-storage-digest-dir")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(dir2)
|
||||
m := combinedOutputOfCommand(c, skopeoBinary, "inspect", "--raw", "docker://estesp/busybox:latest")
|
||||
manifestDigest, err := manifest.Digest([]byte(m))
|
||||
c.Assert(err, check.IsNil)
|
||||
digest := manifestDigest.String()
|
||||
assertSkopeoSucceeds(c, "", "copy", "docker://estesp/busybox@"+digest, "containers-storage:"+storage+"test@"+digest)
|
||||
assertSkopeoSucceeds(c, "", "copy", "containers-storage:"+storage+"test@"+digest, "dir:"+dir1)
|
||||
assertSkopeoSucceeds(c, "", "copy", "docker://estesp/busybox@"+digest, "dir:"+dir2)
|
||||
runDecompressDirs(c, "", dir1, dir2)
|
||||
assertDirImagesAreEqual(c, dir1, dir2)
|
||||
}
|
||||
|
||||
func (s *CopySuite) TestCopyWithManifestListStorageDigestMultipleArchesBothUseListDigest(c *check.C) {
|
||||
storage, err := ioutil.TempDir("", "copy-manifest-list-storage-digest-multiple-arches-both")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(storage)
|
||||
storage = fmt.Sprintf("[vfs@%s/root+%s/runroot]", storage, storage)
|
||||
m := combinedOutputOfCommand(c, skopeoBinary, "inspect", "--raw", "docker://estesp/busybox:latest")
|
||||
manifestDigest, err := manifest.Digest([]byte(m))
|
||||
c.Assert(err, check.IsNil)
|
||||
digest := manifestDigest.String()
|
||||
_, err = manifest.ListFromBlob([]byte(m), manifest.GuessMIMEType([]byte(m)))
|
||||
c.Assert(err, check.IsNil)
|
||||
assertSkopeoSucceeds(c, "", "--override-arch=amd64", "copy", "docker://estesp/busybox@"+digest, "containers-storage:"+storage+"test@"+digest)
|
||||
assertSkopeoSucceeds(c, "", "--override-arch=arm64", "copy", "docker://estesp/busybox@"+digest, "containers-storage:"+storage+"test@"+digest)
|
||||
assertSkopeoFails(c, `.*error reading manifest for image instance.*does not exist.*`, "--override-arch=amd64", "inspect", "containers-storage:"+storage+"test@"+digest)
|
||||
assertSkopeoFails(c, `.*error reading manifest for image instance.*does not exist.*`, "--override-arch=amd64", "inspect", "--config", "containers-storage:"+storage+"test@"+digest)
|
||||
i2 := combinedOutputOfCommand(c, skopeoBinary, "--override-arch=arm64", "inspect", "--config", "containers-storage:"+storage+"test@"+digest)
|
||||
var image2 imgspecv1.Image
|
||||
err = json.Unmarshal([]byte(i2), &image2)
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Assert(image2.Architecture, check.Equals, "arm64")
|
||||
}
|
||||
|
||||
func (s *CopySuite) TestCopyWithManifestListStorageDigestMultipleArchesFirstUsesListDigest(c *check.C) {
|
||||
storage, err := ioutil.TempDir("", "copy-manifest-list-storage-digest-multiple-arches-first")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(storage)
|
||||
storage = fmt.Sprintf("[vfs@%s/root+%s/runroot]", storage, storage)
|
||||
m := combinedOutputOfCommand(c, skopeoBinary, "inspect", "--raw", "docker://estesp/busybox:latest")
|
||||
manifestDigest, err := manifest.Digest([]byte(m))
|
||||
c.Assert(err, check.IsNil)
|
||||
digest := manifestDigest.String()
|
||||
list, err := manifest.ListFromBlob([]byte(m), manifest.GuessMIMEType([]byte(m)))
|
||||
c.Assert(err, check.IsNil)
|
||||
amd64Instance, err := list.ChooseInstance(&types.SystemContext{ArchitectureChoice: "amd64"})
|
||||
c.Assert(err, check.IsNil)
|
||||
arm64Instance, err := list.ChooseInstance(&types.SystemContext{ArchitectureChoice: "arm64"})
|
||||
c.Assert(err, check.IsNil)
|
||||
assertSkopeoSucceeds(c, "", "--override-arch=amd64", "copy", "docker://estesp/busybox@"+digest, "containers-storage:"+storage+"test@"+digest)
|
||||
assertSkopeoSucceeds(c, "", "--override-arch=arm64", "copy", "docker://estesp/busybox@"+arm64Instance.String(), "containers-storage:"+storage+"test@"+arm64Instance.String())
|
||||
i1 := combinedOutputOfCommand(c, skopeoBinary, "--override-arch=amd64", "inspect", "--config", "containers-storage:"+storage+"test@"+digest)
|
||||
var image1 imgspecv1.Image
|
||||
err = json.Unmarshal([]byte(i1), &image1)
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Assert(image1.Architecture, check.Equals, "amd64")
|
||||
i2 := combinedOutputOfCommand(c, skopeoBinary, "--override-arch=amd64", "inspect", "--config", "containers-storage:"+storage+"test@"+amd64Instance.String())
|
||||
var image2 imgspecv1.Image
|
||||
err = json.Unmarshal([]byte(i2), &image2)
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Assert(image2.Architecture, check.Equals, "amd64")
|
||||
assertSkopeoFails(c, `.*error reading manifest for image instance.*does not exist.*`, "--override-arch=arm64", "inspect", "containers-storage:"+storage+"test@"+digest)
|
||||
assertSkopeoFails(c, `.*error reading manifest for image instance.*does not exist.*`, "--override-arch=arm64", "inspect", "--config", "containers-storage:"+storage+"test@"+digest)
|
||||
i3 := combinedOutputOfCommand(c, skopeoBinary, "--override-arch=arm64", "inspect", "--config", "containers-storage:"+storage+"test@"+arm64Instance.String())
|
||||
var image3 imgspecv1.Image
|
||||
err = json.Unmarshal([]byte(i3), &image3)
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Assert(image3.Architecture, check.Equals, "arm64")
|
||||
}
|
||||
|
||||
func (s *CopySuite) TestCopyWithManifestListStorageDigestMultipleArchesSecondUsesListDigest(c *check.C) {
|
||||
storage, err := ioutil.TempDir("", "copy-manifest-list-storage-digest-multiple-arches-second")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(storage)
|
||||
storage = fmt.Sprintf("[vfs@%s/root+%s/runroot]", storage, storage)
|
||||
m := combinedOutputOfCommand(c, skopeoBinary, "inspect", "--raw", "docker://estesp/busybox:latest")
|
||||
manifestDigest, err := manifest.Digest([]byte(m))
|
||||
c.Assert(err, check.IsNil)
|
||||
digest := manifestDigest.String()
|
||||
list, err := manifest.ListFromBlob([]byte(m), manifest.GuessMIMEType([]byte(m)))
|
||||
c.Assert(err, check.IsNil)
|
||||
amd64Instance, err := list.ChooseInstance(&types.SystemContext{ArchitectureChoice: "amd64"})
|
||||
c.Assert(err, check.IsNil)
|
||||
arm64Instance, err := list.ChooseInstance(&types.SystemContext{ArchitectureChoice: "arm64"})
|
||||
c.Assert(err, check.IsNil)
|
||||
assertSkopeoSucceeds(c, "", "--override-arch=amd64", "copy", "docker://estesp/busybox@"+amd64Instance.String(), "containers-storage:"+storage+"test@"+amd64Instance.String())
|
||||
assertSkopeoSucceeds(c, "", "--override-arch=arm64", "copy", "docker://estesp/busybox@"+digest, "containers-storage:"+storage+"test@"+digest)
|
||||
i1 := combinedOutputOfCommand(c, skopeoBinary, "--override-arch=amd64", "inspect", "--config", "containers-storage:"+storage+"test@"+amd64Instance.String())
|
||||
var image1 imgspecv1.Image
|
||||
err = json.Unmarshal([]byte(i1), &image1)
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Assert(image1.Architecture, check.Equals, "amd64")
|
||||
assertSkopeoFails(c, `.*error reading manifest for image instance.*does not exist.*`, "--override-arch=amd64", "inspect", "containers-storage:"+storage+"test@"+digest)
|
||||
assertSkopeoFails(c, `.*error reading manifest for image instance.*does not exist.*`, "--override-arch=amd64", "inspect", "--config", "containers-storage:"+storage+"test@"+digest)
|
||||
i2 := combinedOutputOfCommand(c, skopeoBinary, "--override-arch=arm64", "inspect", "--config", "containers-storage:"+storage+"test@"+digest)
|
||||
var image2 imgspecv1.Image
|
||||
err = json.Unmarshal([]byte(i2), &image2)
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Assert(image2.Architecture, check.Equals, "arm64")
|
||||
i3 := combinedOutputOfCommand(c, skopeoBinary, "--override-arch=arm64", "inspect", "--config", "containers-storage:"+storage+"test@"+arm64Instance.String())
|
||||
var image3 imgspecv1.Image
|
||||
err = json.Unmarshal([]byte(i3), &image3)
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Assert(image3.Architecture, check.Equals, "arm64")
|
||||
}
|
||||
|
||||
func (s *CopySuite) TestCopyWithManifestListStorageDigestMultipleArchesThirdUsesListDigest(c *check.C) {
|
||||
storage, err := ioutil.TempDir("", "copy-manifest-list-storage-digest-multiple-arches-third")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(storage)
|
||||
storage = fmt.Sprintf("[vfs@%s/root+%s/runroot]", storage, storage)
|
||||
m := combinedOutputOfCommand(c, skopeoBinary, "inspect", "--raw", "docker://estesp/busybox:latest")
|
||||
manifestDigest, err := manifest.Digest([]byte(m))
|
||||
c.Assert(err, check.IsNil)
|
||||
digest := manifestDigest.String()
|
||||
list, err := manifest.ListFromBlob([]byte(m), manifest.GuessMIMEType([]byte(m)))
|
||||
c.Assert(err, check.IsNil)
|
||||
amd64Instance, err := list.ChooseInstance(&types.SystemContext{ArchitectureChoice: "amd64"})
|
||||
c.Assert(err, check.IsNil)
|
||||
arm64Instance, err := list.ChooseInstance(&types.SystemContext{ArchitectureChoice: "arm64"})
|
||||
c.Assert(err, check.IsNil)
|
||||
assertSkopeoSucceeds(c, "", "--override-arch=amd64", "copy", "docker://estesp/busybox@"+amd64Instance.String(), "containers-storage:"+storage+"test@"+amd64Instance.String())
|
||||
assertSkopeoSucceeds(c, "", "--override-arch=amd64", "copy", "docker://estesp/busybox@"+digest, "containers-storage:"+storage+"test@"+digest)
|
||||
assertSkopeoSucceeds(c, "", "--override-arch=arm64", "copy", "docker://estesp/busybox@"+digest, "containers-storage:"+storage+"test@"+digest)
|
||||
assertSkopeoFails(c, `.*error reading manifest for image instance.*does not exist.*`, "--override-arch=amd64", "inspect", "--config", "containers-storage:"+storage+"test@"+digest)
|
||||
i1 := combinedOutputOfCommand(c, skopeoBinary, "--override-arch=amd64", "inspect", "--config", "containers-storage:"+storage+"test@"+amd64Instance.String())
|
||||
var image1 imgspecv1.Image
|
||||
err = json.Unmarshal([]byte(i1), &image1)
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Assert(image1.Architecture, check.Equals, "amd64")
|
||||
i2 := combinedOutputOfCommand(c, skopeoBinary, "--override-arch=arm64", "inspect", "--config", "containers-storage:"+storage+"test@"+digest)
|
||||
var image2 imgspecv1.Image
|
||||
err = json.Unmarshal([]byte(i2), &image2)
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Assert(image2.Architecture, check.Equals, "arm64")
|
||||
i3 := combinedOutputOfCommand(c, skopeoBinary, "--override-arch=arm64", "inspect", "--config", "containers-storage:"+storage+"test@"+arm64Instance.String())
|
||||
var image3 imgspecv1.Image
|
||||
err = json.Unmarshal([]byte(i3), &image3)
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Assert(image3.Architecture, check.Equals, "arm64")
|
||||
}
|
||||
|
||||
func (s *CopySuite) TestCopyWithManifestListStorageDigestMultipleArchesTagAndDigest(c *check.C) {
|
||||
storage, err := ioutil.TempDir("", "copy-manifest-list-storage-digest-multiple-arches-tag-digest")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(storage)
|
||||
storage = fmt.Sprintf("[vfs@%s/root+%s/runroot]", storage, storage)
|
||||
m := combinedOutputOfCommand(c, skopeoBinary, "inspect", "--raw", "docker://estesp/busybox:latest")
|
||||
manifestDigest, err := manifest.Digest([]byte(m))
|
||||
c.Assert(err, check.IsNil)
|
||||
digest := manifestDigest.String()
|
||||
list, err := manifest.ListFromBlob([]byte(m), manifest.GuessMIMEType([]byte(m)))
|
||||
c.Assert(err, check.IsNil)
|
||||
amd64Instance, err := list.ChooseInstance(&types.SystemContext{ArchitectureChoice: "amd64"})
|
||||
c.Assert(err, check.IsNil)
|
||||
arm64Instance, err := list.ChooseInstance(&types.SystemContext{ArchitectureChoice: "arm64"})
|
||||
c.Assert(err, check.IsNil)
|
||||
assertSkopeoSucceeds(c, "", "--override-arch=amd64", "copy", "docker://estesp/busybox:latest", "containers-storage:"+storage+"test:latest")
|
||||
assertSkopeoSucceeds(c, "", "--override-arch=arm64", "copy", "docker://estesp/busybox@"+digest, "containers-storage:"+storage+"test@"+digest)
|
||||
assertSkopeoFails(c, `.*error reading manifest for image instance.*does not exist.*`, "--override-arch=amd64", "inspect", "--config", "containers-storage:"+storage+"test@"+digest)
|
||||
i1 := combinedOutputOfCommand(c, skopeoBinary, "--override-arch=arm64", "inspect", "--config", "containers-storage:"+storage+"test:latest")
|
||||
var image1 imgspecv1.Image
|
||||
err = json.Unmarshal([]byte(i1), &image1)
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Assert(image1.Architecture, check.Equals, "amd64")
|
||||
i2 := combinedOutputOfCommand(c, skopeoBinary, "--override-arch=amd64", "inspect", "--config", "containers-storage:"+storage+"test@"+amd64Instance.String())
|
||||
var image2 imgspecv1.Image
|
||||
err = json.Unmarshal([]byte(i2), &image2)
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Assert(image2.Architecture, check.Equals, "amd64")
|
||||
i3 := combinedOutputOfCommand(c, skopeoBinary, "--override-arch=amd64", "inspect", "--config", "containers-storage:"+storage+"test:latest")
|
||||
var image3 imgspecv1.Image
|
||||
err = json.Unmarshal([]byte(i3), &image3)
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Assert(image3.Architecture, check.Equals, "amd64")
|
||||
i4 := combinedOutputOfCommand(c, skopeoBinary, "--override-arch=arm64", "inspect", "--config", "containers-storage:"+storage+"test@"+arm64Instance.String())
|
||||
var image4 imgspecv1.Image
|
||||
err = json.Unmarshal([]byte(i4), &image4)
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Assert(image4.Architecture, check.Equals, "arm64")
|
||||
i5 := combinedOutputOfCommand(c, skopeoBinary, "--override-arch=arm64", "inspect", "--config", "containers-storage:"+storage+"test@"+digest)
|
||||
var image5 imgspecv1.Image
|
||||
err = json.Unmarshal([]byte(i5), &image5)
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Assert(image5.Architecture, check.Equals, "arm64")
|
||||
}
|
||||
|
||||
func (s *CopySuite) TestCopyFailsWhenImageOSDoesntMatchRuntimeOS(c *check.C) {
|
||||
c.Skip("can't run this on Travis")
|
||||
assertSkopeoFails(c, `.*image operating system "windows" cannot be used on "linux".*`, "copy", "docker://microsoft/windowsservercore", "containers-storage:test")
|
||||
storage, err := ioutil.TempDir("", "copy-fails-image-doesnt-match-runtime")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(storage)
|
||||
storage = fmt.Sprintf("[vfs@%s/root+%s/runroot]", storage, storage)
|
||||
assertSkopeoFails(c, `.*no image found in manifest list for architecture .*, variant .*, OS .*`, "copy", knownWindowsOnlyImage, "containers-storage:"+storage+"test")
|
||||
}
|
||||
|
||||
func (s *CopySuite) TestCopySucceedsWhenImageDoesntMatchRuntimeButWeOverride(c *check.C) {
|
||||
storage, err := ioutil.TempDir("", "copy-succeeds-image-doesnt-match-runtime-but-override")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(storage)
|
||||
storage = fmt.Sprintf("[vfs@%s/root+%s/runroot]", storage, storage)
|
||||
assertSkopeoSucceeds(c, "", "--override-os=windows", "--override-arch=amd64", "copy", knownWindowsOnlyImage, "containers-storage:"+storage+"test")
|
||||
}
|
||||
|
||||
func (s *CopySuite) TestCopySimpleAtomicRegistry(c *check.C) {
|
||||
@@ -157,7 +535,134 @@ func (s *CopySuite) TestCopySimple(c *check.C) {
|
||||
assertSkopeoSucceeds(c, "", "copy", "docker://busybox:latest", "oci:"+ociDest)
|
||||
_, err = os.Stat(ociDest)
|
||||
c.Assert(err, check.IsNil)
|
||||
}
|
||||
|
||||
func (s *CopySuite) TestCopyEncryption(c *check.C) {
|
||||
|
||||
originalImageDir, err := ioutil.TempDir("", "copy-1")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(originalImageDir)
|
||||
encryptedImgDir, err := ioutil.TempDir("", "copy-2")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(encryptedImgDir)
|
||||
decryptedImgDir, err := ioutil.TempDir("", "copy-3")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(decryptedImgDir)
|
||||
keysDir, err := ioutil.TempDir("", "copy-4")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(keysDir)
|
||||
undecryptedImgDir, err := ioutil.TempDir("", "copy-5")
|
||||
defer os.RemoveAll(undecryptedImgDir)
|
||||
multiLayerImageDir, err := ioutil.TempDir("", "copy-6")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(multiLayerImageDir)
|
||||
partiallyEncryptedImgDir, err := ioutil.TempDir("", "copy-7")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(partiallyEncryptedImgDir)
|
||||
partiallyDecryptedImgDir, err := ioutil.TempDir("", "copy-8")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(partiallyDecryptedImgDir)
|
||||
|
||||
// Create RSA key pair
|
||||
privateKey, err := rsa.GenerateKey(rand.Reader, 4096)
|
||||
c.Assert(err, check.IsNil)
|
||||
publicKey := &privateKey.PublicKey
|
||||
privateKeyBytes := x509.MarshalPKCS1PrivateKey(privateKey)
|
||||
publicKeyBytes, err := x509.MarshalPKIXPublicKey(publicKey)
|
||||
c.Assert(err, check.IsNil)
|
||||
err = ioutil.WriteFile(keysDir+"/private.key", privateKeyBytes, 0644)
|
||||
c.Assert(err, check.IsNil)
|
||||
err = ioutil.WriteFile(keysDir+"/public.key", publicKeyBytes, 0644)
|
||||
c.Assert(err, check.IsNil)
|
||||
|
||||
// We can either perform encryption or decryption on the image.
|
||||
// This is why use should not be able to specify both encryption and decryption
|
||||
// during copy at the same time.
|
||||
assertSkopeoFails(c, ".*--encryption-key and --decryption-key cannot be specified together.*",
|
||||
"copy", "--encryption-key", "jwe:"+keysDir+"/public.key", "--decryption-key", keysDir+"/private.key",
|
||||
"oci:"+encryptedImgDir+":encrypted", "oci:"+decryptedImgDir+":decrypted")
|
||||
assertSkopeoFails(c, ".*--encryption-key and --decryption-key cannot be specified together.*",
|
||||
"copy", "--decryption-key", keysDir+"/private.key", "--encryption-key", "jwe:"+keysDir+"/public.key",
|
||||
"oci:"+encryptedImgDir+":encrypted", "oci:"+decryptedImgDir+":decrypted")
|
||||
|
||||
// Copy a standard busybox image locally
|
||||
assertSkopeoSucceeds(c, "", "copy", "docker://busybox:1.31.1", "oci:"+originalImageDir+":latest")
|
||||
|
||||
// Encrypt the image
|
||||
assertSkopeoSucceeds(c, "", "copy", "--encryption-key",
|
||||
"jwe:"+keysDir+"/public.key", "oci:"+originalImageDir+":latest", "oci:"+encryptedImgDir+":encrypted")
|
||||
|
||||
// An attempt to decrypt an encrypted image without a valid private key should fail
|
||||
invalidPrivateKey, err := rsa.GenerateKey(rand.Reader, 4096)
|
||||
c.Assert(err, check.IsNil)
|
||||
invalidPrivateKeyBytes := x509.MarshalPKCS1PrivateKey(invalidPrivateKey)
|
||||
err = ioutil.WriteFile(keysDir+"/invalid_private.key", invalidPrivateKeyBytes, 0644)
|
||||
c.Assert(err, check.IsNil)
|
||||
assertSkopeoFails(c, ".*no suitable key unwrapper found or none of the private keys could be used for decryption.*",
|
||||
"copy", "--decryption-key", keysDir+"/invalid_private.key",
|
||||
"oci:"+encryptedImgDir+":encrypted", "oci:"+decryptedImgDir+":decrypted")
|
||||
|
||||
// Copy encrypted image without decrypting it
|
||||
assertSkopeoSucceeds(c, "", "copy", "oci:"+encryptedImgDir+":encrypted", "oci:"+undecryptedImgDir+":encrypted")
|
||||
// Original busybox image has gzipped layers. But encrypted busybox layers should
|
||||
// not be of gzip type
|
||||
matchLayerBlobBinaryType(c, undecryptedImgDir+"/blobs/sha256", "application/x-gzip", 0)
|
||||
|
||||
// Decrypt the image
|
||||
assertSkopeoSucceeds(c, "", "copy", "--decryption-key", keysDir+"/private.key",
|
||||
"oci:"+undecryptedImgDir+":encrypted", "oci:"+decryptedImgDir+":decrypted")
|
||||
|
||||
// After successful decryption we should find the gzipped layer from the
|
||||
// busybox image
|
||||
matchLayerBlobBinaryType(c, decryptedImgDir+"/blobs/sha256", "application/x-gzip", 1)
|
||||
|
||||
// Copy a standard multi layer nginx image locally
|
||||
assertSkopeoSucceeds(c, "", "copy", "docker://nginx:1.17.8", "oci:"+multiLayerImageDir+":latest")
|
||||
|
||||
// Partially encrypt the image
|
||||
assertSkopeoSucceeds(c, "", "copy", "--encryption-key", "jwe:"+keysDir+"/public.key",
|
||||
"--encrypt-layer", "1", "oci:"+multiLayerImageDir+":latest", "oci:"+partiallyEncryptedImgDir+":encrypted")
|
||||
|
||||
// Since the image is partially encrypted we should find layers that aren't encrypted
|
||||
matchLayerBlobBinaryType(c, partiallyEncryptedImgDir+"/blobs/sha256", "application/x-gzip", 2)
|
||||
|
||||
// Decrypt the partically encrypted image
|
||||
assertSkopeoSucceeds(c, "", "copy", "--decryption-key", keysDir+"/private.key",
|
||||
"oci:"+partiallyEncryptedImgDir+":encrypted", "oci:"+partiallyDecryptedImgDir+":decrypted")
|
||||
|
||||
// After successful decryption we should find the gzipped layers from the nginx image
|
||||
matchLayerBlobBinaryType(c, partiallyDecryptedImgDir+"/blobs/sha256", "application/x-gzip", 3)
|
||||
|
||||
}
|
||||
|
||||
func matchLayerBlobBinaryType(c *check.C, ociImageDirPath string, contentType string, matchCount int) {
|
||||
files, err := ioutil.ReadDir(ociImageDirPath)
|
||||
c.Assert(err, check.IsNil)
|
||||
|
||||
foundCount := 0
|
||||
for _, f := range files {
|
||||
fileContent, err := os.Open(ociImageDirPath + "/" + f.Name())
|
||||
c.Assert(err, check.IsNil)
|
||||
layerContentType, err := getFileContentType(fileContent)
|
||||
c.Assert(err, check.IsNil)
|
||||
|
||||
if layerContentType == contentType {
|
||||
foundCount = foundCount + 1
|
||||
}
|
||||
}
|
||||
|
||||
c.Assert(foundCount, check.Equals, matchCount)
|
||||
}
|
||||
|
||||
func getFileContentType(out *os.File) (string, error) {
|
||||
buffer := make([]byte, 512)
|
||||
_, err := out.Read(buffer)
|
||||
if err != nil {
|
||||
return "", err
|
||||
}
|
||||
contentType := http.DetectContentType(buffer)
|
||||
|
||||
return contentType, nil
|
||||
}
|
||||
|
||||
// Check whether dir: images in dir1 and dir2 are equal, ignoring schema1 signatures.
|
||||
@@ -550,7 +1055,7 @@ func (s *CopySuite) TestCopyAtomicExtension(c *check.C) {
|
||||
|
||||
// Get another image (different so that they don't share signatures, and sign it using docker://)
|
||||
assertSkopeoSucceeds(c, "", "--tls-verify=false", "--registries.d", registriesDir,
|
||||
"copy", "--sign-by", "personal@example.com", "docker://estesp/busybox:ppc64le", "atomic:localhost:5000/myns/extension:extension")
|
||||
"copy", "--sign-by", "personal@example.com", "docker://estesp/busybox:ppc64le", "docker://localhost:5000/myns/extension:extension")
|
||||
c.Logf("%s", combinedOutputOfCommand(c, "oc", "get", "istag", "extension:extension", "-o", "json"))
|
||||
// Pulling the image using atomic: succeeds.
|
||||
assertSkopeoSucceeds(c, "", "--debug", "--tls-verify=false", "--policy", policy,
|
||||
@@ -562,6 +1067,67 @@ func (s *CopySuite) TestCopyAtomicExtension(c *check.C) {
|
||||
assertDirImagesAreEqual(c, filepath.Join(topDir, "dirDA"), filepath.Join(topDir, "dirDD"))
|
||||
}
|
||||
|
||||
func (s *CopySuite) TestCopyVerifyingMirroredSignatures(c *check.C) {
|
||||
const regPrefix = "docker://localhost:5006/myns/mirroring-"
|
||||
|
||||
mech, _, err := signature.NewEphemeralGPGSigningMechanism([]byte{})
|
||||
c.Assert(err, check.IsNil)
|
||||
defer mech.Close()
|
||||
if err := mech.SupportsSigning(); err != nil { // FIXME? Test that verification and policy enforcement works, using signatures from fixtures
|
||||
c.Skip(fmt.Sprintf("Signing not supported: %v", err))
|
||||
}
|
||||
|
||||
topDir, err := ioutil.TempDir("", "mirrored-signatures") // FIXME: Will this be used?
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(topDir)
|
||||
registriesDir := filepath.Join(topDir, "registries.d") // An empty directory to disable sigstore use
|
||||
dirDest := "dir:" + filepath.Join(topDir, "unused-dest")
|
||||
|
||||
policy := fileFromFixture(c, "fixtures/policy.json", map[string]string{"@keydir@": s.gpgHome})
|
||||
defer os.Remove(policy)
|
||||
|
||||
// We use X-R-S-S for this testing to avoid having to deal with the sigstores.
|
||||
// A downside is that OpenShift records signatures per image, so the error messsages below
|
||||
// list all signatures for other tags used for the same image as well.
|
||||
// So, make sure to never create a signature that could be considered valid in a different part of the test (i.e. don't reuse tags).
|
||||
|
||||
// Get an image to work with.
|
||||
assertSkopeoSucceeds(c, "", "copy", "--dest-tls-verify=false", "docker://busybox", regPrefix+"primary:unsigned")
|
||||
// Verify that unsigned images are rejected
|
||||
assertSkopeoFails(c, ".*Source image rejected: A signature was required, but no signature exists.*",
|
||||
"--policy", policy, "--registries.d", registriesDir, "--registries-conf", "fixtures/registries.conf", "copy", "--src-tls-verify=false", regPrefix+"primary:unsigned", dirDest)
|
||||
// Sign the image for the primary location
|
||||
assertSkopeoSucceeds(c, "", "--registries.d", registriesDir, "copy", "--src-tls-verify=false", "--dest-tls-verify=false", "--sign-by", "personal@example.com", regPrefix+"primary:unsigned", regPrefix+"primary:direct")
|
||||
// Verify that a correctly signed image in the primary location is usable.
|
||||
assertSkopeoSucceeds(c, "", "--policy", policy, "--registries.d", registriesDir, "--registries-conf", "fixtures/registries.conf", "copy", "--src-tls-verify=false", regPrefix+"primary:direct", dirDest)
|
||||
|
||||
// Sign the image for the mirror
|
||||
assertSkopeoSucceeds(c, "", "--registries.d", registriesDir, "copy", "--src-tls-verify=false", "--dest-tls-verify=false", "--sign-by", "personal@example.com", regPrefix+"primary:unsigned", regPrefix+"mirror:mirror-signed")
|
||||
// Verify that a correctly signed image for the mirror is acessible using the mirror's reference
|
||||
assertSkopeoSucceeds(c, "", "--policy", policy, "--registries.d", registriesDir, "--registries-conf", "fixtures/registries.conf", "copy", "--src-tls-verify=false", regPrefix+"mirror:mirror-signed", dirDest)
|
||||
// … but verify that while it is accessible using the primary location redirecting to the mirror, …
|
||||
assertSkopeoSucceeds(c, "" /* no --policy */, "--registries-conf", "fixtures/registries.conf", "copy", "--src-tls-verify=false", regPrefix+"primary:mirror-signed", dirDest)
|
||||
// … verify it is NOT accessible when requiring a signature.
|
||||
assertSkopeoFails(c, ".*Source image rejected: None of the signatures were accepted, reasons: Signature for identity localhost:5006/myns/mirroring-primary:direct is not accepted; Signature for identity localhost:5006/myns/mirroring-mirror:mirror-signed is not accepted.*",
|
||||
"--policy", policy, "--registries.d", registriesDir, "--registries-conf", "fixtures/registries.conf", "copy", "--src-tls-verify=false", regPrefix+"primary:mirror-signed", dirDest)
|
||||
|
||||
// Create a signature for mirroring-primary:primary-signed without pushing there. This should be easier than using standalone-sign.
|
||||
signingDir := filepath.Join(topDir, "signing-temp")
|
||||
assertSkopeoSucceeds(c, "", "copy", "--src-tls-verify=false", regPrefix+"primary:unsigned", "dir:"+signingDir)
|
||||
c.Logf("%s", combinedOutputOfCommand(c, "ls", "-laR", signingDir))
|
||||
assertSkopeoSucceeds(c, "^$", "standalone-sign", "-o", filepath.Join(signingDir, "signature-1"),
|
||||
filepath.Join(signingDir, "manifest.json"), "localhost:5006/myns/mirroring-primary:primary-signed", "personal@example.com")
|
||||
c.Logf("%s", combinedOutputOfCommand(c, "ls", "-laR", signingDir))
|
||||
assertSkopeoSucceeds(c, "", "--registries.d", registriesDir, "copy", "--dest-tls-verify=false", "dir:"+signingDir, regPrefix+"mirror:primary-signed")
|
||||
// Verify that a correctly signed image for the primary is accessible using the primary's reference
|
||||
assertSkopeoSucceeds(c, "", "--policy", policy, "--registries.d", registriesDir, "--registries-conf", "fixtures/registries.conf", "copy", "--src-tls-verify=false", regPrefix+"primary:primary-signed", dirDest)
|
||||
// … but verify that while it is accessible using the mirror location
|
||||
assertSkopeoSucceeds(c, "" /* no --policy */, "--registries-conf", "fixtures/registries.conf", "copy", "--src-tls-verify=false", regPrefix+"mirror:primary-signed", dirDest)
|
||||
// … verify it is NOT accessible when requiring a signature.
|
||||
assertSkopeoFails(c, ".*Source image rejected: None of the signatures were accepted, reasons: Signature for identity localhost:5006/myns/mirroring-primary:direct is not accepted; Signature for identity localhost:5006/myns/mirroring-mirror:mirror-signed is not accepted; Signature for identity localhost:5006/myns/mirroring-primary:primary-signed is not accepted.*",
|
||||
"--policy", policy, "--registries.d", registriesDir, "--registries-conf", "fixtures/registries.conf", "copy", "--src-tls-verify=false", regPrefix+"mirror:primary-signed", dirDest)
|
||||
}
|
||||
|
||||
func (s *SkopeoSuite) TestCopySrcWithAuth(c *check.C) {
|
||||
assertSkopeoSucceeds(c, "", "--tls-verify=false", "copy", "--dest-creds=testuser:testpassword", "docker://busybox", fmt.Sprintf("docker://%s/busybox:latest", s.regV2WithAuth.url))
|
||||
dir1, err := ioutil.TempDir("", "copy-1")
|
||||
|
||||
23
integration/decompress-dirs.sh
Executable file
23
integration/decompress-dirs.sh
Executable file
@@ -0,0 +1,23 @@
|
||||
#!/bin/bash -e
|
||||
# Account for differences between dir: images that are solely due to one being
|
||||
# compressed (fresh from a registry) and the other not being compressed (read
|
||||
# from storage, which decompressed it and had to reassemble the layer blobs).
|
||||
for dir in "$@" ; do
|
||||
# Updating the manifest's blob digests may change the formatting, so
|
||||
# use jq to get them into similar shape.
|
||||
jq -M . "${dir}"/manifest.json > "${dir}"/manifest.json.tmp && mv "${dir}"/manifest.json.tmp "${dir}"/manifest.json
|
||||
for candidate in "${dir}"/???????????????????????????????????????????????????????????????? ; do
|
||||
# If a digest-identified file looks like it was compressed,
|
||||
# decompress it, and replace its hash and size in the manifest
|
||||
# with the values for their decompressed versions.
|
||||
uncompressed=`zcat "${candidate}" 2> /dev/null | sha256sum | cut -c1-64`
|
||||
if test $? -eq 0 ; then
|
||||
if test "$uncompressed" != e3b0c44298fc1c149afbf4c8996fb92427ae41e4649b934ca495991b7852b855 ; then
|
||||
zcat "${candidate}" > "${dir}"/${uncompressed}
|
||||
sed -r -i -e "s#sha256:$(basename ${candidate})#sha256:${uncompressed}#g" "${dir}"/manifest.json
|
||||
sed -r -i -e "s#\"size\": $(wc -c < ${candidate}),#\"size\": $(wc -c < ${dir}/${uncompressed}),#g" "${dir}"/manifest.json
|
||||
rm -f "${candidate}"
|
||||
fi
|
||||
fi
|
||||
done
|
||||
done
|
||||
@@ -20,6 +20,20 @@
|
||||
"keyPath": "@keydir@/personal-pubkey.gpg"
|
||||
}
|
||||
],
|
||||
"localhost:5006/myns/mirroring-primary": [
|
||||
{
|
||||
"type": "signedBy",
|
||||
"keyType": "GPGKeys",
|
||||
"keyPath": "@keydir@/personal-pubkey.gpg"
|
||||
}
|
||||
],
|
||||
"localhost:5006/myns/mirroring-mirror": [
|
||||
{
|
||||
"type": "signedBy",
|
||||
"keyType": "GPGKeys",
|
||||
"keyPath": "@keydir@/personal-pubkey.gpg"
|
||||
}
|
||||
],
|
||||
"docker.io/openshift": [
|
||||
{
|
||||
"type": "insecureAcceptAnything"
|
||||
|
||||
@@ -26,3 +26,9 @@ mirror = [
|
||||
{ location = "wrong-mirror-0.invalid" },
|
||||
{ location = "gcr.io/google-containers" },
|
||||
]
|
||||
|
||||
[[registry]]
|
||||
location = "localhost:5006/myns/mirroring-primary"
|
||||
mirror = [
|
||||
{ location = "localhost:5006/myns/mirroring-mirror"},
|
||||
]
|
||||
|
||||
@@ -22,6 +22,7 @@ var adminKUBECONFIG = map[string]string{
|
||||
// running on localhost.
|
||||
type openshiftCluster struct {
|
||||
workingDir string
|
||||
dockerDir string
|
||||
processes []*exec.Cmd // Processes to terminate on teardown; append to the end, terminate from end to the start.
|
||||
}
|
||||
|
||||
@@ -211,8 +212,8 @@ func (cluster *openshiftCluster) ocLoginToProject(c *check.C) {
|
||||
// dockerLogin simulates (docker login) to the cluster, or terminates on failure.
|
||||
// We do not run (docker login) directly, because that requires a running daemon and a docker package.
|
||||
func (cluster *openshiftCluster) dockerLogin(c *check.C) {
|
||||
dockerDir := filepath.Join(homedir.Get(), ".docker")
|
||||
err := os.Mkdir(dockerDir, 0700)
|
||||
cluster.dockerDir = filepath.Join(homedir.Get(), ".docker")
|
||||
err := os.Mkdir(cluster.dockerDir, 0700)
|
||||
c.Assert(err, check.IsNil)
|
||||
|
||||
out := combinedOutputOfCommand(c, "oc", "config", "view", "-o", "json", "-o", "jsonpath={.users[*].user.token}")
|
||||
@@ -226,7 +227,7 @@ func (cluster *openshiftCluster) dockerLogin(c *check.C) {
|
||||
}`, port, authValue))
|
||||
}
|
||||
configJSON := `{"auths": {` + strings.Join(auths, ",") + `}}`
|
||||
err = ioutil.WriteFile(filepath.Join(dockerDir, "config.json"), []byte(configJSON), 0600)
|
||||
err = ioutil.WriteFile(filepath.Join(cluster.dockerDir, "config.json"), []byte(configJSON), 0600)
|
||||
c.Assert(err, check.IsNil)
|
||||
}
|
||||
|
||||
@@ -249,4 +250,7 @@ func (cluster *openshiftCluster) tearDown(c *check.C) {
|
||||
if cluster.workingDir != "" {
|
||||
os.RemoveAll(cluster.workingDir)
|
||||
}
|
||||
if cluster.dockerDir != "" {
|
||||
os.RemoveAll(cluster.dockerDir)
|
||||
}
|
||||
}
|
||||
|
||||
@@ -8,7 +8,7 @@ import (
|
||||
"os/exec"
|
||||
"strings"
|
||||
|
||||
"github.com/containers/image/signature"
|
||||
"github.com/containers/image/v5/signature"
|
||||
"github.com/go-check/check"
|
||||
)
|
||||
|
||||
|
||||
514
integration/sync_test.go
Normal file
514
integration/sync_test.go
Normal file
@@ -0,0 +1,514 @@
|
||||
package main
|
||||
|
||||
import (
|
||||
"context"
|
||||
"fmt"
|
||||
"io/ioutil"
|
||||
"os"
|
||||
"path"
|
||||
"path/filepath"
|
||||
"regexp"
|
||||
"strings"
|
||||
|
||||
"github.com/containers/image/v5/docker"
|
||||
"github.com/containers/image/v5/types"
|
||||
"github.com/go-check/check"
|
||||
)
|
||||
|
||||
func init() {
|
||||
check.Suite(&SyncSuite{})
|
||||
}
|
||||
|
||||
type SyncSuite struct {
|
||||
cluster *openshiftCluster
|
||||
registry *testRegistryV2
|
||||
gpgHome string
|
||||
}
|
||||
|
||||
func (s *SyncSuite) SetUpSuite(c *check.C) {
|
||||
const registryAuth = false
|
||||
const registrySchema1 = false
|
||||
|
||||
if os.Getenv("SKOPEO_LOCAL_TESTS") == "1" {
|
||||
c.Log("Running tests without a container")
|
||||
fmt.Printf("NOTE: tests requires a V2 registry at url=%s, with auth=%t, schema1=%t \n", v2DockerRegistryURL, registryAuth, registrySchema1)
|
||||
return
|
||||
}
|
||||
|
||||
if os.Getenv("SKOPEO_CONTAINER_TESTS") != "1" {
|
||||
c.Skip("Not running in a container, refusing to affect user state")
|
||||
}
|
||||
|
||||
s.cluster = startOpenshiftCluster(c) // FIXME: Set up TLS for the docker registry port instead of using "--tls-verify=false" all over the place.
|
||||
|
||||
for _, stream := range []string{"unsigned", "personal", "official", "naming", "cosigned", "compression", "schema1", "schema2"} {
|
||||
isJSON := fmt.Sprintf(`{
|
||||
"kind": "ImageStream",
|
||||
"apiVersion": "v1",
|
||||
"metadata": {
|
||||
"name": "%s"
|
||||
},
|
||||
"spec": {}
|
||||
}`, stream)
|
||||
runCommandWithInput(c, isJSON, "oc", "create", "-f", "-")
|
||||
}
|
||||
|
||||
// FIXME: Set up TLS for the docker registry port instead of using "--tls-verify=false" all over the place.
|
||||
s.registry = setupRegistryV2At(c, v2DockerRegistryURL, registryAuth, registrySchema1)
|
||||
|
||||
gpgHome, err := ioutil.TempDir("", "skopeo-gpg")
|
||||
c.Assert(err, check.IsNil)
|
||||
s.gpgHome = gpgHome
|
||||
os.Setenv("GNUPGHOME", s.gpgHome)
|
||||
|
||||
for _, key := range []string{"personal", "official"} {
|
||||
batchInput := fmt.Sprintf("Key-Type: RSA\nName-Real: Test key - %s\nName-email: %s@example.com\n%%no-protection\n%%commit\n",
|
||||
key, key)
|
||||
runCommandWithInput(c, batchInput, gpgBinary, "--batch", "--gen-key")
|
||||
|
||||
out := combinedOutputOfCommand(c, gpgBinary, "--armor", "--export", fmt.Sprintf("%s@example.com", key))
|
||||
err := ioutil.WriteFile(filepath.Join(s.gpgHome, fmt.Sprintf("%s-pubkey.gpg", key)),
|
||||
[]byte(out), 0600)
|
||||
c.Assert(err, check.IsNil)
|
||||
}
|
||||
}
|
||||
|
||||
func (s *SyncSuite) TearDownSuite(c *check.C) {
|
||||
if os.Getenv("SKOPEO_LOCAL_TESTS") == "1" {
|
||||
return
|
||||
}
|
||||
|
||||
if s.gpgHome != "" {
|
||||
os.RemoveAll(s.gpgHome)
|
||||
}
|
||||
if s.registry != nil {
|
||||
s.registry.Close()
|
||||
}
|
||||
if s.cluster != nil {
|
||||
s.cluster.tearDown(c)
|
||||
}
|
||||
}
|
||||
|
||||
func (s *SyncSuite) TestDocker2DirTagged(c *check.C) {
|
||||
tmpDir, err := ioutil.TempDir("", "skopeo-sync-test")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(tmpDir)
|
||||
|
||||
// FIXME: It would be nice to use one of the local Docker registries instead of neeeding an Internet connection.
|
||||
image := "busybox:latest"
|
||||
imageRef, err := docker.ParseReference(fmt.Sprintf("//%s", image))
|
||||
c.Assert(err, check.IsNil)
|
||||
imagePath := imageRef.DockerReference().String()
|
||||
|
||||
dir1 := path.Join(tmpDir, "dir1")
|
||||
dir2 := path.Join(tmpDir, "dir2")
|
||||
|
||||
// sync docker => dir
|
||||
assertSkopeoSucceeds(c, "", "sync", "--scoped", "--src", "docker", "--dest", "dir", image, dir1)
|
||||
_, err = os.Stat(path.Join(dir1, imagePath, "manifest.json"))
|
||||
c.Assert(err, check.IsNil)
|
||||
|
||||
// copy docker => dir
|
||||
assertSkopeoSucceeds(c, "", "copy", "docker://"+image, "dir:"+dir2)
|
||||
_, err = os.Stat(path.Join(dir2, "manifest.json"))
|
||||
c.Assert(err, check.IsNil)
|
||||
|
||||
out := combinedOutputOfCommand(c, "diff", "-urN", path.Join(dir1, imagePath), dir2)
|
||||
c.Assert(out, check.Equals, "")
|
||||
}
|
||||
|
||||
func (s *SyncSuite) TestScoped(c *check.C) {
|
||||
// FIXME: It would be nice to use one of the local Docker registries instead of neeeding an Internet connection.
|
||||
image := "busybox:latest"
|
||||
imageRef, err := docker.ParseReference(fmt.Sprintf("//%s", image))
|
||||
c.Assert(err, check.IsNil)
|
||||
imagePath := imageRef.DockerReference().String()
|
||||
|
||||
dir1, err := ioutil.TempDir("", "skopeo-sync-test")
|
||||
c.Assert(err, check.IsNil)
|
||||
assertSkopeoSucceeds(c, "", "sync", "--src", "docker", "--dest", "dir", image, dir1)
|
||||
_, err = os.Stat(path.Join(dir1, image, "manifest.json"))
|
||||
c.Assert(err, check.IsNil)
|
||||
|
||||
assertSkopeoSucceeds(c, "", "sync", "--scoped", "--src", "docker", "--dest", "dir", image, dir1)
|
||||
_, err = os.Stat(path.Join(dir1, imagePath, "manifest.json"))
|
||||
c.Assert(err, check.IsNil)
|
||||
|
||||
os.RemoveAll(dir1)
|
||||
}
|
||||
|
||||
func (s *SyncSuite) TestDirIsNotOverwritten(c *check.C) {
|
||||
// FIXME: It would be nice to use one of the local Docker registries instead of neeeding an Internet connection.
|
||||
image := "busybox:latest"
|
||||
imageRef, err := docker.ParseReference(fmt.Sprintf("//%s", image))
|
||||
c.Assert(err, check.IsNil)
|
||||
imagePath := imageRef.DockerReference().String()
|
||||
|
||||
// make a copy of the image in the local registry
|
||||
assertSkopeoSucceeds(c, "", "copy", "--dest-tls-verify=false", "docker://"+image, "docker://"+path.Join(v2DockerRegistryURL, image))
|
||||
|
||||
//sync upstream image to dir, not scoped
|
||||
dir1, err := ioutil.TempDir("", "skopeo-sync-test")
|
||||
c.Assert(err, check.IsNil)
|
||||
assertSkopeoSucceeds(c, "", "sync", "--src", "docker", "--dest", "dir", image, dir1)
|
||||
_, err = os.Stat(path.Join(dir1, image, "manifest.json"))
|
||||
c.Assert(err, check.IsNil)
|
||||
|
||||
//sync local registry image to dir, not scoped
|
||||
assertSkopeoFails(c, ".*Refusing to overwrite destination directory.*", "sync", "--src-tls-verify=false", "--src", "docker", "--dest", "dir", path.Join(v2DockerRegistryURL, image), dir1)
|
||||
|
||||
//sync local registry image to dir, scoped
|
||||
imageRef, err = docker.ParseReference(fmt.Sprintf("//%s", path.Join(v2DockerRegistryURL, image)))
|
||||
c.Assert(err, check.IsNil)
|
||||
imagePath = imageRef.DockerReference().String()
|
||||
assertSkopeoSucceeds(c, "", "sync", "--scoped", "--src-tls-verify=false", "--src", "docker", "--dest", "dir", path.Join(v2DockerRegistryURL, image), dir1)
|
||||
_, err = os.Stat(path.Join(dir1, imagePath, "manifest.json"))
|
||||
c.Assert(err, check.IsNil)
|
||||
os.RemoveAll(dir1)
|
||||
}
|
||||
|
||||
func (s *SyncSuite) TestDocker2DirUntagged(c *check.C) {
|
||||
|
||||
tmpDir, err := ioutil.TempDir("", "skopeo-sync-test")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(tmpDir)
|
||||
|
||||
// FIXME: It would be nice to use one of the local Docker registries instead of neeeding an Internet connection.
|
||||
image := "alpine"
|
||||
imageRef, err := docker.ParseReference(fmt.Sprintf("//%s", image))
|
||||
c.Assert(err, check.IsNil)
|
||||
imagePath := imageRef.DockerReference().String()
|
||||
|
||||
dir1 := path.Join(tmpDir, "dir1")
|
||||
assertSkopeoSucceeds(c, "", "sync", "--scoped", "--src", "docker", "--dest", "dir", image, dir1)
|
||||
|
||||
sysCtx := types.SystemContext{}
|
||||
tags, err := docker.GetRepositoryTags(context.Background(), &sysCtx, imageRef)
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Check(len(tags), check.Not(check.Equals), 0)
|
||||
|
||||
nManifests, err := filepath.Glob(path.Join(dir1, path.Dir(imagePath), "*", "manifest.json"))
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Assert(len(nManifests), check.Equals, len(tags))
|
||||
}
|
||||
|
||||
func (s *SyncSuite) TestYamlUntagged(c *check.C) {
|
||||
tmpDir, err := ioutil.TempDir("", "skopeo-sync-test")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(tmpDir)
|
||||
dir1 := path.Join(tmpDir, "dir1")
|
||||
|
||||
image := "alpine"
|
||||
imageRef, err := docker.ParseReference(fmt.Sprintf("//%s", image))
|
||||
c.Assert(err, check.IsNil)
|
||||
imagePath := imageRef.DockerReference().Name()
|
||||
|
||||
sysCtx := types.SystemContext{}
|
||||
tags, err := docker.GetRepositoryTags(context.Background(), &sysCtx, imageRef)
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Check(len(tags), check.Not(check.Equals), 0)
|
||||
|
||||
yamlConfig := fmt.Sprintf(`
|
||||
docker.io:
|
||||
images:
|
||||
%s:
|
||||
`, image)
|
||||
|
||||
//sync to the local reg
|
||||
yamlFile := path.Join(tmpDir, "registries.yaml")
|
||||
ioutil.WriteFile(yamlFile, []byte(yamlConfig), 0644)
|
||||
assertSkopeoSucceeds(c, "", "sync", "--scoped", "--src", "yaml", "--dest", "docker", "--dest-tls-verify=false", yamlFile, v2DockerRegistryURL)
|
||||
// sync back from local reg to a folder
|
||||
os.Remove(yamlFile)
|
||||
yamlConfig = fmt.Sprintf(`
|
||||
%s:
|
||||
tls-verify: false
|
||||
images:
|
||||
%s:
|
||||
|
||||
`, v2DockerRegistryURL, imagePath)
|
||||
|
||||
ioutil.WriteFile(yamlFile, []byte(yamlConfig), 0644)
|
||||
assertSkopeoSucceeds(c, "", "sync", "--scoped", "--src", "yaml", "--dest", "dir", yamlFile, dir1)
|
||||
|
||||
sysCtx = types.SystemContext{
|
||||
DockerInsecureSkipTLSVerify: types.NewOptionalBool(true),
|
||||
}
|
||||
localTags, err := docker.GetRepositoryTags(context.Background(), &sysCtx, imageRef)
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Check(len(localTags), check.Not(check.Equals), 0)
|
||||
c.Assert(len(localTags), check.Equals, len(tags))
|
||||
|
||||
nManifests := 0
|
||||
//count the number of manifest.json in dir1
|
||||
err = filepath.Walk(dir1, func(path string, info os.FileInfo, err error) error {
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
if !info.IsDir() && info.Name() == "manifest.json" {
|
||||
nManifests++
|
||||
return filepath.SkipDir
|
||||
}
|
||||
return nil
|
||||
})
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Assert(nManifests, check.Equals, len(tags))
|
||||
}
|
||||
|
||||
func (s *SyncSuite) TestYaml2Dir(c *check.C) {
|
||||
tmpDir, err := ioutil.TempDir("", "skopeo-sync-test")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(tmpDir)
|
||||
dir1 := path.Join(tmpDir, "dir1")
|
||||
|
||||
yamlConfig := `
|
||||
docker.io:
|
||||
images:
|
||||
busybox:
|
||||
- latest
|
||||
- musl
|
||||
alpine:
|
||||
- edge
|
||||
- 3.8
|
||||
|
||||
opensuse/leap:
|
||||
- latest
|
||||
|
||||
quay.io:
|
||||
images:
|
||||
quay/busybox:
|
||||
- latest`
|
||||
|
||||
// get the number of tags
|
||||
re := regexp.MustCompile(`^ +- +[^:/ ]+`)
|
||||
var nTags int
|
||||
for _, l := range strings.Split(yamlConfig, "\n") {
|
||||
if re.MatchString(l) {
|
||||
nTags++
|
||||
}
|
||||
}
|
||||
c.Assert(nTags, check.Not(check.Equals), 0)
|
||||
|
||||
yamlFile := path.Join(tmpDir, "registries.yaml")
|
||||
ioutil.WriteFile(yamlFile, []byte(yamlConfig), 0644)
|
||||
assertSkopeoSucceeds(c, "", "sync", "--scoped", "--src", "yaml", "--dest", "dir", yamlFile, dir1)
|
||||
|
||||
nManifests := 0
|
||||
err = filepath.Walk(dir1, func(path string, info os.FileInfo, err error) error {
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
if !info.IsDir() && info.Name() == "manifest.json" {
|
||||
nManifests++
|
||||
return filepath.SkipDir
|
||||
}
|
||||
return nil
|
||||
})
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Assert(nManifests, check.Equals, nTags)
|
||||
}
|
||||
|
||||
func (s *SyncSuite) TestYamlTLSVerify(c *check.C) {
|
||||
const localRegURL = "docker://" + v2DockerRegistryURL + "/"
|
||||
tmpDir, err := ioutil.TempDir("", "skopeo-sync-test")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(tmpDir)
|
||||
dir1 := path.Join(tmpDir, "dir1")
|
||||
image := "busybox"
|
||||
tag := "latest"
|
||||
|
||||
// FIXME: It would be nice to use one of the local Docker registries instead of neeeding an Internet connection.
|
||||
// copy docker => docker
|
||||
assertSkopeoSucceeds(c, "", "copy", "--dest-tls-verify=false", "docker://"+image+":"+tag, localRegURL+image+":"+tag)
|
||||
|
||||
yamlTemplate := `
|
||||
%s:
|
||||
%s
|
||||
images:
|
||||
%s:
|
||||
- %s`
|
||||
|
||||
testCfg := []struct {
|
||||
tlsVerify string
|
||||
msg string
|
||||
checker func(c *check.C, regexp string, args ...string)
|
||||
}{
|
||||
{
|
||||
tlsVerify: "tls-verify: false",
|
||||
msg: "",
|
||||
checker: assertSkopeoSucceeds,
|
||||
},
|
||||
{
|
||||
tlsVerify: "tls-verify: true",
|
||||
msg: ".*server gave HTTP response to HTTPS client.*",
|
||||
checker: assertSkopeoFails,
|
||||
},
|
||||
// no "tls-verify" line means default TLS verify must be ON
|
||||
{
|
||||
tlsVerify: "",
|
||||
msg: ".*server gave HTTP response to HTTPS client.*",
|
||||
checker: assertSkopeoFails,
|
||||
},
|
||||
}
|
||||
|
||||
for _, cfg := range testCfg {
|
||||
yamlConfig := fmt.Sprintf(yamlTemplate, v2DockerRegistryURL, cfg.tlsVerify, image, tag)
|
||||
yamlFile := path.Join(tmpDir, "registries.yaml")
|
||||
ioutil.WriteFile(yamlFile, []byte(yamlConfig), 0644)
|
||||
|
||||
cfg.checker(c, cfg.msg, "sync", "--scoped", "--src", "yaml", "--dest", "dir", yamlFile, dir1)
|
||||
os.Remove(yamlFile)
|
||||
os.RemoveAll(dir1)
|
||||
}
|
||||
|
||||
}
|
||||
|
||||
func (s *SyncSuite) TestDocker2DockerTagged(c *check.C) {
|
||||
const localRegURL = "docker://" + v2DockerRegistryURL + "/"
|
||||
|
||||
tmpDir, err := ioutil.TempDir("", "skopeo-sync-test")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(tmpDir)
|
||||
|
||||
// FIXME: It would be nice to use one of the local Docker registries instead of neeeding an Internet connection.
|
||||
image := "busybox:latest"
|
||||
imageRef, err := docker.ParseReference(fmt.Sprintf("//%s", image))
|
||||
c.Assert(err, check.IsNil)
|
||||
imagePath := imageRef.DockerReference().String()
|
||||
|
||||
dir1 := path.Join(tmpDir, "dir1")
|
||||
dir2 := path.Join(tmpDir, "dir2")
|
||||
|
||||
// sync docker => docker
|
||||
assertSkopeoSucceeds(c, "", "sync", "--scoped", "--dest-tls-verify=false", "--src", "docker", "--dest", "docker", image, v2DockerRegistryURL)
|
||||
|
||||
// copy docker => dir
|
||||
assertSkopeoSucceeds(c, "", "copy", "docker://"+image, "dir:"+dir1)
|
||||
_, err = os.Stat(path.Join(dir1, "manifest.json"))
|
||||
c.Assert(err, check.IsNil)
|
||||
|
||||
// copy docker => dir
|
||||
assertSkopeoSucceeds(c, "", "copy", "--src-tls-verify=false", localRegURL+imagePath, "dir:"+dir2)
|
||||
_, err = os.Stat(path.Join(dir2, "manifest.json"))
|
||||
c.Assert(err, check.IsNil)
|
||||
|
||||
out := combinedOutputOfCommand(c, "diff", "-urN", dir1, dir2)
|
||||
c.Assert(out, check.Equals, "")
|
||||
}
|
||||
|
||||
func (s *SyncSuite) TestDir2DockerTagged(c *check.C) {
|
||||
const localRegURL = "docker://" + v2DockerRegistryURL + "/"
|
||||
|
||||
tmpDir, err := ioutil.TempDir("", "skopeo-sync-test")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(tmpDir)
|
||||
|
||||
// FIXME: It would be nice to use one of the local Docker registries instead of neeeding an Internet connection.
|
||||
image := "busybox:latest"
|
||||
|
||||
dir1 := path.Join(tmpDir, "dir1")
|
||||
err = os.Mkdir(dir1, 0755)
|
||||
c.Assert(err, check.IsNil)
|
||||
dir2 := path.Join(tmpDir, "dir2")
|
||||
err = os.Mkdir(dir2, 0755)
|
||||
c.Assert(err, check.IsNil)
|
||||
|
||||
// copy docker => dir
|
||||
assertSkopeoSucceeds(c, "", "copy", "docker://"+image, "dir:"+path.Join(dir1, image))
|
||||
_, err = os.Stat(path.Join(dir1, image, "manifest.json"))
|
||||
c.Assert(err, check.IsNil)
|
||||
|
||||
// sync dir => docker
|
||||
assertSkopeoSucceeds(c, "", "sync", "--scoped", "--dest-tls-verify=false", "--src", "dir", "--dest", "docker", dir1, v2DockerRegistryURL)
|
||||
|
||||
// copy docker => dir
|
||||
assertSkopeoSucceeds(c, "", "copy", "--src-tls-verify=false", localRegURL+image, "dir:"+path.Join(dir2, image))
|
||||
_, err = os.Stat(path.Join(path.Join(dir2, image), "manifest.json"))
|
||||
c.Assert(err, check.IsNil)
|
||||
|
||||
out := combinedOutputOfCommand(c, "diff", "-urN", dir1, dir2)
|
||||
c.Assert(out, check.Equals, "")
|
||||
}
|
||||
|
||||
func (s *SyncSuite) TestFailsWithDir2Dir(c *check.C) {
|
||||
tmpDir, err := ioutil.TempDir("", "skopeo-sync-test")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(tmpDir)
|
||||
|
||||
dir1 := path.Join(tmpDir, "dir1")
|
||||
dir2 := path.Join(tmpDir, "dir2")
|
||||
|
||||
// sync dir => dir is not allowed
|
||||
assertSkopeoFails(c, ".*sync from 'dir' to 'dir' not implemented.*", "sync", "--scoped", "--src", "dir", "--dest", "dir", dir1, dir2)
|
||||
}
|
||||
|
||||
func (s *SyncSuite) TestFailsNoSourceImages(c *check.C) {
|
||||
tmpDir, err := ioutil.TempDir("", "skopeo-sync-test")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(tmpDir)
|
||||
|
||||
assertSkopeoFails(c, ".*No images to sync found in .*",
|
||||
"sync", "--scoped", "--dest-tls-verify=false", "--src", "dir", "--dest", "docker", tmpDir, v2DockerRegistryURL)
|
||||
|
||||
assertSkopeoFails(c, ".*No images to sync found in .*",
|
||||
"sync", "--scoped", "--dest-tls-verify=false", "--src", "docker", "--dest", "docker", "hopefully_no_images_will_ever_be_called_like_this", v2DockerRegistryURL)
|
||||
}
|
||||
|
||||
func (s *SyncSuite) TestFailsWithDockerSourceNoRegistry(c *check.C) {
|
||||
const regURL = "google.com/namespace/imagename"
|
||||
|
||||
tmpDir, err := ioutil.TempDir("", "skopeo-sync-test")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(tmpDir)
|
||||
|
||||
//untagged
|
||||
assertSkopeoFails(c, ".*invalid status code from registry 404.*",
|
||||
"sync", "--scoped", "--src", "docker", "--dest", "dir", regURL, tmpDir)
|
||||
|
||||
//tagged
|
||||
assertSkopeoFails(c, ".*invalid status code from registry 404.*",
|
||||
"sync", "--scoped", "--src", "docker", "--dest", "dir", regURL+":thetag", tmpDir)
|
||||
}
|
||||
|
||||
func (s *SyncSuite) TestFailsWithDockerSourceUnauthorized(c *check.C) {
|
||||
const repo = "privateimagenamethatshouldnotbepublic"
|
||||
tmpDir, err := ioutil.TempDir("", "skopeo-sync-test")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(tmpDir)
|
||||
|
||||
//untagged
|
||||
assertSkopeoFails(c, ".*Registry disallows tag list retrieval.*",
|
||||
"sync", "--scoped", "--src", "docker", "--dest", "dir", repo, tmpDir)
|
||||
|
||||
//tagged
|
||||
assertSkopeoFails(c, ".*unauthorized: authentication required.*",
|
||||
"sync", "--scoped", "--src", "docker", "--dest", "dir", repo+":thetag", tmpDir)
|
||||
}
|
||||
|
||||
func (s *SyncSuite) TestFailsWithDockerSourceNotExisting(c *check.C) {
|
||||
repo := path.Join(v2DockerRegistryURL, "imagedoesdotexist")
|
||||
tmpDir, err := ioutil.TempDir("", "skopeo-sync-test")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(tmpDir)
|
||||
|
||||
//untagged
|
||||
assertSkopeoFails(c, ".*invalid status code from registry 404.*",
|
||||
"sync", "--scoped", "--src-tls-verify=false", "--src", "docker", "--dest", "dir", repo, tmpDir)
|
||||
|
||||
//tagged
|
||||
assertSkopeoFails(c, ".*Error reading manifest.*",
|
||||
"sync", "--scoped", "--src-tls-verify=false", "--src", "docker", "--dest", "dir", repo+":thetag", tmpDir)
|
||||
}
|
||||
|
||||
func (s *SyncSuite) TestFailsWithDirSourceNotExisting(c *check.C) {
|
||||
// Make sure the dir does not exist!
|
||||
tmpDir, err := ioutil.TempDir("", "skopeo-sync-test")
|
||||
c.Assert(err, check.IsNil)
|
||||
err = os.RemoveAll(tmpDir)
|
||||
c.Assert(err, check.IsNil)
|
||||
_, err = os.Stat(path.Join(tmpDir))
|
||||
c.Check(os.IsNotExist(err), check.Equals, true)
|
||||
|
||||
assertSkopeoFails(c, ".*no such file or directory.*",
|
||||
"sync", "--scoped", "--dest-tls-verify=false", "--src", "dir", "--dest", "docker", tmpDir, v2DockerRegistryURL)
|
||||
}
|
||||
@@ -6,6 +6,7 @@ import (
|
||||
"io/ioutil"
|
||||
"net"
|
||||
"os/exec"
|
||||
"path/filepath"
|
||||
"strings"
|
||||
"time"
|
||||
|
||||
@@ -13,6 +14,7 @@ import (
|
||||
)
|
||||
|
||||
const skopeoBinary = "skopeo"
|
||||
const decompressDirsBinary = "./decompress-dirs.sh"
|
||||
|
||||
// consumeAndLogOutputStream takes (f, err) from an exec.*Pipe(), and causes all output to it to be logged to c.
|
||||
func consumeAndLogOutputStream(c *check.C, id string, f io.ReadCloser, err error) {
|
||||
@@ -174,3 +176,27 @@ func fileFromFixture(c *check.C, inputPath string, edits map[string]string) stri
|
||||
c.Assert(err, check.IsNil)
|
||||
return path
|
||||
}
|
||||
|
||||
// runDecompressDirs runs decompress-dirs.sh using exec.Command().CombinedOutput, verifies that the exit status is 0,
|
||||
// and optionally that the output matches a multi-line regexp if it is nonempty; or terminates c on failure
|
||||
func runDecompressDirs(c *check.C, regexp string, args ...string) {
|
||||
c.Logf("Running %s %s", decompressDirsBinary, strings.Join(args, " "))
|
||||
for i, dir := range args {
|
||||
m, err := ioutil.ReadFile(filepath.Join(dir, "manifest.json"))
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Logf("manifest %d before: %s", i+1, string(m))
|
||||
}
|
||||
out, err := exec.Command(decompressDirsBinary, args...).CombinedOutput()
|
||||
c.Assert(err, check.IsNil, check.Commentf("%s", out))
|
||||
for i, dir := range args {
|
||||
if len(out) > 0 {
|
||||
c.Logf("output: %s", out)
|
||||
}
|
||||
m, err := ioutil.ReadFile(filepath.Join(dir, "manifest.json"))
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Logf("manifest %d after: %s", i+1, string(m))
|
||||
}
|
||||
if regexp != "" {
|
||||
c.Assert(string(out), check.Matches, "(?s)"+regexp) // (?s) : '.' will also match newlines
|
||||
}
|
||||
}
|
||||
|
||||
@@ -64,4 +64,60 @@ Os linux
|
||||
END_EXPECT
|
||||
}
|
||||
|
||||
@test "inspect: env" {
|
||||
remote_image=docker://docker.io/fedora:latest
|
||||
run_skopeo inspect $remote_image
|
||||
inspect_remote=$output
|
||||
|
||||
# Simple check on 'inspect' output with environment variables.
|
||||
# 1) Get remote image values of environment variables (the value of 'Env')
|
||||
# 2) Confirm substring in check_array and the value of 'Env' match.
|
||||
check_array=(PATH=.* )
|
||||
remote=$(jq '.Env[]' <<<"$inspect_remote")
|
||||
for substr in ${check_array[@]}; do
|
||||
expect_output --from="$remote" --substring "$substr"
|
||||
done
|
||||
}
|
||||
|
||||
@test "inspect: image manifest list w/ diff platform" {
|
||||
# When --raw is provided, can inspect show the raw manifest list, w/o
|
||||
# requiring any particular platform to be present
|
||||
# To test whether container image can be inspected successfully w/o
|
||||
# platform dependency.
|
||||
# 1) Get current platform arch
|
||||
# 2) Inspect container image is different from current platform arch
|
||||
# 3) Compare output w/ expected result
|
||||
|
||||
# Here we see a revolting workaround for a podman incompatibility
|
||||
# change: in April 2020, podman info completely changed format
|
||||
# of the keys. What worked until then now throws an error. We
|
||||
# need to work with both old and new podman.
|
||||
arch=$(podman info --format '{{.host.arch}}' || true)
|
||||
if [[ -z "$arch" ]]; then
|
||||
arch=$(podman info --format '{{.Host.Arch}}')
|
||||
fi
|
||||
|
||||
case $arch in
|
||||
"amd64")
|
||||
diff_arch_list="s390x ppc64le"
|
||||
;;
|
||||
"s390x")
|
||||
diff_arch_list="amd64 ppc64le"
|
||||
;;
|
||||
"ppc64le")
|
||||
diff_arch_list="amd64 s390x"
|
||||
;;
|
||||
"*")
|
||||
diff_arch_list="amd64 s390x ppc64le"
|
||||
;;
|
||||
esac
|
||||
|
||||
for arch in $diff_arch_list; do
|
||||
remote_image=docker://docker.io/$arch/golang
|
||||
run_skopeo inspect --tls-verify=false --raw $remote_image
|
||||
remote_arch=$(jq -r '.manifests[0]["platform"]["architecture"]' <<< "$output")
|
||||
expect_output --from="$remote_arch" "$arch" "platform arch of $remote_image"
|
||||
done
|
||||
}
|
||||
|
||||
# vim: filetype=sh
|
||||
|
||||
@@ -14,7 +14,7 @@ function setup() {
|
||||
# From remote, to dir1, to local, to dir2;
|
||||
# compare dir1 and dir2, expect no changes
|
||||
@test "copy: dir, round trip" {
|
||||
local remote_image=docker://busybox:latest
|
||||
local remote_image=docker://docker.io/library/busybox:latest
|
||||
local localimg=docker://localhost:5000/busybox:unsigned
|
||||
|
||||
local dir1=$TESTDIR/dir1
|
||||
@@ -30,7 +30,7 @@ function setup() {
|
||||
|
||||
# Same as above, but using 'oci:' instead of 'dir:' and with a :latest tag
|
||||
@test "copy: oci, round trip" {
|
||||
local remote_image=docker://busybox:latest
|
||||
local remote_image=docker://docker.io/library/busybox:latest
|
||||
local localimg=docker://localhost:5000/busybox:unsigned
|
||||
|
||||
local dir1=$TESTDIR/oci1
|
||||
@@ -44,9 +44,24 @@ function setup() {
|
||||
diff -urN $dir1 $dir2
|
||||
}
|
||||
|
||||
# Compression zstd
|
||||
@test "copy: oci, round trip, zstd" {
|
||||
local remote_image=docker://docker.io/library/busybox:latest
|
||||
|
||||
local dir=$TESTDIR/dir
|
||||
|
||||
run_skopeo copy --dest-compress --dest-compress-format=zstd $remote_image oci:$dir:latest
|
||||
|
||||
# zstd magic number
|
||||
local magic=$(printf "\x28\xb5\x2f\xfd")
|
||||
|
||||
# Check there is at least one file that has the zstd magic number as the first 4 bytes
|
||||
(for i in $dir/blobs/sha256/*; do test "$(head -c 4 $i)" = $magic && exit 0; done; exit 1)
|
||||
}
|
||||
|
||||
# Same image, extracted once with :tag and once without
|
||||
@test "copy: oci w/ and w/o tags" {
|
||||
local remote_image=docker://busybox:latest
|
||||
local remote_image=docker://docker.io/library/busybox:latest
|
||||
|
||||
local dir1=$TESTDIR/dir1
|
||||
local dir2=$TESTDIR/dir2
|
||||
@@ -61,6 +76,15 @@ function setup() {
|
||||
grep '"org.opencontainers.image.ref.name":"withtag"' $dir2/index.json
|
||||
}
|
||||
|
||||
# Registry -> storage -> oci-archive
|
||||
@test "copy: registry -> storage -> oci-archive" {
|
||||
local alpine=docker.io/library/alpine:latest
|
||||
local tmp=$TESTDIR/oci
|
||||
|
||||
run_skopeo copy docker://$alpine containers-storage:$alpine
|
||||
run_skopeo copy containers-storage:$alpine oci-archive:$tmp
|
||||
}
|
||||
|
||||
# This one seems unlikely to get fixed
|
||||
@test "copy: bug 651" {
|
||||
skip "Enable this once skopeo issue #651 has been fixed"
|
||||
|
||||
@@ -14,7 +14,7 @@ function setup() {
|
||||
@test "local registry, with cert" {
|
||||
# Push to local registry...
|
||||
run_skopeo copy --dest-cert-dir=$TESTDIR/client-auth \
|
||||
docker://busybox:latest \
|
||||
docker://docker.io/library/busybox:latest \
|
||||
docker://localhost:5000/busybox:unsigned
|
||||
|
||||
# ...and pull it back out
|
||||
|
||||
@@ -43,7 +43,8 @@ function setup() {
|
||||
|
||||
# These should pass
|
||||
run_skopeo copy --dest-tls-verify=false --dcreds=$testuser:$testpassword \
|
||||
docker://busybox:latest docker://localhost:5000/busybox:mine
|
||||
docker://docker.io/library/busybox:latest \
|
||||
docker://localhost:5000/busybox:mine
|
||||
run_skopeo inspect --tls-verify=false --creds=$testuser:$testpassword \
|
||||
docker://localhost:5000/busybox:mine
|
||||
expect_output --substring "localhost:5000/busybox"
|
||||
@@ -54,7 +55,8 @@ function setup() {
|
||||
podman login --tls-verify=false -u $testuser -p $testpassword localhost:5000
|
||||
|
||||
run_skopeo copy --dest-tls-verify=false \
|
||||
docker://busybox:latest docker://localhost:5000/busybox:mine
|
||||
docker://docker.io/library/busybox:latest \
|
||||
docker://localhost:5000/busybox:mine
|
||||
run_skopeo inspect --tls-verify=false docker://localhost:5000/busybox:mine
|
||||
expect_output --substring "localhost:5000/busybox"
|
||||
|
||||
|
||||
@@ -92,7 +92,8 @@ END_POLICY_JSON
|
||||
fi
|
||||
|
||||
# Cache local copy
|
||||
run_skopeo copy docker://busybox:latest dir:$TESTDIR/busybox
|
||||
run_skopeo copy docker://docker.io/library/busybox:latest \
|
||||
dir:$TESTDIR/busybox
|
||||
|
||||
# Push a bunch of images. Do so *without* --policy flag; this lets us
|
||||
# sign or not, creating images that will or won't conform to policy.
|
||||
|
||||
@@ -13,7 +13,7 @@ function setup() {
|
||||
|
||||
# delete image from registry
|
||||
@test "delete: remove image from registry" {
|
||||
local remote_image=docker://busybox:latest
|
||||
local remote_image=docker://docker.io/library/busybox:latest
|
||||
local localimg=docker://localhost:5000/busybox:unsigned
|
||||
local output=
|
||||
|
||||
|
||||
@@ -5,6 +5,9 @@ SKOPEO_BINARY=${SKOPEO_BINARY:-$(dirname ${BASH_SOURCE})/../skopeo}
|
||||
# Default timeout for a skopeo command.
|
||||
SKOPEO_TIMEOUT=${SKOPEO_TIMEOUT:-300}
|
||||
|
||||
# Default image to run as a local registry
|
||||
REGISTRY_FQIN=${SKOPEO_TEST_REGISTRY_FQIN:-docker.io/library/registry:2}
|
||||
|
||||
###############################################################################
|
||||
# BEGIN setup/teardown
|
||||
|
||||
@@ -106,6 +109,23 @@ function run_skopeo() {
|
||||
fi
|
||||
}
|
||||
|
||||
#################
|
||||
# log_and_run # log a command for later debugging, then run it
|
||||
#################
|
||||
#
|
||||
# When diagnosing a test failure, it can be really nice to see the
|
||||
# more important commands that have been run in test setup: openssl,
|
||||
# podman registry, other complex commands that can give one a boost
|
||||
# when trying to reproduce problems. This simple wrapper takes a
|
||||
# command as its arg, echoes it to stdout (with a '$' prefix),
|
||||
# then runs the command. BATS does not show stdout unless there's
|
||||
# an error. Use this judiciously.
|
||||
#
|
||||
function log_and_run() {
|
||||
echo "\$ $*"
|
||||
"$@"
|
||||
}
|
||||
|
||||
#########
|
||||
# die # Abort with helpful message
|
||||
#########
|
||||
@@ -271,9 +291,21 @@ start_registry() {
|
||||
reg_args+=( -e REGISTRY_STORAGE_DELETE_ENABLED=true)
|
||||
fi
|
||||
|
||||
# TODO: This is TEMPORARY (as of 2020-03-30); remove once crun is fixed.
|
||||
# Skopeo PR #836 claims there's a "regression" in crun with cgroupsv1,
|
||||
# but offers no details about what it is (crun issue nor PR) nor when/if
|
||||
# it's fixed. It's simply a workaround, forcing podman to use runc,
|
||||
# which might work great for skopeo CI but breaks Fedora gating tests.
|
||||
# Instead of always forcing runc, do so only when under cgroups v1:
|
||||
local runtime=
|
||||
cgroup_type=$(stat -f -c %T /sys/fs/cgroup)
|
||||
if [[ $cgroup_type == "tmpfs" ]]; then
|
||||
runtime="--runtime runc"
|
||||
fi
|
||||
|
||||
# cgroup option necessary under podman-in-podman (CI tests),
|
||||
# and doesn't seem to do any harm otherwise.
|
||||
PODMAN="podman --cgroup-manager=cgroupfs"
|
||||
PODMAN="podman $runtime --cgroup-manager=cgroupfs"
|
||||
|
||||
# Called with --testuser? Create an htpasswd file
|
||||
if [[ -n $testuser ]]; then
|
||||
@@ -282,7 +314,7 @@ start_registry() {
|
||||
fi
|
||||
|
||||
if ! egrep -q "^$testuser:" $AUTHDIR/htpasswd; then
|
||||
$PODMAN run --rm --entrypoint htpasswd registry:2 \
|
||||
log_and_run $PODMAN run --rm --entrypoint htpasswd $REGISTRY_FQIN \
|
||||
-Bbn $testuser $testpassword >> $AUTHDIR/htpasswd
|
||||
fi
|
||||
|
||||
@@ -297,7 +329,7 @@ start_registry() {
|
||||
if [[ -n $create_cert ]]; then
|
||||
CERT=$AUTHDIR/domain.crt
|
||||
if [ ! -e $CERT ]; then
|
||||
openssl req -newkey rsa:4096 -nodes -sha256 \
|
||||
log_and_run openssl req -newkey rsa:4096 -nodes -sha256 \
|
||||
-keyout $AUTHDIR/domain.key -x509 -days 2 \
|
||||
-out $CERT \
|
||||
-subj "/C=US/ST=Foo/L=Bar/O=Red Hat, Inc./CN=localhost"
|
||||
@@ -312,15 +344,15 @@ start_registry() {
|
||||
# test the client. (If client sees a matching .key file, it fails)
|
||||
# Thanks to Miloslav Trmac for this hint.
|
||||
mkdir -p $TESTDIR/client-auth
|
||||
cp $CERT $TESTDIR/client-auth/
|
||||
log_and_run cp $CERT $TESTDIR/client-auth/
|
||||
fi
|
||||
|
||||
$PODMAN run -d --name $name "${reg_args[@]}" registry:2
|
||||
log_and_run $PODMAN run -d --name $name "${reg_args[@]}" $REGISTRY_FQIN
|
||||
|
||||
# Wait for registry to actually come up
|
||||
timeout=10
|
||||
while [[ $timeout -ge 1 ]]; do
|
||||
if curl localhost:$port/; then
|
||||
if echo -n >/dev/tcp/127.0.0.1/$port; then
|
||||
return
|
||||
fi
|
||||
|
||||
|
||||
18
vendor/github.com/Microsoft/go-winio/file.go
generated
vendored
18
vendor/github.com/Microsoft/go-winio/file.go
generated
vendored
@@ -16,6 +16,7 @@ import (
|
||||
//sys createIoCompletionPort(file syscall.Handle, port syscall.Handle, key uintptr, threadCount uint32) (newport syscall.Handle, err error) = CreateIoCompletionPort
|
||||
//sys getQueuedCompletionStatus(port syscall.Handle, bytes *uint32, key *uintptr, o **ioOperation, timeout uint32) (err error) = GetQueuedCompletionStatus
|
||||
//sys setFileCompletionNotificationModes(h syscall.Handle, flags uint8) (err error) = SetFileCompletionNotificationModes
|
||||
//sys wsaGetOverlappedResult(h syscall.Handle, o *syscall.Overlapped, bytes *uint32, wait bool, flags *uint32) (err error) = ws2_32.WSAGetOverlappedResult
|
||||
|
||||
type atomicBool int32
|
||||
|
||||
@@ -79,6 +80,7 @@ type win32File struct {
|
||||
wg sync.WaitGroup
|
||||
wgLock sync.RWMutex
|
||||
closing atomicBool
|
||||
socket bool
|
||||
readDeadline deadlineHandler
|
||||
writeDeadline deadlineHandler
|
||||
}
|
||||
@@ -109,7 +111,13 @@ func makeWin32File(h syscall.Handle) (*win32File, error) {
|
||||
}
|
||||
|
||||
func MakeOpenFile(h syscall.Handle) (io.ReadWriteCloser, error) {
|
||||
return makeWin32File(h)
|
||||
// If we return the result of makeWin32File directly, it can result in an
|
||||
// interface-wrapped nil, rather than a nil interface value.
|
||||
f, err := makeWin32File(h)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return f, nil
|
||||
}
|
||||
|
||||
// closeHandle closes the resources associated with a Win32 handle
|
||||
@@ -190,6 +198,10 @@ func (f *win32File) asyncIo(c *ioOperation, d *deadlineHandler, bytes uint32, er
|
||||
if f.closing.isSet() {
|
||||
err = ErrFileClosed
|
||||
}
|
||||
} else if err != nil && f.socket {
|
||||
// err is from Win32. Query the overlapped structure to get the winsock error.
|
||||
var bytes, flags uint32
|
||||
err = wsaGetOverlappedResult(f.handle, &c.o, &bytes, false, &flags)
|
||||
}
|
||||
case <-timeout:
|
||||
cancelIoEx(f.handle, &c.o)
|
||||
@@ -265,6 +277,10 @@ func (f *win32File) Flush() error {
|
||||
return syscall.FlushFileBuffers(f.handle)
|
||||
}
|
||||
|
||||
func (f *win32File) Fd() uintptr {
|
||||
return uintptr(f.handle)
|
||||
}
|
||||
|
||||
func (d *deadlineHandler) set(deadline time.Time) error {
|
||||
d.setLock.Lock()
|
||||
defer d.setLock.Unlock()
|
||||
|
||||
9
vendor/github.com/Microsoft/go-winio/go.mod
generated
vendored
Normal file
9
vendor/github.com/Microsoft/go-winio/go.mod
generated
vendored
Normal file
@@ -0,0 +1,9 @@
|
||||
module github.com/Microsoft/go-winio
|
||||
|
||||
go 1.12
|
||||
|
||||
require (
|
||||
github.com/pkg/errors v0.8.1
|
||||
github.com/sirupsen/logrus v1.4.1
|
||||
golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3
|
||||
)
|
||||
18
vendor/github.com/Microsoft/go-winio/go.sum
generated
vendored
Normal file
18
vendor/github.com/Microsoft/go-winio/go.sum
generated
vendored
Normal file
@@ -0,0 +1,18 @@
|
||||
github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c=
|
||||
github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
|
||||
github.com/konsorten/go-windows-terminal-sequences v1.0.1 h1:mweAR1A6xJ3oS2pRaGiHgQ4OO8tzTaLawm8vnODuwDk=
|
||||
github.com/konsorten/go-windows-terminal-sequences v1.0.1/go.mod h1:T0+1ngSBFLxvqU3pZ+m/2kptfBszLMUkC4ZK/EgS/cQ=
|
||||
github.com/pkg/errors v0.8.1 h1:iURUrRGxPUNPdy5/HRSm+Yj6okJ6UtLINN0Q9M4+h3I=
|
||||
github.com/pkg/errors v0.8.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0=
|
||||
github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM=
|
||||
github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4=
|
||||
github.com/sirupsen/logrus v1.4.1 h1:GL2rEmy6nsikmW0r8opw9JIRScdMF5hA8cOYLH7In1k=
|
||||
github.com/sirupsen/logrus v1.4.1/go.mod h1:ni0Sbl8bgC9z8RoU9G6nDWqqs/fq4eDPysMBDgk/93Q=
|
||||
github.com/stretchr/objx v0.1.1/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME=
|
||||
github.com/stretchr/testify v1.2.2 h1:bSDNvY7ZPG5RlJ8otE/7V6gMiyenm9RtJ7IUVIAoJ1w=
|
||||
github.com/stretchr/testify v1.2.2/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXfy6kDkUVs=
|
||||
golang.org/x/sys v0.0.0-20180905080454-ebe1bf3edb33/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
|
||||
golang.org/x/sys v0.0.0-20190507160741-ecd444e8653b h1:ag/x1USPSsqHud38I9BAC88qdNLDHHtQ4mlgQIZPPNA=
|
||||
golang.org/x/sys v0.0.0-20190507160741-ecd444e8653b/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 h1:7TYNF4UdlohbFwpNH04CoPMp1cHUZgO1Ebq5r2hIjfo=
|
||||
golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
305
vendor/github.com/Microsoft/go-winio/hvsock.go
generated
vendored
Normal file
305
vendor/github.com/Microsoft/go-winio/hvsock.go
generated
vendored
Normal file
@@ -0,0 +1,305 @@
|
||||
package winio
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
"io"
|
||||
"net"
|
||||
"os"
|
||||
"syscall"
|
||||
"time"
|
||||
"unsafe"
|
||||
|
||||
"github.com/Microsoft/go-winio/pkg/guid"
|
||||
)
|
||||
|
||||
//sys bind(s syscall.Handle, name unsafe.Pointer, namelen int32) (err error) [failretval==socketError] = ws2_32.bind
|
||||
|
||||
const (
|
||||
afHvSock = 34 // AF_HYPERV
|
||||
|
||||
socketError = ^uintptr(0)
|
||||
)
|
||||
|
||||
// An HvsockAddr is an address for a AF_HYPERV socket.
|
||||
type HvsockAddr struct {
|
||||
VMID guid.GUID
|
||||
ServiceID guid.GUID
|
||||
}
|
||||
|
||||
type rawHvsockAddr struct {
|
||||
Family uint16
|
||||
_ uint16
|
||||
VMID guid.GUID
|
||||
ServiceID guid.GUID
|
||||
}
|
||||
|
||||
// Network returns the address's network name, "hvsock".
|
||||
func (addr *HvsockAddr) Network() string {
|
||||
return "hvsock"
|
||||
}
|
||||
|
||||
func (addr *HvsockAddr) String() string {
|
||||
return fmt.Sprintf("%s:%s", &addr.VMID, &addr.ServiceID)
|
||||
}
|
||||
|
||||
// VsockServiceID returns an hvsock service ID corresponding to the specified AF_VSOCK port.
|
||||
func VsockServiceID(port uint32) guid.GUID {
|
||||
g, _ := guid.FromString("00000000-facb-11e6-bd58-64006a7986d3")
|
||||
g.Data1 = port
|
||||
return g
|
||||
}
|
||||
|
||||
func (addr *HvsockAddr) raw() rawHvsockAddr {
|
||||
return rawHvsockAddr{
|
||||
Family: afHvSock,
|
||||
VMID: addr.VMID,
|
||||
ServiceID: addr.ServiceID,
|
||||
}
|
||||
}
|
||||
|
||||
func (addr *HvsockAddr) fromRaw(raw *rawHvsockAddr) {
|
||||
addr.VMID = raw.VMID
|
||||
addr.ServiceID = raw.ServiceID
|
||||
}
|
||||
|
||||
// HvsockListener is a socket listener for the AF_HYPERV address family.
|
||||
type HvsockListener struct {
|
||||
sock *win32File
|
||||
addr HvsockAddr
|
||||
}
|
||||
|
||||
// HvsockConn is a connected socket of the AF_HYPERV address family.
|
||||
type HvsockConn struct {
|
||||
sock *win32File
|
||||
local, remote HvsockAddr
|
||||
}
|
||||
|
||||
func newHvSocket() (*win32File, error) {
|
||||
fd, err := syscall.Socket(afHvSock, syscall.SOCK_STREAM, 1)
|
||||
if err != nil {
|
||||
return nil, os.NewSyscallError("socket", err)
|
||||
}
|
||||
f, err := makeWin32File(fd)
|
||||
if err != nil {
|
||||
syscall.Close(fd)
|
||||
return nil, err
|
||||
}
|
||||
f.socket = true
|
||||
return f, nil
|
||||
}
|
||||
|
||||
// ListenHvsock listens for connections on the specified hvsock address.
|
||||
func ListenHvsock(addr *HvsockAddr) (_ *HvsockListener, err error) {
|
||||
l := &HvsockListener{addr: *addr}
|
||||
sock, err := newHvSocket()
|
||||
if err != nil {
|
||||
return nil, l.opErr("listen", err)
|
||||
}
|
||||
sa := addr.raw()
|
||||
err = bind(sock.handle, unsafe.Pointer(&sa), int32(unsafe.Sizeof(sa)))
|
||||
if err != nil {
|
||||
return nil, l.opErr("listen", os.NewSyscallError("socket", err))
|
||||
}
|
||||
err = syscall.Listen(sock.handle, 16)
|
||||
if err != nil {
|
||||
return nil, l.opErr("listen", os.NewSyscallError("listen", err))
|
||||
}
|
||||
return &HvsockListener{sock: sock, addr: *addr}, nil
|
||||
}
|
||||
|
||||
func (l *HvsockListener) opErr(op string, err error) error {
|
||||
return &net.OpError{Op: op, Net: "hvsock", Addr: &l.addr, Err: err}
|
||||
}
|
||||
|
||||
// Addr returns the listener's network address.
|
||||
func (l *HvsockListener) Addr() net.Addr {
|
||||
return &l.addr
|
||||
}
|
||||
|
||||
// Accept waits for the next connection and returns it.
|
||||
func (l *HvsockListener) Accept() (_ net.Conn, err error) {
|
||||
sock, err := newHvSocket()
|
||||
if err != nil {
|
||||
return nil, l.opErr("accept", err)
|
||||
}
|
||||
defer func() {
|
||||
if sock != nil {
|
||||
sock.Close()
|
||||
}
|
||||
}()
|
||||
c, err := l.sock.prepareIo()
|
||||
if err != nil {
|
||||
return nil, l.opErr("accept", err)
|
||||
}
|
||||
defer l.sock.wg.Done()
|
||||
|
||||
// AcceptEx, per documentation, requires an extra 16 bytes per address.
|
||||
const addrlen = uint32(16 + unsafe.Sizeof(rawHvsockAddr{}))
|
||||
var addrbuf [addrlen * 2]byte
|
||||
|
||||
var bytes uint32
|
||||
err = syscall.AcceptEx(l.sock.handle, sock.handle, &addrbuf[0], 0, addrlen, addrlen, &bytes, &c.o)
|
||||
_, err = l.sock.asyncIo(c, nil, bytes, err)
|
||||
if err != nil {
|
||||
return nil, l.opErr("accept", os.NewSyscallError("acceptex", err))
|
||||
}
|
||||
conn := &HvsockConn{
|
||||
sock: sock,
|
||||
}
|
||||
conn.local.fromRaw((*rawHvsockAddr)(unsafe.Pointer(&addrbuf[0])))
|
||||
conn.remote.fromRaw((*rawHvsockAddr)(unsafe.Pointer(&addrbuf[addrlen])))
|
||||
sock = nil
|
||||
return conn, nil
|
||||
}
|
||||
|
||||
// Close closes the listener, causing any pending Accept calls to fail.
|
||||
func (l *HvsockListener) Close() error {
|
||||
return l.sock.Close()
|
||||
}
|
||||
|
||||
/* Need to finish ConnectEx handling
|
||||
func DialHvsock(ctx context.Context, addr *HvsockAddr) (*HvsockConn, error) {
|
||||
sock, err := newHvSocket()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
defer func() {
|
||||
if sock != nil {
|
||||
sock.Close()
|
||||
}
|
||||
}()
|
||||
c, err := sock.prepareIo()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
defer sock.wg.Done()
|
||||
var bytes uint32
|
||||
err = windows.ConnectEx(windows.Handle(sock.handle), sa, nil, 0, &bytes, &c.o)
|
||||
_, err = sock.asyncIo(ctx, c, nil, bytes, err)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
conn := &HvsockConn{
|
||||
sock: sock,
|
||||
remote: *addr,
|
||||
}
|
||||
sock = nil
|
||||
return conn, nil
|
||||
}
|
||||
*/
|
||||
|
||||
func (conn *HvsockConn) opErr(op string, err error) error {
|
||||
return &net.OpError{Op: op, Net: "hvsock", Source: &conn.local, Addr: &conn.remote, Err: err}
|
||||
}
|
||||
|
||||
func (conn *HvsockConn) Read(b []byte) (int, error) {
|
||||
c, err := conn.sock.prepareIo()
|
||||
if err != nil {
|
||||
return 0, conn.opErr("read", err)
|
||||
}
|
||||
defer conn.sock.wg.Done()
|
||||
buf := syscall.WSABuf{Buf: &b[0], Len: uint32(len(b))}
|
||||
var flags, bytes uint32
|
||||
err = syscall.WSARecv(conn.sock.handle, &buf, 1, &bytes, &flags, &c.o, nil)
|
||||
n, err := conn.sock.asyncIo(c, &conn.sock.readDeadline, bytes, err)
|
||||
if err != nil {
|
||||
if _, ok := err.(syscall.Errno); ok {
|
||||
err = os.NewSyscallError("wsarecv", err)
|
||||
}
|
||||
return 0, conn.opErr("read", err)
|
||||
} else if n == 0 {
|
||||
err = io.EOF
|
||||
}
|
||||
return n, err
|
||||
}
|
||||
|
||||
func (conn *HvsockConn) Write(b []byte) (int, error) {
|
||||
t := 0
|
||||
for len(b) != 0 {
|
||||
n, err := conn.write(b)
|
||||
if err != nil {
|
||||
return t + n, err
|
||||
}
|
||||
t += n
|
||||
b = b[n:]
|
||||
}
|
||||
return t, nil
|
||||
}
|
||||
|
||||
func (conn *HvsockConn) write(b []byte) (int, error) {
|
||||
c, err := conn.sock.prepareIo()
|
||||
if err != nil {
|
||||
return 0, conn.opErr("write", err)
|
||||
}
|
||||
defer conn.sock.wg.Done()
|
||||
buf := syscall.WSABuf{Buf: &b[0], Len: uint32(len(b))}
|
||||
var bytes uint32
|
||||
err = syscall.WSASend(conn.sock.handle, &buf, 1, &bytes, 0, &c.o, nil)
|
||||
n, err := conn.sock.asyncIo(c, &conn.sock.writeDeadline, bytes, err)
|
||||
if err != nil {
|
||||
if _, ok := err.(syscall.Errno); ok {
|
||||
err = os.NewSyscallError("wsasend", err)
|
||||
}
|
||||
return 0, conn.opErr("write", err)
|
||||
}
|
||||
return n, err
|
||||
}
|
||||
|
||||
// Close closes the socket connection, failing any pending read or write calls.
|
||||
func (conn *HvsockConn) Close() error {
|
||||
return conn.sock.Close()
|
||||
}
|
||||
|
||||
func (conn *HvsockConn) shutdown(how int) error {
|
||||
err := syscall.Shutdown(conn.sock.handle, syscall.SHUT_RD)
|
||||
if err != nil {
|
||||
return os.NewSyscallError("shutdown", err)
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// CloseRead shuts down the read end of the socket.
|
||||
func (conn *HvsockConn) CloseRead() error {
|
||||
err := conn.shutdown(syscall.SHUT_RD)
|
||||
if err != nil {
|
||||
return conn.opErr("close", err)
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// CloseWrite shuts down the write end of the socket, notifying the other endpoint that
|
||||
// no more data will be written.
|
||||
func (conn *HvsockConn) CloseWrite() error {
|
||||
err := conn.shutdown(syscall.SHUT_WR)
|
||||
if err != nil {
|
||||
return conn.opErr("close", err)
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// LocalAddr returns the local address of the connection.
|
||||
func (conn *HvsockConn) LocalAddr() net.Addr {
|
||||
return &conn.local
|
||||
}
|
||||
|
||||
// RemoteAddr returns the remote address of the connection.
|
||||
func (conn *HvsockConn) RemoteAddr() net.Addr {
|
||||
return &conn.remote
|
||||
}
|
||||
|
||||
// SetDeadline implements the net.Conn SetDeadline method.
|
||||
func (conn *HvsockConn) SetDeadline(t time.Time) error {
|
||||
conn.SetReadDeadline(t)
|
||||
conn.SetWriteDeadline(t)
|
||||
return nil
|
||||
}
|
||||
|
||||
// SetReadDeadline implements the net.Conn SetReadDeadline method.
|
||||
func (conn *HvsockConn) SetReadDeadline(t time.Time) error {
|
||||
return conn.sock.SetReadDeadline(t)
|
||||
}
|
||||
|
||||
// SetWriteDeadline implements the net.Conn SetWriteDeadline method.
|
||||
func (conn *HvsockConn) SetWriteDeadline(t time.Time) error {
|
||||
return conn.sock.SetWriteDeadline(t)
|
||||
}
|
||||
247
vendor/github.com/Microsoft/go-winio/pipe.go
generated
vendored
247
vendor/github.com/Microsoft/go-winio/pipe.go
generated
vendored
@@ -3,10 +3,13 @@
|
||||
package winio
|
||||
|
||||
import (
|
||||
"context"
|
||||
"errors"
|
||||
"fmt"
|
||||
"io"
|
||||
"net"
|
||||
"os"
|
||||
"runtime"
|
||||
"syscall"
|
||||
"time"
|
||||
"unsafe"
|
||||
@@ -18,6 +21,48 @@ import (
|
||||
//sys getNamedPipeInfo(pipe syscall.Handle, flags *uint32, outSize *uint32, inSize *uint32, maxInstances *uint32) (err error) = GetNamedPipeInfo
|
||||
//sys getNamedPipeHandleState(pipe syscall.Handle, state *uint32, curInstances *uint32, maxCollectionCount *uint32, collectDataTimeout *uint32, userName *uint16, maxUserNameSize uint32) (err error) = GetNamedPipeHandleStateW
|
||||
//sys localAlloc(uFlags uint32, length uint32) (ptr uintptr) = LocalAlloc
|
||||
//sys ntCreateNamedPipeFile(pipe *syscall.Handle, access uint32, oa *objectAttributes, iosb *ioStatusBlock, share uint32, disposition uint32, options uint32, typ uint32, readMode uint32, completionMode uint32, maxInstances uint32, inboundQuota uint32, outputQuota uint32, timeout *int64) (status ntstatus) = ntdll.NtCreateNamedPipeFile
|
||||
//sys rtlNtStatusToDosError(status ntstatus) (winerr error) = ntdll.RtlNtStatusToDosErrorNoTeb
|
||||
//sys rtlDosPathNameToNtPathName(name *uint16, ntName *unicodeString, filePart uintptr, reserved uintptr) (status ntstatus) = ntdll.RtlDosPathNameToNtPathName_U
|
||||
//sys rtlDefaultNpAcl(dacl *uintptr) (status ntstatus) = ntdll.RtlDefaultNpAcl
|
||||
|
||||
type ioStatusBlock struct {
|
||||
Status, Information uintptr
|
||||
}
|
||||
|
||||
type objectAttributes struct {
|
||||
Length uintptr
|
||||
RootDirectory uintptr
|
||||
ObjectName *unicodeString
|
||||
Attributes uintptr
|
||||
SecurityDescriptor *securityDescriptor
|
||||
SecurityQoS uintptr
|
||||
}
|
||||
|
||||
type unicodeString struct {
|
||||
Length uint16
|
||||
MaximumLength uint16
|
||||
Buffer uintptr
|
||||
}
|
||||
|
||||
type securityDescriptor struct {
|
||||
Revision byte
|
||||
Sbz1 byte
|
||||
Control uint16
|
||||
Owner uintptr
|
||||
Group uintptr
|
||||
Sacl uintptr
|
||||
Dacl uintptr
|
||||
}
|
||||
|
||||
type ntstatus int32
|
||||
|
||||
func (status ntstatus) Err() error {
|
||||
if status >= 0 {
|
||||
return nil
|
||||
}
|
||||
return rtlNtStatusToDosError(status)
|
||||
}
|
||||
|
||||
const (
|
||||
cERROR_PIPE_BUSY = syscall.Errno(231)
|
||||
@@ -25,21 +70,20 @@ const (
|
||||
cERROR_PIPE_CONNECTED = syscall.Errno(535)
|
||||
cERROR_SEM_TIMEOUT = syscall.Errno(121)
|
||||
|
||||
cPIPE_ACCESS_DUPLEX = 0x3
|
||||
cFILE_FLAG_FIRST_PIPE_INSTANCE = 0x80000
|
||||
cSECURITY_SQOS_PRESENT = 0x100000
|
||||
cSECURITY_ANONYMOUS = 0
|
||||
|
||||
cPIPE_REJECT_REMOTE_CLIENTS = 0x8
|
||||
|
||||
cPIPE_UNLIMITED_INSTANCES = 255
|
||||
|
||||
cNMPWAIT_USE_DEFAULT_WAIT = 0
|
||||
cNMPWAIT_NOWAIT = 1
|
||||
cSECURITY_SQOS_PRESENT = 0x100000
|
||||
cSECURITY_ANONYMOUS = 0
|
||||
|
||||
cPIPE_TYPE_MESSAGE = 4
|
||||
|
||||
cPIPE_READMODE_MESSAGE = 2
|
||||
|
||||
cFILE_OPEN = 1
|
||||
cFILE_CREATE = 2
|
||||
|
||||
cFILE_PIPE_MESSAGE_TYPE = 1
|
||||
cFILE_PIPE_REJECT_REMOTE_CLIENTS = 2
|
||||
|
||||
cSE_DACL_PRESENT = 4
|
||||
)
|
||||
|
||||
var (
|
||||
@@ -137,9 +181,30 @@ func (s pipeAddress) String() string {
|
||||
return string(s)
|
||||
}
|
||||
|
||||
// tryDialPipe attempts to dial the pipe at `path` until `ctx` cancellation or timeout.
|
||||
func tryDialPipe(ctx context.Context, path *string) (syscall.Handle, error) {
|
||||
for {
|
||||
select {
|
||||
case <-ctx.Done():
|
||||
return syscall.Handle(0), ctx.Err()
|
||||
default:
|
||||
h, err := createFile(*path, syscall.GENERIC_READ|syscall.GENERIC_WRITE, 0, nil, syscall.OPEN_EXISTING, syscall.FILE_FLAG_OVERLAPPED|cSECURITY_SQOS_PRESENT|cSECURITY_ANONYMOUS, 0)
|
||||
if err == nil {
|
||||
return h, nil
|
||||
}
|
||||
if err != cERROR_PIPE_BUSY {
|
||||
return h, &os.PathError{Err: err, Op: "open", Path: *path}
|
||||
}
|
||||
// Wait 10 msec and try again. This is a rather simplistic
|
||||
// view, as we always try each 10 milliseconds.
|
||||
time.Sleep(time.Millisecond * 10)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// DialPipe connects to a named pipe by path, timing out if the connection
|
||||
// takes longer than the specified duration. If timeout is nil, then we use
|
||||
// a default timeout of 5 seconds. (We do not use WaitNamedPipe.)
|
||||
// a default timeout of 2 seconds. (We do not use WaitNamedPipe.)
|
||||
func DialPipe(path string, timeout *time.Duration) (net.Conn, error) {
|
||||
var absTimeout time.Time
|
||||
if timeout != nil {
|
||||
@@ -147,23 +212,22 @@ func DialPipe(path string, timeout *time.Duration) (net.Conn, error) {
|
||||
} else {
|
||||
absTimeout = time.Now().Add(time.Second * 2)
|
||||
}
|
||||
ctx, _ := context.WithDeadline(context.Background(), absTimeout)
|
||||
conn, err := DialPipeContext(ctx, path)
|
||||
if err == context.DeadlineExceeded {
|
||||
return nil, ErrTimeout
|
||||
}
|
||||
return conn, err
|
||||
}
|
||||
|
||||
// DialPipeContext attempts to connect to a named pipe by `path` until `ctx`
|
||||
// cancellation or timeout.
|
||||
func DialPipeContext(ctx context.Context, path string) (net.Conn, error) {
|
||||
var err error
|
||||
var h syscall.Handle
|
||||
for {
|
||||
h, err = createFile(path, syscall.GENERIC_READ|syscall.GENERIC_WRITE, 0, nil, syscall.OPEN_EXISTING, syscall.FILE_FLAG_OVERLAPPED|cSECURITY_SQOS_PRESENT|cSECURITY_ANONYMOUS, 0)
|
||||
if err != cERROR_PIPE_BUSY {
|
||||
break
|
||||
}
|
||||
if time.Now().After(absTimeout) {
|
||||
return nil, ErrTimeout
|
||||
}
|
||||
|
||||
// Wait 10 msec and try again. This is a rather simplistic
|
||||
// view, as we always try each 10 milliseconds.
|
||||
time.Sleep(time.Millisecond * 10)
|
||||
}
|
||||
h, err = tryDialPipe(ctx, &path)
|
||||
if err != nil {
|
||||
return nil, &os.PathError{Op: "open", Path: path, Err: err}
|
||||
return nil, err
|
||||
}
|
||||
|
||||
var flags uint32
|
||||
@@ -194,43 +258,87 @@ type acceptResponse struct {
|
||||
}
|
||||
|
||||
type win32PipeListener struct {
|
||||
firstHandle syscall.Handle
|
||||
path string
|
||||
securityDescriptor []byte
|
||||
config PipeConfig
|
||||
acceptCh chan (chan acceptResponse)
|
||||
closeCh chan int
|
||||
doneCh chan int
|
||||
firstHandle syscall.Handle
|
||||
path string
|
||||
config PipeConfig
|
||||
acceptCh chan (chan acceptResponse)
|
||||
closeCh chan int
|
||||
doneCh chan int
|
||||
}
|
||||
|
||||
func makeServerPipeHandle(path string, securityDescriptor []byte, c *PipeConfig, first bool) (syscall.Handle, error) {
|
||||
var flags uint32 = cPIPE_ACCESS_DUPLEX | syscall.FILE_FLAG_OVERLAPPED
|
||||
if first {
|
||||
flags |= cFILE_FLAG_FIRST_PIPE_INSTANCE
|
||||
}
|
||||
|
||||
var mode uint32 = cPIPE_REJECT_REMOTE_CLIENTS
|
||||
if c.MessageMode {
|
||||
mode |= cPIPE_TYPE_MESSAGE
|
||||
}
|
||||
|
||||
sa := &syscall.SecurityAttributes{}
|
||||
sa.Length = uint32(unsafe.Sizeof(*sa))
|
||||
if securityDescriptor != nil {
|
||||
len := uint32(len(securityDescriptor))
|
||||
sa.SecurityDescriptor = localAlloc(0, len)
|
||||
defer localFree(sa.SecurityDescriptor)
|
||||
copy((*[0xffff]byte)(unsafe.Pointer(sa.SecurityDescriptor))[:], securityDescriptor)
|
||||
}
|
||||
h, err := createNamedPipe(path, flags, mode, cPIPE_UNLIMITED_INSTANCES, uint32(c.OutputBufferSize), uint32(c.InputBufferSize), 0, sa)
|
||||
func makeServerPipeHandle(path string, sd []byte, c *PipeConfig, first bool) (syscall.Handle, error) {
|
||||
path16, err := syscall.UTF16FromString(path)
|
||||
if err != nil {
|
||||
return 0, &os.PathError{Op: "open", Path: path, Err: err}
|
||||
}
|
||||
|
||||
var oa objectAttributes
|
||||
oa.Length = unsafe.Sizeof(oa)
|
||||
|
||||
var ntPath unicodeString
|
||||
if err := rtlDosPathNameToNtPathName(&path16[0], &ntPath, 0, 0).Err(); err != nil {
|
||||
return 0, &os.PathError{Op: "open", Path: path, Err: err}
|
||||
}
|
||||
defer localFree(ntPath.Buffer)
|
||||
oa.ObjectName = &ntPath
|
||||
|
||||
// The security descriptor is only needed for the first pipe.
|
||||
if first {
|
||||
if sd != nil {
|
||||
len := uint32(len(sd))
|
||||
sdb := localAlloc(0, len)
|
||||
defer localFree(sdb)
|
||||
copy((*[0xffff]byte)(unsafe.Pointer(sdb))[:], sd)
|
||||
oa.SecurityDescriptor = (*securityDescriptor)(unsafe.Pointer(sdb))
|
||||
} else {
|
||||
// Construct the default named pipe security descriptor.
|
||||
var dacl uintptr
|
||||
if err := rtlDefaultNpAcl(&dacl).Err(); err != nil {
|
||||
return 0, fmt.Errorf("getting default named pipe ACL: %s", err)
|
||||
}
|
||||
defer localFree(dacl)
|
||||
|
||||
sdb := &securityDescriptor{
|
||||
Revision: 1,
|
||||
Control: cSE_DACL_PRESENT,
|
||||
Dacl: dacl,
|
||||
}
|
||||
oa.SecurityDescriptor = sdb
|
||||
}
|
||||
}
|
||||
|
||||
typ := uint32(cFILE_PIPE_REJECT_REMOTE_CLIENTS)
|
||||
if c.MessageMode {
|
||||
typ |= cFILE_PIPE_MESSAGE_TYPE
|
||||
}
|
||||
|
||||
disposition := uint32(cFILE_OPEN)
|
||||
access := uint32(syscall.GENERIC_READ | syscall.GENERIC_WRITE | syscall.SYNCHRONIZE)
|
||||
if first {
|
||||
disposition = cFILE_CREATE
|
||||
// By not asking for read or write access, the named pipe file system
|
||||
// will put this pipe into an initially disconnected state, blocking
|
||||
// client connections until the next call with first == false.
|
||||
access = syscall.SYNCHRONIZE
|
||||
}
|
||||
|
||||
timeout := int64(-50 * 10000) // 50ms
|
||||
|
||||
var (
|
||||
h syscall.Handle
|
||||
iosb ioStatusBlock
|
||||
)
|
||||
err = ntCreateNamedPipeFile(&h, access, &oa, &iosb, syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE, disposition, 0, typ, 0, 0, 0xffffffff, uint32(c.InputBufferSize), uint32(c.OutputBufferSize), &timeout).Err()
|
||||
if err != nil {
|
||||
return 0, &os.PathError{Op: "open", Path: path, Err: err}
|
||||
}
|
||||
|
||||
runtime.KeepAlive(ntPath)
|
||||
return h, nil
|
||||
}
|
||||
|
||||
func (l *win32PipeListener) makeServerPipe() (*win32File, error) {
|
||||
h, err := makeServerPipeHandle(l.path, l.securityDescriptor, &l.config, false)
|
||||
h, err := makeServerPipeHandle(l.path, nil, &l.config, false)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
@@ -341,32 +449,13 @@ func ListenPipe(path string, c *PipeConfig) (net.Listener, error) {
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
// Create a client handle and connect it. This results in the pipe
|
||||
// instance always existing, so that clients see ERROR_PIPE_BUSY
|
||||
// rather than ERROR_FILE_NOT_FOUND. This ties the first instance
|
||||
// up so that no other instances can be used. This would have been
|
||||
// cleaner if the Win32 API matched CreateFile with ConnectNamedPipe
|
||||
// instead of CreateNamedPipe. (Apparently created named pipes are
|
||||
// considered to be in listening state regardless of whether any
|
||||
// active calls to ConnectNamedPipe are outstanding.)
|
||||
h2, err := createFile(path, 0, 0, nil, syscall.OPEN_EXISTING, cSECURITY_SQOS_PRESENT|cSECURITY_ANONYMOUS, 0)
|
||||
if err != nil {
|
||||
syscall.Close(h)
|
||||
return nil, err
|
||||
}
|
||||
// Close the client handle. The server side of the instance will
|
||||
// still be busy, leading to ERROR_PIPE_BUSY instead of
|
||||
// ERROR_NOT_FOUND, as long as we don't close the server handle,
|
||||
// or disconnect the client with DisconnectNamedPipe.
|
||||
syscall.Close(h2)
|
||||
l := &win32PipeListener{
|
||||
firstHandle: h,
|
||||
path: path,
|
||||
securityDescriptor: sd,
|
||||
config: *c,
|
||||
acceptCh: make(chan (chan acceptResponse)),
|
||||
closeCh: make(chan int),
|
||||
doneCh: make(chan int),
|
||||
firstHandle: h,
|
||||
path: path,
|
||||
config: *c,
|
||||
acceptCh: make(chan (chan acceptResponse)),
|
||||
closeCh: make(chan int),
|
||||
doneCh: make(chan int),
|
||||
}
|
||||
go l.listenerRoutine()
|
||||
return l, nil
|
||||
|
||||
235
vendor/github.com/Microsoft/go-winio/pkg/guid/guid.go
generated
vendored
Normal file
235
vendor/github.com/Microsoft/go-winio/pkg/guid/guid.go
generated
vendored
Normal file
@@ -0,0 +1,235 @@
|
||||
// Package guid provides a GUID type. The backing structure for a GUID is
|
||||
// identical to that used by the golang.org/x/sys/windows GUID type.
|
||||
// There are two main binary encodings used for a GUID, the big-endian encoding,
|
||||
// and the Windows (mixed-endian) encoding. See here for details:
|
||||
// https://en.wikipedia.org/wiki/Universally_unique_identifier#Encoding
|
||||
package guid
|
||||
|
||||
import (
|
||||
"crypto/rand"
|
||||
"crypto/sha1"
|
||||
"encoding"
|
||||
"encoding/binary"
|
||||
"fmt"
|
||||
"strconv"
|
||||
|
||||
"golang.org/x/sys/windows"
|
||||
)
|
||||
|
||||
// Variant specifies which GUID variant (or "type") of the GUID. It determines
|
||||
// how the entirety of the rest of the GUID is interpreted.
|
||||
type Variant uint8
|
||||
|
||||
// The variants specified by RFC 4122.
|
||||
const (
|
||||
// VariantUnknown specifies a GUID variant which does not conform to one of
|
||||
// the variant encodings specified in RFC 4122.
|
||||
VariantUnknown Variant = iota
|
||||
VariantNCS
|
||||
VariantRFC4122
|
||||
VariantMicrosoft
|
||||
VariantFuture
|
||||
)
|
||||
|
||||
// Version specifies how the bits in the GUID were generated. For instance, a
|
||||
// version 4 GUID is randomly generated, and a version 5 is generated from the
|
||||
// hash of an input string.
|
||||
type Version uint8
|
||||
|
||||
var _ = (encoding.TextMarshaler)(GUID{})
|
||||
var _ = (encoding.TextUnmarshaler)(&GUID{})
|
||||
|
||||
// GUID represents a GUID/UUID. It has the same structure as
|
||||
// golang.org/x/sys/windows.GUID so that it can be used with functions expecting
|
||||
// that type. It is defined as its own type so that stringification and
|
||||
// marshaling can be supported. The representation matches that used by native
|
||||
// Windows code.
|
||||
type GUID windows.GUID
|
||||
|
||||
// NewV4 returns a new version 4 (pseudorandom) GUID, as defined by RFC 4122.
|
||||
func NewV4() (GUID, error) {
|
||||
var b [16]byte
|
||||
if _, err := rand.Read(b[:]); err != nil {
|
||||
return GUID{}, err
|
||||
}
|
||||
|
||||
g := FromArray(b)
|
||||
g.setVersion(4) // Version 4 means randomly generated.
|
||||
g.setVariant(VariantRFC4122)
|
||||
|
||||
return g, nil
|
||||
}
|
||||
|
||||
// NewV5 returns a new version 5 (generated from a string via SHA-1 hashing)
|
||||
// GUID, as defined by RFC 4122. The RFC is unclear on the encoding of the name,
|
||||
// and the sample code treats it as a series of bytes, so we do the same here.
|
||||
//
|
||||
// Some implementations, such as those found on Windows, treat the name as a
|
||||
// big-endian UTF16 stream of bytes. If that is desired, the string can be
|
||||
// encoded as such before being passed to this function.
|
||||
func NewV5(namespace GUID, name []byte) (GUID, error) {
|
||||
b := sha1.New()
|
||||
namespaceBytes := namespace.ToArray()
|
||||
b.Write(namespaceBytes[:])
|
||||
b.Write(name)
|
||||
|
||||
a := [16]byte{}
|
||||
copy(a[:], b.Sum(nil))
|
||||
|
||||
g := FromArray(a)
|
||||
g.setVersion(5) // Version 5 means generated from a string.
|
||||
g.setVariant(VariantRFC4122)
|
||||
|
||||
return g, nil
|
||||
}
|
||||
|
||||
func fromArray(b [16]byte, order binary.ByteOrder) GUID {
|
||||
var g GUID
|
||||
g.Data1 = order.Uint32(b[0:4])
|
||||
g.Data2 = order.Uint16(b[4:6])
|
||||
g.Data3 = order.Uint16(b[6:8])
|
||||
copy(g.Data4[:], b[8:16])
|
||||
return g
|
||||
}
|
||||
|
||||
func (g GUID) toArray(order binary.ByteOrder) [16]byte {
|
||||
b := [16]byte{}
|
||||
order.PutUint32(b[0:4], g.Data1)
|
||||
order.PutUint16(b[4:6], g.Data2)
|
||||
order.PutUint16(b[6:8], g.Data3)
|
||||
copy(b[8:16], g.Data4[:])
|
||||
return b
|
||||
}
|
||||
|
||||
// FromArray constructs a GUID from a big-endian encoding array of 16 bytes.
|
||||
func FromArray(b [16]byte) GUID {
|
||||
return fromArray(b, binary.BigEndian)
|
||||
}
|
||||
|
||||
// ToArray returns an array of 16 bytes representing the GUID in big-endian
|
||||
// encoding.
|
||||
func (g GUID) ToArray() [16]byte {
|
||||
return g.toArray(binary.BigEndian)
|
||||
}
|
||||
|
||||
// FromWindowsArray constructs a GUID from a Windows encoding array of bytes.
|
||||
func FromWindowsArray(b [16]byte) GUID {
|
||||
return fromArray(b, binary.LittleEndian)
|
||||
}
|
||||
|
||||
// ToWindowsArray returns an array of 16 bytes representing the GUID in Windows
|
||||
// encoding.
|
||||
func (g GUID) ToWindowsArray() [16]byte {
|
||||
return g.toArray(binary.LittleEndian)
|
||||
}
|
||||
|
||||
func (g GUID) String() string {
|
||||
return fmt.Sprintf(
|
||||
"%08x-%04x-%04x-%04x-%012x",
|
||||
g.Data1,
|
||||
g.Data2,
|
||||
g.Data3,
|
||||
g.Data4[:2],
|
||||
g.Data4[2:])
|
||||
}
|
||||
|
||||
// FromString parses a string containing a GUID and returns the GUID. The only
|
||||
// format currently supported is the `xxxxxxxx-xxxx-xxxx-xxxx-xxxxxxxxxxxx`
|
||||
// format.
|
||||
func FromString(s string) (GUID, error) {
|
||||
if len(s) != 36 {
|
||||
return GUID{}, fmt.Errorf("invalid GUID %q", s)
|
||||
}
|
||||
if s[8] != '-' || s[13] != '-' || s[18] != '-' || s[23] != '-' {
|
||||
return GUID{}, fmt.Errorf("invalid GUID %q", s)
|
||||
}
|
||||
|
||||
var g GUID
|
||||
|
||||
data1, err := strconv.ParseUint(s[0:8], 16, 32)
|
||||
if err != nil {
|
||||
return GUID{}, fmt.Errorf("invalid GUID %q", s)
|
||||
}
|
||||
g.Data1 = uint32(data1)
|
||||
|
||||
data2, err := strconv.ParseUint(s[9:13], 16, 16)
|
||||
if err != nil {
|
||||
return GUID{}, fmt.Errorf("invalid GUID %q", s)
|
||||
}
|
||||
g.Data2 = uint16(data2)
|
||||
|
||||
data3, err := strconv.ParseUint(s[14:18], 16, 16)
|
||||
if err != nil {
|
||||
return GUID{}, fmt.Errorf("invalid GUID %q", s)
|
||||
}
|
||||
g.Data3 = uint16(data3)
|
||||
|
||||
for i, x := range []int{19, 21, 24, 26, 28, 30, 32, 34} {
|
||||
v, err := strconv.ParseUint(s[x:x+2], 16, 8)
|
||||
if err != nil {
|
||||
return GUID{}, fmt.Errorf("invalid GUID %q", s)
|
||||
}
|
||||
g.Data4[i] = uint8(v)
|
||||
}
|
||||
|
||||
return g, nil
|
||||
}
|
||||
|
||||
func (g *GUID) setVariant(v Variant) {
|
||||
d := g.Data4[0]
|
||||
switch v {
|
||||
case VariantNCS:
|
||||
d = (d & 0x7f)
|
||||
case VariantRFC4122:
|
||||
d = (d & 0x3f) | 0x80
|
||||
case VariantMicrosoft:
|
||||
d = (d & 0x1f) | 0xc0
|
||||
case VariantFuture:
|
||||
d = (d & 0x0f) | 0xe0
|
||||
case VariantUnknown:
|
||||
fallthrough
|
||||
default:
|
||||
panic(fmt.Sprintf("invalid variant: %d", v))
|
||||
}
|
||||
g.Data4[0] = d
|
||||
}
|
||||
|
||||
// Variant returns the GUID variant, as defined in RFC 4122.
|
||||
func (g GUID) Variant() Variant {
|
||||
b := g.Data4[0]
|
||||
if b&0x80 == 0 {
|
||||
return VariantNCS
|
||||
} else if b&0xc0 == 0x80 {
|
||||
return VariantRFC4122
|
||||
} else if b&0xe0 == 0xc0 {
|
||||
return VariantMicrosoft
|
||||
} else if b&0xe0 == 0xe0 {
|
||||
return VariantFuture
|
||||
}
|
||||
return VariantUnknown
|
||||
}
|
||||
|
||||
func (g *GUID) setVersion(v Version) {
|
||||
g.Data3 = (g.Data3 & 0x0fff) | (uint16(v) << 12)
|
||||
}
|
||||
|
||||
// Version returns the GUID version, as defined in RFC 4122.
|
||||
func (g GUID) Version() Version {
|
||||
return Version((g.Data3 & 0xF000) >> 12)
|
||||
}
|
||||
|
||||
// MarshalText returns the textual representation of the GUID.
|
||||
func (g GUID) MarshalText() ([]byte, error) {
|
||||
return []byte(g.String()), nil
|
||||
}
|
||||
|
||||
// UnmarshalText takes the textual representation of a GUID, and unmarhals it
|
||||
// into this GUID.
|
||||
func (g *GUID) UnmarshalText(text []byte) error {
|
||||
g2, err := FromString(string(text))
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
*g = g2
|
||||
return nil
|
||||
}
|
||||
2
vendor/github.com/Microsoft/go-winio/syscall.go
generated
vendored
2
vendor/github.com/Microsoft/go-winio/syscall.go
generated
vendored
@@ -1,3 +1,3 @@
|
||||
package winio
|
||||
|
||||
//go:generate go run $GOROOT/src/syscall/mksyscall_windows.go -output zsyscall_windows.go file.go pipe.go sd.go fileinfo.go privilege.go backup.go
|
||||
//go:generate go run $GOROOT/src/syscall/mksyscall_windows.go -output zsyscall_windows.go file.go pipe.go sd.go fileinfo.go privilege.go backup.go hvsock.go
|
||||
|
||||
151
vendor/github.com/Microsoft/go-winio/vhd/vhd.go
generated
vendored
Normal file
151
vendor/github.com/Microsoft/go-winio/vhd/vhd.go
generated
vendored
Normal file
@@ -0,0 +1,151 @@
|
||||
// +build windows
|
||||
|
||||
package vhd
|
||||
|
||||
import "syscall"
|
||||
|
||||
//go:generate go run mksyscall_windows.go -output zvhd.go vhd.go
|
||||
|
||||
//sys createVirtualDisk(virtualStorageType *virtualStorageType, path string, virtualDiskAccessMask uint32, securityDescriptor *uintptr, flags uint32, providerSpecificFlags uint32, parameters *createVirtualDiskParameters, o *syscall.Overlapped, handle *syscall.Handle) (err error) [failretval != 0] = VirtDisk.CreateVirtualDisk
|
||||
//sys openVirtualDisk(virtualStorageType *virtualStorageType, path string, virtualDiskAccessMask uint32, flags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (err error) [failretval != 0] = VirtDisk.OpenVirtualDisk
|
||||
//sys detachVirtualDisk(handle syscall.Handle, flags uint32, providerSpecificFlags uint32) (err error) [failretval != 0] = VirtDisk.DetachVirtualDisk
|
||||
|
||||
type virtualStorageType struct {
|
||||
DeviceID uint32
|
||||
VendorID [16]byte
|
||||
}
|
||||
|
||||
type (
|
||||
createVirtualDiskFlag uint32
|
||||
VirtualDiskAccessMask uint32
|
||||
VirtualDiskFlag uint32
|
||||
)
|
||||
|
||||
const (
|
||||
// Flags for creating a VHD (not exported)
|
||||
createVirtualDiskFlagNone createVirtualDiskFlag = 0
|
||||
createVirtualDiskFlagFullPhysicalAllocation createVirtualDiskFlag = 1
|
||||
createVirtualDiskFlagPreventWritesToSourceDisk createVirtualDiskFlag = 2
|
||||
createVirtualDiskFlagDoNotCopyMetadataFromParent createVirtualDiskFlag = 4
|
||||
|
||||
// Access Mask for opening a VHD
|
||||
VirtualDiskAccessNone VirtualDiskAccessMask = 0
|
||||
VirtualDiskAccessAttachRO VirtualDiskAccessMask = 65536
|
||||
VirtualDiskAccessAttachRW VirtualDiskAccessMask = 131072
|
||||
VirtualDiskAccessDetach VirtualDiskAccessMask = 262144
|
||||
VirtualDiskAccessGetInfo VirtualDiskAccessMask = 524288
|
||||
VirtualDiskAccessCreate VirtualDiskAccessMask = 1048576
|
||||
VirtualDiskAccessMetaOps VirtualDiskAccessMask = 2097152
|
||||
VirtualDiskAccessRead VirtualDiskAccessMask = 851968
|
||||
VirtualDiskAccessAll VirtualDiskAccessMask = 4128768
|
||||
VirtualDiskAccessWritable VirtualDiskAccessMask = 3276800
|
||||
|
||||
// Flags for opening a VHD
|
||||
OpenVirtualDiskFlagNone VirtualDiskFlag = 0
|
||||
OpenVirtualDiskFlagNoParents VirtualDiskFlag = 0x1
|
||||
OpenVirtualDiskFlagBlankFile VirtualDiskFlag = 0x2
|
||||
OpenVirtualDiskFlagBootDrive VirtualDiskFlag = 0x4
|
||||
OpenVirtualDiskFlagCachedIO VirtualDiskFlag = 0x8
|
||||
OpenVirtualDiskFlagCustomDiffChain VirtualDiskFlag = 0x10
|
||||
OpenVirtualDiskFlagParentCachedIO VirtualDiskFlag = 0x20
|
||||
OpenVirtualDiskFlagVhdSetFileOnly VirtualDiskFlag = 0x40
|
||||
OpenVirtualDiskFlagIgnoreRelativeParentLocator VirtualDiskFlag = 0x80
|
||||
OpenVirtualDiskFlagNoWriteHardening VirtualDiskFlag = 0x100
|
||||
)
|
||||
|
||||
type createVersion2 struct {
|
||||
UniqueID [16]byte // GUID
|
||||
MaximumSize uint64
|
||||
BlockSizeInBytes uint32
|
||||
SectorSizeInBytes uint32
|
||||
ParentPath *uint16 // string
|
||||
SourcePath *uint16 // string
|
||||
OpenFlags uint32
|
||||
ParentVirtualStorageType virtualStorageType
|
||||
SourceVirtualStorageType virtualStorageType
|
||||
ResiliencyGUID [16]byte // GUID
|
||||
}
|
||||
|
||||
type createVirtualDiskParameters struct {
|
||||
Version uint32 // Must always be set to 2
|
||||
Version2 createVersion2
|
||||
}
|
||||
|
||||
type openVersion2 struct {
|
||||
GetInfoOnly int32 // bool but 4-byte aligned
|
||||
ReadOnly int32 // bool but 4-byte aligned
|
||||
ResiliencyGUID [16]byte // GUID
|
||||
}
|
||||
|
||||
type openVirtualDiskParameters struct {
|
||||
Version uint32 // Must always be set to 2
|
||||
Version2 openVersion2
|
||||
}
|
||||
|
||||
// CreateVhdx will create a simple vhdx file at the given path using default values.
|
||||
func CreateVhdx(path string, maxSizeInGb, blockSizeInMb uint32) error {
|
||||
var (
|
||||
defaultType virtualStorageType
|
||||
handle syscall.Handle
|
||||
)
|
||||
|
||||
parameters := createVirtualDiskParameters{
|
||||
Version: 2,
|
||||
Version2: createVersion2{
|
||||
MaximumSize: uint64(maxSizeInGb) * 1024 * 1024 * 1024,
|
||||
BlockSizeInBytes: blockSizeInMb * 1024 * 1024,
|
||||
},
|
||||
}
|
||||
|
||||
if err := createVirtualDisk(
|
||||
&defaultType,
|
||||
path,
|
||||
uint32(VirtualDiskAccessNone),
|
||||
nil,
|
||||
uint32(createVirtualDiskFlagNone),
|
||||
0,
|
||||
¶meters,
|
||||
nil,
|
||||
&handle); err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
if err := syscall.CloseHandle(handle); err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// DetachVhd detaches a mounted container layer vhd found at `path`.
|
||||
func DetachVhd(path string) error {
|
||||
handle, err := OpenVirtualDisk(
|
||||
path,
|
||||
VirtualDiskAccessNone,
|
||||
OpenVirtualDiskFlagCachedIO|OpenVirtualDiskFlagIgnoreRelativeParentLocator)
|
||||
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
defer syscall.CloseHandle(handle)
|
||||
return detachVirtualDisk(handle, 0, 0)
|
||||
}
|
||||
|
||||
// OpenVirtualDisk obtains a handle to a VHD opened with supplied access mask and flags.
|
||||
func OpenVirtualDisk(path string, accessMask VirtualDiskAccessMask, flag VirtualDiskFlag) (syscall.Handle, error) {
|
||||
var (
|
||||
defaultType virtualStorageType
|
||||
handle syscall.Handle
|
||||
)
|
||||
parameters := openVirtualDiskParameters{Version: 2}
|
||||
if err := openVirtualDisk(
|
||||
&defaultType,
|
||||
path,
|
||||
uint32(accessMask),
|
||||
uint32(flag),
|
||||
¶meters,
|
||||
&handle); err != nil {
|
||||
return 0, err
|
||||
}
|
||||
return handle, nil
|
||||
}
|
||||
99
vendor/github.com/Microsoft/go-winio/vhd/zvhd.go
generated
vendored
Normal file
99
vendor/github.com/Microsoft/go-winio/vhd/zvhd.go
generated
vendored
Normal file
@@ -0,0 +1,99 @@
|
||||
// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT
|
||||
|
||||
package vhd
|
||||
|
||||
import (
|
||||
"syscall"
|
||||
"unsafe"
|
||||
|
||||
"golang.org/x/sys/windows"
|
||||
)
|
||||
|
||||
var _ unsafe.Pointer
|
||||
|
||||
// Do the interface allocations only once for common
|
||||
// Errno values.
|
||||
const (
|
||||
errnoERROR_IO_PENDING = 997
|
||||
)
|
||||
|
||||
var (
|
||||
errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
|
||||
)
|
||||
|
||||
// errnoErr returns common boxed Errno values, to prevent
|
||||
// allocations at runtime.
|
||||
func errnoErr(e syscall.Errno) error {
|
||||
switch e {
|
||||
case 0:
|
||||
return nil
|
||||
case errnoERROR_IO_PENDING:
|
||||
return errERROR_IO_PENDING
|
||||
}
|
||||
// TODO: add more here, after collecting data on the common
|
||||
// error values see on Windows. (perhaps when running
|
||||
// all.bat?)
|
||||
return e
|
||||
}
|
||||
|
||||
var (
|
||||
modVirtDisk = windows.NewLazySystemDLL("VirtDisk.dll")
|
||||
|
||||
procCreateVirtualDisk = modVirtDisk.NewProc("CreateVirtualDisk")
|
||||
procOpenVirtualDisk = modVirtDisk.NewProc("OpenVirtualDisk")
|
||||
procDetachVirtualDisk = modVirtDisk.NewProc("DetachVirtualDisk")
|
||||
)
|
||||
|
||||
func createVirtualDisk(virtualStorageType *virtualStorageType, path string, virtualDiskAccessMask uint32, securityDescriptor *uintptr, flags uint32, providerSpecificFlags uint32, parameters *createVirtualDiskParameters, o *syscall.Overlapped, handle *syscall.Handle) (err error) {
|
||||
var _p0 *uint16
|
||||
_p0, err = syscall.UTF16PtrFromString(path)
|
||||
if err != nil {
|
||||
return
|
||||
}
|
||||
return _createVirtualDisk(virtualStorageType, _p0, virtualDiskAccessMask, securityDescriptor, flags, providerSpecificFlags, parameters, o, handle)
|
||||
}
|
||||
|
||||
func _createVirtualDisk(virtualStorageType *virtualStorageType, path *uint16, virtualDiskAccessMask uint32, securityDescriptor *uintptr, flags uint32, providerSpecificFlags uint32, parameters *createVirtualDiskParameters, o *syscall.Overlapped, handle *syscall.Handle) (err error) {
|
||||
r1, _, e1 := syscall.Syscall9(procCreateVirtualDisk.Addr(), 9, uintptr(unsafe.Pointer(virtualStorageType)), uintptr(unsafe.Pointer(path)), uintptr(virtualDiskAccessMask), uintptr(unsafe.Pointer(securityDescriptor)), uintptr(flags), uintptr(providerSpecificFlags), uintptr(unsafe.Pointer(parameters)), uintptr(unsafe.Pointer(o)), uintptr(unsafe.Pointer(handle)))
|
||||
if r1 != 0 {
|
||||
if e1 != 0 {
|
||||
err = errnoErr(e1)
|
||||
} else {
|
||||
err = syscall.EINVAL
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func openVirtualDisk(virtualStorageType *virtualStorageType, path string, virtualDiskAccessMask uint32, flags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (err error) {
|
||||
var _p0 *uint16
|
||||
_p0, err = syscall.UTF16PtrFromString(path)
|
||||
if err != nil {
|
||||
return
|
||||
}
|
||||
return _openVirtualDisk(virtualStorageType, _p0, virtualDiskAccessMask, flags, parameters, handle)
|
||||
}
|
||||
|
||||
func _openVirtualDisk(virtualStorageType *virtualStorageType, path *uint16, virtualDiskAccessMask uint32, flags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (err error) {
|
||||
r1, _, e1 := syscall.Syscall6(procOpenVirtualDisk.Addr(), 6, uintptr(unsafe.Pointer(virtualStorageType)), uintptr(unsafe.Pointer(path)), uintptr(virtualDiskAccessMask), uintptr(flags), uintptr(unsafe.Pointer(parameters)), uintptr(unsafe.Pointer(handle)))
|
||||
if r1 != 0 {
|
||||
if e1 != 0 {
|
||||
err = errnoErr(e1)
|
||||
} else {
|
||||
err = syscall.EINVAL
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func detachVirtualDisk(handle syscall.Handle, flags uint32, providerSpecificFlags uint32) (err error) {
|
||||
r1, _, e1 := syscall.Syscall(procDetachVirtualDisk.Addr(), 3, uintptr(handle), uintptr(flags), uintptr(providerSpecificFlags))
|
||||
if r1 != 0 {
|
||||
if e1 != 0 {
|
||||
err = errnoErr(e1)
|
||||
} else {
|
||||
err = syscall.EINVAL
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
88
vendor/github.com/Microsoft/go-winio/zsyscall_windows.go
generated
vendored
88
vendor/github.com/Microsoft/go-winio/zsyscall_windows.go
generated
vendored
@@ -1,4 +1,4 @@
|
||||
// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT
|
||||
// Code generated by 'go generate'; DO NOT EDIT.
|
||||
|
||||
package winio
|
||||
|
||||
@@ -38,19 +38,25 @@ func errnoErr(e syscall.Errno) error {
|
||||
|
||||
var (
|
||||
modkernel32 = windows.NewLazySystemDLL("kernel32.dll")
|
||||
modws2_32 = windows.NewLazySystemDLL("ws2_32.dll")
|
||||
modntdll = windows.NewLazySystemDLL("ntdll.dll")
|
||||
modadvapi32 = windows.NewLazySystemDLL("advapi32.dll")
|
||||
|
||||
procCancelIoEx = modkernel32.NewProc("CancelIoEx")
|
||||
procCreateIoCompletionPort = modkernel32.NewProc("CreateIoCompletionPort")
|
||||
procGetQueuedCompletionStatus = modkernel32.NewProc("GetQueuedCompletionStatus")
|
||||
procSetFileCompletionNotificationModes = modkernel32.NewProc("SetFileCompletionNotificationModes")
|
||||
procWSAGetOverlappedResult = modws2_32.NewProc("WSAGetOverlappedResult")
|
||||
procConnectNamedPipe = modkernel32.NewProc("ConnectNamedPipe")
|
||||
procCreateNamedPipeW = modkernel32.NewProc("CreateNamedPipeW")
|
||||
procCreateFileW = modkernel32.NewProc("CreateFileW")
|
||||
procWaitNamedPipeW = modkernel32.NewProc("WaitNamedPipeW")
|
||||
procGetNamedPipeInfo = modkernel32.NewProc("GetNamedPipeInfo")
|
||||
procGetNamedPipeHandleStateW = modkernel32.NewProc("GetNamedPipeHandleStateW")
|
||||
procLocalAlloc = modkernel32.NewProc("LocalAlloc")
|
||||
procNtCreateNamedPipeFile = modntdll.NewProc("NtCreateNamedPipeFile")
|
||||
procRtlNtStatusToDosErrorNoTeb = modntdll.NewProc("RtlNtStatusToDosErrorNoTeb")
|
||||
procRtlDosPathNameToNtPathName_U = modntdll.NewProc("RtlDosPathNameToNtPathName_U")
|
||||
procRtlDefaultNpAcl = modntdll.NewProc("RtlDefaultNpAcl")
|
||||
procLookupAccountNameW = modadvapi32.NewProc("LookupAccountNameW")
|
||||
procConvertSidToStringSidW = modadvapi32.NewProc("ConvertSidToStringSidW")
|
||||
procConvertStringSecurityDescriptorToSecurityDescriptorW = modadvapi32.NewProc("ConvertStringSecurityDescriptorToSecurityDescriptorW")
|
||||
@@ -69,6 +75,7 @@ var (
|
||||
procLookupPrivilegeDisplayNameW = modadvapi32.NewProc("LookupPrivilegeDisplayNameW")
|
||||
procBackupRead = modkernel32.NewProc("BackupRead")
|
||||
procBackupWrite = modkernel32.NewProc("BackupWrite")
|
||||
procbind = modws2_32.NewProc("bind")
|
||||
)
|
||||
|
||||
func cancelIoEx(file syscall.Handle, o *syscall.Overlapped) (err error) {
|
||||
@@ -120,6 +127,24 @@ func setFileCompletionNotificationModes(h syscall.Handle, flags uint8) (err erro
|
||||
return
|
||||
}
|
||||
|
||||
func wsaGetOverlappedResult(h syscall.Handle, o *syscall.Overlapped, bytes *uint32, wait bool, flags *uint32) (err error) {
|
||||
var _p0 uint32
|
||||
if wait {
|
||||
_p0 = 1
|
||||
} else {
|
||||
_p0 = 0
|
||||
}
|
||||
r1, _, e1 := syscall.Syscall6(procWSAGetOverlappedResult.Addr(), 5, uintptr(h), uintptr(unsafe.Pointer(o)), uintptr(unsafe.Pointer(bytes)), uintptr(_p0), uintptr(unsafe.Pointer(flags)), 0)
|
||||
if r1 == 0 {
|
||||
if e1 != 0 {
|
||||
err = errnoErr(e1)
|
||||
} else {
|
||||
err = syscall.EINVAL
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func connectNamedPipe(pipe syscall.Handle, o *syscall.Overlapped) (err error) {
|
||||
r1, _, e1 := syscall.Syscall(procConnectNamedPipe.Addr(), 2, uintptr(pipe), uintptr(unsafe.Pointer(o)), 0)
|
||||
if r1 == 0 {
|
||||
@@ -176,27 +201,6 @@ func _createFile(name *uint16, access uint32, mode uint32, sa *syscall.SecurityA
|
||||
return
|
||||
}
|
||||
|
||||
func waitNamedPipe(name string, timeout uint32) (err error) {
|
||||
var _p0 *uint16
|
||||
_p0, err = syscall.UTF16PtrFromString(name)
|
||||
if err != nil {
|
||||
return
|
||||
}
|
||||
return _waitNamedPipe(_p0, timeout)
|
||||
}
|
||||
|
||||
func _waitNamedPipe(name *uint16, timeout uint32) (err error) {
|
||||
r1, _, e1 := syscall.Syscall(procWaitNamedPipeW.Addr(), 2, uintptr(unsafe.Pointer(name)), uintptr(timeout), 0)
|
||||
if r1 == 0 {
|
||||
if e1 != 0 {
|
||||
err = errnoErr(e1)
|
||||
} else {
|
||||
err = syscall.EINVAL
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func getNamedPipeInfo(pipe syscall.Handle, flags *uint32, outSize *uint32, inSize *uint32, maxInstances *uint32) (err error) {
|
||||
r1, _, e1 := syscall.Syscall6(procGetNamedPipeInfo.Addr(), 5, uintptr(pipe), uintptr(unsafe.Pointer(flags)), uintptr(unsafe.Pointer(outSize)), uintptr(unsafe.Pointer(inSize)), uintptr(unsafe.Pointer(maxInstances)), 0)
|
||||
if r1 == 0 {
|
||||
@@ -227,6 +231,32 @@ func localAlloc(uFlags uint32, length uint32) (ptr uintptr) {
|
||||
return
|
||||
}
|
||||
|
||||
func ntCreateNamedPipeFile(pipe *syscall.Handle, access uint32, oa *objectAttributes, iosb *ioStatusBlock, share uint32, disposition uint32, options uint32, typ uint32, readMode uint32, completionMode uint32, maxInstances uint32, inboundQuota uint32, outputQuota uint32, timeout *int64) (status ntstatus) {
|
||||
r0, _, _ := syscall.Syscall15(procNtCreateNamedPipeFile.Addr(), 14, uintptr(unsafe.Pointer(pipe)), uintptr(access), uintptr(unsafe.Pointer(oa)), uintptr(unsafe.Pointer(iosb)), uintptr(share), uintptr(disposition), uintptr(options), uintptr(typ), uintptr(readMode), uintptr(completionMode), uintptr(maxInstances), uintptr(inboundQuota), uintptr(outputQuota), uintptr(unsafe.Pointer(timeout)), 0)
|
||||
status = ntstatus(r0)
|
||||
return
|
||||
}
|
||||
|
||||
func rtlNtStatusToDosError(status ntstatus) (winerr error) {
|
||||
r0, _, _ := syscall.Syscall(procRtlNtStatusToDosErrorNoTeb.Addr(), 1, uintptr(status), 0, 0)
|
||||
if r0 != 0 {
|
||||
winerr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func rtlDosPathNameToNtPathName(name *uint16, ntName *unicodeString, filePart uintptr, reserved uintptr) (status ntstatus) {
|
||||
r0, _, _ := syscall.Syscall6(procRtlDosPathNameToNtPathName_U.Addr(), 4, uintptr(unsafe.Pointer(name)), uintptr(unsafe.Pointer(ntName)), uintptr(filePart), uintptr(reserved), 0, 0)
|
||||
status = ntstatus(r0)
|
||||
return
|
||||
}
|
||||
|
||||
func rtlDefaultNpAcl(dacl *uintptr) (status ntstatus) {
|
||||
r0, _, _ := syscall.Syscall(procRtlDefaultNpAcl.Addr(), 1, uintptr(unsafe.Pointer(dacl)), 0, 0)
|
||||
status = ntstatus(r0)
|
||||
return
|
||||
}
|
||||
|
||||
func lookupAccountName(systemName *uint16, accountName string, sid *byte, sidSize *uint32, refDomain *uint16, refDomainSize *uint32, sidNameUse *uint32) (err error) {
|
||||
var _p0 *uint16
|
||||
_p0, err = syscall.UTF16PtrFromString(accountName)
|
||||
@@ -518,3 +548,15 @@ func backupWrite(h syscall.Handle, b []byte, bytesWritten *uint32, abort bool, p
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func bind(s syscall.Handle, name unsafe.Pointer, namelen int32) (err error) {
|
||||
r1, _, e1 := syscall.Syscall(procbind.Addr(), 3, uintptr(s), uintptr(name), uintptr(namelen))
|
||||
if r1 == socketError {
|
||||
if e1 != 0 {
|
||||
err = errnoErr(e1)
|
||||
} else {
|
||||
err = syscall.EINVAL
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
3
vendor/github.com/Microsoft/hcsshim/CODEOWNERS
generated
vendored
Normal file
3
vendor/github.com/Microsoft/hcsshim/CODEOWNERS
generated
vendored
Normal file
@@ -0,0 +1,3 @@
|
||||
* @microsoft/containerplat
|
||||
|
||||
/hcn/* @nagiesek
|
||||
54
vendor/github.com/Microsoft/hcsshim/Protobuild.toml
generated
vendored
Normal file
54
vendor/github.com/Microsoft/hcsshim/Protobuild.toml
generated
vendored
Normal file
@@ -0,0 +1,54 @@
|
||||
version = "unstable"
|
||||
generator = "gogoctrd"
|
||||
plugins = ["grpc", "fieldpath"]
|
||||
|
||||
# Control protoc include paths. Below are usually some good defaults, but feel
|
||||
# free to try it without them if it works for your project.
|
||||
[includes]
|
||||
# Include paths that will be added before all others. Typically, you want to
|
||||
# treat the root of the project as an include, but this may not be necessary.
|
||||
before = ["./protobuf"]
|
||||
|
||||
# Paths that should be treated as include roots in relation to the vendor
|
||||
# directory. These will be calculated with the vendor directory nearest the
|
||||
# target package.
|
||||
packages = ["github.com/gogo/protobuf"]
|
||||
|
||||
# Paths that will be added untouched to the end of the includes. We use
|
||||
# `/usr/local/include` to pickup the common install location of protobuf.
|
||||
# This is the default.
|
||||
after = ["/usr/local/include"]
|
||||
|
||||
# This section maps protobuf imports to Go packages. These will become
|
||||
# `-M` directives in the call to the go protobuf generator.
|
||||
[packages]
|
||||
"gogoproto/gogo.proto" = "github.com/gogo/protobuf/gogoproto"
|
||||
"google/protobuf/any.proto" = "github.com/gogo/protobuf/types"
|
||||
"google/protobuf/empty.proto" = "github.com/gogo/protobuf/types"
|
||||
"google/protobuf/descriptor.proto" = "github.com/gogo/protobuf/protoc-gen-gogo/descriptor"
|
||||
"google/protobuf/field_mask.proto" = "github.com/gogo/protobuf/types"
|
||||
"google/protobuf/timestamp.proto" = "github.com/gogo/protobuf/types"
|
||||
"google/protobuf/duration.proto" = "github.com/gogo/protobuf/types"
|
||||
"github/containerd/cgroups/stats/v1/metrics.proto" = "github.com/containerd/cgroups/stats/v1"
|
||||
|
||||
[[overrides]]
|
||||
prefixes = ["github.com/Microsoft/hcsshim/internal/shimdiag"]
|
||||
plugins = ["ttrpc"]
|
||||
|
||||
# Lock down runhcs config
|
||||
|
||||
[[descriptors]]
|
||||
prefix = "github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options"
|
||||
target = "cmd/containerd-shim-runhcs-v1/options/next.pb.txt"
|
||||
ignore_files = [
|
||||
"google/protobuf/descriptor.proto",
|
||||
"gogoproto/gogo.proto"
|
||||
]
|
||||
|
||||
[[descriptors]]
|
||||
prefix = "github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/stats"
|
||||
target = "cmd/containerd-shim-runhcs-v1/stats/next.pb.txt"
|
||||
ignore_files = [
|
||||
"google/protobuf/descriptor.proto",
|
||||
"gogoproto/gogo.proto"
|
||||
]
|
||||
7
vendor/github.com/Microsoft/hcsshim/README.md
generated
vendored
7
vendor/github.com/Microsoft/hcsshim/README.md
generated
vendored
@@ -2,7 +2,7 @@
|
||||
|
||||
[](https://ci.appveyor.com/project/WindowsVirtualization/hcsshim/branch/master)
|
||||
|
||||
This package contains the Golang interface for using the Windows [Host Compute Service](https://blogs.technet.microsoft.com/virtualization/2017/01/27/introducing-the-host-compute-service-hcs/) (HCS) to launch and manage [Windows Containers](https://docs.microsoft.com/en-us/virtualization/windowscontainers/about/). It also contains other helpers and functions for managing Windows Containers such as the Golang interface for the Host Network Service (HNS).
|
||||
This package contains the Golang interface for using the Windows [Host Compute Service](https://techcommunity.microsoft.com/t5/containers/introducing-the-host-compute-service-hcs/ba-p/382332) (HCS) to launch and manage [Windows Containers](https://docs.microsoft.com/en-us/virtualization/windowscontainers/about/). It also contains other helpers and functions for managing Windows Containers such as the Golang interface for the Host Network Service (HNS).
|
||||
|
||||
It is primarily used in the [Moby Project](https://github.com/moby/moby), but it can be freely used by other projects as well.
|
||||
|
||||
@@ -16,6 +16,11 @@ When you submit a pull request, a CLA-bot will automatically determine whether y
|
||||
a CLA and decorate the PR appropriately (e.g., label, comment). Simply follow the instructions
|
||||
provided by the bot. You will only need to do this once across all repos using our CLA.
|
||||
|
||||
We also ask that contributors [sign their commits](https://git-scm.com/docs/git-commit) using `git commit -s` or `git commit --signoff` to certify they either authored the work themselves or otherwise have permission to use it in this project.
|
||||
|
||||
|
||||
## Code of Conduct
|
||||
|
||||
This project has adopted the [Microsoft Open Source Code of Conduct](https://opensource.microsoft.com/codeofconduct/).
|
||||
For more information see the [Code of Conduct FAQ](https://opensource.microsoft.com/codeofconduct/faq/) or
|
||||
contact [opencode@microsoft.com](mailto:opencode@microsoft.com) with any additional questions or comments.
|
||||
|
||||
30
vendor/github.com/Microsoft/hcsshim/appveyor.yml
generated
vendored
30
vendor/github.com/Microsoft/hcsshim/appveyor.yml
generated
vendored
@@ -6,24 +6,38 @@ clone_folder: c:\gopath\src\github.com\Microsoft\hcsshim
|
||||
|
||||
environment:
|
||||
GOPATH: c:\gopath
|
||||
PATH: C:\mingw-w64\x86_64-7.2.0-posix-seh-rt_v5-rev1\mingw64\bin;%GOPATH%\bin;C:\gometalinter-2.0.12-windows-amd64;%PATH%
|
||||
PATH: "%GOPATH%\\bin;C:\\gometalinter-2.0.12-windows-amd64;%PATH%"
|
||||
|
||||
stack: go 1.11
|
||||
stack: go 1.13.4
|
||||
|
||||
build_script:
|
||||
- appveyor DownloadFile https://github.com/alecthomas/gometalinter/releases/download/v2.0.12/gometalinter-2.0.12-windows-amd64.zip
|
||||
- 7z x gometalinter-2.0.12-windows-amd64.zip -y -oC:\ > NUL
|
||||
- gometalinter.exe --config .gometalinter.json ./...
|
||||
- go build ./cmd/wclayer
|
||||
- go build ./cmd/containerd-shim-runhcs-v1
|
||||
- go build ./cmd/runhcs
|
||||
- go build ./cmd/tar2ext4
|
||||
- go build ./cmd/wclayer
|
||||
- go build ./internal/tools/grantvmgroupaccess
|
||||
- go build ./internal/tools/uvmboot
|
||||
- go build ./internal/tools/zapdir
|
||||
- go test -v ./... -tags admin
|
||||
- go test -c ./test/functional/ -tags functional
|
||||
- go test -c ./test/runhcs/ -tags integration
|
||||
- cd test
|
||||
- go test -v ./internal -tags admin
|
||||
- go test -c ./containerd-shim-runhcs-v1/ -tags functional
|
||||
- go test -c ./cri-containerd/ -tags functional
|
||||
- go test -c ./functional/ -tags functional
|
||||
- go test -c ./runhcs/ -tags functional
|
||||
|
||||
artifacts:
|
||||
- path: 'wclayer.exe'
|
||||
- path: 'containerd-shim-runhcs-v1.exe'
|
||||
- path: 'runhcs.exe'
|
||||
- path: 'tar2ext4.exe'
|
||||
- path: 'functional.test.exe'
|
||||
- path: 'runhcs.test.exe'
|
||||
- path: 'wclayer.exe'
|
||||
- path: 'grantvmgroupaccess.exe'
|
||||
- path: 'uvmboot.exe'
|
||||
- path: 'zapdir.exe'
|
||||
- path: './test/containerd-shim-runhcs-v1.test.exe'
|
||||
- path: './test/cri-containerd.test.exe'
|
||||
- path: './test/functional.test.exe'
|
||||
- path: './test/runhcs.test.exe'
|
||||
|
||||
75
vendor/github.com/Microsoft/hcsshim/container.go
generated
vendored
75
vendor/github.com/Microsoft/hcsshim/container.go
generated
vendored
@@ -1,8 +1,10 @@
|
||||
package hcsshim
|
||||
|
||||
import (
|
||||
"context"
|
||||
"fmt"
|
||||
"os"
|
||||
"sync"
|
||||
"time"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/hcs"
|
||||
@@ -52,7 +54,10 @@ const (
|
||||
type ResourceModificationRequestResponse = schema1.ResourceModificationRequestResponse
|
||||
|
||||
type container struct {
|
||||
system *hcs.System
|
||||
system *hcs.System
|
||||
waitOnce sync.Once
|
||||
waitErr error
|
||||
waitCh chan struct{}
|
||||
}
|
||||
|
||||
// createComputeSystemAdditionalJSON is read from the environment at initialisation
|
||||
@@ -71,61 +76,87 @@ func CreateContainer(id string, c *ContainerConfig) (Container, error) {
|
||||
return nil, fmt.Errorf("failed to merge additional JSON '%s': %s", createContainerAdditionalJSON, err)
|
||||
}
|
||||
|
||||
system, err := hcs.CreateComputeSystem(id, fullConfig)
|
||||
system, err := hcs.CreateComputeSystem(context.Background(), id, fullConfig)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return &container{system}, err
|
||||
return &container{system: system}, err
|
||||
}
|
||||
|
||||
// OpenContainer opens an existing container by ID.
|
||||
func OpenContainer(id string) (Container, error) {
|
||||
system, err := hcs.OpenComputeSystem(id)
|
||||
system, err := hcs.OpenComputeSystem(context.Background(), id)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return &container{system}, err
|
||||
return &container{system: system}, err
|
||||
}
|
||||
|
||||
// GetContainers gets a list of the containers on the system that match the query
|
||||
func GetContainers(q ComputeSystemQuery) ([]ContainerProperties, error) {
|
||||
return hcs.GetComputeSystems(q)
|
||||
return hcs.GetComputeSystems(context.Background(), q)
|
||||
}
|
||||
|
||||
// Start synchronously starts the container.
|
||||
func (container *container) Start() error {
|
||||
return convertSystemError(container.system.Start(), container)
|
||||
return convertSystemError(container.system.Start(context.Background()), container)
|
||||
}
|
||||
|
||||
// Shutdown requests a container shutdown, but it may not actually be shutdown until Wait() succeeds.
|
||||
func (container *container) Shutdown() error {
|
||||
return convertSystemError(container.system.Shutdown(), container)
|
||||
err := container.system.Shutdown(context.Background())
|
||||
if err != nil {
|
||||
return convertSystemError(err, container)
|
||||
}
|
||||
return &ContainerError{Container: container, Err: ErrVmcomputeOperationPending, Operation: "hcsshim::ComputeSystem::Shutdown"}
|
||||
}
|
||||
|
||||
// Terminate requests a container terminate, but it may not actually be terminated until Wait() succeeds.
|
||||
func (container *container) Terminate() error {
|
||||
return convertSystemError(container.system.Terminate(), container)
|
||||
err := container.system.Terminate(context.Background())
|
||||
if err != nil {
|
||||
return convertSystemError(err, container)
|
||||
}
|
||||
return &ContainerError{Container: container, Err: ErrVmcomputeOperationPending, Operation: "hcsshim::ComputeSystem::Terminate"}
|
||||
}
|
||||
|
||||
// Waits synchronously waits for the container to shutdown or terminate.
|
||||
func (container *container) Wait() error {
|
||||
return convertSystemError(container.system.Wait(), container)
|
||||
err := container.system.Wait()
|
||||
if err == nil {
|
||||
err = container.system.ExitError()
|
||||
}
|
||||
return convertSystemError(err, container)
|
||||
}
|
||||
|
||||
// WaitTimeout synchronously waits for the container to terminate or the duration to elapse. It
|
||||
// returns false if timeout occurs.
|
||||
func (container *container) WaitTimeout(t time.Duration) error {
|
||||
return convertSystemError(container.system.WaitTimeout(t), container)
|
||||
func (container *container) WaitTimeout(timeout time.Duration) error {
|
||||
container.waitOnce.Do(func() {
|
||||
container.waitCh = make(chan struct{})
|
||||
go func() {
|
||||
container.waitErr = container.Wait()
|
||||
close(container.waitCh)
|
||||
}()
|
||||
})
|
||||
t := time.NewTimer(timeout)
|
||||
defer t.Stop()
|
||||
select {
|
||||
case <-t.C:
|
||||
return &ContainerError{Container: container, Err: ErrTimeout, Operation: "hcsshim::ComputeSystem::Wait"}
|
||||
case <-container.waitCh:
|
||||
return container.waitErr
|
||||
}
|
||||
}
|
||||
|
||||
// Pause pauses the execution of a container.
|
||||
func (container *container) Pause() error {
|
||||
return convertSystemError(container.system.Pause(), container)
|
||||
return convertSystemError(container.system.Pause(context.Background()), container)
|
||||
}
|
||||
|
||||
// Resume resumes the execution of a container.
|
||||
func (container *container) Resume() error {
|
||||
return convertSystemError(container.system.Resume(), container)
|
||||
return convertSystemError(container.system.Resume(context.Background()), container)
|
||||
}
|
||||
|
||||
// HasPendingUpdates returns true if the container has updates pending to install
|
||||
@@ -135,7 +166,7 @@ func (container *container) HasPendingUpdates() (bool, error) {
|
||||
|
||||
// Statistics returns statistics for the container. This is a legacy v1 call
|
||||
func (container *container) Statistics() (Statistics, error) {
|
||||
properties, err := container.system.Properties(schema1.PropertyTypeStatistics)
|
||||
properties, err := container.system.Properties(context.Background(), schema1.PropertyTypeStatistics)
|
||||
if err != nil {
|
||||
return Statistics{}, convertSystemError(err, container)
|
||||
}
|
||||
@@ -145,7 +176,7 @@ func (container *container) Statistics() (Statistics, error) {
|
||||
|
||||
// ProcessList returns an array of ProcessListItems for the container. This is a legacy v1 call
|
||||
func (container *container) ProcessList() ([]ProcessListItem, error) {
|
||||
properties, err := container.system.Properties(schema1.PropertyTypeProcessList)
|
||||
properties, err := container.system.Properties(context.Background(), schema1.PropertyTypeProcessList)
|
||||
if err != nil {
|
||||
return nil, convertSystemError(err, container)
|
||||
}
|
||||
@@ -155,7 +186,7 @@ func (container *container) ProcessList() ([]ProcessListItem, error) {
|
||||
|
||||
// This is a legacy v1 call
|
||||
func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskController, error) {
|
||||
properties, err := container.system.Properties(schema1.PropertyTypeMappedVirtualDisk)
|
||||
properties, err := container.system.Properties(context.Background(), schema1.PropertyTypeMappedVirtualDisk)
|
||||
if err != nil {
|
||||
return nil, convertSystemError(err, container)
|
||||
}
|
||||
@@ -165,20 +196,20 @@ func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskContr
|
||||
|
||||
// CreateProcess launches a new process within the container.
|
||||
func (container *container) CreateProcess(c *ProcessConfig) (Process, error) {
|
||||
p, err := container.system.CreateProcess(c)
|
||||
p, err := container.system.CreateProcess(context.Background(), c)
|
||||
if err != nil {
|
||||
return nil, convertSystemError(err, container)
|
||||
}
|
||||
return &process{p}, nil
|
||||
return &process{p: p.(*hcs.Process)}, nil
|
||||
}
|
||||
|
||||
// OpenProcess gets an interface to an existing process within the container.
|
||||
func (container *container) OpenProcess(pid int) (Process, error) {
|
||||
p, err := container.system.OpenProcess(pid)
|
||||
p, err := container.system.OpenProcess(context.Background(), pid)
|
||||
if err != nil {
|
||||
return nil, convertSystemError(err, container)
|
||||
}
|
||||
return &process{p}, nil
|
||||
return &process{p: p}, nil
|
||||
}
|
||||
|
||||
// Close cleans up any state associated with the container but does not terminate or wait for it.
|
||||
@@ -188,5 +219,5 @@ func (container *container) Close() error {
|
||||
|
||||
// Modify the System
|
||||
func (container *container) Modify(config *ResourceModificationRequestResponse) error {
|
||||
return convertSystemError(container.system.Modify(config), container)
|
||||
return convertSystemError(container.system.Modify(context.Background(), config), container)
|
||||
}
|
||||
|
||||
35
vendor/github.com/Microsoft/hcsshim/go.mod
generated
vendored
Normal file
35
vendor/github.com/Microsoft/hcsshim/go.mod
generated
vendored
Normal file
@@ -0,0 +1,35 @@
|
||||
module github.com/Microsoft/hcsshim
|
||||
|
||||
go 1.13
|
||||
|
||||
require (
|
||||
github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5
|
||||
github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f
|
||||
github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1
|
||||
github.com/containerd/containerd v1.3.2
|
||||
github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc // indirect
|
||||
github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448 // indirect
|
||||
github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3
|
||||
github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de
|
||||
github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd
|
||||
github.com/gogo/protobuf v1.3.1
|
||||
github.com/golang/protobuf v1.3.2 // indirect
|
||||
github.com/kr/pretty v0.1.0 // indirect
|
||||
github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2 // indirect
|
||||
github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f // indirect
|
||||
github.com/opencontainers/runtime-spec v0.1.2-0.20190507144316-5b71a03e2700
|
||||
github.com/pkg/errors v0.8.1
|
||||
github.com/prometheus/procfs v0.0.0-20180125133057-cb4147076ac7 // indirect
|
||||
github.com/sirupsen/logrus v1.4.2
|
||||
github.com/stretchr/testify v1.4.0 // indirect
|
||||
github.com/urfave/cli v0.0.0-20171014202726-7bc6a0acffa5
|
||||
go.opencensus.io v0.22.0
|
||||
golang.org/x/net v0.0.0-20191004110552-13f9640d40b9 // indirect
|
||||
golang.org/x/sync v0.0.0-20190423024810-112230192c58
|
||||
golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3
|
||||
google.golang.org/genproto v0.0.0-20190502173448-54afdca5d873 // indirect
|
||||
google.golang.org/grpc v1.23.1
|
||||
gopkg.in/check.v1 v1.0.0-20180628173108-788fd7840127 // indirect
|
||||
gopkg.in/yaml.v2 v2.2.8 // indirect
|
||||
gotest.tools v2.2.0+incompatible // indirect
|
||||
)
|
||||
149
vendor/github.com/Microsoft/hcsshim/go.sum
generated
vendored
Normal file
149
vendor/github.com/Microsoft/hcsshim/go.sum
generated
vendored
Normal file
@@ -0,0 +1,149 @@
|
||||
cloud.google.com/go v0.26.0/go.mod h1:aQUYkXzVsufM+DwF1aE+0xfcU+56JwCaLick0ClmMTw=
|
||||
github.com/BurntSushi/toml v0.3.1 h1:WXkYYl6Yr3qBf1K79EBnL4mak0OimBfB0XUf9Vl28OQ=
|
||||
github.com/BurntSushi/toml v0.3.1/go.mod h1:xHWCNGjB5oqiDr8zfno3MHue2Ht5sIBksp03qcyfWMU=
|
||||
github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5 h1:ygIc8M6trr62pF5DucadTWGdEB4mEyvzi0e2nbcmcyA=
|
||||
github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5/go.mod h1:tTuCMEN+UleMWgg9dVx4Hu52b1bJo+59jBh3ajtinzw=
|
||||
github.com/client9/misspell v0.3.4/go.mod h1:qj6jICC3Q7zFZvVWo7KLAzC3yx5G7kyvSDkc90ppPyw=
|
||||
github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f h1:tSNMc+rJDfmYntojat8lljbt1mgKNpTxUZJsSzJ9Y1s=
|
||||
github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f/go.mod h1:OApqhQ4XNSNC13gXIwDjhOQxjWa/NxkwZXJ1EvqT0ko=
|
||||
github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1 h1:uict5mhHFTzKLUCufdSLym7z/J0CbBJT59lYbP9wtbg=
|
||||
github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1/go.mod h1:Tj/on1eG8kiEhd0+fhSDzsPAFESxzBBvdyEgyryXffw=
|
||||
github.com/containerd/containerd v1.3.2 h1:ForxmXkA6tPIvffbrDAcPUIB32QgXkt2XFj+F0UxetA=
|
||||
github.com/containerd/containerd v1.3.2/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA=
|
||||
github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc h1:TP+534wVlf61smEIq1nwLLAjQVEK2EADoW3CX9AuT+8=
|
||||
github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y=
|
||||
github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448 h1:PUD50EuOMkXVcpBIA/R95d56duJR9VxhwncsFbNnxW4=
|
||||
github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448/go.mod h1:ODA38xgv3Kuk8dQz2ZQXpnv/UZZUHUCL7pnLehbXgQI=
|
||||
github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3 h1:esQOJREg8nw8aXj6uCN5dfW5cKUBiEJ/+nni1Q/D/sw=
|
||||
github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3/go.mod h1:IV7qH3hrUgRmyYrtgEeGWJfWbgcHL9CSRruz2Vqcph0=
|
||||
github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de h1:dlfGmNcE3jDAecLqwKPMNX6nk2qh1c1Vg1/YTzpOOF4=
|
||||
github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de/go.mod h1:PvCDdDGpgqzQIzDW1TphrGLssLDZp2GuS+X5DkEJB8o=
|
||||
github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd h1:JNn81o/xG+8NEo3bC/vx9pbi/g2WI8mtP2/nXzu297Y=
|
||||
github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd/go.mod h1:Cm3kwCdlkCfMSHURc+r6fwoGH6/F1hH3S4sg0rLFWPc=
|
||||
github.com/coreos/go-systemd v0.0.0-20190321100706-95778dfbb74e h1:Wf6HqHfScWJN9/ZjdUKyjop4mf3Qdd+1TvvltAvM3m8=
|
||||
github.com/coreos/go-systemd v0.0.0-20190321100706-95778dfbb74e/go.mod h1:F5haX7vjVVG0kc13fIWeqUViNPyEJxv/OmvnBo0Yme4=
|
||||
github.com/davecgh/go-spew v1.1.0/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
|
||||
github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c=
|
||||
github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
|
||||
github.com/docker/go-units v0.4.0 h1:3uh0PgVws3nIA0Q+MwDC8yjEPf9zjRfZZWXZYDct3Tw=
|
||||
github.com/docker/go-units v0.4.0/go.mod h1:fgPhTUdO+D/Jk86RDLlptpiXQzgHJF7gydDDbaIK4Dk=
|
||||
github.com/godbus/dbus v0.0.0-20190422162347-ade71ed3457e h1:BWhy2j3IXJhjCbC68FptL43tDKIq8FladmaTs3Xs7Z8=
|
||||
github.com/godbus/dbus v0.0.0-20190422162347-ade71ed3457e/go.mod h1:bBOAhwG1umN6/6ZUMtDFBMQR8jRg9O75tm9K00oMsK4=
|
||||
github.com/gogo/protobuf v1.2.1 h1:/s5zKNz0uPFCZ5hddgPdo2TK2TVrUNMn0OOX8/aZMTE=
|
||||
github.com/gogo/protobuf v1.2.1/go.mod h1:hp+jE20tsWTFYpLwKvXlhS1hjn+gTNwPg2I6zVXpSg4=
|
||||
github.com/gogo/protobuf v1.3.1 h1:DqDEcV5aeaTmdFBePNpYsp3FlcVH/2ISVVM9Qf8PSls=
|
||||
github.com/gogo/protobuf v1.3.1/go.mod h1:SlYgWuQ5SjCEi6WLHjHCa1yvBfUnHcTbrrZtXPKa29o=
|
||||
github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b h1:VKtxabqXZkF25pY9ekfRL6a582T4P37/31XEstQ5p58=
|
||||
github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b/go.mod h1:SBH7ygxi8pfUlaOkMMuAQtPIUF8ecWP5IEl/CR7VP2Q=
|
||||
github.com/golang/mock v1.1.1/go.mod h1:oTYuIxOrZwtPieC+H1uAHpcLFnEyAGVDL/k47Jfbm0A=
|
||||
github.com/golang/protobuf v1.2.0 h1:P3YflyNX/ehuJFLhxviNdFxQPkGK5cDcApsge1SqnvM=
|
||||
github.com/golang/protobuf v1.2.0/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U=
|
||||
github.com/golang/protobuf v1.3.1 h1:YF8+flBXS5eO826T4nzqPrxfhQThhXl0YzfuUPu4SBg=
|
||||
github.com/golang/protobuf v1.3.1/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U=
|
||||
github.com/golang/protobuf v1.3.2 h1:6nsPYzhq5kReh6QImI3k5qWzO4PEbvbIW2cwSfR/6xs=
|
||||
github.com/golang/protobuf v1.3.2/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U=
|
||||
github.com/google/go-cmp v0.2.0/go.mod h1:oXzfMopK8JAjlY9xF4vHSVASa0yLyX7SntLO5aqRK0M=
|
||||
github.com/google/go-cmp v0.3.0 h1:crn/baboCvb5fXaQ0IJ1SGTsTVrWpDsCWC8EGETZijY=
|
||||
github.com/google/go-cmp v0.3.0/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU=
|
||||
github.com/hashicorp/golang-lru v0.5.1 h1:0hERBMJE1eitiLkihrMvRVBYAkpHzc/J3QdDN+dAcgU=
|
||||
github.com/hashicorp/golang-lru v0.5.1/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8=
|
||||
github.com/kisielk/errcheck v1.1.0/go.mod h1:EZBBE59ingxPouuu3KfxchcWSUPOHkagtvWXihfKN4Q=
|
||||
github.com/kisielk/errcheck v1.2.0/go.mod h1:/BMXB+zMLi60iA8Vv6Ksmxu/1UDYcXs4uQLJ+jE2L00=
|
||||
github.com/kisielk/gotool v1.0.0/go.mod h1:XhKaO+MFFWcvkIS/tQcRk01m1F5IRFswLeQ+oQHNcck=
|
||||
github.com/konsorten/go-windows-terminal-sequences v1.0.1 h1:mweAR1A6xJ3oS2pRaGiHgQ4OO8tzTaLawm8vnODuwDk=
|
||||
github.com/konsorten/go-windows-terminal-sequences v1.0.1/go.mod h1:T0+1ngSBFLxvqU3pZ+m/2kptfBszLMUkC4ZK/EgS/cQ=
|
||||
github.com/kr/pretty v0.1.0 h1:L/CwN0zerZDmRFUapSPitk6f+Q3+0za1rQkzVuMiMFI=
|
||||
github.com/kr/pretty v0.1.0/go.mod h1:dAy3ld7l9f0ibDNOQOHHMYYIIbhfbHSm3C4ZsoJORNo=
|
||||
github.com/kr/pty v1.1.1/go.mod h1:pFQYn66WHrOpPYNljwOMqo10TkYh1fy3cYio2l3bCsQ=
|
||||
github.com/kr/text v0.1.0 h1:45sCR5RtlFHMR4UwH9sdQ5TC8v0qDQCHnXt+kaKSTVE=
|
||||
github.com/kr/text v0.1.0/go.mod h1:4Jbv+DJW3UT/LiOwJeYQe1efqtUx/iVham/4vfdArNI=
|
||||
github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2 h1:QhPf3A2AZW3tTGvHPg0TA+CR3oHbVLlXUhlghqISp1I=
|
||||
github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s=
|
||||
github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f h1:a969LJ4IQFwRHYqonHtUDMSh9i54WcKggeEkQ3fZMl4=
|
||||
github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U=
|
||||
github.com/opencontainers/runtime-spec v0.1.2-0.20190507144316-5b71a03e2700 h1:eNUVfm/RFLIi1G7flU5/ZRTHvd4kcVuzfRnL6OFlzCI=
|
||||
github.com/opencontainers/runtime-spec v0.1.2-0.20190507144316-5b71a03e2700/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0=
|
||||
github.com/pkg/errors v0.8.1 h1:iURUrRGxPUNPdy5/HRSm+Yj6okJ6UtLINN0Q9M4+h3I=
|
||||
github.com/pkg/errors v0.8.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0=
|
||||
github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM=
|
||||
github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4=
|
||||
github.com/prometheus/procfs v0.0.0-20180125133057-cb4147076ac7 h1:hhvfGDVThBnd4kYisSFmYuHYeUhglxcwag7FhVPH9zM=
|
||||
github.com/prometheus/procfs v0.0.0-20180125133057-cb4147076ac7/go.mod h1:c3At6R/oaqEKCNdg8wHV1ftS6bRYblBhIjjI8uT2IGk=
|
||||
github.com/sirupsen/logrus v1.4.1 h1:GL2rEmy6nsikmW0r8opw9JIRScdMF5hA8cOYLH7In1k=
|
||||
github.com/sirupsen/logrus v1.4.1/go.mod h1:ni0Sbl8bgC9z8RoU9G6nDWqqs/fq4eDPysMBDgk/93Q=
|
||||
github.com/sirupsen/logrus v1.4.2 h1:SPIRibHv4MatM3XXNO2BJeFLZwZ2LvZgfQ5+UNI2im4=
|
||||
github.com/sirupsen/logrus v1.4.2/go.mod h1:tLMulIdttU9McNUspp0xgXVQah82FyeX6MwdIuYE2rE=
|
||||
github.com/stretchr/objx v0.1.0/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME=
|
||||
github.com/stretchr/objx v0.1.1/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME=
|
||||
github.com/stretchr/testify v1.2.2 h1:bSDNvY7ZPG5RlJ8otE/7V6gMiyenm9RtJ7IUVIAoJ1w=
|
||||
github.com/stretchr/testify v1.2.2/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXfy6kDkUVs=
|
||||
github.com/stretchr/testify v1.4.0 h1:2E4SXV/wtOkTonXsotYi4li6zVWxYlZuYNCXe9XRJyk=
|
||||
github.com/stretchr/testify v1.4.0/go.mod h1:j7eGeouHqKxXV5pUuKE4zz7dFj8WfuZ+81PSLYec5m4=
|
||||
github.com/urfave/cli v0.0.0-20171014202726-7bc6a0acffa5 h1:MCfT24H3f//U5+UCrZp1/riVO3B50BovxtDiNn0XKkk=
|
||||
github.com/urfave/cli v0.0.0-20171014202726-7bc6a0acffa5/go.mod h1:70zkFmudgCuE/ngEzBv17Jvp/497gISqfk5gWijbERA=
|
||||
go.opencensus.io v0.22.0 h1:C9hSCOW830chIVkdja34wa6Ky+IzWllkUinR+BtRZd4=
|
||||
go.opencensus.io v0.22.0/go.mod h1:+kGneAE2xo2IficOXnaByMWTGM9T73dGwxeWcUqIpI8=
|
||||
golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACkg1iLfiJU5Ep61QUkGW8qpdssI0+w=
|
||||
golang.org/x/exp v0.0.0-20190121172915-509febef88a4/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA=
|
||||
golang.org/x/lint v0.0.0-20181026193005-c67002cb31c3/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE=
|
||||
golang.org/x/lint v0.0.0-20190227174305-5b3e6a55c961/go.mod h1:wehouNa3lNwaWXcvxsM5YxQ5yQlVC4a0KAMCusXpPoU=
|
||||
golang.org/x/lint v0.0.0-20190313153728-d0100b6bd8b3/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc=
|
||||
golang.org/x/net v0.0.0-20180724234803-3673e40ba225/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
|
||||
golang.org/x/net v0.0.0-20180826012351-8a410e7b638d/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
|
||||
golang.org/x/net v0.0.0-20190213061140-3a22650c66bd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
|
||||
golang.org/x/net v0.0.0-20190311183353-d8887717615a h1:oWX7TPOiFAMXLq8o0ikBYfCJVlRHBcsciT5bXOrH628=
|
||||
golang.org/x/net v0.0.0-20190311183353-d8887717615a/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg=
|
||||
golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09 h1:KaQtG+aDELoNmXYas3TVkGNYRuq8JQ1aa7LJt8EXVyo=
|
||||
golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg=
|
||||
golang.org/x/net v0.0.0-20191004110552-13f9640d40b9 h1:rjwSpXsdiK0dV8/Naq3kAw9ymfAeJIyd0upUIElB+lI=
|
||||
golang.org/x/net v0.0.0-20191004110552-13f9640d40b9/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s=
|
||||
golang.org/x/oauth2 v0.0.0-20180821212333-d2e6202438be/go.mod h1:N/0e6XlmueqKjAGxoOufVs8QHGRruUQn6yWY3a++T0U=
|
||||
golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
|
||||
golang.org/x/sync v0.0.0-20181108010431-42b317875d0f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
|
||||
golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6 h1:bjcUS9ztw9kFmmIxJInhon/0Is3p+EHBKNgquIzo1OI=
|
||||
golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
|
||||
golang.org/x/sync v0.0.0-20190423024810-112230192c58 h1:8gQV6CLnAEikrhgkHFbMAEhagSSnXWGV915qUMm9mrU=
|
||||
golang.org/x/sync v0.0.0-20190423024810-112230192c58/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
|
||||
golang.org/x/sys v0.0.0-20180830151530-49385e6e1522/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
|
||||
golang.org/x/sys v0.0.0-20180905080454-ebe1bf3edb33/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
|
||||
golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
|
||||
golang.org/x/sys v0.0.0-20190422165155-953cdadca894/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20190514135907-3a4b5fb9f71f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 h1:7TYNF4UdlohbFwpNH04CoPMp1cHUZgO1Ebq5r2hIjfo=
|
||||
golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/text v0.3.0 h1:g61tztE5qeGQ89tm6NTjjM9VPIm088od1l6aSorWRWg=
|
||||
golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ=
|
||||
golang.org/x/text v0.3.2 h1:tW2bmiBqwgJj/UpqtC8EpXEZVYOwU0yG4iWbprSVAcs=
|
||||
golang.org/x/text v0.3.2/go.mod h1:bEr9sfX3Q8Zfm5fL9x+3itogRgK3+ptLWKqgva+5dAk=
|
||||
golang.org/x/tools v0.0.0-20180221164845-07fd8470d635/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ=
|
||||
golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ=
|
||||
golang.org/x/tools v0.0.0-20181030221726-6c7e314b6563/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ=
|
||||
golang.org/x/tools v0.0.0-20190114222345-bf090417da8b/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ=
|
||||
golang.org/x/tools v0.0.0-20190226205152-f727befe758c/go.mod h1:9Yl7xja0Znq3iFh3HoIrodX9oNMXvdceNzlUR8zjMvY=
|
||||
golang.org/x/tools v0.0.0-20190311212946-11955173bddd/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs=
|
||||
golang.org/x/tools v0.0.0-20190524140312-2c0ae7006135/go.mod h1:RgjU9mgBXZiqYHBnxXauZ1Gv1EHHAz9KjViQ78xBX0Q=
|
||||
google.golang.org/appengine v1.1.0/go.mod h1:EbEs0AVv82hx2wNQdGPgUI5lhzA/G0D9YwlJXL52JkM=
|
||||
google.golang.org/appengine v1.4.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4=
|
||||
google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8 h1:Nw54tB0rB7hY/N0NQvRW8DG4Yk3Q6T9cu9RcFQDu1tc=
|
||||
google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8/go.mod h1:JiN7NxoALGmiZfu7CAH4rXhgtRTLTxftemlI0sWmxmc=
|
||||
google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb h1:i1Ppqkc3WQXikh8bXiwHqAN5Rv3/qDCcRk0/Otx73BY=
|
||||
google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE=
|
||||
google.golang.org/genproto v0.0.0-20190502173448-54afdca5d873 h1:nfPFGzJkUDX6uBmpN/pSw7MbOAWegH5QDQuoXFHedLg=
|
||||
google.golang.org/genproto v0.0.0-20190502173448-54afdca5d873/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE=
|
||||
google.golang.org/grpc v1.19.0/go.mod h1:mqu4LbDTu4XGKhr4mRzUsmM4RtVoemTSY81AxZiDr8c=
|
||||
google.golang.org/grpc v1.20.1 h1:Hz2g2wirWK7H0qIIhGIqRGTuMwTE8HEKFnDZZ7lm9NU=
|
||||
google.golang.org/grpc v1.20.1/go.mod h1:10oTOabMzJvdu6/UiuZezV6QK5dSlG84ov/aaiqXj38=
|
||||
google.golang.org/grpc v1.23.1 h1:q4XQuHFC6I28BKZpo6IYyb3mNO+l7lSOxRuYTCiDfXk=
|
||||
google.golang.org/grpc v1.23.1/go.mod h1:Y5yQAOtifL1yxbo5wqy6BxZv8vAUGQwXBOALyacEbxg=
|
||||
gopkg.in/check.v1 v0.0.0-20161208181325-20d25e280405/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0=
|
||||
gopkg.in/check.v1 v1.0.0-20180628173108-788fd7840127 h1:qIbj1fsPNlZgppZ+VLlY7N33q108Sa+fhmuc+sWQYwY=
|
||||
gopkg.in/check.v1 v1.0.0-20180628173108-788fd7840127/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0=
|
||||
gopkg.in/yaml.v2 v2.2.2 h1:ZCJp+EgiOT7lHqUV2J862kp8Qj64Jo6az82+3Td9dZw=
|
||||
gopkg.in/yaml.v2 v2.2.2/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
|
||||
gopkg.in/yaml.v2 v2.2.8 h1:obN1ZagJSUGI0Ek/LBmuj4SNLPfIny3KsKFopxRdj10=
|
||||
gopkg.in/yaml.v2 v2.2.8/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
|
||||
gotest.tools v2.2.0+incompatible h1:VsBPFP1AI068pPrMxtb/S8Zkgf9xEmTLJjfM+P5UIEo=
|
||||
gotest.tools v2.2.0+incompatible/go.mod h1:DsYFclhRJ6vuDpmuTbkuFWG+y2sxOXAzmJt81HFBacw=
|
||||
honnef.co/go/tools v0.0.0-20190102054323-c2f93a96b099/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4=
|
||||
honnef.co/go/tools v0.0.0-20190523083050-ea95bdfd59fc/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4=
|
||||
10
vendor/github.com/Microsoft/hcsshim/hnsendpoint.go
generated
vendored
10
vendor/github.com/Microsoft/hcsshim/hnsendpoint.go
generated
vendored
@@ -39,11 +39,21 @@ func HNSListEndpointRequest() ([]HNSEndpoint, error) {
|
||||
|
||||
// HotAttachEndpoint makes a HCS Call to attach the endpoint to the container
|
||||
func HotAttachEndpoint(containerID string, endpointID string) error {
|
||||
endpoint, err := GetHNSEndpointByID(endpointID)
|
||||
isAttached, err := endpoint.IsAttached(containerID)
|
||||
if isAttached {
|
||||
return err
|
||||
}
|
||||
return modifyNetworkEndpoint(containerID, endpointID, Add)
|
||||
}
|
||||
|
||||
// HotDetachEndpoint makes a HCS Call to detach the endpoint from the container
|
||||
func HotDetachEndpoint(containerID string, endpointID string) error {
|
||||
endpoint, err := GetHNSEndpointByID(endpointID)
|
||||
isAttached, err := endpoint.IsAttached(containerID)
|
||||
if !isAttached {
|
||||
return err
|
||||
}
|
||||
return modifyNetworkEndpoint(containerID, endpointID, Remove)
|
||||
}
|
||||
|
||||
|
||||
3
vendor/github.com/Microsoft/hcsshim/hnspolicy.go
generated
vendored
3
vendor/github.com/Microsoft/hcsshim/hnspolicy.go
generated
vendored
@@ -21,8 +21,11 @@ const (
|
||||
OutboundNat = hns.OutboundNat
|
||||
ExternalLoadBalancer = hns.ExternalLoadBalancer
|
||||
Route = hns.Route
|
||||
Proxy = hns.Proxy
|
||||
)
|
||||
|
||||
type ProxyPolicy = hns.ProxyPolicy
|
||||
|
||||
type NatPolicy = hns.NatPolicy
|
||||
|
||||
type QosPolicy = hns.QosPolicy
|
||||
|
||||
83
vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go
generated
vendored
Normal file
83
vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go
generated
vendored
Normal file
@@ -0,0 +1,83 @@
|
||||
package cow
|
||||
|
||||
import (
|
||||
"context"
|
||||
"io"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/schema1"
|
||||
hcsschema "github.com/Microsoft/hcsshim/internal/schema2"
|
||||
)
|
||||
|
||||
// Process is the interface for an OS process running in a container or utility VM.
|
||||
type Process interface {
|
||||
// Close releases resources associated with the process and closes the
|
||||
// writer and readers returned by Stdio. Depending on the implementation,
|
||||
// this may also terminate the process.
|
||||
Close() error
|
||||
// CloseStdin causes the process's stdin handle to receive EOF/EPIPE/whatever
|
||||
// is appropriate to indicate that no more data is available.
|
||||
CloseStdin(ctx context.Context) error
|
||||
// Pid returns the process ID.
|
||||
Pid() int
|
||||
// Stdio returns the stdio streams for a process. These may be nil if a stream
|
||||
// was not requested during CreateProcess.
|
||||
Stdio() (_ io.Writer, _ io.Reader, _ io.Reader)
|
||||
// ResizeConsole resizes the virtual terminal associated with the process.
|
||||
ResizeConsole(ctx context.Context, width, height uint16) error
|
||||
// Kill sends a SIGKILL or equivalent signal to the process and returns whether
|
||||
// the signal was delivered. It does not wait for the process to terminate.
|
||||
Kill(ctx context.Context) (bool, error)
|
||||
// Signal sends a signal to the process and returns whether the signal was
|
||||
// delivered. The input is OS specific (either
|
||||
// guestrequest.SignalProcessOptionsWCOW or
|
||||
// guestrequest.SignalProcessOptionsLCOW). It does not wait for the process
|
||||
// to terminate.
|
||||
Signal(ctx context.Context, options interface{}) (bool, error)
|
||||
// Wait waits for the process to complete, or for a connection to the process to be
|
||||
// terminated by some error condition (including calling Close).
|
||||
Wait() error
|
||||
// ExitCode returns the exit code of the process. Returns an error if the process is
|
||||
// not running.
|
||||
ExitCode() (int, error)
|
||||
}
|
||||
|
||||
// ProcessHost is the interface for creating processes.
|
||||
type ProcessHost interface {
|
||||
// CreateProcess creates a process. The configuration is host specific
|
||||
// (either hcsschema.ProcessParameters or lcow.ProcessParameters).
|
||||
CreateProcess(ctx context.Context, config interface{}) (Process, error)
|
||||
// OS returns the host's operating system, "linux" or "windows".
|
||||
OS() string
|
||||
// IsOCI specifies whether this is an OCI-compliant process host. If true,
|
||||
// then the configuration passed to CreateProcess should have an OCI process
|
||||
// spec (or nil if this is the initial process in an OCI container).
|
||||
// Otherwise, it should have the HCS-specific process parameters.
|
||||
IsOCI() bool
|
||||
}
|
||||
|
||||
// Container is the interface for container objects, either running on the host or
|
||||
// in a utility VM.
|
||||
type Container interface {
|
||||
ProcessHost
|
||||
// Close releases the resources associated with the container. Depending on
|
||||
// the implementation, this may also terminate the container.
|
||||
Close() error
|
||||
// ID returns the container ID.
|
||||
ID() string
|
||||
// Properties returns the requested container properties targeting a V1 schema container.
|
||||
Properties(ctx context.Context, types ...schema1.PropertyType) (*schema1.ContainerProperties, error)
|
||||
// PropertiesV2 returns the requested container properties targeting a V2 schema container.
|
||||
PropertiesV2(ctx context.Context, types ...hcsschema.PropertyType) (*hcsschema.Properties, error)
|
||||
// Start starts a container.
|
||||
Start(ctx context.Context) error
|
||||
// Shutdown sends a shutdown request to the container (but does not wait for
|
||||
// the shutdown to complete).
|
||||
Shutdown(ctx context.Context) error
|
||||
// Terminate sends a terminate request to the container (but does not wait
|
||||
// for the terminate to complete).
|
||||
Terminate(ctx context.Context) error
|
||||
// Wait waits for the container to terminate, or for the connection to the
|
||||
// container to be terminated by some error condition (including calling
|
||||
// Close).
|
||||
Wait() error
|
||||
}
|
||||
100
vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go
generated
vendored
100
vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go
generated
vendored
@@ -1,100 +0,0 @@
|
||||
package guestrequest
|
||||
|
||||
import (
|
||||
"github.com/Microsoft/hcsshim/internal/schema2"
|
||||
)
|
||||
|
||||
// Arguably, many of these (at least CombinedLayers) should have been generated
|
||||
// by swagger.
|
||||
//
|
||||
// This will also change package name due to an inbound breaking change.
|
||||
|
||||
// This class is used by a modify request to add or remove a combined layers
|
||||
// structure in the guest. For windows, the GCS applies a filter in ContainerRootPath
|
||||
// using the specified layers as the parent content. Ignores property ScratchPath
|
||||
// since the container path is already the scratch path. For linux, the GCS unions
|
||||
// the specified layers and ScratchPath together, placing the resulting union
|
||||
// filesystem at ContainerRootPath.
|
||||
type CombinedLayers struct {
|
||||
ContainerRootPath string `json:"ContainerRootPath,omitempty"`
|
||||
Layers []hcsschema.Layer `json:"Layers,omitempty"`
|
||||
ScratchPath string `json:"ScratchPath,omitempty"`
|
||||
}
|
||||
|
||||
// Defines the schema for hosted settings passed to GCS and/or OpenGCS
|
||||
|
||||
// SCSI. Scratch space for remote file-system commands, or R/W layer for containers
|
||||
type LCOWMappedVirtualDisk struct {
|
||||
MountPath string `json:"MountPath,omitempty"` // /tmp/scratch for an LCOW utility VM being used as a service VM
|
||||
Lun uint8 `json:"Lun,omitempty"`
|
||||
Controller uint8 `json:"Controller,omitempty"`
|
||||
ReadOnly bool `json:"ReadOnly,omitempty"`
|
||||
}
|
||||
|
||||
type WCOWMappedVirtualDisk struct {
|
||||
ContainerPath string `json:"ContainerPath,omitempty"`
|
||||
Lun int32 `json:"Lun,omitempty"`
|
||||
}
|
||||
|
||||
type LCOWMappedDirectory struct {
|
||||
MountPath string `json:"MountPath,omitempty"`
|
||||
Port int32 `json:"Port,omitempty"`
|
||||
ShareName string `json:"ShareName,omitempty"` // If empty not using ANames (not currently supported)
|
||||
ReadOnly bool `json:"ReadOnly,omitempty"`
|
||||
}
|
||||
|
||||
// Read-only layers over VPMem
|
||||
type LCOWMappedVPMemDevice struct {
|
||||
DeviceNumber uint32 `json:"DeviceNumber,omitempty"`
|
||||
MountPath string `json:"MountPath,omitempty"` // /tmp/pN
|
||||
}
|
||||
|
||||
type LCOWNetworkAdapter struct {
|
||||
NamespaceID string `json:",omitempty"`
|
||||
ID string `json:",omitempty"`
|
||||
MacAddress string `json:",omitempty"`
|
||||
IPAddress string `json:",omitempty"`
|
||||
PrefixLength uint8 `json:",omitempty"`
|
||||
GatewayAddress string `json:",omitempty"`
|
||||
DNSSuffix string `json:",omitempty"`
|
||||
DNSServerList string `json:",omitempty"`
|
||||
EnableLowMetric bool `json:",omitempty"`
|
||||
EncapOverhead uint16 `json:",omitempty"`
|
||||
}
|
||||
|
||||
type ResourceType string
|
||||
|
||||
const (
|
||||
// These are constants for v2 schema modify guest requests.
|
||||
ResourceTypeMappedDirectory ResourceType = "MappedDirectory"
|
||||
ResourceTypeMappedVirtualDisk ResourceType = "MappedVirtualDisk"
|
||||
ResourceTypeNetwork ResourceType = "Network"
|
||||
ResourceTypeNetworkNamespace ResourceType = "NetworkNamespace"
|
||||
ResourceTypeCombinedLayers ResourceType = "CombinedLayers"
|
||||
ResourceTypeVPMemDevice ResourceType = "VPMemDevice"
|
||||
)
|
||||
|
||||
// GuestRequest is for modify commands passed to the guest.
|
||||
type GuestRequest struct {
|
||||
RequestType string `json:"RequestType,omitempty"`
|
||||
ResourceType ResourceType `json:"ResourceType,omitempty"`
|
||||
Settings interface{} `json:"Settings,omitempty"`
|
||||
}
|
||||
|
||||
type NetworkModifyRequest struct {
|
||||
AdapterId string `json:"AdapterId,omitempty"`
|
||||
RequestType string `json:"RequestType,omitempty"`
|
||||
Settings interface{} `json:"Settings,omitempty"`
|
||||
}
|
||||
|
||||
type RS4NetworkModifyRequest struct {
|
||||
AdapterInstanceId string `json:"AdapterInstanceId,omitempty"`
|
||||
RequestType string `json:"RequestType,omitempty"`
|
||||
Settings interface{} `json:"Settings,omitempty"`
|
||||
}
|
||||
|
||||
// SignalProcessOptions is the options passed to either WCOW or LCOW
|
||||
// to signal a given process.
|
||||
type SignalProcessOptions struct {
|
||||
Signal int `json:,omitempty`
|
||||
}
|
||||
69
vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go
generated
vendored
69
vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go
generated
vendored
@@ -1,69 +0,0 @@
|
||||
package guid
|
||||
|
||||
import (
|
||||
"crypto/rand"
|
||||
"encoding/json"
|
||||
"fmt"
|
||||
"io"
|
||||
"strconv"
|
||||
"strings"
|
||||
)
|
||||
|
||||
var _ = (json.Marshaler)(&GUID{})
|
||||
var _ = (json.Unmarshaler)(&GUID{})
|
||||
|
||||
type GUID [16]byte
|
||||
|
||||
func New() GUID {
|
||||
g := GUID{}
|
||||
_, err := io.ReadFull(rand.Reader, g[:])
|
||||
if err != nil {
|
||||
panic(err)
|
||||
}
|
||||
return g
|
||||
}
|
||||
|
||||
func (g GUID) String() string {
|
||||
return fmt.Sprintf("%02x%02x%02x%02x-%02x%02x-%02x%02x-%02x-%02x", g[3], g[2], g[1], g[0], g[5], g[4], g[7], g[6], g[8:10], g[10:])
|
||||
}
|
||||
|
||||
func FromString(s string) GUID {
|
||||
if len(s) != 36 {
|
||||
panic(fmt.Sprintf("invalid GUID length: %d", len(s)))
|
||||
}
|
||||
if s[8] != '-' || s[13] != '-' || s[18] != '-' || s[23] != '-' {
|
||||
panic("invalid GUID format")
|
||||
}
|
||||
indexOrder := [16]int{
|
||||
0, 2, 4, 6,
|
||||
9, 11,
|
||||
14, 16,
|
||||
19, 21,
|
||||
24, 26, 28, 30, 32, 34,
|
||||
}
|
||||
byteOrder := [16]int{
|
||||
3, 2, 1, 0,
|
||||
5, 4,
|
||||
7, 6,
|
||||
8, 9,
|
||||
10, 11, 12, 13, 14, 15,
|
||||
}
|
||||
var g GUID
|
||||
for i, x := range indexOrder {
|
||||
b, err := strconv.ParseInt(s[x:x+2], 16, 16)
|
||||
if err != nil {
|
||||
panic(err)
|
||||
}
|
||||
g[byteOrder[i]] = byte(b)
|
||||
}
|
||||
return g
|
||||
}
|
||||
|
||||
func (g GUID) MarshalJSON() ([]byte, error) {
|
||||
return json.Marshal(g.String())
|
||||
}
|
||||
|
||||
func (g *GUID) UnmarshalJSON(data []byte) error {
|
||||
*g = FromString(strings.Trim(string(data), "\""))
|
||||
return nil
|
||||
}
|
||||
102
vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go
generated
vendored
102
vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go
generated
vendored
@@ -1,10 +1,13 @@
|
||||
package hcs
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
"sync"
|
||||
"syscall"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/interop"
|
||||
"github.com/Microsoft/hcsshim/internal/logfields"
|
||||
"github.com/Microsoft/hcsshim/internal/vmcompute"
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
@@ -40,35 +43,83 @@ var (
|
||||
)
|
||||
|
||||
type hcsNotification uint32
|
||||
|
||||
func (hn hcsNotification) String() string {
|
||||
switch hn {
|
||||
case hcsNotificationSystemExited:
|
||||
return "SystemExited"
|
||||
case hcsNotificationSystemCreateCompleted:
|
||||
return "SystemCreateCompleted"
|
||||
case hcsNotificationSystemStartCompleted:
|
||||
return "SystemStartCompleted"
|
||||
case hcsNotificationSystemPauseCompleted:
|
||||
return "SystemPauseCompleted"
|
||||
case hcsNotificationSystemResumeCompleted:
|
||||
return "SystemResumeCompleted"
|
||||
case hcsNotificationSystemCrashReport:
|
||||
return "SystemCrashReport"
|
||||
case hcsNotificationSystemSiloJobCreated:
|
||||
return "SystemSiloJobCreated"
|
||||
case hcsNotificationSystemSaveCompleted:
|
||||
return "SystemSaveCompleted"
|
||||
case hcsNotificationSystemRdpEnhancedModeStateChanged:
|
||||
return "SystemRdpEnhancedModeStateChanged"
|
||||
case hcsNotificationSystemShutdownFailed:
|
||||
return "SystemShutdownFailed"
|
||||
case hcsNotificationSystemGetPropertiesCompleted:
|
||||
return "SystemGetPropertiesCompleted"
|
||||
case hcsNotificationSystemModifyCompleted:
|
||||
return "SystemModifyCompleted"
|
||||
case hcsNotificationSystemCrashInitiated:
|
||||
return "SystemCrashInitiated"
|
||||
case hcsNotificationSystemGuestConnectionClosed:
|
||||
return "SystemGuestConnectionClosed"
|
||||
case hcsNotificationProcessExited:
|
||||
return "ProcessExited"
|
||||
case hcsNotificationInvalid:
|
||||
return "Invalid"
|
||||
case hcsNotificationServiceDisconnect:
|
||||
return "ServiceDisconnect"
|
||||
default:
|
||||
return fmt.Sprintf("Unknown: %d", hn)
|
||||
}
|
||||
}
|
||||
|
||||
type notificationChannel chan error
|
||||
|
||||
type notifcationWatcherContext struct {
|
||||
channels notificationChannels
|
||||
handle hcsCallback
|
||||
handle vmcompute.HcsCallback
|
||||
|
||||
systemID string
|
||||
processID int
|
||||
}
|
||||
|
||||
type notificationChannels map[hcsNotification]notificationChannel
|
||||
|
||||
func newChannels() notificationChannels {
|
||||
func newSystemChannels() notificationChannels {
|
||||
channels := make(notificationChannels)
|
||||
for _, notif := range []hcsNotification{
|
||||
hcsNotificationServiceDisconnect,
|
||||
hcsNotificationSystemExited,
|
||||
hcsNotificationSystemCreateCompleted,
|
||||
hcsNotificationSystemStartCompleted,
|
||||
hcsNotificationSystemPauseCompleted,
|
||||
hcsNotificationSystemResumeCompleted,
|
||||
} {
|
||||
channels[notif] = make(notificationChannel, 1)
|
||||
}
|
||||
return channels
|
||||
}
|
||||
|
||||
channels[hcsNotificationSystemExited] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemCreateCompleted] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemStartCompleted] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemPauseCompleted] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemResumeCompleted] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationProcessExited] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationServiceDisconnect] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemCrashReport] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemSiloJobCreated] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemSaveCompleted] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemRdpEnhancedModeStateChanged] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemShutdownFailed] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemGetPropertiesCompleted] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemModifyCompleted] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemCrashInitiated] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemGuestConnectionClosed] = make(notificationChannel, 1)
|
||||
|
||||
func newProcessChannels() notificationChannels {
|
||||
channels := make(notificationChannels)
|
||||
for _, notif := range []hcsNotification{
|
||||
hcsNotificationServiceDisconnect,
|
||||
hcsNotificationProcessExited,
|
||||
} {
|
||||
channels[notif] = make(notificationChannel, 1)
|
||||
}
|
||||
return channels
|
||||
}
|
||||
|
||||
@@ -92,12 +143,17 @@ func notificationWatcher(notificationType hcsNotification, callbackNumber uintpt
|
||||
return 0
|
||||
}
|
||||
|
||||
log := logrus.WithFields(logrus.Fields{
|
||||
"notification-type": notificationType.String(),
|
||||
"system-id": context.systemID,
|
||||
})
|
||||
if context.processID != 0 {
|
||||
log.Data[logfields.ProcessID] = context.processID
|
||||
}
|
||||
log.Debug("HCS notification")
|
||||
|
||||
if channel, ok := context.channels[notificationType]; ok {
|
||||
channel <- result
|
||||
} else {
|
||||
logrus.WithFields(logrus.Fields{
|
||||
"notification-type": notificationType,
|
||||
}).Warn("Received a callback of an unsupported type")
|
||||
}
|
||||
|
||||
return 0
|
||||
|
||||
7
vendor/github.com/Microsoft/hcsshim/internal/hcs/cgo.go
generated
vendored
7
vendor/github.com/Microsoft/hcsshim/internal/hcs/cgo.go
generated
vendored
@@ -1,7 +0,0 @@
|
||||
package hcs
|
||||
|
||||
import "C"
|
||||
|
||||
// This import is needed to make the library compile as CGO because HCSSHIM
|
||||
// only works with CGO due to callbacks from HCS comming back from a C thread
|
||||
// which is not supported without CGO. See https://github.com/golang/go/issues/10973
|
||||
75
vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go
generated
vendored
75
vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go
generated
vendored
@@ -1,14 +1,14 @@
|
||||
package hcs
|
||||
|
||||
import (
|
||||
"context"
|
||||
"encoding/json"
|
||||
"errors"
|
||||
"fmt"
|
||||
"net"
|
||||
"syscall"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/interop"
|
||||
"github.com/Microsoft/hcsshim/internal/logfields"
|
||||
"github.com/sirupsen/logrus"
|
||||
"github.com/Microsoft/hcsshim/internal/log"
|
||||
)
|
||||
|
||||
var (
|
||||
@@ -117,17 +117,11 @@ func (ev *ErrorEvent) String() string {
|
||||
return evs
|
||||
}
|
||||
|
||||
func processHcsResult(resultp *uint16) []ErrorEvent {
|
||||
if resultp != nil {
|
||||
resultj := interop.ConvertAndFreeCoTaskMemString(resultp)
|
||||
logrus.WithField(logfields.JSON, resultj).
|
||||
Debug("HCS Result")
|
||||
func processHcsResult(ctx context.Context, resultJSON string) []ErrorEvent {
|
||||
if resultJSON != "" {
|
||||
result := &hcsResult{}
|
||||
if err := json.Unmarshal([]byte(resultj), result); err != nil {
|
||||
logrus.WithFields(logrus.Fields{
|
||||
logfields.JSON: resultj,
|
||||
logrus.ErrorKey: err,
|
||||
}).Warning("Could not unmarshal HCS result")
|
||||
if err := json.Unmarshal([]byte(resultJSON), result); err != nil {
|
||||
log.G(ctx).WithError(err).Warning("Could not unmarshal HCS result")
|
||||
return nil
|
||||
}
|
||||
return result.ErrorEvents
|
||||
@@ -141,6 +135,8 @@ type HcsError struct {
|
||||
Events []ErrorEvent
|
||||
}
|
||||
|
||||
var _ net.Error = &HcsError{}
|
||||
|
||||
func (e *HcsError) Error() string {
|
||||
s := e.Op + ": " + e.Err.Error()
|
||||
for _, ev := range e.Events {
|
||||
@@ -149,6 +145,16 @@ func (e *HcsError) Error() string {
|
||||
return s
|
||||
}
|
||||
|
||||
func (e *HcsError) Temporary() bool {
|
||||
err, ok := e.Err.(net.Error)
|
||||
return ok && err.Temporary()
|
||||
}
|
||||
|
||||
func (e *HcsError) Timeout() bool {
|
||||
err, ok := e.Err.(net.Error)
|
||||
return ok && err.Timeout()
|
||||
}
|
||||
|
||||
// ProcessError is an error encountered in HCS during an operation on a Process object
|
||||
type ProcessError struct {
|
||||
SystemID string
|
||||
@@ -158,6 +164,8 @@ type ProcessError struct {
|
||||
Events []ErrorEvent
|
||||
}
|
||||
|
||||
var _ net.Error = &ProcessError{}
|
||||
|
||||
// SystemError is an error encountered in HCS during an operation on a Container object
|
||||
type SystemError struct {
|
||||
ID string
|
||||
@@ -167,6 +175,8 @@ type SystemError struct {
|
||||
Events []ErrorEvent
|
||||
}
|
||||
|
||||
var _ net.Error = &SystemError{}
|
||||
|
||||
func (e *SystemError) Error() string {
|
||||
s := e.Op + " " + e.ID + ": " + e.Err.Error()
|
||||
for _, ev := range e.Events {
|
||||
@@ -178,6 +188,16 @@ func (e *SystemError) Error() string {
|
||||
return s
|
||||
}
|
||||
|
||||
func (e *SystemError) Temporary() bool {
|
||||
err, ok := e.Err.(net.Error)
|
||||
return ok && err.Temporary()
|
||||
}
|
||||
|
||||
func (e *SystemError) Timeout() bool {
|
||||
err, ok := e.Err.(net.Error)
|
||||
return ok && err.Timeout()
|
||||
}
|
||||
|
||||
func makeSystemError(system *System, op string, extra string, err error, events []ErrorEvent) error {
|
||||
// Don't double wrap errors
|
||||
if _, ok := err.(*SystemError); ok {
|
||||
@@ -200,6 +220,16 @@ func (e *ProcessError) Error() string {
|
||||
return s
|
||||
}
|
||||
|
||||
func (e *ProcessError) Temporary() bool {
|
||||
err, ok := e.Err.(net.Error)
|
||||
return ok && err.Temporary()
|
||||
}
|
||||
|
||||
func (e *ProcessError) Timeout() bool {
|
||||
err, ok := e.Err.(net.Error)
|
||||
return ok && err.Timeout()
|
||||
}
|
||||
|
||||
func makeProcessError(process *Process, op string, err error, events []ErrorEvent) error {
|
||||
// Don't double wrap errors
|
||||
if _, ok := err.(*ProcessError); ok {
|
||||
@@ -242,6 +272,9 @@ func IsPending(err error) bool {
|
||||
// IsTimeout returns a boolean indicating whether the error is caused by
|
||||
// a timeout waiting for the operation to complete.
|
||||
func IsTimeout(err error) bool {
|
||||
if err, ok := err.(net.Error); ok && err.Timeout() {
|
||||
return true
|
||||
}
|
||||
err = getInnerError(err)
|
||||
return err == ErrTimeout
|
||||
}
|
||||
@@ -272,6 +305,13 @@ func IsNotSupported(err error) bool {
|
||||
err == ErrVmcomputeUnknownMessage
|
||||
}
|
||||
|
||||
// IsOperationInvalidState returns true when err is caused by
|
||||
// `ErrVmcomputeOperationInvalidState`.
|
||||
func IsOperationInvalidState(err error) bool {
|
||||
err = getInnerError(err)
|
||||
return err == ErrVmcomputeOperationInvalidState
|
||||
}
|
||||
|
||||
func getInnerError(err error) error {
|
||||
switch pe := err.(type) {
|
||||
case nil:
|
||||
@@ -285,3 +325,12 @@ func getInnerError(err error) error {
|
||||
}
|
||||
return err
|
||||
}
|
||||
|
||||
func getOperationLogResult(err error) (string, error) {
|
||||
switch err {
|
||||
case nil:
|
||||
return "Success", nil
|
||||
default:
|
||||
return "Error", err
|
||||
}
|
||||
}
|
||||
|
||||
48
vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go
generated
vendored
48
vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go
generated
vendored
@@ -1,48 +0,0 @@
|
||||
// Shim for the Host Compute Service (HCS) to manage Windows Server
|
||||
// containers and Hyper-V containers.
|
||||
|
||||
package hcs
|
||||
|
||||
import (
|
||||
"syscall"
|
||||
)
|
||||
|
||||
//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hcs.go
|
||||
|
||||
//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems?
|
||||
//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem?
|
||||
//sys hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem?
|
||||
//sys hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem?
|
||||
//sys hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem?
|
||||
//sys hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem?
|
||||
//sys hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem?
|
||||
//sys hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem?
|
||||
//sys hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem?
|
||||
//sys hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties?
|
||||
//sys hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem?
|
||||
//sys hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback?
|
||||
//sys hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback?
|
||||
|
||||
//sys hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess?
|
||||
//sys hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess?
|
||||
//sys hcsCloseProcess(process hcsProcess) (hr error) = vmcompute.HcsCloseProcess?
|
||||
//sys hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess?
|
||||
//sys hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) = vmcompute.HcsTerminateProcess?
|
||||
//sys hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo?
|
||||
//sys hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties?
|
||||
//sys hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess?
|
||||
//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties?
|
||||
//sys hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback?
|
||||
//sys hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback?
|
||||
|
||||
type hcsSystem syscall.Handle
|
||||
type hcsProcess syscall.Handle
|
||||
type hcsCallback syscall.Handle
|
||||
|
||||
type hcsProcessInformation struct {
|
||||
ProcessId uint32
|
||||
Reserved uint32
|
||||
StdInput syscall.Handle
|
||||
StdOutput syscall.Handle
|
||||
StdError syscall.Handle
|
||||
}
|
||||
20
vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go
generated
vendored
20
vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go
generated
vendored
@@ -1,20 +0,0 @@
|
||||
package hcs
|
||||
|
||||
import "github.com/sirupsen/logrus"
|
||||
|
||||
func logOperationBegin(ctx logrus.Fields, msg string) {
|
||||
logrus.WithFields(ctx).Debug(msg)
|
||||
}
|
||||
|
||||
func logOperationEnd(ctx logrus.Fields, msg string, err error) {
|
||||
// Copy the log and fields first.
|
||||
log := logrus.WithFields(ctx)
|
||||
if err == nil {
|
||||
log.Debug(msg)
|
||||
} else {
|
||||
// Edit only the copied field data to avoid race conditions on the
|
||||
// write.
|
||||
log.Data[logrus.ErrorKey] = err
|
||||
log.Error(msg)
|
||||
}
|
||||
}
|
||||
441
vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go
generated
vendored
441
vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go
generated
vendored
@@ -1,48 +1,47 @@
|
||||
package hcs
|
||||
|
||||
import (
|
||||
"context"
|
||||
"encoding/json"
|
||||
"io"
|
||||
"sync"
|
||||
"syscall"
|
||||
"time"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/guestrequest"
|
||||
"github.com/Microsoft/hcsshim/internal/interop"
|
||||
"github.com/Microsoft/hcsshim/internal/logfields"
|
||||
"github.com/sirupsen/logrus"
|
||||
"github.com/Microsoft/hcsshim/internal/log"
|
||||
"github.com/Microsoft/hcsshim/internal/oc"
|
||||
"github.com/Microsoft/hcsshim/internal/vmcompute"
|
||||
"go.opencensus.io/trace"
|
||||
)
|
||||
|
||||
// ContainerError is an error encountered in HCS
|
||||
type Process struct {
|
||||
handleLock sync.RWMutex
|
||||
handle hcsProcess
|
||||
handle vmcompute.HcsProcess
|
||||
processID int
|
||||
system *System
|
||||
cachedPipes *cachedPipes
|
||||
hasCachedStdio bool
|
||||
stdioLock sync.Mutex
|
||||
stdin io.WriteCloser
|
||||
stdout io.ReadCloser
|
||||
stderr io.ReadCloser
|
||||
callbackNumber uintptr
|
||||
|
||||
logctx logrus.Fields
|
||||
closedWaitOnce sync.Once
|
||||
waitBlock chan struct{}
|
||||
exitCode int
|
||||
waitError error
|
||||
}
|
||||
|
||||
func newProcess(process hcsProcess, processID int, computeSystem *System) *Process {
|
||||
func newProcess(process vmcompute.HcsProcess, processID int, computeSystem *System) *Process {
|
||||
return &Process{
|
||||
handle: process,
|
||||
processID: processID,
|
||||
system: computeSystem,
|
||||
logctx: logrus.Fields{
|
||||
logfields.ContainerID: computeSystem.ID(),
|
||||
logfields.ProcessID: processID,
|
||||
},
|
||||
waitBlock: make(chan struct{}),
|
||||
}
|
||||
}
|
||||
|
||||
type cachedPipes struct {
|
||||
stdIn syscall.Handle
|
||||
stdOut syscall.Handle
|
||||
stdErr syscall.Handle
|
||||
}
|
||||
|
||||
type processModifyRequest struct {
|
||||
Operation string
|
||||
ConsoleSize *consoleSize `json:",omitempty"`
|
||||
@@ -58,7 +57,7 @@ type closeHandle struct {
|
||||
Handle string
|
||||
}
|
||||
|
||||
type ProcessStatus struct {
|
||||
type processStatus struct {
|
||||
ProcessID uint32
|
||||
Exited bool
|
||||
ExitCode uint32
|
||||
@@ -86,120 +85,153 @@ func (process *Process) SystemID() string {
|
||||
return process.system.ID()
|
||||
}
|
||||
|
||||
func (process *Process) logOperationBegin(operation string) {
|
||||
logOperationBegin(
|
||||
process.logctx,
|
||||
operation+" - Begin Operation")
|
||||
}
|
||||
|
||||
func (process *Process) logOperationEnd(operation string, err error) {
|
||||
var result string
|
||||
if err == nil {
|
||||
result = "Success"
|
||||
} else {
|
||||
result = "Error"
|
||||
func (process *Process) processSignalResult(ctx context.Context, err error) (bool, error) {
|
||||
switch err {
|
||||
case nil:
|
||||
return true, nil
|
||||
case ErrVmcomputeOperationInvalidState, ErrComputeSystemDoesNotExist, ErrElementNotFound:
|
||||
select {
|
||||
case <-process.waitBlock:
|
||||
// The process exit notification has already arrived.
|
||||
default:
|
||||
// The process should be gone, but we have not received the notification.
|
||||
// After a second, force unblock the process wait to work around a possible
|
||||
// deadlock in the HCS.
|
||||
go func() {
|
||||
time.Sleep(time.Second)
|
||||
process.closedWaitOnce.Do(func() {
|
||||
log.G(ctx).WithError(err).Warn("force unblocking process waits")
|
||||
process.exitCode = -1
|
||||
process.waitError = err
|
||||
close(process.waitBlock)
|
||||
})
|
||||
}()
|
||||
}
|
||||
return false, nil
|
||||
default:
|
||||
return false, err
|
||||
}
|
||||
|
||||
logOperationEnd(
|
||||
process.logctx,
|
||||
operation+" - End Operation - "+result,
|
||||
err)
|
||||
}
|
||||
|
||||
// Signal signals the process with `options`.
|
||||
func (process *Process) Signal(options guestrequest.SignalProcessOptions) (err error) {
|
||||
//
|
||||
// For LCOW `guestrequest.SignalProcessOptionsLCOW`.
|
||||
//
|
||||
// For WCOW `guestrequest.SignalProcessOptionsWCOW`.
|
||||
func (process *Process) Signal(ctx context.Context, options interface{}) (bool, error) {
|
||||
process.handleLock.RLock()
|
||||
defer process.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::Process::Signal"
|
||||
process.logOperationBegin(operation)
|
||||
defer func() { process.logOperationEnd(operation, err) }()
|
||||
|
||||
if process.handle == 0 {
|
||||
return makeProcessError(process, operation, ErrAlreadyClosed, nil)
|
||||
return false, makeProcessError(process, operation, ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
optionsb, err := json.Marshal(options)
|
||||
if err != nil {
|
||||
return err
|
||||
return false, err
|
||||
}
|
||||
|
||||
optionsStr := string(optionsb)
|
||||
|
||||
var resultp *uint16
|
||||
syscallWatcher(process.logctx, func() {
|
||||
err = hcsSignalProcess(process.handle, optionsStr, &resultp)
|
||||
})
|
||||
events := processHcsResult(resultp)
|
||||
resultJSON, err := vmcompute.HcsSignalProcess(ctx, process.handle, string(optionsb))
|
||||
events := processHcsResult(ctx, resultJSON)
|
||||
delivered, err := process.processSignalResult(ctx, err)
|
||||
if err != nil {
|
||||
return makeProcessError(process, operation, err, events)
|
||||
err = makeProcessError(process, operation, err, events)
|
||||
}
|
||||
|
||||
return nil
|
||||
return delivered, err
|
||||
}
|
||||
|
||||
// Kill signals the process to terminate but does not wait for it to finish terminating.
|
||||
func (process *Process) Kill() (err error) {
|
||||
func (process *Process) Kill(ctx context.Context) (bool, error) {
|
||||
process.handleLock.RLock()
|
||||
defer process.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::Process::Kill"
|
||||
process.logOperationBegin(operation)
|
||||
defer func() { process.logOperationEnd(operation, err) }()
|
||||
|
||||
if process.handle == 0 {
|
||||
return makeProcessError(process, operation, ErrAlreadyClosed, nil)
|
||||
return false, makeProcessError(process, operation, ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
var resultp *uint16
|
||||
syscallWatcher(process.logctx, func() {
|
||||
err = hcsTerminateProcess(process.handle, &resultp)
|
||||
resultJSON, err := vmcompute.HcsTerminateProcess(ctx, process.handle)
|
||||
events := processHcsResult(ctx, resultJSON)
|
||||
delivered, err := process.processSignalResult(ctx, err)
|
||||
if err != nil {
|
||||
err = makeProcessError(process, operation, err, events)
|
||||
}
|
||||
return delivered, err
|
||||
}
|
||||
|
||||
// waitBackground waits for the process exit notification. Once received sets
|
||||
// `process.waitError` (if any) and unblocks all `Wait` calls.
|
||||
//
|
||||
// This MUST be called exactly once per `process.handle` but `Wait` is safe to
|
||||
// call multiple times.
|
||||
func (process *Process) waitBackground() {
|
||||
operation := "hcsshim::Process::waitBackground"
|
||||
ctx, span := trace.StartSpan(context.Background(), operation)
|
||||
defer span.End()
|
||||
span.AddAttributes(
|
||||
trace.StringAttribute("cid", process.SystemID()),
|
||||
trace.Int64Attribute("pid", int64(process.processID)))
|
||||
|
||||
var (
|
||||
err error
|
||||
exitCode = -1
|
||||
)
|
||||
|
||||
err = waitForNotification(ctx, process.callbackNumber, hcsNotificationProcessExited, nil)
|
||||
if err != nil {
|
||||
err = makeProcessError(process, operation, err, nil)
|
||||
log.G(ctx).WithError(err).Error("failed wait")
|
||||
} else {
|
||||
process.handleLock.RLock()
|
||||
defer process.handleLock.RUnlock()
|
||||
|
||||
// Make sure we didnt race with Close() here
|
||||
if process.handle != 0 {
|
||||
propertiesJSON, resultJSON, err := vmcompute.HcsGetProcessProperties(ctx, process.handle)
|
||||
events := processHcsResult(ctx, resultJSON)
|
||||
if err != nil {
|
||||
err = makeProcessError(process, operation, err, events)
|
||||
} else {
|
||||
properties := &processStatus{}
|
||||
err = json.Unmarshal([]byte(propertiesJSON), properties)
|
||||
if err != nil {
|
||||
err = makeProcessError(process, operation, err, nil)
|
||||
} else {
|
||||
if properties.LastWaitResult != 0 {
|
||||
log.G(ctx).WithField("wait-result", properties.LastWaitResult).Warning("non-zero last wait result")
|
||||
} else {
|
||||
exitCode = int(properties.ExitCode)
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
log.G(ctx).WithField("exitCode", exitCode).Debug("process exited")
|
||||
|
||||
process.closedWaitOnce.Do(func() {
|
||||
process.exitCode = exitCode
|
||||
process.waitError = err
|
||||
close(process.waitBlock)
|
||||
})
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return makeProcessError(process, operation, err, events)
|
||||
}
|
||||
|
||||
return nil
|
||||
oc.SetSpanStatus(span, err)
|
||||
}
|
||||
|
||||
// Wait waits for the process to exit.
|
||||
func (process *Process) Wait() (err error) {
|
||||
operation := "hcsshim::Process::Wait"
|
||||
process.logOperationBegin(operation)
|
||||
defer func() { process.logOperationEnd(operation, err) }()
|
||||
|
||||
err = waitForNotification(process.callbackNumber, hcsNotificationProcessExited, nil)
|
||||
if err != nil {
|
||||
return makeProcessError(process, operation, err, nil)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// WaitTimeout waits for the process to exit or the duration to elapse. It returns
|
||||
// false if timeout occurs.
|
||||
func (process *Process) WaitTimeout(timeout time.Duration) (err error) {
|
||||
operation := "hcssshim::Process::WaitTimeout"
|
||||
process.logOperationBegin(operation)
|
||||
defer func() { process.logOperationEnd(operation, err) }()
|
||||
|
||||
err = waitForNotification(process.callbackNumber, hcsNotificationProcessExited, &timeout)
|
||||
if err != nil {
|
||||
return makeProcessError(process, operation, err, nil)
|
||||
}
|
||||
|
||||
return nil
|
||||
// Wait waits for the process to exit. If the process has already exited returns
|
||||
// the pervious error (if any).
|
||||
func (process *Process) Wait() error {
|
||||
<-process.waitBlock
|
||||
return process.waitError
|
||||
}
|
||||
|
||||
// ResizeConsole resizes the console of the process.
|
||||
func (process *Process) ResizeConsole(width, height uint16) (err error) {
|
||||
func (process *Process) ResizeConsole(ctx context.Context, width, height uint16) error {
|
||||
process.handleLock.RLock()
|
||||
defer process.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::Process::ResizeConsole"
|
||||
process.logOperationBegin(operation)
|
||||
defer func() { process.logOperationEnd(operation, err) }()
|
||||
|
||||
if process.handle == 0 {
|
||||
return makeProcessError(process, operation, ErrAlreadyClosed, nil)
|
||||
@@ -218,11 +250,8 @@ func (process *Process) ResizeConsole(width, height uint16) (err error) {
|
||||
return err
|
||||
}
|
||||
|
||||
modifyRequestStr := string(modifyRequestb)
|
||||
|
||||
var resultp *uint16
|
||||
err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp)
|
||||
events := processHcsResult(resultp)
|
||||
resultJSON, err := vmcompute.HcsModifyProcess(ctx, process.handle, string(modifyRequestb))
|
||||
events := processHcsResult(ctx, resultJSON)
|
||||
if err != nil {
|
||||
return makeProcessError(process, operation, err, events)
|
||||
}
|
||||
@@ -230,104 +259,55 @@ func (process *Process) ResizeConsole(width, height uint16) (err error) {
|
||||
return nil
|
||||
}
|
||||
|
||||
func (process *Process) Properties() (_ *ProcessStatus, err error) {
|
||||
process.handleLock.RLock()
|
||||
defer process.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::Process::Properties"
|
||||
process.logOperationBegin(operation)
|
||||
defer func() { process.logOperationEnd(operation, err) }()
|
||||
|
||||
if process.handle == 0 {
|
||||
return nil, makeProcessError(process, operation, ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
var (
|
||||
resultp *uint16
|
||||
propertiesp *uint16
|
||||
)
|
||||
syscallWatcher(process.logctx, func() {
|
||||
err = hcsGetProcessProperties(process.handle, &propertiesp, &resultp)
|
||||
})
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return nil, makeProcessError(process, operation, err, events)
|
||||
}
|
||||
|
||||
if propertiesp == nil {
|
||||
return nil, ErrUnexpectedValue
|
||||
}
|
||||
propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp)
|
||||
|
||||
properties := &ProcessStatus{}
|
||||
if err := json.Unmarshal(propertiesRaw, properties); err != nil {
|
||||
return nil, makeProcessError(process, operation, err, nil)
|
||||
}
|
||||
|
||||
return properties, nil
|
||||
}
|
||||
|
||||
// ExitCode returns the exit code of the process. The process must have
|
||||
// already terminated.
|
||||
func (process *Process) ExitCode() (_ int, err error) {
|
||||
operation := "hcsshim::Process::ExitCode"
|
||||
process.logOperationBegin(operation)
|
||||
defer func() { process.logOperationEnd(operation, err) }()
|
||||
|
||||
properties, err := process.Properties()
|
||||
if err != nil {
|
||||
return 0, makeProcessError(process, operation, err, nil)
|
||||
func (process *Process) ExitCode() (int, error) {
|
||||
select {
|
||||
case <-process.waitBlock:
|
||||
if process.waitError != nil {
|
||||
return -1, process.waitError
|
||||
}
|
||||
return process.exitCode, nil
|
||||
default:
|
||||
return -1, makeProcessError(process, "hcsshim::Process::ExitCode", ErrInvalidProcessState, nil)
|
||||
}
|
||||
|
||||
if properties.Exited == false {
|
||||
return 0, makeProcessError(process, operation, ErrInvalidProcessState, nil)
|
||||
}
|
||||
|
||||
if properties.LastWaitResult != 0 {
|
||||
return 0, makeProcessError(process, operation, syscall.Errno(properties.LastWaitResult), nil)
|
||||
}
|
||||
|
||||
return int(properties.ExitCode), nil
|
||||
}
|
||||
|
||||
// Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing
|
||||
// these pipes does not close the underlying pipes; it should be possible to
|
||||
// call this multiple times to get multiple interfaces.
|
||||
func (process *Process) Stdio() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadCloser, err error) {
|
||||
// StdioLegacy returns the stdin, stdout, and stderr pipes, respectively. Closing
|
||||
// these pipes does not close the underlying pipes. Once returned, these pipes
|
||||
// are the responsibility of the caller to close.
|
||||
func (process *Process) StdioLegacy() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadCloser, err error) {
|
||||
operation := "hcsshim::Process::StdioLegacy"
|
||||
ctx, span := trace.StartSpan(context.Background(), operation)
|
||||
defer span.End()
|
||||
defer func() { oc.SetSpanStatus(span, err) }()
|
||||
span.AddAttributes(
|
||||
trace.StringAttribute("cid", process.SystemID()),
|
||||
trace.Int64Attribute("pid", int64(process.processID)))
|
||||
|
||||
process.handleLock.RLock()
|
||||
defer process.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::Process::Stdio"
|
||||
process.logOperationBegin(operation)
|
||||
defer func() { process.logOperationEnd(operation, err) }()
|
||||
|
||||
if process.handle == 0 {
|
||||
return nil, nil, nil, makeProcessError(process, operation, ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
var stdIn, stdOut, stdErr syscall.Handle
|
||||
|
||||
if process.cachedPipes == nil {
|
||||
var (
|
||||
processInfo hcsProcessInformation
|
||||
resultp *uint16
|
||||
)
|
||||
err = hcsGetProcessInfo(process.handle, &processInfo, &resultp)
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return nil, nil, nil, makeProcessError(process, operation, err, events)
|
||||
}
|
||||
|
||||
stdIn, stdOut, stdErr = processInfo.StdInput, processInfo.StdOutput, processInfo.StdError
|
||||
} else {
|
||||
// Use cached pipes
|
||||
stdIn, stdOut, stdErr = process.cachedPipes.stdIn, process.cachedPipes.stdOut, process.cachedPipes.stdErr
|
||||
|
||||
// Invalidate the cache
|
||||
process.cachedPipes = nil
|
||||
process.stdioLock.Lock()
|
||||
defer process.stdioLock.Unlock()
|
||||
if process.hasCachedStdio {
|
||||
stdin, stdout, stderr := process.stdin, process.stdout, process.stderr
|
||||
process.stdin, process.stdout, process.stderr = nil, nil, nil
|
||||
process.hasCachedStdio = false
|
||||
return stdin, stdout, stderr, nil
|
||||
}
|
||||
|
||||
pipes, err := makeOpenFiles([]syscall.Handle{stdIn, stdOut, stdErr})
|
||||
processInfo, resultJSON, err := vmcompute.HcsGetProcessInfo(ctx, process.handle)
|
||||
events := processHcsResult(ctx, resultJSON)
|
||||
if err != nil {
|
||||
return nil, nil, nil, makeProcessError(process, operation, err, events)
|
||||
}
|
||||
|
||||
pipes, err := makeOpenFiles([]syscall.Handle{processInfo.StdInput, processInfo.StdOutput, processInfo.StdError})
|
||||
if err != nil {
|
||||
return nil, nil, nil, makeProcessError(process, operation, err, nil)
|
||||
}
|
||||
@@ -335,15 +315,21 @@ func (process *Process) Stdio() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadClo
|
||||
return pipes[0], pipes[1], pipes[2], nil
|
||||
}
|
||||
|
||||
// Stdio returns the stdin, stdout, and stderr pipes, respectively.
|
||||
// To close them, close the process handle.
|
||||
func (process *Process) Stdio() (stdin io.Writer, stdout, stderr io.Reader) {
|
||||
process.stdioLock.Lock()
|
||||
defer process.stdioLock.Unlock()
|
||||
return process.stdin, process.stdout, process.stderr
|
||||
}
|
||||
|
||||
// CloseStdin closes the write side of the stdin pipe so that the process is
|
||||
// notified on the read side that there is no more data in stdin.
|
||||
func (process *Process) CloseStdin() (err error) {
|
||||
func (process *Process) CloseStdin(ctx context.Context) error {
|
||||
process.handleLock.RLock()
|
||||
defer process.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::Process::CloseStdin"
|
||||
process.logOperationBegin(operation)
|
||||
defer func() { process.logOperationEnd(operation, err) }()
|
||||
|
||||
if process.handle == 0 {
|
||||
return makeProcessError(process, operation, ErrAlreadyClosed, nil)
|
||||
@@ -361,96 +347,125 @@ func (process *Process) CloseStdin() (err error) {
|
||||
return err
|
||||
}
|
||||
|
||||
modifyRequestStr := string(modifyRequestb)
|
||||
|
||||
var resultp *uint16
|
||||
err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp)
|
||||
events := processHcsResult(resultp)
|
||||
resultJSON, err := vmcompute.HcsModifyProcess(ctx, process.handle, string(modifyRequestb))
|
||||
events := processHcsResult(ctx, resultJSON)
|
||||
if err != nil {
|
||||
return makeProcessError(process, operation, err, events)
|
||||
}
|
||||
|
||||
process.stdioLock.Lock()
|
||||
if process.stdin != nil {
|
||||
process.stdin.Close()
|
||||
process.stdin = nil
|
||||
}
|
||||
process.stdioLock.Unlock()
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// Close cleans up any state associated with the process but does not kill
|
||||
// or wait on it.
|
||||
func (process *Process) Close() (err error) {
|
||||
operation := "hcsshim::Process::Close"
|
||||
ctx, span := trace.StartSpan(context.Background(), operation)
|
||||
defer span.End()
|
||||
defer func() { oc.SetSpanStatus(span, err) }()
|
||||
span.AddAttributes(
|
||||
trace.StringAttribute("cid", process.SystemID()),
|
||||
trace.Int64Attribute("pid", int64(process.processID)))
|
||||
|
||||
process.handleLock.Lock()
|
||||
defer process.handleLock.Unlock()
|
||||
|
||||
operation := "hcsshim::Process::Close"
|
||||
process.logOperationBegin(operation)
|
||||
defer func() { process.logOperationEnd(operation, err) }()
|
||||
|
||||
// Don't double free this
|
||||
if process.handle == 0 {
|
||||
return nil
|
||||
}
|
||||
|
||||
if err = process.unregisterCallback(); err != nil {
|
||||
process.stdioLock.Lock()
|
||||
if process.stdin != nil {
|
||||
process.stdin.Close()
|
||||
process.stdin = nil
|
||||
}
|
||||
if process.stdout != nil {
|
||||
process.stdout.Close()
|
||||
process.stdout = nil
|
||||
}
|
||||
if process.stderr != nil {
|
||||
process.stderr.Close()
|
||||
process.stderr = nil
|
||||
}
|
||||
process.stdioLock.Unlock()
|
||||
|
||||
if err = process.unregisterCallback(ctx); err != nil {
|
||||
return makeProcessError(process, operation, err, nil)
|
||||
}
|
||||
|
||||
if err = hcsCloseProcess(process.handle); err != nil {
|
||||
if err = vmcompute.HcsCloseProcess(ctx, process.handle); err != nil {
|
||||
return makeProcessError(process, operation, err, nil)
|
||||
}
|
||||
|
||||
process.handle = 0
|
||||
process.closedWaitOnce.Do(func() {
|
||||
process.exitCode = -1
|
||||
process.waitError = ErrAlreadyClosed
|
||||
close(process.waitBlock)
|
||||
})
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (process *Process) registerCallback() error {
|
||||
context := ¬ifcationWatcherContext{
|
||||
channels: newChannels(),
|
||||
func (process *Process) registerCallback(ctx context.Context) error {
|
||||
callbackContext := ¬ifcationWatcherContext{
|
||||
channels: newProcessChannels(),
|
||||
systemID: process.SystemID(),
|
||||
processID: process.processID,
|
||||
}
|
||||
|
||||
callbackMapLock.Lock()
|
||||
callbackNumber := nextCallback
|
||||
nextCallback++
|
||||
callbackMap[callbackNumber] = context
|
||||
callbackMap[callbackNumber] = callbackContext
|
||||
callbackMapLock.Unlock()
|
||||
|
||||
var callbackHandle hcsCallback
|
||||
err := hcsRegisterProcessCallback(process.handle, notificationWatcherCallback, callbackNumber, &callbackHandle)
|
||||
callbackHandle, err := vmcompute.HcsRegisterProcessCallback(ctx, process.handle, notificationWatcherCallback, callbackNumber)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
context.handle = callbackHandle
|
||||
callbackContext.handle = callbackHandle
|
||||
process.callbackNumber = callbackNumber
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (process *Process) unregisterCallback() error {
|
||||
func (process *Process) unregisterCallback(ctx context.Context) error {
|
||||
callbackNumber := process.callbackNumber
|
||||
|
||||
callbackMapLock.RLock()
|
||||
context := callbackMap[callbackNumber]
|
||||
callbackContext := callbackMap[callbackNumber]
|
||||
callbackMapLock.RUnlock()
|
||||
|
||||
if context == nil {
|
||||
if callbackContext == nil {
|
||||
return nil
|
||||
}
|
||||
|
||||
handle := context.handle
|
||||
handle := callbackContext.handle
|
||||
|
||||
if handle == 0 {
|
||||
return nil
|
||||
}
|
||||
|
||||
// hcsUnregisterProcessCallback has its own syncronization
|
||||
// to wait for all callbacks to complete. We must NOT hold the callbackMapLock.
|
||||
err := hcsUnregisterProcessCallback(handle)
|
||||
// vmcompute.HcsUnregisterProcessCallback has its own synchronization to
|
||||
// wait for all callbacks to complete. We must NOT hold the callbackMapLock.
|
||||
err := vmcompute.HcsUnregisterProcessCallback(ctx, handle)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
closeChannels(context.channels)
|
||||
closeChannels(callbackContext.channels)
|
||||
|
||||
callbackMapLock.Lock()
|
||||
callbackMap[callbackNumber] = nil
|
||||
delete(callbackMap, callbackNumber)
|
||||
callbackMapLock.Unlock()
|
||||
|
||||
handle = 0
|
||||
|
||||
5
vendor/github.com/Microsoft/hcsshim/internal/hcs/syscall.go
generated
vendored
Normal file
5
vendor/github.com/Microsoft/hcsshim/internal/hcs/syscall.go
generated
vendored
Normal file
@@ -0,0 +1,5 @@
|
||||
package hcs
|
||||
|
||||
//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go syscall.go
|
||||
|
||||
//sys hcsFormatWritableLayerVhd(handle uintptr) (hr error) = computestorage.HcsFormatWritableLayerVhd
|
||||
697
vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go
generated
vendored
697
vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go
generated
vendored
@@ -1,86 +1,56 @@
|
||||
package hcs
|
||||
|
||||
import (
|
||||
"context"
|
||||
"encoding/json"
|
||||
"os"
|
||||
"strconv"
|
||||
"errors"
|
||||
"strings"
|
||||
"sync"
|
||||
"syscall"
|
||||
"time"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/interop"
|
||||
"github.com/Microsoft/hcsshim/internal/logfields"
|
||||
"github.com/Microsoft/hcsshim/internal/cow"
|
||||
"github.com/Microsoft/hcsshim/internal/log"
|
||||
"github.com/Microsoft/hcsshim/internal/oc"
|
||||
"github.com/Microsoft/hcsshim/internal/schema1"
|
||||
hcsschema "github.com/Microsoft/hcsshim/internal/schema2"
|
||||
"github.com/Microsoft/hcsshim/internal/timeout"
|
||||
"github.com/sirupsen/logrus"
|
||||
"github.com/Microsoft/hcsshim/internal/vmcompute"
|
||||
"go.opencensus.io/trace"
|
||||
)
|
||||
|
||||
// currentContainerStarts is used to limit the number of concurrent container
|
||||
// starts.
|
||||
var currentContainerStarts containerStarts
|
||||
|
||||
type containerStarts struct {
|
||||
maxParallel int
|
||||
inProgress int
|
||||
sync.Mutex
|
||||
}
|
||||
|
||||
func init() {
|
||||
mpsS := os.Getenv("HCSSHIM_MAX_PARALLEL_START")
|
||||
if len(mpsS) > 0 {
|
||||
mpsI, err := strconv.Atoi(mpsS)
|
||||
if err != nil || mpsI < 0 {
|
||||
return
|
||||
}
|
||||
currentContainerStarts.maxParallel = mpsI
|
||||
}
|
||||
}
|
||||
|
||||
type System struct {
|
||||
handleLock sync.RWMutex
|
||||
handle hcsSystem
|
||||
handle vmcompute.HcsSystem
|
||||
id string
|
||||
callbackNumber uintptr
|
||||
|
||||
logctx logrus.Fields
|
||||
closedWaitOnce sync.Once
|
||||
waitBlock chan struct{}
|
||||
waitError error
|
||||
exitError error
|
||||
|
||||
os, typ string
|
||||
}
|
||||
|
||||
func newSystem(id string) *System {
|
||||
return &System{
|
||||
id: id,
|
||||
logctx: logrus.Fields{
|
||||
logfields.ContainerID: id,
|
||||
},
|
||||
id: id,
|
||||
waitBlock: make(chan struct{}),
|
||||
}
|
||||
}
|
||||
|
||||
func (computeSystem *System) logOperationBegin(operation string) {
|
||||
logOperationBegin(
|
||||
computeSystem.logctx,
|
||||
operation+" - Begin Operation")
|
||||
}
|
||||
|
||||
func (computeSystem *System) logOperationEnd(operation string, err error) {
|
||||
var result string
|
||||
if err == nil {
|
||||
result = "Success"
|
||||
} else {
|
||||
result = "Error"
|
||||
}
|
||||
|
||||
logOperationEnd(
|
||||
computeSystem.logctx,
|
||||
operation+" - End Operation - "+result,
|
||||
err)
|
||||
}
|
||||
|
||||
// CreateComputeSystem creates a new compute system with the given configuration but does not start it.
|
||||
func CreateComputeSystem(id string, hcsDocumentInterface interface{}) (_ *System, err error) {
|
||||
func CreateComputeSystem(ctx context.Context, id string, hcsDocumentInterface interface{}) (_ *System, err error) {
|
||||
operation := "hcsshim::CreateComputeSystem"
|
||||
|
||||
// hcsCreateComputeSystemContext is an async operation. Start the outer span
|
||||
// here to measure the full create time.
|
||||
ctx, span := trace.StartSpan(ctx, operation)
|
||||
defer span.End()
|
||||
defer func() { oc.SetSpanStatus(span, err) }()
|
||||
span.AddAttributes(trace.StringAttribute("cid", id))
|
||||
|
||||
computeSystem := newSystem(id)
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||
|
||||
hcsDocumentB, err := json.Marshal(hcsDocumentInterface)
|
||||
if err != nil {
|
||||
@@ -89,126 +59,114 @@ func CreateComputeSystem(id string, hcsDocumentInterface interface{}) (_ *System
|
||||
|
||||
hcsDocument := string(hcsDocumentB)
|
||||
|
||||
logrus.WithFields(computeSystem.logctx).
|
||||
WithField(logfields.JSON, hcsDocument).
|
||||
Debug("HCS ComputeSystem Document")
|
||||
|
||||
var (
|
||||
resultp *uint16
|
||||
identity syscall.Handle
|
||||
resultJSON string
|
||||
createError error
|
||||
)
|
||||
syscallWatcher(computeSystem.logctx, func() {
|
||||
createError = hcsCreateComputeSystem(id, hcsDocument, identity, &computeSystem.handle, &resultp)
|
||||
})
|
||||
|
||||
computeSystem.handle, resultJSON, createError = vmcompute.HcsCreateComputeSystem(ctx, id, hcsDocument, identity)
|
||||
if createError == nil || IsPending(createError) {
|
||||
if err = computeSystem.registerCallback(); err != nil {
|
||||
defer func() {
|
||||
if err != nil {
|
||||
computeSystem.Close()
|
||||
}
|
||||
}()
|
||||
if err = computeSystem.registerCallback(ctx); err != nil {
|
||||
// Terminate the compute system if it still exists. We're okay to
|
||||
// ignore a failure here.
|
||||
computeSystem.Terminate()
|
||||
computeSystem.Terminate(ctx)
|
||||
return nil, makeSystemError(computeSystem, operation, "", err, nil)
|
||||
}
|
||||
}
|
||||
|
||||
events, err := processAsyncHcsResult(createError, resultp, computeSystem.callbackNumber, hcsNotificationSystemCreateCompleted, &timeout.SystemCreate)
|
||||
events, err := processAsyncHcsResult(ctx, createError, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemCreateCompleted, &timeout.SystemCreate)
|
||||
if err != nil {
|
||||
if err == ErrTimeout {
|
||||
// Terminate the compute system if it still exists. We're okay to
|
||||
// ignore a failure here.
|
||||
computeSystem.Terminate()
|
||||
computeSystem.Terminate(ctx)
|
||||
}
|
||||
return nil, makeSystemError(computeSystem, operation, hcsDocument, err, events)
|
||||
}
|
||||
|
||||
go computeSystem.waitBackground()
|
||||
if err = computeSystem.getCachedProperties(ctx); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return computeSystem, nil
|
||||
}
|
||||
|
||||
// OpenComputeSystem opens an existing compute system by ID.
|
||||
func OpenComputeSystem(id string) (_ *System, err error) {
|
||||
func OpenComputeSystem(ctx context.Context, id string) (*System, error) {
|
||||
operation := "hcsshim::OpenComputeSystem"
|
||||
|
||||
computeSystem := newSystem(id)
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() {
|
||||
if IsNotExist(err) {
|
||||
computeSystem.logOperationEnd(operation, nil)
|
||||
} else {
|
||||
computeSystem.logOperationEnd(operation, err)
|
||||
}
|
||||
}()
|
||||
|
||||
var (
|
||||
handle hcsSystem
|
||||
resultp *uint16
|
||||
)
|
||||
err = hcsOpenComputeSystem(id, &handle, &resultp)
|
||||
events := processHcsResult(resultp)
|
||||
handle, resultJSON, err := vmcompute.HcsOpenComputeSystem(ctx, id)
|
||||
events := processHcsResult(ctx, resultJSON)
|
||||
if err != nil {
|
||||
return nil, makeSystemError(computeSystem, operation, "", err, events)
|
||||
}
|
||||
|
||||
computeSystem.handle = handle
|
||||
|
||||
if err = computeSystem.registerCallback(); err != nil {
|
||||
defer func() {
|
||||
if err != nil {
|
||||
computeSystem.Close()
|
||||
}
|
||||
}()
|
||||
if err = computeSystem.registerCallback(ctx); err != nil {
|
||||
return nil, makeSystemError(computeSystem, operation, "", err, nil)
|
||||
}
|
||||
|
||||
go computeSystem.waitBackground()
|
||||
if err = computeSystem.getCachedProperties(ctx); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return computeSystem, nil
|
||||
}
|
||||
|
||||
func (computeSystem *System) getCachedProperties(ctx context.Context) error {
|
||||
props, err := computeSystem.Properties(ctx)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
computeSystem.typ = strings.ToLower(props.SystemType)
|
||||
computeSystem.os = strings.ToLower(props.RuntimeOSType)
|
||||
if computeSystem.os == "" && computeSystem.typ == "container" {
|
||||
// Pre-RS5 HCS did not return the OS, but it only supported containers
|
||||
// that ran Windows.
|
||||
computeSystem.os = "windows"
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// OS returns the operating system of the compute system, "linux" or "windows".
|
||||
func (computeSystem *System) OS() string {
|
||||
return computeSystem.os
|
||||
}
|
||||
|
||||
// IsOCI returns whether processes in the compute system should be created via
|
||||
// OCI.
|
||||
func (computeSystem *System) IsOCI() bool {
|
||||
return computeSystem.os == "linux" && computeSystem.typ == "container"
|
||||
}
|
||||
|
||||
// GetComputeSystems gets a list of the compute systems on the system that match the query
|
||||
func GetComputeSystems(q schema1.ComputeSystemQuery) (_ []schema1.ContainerProperties, err error) {
|
||||
func GetComputeSystems(ctx context.Context, q schema1.ComputeSystemQuery) ([]schema1.ContainerProperties, error) {
|
||||
operation := "hcsshim::GetComputeSystems"
|
||||
fields := logrus.Fields{}
|
||||
logOperationBegin(
|
||||
fields,
|
||||
operation+" - Begin Operation")
|
||||
|
||||
defer func() {
|
||||
var result string
|
||||
if err == nil {
|
||||
result = "Success"
|
||||
} else {
|
||||
result = "Error"
|
||||
}
|
||||
|
||||
logOperationEnd(
|
||||
fields,
|
||||
operation+" - End Operation - "+result,
|
||||
err)
|
||||
}()
|
||||
|
||||
queryb, err := json.Marshal(q)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
query := string(queryb)
|
||||
|
||||
logrus.WithFields(fields).
|
||||
WithField(logfields.JSON, query).
|
||||
Debug("HCS ComputeSystem Query")
|
||||
|
||||
var (
|
||||
resultp *uint16
|
||||
computeSystemsp *uint16
|
||||
)
|
||||
|
||||
syscallWatcher(fields, func() {
|
||||
err = hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp)
|
||||
})
|
||||
events := processHcsResult(resultp)
|
||||
computeSystemsJSON, resultJSON, err := vmcompute.HcsEnumerateComputeSystems(ctx, string(queryb))
|
||||
events := processHcsResult(ctx, resultJSON)
|
||||
if err != nil {
|
||||
return nil, &HcsError{Op: operation, Err: err, Events: events}
|
||||
}
|
||||
|
||||
if computeSystemsp == nil {
|
||||
if computeSystemsJSON == "" {
|
||||
return nil, ErrUnexpectedValue
|
||||
}
|
||||
computeSystemsRaw := interop.ConvertAndFreeCoTaskMemBytes(computeSystemsp)
|
||||
computeSystems := []schema1.ContainerProperties{}
|
||||
if err = json.Unmarshal(computeSystemsRaw, &computeSystems); err != nil {
|
||||
if err = json.Unmarshal([]byte(computeSystemsJSON), &computeSystems); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
@@ -216,51 +174,27 @@ func GetComputeSystems(q schema1.ComputeSystemQuery) (_ []schema1.ContainerPrope
|
||||
}
|
||||
|
||||
// Start synchronously starts the computeSystem.
|
||||
func (computeSystem *System) Start() (err error) {
|
||||
func (computeSystem *System) Start(ctx context.Context) (err error) {
|
||||
operation := "hcsshim::System::Start"
|
||||
|
||||
// hcsStartComputeSystemContext is an async operation. Start the outer span
|
||||
// here to measure the full start time.
|
||||
ctx, span := trace.StartSpan(ctx, operation)
|
||||
defer span.End()
|
||||
defer func() { oc.SetSpanStatus(span, err) }()
|
||||
span.AddAttributes(trace.StringAttribute("cid", computeSystem.id))
|
||||
|
||||
computeSystem.handleLock.RLock()
|
||||
defer computeSystem.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::ComputeSystem::Start"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||
|
||||
if computeSystem.handle == 0 {
|
||||
return makeSystemError(computeSystem, "Start", "", ErrAlreadyClosed, nil)
|
||||
return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
// This is a very simple backoff-retry loop to limit the number
|
||||
// of parallel container starts if environment variable
|
||||
// HCSSHIM_MAX_PARALLEL_START is set to a positive integer.
|
||||
// It should generally only be used as a workaround to various
|
||||
// platform issues that exist between RS1 and RS4 as of Aug 2018
|
||||
if currentContainerStarts.maxParallel > 0 {
|
||||
for {
|
||||
currentContainerStarts.Lock()
|
||||
if currentContainerStarts.inProgress < currentContainerStarts.maxParallel {
|
||||
currentContainerStarts.inProgress++
|
||||
currentContainerStarts.Unlock()
|
||||
break
|
||||
}
|
||||
if currentContainerStarts.inProgress == currentContainerStarts.maxParallel {
|
||||
currentContainerStarts.Unlock()
|
||||
time.Sleep(100 * time.Millisecond)
|
||||
}
|
||||
}
|
||||
// Make sure we decrement the count when we are done.
|
||||
defer func() {
|
||||
currentContainerStarts.Lock()
|
||||
currentContainerStarts.inProgress--
|
||||
currentContainerStarts.Unlock()
|
||||
}()
|
||||
}
|
||||
|
||||
var resultp *uint16
|
||||
syscallWatcher(computeSystem.logctx, func() {
|
||||
err = hcsStartComputeSystem(computeSystem.handle, "", &resultp)
|
||||
})
|
||||
events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemStartCompleted, &timeout.SystemStart)
|
||||
resultJSON, err := vmcompute.HcsStartComputeSystem(ctx, computeSystem.handle, "")
|
||||
events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemStartCompleted, &timeout.SystemStart)
|
||||
if err != nil {
|
||||
return makeSystemError(computeSystem, "Start", "", err, events)
|
||||
return makeSystemError(computeSystem, operation, "", err, events)
|
||||
}
|
||||
|
||||
return nil
|
||||
@@ -271,360 +205,357 @@ func (computeSystem *System) ID() string {
|
||||
return computeSystem.id
|
||||
}
|
||||
|
||||
// Shutdown requests a compute system shutdown, if IsPending() on the error returned is true,
|
||||
// it may not actually be shut down until Wait() succeeds.
|
||||
func (computeSystem *System) Shutdown() (err error) {
|
||||
// Shutdown requests a compute system shutdown.
|
||||
func (computeSystem *System) Shutdown(ctx context.Context) error {
|
||||
computeSystem.handleLock.RLock()
|
||||
defer computeSystem.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::ComputeSystem::Shutdown"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() {
|
||||
if IsAlreadyStopped(err) {
|
||||
computeSystem.logOperationEnd(operation, nil)
|
||||
} else {
|
||||
computeSystem.logOperationEnd(operation, err)
|
||||
}
|
||||
}()
|
||||
operation := "hcsshim::System::Shutdown"
|
||||
|
||||
if computeSystem.handle == 0 {
|
||||
return makeSystemError(computeSystem, "Shutdown", "", ErrAlreadyClosed, nil)
|
||||
return nil
|
||||
}
|
||||
|
||||
var resultp *uint16
|
||||
syscallWatcher(computeSystem.logctx, func() {
|
||||
err = hcsShutdownComputeSystem(computeSystem.handle, "", &resultp)
|
||||
})
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return makeSystemError(computeSystem, "Shutdown", "", err, events)
|
||||
resultJSON, err := vmcompute.HcsShutdownComputeSystem(ctx, computeSystem.handle, "")
|
||||
events := processHcsResult(ctx, resultJSON)
|
||||
switch err {
|
||||
case nil, ErrVmcomputeAlreadyStopped, ErrComputeSystemDoesNotExist, ErrVmcomputeOperationPending:
|
||||
default:
|
||||
return makeSystemError(computeSystem, operation, "", err, events)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// Terminate requests a compute system terminate, if IsPending() on the error returned is true,
|
||||
// it may not actually be shut down until Wait() succeeds.
|
||||
func (computeSystem *System) Terminate() (err error) {
|
||||
// Terminate requests a compute system terminate.
|
||||
func (computeSystem *System) Terminate(ctx context.Context) error {
|
||||
computeSystem.handleLock.RLock()
|
||||
defer computeSystem.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::ComputeSystem::Terminate"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() {
|
||||
if IsPending(err) {
|
||||
computeSystem.logOperationEnd(operation, nil)
|
||||
} else {
|
||||
computeSystem.logOperationEnd(operation, err)
|
||||
}
|
||||
}()
|
||||
operation := "hcsshim::System::Terminate"
|
||||
|
||||
if computeSystem.handle == 0 {
|
||||
return makeSystemError(computeSystem, "Terminate", "", ErrAlreadyClosed, nil)
|
||||
return nil
|
||||
}
|
||||
|
||||
var resultp *uint16
|
||||
syscallWatcher(computeSystem.logctx, func() {
|
||||
err = hcsTerminateComputeSystem(computeSystem.handle, "", &resultp)
|
||||
resultJSON, err := vmcompute.HcsTerminateComputeSystem(ctx, computeSystem.handle, "")
|
||||
events := processHcsResult(ctx, resultJSON)
|
||||
switch err {
|
||||
case nil, ErrVmcomputeAlreadyStopped, ErrComputeSystemDoesNotExist, ErrVmcomputeOperationPending:
|
||||
default:
|
||||
return makeSystemError(computeSystem, operation, "", err, events)
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// waitBackground waits for the compute system exit notification. Once received
|
||||
// sets `computeSystem.waitError` (if any) and unblocks all `Wait` calls.
|
||||
//
|
||||
// This MUST be called exactly once per `computeSystem.handle` but `Wait` is
|
||||
// safe to call multiple times.
|
||||
func (computeSystem *System) waitBackground() {
|
||||
operation := "hcsshim::System::waitBackground"
|
||||
ctx, span := trace.StartSpan(context.Background(), operation)
|
||||
defer span.End()
|
||||
span.AddAttributes(trace.StringAttribute("cid", computeSystem.id))
|
||||
|
||||
err := waitForNotification(ctx, computeSystem.callbackNumber, hcsNotificationSystemExited, nil)
|
||||
switch err {
|
||||
case nil:
|
||||
log.G(ctx).Debug("system exited")
|
||||
case ErrVmcomputeUnexpectedExit:
|
||||
log.G(ctx).Debug("unexpected system exit")
|
||||
computeSystem.exitError = makeSystemError(computeSystem, operation, "", err, nil)
|
||||
err = nil
|
||||
default:
|
||||
err = makeSystemError(computeSystem, operation, "", err, nil)
|
||||
}
|
||||
computeSystem.closedWaitOnce.Do(func() {
|
||||
computeSystem.waitError = err
|
||||
close(computeSystem.waitBlock)
|
||||
})
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil && err != ErrVmcomputeAlreadyStopped {
|
||||
return makeSystemError(computeSystem, "Terminate", "", err, events)
|
||||
}
|
||||
|
||||
return nil
|
||||
oc.SetSpanStatus(span, err)
|
||||
}
|
||||
|
||||
// Wait synchronously waits for the compute system to shutdown or terminate.
|
||||
func (computeSystem *System) Wait() (err error) {
|
||||
operation := "hcsshim::ComputeSystem::Wait"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||
|
||||
err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, nil)
|
||||
if err != nil {
|
||||
return makeSystemError(computeSystem, "Wait", "", err, nil)
|
||||
}
|
||||
|
||||
return nil
|
||||
// Wait synchronously waits for the compute system to shutdown or terminate. If
|
||||
// the compute system has already exited returns the previous error (if any).
|
||||
func (computeSystem *System) Wait() error {
|
||||
<-computeSystem.waitBlock
|
||||
return computeSystem.waitError
|
||||
}
|
||||
|
||||
// WaitExpectedError synchronously waits for the compute system to shutdown or
|
||||
// terminate, and ignores the passed error if it occurs.
|
||||
func (computeSystem *System) WaitExpectedError(expected error) (err error) {
|
||||
operation := "hcsshim::ComputeSystem::WaitExpectedError"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||
|
||||
err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, nil)
|
||||
if err != nil && getInnerError(err) != expected {
|
||||
return makeSystemError(computeSystem, "WaitExpectedError", "", err, nil)
|
||||
// ExitError returns an error describing the reason the compute system terminated.
|
||||
func (computeSystem *System) ExitError() error {
|
||||
select {
|
||||
case <-computeSystem.waitBlock:
|
||||
if computeSystem.waitError != nil {
|
||||
return computeSystem.waitError
|
||||
}
|
||||
return computeSystem.exitError
|
||||
default:
|
||||
return errors.New("container not exited")
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// WaitTimeout synchronously waits for the compute system to terminate or the duration to elapse.
|
||||
// If the timeout expires, IsTimeout(err) == true
|
||||
func (computeSystem *System) WaitTimeout(timeout time.Duration) (err error) {
|
||||
operation := "hcsshim::ComputeSystem::WaitTimeout"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||
|
||||
err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, &timeout)
|
||||
if err != nil {
|
||||
return makeSystemError(computeSystem, "WaitTimeout", "", err, nil)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (computeSystem *System) Properties(types ...schema1.PropertyType) (_ *schema1.ContainerProperties, err error) {
|
||||
// Properties returns the requested container properties targeting a V1 schema container.
|
||||
func (computeSystem *System) Properties(ctx context.Context, types ...schema1.PropertyType) (*schema1.ContainerProperties, error) {
|
||||
computeSystem.handleLock.RLock()
|
||||
defer computeSystem.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::ComputeSystem::Properties"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||
operation := "hcsshim::System::Properties"
|
||||
|
||||
queryj, err := json.Marshal(schema1.PropertyQuery{types})
|
||||
queryBytes, err := json.Marshal(schema1.PropertyQuery{PropertyTypes: types})
|
||||
if err != nil {
|
||||
return nil, makeSystemError(computeSystem, "Properties", "", err, nil)
|
||||
return nil, makeSystemError(computeSystem, operation, "", err, nil)
|
||||
}
|
||||
|
||||
logrus.WithFields(computeSystem.logctx).
|
||||
WithField(logfields.JSON, queryj).
|
||||
Debug("HCS ComputeSystem Properties Query")
|
||||
|
||||
var resultp, propertiesp *uint16
|
||||
syscallWatcher(computeSystem.logctx, func() {
|
||||
err = hcsGetComputeSystemProperties(computeSystem.handle, string(queryj), &propertiesp, &resultp)
|
||||
})
|
||||
events := processHcsResult(resultp)
|
||||
propertiesJSON, resultJSON, err := vmcompute.HcsGetComputeSystemProperties(ctx, computeSystem.handle, string(queryBytes))
|
||||
events := processHcsResult(ctx, resultJSON)
|
||||
if err != nil {
|
||||
return nil, makeSystemError(computeSystem, "Properties", "", err, events)
|
||||
return nil, makeSystemError(computeSystem, operation, "", err, events)
|
||||
}
|
||||
|
||||
if propertiesp == nil {
|
||||
if propertiesJSON == "" {
|
||||
return nil, ErrUnexpectedValue
|
||||
}
|
||||
propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp)
|
||||
properties := &schema1.ContainerProperties{}
|
||||
if err := json.Unmarshal(propertiesRaw, properties); err != nil {
|
||||
return nil, makeSystemError(computeSystem, "Properties", "", err, nil)
|
||||
if err := json.Unmarshal([]byte(propertiesJSON), properties); err != nil {
|
||||
return nil, makeSystemError(computeSystem, operation, "", err, nil)
|
||||
}
|
||||
|
||||
return properties, nil
|
||||
}
|
||||
|
||||
// PropertiesV2 returns the requested container properties targeting a V2 schema container.
|
||||
func (computeSystem *System) PropertiesV2(ctx context.Context, types ...hcsschema.PropertyType) (*hcsschema.Properties, error) {
|
||||
computeSystem.handleLock.RLock()
|
||||
defer computeSystem.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::System::PropertiesV2"
|
||||
|
||||
queryBytes, err := json.Marshal(hcsschema.PropertyQuery{PropertyTypes: types})
|
||||
if err != nil {
|
||||
return nil, makeSystemError(computeSystem, operation, "", err, nil)
|
||||
}
|
||||
|
||||
propertiesJSON, resultJSON, err := vmcompute.HcsGetComputeSystemProperties(ctx, computeSystem.handle, string(queryBytes))
|
||||
events := processHcsResult(ctx, resultJSON)
|
||||
if err != nil {
|
||||
return nil, makeSystemError(computeSystem, operation, "", err, events)
|
||||
}
|
||||
|
||||
if propertiesJSON == "" {
|
||||
return nil, ErrUnexpectedValue
|
||||
}
|
||||
properties := &hcsschema.Properties{}
|
||||
if err := json.Unmarshal([]byte(propertiesJSON), properties); err != nil {
|
||||
return nil, makeSystemError(computeSystem, operation, "", err, nil)
|
||||
}
|
||||
|
||||
return properties, nil
|
||||
}
|
||||
|
||||
// Pause pauses the execution of the computeSystem. This feature is not enabled in TP5.
|
||||
func (computeSystem *System) Pause() (err error) {
|
||||
func (computeSystem *System) Pause(ctx context.Context) (err error) {
|
||||
operation := "hcsshim::System::Pause"
|
||||
|
||||
// hcsPauseComputeSystemContext is an async peration. Start the outer span
|
||||
// here to measure the full pause time.
|
||||
ctx, span := trace.StartSpan(ctx, operation)
|
||||
defer span.End()
|
||||
defer func() { oc.SetSpanStatus(span, err) }()
|
||||
span.AddAttributes(trace.StringAttribute("cid", computeSystem.id))
|
||||
|
||||
computeSystem.handleLock.RLock()
|
||||
defer computeSystem.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::ComputeSystem::Pause"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||
|
||||
if computeSystem.handle == 0 {
|
||||
return makeSystemError(computeSystem, "Pause", "", ErrAlreadyClosed, nil)
|
||||
return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
var resultp *uint16
|
||||
syscallWatcher(computeSystem.logctx, func() {
|
||||
err = hcsPauseComputeSystem(computeSystem.handle, "", &resultp)
|
||||
})
|
||||
events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemPauseCompleted, &timeout.SystemPause)
|
||||
resultJSON, err := vmcompute.HcsPauseComputeSystem(ctx, computeSystem.handle, "")
|
||||
events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemPauseCompleted, &timeout.SystemPause)
|
||||
if err != nil {
|
||||
return makeSystemError(computeSystem, "Pause", "", err, events)
|
||||
return makeSystemError(computeSystem, operation, "", err, events)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// Resume resumes the execution of the computeSystem. This feature is not enabled in TP5.
|
||||
func (computeSystem *System) Resume() (err error) {
|
||||
func (computeSystem *System) Resume(ctx context.Context) (err error) {
|
||||
operation := "hcsshim::System::Resume"
|
||||
|
||||
// hcsResumeComputeSystemContext is an async operation. Start the outer span
|
||||
// here to measure the full restore time.
|
||||
ctx, span := trace.StartSpan(ctx, operation)
|
||||
defer span.End()
|
||||
defer func() { oc.SetSpanStatus(span, err) }()
|
||||
span.AddAttributes(trace.StringAttribute("cid", computeSystem.id))
|
||||
|
||||
computeSystem.handleLock.RLock()
|
||||
defer computeSystem.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::ComputeSystem::Resume"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||
|
||||
if computeSystem.handle == 0 {
|
||||
return makeSystemError(computeSystem, "Resume", "", ErrAlreadyClosed, nil)
|
||||
return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
var resultp *uint16
|
||||
syscallWatcher(computeSystem.logctx, func() {
|
||||
err = hcsResumeComputeSystem(computeSystem.handle, "", &resultp)
|
||||
})
|
||||
events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemResumeCompleted, &timeout.SystemResume)
|
||||
resultJSON, err := vmcompute.HcsResumeComputeSystem(ctx, computeSystem.handle, "")
|
||||
events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemResumeCompleted, &timeout.SystemResume)
|
||||
if err != nil {
|
||||
return makeSystemError(computeSystem, "Resume", "", err, events)
|
||||
return makeSystemError(computeSystem, operation, "", err, events)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// CreateProcess launches a new process within the computeSystem.
|
||||
func (computeSystem *System) CreateProcess(c interface{}) (_ *Process, err error) {
|
||||
func (computeSystem *System) createProcess(ctx context.Context, operation string, c interface{}) (*Process, *vmcompute.HcsProcessInformation, error) {
|
||||
computeSystem.handleLock.RLock()
|
||||
defer computeSystem.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::ComputeSystem::CreateProcess"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||
|
||||
var (
|
||||
processInfo hcsProcessInformation
|
||||
processHandle hcsProcess
|
||||
resultp *uint16
|
||||
)
|
||||
|
||||
if computeSystem.handle == 0 {
|
||||
return nil, makeSystemError(computeSystem, "CreateProcess", "", ErrAlreadyClosed, nil)
|
||||
return nil, nil, makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
configurationb, err := json.Marshal(c)
|
||||
if err != nil {
|
||||
return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil)
|
||||
return nil, nil, makeSystemError(computeSystem, operation, "", err, nil)
|
||||
}
|
||||
|
||||
configuration := string(configurationb)
|
||||
|
||||
logrus.WithFields(computeSystem.logctx).
|
||||
WithField(logfields.JSON, configuration).
|
||||
Debug("HCS ComputeSystem Process Document")
|
||||
|
||||
syscallWatcher(computeSystem.logctx, func() {
|
||||
err = hcsCreateProcess(computeSystem.handle, configuration, &processInfo, &processHandle, &resultp)
|
||||
})
|
||||
events := processHcsResult(resultp)
|
||||
processInfo, processHandle, resultJSON, err := vmcompute.HcsCreateProcess(ctx, computeSystem.handle, configuration)
|
||||
events := processHcsResult(ctx, resultJSON)
|
||||
if err != nil {
|
||||
return nil, makeSystemError(computeSystem, "CreateProcess", configuration, err, events)
|
||||
return nil, nil, makeSystemError(computeSystem, operation, configuration, err, events)
|
||||
}
|
||||
|
||||
logrus.WithFields(computeSystem.logctx).
|
||||
WithField(logfields.ProcessID, processInfo.ProcessId).
|
||||
Debug("HCS ComputeSystem CreateProcess PID")
|
||||
log.G(ctx).WithField("pid", processInfo.ProcessId).Debug("created process pid")
|
||||
return newProcess(processHandle, int(processInfo.ProcessId), computeSystem), &processInfo, nil
|
||||
}
|
||||
|
||||
process := newProcess(processHandle, int(processInfo.ProcessId), computeSystem)
|
||||
process.cachedPipes = &cachedPipes{
|
||||
stdIn: processInfo.StdInput,
|
||||
stdOut: processInfo.StdOutput,
|
||||
stdErr: processInfo.StdError,
|
||||
// CreateProcess launches a new process within the computeSystem.
|
||||
func (computeSystem *System) CreateProcess(ctx context.Context, c interface{}) (cow.Process, error) {
|
||||
operation := "hcsshim::System::CreateProcess"
|
||||
process, processInfo, err := computeSystem.createProcess(ctx, operation, c)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
defer func() {
|
||||
if err != nil {
|
||||
process.Close()
|
||||
}
|
||||
}()
|
||||
|
||||
if err = process.registerCallback(); err != nil {
|
||||
return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil)
|
||||
pipes, err := makeOpenFiles([]syscall.Handle{processInfo.StdInput, processInfo.StdOutput, processInfo.StdError})
|
||||
if err != nil {
|
||||
return nil, makeSystemError(computeSystem, operation, "", err, nil)
|
||||
}
|
||||
process.stdin = pipes[0]
|
||||
process.stdout = pipes[1]
|
||||
process.stderr = pipes[2]
|
||||
process.hasCachedStdio = true
|
||||
|
||||
if err = process.registerCallback(ctx); err != nil {
|
||||
return nil, makeSystemError(computeSystem, operation, "", err, nil)
|
||||
}
|
||||
go process.waitBackground()
|
||||
|
||||
return process, nil
|
||||
}
|
||||
|
||||
// OpenProcess gets an interface to an existing process within the computeSystem.
|
||||
func (computeSystem *System) OpenProcess(pid int) (_ *Process, err error) {
|
||||
func (computeSystem *System) OpenProcess(ctx context.Context, pid int) (*Process, error) {
|
||||
computeSystem.handleLock.RLock()
|
||||
defer computeSystem.handleLock.RUnlock()
|
||||
|
||||
// Add PID for the context of this operation
|
||||
computeSystem.logctx[logfields.ProcessID] = pid
|
||||
defer delete(computeSystem.logctx, logfields.ProcessID)
|
||||
|
||||
operation := "hcsshim::ComputeSystem::OpenProcess"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||
|
||||
var (
|
||||
processHandle hcsProcess
|
||||
resultp *uint16
|
||||
)
|
||||
operation := "hcsshim::System::OpenProcess"
|
||||
|
||||
if computeSystem.handle == 0 {
|
||||
return nil, makeSystemError(computeSystem, "OpenProcess", "", ErrAlreadyClosed, nil)
|
||||
return nil, makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
syscallWatcher(computeSystem.logctx, func() {
|
||||
err = hcsOpenProcess(computeSystem.handle, uint32(pid), &processHandle, &resultp)
|
||||
})
|
||||
events := processHcsResult(resultp)
|
||||
processHandle, resultJSON, err := vmcompute.HcsOpenProcess(ctx, computeSystem.handle, uint32(pid))
|
||||
events := processHcsResult(ctx, resultJSON)
|
||||
if err != nil {
|
||||
return nil, makeSystemError(computeSystem, "OpenProcess", "", err, events)
|
||||
return nil, makeSystemError(computeSystem, operation, "", err, events)
|
||||
}
|
||||
|
||||
process := newProcess(processHandle, pid, computeSystem)
|
||||
if err = process.registerCallback(); err != nil {
|
||||
return nil, makeSystemError(computeSystem, "OpenProcess", "", err, nil)
|
||||
if err = process.registerCallback(ctx); err != nil {
|
||||
return nil, makeSystemError(computeSystem, operation, "", err, nil)
|
||||
}
|
||||
go process.waitBackground()
|
||||
|
||||
return process, nil
|
||||
}
|
||||
|
||||
// Close cleans up any state associated with the compute system but does not terminate or wait for it.
|
||||
func (computeSystem *System) Close() (err error) {
|
||||
operation := "hcsshim::System::Close"
|
||||
ctx, span := trace.StartSpan(context.Background(), operation)
|
||||
defer span.End()
|
||||
defer func() { oc.SetSpanStatus(span, err) }()
|
||||
span.AddAttributes(trace.StringAttribute("cid", computeSystem.id))
|
||||
|
||||
computeSystem.handleLock.Lock()
|
||||
defer computeSystem.handleLock.Unlock()
|
||||
|
||||
operation := "hcsshim::ComputeSystem::Close"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||
|
||||
// Don't double free this
|
||||
if computeSystem.handle == 0 {
|
||||
return nil
|
||||
}
|
||||
|
||||
if err = computeSystem.unregisterCallback(); err != nil {
|
||||
return makeSystemError(computeSystem, "Close", "", err, nil)
|
||||
if err = computeSystem.unregisterCallback(ctx); err != nil {
|
||||
return makeSystemError(computeSystem, operation, "", err, nil)
|
||||
}
|
||||
|
||||
syscallWatcher(computeSystem.logctx, func() {
|
||||
err = hcsCloseComputeSystem(computeSystem.handle)
|
||||
})
|
||||
err = vmcompute.HcsCloseComputeSystem(ctx, computeSystem.handle)
|
||||
if err != nil {
|
||||
return makeSystemError(computeSystem, "Close", "", err, nil)
|
||||
return makeSystemError(computeSystem, operation, "", err, nil)
|
||||
}
|
||||
|
||||
computeSystem.handle = 0
|
||||
computeSystem.closedWaitOnce.Do(func() {
|
||||
computeSystem.waitError = ErrAlreadyClosed
|
||||
close(computeSystem.waitBlock)
|
||||
})
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (computeSystem *System) registerCallback() error {
|
||||
context := ¬ifcationWatcherContext{
|
||||
channels: newChannels(),
|
||||
func (computeSystem *System) registerCallback(ctx context.Context) error {
|
||||
callbackContext := ¬ifcationWatcherContext{
|
||||
channels: newSystemChannels(),
|
||||
systemID: computeSystem.id,
|
||||
}
|
||||
|
||||
callbackMapLock.Lock()
|
||||
callbackNumber := nextCallback
|
||||
nextCallback++
|
||||
callbackMap[callbackNumber] = context
|
||||
callbackMap[callbackNumber] = callbackContext
|
||||
callbackMapLock.Unlock()
|
||||
|
||||
var callbackHandle hcsCallback
|
||||
err := hcsRegisterComputeSystemCallback(computeSystem.handle, notificationWatcherCallback, callbackNumber, &callbackHandle)
|
||||
callbackHandle, err := vmcompute.HcsRegisterComputeSystemCallback(ctx, computeSystem.handle, notificationWatcherCallback, callbackNumber)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
context.handle = callbackHandle
|
||||
callbackContext.handle = callbackHandle
|
||||
computeSystem.callbackNumber = callbackNumber
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (computeSystem *System) unregisterCallback() error {
|
||||
func (computeSystem *System) unregisterCallback(ctx context.Context) error {
|
||||
callbackNumber := computeSystem.callbackNumber
|
||||
|
||||
callbackMapLock.RLock()
|
||||
context := callbackMap[callbackNumber]
|
||||
callbackContext := callbackMap[callbackNumber]
|
||||
callbackMapLock.RUnlock()
|
||||
|
||||
if context == nil {
|
||||
if callbackContext == nil {
|
||||
return nil
|
||||
}
|
||||
|
||||
handle := context.handle
|
||||
handle := callbackContext.handle
|
||||
|
||||
if handle == 0 {
|
||||
return nil
|
||||
@@ -632,15 +563,15 @@ func (computeSystem *System) unregisterCallback() error {
|
||||
|
||||
// hcsUnregisterComputeSystemCallback has its own syncronization
|
||||
// to wait for all callbacks to complete. We must NOT hold the callbackMapLock.
|
||||
err := hcsUnregisterComputeSystemCallback(handle)
|
||||
err := vmcompute.HcsUnregisterComputeSystemCallback(ctx, handle)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
closeChannels(context.channels)
|
||||
closeChannels(callbackContext.channels)
|
||||
|
||||
callbackMapLock.Lock()
|
||||
callbackMap[callbackNumber] = nil
|
||||
delete(callbackMap, callbackNumber)
|
||||
callbackMapLock.Unlock()
|
||||
|
||||
handle = 0
|
||||
@@ -649,36 +580,26 @@ func (computeSystem *System) unregisterCallback() error {
|
||||
}
|
||||
|
||||
// Modify the System by sending a request to HCS
|
||||
func (computeSystem *System) Modify(config interface{}) (err error) {
|
||||
func (computeSystem *System) Modify(ctx context.Context, config interface{}) error {
|
||||
computeSystem.handleLock.RLock()
|
||||
defer computeSystem.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::ComputeSystem::Modify"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||
operation := "hcsshim::System::Modify"
|
||||
|
||||
if computeSystem.handle == 0 {
|
||||
return makeSystemError(computeSystem, "Modify", "", ErrAlreadyClosed, nil)
|
||||
return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
requestJSON, err := json.Marshal(config)
|
||||
requestBytes, err := json.Marshal(config)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
requestString := string(requestJSON)
|
||||
|
||||
logrus.WithFields(computeSystem.logctx).
|
||||
WithField(logfields.JSON, requestString).
|
||||
Debug("HCS ComputeSystem Modify Document")
|
||||
|
||||
var resultp *uint16
|
||||
syscallWatcher(computeSystem.logctx, func() {
|
||||
err = hcsModifyComputeSystem(computeSystem.handle, requestString, &resultp)
|
||||
})
|
||||
events := processHcsResult(resultp)
|
||||
requestJSON := string(requestBytes)
|
||||
resultJSON, err := vmcompute.HcsModifyComputeSystem(ctx, computeSystem.handle, requestJSON)
|
||||
events := processHcsResult(ctx, resultJSON)
|
||||
if err != nil {
|
||||
return makeSystemError(computeSystem, "Modify", requestString, err, events)
|
||||
return makeSystemError(computeSystem, operation, requestJSON, err, events)
|
||||
}
|
||||
|
||||
return nil
|
||||
|
||||
28
vendor/github.com/Microsoft/hcsshim/internal/hcs/utils.go
generated
vendored
28
vendor/github.com/Microsoft/hcsshim/internal/hcs/utils.go
generated
vendored
@@ -1,10 +1,14 @@
|
||||
package hcs
|
||||
|
||||
import (
|
||||
"context"
|
||||
"io"
|
||||
"syscall"
|
||||
|
||||
"github.com/Microsoft/go-winio"
|
||||
diskutil "github.com/Microsoft/go-winio/vhd"
|
||||
"github.com/pkg/errors"
|
||||
"golang.org/x/sys/windows"
|
||||
)
|
||||
|
||||
// makeOpenFiles calls winio.MakeOpenFile for each handle in a slice but closes all the handles
|
||||
@@ -31,3 +35,27 @@ func makeOpenFiles(hs []syscall.Handle) (_ []io.ReadWriteCloser, err error) {
|
||||
}
|
||||
return fs, nil
|
||||
}
|
||||
|
||||
// creates a VHD formatted with NTFS of size `sizeGB` at the given `vhdPath`.
|
||||
func CreateNTFSVHD(ctx context.Context, vhdPath string, sizeGB uint32) (err error) {
|
||||
if err := diskutil.CreateVhdx(vhdPath, sizeGB, 1); err != nil {
|
||||
return errors.Wrap(err, "failed to create VHD")
|
||||
}
|
||||
|
||||
vhd, err := diskutil.OpenVirtualDisk(vhdPath, diskutil.VirtualDiskAccessNone, diskutil.OpenVirtualDiskFlagNone)
|
||||
if err != nil {
|
||||
return errors.Wrap(err, "failed to open VHD")
|
||||
}
|
||||
defer func() {
|
||||
err2 := windows.CloseHandle(windows.Handle(vhd))
|
||||
if err == nil {
|
||||
err = errors.Wrap(err2, "failed to close VHD")
|
||||
}
|
||||
}()
|
||||
|
||||
if err := hcsFormatWritableLayerVhd(uintptr(vhd)); err != nil {
|
||||
return errors.Wrap(err, "failed to format VHD")
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
18
vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go
generated
vendored
18
vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go
generated
vendored
@@ -1,28 +1,34 @@
|
||||
package hcs
|
||||
|
||||
import (
|
||||
"context"
|
||||
"time"
|
||||
|
||||
"github.com/sirupsen/logrus"
|
||||
"github.com/Microsoft/hcsshim/internal/log"
|
||||
)
|
||||
|
||||
func processAsyncHcsResult(err error, resultp *uint16, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) ([]ErrorEvent, error) {
|
||||
events := processHcsResult(resultp)
|
||||
func processAsyncHcsResult(ctx context.Context, err error, resultJSON string, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) ([]ErrorEvent, error) {
|
||||
events := processHcsResult(ctx, resultJSON)
|
||||
if IsPending(err) {
|
||||
return nil, waitForNotification(callbackNumber, expectedNotification, timeout)
|
||||
return nil, waitForNotification(ctx, callbackNumber, expectedNotification, timeout)
|
||||
}
|
||||
|
||||
return events, err
|
||||
}
|
||||
|
||||
func waitForNotification(callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error {
|
||||
func waitForNotification(ctx context.Context, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error {
|
||||
callbackMapLock.RLock()
|
||||
if _, ok := callbackMap[callbackNumber]; !ok {
|
||||
callbackMapLock.RUnlock()
|
||||
log.G(ctx).WithField("callbackNumber", callbackNumber).Error("failed to waitForNotification: callbackNumber does not exist in callbackMap")
|
||||
return ErrHandleClose
|
||||
}
|
||||
channels := callbackMap[callbackNumber].channels
|
||||
callbackMapLock.RUnlock()
|
||||
|
||||
expectedChannel := channels[expectedNotification]
|
||||
if expectedChannel == nil {
|
||||
logrus.Errorf("unknown notification type in waitForNotification %x", expectedNotification)
|
||||
log.G(ctx).WithField("type", expectedNotification).Error("unknown notification type in waitForNotification")
|
||||
return ErrInvalidNotificationType
|
||||
}
|
||||
|
||||
|
||||
41
vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go
generated
vendored
41
vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go
generated
vendored
@@ -1,41 +0,0 @@
|
||||
package hcs
|
||||
|
||||
import (
|
||||
"context"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/logfields"
|
||||
"github.com/Microsoft/hcsshim/internal/timeout"
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
// syscallWatcher is used as a very simple goroutine around calls into
|
||||
// the platform. In some cases, we have seen HCS APIs not returning due to
|
||||
// various bugs, and the goroutine making the syscall ends up not returning,
|
||||
// prior to its async callback. By spinning up a syscallWatcher, it allows
|
||||
// us to at least log a warning if a syscall doesn't complete in a reasonable
|
||||
// amount of time.
|
||||
//
|
||||
// Usage is:
|
||||
//
|
||||
// syscallWatcher(logContext, func() {
|
||||
// err = <syscall>(args...)
|
||||
// })
|
||||
//
|
||||
|
||||
func syscallWatcher(logContext logrus.Fields, syscallLambda func()) {
|
||||
ctx, cancel := context.WithTimeout(context.Background(), timeout.SyscallWatcher)
|
||||
defer cancel()
|
||||
go watchFunc(ctx, logContext)
|
||||
syscallLambda()
|
||||
}
|
||||
|
||||
func watchFunc(ctx context.Context, logContext logrus.Fields) {
|
||||
select {
|
||||
case <-ctx.Done():
|
||||
if ctx.Err() != context.Canceled {
|
||||
logrus.WithFields(logContext).
|
||||
WithField(logfields.Timeout, timeout.SyscallWatcher).
|
||||
Warning("Syscall did not complete within operation timeout. This may indicate a platform issue. If it appears to be making no forward progress, obtain the stacks and see if there is a syscall stuck in the platform API for a significant length of time.")
|
||||
}
|
||||
}
|
||||
}
|
||||
487
vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go
generated
vendored
487
vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go
generated
vendored
@@ -37,492 +37,13 @@ func errnoErr(e syscall.Errno) error {
|
||||
}
|
||||
|
||||
var (
|
||||
modvmcompute = windows.NewLazySystemDLL("vmcompute.dll")
|
||||
modcomputestorage = windows.NewLazySystemDLL("computestorage.dll")
|
||||
|
||||
procHcsEnumerateComputeSystems = modvmcompute.NewProc("HcsEnumerateComputeSystems")
|
||||
procHcsCreateComputeSystem = modvmcompute.NewProc("HcsCreateComputeSystem")
|
||||
procHcsOpenComputeSystem = modvmcompute.NewProc("HcsOpenComputeSystem")
|
||||
procHcsCloseComputeSystem = modvmcompute.NewProc("HcsCloseComputeSystem")
|
||||
procHcsStartComputeSystem = modvmcompute.NewProc("HcsStartComputeSystem")
|
||||
procHcsShutdownComputeSystem = modvmcompute.NewProc("HcsShutdownComputeSystem")
|
||||
procHcsTerminateComputeSystem = modvmcompute.NewProc("HcsTerminateComputeSystem")
|
||||
procHcsPauseComputeSystem = modvmcompute.NewProc("HcsPauseComputeSystem")
|
||||
procHcsResumeComputeSystem = modvmcompute.NewProc("HcsResumeComputeSystem")
|
||||
procHcsGetComputeSystemProperties = modvmcompute.NewProc("HcsGetComputeSystemProperties")
|
||||
procHcsModifyComputeSystem = modvmcompute.NewProc("HcsModifyComputeSystem")
|
||||
procHcsRegisterComputeSystemCallback = modvmcompute.NewProc("HcsRegisterComputeSystemCallback")
|
||||
procHcsUnregisterComputeSystemCallback = modvmcompute.NewProc("HcsUnregisterComputeSystemCallback")
|
||||
procHcsCreateProcess = modvmcompute.NewProc("HcsCreateProcess")
|
||||
procHcsOpenProcess = modvmcompute.NewProc("HcsOpenProcess")
|
||||
procHcsCloseProcess = modvmcompute.NewProc("HcsCloseProcess")
|
||||
procHcsTerminateProcess = modvmcompute.NewProc("HcsTerminateProcess")
|
||||
|
||||
procHcsGetProcessInfo = modvmcompute.NewProc("HcsGetProcessInfo")
|
||||
procHcsGetProcessProperties = modvmcompute.NewProc("HcsGetProcessProperties")
|
||||
procHcsModifyProcess = modvmcompute.NewProc("HcsModifyProcess")
|
||||
procHcsGetServiceProperties = modvmcompute.NewProc("HcsGetServiceProperties")
|
||||
procHcsRegisterProcessCallback = modvmcompute.NewProc("HcsRegisterProcessCallback")
|
||||
procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback")
|
||||
procHcsFormatWritableLayerVhd = modcomputestorage.NewProc("HcsFormatWritableLayerVhd")
|
||||
)
|
||||
|
||||
func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(query)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsEnumerateComputeSystems(_p0, computeSystems, result)
|
||||
}
|
||||
|
||||
func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsEnumerateComputeSystems.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsEnumerateComputeSystems.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(computeSystems)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(id)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
var _p1 *uint16
|
||||
_p1, hr = syscall.UTF16PtrFromString(configuration)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsCreateComputeSystem(_p0, _p1, identity, computeSystem, result)
|
||||
}
|
||||
|
||||
func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) {
|
||||
if hr = procHcsCreateComputeSystem.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall6(procHcsCreateComputeSystem.Addr(), 5, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(configuration)), uintptr(identity), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)), 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(id)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsOpenComputeSystem(_p0, computeSystem, result)
|
||||
}
|
||||
|
||||
func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16) (hr error) {
|
||||
if hr = procHcsOpenComputeSystem.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsOpenComputeSystem.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) {
|
||||
if hr = procHcsCloseComputeSystem.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsCloseComputeSystem.Addr(), 1, uintptr(computeSystem), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(options)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsStartComputeSystem(computeSystem, _p0, result)
|
||||
}
|
||||
|
||||
func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsStartComputeSystem.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsStartComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(options)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsShutdownComputeSystem(computeSystem, _p0, result)
|
||||
}
|
||||
|
||||
func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsShutdownComputeSystem.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsShutdownComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(options)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsTerminateComputeSystem(computeSystem, _p0, result)
|
||||
}
|
||||
|
||||
func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsTerminateComputeSystem.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsTerminateComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(options)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsPauseComputeSystem(computeSystem, _p0, result)
|
||||
}
|
||||
|
||||
func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsPauseComputeSystem.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsPauseComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(options)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsResumeComputeSystem(computeSystem, _p0, result)
|
||||
}
|
||||
|
||||
func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsResumeComputeSystem.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsResumeComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(propertyQuery)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsGetComputeSystemProperties(computeSystem, _p0, properties, result)
|
||||
}
|
||||
|
||||
func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsGetComputeSystemProperties.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall6(procHcsGetComputeSystemProperties.Addr(), 4, uintptr(computeSystem), uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(configuration)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsModifyComputeSystem(computeSystem, _p0, result)
|
||||
}
|
||||
|
||||
func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsModifyComputeSystem.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsModifyComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(configuration)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) {
|
||||
if hr = procHcsRegisterComputeSystemCallback.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall6(procHcsRegisterComputeSystemCallback.Addr(), 4, uintptr(computeSystem), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) {
|
||||
if hr = procHcsUnregisterComputeSystemCallback.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsUnregisterComputeSystemCallback.Addr(), 1, uintptr(callbackHandle), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(processParameters)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsCreateProcess(computeSystem, _p0, processInformation, process, result)
|
||||
}
|
||||
|
||||
func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) {
|
||||
if hr = procHcsCreateProcess.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall6(procHcsCreateProcess.Addr(), 5, uintptr(computeSystem), uintptr(unsafe.Pointer(processParameters)), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) {
|
||||
if hr = procHcsOpenProcess.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall6(procHcsOpenProcess.Addr(), 4, uintptr(computeSystem), uintptr(pid), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsCloseProcess(process hcsProcess) (hr error) {
|
||||
if hr = procHcsCloseProcess.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsCloseProcess.Addr(), 1, uintptr(process), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) {
|
||||
if hr = procHcsTerminateProcess.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 2, uintptr(process), uintptr(unsafe.Pointer(result)), 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(options)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsSignalProcess(process, _p0, result)
|
||||
}
|
||||
|
||||
func _hcsSignalProcess(process hcsProcess, options *uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsTerminateProcess.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) {
|
||||
if hr = procHcsGetProcessInfo.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsGetProcessInfo.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsGetProcessProperties.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsGetProcessProperties.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processProperties)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(settings)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsModifyProcess(process, _p0, result)
|
||||
}
|
||||
|
||||
func _hcsModifyProcess(process hcsProcess, settings *uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsModifyProcess.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsModifyProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(propertyQuery)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsGetServiceProperties(_p0, properties, result)
|
||||
}
|
||||
|
||||
func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsGetServiceProperties.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsGetServiceProperties.Addr(), 3, uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) {
|
||||
if hr = procHcsRegisterProcessCallback.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall6(procHcsRegisterProcessCallback.Addr(), 4, uintptr(process), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) {
|
||||
if hr = procHcsUnregisterProcessCallback.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsUnregisterProcessCallback.Addr(), 1, uintptr(callbackHandle), 0, 0)
|
||||
func hcsFormatWritableLayerVhd(handle uintptr) (hr error) {
|
||||
r0, _, _ := syscall.Syscall(procHcsFormatWritableLayerVhd.Addr(), 1, uintptr(handle), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
|
||||
43
vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go
generated
vendored
43
vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go
generated
vendored
@@ -3,6 +3,7 @@ package hns
|
||||
import (
|
||||
"encoding/json"
|
||||
"net"
|
||||
"strings"
|
||||
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
@@ -94,6 +95,27 @@ func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) {
|
||||
return nil, EndpointNotFoundError{EndpointName: endpointName}
|
||||
}
|
||||
|
||||
type endpointAttachInfo struct {
|
||||
SharedContainers json.RawMessage `json:",omitempty"`
|
||||
}
|
||||
|
||||
func (endpoint *HNSEndpoint) IsAttached(vID string) (bool, error) {
|
||||
attachInfo := endpointAttachInfo{}
|
||||
err := hnsCall("GET", "/endpoints/"+endpoint.Id, "", &attachInfo)
|
||||
|
||||
// Return false allows us to just return the err
|
||||
if err != nil {
|
||||
return false, err
|
||||
}
|
||||
|
||||
if strings.Contains(strings.ToLower(string(attachInfo.SharedContainers)), strings.ToLower(vID)) {
|
||||
return true, nil
|
||||
}
|
||||
|
||||
return false, nil
|
||||
|
||||
}
|
||||
|
||||
// Create Endpoint by sending EndpointRequest to HNS. TODO: Create a separate HNS interface to place all these methods
|
||||
func (endpoint *HNSEndpoint) Create() (*HNSEndpoint, error) {
|
||||
operation := "Create"
|
||||
@@ -151,6 +173,27 @@ func (endpoint *HNSEndpoint) ApplyACLPolicy(policies ...*ACLPolicy) error {
|
||||
return err
|
||||
}
|
||||
|
||||
// ApplyProxyPolicy applies a set of Proxy Policies on the Endpoint
|
||||
func (endpoint *HNSEndpoint) ApplyProxyPolicy(policies ...*ProxyPolicy) error {
|
||||
operation := "ApplyProxyPolicy"
|
||||
title := "hcsshim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
|
||||
for _, policy := range policies {
|
||||
if policy == nil {
|
||||
continue
|
||||
}
|
||||
jsonString, err := json.Marshal(policy)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
endpoint.Policies = append(endpoint.Policies, jsonString)
|
||||
}
|
||||
|
||||
_, err := endpoint.Update()
|
||||
return err
|
||||
}
|
||||
|
||||
// ContainerAttach attaches an endpoint to container
|
||||
func (endpoint *HNSEndpoint) ContainerAttach(containerID string, compartmentID uint16) error {
|
||||
operation := "ContainerAttach"
|
||||
|
||||
15
vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go
generated
vendored
15
vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go
generated
vendored
@@ -9,23 +9,30 @@ import (
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
func hnsCall(method, path, request string, returnResponse interface{}) error {
|
||||
func hnsCallRawResponse(method, path, request string) (*hnsResponse, error) {
|
||||
var responseBuffer *uint16
|
||||
logrus.Debugf("[%s]=>[%s] Request : %s", method, path, request)
|
||||
|
||||
err := _hnsCall(method, path, request, &responseBuffer)
|
||||
if err != nil {
|
||||
return hcserror.New(err, "hnsCall ", "")
|
||||
return nil, hcserror.New(err, "hnsCall ", "")
|
||||
}
|
||||
response := interop.ConvertAndFreeCoTaskMemString(responseBuffer)
|
||||
|
||||
hnsresponse := &hnsResponse{}
|
||||
if err = json.Unmarshal([]byte(response), &hnsresponse); err != nil {
|
||||
return err
|
||||
return nil, err
|
||||
}
|
||||
return hnsresponse, nil
|
||||
}
|
||||
|
||||
func hnsCall(method, path, request string, returnResponse interface{}) error {
|
||||
hnsresponse, err := hnsCallRawResponse(method, path, request)
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed during hnsCallRawResponse: %v", err)
|
||||
}
|
||||
if !hnsresponse.Success {
|
||||
return fmt.Errorf("HNS failed with error : %s", hnsresponse.Error)
|
||||
return fmt.Errorf("hns failed with error : %s", hnsresponse.Error)
|
||||
}
|
||||
|
||||
if len(hnsresponse.Output) == 0 {
|
||||
|
||||
10
vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go
generated
vendored
10
vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go
generated
vendored
@@ -2,9 +2,9 @@ package hns
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"net"
|
||||
|
||||
"errors"
|
||||
"github.com/sirupsen/logrus"
|
||||
"net"
|
||||
)
|
||||
|
||||
// Subnet is assoicated with a network and represents a list
|
||||
@@ -98,6 +98,12 @@ func (network *HNSNetwork) Create() (*HNSNetwork, error) {
|
||||
title := "hcsshim::HNSNetwork::" + operation
|
||||
logrus.Debugf(title+" id=%s", network.Id)
|
||||
|
||||
for _, subnet := range network.Subnets {
|
||||
if (subnet.AddressPrefix != "") && (subnet.GatewayAddress == "") {
|
||||
return nil, errors.New("network create error, subnet has address prefix but no gateway specified")
|
||||
}
|
||||
}
|
||||
|
||||
jsonString, err := json.Marshal(network)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
|
||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user