mirror of
https://github.com/containers/skopeo.git
synced 2026-01-31 06:19:20 +00:00
Compare commits
249 Commits
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
67abbb3cef | ||
|
|
747abd054f | ||
|
|
8a664856cd | ||
|
|
3f81ee46c3 | ||
|
|
14ba92b2f6 | ||
|
|
63085f5bef | ||
|
|
091f9248dc | ||
|
|
dd7dd75334 | ||
|
|
b70dfae2ae | ||
|
|
0bd78a0604 | ||
|
|
9e0839c33f | ||
|
|
9bafa7e80d | ||
|
|
827293a13b | ||
|
|
6198daeb2c | ||
|
|
161ef5a224 | ||
|
|
9e99ad99d4 | ||
|
|
c36502ce31 | ||
|
|
f9b0d93ee0 | ||
|
|
4eaaf31249 | ||
|
|
c6b488a82c | ||
|
|
7cfc62922f | ||
|
|
5284f6d832 | ||
|
|
ae97c667e3 | ||
|
|
a2c1d46302 | ||
|
|
8b4b954332 | ||
|
|
c103d65284 | ||
|
|
c5183d0e34 | ||
|
|
16b435257b | ||
|
|
35f3595d02 | ||
|
|
0ee81dc9fe | ||
|
|
805885091f | ||
|
|
97ec6873fa | ||
|
|
d16cd39939 | ||
|
|
7439f94e22 | ||
|
|
443380731e | ||
|
|
56c6325ba0 | ||
|
|
0ae9db5dd6 | ||
|
|
677c29bf24 | ||
|
|
72376c4144 | ||
|
|
322625eeca | ||
|
|
9c1936fd07 | ||
|
|
3a94432e42 | ||
|
|
ce1f807aa0 | ||
|
|
a51af64dd9 | ||
|
|
a31d6069dc | ||
|
|
96353f2b64 | ||
|
|
2330455c8d | ||
|
|
91a88de6a1 | ||
|
|
2afe7a3e1e | ||
|
|
bec7f6977e | ||
|
|
60ecaffbe8 | ||
|
|
dcaee948d3 | ||
|
|
2fe7087d52 | ||
|
|
bd162028cd | ||
|
|
a214a305fd | ||
|
|
5093d5b5f6 | ||
|
|
0d9939dcd4 | ||
|
|
1b2de8ec5d | ||
|
|
ab2300500a | ||
|
|
fbf061260c | ||
|
|
4244d68240 | ||
|
|
dda31b3d4b | ||
|
|
2af172653c | ||
|
|
3247c0d229 | ||
|
|
eb024319de | ||
|
|
4ca9b139bb | ||
|
|
b79a37ead9 | ||
|
|
0ec2610f04 | ||
|
|
71a14d7df6 | ||
|
|
8936e76316 | ||
|
|
e21d6b3687 | ||
|
|
a6ab2291ba | ||
|
|
8f845aac23 | ||
|
|
439ea83081 | ||
|
|
42f68c1c76 | ||
|
|
8d252f82fd | ||
|
|
1ddb736b5a | ||
|
|
46fbbbd282 | ||
|
|
e7a7f018bd | ||
|
|
311fc89548 | ||
|
|
a6abdb8547 | ||
|
|
02407d98a5 | ||
|
|
b230a507e7 | ||
|
|
116add9d00 | ||
|
|
2415f3fa4d | ||
|
|
5f8d3fc639 | ||
|
|
1119299c4b | ||
|
|
2d91b93ad0 | ||
|
|
cf4dff471c | ||
|
|
101901ab40 | ||
|
|
17848a1868 | ||
|
|
9d21b48f8b | ||
|
|
2873d8ec91 | ||
|
|
9d63c7cd54 | ||
|
|
1f321dfc69 | ||
|
|
702165af46 | ||
|
|
8c8d9bd23f | ||
|
|
6ac3dce04e | ||
|
|
5b479b1090 | ||
|
|
b2033f3f9d | ||
|
|
f68b53afcd | ||
|
|
71a8ff0122 | ||
|
|
6569236642 | ||
|
|
8fa332618b | ||
|
|
0eef946e55 | ||
|
|
5d512e265a | ||
|
|
82e79e3f43 | ||
|
|
3e9d8ae731 | ||
|
|
325327dc3f | ||
|
|
bd20786c38 | ||
|
|
6e3f4c99be | ||
|
|
6db5626c3b | ||
|
|
eb199dce9c | ||
|
|
27b330f6f1 | ||
|
|
f231b7776b | ||
|
|
018a0108b1 | ||
|
|
55044627cc | ||
|
|
aa20fbfdf5 | ||
|
|
a6f5ef18c5 | ||
|
|
274efdf28f | ||
|
|
501452a500 | ||
|
|
336164246b | ||
|
|
e31d5a0e8f | ||
|
|
ed883c5230 | ||
|
|
7fee7d5019 | ||
|
|
970af7d1b4 | ||
|
|
12865fdfb8 | ||
|
|
1e7fe55be0 | ||
|
|
7170702ee4 | ||
|
|
081e4834d5 | ||
|
|
b541fef300 | ||
|
|
bd59677a84 | ||
|
|
7a0a8c25a2 | ||
|
|
a7ff66f09e | ||
|
|
dda59750e6 | ||
|
|
a99450c002 | ||
|
|
ebeb1c3f59 | ||
|
|
cd1ffbdb90 | ||
|
|
33ebce0880 | ||
|
|
cc43fd50d7 | ||
|
|
0752e837e5 | ||
|
|
2e9a426a78 | ||
|
|
406d3eb134 | ||
|
|
14e9834d55 | ||
|
|
bae3378171 | ||
|
|
71c382c043 | ||
|
|
7dcfc18309 | ||
|
|
9b984e8eba | ||
|
|
4e45fcc584 | ||
|
|
0d84f81305 | ||
|
|
2e65e64c06 | ||
|
|
4c4a4b611e | ||
|
|
ef1b005c95 | ||
|
|
fcbc889abf | ||
|
|
7be2a1bf3b | ||
|
|
c05fbf4573 | ||
|
|
d7a2bd7230 | ||
|
|
f489ba7bfc | ||
|
|
0a91c00ebe | ||
|
|
df2966b766 | ||
|
|
7c29094b51 | ||
|
|
88f6057eaa | ||
|
|
c2fa78096b | ||
|
|
8d1a4649f2 | ||
|
|
377ba25c6b | ||
|
|
1d136f0541 | ||
|
|
7b9629d6dc | ||
|
|
07c89b49ff | ||
|
|
a9854e1173 | ||
|
|
36fdc062ba | ||
|
|
5554964a8f | ||
|
|
b0cfab1d45 | ||
|
|
cce44c45d5 | ||
|
|
c8e0250903 | ||
|
|
f830265034 | ||
|
|
fea7ada700 | ||
|
|
ba8417edf3 | ||
|
|
2eb86a3be7 | ||
|
|
759dc98b32 | ||
|
|
7d080caaa3 | ||
|
|
b6e7fbdfdf | ||
|
|
9d10912ced | ||
|
|
dd8275528a | ||
|
|
b59c018afd | ||
|
|
e3f9f55c56 | ||
|
|
97aae7a7e4 | ||
|
|
2c0a4c9c17 | ||
|
|
9a0dba940d | ||
|
|
a7297d4db7 | ||
|
|
7cbb8ad3ba | ||
|
|
4489ddd8a5 | ||
|
|
c6a731bb2e | ||
|
|
222beaf4c7 | ||
|
|
763e48858b | ||
|
|
6c7dc9b7c9 | ||
|
|
e955849f0a | ||
|
|
27b3e21842 | ||
|
|
8652b650b6 | ||
|
|
17b921cbbc | ||
|
|
c3e6b4f917 | ||
|
|
2f2dc64681 | ||
|
|
5291aac96b | ||
|
|
b0da085857 | ||
|
|
407f2e95e0 | ||
|
|
7d3c3ce561 | ||
|
|
e8d49d60ff | ||
|
|
21613f194f | ||
|
|
afaa9e7f00 | ||
|
|
9c402f3799 | ||
|
|
8ccd7b994d | ||
|
|
3ed6e83c4a | ||
|
|
04bc64f593 | ||
|
|
73248bd639 | ||
|
|
2bfa89532d | ||
|
|
c6bc236769 | ||
|
|
ce6ec7720e | ||
|
|
39ff039b3b | ||
|
|
912b7e1e09 | ||
|
|
88fd117257 | ||
|
|
34ab4c4f32 | ||
|
|
5f3219a854 | ||
|
|
23d9383a36 | ||
|
|
39540db170 | ||
|
|
af0734832b | ||
|
|
81caa0fa5d | ||
|
|
dd66c1d342 | ||
|
|
6991ba8563 | ||
|
|
db877dca36 | ||
|
|
8eba94f271 | ||
|
|
24f4f82c09 | ||
|
|
05ae513b18 | ||
|
|
332bb459e6 | ||
|
|
307d9c2252 | ||
|
|
1094c7d61d | ||
|
|
876595e634 | ||
|
|
140b47e8e9 | ||
|
|
cd8c0085b1 | ||
|
|
75b7d1e2af | ||
|
|
10d0ebb9fe | ||
|
|
a18ec3f693 | ||
|
|
02432cf063 | ||
|
|
d83d081942 | ||
|
|
ce2db02200 | ||
|
|
df92a33ca9 | ||
|
|
153520e20e | ||
|
|
b21a59705f | ||
|
|
a263b353a1 | ||
|
|
a18a5eaecd | ||
|
|
2553a230d0 |
3
.gitignore
vendored
3
.gitignore
vendored
@@ -1,3 +1,6 @@
|
||||
*.1
|
||||
/layers-*
|
||||
/skopeo
|
||||
|
||||
# ignore JetBrains IDEs (GoLand) config folder
|
||||
.idea
|
||||
@@ -8,6 +8,9 @@ matrix:
|
||||
- docker
|
||||
- os: osx
|
||||
|
||||
go:
|
||||
- 1.13.x
|
||||
|
||||
notifications:
|
||||
email: false
|
||||
|
||||
|
||||
3
CODE-OF-CONDUCT.md
Normal file
3
CODE-OF-CONDUCT.md
Normal file
@@ -0,0 +1,3 @@
|
||||
## The skopeo Project Community Code of Conduct
|
||||
|
||||
The skopeo project follows the [Containers Community Code of Conduct](https://github.com/containers/common/blob/master/CODE-OF-CONDUCT.md).
|
||||
@@ -1,16 +1,17 @@
|
||||
FROM fedora
|
||||
|
||||
RUN dnf -y update && dnf install -y make git golang golang-github-cpuguy83-go-md2man \
|
||||
RUN dnf -y update && dnf install -y make git golang golang-github-cpuguy83-md2man \
|
||||
# storage deps
|
||||
btrfs-progs-devel \
|
||||
device-mapper-devel \
|
||||
# gpgme bindings deps
|
||||
libassuan-devel gpgme-devel \
|
||||
ostree-devel \
|
||||
gnupg \
|
||||
# htpasswd for system tests
|
||||
httpd-tools \
|
||||
# OpenShift deps
|
||||
which tar wget hostname util-linux bsdtar socat ethtool device-mapper iptables tree findutils nmap-ncat e2fsprogs xfsprogs lsof docker iproute \
|
||||
bats jq podman \
|
||||
bats jq podman runc \
|
||||
golint \
|
||||
&& dnf clean all
|
||||
|
||||
|
||||
@@ -1,4 +1,4 @@
|
||||
FROM ubuntu:18.10
|
||||
FROM ubuntu:19.10
|
||||
|
||||
RUN apt-get update && apt-get install -y \
|
||||
golang \
|
||||
@@ -7,8 +7,7 @@ RUN apt-get update && apt-get install -y \
|
||||
libdevmapper-dev \
|
||||
libgpgme11-dev \
|
||||
go-md2man \
|
||||
libglib2.0-dev \
|
||||
libostree-dev
|
||||
libglib2.0-dev
|
||||
|
||||
ENV GOPATH=/
|
||||
WORKDIR /src/github.com/containers/skopeo
|
||||
|
||||
44
Makefile
44
Makefile
@@ -1,10 +1,10 @@
|
||||
.PHONY: all binary build-container docs docs-in-container build-local clean install install-binary install-completions shell test-integration .install.vndr vendor
|
||||
.PHONY: all binary build-container docs docs-in-container build-local clean install install-binary install-completions shell test-integration .install.vndr vendor vendor-in-container
|
||||
|
||||
export GOPROXY=https://proxy.golang.org
|
||||
|
||||
ifeq ($(shell uname),Darwin)
|
||||
PREFIX ?= ${DESTDIR}/usr/local
|
||||
DARWIN_BUILD_TAG=containers_image_ostree_stub
|
||||
DARWIN_BUILD_TAG=
|
||||
# On macOS, (brew install gpgme) installs it within /usr/local, but /usr/local/include is not in the default search path.
|
||||
# Rather than hard-code this directory, use gpgme-config. Sadly that must be done at the top-level user
|
||||
# instead of locally in the gpgme subpackage, because cgo supports only pkg-config, not general shell scripts,
|
||||
@@ -20,16 +20,23 @@ INSTALLDIR=${PREFIX}/bin
|
||||
MANINSTALLDIR=${PREFIX}/share/man
|
||||
CONTAINERSSYSCONFIGDIR=${DESTDIR}/etc/containers
|
||||
REGISTRIESDDIR=${CONTAINERSSYSCONFIGDIR}/registries.d
|
||||
SIGSTOREDIR=${DESTDIR}/var/lib/atomic/sigstore
|
||||
SIGSTOREDIR=${DESTDIR}/var/lib/containers/sigstore
|
||||
BASHINSTALLDIR=${PREFIX}/share/bash-completion/completions
|
||||
|
||||
GO ?= go
|
||||
GOBIN := $(shell $(GO) env GOBIN)
|
||||
ifeq ($(GOBIN),)
|
||||
GOBIN := $(GOPATH)/bin
|
||||
endif
|
||||
|
||||
CONTAINER_RUNTIME := $(shell command -v podman 2> /dev/null || echo docker)
|
||||
GOMD2MAN ?= $(shell command -v go-md2man || echo '$(GOBIN)/go-md2man')
|
||||
|
||||
GO_BUILD=$(GO) build
|
||||
# Go module support: set `-mod=vendor` to use the vendored sources
|
||||
# Go module support: set `-mod=vendor` to use the vendored sources.
|
||||
# See also hack/make.sh.
|
||||
ifeq ($(shell go help mod >/dev/null 2>&1 && echo true), true)
|
||||
GO_BUILD=GO111MODULE=on $(GO) build -mod=vendor
|
||||
GO:=GO111MODULE=on $(GO)
|
||||
MOD_VENDOR=-mod=vendor
|
||||
endif
|
||||
|
||||
ifeq ($(DEBUG), 1)
|
||||
@@ -60,12 +67,11 @@ MANPAGES ?= $(MANPAGES_MD:%.md=%)
|
||||
|
||||
BTRFS_BUILD_TAG = $(shell hack/btrfs_tag.sh) $(shell hack/btrfs_installed_tag.sh)
|
||||
LIBDM_BUILD_TAG = $(shell hack/libdm_tag.sh)
|
||||
OSTREE_BUILD_TAG = $(shell hack/ostree_tag.sh)
|
||||
LOCAL_BUILD_TAGS = $(BTRFS_BUILD_TAG) $(LIBDM_BUILD_TAG) $(OSTREE_BUILD_TAG) $(DARWIN_BUILD_TAG)
|
||||
LOCAL_BUILD_TAGS = $(BTRFS_BUILD_TAG) $(LIBDM_BUILD_TAG) $(DARWIN_BUILD_TAG)
|
||||
BUILDTAGS += $(LOCAL_BUILD_TAGS)
|
||||
|
||||
ifeq ($(DISABLE_CGO), 1)
|
||||
override BUILDTAGS = containers_image_ostree_stub exclude_graphdriver_devicemapper exclude_graphdriver_btrfs containers_image_openpgp
|
||||
override BUILDTAGS = exclude_graphdriver_devicemapper exclude_graphdriver_btrfs containers_image_openpgp
|
||||
endif
|
||||
|
||||
# make all DEBUG=1
|
||||
@@ -101,10 +107,10 @@ binary-static: cmd/skopeo
|
||||
|
||||
# Build w/o using containers
|
||||
binary-local:
|
||||
$(GPGME_ENV) $(GO_BUILD) ${GO_DYN_FLAGS} -ldflags "-X main.gitCommit=${GIT_COMMIT}" -gcflags "$(GOGCFLAGS)" -tags "$(BUILDTAGS)" -o skopeo ./cmd/skopeo
|
||||
$(GPGME_ENV) $(GO) build $(MOD_VENDOR) ${GO_DYN_FLAGS} -ldflags "-X main.gitCommit=${GIT_COMMIT}" -gcflags "$(GOGCFLAGS)" -tags "$(BUILDTAGS)" -o skopeo ./cmd/skopeo
|
||||
|
||||
binary-local-static:
|
||||
$(GPGME_ENV) $(GO_BUILD) -ldflags "-extldflags \"-static\" -X main.gitCommit=${GIT_COMMIT}" -gcflags "$(GOGCFLAGS)" -tags "$(BUILDTAGS)" -o skopeo ./cmd/skopeo
|
||||
$(GPGME_ENV) $(GO) build $(MOD_VENDOR) -ldflags "-extldflags \"-static\" -X main.gitCommit=${GIT_COMMIT}" -gcflags "$(GOGCFLAGS)" -tags "$(BUILDTAGS)" -o skopeo ./cmd/skopeo
|
||||
|
||||
build-container:
|
||||
${CONTAINER_RUNTIME} build ${BUILD_ARGS} -t "$(IMAGE)" .
|
||||
@@ -153,8 +159,8 @@ test-integration: build-container
|
||||
# complicated set of options needed to run podman-in-podman
|
||||
test-system: build-container
|
||||
DTEMP=$(shell mktemp -d --tmpdir=/var/tmp podman-tmp.XXXXXX); \
|
||||
$(CONTAINER_CMD) --privileged --net=host \
|
||||
-v $$DTEMP:/var/lib/containers:Z \
|
||||
$(CONTAINER_CMD) --privileged \
|
||||
-v $$DTEMP:/var/lib/containers:Z -v /run/systemd/journal/socket:/run/systemd/journal/socket \
|
||||
"$(IMAGE)" \
|
||||
bash -c 'BUILDTAGS="$(BUILDTAGS)" hack/make.sh test-system'; \
|
||||
rc=$$?; \
|
||||
@@ -175,10 +181,12 @@ validate-local:
|
||||
hack/make.sh validate-git-marks validate-gofmt validate-lint validate-vet
|
||||
|
||||
test-unit-local:
|
||||
$(GPGME_ENV) $(GO) test -tags "$(BUILDTAGS)" $$($(GO) list -tags "$(BUILDTAGS)" -e ./... | grep -v '^github\.com/containers/skopeo/\(integration\|vendor/.*\)$$')
|
||||
$(GPGME_ENV) $(GO) test $(MOD_VENDOR) -tags "$(BUILDTAGS)" $$($(GO) list $(MOD_VENDOR) -tags "$(BUILDTAGS)" -e ./... | grep -v '^github\.com/containers/skopeo/\(integration\|vendor/.*\)$$')
|
||||
|
||||
vendor:
|
||||
export GO111MODULE=on \
|
||||
$(GO) mod tidy && \
|
||||
$(GO) mod vendor && \
|
||||
$(GO) mod verify
|
||||
$(GO) mod tidy
|
||||
$(GO) mod vendor
|
||||
$(GO) mod verify
|
||||
|
||||
vendor-in-container:
|
||||
podman run --privileged --rm --env HOME=/root -v `pwd`:/src -w /src docker.io/library/golang:1.13 make vendor
|
||||
|
||||
267
README.md
267
README.md
@@ -7,9 +7,13 @@ skopeo [ as well as the original Docker v2 images.
|
||||
|
||||
Skopeo works with API V2 registries such as Docker registries, the Atomic registry, private registries, local directories and local OCI-layout directories. Skopeo does not require a daemon to be running to perform these operations which consist of:
|
||||
Skopeo works with API V2 container image registries such as [docker.io](https://docker.io) and [quay.io](https://quay.io) registries, private registries, local directories and local OCI-layout directories. Skopeo can perform operations which consist of:
|
||||
|
||||
* Copying an image from and to various storage mechanisms.
|
||||
For example you can copy images from one registry to another, without requiring privilege.
|
||||
@@ -20,16 +24,16 @@ Skopeo works with API V2 registries such as Docker registries, the Atomic regist
|
||||
Skopeo operates on the following image and repository types:
|
||||
|
||||
* containers-storage:docker-reference
|
||||
An image located in a local containers/storage image store. Location and image store specified in /etc/containers/storage.conf
|
||||
An image located in a local containers/storage image store. Both the location and image store are specified in /etc/containers/storage.conf. (This is the backend for [Podman](https://podman.io), [CRI-O](https://cri-o.io), [Buildah](https://buildah.io) and friends)
|
||||
|
||||
* dir:path
|
||||
An existing local directory path storing the manifest, layer tarballs and signatures as individual files. This is a non-standardized format, primarily useful for debugging or noninvasive container inspection.
|
||||
|
||||
* docker://docker-reference
|
||||
An image in a registry implementing the "Docker Registry HTTP API V2". By default, uses the authorization state in $HOME/.docker/config.json, which is set e.g. using (docker login).
|
||||
An image in a registry implementing the "Docker Registry HTTP API V2". By default, uses the authorization state in `$XDG_RUNTIME_DIR/containers/auth.json`, which is set using `skopeo login`.
|
||||
|
||||
* docker-archive:path[:docker-reference]
|
||||
An image is stored in the `docker save` formated file. docker-reference is only used when creating such a file, and it must not contain a digest.
|
||||
An image is stored in a `docker save`-formatted file. docker-reference is only used when creating such a file, and it must not contain a digest.
|
||||
|
||||
* docker-daemon:docker-reference
|
||||
An image docker-reference stored in the docker daemon internal storage. docker-reference must contain either a tag or a digest. Alternatively, when reading images, the format can also be docker-daemon:algo:digest (an image ID).
|
||||
@@ -37,209 +41,150 @@ Skopeo works with API V2 registries such as Docker registries, the Atomic regist
|
||||
* oci:path:tag
|
||||
An image tag in a directory compliant with "Open Container Image Layout Specification" at path.
|
||||
|
||||
* ostree:image[@/absolute/repo/path]
|
||||
An image in local OSTree repository. /absolute/repo/path defaults to /ostree/repo.
|
||||
|
||||
Inspecting a repository
|
||||
-
|
||||
`skopeo` is able to _inspect_ a repository on a Docker registry and fetch images layers.
|
||||
## Inspecting a repository
|
||||
`skopeo` is able to _inspect_ a repository on a container registry and fetch images layers.
|
||||
The _inspect_ command fetches the repository's manifest and it is able to show you a `docker inspect`-like
|
||||
json output about a whole repository or a tag. This tool, in contrast to `docker inspect`, helps you gather useful information about
|
||||
a repository or a tag before pulling it (using disk space). The inspect command can show you which tags are available for the given
|
||||
repository, the labels the image has, the creation date and operating system of the image and more.
|
||||
|
||||
|
||||
Examples:
|
||||
```sh
|
||||
# show properties of fedora:latest
|
||||
$ skopeo inspect docker://docker.io/fedora
|
||||
|
||||
#### Show properties of fedora:latest
|
||||
```console
|
||||
$ skopeo inspect docker://registry.fedoraproject.org/fedora:latest
|
||||
{
|
||||
"Name": "docker.io/library/fedora",
|
||||
"Tag": "latest",
|
||||
"Digest": "sha256:cfd8f071bf8da7a466748f522406f7ae5908d002af1b1a1c0dcf893e183e5b32",
|
||||
"Name": "registry.fedoraproject.org/fedora",
|
||||
"Digest": "sha256:655721ff613ee766a4126cb5e0d5ae81598e1b0c3bcf7017c36c4d72cb092fe9",
|
||||
"RepoTags": [
|
||||
"20",
|
||||
"21",
|
||||
"22",
|
||||
"23",
|
||||
"heisenbug",
|
||||
"latest",
|
||||
"rawhide"
|
||||
"24",
|
||||
"25",
|
||||
"26-modular",
|
||||
...
|
||||
],
|
||||
"Created": "2016-03-04T18:40:02.92155334Z",
|
||||
"DockerVersion": "1.9.1",
|
||||
"Labels": {},
|
||||
"Created": "2020-04-29T06:48:16Z",
|
||||
"DockerVersion": "1.10.1",
|
||||
"Labels": {
|
||||
"license": "MIT",
|
||||
"name": "fedora",
|
||||
"vendor": "Fedora Project",
|
||||
"version": "32"
|
||||
},
|
||||
"Architecture": "amd64",
|
||||
"Os": "linux",
|
||||
"Layers": [
|
||||
"sha256:236608c7b546e2f4e7223526c74fc71470ba06d46ec82aeb402e704bfdee02a2",
|
||||
"sha256:a3ed95caeb02ffe68cdd9fd84406680ae93d633cb16422d00e8a7c22955b46d4"
|
||||
"sha256:3088721d7dbf674fc0be64cd3cf00c25aab921cacf35fa0e7b1578500a3e1653"
|
||||
],
|
||||
"Env": [
|
||||
"DISTTAG=f32container",
|
||||
"FGC=f32",
|
||||
"container=oci"
|
||||
]
|
||||
}
|
||||
|
||||
# show unverifed image's digest
|
||||
$ skopeo inspect docker://docker.io/fedora:rawhide | jq '.Digest'
|
||||
"sha256:905b4846938c8aef94f52f3e41a11398ae5b40f5855fb0e40ed9c157e721d7f8"
|
||||
```
|
||||
|
||||
Copying images
|
||||
-
|
||||
`skopeo` can copy container images between various storage mechanisms, including:
|
||||
* Docker distribution based registries
|
||||
#### Show container configuration from `fedora:latest`
|
||||
|
||||
- The Docker Hub, OpenShift, GCR, Artifactory, Quay ...
|
||||
```console
|
||||
$ skopeo inspect --config docker://registry.fedoraproject.org/fedora:latest | jq
|
||||
{
|
||||
"created": "2020-04-29T06:48:16Z",
|
||||
"architecture": "amd64",
|
||||
"os": "linux",
|
||||
"config": {
|
||||
"Env": [
|
||||
"DISTTAG=f32container",
|
||||
"FGC=f32",
|
||||
"container=oci"
|
||||
],
|
||||
"Cmd": [
|
||||
"/bin/bash"
|
||||
],
|
||||
"Labels": {
|
||||
"license": "MIT",
|
||||
"name": "fedora",
|
||||
"vendor": "Fedora Project",
|
||||
"version": "32"
|
||||
}
|
||||
},
|
||||
"rootfs": {
|
||||
"type": "layers",
|
||||
"diff_ids": [
|
||||
"sha256:a4c0fa2b217d3fd63d51e55a6fd59432e543d499c0df2b1acd48fbe424f2ddd1"
|
||||
]
|
||||
},
|
||||
"history": [
|
||||
{
|
||||
"created": "2020-04-29T06:48:16Z",
|
||||
"comment": "Created by Image Factory"
|
||||
}
|
||||
]
|
||||
}
|
||||
```
|
||||
#### Show unverifed image's digest
|
||||
```console
|
||||
$ skopeo inspect docker://registry.fedoraproject.org/fedora:latest | jq '.Digest'
|
||||
"sha256:655721ff613ee766a4126cb5e0d5ae81598e1b0c3bcf7017c36c4d72cb092fe9"
|
||||
```
|
||||
|
||||
## Copying images
|
||||
|
||||
`skopeo` can copy container images between various storage mechanisms, including:
|
||||
* Container registries
|
||||
|
||||
- The Quay, Docker Hub, OpenShift, GCR, Artifactory ...
|
||||
|
||||
* Container Storage backends
|
||||
|
||||
- Docker daemon storage
|
||||
- github.com/containers/storage (Backend for [Podman](https://podman.io), [CRI-O](https://cri-o.io), [Buildah](https://buildah.io) and friends)
|
||||
|
||||
- github.com/containers/storage (Backend for CRI-O, Buildah and friends)
|
||||
- Docker daemon storage
|
||||
|
||||
* Local directories
|
||||
|
||||
* Local OCI-layout directories
|
||||
|
||||
```sh
|
||||
$ skopeo copy docker://busybox:1-glibc atomic:myns/unsigned:streaming
|
||||
$ skopeo copy docker://busybox:latest dir:existingemptydirectory
|
||||
$ skopeo copy docker://busybox:latest oci:busybox_ocilayout:latest
|
||||
```console
|
||||
$ skopeo copy docker://quay.io/buildah/stable docker://registry.internal.company.com/buildah
|
||||
$ skopeo copy oci:busybox_ocilayout:latest dir:existingemptydirectory
|
||||
```
|
||||
|
||||
Deleting images
|
||||
-
|
||||
For example,
|
||||
```sh
|
||||
## Deleting images
|
||||
```console
|
||||
$ skopeo delete docker://localhost:5000/imagename:latest
|
||||
```
|
||||
|
||||
Private registries with authentication
|
||||
-
|
||||
When interacting with private registries, `skopeo` first looks for `--creds` (for `skopeo inspect|delete`) or `--src-creds|--dest-creds` (for `skopeo copy`) flags. If those aren't provided, it looks for the Docker's cli config file (usually located at `$HOME/.docker/config.json`) to get the credentials needed to authenticate. The ultimate fallback, as Docker does, is to provide an empty authentication when interacting with those registries.
|
||||
## Authenticating to a registry
|
||||
|
||||
Examples:
|
||||
```sh
|
||||
$ cat /home/runcom/.docker/config.json
|
||||
{
|
||||
"auths": {
|
||||
"myregistrydomain.com:5000": {
|
||||
"auth": "dGVzdHVzZXI6dGVzdHBhc3N3b3Jk",
|
||||
"email": "stuf@ex.cm"
|
||||
}
|
||||
}
|
||||
}
|
||||
#### Private registries with authentication
|
||||
skopeo uses credentials from the --creds (for skopeo inspect|delete) or --src-creds|--dest-creds (for skopeo copy) flags, if set; otherwise it uses configuration set by skopeo login, podman login, buildah login, or docker login.
|
||||
|
||||
# we can see I'm already authenticated via docker login so everything will be fine
|
||||
```console
|
||||
$ skopeo login --user USER docker://myregistrydomain.com:5000
|
||||
Password:
|
||||
$ skopeo inspect docker://myregistrydomain.com:5000/busybox
|
||||
{"Tag":"latest","Digest":"sha256:473bb2189d7b913ed7187a33d11e743fdc2f88931122a44d91a301b64419f092","RepoTags":["latest"],"Comment":"","Created":"2016-01-15T18:06:41.282540103Z","ContainerConfig":{"Hostname":"aded96b43f48","Domainname":"","User":"","AttachStdin":false,"AttachStdout":false,"AttachStderr":false,"Tty":false,"OpenStdin":false,"StdinOnce":false,"Env":null,"Cmd":["/bin/sh","-c","#(nop) CMD [\"sh\"]"],"Image":"9e77fef7a1c9f989988c06620dabc4020c607885b959a2cbd7c2283c91da3e33","Volumes":null,"WorkingDir":"","Entrypoint":null,"OnBuild":null,"Labels":null},"DockerVersion":"1.8.3","Author":"","Config":{"Hostname":"aded96b43f48","Domainname":"","User":"","AttachStdin":false,"AttachStdout":false,"AttachStderr":false,"Tty":false,"OpenStdin":false,"StdinOnce":false,"Env":null,"Cmd":["sh"],"Image":"9e77fef7a1c9f989988c06620dabc4020c607885b959a2cbd7c2283c91da3e33","Volumes":null,"WorkingDir":"","Entrypoint":null,"OnBuild":null,"Labels":null},"Architecture":"amd64","Os":"linux"}
|
||||
$ skopeo logout docker://myregistrydomain.com:5000
|
||||
```
|
||||
|
||||
# let's try now to fake a non existent Docker's config file
|
||||
$ cat /home/runcom/.docker/config.json
|
||||
{}
|
||||
#### Using --creds directly
|
||||
|
||||
$ skopeo inspect docker://myregistrydomain.com:5000/busybox
|
||||
FATA[0000] unauthorized: authentication required
|
||||
|
||||
# passing --creds - we can see that everything goes fine
|
||||
```console
|
||||
$ skopeo inspect --creds=testuser:testpassword docker://myregistrydomain.com:5000/busybox
|
||||
{"Tag":"latest","Digest":"sha256:473bb2189d7b913ed7187a33d11e743fdc2f88931122a44d91a301b64419f092","RepoTags":["latest"],"Comment":"","Created":"2016-01-15T18:06:41.282540103Z","ContainerConfig":{"Hostname":"aded96b43f48","Domainname":"","User":"","AttachStdin":false,"AttachStdout":false,"AttachStderr":false,"Tty":false,"OpenStdin":false,"StdinOnce":false,"Env":null,"Cmd":["/bin/sh","-c","#(nop) CMD [\"sh\"]"],"Image":"9e77fef7a1c9f989988c06620dabc4020c607885b959a2cbd7c2283c91da3e33","Volumes":null,"WorkingDir":"","Entrypoint":null,"OnBuild":null,"Labels":null},"DockerVersion":"1.8.3","Author":"","Config":{"Hostname":"aded96b43f48","Domainname":"","User":"","AttachStdin":false,"AttachStdout":false,"AttachStderr":false,"Tty":false,"OpenStdin":false,"StdinOnce":false,"Env":null,"Cmd":["sh"],"Image":"9e77fef7a1c9f989988c06620dabc4020c607885b959a2cbd7c2283c91da3e33","Volumes":null,"WorkingDir":"","Entrypoint":null,"OnBuild":null,"Labels":null},"Architecture":"amd64","Os":"linux"}
|
||||
```
|
||||
|
||||
# skopeo copy example:
|
||||
```console
|
||||
$ skopeo copy --src-creds=testuser:testpassword docker://myregistrydomain.com:5000/private oci:local_oci_image
|
||||
```
|
||||
If your cli config is found but it doesn't contain the necessary credentials for the queried registry
|
||||
you'll get an error. You can fix this by either logging in (via `docker login`) or providing `--creds` or `--src-creds|--dest-creds`.
|
||||
|
||||
|
||||
Obtaining skopeo
|
||||
[Obtaining skopeo](./install.md)
|
||||
-
|
||||
`skopeo` may already be packaged in your distribution, for example on Fedora 23 and later you can install it using
|
||||
```sh
|
||||
$ sudo dnf install skopeo
|
||||
```
|
||||
for openSUSE:
|
||||
```sh
|
||||
$ sudo zypper install skopeo
|
||||
```
|
||||
|
||||
For a detailed description how to install or build skopeo, see
|
||||
[install.md](./install.md).
|
||||
|
||||
Otherwise, read on for building and installing it from source:
|
||||
|
||||
To build the `skopeo` binary you need at least Go 1.9.
|
||||
|
||||
There are two ways to build skopeo: in a container, or locally without a container. Choose the one which better matches your needs and environment.
|
||||
|
||||
### Building without a container
|
||||
Building without a container requires a bit more manual work and setup in your environment, but it is more flexible:
|
||||
- It should work in more environments (e.g. for native macOS builds)
|
||||
- It does not require root privileges (after dependencies are installed)
|
||||
- It is faster, therefore more convenient for developing `skopeo`.
|
||||
|
||||
Install the necessary dependencies:
|
||||
```sh
|
||||
# Fedora:
|
||||
sudo dnf install gpgme-devel libassuan-devel btrfs-progs-devel device-mapper-devel ostree-devel
|
||||
|
||||
# Ubuntu (`libbtrfs-dev` requires Ubuntu 18.10 and above):
|
||||
sudo apt install libgpgme-dev libassuan-dev libbtrfs-dev libdevmapper-dev libostree-dev
|
||||
|
||||
# macOS:
|
||||
brew install gpgme
|
||||
|
||||
# openSUSE
|
||||
sudo zypper install libgpgme-devel device-mapper-devel libbtrfs-devel glib2-devel
|
||||
```
|
||||
|
||||
Make sure to clone this repository in your `GOPATH` - otherwise compilation fails.
|
||||
|
||||
```sh
|
||||
$ git clone https://github.com/containers/skopeo $GOPATH/src/github.com/containers/skopeo
|
||||
$ cd $GOPATH/src/github.com/containers/skopeo && make binary-local
|
||||
```
|
||||
|
||||
### Building in a container
|
||||
Building in a container is simpler, but more restrictive:
|
||||
- It requires the `docker` command and the ability to run Linux containers
|
||||
- The created executable is a Linux executable, and depends on dynamic libraries which may only be available only in a container of a similar Linux distribution.
|
||||
|
||||
```sh
|
||||
$ make binary # Or (make all) to also build documentation, see below.
|
||||
```
|
||||
|
||||
To build a pure-Go static binary (disables ostree, devicemapper, btrfs, and gpgme):
|
||||
|
||||
```sh
|
||||
$ make binary-static DISABLE_CGO=1
|
||||
```
|
||||
|
||||
### Building documentation
|
||||
To build the manual you will need go-md2man.
|
||||
```sh
|
||||
Debian$ sudo apt-get install go-md2man
|
||||
Fedora$ sudo dnf install go-md2man
|
||||
```
|
||||
Then
|
||||
```sh
|
||||
$ make docs
|
||||
```
|
||||
|
||||
### Installation
|
||||
Finally, after the binary and documentation is built:
|
||||
```sh
|
||||
$ sudo make install
|
||||
```
|
||||
|
||||
TODO
|
||||
-
|
||||
- list all images on registry?
|
||||
- registry v2 search?
|
||||
- show repo tags via flag or when reference isn't tagged or digested
|
||||
- support rkt/appc image spec
|
||||
|
||||
NOT TODO
|
||||
-
|
||||
- provide a _format_ flag - just use the awesome [jq](https://stedolan.github.io/jq/)
|
||||
|
||||
CONTRIBUTING
|
||||
Contributing
|
||||
-
|
||||
|
||||
Please read the [contribution guide](CONTRIBUTING.md) if you want to collaborate in the project.
|
||||
|
||||
3
SECURITY.md
Normal file
3
SECURITY.md
Normal file
@@ -0,0 +1,3 @@
|
||||
## Security and Disclosure Information Policy for the skopeo Project
|
||||
|
||||
The skopeo Project follows the [Security and Disclosure Information Policy](https://github.com/containers/common/blob/master/SECURITY.md) for the Containers Projects.
|
||||
@@ -11,23 +11,29 @@ import (
|
||||
"github.com/containers/image/v5/manifest"
|
||||
"github.com/containers/image/v5/transports"
|
||||
"github.com/containers/image/v5/transports/alltransports"
|
||||
"github.com/spf13/cobra"
|
||||
|
||||
encconfig "github.com/containers/ocicrypt/config"
|
||||
enchelpers "github.com/containers/ocicrypt/helpers"
|
||||
imgspecv1 "github.com/opencontainers/image-spec/specs-go/v1"
|
||||
"github.com/urfave/cli"
|
||||
)
|
||||
|
||||
type copyOptions struct {
|
||||
global *globalOptions
|
||||
srcImage *imageOptions
|
||||
destImage *imageDestOptions
|
||||
additionalTags cli.StringSlice // For docker-archive: destinations, in addition to the name:tag specified as destination, also add these
|
||||
removeSignatures bool // Do not copy signatures from the source image
|
||||
signByFingerprint string // Sign the image using a GPG key with the specified fingerprint
|
||||
format optionalString // Force conversion of the image to a specified format
|
||||
quiet bool // Suppress output information when copying images
|
||||
all bool // Copy all of the images if the source is a list
|
||||
additionalTags []string // For docker-archive: destinations, in addition to the name:tag specified as destination, also add these
|
||||
removeSignatures bool // Do not copy signatures from the source image
|
||||
signByFingerprint string // Sign the image using a GPG key with the specified fingerprint
|
||||
format optionalString // Force conversion of the image to a specified format
|
||||
quiet bool // Suppress output information when copying images
|
||||
all bool // Copy all of the images if the source is a list
|
||||
encryptLayer []int // The list of layers to encrypt
|
||||
encryptionKeys []string // Keys needed to encrypt the image
|
||||
decryptionKeys []string // Keys needed to decrypt the image
|
||||
}
|
||||
|
||||
func copyCmd(global *globalOptions) cli.Command {
|
||||
func copyCmd(global *globalOptions) *cobra.Command {
|
||||
sharedFlags, sharedOpts := sharedImageFlags()
|
||||
srcFlags, srcOpts := imageFlags(global, sharedOpts, "src-", "screds")
|
||||
destFlags, destOpts := imageDestFlags(global, sharedOpts, "dest-", "dcreds")
|
||||
@@ -35,55 +41,34 @@ func copyCmd(global *globalOptions) cli.Command {
|
||||
srcImage: srcOpts,
|
||||
destImage: destOpts,
|
||||
}
|
||||
cmd := &cobra.Command{
|
||||
Use: "copy [command options] SOURCE-IMAGE DESTINATION-IMAGE",
|
||||
Short: "Copy an IMAGE-NAME from one location to another",
|
||||
Long: fmt.Sprintf(`Container "IMAGE-NAME" uses a "transport":"details" format.
|
||||
|
||||
return cli.Command{
|
||||
Name: "copy",
|
||||
Usage: "Copy an IMAGE-NAME from one location to another",
|
||||
Description: fmt.Sprintf(`
|
||||
Supported transports:
|
||||
%s
|
||||
|
||||
Container "IMAGE-NAME" uses a "transport":"details" format.
|
||||
|
||||
Supported transports:
|
||||
%s
|
||||
|
||||
See skopeo(1) section "IMAGE NAMES" for the expected format
|
||||
`, strings.Join(transports.ListNames(), ", ")),
|
||||
ArgsUsage: "SOURCE-IMAGE DESTINATION-IMAGE",
|
||||
Action: commandAction(opts.run),
|
||||
// FIXME: Do we need to namespace the GPG aspect?
|
||||
Flags: append(append(append([]cli.Flag{
|
||||
cli.StringSliceFlag{
|
||||
Name: "additional-tag",
|
||||
Usage: "additional tags (supports docker-archive)",
|
||||
Value: &opts.additionalTags, // Surprisingly StringSliceFlag does not support Destination:, but modifies Value: in place.
|
||||
},
|
||||
cli.BoolFlag{
|
||||
Name: "quiet, q",
|
||||
Usage: "Suppress output information when copying images",
|
||||
Destination: &opts.quiet,
|
||||
},
|
||||
cli.BoolFlag{
|
||||
Name: "all, a",
|
||||
Usage: "Copy all images if SOURCE-IMAGE is a list",
|
||||
Destination: &opts.all,
|
||||
},
|
||||
cli.BoolFlag{
|
||||
Name: "remove-signatures",
|
||||
Usage: "Do not copy signatures from SOURCE-IMAGE",
|
||||
Destination: &opts.removeSignatures,
|
||||
},
|
||||
cli.StringFlag{
|
||||
Name: "sign-by",
|
||||
Usage: "Sign the image using a GPG key with the specified `FINGERPRINT`",
|
||||
Destination: &opts.signByFingerprint,
|
||||
},
|
||||
cli.GenericFlag{
|
||||
Name: "format, f",
|
||||
Usage: "`MANIFEST TYPE` (oci, v2s1, or v2s2) to use when saving image to directory using the 'dir:' transport (default is manifest type of source)",
|
||||
Value: newOptionalStringValue(&opts.format),
|
||||
},
|
||||
}, sharedFlags...), srcFlags...), destFlags...),
|
||||
See skopeo(1) section "IMAGE NAMES" for the expected format
|
||||
`, strings.Join(transports.ListNames(), ", ")),
|
||||
RunE: commandAction(opts.run),
|
||||
Example: `skopeo copy --sign-by dev@example.com container-storage:example/busybox:streaming docker://example/busybox:gold`,
|
||||
}
|
||||
adjustUsage(cmd)
|
||||
flags := cmd.Flags()
|
||||
flags.AddFlagSet(&sharedFlags)
|
||||
flags.AddFlagSet(&srcFlags)
|
||||
flags.AddFlagSet(&destFlags)
|
||||
flags.StringSliceVar(&opts.additionalTags, "additional-tag", []string{}, "additional tags (supports docker-archive)")
|
||||
flags.BoolVarP(&opts.quiet, "quiet", "q", false, "Suppress output information when copying images")
|
||||
flags.BoolVarP(&opts.all, "all", "a", false, "Copy all images if SOURCE-IMAGE is a list")
|
||||
flags.BoolVar(&opts.removeSignatures, "remove-signatures", false, "Do not copy signatures from SOURCE-IMAGE")
|
||||
flags.StringVar(&opts.signByFingerprint, "sign-by", "", "Sign the image using a GPG key with the specified `FINGERPRINT`")
|
||||
flags.VarP(newOptionalStringValue(&opts.format), "format", "f", `MANIFEST TYPE (oci, v2s1, or v2s2) to use when saving image to directory using the 'dir:' transport (default is manifest type of source)`)
|
||||
flags.StringSliceVar(&opts.encryptionKeys, "encryption-key", []string{}, "*Experimental* key with the encryption protocol to use needed to encrypt the image (e.g. jwe:/path/to/key.pem)")
|
||||
flags.IntSliceVar(&opts.encryptLayer, "encrypt-layer", []int{}, "*Experimental* the 0-indexed layer indices, with support for negative indexing (e.g. 0 is the first layer, -1 is the last layer)")
|
||||
flags.StringSliceVar(&opts.decryptionKeys, "decryption-key", []string{}, "*Experimental* key needed to decrypt the image")
|
||||
return cmd
|
||||
}
|
||||
|
||||
func (opts *copyOptions) run(args []string, stdout io.Writer) error {
|
||||
@@ -156,6 +141,43 @@ func (opts *copyOptions) run(args []string, stdout io.Writer) error {
|
||||
if opts.all {
|
||||
imageListSelection = copy.CopyAllImages
|
||||
}
|
||||
|
||||
if len(opts.encryptionKeys) > 0 && len(opts.decryptionKeys) > 0 {
|
||||
return fmt.Errorf("--encryption-key and --decryption-key cannot be specified together")
|
||||
}
|
||||
|
||||
var encLayers *[]int
|
||||
var encConfig *encconfig.EncryptConfig
|
||||
var decConfig *encconfig.DecryptConfig
|
||||
|
||||
if len(opts.encryptLayer) > 0 && len(opts.encryptionKeys) == 0 {
|
||||
return fmt.Errorf("--encrypt-layer can only be used with --encryption-key")
|
||||
}
|
||||
|
||||
if len(opts.encryptionKeys) > 0 {
|
||||
// encryption
|
||||
p := opts.encryptLayer
|
||||
encLayers = &p
|
||||
encryptionKeys := opts.encryptionKeys
|
||||
ecc, err := enchelpers.CreateCryptoConfig(encryptionKeys, []string{})
|
||||
if err != nil {
|
||||
return fmt.Errorf("Invalid encryption keys: %v", err)
|
||||
}
|
||||
cc := encconfig.CombineCryptoConfigs([]encconfig.CryptoConfig{ecc})
|
||||
encConfig = cc.EncryptConfig
|
||||
}
|
||||
|
||||
if len(opts.decryptionKeys) > 0 {
|
||||
// decryption
|
||||
decryptionKeys := opts.decryptionKeys
|
||||
dcc, err := enchelpers.CreateCryptoConfig([]string{}, decryptionKeys)
|
||||
if err != nil {
|
||||
return fmt.Errorf("Invalid decryption keys: %v", err)
|
||||
}
|
||||
cc := encconfig.CombineCryptoConfigs([]encconfig.CryptoConfig{dcc})
|
||||
decConfig = cc.DecryptConfig
|
||||
}
|
||||
|
||||
_, err = copy.Image(ctx, policyContext, destRef, srcRef, ©.Options{
|
||||
RemoveSignatures: opts.removeSignatures,
|
||||
SignBy: opts.signByFingerprint,
|
||||
@@ -164,6 +186,9 @@ func (opts *copyOptions) run(args []string, stdout io.Writer) error {
|
||||
DestinationCtx: destinationCtx,
|
||||
ForceManifestMIMEType: manifestType,
|
||||
ImageListSelection: imageListSelection,
|
||||
OciDecryptConfig: decConfig,
|
||||
OciEncryptLayers: encLayers,
|
||||
OciEncryptConfig: encConfig,
|
||||
})
|
||||
return err
|
||||
}
|
||||
|
||||
@@ -8,7 +8,7 @@ import (
|
||||
|
||||
"github.com/containers/image/v5/transports"
|
||||
"github.com/containers/image/v5/transports/alltransports"
|
||||
"github.com/urfave/cli"
|
||||
"github.com/spf13/cobra"
|
||||
)
|
||||
|
||||
type deleteOptions struct {
|
||||
@@ -16,28 +16,29 @@ type deleteOptions struct {
|
||||
image *imageOptions
|
||||
}
|
||||
|
||||
func deleteCmd(global *globalOptions) cli.Command {
|
||||
func deleteCmd(global *globalOptions) *cobra.Command {
|
||||
sharedFlags, sharedOpts := sharedImageFlags()
|
||||
imageFlags, imageOpts := imageFlags(global, sharedOpts, "", "")
|
||||
opts := deleteOptions{
|
||||
global: global,
|
||||
image: imageOpts,
|
||||
}
|
||||
return cli.Command{
|
||||
Name: "delete",
|
||||
Usage: "Delete image IMAGE-NAME",
|
||||
Description: fmt.Sprintf(`
|
||||
Delete an "IMAGE_NAME" from a transport
|
||||
|
||||
Supported transports:
|
||||
%s
|
||||
|
||||
See skopeo(1) section "IMAGE NAMES" for the expected format
|
||||
`, strings.Join(transports.ListNames(), ", ")),
|
||||
ArgsUsage: "IMAGE-NAME",
|
||||
Action: commandAction(opts.run),
|
||||
Flags: append(sharedFlags, imageFlags...),
|
||||
cmd := &cobra.Command{
|
||||
Use: "delete [command options] IMAGE-NAME",
|
||||
Short: "Delete image IMAGE-NAME",
|
||||
Long: fmt.Sprintf(`Delete an "IMAGE_NAME" from a transport
|
||||
Supported transports:
|
||||
%s
|
||||
See skopeo(1) section "IMAGE NAMES" for the expected format
|
||||
`, strings.Join(transports.ListNames(), ", ")),
|
||||
RunE: commandAction(opts.run),
|
||||
Example: `skopeo delete docker://registry.example.com/example/pause:latest`,
|
||||
}
|
||||
adjustUsage(cmd)
|
||||
flags := cmd.Flags()
|
||||
flags.AddFlagSet(&sharedFlags)
|
||||
flags.AddFlagSet(&imageFlags)
|
||||
return cmd
|
||||
}
|
||||
|
||||
func (opts *deleteOptions) run(args []string, stdout io.Writer) error {
|
||||
|
||||
@@ -3,7 +3,7 @@ package main
|
||||
import (
|
||||
"strconv"
|
||||
|
||||
"github.com/urfave/cli"
|
||||
"github.com/spf13/pflag"
|
||||
)
|
||||
|
||||
// optionalBool is a boolean with a separate presence flag.
|
||||
@@ -15,10 +15,18 @@ type optionalBool struct {
|
||||
// optionalBool is a cli.Generic == flag.Value implementation equivalent to
|
||||
// the one underlying flag.Bool, except that it records whether the flag has been set.
|
||||
// This is distinct from optionalBool to (pretend to) force callers to use
|
||||
// newOptionalBool
|
||||
// optionalBoolFlag
|
||||
type optionalBoolValue optionalBool
|
||||
|
||||
func newOptionalBoolValue(p *optionalBool) cli.Generic {
|
||||
func optionalBoolFlag(fs *pflag.FlagSet, p *optionalBool, name, usage string) *pflag.Flag {
|
||||
flag := fs.VarPF(internalNewOptionalBoolValue(p), name, "", usage)
|
||||
flag.NoOptDefVal = "true"
|
||||
return flag
|
||||
}
|
||||
|
||||
// WARNING: Do not directly use this method to define optionalBool flag.
|
||||
// Caller should use optionalBoolFlag
|
||||
func internalNewOptionalBoolValue(p *optionalBool) pflag.Value {
|
||||
p.present = false
|
||||
return (*optionalBoolValue)(p)
|
||||
}
|
||||
@@ -40,6 +48,10 @@ func (ob *optionalBoolValue) String() string {
|
||||
return strconv.FormatBool(ob.value)
|
||||
}
|
||||
|
||||
func (ob *optionalBoolValue) Type() string {
|
||||
return "bool"
|
||||
}
|
||||
|
||||
func (ob *optionalBoolValue) IsBoolFlag() bool {
|
||||
return true
|
||||
}
|
||||
@@ -56,7 +68,7 @@ type optionalString struct {
|
||||
// newoptionalString
|
||||
type optionalStringValue optionalString
|
||||
|
||||
func newOptionalStringValue(p *optionalString) cli.Generic {
|
||||
func newOptionalStringValue(p *optionalString) pflag.Value {
|
||||
p.present = false
|
||||
return (*optionalStringValue)(p)
|
||||
}
|
||||
@@ -74,6 +86,10 @@ func (ob *optionalStringValue) String() string {
|
||||
return ob.value
|
||||
}
|
||||
|
||||
func (ob *optionalStringValue) Type() string {
|
||||
return "string"
|
||||
}
|
||||
|
||||
// optionalInt is a int with a separate presence flag.
|
||||
type optionalInt struct {
|
||||
present bool
|
||||
@@ -86,7 +102,7 @@ type optionalInt struct {
|
||||
// newoptionalIntValue
|
||||
type optionalIntValue optionalInt
|
||||
|
||||
func newOptionalIntValue(p *optionalInt) cli.Generic {
|
||||
func newOptionalIntValue(p *optionalInt) pflag.Value {
|
||||
p.present = false
|
||||
return (*optionalIntValue)(p)
|
||||
}
|
||||
@@ -107,3 +123,7 @@ func (ob *optionalIntValue) String() string {
|
||||
}
|
||||
return strconv.Itoa(int(ob.value))
|
||||
}
|
||||
|
||||
func (ob *optionalIntValue) Type() string {
|
||||
return "int"
|
||||
}
|
||||
|
||||
@@ -3,9 +3,9 @@ package main
|
||||
import (
|
||||
"testing"
|
||||
|
||||
"github.com/spf13/cobra"
|
||||
"github.com/stretchr/testify/assert"
|
||||
"github.com/stretchr/testify/require"
|
||||
"github.com/urfave/cli"
|
||||
)
|
||||
|
||||
func TestOptionalBoolSet(t *testing.T) {
|
||||
@@ -34,7 +34,7 @@ func TestOptionalBoolSet(t *testing.T) {
|
||||
{"2", false, false},
|
||||
} {
|
||||
var ob optionalBool
|
||||
v := newOptionalBoolValue(&ob)
|
||||
v := internalNewOptionalBoolValue(&ob)
|
||||
require.False(t, ob.present)
|
||||
err := v.Set(c.input)
|
||||
if c.accepted {
|
||||
@@ -51,30 +51,23 @@ func TestOptionalBoolSet(t *testing.T) {
|
||||
// is not called in any possible situation).
|
||||
var globalOB, commandOB optionalBool
|
||||
actionRun := false
|
||||
app := cli.NewApp()
|
||||
app.EnableBashCompletion = true
|
||||
app.Flags = []cli.Flag{
|
||||
cli.GenericFlag{
|
||||
Name: "global-OB",
|
||||
Value: newOptionalBoolValue(&globalOB),
|
||||
},
|
||||
app := &cobra.Command{
|
||||
Use: "app",
|
||||
}
|
||||
app.Commands = []cli.Command{{
|
||||
Name: "cmd",
|
||||
Flags: []cli.Flag{
|
||||
cli.GenericFlag{
|
||||
Name: "command-OB",
|
||||
Value: newOptionalBoolValue(&commandOB),
|
||||
},
|
||||
},
|
||||
Action: func(*cli.Context) error {
|
||||
optionalBoolFlag(app.PersistentFlags(), &globalOB, "global-OB", "")
|
||||
cmd := &cobra.Command{
|
||||
Use: "cmd",
|
||||
RunE: func(cmd *cobra.Command, args []string) error {
|
||||
assert.False(t, globalOB.present)
|
||||
assert.False(t, commandOB.present)
|
||||
actionRun = true
|
||||
return nil
|
||||
},
|
||||
}}
|
||||
err := app.Run([]string{"app", "cmd"})
|
||||
}
|
||||
optionalBoolFlag(cmd.Flags(), &commandOB, "command-OB", "")
|
||||
app.AddCommand(cmd)
|
||||
app.SetArgs([]string{"cmd"})
|
||||
err := app.Execute()
|
||||
require.NoError(t, err)
|
||||
assert.True(t, actionRun)
|
||||
}
|
||||
@@ -90,7 +83,7 @@ func TestOptionalBoolString(t *testing.T) {
|
||||
{optionalBool{present: false, value: false}, ""},
|
||||
} {
|
||||
var ob optionalBool
|
||||
v := newOptionalBoolValue(&ob)
|
||||
v := internalNewOptionalBoolValue(&ob)
|
||||
ob = c.input
|
||||
res := v.String()
|
||||
assert.Equal(t, c.expected, res)
|
||||
@@ -114,23 +107,21 @@ func TestOptionalBoolIsBoolFlag(t *testing.T) {
|
||||
} {
|
||||
var ob optionalBool
|
||||
actionRun := false
|
||||
app := cli.NewApp()
|
||||
app.Commands = []cli.Command{{
|
||||
Name: "cmd",
|
||||
Flags: []cli.Flag{
|
||||
cli.GenericFlag{
|
||||
Name: "OB",
|
||||
Value: newOptionalBoolValue(&ob),
|
||||
},
|
||||
},
|
||||
Action: func(ctx *cli.Context) error {
|
||||
app := &cobra.Command{Use: "app"}
|
||||
cmd := &cobra.Command{
|
||||
Use: "cmd",
|
||||
RunE: func(cmd *cobra.Command, args []string) error {
|
||||
assert.Equal(t, c.expectedOB, ob)
|
||||
assert.Equal(t, c.expectedArgs, ([]string)(ctx.Args()))
|
||||
assert.Equal(t, c.expectedArgs, args)
|
||||
actionRun = true
|
||||
return nil
|
||||
},
|
||||
}}
|
||||
err := app.Run(append([]string{"app", "cmd"}, c.input...))
|
||||
}
|
||||
optionalBoolFlag(cmd.Flags(), &ob, "OB", "")
|
||||
app.AddCommand(cmd)
|
||||
|
||||
app.SetArgs(append([]string{"cmd"}, c.input...))
|
||||
err := app.Execute()
|
||||
require.NoError(t, err)
|
||||
assert.True(t, actionRun)
|
||||
}
|
||||
@@ -152,30 +143,23 @@ func TestOptionalStringSet(t *testing.T) {
|
||||
// is not called in any possible situation).
|
||||
var globalOS, commandOS optionalString
|
||||
actionRun := false
|
||||
app := cli.NewApp()
|
||||
app.EnableBashCompletion = true
|
||||
app.Flags = []cli.Flag{
|
||||
cli.GenericFlag{
|
||||
Name: "global-OS",
|
||||
Value: newOptionalStringValue(&globalOS),
|
||||
},
|
||||
app := &cobra.Command{
|
||||
Use: "app",
|
||||
}
|
||||
app.Commands = []cli.Command{{
|
||||
Name: "cmd",
|
||||
Flags: []cli.Flag{
|
||||
cli.GenericFlag{
|
||||
Name: "command-OS",
|
||||
Value: newOptionalStringValue(&commandOS),
|
||||
},
|
||||
},
|
||||
Action: func(*cli.Context) error {
|
||||
app.PersistentFlags().Var(newOptionalStringValue(&globalOS), "global-OS", "")
|
||||
cmd := &cobra.Command{
|
||||
Use: "cmd",
|
||||
RunE: func(cmd *cobra.Command, args []string) error {
|
||||
assert.False(t, globalOS.present)
|
||||
assert.False(t, commandOS.present)
|
||||
actionRun = true
|
||||
return nil
|
||||
},
|
||||
}}
|
||||
err := app.Run([]string{"app", "cmd"})
|
||||
}
|
||||
cmd.Flags().Var(newOptionalStringValue(&commandOS), "command-OS", "")
|
||||
app.AddCommand(cmd)
|
||||
app.SetArgs([]string{"cmd"})
|
||||
err := app.Execute()
|
||||
require.NoError(t, err)
|
||||
assert.True(t, actionRun)
|
||||
}
|
||||
@@ -216,23 +200,22 @@ func TestOptionalStringIsBoolFlag(t *testing.T) {
|
||||
} {
|
||||
var os optionalString
|
||||
actionRun := false
|
||||
app := cli.NewApp()
|
||||
app.Commands = []cli.Command{{
|
||||
Name: "cmd",
|
||||
Flags: []cli.Flag{
|
||||
cli.GenericFlag{
|
||||
Name: "OS",
|
||||
Value: newOptionalStringValue(&os),
|
||||
},
|
||||
},
|
||||
Action: func(ctx *cli.Context) error {
|
||||
app := &cobra.Command{
|
||||
Use: "app",
|
||||
}
|
||||
cmd := &cobra.Command{
|
||||
Use: "cmd",
|
||||
RunE: func(cmd *cobra.Command, args []string) error {
|
||||
assert.Equal(t, c.expectedOS, os)
|
||||
assert.Equal(t, c.expectedArgs, ([]string)(ctx.Args()))
|
||||
assert.Equal(t, c.expectedArgs, args)
|
||||
actionRun = true
|
||||
return nil
|
||||
},
|
||||
}}
|
||||
err := app.Run(append([]string{"app", "cmd"}, c.input...))
|
||||
}
|
||||
cmd.Flags().Var(newOptionalStringValue(&os), "OS", "")
|
||||
app.AddCommand(cmd)
|
||||
app.SetArgs(append([]string{"cmd"}, c.input...))
|
||||
err := app.Execute()
|
||||
require.NoError(t, err)
|
||||
assert.True(t, actionRun)
|
||||
}
|
||||
|
||||
@@ -11,10 +11,10 @@ import (
|
||||
"github.com/containers/image/v5/image"
|
||||
"github.com/containers/image/v5/manifest"
|
||||
"github.com/containers/image/v5/transports"
|
||||
"github.com/opencontainers/go-digest"
|
||||
digest "github.com/opencontainers/go-digest"
|
||||
"github.com/pkg/errors"
|
||||
"github.com/sirupsen/logrus"
|
||||
"github.com/urfave/cli"
|
||||
"github.com/spf13/cobra"
|
||||
)
|
||||
|
||||
// inspectOutput is the output format of (skopeo inspect), primarily so that we can format it with a simple json.MarshalIndent.
|
||||
@@ -39,39 +39,32 @@ type inspectOptions struct {
|
||||
config bool // Output the raw config blob instead of parsing information about the image
|
||||
}
|
||||
|
||||
func inspectCmd(global *globalOptions) cli.Command {
|
||||
func inspectCmd(global *globalOptions) *cobra.Command {
|
||||
sharedFlags, sharedOpts := sharedImageFlags()
|
||||
imageFlags, imageOpts := imageFlags(global, sharedOpts, "", "")
|
||||
opts := inspectOptions{
|
||||
global: global,
|
||||
image: imageOpts,
|
||||
}
|
||||
return cli.Command{
|
||||
Name: "inspect",
|
||||
Usage: "Inspect image IMAGE-NAME",
|
||||
Description: fmt.Sprintf(`
|
||||
Return low-level information about "IMAGE-NAME" in a registry/transport
|
||||
cmd := &cobra.Command{
|
||||
Use: "inspect [command options] IMAGE-NAME",
|
||||
Short: "Inspect image IMAGE-NAME",
|
||||
Long: fmt.Sprintf(`Return low-level information about "IMAGE-NAME" in a registry/transport
|
||||
Supported transports:
|
||||
%s
|
||||
|
||||
Supported transports:
|
||||
%s
|
||||
|
||||
See skopeo(1) section "IMAGE NAMES" for the expected format
|
||||
`, strings.Join(transports.ListNames(), ", ")),
|
||||
ArgsUsage: "IMAGE-NAME",
|
||||
Flags: append(append([]cli.Flag{
|
||||
cli.BoolFlag{
|
||||
Name: "raw",
|
||||
Usage: "output raw manifest or configuration",
|
||||
Destination: &opts.raw,
|
||||
},
|
||||
cli.BoolFlag{
|
||||
Name: "config",
|
||||
Usage: "output configuration",
|
||||
Destination: &opts.config,
|
||||
},
|
||||
}, sharedFlags...), imageFlags...),
|
||||
Action: commandAction(opts.run),
|
||||
See skopeo(1) section "IMAGE NAMES" for the expected format
|
||||
`, strings.Join(transports.ListNames(), ", ")),
|
||||
RunE: commandAction(opts.run),
|
||||
Example: `skopeo inspect docker://docker.io/fedora`,
|
||||
}
|
||||
adjustUsage(cmd)
|
||||
flags := cmd.Flags()
|
||||
flags.BoolVar(&opts.raw, "raw", false, "output raw manifest or configuration")
|
||||
flags.BoolVar(&opts.config, "config", false, "output configuration")
|
||||
flags.AddFlagSet(&sharedFlags)
|
||||
flags.AddFlagSet(&imageFlags)
|
||||
return cmd
|
||||
}
|
||||
|
||||
func (opts *inspectOptions) run(args []string, stdout io.Writer) (retErr error) {
|
||||
@@ -177,7 +170,9 @@ func (opts *inspectOptions) run(args []string, stdout io.Writer) (retErr error)
|
||||
// some registries may decide to block the "list all tags" endpoint
|
||||
// gracefully allow the inspect to continue in this case. Currently
|
||||
// the IBM Bluemix container registry has this restriction.
|
||||
if !strings.Contains(err.Error(), "401") {
|
||||
// In addition, AWS ECR rejects it with 403 (Forbidden) if the "ecr:ListImages"
|
||||
// action is not allowed.
|
||||
if !strings.Contains(err.Error(), "401") && !strings.Contains(err.Error(), "403") {
|
||||
return fmt.Errorf("Error determining repository tags: %v", err)
|
||||
}
|
||||
logrus.Warnf("Registry disallows tag list retrieval; skipping")
|
||||
|
||||
@@ -13,7 +13,7 @@ import (
|
||||
"github.com/containers/image/v5/types"
|
||||
"github.com/opencontainers/go-digest"
|
||||
"github.com/pkg/errors"
|
||||
"github.com/urfave/cli"
|
||||
"github.com/spf13/cobra"
|
||||
)
|
||||
|
||||
type layersOptions struct {
|
||||
@@ -21,21 +21,24 @@ type layersOptions struct {
|
||||
image *imageOptions
|
||||
}
|
||||
|
||||
func layersCmd(global *globalOptions) cli.Command {
|
||||
func layersCmd(global *globalOptions) *cobra.Command {
|
||||
sharedFlags, sharedOpts := sharedImageFlags()
|
||||
imageFlags, imageOpts := imageFlags(global, sharedOpts, "", "")
|
||||
opts := layersOptions{
|
||||
global: global,
|
||||
image: imageOpts,
|
||||
}
|
||||
return cli.Command{
|
||||
Name: "layers",
|
||||
Usage: "Get layers of IMAGE-NAME",
|
||||
ArgsUsage: "IMAGE-NAME [LAYER...]",
|
||||
Hidden: true,
|
||||
Action: commandAction(opts.run),
|
||||
Flags: append(sharedFlags, imageFlags...),
|
||||
cmd := &cobra.Command{
|
||||
Hidden: true,
|
||||
Use: "layers [command options] IMAGE-NAME [LAYER...]",
|
||||
Short: "Get layers of IMAGE-NAME",
|
||||
RunE: commandAction(opts.run),
|
||||
}
|
||||
adjustUsage(cmd)
|
||||
flags := cmd.Flags()
|
||||
flags.AddFlagSet(&sharedFlags)
|
||||
flags.AddFlagSet(&imageFlags)
|
||||
return cmd
|
||||
}
|
||||
|
||||
func (opts *layersOptions) run(args []string, stdout io.Writer) (retErr error) {
|
||||
|
||||
138
cmd/skopeo/list_tags.go
Normal file
138
cmd/skopeo/list_tags.go
Normal file
@@ -0,0 +1,138 @@
|
||||
package main
|
||||
|
||||
import (
|
||||
"context"
|
||||
"encoding/json"
|
||||
"fmt"
|
||||
"io"
|
||||
"strings"
|
||||
|
||||
"github.com/containers/image/v5/docker"
|
||||
"github.com/containers/image/v5/docker/reference"
|
||||
"github.com/containers/image/v5/transports/alltransports"
|
||||
"github.com/containers/image/v5/types"
|
||||
"github.com/pkg/errors"
|
||||
"github.com/spf13/cobra"
|
||||
)
|
||||
|
||||
// tagListOutput is the output format of (skopeo list-tags), primarily so that we can format it with a simple json.MarshalIndent.
|
||||
type tagListOutput struct {
|
||||
Repository string
|
||||
Tags []string
|
||||
}
|
||||
|
||||
type tagsOptions struct {
|
||||
global *globalOptions
|
||||
image *imageOptions
|
||||
}
|
||||
|
||||
func tagsCmd(global *globalOptions) *cobra.Command {
|
||||
sharedFlags, sharedOpts := sharedImageFlags()
|
||||
imageFlags, imageOpts := dockerImageFlags(global, sharedOpts, "", "")
|
||||
|
||||
opts := tagsOptions{
|
||||
global: global,
|
||||
image: imageOpts,
|
||||
}
|
||||
cmd := &cobra.Command{
|
||||
Use: "list-tags [command options] REPOSITORY-NAME",
|
||||
Short: "List tags in the transport/repository specified by the REPOSITORY-NAME",
|
||||
Long: `Return the list of tags from the transport/repository "REPOSITORY-NAME"
|
||||
|
||||
Supported transports:
|
||||
docker
|
||||
|
||||
See skopeo-list-tags(1) section "REPOSITORY NAMES" for the expected format
|
||||
`,
|
||||
RunE: commandAction(opts.run),
|
||||
Example: `skopeo list-tags docker://docker.io/fedora`,
|
||||
}
|
||||
adjustUsage(cmd)
|
||||
flags := cmd.Flags()
|
||||
flags.AddFlagSet(&sharedFlags)
|
||||
flags.AddFlagSet(&imageFlags)
|
||||
return cmd
|
||||
}
|
||||
|
||||
// Customized version of the alltransports.ParseImageName and docker.ParseReference that does not place a default tag in the reference
|
||||
// Would really love to not have this, but needed to enforce tag-less and digest-less names
|
||||
func parseDockerRepositoryReference(refString string) (types.ImageReference, error) {
|
||||
if !strings.HasPrefix(refString, docker.Transport.Name()+"://") {
|
||||
return nil, errors.Errorf("docker: image reference %s does not start with %s://", refString, docker.Transport.Name())
|
||||
}
|
||||
|
||||
parts := strings.SplitN(refString, ":", 2)
|
||||
if len(parts) != 2 {
|
||||
return nil, errors.Errorf(`Invalid image name "%s", expected colon-separated transport:reference`, refString)
|
||||
}
|
||||
|
||||
ref, err := reference.ParseNormalizedNamed(strings.TrimPrefix(parts[1], "//"))
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
if !reference.IsNameOnly(ref) {
|
||||
return nil, errors.New(`No tag or digest allowed in reference`)
|
||||
}
|
||||
|
||||
// Checks ok, now return a reference. This is a hack because the tag listing code expects a full image reference even though the tag is ignored
|
||||
return docker.NewReference(reference.TagNameOnly(ref))
|
||||
}
|
||||
|
||||
// List the tags from a repository contained in the imgRef reference. Any tag value in the reference is ignored
|
||||
func listDockerTags(ctx context.Context, sys *types.SystemContext, imgRef types.ImageReference) (string, []string, error) {
|
||||
repositoryName := imgRef.DockerReference().Name()
|
||||
|
||||
tags, err := docker.GetRepositoryTags(ctx, sys, imgRef)
|
||||
if err != nil {
|
||||
return ``, nil, fmt.Errorf("Error listing repository tags: %v", err)
|
||||
}
|
||||
return repositoryName, tags, nil
|
||||
}
|
||||
|
||||
func (opts *tagsOptions) run(args []string, stdout io.Writer) (retErr error) {
|
||||
ctx, cancel := opts.global.commandTimeoutContext()
|
||||
defer cancel()
|
||||
|
||||
if len(args) != 1 {
|
||||
return errorShouldDisplayUsage{errors.New("Exactly one non-option argument expected")}
|
||||
}
|
||||
|
||||
sys, err := opts.image.newSystemContext()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
transport := alltransports.TransportFromImageName(args[0])
|
||||
if transport == nil {
|
||||
return fmt.Errorf("Invalid %q: does not specify a transport", args[0])
|
||||
}
|
||||
|
||||
if transport.Name() != docker.Transport.Name() {
|
||||
return fmt.Errorf("Unsupported transport '%v' for tag listing. Only '%v' currently supported", transport.Name(), docker.Transport.Name())
|
||||
}
|
||||
|
||||
// Do transport-specific parsing and validation to get an image reference
|
||||
imgRef, err := parseDockerRepositoryReference(args[0])
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
repositoryName, tagListing, err := listDockerTags(ctx, sys, imgRef)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
outputData := tagListOutput{
|
||||
Repository: repositoryName,
|
||||
Tags: tagListing,
|
||||
}
|
||||
|
||||
out, err := json.MarshalIndent(outputData, "", " ")
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
_, err = fmt.Fprintf(stdout, "%s\n", string(out))
|
||||
|
||||
return err
|
||||
}
|
||||
57
cmd/skopeo/list_tags_test.go
Normal file
57
cmd/skopeo/list_tags_test.go
Normal file
@@ -0,0 +1,57 @@
|
||||
package main
|
||||
|
||||
import (
|
||||
"testing"
|
||||
|
||||
"github.com/containers/image/v5/transports/alltransports"
|
||||
"github.com/stretchr/testify/assert"
|
||||
)
|
||||
|
||||
// Tests the kinds of inputs allowed and expected to the command
|
||||
func TestDockerRepositoryReferenceParser(t *testing.T) {
|
||||
for _, test := range [][]string{
|
||||
{"docker://myhost.com:1000/nginx"}, //no tag
|
||||
{"docker://myhost.com/nginx"}, //no port or tag
|
||||
{"docker://somehost.com"}, // Valid default expansion
|
||||
{"docker://nginx"}, // Valid default expansion
|
||||
} {
|
||||
|
||||
ref, err := parseDockerRepositoryReference(test[0])
|
||||
expected, err := alltransports.ParseImageName(test[0])
|
||||
if assert.NoError(t, err, "Could not parse, got error on %v", test[0]) {
|
||||
assert.Equal(t, expected.DockerReference().Name(), ref.DockerReference().Name(), "Mismatched parse result for input %v", test[0])
|
||||
}
|
||||
}
|
||||
|
||||
for _, test := range [][]string{
|
||||
{"oci://somedir"},
|
||||
{"dir:/somepath"},
|
||||
{"docker-archive:/tmp/dir"},
|
||||
{"container-storage:myhost.com/someimage"},
|
||||
{"docker-daemon:myhost.com/someimage"},
|
||||
{"docker://myhost.com:1000/nginx:foobar:foobar"}, // Invalid repository ref
|
||||
{"docker://somehost.com:5000/"}, // no repo
|
||||
{"docker://myhost.com:1000/nginx:latest"}, //tag not allowed
|
||||
{"docker://myhost.com:1000/nginx@sha256:abcdef1234567890"}, //digest not allowed
|
||||
} {
|
||||
_, err := parseDockerRepositoryReference(test[0])
|
||||
assert.Error(t, err, test[0])
|
||||
}
|
||||
}
|
||||
|
||||
func TestDockerRepositoryReferenceParserDrift(t *testing.T) {
|
||||
for _, test := range [][]string{
|
||||
{"docker://myhost.com:1000/nginx", "myhost.com:1000/nginx"}, //no tag
|
||||
{"docker://myhost.com/nginx", "myhost.com/nginx"}, //no port or tag
|
||||
{"docker://somehost.com", "docker.io/library/somehost.com"}, // Valid default expansion
|
||||
{"docker://nginx", "docker.io/library/nginx"}, // Valid default expansion
|
||||
} {
|
||||
|
||||
ref, err := parseDockerRepositoryReference(test[0])
|
||||
ref2, err2 := alltransports.ParseImageName(test[0])
|
||||
|
||||
if assert.NoError(t, err, "Could not parse, got error on %v", test[0]) && assert.NoError(t, err2, "Could not parse with regular parser, got error on %v", test[0]) {
|
||||
assert.Equal(t, ref.DockerReference().String(), ref2.DockerReference().String(), "Different parsing output for input %v. Repo parse = %v, regular parser = %v", test[0], ref, ref2)
|
||||
}
|
||||
}
|
||||
}
|
||||
47
cmd/skopeo/login.go
Normal file
47
cmd/skopeo/login.go
Normal file
@@ -0,0 +1,47 @@
|
||||
package main
|
||||
|
||||
import (
|
||||
"io"
|
||||
"os"
|
||||
|
||||
"github.com/containers/common/pkg/auth"
|
||||
"github.com/containers/image/v5/types"
|
||||
"github.com/spf13/cobra"
|
||||
)
|
||||
|
||||
type loginOptions struct {
|
||||
global *globalOptions
|
||||
loginOpts auth.LoginOptions
|
||||
getLogin optionalBool
|
||||
tlsVerify optionalBool
|
||||
}
|
||||
|
||||
func loginCmd(global *globalOptions) *cobra.Command {
|
||||
opts := loginOptions{
|
||||
global: global,
|
||||
}
|
||||
cmd := &cobra.Command{
|
||||
Use: "login",
|
||||
Short: "Login to a container registry",
|
||||
Long: "Login to a container registry on a specified server.",
|
||||
RunE: commandAction(opts.run),
|
||||
Example: `skopeo login quay.io`,
|
||||
}
|
||||
adjustUsage(cmd)
|
||||
flags := cmd.Flags()
|
||||
optionalBoolFlag(flags, &opts.tlsVerify, "tls-verify", "require HTTPS and verify certificates when accessing the registry")
|
||||
flags.AddFlagSet(auth.GetLoginFlags(&opts.loginOpts))
|
||||
return cmd
|
||||
}
|
||||
|
||||
func (opts *loginOptions) run(args []string, stdout io.Writer) error {
|
||||
ctx, cancel := opts.global.commandTimeoutContext()
|
||||
defer cancel()
|
||||
opts.loginOpts.Stdout = stdout
|
||||
opts.loginOpts.Stdin = os.Stdin
|
||||
sys := opts.global.newSystemContext()
|
||||
if opts.tlsVerify.present {
|
||||
sys.DockerInsecureSkipTLSVerify = types.NewOptionalBool(!opts.tlsVerify.value)
|
||||
}
|
||||
return auth.Login(ctx, sys, &opts.loginOpts, args)
|
||||
}
|
||||
35
cmd/skopeo/logout.go
Normal file
35
cmd/skopeo/logout.go
Normal file
@@ -0,0 +1,35 @@
|
||||
package main
|
||||
|
||||
import (
|
||||
"io"
|
||||
|
||||
"github.com/containers/common/pkg/auth"
|
||||
"github.com/spf13/cobra"
|
||||
)
|
||||
|
||||
type logoutOptions struct {
|
||||
global *globalOptions
|
||||
logoutOpts auth.LogoutOptions
|
||||
}
|
||||
|
||||
func logoutCmd(global *globalOptions) *cobra.Command {
|
||||
opts := logoutOptions{
|
||||
global: global,
|
||||
}
|
||||
cmd := &cobra.Command{
|
||||
Use: "logout",
|
||||
Short: "Logout of a container registry",
|
||||
Long: "Logout of a container registry on a specified server.",
|
||||
RunE: commandAction(opts.run),
|
||||
Example: `skopeo logout quay.io`,
|
||||
}
|
||||
adjustUsage(cmd)
|
||||
cmd.Flags().AddFlagSet(auth.GetLogoutFlags(&opts.logoutOpts))
|
||||
return cmd
|
||||
}
|
||||
|
||||
func (opts *logoutOptions) run(args []string, stdout io.Writer) error {
|
||||
opts.logoutOpts.Stdout = stdout
|
||||
sys := opts.global.newSystemContext()
|
||||
return auth.Logout(sys, &opts.logoutOpts, args)
|
||||
}
|
||||
@@ -3,14 +3,14 @@ package main
|
||||
import (
|
||||
"context"
|
||||
"fmt"
|
||||
"os"
|
||||
"time"
|
||||
|
||||
"github.com/containers/image/v5/signature"
|
||||
"github.com/containers/image/v5/types"
|
||||
"github.com/containers/skopeo/version"
|
||||
"github.com/containers/storage/pkg/reexec"
|
||||
"github.com/sirupsen/logrus"
|
||||
"github.com/urfave/cli"
|
||||
"github.com/spf13/cobra"
|
||||
)
|
||||
|
||||
// gitCommit will be the hash that the binary was built from
|
||||
@@ -25,88 +25,67 @@ type globalOptions struct {
|
||||
registriesDirPath string // Path to a "registries.d" registry configuration directory
|
||||
overrideArch string // Architecture to use for choosing images, instead of the runtime one
|
||||
overrideOS string // OS to use for choosing images, instead of the runtime one
|
||||
overrideVariant string // Architecture variant to use for choosing images, instead of the runtime one
|
||||
commandTimeout time.Duration // Timeout for the command execution
|
||||
registriesConfPath string // Path to the "registries.conf" file
|
||||
tmpDir string // Path to use for big temporary files
|
||||
}
|
||||
|
||||
// createApp returns a cli.App, and the underlying globalOptions object, to be run or tested.
|
||||
func createApp() (*cli.App, *globalOptions) {
|
||||
// createApp returns a cobra.Command, and the underlying globalOptions object, to be run or tested.
|
||||
func createApp() (*cobra.Command, *globalOptions) {
|
||||
opts := globalOptions{}
|
||||
|
||||
app := cli.NewApp()
|
||||
app.EnableBashCompletion = true
|
||||
app.Name = "skopeo"
|
||||
rootCommand := &cobra.Command{
|
||||
Use: "skopeo",
|
||||
Long: "Various operations with container images and container image registries",
|
||||
PersistentPreRunE: func(cmd *cobra.Command, args []string) error {
|
||||
return opts.before(cmd)
|
||||
},
|
||||
SilenceUsage: true,
|
||||
SilenceErrors: true,
|
||||
}
|
||||
if gitCommit != "" {
|
||||
app.Version = fmt.Sprintf("%s commit: %s", version.Version, gitCommit)
|
||||
rootCommand.Version = fmt.Sprintf("%s commit: %s", version.Version, gitCommit)
|
||||
} else {
|
||||
app.Version = version.Version
|
||||
rootCommand.Version = version.Version
|
||||
}
|
||||
app.Usage = "Various operations with container images and container image registries"
|
||||
app.Flags = []cli.Flag{
|
||||
cli.BoolFlag{
|
||||
Name: "debug",
|
||||
Usage: "enable debug output",
|
||||
Destination: &opts.debug,
|
||||
},
|
||||
cli.GenericFlag{
|
||||
Name: "tls-verify",
|
||||
Usage: "require HTTPS and verify certificates when talking to container registries (defaults to true)",
|
||||
Hidden: true,
|
||||
Value: newOptionalBoolValue(&opts.tlsVerify),
|
||||
},
|
||||
cli.StringFlag{
|
||||
Name: "policy",
|
||||
Usage: "Path to a trust policy file",
|
||||
Destination: &opts.policyPath,
|
||||
},
|
||||
cli.BoolFlag{
|
||||
Name: "insecure-policy",
|
||||
Usage: "run the tool without any policy check",
|
||||
Destination: &opts.insecurePolicy,
|
||||
},
|
||||
cli.StringFlag{
|
||||
Name: "registries.d",
|
||||
Usage: "use registry configuration files in `DIR` (e.g. for container signature storage)",
|
||||
Destination: &opts.registriesDirPath,
|
||||
},
|
||||
cli.StringFlag{
|
||||
Name: "override-arch",
|
||||
Usage: "use `ARCH` instead of the architecture of the machine for choosing images",
|
||||
Destination: &opts.overrideArch,
|
||||
},
|
||||
cli.StringFlag{
|
||||
Name: "override-os",
|
||||
Usage: "use `OS` instead of the running OS for choosing images",
|
||||
Destination: &opts.overrideOS,
|
||||
},
|
||||
cli.DurationFlag{
|
||||
Name: "command-timeout",
|
||||
Usage: "timeout for the command execution",
|
||||
Destination: &opts.commandTimeout,
|
||||
},
|
||||
cli.StringFlag{
|
||||
Name: "registries-conf",
|
||||
Usage: "path to the registries.conf file",
|
||||
Destination: &opts.registriesConfPath,
|
||||
Hidden: true,
|
||||
},
|
||||
// Override default `--version` global flag to enable `-v` shorthand
|
||||
var dummyVersion bool
|
||||
rootCommand.Flags().BoolVarP(&dummyVersion, "version", "v", false, "Version for Skopeo")
|
||||
rootCommand.PersistentFlags().BoolVar(&opts.debug, "debug", false, "enable debug output")
|
||||
flag := optionalBoolFlag(rootCommand.PersistentFlags(), &opts.tlsVerify, "tls-verify", "Require HTTPS and verify certificates when accessing the registry")
|
||||
flag.Hidden = true
|
||||
rootCommand.PersistentFlags().StringVar(&opts.policyPath, "policy", "", "Path to a trust policy file")
|
||||
rootCommand.PersistentFlags().BoolVar(&opts.insecurePolicy, "insecure-policy", false, "run the tool without any policy check")
|
||||
rootCommand.PersistentFlags().StringVar(&opts.registriesDirPath, "registries.d", "", "use registry configuration files in `DIR` (e.g. for container signature storage)")
|
||||
rootCommand.PersistentFlags().StringVar(&opts.overrideArch, "override-arch", "", "use `ARCH` instead of the architecture of the machine for choosing images")
|
||||
rootCommand.PersistentFlags().StringVar(&opts.overrideOS, "override-os", "", "use `OS` instead of the running OS for choosing images")
|
||||
rootCommand.PersistentFlags().StringVar(&opts.overrideVariant, "override-variant", "", "use `VARIANT` instead of the running architecture variant for choosing images")
|
||||
rootCommand.PersistentFlags().DurationVar(&opts.commandTimeout, "command-timeout", 0, "timeout for the command execution")
|
||||
rootCommand.PersistentFlags().StringVar(&opts.registriesConfPath, "registries-conf", "", "path to the registries.conf file")
|
||||
if err := rootCommand.PersistentFlags().MarkHidden("registries-conf"); err != nil {
|
||||
logrus.Fatal("unable to mark registries-conf flag as hidden")
|
||||
}
|
||||
app.Before = opts.before
|
||||
app.Commands = []cli.Command{
|
||||
rootCommand.PersistentFlags().StringVar(&opts.tmpDir, "tmpdir", "", "directory used to store temporary files")
|
||||
rootCommand.AddCommand(
|
||||
copyCmd(&opts),
|
||||
deleteCmd(&opts),
|
||||
inspectCmd(&opts),
|
||||
layersCmd(&opts),
|
||||
deleteCmd(&opts),
|
||||
loginCmd(&opts),
|
||||
logoutCmd(&opts),
|
||||
manifestDigestCmd(),
|
||||
syncCmd(&opts),
|
||||
standaloneSignCmd(),
|
||||
standaloneVerifyCmd(),
|
||||
tagsCmd(&opts),
|
||||
untrustedSignatureDumpCmd(),
|
||||
}
|
||||
return app, &opts
|
||||
)
|
||||
return rootCommand, &opts
|
||||
}
|
||||
|
||||
// before is run by the cli package for any command, before running the command-specific handler.
|
||||
func (opts *globalOptions) before(ctx *cli.Context) error {
|
||||
func (opts *globalOptions) before(cmd *cobra.Command) error {
|
||||
if opts.debug {
|
||||
logrus.SetLevel(logrus.DebugLevel)
|
||||
}
|
||||
@@ -120,8 +99,8 @@ func main() {
|
||||
if reexec.Init() {
|
||||
return
|
||||
}
|
||||
app, _ := createApp()
|
||||
if err := app.Run(os.Args); err != nil {
|
||||
rootCmd, _ := createApp()
|
||||
if err := rootCmd.Execute(); err != nil {
|
||||
logrus.Fatal(err)
|
||||
}
|
||||
}
|
||||
@@ -153,3 +132,21 @@ func (opts *globalOptions) commandTimeoutContext() (context.Context, context.Can
|
||||
}
|
||||
return ctx, cancel
|
||||
}
|
||||
|
||||
// newSystemContext returns a *types.SystemContext corresponding to opts.
|
||||
// It is guaranteed to return a fresh instance, so it is safe to make additional updates to it.
|
||||
func (opts *globalOptions) newSystemContext() *types.SystemContext {
|
||||
ctx := &types.SystemContext{
|
||||
RegistriesDirPath: opts.registriesDirPath,
|
||||
ArchitectureChoice: opts.overrideArch,
|
||||
OSChoice: opts.overrideOS,
|
||||
VariantChoice: opts.overrideVariant,
|
||||
SystemRegistriesConfPath: opts.registriesConfPath,
|
||||
BigFilesTemporaryDir: opts.tmpDir,
|
||||
}
|
||||
// DEPRECATED: We support this for backward compatibility, but override it if a per-image flag is provided.
|
||||
if opts.tlsVerify.present {
|
||||
ctx.DockerInsecureSkipTLSVerify = types.NewOptionalBool(!opts.tlsVerify.value)
|
||||
}
|
||||
return ctx
|
||||
}
|
||||
|
||||
@@ -1,14 +1,47 @@
|
||||
package main
|
||||
|
||||
import "bytes"
|
||||
import (
|
||||
"bytes"
|
||||
"testing"
|
||||
|
||||
"github.com/containers/image/v5/types"
|
||||
"github.com/stretchr/testify/assert"
|
||||
)
|
||||
|
||||
// runSkopeo creates an app object and runs it with args, with an implied first "skopeo".
|
||||
// Returns output intended for stdout and the returned error, if any.
|
||||
func runSkopeo(args ...string) (string, error) {
|
||||
app, _ := createApp()
|
||||
stdout := bytes.Buffer{}
|
||||
app.Writer = &stdout
|
||||
args = append([]string{"skopeo"}, args...)
|
||||
err := app.Run(args)
|
||||
app.SetOut(&stdout)
|
||||
app.SetArgs(args)
|
||||
err := app.Execute()
|
||||
return stdout.String(), err
|
||||
}
|
||||
|
||||
func TestGlobalOptionsNewSystemContext(t *testing.T) {
|
||||
// Default state
|
||||
opts, _ := fakeGlobalOptions(t, []string{})
|
||||
res := opts.newSystemContext()
|
||||
assert.Equal(t, &types.SystemContext{}, res)
|
||||
// Set everything to non-default values.
|
||||
opts, _ = fakeGlobalOptions(t, []string{
|
||||
"--registries.d", "/srv/registries.d",
|
||||
"--override-arch", "overridden-arch",
|
||||
"--override-os", "overridden-os",
|
||||
"--override-variant", "overridden-variant",
|
||||
"--tmpdir", "/srv",
|
||||
"--registries-conf", "/srv/registries.conf",
|
||||
"--tls-verify=false",
|
||||
})
|
||||
res = opts.newSystemContext()
|
||||
assert.Equal(t, &types.SystemContext{
|
||||
RegistriesDirPath: "/srv/registries.d",
|
||||
ArchitectureChoice: "overridden-arch",
|
||||
OSChoice: "overridden-os",
|
||||
VariantChoice: "overridden-variant",
|
||||
BigFilesTemporaryDir: "/srv",
|
||||
SystemRegistriesConfPath: "/srv/registries.conf",
|
||||
DockerInsecureSkipTLSVerify: types.OptionalBoolTrue,
|
||||
}, res)
|
||||
}
|
||||
|
||||
@@ -7,20 +7,22 @@ import (
|
||||
"io/ioutil"
|
||||
|
||||
"github.com/containers/image/v5/manifest"
|
||||
"github.com/urfave/cli"
|
||||
"github.com/spf13/cobra"
|
||||
)
|
||||
|
||||
type manifestDigestOptions struct {
|
||||
}
|
||||
|
||||
func manifestDigestCmd() cli.Command {
|
||||
opts := manifestDigestOptions{}
|
||||
return cli.Command{
|
||||
Name: "manifest-digest",
|
||||
Usage: "Compute a manifest digest of a file",
|
||||
ArgsUsage: "MANIFEST",
|
||||
Action: commandAction(opts.run),
|
||||
func manifestDigestCmd() *cobra.Command {
|
||||
var opts manifestDigestOptions
|
||||
cmd := &cobra.Command{
|
||||
Use: "manifest-digest MANIFEST",
|
||||
Short: "Compute a manifest digest of a file",
|
||||
RunE: commandAction(opts.run),
|
||||
Example: "skopeo manifest-digest manifest.json",
|
||||
}
|
||||
adjustUsage(cmd)
|
||||
return cmd
|
||||
}
|
||||
|
||||
func (opts *manifestDigestOptions) run(args []string, stdout io.Writer) error {
|
||||
|
||||
@@ -8,28 +8,24 @@ import (
|
||||
"io/ioutil"
|
||||
|
||||
"github.com/containers/image/v5/signature"
|
||||
"github.com/urfave/cli"
|
||||
"github.com/spf13/cobra"
|
||||
)
|
||||
|
||||
type standaloneSignOptions struct {
|
||||
output string // Output file path
|
||||
}
|
||||
|
||||
func standaloneSignCmd() cli.Command {
|
||||
func standaloneSignCmd() *cobra.Command {
|
||||
opts := standaloneSignOptions{}
|
||||
return cli.Command{
|
||||
Name: "standalone-sign",
|
||||
Usage: "Create a signature using local files",
|
||||
ArgsUsage: "MANIFEST DOCKER-REFERENCE KEY-FINGERPRINT",
|
||||
Action: commandAction(opts.run),
|
||||
Flags: []cli.Flag{
|
||||
cli.StringFlag{
|
||||
Name: "output, o",
|
||||
Usage: "output the signature to `SIGNATURE`",
|
||||
Destination: &opts.output,
|
||||
},
|
||||
},
|
||||
cmd := &cobra.Command{
|
||||
Use: "standalone-sign [command options] MANIFEST DOCKER-REFERENCE KEY-FINGERPRINT",
|
||||
Short: "Create a signature using local files",
|
||||
RunE: commandAction(opts.run),
|
||||
}
|
||||
adjustUsage(cmd)
|
||||
flags := cmd.Flags()
|
||||
flags.StringVarP(&opts.output, "output", "o", "", "output the signature to `SIGNATURE`")
|
||||
return cmd
|
||||
}
|
||||
|
||||
func (opts *standaloneSignOptions) run(args []string, stdout io.Writer) error {
|
||||
@@ -64,14 +60,15 @@ func (opts *standaloneSignOptions) run(args []string, stdout io.Writer) error {
|
||||
type standaloneVerifyOptions struct {
|
||||
}
|
||||
|
||||
func standaloneVerifyCmd() cli.Command {
|
||||
func standaloneVerifyCmd() *cobra.Command {
|
||||
opts := standaloneVerifyOptions{}
|
||||
return cli.Command{
|
||||
Name: "standalone-verify",
|
||||
Usage: "Verify a signature using local files",
|
||||
ArgsUsage: "MANIFEST DOCKER-REFERENCE KEY-FINGERPRINT SIGNATURE",
|
||||
Action: commandAction(opts.run),
|
||||
cmd := &cobra.Command{
|
||||
Use: "standalone-verify MANIFEST DOCKER-REFERENCE KEY-FINGERPRINT SIGNATURE",
|
||||
Short: "Verify a signature using local files",
|
||||
RunE: commandAction(opts.run),
|
||||
}
|
||||
adjustUsage(cmd)
|
||||
return cmd
|
||||
}
|
||||
|
||||
func (opts *standaloneVerifyOptions) run(args []string, stdout io.Writer) error {
|
||||
@@ -115,15 +112,16 @@ func (opts *standaloneVerifyOptions) run(args []string, stdout io.Writer) error
|
||||
type untrustedSignatureDumpOptions struct {
|
||||
}
|
||||
|
||||
func untrustedSignatureDumpCmd() cli.Command {
|
||||
func untrustedSignatureDumpCmd() *cobra.Command {
|
||||
opts := untrustedSignatureDumpOptions{}
|
||||
return cli.Command{
|
||||
Name: "untrusted-signature-dump-without-verification",
|
||||
Usage: "Dump contents of a signature WITHOUT VERIFYING IT",
|
||||
ArgsUsage: "SIGNATURE",
|
||||
Hidden: true,
|
||||
Action: commandAction(opts.run),
|
||||
cmd := &cobra.Command{
|
||||
Use: "untrusted-signature-dump-without-verification SIGNATURE",
|
||||
Short: "Dump contents of a signature WITHOUT VERIFYING IT",
|
||||
RunE: commandAction(opts.run),
|
||||
Hidden: true,
|
||||
}
|
||||
adjustUsage(cmd)
|
||||
return cmd
|
||||
}
|
||||
|
||||
func (opts *untrustedSignatureDumpOptions) run(args []string, stdout io.Writer) error {
|
||||
|
||||
576
cmd/skopeo/sync.go
Normal file
576
cmd/skopeo/sync.go
Normal file
@@ -0,0 +1,576 @@
|
||||
package main
|
||||
|
||||
import (
|
||||
"context"
|
||||
"fmt"
|
||||
"io"
|
||||
"io/ioutil"
|
||||
"os"
|
||||
"path"
|
||||
"path/filepath"
|
||||
"regexp"
|
||||
"strings"
|
||||
|
||||
"github.com/containers/image/v5/copy"
|
||||
"github.com/containers/image/v5/directory"
|
||||
"github.com/containers/image/v5/docker"
|
||||
"github.com/containers/image/v5/docker/reference"
|
||||
"github.com/containers/image/v5/transports"
|
||||
"github.com/containers/image/v5/types"
|
||||
"github.com/pkg/errors"
|
||||
"github.com/sirupsen/logrus"
|
||||
"github.com/spf13/cobra"
|
||||
"gopkg.in/yaml.v2"
|
||||
)
|
||||
|
||||
// syncOptions contains information retrieved from the skopeo sync command line.
|
||||
type syncOptions struct {
|
||||
global *globalOptions // Global (not command dependant) skopeo options
|
||||
srcImage *imageOptions // Source image options
|
||||
destImage *imageDestOptions // Destination image options
|
||||
removeSignatures bool // Do not copy signatures from the source image
|
||||
signByFingerprint string // Sign the image using a GPG key with the specified fingerprint
|
||||
source string // Source repository name
|
||||
destination string // Destination registry name
|
||||
scoped bool // When true, namespace copied images at destination using the source repository name
|
||||
}
|
||||
|
||||
// repoDescriptor contains information of a single repository used as a sync source.
|
||||
type repoDescriptor struct {
|
||||
DirBasePath string // base path when source is 'dir'
|
||||
TaggedImages []types.ImageReference // List of tagged image found for the repository
|
||||
Context *types.SystemContext // SystemContext for the sync command
|
||||
}
|
||||
|
||||
// tlsVerify is an implementation of the Unmarshaler interface, used to
|
||||
// customize the unmarshaling behaviour of the tls-verify YAML key.
|
||||
type tlsVerifyConfig struct {
|
||||
skip types.OptionalBool // skip TLS verification check (false by default)
|
||||
}
|
||||
|
||||
// registrySyncConfig contains information about a single registry, read from
|
||||
// the source YAML file
|
||||
type registrySyncConfig struct {
|
||||
Images map[string][]string // Images map images name to slices with the images' tags
|
||||
ImagesByTagRegex map[string]string `yaml:"images-by-tag-regex"` // Images map images name to regular expression with the images' tags
|
||||
Credentials types.DockerAuthConfig // Username and password used to authenticate with the registry
|
||||
TLSVerify tlsVerifyConfig `yaml:"tls-verify"` // TLS verification mode (enabled by default)
|
||||
CertDir string `yaml:"cert-dir"` // Path to the TLS certificates of the registry
|
||||
}
|
||||
|
||||
// sourceConfig contains all registries information read from the source YAML file
|
||||
type sourceConfig map[string]registrySyncConfig
|
||||
|
||||
func syncCmd(global *globalOptions) *cobra.Command {
|
||||
sharedFlags, sharedOpts := sharedImageFlags()
|
||||
srcFlags, srcOpts := dockerImageFlags(global, sharedOpts, "src-", "screds")
|
||||
destFlags, destOpts := dockerImageFlags(global, sharedOpts, "dest-", "dcreds")
|
||||
|
||||
opts := syncOptions{
|
||||
global: global,
|
||||
srcImage: srcOpts,
|
||||
destImage: &imageDestOptions{imageOptions: destOpts},
|
||||
}
|
||||
|
||||
cmd := &cobra.Command{
|
||||
Use: "sync [command options] --src SOURCE-LOCATION --dest DESTINATION-LOCATION SOURCE DESTINATION",
|
||||
Short: "Synchronize one or more images from one location to another",
|
||||
Long: fmt.Sprint(`Copy all the images from a SOURCE to a DESTINATION.
|
||||
|
||||
Allowed SOURCE transports (specified with --src): docker, dir, yaml.
|
||||
Allowed DESTINATION transports (specified with --dest): docker, dir.
|
||||
|
||||
See skopeo-sync(1) for details.
|
||||
`),
|
||||
RunE: commandAction(opts.run),
|
||||
Example: `skopeo sync --src docker --dest dir --scoped registry.example.com/busybox /media/usb`,
|
||||
}
|
||||
adjustUsage(cmd)
|
||||
flags := cmd.Flags()
|
||||
flags.BoolVar(&opts.removeSignatures, "remove-signatures", false, "Do not copy signatures from SOURCE images")
|
||||
flags.StringVar(&opts.signByFingerprint, "sign-by", "", "Sign the image using a GPG key with the specified `FINGERPRINT`")
|
||||
flags.StringVarP(&opts.source, "src", "s", "", "SOURCE transport type")
|
||||
flags.StringVarP(&opts.destination, "dest", "d", "", "DESTINATION transport type")
|
||||
flags.BoolVar(&opts.scoped, "scoped", false, "Images at DESTINATION are prefix using the full source image path as scope")
|
||||
flags.AddFlagSet(&sharedFlags)
|
||||
flags.AddFlagSet(&srcFlags)
|
||||
flags.AddFlagSet(&destFlags)
|
||||
return cmd
|
||||
}
|
||||
|
||||
// unmarshalYAML is the implementation of the Unmarshaler interface method
|
||||
// method for the tlsVerifyConfig type.
|
||||
// It unmarshals the 'tls-verify' YAML key so that, when they key is not
|
||||
// specified, tls verification is enforced.
|
||||
func (tls *tlsVerifyConfig) UnmarshalYAML(unmarshal func(interface{}) error) error {
|
||||
var verify bool
|
||||
if err := unmarshal(&verify); err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
tls.skip = types.NewOptionalBool(!verify)
|
||||
return nil
|
||||
}
|
||||
|
||||
// newSourceConfig unmarshals the provided YAML file path to the sourceConfig type.
|
||||
// It returns a new unmarshaled sourceConfig object and any error encountered.
|
||||
func newSourceConfig(yamlFile string) (sourceConfig, error) {
|
||||
var cfg sourceConfig
|
||||
source, err := ioutil.ReadFile(yamlFile)
|
||||
if err != nil {
|
||||
return cfg, err
|
||||
}
|
||||
err = yaml.Unmarshal(source, &cfg)
|
||||
if err != nil {
|
||||
return cfg, errors.Wrapf(err, "Failed to unmarshal %q", yamlFile)
|
||||
}
|
||||
return cfg, nil
|
||||
}
|
||||
|
||||
// parseRepositoryReference parses input into a reference.Named, and verifies that it names a repository, not an image.
|
||||
func parseRepositoryReference(input string) (reference.Named, error) {
|
||||
ref, err := reference.ParseNormalizedNamed(input)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
if !reference.IsNameOnly(ref) {
|
||||
return nil, errors.Errorf("input names a reference, not a repository")
|
||||
}
|
||||
return ref, nil
|
||||
}
|
||||
|
||||
// destinationReference creates an image reference using the provided transport.
|
||||
// It returns a image reference to be used as destination of an image copy and
|
||||
// any error encountered.
|
||||
func destinationReference(destination string, transport string) (types.ImageReference, error) {
|
||||
var imageTransport types.ImageTransport
|
||||
|
||||
switch transport {
|
||||
case docker.Transport.Name():
|
||||
destination = fmt.Sprintf("//%s", destination)
|
||||
imageTransport = docker.Transport
|
||||
case directory.Transport.Name():
|
||||
_, err := os.Stat(destination)
|
||||
if err == nil {
|
||||
return nil, errors.Errorf("Refusing to overwrite destination directory %q", destination)
|
||||
}
|
||||
if !os.IsNotExist(err) {
|
||||
return nil, errors.Wrap(err, "Destination directory could not be used")
|
||||
}
|
||||
// the directory holding the image must be created here
|
||||
if err = os.MkdirAll(destination, 0755); err != nil {
|
||||
return nil, errors.Wrapf(err, "Error creating directory for image %s", destination)
|
||||
}
|
||||
imageTransport = directory.Transport
|
||||
default:
|
||||
return nil, errors.Errorf("%q is not a valid destination transport", transport)
|
||||
}
|
||||
logrus.Debugf("Destination for transport %q: %s", transport, destination)
|
||||
|
||||
destRef, err := imageTransport.ParseReference(destination)
|
||||
if err != nil {
|
||||
return nil, errors.Wrapf(err, "Cannot obtain a valid image reference for transport %q and reference %q", imageTransport.Name(), destination)
|
||||
}
|
||||
|
||||
return destRef, nil
|
||||
}
|
||||
|
||||
// getImageTags lists all tags in a repository.
|
||||
// It returns a string slice of tags and any error encountered.
|
||||
func getImageTags(ctx context.Context, sysCtx *types.SystemContext, repoRef reference.Named) ([]string, error) {
|
||||
name := repoRef.Name()
|
||||
logrus.WithFields(logrus.Fields{
|
||||
"image": name,
|
||||
}).Info("Getting tags")
|
||||
// Ugly: NewReference rejects IsNameOnly references, and GetRepositoryTags ignores the tag/digest.
|
||||
// So, we use TagNameOnly here only to shut up NewReference
|
||||
dockerRef, err := docker.NewReference(reference.TagNameOnly(repoRef))
|
||||
if err != nil {
|
||||
return nil, err // Should never happen for a reference with tag and no digest
|
||||
}
|
||||
tags, err := docker.GetRepositoryTags(ctx, sysCtx, dockerRef)
|
||||
|
||||
switch err := err.(type) {
|
||||
case nil:
|
||||
break
|
||||
case docker.ErrUnauthorizedForCredentials:
|
||||
// Some registries may decide to block the "list all tags" endpoint.
|
||||
// Gracefully allow the sync to continue in this case.
|
||||
logrus.Warnf("Registry disallows tag list retrieval: %s", err)
|
||||
break
|
||||
default:
|
||||
return tags, errors.Wrapf(err, "Error determining repository tags for image %s", name)
|
||||
}
|
||||
|
||||
return tags, nil
|
||||
}
|
||||
|
||||
// imagesToCopyFromRepo builds a list of image references from the tags
|
||||
// found in a source repository.
|
||||
// It returns an image reference slice with as many elements as the tags found
|
||||
// and any error encountered.
|
||||
func imagesToCopyFromRepo(sys *types.SystemContext, repoRef reference.Named) ([]types.ImageReference, error) {
|
||||
tags, err := getImageTags(context.Background(), sys, repoRef)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
var sourceReferences []types.ImageReference
|
||||
for _, tag := range tags {
|
||||
taggedRef, err := reference.WithTag(repoRef, tag)
|
||||
if err != nil {
|
||||
return nil, errors.Wrapf(err, "Error creating a reference for repository %s and tag %q", repoRef.Name(), tag)
|
||||
}
|
||||
ref, err := docker.NewReference(taggedRef)
|
||||
if err != nil {
|
||||
return nil, errors.Wrapf(err, "Cannot obtain a valid image reference for transport %q and reference %s", docker.Transport.Name(), taggedRef.String())
|
||||
}
|
||||
sourceReferences = append(sourceReferences, ref)
|
||||
}
|
||||
return sourceReferences, nil
|
||||
}
|
||||
|
||||
// imagesTopCopyFromDir builds a list of image references from the images found
|
||||
// in the source directory.
|
||||
// It returns an image reference slice with as many elements as the images found
|
||||
// and any error encountered.
|
||||
func imagesToCopyFromDir(dirPath string) ([]types.ImageReference, error) {
|
||||
var sourceReferences []types.ImageReference
|
||||
err := filepath.Walk(dirPath, func(path string, info os.FileInfo, err error) error {
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
if !info.IsDir() && info.Name() == "manifest.json" {
|
||||
dirname := filepath.Dir(path)
|
||||
ref, err := directory.Transport.ParseReference(dirname)
|
||||
if err != nil {
|
||||
return errors.Wrapf(err, "Cannot obtain a valid image reference for transport %q and reference %q", directory.Transport.Name(), dirname)
|
||||
}
|
||||
sourceReferences = append(sourceReferences, ref)
|
||||
return filepath.SkipDir
|
||||
}
|
||||
return nil
|
||||
})
|
||||
|
||||
if err != nil {
|
||||
return sourceReferences,
|
||||
errors.Wrapf(err, "Error walking the path %q", dirPath)
|
||||
}
|
||||
|
||||
return sourceReferences, nil
|
||||
}
|
||||
|
||||
// imagesTopCopyFromDir builds a list of repository descriptors from the images
|
||||
// in a registry configuration.
|
||||
// It returns a repository descriptors slice with as many elements as the images
|
||||
// found and any error encountered. Each element of the slice is a list of
|
||||
// tagged image references, to be used as sync source.
|
||||
func imagesToCopyFromRegistry(registryName string, cfg registrySyncConfig, sourceCtx types.SystemContext) ([]repoDescriptor, error) {
|
||||
serverCtx := &sourceCtx
|
||||
// override ctx with per-registryName options
|
||||
serverCtx.DockerCertPath = cfg.CertDir
|
||||
serverCtx.DockerDaemonCertPath = cfg.CertDir
|
||||
serverCtx.DockerDaemonInsecureSkipTLSVerify = (cfg.TLSVerify.skip == types.OptionalBoolTrue)
|
||||
serverCtx.DockerInsecureSkipTLSVerify = cfg.TLSVerify.skip
|
||||
serverCtx.DockerAuthConfig = &cfg.Credentials
|
||||
|
||||
var repoDescList []repoDescriptor
|
||||
for imageName, tags := range cfg.Images {
|
||||
repoLogger := logrus.WithFields(logrus.Fields{
|
||||
"repo": imageName,
|
||||
"registry": registryName,
|
||||
})
|
||||
repoRef, err := parseRepositoryReference(fmt.Sprintf("%s/%s", registryName, imageName))
|
||||
if err != nil {
|
||||
repoLogger.Error("Error parsing repository name, skipping")
|
||||
logrus.Error(err)
|
||||
continue
|
||||
}
|
||||
|
||||
repoLogger.Info("Processing repo")
|
||||
|
||||
var sourceReferences []types.ImageReference
|
||||
if len(tags) != 0 {
|
||||
for _, tag := range tags {
|
||||
tagLogger := logrus.WithFields(logrus.Fields{"tag": tag})
|
||||
taggedRef, err := reference.WithTag(repoRef, tag)
|
||||
if err != nil {
|
||||
tagLogger.Error("Error parsing tag, skipping")
|
||||
logrus.Error(err)
|
||||
continue
|
||||
}
|
||||
imageRef, err := docker.NewReference(taggedRef)
|
||||
if err != nil {
|
||||
tagLogger.Error("Error processing tag, skipping")
|
||||
logrus.Errorf("Error getting image reference: %s", err)
|
||||
continue
|
||||
}
|
||||
sourceReferences = append(sourceReferences, imageRef)
|
||||
}
|
||||
} else { // len(tags) == 0
|
||||
repoLogger.Info("Querying registry for image tags")
|
||||
sourceReferences, err = imagesToCopyFromRepo(serverCtx, repoRef)
|
||||
if err != nil {
|
||||
repoLogger.Error("Error processing repo, skipping")
|
||||
logrus.Error(err)
|
||||
continue
|
||||
}
|
||||
}
|
||||
|
||||
if len(sourceReferences) == 0 {
|
||||
repoLogger.Warnf("No tags to sync found")
|
||||
continue
|
||||
}
|
||||
repoDescList = append(repoDescList, repoDescriptor{
|
||||
TaggedImages: sourceReferences,
|
||||
Context: serverCtx})
|
||||
}
|
||||
|
||||
for imageName, tagRegex := range cfg.ImagesByTagRegex {
|
||||
repoLogger := logrus.WithFields(logrus.Fields{
|
||||
"repo": imageName,
|
||||
"registry": registryName,
|
||||
})
|
||||
repoRef, err := parseRepositoryReference(fmt.Sprintf("%s/%s", registryName, imageName))
|
||||
if err != nil {
|
||||
repoLogger.Error("Error parsing repository name, skipping")
|
||||
logrus.Error(err)
|
||||
continue
|
||||
}
|
||||
|
||||
repoLogger.Info("Processing repo")
|
||||
|
||||
var sourceReferences []types.ImageReference
|
||||
|
||||
tagReg, err := regexp.Compile(tagRegex)
|
||||
if err != nil {
|
||||
repoLogger.WithFields(logrus.Fields{
|
||||
"regex": tagRegex,
|
||||
}).Error("Error parsing regex, skipping")
|
||||
logrus.Error(err)
|
||||
continue
|
||||
}
|
||||
|
||||
repoLogger.Info("Querying registry for image tags")
|
||||
allSourceReferences, err := imagesToCopyFromRepo(serverCtx, repoRef)
|
||||
if err != nil {
|
||||
repoLogger.Error("Error processing repo, skipping")
|
||||
logrus.Error(err)
|
||||
continue
|
||||
}
|
||||
|
||||
repoLogger.Infof("Start filtering using the regular expression: %v", tagRegex)
|
||||
for _, sReference := range allSourceReferences {
|
||||
tagged, isTagged := sReference.DockerReference().(reference.Tagged)
|
||||
if !isTagged {
|
||||
repoLogger.Errorf("Internal error, reference %s does not have a tag, skipping", sReference.DockerReference())
|
||||
continue
|
||||
}
|
||||
if tagReg.MatchString(tagged.Tag()) {
|
||||
sourceReferences = append(sourceReferences, sReference)
|
||||
}
|
||||
}
|
||||
|
||||
if len(sourceReferences) == 0 {
|
||||
repoLogger.Warnf("No tags to sync found")
|
||||
continue
|
||||
}
|
||||
repoDescList = append(repoDescList, repoDescriptor{
|
||||
TaggedImages: sourceReferences,
|
||||
Context: serverCtx})
|
||||
}
|
||||
|
||||
return repoDescList, nil
|
||||
}
|
||||
|
||||
// imagesToCopy retrieves all the images to copy from a specified sync source
|
||||
// and transport.
|
||||
// It returns a slice of repository descriptors, where each descriptor is a
|
||||
// list of tagged image references to be used as sync source, and any error
|
||||
// encountered.
|
||||
func imagesToCopy(source string, transport string, sourceCtx *types.SystemContext) ([]repoDescriptor, error) {
|
||||
var descriptors []repoDescriptor
|
||||
|
||||
switch transport {
|
||||
case docker.Transport.Name():
|
||||
desc := repoDescriptor{
|
||||
Context: sourceCtx,
|
||||
}
|
||||
named, err := reference.ParseNormalizedNamed(source) // May be a repository or an image.
|
||||
if err != nil {
|
||||
return nil, errors.Wrapf(err, "Cannot obtain a valid image reference for transport %q and reference %q", docker.Transport.Name(), source)
|
||||
}
|
||||
imageTagged := !reference.IsNameOnly(named)
|
||||
logrus.WithFields(logrus.Fields{
|
||||
"imagename": source,
|
||||
"tagged": imageTagged,
|
||||
}).Info("Tag presence check")
|
||||
if imageTagged {
|
||||
srcRef, err := docker.NewReference(named)
|
||||
if err != nil {
|
||||
return nil, errors.Wrapf(err, "Cannot obtain a valid image reference for transport %q and reference %q", docker.Transport.Name(), named.String())
|
||||
}
|
||||
desc.TaggedImages = []types.ImageReference{srcRef}
|
||||
} else {
|
||||
desc.TaggedImages, err = imagesToCopyFromRepo(sourceCtx, named)
|
||||
if err != nil {
|
||||
return descriptors, err
|
||||
}
|
||||
if len(desc.TaggedImages) == 0 {
|
||||
return descriptors, errors.Errorf("No images to sync found in %q", source)
|
||||
}
|
||||
}
|
||||
descriptors = append(descriptors, desc)
|
||||
|
||||
case directory.Transport.Name():
|
||||
desc := repoDescriptor{
|
||||
Context: sourceCtx,
|
||||
}
|
||||
|
||||
if _, err := os.Stat(source); err != nil {
|
||||
return descriptors, errors.Wrap(err, "Invalid source directory specified")
|
||||
}
|
||||
desc.DirBasePath = source
|
||||
var err error
|
||||
desc.TaggedImages, err = imagesToCopyFromDir(source)
|
||||
if err != nil {
|
||||
return descriptors, err
|
||||
}
|
||||
if len(desc.TaggedImages) == 0 {
|
||||
return descriptors, errors.Errorf("No images to sync found in %q", source)
|
||||
}
|
||||
descriptors = append(descriptors, desc)
|
||||
|
||||
case "yaml":
|
||||
cfg, err := newSourceConfig(source)
|
||||
if err != nil {
|
||||
return descriptors, err
|
||||
}
|
||||
for registryName, registryConfig := range cfg {
|
||||
if len(registryConfig.Images) == 0 && len(registryConfig.ImagesByTagRegex) == 0 {
|
||||
logrus.WithFields(logrus.Fields{
|
||||
"registry": registryName,
|
||||
}).Warn("No images specified for registry")
|
||||
continue
|
||||
}
|
||||
|
||||
descs, err := imagesToCopyFromRegistry(registryName, registryConfig, *sourceCtx)
|
||||
if err != nil {
|
||||
return descriptors, errors.Wrapf(err, "Failed to retrieve list of images from registry %q", registryName)
|
||||
}
|
||||
descriptors = append(descriptors, descs...)
|
||||
}
|
||||
}
|
||||
|
||||
return descriptors, nil
|
||||
}
|
||||
|
||||
func (opts *syncOptions) run(args []string, stdout io.Writer) error {
|
||||
if len(args) != 2 {
|
||||
return errorShouldDisplayUsage{errors.New("Exactly two arguments expected")}
|
||||
}
|
||||
|
||||
policyContext, err := opts.global.getPolicyContext()
|
||||
if err != nil {
|
||||
return errors.Wrapf(err, "Error loading trust policy")
|
||||
}
|
||||
defer policyContext.Destroy()
|
||||
|
||||
// validate source and destination options
|
||||
contains := func(val string, list []string) (_ bool) {
|
||||
for _, l := range list {
|
||||
if l == val {
|
||||
return true
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
if len(opts.source) == 0 {
|
||||
return errors.New("A source transport must be specified")
|
||||
}
|
||||
if !contains(opts.source, []string{docker.Transport.Name(), directory.Transport.Name(), "yaml"}) {
|
||||
return errors.Errorf("%q is not a valid source transport", opts.source)
|
||||
}
|
||||
|
||||
if len(opts.destination) == 0 {
|
||||
return errors.New("A destination transport must be specified")
|
||||
}
|
||||
if !contains(opts.destination, []string{docker.Transport.Name(), directory.Transport.Name()}) {
|
||||
return errors.Errorf("%q is not a valid destination transport", opts.destination)
|
||||
}
|
||||
|
||||
if opts.source == opts.destination && opts.source == directory.Transport.Name() {
|
||||
return errors.New("sync from 'dir' to 'dir' not implemented, consider using rsync instead")
|
||||
}
|
||||
|
||||
sourceCtx, err := opts.srcImage.newSystemContext()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
sourceArg := args[0]
|
||||
srcRepoList, err := imagesToCopy(sourceArg, opts.source, sourceCtx)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
destination := args[1]
|
||||
destinationCtx, err := opts.destImage.newSystemContext()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
ctx, cancel := opts.global.commandTimeoutContext()
|
||||
defer cancel()
|
||||
|
||||
imagesNumber := 0
|
||||
options := copy.Options{
|
||||
RemoveSignatures: opts.removeSignatures,
|
||||
SignBy: opts.signByFingerprint,
|
||||
ReportWriter: os.Stdout,
|
||||
DestinationCtx: destinationCtx,
|
||||
}
|
||||
|
||||
for _, srcRepo := range srcRepoList {
|
||||
options.SourceCtx = srcRepo.Context
|
||||
for counter, ref := range srcRepo.TaggedImages {
|
||||
var destSuffix string
|
||||
switch ref.Transport() {
|
||||
case docker.Transport:
|
||||
// docker -> dir or docker -> docker
|
||||
destSuffix = ref.DockerReference().String()
|
||||
case directory.Transport:
|
||||
// dir -> docker (we don't allow `dir` -> `dir` sync operations)
|
||||
destSuffix = strings.TrimPrefix(ref.StringWithinTransport(), srcRepo.DirBasePath)
|
||||
if destSuffix == "" {
|
||||
// if source is a full path to an image, have destPath scoped to repo:tag
|
||||
destSuffix = path.Base(srcRepo.DirBasePath)
|
||||
}
|
||||
}
|
||||
|
||||
if !opts.scoped {
|
||||
destSuffix = path.Base(destSuffix)
|
||||
}
|
||||
|
||||
destRef, err := destinationReference(path.Join(destination, destSuffix), opts.destination)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
logrus.WithFields(logrus.Fields{
|
||||
"from": transports.ImageName(ref),
|
||||
"to": transports.ImageName(destRef),
|
||||
}).Infof("Copying image tag %d/%d", counter+1, len(srcRepo.TaggedImages))
|
||||
|
||||
_, err = copy.Image(ctx, policyContext, destRef, ref, &options)
|
||||
if err != nil {
|
||||
return errors.Wrapf(err, "Error copying tag %q", transports.ImageName(ref))
|
||||
}
|
||||
imagesNumber++
|
||||
}
|
||||
}
|
||||
|
||||
logrus.Infof("Synced %d images from %d sources", imagesNumber, len(srcRepoList))
|
||||
return nil
|
||||
}
|
||||
@@ -1,9 +1,8 @@
|
||||
package main
|
||||
|
||||
import (
|
||||
"github.com/containers/buildah/pkg/unshare"
|
||||
"github.com/containers/image/v5/storage"
|
||||
"github.com/containers/image/v5/transports/alltransports"
|
||||
"github.com/containers/storage/pkg/unshare"
|
||||
"github.com/pkg/errors"
|
||||
"github.com/syndtr/gocapability/capability"
|
||||
)
|
||||
@@ -36,10 +35,12 @@ func maybeReexec() error {
|
||||
}
|
||||
|
||||
func reexecIfNecessaryForImages(imageNames ...string) error {
|
||||
// Check if container-storage are used before doing unshare
|
||||
// Check if container-storage is used before doing unshare
|
||||
for _, imageName := range imageNames {
|
||||
transport := alltransports.TransportFromImageName(imageName)
|
||||
if transport != nil && transport.Name() == storage.Transport.Name() {
|
||||
// Hard-code the storage name to avoid a reference on c/image/storage.
|
||||
// See https://github.com/containers/skopeo/issues/771#issuecomment-563125006.
|
||||
if transport != nil && transport.Name() == "containers-storage" {
|
||||
return maybeReexec()
|
||||
}
|
||||
}
|
||||
|
||||
@@ -2,14 +2,16 @@ package main
|
||||
|
||||
import (
|
||||
"context"
|
||||
"errors"
|
||||
"io"
|
||||
"os"
|
||||
"strings"
|
||||
|
||||
"github.com/containers/image/v5/pkg/compression"
|
||||
"github.com/containers/image/v5/transports/alltransports"
|
||||
"github.com/containers/image/v5/types"
|
||||
"github.com/urfave/cli"
|
||||
"github.com/pkg/errors"
|
||||
"github.com/spf13/cobra"
|
||||
"github.com/spf13/pflag"
|
||||
)
|
||||
|
||||
// errorShouldDisplayUsage is a subtype of error used by command handlers to indicate that cli.ShowSubcommandHelp should be called.
|
||||
@@ -17,16 +19,16 @@ type errorShouldDisplayUsage struct {
|
||||
error
|
||||
}
|
||||
|
||||
// commandAction intermediates between the cli.ActionFunc interface and the real handler,
|
||||
// primarily to ensure that cli.Context is not available to the handler, which in turn
|
||||
// makes sure that the cli.String() etc. flag access functions are not used,
|
||||
// and everything is done using the *Options structures and the Destination: members of cli.Flag.
|
||||
// handler may return errorShouldDisplayUsage to cause cli.ShowSubcommandHelp to be called.
|
||||
func commandAction(handler func(args []string, stdout io.Writer) error) cli.ActionFunc {
|
||||
return func(c *cli.Context) error {
|
||||
err := handler(([]string)(c.Args()), c.App.Writer)
|
||||
// commandAction intermediates between the RunE interface and the real handler,
|
||||
// primarily to ensure that cobra.Command is not available to the handler, which in turn
|
||||
// makes sure that the cmd.Flags() etc. flag access functions are not used,
|
||||
// and everything is done using the *Options structures and the *Var() methods of cmd.Flag().
|
||||
// handler may return errorShouldDisplayUsage to cause c.Help to be called.
|
||||
func commandAction(handler func(args []string, stdout io.Writer) error) func(cmd *cobra.Command, args []string) error {
|
||||
return func(c *cobra.Command, args []string) error {
|
||||
err := handler(args, c.OutOrStdout())
|
||||
if _, ok := err.(errorShouldDisplayUsage); ok {
|
||||
cli.ShowSubcommandHelp(c)
|
||||
c.Help()
|
||||
}
|
||||
return err
|
||||
}
|
||||
@@ -38,100 +40,91 @@ type sharedImageOptions struct {
|
||||
authFilePath string // Path to a */containers/auth.json
|
||||
}
|
||||
|
||||
// imageFlags prepares a collection of CLI flags writing into sharedImageOptions, and the managed sharedImageOptions structure.
|
||||
func sharedImageFlags() ([]cli.Flag, *sharedImageOptions) {
|
||||
// sharedImageFlags prepares a collection of CLI flags writing into sharedImageOptions, and the managed sharedImageOptions structure.
|
||||
func sharedImageFlags() (pflag.FlagSet, *sharedImageOptions) {
|
||||
opts := sharedImageOptions{}
|
||||
return []cli.Flag{
|
||||
cli.StringFlag{
|
||||
Name: "authfile",
|
||||
Usage: "path of the authentication file. Default is ${XDG_RUNTIME_DIR}/containers/auth.json",
|
||||
Destination: &opts.authFilePath,
|
||||
},
|
||||
}, &opts
|
||||
fs := pflag.FlagSet{}
|
||||
fs.StringVar(&opts.authFilePath, "authfile", os.Getenv("REGISTRY_AUTH_FILE"), "path of the authentication file. Default is ${XDG_RUNTIME_DIR}/containers/auth.json")
|
||||
return fs, &opts
|
||||
}
|
||||
|
||||
// dockerImageOptions collects CLI flags specific to the "docker" transport, which are
|
||||
// the same across subcommands, but may be different for each image
|
||||
// (e.g. may differ between the source and destination of a copy)
|
||||
type dockerImageOptions struct {
|
||||
global *globalOptions // May be shared across several imageOptions instances.
|
||||
shared *sharedImageOptions // May be shared across several imageOptions instances.
|
||||
authFilePath optionalString // Path to a */containers/auth.json (prefixed version to override shared image option).
|
||||
credsOption optionalString // username[:password] for accessing a registry
|
||||
dockerCertPath string // A directory using Docker-like *.{crt,cert,key} files for connecting to a registry or a daemon
|
||||
tlsVerify optionalBool // Require HTTPS and verify certificates (for docker: and docker-daemon:)
|
||||
noCreds bool // Access the registry anonymously
|
||||
}
|
||||
|
||||
// imageOptions collects CLI flags which are the same across subcommands, but may be different for each image
|
||||
// (e.g. may differ between the source and destination of a copy)
|
||||
type imageOptions struct {
|
||||
global *globalOptions // May be shared across several imageOptions instances.
|
||||
shared *sharedImageOptions // May be shared across several imageOptions instances.
|
||||
credsOption optionalString // username[:password] for accessing a registry
|
||||
dockerCertPath string // A directory using Docker-like *.{crt,cert,key} files for connecting to a registry or a daemon
|
||||
tlsVerify optionalBool // Require HTTPS and verify certificates (for docker: and docker-daemon:)
|
||||
sharedBlobDir string // A directory to use for OCI blobs, shared across repositories
|
||||
dockerDaemonHost string // docker-daemon: host to connect to
|
||||
noCreds bool // Access the registry anonymously
|
||||
dockerImageOptions
|
||||
sharedBlobDir string // A directory to use for OCI blobs, shared across repositories
|
||||
dockerDaemonHost string // docker-daemon: host to connect to
|
||||
}
|
||||
|
||||
// dockerImageFlags prepares a collection of docker-transport specific CLI flags
|
||||
// writing into imageOptions, and the managed imageOptions structure.
|
||||
func dockerImageFlags(global *globalOptions, shared *sharedImageOptions, flagPrefix, credsOptionAlias string) (pflag.FlagSet, *imageOptions) {
|
||||
flags := imageOptions{
|
||||
dockerImageOptions: dockerImageOptions{
|
||||
global: global,
|
||||
shared: shared,
|
||||
},
|
||||
}
|
||||
|
||||
fs := pflag.FlagSet{}
|
||||
if flagPrefix != "" {
|
||||
// the non-prefixed flag is handled by a shared flag.
|
||||
fs.Var(newOptionalStringValue(&flags.authFilePath), flagPrefix+"authfile", "path of the authentication file. Default is ${XDG_RUNTIME_DIR}/containers/auth.json")
|
||||
}
|
||||
fs.Var(newOptionalStringValue(&flags.credsOption), flagPrefix+"creds", "Use `USERNAME[:PASSWORD]` for accessing the registry")
|
||||
if credsOptionAlias != "" {
|
||||
// This is horribly ugly, but we need to support the old option forms of (skopeo copy) for compatibility.
|
||||
// Don't add any more cases like this.
|
||||
f := fs.VarPF(newOptionalStringValue(&flags.credsOption), credsOptionAlias, "", "Use `USERNAME[:PASSWORD]` for accessing the registry")
|
||||
f.Hidden = true
|
||||
}
|
||||
fs.StringVar(&flags.dockerCertPath, flagPrefix+"cert-dir", "", "use certificates at `PATH` (*.crt, *.cert, *.key) to connect to the registry or daemon")
|
||||
optionalBoolFlag(&fs, &flags.tlsVerify, flagPrefix+"tls-verify", "require HTTPS and verify certificates when talking to the container registry or daemon (defaults to true)")
|
||||
fs.BoolVar(&flags.noCreds, flagPrefix+"no-creds", false, "Access the registry anonymously")
|
||||
return fs, &flags
|
||||
}
|
||||
|
||||
// imageFlags prepares a collection of CLI flags writing into imageOptions, and the managed imageOptions structure.
|
||||
func imageFlags(global *globalOptions, shared *sharedImageOptions, flagPrefix, credsOptionAlias string) ([]cli.Flag, *imageOptions) {
|
||||
opts := imageOptions{
|
||||
global: global,
|
||||
shared: shared,
|
||||
}
|
||||
func imageFlags(global *globalOptions, shared *sharedImageOptions, flagPrefix, credsOptionAlias string) (pflag.FlagSet, *imageOptions) {
|
||||
dockerFlags, opts := dockerImageFlags(global, shared, flagPrefix, credsOptionAlias)
|
||||
|
||||
// This is horribly ugly, but we need to support the old option forms of (skopeo copy) for compatibility.
|
||||
// Don't add any more cases like this.
|
||||
credsOptionExtra := ""
|
||||
if credsOptionAlias != "" {
|
||||
credsOptionExtra += "," + credsOptionAlias
|
||||
}
|
||||
|
||||
return []cli.Flag{
|
||||
cli.GenericFlag{
|
||||
Name: flagPrefix + "creds" + credsOptionExtra,
|
||||
Usage: "Use `USERNAME[:PASSWORD]` for accessing the registry",
|
||||
Value: newOptionalStringValue(&opts.credsOption),
|
||||
},
|
||||
cli.StringFlag{
|
||||
Name: flagPrefix + "cert-dir",
|
||||
Usage: "use certificates at `PATH` (*.crt, *.cert, *.key) to connect to the registry or daemon",
|
||||
Destination: &opts.dockerCertPath,
|
||||
},
|
||||
cli.GenericFlag{
|
||||
Name: flagPrefix + "tls-verify",
|
||||
Usage: "require HTTPS and verify certificates when talking to the container registry or daemon (defaults to true)",
|
||||
Value: newOptionalBoolValue(&opts.tlsVerify),
|
||||
},
|
||||
cli.StringFlag{
|
||||
Name: flagPrefix + "shared-blob-dir",
|
||||
Usage: "`DIRECTORY` to use to share blobs across OCI repositories",
|
||||
Destination: &opts.sharedBlobDir,
|
||||
},
|
||||
cli.StringFlag{
|
||||
Name: flagPrefix + "daemon-host",
|
||||
Usage: "use docker daemon host at `HOST` (docker-daemon: only)",
|
||||
Destination: &opts.dockerDaemonHost,
|
||||
},
|
||||
cli.BoolFlag{
|
||||
Name: flagPrefix + "no-creds",
|
||||
Usage: "Access the registry anonymously",
|
||||
Destination: &opts.noCreds,
|
||||
},
|
||||
}, &opts
|
||||
fs := pflag.FlagSet{}
|
||||
fs.StringVar(&opts.sharedBlobDir, flagPrefix+"shared-blob-dir", "", "`DIRECTORY` to use to share blobs across OCI repositories")
|
||||
fs.StringVar(&opts.dockerDaemonHost, flagPrefix+"daemon-host", "", "use docker daemon host at `HOST` (docker-daemon: only)")
|
||||
fs.AddFlagSet(&dockerFlags)
|
||||
return fs, opts
|
||||
}
|
||||
|
||||
// newSystemContext returns a *types.SystemContext corresponding to opts.
|
||||
// It is guaranteed to return a fresh instance, so it is safe to make additional updates to it.
|
||||
func (opts *imageOptions) newSystemContext() (*types.SystemContext, error) {
|
||||
ctx := &types.SystemContext{
|
||||
RegistriesDirPath: opts.global.registriesDirPath,
|
||||
ArchitectureChoice: opts.global.overrideArch,
|
||||
OSChoice: opts.global.overrideOS,
|
||||
DockerCertPath: opts.dockerCertPath,
|
||||
OCISharedBlobDirPath: opts.sharedBlobDir,
|
||||
AuthFilePath: opts.shared.authFilePath,
|
||||
DockerDaemonHost: opts.dockerDaemonHost,
|
||||
DockerDaemonCertPath: opts.dockerCertPath,
|
||||
SystemRegistriesConfPath: opts.global.registriesConfPath,
|
||||
// *types.SystemContext instance from globalOptions
|
||||
// imageOptions option overrides the instance if both are present.
|
||||
ctx := opts.global.newSystemContext()
|
||||
ctx.DockerCertPath = opts.dockerCertPath
|
||||
ctx.OCISharedBlobDirPath = opts.sharedBlobDir
|
||||
ctx.AuthFilePath = opts.shared.authFilePath
|
||||
ctx.DockerDaemonHost = opts.dockerDaemonHost
|
||||
ctx.DockerDaemonCertPath = opts.dockerCertPath
|
||||
if opts.dockerImageOptions.authFilePath.present {
|
||||
ctx.AuthFilePath = opts.dockerImageOptions.authFilePath.value
|
||||
}
|
||||
if opts.tlsVerify.present {
|
||||
ctx.DockerDaemonInsecureSkipTLSVerify = !opts.tlsVerify.value
|
||||
}
|
||||
// DEPRECATED: We support this for backward compatibility, but override it if a per-image flag is provided.
|
||||
if opts.global.tlsVerify.present {
|
||||
ctx.DockerInsecureSkipTLSVerify = types.NewOptionalBool(!opts.global.tlsVerify.value)
|
||||
}
|
||||
if opts.tlsVerify.present {
|
||||
ctx.DockerInsecureSkipTLSVerify = types.NewOptionalBool(!opts.tlsVerify.value)
|
||||
}
|
||||
@@ -155,7 +148,6 @@ func (opts *imageOptions) newSystemContext() (*types.SystemContext, error) {
|
||||
// imageDestOptions is a superset of imageOptions specialized for iamge destinations.
|
||||
type imageDestOptions struct {
|
||||
*imageOptions
|
||||
osTreeTmpDir string // A directory to use for OSTree temporary files
|
||||
dirForceCompression bool // Compress layers when saving to the dir: transport
|
||||
ociAcceptUncompressedLayers bool // Whether to accept uncompressed layers in the oci: transport
|
||||
compressionFormat string // Format to use for the compression
|
||||
@@ -163,37 +155,16 @@ type imageDestOptions struct {
|
||||
}
|
||||
|
||||
// imageDestFlags prepares a collection of CLI flags writing into imageDestOptions, and the managed imageDestOptions structure.
|
||||
func imageDestFlags(global *globalOptions, shared *sharedImageOptions, flagPrefix, credsOptionAlias string) ([]cli.Flag, *imageDestOptions) {
|
||||
func imageDestFlags(global *globalOptions, shared *sharedImageOptions, flagPrefix, credsOptionAlias string) (pflag.FlagSet, *imageDestOptions) {
|
||||
genericFlags, genericOptions := imageFlags(global, shared, flagPrefix, credsOptionAlias)
|
||||
opts := imageDestOptions{imageOptions: genericOptions}
|
||||
|
||||
return append(genericFlags, []cli.Flag{
|
||||
cli.StringFlag{
|
||||
Name: flagPrefix + "ostree-tmp-dir",
|
||||
Usage: "`DIRECTORY` to use for OSTree temporary files",
|
||||
Destination: &opts.osTreeTmpDir,
|
||||
},
|
||||
cli.BoolFlag{
|
||||
Name: flagPrefix + "compress",
|
||||
Usage: "Compress tarball image layers when saving to directory using the 'dir' transport. (default is same compression type as source)",
|
||||
Destination: &opts.dirForceCompression,
|
||||
},
|
||||
cli.BoolFlag{
|
||||
Name: flagPrefix + "oci-accept-uncompressed-layers",
|
||||
Usage: "Allow uncompressed image layers when saving to an OCI image using the 'oci' transport. (default is to compress things that aren't compressed)",
|
||||
Destination: &opts.ociAcceptUncompressedLayers,
|
||||
},
|
||||
cli.StringFlag{
|
||||
Name: flagPrefix + "compress-format",
|
||||
Usage: "`FORMAT` to use for the compression",
|
||||
Destination: &opts.compressionFormat,
|
||||
},
|
||||
cli.GenericFlag{
|
||||
Name: flagPrefix + "compress-level",
|
||||
Usage: "`LEVEL` to use for the compression",
|
||||
Value: newOptionalIntValue(&opts.compressionLevel),
|
||||
},
|
||||
}...), &opts
|
||||
fs := pflag.FlagSet{}
|
||||
fs.AddFlagSet(&genericFlags)
|
||||
fs.BoolVar(&opts.dirForceCompression, flagPrefix+"compress", false, "Compress tarball image layers when saving to directory using the 'dir' transport. (default is same compression type as source)")
|
||||
fs.BoolVar(&opts.ociAcceptUncompressedLayers, flagPrefix+"oci-accept-uncompressed-layers", false, "Allow uncompressed image layers when saving to an OCI image using the 'oci' transport. (default is to compress things that aren't compressed)")
|
||||
fs.StringVar(&opts.compressionFormat, flagPrefix+"compress-format", "", "`FORMAT` to use for the compression")
|
||||
fs.Var(newOptionalIntValue(&opts.compressionLevel), flagPrefix+"compress-level", "`LEVEL` to use for the compression")
|
||||
return fs, &opts
|
||||
}
|
||||
|
||||
// newSystemContext returns a *types.SystemContext corresponding to opts.
|
||||
@@ -204,7 +175,6 @@ func (opts *imageDestOptions) newSystemContext() (*types.SystemContext, error) {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
ctx.OSTreeTmpDirPath = opts.osTreeTmpDir
|
||||
ctx.DirForceCompress = opts.dirForceCompression
|
||||
ctx.OCIAcceptUncompressedLayers = opts.ociAcceptUncompressedLayers
|
||||
if opts.compressionFormat != "" {
|
||||
@@ -245,20 +215,6 @@ func getDockerAuth(creds string) (*types.DockerAuthConfig, error) {
|
||||
}, nil
|
||||
}
|
||||
|
||||
// parseImage converts image URL-like string to an initialized handler for that image.
|
||||
// The caller must call .Close() on the returned ImageCloser.
|
||||
func parseImage(ctx context.Context, opts *imageOptions, name string) (types.ImageCloser, error) {
|
||||
ref, err := alltransports.ParseImageName(name)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
sys, err := opts.newSystemContext()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return ref.NewImage(ctx, sys)
|
||||
}
|
||||
|
||||
// parseImageSource converts image URL-like string to an ImageSource.
|
||||
// The caller must call .Close() on the returned ImageSource.
|
||||
func parseImageSource(ctx context.Context, opts *imageOptions, name string) (types.ImageSource, error) {
|
||||
@@ -272,3 +228,32 @@ func parseImageSource(ctx context.Context, opts *imageOptions, name string) (typ
|
||||
}
|
||||
return ref.NewImageSource(ctx, sys)
|
||||
}
|
||||
|
||||
// usageTemplate returns the usage template for skopeo commands
|
||||
// This blocks the displaying of the global options. The main skopeo
|
||||
// command should not use this.
|
||||
const usageTemplate = `Usage:{{if .Runnable}}
|
||||
{{.UseLine}}{{end}}{{if .HasAvailableSubCommands}}
|
||||
|
||||
{{.CommandPath}} [command]{{end}}{{if gt (len .Aliases) 0}}
|
||||
|
||||
Aliases:
|
||||
{{.NameAndAliases}}{{end}}{{if .HasExample}}
|
||||
|
||||
Examples:
|
||||
{{.Example}}{{end}}{{if .HasAvailableSubCommands}}
|
||||
|
||||
Available Commands:{{range .Commands}}{{if (or .IsAvailableCommand (eq .Name "help"))}}
|
||||
{{rpad .Name .NamePadding }} {{.Short}}{{end}}{{end}}{{end}}{{if .HasAvailableLocalFlags}}
|
||||
|
||||
Flags:
|
||||
{{.LocalFlags.FlagUsages | trimTrailingWhitespaces}}{{end}}{{if .HasAvailableInheritedFlags}}
|
||||
{{end}}
|
||||
`
|
||||
|
||||
// adjustUsage uses usageTemplate template to get rid the GlobalOption from usage
|
||||
// and disable [flag] at the end of command usage
|
||||
func adjustUsage(c *cobra.Command) {
|
||||
c.SetUsageTemplate(usageTemplate)
|
||||
c.DisableFlagsInUseLine = true
|
||||
}
|
||||
|
||||
@@ -1,41 +1,33 @@
|
||||
package main
|
||||
|
||||
import (
|
||||
"flag"
|
||||
"os"
|
||||
"testing"
|
||||
|
||||
"github.com/containers/image/v5/types"
|
||||
"github.com/spf13/cobra"
|
||||
"github.com/stretchr/testify/assert"
|
||||
"github.com/stretchr/testify/require"
|
||||
)
|
||||
|
||||
// fakeGlobalOptions creates globalOptions and sets it according to flags.
|
||||
// NOTE: This is QUITE FAKE; none of the urfave/cli normalization and the like happens.
|
||||
func fakeGlobalOptions(t *testing.T, flags []string) *globalOptions {
|
||||
func fakeGlobalOptions(t *testing.T, flags []string) (*globalOptions, *cobra.Command) {
|
||||
app, opts := createApp()
|
||||
|
||||
flagSet := flag.NewFlagSet(app.Name, flag.ContinueOnError)
|
||||
for _, f := range app.Flags {
|
||||
f.Apply(flagSet)
|
||||
}
|
||||
err := flagSet.Parse(flags)
|
||||
cmd := &cobra.Command{}
|
||||
app.AddCommand(cmd)
|
||||
err := cmd.ParseFlags(flags)
|
||||
require.NoError(t, err)
|
||||
|
||||
return opts
|
||||
return opts, cmd
|
||||
}
|
||||
|
||||
// fakeImageOptions creates imageOptions and sets it according to globalFlags/cmdFlags.
|
||||
// NOTE: This is QUITE FAKE; none of the urfave/cli normalization and the like happens.
|
||||
func fakeImageOptions(t *testing.T, flagPrefix string, globalFlags []string, cmdFlags []string) *imageOptions {
|
||||
globalOpts := fakeGlobalOptions(t, globalFlags)
|
||||
|
||||
globalOpts, cmd := fakeGlobalOptions(t, globalFlags)
|
||||
sharedFlags, sharedOpts := sharedImageFlags()
|
||||
imageFlags, imageOpts := imageFlags(globalOpts, sharedOpts, flagPrefix, "")
|
||||
flagSet := flag.NewFlagSet("fakeImageOptions", flag.ContinueOnError)
|
||||
for _, f := range append(sharedFlags, imageFlags...) {
|
||||
f.Apply(flagSet)
|
||||
}
|
||||
err := flagSet.Parse(cmdFlags)
|
||||
cmd.Flags().AddFlagSet(&sharedFlags)
|
||||
cmd.Flags().AddFlagSet(&imageFlags)
|
||||
err := cmd.ParseFlags(cmdFlags)
|
||||
require.NoError(t, err)
|
||||
return imageOpts
|
||||
}
|
||||
@@ -52,8 +44,11 @@ func TestImageOptionsNewSystemContext(t *testing.T) {
|
||||
"--registries.d", "/srv/registries.d",
|
||||
"--override-arch", "overridden-arch",
|
||||
"--override-os", "overridden-os",
|
||||
"--override-variant", "overridden-variant",
|
||||
"--tmpdir", "/srv",
|
||||
}, []string{
|
||||
"--authfile", "/srv/authfile",
|
||||
"--dest-authfile", "/srv/dest-authfile",
|
||||
"--dest-cert-dir", "/srv/cert-dir",
|
||||
"--dest-shared-blob-dir", "/srv/shared-blob-dir",
|
||||
"--dest-daemon-host", "daemon-host.example.com",
|
||||
@@ -64,9 +59,10 @@ func TestImageOptionsNewSystemContext(t *testing.T) {
|
||||
require.NoError(t, err)
|
||||
assert.Equal(t, &types.SystemContext{
|
||||
RegistriesDirPath: "/srv/registries.d",
|
||||
AuthFilePath: "/srv/authfile",
|
||||
AuthFilePath: "/srv/dest-authfile",
|
||||
ArchitectureChoice: "overridden-arch",
|
||||
OSChoice: "overridden-os",
|
||||
VariantChoice: "overridden-variant",
|
||||
OCISharedBlobDirPath: "/srv/shared-blob-dir",
|
||||
DockerCertPath: "/srv/cert-dir",
|
||||
DockerInsecureSkipTLSVerify: types.OptionalBoolTrue,
|
||||
@@ -74,6 +70,7 @@ func TestImageOptionsNewSystemContext(t *testing.T) {
|
||||
DockerDaemonCertPath: "/srv/cert-dir",
|
||||
DockerDaemonHost: "daemon-host.example.com",
|
||||
DockerDaemonInsecureSkipTLSVerify: true,
|
||||
BigFilesTemporaryDir: "/srv",
|
||||
}, res)
|
||||
|
||||
// Global/per-command tlsVerify behavior
|
||||
@@ -114,17 +111,13 @@ func TestImageOptionsNewSystemContext(t *testing.T) {
|
||||
}
|
||||
|
||||
// fakeImageDestOptions creates imageDestOptions and sets it according to globalFlags/cmdFlags.
|
||||
// NOTE: This is QUITE FAKE; none of the urfave/cli normalization and the like happens.
|
||||
func fakeImageDestOptions(t *testing.T, flagPrefix string, globalFlags []string, cmdFlags []string) *imageDestOptions {
|
||||
globalOpts := fakeGlobalOptions(t, globalFlags)
|
||||
|
||||
globalOpts, cmd := fakeGlobalOptions(t, globalFlags)
|
||||
sharedFlags, sharedOpts := sharedImageFlags()
|
||||
imageFlags, imageOpts := imageDestFlags(globalOpts, sharedOpts, flagPrefix, "")
|
||||
flagSet := flag.NewFlagSet("fakeImageDestOptions", flag.ContinueOnError)
|
||||
for _, f := range append(sharedFlags, imageFlags...) {
|
||||
f.Apply(flagSet)
|
||||
}
|
||||
err := flagSet.Parse(cmdFlags)
|
||||
cmd.Flags().AddFlagSet(&sharedFlags)
|
||||
cmd.Flags().AddFlagSet(&imageFlags)
|
||||
err := cmd.ParseFlags(cmdFlags)
|
||||
require.NoError(t, err)
|
||||
return imageOpts
|
||||
}
|
||||
@@ -136,23 +129,36 @@ func TestImageDestOptionsNewSystemContext(t *testing.T) {
|
||||
require.NoError(t, err)
|
||||
assert.Equal(t, &types.SystemContext{}, res)
|
||||
|
||||
oldXRD, hasXRD := os.LookupEnv("REGISTRY_AUTH_FILE")
|
||||
defer func() {
|
||||
if hasXRD {
|
||||
os.Setenv("REGISTRY_AUTH_FILE", oldXRD)
|
||||
} else {
|
||||
os.Unsetenv("REGISTRY_AUTH_FILE")
|
||||
}
|
||||
}()
|
||||
authFile := "/tmp/auth.json"
|
||||
// Make sure when REGISTRY_AUTH_FILE is set the auth file is used
|
||||
os.Setenv("REGISTRY_AUTH_FILE", authFile)
|
||||
|
||||
// Explicitly set everything to default, except for when the default is “not present”
|
||||
opts = fakeImageDestOptions(t, "dest-", []string{}, []string{
|
||||
"--dest-compress=false",
|
||||
})
|
||||
res, err = opts.newSystemContext()
|
||||
require.NoError(t, err)
|
||||
assert.Equal(t, &types.SystemContext{}, res)
|
||||
assert.Equal(t, &types.SystemContext{AuthFilePath: authFile}, res)
|
||||
|
||||
// Set everything to non-default values.
|
||||
opts = fakeImageDestOptions(t, "dest-", []string{
|
||||
"--registries.d", "/srv/registries.d",
|
||||
"--override-arch", "overridden-arch",
|
||||
"--override-os", "overridden-os",
|
||||
"--override-variant", "overridden-variant",
|
||||
"--tmpdir", "/srv",
|
||||
}, []string{
|
||||
"--authfile", "/srv/authfile",
|
||||
"--dest-cert-dir", "/srv/cert-dir",
|
||||
"--dest-ostree-tmp-dir", "/srv/ostree-tmp-dir",
|
||||
"--dest-shared-blob-dir", "/srv/shared-blob-dir",
|
||||
"--dest-compress=true",
|
||||
"--dest-daemon-host", "daemon-host.example.com",
|
||||
@@ -166,15 +172,16 @@ func TestImageDestOptionsNewSystemContext(t *testing.T) {
|
||||
AuthFilePath: "/srv/authfile",
|
||||
ArchitectureChoice: "overridden-arch",
|
||||
OSChoice: "overridden-os",
|
||||
VariantChoice: "overridden-variant",
|
||||
OCISharedBlobDirPath: "/srv/shared-blob-dir",
|
||||
DockerCertPath: "/srv/cert-dir",
|
||||
DockerInsecureSkipTLSVerify: types.OptionalBoolTrue,
|
||||
DockerAuthConfig: &types.DockerAuthConfig{Username: "creds-user", Password: "creds-password"},
|
||||
OSTreeTmpDirPath: "/srv/ostree-tmp-dir",
|
||||
DockerDaemonCertPath: "/srv/cert-dir",
|
||||
DockerDaemonHost: "daemon-host.example.com",
|
||||
DockerDaemonInsecureSkipTLSVerify: true,
|
||||
DirForceCompress: true,
|
||||
BigFilesTemporaryDir: "/srv",
|
||||
}, res)
|
||||
|
||||
// Invalid option values in imageOptions
|
||||
@@ -182,3 +189,47 @@ func TestImageDestOptionsNewSystemContext(t *testing.T) {
|
||||
_, err = opts.newSystemContext()
|
||||
assert.Error(t, err)
|
||||
}
|
||||
|
||||
// since there is a shared authfile image option and a non-shared (prefixed) one, make sure the override logic
|
||||
// works correctly.
|
||||
func TestImageOptionsAuthfileOverride(t *testing.T) {
|
||||
|
||||
for _, testCase := range []struct {
|
||||
flagPrefix string
|
||||
cmdFlags []string
|
||||
expectedAuthfilePath string
|
||||
}{
|
||||
// if there is no prefix, only authfile is allowed.
|
||||
{"",
|
||||
[]string{
|
||||
"--authfile", "/srv/authfile",
|
||||
}, "/srv/authfile"},
|
||||
// if authfile and dest-authfile is provided, dest-authfile wins
|
||||
{"dest-",
|
||||
[]string{
|
||||
"--authfile", "/srv/authfile",
|
||||
"--dest-authfile", "/srv/dest-authfile",
|
||||
}, "/srv/dest-authfile",
|
||||
},
|
||||
// if only the shared authfile is provided, authfile must be present in system context
|
||||
{"dest-",
|
||||
[]string{
|
||||
"--authfile", "/srv/authfile",
|
||||
}, "/srv/authfile",
|
||||
},
|
||||
// if only the dest authfile is provided, dest-authfile must be present in system context
|
||||
{"dest-",
|
||||
[]string{
|
||||
"--dest-authfile", "/srv/dest-authfile",
|
||||
}, "/srv/dest-authfile",
|
||||
},
|
||||
} {
|
||||
opts := fakeImageOptions(t, testCase.flagPrefix, []string{}, testCase.cmdFlags)
|
||||
res, err := opts.newSystemContext()
|
||||
require.NoError(t, err)
|
||||
|
||||
assert.Equal(t, &types.SystemContext{
|
||||
AuthFilePath: testCase.expectedAuthfilePath,
|
||||
}, res)
|
||||
}
|
||||
}
|
||||
|
||||
@@ -37,6 +37,8 @@ _skopeo_supported_transports() {
|
||||
_skopeo_copy() {
|
||||
local options_with_args="
|
||||
--authfile
|
||||
--src-authfile
|
||||
--dest-authfile
|
||||
--format -f
|
||||
--sign-by
|
||||
--src-creds --screds
|
||||
@@ -44,7 +46,6 @@ _skopeo_copy() {
|
||||
--src-tls-verify
|
||||
--dest-creds --dcreds
|
||||
--dest-cert-dir
|
||||
--dest-ostree-tmp-dir
|
||||
--dest-tls-verify
|
||||
--src-daemon-host
|
||||
--dest-daemon-host
|
||||
@@ -143,6 +144,47 @@ _skopeo_layers() {
|
||||
_complete_ "$options_with_args" "$boolean_options"
|
||||
}
|
||||
|
||||
_skopeo_list_repository_tags() {
|
||||
local options_with_args="
|
||||
--authfile
|
||||
--creds
|
||||
--cert-dir
|
||||
"
|
||||
|
||||
local boolean_options="
|
||||
--tls-verify
|
||||
--no-creds
|
||||
"
|
||||
_complete_ "$options_with_args" "$boolean_options"
|
||||
}
|
||||
|
||||
_skopeo_login() {
|
||||
local options_with_args="
|
||||
--authfile
|
||||
--cert-dir
|
||||
--password -p
|
||||
--username -u
|
||||
"
|
||||
|
||||
local boolean_options="
|
||||
--get-login
|
||||
--tls-verify
|
||||
--password-stdin
|
||||
"
|
||||
_complete_ "$options_with_args" "$boolean_options"
|
||||
}
|
||||
|
||||
_skopeo_logout() {
|
||||
local options_with_args="
|
||||
--authfile
|
||||
"
|
||||
|
||||
local boolean_options="
|
||||
--all -a
|
||||
"
|
||||
_complete_ "$options_with_args" "$boolean_options"
|
||||
}
|
||||
|
||||
_skopeo_skopeo() {
|
||||
# XXX: Changes here need to be refleceted in the manually expanded
|
||||
# string in the `case` statement below as well.
|
||||
@@ -151,7 +193,9 @@ _skopeo_skopeo() {
|
||||
--registries.d
|
||||
--override-arch
|
||||
--override-os
|
||||
--override-variant
|
||||
--command-timeout
|
||||
--tmpdir
|
||||
"
|
||||
local boolean_options="
|
||||
--insecure-policy
|
||||
@@ -160,9 +204,24 @@ _skopeo_skopeo() {
|
||||
--help -h
|
||||
"
|
||||
|
||||
local commands=(
|
||||
copy
|
||||
delete
|
||||
inspect
|
||||
list-tags
|
||||
login
|
||||
logout
|
||||
manifest-digest
|
||||
standalone-sign
|
||||
standalone-verify
|
||||
sync
|
||||
help
|
||||
h
|
||||
)
|
||||
|
||||
case "$prev" in
|
||||
# XXX: Changes here need to be refleceted in $options_with_args as well.
|
||||
--policy|--registries.d|--override-arch|--override-os|--command-timeout)
|
||||
--policy|--registries.d|--override-arch|--override-os|--override-variant|--command-timeout)
|
||||
return
|
||||
;;
|
||||
esac
|
||||
@@ -172,8 +231,6 @@ _skopeo_skopeo() {
|
||||
while IFS='' read -r line; do COMPREPLY+=("$line"); done < <(compgen -W "$boolean_options $options_with_args" -- "$cur")
|
||||
;;
|
||||
*)
|
||||
commands=$( "${COMP_WORDS[@]:0:$COMP_CWORD}" --generate-bash-completion )
|
||||
|
||||
while IFS='' read -r line; do COMPREPLY+=("$line"); done < <(compgen -W "${commands[*]} help" -- "$cur")
|
||||
;;
|
||||
esac
|
||||
@@ -193,7 +250,7 @@ _cli_bash_autocomplete() {
|
||||
local counter=1
|
||||
while [ $counter -lt "$cword" ]; do
|
||||
case "${words[$counter]}" in
|
||||
skopeo|copy|inspect|delete|manifest-digest|standalone-sign|standalone-verify|help|h)
|
||||
skopeo|copy|inspect|delete|manifest-digest|standalone-sign|standalone-verify|help|h|list-repository-tags)
|
||||
command="${words[$counter]//-/_}"
|
||||
cpos=$counter
|
||||
(( cpos++ ))
|
||||
|
||||
@@ -1,60 +0,0 @@
|
||||
% storage.conf(5) Container Storage Configuration File
|
||||
% Dan Walsh
|
||||
% May 2017
|
||||
|
||||
# NAME
|
||||
storage.conf - Syntax of Container Storage configuration file
|
||||
|
||||
# DESCRIPTION
|
||||
The STORAGE configuration file specifies all of the available container storage options
|
||||
for tools using shared container storage.
|
||||
|
||||
# FORMAT
|
||||
The [TOML format][toml] is used as the encoding of the configuration file.
|
||||
Every option and subtable listed here is nested under a global "storage" table.
|
||||
No bare options are used. The format of TOML can be simplified to:
|
||||
|
||||
[table]
|
||||
option = value
|
||||
|
||||
[table.subtable1]
|
||||
option = value
|
||||
|
||||
[table.subtable2]
|
||||
option = value
|
||||
|
||||
## STORAGE TABLE
|
||||
|
||||
The `storage` table supports the following options:
|
||||
|
||||
**graphroot**=""
|
||||
container storage graph dir (default: "/var/lib/containers/storage")
|
||||
Default directory to store all writable content created by container storage programs.
|
||||
|
||||
**runroot**=""
|
||||
container storage run dir (default: "/var/run/containers/storage")
|
||||
Default directory to store all temporary writable content created by container storage programs.
|
||||
|
||||
**driver**=""
|
||||
container storage driver (default is "overlay")
|
||||
Default Copy On Write (COW) container storage driver.
|
||||
|
||||
### STORAGE OPTIONS TABLE
|
||||
|
||||
The `storage.options` table supports the following options:
|
||||
|
||||
**additionalimagestores**=[]
|
||||
Paths to additional container image stores. Usually these are read-only and stored on remote network shares.
|
||||
|
||||
**size**=""
|
||||
Maximum size of a container image. Default is 10GB. This flag can be used to set quota
|
||||
on the size of container images.
|
||||
|
||||
**override_kernel_check**=""
|
||||
Tell storage drivers to ignore kernel version checks. Some storage drivers assume that if a kernel is too
|
||||
old, the driver is not supported. But for kernels that have had the drivers backported, this flag
|
||||
allows users to override the checks.
|
||||
|
||||
# HISTORY
|
||||
May 2017, Originally compiled by Dan Walsh <dwalsh@redhat.com>
|
||||
Format copied from crio.conf man page created by Aleksa Sarai <asarai@suse.de>
|
||||
36
contrib/skopeoimage/README.md
Normal file
36
contrib/skopeoimage/README.md
Normal file
@@ -0,0 +1,36 @@
|
||||
<img src="https://cdn.rawgit.com/containers/skopeo/master/docs/skopeo.svg" width="250">
|
||||
|
||||
----
|
||||
|
||||
# skopeoimage
|
||||
|
||||
## Overview
|
||||
|
||||
This directory contains the Dockerfiles necessary to create the three skopeoimage container
|
||||
images that are housed on quay.io under the skopeo account. All three repositories where
|
||||
the images live are public and can be pulled without credentials. These container images
|
||||
are secured and the resulting containers can run safely. The container images are built
|
||||
using the latest Fedora and then Skopeo is installed into them:
|
||||
|
||||
* quay.io/skopeo/stable - This image is built using the latest stable version of Skopeo in a Fedora based container. Built with skopeoimage/stable/Dockerfile.
|
||||
* quay.io/skopeo/upstream - This image is built using the latest code found in this GitHub repository. When someone creates a commit and pushes it, the image is created. Due to that the image changes frequently and is not guaranteed to be stable. Built with skopeoimage/upstream/Dockerfile.
|
||||
* quay.io/skopeo/testing - This image is built using the latest version of Skopeo that is or was in updates testing for Fedora. At times this may be the same as the stable image. This container image will primarily be used by the development teams for verification testing when a new package is created. Built with skopeoimage/testing/Dockerfile.
|
||||
|
||||
## Sample Usage
|
||||
|
||||
Although not required, it is suggested that [Podman](https://github.com/containers/libpod) be used with these container images.
|
||||
|
||||
```
|
||||
# Get Help on Skopeo
|
||||
podman run docker://quay.io/skopeo/stable:latest --help
|
||||
|
||||
# Get help on the Skopeo Copy command
|
||||
podman run docker://quay.io/skopeo/stable:latest copy --help
|
||||
|
||||
# Copy the Skopeo container image from quay.io to
|
||||
# a private registry
|
||||
podman run docker://quay.io/skopeo/stable:latest copy docker://quay.io/skopeo/stable docker://registry.internal.company.com/skopeo
|
||||
|
||||
# Inspect the fedora:latest image
|
||||
podman run docker://quay.io/skopeo/stable:latest inspect --config docker://registry.fedoraproject.org/fedora:latest | jq
|
||||
```
|
||||
33
contrib/skopeoimage/stable/Dockerfile
Normal file
33
contrib/skopeoimage/stable/Dockerfile
Normal file
@@ -0,0 +1,33 @@
|
||||
# stable/Dockerfile
|
||||
#
|
||||
# Build a Skopeo container image from the latest
|
||||
# stable version of Skopeo on the Fedoras Updates System.
|
||||
# https://bodhi.fedoraproject.org/updates/?search=skopeo
|
||||
# This image can be used to create a secured container
|
||||
# that runs safely with privileges within the container.
|
||||
#
|
||||
FROM registry.fedoraproject.org/fedora:32
|
||||
|
||||
# Don't include container-selinux and remove
|
||||
# directories used by yum that are just taking
|
||||
# up space. Also reinstall shadow-utils as without
|
||||
# doing so, the setuid/setgid bits on newuidmap
|
||||
# and newgidmap are lost in the Fedora images.
|
||||
RUN useradd skopeo; yum -y update; yum -y reinstall shadow-utils; yum -y install skopeo fuse-overlayfs --exclude container-selinux; yum clean all; rm -rf /var/cache /var/log/dnf* /var/log/yum.*;
|
||||
|
||||
# Adjust storage.conf to enable Fuse storage.
|
||||
RUN sed -i -e 's|^#mount_program|mount_program|g' -e '/additionalimage.*/a "/var/lib/shared",' -e 's|^mountopt[[:space:]]*=.*$|mountopt = "nodev,fsync=0"|g' /etc/containers/storage.conf
|
||||
|
||||
# Setup the ability to use additional stores
|
||||
# with this container image.
|
||||
RUN mkdir -p /var/lib/shared/overlay-images /var/lib/shared/overlay-layers; touch /var/lib/shared/overlay-images/images.lock; touch /var/lib/shared/overlay-layers/layers.lock
|
||||
|
||||
# Setup skopeo's uid/guid entries
|
||||
RUN echo skopeo:100000:65536 > /etc/subuid
|
||||
RUN echo skopeo:100000:65536 > /etc/subgid
|
||||
|
||||
# Point to the Authorization file
|
||||
ENV REGISTRY_AUTH_FILE=/auth.json
|
||||
|
||||
# Set the entrypoint
|
||||
ENTRYPOINT ["/usr/bin/skopeo"]
|
||||
34
contrib/skopeoimage/testing/Dockerfile
Normal file
34
contrib/skopeoimage/testing/Dockerfile
Normal file
@@ -0,0 +1,34 @@
|
||||
# testing/Dockerfile
|
||||
#
|
||||
# Build a Skopeo container image from the latest
|
||||
# version of Skopeo that is in updates-testing
|
||||
# on the Fedoras Updates System.
|
||||
# https://bodhi.fedoraproject.org/updates/?search=skopeo
|
||||
# This image can be used to create a secured container
|
||||
# that runs safely with privileges within the container.
|
||||
#
|
||||
FROM registry.fedoraproject.org/fedora:32
|
||||
|
||||
# Don't include container-selinux and remove
|
||||
# directories used by yum that are just taking
|
||||
# up space. Also reinstall shadow-utils as without
|
||||
# doing so, the setuid/setgid bits on newuidmap
|
||||
# and newgidmap are lost in the Fedora images.
|
||||
RUN useradd skopeo; yum -y update; yum -y reinstall shadow-utils; yum -y install skopeo fuse-overlayfs --enablerepo updates-testing --exclude container-selinux; yum clean all; rm -rf /var/cache /var/log/dnf* /var/log/yum.*;
|
||||
|
||||
# Adjust storage.conf to enable Fuse storage.
|
||||
RUN sed -i -e 's|^#mount_program|mount_program|g' -e '/additionalimage.*/a "/var/lib/shared",' -e 's|^mountopt[[:space:]]*=.*$|mountopt = "nodev,fsync=0"|g' /etc/containers/storage.conf
|
||||
|
||||
# Setup the ability to use additional stores
|
||||
# with this container image.
|
||||
RUN mkdir -p /var/lib/shared/overlay-images /var/lib/shared/overlay-layers; touch /var/lib/shared/overlay-images/images.lock; touch /var/lib/shared/overlay-layers/layers.lock
|
||||
|
||||
# Setup skopeo's uid/guid entries
|
||||
RUN echo skopeo:100000:65536 > /etc/subuid
|
||||
RUN echo skopeo:100000:65536 > /etc/subgid
|
||||
|
||||
# Point to the Authorization file
|
||||
ENV REGISTRY_AUTH_FILE=/auth.json
|
||||
|
||||
# Set the entrypoint
|
||||
ENTRYPOINT ["/usr/bin/skopeo"]
|
||||
53
contrib/skopeoimage/upstream/Dockerfile
Normal file
53
contrib/skopeoimage/upstream/Dockerfile
Normal file
@@ -0,0 +1,53 @@
|
||||
# upstream/Dockerfile
|
||||
#
|
||||
# Build a Skopeo container image from the latest
|
||||
# upstream version of Skopeo on GitHub.
|
||||
# https://github.com/containers/skopeo
|
||||
# This image can be used to create a secured container
|
||||
# that runs safely with privileges within the container.
|
||||
#
|
||||
FROM registry.fedoraproject.org/fedora:32
|
||||
|
||||
# Don't include container-selinux and remove
|
||||
# directories used by yum that are just taking
|
||||
# up space. Also reinstall shadow-utils as without
|
||||
# doing so, the setuid/setgid bits on newuidmap
|
||||
# and newgidmap are lost in the Fedora images.
|
||||
RUN useradd skopeo; yum -y update; yum -y reinstall shadow-utils; \
|
||||
yum -y install make \
|
||||
golang \
|
||||
git \
|
||||
go-md2man \
|
||||
fuse-overlayfs \
|
||||
fuse3 \
|
||||
containers-common \
|
||||
gpgme-devel \
|
||||
libassuan-devel \
|
||||
btrfs-progs-devel \
|
||||
device-mapper-devel --enablerepo updates-testing --exclude container-selinux; \
|
||||
mkdir /root/skopeo; \
|
||||
git clone https://github.com/containers/skopeo /root/skopeo/src/github.com/containers/skopeo; \
|
||||
export GOPATH=/root/skopeo; \
|
||||
cd /root/skopeo/src/github.com/containers/skopeo; \
|
||||
make binary-local;\
|
||||
make install;\
|
||||
rm -rf /root/skopeo/*; \
|
||||
yum -y remove git golang go-md2man make; \
|
||||
yum clean all; rm -rf /var/cache /var/log/dnf* /var/log/yum.*;
|
||||
|
||||
# Adjust storage.conf to enable Fuse storage.
|
||||
RUN sed -i -e 's|^#mount_program|mount_program|g' -e '/additionalimage.*/a "/var/lib/shared",' -e 's|^mountopt[[:space:]]*=.*$|mountopt = "nodev,fsync=0"|g' /etc/containers/storage.conf
|
||||
|
||||
# Setup the ability to use additional stores
|
||||
# with this container image.
|
||||
RUN mkdir -p /var/lib/shared/overlay-images /var/lib/shared/overlay-layers; touch /var/lib/shared/overlay-images/images.lock; touch /var/lib/shared/overlay-layers/layers.lock
|
||||
|
||||
# Setup skopeo's uid/guid entries
|
||||
RUN echo skopeo:100000:65536 > /etc/subuid
|
||||
RUN echo skopeo:100000:65536 > /etc/subgid
|
||||
|
||||
# Point to the Authorization file
|
||||
ENV REGISTRY_AUTH_FILE=/auth.json
|
||||
|
||||
# Set the entrypoint
|
||||
ENTRYPOINT ["/usr/bin/skopeo"]
|
||||
@@ -1,28 +0,0 @@
|
||||
# storage.conf is the configuration file for all tools
|
||||
# that share the containers/storage libraries
|
||||
# See man 5 containers-storage.conf for more information
|
||||
|
||||
# The "container storage" table contains all of the server options.
|
||||
[storage]
|
||||
|
||||
# Default Storage Driver
|
||||
driver = "overlay"
|
||||
|
||||
# Temporary storage location
|
||||
runroot = "/var/run/containers/storage"
|
||||
|
||||
# Primary read-write location of container storage
|
||||
graphroot = "/var/lib/containers/storage"
|
||||
|
||||
[storage.options]
|
||||
# AdditionalImageStores is used to pass paths to additional read-only image stores
|
||||
# Must be comma separated list.
|
||||
additionalimagestores = [
|
||||
]
|
||||
|
||||
# Size is used to set a maximum size of the container image. Only supported by
|
||||
# certain container storage drivers (currently overlay, zfs, vfs, btrfs)
|
||||
size = ""
|
||||
|
||||
# OverrideKernelCheck tells the driver to ignore kernel checks based on kernel version
|
||||
override_kernel_check = "true"
|
||||
@@ -12,8 +12,8 @@
|
||||
|
||||
# This is the default signature write location for docker registries.
|
||||
default-docker:
|
||||
# sigstore: file:///var/lib/atomic/sigstore
|
||||
sigstore-staging: file:///var/lib/atomic/sigstore
|
||||
# sigstore: file:///var/lib/containers/sigstore
|
||||
sigstore-staging: file:///var/lib/containers/sigstore
|
||||
|
||||
# The 'docker' indicator here is the start of the configuration
|
||||
# for docker registries.
|
||||
|
||||
@@ -20,14 +20,25 @@ Uses the system's trust policy to validate images, rejects images not trusted by
|
||||
**--all**
|
||||
|
||||
If _source-image_ refers to a list of images, instead of copying just the image which matches the current OS and
|
||||
architecture (subject to the use of the global --override-os and --override-arch options), attempt to copy all of
|
||||
architecture (subject to the use of the global --override-os, --override-arch and --override-variant options), attempt to copy all of
|
||||
the images in the list, and the list itself.
|
||||
|
||||
**--authfile** _path_
|
||||
|
||||
Path of the authentication file. Default is ${XDG_RUNTIME\_DIR}/containers/auth.json, which is set using `podman login`.
|
||||
Path of the authentication file. Default is ${XDG_RUNTIME\_DIR}/containers/auth.json, which is set using `skopeo login`.
|
||||
If the authorization state is not found there, $HOME/.docker/config.json is checked, which is set using `docker login`.
|
||||
|
||||
Note: You can also override the default path of the authentication file by setting the REGISTRY\_AUTH\_FILE
|
||||
environment variable. `export REGISTRY_AUTH_FILE=path`
|
||||
|
||||
**--src-authfile** _path_
|
||||
|
||||
Path of the authentication file for the source registry. Uses path given by `--authfile`, if not provided.
|
||||
|
||||
**--dest-authfile** _path_
|
||||
|
||||
Path of the authentication file for the destination registry. Uses path given by `--authfile`, if not provided.
|
||||
|
||||
**--format, -f** _manifest-type_ Manifest type (oci, v2s1, or v2s2) to use when saving image to directory using the 'dir:' transport (default is manifest type of source)
|
||||
|
||||
**--quiet, -q** suppress output information when copying images
|
||||
@@ -36,6 +47,10 @@ If the authorization state is not found there, $HOME/.docker/config.json is chec
|
||||
|
||||
**--sign-by=**_key-id_ add a signature using that key ID for an image name corresponding to _destination-image_
|
||||
|
||||
**--encryption-key** _Key_ a reference prefixed with the encryption protocol to use. The supported protocols are JWE, PGP and PKCS7. For instance, jwe:/path/to/key.pem or pgp:admin@example.com or pkcs7:/path/to/x509-file. This feature is still *experimental*.
|
||||
|
||||
**--decryption-key** _Key_ a reference required to perform decryption of container images. This should point to files which represent keys and/or certificates that can be used for decryption. Decryption will be tried with all keys. This feature is still *experimental*.
|
||||
|
||||
**--src-creds** _username[:password]_ for accessing the source registry
|
||||
|
||||
**--dest-compress** _bool-value_ Compress tarball image layers when saving to directory using the 'dir' transport. (default is same compression type as source)
|
||||
@@ -54,8 +69,6 @@ If the authorization state is not found there, $HOME/.docker/config.json is chec
|
||||
|
||||
**--dest-no-creds** _bool-value_ Access the registry anonymously.
|
||||
|
||||
**--dest-ostree-tmp-dir** _path_ Directory to use for OSTree temporary files.
|
||||
|
||||
**--dest-tls-verify** _bool-value_ Require HTTPS and verify certificates when talking to container destination registry or daemon (defaults to true)
|
||||
|
||||
**--src-daemon-host** _host_ Copy from docker daemon at _host_. If _host_ starts with `tcp://`, HTTPS is enabled by default. To use plain HTTP, use the form `http://` (default is `unix:///var/run/docker.sock`).
|
||||
@@ -83,11 +96,43 @@ $ ls /var/lib/images/busybox/*
|
||||
To copy and sign an image:
|
||||
|
||||
```sh
|
||||
$ skopeo copy --sign-by dev@example.com atomic:example/busybox:streaming atomic:example/busybox:gold
|
||||
# skopeo copy --sign-by dev@example.com containers-storage:example/busybox:streaming docker://example/busybox:gold
|
||||
```
|
||||
|
||||
To encrypt an image:
|
||||
```sh
|
||||
skopeo copy docker://docker.io/library/nginx:1.17.8 oci:local_nginx:1.17.8
|
||||
|
||||
openssl genrsa -out private.key 1024
|
||||
openssl rsa -in private.key -pubout > public.key
|
||||
|
||||
skopeo copy --encryption-key jwe:./public.key oci:local_nginx:1.17.8 oci:try-encrypt:encrypted
|
||||
```
|
||||
|
||||
To decrypt an image:
|
||||
```sh
|
||||
skopeo copy --decryption-key ./private.key oci:try-encrypt:encrypted oci:try-decrypt:decrypted
|
||||
```
|
||||
|
||||
To copy encrypted image without decryption:
|
||||
```sh
|
||||
skopeo copy oci:try-encrypt:encrypted oci:try-encrypt-copy:encrypted
|
||||
```
|
||||
|
||||
To decrypt an image that requires more than one key:
|
||||
```sh
|
||||
skopeo copy --decryption-key ./private1.key --decryption-key ./private2.key --decryption-key ./private3.key oci:try-encrypt:encrypted oci:try-decrypt:decrypted
|
||||
```
|
||||
|
||||
Container images can also be partially encrypted by specifying the index of the layer. Layers are 0-indexed indices, with support for negative indexing. i.e. 0 is the first layer, -1 is the last layer.
|
||||
|
||||
Let's say out of 3 layers that the image `docker.io/library/nginx:1.17.8` is made up of, we only want to encrypt the 2nd layer,
|
||||
```sh
|
||||
skopeo copy --encryption-key jwe:./public.key --encrypt-layer 1 oci:local_nginx:1.17.8 oci:try-encrypt:encrypted
|
||||
```
|
||||
|
||||
## SEE ALSO
|
||||
skopeo(1), podman-login(1), docker-login(1)
|
||||
skopeo(1), skopeo-login(1), docker-login(1), containers-auth.json(5), containers-policy.json(5), containers-transports(5)
|
||||
|
||||
## AUTHORS
|
||||
|
||||
|
||||
@@ -21,7 +21,7 @@ $ docker exec -it registry /usr/bin/registry garbage-collect /etc/docker-distrib
|
||||
|
||||
**--authfile** _path_
|
||||
|
||||
Path of the authentication file. Default is ${XDG_RUNTIME\_DIR}/containers/auth.json, which is set using `podman login`.
|
||||
Path of the authentication file. Default is ${XDG_RUNTIME\_DIR}/containers/auth.json, which is set using `skopeo login`.
|
||||
If the authorization state is not found there, $HOME/.docker/config.json is checked, which is set using `docker login`.
|
||||
|
||||
**--creds** _username[:password]_ for accessing the registry
|
||||
@@ -44,7 +44,7 @@ See above for additional details on using the command **delete**.
|
||||
|
||||
|
||||
## SEE ALSO
|
||||
skopeo(1), podman-login(1), docker-login(1)
|
||||
skopeo(1), skopeo-login(1), docker-login(1), containers-auth.json(5)
|
||||
|
||||
## AUTHORS
|
||||
|
||||
|
||||
@@ -22,7 +22,7 @@ Return low-level information about _image-name_ in a registry
|
||||
|
||||
**--authfile** _path_
|
||||
|
||||
Path of the authentication file. Default is ${XDG\_RUNTIME\_DIR}/containers/auth.json, which is set using `podman login`.
|
||||
Path of the authentication file. Default is ${XDG\_RUNTIME\_DIR}/containers/auth.json, which is set using `skopeo login`.
|
||||
If the authorization state is not found there, $HOME/.docker/config.json is checked, which is set using `docker login`.
|
||||
|
||||
**--creds** _username[:password]_ for accessing the registry
|
||||
@@ -63,7 +63,7 @@ $ skopeo inspect docker://docker.io/fedora
|
||||
```
|
||||
|
||||
# SEE ALSO
|
||||
skopeo(1), podman-login(1), docker-login(1)
|
||||
skopeo(1), skopeo-login(1), docker-login(1), containers-auth.json(5)
|
||||
|
||||
## AUTHORS
|
||||
|
||||
|
||||
102
docs/skopeo-list-tags.1.md
Normal file
102
docs/skopeo-list-tags.1.md
Normal file
@@ -0,0 +1,102 @@
|
||||
% skopeo-list-tags(1)
|
||||
|
||||
## NAME
|
||||
skopeo\-list\-tags - Return a list of tags the transport-specific image repository
|
||||
|
||||
## SYNOPSIS
|
||||
**skopeo list-tags** _repository-name_
|
||||
|
||||
Return a list of tags from _repository-name_ in a registry.
|
||||
|
||||
_repository-name_ name of repository to retrieve tag listing from
|
||||
|
||||
**--authfile** _path_
|
||||
|
||||
Path of the authentication file. Default is ${XDG\_RUNTIME\_DIR}/containers/auth.json, which is set using `skopeo login`.
|
||||
If the authorization state is not found there, $HOME/.docker/config.json is checked, which is set using `docker login`.
|
||||
|
||||
**--creds** _username[:password]_ for accessing the registry
|
||||
|
||||
**--cert-dir** _path_ Use certificates at _path_ (\*.crt, \*.cert, \*.key) to connect to the registry
|
||||
|
||||
**--tls-verify** _bool-value_ Require HTTPS and verify certificates when talking to container registries (defaults to true)
|
||||
|
||||
**--no-creds** _bool-value_ Access the registry anonymously.
|
||||
|
||||
## REPOSITORY NAMES
|
||||
|
||||
Repository names are transport-specific references as each transport may have its own concept of a "repository" and "tags". Currently, only the Docker transport is supported.
|
||||
|
||||
This commands refers to repositories using a _transport_`:`_details_ format. The following formats are supported:
|
||||
|
||||
**docker://**_docker-repository-reference_
|
||||
A repository in a registry implementing the "Docker Registry HTTP API V2". By default, uses the authorization state in either `$XDG_RUNTIME_DIR/containers/auth.json`, which is set using `(skopeo login)`. If the authorization state is not found there, `$HOME/.docker/config.json` is checked, which is set using `(docker login)`.
|
||||
A _docker-repository-reference_ is of the form: **registryhost:port/repositoryname** which is similar to an _image-reference_ but with no tag or digest allowed as the last component (e.g no `:latest` or `@sha256:xyz`)
|
||||
|
||||
Examples of valid docker-repository-references:
|
||||
"docker.io/myuser/myrepo"
|
||||
"docker.io/nginx"
|
||||
"docker.io/library/fedora"
|
||||
"localhost:5000/myrepository"
|
||||
|
||||
Examples of invalid references:
|
||||
"docker.io/nginx:latest"
|
||||
"docker.io/myuser/myimage:v1.0"
|
||||
"docker.io/myuser/myimage@sha256:f48c4cc192f4c3c6a069cb5cca6d0a9e34d6076ba7c214fd0cc3ca60e0af76bb"
|
||||
|
||||
|
||||
## EXAMPLES
|
||||
|
||||
### Docker Transport
|
||||
To get the list of tags in the "fedora" repository from the docker.io registry (the repository name expands to "library/fedora" per docker transport canonical form):
|
||||
```sh
|
||||
$ skopeo list-tags docker://docker.io/fedora
|
||||
{
|
||||
"Repository": "docker.io/library/fedora",
|
||||
"Tags": [
|
||||
"20",
|
||||
"21",
|
||||
"22",
|
||||
"23",
|
||||
"24",
|
||||
"25",
|
||||
"26-modular",
|
||||
"26",
|
||||
"27",
|
||||
"28",
|
||||
"29",
|
||||
"30",
|
||||
"31",
|
||||
"32",
|
||||
"branched",
|
||||
"heisenbug",
|
||||
"latest",
|
||||
"modular",
|
||||
"rawhide"
|
||||
]
|
||||
}
|
||||
|
||||
```
|
||||
|
||||
To list the tags in a local host docker/distribution registry on port 5000, in this case for the "fedora" repository:
|
||||
|
||||
```sh
|
||||
$ skopeo list-tags docker://localhost:5000/fedora
|
||||
{
|
||||
"Repository": "localhost:5000/fedora",
|
||||
"Tags": [
|
||||
"latest",
|
||||
"30",
|
||||
"31"
|
||||
]
|
||||
}
|
||||
|
||||
```
|
||||
|
||||
# SEE ALSO
|
||||
skopeo(1), skopeo-login(1), docker-login(1), containers-auth.json(5)
|
||||
|
||||
## AUTHORS
|
||||
|
||||
Zach Hill <zach@anchore.com>
|
||||
|
||||
101
docs/skopeo-login.1.md
Normal file
101
docs/skopeo-login.1.md
Normal file
@@ -0,0 +1,101 @@
|
||||
% skopeo-login(1)
|
||||
|
||||
## NAME
|
||||
skopeo\-login - Login to a container registry
|
||||
|
||||
## SYNOPSIS
|
||||
**skoepo login** [*options*] *registry*
|
||||
|
||||
## DESCRIPTION
|
||||
**skopeo login** logs into a specified registry server with the correct username
|
||||
and password. **skopeo login** reads in the username and password from STDIN.
|
||||
The username and password can also be set using the **username** and **password** flags.
|
||||
The path of the authentication file can be specified by the user by setting the **authfile**
|
||||
flag. The default path used is **${XDG\_RUNTIME\_DIR}/containers/auth.json**.
|
||||
|
||||
## OPTIONS
|
||||
|
||||
**--password**, **-p**=*password*
|
||||
|
||||
Password for registry
|
||||
|
||||
**--password-stdin**
|
||||
|
||||
Take the password from stdin
|
||||
|
||||
**--username**, **-u**=*username*
|
||||
|
||||
Username for registry
|
||||
|
||||
**--authfile**=*path*
|
||||
|
||||
Path of the authentication file. Default is ${XDG\_RUNTIME\_DIR}/containers/auth.json
|
||||
|
||||
Note: You can also override the default path of the authentication file by setting the REGISTRY\_AUTH\_FILE
|
||||
environment variable. `export REGISTRY_AUTH_FILE=path`
|
||||
|
||||
**--get-login**
|
||||
|
||||
Return the logged-in user for the registry. Return error if no login is found.
|
||||
|
||||
**--cert-dir**=*path*
|
||||
|
||||
Use certificates at *path* (\*.crt, \*.cert, \*.key) to connect to the registry.
|
||||
Default certificates directory is _/etc/containers/certs.d_.
|
||||
|
||||
**--tls-verify**=*true|false*
|
||||
|
||||
Require HTTPS and verify certificates when contacting registries (default: true). If explicitly set to true,
|
||||
then TLS verification will be used. If set to false, then TLS verification will not be used. If not specified,
|
||||
TLS verification will be used unless the target registry is listed as an insecure registry in registries.conf.
|
||||
|
||||
**--help**, **-h**
|
||||
|
||||
Print usage statement
|
||||
|
||||
## EXAMPLES
|
||||
|
||||
```
|
||||
$ skopeo login docker.io
|
||||
Username: testuser
|
||||
Password:
|
||||
Login Succeeded!
|
||||
```
|
||||
|
||||
```
|
||||
$ skopeo login -u testuser -p testpassword localhost:5000
|
||||
Login Succeeded!
|
||||
```
|
||||
|
||||
```
|
||||
$ skopeo login --authfile authdir/myauths.json docker.io
|
||||
Username: testuser
|
||||
Password:
|
||||
Login Succeeded!
|
||||
```
|
||||
|
||||
```
|
||||
$ skopeo login --tls-verify=false -u test -p test localhost:5000
|
||||
Login Succeeded!
|
||||
```
|
||||
|
||||
```
|
||||
$ skopeo login --cert-dir /etc/containers/certs.d/ -u foo -p bar localhost:5000
|
||||
Login Succeeded!
|
||||
```
|
||||
|
||||
```
|
||||
$ skopeo login -u testuser --password-stdin < testpassword.txt docker.io
|
||||
Login Succeeded!
|
||||
```
|
||||
|
||||
```
|
||||
$ echo $testpassword | skopeo login -u testuser --password-stdin docker.io
|
||||
Login Succeeded!
|
||||
```
|
||||
|
||||
## SEE ALSO
|
||||
skopeo(1), skopeo-logout(1), containers-auth.json(5), containers-registries.conf(5), containers-certs.d.5.md
|
||||
|
||||
## HISTORY
|
||||
May 2020, Originally compiled by Qi Wang <qiwan@redhat.com>
|
||||
53
docs/skopeo-logout.1.md
Normal file
53
docs/skopeo-logout.1.md
Normal file
@@ -0,0 +1,53 @@
|
||||
% skopeo-logout(1)
|
||||
|
||||
## NAME
|
||||
skopeo\-logout - Logout of a container registry
|
||||
|
||||
## SYNOPSIS
|
||||
**skopeo logout** [*options*] *registry*
|
||||
|
||||
## DESCRIPTION
|
||||
**skopeo logout** logs out of a specified registry server by deleting the cached credentials
|
||||
stored in the **auth.json** file. The path of the authentication file can be overridden by the user by setting the **authfile** flag.
|
||||
The default path used is **${XDG\_RUNTIME\_DIR}/containers/auth.json**.
|
||||
All the cached credentials can be removed by setting the **all** flag.
|
||||
|
||||
## OPTIONS
|
||||
|
||||
**--authfile**=*path*
|
||||
|
||||
Path of the authentication file. Default is ${XDG\_RUNTIME\_DIR}/containers/auth.json
|
||||
|
||||
Note: You can also override the default path of the authentication file by setting the REGISTRY\_AUTH\_FILE
|
||||
environment variable. `export REGISTRY_AUTH_FILE=path`
|
||||
|
||||
**--all**, **-a**
|
||||
|
||||
Remove the cached credentials for all registries in the auth file
|
||||
|
||||
**--help**, **-h**
|
||||
|
||||
Print usage statement
|
||||
|
||||
## EXAMPLES
|
||||
|
||||
```
|
||||
$ skopeo logout docker.io
|
||||
Remove login credentials for docker.io
|
||||
```
|
||||
|
||||
```
|
||||
$ skopeo logout --authfile authdir/myauths.json docker.io
|
||||
Remove login credentials for docker.io
|
||||
```
|
||||
|
||||
```
|
||||
$ skopeo logout --all
|
||||
Remove login credentials for all registries
|
||||
```
|
||||
|
||||
## SEE ALSO
|
||||
skopeo(1), skopeo-login(1), containers-auth.json(5)
|
||||
|
||||
## HISTORY
|
||||
May 2020, Originally compiled by Qi Wang <qiwan@redhat.com>
|
||||
@@ -26,7 +26,7 @@ $
|
||||
```
|
||||
|
||||
## SEE ALSO
|
||||
skopeo(1), skopeo-copy(1)
|
||||
skopeo(1), skopeo-copy(1), containers-signature(5)
|
||||
|
||||
## AUTHORS
|
||||
|
||||
|
||||
@@ -28,7 +28,7 @@ Signature verified, digest sha256:20bf21ed457b390829cdbeec8795a7bea1626991fda603
|
||||
```
|
||||
|
||||
## SEE ALSO
|
||||
skopeo(1)
|
||||
skopeo(1), containers-signature(5)
|
||||
|
||||
## AUTHORS
|
||||
|
||||
|
||||
180
docs/skopeo-sync.1.md
Normal file
180
docs/skopeo-sync.1.md
Normal file
@@ -0,0 +1,180 @@
|
||||
% skopeo-sync(1)
|
||||
|
||||
## NAME
|
||||
skopeo\-sync - Synchronize images between container registries and local directories.
|
||||
|
||||
|
||||
## SYNOPSIS
|
||||
**skopeo sync** --src _transport_ --dest _transport_ _source_ _destination_
|
||||
|
||||
## DESCRIPTION
|
||||
Synchronize images between container registries and local directories.
|
||||
The synchronization is achieved by copying all the images found at _source_ to _destination_.
|
||||
|
||||
Useful to synchronize a local container registry mirror, and to to populate registries running inside of air-gapped environments.
|
||||
|
||||
Differently from other skopeo commands, skopeo sync requires both source and destination transports to be specified separately from _source_ and _destination_.
|
||||
One of the problems of prefixing a destination with its transport is that, the registry `docker://hostname:port` would be wrongly interpreted as an image reference at a non-fully qualified registry, with `hostname` and `port` the image name and tag.
|
||||
|
||||
Available _source_ transports:
|
||||
- _docker_ (i.e. `--src docker`): _source_ is a repository hosted on a container registry (e.g.: `registry.example.com/busybox`).
|
||||
If no image tag is specified, skopeo sync copies all the tags found in that repository.
|
||||
- _dir_ (i.e. `--src dir`): _source_ is a local directory path (e.g.: `/media/usb/`). Refer to skopeo(1) **dir:**_path_ for the local image format.
|
||||
- _yaml_ (i.e. `--src yaml`): _source_ is local YAML file path.
|
||||
The YAML file should specify the list of images copied from different container registries (local directories are not supported). Refer to EXAMPLES for the file format.
|
||||
|
||||
Available _destination_ transports:
|
||||
- _docker_ (i.e. `--dest docker`): _destination_ is a container registry (e.g.: `my-registry.local.lan`).
|
||||
- _dir_ (i.e. `--dest dir`): _destination_ is a local directory path (e.g.: `/media/usb/`).
|
||||
One directory per source 'image:tag' is created for each copied image.
|
||||
|
||||
When the `--scoped` option is specified, images are prefixed with the source image path so that multiple images with the same
|
||||
name can be stored at _destination_.
|
||||
|
||||
## OPTIONS
|
||||
**--authfile** _path_
|
||||
|
||||
Path of the authentication file. Default is ${XDG\_RUNTIME\_DIR}/containers/auth.json, which is set using `skopeo login`.
|
||||
If the authorization state is not found there, $HOME/.docker/config.json is checked, which is set using `docker login`.
|
||||
|
||||
**--src-authfile** _path_
|
||||
|
||||
Path of the authentication file for the source registry. Uses path given by `--authfile`, if not provided.
|
||||
|
||||
**--dest-authfile** _path_
|
||||
|
||||
Path of the authentication file for the destination registry. Uses path given by `--authfile`, if not provided.
|
||||
|
||||
**--src** _transport_ Transport for the source repository.
|
||||
|
||||
**--dest** _transport_ Destination transport.
|
||||
|
||||
**--scoped** Prefix images with the source image path, so that multiple images with the same name can be stored at _destination_.
|
||||
|
||||
**--remove-signatures** Do not copy signatures, if any, from _source-image_. This is necessary when copying a signed image to a destination which does not support signatures.
|
||||
|
||||
**--sign-by=**_key-id_ Add a signature using that key ID for an image name corresponding to _destination-image_.
|
||||
|
||||
**--src-creds** _username[:password]_ for accessing the source registry.
|
||||
|
||||
**--dest-creds** _username[:password]_ for accessing the destination registry.
|
||||
|
||||
**--src-cert-dir** _path_ Use certificates (*.crt, *.cert, *.key) at _path_ to connect to the source registry or daemon.
|
||||
|
||||
**--src-no-creds** _bool-value_ Access the registry anonymously.
|
||||
|
||||
**--src-tls-verify** _bool-value_ Require HTTPS and verify certificates when talking to a container source registry or daemon (defaults to true).
|
||||
|
||||
**--dest-cert-dir** _path_ Use certificates (*.crt, *.cert, *.key) at _path_ to connect to the destination registry or daemon.
|
||||
|
||||
**--dest-no-creds** _bool-value_ Access the registry anonymously.
|
||||
|
||||
**--dest-tls-verify** _bool-value_ Require HTTPS and verify certificates when talking to a container destination registry or daemon (defaults to true).
|
||||
|
||||
## EXAMPLES
|
||||
|
||||
### Synchronizing to a local directory
|
||||
```
|
||||
$ skopeo sync --src docker --dest dir registry.example.com/busybox /media/usb
|
||||
```
|
||||
Images are located at:
|
||||
```
|
||||
/media/usb/busybox:1-glibc
|
||||
/media/usb/busybox:1-musl
|
||||
/media/usb/busybox:1-ubuntu
|
||||
...
|
||||
/media/usb/busybox:latest
|
||||
```
|
||||
|
||||
### Synchronizing to a container registry from local
|
||||
Images are located at:
|
||||
```
|
||||
/media/usb/busybox:1-glibc
|
||||
```
|
||||
Sync run
|
||||
```
|
||||
$ skopeo sync --src dir --dest docker /media/usb/busybox:1-glibc my-registry.local.lan/test/
|
||||
```
|
||||
Destination registry content:
|
||||
```
|
||||
REPO TAGS
|
||||
my-registry.local.lan/test/busybox 1-glibc
|
||||
```
|
||||
|
||||
### Synchronizing to a local directory, scoped
|
||||
```
|
||||
$ skopeo sync --src docker --dest dir --scoped registry.example.com/busybox /media/usb
|
||||
```
|
||||
Images are located at:
|
||||
```
|
||||
/media/usb/registry.example.com/busybox:1-glibc
|
||||
/media/usb/registry.example.com/busybox:1-musl
|
||||
/media/usb/registry.example.com/busybox:1-ubuntu
|
||||
...
|
||||
/media/usb/registry.example.com/busybox:latest
|
||||
```
|
||||
|
||||
### Synchronizing to a container registry
|
||||
```
|
||||
skopeo sync --src docker --dest docker registry.example.com/busybox my-registry.local.lan
|
||||
```
|
||||
Destination registry content:
|
||||
```
|
||||
REPO TAGS
|
||||
registry.local.lan/busybox 1-glibc, 1-musl, 1-ubuntu, ..., latest
|
||||
```
|
||||
|
||||
### Synchronizing to a container registry keeping the repository
|
||||
```
|
||||
skopeo sync --src docker --dest docker registry.example.com/repo/busybox my-registry.local.lan/repo
|
||||
```
|
||||
Destination registry content:
|
||||
```
|
||||
REPO TAGS
|
||||
registry.local.lan/repo/busybox 1-glibc, 1-musl, 1-ubuntu, ..., latest
|
||||
```
|
||||
|
||||
### YAML file content (used _source_ for `**--src yaml**`)
|
||||
|
||||
```yaml
|
||||
registry.example.com:
|
||||
images:
|
||||
busybox: []
|
||||
redis:
|
||||
- "1.0"
|
||||
- "2.0"
|
||||
images-by-tag-regex:
|
||||
nginx: ^1\.13\.[12]-alpine-perl$
|
||||
credentials:
|
||||
username: john
|
||||
password: this is a secret
|
||||
tls-verify: true
|
||||
cert-dir: /home/john/certs
|
||||
quay.io:
|
||||
tls-verify: false
|
||||
images:
|
||||
coreos/etcd:
|
||||
- latest
|
||||
```
|
||||
If the yaml filename is `sync.yml`, sync run:
|
||||
```
|
||||
skopeo sync --src yaml --dest docker sync.yml my-registry.local.lan/repo/
|
||||
```
|
||||
This will copy the following images:
|
||||
- Repository `registry.example.com/busybox`: all images, as no tags are specified.
|
||||
- Repository `registry.example.com/redis`: images tagged "1.0" and "2.0".
|
||||
- Repository `registry.example.com/nginx`: images tagged "1.13.1-alpine-perl" and "1.13.2-alpine-perl".
|
||||
- Repository `quay.io/coreos/etcd`: images tagged "latest".
|
||||
|
||||
For the registry `registry.example.com`, the "john"/"this is a secret" credentials are used, with server TLS certificates located at `/home/john/certs`.
|
||||
|
||||
TLS verification is normally enabled, and it can be disabled setting `tls-verify` to `false`.
|
||||
In the above example, TLS verification is enabled for `reigstry.example.com`, while is
|
||||
disabled for `quay.io`.
|
||||
|
||||
## SEE ALSO
|
||||
skopeo(1), skopeo-login(1), docker-login(1), containers-auth.json(5), containers-policy.json(5), containers-transports(5)
|
||||
|
||||
## AUTHORS
|
||||
|
||||
Flavio Castelli <fcastelli@suse.com>, Marco Vedovati <mvedovati@suse.com>
|
||||
@@ -27,13 +27,13 @@ its functionality. It also does not require root, unless you are copying images
|
||||
Most commands refer to container images, using a _transport_`:`_details_ format. The following formats are supported:
|
||||
|
||||
**containers-storage:**_docker-reference_
|
||||
An image located in a local containers/storage image store. Location and image store specified in /etc/containers/storage.conf
|
||||
An image located in a local containers/storage image store. Both the location and image store are specified in /etc/containers/storage.conf. (Backend for Podman, CRI-O, Buildah and friends)
|
||||
|
||||
**dir:**_path_
|
||||
An existing local directory _path_ storing the manifest, layer tarballs and signatures as individual files. This is a non-standardized format, primarily useful for debugging or noninvasive container inspection.
|
||||
|
||||
**docker://**_docker-reference_
|
||||
An image in a registry implementing the "Docker Registry HTTP API V2". By default, uses the authorization state in either `$XDG_RUNTIME_DIR/containers/auth.json`, which is set using `(podman login)`. If the authorization state is not found there, `$HOME/.docker/config.json` is checked, which is set using `(docker login)`.
|
||||
An image in a registry implementing the "Docker Registry HTTP API V2". By default, uses the authorization state in either `$XDG_RUNTIME_DIR/containers/auth.json`, which is set using `(skopeo login)`. If the authorization state is not found there, `$HOME/.docker/config.json` is checked, which is set using `(docker login)`.
|
||||
|
||||
**docker-archive:**_path_[**:**_docker-reference_]
|
||||
An image is stored in the `docker save` formatted file. _docker-reference_ is only used when creating such a file, and it must not contain a digest.
|
||||
@@ -44,26 +44,27 @@ Most commands refer to container images, using a _transport_`:`_details_ format.
|
||||
**oci:**_path_**:**_tag_
|
||||
An image _tag_ in a directory compliant with "Open Container Image Layout Specification" at _path_.
|
||||
|
||||
**ostree:**_image_[**@**_/absolute/repo/path_]
|
||||
An image in local OSTree repository. _/absolute/repo/path_ defaults to _/ostree/repo_.
|
||||
|
||||
## OPTIONS
|
||||
|
||||
**--command-timeout** _duration_ Timeout for the command execution.
|
||||
|
||||
**--debug** enable debug output
|
||||
|
||||
**--policy** _path-to-policy_ Path to a policy.json file to use for verifying signatures and deciding whether an image is trusted, overriding the default trust policy file.
|
||||
**--help**|**-h** Show help
|
||||
|
||||
**--insecure-policy** Adopt an insecure, permissive policy that allows anything. This obviates the need for a policy file.
|
||||
|
||||
**--registries.d** _dir_ use registry configuration files in _dir_ (e.g. for container signature storage), overriding the default path.
|
||||
|
||||
**--override-arch** _arch_ Use _arch_ instead of the architecture of the machine for choosing images.
|
||||
|
||||
**--override-os** _OS_ Use _OS_ instead of the running OS for choosing images.
|
||||
|
||||
**--command-timeout** _duration_ Timeout for the command execution.
|
||||
**--override-variant** _VARIANT_ Use _VARIANT_ instead of the running architecture variant for choosing images.
|
||||
|
||||
**--help**|**-h** Show help
|
||||
**--policy** _path-to-policy_ Path to a policy.json file to use for verifying signatures and deciding whether an image is trusted, overriding the default trust policy file.
|
||||
|
||||
**--registries.d** _dir_ use registry configuration files in _dir_ (e.g. for container signature storage), overriding the default path.
|
||||
|
||||
**--tmpdir** _dir_ used to store temporary files. Defaults to /var/tmp.
|
||||
|
||||
**--version**|**-v** print the version number
|
||||
|
||||
@@ -74,21 +75,25 @@ Most commands refer to container images, using a _transport_`:`_details_ format.
|
||||
| [skopeo-copy(1)](skopeo-copy.1.md) | Copy an image (manifest, filesystem layers, signatures) from one location to another. |
|
||||
| [skopeo-delete(1)](skopeo-delete.1.md) | Mark image-name for deletion. |
|
||||
| [skopeo-inspect(1)](skopeo-inspect.1.md) | Return low-level information about image-name in a registry. |
|
||||
| [skopeo-list-tags(1)](skopeo-list-tags.1.md) | List the tags for the given transport/repository. |
|
||||
| [skopeo-login(1)](skopeo-login.1.md) | Login to a container registry. |
|
||||
| [skopeo-logout(1)](skopeo-logout.1.md) | Logout of a container registry. |
|
||||
| [skopeo-manifest-digest(1)](skopeo-manifest-digest.1.md) | Compute a manifest digest of manifest-file and write it to standard output.|
|
||||
| [skopeo-standalone-sign(1)](skopeo-standalone-sign.1.md) | Sign an image. |
|
||||
| [skopeo-standalone-verify(1)](skopeo-standalone-verify.1.md)| Verify an image. |
|
||||
| [skopeo-sync(1)](skopeo-sync.1.md)| Copy images from one or more repositories to a user specified destination. |
|
||||
|
||||
## FILES
|
||||
**/etc/containers/policy.json**
|
||||
Default trust policy file, if **--policy** is not specified.
|
||||
The policy format is documented in https://github.com/containers/image/blob/master/docs/containers-policy.json.5.md .
|
||||
The policy format is documented in [containers-policy.json(5)](https://github.com/containers/image/blob/master/docs/containers-policy.json.5.md) .
|
||||
|
||||
**/etc/containers/registries.d**
|
||||
Default directory containing registry configuration, if **--registries.d** is not specified.
|
||||
The contents of this directory are documented in https://github.com/containers/image/blob/master/docs/containers-policy.json.5.md .
|
||||
The contents of this directory are documented in [containers-policy.json(5)](https://github.com/containers/image/blob/master/docs/containers-policy.json.5.md).
|
||||
|
||||
## SEE ALSO
|
||||
podman-login(1), docker-login(1)
|
||||
skopeo-login(1), docker-login(1), containers-auth.json(5), containers-storage.conf(5), containers-policy.json(5), containers-transports(5)
|
||||
|
||||
## AUTHORS
|
||||
|
||||
|
||||
25
go.mod
25
go.mod
@@ -3,24 +3,25 @@ module github.com/containers/skopeo
|
||||
go 1.12
|
||||
|
||||
require (
|
||||
github.com/containers/buildah v1.8.4
|
||||
github.com/containers/image/v5 v5.0.0
|
||||
github.com/containers/storage v1.13.4
|
||||
github.com/docker/docker v0.0.0-20180522102801-da99009bbb11
|
||||
github.com/containers/common v0.14.0
|
||||
github.com/containers/image/v5 v5.5.1
|
||||
github.com/containers/ocicrypt v1.0.2
|
||||
github.com/containers/storage v1.20.2
|
||||
github.com/docker/docker v1.4.2-0.20191219165747-a9416c67da9f
|
||||
github.com/dsnet/compress v0.0.1 // indirect
|
||||
github.com/go-check/check v0.0.0-20180628173108-788fd7840127
|
||||
github.com/opencontainers/go-digest v1.0.0-rc1
|
||||
github.com/opencontainers/go-digest v1.0.0
|
||||
github.com/opencontainers/image-spec v1.0.2-0.20190823105129-775207bd45b6
|
||||
github.com/opencontainers/image-tools v0.0.0-20170926011501-6d941547fa1d
|
||||
github.com/opencontainers/runtime-spec v1.0.0 // indirect
|
||||
github.com/pkg/errors v0.8.1
|
||||
github.com/pkg/errors v0.9.1
|
||||
github.com/russross/blackfriday v2.0.0+incompatible // indirect
|
||||
github.com/shurcooL/sanitized_anchor_name v1.0.0 // indirect
|
||||
github.com/sirupsen/logrus v1.4.2
|
||||
github.com/stretchr/testify v1.4.0
|
||||
github.com/sirupsen/logrus v1.6.0
|
||||
github.com/spf13/cobra v1.0.0
|
||||
github.com/spf13/pflag v1.0.5
|
||||
github.com/stretchr/testify v1.6.1
|
||||
github.com/syndtr/gocapability v0.0.0-20180916011248-d98352740cb2
|
||||
github.com/urfave/cli v1.20.0
|
||||
github.com/xeipuuv/gojsonschema v1.1.0 // indirect
|
||||
go4.org v0.0.0-20190218023631-ce4c26f7be8e // indirect
|
||||
k8s.io/client-go v0.0.0-20181219152756-3dd551c0f083 // indirect
|
||||
golang.org/x/text v0.3.3 // indirect
|
||||
gopkg.in/yaml.v2 v2.3.0
|
||||
)
|
||||
|
||||
469
go.sum
469
go.sum
@@ -1,40 +1,80 @@
|
||||
cloud.google.com/go v0.26.0/go.mod h1:aQUYkXzVsufM+DwF1aE+0xfcU+56JwCaLick0ClmMTw=
|
||||
github.com/14rcole/gopopulate v0.0.0-20180821133914-b175b219e774 h1:SCbEWT58NSt7d2mcFdvxC9uyrdcTfvBbPLThhkDmXzg=
|
||||
github.com/14rcole/gopopulate v0.0.0-20180821133914-b175b219e774/go.mod h1:6/0dYRLLXyJjbkIPeeGyoJ/eKOSI0eU6eTlCBYibgd0=
|
||||
github.com/Azure/go-ansiterm v0.0.0-20170929234023-d6e3b3328b78 h1:w+iIsaOQNcT7OZ575w+acHgRric5iCyQh+xv+KJ4HB8=
|
||||
github.com/Azure/go-ansiterm v0.0.0-20170929234023-d6e3b3328b78/go.mod h1:LmzpDX56iTiv29bbRTIsUNlaFfuhWRQBWjQdVyAevI8=
|
||||
github.com/BurntSushi/toml v0.3.1 h1:WXkYYl6Yr3qBf1K79EBnL4mak0OimBfB0XUf9Vl28OQ=
|
||||
github.com/BurntSushi/toml v0.3.1/go.mod h1:xHWCNGjB5oqiDr8zfno3MHue2Ht5sIBksp03qcyfWMU=
|
||||
github.com/DataDog/zstd v1.4.0/go.mod h1:1jcaCB/ufaK+sKp1NBhlGmpz41jOoPQ35bpF36t7BBo=
|
||||
github.com/Microsoft/go-winio v0.4.12 h1:xAfWHN1IrQ0NJ9TBC0KBZoqLjzDTr1ML+4MywiUOryc=
|
||||
github.com/Microsoft/go-winio v0.4.12/go.mod h1:VhR8bwka0BXejwEJY73c50VrPtXAaKcyvVC4A4RozmA=
|
||||
github.com/Microsoft/hcsshim v0.8.6 h1:ZfF0+zZeYdzMIVMZHKtDKJvLHj76XCuVae/jNkjj0IA=
|
||||
github.com/Microsoft/hcsshim v0.8.6/go.mod h1:Op3hHsoHPAvb6lceZHDtd9OkTew38wNoXnJs8iY7rUg=
|
||||
github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5 h1:ygIc8M6trr62pF5DucadTWGdEB4mEyvzi0e2nbcmcyA=
|
||||
github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5/go.mod h1:tTuCMEN+UleMWgg9dVx4Hu52b1bJo+59jBh3ajtinzw=
|
||||
github.com/Microsoft/hcsshim v0.8.7 h1:ptnOoufxGSzauVTsdE+wMYnCWA301PdoN4xg5oRdZpg=
|
||||
github.com/Microsoft/hcsshim v0.8.7/go.mod h1:OHd7sQqRFrYd3RmSgbgji+ctCwkbq2wbEYNSzOYtcBQ=
|
||||
github.com/Microsoft/hcsshim v0.8.9 h1:VrfodqvztU8YSOvygU+DN1BGaSGxmrNfqOv5oOuX2Bk=
|
||||
github.com/Microsoft/hcsshim v0.8.9/go.mod h1:5692vkUqntj1idxauYlpoINNKeqCiG6Sg38RRsjT5y8=
|
||||
github.com/OneOfOne/xxhash v1.2.2/go.mod h1:HSdplMjZKSmBqAxg5vPj2TmRDmfkzw+cTzAElWljhcU=
|
||||
github.com/VividCortex/ewma v1.1.1 h1:MnEK4VOv6n0RSY4vtRe3h11qjxL3+t0B8yOL8iMXdcM=
|
||||
github.com/VividCortex/ewma v1.1.1/go.mod h1:2Tkkvm3sRDVXaiyucHiACn4cqf7DpdyLvmxzcbUokwA=
|
||||
github.com/containerd/continuity v0.0.0-20180216233310-d8fb8589b0e8 h1:ZZOFPzvZO3N0f4LIQvZi68F2XDAMl/gqBfFMVjY6B3Y=
|
||||
github.com/containerd/continuity v0.0.0-20180216233310-d8fb8589b0e8/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y=
|
||||
github.com/containers/buildah v1.8.4 h1:06c+UNeEWMa2wA1Z7muZ0ZqUzE91sDuZJbB0BiZaeYQ=
|
||||
github.com/containers/buildah v1.8.4/go.mod h1:1CsiLJvyU+h+wOjnqJJOWuJCVcMxZOr5HN/gHGdzJxY=
|
||||
github.com/containers/image/v4 v4.0.1 h1:idNGHChj0Pyv3vLrxul2oSVMZLeFqpoq3CjLeVgapSQ=
|
||||
github.com/containers/image/v4 v4.0.1/go.mod h1:0ASJH1YgJiX/eqFZObqepgsvIA4XjCgpyfwn9pDGafA=
|
||||
github.com/containers/image/v4 v4.0.2-0.20191021195858-69340234bfc6 h1:sFL2cwC0xjphJHpa6DXhka2jTLGI5HwbnAUSAKFhg2M=
|
||||
github.com/containers/image/v4 v4.0.2-0.20191021195858-69340234bfc6/go.mod h1:0ASJH1YgJiX/eqFZObqepgsvIA4XjCgpyfwn9pDGafA=
|
||||
github.com/containers/image/v5 v5.0.0 h1:arnXgbt1ucsC/ndtSpiQY87rA0UjhF+/xQnPzqdBDn4=
|
||||
github.com/containers/image/v5 v5.0.0/go.mod h1:MgiLzCfIeo8lrHi+4Lb8HP+rh513sm0Mlk6RrhjFOLY=
|
||||
github.com/acarl005/stripansi v0.0.0-20180116102854-5a71ef0e047d h1:licZJFw2RwpHMqeKTCYkitsPqHNxTmd4SNR5r94FGM8=
|
||||
github.com/acarl005/stripansi v0.0.0-20180116102854-5a71ef0e047d/go.mod h1:asat636LX7Bqt5lYEZ27JNDcqxfjdBQuJ/MM4CN/Lzo=
|
||||
github.com/alecthomas/template v0.0.0-20160405071501-a0175ee3bccc/go.mod h1:LOuyumcjzFXgccqObfd/Ljyb9UuFJ6TxHnclSeseNhc=
|
||||
github.com/alecthomas/units v0.0.0-20151022065526-2efee857e7cf/go.mod h1:ybxpYRFXyAe+OPACYpWeL0wqObRcbAqCMya13uyzqw0=
|
||||
github.com/armon/consul-api v0.0.0-20180202201655-eb2c6b5be1b6/go.mod h1:grANhF5doyWs3UAsr3K4I6qtAmlQcZDesFNEHPZAzj8=
|
||||
github.com/beorn7/perks v0.0.0-20180321164747-3a771d992973/go.mod h1:Dwedo/Wpr24TaqPxmxbtue+5NUziq4I4S80YR8gNf3Q=
|
||||
github.com/beorn7/perks v1.0.0/go.mod h1:KWe93zE9D1o94FZ5RNwFwVgaQK1VOXiVxmqh+CedLV8=
|
||||
github.com/beorn7/perks v1.0.1 h1:VlbKKnNfV8bJzeqoa4cOKqO6bYr3WgKZxO8Z16+hsOM=
|
||||
github.com/beorn7/perks v1.0.1/go.mod h1:G2ZrVWU2WbWT9wwq4/hrbKbnv/1ERSJQ0ibhJ6rlkpw=
|
||||
github.com/blang/semver v3.1.0+incompatible/go.mod h1:kRBLl5iJ+tD4TcOOxsy/0fnwebNt5EWlYSAyrTnjyyk=
|
||||
github.com/cespare/xxhash v1.1.0/go.mod h1:XrSqR1VqqWfGrhpAt58auRo0WTKS1nRRg3ghfAqPWnc=
|
||||
github.com/client9/misspell v0.3.4/go.mod h1:qj6jICC3Q7zFZvVWo7KLAzC3yx5G7kyvSDkc90ppPyw=
|
||||
github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f h1:tSNMc+rJDfmYntojat8lljbt1mgKNpTxUZJsSzJ9Y1s=
|
||||
github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f/go.mod h1:OApqhQ4XNSNC13gXIwDjhOQxjWa/NxkwZXJ1EvqT0ko=
|
||||
github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1/go.mod h1:Tj/on1eG8kiEhd0+fhSDzsPAFESxzBBvdyEgyryXffw=
|
||||
github.com/containerd/containerd v1.2.10/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA=
|
||||
github.com/containerd/containerd v1.3.0-beta.2.0.20190828155532-0293cbd26c69 h1:rG1clvJbgsUcmb50J82YUJhUMopWNtZvyMZjb+4fqGw=
|
||||
github.com/containerd/containerd v1.3.0-beta.2.0.20190828155532-0293cbd26c69/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA=
|
||||
github.com/containerd/containerd v1.3.2 h1:ForxmXkA6tPIvffbrDAcPUIB32QgXkt2XFj+F0UxetA=
|
||||
github.com/containerd/containerd v1.3.2/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA=
|
||||
github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc h1:TP+534wVlf61smEIq1nwLLAjQVEK2EADoW3CX9AuT+8=
|
||||
github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y=
|
||||
github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448/go.mod h1:ODA38xgv3Kuk8dQz2ZQXpnv/UZZUHUCL7pnLehbXgQI=
|
||||
github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3/go.mod h1:IV7qH3hrUgRmyYrtgEeGWJfWbgcHL9CSRruz2Vqcph0=
|
||||
github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de/go.mod h1:PvCDdDGpgqzQIzDW1TphrGLssLDZp2GuS+X5DkEJB8o=
|
||||
github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd/go.mod h1:Cm3kwCdlkCfMSHURc+r6fwoGH6/F1hH3S4sg0rLFWPc=
|
||||
github.com/containers/common v0.14.0 h1:hiZFDPf6ajKiDmojN5f5X3gboKPO73NLrYb0RXfrQiA=
|
||||
github.com/containers/common v0.14.0/go.mod h1:9olhlE+WhYof1npnMJdyRMX14/yIUint6zyHzcyRVAg=
|
||||
github.com/containers/image/v5 v5.4.4 h1:JSanNn3v/BMd3o0MEvO4R4OKNuoJUSzVGQAI1+0FMXE=
|
||||
github.com/containers/image/v5 v5.4.4/go.mod h1:g7cxNXitiLi6pEr9/L9n/0wfazRuhDKXU15kV86N8h8=
|
||||
github.com/containers/image/v5 v5.5.1 h1:h1FCOXH6Ux9/p/E4rndsQOC4yAdRU0msRTfLVeQ7FDQ=
|
||||
github.com/containers/image/v5 v5.5.1/go.mod h1:4PyNYR0nwlGq/ybVJD9hWlhmIsNra4Q8uOQX2s6E2uM=
|
||||
github.com/containers/libtrust v0.0.0-20190913040956-14b96171aa3b h1:Q8ePgVfHDplZ7U33NwHZkrVELsZP5fYj9pM5WBZB2GE=
|
||||
github.com/containers/libtrust v0.0.0-20190913040956-14b96171aa3b/go.mod h1:9rfv8iPl1ZP7aqh9YA68wnZv2NUDbXdcdPHVz0pFbPY=
|
||||
github.com/containers/storage v1.13.4 h1:j0bBaJDKbUHtAW1MXPFnwXJtqcH+foWeuXK1YaBV5GA=
|
||||
github.com/containers/storage v1.13.4/go.mod h1:6D8nK2sU9V7nEmAraINRs88ZEscM5C5DK+8Npp27GeA=
|
||||
github.com/containers/ocicrypt v1.0.2 h1:Q0/IPs8ohfbXNxEfyJ2pFVmvJu5BhqJUAmc6ES9NKbo=
|
||||
github.com/containers/ocicrypt v1.0.2/go.mod h1:nsOhbP19flrX6rE7ieGFvBlr7modwmNjsqWarIUce4M=
|
||||
github.com/containers/storage v1.19.1 h1:YKIzOO12iaD5Ra0PKFS6emcygbHLmwmQOCQRU/19YAQ=
|
||||
github.com/containers/storage v1.19.1/go.mod h1:KbXjSwKnx17ejOsjFcCXSf78mCgZkQSLPBNTMRc3XrQ=
|
||||
github.com/containers/storage v1.20.2 h1:tw/uKRPDnmVrluIzer3dawTFG/bTJLP8IEUyHFhltYk=
|
||||
github.com/containers/storage v1.20.2/go.mod h1:oOB9Ie8OVPojvoaKWEGSEtHbXUAs+tSyr7RO7ZGteMc=
|
||||
github.com/coreos/bbolt v1.3.2/go.mod h1:iRUV2dpdMOn7Bo10OQBFzIJO9kkE559Wcmn+qkEiiKk=
|
||||
github.com/coreos/etcd v3.3.10+incompatible/go.mod h1:uF7uidLiAD3TWHmW31ZFd/JWoc32PjwdhPthX9715RE=
|
||||
github.com/coreos/go-semver v0.2.0/go.mod h1:nnelYz7RCh+5ahJtPPxZlU+153eP4D4r3EedlOD2RNk=
|
||||
github.com/coreos/go-systemd v0.0.0-20190321100706-95778dfbb74e/go.mod h1:F5haX7vjVVG0kc13fIWeqUViNPyEJxv/OmvnBo0Yme4=
|
||||
github.com/coreos/pkg v0.0.0-20180928190104-399ea9e2e55f/go.mod h1:E3G3o1h8I7cfcXa63jLwjI0eiQQMgzzUDFVpN/nH/eA=
|
||||
github.com/cpuguy83/go-md2man/v2 v2.0.0/go.mod h1:maD7wRr/U5Z6m/iR4s+kqSMx2CaBsrgA7czyZG/E6dU=
|
||||
github.com/davecgh/go-spew v1.1.0/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
|
||||
github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c=
|
||||
github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
|
||||
github.com/docker/distribution v0.0.0-20170817175659-5f6282db7d65 h1:4zlOyrJUbYnrvlzChJ+jP2J3i77Jbhm336NEuCv7kZo=
|
||||
github.com/docker/distribution v0.0.0-20170817175659-5f6282db7d65/go.mod h1:J2gT2udsDAN96Uj4KfcMRqY0/ypR+oyYUYmja8H+y+w=
|
||||
github.com/docker/docker v0.0.0-20171019062838-86f080cff091/go.mod h1:eEKB0N0r5NX/I1kEveEz05bcu8tLC/8azJZsviup8Sk=
|
||||
github.com/docker/docker v0.0.0-20180522102801-da99009bbb11 h1:p8hSDXZgVhyh/C9bPlG8QMY64VeXtVfjmjIlzaQok5Q=
|
||||
github.com/docker/docker v0.0.0-20180522102801-da99009bbb11/go.mod h1:eEKB0N0r5NX/I1kEveEz05bcu8tLC/8azJZsviup8Sk=
|
||||
github.com/docker/docker-credential-helpers v0.6.0 h1:5bhDRLn1roGiNjz8IezRngHxMfoeaXGyr0BeMHq4rD8=
|
||||
github.com/docker/docker-credential-helpers v0.6.0/go.mod h1:WRaJzqw3CTB9bk10avuGsjVBZsD05qeibJ1/TYlvc0Y=
|
||||
github.com/docker/go-connections v0.0.0-20180212134524-7beb39f0b969 h1:p2WzwcFof6KwsloLgCiAKkU5DJSVgOKGdevswAmskvY=
|
||||
github.com/docker/go-connections v0.0.0-20180212134524-7beb39f0b969/go.mod h1:Gbd7IOopHjR8Iph03tsViu4nIes5XhDvyHbTtUxmeec=
|
||||
github.com/dgrijalva/jwt-go v3.2.0+incompatible/go.mod h1:E3ru+11k8xSBh+hMPgOLZmtrrCbhqsmaPHjLKYnJCaQ=
|
||||
github.com/dgryski/go-sip13 v0.0.0-20181026042036-e10d5fee7954/go.mod h1:vAd38F8PWV+bWy6jNmig1y/TA+kYO4g3RSRF0IAv0no=
|
||||
github.com/docker/distribution v2.7.1+incompatible h1:a5mlkVzth6W5A4fOsS3D2EO5BUmsJpcB+cRlLU7cSug=
|
||||
github.com/docker/distribution v2.7.1+incompatible/go.mod h1:J2gT2udsDAN96Uj4KfcMRqY0/ypR+oyYUYmja8H+y+w=
|
||||
github.com/docker/docker v1.4.2-0.20191219165747-a9416c67da9f h1:Sm8iD2lifO31DwXfkGzq8VgA7rwxPjRsYmeo0K/dF9Y=
|
||||
github.com/docker/docker v1.4.2-0.20191219165747-a9416c67da9f/go.mod h1:eEKB0N0r5NX/I1kEveEz05bcu8tLC/8azJZsviup8Sk=
|
||||
github.com/docker/docker-credential-helpers v0.6.3 h1:zI2p9+1NQYdnG6sMU26EX4aVGlqbInSQxQXLvzJ4RPQ=
|
||||
github.com/docker/docker-credential-helpers v0.6.3/go.mod h1:WRaJzqw3CTB9bk10avuGsjVBZsD05qeibJ1/TYlvc0Y=
|
||||
github.com/docker/go-connections v0.4.0 h1:El9xVISelRB7BuFusrZozjnkIM5YnzCViNKohAFqRJQ=
|
||||
github.com/docker/go-connections v0.4.0/go.mod h1:Gbd7IOopHjR8Iph03tsViu4nIes5XhDvyHbTtUxmeec=
|
||||
github.com/docker/go-metrics v0.0.1 h1:AgB/0SvBxihN0X8OR4SjsblXkbMvalQ8cjmtKQ2rQV8=
|
||||
github.com/docker/go-metrics v0.0.1/go.mod h1:cG1hvH2utMXtqgqqYE9plW6lDxS3/5ayHzueweSI3Vw=
|
||||
github.com/docker/go-units v0.4.0 h1:3uh0PgVws3nIA0Q+MwDC8yjEPf9zjRfZZWXZYDct3Tw=
|
||||
github.com/docker/go-units v0.4.0/go.mod h1:fgPhTUdO+D/Jk86RDLlptpiXQzgHJF7gydDDbaIK4Dk=
|
||||
github.com/docker/libtrust v0.0.0-20160708172513-aabc10ec26b7 h1:UhxFibDNY/bfvqU5CAUmr9zpesgbU6SWc8/B4mflAE4=
|
||||
@@ -42,143 +82,370 @@ github.com/docker/libtrust v0.0.0-20160708172513-aabc10ec26b7/go.mod h1:cyGadeNE
|
||||
github.com/dsnet/compress v0.0.1 h1:PlZu0n3Tuv04TzpfPbrnI0HW/YwodEXDS+oPKahKF0Q=
|
||||
github.com/dsnet/compress v0.0.1/go.mod h1:Aw8dCMJ7RioblQeTqt88akK31OvO8Dhf5JflhBbQEHo=
|
||||
github.com/dsnet/golib v0.0.0-20171103203638-1ea166775780/go.mod h1:Lj+Z9rebOhdfkVLjJ8T6VcRQv3SXugXy999NBtR9aFY=
|
||||
github.com/etcd-io/bbolt v1.3.3 h1:gSJmxrs37LgTqR/oyJBWok6k6SvXEUerFTbltIhXkBM=
|
||||
github.com/etcd-io/bbolt v1.3.3/go.mod h1:ZF2nL25h33cCyBtcyWeZ2/I3HQOfTP+0PIEvHjkjCrw=
|
||||
github.com/ghodss/yaml v0.0.0-20161207003320-04f313413ffd h1:U3yHrYB7NWH2o3UFzJ1J+TknZqM9QQtF8KVIE6Qzrfs=
|
||||
github.com/ghodss/yaml v0.0.0-20161207003320-04f313413ffd/go.mod h1:4dBDuWmgqj2HViK6kFavaiC9ZROes6MMH2rRYeMEF04=
|
||||
github.com/fsnotify/fsnotify v1.4.7/go.mod h1:jwhsz4b93w/PPRr/qN1Yymfu8t87LnFCMoQvtojpjFo=
|
||||
github.com/fsnotify/fsnotify v1.4.9/go.mod h1:znqG4EE+3YCdAaPaxE2ZRY/06pZUdp0tY4IgpuI1SZQ=
|
||||
github.com/fullsailor/pkcs7 v0.0.0-20190404230743-d7302db945fa h1:RDBNVkRviHZtvDvId8XSGPu3rmpmSe+wKRcEWNgsfWU=
|
||||
github.com/fullsailor/pkcs7 v0.0.0-20190404230743-d7302db945fa/go.mod h1:KnogPXtdwXqoenmZCw6S+25EAm2MkxbG0deNDu4cbSA=
|
||||
github.com/ghodss/yaml v1.0.0 h1:wQHKEahhL6wmXdzwWG11gIVCkOv05bNOh+Rxn0yngAk=
|
||||
github.com/ghodss/yaml v1.0.0/go.mod h1:4dBDuWmgqj2HViK6kFavaiC9ZROes6MMH2rRYeMEF04=
|
||||
github.com/go-check/check v0.0.0-20180628173108-788fd7840127 h1:0gkP6mzaMqkmpcJYCFOLkIBwI7xFExG03bbkOkCvUPI=
|
||||
github.com/go-check/check v0.0.0-20180628173108-788fd7840127/go.mod h1:9ES+weclKsC9YodN5RgxqK/VD9HM9JsCSh7rNhMZE98=
|
||||
github.com/gogo/protobuf v0.0.0-20170815085658-fcdc5011193f h1:r/AdTzqktq9nQpFlFePWcp+scVi+oFRajfjRJ3UnETg=
|
||||
github.com/gogo/protobuf v0.0.0-20170815085658-fcdc5011193f/go.mod h1:r8qH/GZQm5c6nD/R0oafs1akxWv10x8SbQlK7atdtwQ=
|
||||
github.com/google/go-cmp v0.2.0 h1:+dTQ8DZQJz0Mb/HjFlkptS1FeQ4cWSnN941F8aEG4SQ=
|
||||
github.com/go-kit/kit v0.8.0/go.mod h1:xBxKIO96dXMWWy0MnWVtmwkA9/13aqxPnvrjFYMA2as=
|
||||
github.com/go-logfmt/logfmt v0.3.0/go.mod h1:Qt1PoO58o5twSAckw1HlFXLmHsOX5/0LbT9GBnD5lWE=
|
||||
github.com/go-logfmt/logfmt v0.4.0/go.mod h1:3RMwSq7FuexP4Kalkev3ejPJsZTpXXBr9+V4qmtdjCk=
|
||||
github.com/go-stack/stack v1.8.0/go.mod h1:v0f6uXyyMGvRgIKkXu+yp6POWl0qKG85gN/melR3HDY=
|
||||
github.com/godbus/dbus v0.0.0-20190422162347-ade71ed3457e/go.mod h1:bBOAhwG1umN6/6ZUMtDFBMQR8jRg9O75tm9K00oMsK4=
|
||||
github.com/gogo/protobuf v1.1.1/go.mod h1:r8qH/GZQm5c6nD/R0oafs1akxWv10x8SbQlK7atdtwQ=
|
||||
github.com/gogo/protobuf v1.2.1/go.mod h1:hp+jE20tsWTFYpLwKvXlhS1hjn+gTNwPg2I6zVXpSg4=
|
||||
github.com/gogo/protobuf v1.3.1 h1:DqDEcV5aeaTmdFBePNpYsp3FlcVH/2ISVVM9Qf8PSls=
|
||||
github.com/gogo/protobuf v1.3.1/go.mod h1:SlYgWuQ5SjCEi6WLHjHCa1yvBfUnHcTbrrZtXPKa29o=
|
||||
github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b h1:VKtxabqXZkF25pY9ekfRL6a582T4P37/31XEstQ5p58=
|
||||
github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b/go.mod h1:SBH7ygxi8pfUlaOkMMuAQtPIUF8ecWP5IEl/CR7VP2Q=
|
||||
github.com/golang/groupcache v0.0.0-20190129154638-5b532d6fd5ef/go.mod h1:cIg4eruTrX1D+g88fzRXU5OdNfaM+9IcxsU14FzY7Hc=
|
||||
github.com/golang/mock v1.1.1/go.mod h1:oTYuIxOrZwtPieC+H1uAHpcLFnEyAGVDL/k47Jfbm0A=
|
||||
github.com/golang/protobuf v1.2.0/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U=
|
||||
github.com/golang/protobuf v1.3.1/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U=
|
||||
github.com/golang/protobuf v1.3.2 h1:6nsPYzhq5kReh6QImI3k5qWzO4PEbvbIW2cwSfR/6xs=
|
||||
github.com/golang/protobuf v1.3.2/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U=
|
||||
github.com/golang/protobuf v1.4.0-rc.1/go.mod h1:ceaxUfeHdC40wWswd/P6IGgMaK3YpKi5j83Wpe3EHw8=
|
||||
github.com/golang/protobuf v1.4.0-rc.1.0.20200221234624-67d41d38c208/go.mod h1:xKAWHe0F5eneWXFV3EuXVDTCmh+JuBKY0li0aMyXATA=
|
||||
github.com/golang/protobuf v1.4.0-rc.2/go.mod h1:LlEzMj4AhA7rCAGe4KMBDvJI+AwstrUpVNzEA03Pprs=
|
||||
github.com/golang/protobuf v1.4.0-rc.4.0.20200313231945-b860323f09d0/go.mod h1:WU3c8KckQ9AFe+yFwt9sWVRKCVIyN9cPHBJSNnbL67w=
|
||||
github.com/golang/protobuf v1.4.0/go.mod h1:jodUvKwWbYaEsadDk5Fwe5c77LiNKVO9IDvqG2KuDX0=
|
||||
github.com/golang/protobuf v1.4.2 h1:+Z5KGCizgyZCbGh1KZqA0fcLLkwbsjIzS4aV2v7wJX0=
|
||||
github.com/golang/protobuf v1.4.2/go.mod h1:oDoupMAO8OvCJWAcko0GGGIgR6R6ocIYbsSw735rRwI=
|
||||
github.com/google/btree v1.0.0/go.mod h1:lNA+9X1NB3Zf8V7Ke586lFgjr2dZNuvo3lPJSGZ5JPQ=
|
||||
github.com/google/go-cmp v0.2.0/go.mod h1:oXzfMopK8JAjlY9xF4vHSVASa0yLyX7SntLO5aqRK0M=
|
||||
github.com/gorilla/context v1.1.1 h1:AWwleXJkX/nhcU9bZSnZoi3h/qGYqQAGhq6zZe/aQW8=
|
||||
github.com/gorilla/context v1.1.1/go.mod h1:kBGZzfjB9CEq2AlWe17Uuf7NDRt0dE0s8S51q0aT7Yg=
|
||||
github.com/gorilla/mux v0.0.0-20170217192616-94e7d24fd285 h1:pBGAMRKP7Tpv4mOq+RgzKz+jAj+ylo9O8PiNoMmCuu8=
|
||||
github.com/gorilla/mux v0.0.0-20170217192616-94e7d24fd285/go.mod h1:1lud6UwP+6orDFRuTfBEV8e9/aOM/c4fVVCaMa2zaAs=
|
||||
github.com/gotestyourself/gotestyourself v2.2.0+incompatible h1:AQwinXlbQR2HvPjQZOmDhRqsv5mZf+Jb1RnSLxcqZcI=
|
||||
github.com/gotestyourself/gotestyourself v2.2.0+incompatible/go.mod h1:zZKM6oeNM8k+FRljX1mnzVYeS8wiGgQyvST1/GafPbY=
|
||||
github.com/imdario/mergo v0.3.5 h1:JboBksRwiiAJWvIYJVo46AfV+IAIKZpfrSzVKj42R4Q=
|
||||
github.com/imdario/mergo v0.3.5/go.mod h1:2EnlNZ0deacrJVfApfmtdGgDfMuh/nq6Ok1EcJh5FfA=
|
||||
github.com/klauspost/compress v1.4.1 h1:8VMb5+0wMgdBykOV96DwNwKFQ+WTI4pzYURP99CcB9E=
|
||||
github.com/google/go-cmp v0.3.0/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU=
|
||||
github.com/google/go-cmp v0.3.1 h1:Xye71clBPdm5HgqGwUkwhbynsUJZhDbS20FvLhQ2izg=
|
||||
github.com/google/go-cmp v0.3.1/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU=
|
||||
github.com/google/go-cmp v0.4.0 h1:xsAVV57WRhGj6kEIi8ReJzQlHHqcBYCElAvkovg3B/4=
|
||||
github.com/google/go-cmp v0.4.0/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE=
|
||||
github.com/google/gofuzz v1.0.0/go.mod h1:dBl0BpW6vV/+mYPU4Po3pmUjxk6FQPldtuIdl/M65Eg=
|
||||
github.com/gorilla/mux v1.7.4 h1:VuZ8uybHlWmqV03+zRzdwKL4tUnIp1MAQtp1mIFE1bc=
|
||||
github.com/gorilla/mux v1.7.4/go.mod h1:DVbg23sWSpFRCP0SfiEN6jmj59UnW/n46BH5rLB71So=
|
||||
github.com/gorilla/websocket v1.4.0/go.mod h1:E7qHFY5m1UJ88s3WnNqhKjPHQ0heANvMoAMk2YaljkQ=
|
||||
github.com/grpc-ecosystem/go-grpc-middleware v1.0.0/go.mod h1:FiyG127CGDf3tlThmgyCl78X/SZQqEOJBCDaAfeWzPs=
|
||||
github.com/grpc-ecosystem/go-grpc-prometheus v1.2.0/go.mod h1:8NvIoxWQoOIhqOTXgfV/d3M/q6VIi02HzZEHgUlZvzk=
|
||||
github.com/grpc-ecosystem/grpc-gateway v1.9.0/go.mod h1:vNeuVxBJEsws4ogUvrchl83t/GYV9WGTSLVdBhOQFDY=
|
||||
github.com/hashicorp/errwrap v0.0.0-20141028054710-7554cd9344ce/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4=
|
||||
github.com/hashicorp/errwrap v1.0.0 h1:hLrqtEDnRye3+sgx6z4qVLNuviH3MR5aQ0ykNJa/UYA=
|
||||
github.com/hashicorp/errwrap v1.0.0/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4=
|
||||
github.com/hashicorp/go-multierror v0.0.0-20161216184304-ed905158d874/go.mod h1:JMRHfdO9jKNzS/+BTlxCjKNQHg/jZAft8U7LloJvN7I=
|
||||
github.com/hashicorp/go-multierror v1.0.0 h1:iVjPR7a6H0tWELX5NxNe7bYopibicUzc7uPribsnS6o=
|
||||
github.com/hashicorp/go-multierror v1.0.0/go.mod h1:dHtQlpGsu+cZNNAkkCN/P3hoUDHhCYQXV3UM06sGGrk=
|
||||
github.com/hashicorp/golang-lru v0.5.1 h1:0hERBMJE1eitiLkihrMvRVBYAkpHzc/J3QdDN+dAcgU=
|
||||
github.com/hashicorp/golang-lru v0.5.1/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8=
|
||||
github.com/hashicorp/hcl v1.0.0/go.mod h1:E5yfLk+7swimpb2L/Alb/PJmXilQ/rhwaUYs4T20WEQ=
|
||||
github.com/hpcloud/tail v1.0.0/go.mod h1:ab1qPbhIpdTxEkNHXyeSf5vhxWSCs/tWer42PpOxQnU=
|
||||
github.com/imdario/mergo v0.3.9 h1:UauaLniWCFHWd+Jp9oCEkTBj8VO/9DKg3PV3VCNMDIg=
|
||||
github.com/imdario/mergo v0.3.9/go.mod h1:2EnlNZ0deacrJVfApfmtdGgDfMuh/nq6Ok1EcJh5FfA=
|
||||
github.com/inconshreveable/mousetrap v1.0.0 h1:Z8tu5sraLXCXIcARxBp/8cbvlwVa7Z1NHg9XEKhtSvM=
|
||||
github.com/inconshreveable/mousetrap v1.0.0/go.mod h1:PxqpIevigyE2G7u3NXJIT2ANytuPF1OarO4DADm73n8=
|
||||
github.com/jonboulle/clockwork v0.1.0/go.mod h1:Ii8DK3G1RaLaWxj9trq07+26W01tbo22gdxWY5EU2bo=
|
||||
github.com/json-iterator/go v1.1.6/go.mod h1:+SdeFBvtyEkXs7REEP0seUULqWtbJapLOCVDaaPEHmU=
|
||||
github.com/json-iterator/go v1.1.7/go.mod h1:KdQUCv79m/52Kvf8AW2vK1V8akMuk1QjK/uOdHXbAo4=
|
||||
github.com/julienschmidt/httprouter v1.2.0/go.mod h1:SYymIcj16QtmaHHD7aYtjjsJG7VTCxuUUipMqKk8s4w=
|
||||
github.com/kisielk/errcheck v1.1.0/go.mod h1:EZBBE59ingxPouuu3KfxchcWSUPOHkagtvWXihfKN4Q=
|
||||
github.com/kisielk/errcheck v1.2.0/go.mod h1:/BMXB+zMLi60iA8Vv6Ksmxu/1UDYcXs4uQLJ+jE2L00=
|
||||
github.com/kisielk/gotool v1.0.0/go.mod h1:XhKaO+MFFWcvkIS/tQcRk01m1F5IRFswLeQ+oQHNcck=
|
||||
github.com/klauspost/compress v1.4.1/go.mod h1:RyIbtBH6LamlWaDj8nUwkbUhJ87Yi3uG0guNDohfE1A=
|
||||
github.com/klauspost/compress v1.7.2 h1:liMOoeIvFpr9kEvalrZ7VVBA4wGf7zfOgwBjzz/5g2Y=
|
||||
github.com/klauspost/compress v1.7.2/go.mod h1:RyIbtBH6LamlWaDj8nUwkbUhJ87Yi3uG0guNDohfE1A=
|
||||
github.com/klauspost/compress v1.8.1 h1:oygt2ychZFHOB6M9gUgajzgKrwRgHbGC77NwA4COVgI=
|
||||
github.com/klauspost/compress v1.8.1/go.mod h1:RyIbtBH6LamlWaDj8nUwkbUhJ87Yi3uG0guNDohfE1A=
|
||||
github.com/klauspost/cpuid v1.2.0 h1:NMpwD2G9JSFOE1/TJjGSo5zG7Yb2bTe7eq1jH+irmeE=
|
||||
github.com/klauspost/compress v1.10.5 h1:7q6vHIqubShURwQz8cQK6yIe/xC3IF0Vm7TGfqjewrc=
|
||||
github.com/klauspost/compress v1.10.5/go.mod h1:aoV0uJVorq1K+umq18yTdKaF57EivdYsUV+/s2qKfXs=
|
||||
github.com/klauspost/compress v1.10.7 h1:7rix8v8GpI3ZBb0nSozFRgbtXKv+hOe+qfEpZqybrAg=
|
||||
github.com/klauspost/compress v1.10.7/go.mod h1:aoV0uJVorq1K+umq18yTdKaF57EivdYsUV+/s2qKfXs=
|
||||
github.com/klauspost/compress v1.10.8 h1:eLeJ3dr/Y9+XRfJT4l+8ZjmtB5RPJhucH2HeCV5+IZY=
|
||||
github.com/klauspost/compress v1.10.8/go.mod h1:aoV0uJVorq1K+umq18yTdKaF57EivdYsUV+/s2qKfXs=
|
||||
github.com/klauspost/cpuid v1.2.0/go.mod h1:Pj4uuM528wm8OyEC2QMXAi2YiTZ96dNQPGgoMS4s3ek=
|
||||
github.com/klauspost/cpuid v1.2.1 h1:vJi+O/nMdFt0vqm8NZBI6wzALWdA2X+egi0ogNyrC/w=
|
||||
github.com/klauspost/cpuid v1.2.1/go.mod h1:Pj4uuM528wm8OyEC2QMXAi2YiTZ96dNQPGgoMS4s3ek=
|
||||
github.com/klauspost/pgzip v1.2.1 h1:oIPZROsWuPHpOdMVWLuJZXwgjhrW8r1yEX8UqMyeNHM=
|
||||
github.com/klauspost/pgzip v1.2.1/go.mod h1:Ch1tH69qFZu15pkjo5kYi6mth2Zzwzt50oCQKQE9RUs=
|
||||
github.com/konsorten/go-windows-terminal-sequences v1.0.1 h1:mweAR1A6xJ3oS2pRaGiHgQ4OO8tzTaLawm8vnODuwDk=
|
||||
github.com/klauspost/pgzip v1.2.3 h1:Ce2to9wvs/cuJ2b86/CKQoTYr9VHfpanYosZ0UBJqdw=
|
||||
github.com/klauspost/pgzip v1.2.3/go.mod h1:Ch1tH69qFZu15pkjo5kYi6mth2Zzwzt50oCQKQE9RUs=
|
||||
github.com/klauspost/pgzip v1.2.4 h1:TQ7CNpYKovDOmqzRHKxJh0BeaBI7UdQZYc6p7pMQh1A=
|
||||
github.com/klauspost/pgzip v1.2.4/go.mod h1:Ch1tH69qFZu15pkjo5kYi6mth2Zzwzt50oCQKQE9RUs=
|
||||
github.com/konsorten/go-windows-terminal-sequences v1.0.1/go.mod h1:T0+1ngSBFLxvqU3pZ+m/2kptfBszLMUkC4ZK/EgS/cQ=
|
||||
github.com/konsorten/go-windows-terminal-sequences v1.0.2 h1:DB17ag19krx9CFsz4o3enTrPXyIXCl+2iCXH/aMAp9s=
|
||||
github.com/konsorten/go-windows-terminal-sequences v1.0.2/go.mod h1:T0+1ngSBFLxvqU3pZ+m/2kptfBszLMUkC4ZK/EgS/cQ=
|
||||
github.com/konsorten/go-windows-terminal-sequences v1.0.3 h1:CE8S1cTafDpPvMhIxNJKvHsGVBgn1xWYf1NbHQhywc8=
|
||||
github.com/konsorten/go-windows-terminal-sequences v1.0.3/go.mod h1:T0+1ngSBFLxvqU3pZ+m/2kptfBszLMUkC4ZK/EgS/cQ=
|
||||
github.com/kr/logfmt v0.0.0-20140226030751-b84e30acd515/go.mod h1:+0opPa2QZZtGFBFZlji/RkVcI2GknAs/DXo4wKdlNEc=
|
||||
github.com/kr/pretty v0.1.0 h1:L/CwN0zerZDmRFUapSPitk6f+Q3+0za1rQkzVuMiMFI=
|
||||
github.com/kr/pretty v0.1.0/go.mod h1:dAy3ld7l9f0ibDNOQOHHMYYIIbhfbHSm3C4ZsoJORNo=
|
||||
github.com/kr/pty v1.1.1/go.mod h1:pFQYn66WHrOpPYNljwOMqo10TkYh1fy3cYio2l3bCsQ=
|
||||
github.com/kr/text v0.1.0 h1:45sCR5RtlFHMR4UwH9sdQ5TC8v0qDQCHnXt+kaKSTVE=
|
||||
github.com/kr/text v0.1.0/go.mod h1:4Jbv+DJW3UT/LiOwJeYQe1efqtUx/iVham/4vfdArNI=
|
||||
github.com/mattn/go-isatty v0.0.4 h1:bnP0vzxcAdeI1zdubAl5PjU6zsERjGZb7raWodagDYs=
|
||||
github.com/mattn/go-isatty v0.0.4/go.mod h1:M+lRXTBqGeGNdLjl/ufCoiOlB5xdOkqRJdNxMWT7Zi4=
|
||||
github.com/mattn/go-shellwords v1.0.5 h1:JhhFTIOslh5ZsPrpa3Wdg8bF0WI3b44EMblmU9wIsXc=
|
||||
github.com/mattn/go-shellwords v1.0.5/go.mod h1:3xCvwCdWdlDJUrvuMn7Wuy9eWs4pE8vqg+NOMyg4B2o=
|
||||
github.com/magiconair/properties v1.8.0/go.mod h1:PppfXfuXeibc/6YijjN8zIbojt8czPbwD3XqdrwzmxQ=
|
||||
github.com/mattn/go-isatty v0.0.12 h1:wuysRhFDzyxgEmMf5xjvJ2M9dZoWAXNNr5LSBS7uHXY=
|
||||
github.com/mattn/go-isatty v0.0.12/go.mod h1:cbi8OIDigv2wuxKPP5vlRcQ1OAZbq2CE4Kysco4FUpU=
|
||||
github.com/mattn/go-runewidth v0.0.9 h1:Lm995f3rfxdpd6TSmuVCHVb/QhupuXlYr8sCI/QdE+0=
|
||||
github.com/mattn/go-runewidth v0.0.9/go.mod h1:H031xJmbD/WCDINGzjvQ9THkh0rPKHF+m2gUSrubnMI=
|
||||
github.com/mattn/go-shellwords v1.0.10 h1:Y7Xqm8piKOO3v10Thp7Z36h4FYFjt5xB//6XvOrs2Gw=
|
||||
github.com/mattn/go-shellwords v1.0.10/go.mod h1:EZzvwXDESEeg03EKmM+RmDnNOPKG4lLtQsUlTZDWQ8Y=
|
||||
github.com/matttproud/golang_protobuf_extensions v1.0.1 h1:4hp9jkHxhMHkqkrB3Ix0jegS5sx/RkqARlsWZ6pIwiU=
|
||||
github.com/matttproud/golang_protobuf_extensions v1.0.1/go.mod h1:D8He9yQNgCq6Z5Ld7szi9bcBfOoFv/3dc6xSMkL2PC0=
|
||||
github.com/mistifyio/go-zfs v2.1.1+incompatible h1:gAMO1HM9xBRONLHHYnu5iFsOJUiJdNZo6oqSENd4eW8=
|
||||
github.com/mistifyio/go-zfs v2.1.1+incompatible/go.mod h1:8AuVvqP/mXw1px98n46wfvcGfQ4ci2FwoAjKYxuo3Z4=
|
||||
github.com/mtrmac/gpgme v0.0.0-20170102180018-b2432428689c h1:xa+eQWKuJ9MbB9FBL/eoNvDFvveAkz2LQoz8PzX7Q/4=
|
||||
github.com/mtrmac/gpgme v0.0.0-20170102180018-b2432428689c/go.mod h1:GhAqVMEWnTcW2dxoD/SO3n2enrgWl3y6Dnx4m59GvcA=
|
||||
github.com/mtrmac/image/v4 v4.0.0-20191002203927-a64d9d2717f4 h1:AE5cilZfrGtAgMg5Ed4c2Y2KczlOsMVZAK055sSq+gc=
|
||||
github.com/mtrmac/image/v4 v4.0.0-20191002203927-a64d9d2717f4/go.mod h1:0ASJH1YgJiX/eqFZObqepgsvIA4XjCgpyfwn9pDGafA=
|
||||
github.com/mtrmac/image/v4 v4.0.0-20191003181245-f4c983e93262 h1:HMUEnWU3OPT09JRFQLn8VTp3GfdfiEhDMAEhkdX8QnA=
|
||||
github.com/mtrmac/image/v4 v4.0.0-20191003181245-f4c983e93262/go.mod h1:0ASJH1YgJiX/eqFZObqepgsvIA4XjCgpyfwn9pDGafA=
|
||||
github.com/mtrmac/image/v4 v4.0.0-20191003205427-4e53c7e04270 h1:pDOlOCB9naHCcv/RXWO129Dd03r710hQ2N83egZIf7A=
|
||||
github.com/mtrmac/image/v4 v4.0.0-20191003205427-4e53c7e04270/go.mod h1:0ASJH1YgJiX/eqFZObqepgsvIA4XjCgpyfwn9pDGafA=
|
||||
github.com/mitchellh/go-homedir v1.1.0/go.mod h1:SfyaCUpYCn1Vlf4IUYiD9fPX4A5wJrkLzIz1N1q0pr0=
|
||||
github.com/mitchellh/mapstructure v1.1.2/go.mod h1:FVVH3fgwuzCH5S8UJGiWEs2h04kUh9fWfEaFds41c1Y=
|
||||
github.com/modern-go/concurrent v0.0.0-20180228061459-e0a39a4cb421/go.mod h1:6dJC0mAP4ikYIbvyc7fijjWJddQyLn8Ig3JB5CqoB9Q=
|
||||
github.com/modern-go/concurrent v0.0.0-20180306012644-bacd9c7ef1dd/go.mod h1:6dJC0mAP4ikYIbvyc7fijjWJddQyLn8Ig3JB5CqoB9Q=
|
||||
github.com/modern-go/reflect2 v0.0.0-20180701023420-4b7aa43c6742/go.mod h1:bx2lNnkwVCuqBIxFjflWJWanXIb3RllmbCylyMrvgv0=
|
||||
github.com/modern-go/reflect2 v1.0.1/go.mod h1:bx2lNnkwVCuqBIxFjflWJWanXIb3RllmbCylyMrvgv0=
|
||||
github.com/morikuni/aec v1.0.0 h1:nP9CBfwrvYnBRgY6qfDQkygYDmYwOilePFkwzv4dU8A=
|
||||
github.com/morikuni/aec v1.0.0/go.mod h1:BbKIizmSmc5MMPqRYbxO4ZU0S0+P200+tUnFx7PXmsc=
|
||||
github.com/mtrmac/gpgme v0.1.2 h1:dNOmvYmsrakgW7LcgiprD0yfRuQQe8/C8F6Z+zogO3s=
|
||||
github.com/mtrmac/gpgme v0.1.2/go.mod h1:GYYHnGSuS7HK3zVS2n3y73y0okK/BeKzwnn5jgiVFNI=
|
||||
github.com/mwitkow/go-conntrack v0.0.0-20161129095857-cc309e4a2223/go.mod h1:qRWi+5nqEBWmkhHvq77mSJWrCKwh8bxhgT7d/eI7P4U=
|
||||
github.com/nxadm/tail v1.4.4/go.mod h1:kenIhsEOeOJmVchQTgglprH7qJGnHDVpk1VPCcaMI8A=
|
||||
github.com/oklog/ulid v1.3.1/go.mod h1:CirwcVhetQ6Lv90oh/F+FBtV6XMibvdAFo93nm5qn4U=
|
||||
github.com/onsi/ginkgo v1.6.0/go.mod h1:lLunBs/Ym6LB5Z9jYTR76FiuTmxDTDusOGeTQH+WWjE=
|
||||
github.com/onsi/ginkgo v1.12.1/go.mod h1:zj2OWP4+oCPe1qIXoGWkgMRwljMUYCdkwsT2108oapk=
|
||||
github.com/onsi/ginkgo v1.13.0/go.mod h1:+REjRxOmWfHCjfv9TTWB1jD1Frx4XydAD3zm1lskyM0=
|
||||
github.com/onsi/gomega v1.7.1/go.mod h1:XdKZgCCFLUoM/7CFJVPcG8C1xQ1AJ0vpAezJrB7JYyY=
|
||||
github.com/onsi/gomega v1.10.1/go.mod h1:iN09h71vgCQne3DLsj+A5owkum+a2tYe+TOCB1ybHNo=
|
||||
github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s=
|
||||
github.com/opencontainers/go-digest v1.0.0-rc1 h1:WzifXhOVOEOuFYOJAW6aQqW0TooG2iki3E3Ii+WN7gQ=
|
||||
github.com/opencontainers/go-digest v1.0.0-rc1/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s=
|
||||
github.com/opencontainers/go-digest v1.0.0 h1:apOUWs51W5PlhuyGyz9FCeeBIOUDA/6nW8Oi/yOhh5U=
|
||||
github.com/opencontainers/go-digest v1.0.0/go.mod h1:0JzlMkj0TRzQZfJkVvzbP0HBR3IKzErnv2BNG4W4MAM=
|
||||
github.com/opencontainers/image-spec v1.0.1/go.mod h1:BtxoFyWECRxE4U/7sNtV5W15zMzWCbyJoFRP3s7yZA0=
|
||||
github.com/opencontainers/image-spec v1.0.2-0.20190823105129-775207bd45b6 h1:yN8BPXVwMBAm3Cuvh1L5XE8XpvYRMdsVLd82ILprhUU=
|
||||
github.com/opencontainers/image-spec v1.0.2-0.20190823105129-775207bd45b6/go.mod h1:BtxoFyWECRxE4U/7sNtV5W15zMzWCbyJoFRP3s7yZA0=
|
||||
github.com/opencontainers/image-tools v0.0.0-20170926011501-6d941547fa1d h1:X9WSFjjZNqYRqO2MenUgqE2nj/oydcfIzXJ0R/SVnnA=
|
||||
github.com/opencontainers/image-tools v0.0.0-20170926011501-6d941547fa1d/go.mod h1:A9btVpZLzttF4iFaKNychhPyrhfOjJ1OF5KrA8GcLj4=
|
||||
github.com/opencontainers/runc v1.0.0-rc8 h1:dDCFes8Hj1r/i5qnypONo5jdOme/8HWZC/aNDyhECt0=
|
||||
github.com/opencontainers/runc v1.0.0-rc8/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U=
|
||||
github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U=
|
||||
github.com/opencontainers/runc v1.0.0-rc9 h1:/k06BMULKF5hidyoZymkoDCzdJzltZpz/UU4LguQVtc=
|
||||
github.com/opencontainers/runc v1.0.0-rc9/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U=
|
||||
github.com/opencontainers/runc v1.0.0-rc90 h1:4+xo8mtWixbHoEm451+WJNUrq12o2/tDsyK9Vgc/NcA=
|
||||
github.com/opencontainers/runc v1.0.0-rc90/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U=
|
||||
github.com/opencontainers/runtime-spec v0.1.2-0.20190507144316-5b71a03e2700/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0=
|
||||
github.com/opencontainers/runtime-spec v0.1.2-0.20190618234442-a950415649c7/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0=
|
||||
github.com/opencontainers/runtime-spec v1.0.0 h1:O6L965K88AilqnxeYPks/75HLpp4IG+FjeSCI3cVdRg=
|
||||
github.com/opencontainers/runtime-spec v1.0.0/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0=
|
||||
github.com/opencontainers/selinux v1.2.2 h1:Kx9J6eDG5/24A6DtUquGSpJQ+m2MUTahn4FtGEe8bFg=
|
||||
github.com/opencontainers/selinux v1.2.2/go.mod h1:+BLncwf63G4dgOzykXAxcmnFlUaOlkDdmw/CqsW6pjs=
|
||||
github.com/opencontainers/runtime-tools v0.0.0-20181011054405-1d69bd0f9c39/go.mod h1:r3f7wjNzSs2extwzU3Y+6pKfobzPh+kKFJ3ofN+3nfs=
|
||||
github.com/opencontainers/selinux v1.5.1 h1:jskKwSMFYqyTrHEuJgQoUlTcId0av64S6EWObrIfn5Y=
|
||||
github.com/opencontainers/selinux v1.5.1/go.mod h1:yTcKuYAh6R95iDpefGLQaPaRwJFwyzAJufJyiTt7s0g=
|
||||
github.com/opencontainers/selinux v1.5.2 h1:F6DgIsjgBIcDksLW4D5RG9bXok6oqZ3nvMwj4ZoFu/Q=
|
||||
github.com/opencontainers/selinux v1.5.2/go.mod h1:yTcKuYAh6R95iDpefGLQaPaRwJFwyzAJufJyiTt7s0g=
|
||||
github.com/ostreedev/ostree-go v0.0.0-20190702140239-759a8c1ac913 h1:TnbXhKzrTOyuvWrjI8W6pcoI9XPbLHFXCdN2dtUw7Rw=
|
||||
github.com/ostreedev/ostree-go v0.0.0-20190702140239-759a8c1ac913/go.mod h1:J6OG6YJVEWopen4avK3VNQSnALmmjvniMmni/YFYAwc=
|
||||
github.com/pelletier/go-toml v1.2.0/go.mod h1:5z9KED0ma1S8pY6P1sdut58dfprrGBbd/94hg7ilaic=
|
||||
github.com/pkg/errors v0.8.0/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0=
|
||||
github.com/pkg/errors v0.8.1 h1:iURUrRGxPUNPdy5/HRSm+Yj6okJ6UtLINN0Q9M4+h3I=
|
||||
github.com/pkg/errors v0.8.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0=
|
||||
github.com/pkg/errors v0.9.1 h1:FEBLx1zS214owpjy7qsBeixbURkuhQAwrK5UwLGTwt4=
|
||||
github.com/pkg/errors v0.9.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0=
|
||||
github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM=
|
||||
github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4=
|
||||
github.com/pquerna/ffjson v0.0.0-20181028064349-e517b90714f7 h1:gGBSHPOU7g8YjTbhwn+lvFm2VDEhhA+PwDIlstkgSxE=
|
||||
github.com/pquerna/ffjson v0.0.0-20181028064349-e517b90714f7/go.mod h1:YARuvh7BUWHNhzDq2OM5tzR2RiCcN2D7sapiKyCel/M=
|
||||
github.com/pquerna/ffjson v0.0.0-20190813045741-dac163c6c0a9 h1:kyf9snWXHvQc+yxE9imhdI8YAm4oKeZISlaAR+x73zs=
|
||||
github.com/pquerna/ffjson v0.0.0-20190813045741-dac163c6c0a9/go.mod h1:YARuvh7BUWHNhzDq2OM5tzR2RiCcN2D7sapiKyCel/M=
|
||||
github.com/prometheus/client_golang v0.9.1/go.mod h1:7SWBe2y4D6OKWSNQJUaRYU/AaXPKyh/dDVn+NZz0KFw=
|
||||
github.com/prometheus/client_golang v0.9.3/go.mod h1:/TN21ttK/J9q6uSwhBd54HahCDft0ttaMvbicHlPoso=
|
||||
github.com/prometheus/client_golang v1.0.0/go.mod h1:db9x61etRT2tGnBNRi70OPL5FsnadC4Ky3P0J6CfImo=
|
||||
github.com/prometheus/client_golang v1.1.0 h1:BQ53HtBmfOitExawJ6LokA4x8ov/z0SYYb0+HxJfRI8=
|
||||
github.com/prometheus/client_golang v1.1.0/go.mod h1:I1FGZT9+L76gKKOs5djB6ezCbFQP1xR9D75/vuwEF3g=
|
||||
github.com/prometheus/client_model v0.0.0-20180712105110-5c3871d89910/go.mod h1:MbSGuTsp3dbXC40dX6PRTWyKYBIrTGTE9sqQNg2J8bo=
|
||||
github.com/prometheus/client_model v0.0.0-20190129233127-fd36f4220a90 h1:S/YWwWx/RA8rT8tKFRuGUZhuA90OyIBpPCXkcbwU8DE=
|
||||
github.com/prometheus/client_model v0.0.0-20190129233127-fd36f4220a90/go.mod h1:xMI15A0UPsDsEKsMN9yxemIoYk6Tm2C1GtYGdfGttqA=
|
||||
github.com/prometheus/common v0.0.0-20181113130724-41aa239b4cce/go.mod h1:daVV7qP5qjZbuso7PdcryaAu0sAZbrN9i7WWcTMWvro=
|
||||
github.com/prometheus/common v0.4.0/go.mod h1:TNfzLD0ON7rHzMJeJkieUDPYmFC7Snx/y86RQel1bk4=
|
||||
github.com/prometheus/common v0.4.1/go.mod h1:TNfzLD0ON7rHzMJeJkieUDPYmFC7Snx/y86RQel1bk4=
|
||||
github.com/prometheus/common v0.6.0 h1:kRhiuYSXR3+uv2IbVbZhUxK5zVD/2pp3Gd2PpvPkpEo=
|
||||
github.com/prometheus/common v0.6.0/go.mod h1:eBmuwkDJBwy6iBfxCBob6t6dR6ENT/y+J+Zk0j9GMYc=
|
||||
github.com/prometheus/procfs v0.0.0-20180125133057-cb4147076ac7/go.mod h1:c3At6R/oaqEKCNdg8wHV1ftS6bRYblBhIjjI8uT2IGk=
|
||||
github.com/prometheus/procfs v0.0.0-20181005140218-185b4288413d/go.mod h1:c3At6R/oaqEKCNdg8wHV1ftS6bRYblBhIjjI8uT2IGk=
|
||||
github.com/prometheus/procfs v0.0.0-20190507164030-5867b95ac084/go.mod h1:TjEm7ze935MbeOT/UhFTIMYKhuLP4wbCsTZCD3I8kEA=
|
||||
github.com/prometheus/procfs v0.0.2/go.mod h1:TjEm7ze935MbeOT/UhFTIMYKhuLP4wbCsTZCD3I8kEA=
|
||||
github.com/prometheus/procfs v0.0.3/go.mod h1:4A/X28fw3Fc593LaREMrKMqOKvUAntwMDaekg4FpcdQ=
|
||||
github.com/prometheus/procfs v0.0.5 h1:3+auTFlqw+ZaQYJARz6ArODtkaIwtvBTx3N2NehQlL8=
|
||||
github.com/prometheus/procfs v0.0.5/go.mod h1:4A/X28fw3Fc593LaREMrKMqOKvUAntwMDaekg4FpcdQ=
|
||||
github.com/prometheus/tsdb v0.7.1/go.mod h1:qhTCs0VvXwvX/y3TZrWD7rabWM+ijKTux40TwIPHuXU=
|
||||
github.com/rogpeppe/fastuuid v0.0.0-20150106093220-6724a57986af/go.mod h1:XWv6SoW27p1b0cqNHllgS5HIMJraePCO15w5zCzIWYg=
|
||||
github.com/russross/blackfriday v2.0.0+incompatible h1:cBXrhZNUf9C+La9/YpS+UHpUT8YD6Td9ZMSU9APFcsk=
|
||||
github.com/russross/blackfriday v2.0.0+incompatible/go.mod h1:JO/DiYxRf+HjHt06OyowR9PTA263kcR/rfWxYHBV53g=
|
||||
github.com/russross/blackfriday/v2 v2.0.1/go.mod h1:+Rmxgy9KzJVeS9/2gXHxylqXiyQDYRxCVz55jmeOWTM=
|
||||
github.com/sclevine/agouti v3.0.0+incompatible/go.mod h1:b4WX9W9L1sfQKXeJf1mUTLZKJ48R1S7H23Ji7oFO5Bw=
|
||||
github.com/shurcooL/sanitized_anchor_name v1.0.0 h1:PdmoCO6wvbs+7yrJyMORt4/BmY5IYyJwS/kOiWx8mHo=
|
||||
github.com/shurcooL/sanitized_anchor_name v1.0.0/go.mod h1:1NzhyTcUVG4SuEtjjoZeVRXNmyL/1OwPU0+IJeTBvfc=
|
||||
github.com/sirupsen/logrus v1.4.2 h1:SPIRibHv4MatM3XXNO2BJeFLZwZ2LvZgfQ5+UNI2im4=
|
||||
github.com/sirupsen/logrus v1.2.0/go.mod h1:LxeOpSwHxABJmUn/MG1IvRgCAasNZTLOkJPxbbu5VWo=
|
||||
github.com/sirupsen/logrus v1.4.1/go.mod h1:ni0Sbl8bgC9z8RoU9G6nDWqqs/fq4eDPysMBDgk/93Q=
|
||||
github.com/sirupsen/logrus v1.4.2/go.mod h1:tLMulIdttU9McNUspp0xgXVQah82FyeX6MwdIuYE2rE=
|
||||
github.com/sirupsen/logrus v1.6.0 h1:UBcNElsrwanuuMsnGSlYmtmgbb23qDR5dG+6X6Oo89I=
|
||||
github.com/sirupsen/logrus v1.6.0/go.mod h1:7uNnSEd1DgxDLC74fIahvMZmmYsHGZGEOFrfsX/uA88=
|
||||
github.com/soheilhy/cmux v0.1.4/go.mod h1:IM3LyeVVIOuxMH7sFAkER9+bJ4dT7Ms6E4xg4kGIyLM=
|
||||
github.com/spaolacci/murmur3 v0.0.0-20180118202830-f09979ecbc72/go.mod h1:JwIasOWyU6f++ZhiEuf87xNszmSA2myDM2Kzu9HwQUA=
|
||||
github.com/spf13/afero v1.1.2/go.mod h1:j4pytiNVoe2o6bmDsKpLACNPDBIoEAkihy7loJ1B0CQ=
|
||||
github.com/spf13/cast v1.3.0/go.mod h1:Qx5cxh0v+4UWYiBimWS+eyWzqEqokIECu5etghLkUJE=
|
||||
github.com/spf13/cobra v1.0.0 h1:6m/oheQuQ13N9ks4hubMG6BnvwOeaJrqSPLahSnczz8=
|
||||
github.com/spf13/cobra v1.0.0/go.mod h1:/6GTrnGXV9HjY+aR4k0oJ5tcvakLuG6EuKReYlHNrgE=
|
||||
github.com/spf13/jwalterweatherman v1.0.0/go.mod h1:cQK4TGJAtQXfYWX+Ddv3mKDzgVb68N+wFjFa4jdeBTo=
|
||||
github.com/spf13/pflag v1.0.3/go.mod h1:DYY7MBk1bdzusC3SYhjObp+wFpr4gzcvqqNjLnInEg4=
|
||||
github.com/spf13/pflag v1.0.5 h1:iy+VFUOCP1a+8yFto/drg2CJ5u0yRoB7fZw3DKv/JXA=
|
||||
github.com/spf13/pflag v1.0.5/go.mod h1:McXfInJRrz4CZXVZOBLb0bTZqETkiAhM9Iw0y3An2Bg=
|
||||
github.com/spf13/viper v1.4.0/go.mod h1:PTJ7Z/lr49W6bUbkmS1V3by4uWynFiR9p7+dSq/yZzE=
|
||||
github.com/stretchr/objx v0.1.0/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME=
|
||||
github.com/stretchr/objx v0.1.1 h1:2vfRuCMp5sSVIDSqO8oNnWJq7mPa6KVP3iPIwFBuy8A=
|
||||
github.com/stretchr/objx v0.1.1/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME=
|
||||
github.com/stretchr/testify v1.2.2/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXfy6kDkUVs=
|
||||
github.com/stretchr/testify v1.3.0 h1:TivCn/peBQ7UY8ooIcPgZFpTNSz0Q2U6UrFlUfqbe0Q=
|
||||
github.com/stretchr/testify v1.3.0/go.mod h1:M5WIy9Dh21IEIfnGCwXGc5bZfKNJtfHm1UVUgZn+9EI=
|
||||
github.com/stretchr/testify v1.4.0 h1:2E4SXV/wtOkTonXsotYi4li6zVWxYlZuYNCXe9XRJyk=
|
||||
github.com/stretchr/testify v1.4.0/go.mod h1:j7eGeouHqKxXV5pUuKE4zz7dFj8WfuZ+81PSLYec5m4=
|
||||
github.com/stretchr/testify v1.5.1 h1:nOGnQDM7FYENwehXlg/kFVnos3rEvtKTjRvOWSzb6H4=
|
||||
github.com/stretchr/testify v1.5.1/go.mod h1:5W2xD1RspED5o8YsWQXVCued0rvSQ+mT+I5cxcmMvtA=
|
||||
github.com/stretchr/testify v1.6.0 h1:jlIyCplCJFULU/01vCkhKuTyc3OorI3bJFuw6obfgho=
|
||||
github.com/stretchr/testify v1.6.0/go.mod h1:6Fq8oRcR53rry900zMqJjRRixrwX3KX962/h/Wwjteg=
|
||||
github.com/stretchr/testify v1.6.1 h1:hDPOHmpOpP40lSULcqw7IrRb/u7w6RpDC9399XyoNd0=
|
||||
github.com/stretchr/testify v1.6.1/go.mod h1:6Fq8oRcR53rry900zMqJjRRixrwX3KX962/h/Wwjteg=
|
||||
github.com/syndtr/gocapability v0.0.0-20170704070218-db04d3cc01c8/go.mod h1:hkRG7XYTFWNJGYcbNJQlaLq0fg1yr4J4t/NcTQtrfww=
|
||||
github.com/syndtr/gocapability v0.0.0-20180916011248-d98352740cb2 h1:b6uOv7YOFK0TYG7HtkIgExQo+2RdLuwRft63jn2HWj8=
|
||||
github.com/syndtr/gocapability v0.0.0-20180916011248-d98352740cb2/go.mod h1:hkRG7XYTFWNJGYcbNJQlaLq0fg1yr4J4t/NcTQtrfww=
|
||||
github.com/tchap/go-patricia v2.3.0+incompatible h1:GkY4dP3cEfEASBPPkWd+AmjYxhmDkqO9/zg7R0lSQRs=
|
||||
github.com/tchap/go-patricia v2.3.0+incompatible/go.mod h1:bmLyhP68RS6kStMGxByiQ23RP/odRBOTVjwp2cDyi6I=
|
||||
github.com/ulikunitz/xz v0.5.6 h1:jGHAfXawEGZQ3blwU5wnWKQJvAraT7Ftq9EXjnXYgt8=
|
||||
github.com/tmc/grpc-websocket-proxy v0.0.0-20190109142713-0ad062ec5ee5/go.mod h1:ncp9v5uamzpCO7NfCPTXjqaC+bZgJeR0sMTm6dMHP7U=
|
||||
github.com/ugorji/go v1.1.4/go.mod h1:uQMGLiO92mf5W77hV/PUCpI3pbzQx3CRekS0kk+RGrc=
|
||||
github.com/ulikunitz/xz v0.5.6/go.mod h1:2bypXElzHzzJZwzH67Y6wb67pO62Rzfn7BSiF4ABRW8=
|
||||
github.com/urfave/cli v1.20.0 h1:fDqGv3UG/4jbVl/QkFwEdddtEDjh/5Ov6X+0B/3bPaw=
|
||||
github.com/urfave/cli v1.20.0/go.mod h1:70zkFmudgCuE/ngEzBv17Jvp/497gISqfk5gWijbERA=
|
||||
github.com/ulikunitz/xz v0.5.7 h1:YvTNdFzX6+W5m9msiYg/zpkSURPPtOlzbqYjrFn7Yt4=
|
||||
github.com/ulikunitz/xz v0.5.7/go.mod h1:nbz6k7qbPmH4IRqmfOplQw/tblSgqTqBwxkY0oWt/14=
|
||||
github.com/urfave/cli v0.0.0-20171014202726-7bc6a0acffa5/go.mod h1:70zkFmudgCuE/ngEzBv17Jvp/497gISqfk5gWijbERA=
|
||||
github.com/vbatts/tar-split v0.11.1 h1:0Odu65rhcZ3JZaPHxl7tCI3V/C/Q9Zf82UFravl02dE=
|
||||
github.com/vbatts/tar-split v0.11.1/go.mod h1:LEuURwDEiWjRjwu46yU3KVGuUdVv/dcnpcEPSzR8z6g=
|
||||
github.com/vbauerster/mpb v3.4.0+incompatible h1:mfiiYw87ARaeRW6x5gWwYRUawxaW1tLAD8IceomUCNw=
|
||||
github.com/vbauerster/mpb v3.4.0+incompatible/go.mod h1:zAHG26FUhVKETRu+MWqYXcI70POlC6N8up9p1dID7SU=
|
||||
github.com/xeipuuv/gojsonpointer v0.0.0-20180127040702-4e3ac2762d5f h1:J9EGpcZtP0E/raorCMxlFGSTBrsSlaDGf3jU/qvAE2c=
|
||||
github.com/vbauerster/mpb/v5 v5.0.4 h1:w7l/tJfHmtIOKZkU+bhbDZOUxj1kln9jy4DUOp3Tl14=
|
||||
github.com/vbauerster/mpb/v5 v5.0.4/go.mod h1:fvzasBUyuo35UyuA6sSOlVhpLoNQsp2nBdHw7OiSUU8=
|
||||
github.com/vbauerster/mpb/v5 v5.2.2 h1:zIICVOm+XD+uV6crpSORaL6I0Q1WqOdvxZTp+r3L9cw=
|
||||
github.com/vbauerster/mpb/v5 v5.2.2/go.mod h1:W5Fvgw4dm3/0NhqzV8j6EacfuTe5SvnzBRwiXxDR9ww=
|
||||
github.com/xeipuuv/gojsonpointer v0.0.0-20180127040702-4e3ac2762d5f/go.mod h1:N2zxlSyiKSe5eX1tZViRH5QA0qijqEDrYZiPEAiq3wU=
|
||||
github.com/xeipuuv/gojsonpointer v0.0.0-20190809123943-df4f5c81cb3b h1:6cLsL+2FW6dRAdl5iMtHgRogVCff0QpRi9653YmdcJA=
|
||||
github.com/xeipuuv/gojsonpointer v0.0.0-20190809123943-df4f5c81cb3b/go.mod h1:N2zxlSyiKSe5eX1tZViRH5QA0qijqEDrYZiPEAiq3wU=
|
||||
github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415 h1:EzJWgHovont7NscjpAxXsDA8S8BMYve8Y5+7cuRE7R0=
|
||||
github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415/go.mod h1:GwrjFmJcFw6At/Gs6z4yjiIwzuJ1/+UwLxMQDVQXShQ=
|
||||
github.com/xeipuuv/gojsonschema v0.0.0-20190816131739-be0936907f66/go.mod h1:anYRn/JVcOK2ZgGU+IjEV4nwlhoK5sQluxsYJ78Id3Y=
|
||||
github.com/xeipuuv/gojsonschema v1.1.0 h1:ngVtJC9TY/lg0AA/1k48FYhBrhRoFlEmWzsehpNAaZg=
|
||||
github.com/xeipuuv/gojsonschema v1.1.0/go.mod h1:5yf86TLmAcydyeJq5YvxkGPE2fm/u4myDekKRoLuqhs=
|
||||
go.etcd.io/bbolt v1.3.3 h1:MUGmc65QhB3pIlaQ5bB4LwqSj6GIonVJXpZiaKNyaKk=
|
||||
go.etcd.io/bbolt v1.3.3/go.mod h1:IbVyRI1SCnLcuJnV2u8VeU0CEYM7e686BmAb1XKL+uU=
|
||||
github.com/xeipuuv/gojsonschema v0.0.0-20180618132009-1d523034197f/go.mod h1:5yf86TLmAcydyeJq5YvxkGPE2fm/u4myDekKRoLuqhs=
|
||||
github.com/xeipuuv/gojsonschema v1.2.0 h1:LhYJRs+L4fBtjZUfuSZIKGeVu0QRy8e5Xi7D17UxZ74=
|
||||
github.com/xeipuuv/gojsonschema v1.2.0/go.mod h1:anYRn/JVcOK2ZgGU+IjEV4nwlhoK5sQluxsYJ78Id3Y=
|
||||
github.com/xiang90/probing v0.0.0-20190116061207-43a291ad63a2/go.mod h1:UETIi67q53MR2AWcXfiuqkDkRtnGDLqkBTpCHuJHxtU=
|
||||
github.com/xordataexchange/crypt v0.0.3-0.20170626215501-b2862e3d0a77/go.mod h1:aYKd//L2LvnjZzWKhF00oedf4jCCReLcmhLdhm1A27Q=
|
||||
go.etcd.io/bbolt v1.3.2/go.mod h1:IbVyRI1SCnLcuJnV2u8VeU0CEYM7e686BmAb1XKL+uU=
|
||||
go.etcd.io/bbolt v1.3.4 h1:hi1bXHMVrlQh6WwxAy+qZCV/SYIlqo+Ushwdpa4tAKg=
|
||||
go.etcd.io/bbolt v1.3.4/go.mod h1:G5EMThwa9y8QZGBClrRx5EY+Yw9kAhnjy3bSjsnlVTQ=
|
||||
go.opencensus.io v0.22.0 h1:C9hSCOW830chIVkdja34wa6Ky+IzWllkUinR+BtRZd4=
|
||||
go.opencensus.io v0.22.0/go.mod h1:+kGneAE2xo2IficOXnaByMWTGM9T73dGwxeWcUqIpI8=
|
||||
go.uber.org/atomic v1.4.0/go.mod h1:gD2HeocX3+yG+ygLZcrzQJaqmWj9AIm7n08wl/qW/PE=
|
||||
go.uber.org/multierr v1.1.0/go.mod h1:wR5kodmAFQ0UK8QlbwjlSNy0Z68gJhDJUG5sjR94q/0=
|
||||
go.uber.org/zap v1.10.0/go.mod h1:vwi/ZaCAaUcBkycHslxD9B2zi4UTXhF60s6SWpuDF0Q=
|
||||
go4.org v0.0.0-20190218023631-ce4c26f7be8e h1:m9LfARr2VIOW0vsV19kEKp/sWQvZnGobA8JHui/XJoY=
|
||||
go4.org v0.0.0-20190218023631-ce4c26f7be8e/go.mod h1:MkTOUMDaeVYJUOUsaDXIhWPZYa1yOyC1qaOBpL57BhE=
|
||||
golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2 h1:VklqNMn3ovrHsnt90PveolxSbWFaJdECFbxSq0Mqo2M=
|
||||
golang.org/x/crypto v0.0.0-20180904163835-0709b304e793/go.mod h1:6SG95UA2DQfeDnfUPMdvaQW0Q7yPrPDi9nlGo2tz2b4=
|
||||
golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACkg1iLfiJU5Ep61QUkGW8qpdssI0+w=
|
||||
golang.org/x/net v0.0.0-20190628185345-da137c7871d7 h1:rTIdg5QFRR7XCaK4LCjBiPbx8j4DQRpdYMnGn/bJUEU=
|
||||
golang.org/x/crypto v0.0.0-20190701094942-4def268fd1a4/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI=
|
||||
golang.org/x/crypto v0.0.0-20200423211502-4bdfaf469ed5 h1:Q7tZBpemrlsc2I7IyODzhtallWRSm4Q0d09pL6XbQtU=
|
||||
golang.org/x/crypto v0.0.0-20200423211502-4bdfaf469ed5/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto=
|
||||
golang.org/x/exp v0.0.0-20190121172915-509febef88a4/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA=
|
||||
golang.org/x/lint v0.0.0-20181026193005-c67002cb31c3/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE=
|
||||
golang.org/x/lint v0.0.0-20190227174305-5b3e6a55c961/go.mod h1:wehouNa3lNwaWXcvxsM5YxQ5yQlVC4a0KAMCusXpPoU=
|
||||
golang.org/x/lint v0.0.0-20190313153728-d0100b6bd8b3/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc=
|
||||
golang.org/x/net v0.0.0-20180724234803-3673e40ba225/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
|
||||
golang.org/x/net v0.0.0-20180826012351-8a410e7b638d/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
|
||||
golang.org/x/net v0.0.0-20180906233101-161cd47e91fd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
|
||||
golang.org/x/net v0.0.0-20181114220301-adae6a3d119a/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
|
||||
golang.org/x/net v0.0.0-20181220203305-927f97764cc3/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
|
||||
golang.org/x/net v0.0.0-20190213061140-3a22650c66bd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
|
||||
golang.org/x/net v0.0.0-20190311183353-d8887717615a/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg=
|
||||
golang.org/x/net v0.0.0-20190404232315-eb5bcb51f2a3/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg=
|
||||
golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg=
|
||||
golang.org/x/net v0.0.0-20190522155817-f3200d17e092/go.mod h1:HSz+uSET+XFnRR8LxR5pz3Of3rY3CfYBVs4xY44aLks=
|
||||
golang.org/x/net v0.0.0-20190613194153-d28f0bde5980/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s=
|
||||
golang.org/x/net v0.0.0-20190628185345-da137c7871d7/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s=
|
||||
golang.org/x/sync v0.0.0-20181108010431-42b317875d0f h1:Bl/8QSvNqXvPGPGXa2z5xUTmV7VDcZyvRZ+QQXkXTZQ=
|
||||
golang.org/x/net v0.0.0-20191004110552-13f9640d40b9/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s=
|
||||
golang.org/x/net v0.0.0-20200324143707-d3edc9973b7e h1:3G+cUijn7XD+S4eJFddp53Pv7+slrESplyjG25HgL+k=
|
||||
golang.org/x/net v0.0.0-20200324143707-d3edc9973b7e/go.mod h1:qpuaurCH72eLCgpAm/N6yyVIVM9cpaDIP3A8BGJEC5A=
|
||||
golang.org/x/net v0.0.0-20200520004742-59133d7f0dd7 h1:AeiKBIuRw3UomYXSbLy0Mc2dDLfdtbT/IVn4keq83P0=
|
||||
golang.org/x/net v0.0.0-20200520004742-59133d7f0dd7/go.mod h1:qpuaurCH72eLCgpAm/N6yyVIVM9cpaDIP3A8BGJEC5A=
|
||||
golang.org/x/oauth2 v0.0.0-20180821212333-d2e6202438be/go.mod h1:N/0e6XlmueqKjAGxoOufVs8QHGRruUQn6yWY3a++T0U=
|
||||
golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
|
||||
golang.org/x/sync v0.0.0-20181108010431-42b317875d0f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
|
||||
golang.org/x/sync v0.0.0-20181221193216-37e7f081c4d4/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
|
||||
golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
|
||||
golang.org/x/sync v0.0.0-20190423024810-112230192c58/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
|
||||
golang.org/x/sync v0.0.0-20200317015054-43a5402ce75a h1:WXEvlFVvvGxCJLG6REjsT03iWnKLEWinaScsxF2Vm2o=
|
||||
golang.org/x/sync v0.0.0-20200317015054-43a5402ce75a/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
|
||||
golang.org/x/sys v0.0.0-20180830151530-49385e6e1522/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
|
||||
golang.org/x/sys v0.0.0-20180905080454-ebe1bf3edb33/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
|
||||
golang.org/x/sys v0.0.0-20180909124046-d0be0721c37e/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
|
||||
golang.org/x/sys v0.0.0-20181107165924-66b7b1311ac8/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
|
||||
golang.org/x/sys v0.0.0-20181116152217-5ac8a444bdc5/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
|
||||
golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
|
||||
golang.org/x/sys v0.0.0-20190412213103-97732733099d/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20190422165155-953cdadca894/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20190626221950-04f50cda93cb h1:fgwFCsaw9buMuxNd6+DQfAuSFqbNiQZpcgJQAgJsK6k=
|
||||
golang.org/x/sys v0.0.0-20190626221950-04f50cda93cb/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20190902133755-9109b7679e13 h1:tdsQdquKbTNMsSZLqnLELJGzCANp9oXhu6zFBW6ODx4=
|
||||
golang.org/x/sys v0.0.0-20190902133755-9109b7679e13/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/text v0.3.0 h1:g61tztE5qeGQ89tm6NTjjM9VPIm088od1l6aSorWRWg=
|
||||
golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20190514135907-3a4b5fb9f71f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20190801041406-cbf593c0f2f3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20190904154756-749cb33beabd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20191005200804-aed5e4c7ecf9/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20191115151921-52ab43148777/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20191120155948-bd437916bb0e/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20191127021746-63cb32ae39b2/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20200116001909-b77594299b42/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20200124204421-9fbb57f87de9/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20200202164722-d101bd2416d5/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20200323222414-85ca7c5b95cd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20200420163511-1957bb5e6d1f h1:gWF768j/LaZugp8dyS4UwsslYCYz9XgFxvlgsn0n9H8=
|
||||
golang.org/x/sys v0.0.0-20200420163511-1957bb5e6d1f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20200519105757-fe76b779f299 h1:DYfZAGf2WMFjMxbgTjaC+2HC7NkNAQs+6Q8b9WEB/F4=
|
||||
golang.org/x/sys v0.0.0-20200519105757-fe76b779f299/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ=
|
||||
golang.org/x/tools v0.0.0-20180810170437-e96c4e24768d/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ=
|
||||
golang.org/x/text v0.3.2 h1:tW2bmiBqwgJj/UpqtC8EpXEZVYOwU0yG4iWbprSVAcs=
|
||||
golang.org/x/text v0.3.2/go.mod h1:bEr9sfX3Q8Zfm5fL9x+3itogRgK3+ptLWKqgva+5dAk=
|
||||
golang.org/x/text v0.3.3 h1:cokOdA+Jmi5PJGXLlLllQSgYigAEfHXJAERHVMaCc2k=
|
||||
golang.org/x/text v0.3.3/go.mod h1:5Zoc/QRtKVWzQhOtBMvqHzDpF6irO9z98xDceosuGiQ=
|
||||
golang.org/x/time v0.0.0-20190308202827-9d24e82272b4/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ=
|
||||
golang.org/x/time v0.0.0-20191024005414-555d28b269f0 h1:/5xXl8Y5W96D+TtHSlonuFqGHIWVuyCkGJLwGh9JJFs=
|
||||
golang.org/x/time v0.0.0-20191024005414-555d28b269f0/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ=
|
||||
golang.org/x/tools v0.0.0-20180221164845-07fd8470d635/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ=
|
||||
golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ=
|
||||
golang.org/x/tools v0.0.0-20181030221726-6c7e314b6563/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ=
|
||||
golang.org/x/tools v0.0.0-20190114222345-bf090417da8b/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ=
|
||||
golang.org/x/tools v0.0.0-20190226205152-f727befe758c/go.mod h1:9Yl7xja0Znq3iFh3HoIrodX9oNMXvdceNzlUR8zjMvY=
|
||||
golang.org/x/tools v0.0.0-20190311212946-11955173bddd/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs=
|
||||
golang.org/x/tools v0.0.0-20190524140312-2c0ae7006135/go.mod h1:RgjU9mgBXZiqYHBnxXauZ1Gv1EHHAz9KjViQ78xBX0Q=
|
||||
golang.org/x/xerrors v0.0.0-20191204190536-9bdfabe68543 h1:E7g+9GITq07hpfrRu66IVDexMakfv52eLZ2CXBWiKr4=
|
||||
golang.org/x/xerrors v0.0.0-20191204190536-9bdfabe68543/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0=
|
||||
google.golang.org/appengine v1.1.0/go.mod h1:EbEs0AVv82hx2wNQdGPgUI5lhzA/G0D9YwlJXL52JkM=
|
||||
google.golang.org/appengine v1.4.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4=
|
||||
google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8/go.mod h1:JiN7NxoALGmiZfu7CAH4rXhgtRTLTxftemlI0sWmxmc=
|
||||
google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb h1:i1Ppqkc3WQXikh8bXiwHqAN5Rv3/qDCcRk0/Otx73BY=
|
||||
google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE=
|
||||
google.golang.org/genproto v0.0.0-20190502173448-54afdca5d873 h1:nfPFGzJkUDX6uBmpN/pSw7MbOAWegH5QDQuoXFHedLg=
|
||||
google.golang.org/genproto v0.0.0-20190502173448-54afdca5d873/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE=
|
||||
google.golang.org/grpc v1.19.0/go.mod h1:mqu4LbDTu4XGKhr4mRzUsmM4RtVoemTSY81AxZiDr8c=
|
||||
google.golang.org/grpc v1.20.1/go.mod h1:10oTOabMzJvdu6/UiuZezV6QK5dSlG84ov/aaiqXj38=
|
||||
google.golang.org/grpc v1.21.0/go.mod h1:oYelfM1adQP15Ek0mdvEgi9Df8B9CZIaU1084ijfRaM=
|
||||
google.golang.org/grpc v1.23.1/go.mod h1:Y5yQAOtifL1yxbo5wqy6BxZv8vAUGQwXBOALyacEbxg=
|
||||
google.golang.org/grpc v1.24.0 h1:vb/1TCsVn3DcJlQ0Gs1yB1pKI6Do2/QNwxdKqmc/b0s=
|
||||
google.golang.org/grpc v1.24.0/go.mod h1:XDChyiUovWa60DnaeDeZmSW86xtLtjtZbwvSiRnRtcA=
|
||||
google.golang.org/protobuf v0.0.0-20200109180630-ec00e32a8dfd/go.mod h1:DFci5gLYBciE7Vtevhsrf46CRTquxDuWsQurQQe4oz8=
|
||||
google.golang.org/protobuf v0.0.0-20200221191635-4d8936d0db64/go.mod h1:kwYJMbMJ01Woi6D6+Kah6886xMZcty6N08ah7+eCXa0=
|
||||
google.golang.org/protobuf v0.0.0-20200228230310-ab0ca4ff8a60/go.mod h1:cfTl7dwQJ+fmap5saPgwCLgHXTUD7jkjRqWcaiX5VyM=
|
||||
google.golang.org/protobuf v1.20.1-0.20200309200217-e05f789c0967/go.mod h1:A+miEFZTKqfCUM6K7xSMQL9OKL/b6hQv+e19PK+JZNE=
|
||||
google.golang.org/protobuf v1.21.0/go.mod h1:47Nbq4nVaFHyn7ilMalzfO3qCViNmqZ2kzikPIcrTAo=
|
||||
google.golang.org/protobuf v1.23.0 h1:4MY060fB1DLGMB/7MBTLnwQUY6+F09GEiz6SsrNqyzM=
|
||||
google.golang.org/protobuf v1.23.0/go.mod h1:EGpADcykh3NcUnDUJcl1+ZksZNG86OlYog2l/sGQquU=
|
||||
gopkg.in/alecthomas/kingpin.v2 v2.2.6/go.mod h1:FMv+mEhP44yOT+4EoQTLFTRgOQ1FBLkstjWtayDeSgw=
|
||||
gopkg.in/check.v1 v0.0.0-20161208181325-20d25e280405/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0=
|
||||
gopkg.in/check.v1 v1.0.0-20180628173108-788fd7840127/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0=
|
||||
gopkg.in/check.v1 v1.0.0-20190902080502-41f04d3bba15 h1:YR8cESwS4TdDjEe65xsg0ogRM/Nc3DYOhEAlW+xobZo=
|
||||
gopkg.in/check.v1 v1.0.0-20190902080502-41f04d3bba15/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0=
|
||||
gopkg.in/yaml.v2 v2.2.2 h1:ZCJp+EgiOT7lHqUV2J862kp8Qj64Jo6az82+3Td9dZw=
|
||||
gopkg.in/fsnotify.v1 v1.4.7/go.mod h1:Tz8NjZHkW78fSQdbUxIjBTcgA1z1m8ZHf0WmKUhAMys=
|
||||
gopkg.in/resty.v1 v1.12.0/go.mod h1:mDo4pnntr5jdWRML875a/NmxYqAlA73dVijT2AXvQQo=
|
||||
gopkg.in/square/go-jose.v2 v2.3.1 h1:SK5KegNXmKmqE342YYN2qPHEnUYeoMiXXl1poUlI+o4=
|
||||
gopkg.in/square/go-jose.v2 v2.3.1/go.mod h1:M9dMgbHiYLoDGQrXy7OpJDJWiKiU//h+vD76mk0e1AI=
|
||||
gopkg.in/tomb.v1 v1.0.0-20141024135613-dd632973f1e7/go.mod h1:dt/ZhP58zS4L8KSrWDmTeBkI65Dw0HsyUHuEVlX15mw=
|
||||
gopkg.in/yaml.v2 v2.0.0-20170812160011-eb3733d160e7/go.mod h1:JAlM8MvJe8wmxCU4Bli9HhUf9+ttbYbLASfIpnQbh74=
|
||||
gopkg.in/yaml.v2 v2.2.1/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
|
||||
gopkg.in/yaml.v2 v2.2.2/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
|
||||
gotest.tools v0.0.0-20190624233834-05ebafbffc79 h1:C+K4iPg1rIvmCf4JjelkbWv2jeWevEwp05Lz8XfTYgE=
|
||||
gotest.tools v0.0.0-20190624233834-05ebafbffc79/go.mod h1:R//lfYlUuTOTfblYI3lGoAAAebUdzjvbmQsuB7Ykd90=
|
||||
k8s.io/client-go v0.0.0-20170217214107-bcde30fb7eae/go.mod h1:7vJpHMYJwNQCWgzmNV+VYUl1zCObLyodBc8nIyt8L5s=
|
||||
k8s.io/client-go v0.0.0-20181219152756-3dd551c0f083 h1:+Qf/nITucAbm09aIdxvoA+7X0BwaXmQGVoR8k7Ynk9o=
|
||||
k8s.io/client-go v0.0.0-20181219152756-3dd551c0f083/go.mod h1:7vJpHMYJwNQCWgzmNV+VYUl1zCObLyodBc8nIyt8L5s=
|
||||
gopkg.in/yaml.v2 v2.2.4/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
|
||||
gopkg.in/yaml.v2 v2.2.8 h1:obN1ZagJSUGI0Ek/LBmuj4SNLPfIny3KsKFopxRdj10=
|
||||
gopkg.in/yaml.v2 v2.2.8/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
|
||||
gopkg.in/yaml.v2 v2.3.0 h1:clyUAQHOM3G0M3f5vQj7LuJrETvjVot3Z5el9nffUtU=
|
||||
gopkg.in/yaml.v2 v2.3.0/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
|
||||
gopkg.in/yaml.v3 v3.0.0-20200313102051-9f266ea9e77c h1:dUUwHk2QECo/6vqA44rthZ8ie2QXMNeKRTHCNY2nXvo=
|
||||
gopkg.in/yaml.v3 v3.0.0-20200313102051-9f266ea9e77c/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM=
|
||||
gotest.tools v2.2.0+incompatible h1:VsBPFP1AI068pPrMxtb/S8Zkgf9xEmTLJjfM+P5UIEo=
|
||||
gotest.tools v2.2.0+incompatible/go.mod h1:DsYFclhRJ6vuDpmuTbkuFWG+y2sxOXAzmJt81HFBacw=
|
||||
honnef.co/go/tools v0.0.0-20190102054323-c2f93a96b099/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4=
|
||||
honnef.co/go/tools v0.0.0-20190523083050-ea95bdfd59fc/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4=
|
||||
k8s.io/kubernetes v1.13.0/go.mod h1:ocZa8+6APFNC2tX1DZASIbocyYT5jHzqFVsY5aoB7Jk=
|
||||
|
||||
14
hack/make.sh
14
hack/make.sh
@@ -57,7 +57,15 @@ DEFAULT_BUNDLES=(
|
||||
test-integration
|
||||
)
|
||||
|
||||
TESTFLAGS+=" -test.timeout=10m"
|
||||
TESTFLAGS+=" -test.timeout=15m"
|
||||
|
||||
# Go module support: set `-mod=vendor` to use the vendored sources
|
||||
# See also the top-level Makefile.
|
||||
mod_vendor=
|
||||
if go help mod >/dev/null 2>&1; then
|
||||
export GO111MODULE=on
|
||||
mod_vendor='-mod=vendor'
|
||||
fi
|
||||
|
||||
# If $TESTFLAGS is set in the environment, it is passed as extra arguments to 'go test'.
|
||||
# You can use this to select certain tests to run, eg.
|
||||
@@ -72,10 +80,10 @@ TESTFLAGS+=" -test.timeout=10m"
|
||||
go_test_dir() {
|
||||
dir=$1
|
||||
(
|
||||
echo '+ go test' $TESTFLAGS ${BUILDTAGS:+-tags "$BUILDTAGS"} "${SKOPEO_PKG}${dir#.}"
|
||||
echo '+ go test' $mod_vendor $TESTFLAGS ${BUILDTAGS:+-tags "$BUILDTAGS"} "${SKOPEO_PKG}${dir#.}"
|
||||
cd "$dir"
|
||||
export DEST="$ABS_DEST" # we're in a subshell, so this is safe -- our integration-cli tests need DEST, and "cd" screws it up
|
||||
go test $TESTFLAGS ${BUILDTAGS:+-tags "$BUILDTAGS"}
|
||||
go test $mod_vendor $TESTFLAGS ${BUILDTAGS:+-tags "$BUILDTAGS"}
|
||||
)
|
||||
}
|
||||
|
||||
|
||||
@@ -1,6 +1,6 @@
|
||||
#!/bin/bash
|
||||
|
||||
errors=$(go vet $(go list -e ./... | grep -v "$SKOPEO_PKG"/vendor))
|
||||
errors=$(go vet $mod_vendor $(go list $mod_vendor -e ./...))
|
||||
|
||||
if [ -z "$errors" ]; then
|
||||
echo 'Congratulations! All Go source files have been vetted.'
|
||||
|
||||
@@ -1,11 +0,0 @@
|
||||
#!/bin/bash
|
||||
|
||||
if test $(${GO:-go} env GOOS) != "linux" ; then
|
||||
exit 0
|
||||
fi
|
||||
|
||||
if pkg-config ostree-1 &> /dev/null ; then
|
||||
# ostree: used by containers/storage
|
||||
# containers_image_ostree: used by containers/image
|
||||
echo "ostree containers_image_ostree"
|
||||
fi
|
||||
165
install.md
Normal file
165
install.md
Normal file
@@ -0,0 +1,165 @@
|
||||
# Installing from packages
|
||||
|
||||
`skopeo` may already be packaged in your distribution, for example on
|
||||
RHEL/CentOS ≥ 8 or Fedora you can install it using:
|
||||
|
||||
```sh
|
||||
$ sudo dnf install skopeo
|
||||
```
|
||||
|
||||
on RHEL/CentOS ≤ 7.x:
|
||||
|
||||
```sh
|
||||
$ sudo yum install skopeo
|
||||
```
|
||||
|
||||
for openSUSE:
|
||||
|
||||
```sh
|
||||
$ sudo zypper install skopeo
|
||||
```
|
||||
|
||||
on alpine:
|
||||
|
||||
```sh
|
||||
$ sudo apk add skopeo
|
||||
```
|
||||
|
||||
on macOS:
|
||||
|
||||
```sh
|
||||
$ brew install skopeo
|
||||
```
|
||||
|
||||
Debian (10 and newer including Raspbian) and Ubuntu (18.04 and newer): Packages
|
||||
are available via the [Kubic][0] project repositories:
|
||||
|
||||
[0]: https://build.opensuse.org/project/show/devel:kubic:libcontainers:stable
|
||||
|
||||
```bash
|
||||
# Debian Unstable/Sid:
|
||||
$ echo 'deb http://download.opensuse.org/repositories/devel:/kubic:/libcontainers:/stable/Debian_Unstable/ /' > /etc/apt/sources.list.d/devel:kubic:libcontainers:stable.list
|
||||
$ wget -nv https://download.opensuse.org/repositories/devel:kubic:libcontainers:stable/Debian_Unstable/Release.key -O- | sudo apt-key add -
|
||||
```
|
||||
|
||||
```bash
|
||||
# Debian Testing:
|
||||
$ echo 'deb http://download.opensuse.org/repositories/devel:/kubic:/libcontainers:/stable/Debian_Testing/ /' > /etc/apt/sources.list.d/devel:kubic:libcontainers:stable.list
|
||||
$ wget -nv https://download.opensuse.org/repositories/devel:kubic:libcontainers:stable/Debian_Testing/Release.key -O- | sudo apt-key add -
|
||||
```
|
||||
|
||||
```bash
|
||||
# Debian 10:
|
||||
$ echo 'deb http://download.opensuse.org/repositories/devel:/kubic:/libcontainers:/stable/Debian_10/ /' > /etc/apt/sources.list.d/devel:kubic:libcontainers:stable.list
|
||||
$ wget -nv https://download.opensuse.org/repositories/devel:kubic:libcontainers:stable/Debian_10/Release.key -O- | sudo apt-key add -
|
||||
```
|
||||
|
||||
```bash
|
||||
# Raspbian 10:
|
||||
$ echo 'deb http://download.opensuse.org/repositories/devel:/kubic:/libcontainers:/stable/Raspbian_10/ /' > /etc/apt/sources.list.d/devel:kubic:libcontainers:stable.list
|
||||
$ wget -nv https://download.opensuse.org/repositories/devel:kubic:libcontainers:stable/Raspbian_10/Release.key -O- | sudo apt-key add -
|
||||
```
|
||||
|
||||
```bash
|
||||
# Ubuntu (18.04, 19.04 and 19.10):
|
||||
$ . /etc/os-release
|
||||
$ sudo sh -c "echo 'deb http://download.opensuse.org/repositories/devel:/kubic:/libcontainers:/stable/x${NAME}_${VERSION_ID}/ /' > /etc/apt/sources.list.d/devel:kubic:libcontainers:stable.list"
|
||||
$ wget -nv https://download.opensuse.org/repositories/devel:kubic:libcontainers:stable/x${NAME}_${VERSION_ID}/Release.key -O- | sudo apt-key add -
|
||||
```
|
||||
|
||||
```bash
|
||||
$ sudo apt-get update -qq
|
||||
$ sudo apt-get install skopeo
|
||||
```
|
||||
|
||||
Otherwise, read on for building and installing it from source:
|
||||
|
||||
To build the `skopeo` binary you need at least Go 1.12.
|
||||
|
||||
There are two ways to build skopeo: in a container, or locally without a
|
||||
container. Choose the one which better matches your needs and environment.
|
||||
|
||||
### Building without a container
|
||||
|
||||
Building without a container requires a bit more manual work and setup in your
|
||||
environment, but it is more flexible:
|
||||
|
||||
- It should work in more environments (e.g. for native macOS builds)
|
||||
- It does not require root privileges (after dependencies are installed)
|
||||
- It is faster, therefore more convenient for developing `skopeo`.
|
||||
|
||||
Install the necessary dependencies:
|
||||
|
||||
```bash
|
||||
# Fedora:
|
||||
$ sudo dnf install gpgme-devel libassuan-devel btrfs-progs-devel device-mapper-devel
|
||||
```
|
||||
|
||||
```bash
|
||||
# Ubuntu (`libbtrfs-dev` requires Ubuntu 18.10 and above):
|
||||
$ sudo apt install libgpgme-dev libassuan-dev libbtrfs-dev libdevmapper-dev
|
||||
```
|
||||
|
||||
```bash
|
||||
# macOS:
|
||||
$ brew install gpgme
|
||||
```
|
||||
|
||||
```bash
|
||||
# openSUSE:
|
||||
$ sudo zypper install libgpgme-devel device-mapper-devel libbtrfs-devel glib2-devel
|
||||
```
|
||||
|
||||
Make sure to clone this repository in your `GOPATH` - otherwise compilation fails.
|
||||
|
||||
```bash
|
||||
$ git clone https://github.com/containers/skopeo $GOPATH/src/github.com/containers/skopeo
|
||||
$ cd $GOPATH/src/github.com/containers/skopeo && make binary-local
|
||||
```
|
||||
|
||||
### Building in a container
|
||||
|
||||
Building in a container is simpler, but more restrictive:
|
||||
|
||||
- It requires the `podman` command and the ability to run Linux containers
|
||||
- The created executable is a Linux executable, and depends on dynamic libraries
|
||||
which may only be available only in a container of a similar Linux
|
||||
distribution.
|
||||
|
||||
```bash
|
||||
$ make binary # Or (make all) to also build documentation, see below.
|
||||
```
|
||||
|
||||
To build a pure-Go static binary (disables devicemapper, btrfs, and gpgme):
|
||||
|
||||
```bash
|
||||
$ make binary-static DISABLE_CGO=1
|
||||
```
|
||||
|
||||
### Building documentation
|
||||
|
||||
To build the manual you will need go-md2man.
|
||||
|
||||
```bash
|
||||
# Debian:
|
||||
$ sudo apt-get install go-md2man
|
||||
```
|
||||
|
||||
```
|
||||
# Fedora:
|
||||
$ sudo dnf install go-md2man
|
||||
```
|
||||
|
||||
Then
|
||||
|
||||
```bash
|
||||
$ make docs
|
||||
```
|
||||
|
||||
### Installation
|
||||
|
||||
Finally, after the binary and documentation is built:
|
||||
|
||||
```bash
|
||||
$ sudo make install
|
||||
```
|
||||
@@ -30,18 +30,11 @@ type SkopeoSuite struct {
|
||||
func (s *SkopeoSuite) SetUpSuite(c *check.C) {
|
||||
_, err := exec.LookPath(skopeoBinary)
|
||||
c.Assert(err, check.IsNil)
|
||||
}
|
||||
|
||||
func (s *SkopeoSuite) TearDownSuite(c *check.C) {
|
||||
|
||||
}
|
||||
|
||||
func (s *SkopeoSuite) SetUpTest(c *check.C) {
|
||||
s.regV2 = setupRegistryV2At(c, privateRegistryURL0, false, false)
|
||||
s.regV2WithAuth = setupRegistryV2At(c, privateRegistryURL1, true, false)
|
||||
}
|
||||
|
||||
func (s *SkopeoSuite) TearDownTest(c *check.C) {
|
||||
func (s *SkopeoSuite) TearDownSuite(c *check.C) {
|
||||
if s.regV2 != nil {
|
||||
s.regV2.Close()
|
||||
}
|
||||
@@ -71,7 +64,7 @@ func (s *SkopeoSuite) TestNeedAuthToPrivateRegistryV2WithoutDockerCfg(c *check.C
|
||||
}
|
||||
|
||||
func (s *SkopeoSuite) TestCertDirInsteadOfCertPath(c *check.C) {
|
||||
wanted := ".*flag provided but not defined: -cert-path.*"
|
||||
wanted := ".*unknown flag: --cert-path.*"
|
||||
assertSkopeoFails(c, wanted, "--tls-verify=false", "inspect", fmt.Sprintf("docker://%s/busybox:latest", s.regV2WithAuth.url), "--cert-path=/")
|
||||
wanted = ".*unauthorized: authentication required.*"
|
||||
assertSkopeoFails(c, wanted, "--tls-verify=false", "inspect", fmt.Sprintf("docker://%s/busybox:latest", s.regV2WithAuth.url), "--cert-dir=/etc/docker/certs.d/")
|
||||
@@ -91,3 +84,30 @@ func (s *SkopeoSuite) TestNoNeedAuthToPrivateRegistryV2ImageNotFound(c *check.C)
|
||||
func (s *SkopeoSuite) TestInspectFailsWhenReferenceIsInvalid(c *check.C) {
|
||||
assertSkopeoFails(c, `.*Invalid image name.*`, "inspect", "unknown")
|
||||
}
|
||||
|
||||
func (s *SkopeoSuite) TestLoginLogout(c *check.C) {
|
||||
wanted := "^Login Succeeded!\n$"
|
||||
assertSkopeoSucceeds(c, wanted, "login", "--tls-verify=false", "--username="+s.regV2WithAuth.username, "--password="+s.regV2WithAuth.password, s.regV2WithAuth.url)
|
||||
// test --get-login returns username
|
||||
wanted = fmt.Sprintf("^%s\n$", s.regV2WithAuth.username)
|
||||
assertSkopeoSucceeds(c, wanted, "login", "--tls-verify=false", "--get-login", s.regV2WithAuth.url)
|
||||
// test logout
|
||||
wanted = fmt.Sprintf("^Removed login credentials for %s\n$", s.regV2WithAuth.url)
|
||||
assertSkopeoSucceeds(c, wanted, "logout", s.regV2WithAuth.url)
|
||||
}
|
||||
|
||||
func (s *SkopeoSuite) TestCopyWithLocalAuth(c *check.C) {
|
||||
wanted := "^Login Succeeded!\n$"
|
||||
assertSkopeoSucceeds(c, wanted, "login", "--tls-verify=false", "--username="+s.regV2WithAuth.username, "--password="+s.regV2WithAuth.password, s.regV2WithAuth.url)
|
||||
// copy to private registry using local authentication
|
||||
imageName := fmt.Sprintf("docker://%s/busybox:mine", s.regV2WithAuth.url)
|
||||
assertSkopeoSucceeds(c, "", "copy", "--dest-tls-verify=false", "docker://docker.io/library/busybox:latest", imageName)
|
||||
// inspec from private registry
|
||||
assertSkopeoSucceeds(c, "", "inspect", "--tls-verify=false", imageName)
|
||||
// logout from the registry
|
||||
wanted = fmt.Sprintf("^Removed login credentials for %s\n$", s.regV2WithAuth.url)
|
||||
assertSkopeoSucceeds(c, wanted, "logout", s.regV2WithAuth.url)
|
||||
// inspect from private registry should fail after logout
|
||||
wanted = ".*unauthorized: authentication required.*"
|
||||
assertSkopeoFails(c, wanted, "inspect", "--tls-verify=false", imageName)
|
||||
}
|
||||
|
||||
@@ -1,6 +1,9 @@
|
||||
package main
|
||||
|
||||
import (
|
||||
"crypto/rand"
|
||||
"crypto/rsa"
|
||||
"crypto/x509"
|
||||
"encoding/json"
|
||||
"fmt"
|
||||
"io/ioutil"
|
||||
@@ -27,7 +30,7 @@ func init() {
|
||||
const (
|
||||
v2DockerRegistryURL = "localhost:5555" // Update also policy.json
|
||||
v2s1DockerRegistryURL = "localhost:5556"
|
||||
knownWindowsOnlyImage = "docker://mcr.microsoft.com/windows/servercore:ltsc2019"
|
||||
knownWindowsOnlyImage = "docker://mcr.microsoft.com/windows/nanoserver:1909"
|
||||
)
|
||||
|
||||
type CopySuite struct {
|
||||
@@ -466,7 +469,7 @@ func (s *CopySuite) TestCopyFailsWhenImageOSDoesntMatchRuntimeOS(c *check.C) {
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(storage)
|
||||
storage = fmt.Sprintf("[vfs@%s/root+%s/runroot]", storage, storage)
|
||||
assertSkopeoFails(c, `.*no image found in manifest list for architecture .*, OS .*`, "copy", knownWindowsOnlyImage, "containers-storage:"+storage+"test")
|
||||
assertSkopeoFails(c, `.*no image found in manifest list for architecture .*, variant .*, OS .*`, "copy", knownWindowsOnlyImage, "containers-storage:"+storage+"test")
|
||||
}
|
||||
|
||||
func (s *CopySuite) TestCopySucceedsWhenImageDoesntMatchRuntimeButWeOverride(c *check.C) {
|
||||
@@ -534,6 +537,134 @@ func (s *CopySuite) TestCopySimple(c *check.C) {
|
||||
c.Assert(err, check.IsNil)
|
||||
}
|
||||
|
||||
func (s *CopySuite) TestCopyEncryption(c *check.C) {
|
||||
|
||||
originalImageDir, err := ioutil.TempDir("", "copy-1")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(originalImageDir)
|
||||
encryptedImgDir, err := ioutil.TempDir("", "copy-2")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(encryptedImgDir)
|
||||
decryptedImgDir, err := ioutil.TempDir("", "copy-3")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(decryptedImgDir)
|
||||
keysDir, err := ioutil.TempDir("", "copy-4")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(keysDir)
|
||||
undecryptedImgDir, err := ioutil.TempDir("", "copy-5")
|
||||
defer os.RemoveAll(undecryptedImgDir)
|
||||
multiLayerImageDir, err := ioutil.TempDir("", "copy-6")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(multiLayerImageDir)
|
||||
partiallyEncryptedImgDir, err := ioutil.TempDir("", "copy-7")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(partiallyEncryptedImgDir)
|
||||
partiallyDecryptedImgDir, err := ioutil.TempDir("", "copy-8")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(partiallyDecryptedImgDir)
|
||||
|
||||
// Create RSA key pair
|
||||
privateKey, err := rsa.GenerateKey(rand.Reader, 4096)
|
||||
c.Assert(err, check.IsNil)
|
||||
publicKey := &privateKey.PublicKey
|
||||
privateKeyBytes := x509.MarshalPKCS1PrivateKey(privateKey)
|
||||
publicKeyBytes, err := x509.MarshalPKIXPublicKey(publicKey)
|
||||
c.Assert(err, check.IsNil)
|
||||
err = ioutil.WriteFile(keysDir+"/private.key", privateKeyBytes, 0644)
|
||||
c.Assert(err, check.IsNil)
|
||||
err = ioutil.WriteFile(keysDir+"/public.key", publicKeyBytes, 0644)
|
||||
c.Assert(err, check.IsNil)
|
||||
|
||||
// We can either perform encryption or decryption on the image.
|
||||
// This is why use should not be able to specify both encryption and decryption
|
||||
// during copy at the same time.
|
||||
assertSkopeoFails(c, ".*--encryption-key and --decryption-key cannot be specified together.*",
|
||||
"copy", "--encryption-key", "jwe:"+keysDir+"/public.key", "--decryption-key", keysDir+"/private.key",
|
||||
"oci:"+encryptedImgDir+":encrypted", "oci:"+decryptedImgDir+":decrypted")
|
||||
assertSkopeoFails(c, ".*--encryption-key and --decryption-key cannot be specified together.*",
|
||||
"copy", "--decryption-key", keysDir+"/private.key", "--encryption-key", "jwe:"+keysDir+"/public.key",
|
||||
"oci:"+encryptedImgDir+":encrypted", "oci:"+decryptedImgDir+":decrypted")
|
||||
|
||||
// Copy a standard busybox image locally
|
||||
assertSkopeoSucceeds(c, "", "copy", "docker://busybox:1.31.1", "oci:"+originalImageDir+":latest")
|
||||
|
||||
// Encrypt the image
|
||||
assertSkopeoSucceeds(c, "", "copy", "--encryption-key",
|
||||
"jwe:"+keysDir+"/public.key", "oci:"+originalImageDir+":latest", "oci:"+encryptedImgDir+":encrypted")
|
||||
|
||||
// An attempt to decrypt an encrypted image without a valid private key should fail
|
||||
invalidPrivateKey, err := rsa.GenerateKey(rand.Reader, 4096)
|
||||
c.Assert(err, check.IsNil)
|
||||
invalidPrivateKeyBytes := x509.MarshalPKCS1PrivateKey(invalidPrivateKey)
|
||||
err = ioutil.WriteFile(keysDir+"/invalid_private.key", invalidPrivateKeyBytes, 0644)
|
||||
c.Assert(err, check.IsNil)
|
||||
assertSkopeoFails(c, ".*no suitable key unwrapper found or none of the private keys could be used for decryption.*",
|
||||
"copy", "--decryption-key", keysDir+"/invalid_private.key",
|
||||
"oci:"+encryptedImgDir+":encrypted", "oci:"+decryptedImgDir+":decrypted")
|
||||
|
||||
// Copy encrypted image without decrypting it
|
||||
assertSkopeoSucceeds(c, "", "copy", "oci:"+encryptedImgDir+":encrypted", "oci:"+undecryptedImgDir+":encrypted")
|
||||
// Original busybox image has gzipped layers. But encrypted busybox layers should
|
||||
// not be of gzip type
|
||||
matchLayerBlobBinaryType(c, undecryptedImgDir+"/blobs/sha256", "application/x-gzip", 0)
|
||||
|
||||
// Decrypt the image
|
||||
assertSkopeoSucceeds(c, "", "copy", "--decryption-key", keysDir+"/private.key",
|
||||
"oci:"+undecryptedImgDir+":encrypted", "oci:"+decryptedImgDir+":decrypted")
|
||||
|
||||
// After successful decryption we should find the gzipped layer from the
|
||||
// busybox image
|
||||
matchLayerBlobBinaryType(c, decryptedImgDir+"/blobs/sha256", "application/x-gzip", 1)
|
||||
|
||||
// Copy a standard multi layer nginx image locally
|
||||
assertSkopeoSucceeds(c, "", "copy", "docker://nginx:1.17.8", "oci:"+multiLayerImageDir+":latest")
|
||||
|
||||
// Partially encrypt the image
|
||||
assertSkopeoSucceeds(c, "", "copy", "--encryption-key", "jwe:"+keysDir+"/public.key",
|
||||
"--encrypt-layer", "1", "oci:"+multiLayerImageDir+":latest", "oci:"+partiallyEncryptedImgDir+":encrypted")
|
||||
|
||||
// Since the image is partially encrypted we should find layers that aren't encrypted
|
||||
matchLayerBlobBinaryType(c, partiallyEncryptedImgDir+"/blobs/sha256", "application/x-gzip", 2)
|
||||
|
||||
// Decrypt the partically encrypted image
|
||||
assertSkopeoSucceeds(c, "", "copy", "--decryption-key", keysDir+"/private.key",
|
||||
"oci:"+partiallyEncryptedImgDir+":encrypted", "oci:"+partiallyDecryptedImgDir+":decrypted")
|
||||
|
||||
// After successful decryption we should find the gzipped layers from the nginx image
|
||||
matchLayerBlobBinaryType(c, partiallyDecryptedImgDir+"/blobs/sha256", "application/x-gzip", 3)
|
||||
|
||||
}
|
||||
|
||||
func matchLayerBlobBinaryType(c *check.C, ociImageDirPath string, contentType string, matchCount int) {
|
||||
files, err := ioutil.ReadDir(ociImageDirPath)
|
||||
c.Assert(err, check.IsNil)
|
||||
|
||||
foundCount := 0
|
||||
for _, f := range files {
|
||||
fileContent, err := os.Open(ociImageDirPath + "/" + f.Name())
|
||||
c.Assert(err, check.IsNil)
|
||||
layerContentType, err := getFileContentType(fileContent)
|
||||
c.Assert(err, check.IsNil)
|
||||
|
||||
if layerContentType == contentType {
|
||||
foundCount = foundCount + 1
|
||||
}
|
||||
}
|
||||
|
||||
c.Assert(foundCount, check.Equals, matchCount)
|
||||
}
|
||||
|
||||
func getFileContentType(out *os.File) (string, error) {
|
||||
buffer := make([]byte, 512)
|
||||
_, err := out.Read(buffer)
|
||||
if err != nil {
|
||||
return "", err
|
||||
}
|
||||
contentType := http.DetectContentType(buffer)
|
||||
|
||||
return contentType, nil
|
||||
}
|
||||
|
||||
// Check whether dir: images in dir1 and dir2 are equal, ignoring schema1 signatures.
|
||||
func assertDirImagesAreEqual(c *check.C, dir1, dir2 string) {
|
||||
// The manifests may have different JWS signatures; so, compare the manifests by digests, which
|
||||
@@ -924,7 +1055,7 @@ func (s *CopySuite) TestCopyAtomicExtension(c *check.C) {
|
||||
|
||||
// Get another image (different so that they don't share signatures, and sign it using docker://)
|
||||
assertSkopeoSucceeds(c, "", "--tls-verify=false", "--registries.d", registriesDir,
|
||||
"copy", "--sign-by", "personal@example.com", "docker://estesp/busybox:ppc64le", "atomic:localhost:5000/myns/extension:extension")
|
||||
"copy", "--sign-by", "personal@example.com", "docker://estesp/busybox:ppc64le", "docker://localhost:5000/myns/extension:extension")
|
||||
c.Logf("%s", combinedOutputOfCommand(c, "oc", "get", "istag", "extension:extension", "-o", "json"))
|
||||
// Pulling the image using atomic: succeeds.
|
||||
assertSkopeoSucceeds(c, "", "--debug", "--tls-verify=false", "--policy", policy,
|
||||
@@ -936,6 +1067,67 @@ func (s *CopySuite) TestCopyAtomicExtension(c *check.C) {
|
||||
assertDirImagesAreEqual(c, filepath.Join(topDir, "dirDA"), filepath.Join(topDir, "dirDD"))
|
||||
}
|
||||
|
||||
func (s *CopySuite) TestCopyVerifyingMirroredSignatures(c *check.C) {
|
||||
const regPrefix = "docker://localhost:5006/myns/mirroring-"
|
||||
|
||||
mech, _, err := signature.NewEphemeralGPGSigningMechanism([]byte{})
|
||||
c.Assert(err, check.IsNil)
|
||||
defer mech.Close()
|
||||
if err := mech.SupportsSigning(); err != nil { // FIXME? Test that verification and policy enforcement works, using signatures from fixtures
|
||||
c.Skip(fmt.Sprintf("Signing not supported: %v", err))
|
||||
}
|
||||
|
||||
topDir, err := ioutil.TempDir("", "mirrored-signatures") // FIXME: Will this be used?
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(topDir)
|
||||
registriesDir := filepath.Join(topDir, "registries.d") // An empty directory to disable sigstore use
|
||||
dirDest := "dir:" + filepath.Join(topDir, "unused-dest")
|
||||
|
||||
policy := fileFromFixture(c, "fixtures/policy.json", map[string]string{"@keydir@": s.gpgHome})
|
||||
defer os.Remove(policy)
|
||||
|
||||
// We use X-R-S-S for this testing to avoid having to deal with the sigstores.
|
||||
// A downside is that OpenShift records signatures per image, so the error messsages below
|
||||
// list all signatures for other tags used for the same image as well.
|
||||
// So, make sure to never create a signature that could be considered valid in a different part of the test (i.e. don't reuse tags).
|
||||
|
||||
// Get an image to work with.
|
||||
assertSkopeoSucceeds(c, "", "copy", "--dest-tls-verify=false", "docker://busybox", regPrefix+"primary:unsigned")
|
||||
// Verify that unsigned images are rejected
|
||||
assertSkopeoFails(c, ".*Source image rejected: A signature was required, but no signature exists.*",
|
||||
"--policy", policy, "--registries.d", registriesDir, "--registries-conf", "fixtures/registries.conf", "copy", "--src-tls-verify=false", regPrefix+"primary:unsigned", dirDest)
|
||||
// Sign the image for the primary location
|
||||
assertSkopeoSucceeds(c, "", "--registries.d", registriesDir, "copy", "--src-tls-verify=false", "--dest-tls-verify=false", "--sign-by", "personal@example.com", regPrefix+"primary:unsigned", regPrefix+"primary:direct")
|
||||
// Verify that a correctly signed image in the primary location is usable.
|
||||
assertSkopeoSucceeds(c, "", "--policy", policy, "--registries.d", registriesDir, "--registries-conf", "fixtures/registries.conf", "copy", "--src-tls-verify=false", regPrefix+"primary:direct", dirDest)
|
||||
|
||||
// Sign the image for the mirror
|
||||
assertSkopeoSucceeds(c, "", "--registries.d", registriesDir, "copy", "--src-tls-verify=false", "--dest-tls-verify=false", "--sign-by", "personal@example.com", regPrefix+"primary:unsigned", regPrefix+"mirror:mirror-signed")
|
||||
// Verify that a correctly signed image for the mirror is acessible using the mirror's reference
|
||||
assertSkopeoSucceeds(c, "", "--policy", policy, "--registries.d", registriesDir, "--registries-conf", "fixtures/registries.conf", "copy", "--src-tls-verify=false", regPrefix+"mirror:mirror-signed", dirDest)
|
||||
// … but verify that while it is accessible using the primary location redirecting to the mirror, …
|
||||
assertSkopeoSucceeds(c, "" /* no --policy */, "--registries-conf", "fixtures/registries.conf", "copy", "--src-tls-verify=false", regPrefix+"primary:mirror-signed", dirDest)
|
||||
// … verify it is NOT accessible when requiring a signature.
|
||||
assertSkopeoFails(c, ".*Source image rejected: None of the signatures were accepted, reasons: Signature for identity localhost:5006/myns/mirroring-primary:direct is not accepted; Signature for identity localhost:5006/myns/mirroring-mirror:mirror-signed is not accepted.*",
|
||||
"--policy", policy, "--registries.d", registriesDir, "--registries-conf", "fixtures/registries.conf", "copy", "--src-tls-verify=false", regPrefix+"primary:mirror-signed", dirDest)
|
||||
|
||||
// Create a signature for mirroring-primary:primary-signed without pushing there. This should be easier than using standalone-sign.
|
||||
signingDir := filepath.Join(topDir, "signing-temp")
|
||||
assertSkopeoSucceeds(c, "", "copy", "--src-tls-verify=false", regPrefix+"primary:unsigned", "dir:"+signingDir)
|
||||
c.Logf("%s", combinedOutputOfCommand(c, "ls", "-laR", signingDir))
|
||||
assertSkopeoSucceeds(c, "^$", "standalone-sign", "-o", filepath.Join(signingDir, "signature-1"),
|
||||
filepath.Join(signingDir, "manifest.json"), "localhost:5006/myns/mirroring-primary:primary-signed", "personal@example.com")
|
||||
c.Logf("%s", combinedOutputOfCommand(c, "ls", "-laR", signingDir))
|
||||
assertSkopeoSucceeds(c, "", "--registries.d", registriesDir, "copy", "--dest-tls-verify=false", "dir:"+signingDir, regPrefix+"mirror:primary-signed")
|
||||
// Verify that a correctly signed image for the primary is accessible using the primary's reference
|
||||
assertSkopeoSucceeds(c, "", "--policy", policy, "--registries.d", registriesDir, "--registries-conf", "fixtures/registries.conf", "copy", "--src-tls-verify=false", regPrefix+"primary:primary-signed", dirDest)
|
||||
// … but verify that while it is accessible using the mirror location
|
||||
assertSkopeoSucceeds(c, "" /* no --policy */, "--registries-conf", "fixtures/registries.conf", "copy", "--src-tls-verify=false", regPrefix+"mirror:primary-signed", dirDest)
|
||||
// … verify it is NOT accessible when requiring a signature.
|
||||
assertSkopeoFails(c, ".*Source image rejected: None of the signatures were accepted, reasons: Signature for identity localhost:5006/myns/mirroring-primary:direct is not accepted; Signature for identity localhost:5006/myns/mirroring-mirror:mirror-signed is not accepted; Signature for identity localhost:5006/myns/mirroring-primary:primary-signed is not accepted.*",
|
||||
"--policy", policy, "--registries.d", registriesDir, "--registries-conf", "fixtures/registries.conf", "copy", "--src-tls-verify=false", regPrefix+"mirror:primary-signed", dirDest)
|
||||
}
|
||||
|
||||
func (s *SkopeoSuite) TestCopySrcWithAuth(c *check.C) {
|
||||
assertSkopeoSucceeds(c, "", "--tls-verify=false", "copy", "--dest-creds=testuser:testpassword", "docker://busybox", fmt.Sprintf("docker://%s/busybox:latest", s.regV2WithAuth.url))
|
||||
dir1, err := ioutil.TempDir("", "copy-1")
|
||||
|
||||
@@ -20,6 +20,20 @@
|
||||
"keyPath": "@keydir@/personal-pubkey.gpg"
|
||||
}
|
||||
],
|
||||
"localhost:5006/myns/mirroring-primary": [
|
||||
{
|
||||
"type": "signedBy",
|
||||
"keyType": "GPGKeys",
|
||||
"keyPath": "@keydir@/personal-pubkey.gpg"
|
||||
}
|
||||
],
|
||||
"localhost:5006/myns/mirroring-mirror": [
|
||||
{
|
||||
"type": "signedBy",
|
||||
"keyType": "GPGKeys",
|
||||
"keyPath": "@keydir@/personal-pubkey.gpg"
|
||||
}
|
||||
],
|
||||
"docker.io/openshift": [
|
||||
{
|
||||
"type": "insecureAcceptAnything"
|
||||
|
||||
@@ -26,3 +26,9 @@ mirror = [
|
||||
{ location = "wrong-mirror-0.invalid" },
|
||||
{ location = "gcr.io/google-containers" },
|
||||
]
|
||||
|
||||
[[registry]]
|
||||
location = "localhost:5006/myns/mirroring-primary"
|
||||
mirror = [
|
||||
{ location = "localhost:5006/myns/mirroring-mirror"},
|
||||
]
|
||||
|
||||
@@ -22,6 +22,7 @@ var adminKUBECONFIG = map[string]string{
|
||||
// running on localhost.
|
||||
type openshiftCluster struct {
|
||||
workingDir string
|
||||
dockerDir string
|
||||
processes []*exec.Cmd // Processes to terminate on teardown; append to the end, terminate from end to the start.
|
||||
}
|
||||
|
||||
@@ -211,8 +212,8 @@ func (cluster *openshiftCluster) ocLoginToProject(c *check.C) {
|
||||
// dockerLogin simulates (docker login) to the cluster, or terminates on failure.
|
||||
// We do not run (docker login) directly, because that requires a running daemon and a docker package.
|
||||
func (cluster *openshiftCluster) dockerLogin(c *check.C) {
|
||||
dockerDir := filepath.Join(homedir.Get(), ".docker")
|
||||
err := os.Mkdir(dockerDir, 0700)
|
||||
cluster.dockerDir = filepath.Join(homedir.Get(), ".docker")
|
||||
err := os.Mkdir(cluster.dockerDir, 0700)
|
||||
c.Assert(err, check.IsNil)
|
||||
|
||||
out := combinedOutputOfCommand(c, "oc", "config", "view", "-o", "json", "-o", "jsonpath={.users[*].user.token}")
|
||||
@@ -226,7 +227,7 @@ func (cluster *openshiftCluster) dockerLogin(c *check.C) {
|
||||
}`, port, authValue))
|
||||
}
|
||||
configJSON := `{"auths": {` + strings.Join(auths, ",") + `}}`
|
||||
err = ioutil.WriteFile(filepath.Join(dockerDir, "config.json"), []byte(configJSON), 0600)
|
||||
err = ioutil.WriteFile(filepath.Join(cluster.dockerDir, "config.json"), []byte(configJSON), 0600)
|
||||
c.Assert(err, check.IsNil)
|
||||
}
|
||||
|
||||
@@ -249,4 +250,7 @@ func (cluster *openshiftCluster) tearDown(c *check.C) {
|
||||
if cluster.workingDir != "" {
|
||||
os.RemoveAll(cluster.workingDir)
|
||||
}
|
||||
if cluster.dockerDir != "" {
|
||||
os.RemoveAll(cluster.dockerDir)
|
||||
}
|
||||
}
|
||||
|
||||
547
integration/sync_test.go
Normal file
547
integration/sync_test.go
Normal file
@@ -0,0 +1,547 @@
|
||||
package main
|
||||
|
||||
import (
|
||||
"context"
|
||||
"fmt"
|
||||
"io/ioutil"
|
||||
"os"
|
||||
"path"
|
||||
"path/filepath"
|
||||
"regexp"
|
||||
"strings"
|
||||
|
||||
"github.com/containers/image/v5/docker"
|
||||
"github.com/containers/image/v5/types"
|
||||
"github.com/go-check/check"
|
||||
)
|
||||
|
||||
func init() {
|
||||
check.Suite(&SyncSuite{})
|
||||
}
|
||||
|
||||
type SyncSuite struct {
|
||||
cluster *openshiftCluster
|
||||
registry *testRegistryV2
|
||||
gpgHome string
|
||||
}
|
||||
|
||||
func (s *SyncSuite) SetUpSuite(c *check.C) {
|
||||
const registryAuth = false
|
||||
const registrySchema1 = false
|
||||
|
||||
if os.Getenv("SKOPEO_LOCAL_TESTS") == "1" {
|
||||
c.Log("Running tests without a container")
|
||||
fmt.Printf("NOTE: tests requires a V2 registry at url=%s, with auth=%t, schema1=%t \n", v2DockerRegistryURL, registryAuth, registrySchema1)
|
||||
return
|
||||
}
|
||||
|
||||
if os.Getenv("SKOPEO_CONTAINER_TESTS") != "1" {
|
||||
c.Skip("Not running in a container, refusing to affect user state")
|
||||
}
|
||||
|
||||
s.cluster = startOpenshiftCluster(c) // FIXME: Set up TLS for the docker registry port instead of using "--tls-verify=false" all over the place.
|
||||
|
||||
for _, stream := range []string{"unsigned", "personal", "official", "naming", "cosigned", "compression", "schema1", "schema2"} {
|
||||
isJSON := fmt.Sprintf(`{
|
||||
"kind": "ImageStream",
|
||||
"apiVersion": "v1",
|
||||
"metadata": {
|
||||
"name": "%s"
|
||||
},
|
||||
"spec": {}
|
||||
}`, stream)
|
||||
runCommandWithInput(c, isJSON, "oc", "create", "-f", "-")
|
||||
}
|
||||
|
||||
// FIXME: Set up TLS for the docker registry port instead of using "--tls-verify=false" all over the place.
|
||||
s.registry = setupRegistryV2At(c, v2DockerRegistryURL, registryAuth, registrySchema1)
|
||||
|
||||
gpgHome, err := ioutil.TempDir("", "skopeo-gpg")
|
||||
c.Assert(err, check.IsNil)
|
||||
s.gpgHome = gpgHome
|
||||
os.Setenv("GNUPGHOME", s.gpgHome)
|
||||
|
||||
for _, key := range []string{"personal", "official"} {
|
||||
batchInput := fmt.Sprintf("Key-Type: RSA\nName-Real: Test key - %s\nName-email: %s@example.com\n%%no-protection\n%%commit\n",
|
||||
key, key)
|
||||
runCommandWithInput(c, batchInput, gpgBinary, "--batch", "--gen-key")
|
||||
|
||||
out := combinedOutputOfCommand(c, gpgBinary, "--armor", "--export", fmt.Sprintf("%s@example.com", key))
|
||||
err := ioutil.WriteFile(filepath.Join(s.gpgHome, fmt.Sprintf("%s-pubkey.gpg", key)),
|
||||
[]byte(out), 0600)
|
||||
c.Assert(err, check.IsNil)
|
||||
}
|
||||
}
|
||||
|
||||
func (s *SyncSuite) TearDownSuite(c *check.C) {
|
||||
if os.Getenv("SKOPEO_LOCAL_TESTS") == "1" {
|
||||
return
|
||||
}
|
||||
|
||||
if s.gpgHome != "" {
|
||||
os.RemoveAll(s.gpgHome)
|
||||
}
|
||||
if s.registry != nil {
|
||||
s.registry.Close()
|
||||
}
|
||||
if s.cluster != nil {
|
||||
s.cluster.tearDown(c)
|
||||
}
|
||||
}
|
||||
|
||||
func (s *SyncSuite) TestDocker2DirTagged(c *check.C) {
|
||||
tmpDir, err := ioutil.TempDir("", "skopeo-sync-test")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(tmpDir)
|
||||
|
||||
// FIXME: It would be nice to use one of the local Docker registries instead of neeeding an Internet connection.
|
||||
image := "busybox:latest"
|
||||
imageRef, err := docker.ParseReference(fmt.Sprintf("//%s", image))
|
||||
c.Assert(err, check.IsNil)
|
||||
imagePath := imageRef.DockerReference().String()
|
||||
|
||||
dir1 := path.Join(tmpDir, "dir1")
|
||||
dir2 := path.Join(tmpDir, "dir2")
|
||||
|
||||
// sync docker => dir
|
||||
assertSkopeoSucceeds(c, "", "sync", "--scoped", "--src", "docker", "--dest", "dir", image, dir1)
|
||||
_, err = os.Stat(path.Join(dir1, imagePath, "manifest.json"))
|
||||
c.Assert(err, check.IsNil)
|
||||
|
||||
// copy docker => dir
|
||||
assertSkopeoSucceeds(c, "", "copy", "docker://"+image, "dir:"+dir2)
|
||||
_, err = os.Stat(path.Join(dir2, "manifest.json"))
|
||||
c.Assert(err, check.IsNil)
|
||||
|
||||
out := combinedOutputOfCommand(c, "diff", "-urN", path.Join(dir1, imagePath), dir2)
|
||||
c.Assert(out, check.Equals, "")
|
||||
}
|
||||
|
||||
func (s *SyncSuite) TestScoped(c *check.C) {
|
||||
// FIXME: It would be nice to use one of the local Docker registries instead of neeeding an Internet connection.
|
||||
image := "busybox:latest"
|
||||
imageRef, err := docker.ParseReference(fmt.Sprintf("//%s", image))
|
||||
c.Assert(err, check.IsNil)
|
||||
imagePath := imageRef.DockerReference().String()
|
||||
|
||||
dir1, err := ioutil.TempDir("", "skopeo-sync-test")
|
||||
c.Assert(err, check.IsNil)
|
||||
assertSkopeoSucceeds(c, "", "sync", "--src", "docker", "--dest", "dir", image, dir1)
|
||||
_, err = os.Stat(path.Join(dir1, image, "manifest.json"))
|
||||
c.Assert(err, check.IsNil)
|
||||
|
||||
assertSkopeoSucceeds(c, "", "sync", "--scoped", "--src", "docker", "--dest", "dir", image, dir1)
|
||||
_, err = os.Stat(path.Join(dir1, imagePath, "manifest.json"))
|
||||
c.Assert(err, check.IsNil)
|
||||
|
||||
os.RemoveAll(dir1)
|
||||
}
|
||||
|
||||
func (s *SyncSuite) TestDirIsNotOverwritten(c *check.C) {
|
||||
// FIXME: It would be nice to use one of the local Docker registries instead of neeeding an Internet connection.
|
||||
image := "busybox:latest"
|
||||
imageRef, err := docker.ParseReference(fmt.Sprintf("//%s", image))
|
||||
c.Assert(err, check.IsNil)
|
||||
imagePath := imageRef.DockerReference().String()
|
||||
|
||||
// make a copy of the image in the local registry
|
||||
assertSkopeoSucceeds(c, "", "copy", "--dest-tls-verify=false", "docker://"+image, "docker://"+path.Join(v2DockerRegistryURL, image))
|
||||
|
||||
//sync upstream image to dir, not scoped
|
||||
dir1, err := ioutil.TempDir("", "skopeo-sync-test")
|
||||
c.Assert(err, check.IsNil)
|
||||
assertSkopeoSucceeds(c, "", "sync", "--src", "docker", "--dest", "dir", image, dir1)
|
||||
_, err = os.Stat(path.Join(dir1, image, "manifest.json"))
|
||||
c.Assert(err, check.IsNil)
|
||||
|
||||
//sync local registry image to dir, not scoped
|
||||
assertSkopeoFails(c, ".*Refusing to overwrite destination directory.*", "sync", "--src-tls-verify=false", "--src", "docker", "--dest", "dir", path.Join(v2DockerRegistryURL, image), dir1)
|
||||
|
||||
//sync local registry image to dir, scoped
|
||||
imageRef, err = docker.ParseReference(fmt.Sprintf("//%s", path.Join(v2DockerRegistryURL, image)))
|
||||
c.Assert(err, check.IsNil)
|
||||
imagePath = imageRef.DockerReference().String()
|
||||
assertSkopeoSucceeds(c, "", "sync", "--scoped", "--src-tls-verify=false", "--src", "docker", "--dest", "dir", path.Join(v2DockerRegistryURL, image), dir1)
|
||||
_, err = os.Stat(path.Join(dir1, imagePath, "manifest.json"))
|
||||
c.Assert(err, check.IsNil)
|
||||
os.RemoveAll(dir1)
|
||||
}
|
||||
|
||||
func (s *SyncSuite) TestDocker2DirUntagged(c *check.C) {
|
||||
|
||||
tmpDir, err := ioutil.TempDir("", "skopeo-sync-test")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(tmpDir)
|
||||
|
||||
// FIXME: It would be nice to use one of the local Docker registries instead of neeeding an Internet connection.
|
||||
image := "alpine"
|
||||
imageRef, err := docker.ParseReference(fmt.Sprintf("//%s", image))
|
||||
c.Assert(err, check.IsNil)
|
||||
imagePath := imageRef.DockerReference().String()
|
||||
|
||||
dir1 := path.Join(tmpDir, "dir1")
|
||||
assertSkopeoSucceeds(c, "", "sync", "--scoped", "--src", "docker", "--dest", "dir", image, dir1)
|
||||
|
||||
sysCtx := types.SystemContext{}
|
||||
tags, err := docker.GetRepositoryTags(context.Background(), &sysCtx, imageRef)
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Check(len(tags), check.Not(check.Equals), 0)
|
||||
|
||||
nManifests, err := filepath.Glob(path.Join(dir1, path.Dir(imagePath), "*", "manifest.json"))
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Assert(len(nManifests), check.Equals, len(tags))
|
||||
}
|
||||
|
||||
func (s *SyncSuite) TestYamlUntagged(c *check.C) {
|
||||
tmpDir, err := ioutil.TempDir("", "skopeo-sync-test")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(tmpDir)
|
||||
dir1 := path.Join(tmpDir, "dir1")
|
||||
|
||||
image := "alpine"
|
||||
imageRef, err := docker.ParseReference(fmt.Sprintf("//%s", image))
|
||||
c.Assert(err, check.IsNil)
|
||||
imagePath := imageRef.DockerReference().Name()
|
||||
|
||||
sysCtx := types.SystemContext{}
|
||||
tags, err := docker.GetRepositoryTags(context.Background(), &sysCtx, imageRef)
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Check(len(tags), check.Not(check.Equals), 0)
|
||||
|
||||
yamlConfig := fmt.Sprintf(`
|
||||
docker.io:
|
||||
images:
|
||||
%s:
|
||||
`, image)
|
||||
|
||||
//sync to the local reg
|
||||
yamlFile := path.Join(tmpDir, "registries.yaml")
|
||||
ioutil.WriteFile(yamlFile, []byte(yamlConfig), 0644)
|
||||
assertSkopeoSucceeds(c, "", "sync", "--scoped", "--src", "yaml", "--dest", "docker", "--dest-tls-verify=false", yamlFile, v2DockerRegistryURL)
|
||||
// sync back from local reg to a folder
|
||||
os.Remove(yamlFile)
|
||||
yamlConfig = fmt.Sprintf(`
|
||||
%s:
|
||||
tls-verify: false
|
||||
images:
|
||||
%s:
|
||||
|
||||
`, v2DockerRegistryURL, imagePath)
|
||||
|
||||
ioutil.WriteFile(yamlFile, []byte(yamlConfig), 0644)
|
||||
assertSkopeoSucceeds(c, "", "sync", "--scoped", "--src", "yaml", "--dest", "dir", yamlFile, dir1)
|
||||
|
||||
sysCtx = types.SystemContext{
|
||||
DockerInsecureSkipTLSVerify: types.NewOptionalBool(true),
|
||||
}
|
||||
localTags, err := docker.GetRepositoryTags(context.Background(), &sysCtx, imageRef)
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Check(len(localTags), check.Not(check.Equals), 0)
|
||||
c.Assert(len(localTags), check.Equals, len(tags))
|
||||
|
||||
nManifests := 0
|
||||
//count the number of manifest.json in dir1
|
||||
err = filepath.Walk(dir1, func(path string, info os.FileInfo, err error) error {
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
if !info.IsDir() && info.Name() == "manifest.json" {
|
||||
nManifests++
|
||||
return filepath.SkipDir
|
||||
}
|
||||
return nil
|
||||
})
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Assert(nManifests, check.Equals, len(tags))
|
||||
}
|
||||
|
||||
func (s *SyncSuite) TestYamlRegex2Dir(c *check.C) {
|
||||
tmpDir, err := ioutil.TempDir("", "skopeo-sync-test")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(tmpDir)
|
||||
dir1 := path.Join(tmpDir, "dir1")
|
||||
|
||||
yamlConfig := `
|
||||
docker.io:
|
||||
images-by-tag-regex:
|
||||
nginx: ^1\.13\.[12]-alpine-perl$ # regex string test
|
||||
`
|
||||
// the ↑ regex strings always matches only 2 images
|
||||
var nTags = 2
|
||||
c.Assert(nTags, check.Not(check.Equals), 0)
|
||||
|
||||
yamlFile := path.Join(tmpDir, "registries.yaml")
|
||||
ioutil.WriteFile(yamlFile, []byte(yamlConfig), 0644)
|
||||
assertSkopeoSucceeds(c, "", "sync", "--scoped", "--src", "yaml", "--dest", "dir", yamlFile, dir1)
|
||||
|
||||
nManifests := 0
|
||||
err = filepath.Walk(dir1, func(path string, info os.FileInfo, err error) error {
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
if !info.IsDir() && info.Name() == "manifest.json" {
|
||||
nManifests++
|
||||
return filepath.SkipDir
|
||||
}
|
||||
return nil
|
||||
})
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Assert(nManifests, check.Equals, nTags)
|
||||
}
|
||||
|
||||
func (s *SyncSuite) TestYaml2Dir(c *check.C) {
|
||||
tmpDir, err := ioutil.TempDir("", "skopeo-sync-test")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(tmpDir)
|
||||
dir1 := path.Join(tmpDir, "dir1")
|
||||
|
||||
yamlConfig := `
|
||||
docker.io:
|
||||
images:
|
||||
busybox:
|
||||
- latest
|
||||
- musl
|
||||
alpine:
|
||||
- edge
|
||||
- 3.8
|
||||
opensuse/leap:
|
||||
- latest
|
||||
|
||||
quay.io:
|
||||
images:
|
||||
quay/busybox:
|
||||
- latest`
|
||||
|
||||
// get the number of tags
|
||||
re := regexp.MustCompile(`^ +- +[^:/ ]+`)
|
||||
var nTags int
|
||||
for _, l := range strings.Split(yamlConfig, "\n") {
|
||||
if re.MatchString(l) {
|
||||
nTags++
|
||||
}
|
||||
}
|
||||
c.Assert(nTags, check.Not(check.Equals), 0)
|
||||
|
||||
yamlFile := path.Join(tmpDir, "registries.yaml")
|
||||
ioutil.WriteFile(yamlFile, []byte(yamlConfig), 0644)
|
||||
assertSkopeoSucceeds(c, "", "sync", "--scoped", "--src", "yaml", "--dest", "dir", yamlFile, dir1)
|
||||
|
||||
nManifests := 0
|
||||
err = filepath.Walk(dir1, func(path string, info os.FileInfo, err error) error {
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
if !info.IsDir() && info.Name() == "manifest.json" {
|
||||
nManifests++
|
||||
return filepath.SkipDir
|
||||
}
|
||||
return nil
|
||||
})
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Assert(nManifests, check.Equals, nTags)
|
||||
}
|
||||
|
||||
func (s *SyncSuite) TestYamlTLSVerify(c *check.C) {
|
||||
const localRegURL = "docker://" + v2DockerRegistryURL + "/"
|
||||
tmpDir, err := ioutil.TempDir("", "skopeo-sync-test")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(tmpDir)
|
||||
dir1 := path.Join(tmpDir, "dir1")
|
||||
image := "busybox"
|
||||
tag := "latest"
|
||||
|
||||
// FIXME: It would be nice to use one of the local Docker registries instead of neeeding an Internet connection.
|
||||
// copy docker => docker
|
||||
assertSkopeoSucceeds(c, "", "copy", "--dest-tls-verify=false", "docker://"+image+":"+tag, localRegURL+image+":"+tag)
|
||||
|
||||
yamlTemplate := `
|
||||
%s:
|
||||
%s
|
||||
images:
|
||||
%s:
|
||||
- %s`
|
||||
|
||||
testCfg := []struct {
|
||||
tlsVerify string
|
||||
msg string
|
||||
checker func(c *check.C, regexp string, args ...string)
|
||||
}{
|
||||
{
|
||||
tlsVerify: "tls-verify: false",
|
||||
msg: "",
|
||||
checker: assertSkopeoSucceeds,
|
||||
},
|
||||
{
|
||||
tlsVerify: "tls-verify: true",
|
||||
msg: ".*server gave HTTP response to HTTPS client.*",
|
||||
checker: assertSkopeoFails,
|
||||
},
|
||||
// no "tls-verify" line means default TLS verify must be ON
|
||||
{
|
||||
tlsVerify: "",
|
||||
msg: ".*server gave HTTP response to HTTPS client.*",
|
||||
checker: assertSkopeoFails,
|
||||
},
|
||||
}
|
||||
|
||||
for _, cfg := range testCfg {
|
||||
yamlConfig := fmt.Sprintf(yamlTemplate, v2DockerRegistryURL, cfg.tlsVerify, image, tag)
|
||||
yamlFile := path.Join(tmpDir, "registries.yaml")
|
||||
ioutil.WriteFile(yamlFile, []byte(yamlConfig), 0644)
|
||||
|
||||
cfg.checker(c, cfg.msg, "sync", "--scoped", "--src", "yaml", "--dest", "dir", yamlFile, dir1)
|
||||
os.Remove(yamlFile)
|
||||
os.RemoveAll(dir1)
|
||||
}
|
||||
|
||||
}
|
||||
|
||||
func (s *SyncSuite) TestDocker2DockerTagged(c *check.C) {
|
||||
const localRegURL = "docker://" + v2DockerRegistryURL + "/"
|
||||
|
||||
tmpDir, err := ioutil.TempDir("", "skopeo-sync-test")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(tmpDir)
|
||||
|
||||
// FIXME: It would be nice to use one of the local Docker registries instead of neeeding an Internet connection.
|
||||
image := "busybox:latest"
|
||||
imageRef, err := docker.ParseReference(fmt.Sprintf("//%s", image))
|
||||
c.Assert(err, check.IsNil)
|
||||
imagePath := imageRef.DockerReference().String()
|
||||
|
||||
dir1 := path.Join(tmpDir, "dir1")
|
||||
dir2 := path.Join(tmpDir, "dir2")
|
||||
|
||||
// sync docker => docker
|
||||
assertSkopeoSucceeds(c, "", "sync", "--scoped", "--dest-tls-verify=false", "--src", "docker", "--dest", "docker", image, v2DockerRegistryURL)
|
||||
|
||||
// copy docker => dir
|
||||
assertSkopeoSucceeds(c, "", "copy", "docker://"+image, "dir:"+dir1)
|
||||
_, err = os.Stat(path.Join(dir1, "manifest.json"))
|
||||
c.Assert(err, check.IsNil)
|
||||
|
||||
// copy docker => dir
|
||||
assertSkopeoSucceeds(c, "", "copy", "--src-tls-verify=false", localRegURL+imagePath, "dir:"+dir2)
|
||||
_, err = os.Stat(path.Join(dir2, "manifest.json"))
|
||||
c.Assert(err, check.IsNil)
|
||||
|
||||
out := combinedOutputOfCommand(c, "diff", "-urN", dir1, dir2)
|
||||
c.Assert(out, check.Equals, "")
|
||||
}
|
||||
|
||||
func (s *SyncSuite) TestDir2DockerTagged(c *check.C) {
|
||||
const localRegURL = "docker://" + v2DockerRegistryURL + "/"
|
||||
|
||||
tmpDir, err := ioutil.TempDir("", "skopeo-sync-test")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(tmpDir)
|
||||
|
||||
// FIXME: It would be nice to use one of the local Docker registries instead of neeeding an Internet connection.
|
||||
image := "busybox:latest"
|
||||
|
||||
dir1 := path.Join(tmpDir, "dir1")
|
||||
err = os.Mkdir(dir1, 0755)
|
||||
c.Assert(err, check.IsNil)
|
||||
dir2 := path.Join(tmpDir, "dir2")
|
||||
err = os.Mkdir(dir2, 0755)
|
||||
c.Assert(err, check.IsNil)
|
||||
|
||||
// copy docker => dir
|
||||
assertSkopeoSucceeds(c, "", "copy", "docker://"+image, "dir:"+path.Join(dir1, image))
|
||||
_, err = os.Stat(path.Join(dir1, image, "manifest.json"))
|
||||
c.Assert(err, check.IsNil)
|
||||
|
||||
// sync dir => docker
|
||||
assertSkopeoSucceeds(c, "", "sync", "--scoped", "--dest-tls-verify=false", "--src", "dir", "--dest", "docker", dir1, v2DockerRegistryURL)
|
||||
|
||||
// copy docker => dir
|
||||
assertSkopeoSucceeds(c, "", "copy", "--src-tls-verify=false", localRegURL+image, "dir:"+path.Join(dir2, image))
|
||||
_, err = os.Stat(path.Join(path.Join(dir2, image), "manifest.json"))
|
||||
c.Assert(err, check.IsNil)
|
||||
|
||||
out := combinedOutputOfCommand(c, "diff", "-urN", dir1, dir2)
|
||||
c.Assert(out, check.Equals, "")
|
||||
}
|
||||
|
||||
func (s *SyncSuite) TestFailsWithDir2Dir(c *check.C) {
|
||||
tmpDir, err := ioutil.TempDir("", "skopeo-sync-test")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(tmpDir)
|
||||
|
||||
dir1 := path.Join(tmpDir, "dir1")
|
||||
dir2 := path.Join(tmpDir, "dir2")
|
||||
|
||||
// sync dir => dir is not allowed
|
||||
assertSkopeoFails(c, ".*sync from 'dir' to 'dir' not implemented.*", "sync", "--scoped", "--src", "dir", "--dest", "dir", dir1, dir2)
|
||||
}
|
||||
|
||||
func (s *SyncSuite) TestFailsNoSourceImages(c *check.C) {
|
||||
tmpDir, err := ioutil.TempDir("", "skopeo-sync-test")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(tmpDir)
|
||||
|
||||
assertSkopeoFails(c, ".*No images to sync found in .*",
|
||||
"sync", "--scoped", "--dest-tls-verify=false", "--src", "dir", "--dest", "docker", tmpDir, v2DockerRegistryURL)
|
||||
|
||||
assertSkopeoFails(c, ".*No images to sync found in .*",
|
||||
"sync", "--scoped", "--dest-tls-verify=false", "--src", "docker", "--dest", "docker", "hopefully_no_images_will_ever_be_called_like_this", v2DockerRegistryURL)
|
||||
}
|
||||
|
||||
func (s *SyncSuite) TestFailsWithDockerSourceNoRegistry(c *check.C) {
|
||||
const regURL = "google.com/namespace/imagename"
|
||||
|
||||
tmpDir, err := ioutil.TempDir("", "skopeo-sync-test")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(tmpDir)
|
||||
|
||||
//untagged
|
||||
assertSkopeoFails(c, ".*invalid status code from registry 404.*",
|
||||
"sync", "--scoped", "--src", "docker", "--dest", "dir", regURL, tmpDir)
|
||||
|
||||
//tagged
|
||||
assertSkopeoFails(c, ".*invalid status code from registry 404.*",
|
||||
"sync", "--scoped", "--src", "docker", "--dest", "dir", regURL+":thetag", tmpDir)
|
||||
}
|
||||
|
||||
func (s *SyncSuite) TestFailsWithDockerSourceUnauthorized(c *check.C) {
|
||||
const repo = "privateimagenamethatshouldnotbepublic"
|
||||
tmpDir, err := ioutil.TempDir("", "skopeo-sync-test")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(tmpDir)
|
||||
|
||||
//untagged
|
||||
assertSkopeoFails(c, ".*Registry disallows tag list retrieval.*",
|
||||
"sync", "--scoped", "--src", "docker", "--dest", "dir", repo, tmpDir)
|
||||
|
||||
//tagged
|
||||
assertSkopeoFails(c, ".*unauthorized: authentication required.*",
|
||||
"sync", "--scoped", "--src", "docker", "--dest", "dir", repo+":thetag", tmpDir)
|
||||
}
|
||||
|
||||
func (s *SyncSuite) TestFailsWithDockerSourceNotExisting(c *check.C) {
|
||||
repo := path.Join(v2DockerRegistryURL, "imagedoesdotexist")
|
||||
tmpDir, err := ioutil.TempDir("", "skopeo-sync-test")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(tmpDir)
|
||||
|
||||
//untagged
|
||||
assertSkopeoFails(c, ".*invalid status code from registry 404.*",
|
||||
"sync", "--scoped", "--src-tls-verify=false", "--src", "docker", "--dest", "dir", repo, tmpDir)
|
||||
|
||||
//tagged
|
||||
assertSkopeoFails(c, ".*Error reading manifest.*",
|
||||
"sync", "--scoped", "--src-tls-verify=false", "--src", "docker", "--dest", "dir", repo+":thetag", tmpDir)
|
||||
}
|
||||
|
||||
func (s *SyncSuite) TestFailsWithDirSourceNotExisting(c *check.C) {
|
||||
// Make sure the dir does not exist!
|
||||
tmpDir, err := ioutil.TempDir("", "skopeo-sync-test")
|
||||
c.Assert(err, check.IsNil)
|
||||
err = os.RemoveAll(tmpDir)
|
||||
c.Assert(err, check.IsNil)
|
||||
_, err = os.Stat(path.Join(tmpDir))
|
||||
c.Check(os.IsNotExist(err), check.Equals, true)
|
||||
|
||||
assertSkopeoFails(c, ".*no such file or directory.*",
|
||||
"sync", "--scoped", "--dest-tls-verify=false", "--src", "dir", "--dest", "docker", tmpDir, v2DockerRegistryURL)
|
||||
}
|
||||
@@ -73,10 +73,51 @@ END_EXPECT
|
||||
# 1) Get remote image values of environment variables (the value of 'Env')
|
||||
# 2) Confirm substring in check_array and the value of 'Env' match.
|
||||
check_array=(PATH=.* )
|
||||
remote=$(echo "$inspect_remote" | jq '.Env[]')
|
||||
remote=$(jq '.Env[]' <<<"$inspect_remote")
|
||||
for substr in ${check_array[@]}; do
|
||||
expect_output --from="$remote" --substring "$substr"
|
||||
done
|
||||
}
|
||||
|
||||
@test "inspect: image manifest list w/ diff platform" {
|
||||
# When --raw is provided, can inspect show the raw manifest list, w/o
|
||||
# requiring any particular platform to be present
|
||||
# To test whether container image can be inspected successfully w/o
|
||||
# platform dependency.
|
||||
# 1) Get current platform arch
|
||||
# 2) Inspect container image is different from current platform arch
|
||||
# 3) Compare output w/ expected result
|
||||
|
||||
# Here we see a revolting workaround for a podman incompatibility
|
||||
# change: in April 2020, podman info completely changed format
|
||||
# of the keys. What worked until then now throws an error. We
|
||||
# need to work with both old and new podman.
|
||||
arch=$(podman info --format '{{.host.arch}}' || true)
|
||||
if [[ -z "$arch" ]]; then
|
||||
arch=$(podman info --format '{{.Host.Arch}}')
|
||||
fi
|
||||
|
||||
case $arch in
|
||||
"amd64")
|
||||
diff_arch_list="s390x ppc64le"
|
||||
;;
|
||||
"s390x")
|
||||
diff_arch_list="amd64 ppc64le"
|
||||
;;
|
||||
"ppc64le")
|
||||
diff_arch_list="amd64 s390x"
|
||||
;;
|
||||
"*")
|
||||
diff_arch_list="amd64 s390x ppc64le"
|
||||
;;
|
||||
esac
|
||||
|
||||
for arch in $diff_arch_list; do
|
||||
remote_image=docker://docker.io/$arch/golang
|
||||
run_skopeo inspect --tls-verify=false --raw $remote_image
|
||||
remote_arch=$(jq -r '.manifests[0]["platform"]["architecture"]' <<< "$output")
|
||||
expect_output --from="$remote_arch" "$arch" "platform arch of $remote_image"
|
||||
done
|
||||
}
|
||||
|
||||
# vim: filetype=sh
|
||||
|
||||
@@ -14,7 +14,7 @@ function setup() {
|
||||
# From remote, to dir1, to local, to dir2;
|
||||
# compare dir1 and dir2, expect no changes
|
||||
@test "copy: dir, round trip" {
|
||||
local remote_image=docker://busybox:latest
|
||||
local remote_image=docker://docker.io/library/busybox:latest
|
||||
local localimg=docker://localhost:5000/busybox:unsigned
|
||||
|
||||
local dir1=$TESTDIR/dir1
|
||||
@@ -30,7 +30,7 @@ function setup() {
|
||||
|
||||
# Same as above, but using 'oci:' instead of 'dir:' and with a :latest tag
|
||||
@test "copy: oci, round trip" {
|
||||
local remote_image=docker://busybox:latest
|
||||
local remote_image=docker://docker.io/library/busybox:latest
|
||||
local localimg=docker://localhost:5000/busybox:unsigned
|
||||
|
||||
local dir1=$TESTDIR/oci1
|
||||
@@ -46,7 +46,7 @@ function setup() {
|
||||
|
||||
# Compression zstd
|
||||
@test "copy: oci, round trip, zstd" {
|
||||
local remote_image=docker://busybox:latest
|
||||
local remote_image=docker://docker.io/library/busybox:latest
|
||||
|
||||
local dir=$TESTDIR/dir
|
||||
|
||||
@@ -61,7 +61,7 @@ function setup() {
|
||||
|
||||
# Same image, extracted once with :tag and once without
|
||||
@test "copy: oci w/ and w/o tags" {
|
||||
local remote_image=docker://busybox:latest
|
||||
local remote_image=docker://docker.io/library/busybox:latest
|
||||
|
||||
local dir1=$TESTDIR/dir1
|
||||
local dir2=$TESTDIR/dir2
|
||||
|
||||
@@ -14,7 +14,7 @@ function setup() {
|
||||
@test "local registry, with cert" {
|
||||
# Push to local registry...
|
||||
run_skopeo copy --dest-cert-dir=$TESTDIR/client-auth \
|
||||
docker://busybox:latest \
|
||||
docker://docker.io/library/busybox:latest \
|
||||
docker://localhost:5000/busybox:unsigned
|
||||
|
||||
# ...and pull it back out
|
||||
|
||||
@@ -14,15 +14,6 @@ function setup() {
|
||||
mkdir -p $_cred_dir/containers
|
||||
rm -f $_cred_dir/containers/auth.json
|
||||
|
||||
# TODO: This is here to work around
|
||||
# https://github.com/containers/libpod/issues/4227 in the
|
||||
# "auth: credentials via podman login" test.
|
||||
# It should be removed once a packaged version of podman which includes
|
||||
# that fix is available in our CI environment, since we _want_ to be
|
||||
# checking that podman and skopeo agree on the default for where registry
|
||||
# credentials should be stored.
|
||||
export REGISTRY_AUTH_FILE=$_cred_dir/containers/auth.json
|
||||
|
||||
# Start authenticated registry with random password
|
||||
testuser=testuser
|
||||
testpassword=$(random_string 15)
|
||||
@@ -52,7 +43,8 @@ function setup() {
|
||||
|
||||
# These should pass
|
||||
run_skopeo copy --dest-tls-verify=false --dcreds=$testuser:$testpassword \
|
||||
docker://busybox:latest docker://localhost:5000/busybox:mine
|
||||
docker://docker.io/library/busybox:latest \
|
||||
docker://localhost:5000/busybox:mine
|
||||
run_skopeo inspect --tls-verify=false --creds=$testuser:$testpassword \
|
||||
docker://localhost:5000/busybox:mine
|
||||
expect_output --substring "localhost:5000/busybox"
|
||||
@@ -63,7 +55,8 @@ function setup() {
|
||||
podman login --tls-verify=false -u $testuser -p $testpassword localhost:5000
|
||||
|
||||
run_skopeo copy --dest-tls-verify=false \
|
||||
docker://busybox:latest docker://localhost:5000/busybox:mine
|
||||
docker://docker.io/library/busybox:latest \
|
||||
docker://localhost:5000/busybox:mine
|
||||
run_skopeo inspect --tls-verify=false docker://localhost:5000/busybox:mine
|
||||
expect_output --substring "localhost:5000/busybox"
|
||||
|
||||
|
||||
@@ -92,7 +92,8 @@ END_POLICY_JSON
|
||||
fi
|
||||
|
||||
# Cache local copy
|
||||
run_skopeo copy docker://busybox:latest dir:$TESTDIR/busybox
|
||||
run_skopeo copy docker://docker.io/library/busybox:latest \
|
||||
dir:$TESTDIR/busybox
|
||||
|
||||
# Push a bunch of images. Do so *without* --policy flag; this lets us
|
||||
# sign or not, creating images that will or won't conform to policy.
|
||||
|
||||
@@ -13,7 +13,7 @@ function setup() {
|
||||
|
||||
# delete image from registry
|
||||
@test "delete: remove image from registry" {
|
||||
local remote_image=docker://busybox:latest
|
||||
local remote_image=docker://docker.io/library/busybox:latest
|
||||
local localimg=docker://localhost:5000/busybox:unsigned
|
||||
local output=
|
||||
|
||||
|
||||
@@ -5,6 +5,9 @@ SKOPEO_BINARY=${SKOPEO_BINARY:-$(dirname ${BASH_SOURCE})/../skopeo}
|
||||
# Default timeout for a skopeo command.
|
||||
SKOPEO_TIMEOUT=${SKOPEO_TIMEOUT:-300}
|
||||
|
||||
# Default image to run as a local registry
|
||||
REGISTRY_FQIN=${SKOPEO_TEST_REGISTRY_FQIN:-docker.io/library/registry:2}
|
||||
|
||||
###############################################################################
|
||||
# BEGIN setup/teardown
|
||||
|
||||
@@ -288,9 +291,21 @@ start_registry() {
|
||||
reg_args+=( -e REGISTRY_STORAGE_DELETE_ENABLED=true)
|
||||
fi
|
||||
|
||||
# TODO: This is TEMPORARY (as of 2020-03-30); remove once crun is fixed.
|
||||
# Skopeo PR #836 claims there's a "regression" in crun with cgroupsv1,
|
||||
# but offers no details about what it is (crun issue nor PR) nor when/if
|
||||
# it's fixed. It's simply a workaround, forcing podman to use runc,
|
||||
# which might work great for skopeo CI but breaks Fedora gating tests.
|
||||
# Instead of always forcing runc, do so only when under cgroups v1:
|
||||
local runtime=
|
||||
cgroup_type=$(stat -f -c %T /sys/fs/cgroup)
|
||||
if [[ $cgroup_type == "tmpfs" ]]; then
|
||||
runtime="--runtime runc"
|
||||
fi
|
||||
|
||||
# cgroup option necessary under podman-in-podman (CI tests),
|
||||
# and doesn't seem to do any harm otherwise.
|
||||
PODMAN="podman --cgroup-manager=cgroupfs"
|
||||
PODMAN="podman $runtime --cgroup-manager=cgroupfs"
|
||||
|
||||
# Called with --testuser? Create an htpasswd file
|
||||
if [[ -n $testuser ]]; then
|
||||
@@ -299,8 +314,7 @@ start_registry() {
|
||||
fi
|
||||
|
||||
if ! egrep -q "^$testuser:" $AUTHDIR/htpasswd; then
|
||||
log_and_run $PODMAN run --rm --entrypoint htpasswd registry:2 \
|
||||
-Bbn $testuser $testpassword >> $AUTHDIR/htpasswd
|
||||
htpasswd -Bbn $testuser $testpassword >> $AUTHDIR/htpasswd
|
||||
fi
|
||||
|
||||
reg_args+=(
|
||||
@@ -332,7 +346,7 @@ start_registry() {
|
||||
log_and_run cp $CERT $TESTDIR/client-auth/
|
||||
fi
|
||||
|
||||
log_and_run $PODMAN run -d --name $name "${reg_args[@]}" registry:2
|
||||
log_and_run $PODMAN run -d --name $name "${reg_args[@]}" $REGISTRY_FQIN
|
||||
|
||||
# Wait for registry to actually come up
|
||||
timeout=10
|
||||
|
||||
18
vendor/github.com/Microsoft/go-winio/file.go
generated
vendored
18
vendor/github.com/Microsoft/go-winio/file.go
generated
vendored
@@ -16,6 +16,7 @@ import (
|
||||
//sys createIoCompletionPort(file syscall.Handle, port syscall.Handle, key uintptr, threadCount uint32) (newport syscall.Handle, err error) = CreateIoCompletionPort
|
||||
//sys getQueuedCompletionStatus(port syscall.Handle, bytes *uint32, key *uintptr, o **ioOperation, timeout uint32) (err error) = GetQueuedCompletionStatus
|
||||
//sys setFileCompletionNotificationModes(h syscall.Handle, flags uint8) (err error) = SetFileCompletionNotificationModes
|
||||
//sys wsaGetOverlappedResult(h syscall.Handle, o *syscall.Overlapped, bytes *uint32, wait bool, flags *uint32) (err error) = ws2_32.WSAGetOverlappedResult
|
||||
|
||||
type atomicBool int32
|
||||
|
||||
@@ -79,6 +80,7 @@ type win32File struct {
|
||||
wg sync.WaitGroup
|
||||
wgLock sync.RWMutex
|
||||
closing atomicBool
|
||||
socket bool
|
||||
readDeadline deadlineHandler
|
||||
writeDeadline deadlineHandler
|
||||
}
|
||||
@@ -109,7 +111,13 @@ func makeWin32File(h syscall.Handle) (*win32File, error) {
|
||||
}
|
||||
|
||||
func MakeOpenFile(h syscall.Handle) (io.ReadWriteCloser, error) {
|
||||
return makeWin32File(h)
|
||||
// If we return the result of makeWin32File directly, it can result in an
|
||||
// interface-wrapped nil, rather than a nil interface value.
|
||||
f, err := makeWin32File(h)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return f, nil
|
||||
}
|
||||
|
||||
// closeHandle closes the resources associated with a Win32 handle
|
||||
@@ -190,6 +198,10 @@ func (f *win32File) asyncIo(c *ioOperation, d *deadlineHandler, bytes uint32, er
|
||||
if f.closing.isSet() {
|
||||
err = ErrFileClosed
|
||||
}
|
||||
} else if err != nil && f.socket {
|
||||
// err is from Win32. Query the overlapped structure to get the winsock error.
|
||||
var bytes, flags uint32
|
||||
err = wsaGetOverlappedResult(f.handle, &c.o, &bytes, false, &flags)
|
||||
}
|
||||
case <-timeout:
|
||||
cancelIoEx(f.handle, &c.o)
|
||||
@@ -265,6 +277,10 @@ func (f *win32File) Flush() error {
|
||||
return syscall.FlushFileBuffers(f.handle)
|
||||
}
|
||||
|
||||
func (f *win32File) Fd() uintptr {
|
||||
return uintptr(f.handle)
|
||||
}
|
||||
|
||||
func (d *deadlineHandler) set(deadline time.Time) error {
|
||||
d.setLock.Lock()
|
||||
defer d.setLock.Unlock()
|
||||
|
||||
9
vendor/github.com/Microsoft/go-winio/go.mod
generated
vendored
Normal file
9
vendor/github.com/Microsoft/go-winio/go.mod
generated
vendored
Normal file
@@ -0,0 +1,9 @@
|
||||
module github.com/Microsoft/go-winio
|
||||
|
||||
go 1.12
|
||||
|
||||
require (
|
||||
github.com/pkg/errors v0.8.1
|
||||
github.com/sirupsen/logrus v1.4.1
|
||||
golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3
|
||||
)
|
||||
18
vendor/github.com/Microsoft/go-winio/go.sum
generated
vendored
Normal file
18
vendor/github.com/Microsoft/go-winio/go.sum
generated
vendored
Normal file
@@ -0,0 +1,18 @@
|
||||
github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c=
|
||||
github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
|
||||
github.com/konsorten/go-windows-terminal-sequences v1.0.1 h1:mweAR1A6xJ3oS2pRaGiHgQ4OO8tzTaLawm8vnODuwDk=
|
||||
github.com/konsorten/go-windows-terminal-sequences v1.0.1/go.mod h1:T0+1ngSBFLxvqU3pZ+m/2kptfBszLMUkC4ZK/EgS/cQ=
|
||||
github.com/pkg/errors v0.8.1 h1:iURUrRGxPUNPdy5/HRSm+Yj6okJ6UtLINN0Q9M4+h3I=
|
||||
github.com/pkg/errors v0.8.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0=
|
||||
github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM=
|
||||
github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4=
|
||||
github.com/sirupsen/logrus v1.4.1 h1:GL2rEmy6nsikmW0r8opw9JIRScdMF5hA8cOYLH7In1k=
|
||||
github.com/sirupsen/logrus v1.4.1/go.mod h1:ni0Sbl8bgC9z8RoU9G6nDWqqs/fq4eDPysMBDgk/93Q=
|
||||
github.com/stretchr/objx v0.1.1/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME=
|
||||
github.com/stretchr/testify v1.2.2 h1:bSDNvY7ZPG5RlJ8otE/7V6gMiyenm9RtJ7IUVIAoJ1w=
|
||||
github.com/stretchr/testify v1.2.2/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXfy6kDkUVs=
|
||||
golang.org/x/sys v0.0.0-20180905080454-ebe1bf3edb33/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
|
||||
golang.org/x/sys v0.0.0-20190507160741-ecd444e8653b h1:ag/x1USPSsqHud38I9BAC88qdNLDHHtQ4mlgQIZPPNA=
|
||||
golang.org/x/sys v0.0.0-20190507160741-ecd444e8653b/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 h1:7TYNF4UdlohbFwpNH04CoPMp1cHUZgO1Ebq5r2hIjfo=
|
||||
golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
305
vendor/github.com/Microsoft/go-winio/hvsock.go
generated
vendored
Normal file
305
vendor/github.com/Microsoft/go-winio/hvsock.go
generated
vendored
Normal file
@@ -0,0 +1,305 @@
|
||||
package winio
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
"io"
|
||||
"net"
|
||||
"os"
|
||||
"syscall"
|
||||
"time"
|
||||
"unsafe"
|
||||
|
||||
"github.com/Microsoft/go-winio/pkg/guid"
|
||||
)
|
||||
|
||||
//sys bind(s syscall.Handle, name unsafe.Pointer, namelen int32) (err error) [failretval==socketError] = ws2_32.bind
|
||||
|
||||
const (
|
||||
afHvSock = 34 // AF_HYPERV
|
||||
|
||||
socketError = ^uintptr(0)
|
||||
)
|
||||
|
||||
// An HvsockAddr is an address for a AF_HYPERV socket.
|
||||
type HvsockAddr struct {
|
||||
VMID guid.GUID
|
||||
ServiceID guid.GUID
|
||||
}
|
||||
|
||||
type rawHvsockAddr struct {
|
||||
Family uint16
|
||||
_ uint16
|
||||
VMID guid.GUID
|
||||
ServiceID guid.GUID
|
||||
}
|
||||
|
||||
// Network returns the address's network name, "hvsock".
|
||||
func (addr *HvsockAddr) Network() string {
|
||||
return "hvsock"
|
||||
}
|
||||
|
||||
func (addr *HvsockAddr) String() string {
|
||||
return fmt.Sprintf("%s:%s", &addr.VMID, &addr.ServiceID)
|
||||
}
|
||||
|
||||
// VsockServiceID returns an hvsock service ID corresponding to the specified AF_VSOCK port.
|
||||
func VsockServiceID(port uint32) guid.GUID {
|
||||
g, _ := guid.FromString("00000000-facb-11e6-bd58-64006a7986d3")
|
||||
g.Data1 = port
|
||||
return g
|
||||
}
|
||||
|
||||
func (addr *HvsockAddr) raw() rawHvsockAddr {
|
||||
return rawHvsockAddr{
|
||||
Family: afHvSock,
|
||||
VMID: addr.VMID,
|
||||
ServiceID: addr.ServiceID,
|
||||
}
|
||||
}
|
||||
|
||||
func (addr *HvsockAddr) fromRaw(raw *rawHvsockAddr) {
|
||||
addr.VMID = raw.VMID
|
||||
addr.ServiceID = raw.ServiceID
|
||||
}
|
||||
|
||||
// HvsockListener is a socket listener for the AF_HYPERV address family.
|
||||
type HvsockListener struct {
|
||||
sock *win32File
|
||||
addr HvsockAddr
|
||||
}
|
||||
|
||||
// HvsockConn is a connected socket of the AF_HYPERV address family.
|
||||
type HvsockConn struct {
|
||||
sock *win32File
|
||||
local, remote HvsockAddr
|
||||
}
|
||||
|
||||
func newHvSocket() (*win32File, error) {
|
||||
fd, err := syscall.Socket(afHvSock, syscall.SOCK_STREAM, 1)
|
||||
if err != nil {
|
||||
return nil, os.NewSyscallError("socket", err)
|
||||
}
|
||||
f, err := makeWin32File(fd)
|
||||
if err != nil {
|
||||
syscall.Close(fd)
|
||||
return nil, err
|
||||
}
|
||||
f.socket = true
|
||||
return f, nil
|
||||
}
|
||||
|
||||
// ListenHvsock listens for connections on the specified hvsock address.
|
||||
func ListenHvsock(addr *HvsockAddr) (_ *HvsockListener, err error) {
|
||||
l := &HvsockListener{addr: *addr}
|
||||
sock, err := newHvSocket()
|
||||
if err != nil {
|
||||
return nil, l.opErr("listen", err)
|
||||
}
|
||||
sa := addr.raw()
|
||||
err = bind(sock.handle, unsafe.Pointer(&sa), int32(unsafe.Sizeof(sa)))
|
||||
if err != nil {
|
||||
return nil, l.opErr("listen", os.NewSyscallError("socket", err))
|
||||
}
|
||||
err = syscall.Listen(sock.handle, 16)
|
||||
if err != nil {
|
||||
return nil, l.opErr("listen", os.NewSyscallError("listen", err))
|
||||
}
|
||||
return &HvsockListener{sock: sock, addr: *addr}, nil
|
||||
}
|
||||
|
||||
func (l *HvsockListener) opErr(op string, err error) error {
|
||||
return &net.OpError{Op: op, Net: "hvsock", Addr: &l.addr, Err: err}
|
||||
}
|
||||
|
||||
// Addr returns the listener's network address.
|
||||
func (l *HvsockListener) Addr() net.Addr {
|
||||
return &l.addr
|
||||
}
|
||||
|
||||
// Accept waits for the next connection and returns it.
|
||||
func (l *HvsockListener) Accept() (_ net.Conn, err error) {
|
||||
sock, err := newHvSocket()
|
||||
if err != nil {
|
||||
return nil, l.opErr("accept", err)
|
||||
}
|
||||
defer func() {
|
||||
if sock != nil {
|
||||
sock.Close()
|
||||
}
|
||||
}()
|
||||
c, err := l.sock.prepareIo()
|
||||
if err != nil {
|
||||
return nil, l.opErr("accept", err)
|
||||
}
|
||||
defer l.sock.wg.Done()
|
||||
|
||||
// AcceptEx, per documentation, requires an extra 16 bytes per address.
|
||||
const addrlen = uint32(16 + unsafe.Sizeof(rawHvsockAddr{}))
|
||||
var addrbuf [addrlen * 2]byte
|
||||
|
||||
var bytes uint32
|
||||
err = syscall.AcceptEx(l.sock.handle, sock.handle, &addrbuf[0], 0, addrlen, addrlen, &bytes, &c.o)
|
||||
_, err = l.sock.asyncIo(c, nil, bytes, err)
|
||||
if err != nil {
|
||||
return nil, l.opErr("accept", os.NewSyscallError("acceptex", err))
|
||||
}
|
||||
conn := &HvsockConn{
|
||||
sock: sock,
|
||||
}
|
||||
conn.local.fromRaw((*rawHvsockAddr)(unsafe.Pointer(&addrbuf[0])))
|
||||
conn.remote.fromRaw((*rawHvsockAddr)(unsafe.Pointer(&addrbuf[addrlen])))
|
||||
sock = nil
|
||||
return conn, nil
|
||||
}
|
||||
|
||||
// Close closes the listener, causing any pending Accept calls to fail.
|
||||
func (l *HvsockListener) Close() error {
|
||||
return l.sock.Close()
|
||||
}
|
||||
|
||||
/* Need to finish ConnectEx handling
|
||||
func DialHvsock(ctx context.Context, addr *HvsockAddr) (*HvsockConn, error) {
|
||||
sock, err := newHvSocket()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
defer func() {
|
||||
if sock != nil {
|
||||
sock.Close()
|
||||
}
|
||||
}()
|
||||
c, err := sock.prepareIo()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
defer sock.wg.Done()
|
||||
var bytes uint32
|
||||
err = windows.ConnectEx(windows.Handle(sock.handle), sa, nil, 0, &bytes, &c.o)
|
||||
_, err = sock.asyncIo(ctx, c, nil, bytes, err)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
conn := &HvsockConn{
|
||||
sock: sock,
|
||||
remote: *addr,
|
||||
}
|
||||
sock = nil
|
||||
return conn, nil
|
||||
}
|
||||
*/
|
||||
|
||||
func (conn *HvsockConn) opErr(op string, err error) error {
|
||||
return &net.OpError{Op: op, Net: "hvsock", Source: &conn.local, Addr: &conn.remote, Err: err}
|
||||
}
|
||||
|
||||
func (conn *HvsockConn) Read(b []byte) (int, error) {
|
||||
c, err := conn.sock.prepareIo()
|
||||
if err != nil {
|
||||
return 0, conn.opErr("read", err)
|
||||
}
|
||||
defer conn.sock.wg.Done()
|
||||
buf := syscall.WSABuf{Buf: &b[0], Len: uint32(len(b))}
|
||||
var flags, bytes uint32
|
||||
err = syscall.WSARecv(conn.sock.handle, &buf, 1, &bytes, &flags, &c.o, nil)
|
||||
n, err := conn.sock.asyncIo(c, &conn.sock.readDeadline, bytes, err)
|
||||
if err != nil {
|
||||
if _, ok := err.(syscall.Errno); ok {
|
||||
err = os.NewSyscallError("wsarecv", err)
|
||||
}
|
||||
return 0, conn.opErr("read", err)
|
||||
} else if n == 0 {
|
||||
err = io.EOF
|
||||
}
|
||||
return n, err
|
||||
}
|
||||
|
||||
func (conn *HvsockConn) Write(b []byte) (int, error) {
|
||||
t := 0
|
||||
for len(b) != 0 {
|
||||
n, err := conn.write(b)
|
||||
if err != nil {
|
||||
return t + n, err
|
||||
}
|
||||
t += n
|
||||
b = b[n:]
|
||||
}
|
||||
return t, nil
|
||||
}
|
||||
|
||||
func (conn *HvsockConn) write(b []byte) (int, error) {
|
||||
c, err := conn.sock.prepareIo()
|
||||
if err != nil {
|
||||
return 0, conn.opErr("write", err)
|
||||
}
|
||||
defer conn.sock.wg.Done()
|
||||
buf := syscall.WSABuf{Buf: &b[0], Len: uint32(len(b))}
|
||||
var bytes uint32
|
||||
err = syscall.WSASend(conn.sock.handle, &buf, 1, &bytes, 0, &c.o, nil)
|
||||
n, err := conn.sock.asyncIo(c, &conn.sock.writeDeadline, bytes, err)
|
||||
if err != nil {
|
||||
if _, ok := err.(syscall.Errno); ok {
|
||||
err = os.NewSyscallError("wsasend", err)
|
||||
}
|
||||
return 0, conn.opErr("write", err)
|
||||
}
|
||||
return n, err
|
||||
}
|
||||
|
||||
// Close closes the socket connection, failing any pending read or write calls.
|
||||
func (conn *HvsockConn) Close() error {
|
||||
return conn.sock.Close()
|
||||
}
|
||||
|
||||
func (conn *HvsockConn) shutdown(how int) error {
|
||||
err := syscall.Shutdown(conn.sock.handle, syscall.SHUT_RD)
|
||||
if err != nil {
|
||||
return os.NewSyscallError("shutdown", err)
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// CloseRead shuts down the read end of the socket.
|
||||
func (conn *HvsockConn) CloseRead() error {
|
||||
err := conn.shutdown(syscall.SHUT_RD)
|
||||
if err != nil {
|
||||
return conn.opErr("close", err)
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// CloseWrite shuts down the write end of the socket, notifying the other endpoint that
|
||||
// no more data will be written.
|
||||
func (conn *HvsockConn) CloseWrite() error {
|
||||
err := conn.shutdown(syscall.SHUT_WR)
|
||||
if err != nil {
|
||||
return conn.opErr("close", err)
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// LocalAddr returns the local address of the connection.
|
||||
func (conn *HvsockConn) LocalAddr() net.Addr {
|
||||
return &conn.local
|
||||
}
|
||||
|
||||
// RemoteAddr returns the remote address of the connection.
|
||||
func (conn *HvsockConn) RemoteAddr() net.Addr {
|
||||
return &conn.remote
|
||||
}
|
||||
|
||||
// SetDeadline implements the net.Conn SetDeadline method.
|
||||
func (conn *HvsockConn) SetDeadline(t time.Time) error {
|
||||
conn.SetReadDeadline(t)
|
||||
conn.SetWriteDeadline(t)
|
||||
return nil
|
||||
}
|
||||
|
||||
// SetReadDeadline implements the net.Conn SetReadDeadline method.
|
||||
func (conn *HvsockConn) SetReadDeadline(t time.Time) error {
|
||||
return conn.sock.SetReadDeadline(t)
|
||||
}
|
||||
|
||||
// SetWriteDeadline implements the net.Conn SetWriteDeadline method.
|
||||
func (conn *HvsockConn) SetWriteDeadline(t time.Time) error {
|
||||
return conn.sock.SetWriteDeadline(t)
|
||||
}
|
||||
247
vendor/github.com/Microsoft/go-winio/pipe.go
generated
vendored
247
vendor/github.com/Microsoft/go-winio/pipe.go
generated
vendored
@@ -3,10 +3,13 @@
|
||||
package winio
|
||||
|
||||
import (
|
||||
"context"
|
||||
"errors"
|
||||
"fmt"
|
||||
"io"
|
||||
"net"
|
||||
"os"
|
||||
"runtime"
|
||||
"syscall"
|
||||
"time"
|
||||
"unsafe"
|
||||
@@ -18,6 +21,48 @@ import (
|
||||
//sys getNamedPipeInfo(pipe syscall.Handle, flags *uint32, outSize *uint32, inSize *uint32, maxInstances *uint32) (err error) = GetNamedPipeInfo
|
||||
//sys getNamedPipeHandleState(pipe syscall.Handle, state *uint32, curInstances *uint32, maxCollectionCount *uint32, collectDataTimeout *uint32, userName *uint16, maxUserNameSize uint32) (err error) = GetNamedPipeHandleStateW
|
||||
//sys localAlloc(uFlags uint32, length uint32) (ptr uintptr) = LocalAlloc
|
||||
//sys ntCreateNamedPipeFile(pipe *syscall.Handle, access uint32, oa *objectAttributes, iosb *ioStatusBlock, share uint32, disposition uint32, options uint32, typ uint32, readMode uint32, completionMode uint32, maxInstances uint32, inboundQuota uint32, outputQuota uint32, timeout *int64) (status ntstatus) = ntdll.NtCreateNamedPipeFile
|
||||
//sys rtlNtStatusToDosError(status ntstatus) (winerr error) = ntdll.RtlNtStatusToDosErrorNoTeb
|
||||
//sys rtlDosPathNameToNtPathName(name *uint16, ntName *unicodeString, filePart uintptr, reserved uintptr) (status ntstatus) = ntdll.RtlDosPathNameToNtPathName_U
|
||||
//sys rtlDefaultNpAcl(dacl *uintptr) (status ntstatus) = ntdll.RtlDefaultNpAcl
|
||||
|
||||
type ioStatusBlock struct {
|
||||
Status, Information uintptr
|
||||
}
|
||||
|
||||
type objectAttributes struct {
|
||||
Length uintptr
|
||||
RootDirectory uintptr
|
||||
ObjectName *unicodeString
|
||||
Attributes uintptr
|
||||
SecurityDescriptor *securityDescriptor
|
||||
SecurityQoS uintptr
|
||||
}
|
||||
|
||||
type unicodeString struct {
|
||||
Length uint16
|
||||
MaximumLength uint16
|
||||
Buffer uintptr
|
||||
}
|
||||
|
||||
type securityDescriptor struct {
|
||||
Revision byte
|
||||
Sbz1 byte
|
||||
Control uint16
|
||||
Owner uintptr
|
||||
Group uintptr
|
||||
Sacl uintptr
|
||||
Dacl uintptr
|
||||
}
|
||||
|
||||
type ntstatus int32
|
||||
|
||||
func (status ntstatus) Err() error {
|
||||
if status >= 0 {
|
||||
return nil
|
||||
}
|
||||
return rtlNtStatusToDosError(status)
|
||||
}
|
||||
|
||||
const (
|
||||
cERROR_PIPE_BUSY = syscall.Errno(231)
|
||||
@@ -25,21 +70,20 @@ const (
|
||||
cERROR_PIPE_CONNECTED = syscall.Errno(535)
|
||||
cERROR_SEM_TIMEOUT = syscall.Errno(121)
|
||||
|
||||
cPIPE_ACCESS_DUPLEX = 0x3
|
||||
cFILE_FLAG_FIRST_PIPE_INSTANCE = 0x80000
|
||||
cSECURITY_SQOS_PRESENT = 0x100000
|
||||
cSECURITY_ANONYMOUS = 0
|
||||
|
||||
cPIPE_REJECT_REMOTE_CLIENTS = 0x8
|
||||
|
||||
cPIPE_UNLIMITED_INSTANCES = 255
|
||||
|
||||
cNMPWAIT_USE_DEFAULT_WAIT = 0
|
||||
cNMPWAIT_NOWAIT = 1
|
||||
cSECURITY_SQOS_PRESENT = 0x100000
|
||||
cSECURITY_ANONYMOUS = 0
|
||||
|
||||
cPIPE_TYPE_MESSAGE = 4
|
||||
|
||||
cPIPE_READMODE_MESSAGE = 2
|
||||
|
||||
cFILE_OPEN = 1
|
||||
cFILE_CREATE = 2
|
||||
|
||||
cFILE_PIPE_MESSAGE_TYPE = 1
|
||||
cFILE_PIPE_REJECT_REMOTE_CLIENTS = 2
|
||||
|
||||
cSE_DACL_PRESENT = 4
|
||||
)
|
||||
|
||||
var (
|
||||
@@ -137,9 +181,30 @@ func (s pipeAddress) String() string {
|
||||
return string(s)
|
||||
}
|
||||
|
||||
// tryDialPipe attempts to dial the pipe at `path` until `ctx` cancellation or timeout.
|
||||
func tryDialPipe(ctx context.Context, path *string) (syscall.Handle, error) {
|
||||
for {
|
||||
select {
|
||||
case <-ctx.Done():
|
||||
return syscall.Handle(0), ctx.Err()
|
||||
default:
|
||||
h, err := createFile(*path, syscall.GENERIC_READ|syscall.GENERIC_WRITE, 0, nil, syscall.OPEN_EXISTING, syscall.FILE_FLAG_OVERLAPPED|cSECURITY_SQOS_PRESENT|cSECURITY_ANONYMOUS, 0)
|
||||
if err == nil {
|
||||
return h, nil
|
||||
}
|
||||
if err != cERROR_PIPE_BUSY {
|
||||
return h, &os.PathError{Err: err, Op: "open", Path: *path}
|
||||
}
|
||||
// Wait 10 msec and try again. This is a rather simplistic
|
||||
// view, as we always try each 10 milliseconds.
|
||||
time.Sleep(time.Millisecond * 10)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// DialPipe connects to a named pipe by path, timing out if the connection
|
||||
// takes longer than the specified duration. If timeout is nil, then we use
|
||||
// a default timeout of 5 seconds. (We do not use WaitNamedPipe.)
|
||||
// a default timeout of 2 seconds. (We do not use WaitNamedPipe.)
|
||||
func DialPipe(path string, timeout *time.Duration) (net.Conn, error) {
|
||||
var absTimeout time.Time
|
||||
if timeout != nil {
|
||||
@@ -147,23 +212,22 @@ func DialPipe(path string, timeout *time.Duration) (net.Conn, error) {
|
||||
} else {
|
||||
absTimeout = time.Now().Add(time.Second * 2)
|
||||
}
|
||||
ctx, _ := context.WithDeadline(context.Background(), absTimeout)
|
||||
conn, err := DialPipeContext(ctx, path)
|
||||
if err == context.DeadlineExceeded {
|
||||
return nil, ErrTimeout
|
||||
}
|
||||
return conn, err
|
||||
}
|
||||
|
||||
// DialPipeContext attempts to connect to a named pipe by `path` until `ctx`
|
||||
// cancellation or timeout.
|
||||
func DialPipeContext(ctx context.Context, path string) (net.Conn, error) {
|
||||
var err error
|
||||
var h syscall.Handle
|
||||
for {
|
||||
h, err = createFile(path, syscall.GENERIC_READ|syscall.GENERIC_WRITE, 0, nil, syscall.OPEN_EXISTING, syscall.FILE_FLAG_OVERLAPPED|cSECURITY_SQOS_PRESENT|cSECURITY_ANONYMOUS, 0)
|
||||
if err != cERROR_PIPE_BUSY {
|
||||
break
|
||||
}
|
||||
if time.Now().After(absTimeout) {
|
||||
return nil, ErrTimeout
|
||||
}
|
||||
|
||||
// Wait 10 msec and try again. This is a rather simplistic
|
||||
// view, as we always try each 10 milliseconds.
|
||||
time.Sleep(time.Millisecond * 10)
|
||||
}
|
||||
h, err = tryDialPipe(ctx, &path)
|
||||
if err != nil {
|
||||
return nil, &os.PathError{Op: "open", Path: path, Err: err}
|
||||
return nil, err
|
||||
}
|
||||
|
||||
var flags uint32
|
||||
@@ -194,43 +258,87 @@ type acceptResponse struct {
|
||||
}
|
||||
|
||||
type win32PipeListener struct {
|
||||
firstHandle syscall.Handle
|
||||
path string
|
||||
securityDescriptor []byte
|
||||
config PipeConfig
|
||||
acceptCh chan (chan acceptResponse)
|
||||
closeCh chan int
|
||||
doneCh chan int
|
||||
firstHandle syscall.Handle
|
||||
path string
|
||||
config PipeConfig
|
||||
acceptCh chan (chan acceptResponse)
|
||||
closeCh chan int
|
||||
doneCh chan int
|
||||
}
|
||||
|
||||
func makeServerPipeHandle(path string, securityDescriptor []byte, c *PipeConfig, first bool) (syscall.Handle, error) {
|
||||
var flags uint32 = cPIPE_ACCESS_DUPLEX | syscall.FILE_FLAG_OVERLAPPED
|
||||
if first {
|
||||
flags |= cFILE_FLAG_FIRST_PIPE_INSTANCE
|
||||
}
|
||||
|
||||
var mode uint32 = cPIPE_REJECT_REMOTE_CLIENTS
|
||||
if c.MessageMode {
|
||||
mode |= cPIPE_TYPE_MESSAGE
|
||||
}
|
||||
|
||||
sa := &syscall.SecurityAttributes{}
|
||||
sa.Length = uint32(unsafe.Sizeof(*sa))
|
||||
if securityDescriptor != nil {
|
||||
len := uint32(len(securityDescriptor))
|
||||
sa.SecurityDescriptor = localAlloc(0, len)
|
||||
defer localFree(sa.SecurityDescriptor)
|
||||
copy((*[0xffff]byte)(unsafe.Pointer(sa.SecurityDescriptor))[:], securityDescriptor)
|
||||
}
|
||||
h, err := createNamedPipe(path, flags, mode, cPIPE_UNLIMITED_INSTANCES, uint32(c.OutputBufferSize), uint32(c.InputBufferSize), 0, sa)
|
||||
func makeServerPipeHandle(path string, sd []byte, c *PipeConfig, first bool) (syscall.Handle, error) {
|
||||
path16, err := syscall.UTF16FromString(path)
|
||||
if err != nil {
|
||||
return 0, &os.PathError{Op: "open", Path: path, Err: err}
|
||||
}
|
||||
|
||||
var oa objectAttributes
|
||||
oa.Length = unsafe.Sizeof(oa)
|
||||
|
||||
var ntPath unicodeString
|
||||
if err := rtlDosPathNameToNtPathName(&path16[0], &ntPath, 0, 0).Err(); err != nil {
|
||||
return 0, &os.PathError{Op: "open", Path: path, Err: err}
|
||||
}
|
||||
defer localFree(ntPath.Buffer)
|
||||
oa.ObjectName = &ntPath
|
||||
|
||||
// The security descriptor is only needed for the first pipe.
|
||||
if first {
|
||||
if sd != nil {
|
||||
len := uint32(len(sd))
|
||||
sdb := localAlloc(0, len)
|
||||
defer localFree(sdb)
|
||||
copy((*[0xffff]byte)(unsafe.Pointer(sdb))[:], sd)
|
||||
oa.SecurityDescriptor = (*securityDescriptor)(unsafe.Pointer(sdb))
|
||||
} else {
|
||||
// Construct the default named pipe security descriptor.
|
||||
var dacl uintptr
|
||||
if err := rtlDefaultNpAcl(&dacl).Err(); err != nil {
|
||||
return 0, fmt.Errorf("getting default named pipe ACL: %s", err)
|
||||
}
|
||||
defer localFree(dacl)
|
||||
|
||||
sdb := &securityDescriptor{
|
||||
Revision: 1,
|
||||
Control: cSE_DACL_PRESENT,
|
||||
Dacl: dacl,
|
||||
}
|
||||
oa.SecurityDescriptor = sdb
|
||||
}
|
||||
}
|
||||
|
||||
typ := uint32(cFILE_PIPE_REJECT_REMOTE_CLIENTS)
|
||||
if c.MessageMode {
|
||||
typ |= cFILE_PIPE_MESSAGE_TYPE
|
||||
}
|
||||
|
||||
disposition := uint32(cFILE_OPEN)
|
||||
access := uint32(syscall.GENERIC_READ | syscall.GENERIC_WRITE | syscall.SYNCHRONIZE)
|
||||
if first {
|
||||
disposition = cFILE_CREATE
|
||||
// By not asking for read or write access, the named pipe file system
|
||||
// will put this pipe into an initially disconnected state, blocking
|
||||
// client connections until the next call with first == false.
|
||||
access = syscall.SYNCHRONIZE
|
||||
}
|
||||
|
||||
timeout := int64(-50 * 10000) // 50ms
|
||||
|
||||
var (
|
||||
h syscall.Handle
|
||||
iosb ioStatusBlock
|
||||
)
|
||||
err = ntCreateNamedPipeFile(&h, access, &oa, &iosb, syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE, disposition, 0, typ, 0, 0, 0xffffffff, uint32(c.InputBufferSize), uint32(c.OutputBufferSize), &timeout).Err()
|
||||
if err != nil {
|
||||
return 0, &os.PathError{Op: "open", Path: path, Err: err}
|
||||
}
|
||||
|
||||
runtime.KeepAlive(ntPath)
|
||||
return h, nil
|
||||
}
|
||||
|
||||
func (l *win32PipeListener) makeServerPipe() (*win32File, error) {
|
||||
h, err := makeServerPipeHandle(l.path, l.securityDescriptor, &l.config, false)
|
||||
h, err := makeServerPipeHandle(l.path, nil, &l.config, false)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
@@ -341,32 +449,13 @@ func ListenPipe(path string, c *PipeConfig) (net.Listener, error) {
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
// Create a client handle and connect it. This results in the pipe
|
||||
// instance always existing, so that clients see ERROR_PIPE_BUSY
|
||||
// rather than ERROR_FILE_NOT_FOUND. This ties the first instance
|
||||
// up so that no other instances can be used. This would have been
|
||||
// cleaner if the Win32 API matched CreateFile with ConnectNamedPipe
|
||||
// instead of CreateNamedPipe. (Apparently created named pipes are
|
||||
// considered to be in listening state regardless of whether any
|
||||
// active calls to ConnectNamedPipe are outstanding.)
|
||||
h2, err := createFile(path, 0, 0, nil, syscall.OPEN_EXISTING, cSECURITY_SQOS_PRESENT|cSECURITY_ANONYMOUS, 0)
|
||||
if err != nil {
|
||||
syscall.Close(h)
|
||||
return nil, err
|
||||
}
|
||||
// Close the client handle. The server side of the instance will
|
||||
// still be busy, leading to ERROR_PIPE_BUSY instead of
|
||||
// ERROR_NOT_FOUND, as long as we don't close the server handle,
|
||||
// or disconnect the client with DisconnectNamedPipe.
|
||||
syscall.Close(h2)
|
||||
l := &win32PipeListener{
|
||||
firstHandle: h,
|
||||
path: path,
|
||||
securityDescriptor: sd,
|
||||
config: *c,
|
||||
acceptCh: make(chan (chan acceptResponse)),
|
||||
closeCh: make(chan int),
|
||||
doneCh: make(chan int),
|
||||
firstHandle: h,
|
||||
path: path,
|
||||
config: *c,
|
||||
acceptCh: make(chan (chan acceptResponse)),
|
||||
closeCh: make(chan int),
|
||||
doneCh: make(chan int),
|
||||
}
|
||||
go l.listenerRoutine()
|
||||
return l, nil
|
||||
|
||||
235
vendor/github.com/Microsoft/go-winio/pkg/guid/guid.go
generated
vendored
Normal file
235
vendor/github.com/Microsoft/go-winio/pkg/guid/guid.go
generated
vendored
Normal file
@@ -0,0 +1,235 @@
|
||||
// Package guid provides a GUID type. The backing structure for a GUID is
|
||||
// identical to that used by the golang.org/x/sys/windows GUID type.
|
||||
// There are two main binary encodings used for a GUID, the big-endian encoding,
|
||||
// and the Windows (mixed-endian) encoding. See here for details:
|
||||
// https://en.wikipedia.org/wiki/Universally_unique_identifier#Encoding
|
||||
package guid
|
||||
|
||||
import (
|
||||
"crypto/rand"
|
||||
"crypto/sha1"
|
||||
"encoding"
|
||||
"encoding/binary"
|
||||
"fmt"
|
||||
"strconv"
|
||||
|
||||
"golang.org/x/sys/windows"
|
||||
)
|
||||
|
||||
// Variant specifies which GUID variant (or "type") of the GUID. It determines
|
||||
// how the entirety of the rest of the GUID is interpreted.
|
||||
type Variant uint8
|
||||
|
||||
// The variants specified by RFC 4122.
|
||||
const (
|
||||
// VariantUnknown specifies a GUID variant which does not conform to one of
|
||||
// the variant encodings specified in RFC 4122.
|
||||
VariantUnknown Variant = iota
|
||||
VariantNCS
|
||||
VariantRFC4122
|
||||
VariantMicrosoft
|
||||
VariantFuture
|
||||
)
|
||||
|
||||
// Version specifies how the bits in the GUID were generated. For instance, a
|
||||
// version 4 GUID is randomly generated, and a version 5 is generated from the
|
||||
// hash of an input string.
|
||||
type Version uint8
|
||||
|
||||
var _ = (encoding.TextMarshaler)(GUID{})
|
||||
var _ = (encoding.TextUnmarshaler)(&GUID{})
|
||||
|
||||
// GUID represents a GUID/UUID. It has the same structure as
|
||||
// golang.org/x/sys/windows.GUID so that it can be used with functions expecting
|
||||
// that type. It is defined as its own type so that stringification and
|
||||
// marshaling can be supported. The representation matches that used by native
|
||||
// Windows code.
|
||||
type GUID windows.GUID
|
||||
|
||||
// NewV4 returns a new version 4 (pseudorandom) GUID, as defined by RFC 4122.
|
||||
func NewV4() (GUID, error) {
|
||||
var b [16]byte
|
||||
if _, err := rand.Read(b[:]); err != nil {
|
||||
return GUID{}, err
|
||||
}
|
||||
|
||||
g := FromArray(b)
|
||||
g.setVersion(4) // Version 4 means randomly generated.
|
||||
g.setVariant(VariantRFC4122)
|
||||
|
||||
return g, nil
|
||||
}
|
||||
|
||||
// NewV5 returns a new version 5 (generated from a string via SHA-1 hashing)
|
||||
// GUID, as defined by RFC 4122. The RFC is unclear on the encoding of the name,
|
||||
// and the sample code treats it as a series of bytes, so we do the same here.
|
||||
//
|
||||
// Some implementations, such as those found on Windows, treat the name as a
|
||||
// big-endian UTF16 stream of bytes. If that is desired, the string can be
|
||||
// encoded as such before being passed to this function.
|
||||
func NewV5(namespace GUID, name []byte) (GUID, error) {
|
||||
b := sha1.New()
|
||||
namespaceBytes := namespace.ToArray()
|
||||
b.Write(namespaceBytes[:])
|
||||
b.Write(name)
|
||||
|
||||
a := [16]byte{}
|
||||
copy(a[:], b.Sum(nil))
|
||||
|
||||
g := FromArray(a)
|
||||
g.setVersion(5) // Version 5 means generated from a string.
|
||||
g.setVariant(VariantRFC4122)
|
||||
|
||||
return g, nil
|
||||
}
|
||||
|
||||
func fromArray(b [16]byte, order binary.ByteOrder) GUID {
|
||||
var g GUID
|
||||
g.Data1 = order.Uint32(b[0:4])
|
||||
g.Data2 = order.Uint16(b[4:6])
|
||||
g.Data3 = order.Uint16(b[6:8])
|
||||
copy(g.Data4[:], b[8:16])
|
||||
return g
|
||||
}
|
||||
|
||||
func (g GUID) toArray(order binary.ByteOrder) [16]byte {
|
||||
b := [16]byte{}
|
||||
order.PutUint32(b[0:4], g.Data1)
|
||||
order.PutUint16(b[4:6], g.Data2)
|
||||
order.PutUint16(b[6:8], g.Data3)
|
||||
copy(b[8:16], g.Data4[:])
|
||||
return b
|
||||
}
|
||||
|
||||
// FromArray constructs a GUID from a big-endian encoding array of 16 bytes.
|
||||
func FromArray(b [16]byte) GUID {
|
||||
return fromArray(b, binary.BigEndian)
|
||||
}
|
||||
|
||||
// ToArray returns an array of 16 bytes representing the GUID in big-endian
|
||||
// encoding.
|
||||
func (g GUID) ToArray() [16]byte {
|
||||
return g.toArray(binary.BigEndian)
|
||||
}
|
||||
|
||||
// FromWindowsArray constructs a GUID from a Windows encoding array of bytes.
|
||||
func FromWindowsArray(b [16]byte) GUID {
|
||||
return fromArray(b, binary.LittleEndian)
|
||||
}
|
||||
|
||||
// ToWindowsArray returns an array of 16 bytes representing the GUID in Windows
|
||||
// encoding.
|
||||
func (g GUID) ToWindowsArray() [16]byte {
|
||||
return g.toArray(binary.LittleEndian)
|
||||
}
|
||||
|
||||
func (g GUID) String() string {
|
||||
return fmt.Sprintf(
|
||||
"%08x-%04x-%04x-%04x-%012x",
|
||||
g.Data1,
|
||||
g.Data2,
|
||||
g.Data3,
|
||||
g.Data4[:2],
|
||||
g.Data4[2:])
|
||||
}
|
||||
|
||||
// FromString parses a string containing a GUID and returns the GUID. The only
|
||||
// format currently supported is the `xxxxxxxx-xxxx-xxxx-xxxx-xxxxxxxxxxxx`
|
||||
// format.
|
||||
func FromString(s string) (GUID, error) {
|
||||
if len(s) != 36 {
|
||||
return GUID{}, fmt.Errorf("invalid GUID %q", s)
|
||||
}
|
||||
if s[8] != '-' || s[13] != '-' || s[18] != '-' || s[23] != '-' {
|
||||
return GUID{}, fmt.Errorf("invalid GUID %q", s)
|
||||
}
|
||||
|
||||
var g GUID
|
||||
|
||||
data1, err := strconv.ParseUint(s[0:8], 16, 32)
|
||||
if err != nil {
|
||||
return GUID{}, fmt.Errorf("invalid GUID %q", s)
|
||||
}
|
||||
g.Data1 = uint32(data1)
|
||||
|
||||
data2, err := strconv.ParseUint(s[9:13], 16, 16)
|
||||
if err != nil {
|
||||
return GUID{}, fmt.Errorf("invalid GUID %q", s)
|
||||
}
|
||||
g.Data2 = uint16(data2)
|
||||
|
||||
data3, err := strconv.ParseUint(s[14:18], 16, 16)
|
||||
if err != nil {
|
||||
return GUID{}, fmt.Errorf("invalid GUID %q", s)
|
||||
}
|
||||
g.Data3 = uint16(data3)
|
||||
|
||||
for i, x := range []int{19, 21, 24, 26, 28, 30, 32, 34} {
|
||||
v, err := strconv.ParseUint(s[x:x+2], 16, 8)
|
||||
if err != nil {
|
||||
return GUID{}, fmt.Errorf("invalid GUID %q", s)
|
||||
}
|
||||
g.Data4[i] = uint8(v)
|
||||
}
|
||||
|
||||
return g, nil
|
||||
}
|
||||
|
||||
func (g *GUID) setVariant(v Variant) {
|
||||
d := g.Data4[0]
|
||||
switch v {
|
||||
case VariantNCS:
|
||||
d = (d & 0x7f)
|
||||
case VariantRFC4122:
|
||||
d = (d & 0x3f) | 0x80
|
||||
case VariantMicrosoft:
|
||||
d = (d & 0x1f) | 0xc0
|
||||
case VariantFuture:
|
||||
d = (d & 0x0f) | 0xe0
|
||||
case VariantUnknown:
|
||||
fallthrough
|
||||
default:
|
||||
panic(fmt.Sprintf("invalid variant: %d", v))
|
||||
}
|
||||
g.Data4[0] = d
|
||||
}
|
||||
|
||||
// Variant returns the GUID variant, as defined in RFC 4122.
|
||||
func (g GUID) Variant() Variant {
|
||||
b := g.Data4[0]
|
||||
if b&0x80 == 0 {
|
||||
return VariantNCS
|
||||
} else if b&0xc0 == 0x80 {
|
||||
return VariantRFC4122
|
||||
} else if b&0xe0 == 0xc0 {
|
||||
return VariantMicrosoft
|
||||
} else if b&0xe0 == 0xe0 {
|
||||
return VariantFuture
|
||||
}
|
||||
return VariantUnknown
|
||||
}
|
||||
|
||||
func (g *GUID) setVersion(v Version) {
|
||||
g.Data3 = (g.Data3 & 0x0fff) | (uint16(v) << 12)
|
||||
}
|
||||
|
||||
// Version returns the GUID version, as defined in RFC 4122.
|
||||
func (g GUID) Version() Version {
|
||||
return Version((g.Data3 & 0xF000) >> 12)
|
||||
}
|
||||
|
||||
// MarshalText returns the textual representation of the GUID.
|
||||
func (g GUID) MarshalText() ([]byte, error) {
|
||||
return []byte(g.String()), nil
|
||||
}
|
||||
|
||||
// UnmarshalText takes the textual representation of a GUID, and unmarhals it
|
||||
// into this GUID.
|
||||
func (g *GUID) UnmarshalText(text []byte) error {
|
||||
g2, err := FromString(string(text))
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
*g = g2
|
||||
return nil
|
||||
}
|
||||
2
vendor/github.com/Microsoft/go-winio/syscall.go
generated
vendored
2
vendor/github.com/Microsoft/go-winio/syscall.go
generated
vendored
@@ -1,3 +1,3 @@
|
||||
package winio
|
||||
|
||||
//go:generate go run $GOROOT/src/syscall/mksyscall_windows.go -output zsyscall_windows.go file.go pipe.go sd.go fileinfo.go privilege.go backup.go
|
||||
//go:generate go run $GOROOT/src/syscall/mksyscall_windows.go -output zsyscall_windows.go file.go pipe.go sd.go fileinfo.go privilege.go backup.go hvsock.go
|
||||
|
||||
151
vendor/github.com/Microsoft/go-winio/vhd/vhd.go
generated
vendored
Normal file
151
vendor/github.com/Microsoft/go-winio/vhd/vhd.go
generated
vendored
Normal file
@@ -0,0 +1,151 @@
|
||||
// +build windows
|
||||
|
||||
package vhd
|
||||
|
||||
import "syscall"
|
||||
|
||||
//go:generate go run mksyscall_windows.go -output zvhd.go vhd.go
|
||||
|
||||
//sys createVirtualDisk(virtualStorageType *virtualStorageType, path string, virtualDiskAccessMask uint32, securityDescriptor *uintptr, flags uint32, providerSpecificFlags uint32, parameters *createVirtualDiskParameters, o *syscall.Overlapped, handle *syscall.Handle) (err error) [failretval != 0] = VirtDisk.CreateVirtualDisk
|
||||
//sys openVirtualDisk(virtualStorageType *virtualStorageType, path string, virtualDiskAccessMask uint32, flags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (err error) [failretval != 0] = VirtDisk.OpenVirtualDisk
|
||||
//sys detachVirtualDisk(handle syscall.Handle, flags uint32, providerSpecificFlags uint32) (err error) [failretval != 0] = VirtDisk.DetachVirtualDisk
|
||||
|
||||
type virtualStorageType struct {
|
||||
DeviceID uint32
|
||||
VendorID [16]byte
|
||||
}
|
||||
|
||||
type (
|
||||
createVirtualDiskFlag uint32
|
||||
VirtualDiskAccessMask uint32
|
||||
VirtualDiskFlag uint32
|
||||
)
|
||||
|
||||
const (
|
||||
// Flags for creating a VHD (not exported)
|
||||
createVirtualDiskFlagNone createVirtualDiskFlag = 0
|
||||
createVirtualDiskFlagFullPhysicalAllocation createVirtualDiskFlag = 1
|
||||
createVirtualDiskFlagPreventWritesToSourceDisk createVirtualDiskFlag = 2
|
||||
createVirtualDiskFlagDoNotCopyMetadataFromParent createVirtualDiskFlag = 4
|
||||
|
||||
// Access Mask for opening a VHD
|
||||
VirtualDiskAccessNone VirtualDiskAccessMask = 0
|
||||
VirtualDiskAccessAttachRO VirtualDiskAccessMask = 65536
|
||||
VirtualDiskAccessAttachRW VirtualDiskAccessMask = 131072
|
||||
VirtualDiskAccessDetach VirtualDiskAccessMask = 262144
|
||||
VirtualDiskAccessGetInfo VirtualDiskAccessMask = 524288
|
||||
VirtualDiskAccessCreate VirtualDiskAccessMask = 1048576
|
||||
VirtualDiskAccessMetaOps VirtualDiskAccessMask = 2097152
|
||||
VirtualDiskAccessRead VirtualDiskAccessMask = 851968
|
||||
VirtualDiskAccessAll VirtualDiskAccessMask = 4128768
|
||||
VirtualDiskAccessWritable VirtualDiskAccessMask = 3276800
|
||||
|
||||
// Flags for opening a VHD
|
||||
OpenVirtualDiskFlagNone VirtualDiskFlag = 0
|
||||
OpenVirtualDiskFlagNoParents VirtualDiskFlag = 0x1
|
||||
OpenVirtualDiskFlagBlankFile VirtualDiskFlag = 0x2
|
||||
OpenVirtualDiskFlagBootDrive VirtualDiskFlag = 0x4
|
||||
OpenVirtualDiskFlagCachedIO VirtualDiskFlag = 0x8
|
||||
OpenVirtualDiskFlagCustomDiffChain VirtualDiskFlag = 0x10
|
||||
OpenVirtualDiskFlagParentCachedIO VirtualDiskFlag = 0x20
|
||||
OpenVirtualDiskFlagVhdSetFileOnly VirtualDiskFlag = 0x40
|
||||
OpenVirtualDiskFlagIgnoreRelativeParentLocator VirtualDiskFlag = 0x80
|
||||
OpenVirtualDiskFlagNoWriteHardening VirtualDiskFlag = 0x100
|
||||
)
|
||||
|
||||
type createVersion2 struct {
|
||||
UniqueID [16]byte // GUID
|
||||
MaximumSize uint64
|
||||
BlockSizeInBytes uint32
|
||||
SectorSizeInBytes uint32
|
||||
ParentPath *uint16 // string
|
||||
SourcePath *uint16 // string
|
||||
OpenFlags uint32
|
||||
ParentVirtualStorageType virtualStorageType
|
||||
SourceVirtualStorageType virtualStorageType
|
||||
ResiliencyGUID [16]byte // GUID
|
||||
}
|
||||
|
||||
type createVirtualDiskParameters struct {
|
||||
Version uint32 // Must always be set to 2
|
||||
Version2 createVersion2
|
||||
}
|
||||
|
||||
type openVersion2 struct {
|
||||
GetInfoOnly int32 // bool but 4-byte aligned
|
||||
ReadOnly int32 // bool but 4-byte aligned
|
||||
ResiliencyGUID [16]byte // GUID
|
||||
}
|
||||
|
||||
type openVirtualDiskParameters struct {
|
||||
Version uint32 // Must always be set to 2
|
||||
Version2 openVersion2
|
||||
}
|
||||
|
||||
// CreateVhdx will create a simple vhdx file at the given path using default values.
|
||||
func CreateVhdx(path string, maxSizeInGb, blockSizeInMb uint32) error {
|
||||
var (
|
||||
defaultType virtualStorageType
|
||||
handle syscall.Handle
|
||||
)
|
||||
|
||||
parameters := createVirtualDiskParameters{
|
||||
Version: 2,
|
||||
Version2: createVersion2{
|
||||
MaximumSize: uint64(maxSizeInGb) * 1024 * 1024 * 1024,
|
||||
BlockSizeInBytes: blockSizeInMb * 1024 * 1024,
|
||||
},
|
||||
}
|
||||
|
||||
if err := createVirtualDisk(
|
||||
&defaultType,
|
||||
path,
|
||||
uint32(VirtualDiskAccessNone),
|
||||
nil,
|
||||
uint32(createVirtualDiskFlagNone),
|
||||
0,
|
||||
¶meters,
|
||||
nil,
|
||||
&handle); err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
if err := syscall.CloseHandle(handle); err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// DetachVhd detaches a mounted container layer vhd found at `path`.
|
||||
func DetachVhd(path string) error {
|
||||
handle, err := OpenVirtualDisk(
|
||||
path,
|
||||
VirtualDiskAccessNone,
|
||||
OpenVirtualDiskFlagCachedIO|OpenVirtualDiskFlagIgnoreRelativeParentLocator)
|
||||
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
defer syscall.CloseHandle(handle)
|
||||
return detachVirtualDisk(handle, 0, 0)
|
||||
}
|
||||
|
||||
// OpenVirtualDisk obtains a handle to a VHD opened with supplied access mask and flags.
|
||||
func OpenVirtualDisk(path string, accessMask VirtualDiskAccessMask, flag VirtualDiskFlag) (syscall.Handle, error) {
|
||||
var (
|
||||
defaultType virtualStorageType
|
||||
handle syscall.Handle
|
||||
)
|
||||
parameters := openVirtualDiskParameters{Version: 2}
|
||||
if err := openVirtualDisk(
|
||||
&defaultType,
|
||||
path,
|
||||
uint32(accessMask),
|
||||
uint32(flag),
|
||||
¶meters,
|
||||
&handle); err != nil {
|
||||
return 0, err
|
||||
}
|
||||
return handle, nil
|
||||
}
|
||||
99
vendor/github.com/Microsoft/go-winio/vhd/zvhd.go
generated
vendored
Normal file
99
vendor/github.com/Microsoft/go-winio/vhd/zvhd.go
generated
vendored
Normal file
@@ -0,0 +1,99 @@
|
||||
// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT
|
||||
|
||||
package vhd
|
||||
|
||||
import (
|
||||
"syscall"
|
||||
"unsafe"
|
||||
|
||||
"golang.org/x/sys/windows"
|
||||
)
|
||||
|
||||
var _ unsafe.Pointer
|
||||
|
||||
// Do the interface allocations only once for common
|
||||
// Errno values.
|
||||
const (
|
||||
errnoERROR_IO_PENDING = 997
|
||||
)
|
||||
|
||||
var (
|
||||
errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
|
||||
)
|
||||
|
||||
// errnoErr returns common boxed Errno values, to prevent
|
||||
// allocations at runtime.
|
||||
func errnoErr(e syscall.Errno) error {
|
||||
switch e {
|
||||
case 0:
|
||||
return nil
|
||||
case errnoERROR_IO_PENDING:
|
||||
return errERROR_IO_PENDING
|
||||
}
|
||||
// TODO: add more here, after collecting data on the common
|
||||
// error values see on Windows. (perhaps when running
|
||||
// all.bat?)
|
||||
return e
|
||||
}
|
||||
|
||||
var (
|
||||
modVirtDisk = windows.NewLazySystemDLL("VirtDisk.dll")
|
||||
|
||||
procCreateVirtualDisk = modVirtDisk.NewProc("CreateVirtualDisk")
|
||||
procOpenVirtualDisk = modVirtDisk.NewProc("OpenVirtualDisk")
|
||||
procDetachVirtualDisk = modVirtDisk.NewProc("DetachVirtualDisk")
|
||||
)
|
||||
|
||||
func createVirtualDisk(virtualStorageType *virtualStorageType, path string, virtualDiskAccessMask uint32, securityDescriptor *uintptr, flags uint32, providerSpecificFlags uint32, parameters *createVirtualDiskParameters, o *syscall.Overlapped, handle *syscall.Handle) (err error) {
|
||||
var _p0 *uint16
|
||||
_p0, err = syscall.UTF16PtrFromString(path)
|
||||
if err != nil {
|
||||
return
|
||||
}
|
||||
return _createVirtualDisk(virtualStorageType, _p0, virtualDiskAccessMask, securityDescriptor, flags, providerSpecificFlags, parameters, o, handle)
|
||||
}
|
||||
|
||||
func _createVirtualDisk(virtualStorageType *virtualStorageType, path *uint16, virtualDiskAccessMask uint32, securityDescriptor *uintptr, flags uint32, providerSpecificFlags uint32, parameters *createVirtualDiskParameters, o *syscall.Overlapped, handle *syscall.Handle) (err error) {
|
||||
r1, _, e1 := syscall.Syscall9(procCreateVirtualDisk.Addr(), 9, uintptr(unsafe.Pointer(virtualStorageType)), uintptr(unsafe.Pointer(path)), uintptr(virtualDiskAccessMask), uintptr(unsafe.Pointer(securityDescriptor)), uintptr(flags), uintptr(providerSpecificFlags), uintptr(unsafe.Pointer(parameters)), uintptr(unsafe.Pointer(o)), uintptr(unsafe.Pointer(handle)))
|
||||
if r1 != 0 {
|
||||
if e1 != 0 {
|
||||
err = errnoErr(e1)
|
||||
} else {
|
||||
err = syscall.EINVAL
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func openVirtualDisk(virtualStorageType *virtualStorageType, path string, virtualDiskAccessMask uint32, flags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (err error) {
|
||||
var _p0 *uint16
|
||||
_p0, err = syscall.UTF16PtrFromString(path)
|
||||
if err != nil {
|
||||
return
|
||||
}
|
||||
return _openVirtualDisk(virtualStorageType, _p0, virtualDiskAccessMask, flags, parameters, handle)
|
||||
}
|
||||
|
||||
func _openVirtualDisk(virtualStorageType *virtualStorageType, path *uint16, virtualDiskAccessMask uint32, flags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (err error) {
|
||||
r1, _, e1 := syscall.Syscall6(procOpenVirtualDisk.Addr(), 6, uintptr(unsafe.Pointer(virtualStorageType)), uintptr(unsafe.Pointer(path)), uintptr(virtualDiskAccessMask), uintptr(flags), uintptr(unsafe.Pointer(parameters)), uintptr(unsafe.Pointer(handle)))
|
||||
if r1 != 0 {
|
||||
if e1 != 0 {
|
||||
err = errnoErr(e1)
|
||||
} else {
|
||||
err = syscall.EINVAL
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func detachVirtualDisk(handle syscall.Handle, flags uint32, providerSpecificFlags uint32) (err error) {
|
||||
r1, _, e1 := syscall.Syscall(procDetachVirtualDisk.Addr(), 3, uintptr(handle), uintptr(flags), uintptr(providerSpecificFlags))
|
||||
if r1 != 0 {
|
||||
if e1 != 0 {
|
||||
err = errnoErr(e1)
|
||||
} else {
|
||||
err = syscall.EINVAL
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
88
vendor/github.com/Microsoft/go-winio/zsyscall_windows.go
generated
vendored
88
vendor/github.com/Microsoft/go-winio/zsyscall_windows.go
generated
vendored
@@ -1,4 +1,4 @@
|
||||
// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT
|
||||
// Code generated by 'go generate'; DO NOT EDIT.
|
||||
|
||||
package winio
|
||||
|
||||
@@ -38,19 +38,25 @@ func errnoErr(e syscall.Errno) error {
|
||||
|
||||
var (
|
||||
modkernel32 = windows.NewLazySystemDLL("kernel32.dll")
|
||||
modws2_32 = windows.NewLazySystemDLL("ws2_32.dll")
|
||||
modntdll = windows.NewLazySystemDLL("ntdll.dll")
|
||||
modadvapi32 = windows.NewLazySystemDLL("advapi32.dll")
|
||||
|
||||
procCancelIoEx = modkernel32.NewProc("CancelIoEx")
|
||||
procCreateIoCompletionPort = modkernel32.NewProc("CreateIoCompletionPort")
|
||||
procGetQueuedCompletionStatus = modkernel32.NewProc("GetQueuedCompletionStatus")
|
||||
procSetFileCompletionNotificationModes = modkernel32.NewProc("SetFileCompletionNotificationModes")
|
||||
procWSAGetOverlappedResult = modws2_32.NewProc("WSAGetOverlappedResult")
|
||||
procConnectNamedPipe = modkernel32.NewProc("ConnectNamedPipe")
|
||||
procCreateNamedPipeW = modkernel32.NewProc("CreateNamedPipeW")
|
||||
procCreateFileW = modkernel32.NewProc("CreateFileW")
|
||||
procWaitNamedPipeW = modkernel32.NewProc("WaitNamedPipeW")
|
||||
procGetNamedPipeInfo = modkernel32.NewProc("GetNamedPipeInfo")
|
||||
procGetNamedPipeHandleStateW = modkernel32.NewProc("GetNamedPipeHandleStateW")
|
||||
procLocalAlloc = modkernel32.NewProc("LocalAlloc")
|
||||
procNtCreateNamedPipeFile = modntdll.NewProc("NtCreateNamedPipeFile")
|
||||
procRtlNtStatusToDosErrorNoTeb = modntdll.NewProc("RtlNtStatusToDosErrorNoTeb")
|
||||
procRtlDosPathNameToNtPathName_U = modntdll.NewProc("RtlDosPathNameToNtPathName_U")
|
||||
procRtlDefaultNpAcl = modntdll.NewProc("RtlDefaultNpAcl")
|
||||
procLookupAccountNameW = modadvapi32.NewProc("LookupAccountNameW")
|
||||
procConvertSidToStringSidW = modadvapi32.NewProc("ConvertSidToStringSidW")
|
||||
procConvertStringSecurityDescriptorToSecurityDescriptorW = modadvapi32.NewProc("ConvertStringSecurityDescriptorToSecurityDescriptorW")
|
||||
@@ -69,6 +75,7 @@ var (
|
||||
procLookupPrivilegeDisplayNameW = modadvapi32.NewProc("LookupPrivilegeDisplayNameW")
|
||||
procBackupRead = modkernel32.NewProc("BackupRead")
|
||||
procBackupWrite = modkernel32.NewProc("BackupWrite")
|
||||
procbind = modws2_32.NewProc("bind")
|
||||
)
|
||||
|
||||
func cancelIoEx(file syscall.Handle, o *syscall.Overlapped) (err error) {
|
||||
@@ -120,6 +127,24 @@ func setFileCompletionNotificationModes(h syscall.Handle, flags uint8) (err erro
|
||||
return
|
||||
}
|
||||
|
||||
func wsaGetOverlappedResult(h syscall.Handle, o *syscall.Overlapped, bytes *uint32, wait bool, flags *uint32) (err error) {
|
||||
var _p0 uint32
|
||||
if wait {
|
||||
_p0 = 1
|
||||
} else {
|
||||
_p0 = 0
|
||||
}
|
||||
r1, _, e1 := syscall.Syscall6(procWSAGetOverlappedResult.Addr(), 5, uintptr(h), uintptr(unsafe.Pointer(o)), uintptr(unsafe.Pointer(bytes)), uintptr(_p0), uintptr(unsafe.Pointer(flags)), 0)
|
||||
if r1 == 0 {
|
||||
if e1 != 0 {
|
||||
err = errnoErr(e1)
|
||||
} else {
|
||||
err = syscall.EINVAL
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func connectNamedPipe(pipe syscall.Handle, o *syscall.Overlapped) (err error) {
|
||||
r1, _, e1 := syscall.Syscall(procConnectNamedPipe.Addr(), 2, uintptr(pipe), uintptr(unsafe.Pointer(o)), 0)
|
||||
if r1 == 0 {
|
||||
@@ -176,27 +201,6 @@ func _createFile(name *uint16, access uint32, mode uint32, sa *syscall.SecurityA
|
||||
return
|
||||
}
|
||||
|
||||
func waitNamedPipe(name string, timeout uint32) (err error) {
|
||||
var _p0 *uint16
|
||||
_p0, err = syscall.UTF16PtrFromString(name)
|
||||
if err != nil {
|
||||
return
|
||||
}
|
||||
return _waitNamedPipe(_p0, timeout)
|
||||
}
|
||||
|
||||
func _waitNamedPipe(name *uint16, timeout uint32) (err error) {
|
||||
r1, _, e1 := syscall.Syscall(procWaitNamedPipeW.Addr(), 2, uintptr(unsafe.Pointer(name)), uintptr(timeout), 0)
|
||||
if r1 == 0 {
|
||||
if e1 != 0 {
|
||||
err = errnoErr(e1)
|
||||
} else {
|
||||
err = syscall.EINVAL
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func getNamedPipeInfo(pipe syscall.Handle, flags *uint32, outSize *uint32, inSize *uint32, maxInstances *uint32) (err error) {
|
||||
r1, _, e1 := syscall.Syscall6(procGetNamedPipeInfo.Addr(), 5, uintptr(pipe), uintptr(unsafe.Pointer(flags)), uintptr(unsafe.Pointer(outSize)), uintptr(unsafe.Pointer(inSize)), uintptr(unsafe.Pointer(maxInstances)), 0)
|
||||
if r1 == 0 {
|
||||
@@ -227,6 +231,32 @@ func localAlloc(uFlags uint32, length uint32) (ptr uintptr) {
|
||||
return
|
||||
}
|
||||
|
||||
func ntCreateNamedPipeFile(pipe *syscall.Handle, access uint32, oa *objectAttributes, iosb *ioStatusBlock, share uint32, disposition uint32, options uint32, typ uint32, readMode uint32, completionMode uint32, maxInstances uint32, inboundQuota uint32, outputQuota uint32, timeout *int64) (status ntstatus) {
|
||||
r0, _, _ := syscall.Syscall15(procNtCreateNamedPipeFile.Addr(), 14, uintptr(unsafe.Pointer(pipe)), uintptr(access), uintptr(unsafe.Pointer(oa)), uintptr(unsafe.Pointer(iosb)), uintptr(share), uintptr(disposition), uintptr(options), uintptr(typ), uintptr(readMode), uintptr(completionMode), uintptr(maxInstances), uintptr(inboundQuota), uintptr(outputQuota), uintptr(unsafe.Pointer(timeout)), 0)
|
||||
status = ntstatus(r0)
|
||||
return
|
||||
}
|
||||
|
||||
func rtlNtStatusToDosError(status ntstatus) (winerr error) {
|
||||
r0, _, _ := syscall.Syscall(procRtlNtStatusToDosErrorNoTeb.Addr(), 1, uintptr(status), 0, 0)
|
||||
if r0 != 0 {
|
||||
winerr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func rtlDosPathNameToNtPathName(name *uint16, ntName *unicodeString, filePart uintptr, reserved uintptr) (status ntstatus) {
|
||||
r0, _, _ := syscall.Syscall6(procRtlDosPathNameToNtPathName_U.Addr(), 4, uintptr(unsafe.Pointer(name)), uintptr(unsafe.Pointer(ntName)), uintptr(filePart), uintptr(reserved), 0, 0)
|
||||
status = ntstatus(r0)
|
||||
return
|
||||
}
|
||||
|
||||
func rtlDefaultNpAcl(dacl *uintptr) (status ntstatus) {
|
||||
r0, _, _ := syscall.Syscall(procRtlDefaultNpAcl.Addr(), 1, uintptr(unsafe.Pointer(dacl)), 0, 0)
|
||||
status = ntstatus(r0)
|
||||
return
|
||||
}
|
||||
|
||||
func lookupAccountName(systemName *uint16, accountName string, sid *byte, sidSize *uint32, refDomain *uint16, refDomainSize *uint32, sidNameUse *uint32) (err error) {
|
||||
var _p0 *uint16
|
||||
_p0, err = syscall.UTF16PtrFromString(accountName)
|
||||
@@ -518,3 +548,15 @@ func backupWrite(h syscall.Handle, b []byte, bytesWritten *uint32, abort bool, p
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func bind(s syscall.Handle, name unsafe.Pointer, namelen int32) (err error) {
|
||||
r1, _, e1 := syscall.Syscall(procbind.Addr(), 3, uintptr(s), uintptr(name), uintptr(namelen))
|
||||
if r1 == socketError {
|
||||
if e1 != 0 {
|
||||
err = errnoErr(e1)
|
||||
} else {
|
||||
err = syscall.EINVAL
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
3
vendor/github.com/Microsoft/hcsshim/CODEOWNERS
generated
vendored
Normal file
3
vendor/github.com/Microsoft/hcsshim/CODEOWNERS
generated
vendored
Normal file
@@ -0,0 +1,3 @@
|
||||
* @microsoft/containerplat
|
||||
|
||||
/hcn/* @nagiesek
|
||||
54
vendor/github.com/Microsoft/hcsshim/Protobuild.toml
generated
vendored
Normal file
54
vendor/github.com/Microsoft/hcsshim/Protobuild.toml
generated
vendored
Normal file
@@ -0,0 +1,54 @@
|
||||
version = "unstable"
|
||||
generator = "gogoctrd"
|
||||
plugins = ["grpc", "fieldpath"]
|
||||
|
||||
# Control protoc include paths. Below are usually some good defaults, but feel
|
||||
# free to try it without them if it works for your project.
|
||||
[includes]
|
||||
# Include paths that will be added before all others. Typically, you want to
|
||||
# treat the root of the project as an include, but this may not be necessary.
|
||||
before = ["./protobuf"]
|
||||
|
||||
# Paths that should be treated as include roots in relation to the vendor
|
||||
# directory. These will be calculated with the vendor directory nearest the
|
||||
# target package.
|
||||
packages = ["github.com/gogo/protobuf"]
|
||||
|
||||
# Paths that will be added untouched to the end of the includes. We use
|
||||
# `/usr/local/include` to pickup the common install location of protobuf.
|
||||
# This is the default.
|
||||
after = ["/usr/local/include"]
|
||||
|
||||
# This section maps protobuf imports to Go packages. These will become
|
||||
# `-M` directives in the call to the go protobuf generator.
|
||||
[packages]
|
||||
"gogoproto/gogo.proto" = "github.com/gogo/protobuf/gogoproto"
|
||||
"google/protobuf/any.proto" = "github.com/gogo/protobuf/types"
|
||||
"google/protobuf/empty.proto" = "github.com/gogo/protobuf/types"
|
||||
"google/protobuf/descriptor.proto" = "github.com/gogo/protobuf/protoc-gen-gogo/descriptor"
|
||||
"google/protobuf/field_mask.proto" = "github.com/gogo/protobuf/types"
|
||||
"google/protobuf/timestamp.proto" = "github.com/gogo/protobuf/types"
|
||||
"google/protobuf/duration.proto" = "github.com/gogo/protobuf/types"
|
||||
"github/containerd/cgroups/stats/v1/metrics.proto" = "github.com/containerd/cgroups/stats/v1"
|
||||
|
||||
[[overrides]]
|
||||
prefixes = ["github.com/Microsoft/hcsshim/internal/shimdiag"]
|
||||
plugins = ["ttrpc"]
|
||||
|
||||
# Lock down runhcs config
|
||||
|
||||
[[descriptors]]
|
||||
prefix = "github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options"
|
||||
target = "cmd/containerd-shim-runhcs-v1/options/next.pb.txt"
|
||||
ignore_files = [
|
||||
"google/protobuf/descriptor.proto",
|
||||
"gogoproto/gogo.proto"
|
||||
]
|
||||
|
||||
[[descriptors]]
|
||||
prefix = "github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/stats"
|
||||
target = "cmd/containerd-shim-runhcs-v1/stats/next.pb.txt"
|
||||
ignore_files = [
|
||||
"google/protobuf/descriptor.proto",
|
||||
"gogoproto/gogo.proto"
|
||||
]
|
||||
7
vendor/github.com/Microsoft/hcsshim/README.md
generated
vendored
7
vendor/github.com/Microsoft/hcsshim/README.md
generated
vendored
@@ -2,7 +2,7 @@
|
||||
|
||||
[](https://ci.appveyor.com/project/WindowsVirtualization/hcsshim/branch/master)
|
||||
|
||||
This package contains the Golang interface for using the Windows [Host Compute Service](https://blogs.technet.microsoft.com/virtualization/2017/01/27/introducing-the-host-compute-service-hcs/) (HCS) to launch and manage [Windows Containers](https://docs.microsoft.com/en-us/virtualization/windowscontainers/about/). It also contains other helpers and functions for managing Windows Containers such as the Golang interface for the Host Network Service (HNS).
|
||||
This package contains the Golang interface for using the Windows [Host Compute Service](https://techcommunity.microsoft.com/t5/containers/introducing-the-host-compute-service-hcs/ba-p/382332) (HCS) to launch and manage [Windows Containers](https://docs.microsoft.com/en-us/virtualization/windowscontainers/about/). It also contains other helpers and functions for managing Windows Containers such as the Golang interface for the Host Network Service (HNS).
|
||||
|
||||
It is primarily used in the [Moby Project](https://github.com/moby/moby), but it can be freely used by other projects as well.
|
||||
|
||||
@@ -16,6 +16,11 @@ When you submit a pull request, a CLA-bot will automatically determine whether y
|
||||
a CLA and decorate the PR appropriately (e.g., label, comment). Simply follow the instructions
|
||||
provided by the bot. You will only need to do this once across all repos using our CLA.
|
||||
|
||||
We also ask that contributors [sign their commits](https://git-scm.com/docs/git-commit) using `git commit -s` or `git commit --signoff` to certify they either authored the work themselves or otherwise have permission to use it in this project.
|
||||
|
||||
|
||||
## Code of Conduct
|
||||
|
||||
This project has adopted the [Microsoft Open Source Code of Conduct](https://opensource.microsoft.com/codeofconduct/).
|
||||
For more information see the [Code of Conduct FAQ](https://opensource.microsoft.com/codeofconduct/faq/) or
|
||||
contact [opencode@microsoft.com](mailto:opencode@microsoft.com) with any additional questions or comments.
|
||||
|
||||
30
vendor/github.com/Microsoft/hcsshim/appveyor.yml
generated
vendored
30
vendor/github.com/Microsoft/hcsshim/appveyor.yml
generated
vendored
@@ -6,24 +6,38 @@ clone_folder: c:\gopath\src\github.com\Microsoft\hcsshim
|
||||
|
||||
environment:
|
||||
GOPATH: c:\gopath
|
||||
PATH: C:\mingw-w64\x86_64-7.2.0-posix-seh-rt_v5-rev1\mingw64\bin;%GOPATH%\bin;C:\gometalinter-2.0.12-windows-amd64;%PATH%
|
||||
PATH: "%GOPATH%\\bin;C:\\gometalinter-2.0.12-windows-amd64;%PATH%"
|
||||
|
||||
stack: go 1.11
|
||||
stack: go 1.13.4
|
||||
|
||||
build_script:
|
||||
- appveyor DownloadFile https://github.com/alecthomas/gometalinter/releases/download/v2.0.12/gometalinter-2.0.12-windows-amd64.zip
|
||||
- 7z x gometalinter-2.0.12-windows-amd64.zip -y -oC:\ > NUL
|
||||
- gometalinter.exe --config .gometalinter.json ./...
|
||||
- go build ./cmd/wclayer
|
||||
- go build ./cmd/containerd-shim-runhcs-v1
|
||||
- go build ./cmd/runhcs
|
||||
- go build ./cmd/tar2ext4
|
||||
- go build ./cmd/wclayer
|
||||
- go build ./internal/tools/grantvmgroupaccess
|
||||
- go build ./internal/tools/uvmboot
|
||||
- go build ./internal/tools/zapdir
|
||||
- go test -v ./... -tags admin
|
||||
- go test -c ./test/functional/ -tags functional
|
||||
- go test -c ./test/runhcs/ -tags integration
|
||||
- cd test
|
||||
- go test -v ./internal -tags admin
|
||||
- go test -c ./containerd-shim-runhcs-v1/ -tags functional
|
||||
- go test -c ./cri-containerd/ -tags functional
|
||||
- go test -c ./functional/ -tags functional
|
||||
- go test -c ./runhcs/ -tags functional
|
||||
|
||||
artifacts:
|
||||
- path: 'wclayer.exe'
|
||||
- path: 'containerd-shim-runhcs-v1.exe'
|
||||
- path: 'runhcs.exe'
|
||||
- path: 'tar2ext4.exe'
|
||||
- path: 'functional.test.exe'
|
||||
- path: 'runhcs.test.exe'
|
||||
- path: 'wclayer.exe'
|
||||
- path: 'grantvmgroupaccess.exe'
|
||||
- path: 'uvmboot.exe'
|
||||
- path: 'zapdir.exe'
|
||||
- path: './test/containerd-shim-runhcs-v1.test.exe'
|
||||
- path: './test/cri-containerd.test.exe'
|
||||
- path: './test/functional.test.exe'
|
||||
- path: './test/runhcs.test.exe'
|
||||
|
||||
75
vendor/github.com/Microsoft/hcsshim/container.go
generated
vendored
75
vendor/github.com/Microsoft/hcsshim/container.go
generated
vendored
@@ -1,8 +1,10 @@
|
||||
package hcsshim
|
||||
|
||||
import (
|
||||
"context"
|
||||
"fmt"
|
||||
"os"
|
||||
"sync"
|
||||
"time"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/hcs"
|
||||
@@ -52,7 +54,10 @@ const (
|
||||
type ResourceModificationRequestResponse = schema1.ResourceModificationRequestResponse
|
||||
|
||||
type container struct {
|
||||
system *hcs.System
|
||||
system *hcs.System
|
||||
waitOnce sync.Once
|
||||
waitErr error
|
||||
waitCh chan struct{}
|
||||
}
|
||||
|
||||
// createComputeSystemAdditionalJSON is read from the environment at initialisation
|
||||
@@ -71,61 +76,87 @@ func CreateContainer(id string, c *ContainerConfig) (Container, error) {
|
||||
return nil, fmt.Errorf("failed to merge additional JSON '%s': %s", createContainerAdditionalJSON, err)
|
||||
}
|
||||
|
||||
system, err := hcs.CreateComputeSystem(id, fullConfig)
|
||||
system, err := hcs.CreateComputeSystem(context.Background(), id, fullConfig)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return &container{system}, err
|
||||
return &container{system: system}, err
|
||||
}
|
||||
|
||||
// OpenContainer opens an existing container by ID.
|
||||
func OpenContainer(id string) (Container, error) {
|
||||
system, err := hcs.OpenComputeSystem(id)
|
||||
system, err := hcs.OpenComputeSystem(context.Background(), id)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return &container{system}, err
|
||||
return &container{system: system}, err
|
||||
}
|
||||
|
||||
// GetContainers gets a list of the containers on the system that match the query
|
||||
func GetContainers(q ComputeSystemQuery) ([]ContainerProperties, error) {
|
||||
return hcs.GetComputeSystems(q)
|
||||
return hcs.GetComputeSystems(context.Background(), q)
|
||||
}
|
||||
|
||||
// Start synchronously starts the container.
|
||||
func (container *container) Start() error {
|
||||
return convertSystemError(container.system.Start(), container)
|
||||
return convertSystemError(container.system.Start(context.Background()), container)
|
||||
}
|
||||
|
||||
// Shutdown requests a container shutdown, but it may not actually be shutdown until Wait() succeeds.
|
||||
func (container *container) Shutdown() error {
|
||||
return convertSystemError(container.system.Shutdown(), container)
|
||||
err := container.system.Shutdown(context.Background())
|
||||
if err != nil {
|
||||
return convertSystemError(err, container)
|
||||
}
|
||||
return &ContainerError{Container: container, Err: ErrVmcomputeOperationPending, Operation: "hcsshim::ComputeSystem::Shutdown"}
|
||||
}
|
||||
|
||||
// Terminate requests a container terminate, but it may not actually be terminated until Wait() succeeds.
|
||||
func (container *container) Terminate() error {
|
||||
return convertSystemError(container.system.Terminate(), container)
|
||||
err := container.system.Terminate(context.Background())
|
||||
if err != nil {
|
||||
return convertSystemError(err, container)
|
||||
}
|
||||
return &ContainerError{Container: container, Err: ErrVmcomputeOperationPending, Operation: "hcsshim::ComputeSystem::Terminate"}
|
||||
}
|
||||
|
||||
// Waits synchronously waits for the container to shutdown or terminate.
|
||||
func (container *container) Wait() error {
|
||||
return convertSystemError(container.system.Wait(), container)
|
||||
err := container.system.Wait()
|
||||
if err == nil {
|
||||
err = container.system.ExitError()
|
||||
}
|
||||
return convertSystemError(err, container)
|
||||
}
|
||||
|
||||
// WaitTimeout synchronously waits for the container to terminate or the duration to elapse. It
|
||||
// returns false if timeout occurs.
|
||||
func (container *container) WaitTimeout(t time.Duration) error {
|
||||
return convertSystemError(container.system.WaitTimeout(t), container)
|
||||
func (container *container) WaitTimeout(timeout time.Duration) error {
|
||||
container.waitOnce.Do(func() {
|
||||
container.waitCh = make(chan struct{})
|
||||
go func() {
|
||||
container.waitErr = container.Wait()
|
||||
close(container.waitCh)
|
||||
}()
|
||||
})
|
||||
t := time.NewTimer(timeout)
|
||||
defer t.Stop()
|
||||
select {
|
||||
case <-t.C:
|
||||
return &ContainerError{Container: container, Err: ErrTimeout, Operation: "hcsshim::ComputeSystem::Wait"}
|
||||
case <-container.waitCh:
|
||||
return container.waitErr
|
||||
}
|
||||
}
|
||||
|
||||
// Pause pauses the execution of a container.
|
||||
func (container *container) Pause() error {
|
||||
return convertSystemError(container.system.Pause(), container)
|
||||
return convertSystemError(container.system.Pause(context.Background()), container)
|
||||
}
|
||||
|
||||
// Resume resumes the execution of a container.
|
||||
func (container *container) Resume() error {
|
||||
return convertSystemError(container.system.Resume(), container)
|
||||
return convertSystemError(container.system.Resume(context.Background()), container)
|
||||
}
|
||||
|
||||
// HasPendingUpdates returns true if the container has updates pending to install
|
||||
@@ -135,7 +166,7 @@ func (container *container) HasPendingUpdates() (bool, error) {
|
||||
|
||||
// Statistics returns statistics for the container. This is a legacy v1 call
|
||||
func (container *container) Statistics() (Statistics, error) {
|
||||
properties, err := container.system.Properties(schema1.PropertyTypeStatistics)
|
||||
properties, err := container.system.Properties(context.Background(), schema1.PropertyTypeStatistics)
|
||||
if err != nil {
|
||||
return Statistics{}, convertSystemError(err, container)
|
||||
}
|
||||
@@ -145,7 +176,7 @@ func (container *container) Statistics() (Statistics, error) {
|
||||
|
||||
// ProcessList returns an array of ProcessListItems for the container. This is a legacy v1 call
|
||||
func (container *container) ProcessList() ([]ProcessListItem, error) {
|
||||
properties, err := container.system.Properties(schema1.PropertyTypeProcessList)
|
||||
properties, err := container.system.Properties(context.Background(), schema1.PropertyTypeProcessList)
|
||||
if err != nil {
|
||||
return nil, convertSystemError(err, container)
|
||||
}
|
||||
@@ -155,7 +186,7 @@ func (container *container) ProcessList() ([]ProcessListItem, error) {
|
||||
|
||||
// This is a legacy v1 call
|
||||
func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskController, error) {
|
||||
properties, err := container.system.Properties(schema1.PropertyTypeMappedVirtualDisk)
|
||||
properties, err := container.system.Properties(context.Background(), schema1.PropertyTypeMappedVirtualDisk)
|
||||
if err != nil {
|
||||
return nil, convertSystemError(err, container)
|
||||
}
|
||||
@@ -165,20 +196,20 @@ func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskContr
|
||||
|
||||
// CreateProcess launches a new process within the container.
|
||||
func (container *container) CreateProcess(c *ProcessConfig) (Process, error) {
|
||||
p, err := container.system.CreateProcess(c)
|
||||
p, err := container.system.CreateProcess(context.Background(), c)
|
||||
if err != nil {
|
||||
return nil, convertSystemError(err, container)
|
||||
}
|
||||
return &process{p}, nil
|
||||
return &process{p: p.(*hcs.Process)}, nil
|
||||
}
|
||||
|
||||
// OpenProcess gets an interface to an existing process within the container.
|
||||
func (container *container) OpenProcess(pid int) (Process, error) {
|
||||
p, err := container.system.OpenProcess(pid)
|
||||
p, err := container.system.OpenProcess(context.Background(), pid)
|
||||
if err != nil {
|
||||
return nil, convertSystemError(err, container)
|
||||
}
|
||||
return &process{p}, nil
|
||||
return &process{p: p}, nil
|
||||
}
|
||||
|
||||
// Close cleans up any state associated with the container but does not terminate or wait for it.
|
||||
@@ -188,5 +219,5 @@ func (container *container) Close() error {
|
||||
|
||||
// Modify the System
|
||||
func (container *container) Modify(config *ResourceModificationRequestResponse) error {
|
||||
return convertSystemError(container.system.Modify(config), container)
|
||||
return convertSystemError(container.system.Modify(context.Background(), config), container)
|
||||
}
|
||||
|
||||
35
vendor/github.com/Microsoft/hcsshim/go.mod
generated
vendored
Normal file
35
vendor/github.com/Microsoft/hcsshim/go.mod
generated
vendored
Normal file
@@ -0,0 +1,35 @@
|
||||
module github.com/Microsoft/hcsshim
|
||||
|
||||
go 1.13
|
||||
|
||||
require (
|
||||
github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5
|
||||
github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f
|
||||
github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1
|
||||
github.com/containerd/containerd v1.3.2
|
||||
github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc // indirect
|
||||
github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448 // indirect
|
||||
github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3
|
||||
github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de
|
||||
github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd
|
||||
github.com/gogo/protobuf v1.3.1
|
||||
github.com/golang/protobuf v1.3.2 // indirect
|
||||
github.com/kr/pretty v0.1.0 // indirect
|
||||
github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2 // indirect
|
||||
github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f // indirect
|
||||
github.com/opencontainers/runtime-spec v0.1.2-0.20190507144316-5b71a03e2700
|
||||
github.com/pkg/errors v0.8.1
|
||||
github.com/prometheus/procfs v0.0.0-20180125133057-cb4147076ac7 // indirect
|
||||
github.com/sirupsen/logrus v1.4.2
|
||||
github.com/stretchr/testify v1.4.0 // indirect
|
||||
github.com/urfave/cli v0.0.0-20171014202726-7bc6a0acffa5
|
||||
go.opencensus.io v0.22.0
|
||||
golang.org/x/net v0.0.0-20191004110552-13f9640d40b9 // indirect
|
||||
golang.org/x/sync v0.0.0-20190423024810-112230192c58
|
||||
golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3
|
||||
google.golang.org/genproto v0.0.0-20190502173448-54afdca5d873 // indirect
|
||||
google.golang.org/grpc v1.23.1
|
||||
gopkg.in/check.v1 v1.0.0-20180628173108-788fd7840127 // indirect
|
||||
gopkg.in/yaml.v2 v2.2.8 // indirect
|
||||
gotest.tools v2.2.0+incompatible // indirect
|
||||
)
|
||||
149
vendor/github.com/Microsoft/hcsshim/go.sum
generated
vendored
Normal file
149
vendor/github.com/Microsoft/hcsshim/go.sum
generated
vendored
Normal file
@@ -0,0 +1,149 @@
|
||||
cloud.google.com/go v0.26.0/go.mod h1:aQUYkXzVsufM+DwF1aE+0xfcU+56JwCaLick0ClmMTw=
|
||||
github.com/BurntSushi/toml v0.3.1 h1:WXkYYl6Yr3qBf1K79EBnL4mak0OimBfB0XUf9Vl28OQ=
|
||||
github.com/BurntSushi/toml v0.3.1/go.mod h1:xHWCNGjB5oqiDr8zfno3MHue2Ht5sIBksp03qcyfWMU=
|
||||
github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5 h1:ygIc8M6trr62pF5DucadTWGdEB4mEyvzi0e2nbcmcyA=
|
||||
github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5/go.mod h1:tTuCMEN+UleMWgg9dVx4Hu52b1bJo+59jBh3ajtinzw=
|
||||
github.com/client9/misspell v0.3.4/go.mod h1:qj6jICC3Q7zFZvVWo7KLAzC3yx5G7kyvSDkc90ppPyw=
|
||||
github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f h1:tSNMc+rJDfmYntojat8lljbt1mgKNpTxUZJsSzJ9Y1s=
|
||||
github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f/go.mod h1:OApqhQ4XNSNC13gXIwDjhOQxjWa/NxkwZXJ1EvqT0ko=
|
||||
github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1 h1:uict5mhHFTzKLUCufdSLym7z/J0CbBJT59lYbP9wtbg=
|
||||
github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1/go.mod h1:Tj/on1eG8kiEhd0+fhSDzsPAFESxzBBvdyEgyryXffw=
|
||||
github.com/containerd/containerd v1.3.2 h1:ForxmXkA6tPIvffbrDAcPUIB32QgXkt2XFj+F0UxetA=
|
||||
github.com/containerd/containerd v1.3.2/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA=
|
||||
github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc h1:TP+534wVlf61smEIq1nwLLAjQVEK2EADoW3CX9AuT+8=
|
||||
github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y=
|
||||
github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448 h1:PUD50EuOMkXVcpBIA/R95d56duJR9VxhwncsFbNnxW4=
|
||||
github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448/go.mod h1:ODA38xgv3Kuk8dQz2ZQXpnv/UZZUHUCL7pnLehbXgQI=
|
||||
github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3 h1:esQOJREg8nw8aXj6uCN5dfW5cKUBiEJ/+nni1Q/D/sw=
|
||||
github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3/go.mod h1:IV7qH3hrUgRmyYrtgEeGWJfWbgcHL9CSRruz2Vqcph0=
|
||||
github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de h1:dlfGmNcE3jDAecLqwKPMNX6nk2qh1c1Vg1/YTzpOOF4=
|
||||
github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de/go.mod h1:PvCDdDGpgqzQIzDW1TphrGLssLDZp2GuS+X5DkEJB8o=
|
||||
github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd h1:JNn81o/xG+8NEo3bC/vx9pbi/g2WI8mtP2/nXzu297Y=
|
||||
github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd/go.mod h1:Cm3kwCdlkCfMSHURc+r6fwoGH6/F1hH3S4sg0rLFWPc=
|
||||
github.com/coreos/go-systemd v0.0.0-20190321100706-95778dfbb74e h1:Wf6HqHfScWJN9/ZjdUKyjop4mf3Qdd+1TvvltAvM3m8=
|
||||
github.com/coreos/go-systemd v0.0.0-20190321100706-95778dfbb74e/go.mod h1:F5haX7vjVVG0kc13fIWeqUViNPyEJxv/OmvnBo0Yme4=
|
||||
github.com/davecgh/go-spew v1.1.0/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
|
||||
github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c=
|
||||
github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
|
||||
github.com/docker/go-units v0.4.0 h1:3uh0PgVws3nIA0Q+MwDC8yjEPf9zjRfZZWXZYDct3Tw=
|
||||
github.com/docker/go-units v0.4.0/go.mod h1:fgPhTUdO+D/Jk86RDLlptpiXQzgHJF7gydDDbaIK4Dk=
|
||||
github.com/godbus/dbus v0.0.0-20190422162347-ade71ed3457e h1:BWhy2j3IXJhjCbC68FptL43tDKIq8FladmaTs3Xs7Z8=
|
||||
github.com/godbus/dbus v0.0.0-20190422162347-ade71ed3457e/go.mod h1:bBOAhwG1umN6/6ZUMtDFBMQR8jRg9O75tm9K00oMsK4=
|
||||
github.com/gogo/protobuf v1.2.1 h1:/s5zKNz0uPFCZ5hddgPdo2TK2TVrUNMn0OOX8/aZMTE=
|
||||
github.com/gogo/protobuf v1.2.1/go.mod h1:hp+jE20tsWTFYpLwKvXlhS1hjn+gTNwPg2I6zVXpSg4=
|
||||
github.com/gogo/protobuf v1.3.1 h1:DqDEcV5aeaTmdFBePNpYsp3FlcVH/2ISVVM9Qf8PSls=
|
||||
github.com/gogo/protobuf v1.3.1/go.mod h1:SlYgWuQ5SjCEi6WLHjHCa1yvBfUnHcTbrrZtXPKa29o=
|
||||
github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b h1:VKtxabqXZkF25pY9ekfRL6a582T4P37/31XEstQ5p58=
|
||||
github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b/go.mod h1:SBH7ygxi8pfUlaOkMMuAQtPIUF8ecWP5IEl/CR7VP2Q=
|
||||
github.com/golang/mock v1.1.1/go.mod h1:oTYuIxOrZwtPieC+H1uAHpcLFnEyAGVDL/k47Jfbm0A=
|
||||
github.com/golang/protobuf v1.2.0 h1:P3YflyNX/ehuJFLhxviNdFxQPkGK5cDcApsge1SqnvM=
|
||||
github.com/golang/protobuf v1.2.0/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U=
|
||||
github.com/golang/protobuf v1.3.1 h1:YF8+flBXS5eO826T4nzqPrxfhQThhXl0YzfuUPu4SBg=
|
||||
github.com/golang/protobuf v1.3.1/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U=
|
||||
github.com/golang/protobuf v1.3.2 h1:6nsPYzhq5kReh6QImI3k5qWzO4PEbvbIW2cwSfR/6xs=
|
||||
github.com/golang/protobuf v1.3.2/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U=
|
||||
github.com/google/go-cmp v0.2.0/go.mod h1:oXzfMopK8JAjlY9xF4vHSVASa0yLyX7SntLO5aqRK0M=
|
||||
github.com/google/go-cmp v0.3.0 h1:crn/baboCvb5fXaQ0IJ1SGTsTVrWpDsCWC8EGETZijY=
|
||||
github.com/google/go-cmp v0.3.0/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU=
|
||||
github.com/hashicorp/golang-lru v0.5.1 h1:0hERBMJE1eitiLkihrMvRVBYAkpHzc/J3QdDN+dAcgU=
|
||||
github.com/hashicorp/golang-lru v0.5.1/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8=
|
||||
github.com/kisielk/errcheck v1.1.0/go.mod h1:EZBBE59ingxPouuu3KfxchcWSUPOHkagtvWXihfKN4Q=
|
||||
github.com/kisielk/errcheck v1.2.0/go.mod h1:/BMXB+zMLi60iA8Vv6Ksmxu/1UDYcXs4uQLJ+jE2L00=
|
||||
github.com/kisielk/gotool v1.0.0/go.mod h1:XhKaO+MFFWcvkIS/tQcRk01m1F5IRFswLeQ+oQHNcck=
|
||||
github.com/konsorten/go-windows-terminal-sequences v1.0.1 h1:mweAR1A6xJ3oS2pRaGiHgQ4OO8tzTaLawm8vnODuwDk=
|
||||
github.com/konsorten/go-windows-terminal-sequences v1.0.1/go.mod h1:T0+1ngSBFLxvqU3pZ+m/2kptfBszLMUkC4ZK/EgS/cQ=
|
||||
github.com/kr/pretty v0.1.0 h1:L/CwN0zerZDmRFUapSPitk6f+Q3+0za1rQkzVuMiMFI=
|
||||
github.com/kr/pretty v0.1.0/go.mod h1:dAy3ld7l9f0ibDNOQOHHMYYIIbhfbHSm3C4ZsoJORNo=
|
||||
github.com/kr/pty v1.1.1/go.mod h1:pFQYn66WHrOpPYNljwOMqo10TkYh1fy3cYio2l3bCsQ=
|
||||
github.com/kr/text v0.1.0 h1:45sCR5RtlFHMR4UwH9sdQ5TC8v0qDQCHnXt+kaKSTVE=
|
||||
github.com/kr/text v0.1.0/go.mod h1:4Jbv+DJW3UT/LiOwJeYQe1efqtUx/iVham/4vfdArNI=
|
||||
github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2 h1:QhPf3A2AZW3tTGvHPg0TA+CR3oHbVLlXUhlghqISp1I=
|
||||
github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s=
|
||||
github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f h1:a969LJ4IQFwRHYqonHtUDMSh9i54WcKggeEkQ3fZMl4=
|
||||
github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U=
|
||||
github.com/opencontainers/runtime-spec v0.1.2-0.20190507144316-5b71a03e2700 h1:eNUVfm/RFLIi1G7flU5/ZRTHvd4kcVuzfRnL6OFlzCI=
|
||||
github.com/opencontainers/runtime-spec v0.1.2-0.20190507144316-5b71a03e2700/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0=
|
||||
github.com/pkg/errors v0.8.1 h1:iURUrRGxPUNPdy5/HRSm+Yj6okJ6UtLINN0Q9M4+h3I=
|
||||
github.com/pkg/errors v0.8.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0=
|
||||
github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM=
|
||||
github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4=
|
||||
github.com/prometheus/procfs v0.0.0-20180125133057-cb4147076ac7 h1:hhvfGDVThBnd4kYisSFmYuHYeUhglxcwag7FhVPH9zM=
|
||||
github.com/prometheus/procfs v0.0.0-20180125133057-cb4147076ac7/go.mod h1:c3At6R/oaqEKCNdg8wHV1ftS6bRYblBhIjjI8uT2IGk=
|
||||
github.com/sirupsen/logrus v1.4.1 h1:GL2rEmy6nsikmW0r8opw9JIRScdMF5hA8cOYLH7In1k=
|
||||
github.com/sirupsen/logrus v1.4.1/go.mod h1:ni0Sbl8bgC9z8RoU9G6nDWqqs/fq4eDPysMBDgk/93Q=
|
||||
github.com/sirupsen/logrus v1.4.2 h1:SPIRibHv4MatM3XXNO2BJeFLZwZ2LvZgfQ5+UNI2im4=
|
||||
github.com/sirupsen/logrus v1.4.2/go.mod h1:tLMulIdttU9McNUspp0xgXVQah82FyeX6MwdIuYE2rE=
|
||||
github.com/stretchr/objx v0.1.0/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME=
|
||||
github.com/stretchr/objx v0.1.1/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME=
|
||||
github.com/stretchr/testify v1.2.2 h1:bSDNvY7ZPG5RlJ8otE/7V6gMiyenm9RtJ7IUVIAoJ1w=
|
||||
github.com/stretchr/testify v1.2.2/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXfy6kDkUVs=
|
||||
github.com/stretchr/testify v1.4.0 h1:2E4SXV/wtOkTonXsotYi4li6zVWxYlZuYNCXe9XRJyk=
|
||||
github.com/stretchr/testify v1.4.0/go.mod h1:j7eGeouHqKxXV5pUuKE4zz7dFj8WfuZ+81PSLYec5m4=
|
||||
github.com/urfave/cli v0.0.0-20171014202726-7bc6a0acffa5 h1:MCfT24H3f//U5+UCrZp1/riVO3B50BovxtDiNn0XKkk=
|
||||
github.com/urfave/cli v0.0.0-20171014202726-7bc6a0acffa5/go.mod h1:70zkFmudgCuE/ngEzBv17Jvp/497gISqfk5gWijbERA=
|
||||
go.opencensus.io v0.22.0 h1:C9hSCOW830chIVkdja34wa6Ky+IzWllkUinR+BtRZd4=
|
||||
go.opencensus.io v0.22.0/go.mod h1:+kGneAE2xo2IficOXnaByMWTGM9T73dGwxeWcUqIpI8=
|
||||
golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACkg1iLfiJU5Ep61QUkGW8qpdssI0+w=
|
||||
golang.org/x/exp v0.0.0-20190121172915-509febef88a4/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA=
|
||||
golang.org/x/lint v0.0.0-20181026193005-c67002cb31c3/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE=
|
||||
golang.org/x/lint v0.0.0-20190227174305-5b3e6a55c961/go.mod h1:wehouNa3lNwaWXcvxsM5YxQ5yQlVC4a0KAMCusXpPoU=
|
||||
golang.org/x/lint v0.0.0-20190313153728-d0100b6bd8b3/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc=
|
||||
golang.org/x/net v0.0.0-20180724234803-3673e40ba225/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
|
||||
golang.org/x/net v0.0.0-20180826012351-8a410e7b638d/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
|
||||
golang.org/x/net v0.0.0-20190213061140-3a22650c66bd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
|
||||
golang.org/x/net v0.0.0-20190311183353-d8887717615a h1:oWX7TPOiFAMXLq8o0ikBYfCJVlRHBcsciT5bXOrH628=
|
||||
golang.org/x/net v0.0.0-20190311183353-d8887717615a/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg=
|
||||
golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09 h1:KaQtG+aDELoNmXYas3TVkGNYRuq8JQ1aa7LJt8EXVyo=
|
||||
golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg=
|
||||
golang.org/x/net v0.0.0-20191004110552-13f9640d40b9 h1:rjwSpXsdiK0dV8/Naq3kAw9ymfAeJIyd0upUIElB+lI=
|
||||
golang.org/x/net v0.0.0-20191004110552-13f9640d40b9/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s=
|
||||
golang.org/x/oauth2 v0.0.0-20180821212333-d2e6202438be/go.mod h1:N/0e6XlmueqKjAGxoOufVs8QHGRruUQn6yWY3a++T0U=
|
||||
golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
|
||||
golang.org/x/sync v0.0.0-20181108010431-42b317875d0f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
|
||||
golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6 h1:bjcUS9ztw9kFmmIxJInhon/0Is3p+EHBKNgquIzo1OI=
|
||||
golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
|
||||
golang.org/x/sync v0.0.0-20190423024810-112230192c58 h1:8gQV6CLnAEikrhgkHFbMAEhagSSnXWGV915qUMm9mrU=
|
||||
golang.org/x/sync v0.0.0-20190423024810-112230192c58/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
|
||||
golang.org/x/sys v0.0.0-20180830151530-49385e6e1522/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
|
||||
golang.org/x/sys v0.0.0-20180905080454-ebe1bf3edb33/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
|
||||
golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
|
||||
golang.org/x/sys v0.0.0-20190422165155-953cdadca894/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20190514135907-3a4b5fb9f71f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 h1:7TYNF4UdlohbFwpNH04CoPMp1cHUZgO1Ebq5r2hIjfo=
|
||||
golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/text v0.3.0 h1:g61tztE5qeGQ89tm6NTjjM9VPIm088od1l6aSorWRWg=
|
||||
golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ=
|
||||
golang.org/x/text v0.3.2 h1:tW2bmiBqwgJj/UpqtC8EpXEZVYOwU0yG4iWbprSVAcs=
|
||||
golang.org/x/text v0.3.2/go.mod h1:bEr9sfX3Q8Zfm5fL9x+3itogRgK3+ptLWKqgva+5dAk=
|
||||
golang.org/x/tools v0.0.0-20180221164845-07fd8470d635/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ=
|
||||
golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ=
|
||||
golang.org/x/tools v0.0.0-20181030221726-6c7e314b6563/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ=
|
||||
golang.org/x/tools v0.0.0-20190114222345-bf090417da8b/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ=
|
||||
golang.org/x/tools v0.0.0-20190226205152-f727befe758c/go.mod h1:9Yl7xja0Znq3iFh3HoIrodX9oNMXvdceNzlUR8zjMvY=
|
||||
golang.org/x/tools v0.0.0-20190311212946-11955173bddd/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs=
|
||||
golang.org/x/tools v0.0.0-20190524140312-2c0ae7006135/go.mod h1:RgjU9mgBXZiqYHBnxXauZ1Gv1EHHAz9KjViQ78xBX0Q=
|
||||
google.golang.org/appengine v1.1.0/go.mod h1:EbEs0AVv82hx2wNQdGPgUI5lhzA/G0D9YwlJXL52JkM=
|
||||
google.golang.org/appengine v1.4.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4=
|
||||
google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8 h1:Nw54tB0rB7hY/N0NQvRW8DG4Yk3Q6T9cu9RcFQDu1tc=
|
||||
google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8/go.mod h1:JiN7NxoALGmiZfu7CAH4rXhgtRTLTxftemlI0sWmxmc=
|
||||
google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb h1:i1Ppqkc3WQXikh8bXiwHqAN5Rv3/qDCcRk0/Otx73BY=
|
||||
google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE=
|
||||
google.golang.org/genproto v0.0.0-20190502173448-54afdca5d873 h1:nfPFGzJkUDX6uBmpN/pSw7MbOAWegH5QDQuoXFHedLg=
|
||||
google.golang.org/genproto v0.0.0-20190502173448-54afdca5d873/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE=
|
||||
google.golang.org/grpc v1.19.0/go.mod h1:mqu4LbDTu4XGKhr4mRzUsmM4RtVoemTSY81AxZiDr8c=
|
||||
google.golang.org/grpc v1.20.1 h1:Hz2g2wirWK7H0qIIhGIqRGTuMwTE8HEKFnDZZ7lm9NU=
|
||||
google.golang.org/grpc v1.20.1/go.mod h1:10oTOabMzJvdu6/UiuZezV6QK5dSlG84ov/aaiqXj38=
|
||||
google.golang.org/grpc v1.23.1 h1:q4XQuHFC6I28BKZpo6IYyb3mNO+l7lSOxRuYTCiDfXk=
|
||||
google.golang.org/grpc v1.23.1/go.mod h1:Y5yQAOtifL1yxbo5wqy6BxZv8vAUGQwXBOALyacEbxg=
|
||||
gopkg.in/check.v1 v0.0.0-20161208181325-20d25e280405/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0=
|
||||
gopkg.in/check.v1 v1.0.0-20180628173108-788fd7840127 h1:qIbj1fsPNlZgppZ+VLlY7N33q108Sa+fhmuc+sWQYwY=
|
||||
gopkg.in/check.v1 v1.0.0-20180628173108-788fd7840127/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0=
|
||||
gopkg.in/yaml.v2 v2.2.2 h1:ZCJp+EgiOT7lHqUV2J862kp8Qj64Jo6az82+3Td9dZw=
|
||||
gopkg.in/yaml.v2 v2.2.2/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
|
||||
gopkg.in/yaml.v2 v2.2.8 h1:obN1ZagJSUGI0Ek/LBmuj4SNLPfIny3KsKFopxRdj10=
|
||||
gopkg.in/yaml.v2 v2.2.8/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
|
||||
gotest.tools v2.2.0+incompatible h1:VsBPFP1AI068pPrMxtb/S8Zkgf9xEmTLJjfM+P5UIEo=
|
||||
gotest.tools v2.2.0+incompatible/go.mod h1:DsYFclhRJ6vuDpmuTbkuFWG+y2sxOXAzmJt81HFBacw=
|
||||
honnef.co/go/tools v0.0.0-20190102054323-c2f93a96b099/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4=
|
||||
honnef.co/go/tools v0.0.0-20190523083050-ea95bdfd59fc/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4=
|
||||
10
vendor/github.com/Microsoft/hcsshim/hnsendpoint.go
generated
vendored
10
vendor/github.com/Microsoft/hcsshim/hnsendpoint.go
generated
vendored
@@ -39,11 +39,21 @@ func HNSListEndpointRequest() ([]HNSEndpoint, error) {
|
||||
|
||||
// HotAttachEndpoint makes a HCS Call to attach the endpoint to the container
|
||||
func HotAttachEndpoint(containerID string, endpointID string) error {
|
||||
endpoint, err := GetHNSEndpointByID(endpointID)
|
||||
isAttached, err := endpoint.IsAttached(containerID)
|
||||
if isAttached {
|
||||
return err
|
||||
}
|
||||
return modifyNetworkEndpoint(containerID, endpointID, Add)
|
||||
}
|
||||
|
||||
// HotDetachEndpoint makes a HCS Call to detach the endpoint from the container
|
||||
func HotDetachEndpoint(containerID string, endpointID string) error {
|
||||
endpoint, err := GetHNSEndpointByID(endpointID)
|
||||
isAttached, err := endpoint.IsAttached(containerID)
|
||||
if !isAttached {
|
||||
return err
|
||||
}
|
||||
return modifyNetworkEndpoint(containerID, endpointID, Remove)
|
||||
}
|
||||
|
||||
|
||||
3
vendor/github.com/Microsoft/hcsshim/hnspolicy.go
generated
vendored
3
vendor/github.com/Microsoft/hcsshim/hnspolicy.go
generated
vendored
@@ -21,8 +21,11 @@ const (
|
||||
OutboundNat = hns.OutboundNat
|
||||
ExternalLoadBalancer = hns.ExternalLoadBalancer
|
||||
Route = hns.Route
|
||||
Proxy = hns.Proxy
|
||||
)
|
||||
|
||||
type ProxyPolicy = hns.ProxyPolicy
|
||||
|
||||
type NatPolicy = hns.NatPolicy
|
||||
|
||||
type QosPolicy = hns.QosPolicy
|
||||
|
||||
83
vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go
generated
vendored
Normal file
83
vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go
generated
vendored
Normal file
@@ -0,0 +1,83 @@
|
||||
package cow
|
||||
|
||||
import (
|
||||
"context"
|
||||
"io"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/schema1"
|
||||
hcsschema "github.com/Microsoft/hcsshim/internal/schema2"
|
||||
)
|
||||
|
||||
// Process is the interface for an OS process running in a container or utility VM.
|
||||
type Process interface {
|
||||
// Close releases resources associated with the process and closes the
|
||||
// writer and readers returned by Stdio. Depending on the implementation,
|
||||
// this may also terminate the process.
|
||||
Close() error
|
||||
// CloseStdin causes the process's stdin handle to receive EOF/EPIPE/whatever
|
||||
// is appropriate to indicate that no more data is available.
|
||||
CloseStdin(ctx context.Context) error
|
||||
// Pid returns the process ID.
|
||||
Pid() int
|
||||
// Stdio returns the stdio streams for a process. These may be nil if a stream
|
||||
// was not requested during CreateProcess.
|
||||
Stdio() (_ io.Writer, _ io.Reader, _ io.Reader)
|
||||
// ResizeConsole resizes the virtual terminal associated with the process.
|
||||
ResizeConsole(ctx context.Context, width, height uint16) error
|
||||
// Kill sends a SIGKILL or equivalent signal to the process and returns whether
|
||||
// the signal was delivered. It does not wait for the process to terminate.
|
||||
Kill(ctx context.Context) (bool, error)
|
||||
// Signal sends a signal to the process and returns whether the signal was
|
||||
// delivered. The input is OS specific (either
|
||||
// guestrequest.SignalProcessOptionsWCOW or
|
||||
// guestrequest.SignalProcessOptionsLCOW). It does not wait for the process
|
||||
// to terminate.
|
||||
Signal(ctx context.Context, options interface{}) (bool, error)
|
||||
// Wait waits for the process to complete, or for a connection to the process to be
|
||||
// terminated by some error condition (including calling Close).
|
||||
Wait() error
|
||||
// ExitCode returns the exit code of the process. Returns an error if the process is
|
||||
// not running.
|
||||
ExitCode() (int, error)
|
||||
}
|
||||
|
||||
// ProcessHost is the interface for creating processes.
|
||||
type ProcessHost interface {
|
||||
// CreateProcess creates a process. The configuration is host specific
|
||||
// (either hcsschema.ProcessParameters or lcow.ProcessParameters).
|
||||
CreateProcess(ctx context.Context, config interface{}) (Process, error)
|
||||
// OS returns the host's operating system, "linux" or "windows".
|
||||
OS() string
|
||||
// IsOCI specifies whether this is an OCI-compliant process host. If true,
|
||||
// then the configuration passed to CreateProcess should have an OCI process
|
||||
// spec (or nil if this is the initial process in an OCI container).
|
||||
// Otherwise, it should have the HCS-specific process parameters.
|
||||
IsOCI() bool
|
||||
}
|
||||
|
||||
// Container is the interface for container objects, either running on the host or
|
||||
// in a utility VM.
|
||||
type Container interface {
|
||||
ProcessHost
|
||||
// Close releases the resources associated with the container. Depending on
|
||||
// the implementation, this may also terminate the container.
|
||||
Close() error
|
||||
// ID returns the container ID.
|
||||
ID() string
|
||||
// Properties returns the requested container properties targeting a V1 schema container.
|
||||
Properties(ctx context.Context, types ...schema1.PropertyType) (*schema1.ContainerProperties, error)
|
||||
// PropertiesV2 returns the requested container properties targeting a V2 schema container.
|
||||
PropertiesV2(ctx context.Context, types ...hcsschema.PropertyType) (*hcsschema.Properties, error)
|
||||
// Start starts a container.
|
||||
Start(ctx context.Context) error
|
||||
// Shutdown sends a shutdown request to the container (but does not wait for
|
||||
// the shutdown to complete).
|
||||
Shutdown(ctx context.Context) error
|
||||
// Terminate sends a terminate request to the container (but does not wait
|
||||
// for the terminate to complete).
|
||||
Terminate(ctx context.Context) error
|
||||
// Wait waits for the container to terminate, or for the connection to the
|
||||
// container to be terminated by some error condition (including calling
|
||||
// Close).
|
||||
Wait() error
|
||||
}
|
||||
100
vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go
generated
vendored
100
vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go
generated
vendored
@@ -1,100 +0,0 @@
|
||||
package guestrequest
|
||||
|
||||
import (
|
||||
"github.com/Microsoft/hcsshim/internal/schema2"
|
||||
)
|
||||
|
||||
// Arguably, many of these (at least CombinedLayers) should have been generated
|
||||
// by swagger.
|
||||
//
|
||||
// This will also change package name due to an inbound breaking change.
|
||||
|
||||
// This class is used by a modify request to add or remove a combined layers
|
||||
// structure in the guest. For windows, the GCS applies a filter in ContainerRootPath
|
||||
// using the specified layers as the parent content. Ignores property ScratchPath
|
||||
// since the container path is already the scratch path. For linux, the GCS unions
|
||||
// the specified layers and ScratchPath together, placing the resulting union
|
||||
// filesystem at ContainerRootPath.
|
||||
type CombinedLayers struct {
|
||||
ContainerRootPath string `json:"ContainerRootPath,omitempty"`
|
||||
Layers []hcsschema.Layer `json:"Layers,omitempty"`
|
||||
ScratchPath string `json:"ScratchPath,omitempty"`
|
||||
}
|
||||
|
||||
// Defines the schema for hosted settings passed to GCS and/or OpenGCS
|
||||
|
||||
// SCSI. Scratch space for remote file-system commands, or R/W layer for containers
|
||||
type LCOWMappedVirtualDisk struct {
|
||||
MountPath string `json:"MountPath,omitempty"` // /tmp/scratch for an LCOW utility VM being used as a service VM
|
||||
Lun uint8 `json:"Lun,omitempty"`
|
||||
Controller uint8 `json:"Controller,omitempty"`
|
||||
ReadOnly bool `json:"ReadOnly,omitempty"`
|
||||
}
|
||||
|
||||
type WCOWMappedVirtualDisk struct {
|
||||
ContainerPath string `json:"ContainerPath,omitempty"`
|
||||
Lun int32 `json:"Lun,omitempty"`
|
||||
}
|
||||
|
||||
type LCOWMappedDirectory struct {
|
||||
MountPath string `json:"MountPath,omitempty"`
|
||||
Port int32 `json:"Port,omitempty"`
|
||||
ShareName string `json:"ShareName,omitempty"` // If empty not using ANames (not currently supported)
|
||||
ReadOnly bool `json:"ReadOnly,omitempty"`
|
||||
}
|
||||
|
||||
// Read-only layers over VPMem
|
||||
type LCOWMappedVPMemDevice struct {
|
||||
DeviceNumber uint32 `json:"DeviceNumber,omitempty"`
|
||||
MountPath string `json:"MountPath,omitempty"` // /tmp/pN
|
||||
}
|
||||
|
||||
type LCOWNetworkAdapter struct {
|
||||
NamespaceID string `json:",omitempty"`
|
||||
ID string `json:",omitempty"`
|
||||
MacAddress string `json:",omitempty"`
|
||||
IPAddress string `json:",omitempty"`
|
||||
PrefixLength uint8 `json:",omitempty"`
|
||||
GatewayAddress string `json:",omitempty"`
|
||||
DNSSuffix string `json:",omitempty"`
|
||||
DNSServerList string `json:",omitempty"`
|
||||
EnableLowMetric bool `json:",omitempty"`
|
||||
EncapOverhead uint16 `json:",omitempty"`
|
||||
}
|
||||
|
||||
type ResourceType string
|
||||
|
||||
const (
|
||||
// These are constants for v2 schema modify guest requests.
|
||||
ResourceTypeMappedDirectory ResourceType = "MappedDirectory"
|
||||
ResourceTypeMappedVirtualDisk ResourceType = "MappedVirtualDisk"
|
||||
ResourceTypeNetwork ResourceType = "Network"
|
||||
ResourceTypeNetworkNamespace ResourceType = "NetworkNamespace"
|
||||
ResourceTypeCombinedLayers ResourceType = "CombinedLayers"
|
||||
ResourceTypeVPMemDevice ResourceType = "VPMemDevice"
|
||||
)
|
||||
|
||||
// GuestRequest is for modify commands passed to the guest.
|
||||
type GuestRequest struct {
|
||||
RequestType string `json:"RequestType,omitempty"`
|
||||
ResourceType ResourceType `json:"ResourceType,omitempty"`
|
||||
Settings interface{} `json:"Settings,omitempty"`
|
||||
}
|
||||
|
||||
type NetworkModifyRequest struct {
|
||||
AdapterId string `json:"AdapterId,omitempty"`
|
||||
RequestType string `json:"RequestType,omitempty"`
|
||||
Settings interface{} `json:"Settings,omitempty"`
|
||||
}
|
||||
|
||||
type RS4NetworkModifyRequest struct {
|
||||
AdapterInstanceId string `json:"AdapterInstanceId,omitempty"`
|
||||
RequestType string `json:"RequestType,omitempty"`
|
||||
Settings interface{} `json:"Settings,omitempty"`
|
||||
}
|
||||
|
||||
// SignalProcessOptions is the options passed to either WCOW or LCOW
|
||||
// to signal a given process.
|
||||
type SignalProcessOptions struct {
|
||||
Signal int `json:,omitempty`
|
||||
}
|
||||
69
vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go
generated
vendored
69
vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go
generated
vendored
@@ -1,69 +0,0 @@
|
||||
package guid
|
||||
|
||||
import (
|
||||
"crypto/rand"
|
||||
"encoding/json"
|
||||
"fmt"
|
||||
"io"
|
||||
"strconv"
|
||||
"strings"
|
||||
)
|
||||
|
||||
var _ = (json.Marshaler)(&GUID{})
|
||||
var _ = (json.Unmarshaler)(&GUID{})
|
||||
|
||||
type GUID [16]byte
|
||||
|
||||
func New() GUID {
|
||||
g := GUID{}
|
||||
_, err := io.ReadFull(rand.Reader, g[:])
|
||||
if err != nil {
|
||||
panic(err)
|
||||
}
|
||||
return g
|
||||
}
|
||||
|
||||
func (g GUID) String() string {
|
||||
return fmt.Sprintf("%02x%02x%02x%02x-%02x%02x-%02x%02x-%02x-%02x", g[3], g[2], g[1], g[0], g[5], g[4], g[7], g[6], g[8:10], g[10:])
|
||||
}
|
||||
|
||||
func FromString(s string) GUID {
|
||||
if len(s) != 36 {
|
||||
panic(fmt.Sprintf("invalid GUID length: %d", len(s)))
|
||||
}
|
||||
if s[8] != '-' || s[13] != '-' || s[18] != '-' || s[23] != '-' {
|
||||
panic("invalid GUID format")
|
||||
}
|
||||
indexOrder := [16]int{
|
||||
0, 2, 4, 6,
|
||||
9, 11,
|
||||
14, 16,
|
||||
19, 21,
|
||||
24, 26, 28, 30, 32, 34,
|
||||
}
|
||||
byteOrder := [16]int{
|
||||
3, 2, 1, 0,
|
||||
5, 4,
|
||||
7, 6,
|
||||
8, 9,
|
||||
10, 11, 12, 13, 14, 15,
|
||||
}
|
||||
var g GUID
|
||||
for i, x := range indexOrder {
|
||||
b, err := strconv.ParseInt(s[x:x+2], 16, 16)
|
||||
if err != nil {
|
||||
panic(err)
|
||||
}
|
||||
g[byteOrder[i]] = byte(b)
|
||||
}
|
||||
return g
|
||||
}
|
||||
|
||||
func (g GUID) MarshalJSON() ([]byte, error) {
|
||||
return json.Marshal(g.String())
|
||||
}
|
||||
|
||||
func (g *GUID) UnmarshalJSON(data []byte) error {
|
||||
*g = FromString(strings.Trim(string(data), "\""))
|
||||
return nil
|
||||
}
|
||||
102
vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go
generated
vendored
102
vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go
generated
vendored
@@ -1,10 +1,13 @@
|
||||
package hcs
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
"sync"
|
||||
"syscall"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/interop"
|
||||
"github.com/Microsoft/hcsshim/internal/logfields"
|
||||
"github.com/Microsoft/hcsshim/internal/vmcompute"
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
@@ -40,35 +43,83 @@ var (
|
||||
)
|
||||
|
||||
type hcsNotification uint32
|
||||
|
||||
func (hn hcsNotification) String() string {
|
||||
switch hn {
|
||||
case hcsNotificationSystemExited:
|
||||
return "SystemExited"
|
||||
case hcsNotificationSystemCreateCompleted:
|
||||
return "SystemCreateCompleted"
|
||||
case hcsNotificationSystemStartCompleted:
|
||||
return "SystemStartCompleted"
|
||||
case hcsNotificationSystemPauseCompleted:
|
||||
return "SystemPauseCompleted"
|
||||
case hcsNotificationSystemResumeCompleted:
|
||||
return "SystemResumeCompleted"
|
||||
case hcsNotificationSystemCrashReport:
|
||||
return "SystemCrashReport"
|
||||
case hcsNotificationSystemSiloJobCreated:
|
||||
return "SystemSiloJobCreated"
|
||||
case hcsNotificationSystemSaveCompleted:
|
||||
return "SystemSaveCompleted"
|
||||
case hcsNotificationSystemRdpEnhancedModeStateChanged:
|
||||
return "SystemRdpEnhancedModeStateChanged"
|
||||
case hcsNotificationSystemShutdownFailed:
|
||||
return "SystemShutdownFailed"
|
||||
case hcsNotificationSystemGetPropertiesCompleted:
|
||||
return "SystemGetPropertiesCompleted"
|
||||
case hcsNotificationSystemModifyCompleted:
|
||||
return "SystemModifyCompleted"
|
||||
case hcsNotificationSystemCrashInitiated:
|
||||
return "SystemCrashInitiated"
|
||||
case hcsNotificationSystemGuestConnectionClosed:
|
||||
return "SystemGuestConnectionClosed"
|
||||
case hcsNotificationProcessExited:
|
||||
return "ProcessExited"
|
||||
case hcsNotificationInvalid:
|
||||
return "Invalid"
|
||||
case hcsNotificationServiceDisconnect:
|
||||
return "ServiceDisconnect"
|
||||
default:
|
||||
return fmt.Sprintf("Unknown: %d", hn)
|
||||
}
|
||||
}
|
||||
|
||||
type notificationChannel chan error
|
||||
|
||||
type notifcationWatcherContext struct {
|
||||
channels notificationChannels
|
||||
handle hcsCallback
|
||||
handle vmcompute.HcsCallback
|
||||
|
||||
systemID string
|
||||
processID int
|
||||
}
|
||||
|
||||
type notificationChannels map[hcsNotification]notificationChannel
|
||||
|
||||
func newChannels() notificationChannels {
|
||||
func newSystemChannels() notificationChannels {
|
||||
channels := make(notificationChannels)
|
||||
for _, notif := range []hcsNotification{
|
||||
hcsNotificationServiceDisconnect,
|
||||
hcsNotificationSystemExited,
|
||||
hcsNotificationSystemCreateCompleted,
|
||||
hcsNotificationSystemStartCompleted,
|
||||
hcsNotificationSystemPauseCompleted,
|
||||
hcsNotificationSystemResumeCompleted,
|
||||
} {
|
||||
channels[notif] = make(notificationChannel, 1)
|
||||
}
|
||||
return channels
|
||||
}
|
||||
|
||||
channels[hcsNotificationSystemExited] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemCreateCompleted] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemStartCompleted] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemPauseCompleted] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemResumeCompleted] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationProcessExited] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationServiceDisconnect] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemCrashReport] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemSiloJobCreated] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemSaveCompleted] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemRdpEnhancedModeStateChanged] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemShutdownFailed] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemGetPropertiesCompleted] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemModifyCompleted] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemCrashInitiated] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemGuestConnectionClosed] = make(notificationChannel, 1)
|
||||
|
||||
func newProcessChannels() notificationChannels {
|
||||
channels := make(notificationChannels)
|
||||
for _, notif := range []hcsNotification{
|
||||
hcsNotificationServiceDisconnect,
|
||||
hcsNotificationProcessExited,
|
||||
} {
|
||||
channels[notif] = make(notificationChannel, 1)
|
||||
}
|
||||
return channels
|
||||
}
|
||||
|
||||
@@ -92,12 +143,17 @@ func notificationWatcher(notificationType hcsNotification, callbackNumber uintpt
|
||||
return 0
|
||||
}
|
||||
|
||||
log := logrus.WithFields(logrus.Fields{
|
||||
"notification-type": notificationType.String(),
|
||||
"system-id": context.systemID,
|
||||
})
|
||||
if context.processID != 0 {
|
||||
log.Data[logfields.ProcessID] = context.processID
|
||||
}
|
||||
log.Debug("HCS notification")
|
||||
|
||||
if channel, ok := context.channels[notificationType]; ok {
|
||||
channel <- result
|
||||
} else {
|
||||
logrus.WithFields(logrus.Fields{
|
||||
"notification-type": notificationType,
|
||||
}).Warn("Received a callback of an unsupported type")
|
||||
}
|
||||
|
||||
return 0
|
||||
|
||||
7
vendor/github.com/Microsoft/hcsshim/internal/hcs/cgo.go
generated
vendored
7
vendor/github.com/Microsoft/hcsshim/internal/hcs/cgo.go
generated
vendored
@@ -1,7 +0,0 @@
|
||||
package hcs
|
||||
|
||||
import "C"
|
||||
|
||||
// This import is needed to make the library compile as CGO because HCSSHIM
|
||||
// only works with CGO due to callbacks from HCS comming back from a C thread
|
||||
// which is not supported without CGO. See https://github.com/golang/go/issues/10973
|
||||
75
vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go
generated
vendored
75
vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go
generated
vendored
@@ -1,14 +1,14 @@
|
||||
package hcs
|
||||
|
||||
import (
|
||||
"context"
|
||||
"encoding/json"
|
||||
"errors"
|
||||
"fmt"
|
||||
"net"
|
||||
"syscall"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/interop"
|
||||
"github.com/Microsoft/hcsshim/internal/logfields"
|
||||
"github.com/sirupsen/logrus"
|
||||
"github.com/Microsoft/hcsshim/internal/log"
|
||||
)
|
||||
|
||||
var (
|
||||
@@ -117,17 +117,11 @@ func (ev *ErrorEvent) String() string {
|
||||
return evs
|
||||
}
|
||||
|
||||
func processHcsResult(resultp *uint16) []ErrorEvent {
|
||||
if resultp != nil {
|
||||
resultj := interop.ConvertAndFreeCoTaskMemString(resultp)
|
||||
logrus.WithField(logfields.JSON, resultj).
|
||||
Debug("HCS Result")
|
||||
func processHcsResult(ctx context.Context, resultJSON string) []ErrorEvent {
|
||||
if resultJSON != "" {
|
||||
result := &hcsResult{}
|
||||
if err := json.Unmarshal([]byte(resultj), result); err != nil {
|
||||
logrus.WithFields(logrus.Fields{
|
||||
logfields.JSON: resultj,
|
||||
logrus.ErrorKey: err,
|
||||
}).Warning("Could not unmarshal HCS result")
|
||||
if err := json.Unmarshal([]byte(resultJSON), result); err != nil {
|
||||
log.G(ctx).WithError(err).Warning("Could not unmarshal HCS result")
|
||||
return nil
|
||||
}
|
||||
return result.ErrorEvents
|
||||
@@ -141,6 +135,8 @@ type HcsError struct {
|
||||
Events []ErrorEvent
|
||||
}
|
||||
|
||||
var _ net.Error = &HcsError{}
|
||||
|
||||
func (e *HcsError) Error() string {
|
||||
s := e.Op + ": " + e.Err.Error()
|
||||
for _, ev := range e.Events {
|
||||
@@ -149,6 +145,16 @@ func (e *HcsError) Error() string {
|
||||
return s
|
||||
}
|
||||
|
||||
func (e *HcsError) Temporary() bool {
|
||||
err, ok := e.Err.(net.Error)
|
||||
return ok && err.Temporary()
|
||||
}
|
||||
|
||||
func (e *HcsError) Timeout() bool {
|
||||
err, ok := e.Err.(net.Error)
|
||||
return ok && err.Timeout()
|
||||
}
|
||||
|
||||
// ProcessError is an error encountered in HCS during an operation on a Process object
|
||||
type ProcessError struct {
|
||||
SystemID string
|
||||
@@ -158,6 +164,8 @@ type ProcessError struct {
|
||||
Events []ErrorEvent
|
||||
}
|
||||
|
||||
var _ net.Error = &ProcessError{}
|
||||
|
||||
// SystemError is an error encountered in HCS during an operation on a Container object
|
||||
type SystemError struct {
|
||||
ID string
|
||||
@@ -167,6 +175,8 @@ type SystemError struct {
|
||||
Events []ErrorEvent
|
||||
}
|
||||
|
||||
var _ net.Error = &SystemError{}
|
||||
|
||||
func (e *SystemError) Error() string {
|
||||
s := e.Op + " " + e.ID + ": " + e.Err.Error()
|
||||
for _, ev := range e.Events {
|
||||
@@ -178,6 +188,16 @@ func (e *SystemError) Error() string {
|
||||
return s
|
||||
}
|
||||
|
||||
func (e *SystemError) Temporary() bool {
|
||||
err, ok := e.Err.(net.Error)
|
||||
return ok && err.Temporary()
|
||||
}
|
||||
|
||||
func (e *SystemError) Timeout() bool {
|
||||
err, ok := e.Err.(net.Error)
|
||||
return ok && err.Timeout()
|
||||
}
|
||||
|
||||
func makeSystemError(system *System, op string, extra string, err error, events []ErrorEvent) error {
|
||||
// Don't double wrap errors
|
||||
if _, ok := err.(*SystemError); ok {
|
||||
@@ -200,6 +220,16 @@ func (e *ProcessError) Error() string {
|
||||
return s
|
||||
}
|
||||
|
||||
func (e *ProcessError) Temporary() bool {
|
||||
err, ok := e.Err.(net.Error)
|
||||
return ok && err.Temporary()
|
||||
}
|
||||
|
||||
func (e *ProcessError) Timeout() bool {
|
||||
err, ok := e.Err.(net.Error)
|
||||
return ok && err.Timeout()
|
||||
}
|
||||
|
||||
func makeProcessError(process *Process, op string, err error, events []ErrorEvent) error {
|
||||
// Don't double wrap errors
|
||||
if _, ok := err.(*ProcessError); ok {
|
||||
@@ -242,6 +272,9 @@ func IsPending(err error) bool {
|
||||
// IsTimeout returns a boolean indicating whether the error is caused by
|
||||
// a timeout waiting for the operation to complete.
|
||||
func IsTimeout(err error) bool {
|
||||
if err, ok := err.(net.Error); ok && err.Timeout() {
|
||||
return true
|
||||
}
|
||||
err = getInnerError(err)
|
||||
return err == ErrTimeout
|
||||
}
|
||||
@@ -272,6 +305,13 @@ func IsNotSupported(err error) bool {
|
||||
err == ErrVmcomputeUnknownMessage
|
||||
}
|
||||
|
||||
// IsOperationInvalidState returns true when err is caused by
|
||||
// `ErrVmcomputeOperationInvalidState`.
|
||||
func IsOperationInvalidState(err error) bool {
|
||||
err = getInnerError(err)
|
||||
return err == ErrVmcomputeOperationInvalidState
|
||||
}
|
||||
|
||||
func getInnerError(err error) error {
|
||||
switch pe := err.(type) {
|
||||
case nil:
|
||||
@@ -285,3 +325,12 @@ func getInnerError(err error) error {
|
||||
}
|
||||
return err
|
||||
}
|
||||
|
||||
func getOperationLogResult(err error) (string, error) {
|
||||
switch err {
|
||||
case nil:
|
||||
return "Success", nil
|
||||
default:
|
||||
return "Error", err
|
||||
}
|
||||
}
|
||||
|
||||
48
vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go
generated
vendored
48
vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go
generated
vendored
@@ -1,48 +0,0 @@
|
||||
// Shim for the Host Compute Service (HCS) to manage Windows Server
|
||||
// containers and Hyper-V containers.
|
||||
|
||||
package hcs
|
||||
|
||||
import (
|
||||
"syscall"
|
||||
)
|
||||
|
||||
//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hcs.go
|
||||
|
||||
//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems?
|
||||
//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem?
|
||||
//sys hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem?
|
||||
//sys hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem?
|
||||
//sys hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem?
|
||||
//sys hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem?
|
||||
//sys hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem?
|
||||
//sys hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem?
|
||||
//sys hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem?
|
||||
//sys hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties?
|
||||
//sys hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem?
|
||||
//sys hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback?
|
||||
//sys hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback?
|
||||
|
||||
//sys hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess?
|
||||
//sys hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess?
|
||||
//sys hcsCloseProcess(process hcsProcess) (hr error) = vmcompute.HcsCloseProcess?
|
||||
//sys hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess?
|
||||
//sys hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) = vmcompute.HcsTerminateProcess?
|
||||
//sys hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo?
|
||||
//sys hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties?
|
||||
//sys hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess?
|
||||
//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties?
|
||||
//sys hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback?
|
||||
//sys hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback?
|
||||
|
||||
type hcsSystem syscall.Handle
|
||||
type hcsProcess syscall.Handle
|
||||
type hcsCallback syscall.Handle
|
||||
|
||||
type hcsProcessInformation struct {
|
||||
ProcessId uint32
|
||||
Reserved uint32
|
||||
StdInput syscall.Handle
|
||||
StdOutput syscall.Handle
|
||||
StdError syscall.Handle
|
||||
}
|
||||
20
vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go
generated
vendored
20
vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go
generated
vendored
@@ -1,20 +0,0 @@
|
||||
package hcs
|
||||
|
||||
import "github.com/sirupsen/logrus"
|
||||
|
||||
func logOperationBegin(ctx logrus.Fields, msg string) {
|
||||
logrus.WithFields(ctx).Debug(msg)
|
||||
}
|
||||
|
||||
func logOperationEnd(ctx logrus.Fields, msg string, err error) {
|
||||
// Copy the log and fields first.
|
||||
log := logrus.WithFields(ctx)
|
||||
if err == nil {
|
||||
log.Debug(msg)
|
||||
} else {
|
||||
// Edit only the copied field data to avoid race conditions on the
|
||||
// write.
|
||||
log.Data[logrus.ErrorKey] = err
|
||||
log.Error(msg)
|
||||
}
|
||||
}
|
||||
441
vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go
generated
vendored
441
vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go
generated
vendored
@@ -1,48 +1,47 @@
|
||||
package hcs
|
||||
|
||||
import (
|
||||
"context"
|
||||
"encoding/json"
|
||||
"io"
|
||||
"sync"
|
||||
"syscall"
|
||||
"time"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/guestrequest"
|
||||
"github.com/Microsoft/hcsshim/internal/interop"
|
||||
"github.com/Microsoft/hcsshim/internal/logfields"
|
||||
"github.com/sirupsen/logrus"
|
||||
"github.com/Microsoft/hcsshim/internal/log"
|
||||
"github.com/Microsoft/hcsshim/internal/oc"
|
||||
"github.com/Microsoft/hcsshim/internal/vmcompute"
|
||||
"go.opencensus.io/trace"
|
||||
)
|
||||
|
||||
// ContainerError is an error encountered in HCS
|
||||
type Process struct {
|
||||
handleLock sync.RWMutex
|
||||
handle hcsProcess
|
||||
handle vmcompute.HcsProcess
|
||||
processID int
|
||||
system *System
|
||||
cachedPipes *cachedPipes
|
||||
hasCachedStdio bool
|
||||
stdioLock sync.Mutex
|
||||
stdin io.WriteCloser
|
||||
stdout io.ReadCloser
|
||||
stderr io.ReadCloser
|
||||
callbackNumber uintptr
|
||||
|
||||
logctx logrus.Fields
|
||||
closedWaitOnce sync.Once
|
||||
waitBlock chan struct{}
|
||||
exitCode int
|
||||
waitError error
|
||||
}
|
||||
|
||||
func newProcess(process hcsProcess, processID int, computeSystem *System) *Process {
|
||||
func newProcess(process vmcompute.HcsProcess, processID int, computeSystem *System) *Process {
|
||||
return &Process{
|
||||
handle: process,
|
||||
processID: processID,
|
||||
system: computeSystem,
|
||||
logctx: logrus.Fields{
|
||||
logfields.ContainerID: computeSystem.ID(),
|
||||
logfields.ProcessID: processID,
|
||||
},
|
||||
waitBlock: make(chan struct{}),
|
||||
}
|
||||
}
|
||||
|
||||
type cachedPipes struct {
|
||||
stdIn syscall.Handle
|
||||
stdOut syscall.Handle
|
||||
stdErr syscall.Handle
|
||||
}
|
||||
|
||||
type processModifyRequest struct {
|
||||
Operation string
|
||||
ConsoleSize *consoleSize `json:",omitempty"`
|
||||
@@ -58,7 +57,7 @@ type closeHandle struct {
|
||||
Handle string
|
||||
}
|
||||
|
||||
type ProcessStatus struct {
|
||||
type processStatus struct {
|
||||
ProcessID uint32
|
||||
Exited bool
|
||||
ExitCode uint32
|
||||
@@ -86,120 +85,153 @@ func (process *Process) SystemID() string {
|
||||
return process.system.ID()
|
||||
}
|
||||
|
||||
func (process *Process) logOperationBegin(operation string) {
|
||||
logOperationBegin(
|
||||
process.logctx,
|
||||
operation+" - Begin Operation")
|
||||
}
|
||||
|
||||
func (process *Process) logOperationEnd(operation string, err error) {
|
||||
var result string
|
||||
if err == nil {
|
||||
result = "Success"
|
||||
} else {
|
||||
result = "Error"
|
||||
func (process *Process) processSignalResult(ctx context.Context, err error) (bool, error) {
|
||||
switch err {
|
||||
case nil:
|
||||
return true, nil
|
||||
case ErrVmcomputeOperationInvalidState, ErrComputeSystemDoesNotExist, ErrElementNotFound:
|
||||
select {
|
||||
case <-process.waitBlock:
|
||||
// The process exit notification has already arrived.
|
||||
default:
|
||||
// The process should be gone, but we have not received the notification.
|
||||
// After a second, force unblock the process wait to work around a possible
|
||||
// deadlock in the HCS.
|
||||
go func() {
|
||||
time.Sleep(time.Second)
|
||||
process.closedWaitOnce.Do(func() {
|
||||
log.G(ctx).WithError(err).Warn("force unblocking process waits")
|
||||
process.exitCode = -1
|
||||
process.waitError = err
|
||||
close(process.waitBlock)
|
||||
})
|
||||
}()
|
||||
}
|
||||
return false, nil
|
||||
default:
|
||||
return false, err
|
||||
}
|
||||
|
||||
logOperationEnd(
|
||||
process.logctx,
|
||||
operation+" - End Operation - "+result,
|
||||
err)
|
||||
}
|
||||
|
||||
// Signal signals the process with `options`.
|
||||
func (process *Process) Signal(options guestrequest.SignalProcessOptions) (err error) {
|
||||
//
|
||||
// For LCOW `guestrequest.SignalProcessOptionsLCOW`.
|
||||
//
|
||||
// For WCOW `guestrequest.SignalProcessOptionsWCOW`.
|
||||
func (process *Process) Signal(ctx context.Context, options interface{}) (bool, error) {
|
||||
process.handleLock.RLock()
|
||||
defer process.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::Process::Signal"
|
||||
process.logOperationBegin(operation)
|
||||
defer func() { process.logOperationEnd(operation, err) }()
|
||||
|
||||
if process.handle == 0 {
|
||||
return makeProcessError(process, operation, ErrAlreadyClosed, nil)
|
||||
return false, makeProcessError(process, operation, ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
optionsb, err := json.Marshal(options)
|
||||
if err != nil {
|
||||
return err
|
||||
return false, err
|
||||
}
|
||||
|
||||
optionsStr := string(optionsb)
|
||||
|
||||
var resultp *uint16
|
||||
syscallWatcher(process.logctx, func() {
|
||||
err = hcsSignalProcess(process.handle, optionsStr, &resultp)
|
||||
})
|
||||
events := processHcsResult(resultp)
|
||||
resultJSON, err := vmcompute.HcsSignalProcess(ctx, process.handle, string(optionsb))
|
||||
events := processHcsResult(ctx, resultJSON)
|
||||
delivered, err := process.processSignalResult(ctx, err)
|
||||
if err != nil {
|
||||
return makeProcessError(process, operation, err, events)
|
||||
err = makeProcessError(process, operation, err, events)
|
||||
}
|
||||
|
||||
return nil
|
||||
return delivered, err
|
||||
}
|
||||
|
||||
// Kill signals the process to terminate but does not wait for it to finish terminating.
|
||||
func (process *Process) Kill() (err error) {
|
||||
func (process *Process) Kill(ctx context.Context) (bool, error) {
|
||||
process.handleLock.RLock()
|
||||
defer process.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::Process::Kill"
|
||||
process.logOperationBegin(operation)
|
||||
defer func() { process.logOperationEnd(operation, err) }()
|
||||
|
||||
if process.handle == 0 {
|
||||
return makeProcessError(process, operation, ErrAlreadyClosed, nil)
|
||||
return false, makeProcessError(process, operation, ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
var resultp *uint16
|
||||
syscallWatcher(process.logctx, func() {
|
||||
err = hcsTerminateProcess(process.handle, &resultp)
|
||||
resultJSON, err := vmcompute.HcsTerminateProcess(ctx, process.handle)
|
||||
events := processHcsResult(ctx, resultJSON)
|
||||
delivered, err := process.processSignalResult(ctx, err)
|
||||
if err != nil {
|
||||
err = makeProcessError(process, operation, err, events)
|
||||
}
|
||||
return delivered, err
|
||||
}
|
||||
|
||||
// waitBackground waits for the process exit notification. Once received sets
|
||||
// `process.waitError` (if any) and unblocks all `Wait` calls.
|
||||
//
|
||||
// This MUST be called exactly once per `process.handle` but `Wait` is safe to
|
||||
// call multiple times.
|
||||
func (process *Process) waitBackground() {
|
||||
operation := "hcsshim::Process::waitBackground"
|
||||
ctx, span := trace.StartSpan(context.Background(), operation)
|
||||
defer span.End()
|
||||
span.AddAttributes(
|
||||
trace.StringAttribute("cid", process.SystemID()),
|
||||
trace.Int64Attribute("pid", int64(process.processID)))
|
||||
|
||||
var (
|
||||
err error
|
||||
exitCode = -1
|
||||
)
|
||||
|
||||
err = waitForNotification(ctx, process.callbackNumber, hcsNotificationProcessExited, nil)
|
||||
if err != nil {
|
||||
err = makeProcessError(process, operation, err, nil)
|
||||
log.G(ctx).WithError(err).Error("failed wait")
|
||||
} else {
|
||||
process.handleLock.RLock()
|
||||
defer process.handleLock.RUnlock()
|
||||
|
||||
// Make sure we didnt race with Close() here
|
||||
if process.handle != 0 {
|
||||
propertiesJSON, resultJSON, err := vmcompute.HcsGetProcessProperties(ctx, process.handle)
|
||||
events := processHcsResult(ctx, resultJSON)
|
||||
if err != nil {
|
||||
err = makeProcessError(process, operation, err, events)
|
||||
} else {
|
||||
properties := &processStatus{}
|
||||
err = json.Unmarshal([]byte(propertiesJSON), properties)
|
||||
if err != nil {
|
||||
err = makeProcessError(process, operation, err, nil)
|
||||
} else {
|
||||
if properties.LastWaitResult != 0 {
|
||||
log.G(ctx).WithField("wait-result", properties.LastWaitResult).Warning("non-zero last wait result")
|
||||
} else {
|
||||
exitCode = int(properties.ExitCode)
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
log.G(ctx).WithField("exitCode", exitCode).Debug("process exited")
|
||||
|
||||
process.closedWaitOnce.Do(func() {
|
||||
process.exitCode = exitCode
|
||||
process.waitError = err
|
||||
close(process.waitBlock)
|
||||
})
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return makeProcessError(process, operation, err, events)
|
||||
}
|
||||
|
||||
return nil
|
||||
oc.SetSpanStatus(span, err)
|
||||
}
|
||||
|
||||
// Wait waits for the process to exit.
|
||||
func (process *Process) Wait() (err error) {
|
||||
operation := "hcsshim::Process::Wait"
|
||||
process.logOperationBegin(operation)
|
||||
defer func() { process.logOperationEnd(operation, err) }()
|
||||
|
||||
err = waitForNotification(process.callbackNumber, hcsNotificationProcessExited, nil)
|
||||
if err != nil {
|
||||
return makeProcessError(process, operation, err, nil)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// WaitTimeout waits for the process to exit or the duration to elapse. It returns
|
||||
// false if timeout occurs.
|
||||
func (process *Process) WaitTimeout(timeout time.Duration) (err error) {
|
||||
operation := "hcssshim::Process::WaitTimeout"
|
||||
process.logOperationBegin(operation)
|
||||
defer func() { process.logOperationEnd(operation, err) }()
|
||||
|
||||
err = waitForNotification(process.callbackNumber, hcsNotificationProcessExited, &timeout)
|
||||
if err != nil {
|
||||
return makeProcessError(process, operation, err, nil)
|
||||
}
|
||||
|
||||
return nil
|
||||
// Wait waits for the process to exit. If the process has already exited returns
|
||||
// the pervious error (if any).
|
||||
func (process *Process) Wait() error {
|
||||
<-process.waitBlock
|
||||
return process.waitError
|
||||
}
|
||||
|
||||
// ResizeConsole resizes the console of the process.
|
||||
func (process *Process) ResizeConsole(width, height uint16) (err error) {
|
||||
func (process *Process) ResizeConsole(ctx context.Context, width, height uint16) error {
|
||||
process.handleLock.RLock()
|
||||
defer process.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::Process::ResizeConsole"
|
||||
process.logOperationBegin(operation)
|
||||
defer func() { process.logOperationEnd(operation, err) }()
|
||||
|
||||
if process.handle == 0 {
|
||||
return makeProcessError(process, operation, ErrAlreadyClosed, nil)
|
||||
@@ -218,11 +250,8 @@ func (process *Process) ResizeConsole(width, height uint16) (err error) {
|
||||
return err
|
||||
}
|
||||
|
||||
modifyRequestStr := string(modifyRequestb)
|
||||
|
||||
var resultp *uint16
|
||||
err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp)
|
||||
events := processHcsResult(resultp)
|
||||
resultJSON, err := vmcompute.HcsModifyProcess(ctx, process.handle, string(modifyRequestb))
|
||||
events := processHcsResult(ctx, resultJSON)
|
||||
if err != nil {
|
||||
return makeProcessError(process, operation, err, events)
|
||||
}
|
||||
@@ -230,104 +259,55 @@ func (process *Process) ResizeConsole(width, height uint16) (err error) {
|
||||
return nil
|
||||
}
|
||||
|
||||
func (process *Process) Properties() (_ *ProcessStatus, err error) {
|
||||
process.handleLock.RLock()
|
||||
defer process.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::Process::Properties"
|
||||
process.logOperationBegin(operation)
|
||||
defer func() { process.logOperationEnd(operation, err) }()
|
||||
|
||||
if process.handle == 0 {
|
||||
return nil, makeProcessError(process, operation, ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
var (
|
||||
resultp *uint16
|
||||
propertiesp *uint16
|
||||
)
|
||||
syscallWatcher(process.logctx, func() {
|
||||
err = hcsGetProcessProperties(process.handle, &propertiesp, &resultp)
|
||||
})
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return nil, makeProcessError(process, operation, err, events)
|
||||
}
|
||||
|
||||
if propertiesp == nil {
|
||||
return nil, ErrUnexpectedValue
|
||||
}
|
||||
propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp)
|
||||
|
||||
properties := &ProcessStatus{}
|
||||
if err := json.Unmarshal(propertiesRaw, properties); err != nil {
|
||||
return nil, makeProcessError(process, operation, err, nil)
|
||||
}
|
||||
|
||||
return properties, nil
|
||||
}
|
||||
|
||||
// ExitCode returns the exit code of the process. The process must have
|
||||
// already terminated.
|
||||
func (process *Process) ExitCode() (_ int, err error) {
|
||||
operation := "hcsshim::Process::ExitCode"
|
||||
process.logOperationBegin(operation)
|
||||
defer func() { process.logOperationEnd(operation, err) }()
|
||||
|
||||
properties, err := process.Properties()
|
||||
if err != nil {
|
||||
return 0, makeProcessError(process, operation, err, nil)
|
||||
func (process *Process) ExitCode() (int, error) {
|
||||
select {
|
||||
case <-process.waitBlock:
|
||||
if process.waitError != nil {
|
||||
return -1, process.waitError
|
||||
}
|
||||
return process.exitCode, nil
|
||||
default:
|
||||
return -1, makeProcessError(process, "hcsshim::Process::ExitCode", ErrInvalidProcessState, nil)
|
||||
}
|
||||
|
||||
if properties.Exited == false {
|
||||
return 0, makeProcessError(process, operation, ErrInvalidProcessState, nil)
|
||||
}
|
||||
|
||||
if properties.LastWaitResult != 0 {
|
||||
return 0, makeProcessError(process, operation, syscall.Errno(properties.LastWaitResult), nil)
|
||||
}
|
||||
|
||||
return int(properties.ExitCode), nil
|
||||
}
|
||||
|
||||
// Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing
|
||||
// these pipes does not close the underlying pipes; it should be possible to
|
||||
// call this multiple times to get multiple interfaces.
|
||||
func (process *Process) Stdio() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadCloser, err error) {
|
||||
// StdioLegacy returns the stdin, stdout, and stderr pipes, respectively. Closing
|
||||
// these pipes does not close the underlying pipes. Once returned, these pipes
|
||||
// are the responsibility of the caller to close.
|
||||
func (process *Process) StdioLegacy() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadCloser, err error) {
|
||||
operation := "hcsshim::Process::StdioLegacy"
|
||||
ctx, span := trace.StartSpan(context.Background(), operation)
|
||||
defer span.End()
|
||||
defer func() { oc.SetSpanStatus(span, err) }()
|
||||
span.AddAttributes(
|
||||
trace.StringAttribute("cid", process.SystemID()),
|
||||
trace.Int64Attribute("pid", int64(process.processID)))
|
||||
|
||||
process.handleLock.RLock()
|
||||
defer process.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::Process::Stdio"
|
||||
process.logOperationBegin(operation)
|
||||
defer func() { process.logOperationEnd(operation, err) }()
|
||||
|
||||
if process.handle == 0 {
|
||||
return nil, nil, nil, makeProcessError(process, operation, ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
var stdIn, stdOut, stdErr syscall.Handle
|
||||
|
||||
if process.cachedPipes == nil {
|
||||
var (
|
||||
processInfo hcsProcessInformation
|
||||
resultp *uint16
|
||||
)
|
||||
err = hcsGetProcessInfo(process.handle, &processInfo, &resultp)
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return nil, nil, nil, makeProcessError(process, operation, err, events)
|
||||
}
|
||||
|
||||
stdIn, stdOut, stdErr = processInfo.StdInput, processInfo.StdOutput, processInfo.StdError
|
||||
} else {
|
||||
// Use cached pipes
|
||||
stdIn, stdOut, stdErr = process.cachedPipes.stdIn, process.cachedPipes.stdOut, process.cachedPipes.stdErr
|
||||
|
||||
// Invalidate the cache
|
||||
process.cachedPipes = nil
|
||||
process.stdioLock.Lock()
|
||||
defer process.stdioLock.Unlock()
|
||||
if process.hasCachedStdio {
|
||||
stdin, stdout, stderr := process.stdin, process.stdout, process.stderr
|
||||
process.stdin, process.stdout, process.stderr = nil, nil, nil
|
||||
process.hasCachedStdio = false
|
||||
return stdin, stdout, stderr, nil
|
||||
}
|
||||
|
||||
pipes, err := makeOpenFiles([]syscall.Handle{stdIn, stdOut, stdErr})
|
||||
processInfo, resultJSON, err := vmcompute.HcsGetProcessInfo(ctx, process.handle)
|
||||
events := processHcsResult(ctx, resultJSON)
|
||||
if err != nil {
|
||||
return nil, nil, nil, makeProcessError(process, operation, err, events)
|
||||
}
|
||||
|
||||
pipes, err := makeOpenFiles([]syscall.Handle{processInfo.StdInput, processInfo.StdOutput, processInfo.StdError})
|
||||
if err != nil {
|
||||
return nil, nil, nil, makeProcessError(process, operation, err, nil)
|
||||
}
|
||||
@@ -335,15 +315,21 @@ func (process *Process) Stdio() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadClo
|
||||
return pipes[0], pipes[1], pipes[2], nil
|
||||
}
|
||||
|
||||
// Stdio returns the stdin, stdout, and stderr pipes, respectively.
|
||||
// To close them, close the process handle.
|
||||
func (process *Process) Stdio() (stdin io.Writer, stdout, stderr io.Reader) {
|
||||
process.stdioLock.Lock()
|
||||
defer process.stdioLock.Unlock()
|
||||
return process.stdin, process.stdout, process.stderr
|
||||
}
|
||||
|
||||
// CloseStdin closes the write side of the stdin pipe so that the process is
|
||||
// notified on the read side that there is no more data in stdin.
|
||||
func (process *Process) CloseStdin() (err error) {
|
||||
func (process *Process) CloseStdin(ctx context.Context) error {
|
||||
process.handleLock.RLock()
|
||||
defer process.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::Process::CloseStdin"
|
||||
process.logOperationBegin(operation)
|
||||
defer func() { process.logOperationEnd(operation, err) }()
|
||||
|
||||
if process.handle == 0 {
|
||||
return makeProcessError(process, operation, ErrAlreadyClosed, nil)
|
||||
@@ -361,96 +347,125 @@ func (process *Process) CloseStdin() (err error) {
|
||||
return err
|
||||
}
|
||||
|
||||
modifyRequestStr := string(modifyRequestb)
|
||||
|
||||
var resultp *uint16
|
||||
err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp)
|
||||
events := processHcsResult(resultp)
|
||||
resultJSON, err := vmcompute.HcsModifyProcess(ctx, process.handle, string(modifyRequestb))
|
||||
events := processHcsResult(ctx, resultJSON)
|
||||
if err != nil {
|
||||
return makeProcessError(process, operation, err, events)
|
||||
}
|
||||
|
||||
process.stdioLock.Lock()
|
||||
if process.stdin != nil {
|
||||
process.stdin.Close()
|
||||
process.stdin = nil
|
||||
}
|
||||
process.stdioLock.Unlock()
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// Close cleans up any state associated with the process but does not kill
|
||||
// or wait on it.
|
||||
func (process *Process) Close() (err error) {
|
||||
operation := "hcsshim::Process::Close"
|
||||
ctx, span := trace.StartSpan(context.Background(), operation)
|
||||
defer span.End()
|
||||
defer func() { oc.SetSpanStatus(span, err) }()
|
||||
span.AddAttributes(
|
||||
trace.StringAttribute("cid", process.SystemID()),
|
||||
trace.Int64Attribute("pid", int64(process.processID)))
|
||||
|
||||
process.handleLock.Lock()
|
||||
defer process.handleLock.Unlock()
|
||||
|
||||
operation := "hcsshim::Process::Close"
|
||||
process.logOperationBegin(operation)
|
||||
defer func() { process.logOperationEnd(operation, err) }()
|
||||
|
||||
// Don't double free this
|
||||
if process.handle == 0 {
|
||||
return nil
|
||||
}
|
||||
|
||||
if err = process.unregisterCallback(); err != nil {
|
||||
process.stdioLock.Lock()
|
||||
if process.stdin != nil {
|
||||
process.stdin.Close()
|
||||
process.stdin = nil
|
||||
}
|
||||
if process.stdout != nil {
|
||||
process.stdout.Close()
|
||||
process.stdout = nil
|
||||
}
|
||||
if process.stderr != nil {
|
||||
process.stderr.Close()
|
||||
process.stderr = nil
|
||||
}
|
||||
process.stdioLock.Unlock()
|
||||
|
||||
if err = process.unregisterCallback(ctx); err != nil {
|
||||
return makeProcessError(process, operation, err, nil)
|
||||
}
|
||||
|
||||
if err = hcsCloseProcess(process.handle); err != nil {
|
||||
if err = vmcompute.HcsCloseProcess(ctx, process.handle); err != nil {
|
||||
return makeProcessError(process, operation, err, nil)
|
||||
}
|
||||
|
||||
process.handle = 0
|
||||
process.closedWaitOnce.Do(func() {
|
||||
process.exitCode = -1
|
||||
process.waitError = ErrAlreadyClosed
|
||||
close(process.waitBlock)
|
||||
})
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (process *Process) registerCallback() error {
|
||||
context := ¬ifcationWatcherContext{
|
||||
channels: newChannels(),
|
||||
func (process *Process) registerCallback(ctx context.Context) error {
|
||||
callbackContext := ¬ifcationWatcherContext{
|
||||
channels: newProcessChannels(),
|
||||
systemID: process.SystemID(),
|
||||
processID: process.processID,
|
||||
}
|
||||
|
||||
callbackMapLock.Lock()
|
||||
callbackNumber := nextCallback
|
||||
nextCallback++
|
||||
callbackMap[callbackNumber] = context
|
||||
callbackMap[callbackNumber] = callbackContext
|
||||
callbackMapLock.Unlock()
|
||||
|
||||
var callbackHandle hcsCallback
|
||||
err := hcsRegisterProcessCallback(process.handle, notificationWatcherCallback, callbackNumber, &callbackHandle)
|
||||
callbackHandle, err := vmcompute.HcsRegisterProcessCallback(ctx, process.handle, notificationWatcherCallback, callbackNumber)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
context.handle = callbackHandle
|
||||
callbackContext.handle = callbackHandle
|
||||
process.callbackNumber = callbackNumber
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (process *Process) unregisterCallback() error {
|
||||
func (process *Process) unregisterCallback(ctx context.Context) error {
|
||||
callbackNumber := process.callbackNumber
|
||||
|
||||
callbackMapLock.RLock()
|
||||
context := callbackMap[callbackNumber]
|
||||
callbackContext := callbackMap[callbackNumber]
|
||||
callbackMapLock.RUnlock()
|
||||
|
||||
if context == nil {
|
||||
if callbackContext == nil {
|
||||
return nil
|
||||
}
|
||||
|
||||
handle := context.handle
|
||||
handle := callbackContext.handle
|
||||
|
||||
if handle == 0 {
|
||||
return nil
|
||||
}
|
||||
|
||||
// hcsUnregisterProcessCallback has its own syncronization
|
||||
// to wait for all callbacks to complete. We must NOT hold the callbackMapLock.
|
||||
err := hcsUnregisterProcessCallback(handle)
|
||||
// vmcompute.HcsUnregisterProcessCallback has its own synchronization to
|
||||
// wait for all callbacks to complete. We must NOT hold the callbackMapLock.
|
||||
err := vmcompute.HcsUnregisterProcessCallback(ctx, handle)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
closeChannels(context.channels)
|
||||
closeChannels(callbackContext.channels)
|
||||
|
||||
callbackMapLock.Lock()
|
||||
callbackMap[callbackNumber] = nil
|
||||
delete(callbackMap, callbackNumber)
|
||||
callbackMapLock.Unlock()
|
||||
|
||||
handle = 0
|
||||
|
||||
5
vendor/github.com/Microsoft/hcsshim/internal/hcs/syscall.go
generated
vendored
Normal file
5
vendor/github.com/Microsoft/hcsshim/internal/hcs/syscall.go
generated
vendored
Normal file
@@ -0,0 +1,5 @@
|
||||
package hcs
|
||||
|
||||
//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go syscall.go
|
||||
|
||||
//sys hcsFormatWritableLayerVhd(handle uintptr) (hr error) = computestorage.HcsFormatWritableLayerVhd
|
||||
697
vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go
generated
vendored
697
vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go
generated
vendored
@@ -1,86 +1,56 @@
|
||||
package hcs
|
||||
|
||||
import (
|
||||
"context"
|
||||
"encoding/json"
|
||||
"os"
|
||||
"strconv"
|
||||
"errors"
|
||||
"strings"
|
||||
"sync"
|
||||
"syscall"
|
||||
"time"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/interop"
|
||||
"github.com/Microsoft/hcsshim/internal/logfields"
|
||||
"github.com/Microsoft/hcsshim/internal/cow"
|
||||
"github.com/Microsoft/hcsshim/internal/log"
|
||||
"github.com/Microsoft/hcsshim/internal/oc"
|
||||
"github.com/Microsoft/hcsshim/internal/schema1"
|
||||
hcsschema "github.com/Microsoft/hcsshim/internal/schema2"
|
||||
"github.com/Microsoft/hcsshim/internal/timeout"
|
||||
"github.com/sirupsen/logrus"
|
||||
"github.com/Microsoft/hcsshim/internal/vmcompute"
|
||||
"go.opencensus.io/trace"
|
||||
)
|
||||
|
||||
// currentContainerStarts is used to limit the number of concurrent container
|
||||
// starts.
|
||||
var currentContainerStarts containerStarts
|
||||
|
||||
type containerStarts struct {
|
||||
maxParallel int
|
||||
inProgress int
|
||||
sync.Mutex
|
||||
}
|
||||
|
||||
func init() {
|
||||
mpsS := os.Getenv("HCSSHIM_MAX_PARALLEL_START")
|
||||
if len(mpsS) > 0 {
|
||||
mpsI, err := strconv.Atoi(mpsS)
|
||||
if err != nil || mpsI < 0 {
|
||||
return
|
||||
}
|
||||
currentContainerStarts.maxParallel = mpsI
|
||||
}
|
||||
}
|
||||
|
||||
type System struct {
|
||||
handleLock sync.RWMutex
|
||||
handle hcsSystem
|
||||
handle vmcompute.HcsSystem
|
||||
id string
|
||||
callbackNumber uintptr
|
||||
|
||||
logctx logrus.Fields
|
||||
closedWaitOnce sync.Once
|
||||
waitBlock chan struct{}
|
||||
waitError error
|
||||
exitError error
|
||||
|
||||
os, typ string
|
||||
}
|
||||
|
||||
func newSystem(id string) *System {
|
||||
return &System{
|
||||
id: id,
|
||||
logctx: logrus.Fields{
|
||||
logfields.ContainerID: id,
|
||||
},
|
||||
id: id,
|
||||
waitBlock: make(chan struct{}),
|
||||
}
|
||||
}
|
||||
|
||||
func (computeSystem *System) logOperationBegin(operation string) {
|
||||
logOperationBegin(
|
||||
computeSystem.logctx,
|
||||
operation+" - Begin Operation")
|
||||
}
|
||||
|
||||
func (computeSystem *System) logOperationEnd(operation string, err error) {
|
||||
var result string
|
||||
if err == nil {
|
||||
result = "Success"
|
||||
} else {
|
||||
result = "Error"
|
||||
}
|
||||
|
||||
logOperationEnd(
|
||||
computeSystem.logctx,
|
||||
operation+" - End Operation - "+result,
|
||||
err)
|
||||
}
|
||||
|
||||
// CreateComputeSystem creates a new compute system with the given configuration but does not start it.
|
||||
func CreateComputeSystem(id string, hcsDocumentInterface interface{}) (_ *System, err error) {
|
||||
func CreateComputeSystem(ctx context.Context, id string, hcsDocumentInterface interface{}) (_ *System, err error) {
|
||||
operation := "hcsshim::CreateComputeSystem"
|
||||
|
||||
// hcsCreateComputeSystemContext is an async operation. Start the outer span
|
||||
// here to measure the full create time.
|
||||
ctx, span := trace.StartSpan(ctx, operation)
|
||||
defer span.End()
|
||||
defer func() { oc.SetSpanStatus(span, err) }()
|
||||
span.AddAttributes(trace.StringAttribute("cid", id))
|
||||
|
||||
computeSystem := newSystem(id)
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||
|
||||
hcsDocumentB, err := json.Marshal(hcsDocumentInterface)
|
||||
if err != nil {
|
||||
@@ -89,126 +59,114 @@ func CreateComputeSystem(id string, hcsDocumentInterface interface{}) (_ *System
|
||||
|
||||
hcsDocument := string(hcsDocumentB)
|
||||
|
||||
logrus.WithFields(computeSystem.logctx).
|
||||
WithField(logfields.JSON, hcsDocument).
|
||||
Debug("HCS ComputeSystem Document")
|
||||
|
||||
var (
|
||||
resultp *uint16
|
||||
identity syscall.Handle
|
||||
resultJSON string
|
||||
createError error
|
||||
)
|
||||
syscallWatcher(computeSystem.logctx, func() {
|
||||
createError = hcsCreateComputeSystem(id, hcsDocument, identity, &computeSystem.handle, &resultp)
|
||||
})
|
||||
|
||||
computeSystem.handle, resultJSON, createError = vmcompute.HcsCreateComputeSystem(ctx, id, hcsDocument, identity)
|
||||
if createError == nil || IsPending(createError) {
|
||||
if err = computeSystem.registerCallback(); err != nil {
|
||||
defer func() {
|
||||
if err != nil {
|
||||
computeSystem.Close()
|
||||
}
|
||||
}()
|
||||
if err = computeSystem.registerCallback(ctx); err != nil {
|
||||
// Terminate the compute system if it still exists. We're okay to
|
||||
// ignore a failure here.
|
||||
computeSystem.Terminate()
|
||||
computeSystem.Terminate(ctx)
|
||||
return nil, makeSystemError(computeSystem, operation, "", err, nil)
|
||||
}
|
||||
}
|
||||
|
||||
events, err := processAsyncHcsResult(createError, resultp, computeSystem.callbackNumber, hcsNotificationSystemCreateCompleted, &timeout.SystemCreate)
|
||||
events, err := processAsyncHcsResult(ctx, createError, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemCreateCompleted, &timeout.SystemCreate)
|
||||
if err != nil {
|
||||
if err == ErrTimeout {
|
||||
// Terminate the compute system if it still exists. We're okay to
|
||||
// ignore a failure here.
|
||||
computeSystem.Terminate()
|
||||
computeSystem.Terminate(ctx)
|
||||
}
|
||||
return nil, makeSystemError(computeSystem, operation, hcsDocument, err, events)
|
||||
}
|
||||
|
||||
go computeSystem.waitBackground()
|
||||
if err = computeSystem.getCachedProperties(ctx); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return computeSystem, nil
|
||||
}
|
||||
|
||||
// OpenComputeSystem opens an existing compute system by ID.
|
||||
func OpenComputeSystem(id string) (_ *System, err error) {
|
||||
func OpenComputeSystem(ctx context.Context, id string) (*System, error) {
|
||||
operation := "hcsshim::OpenComputeSystem"
|
||||
|
||||
computeSystem := newSystem(id)
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() {
|
||||
if IsNotExist(err) {
|
||||
computeSystem.logOperationEnd(operation, nil)
|
||||
} else {
|
||||
computeSystem.logOperationEnd(operation, err)
|
||||
}
|
||||
}()
|
||||
|
||||
var (
|
||||
handle hcsSystem
|
||||
resultp *uint16
|
||||
)
|
||||
err = hcsOpenComputeSystem(id, &handle, &resultp)
|
||||
events := processHcsResult(resultp)
|
||||
handle, resultJSON, err := vmcompute.HcsOpenComputeSystem(ctx, id)
|
||||
events := processHcsResult(ctx, resultJSON)
|
||||
if err != nil {
|
||||
return nil, makeSystemError(computeSystem, operation, "", err, events)
|
||||
}
|
||||
|
||||
computeSystem.handle = handle
|
||||
|
||||
if err = computeSystem.registerCallback(); err != nil {
|
||||
defer func() {
|
||||
if err != nil {
|
||||
computeSystem.Close()
|
||||
}
|
||||
}()
|
||||
if err = computeSystem.registerCallback(ctx); err != nil {
|
||||
return nil, makeSystemError(computeSystem, operation, "", err, nil)
|
||||
}
|
||||
|
||||
go computeSystem.waitBackground()
|
||||
if err = computeSystem.getCachedProperties(ctx); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return computeSystem, nil
|
||||
}
|
||||
|
||||
func (computeSystem *System) getCachedProperties(ctx context.Context) error {
|
||||
props, err := computeSystem.Properties(ctx)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
computeSystem.typ = strings.ToLower(props.SystemType)
|
||||
computeSystem.os = strings.ToLower(props.RuntimeOSType)
|
||||
if computeSystem.os == "" && computeSystem.typ == "container" {
|
||||
// Pre-RS5 HCS did not return the OS, but it only supported containers
|
||||
// that ran Windows.
|
||||
computeSystem.os = "windows"
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// OS returns the operating system of the compute system, "linux" or "windows".
|
||||
func (computeSystem *System) OS() string {
|
||||
return computeSystem.os
|
||||
}
|
||||
|
||||
// IsOCI returns whether processes in the compute system should be created via
|
||||
// OCI.
|
||||
func (computeSystem *System) IsOCI() bool {
|
||||
return computeSystem.os == "linux" && computeSystem.typ == "container"
|
||||
}
|
||||
|
||||
// GetComputeSystems gets a list of the compute systems on the system that match the query
|
||||
func GetComputeSystems(q schema1.ComputeSystemQuery) (_ []schema1.ContainerProperties, err error) {
|
||||
func GetComputeSystems(ctx context.Context, q schema1.ComputeSystemQuery) ([]schema1.ContainerProperties, error) {
|
||||
operation := "hcsshim::GetComputeSystems"
|
||||
fields := logrus.Fields{}
|
||||
logOperationBegin(
|
||||
fields,
|
||||
operation+" - Begin Operation")
|
||||
|
||||
defer func() {
|
||||
var result string
|
||||
if err == nil {
|
||||
result = "Success"
|
||||
} else {
|
||||
result = "Error"
|
||||
}
|
||||
|
||||
logOperationEnd(
|
||||
fields,
|
||||
operation+" - End Operation - "+result,
|
||||
err)
|
||||
}()
|
||||
|
||||
queryb, err := json.Marshal(q)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
query := string(queryb)
|
||||
|
||||
logrus.WithFields(fields).
|
||||
WithField(logfields.JSON, query).
|
||||
Debug("HCS ComputeSystem Query")
|
||||
|
||||
var (
|
||||
resultp *uint16
|
||||
computeSystemsp *uint16
|
||||
)
|
||||
|
||||
syscallWatcher(fields, func() {
|
||||
err = hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp)
|
||||
})
|
||||
events := processHcsResult(resultp)
|
||||
computeSystemsJSON, resultJSON, err := vmcompute.HcsEnumerateComputeSystems(ctx, string(queryb))
|
||||
events := processHcsResult(ctx, resultJSON)
|
||||
if err != nil {
|
||||
return nil, &HcsError{Op: operation, Err: err, Events: events}
|
||||
}
|
||||
|
||||
if computeSystemsp == nil {
|
||||
if computeSystemsJSON == "" {
|
||||
return nil, ErrUnexpectedValue
|
||||
}
|
||||
computeSystemsRaw := interop.ConvertAndFreeCoTaskMemBytes(computeSystemsp)
|
||||
computeSystems := []schema1.ContainerProperties{}
|
||||
if err = json.Unmarshal(computeSystemsRaw, &computeSystems); err != nil {
|
||||
if err = json.Unmarshal([]byte(computeSystemsJSON), &computeSystems); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
@@ -216,51 +174,27 @@ func GetComputeSystems(q schema1.ComputeSystemQuery) (_ []schema1.ContainerPrope
|
||||
}
|
||||
|
||||
// Start synchronously starts the computeSystem.
|
||||
func (computeSystem *System) Start() (err error) {
|
||||
func (computeSystem *System) Start(ctx context.Context) (err error) {
|
||||
operation := "hcsshim::System::Start"
|
||||
|
||||
// hcsStartComputeSystemContext is an async operation. Start the outer span
|
||||
// here to measure the full start time.
|
||||
ctx, span := trace.StartSpan(ctx, operation)
|
||||
defer span.End()
|
||||
defer func() { oc.SetSpanStatus(span, err) }()
|
||||
span.AddAttributes(trace.StringAttribute("cid", computeSystem.id))
|
||||
|
||||
computeSystem.handleLock.RLock()
|
||||
defer computeSystem.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::ComputeSystem::Start"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||
|
||||
if computeSystem.handle == 0 {
|
||||
return makeSystemError(computeSystem, "Start", "", ErrAlreadyClosed, nil)
|
||||
return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
// This is a very simple backoff-retry loop to limit the number
|
||||
// of parallel container starts if environment variable
|
||||
// HCSSHIM_MAX_PARALLEL_START is set to a positive integer.
|
||||
// It should generally only be used as a workaround to various
|
||||
// platform issues that exist between RS1 and RS4 as of Aug 2018
|
||||
if currentContainerStarts.maxParallel > 0 {
|
||||
for {
|
||||
currentContainerStarts.Lock()
|
||||
if currentContainerStarts.inProgress < currentContainerStarts.maxParallel {
|
||||
currentContainerStarts.inProgress++
|
||||
currentContainerStarts.Unlock()
|
||||
break
|
||||
}
|
||||
if currentContainerStarts.inProgress == currentContainerStarts.maxParallel {
|
||||
currentContainerStarts.Unlock()
|
||||
time.Sleep(100 * time.Millisecond)
|
||||
}
|
||||
}
|
||||
// Make sure we decrement the count when we are done.
|
||||
defer func() {
|
||||
currentContainerStarts.Lock()
|
||||
currentContainerStarts.inProgress--
|
||||
currentContainerStarts.Unlock()
|
||||
}()
|
||||
}
|
||||
|
||||
var resultp *uint16
|
||||
syscallWatcher(computeSystem.logctx, func() {
|
||||
err = hcsStartComputeSystem(computeSystem.handle, "", &resultp)
|
||||
})
|
||||
events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemStartCompleted, &timeout.SystemStart)
|
||||
resultJSON, err := vmcompute.HcsStartComputeSystem(ctx, computeSystem.handle, "")
|
||||
events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemStartCompleted, &timeout.SystemStart)
|
||||
if err != nil {
|
||||
return makeSystemError(computeSystem, "Start", "", err, events)
|
||||
return makeSystemError(computeSystem, operation, "", err, events)
|
||||
}
|
||||
|
||||
return nil
|
||||
@@ -271,360 +205,357 @@ func (computeSystem *System) ID() string {
|
||||
return computeSystem.id
|
||||
}
|
||||
|
||||
// Shutdown requests a compute system shutdown, if IsPending() on the error returned is true,
|
||||
// it may not actually be shut down until Wait() succeeds.
|
||||
func (computeSystem *System) Shutdown() (err error) {
|
||||
// Shutdown requests a compute system shutdown.
|
||||
func (computeSystem *System) Shutdown(ctx context.Context) error {
|
||||
computeSystem.handleLock.RLock()
|
||||
defer computeSystem.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::ComputeSystem::Shutdown"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() {
|
||||
if IsAlreadyStopped(err) {
|
||||
computeSystem.logOperationEnd(operation, nil)
|
||||
} else {
|
||||
computeSystem.logOperationEnd(operation, err)
|
||||
}
|
||||
}()
|
||||
operation := "hcsshim::System::Shutdown"
|
||||
|
||||
if computeSystem.handle == 0 {
|
||||
return makeSystemError(computeSystem, "Shutdown", "", ErrAlreadyClosed, nil)
|
||||
return nil
|
||||
}
|
||||
|
||||
var resultp *uint16
|
||||
syscallWatcher(computeSystem.logctx, func() {
|
||||
err = hcsShutdownComputeSystem(computeSystem.handle, "", &resultp)
|
||||
})
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return makeSystemError(computeSystem, "Shutdown", "", err, events)
|
||||
resultJSON, err := vmcompute.HcsShutdownComputeSystem(ctx, computeSystem.handle, "")
|
||||
events := processHcsResult(ctx, resultJSON)
|
||||
switch err {
|
||||
case nil, ErrVmcomputeAlreadyStopped, ErrComputeSystemDoesNotExist, ErrVmcomputeOperationPending:
|
||||
default:
|
||||
return makeSystemError(computeSystem, operation, "", err, events)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// Terminate requests a compute system terminate, if IsPending() on the error returned is true,
|
||||
// it may not actually be shut down until Wait() succeeds.
|
||||
func (computeSystem *System) Terminate() (err error) {
|
||||
// Terminate requests a compute system terminate.
|
||||
func (computeSystem *System) Terminate(ctx context.Context) error {
|
||||
computeSystem.handleLock.RLock()
|
||||
defer computeSystem.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::ComputeSystem::Terminate"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() {
|
||||
if IsPending(err) {
|
||||
computeSystem.logOperationEnd(operation, nil)
|
||||
} else {
|
||||
computeSystem.logOperationEnd(operation, err)
|
||||
}
|
||||
}()
|
||||
operation := "hcsshim::System::Terminate"
|
||||
|
||||
if computeSystem.handle == 0 {
|
||||
return makeSystemError(computeSystem, "Terminate", "", ErrAlreadyClosed, nil)
|
||||
return nil
|
||||
}
|
||||
|
||||
var resultp *uint16
|
||||
syscallWatcher(computeSystem.logctx, func() {
|
||||
err = hcsTerminateComputeSystem(computeSystem.handle, "", &resultp)
|
||||
resultJSON, err := vmcompute.HcsTerminateComputeSystem(ctx, computeSystem.handle, "")
|
||||
events := processHcsResult(ctx, resultJSON)
|
||||
switch err {
|
||||
case nil, ErrVmcomputeAlreadyStopped, ErrComputeSystemDoesNotExist, ErrVmcomputeOperationPending:
|
||||
default:
|
||||
return makeSystemError(computeSystem, operation, "", err, events)
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// waitBackground waits for the compute system exit notification. Once received
|
||||
// sets `computeSystem.waitError` (if any) and unblocks all `Wait` calls.
|
||||
//
|
||||
// This MUST be called exactly once per `computeSystem.handle` but `Wait` is
|
||||
// safe to call multiple times.
|
||||
func (computeSystem *System) waitBackground() {
|
||||
operation := "hcsshim::System::waitBackground"
|
||||
ctx, span := trace.StartSpan(context.Background(), operation)
|
||||
defer span.End()
|
||||
span.AddAttributes(trace.StringAttribute("cid", computeSystem.id))
|
||||
|
||||
err := waitForNotification(ctx, computeSystem.callbackNumber, hcsNotificationSystemExited, nil)
|
||||
switch err {
|
||||
case nil:
|
||||
log.G(ctx).Debug("system exited")
|
||||
case ErrVmcomputeUnexpectedExit:
|
||||
log.G(ctx).Debug("unexpected system exit")
|
||||
computeSystem.exitError = makeSystemError(computeSystem, operation, "", err, nil)
|
||||
err = nil
|
||||
default:
|
||||
err = makeSystemError(computeSystem, operation, "", err, nil)
|
||||
}
|
||||
computeSystem.closedWaitOnce.Do(func() {
|
||||
computeSystem.waitError = err
|
||||
close(computeSystem.waitBlock)
|
||||
})
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil && err != ErrVmcomputeAlreadyStopped {
|
||||
return makeSystemError(computeSystem, "Terminate", "", err, events)
|
||||
}
|
||||
|
||||
return nil
|
||||
oc.SetSpanStatus(span, err)
|
||||
}
|
||||
|
||||
// Wait synchronously waits for the compute system to shutdown or terminate.
|
||||
func (computeSystem *System) Wait() (err error) {
|
||||
operation := "hcsshim::ComputeSystem::Wait"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||
|
||||
err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, nil)
|
||||
if err != nil {
|
||||
return makeSystemError(computeSystem, "Wait", "", err, nil)
|
||||
}
|
||||
|
||||
return nil
|
||||
// Wait synchronously waits for the compute system to shutdown or terminate. If
|
||||
// the compute system has already exited returns the previous error (if any).
|
||||
func (computeSystem *System) Wait() error {
|
||||
<-computeSystem.waitBlock
|
||||
return computeSystem.waitError
|
||||
}
|
||||
|
||||
// WaitExpectedError synchronously waits for the compute system to shutdown or
|
||||
// terminate, and ignores the passed error if it occurs.
|
||||
func (computeSystem *System) WaitExpectedError(expected error) (err error) {
|
||||
operation := "hcsshim::ComputeSystem::WaitExpectedError"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||
|
||||
err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, nil)
|
||||
if err != nil && getInnerError(err) != expected {
|
||||
return makeSystemError(computeSystem, "WaitExpectedError", "", err, nil)
|
||||
// ExitError returns an error describing the reason the compute system terminated.
|
||||
func (computeSystem *System) ExitError() error {
|
||||
select {
|
||||
case <-computeSystem.waitBlock:
|
||||
if computeSystem.waitError != nil {
|
||||
return computeSystem.waitError
|
||||
}
|
||||
return computeSystem.exitError
|
||||
default:
|
||||
return errors.New("container not exited")
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// WaitTimeout synchronously waits for the compute system to terminate or the duration to elapse.
|
||||
// If the timeout expires, IsTimeout(err) == true
|
||||
func (computeSystem *System) WaitTimeout(timeout time.Duration) (err error) {
|
||||
operation := "hcsshim::ComputeSystem::WaitTimeout"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||
|
||||
err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, &timeout)
|
||||
if err != nil {
|
||||
return makeSystemError(computeSystem, "WaitTimeout", "", err, nil)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (computeSystem *System) Properties(types ...schema1.PropertyType) (_ *schema1.ContainerProperties, err error) {
|
||||
// Properties returns the requested container properties targeting a V1 schema container.
|
||||
func (computeSystem *System) Properties(ctx context.Context, types ...schema1.PropertyType) (*schema1.ContainerProperties, error) {
|
||||
computeSystem.handleLock.RLock()
|
||||
defer computeSystem.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::ComputeSystem::Properties"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||
operation := "hcsshim::System::Properties"
|
||||
|
||||
queryj, err := json.Marshal(schema1.PropertyQuery{types})
|
||||
queryBytes, err := json.Marshal(schema1.PropertyQuery{PropertyTypes: types})
|
||||
if err != nil {
|
||||
return nil, makeSystemError(computeSystem, "Properties", "", err, nil)
|
||||
return nil, makeSystemError(computeSystem, operation, "", err, nil)
|
||||
}
|
||||
|
||||
logrus.WithFields(computeSystem.logctx).
|
||||
WithField(logfields.JSON, queryj).
|
||||
Debug("HCS ComputeSystem Properties Query")
|
||||
|
||||
var resultp, propertiesp *uint16
|
||||
syscallWatcher(computeSystem.logctx, func() {
|
||||
err = hcsGetComputeSystemProperties(computeSystem.handle, string(queryj), &propertiesp, &resultp)
|
||||
})
|
||||
events := processHcsResult(resultp)
|
||||
propertiesJSON, resultJSON, err := vmcompute.HcsGetComputeSystemProperties(ctx, computeSystem.handle, string(queryBytes))
|
||||
events := processHcsResult(ctx, resultJSON)
|
||||
if err != nil {
|
||||
return nil, makeSystemError(computeSystem, "Properties", "", err, events)
|
||||
return nil, makeSystemError(computeSystem, operation, "", err, events)
|
||||
}
|
||||
|
||||
if propertiesp == nil {
|
||||
if propertiesJSON == "" {
|
||||
return nil, ErrUnexpectedValue
|
||||
}
|
||||
propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp)
|
||||
properties := &schema1.ContainerProperties{}
|
||||
if err := json.Unmarshal(propertiesRaw, properties); err != nil {
|
||||
return nil, makeSystemError(computeSystem, "Properties", "", err, nil)
|
||||
if err := json.Unmarshal([]byte(propertiesJSON), properties); err != nil {
|
||||
return nil, makeSystemError(computeSystem, operation, "", err, nil)
|
||||
}
|
||||
|
||||
return properties, nil
|
||||
}
|
||||
|
||||
// PropertiesV2 returns the requested container properties targeting a V2 schema container.
|
||||
func (computeSystem *System) PropertiesV2(ctx context.Context, types ...hcsschema.PropertyType) (*hcsschema.Properties, error) {
|
||||
computeSystem.handleLock.RLock()
|
||||
defer computeSystem.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::System::PropertiesV2"
|
||||
|
||||
queryBytes, err := json.Marshal(hcsschema.PropertyQuery{PropertyTypes: types})
|
||||
if err != nil {
|
||||
return nil, makeSystemError(computeSystem, operation, "", err, nil)
|
||||
}
|
||||
|
||||
propertiesJSON, resultJSON, err := vmcompute.HcsGetComputeSystemProperties(ctx, computeSystem.handle, string(queryBytes))
|
||||
events := processHcsResult(ctx, resultJSON)
|
||||
if err != nil {
|
||||
return nil, makeSystemError(computeSystem, operation, "", err, events)
|
||||
}
|
||||
|
||||
if propertiesJSON == "" {
|
||||
return nil, ErrUnexpectedValue
|
||||
}
|
||||
properties := &hcsschema.Properties{}
|
||||
if err := json.Unmarshal([]byte(propertiesJSON), properties); err != nil {
|
||||
return nil, makeSystemError(computeSystem, operation, "", err, nil)
|
||||
}
|
||||
|
||||
return properties, nil
|
||||
}
|
||||
|
||||
// Pause pauses the execution of the computeSystem. This feature is not enabled in TP5.
|
||||
func (computeSystem *System) Pause() (err error) {
|
||||
func (computeSystem *System) Pause(ctx context.Context) (err error) {
|
||||
operation := "hcsshim::System::Pause"
|
||||
|
||||
// hcsPauseComputeSystemContext is an async peration. Start the outer span
|
||||
// here to measure the full pause time.
|
||||
ctx, span := trace.StartSpan(ctx, operation)
|
||||
defer span.End()
|
||||
defer func() { oc.SetSpanStatus(span, err) }()
|
||||
span.AddAttributes(trace.StringAttribute("cid", computeSystem.id))
|
||||
|
||||
computeSystem.handleLock.RLock()
|
||||
defer computeSystem.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::ComputeSystem::Pause"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||
|
||||
if computeSystem.handle == 0 {
|
||||
return makeSystemError(computeSystem, "Pause", "", ErrAlreadyClosed, nil)
|
||||
return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
var resultp *uint16
|
||||
syscallWatcher(computeSystem.logctx, func() {
|
||||
err = hcsPauseComputeSystem(computeSystem.handle, "", &resultp)
|
||||
})
|
||||
events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemPauseCompleted, &timeout.SystemPause)
|
||||
resultJSON, err := vmcompute.HcsPauseComputeSystem(ctx, computeSystem.handle, "")
|
||||
events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemPauseCompleted, &timeout.SystemPause)
|
||||
if err != nil {
|
||||
return makeSystemError(computeSystem, "Pause", "", err, events)
|
||||
return makeSystemError(computeSystem, operation, "", err, events)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// Resume resumes the execution of the computeSystem. This feature is not enabled in TP5.
|
||||
func (computeSystem *System) Resume() (err error) {
|
||||
func (computeSystem *System) Resume(ctx context.Context) (err error) {
|
||||
operation := "hcsshim::System::Resume"
|
||||
|
||||
// hcsResumeComputeSystemContext is an async operation. Start the outer span
|
||||
// here to measure the full restore time.
|
||||
ctx, span := trace.StartSpan(ctx, operation)
|
||||
defer span.End()
|
||||
defer func() { oc.SetSpanStatus(span, err) }()
|
||||
span.AddAttributes(trace.StringAttribute("cid", computeSystem.id))
|
||||
|
||||
computeSystem.handleLock.RLock()
|
||||
defer computeSystem.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::ComputeSystem::Resume"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||
|
||||
if computeSystem.handle == 0 {
|
||||
return makeSystemError(computeSystem, "Resume", "", ErrAlreadyClosed, nil)
|
||||
return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
var resultp *uint16
|
||||
syscallWatcher(computeSystem.logctx, func() {
|
||||
err = hcsResumeComputeSystem(computeSystem.handle, "", &resultp)
|
||||
})
|
||||
events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemResumeCompleted, &timeout.SystemResume)
|
||||
resultJSON, err := vmcompute.HcsResumeComputeSystem(ctx, computeSystem.handle, "")
|
||||
events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemResumeCompleted, &timeout.SystemResume)
|
||||
if err != nil {
|
||||
return makeSystemError(computeSystem, "Resume", "", err, events)
|
||||
return makeSystemError(computeSystem, operation, "", err, events)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// CreateProcess launches a new process within the computeSystem.
|
||||
func (computeSystem *System) CreateProcess(c interface{}) (_ *Process, err error) {
|
||||
func (computeSystem *System) createProcess(ctx context.Context, operation string, c interface{}) (*Process, *vmcompute.HcsProcessInformation, error) {
|
||||
computeSystem.handleLock.RLock()
|
||||
defer computeSystem.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::ComputeSystem::CreateProcess"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||
|
||||
var (
|
||||
processInfo hcsProcessInformation
|
||||
processHandle hcsProcess
|
||||
resultp *uint16
|
||||
)
|
||||
|
||||
if computeSystem.handle == 0 {
|
||||
return nil, makeSystemError(computeSystem, "CreateProcess", "", ErrAlreadyClosed, nil)
|
||||
return nil, nil, makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
configurationb, err := json.Marshal(c)
|
||||
if err != nil {
|
||||
return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil)
|
||||
return nil, nil, makeSystemError(computeSystem, operation, "", err, nil)
|
||||
}
|
||||
|
||||
configuration := string(configurationb)
|
||||
|
||||
logrus.WithFields(computeSystem.logctx).
|
||||
WithField(logfields.JSON, configuration).
|
||||
Debug("HCS ComputeSystem Process Document")
|
||||
|
||||
syscallWatcher(computeSystem.logctx, func() {
|
||||
err = hcsCreateProcess(computeSystem.handle, configuration, &processInfo, &processHandle, &resultp)
|
||||
})
|
||||
events := processHcsResult(resultp)
|
||||
processInfo, processHandle, resultJSON, err := vmcompute.HcsCreateProcess(ctx, computeSystem.handle, configuration)
|
||||
events := processHcsResult(ctx, resultJSON)
|
||||
if err != nil {
|
||||
return nil, makeSystemError(computeSystem, "CreateProcess", configuration, err, events)
|
||||
return nil, nil, makeSystemError(computeSystem, operation, configuration, err, events)
|
||||
}
|
||||
|
||||
logrus.WithFields(computeSystem.logctx).
|
||||
WithField(logfields.ProcessID, processInfo.ProcessId).
|
||||
Debug("HCS ComputeSystem CreateProcess PID")
|
||||
log.G(ctx).WithField("pid", processInfo.ProcessId).Debug("created process pid")
|
||||
return newProcess(processHandle, int(processInfo.ProcessId), computeSystem), &processInfo, nil
|
||||
}
|
||||
|
||||
process := newProcess(processHandle, int(processInfo.ProcessId), computeSystem)
|
||||
process.cachedPipes = &cachedPipes{
|
||||
stdIn: processInfo.StdInput,
|
||||
stdOut: processInfo.StdOutput,
|
||||
stdErr: processInfo.StdError,
|
||||
// CreateProcess launches a new process within the computeSystem.
|
||||
func (computeSystem *System) CreateProcess(ctx context.Context, c interface{}) (cow.Process, error) {
|
||||
operation := "hcsshim::System::CreateProcess"
|
||||
process, processInfo, err := computeSystem.createProcess(ctx, operation, c)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
defer func() {
|
||||
if err != nil {
|
||||
process.Close()
|
||||
}
|
||||
}()
|
||||
|
||||
if err = process.registerCallback(); err != nil {
|
||||
return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil)
|
||||
pipes, err := makeOpenFiles([]syscall.Handle{processInfo.StdInput, processInfo.StdOutput, processInfo.StdError})
|
||||
if err != nil {
|
||||
return nil, makeSystemError(computeSystem, operation, "", err, nil)
|
||||
}
|
||||
process.stdin = pipes[0]
|
||||
process.stdout = pipes[1]
|
||||
process.stderr = pipes[2]
|
||||
process.hasCachedStdio = true
|
||||
|
||||
if err = process.registerCallback(ctx); err != nil {
|
||||
return nil, makeSystemError(computeSystem, operation, "", err, nil)
|
||||
}
|
||||
go process.waitBackground()
|
||||
|
||||
return process, nil
|
||||
}
|
||||
|
||||
// OpenProcess gets an interface to an existing process within the computeSystem.
|
||||
func (computeSystem *System) OpenProcess(pid int) (_ *Process, err error) {
|
||||
func (computeSystem *System) OpenProcess(ctx context.Context, pid int) (*Process, error) {
|
||||
computeSystem.handleLock.RLock()
|
||||
defer computeSystem.handleLock.RUnlock()
|
||||
|
||||
// Add PID for the context of this operation
|
||||
computeSystem.logctx[logfields.ProcessID] = pid
|
||||
defer delete(computeSystem.logctx, logfields.ProcessID)
|
||||
|
||||
operation := "hcsshim::ComputeSystem::OpenProcess"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||
|
||||
var (
|
||||
processHandle hcsProcess
|
||||
resultp *uint16
|
||||
)
|
||||
operation := "hcsshim::System::OpenProcess"
|
||||
|
||||
if computeSystem.handle == 0 {
|
||||
return nil, makeSystemError(computeSystem, "OpenProcess", "", ErrAlreadyClosed, nil)
|
||||
return nil, makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
syscallWatcher(computeSystem.logctx, func() {
|
||||
err = hcsOpenProcess(computeSystem.handle, uint32(pid), &processHandle, &resultp)
|
||||
})
|
||||
events := processHcsResult(resultp)
|
||||
processHandle, resultJSON, err := vmcompute.HcsOpenProcess(ctx, computeSystem.handle, uint32(pid))
|
||||
events := processHcsResult(ctx, resultJSON)
|
||||
if err != nil {
|
||||
return nil, makeSystemError(computeSystem, "OpenProcess", "", err, events)
|
||||
return nil, makeSystemError(computeSystem, operation, "", err, events)
|
||||
}
|
||||
|
||||
process := newProcess(processHandle, pid, computeSystem)
|
||||
if err = process.registerCallback(); err != nil {
|
||||
return nil, makeSystemError(computeSystem, "OpenProcess", "", err, nil)
|
||||
if err = process.registerCallback(ctx); err != nil {
|
||||
return nil, makeSystemError(computeSystem, operation, "", err, nil)
|
||||
}
|
||||
go process.waitBackground()
|
||||
|
||||
return process, nil
|
||||
}
|
||||
|
||||
// Close cleans up any state associated with the compute system but does not terminate or wait for it.
|
||||
func (computeSystem *System) Close() (err error) {
|
||||
operation := "hcsshim::System::Close"
|
||||
ctx, span := trace.StartSpan(context.Background(), operation)
|
||||
defer span.End()
|
||||
defer func() { oc.SetSpanStatus(span, err) }()
|
||||
span.AddAttributes(trace.StringAttribute("cid", computeSystem.id))
|
||||
|
||||
computeSystem.handleLock.Lock()
|
||||
defer computeSystem.handleLock.Unlock()
|
||||
|
||||
operation := "hcsshim::ComputeSystem::Close"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||
|
||||
// Don't double free this
|
||||
if computeSystem.handle == 0 {
|
||||
return nil
|
||||
}
|
||||
|
||||
if err = computeSystem.unregisterCallback(); err != nil {
|
||||
return makeSystemError(computeSystem, "Close", "", err, nil)
|
||||
if err = computeSystem.unregisterCallback(ctx); err != nil {
|
||||
return makeSystemError(computeSystem, operation, "", err, nil)
|
||||
}
|
||||
|
||||
syscallWatcher(computeSystem.logctx, func() {
|
||||
err = hcsCloseComputeSystem(computeSystem.handle)
|
||||
})
|
||||
err = vmcompute.HcsCloseComputeSystem(ctx, computeSystem.handle)
|
||||
if err != nil {
|
||||
return makeSystemError(computeSystem, "Close", "", err, nil)
|
||||
return makeSystemError(computeSystem, operation, "", err, nil)
|
||||
}
|
||||
|
||||
computeSystem.handle = 0
|
||||
computeSystem.closedWaitOnce.Do(func() {
|
||||
computeSystem.waitError = ErrAlreadyClosed
|
||||
close(computeSystem.waitBlock)
|
||||
})
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (computeSystem *System) registerCallback() error {
|
||||
context := ¬ifcationWatcherContext{
|
||||
channels: newChannels(),
|
||||
func (computeSystem *System) registerCallback(ctx context.Context) error {
|
||||
callbackContext := ¬ifcationWatcherContext{
|
||||
channels: newSystemChannels(),
|
||||
systemID: computeSystem.id,
|
||||
}
|
||||
|
||||
callbackMapLock.Lock()
|
||||
callbackNumber := nextCallback
|
||||
nextCallback++
|
||||
callbackMap[callbackNumber] = context
|
||||
callbackMap[callbackNumber] = callbackContext
|
||||
callbackMapLock.Unlock()
|
||||
|
||||
var callbackHandle hcsCallback
|
||||
err := hcsRegisterComputeSystemCallback(computeSystem.handle, notificationWatcherCallback, callbackNumber, &callbackHandle)
|
||||
callbackHandle, err := vmcompute.HcsRegisterComputeSystemCallback(ctx, computeSystem.handle, notificationWatcherCallback, callbackNumber)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
context.handle = callbackHandle
|
||||
callbackContext.handle = callbackHandle
|
||||
computeSystem.callbackNumber = callbackNumber
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (computeSystem *System) unregisterCallback() error {
|
||||
func (computeSystem *System) unregisterCallback(ctx context.Context) error {
|
||||
callbackNumber := computeSystem.callbackNumber
|
||||
|
||||
callbackMapLock.RLock()
|
||||
context := callbackMap[callbackNumber]
|
||||
callbackContext := callbackMap[callbackNumber]
|
||||
callbackMapLock.RUnlock()
|
||||
|
||||
if context == nil {
|
||||
if callbackContext == nil {
|
||||
return nil
|
||||
}
|
||||
|
||||
handle := context.handle
|
||||
handle := callbackContext.handle
|
||||
|
||||
if handle == 0 {
|
||||
return nil
|
||||
@@ -632,15 +563,15 @@ func (computeSystem *System) unregisterCallback() error {
|
||||
|
||||
// hcsUnregisterComputeSystemCallback has its own syncronization
|
||||
// to wait for all callbacks to complete. We must NOT hold the callbackMapLock.
|
||||
err := hcsUnregisterComputeSystemCallback(handle)
|
||||
err := vmcompute.HcsUnregisterComputeSystemCallback(ctx, handle)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
closeChannels(context.channels)
|
||||
closeChannels(callbackContext.channels)
|
||||
|
||||
callbackMapLock.Lock()
|
||||
callbackMap[callbackNumber] = nil
|
||||
delete(callbackMap, callbackNumber)
|
||||
callbackMapLock.Unlock()
|
||||
|
||||
handle = 0
|
||||
@@ -649,36 +580,26 @@ func (computeSystem *System) unregisterCallback() error {
|
||||
}
|
||||
|
||||
// Modify the System by sending a request to HCS
|
||||
func (computeSystem *System) Modify(config interface{}) (err error) {
|
||||
func (computeSystem *System) Modify(ctx context.Context, config interface{}) error {
|
||||
computeSystem.handleLock.RLock()
|
||||
defer computeSystem.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::ComputeSystem::Modify"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||
operation := "hcsshim::System::Modify"
|
||||
|
||||
if computeSystem.handle == 0 {
|
||||
return makeSystemError(computeSystem, "Modify", "", ErrAlreadyClosed, nil)
|
||||
return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
requestJSON, err := json.Marshal(config)
|
||||
requestBytes, err := json.Marshal(config)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
requestString := string(requestJSON)
|
||||
|
||||
logrus.WithFields(computeSystem.logctx).
|
||||
WithField(logfields.JSON, requestString).
|
||||
Debug("HCS ComputeSystem Modify Document")
|
||||
|
||||
var resultp *uint16
|
||||
syscallWatcher(computeSystem.logctx, func() {
|
||||
err = hcsModifyComputeSystem(computeSystem.handle, requestString, &resultp)
|
||||
})
|
||||
events := processHcsResult(resultp)
|
||||
requestJSON := string(requestBytes)
|
||||
resultJSON, err := vmcompute.HcsModifyComputeSystem(ctx, computeSystem.handle, requestJSON)
|
||||
events := processHcsResult(ctx, resultJSON)
|
||||
if err != nil {
|
||||
return makeSystemError(computeSystem, "Modify", requestString, err, events)
|
||||
return makeSystemError(computeSystem, operation, requestJSON, err, events)
|
||||
}
|
||||
|
||||
return nil
|
||||
|
||||
28
vendor/github.com/Microsoft/hcsshim/internal/hcs/utils.go
generated
vendored
28
vendor/github.com/Microsoft/hcsshim/internal/hcs/utils.go
generated
vendored
@@ -1,10 +1,14 @@
|
||||
package hcs
|
||||
|
||||
import (
|
||||
"context"
|
||||
"io"
|
||||
"syscall"
|
||||
|
||||
"github.com/Microsoft/go-winio"
|
||||
diskutil "github.com/Microsoft/go-winio/vhd"
|
||||
"github.com/pkg/errors"
|
||||
"golang.org/x/sys/windows"
|
||||
)
|
||||
|
||||
// makeOpenFiles calls winio.MakeOpenFile for each handle in a slice but closes all the handles
|
||||
@@ -31,3 +35,27 @@ func makeOpenFiles(hs []syscall.Handle) (_ []io.ReadWriteCloser, err error) {
|
||||
}
|
||||
return fs, nil
|
||||
}
|
||||
|
||||
// creates a VHD formatted with NTFS of size `sizeGB` at the given `vhdPath`.
|
||||
func CreateNTFSVHD(ctx context.Context, vhdPath string, sizeGB uint32) (err error) {
|
||||
if err := diskutil.CreateVhdx(vhdPath, sizeGB, 1); err != nil {
|
||||
return errors.Wrap(err, "failed to create VHD")
|
||||
}
|
||||
|
||||
vhd, err := diskutil.OpenVirtualDisk(vhdPath, diskutil.VirtualDiskAccessNone, diskutil.OpenVirtualDiskFlagNone)
|
||||
if err != nil {
|
||||
return errors.Wrap(err, "failed to open VHD")
|
||||
}
|
||||
defer func() {
|
||||
err2 := windows.CloseHandle(windows.Handle(vhd))
|
||||
if err == nil {
|
||||
err = errors.Wrap(err2, "failed to close VHD")
|
||||
}
|
||||
}()
|
||||
|
||||
if err := hcsFormatWritableLayerVhd(uintptr(vhd)); err != nil {
|
||||
return errors.Wrap(err, "failed to format VHD")
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
18
vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go
generated
vendored
18
vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go
generated
vendored
@@ -1,28 +1,34 @@
|
||||
package hcs
|
||||
|
||||
import (
|
||||
"context"
|
||||
"time"
|
||||
|
||||
"github.com/sirupsen/logrus"
|
||||
"github.com/Microsoft/hcsshim/internal/log"
|
||||
)
|
||||
|
||||
func processAsyncHcsResult(err error, resultp *uint16, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) ([]ErrorEvent, error) {
|
||||
events := processHcsResult(resultp)
|
||||
func processAsyncHcsResult(ctx context.Context, err error, resultJSON string, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) ([]ErrorEvent, error) {
|
||||
events := processHcsResult(ctx, resultJSON)
|
||||
if IsPending(err) {
|
||||
return nil, waitForNotification(callbackNumber, expectedNotification, timeout)
|
||||
return nil, waitForNotification(ctx, callbackNumber, expectedNotification, timeout)
|
||||
}
|
||||
|
||||
return events, err
|
||||
}
|
||||
|
||||
func waitForNotification(callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error {
|
||||
func waitForNotification(ctx context.Context, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error {
|
||||
callbackMapLock.RLock()
|
||||
if _, ok := callbackMap[callbackNumber]; !ok {
|
||||
callbackMapLock.RUnlock()
|
||||
log.G(ctx).WithField("callbackNumber", callbackNumber).Error("failed to waitForNotification: callbackNumber does not exist in callbackMap")
|
||||
return ErrHandleClose
|
||||
}
|
||||
channels := callbackMap[callbackNumber].channels
|
||||
callbackMapLock.RUnlock()
|
||||
|
||||
expectedChannel := channels[expectedNotification]
|
||||
if expectedChannel == nil {
|
||||
logrus.Errorf("unknown notification type in waitForNotification %x", expectedNotification)
|
||||
log.G(ctx).WithField("type", expectedNotification).Error("unknown notification type in waitForNotification")
|
||||
return ErrInvalidNotificationType
|
||||
}
|
||||
|
||||
|
||||
41
vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go
generated
vendored
41
vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go
generated
vendored
@@ -1,41 +0,0 @@
|
||||
package hcs
|
||||
|
||||
import (
|
||||
"context"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/logfields"
|
||||
"github.com/Microsoft/hcsshim/internal/timeout"
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
// syscallWatcher is used as a very simple goroutine around calls into
|
||||
// the platform. In some cases, we have seen HCS APIs not returning due to
|
||||
// various bugs, and the goroutine making the syscall ends up not returning,
|
||||
// prior to its async callback. By spinning up a syscallWatcher, it allows
|
||||
// us to at least log a warning if a syscall doesn't complete in a reasonable
|
||||
// amount of time.
|
||||
//
|
||||
// Usage is:
|
||||
//
|
||||
// syscallWatcher(logContext, func() {
|
||||
// err = <syscall>(args...)
|
||||
// })
|
||||
//
|
||||
|
||||
func syscallWatcher(logContext logrus.Fields, syscallLambda func()) {
|
||||
ctx, cancel := context.WithTimeout(context.Background(), timeout.SyscallWatcher)
|
||||
defer cancel()
|
||||
go watchFunc(ctx, logContext)
|
||||
syscallLambda()
|
||||
}
|
||||
|
||||
func watchFunc(ctx context.Context, logContext logrus.Fields) {
|
||||
select {
|
||||
case <-ctx.Done():
|
||||
if ctx.Err() != context.Canceled {
|
||||
logrus.WithFields(logContext).
|
||||
WithField(logfields.Timeout, timeout.SyscallWatcher).
|
||||
Warning("Syscall did not complete within operation timeout. This may indicate a platform issue. If it appears to be making no forward progress, obtain the stacks and see if there is a syscall stuck in the platform API for a significant length of time.")
|
||||
}
|
||||
}
|
||||
}
|
||||
487
vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go
generated
vendored
487
vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go
generated
vendored
@@ -37,492 +37,13 @@ func errnoErr(e syscall.Errno) error {
|
||||
}
|
||||
|
||||
var (
|
||||
modvmcompute = windows.NewLazySystemDLL("vmcompute.dll")
|
||||
modcomputestorage = windows.NewLazySystemDLL("computestorage.dll")
|
||||
|
||||
procHcsEnumerateComputeSystems = modvmcompute.NewProc("HcsEnumerateComputeSystems")
|
||||
procHcsCreateComputeSystem = modvmcompute.NewProc("HcsCreateComputeSystem")
|
||||
procHcsOpenComputeSystem = modvmcompute.NewProc("HcsOpenComputeSystem")
|
||||
procHcsCloseComputeSystem = modvmcompute.NewProc("HcsCloseComputeSystem")
|
||||
procHcsStartComputeSystem = modvmcompute.NewProc("HcsStartComputeSystem")
|
||||
procHcsShutdownComputeSystem = modvmcompute.NewProc("HcsShutdownComputeSystem")
|
||||
procHcsTerminateComputeSystem = modvmcompute.NewProc("HcsTerminateComputeSystem")
|
||||
procHcsPauseComputeSystem = modvmcompute.NewProc("HcsPauseComputeSystem")
|
||||
procHcsResumeComputeSystem = modvmcompute.NewProc("HcsResumeComputeSystem")
|
||||
procHcsGetComputeSystemProperties = modvmcompute.NewProc("HcsGetComputeSystemProperties")
|
||||
procHcsModifyComputeSystem = modvmcompute.NewProc("HcsModifyComputeSystem")
|
||||
procHcsRegisterComputeSystemCallback = modvmcompute.NewProc("HcsRegisterComputeSystemCallback")
|
||||
procHcsUnregisterComputeSystemCallback = modvmcompute.NewProc("HcsUnregisterComputeSystemCallback")
|
||||
procHcsCreateProcess = modvmcompute.NewProc("HcsCreateProcess")
|
||||
procHcsOpenProcess = modvmcompute.NewProc("HcsOpenProcess")
|
||||
procHcsCloseProcess = modvmcompute.NewProc("HcsCloseProcess")
|
||||
procHcsTerminateProcess = modvmcompute.NewProc("HcsTerminateProcess")
|
||||
|
||||
procHcsGetProcessInfo = modvmcompute.NewProc("HcsGetProcessInfo")
|
||||
procHcsGetProcessProperties = modvmcompute.NewProc("HcsGetProcessProperties")
|
||||
procHcsModifyProcess = modvmcompute.NewProc("HcsModifyProcess")
|
||||
procHcsGetServiceProperties = modvmcompute.NewProc("HcsGetServiceProperties")
|
||||
procHcsRegisterProcessCallback = modvmcompute.NewProc("HcsRegisterProcessCallback")
|
||||
procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback")
|
||||
procHcsFormatWritableLayerVhd = modcomputestorage.NewProc("HcsFormatWritableLayerVhd")
|
||||
)
|
||||
|
||||
func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(query)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsEnumerateComputeSystems(_p0, computeSystems, result)
|
||||
}
|
||||
|
||||
func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsEnumerateComputeSystems.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsEnumerateComputeSystems.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(computeSystems)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(id)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
var _p1 *uint16
|
||||
_p1, hr = syscall.UTF16PtrFromString(configuration)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsCreateComputeSystem(_p0, _p1, identity, computeSystem, result)
|
||||
}
|
||||
|
||||
func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) {
|
||||
if hr = procHcsCreateComputeSystem.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall6(procHcsCreateComputeSystem.Addr(), 5, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(configuration)), uintptr(identity), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)), 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(id)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsOpenComputeSystem(_p0, computeSystem, result)
|
||||
}
|
||||
|
||||
func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16) (hr error) {
|
||||
if hr = procHcsOpenComputeSystem.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsOpenComputeSystem.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) {
|
||||
if hr = procHcsCloseComputeSystem.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsCloseComputeSystem.Addr(), 1, uintptr(computeSystem), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(options)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsStartComputeSystem(computeSystem, _p0, result)
|
||||
}
|
||||
|
||||
func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsStartComputeSystem.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsStartComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(options)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsShutdownComputeSystem(computeSystem, _p0, result)
|
||||
}
|
||||
|
||||
func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsShutdownComputeSystem.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsShutdownComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(options)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsTerminateComputeSystem(computeSystem, _p0, result)
|
||||
}
|
||||
|
||||
func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsTerminateComputeSystem.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsTerminateComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(options)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsPauseComputeSystem(computeSystem, _p0, result)
|
||||
}
|
||||
|
||||
func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsPauseComputeSystem.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsPauseComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(options)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsResumeComputeSystem(computeSystem, _p0, result)
|
||||
}
|
||||
|
||||
func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsResumeComputeSystem.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsResumeComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(propertyQuery)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsGetComputeSystemProperties(computeSystem, _p0, properties, result)
|
||||
}
|
||||
|
||||
func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsGetComputeSystemProperties.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall6(procHcsGetComputeSystemProperties.Addr(), 4, uintptr(computeSystem), uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(configuration)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsModifyComputeSystem(computeSystem, _p0, result)
|
||||
}
|
||||
|
||||
func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsModifyComputeSystem.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsModifyComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(configuration)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) {
|
||||
if hr = procHcsRegisterComputeSystemCallback.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall6(procHcsRegisterComputeSystemCallback.Addr(), 4, uintptr(computeSystem), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) {
|
||||
if hr = procHcsUnregisterComputeSystemCallback.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsUnregisterComputeSystemCallback.Addr(), 1, uintptr(callbackHandle), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(processParameters)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsCreateProcess(computeSystem, _p0, processInformation, process, result)
|
||||
}
|
||||
|
||||
func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) {
|
||||
if hr = procHcsCreateProcess.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall6(procHcsCreateProcess.Addr(), 5, uintptr(computeSystem), uintptr(unsafe.Pointer(processParameters)), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) {
|
||||
if hr = procHcsOpenProcess.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall6(procHcsOpenProcess.Addr(), 4, uintptr(computeSystem), uintptr(pid), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsCloseProcess(process hcsProcess) (hr error) {
|
||||
if hr = procHcsCloseProcess.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsCloseProcess.Addr(), 1, uintptr(process), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) {
|
||||
if hr = procHcsTerminateProcess.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 2, uintptr(process), uintptr(unsafe.Pointer(result)), 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(options)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsSignalProcess(process, _p0, result)
|
||||
}
|
||||
|
||||
func _hcsSignalProcess(process hcsProcess, options *uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsTerminateProcess.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) {
|
||||
if hr = procHcsGetProcessInfo.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsGetProcessInfo.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsGetProcessProperties.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsGetProcessProperties.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processProperties)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(settings)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsModifyProcess(process, _p0, result)
|
||||
}
|
||||
|
||||
func _hcsModifyProcess(process hcsProcess, settings *uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsModifyProcess.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsModifyProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(propertyQuery)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsGetServiceProperties(_p0, properties, result)
|
||||
}
|
||||
|
||||
func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsGetServiceProperties.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsGetServiceProperties.Addr(), 3, uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) {
|
||||
if hr = procHcsRegisterProcessCallback.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall6(procHcsRegisterProcessCallback.Addr(), 4, uintptr(process), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) {
|
||||
if hr = procHcsUnregisterProcessCallback.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsUnregisterProcessCallback.Addr(), 1, uintptr(callbackHandle), 0, 0)
|
||||
func hcsFormatWritableLayerVhd(handle uintptr) (hr error) {
|
||||
r0, _, _ := syscall.Syscall(procHcsFormatWritableLayerVhd.Addr(), 1, uintptr(handle), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
|
||||
43
vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go
generated
vendored
43
vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go
generated
vendored
@@ -3,6 +3,7 @@ package hns
|
||||
import (
|
||||
"encoding/json"
|
||||
"net"
|
||||
"strings"
|
||||
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
@@ -94,6 +95,27 @@ func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) {
|
||||
return nil, EndpointNotFoundError{EndpointName: endpointName}
|
||||
}
|
||||
|
||||
type endpointAttachInfo struct {
|
||||
SharedContainers json.RawMessage `json:",omitempty"`
|
||||
}
|
||||
|
||||
func (endpoint *HNSEndpoint) IsAttached(vID string) (bool, error) {
|
||||
attachInfo := endpointAttachInfo{}
|
||||
err := hnsCall("GET", "/endpoints/"+endpoint.Id, "", &attachInfo)
|
||||
|
||||
// Return false allows us to just return the err
|
||||
if err != nil {
|
||||
return false, err
|
||||
}
|
||||
|
||||
if strings.Contains(strings.ToLower(string(attachInfo.SharedContainers)), strings.ToLower(vID)) {
|
||||
return true, nil
|
||||
}
|
||||
|
||||
return false, nil
|
||||
|
||||
}
|
||||
|
||||
// Create Endpoint by sending EndpointRequest to HNS. TODO: Create a separate HNS interface to place all these methods
|
||||
func (endpoint *HNSEndpoint) Create() (*HNSEndpoint, error) {
|
||||
operation := "Create"
|
||||
@@ -151,6 +173,27 @@ func (endpoint *HNSEndpoint) ApplyACLPolicy(policies ...*ACLPolicy) error {
|
||||
return err
|
||||
}
|
||||
|
||||
// ApplyProxyPolicy applies a set of Proxy Policies on the Endpoint
|
||||
func (endpoint *HNSEndpoint) ApplyProxyPolicy(policies ...*ProxyPolicy) error {
|
||||
operation := "ApplyProxyPolicy"
|
||||
title := "hcsshim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
|
||||
for _, policy := range policies {
|
||||
if policy == nil {
|
||||
continue
|
||||
}
|
||||
jsonString, err := json.Marshal(policy)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
endpoint.Policies = append(endpoint.Policies, jsonString)
|
||||
}
|
||||
|
||||
_, err := endpoint.Update()
|
||||
return err
|
||||
}
|
||||
|
||||
// ContainerAttach attaches an endpoint to container
|
||||
func (endpoint *HNSEndpoint) ContainerAttach(containerID string, compartmentID uint16) error {
|
||||
operation := "ContainerAttach"
|
||||
|
||||
15
vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go
generated
vendored
15
vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go
generated
vendored
@@ -9,23 +9,30 @@ import (
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
func hnsCall(method, path, request string, returnResponse interface{}) error {
|
||||
func hnsCallRawResponse(method, path, request string) (*hnsResponse, error) {
|
||||
var responseBuffer *uint16
|
||||
logrus.Debugf("[%s]=>[%s] Request : %s", method, path, request)
|
||||
|
||||
err := _hnsCall(method, path, request, &responseBuffer)
|
||||
if err != nil {
|
||||
return hcserror.New(err, "hnsCall ", "")
|
||||
return nil, hcserror.New(err, "hnsCall ", "")
|
||||
}
|
||||
response := interop.ConvertAndFreeCoTaskMemString(responseBuffer)
|
||||
|
||||
hnsresponse := &hnsResponse{}
|
||||
if err = json.Unmarshal([]byte(response), &hnsresponse); err != nil {
|
||||
return err
|
||||
return nil, err
|
||||
}
|
||||
return hnsresponse, nil
|
||||
}
|
||||
|
||||
func hnsCall(method, path, request string, returnResponse interface{}) error {
|
||||
hnsresponse, err := hnsCallRawResponse(method, path, request)
|
||||
if err != nil {
|
||||
return fmt.Errorf("failed during hnsCallRawResponse: %v", err)
|
||||
}
|
||||
if !hnsresponse.Success {
|
||||
return fmt.Errorf("HNS failed with error : %s", hnsresponse.Error)
|
||||
return fmt.Errorf("hns failed with error : %s", hnsresponse.Error)
|
||||
}
|
||||
|
||||
if len(hnsresponse.Output) == 0 {
|
||||
|
||||
10
vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go
generated
vendored
10
vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go
generated
vendored
@@ -2,9 +2,9 @@ package hns
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"net"
|
||||
|
||||
"errors"
|
||||
"github.com/sirupsen/logrus"
|
||||
"net"
|
||||
)
|
||||
|
||||
// Subnet is assoicated with a network and represents a list
|
||||
@@ -98,6 +98,12 @@ func (network *HNSNetwork) Create() (*HNSNetwork, error) {
|
||||
title := "hcsshim::HNSNetwork::" + operation
|
||||
logrus.Debugf(title+" id=%s", network.Id)
|
||||
|
||||
for _, subnet := range network.Subnets {
|
||||
if (subnet.AddressPrefix != "") && (subnet.GatewayAddress == "") {
|
||||
return nil, errors.New("network create error, subnet has address prefix but no gateway specified")
|
||||
}
|
||||
}
|
||||
|
||||
jsonString, err := json.Marshal(network)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
|
||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user