mirror of
https://github.com/containers/skopeo.git
synced 2026-02-21 06:32:10 +00:00
Compare commits
115 Commits
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
be6146b0a8 | ||
|
|
8057da700c | ||
|
|
8f24d28130 | ||
|
|
4b6a5da86a | ||
|
|
7d251f5a74 | ||
|
|
5f9a6ea621 | ||
|
|
58248412bd | ||
|
|
5b0a7890ea | ||
|
|
4962559e5c | ||
|
|
f72e39fc10 | ||
|
|
7922028d7c | ||
|
|
881edbf122 | ||
|
|
51b54191a8 | ||
|
|
fa6e58074d | ||
|
|
1c243a5b12 | ||
|
|
7eb5f39255 | ||
|
|
8d1bb15075 | ||
|
|
5ae6b16c0f | ||
|
|
8c96dca362 | ||
|
|
1d8f5f29a5 | ||
|
|
b31f0da5c6 | ||
|
|
a02e57dde8 | ||
|
|
a000c1943d | ||
|
|
86e3564356 | ||
|
|
c61a5ea2c4 | ||
|
|
89bb6158eb | ||
|
|
646e197eed | ||
|
|
699c25568c | ||
|
|
0c579aca9c | ||
|
|
bc8281c016 | ||
|
|
91510e39ab | ||
|
|
7b0db25a74 | ||
|
|
18f0e1e20c | ||
|
|
a36d81c55c | ||
|
|
976dd83a62 | ||
|
|
9019e27ec5 | ||
|
|
a1c5a1f4d2 | ||
|
|
c4b0c7ce05 | ||
|
|
43b014c82a | ||
|
|
1e2d6f619b | ||
|
|
f1d8451b09 | ||
|
|
481bb94c5f | ||
|
|
a778e595b3 | ||
|
|
ee9e9dfc89 | ||
|
|
0f1ded2ac8 | ||
|
|
44bc4a9eb7 | ||
|
|
89d6d0c70f | ||
|
|
1cf1e06582 | ||
|
|
700b3102af | ||
|
|
c040b28fb8 | ||
|
|
af54437b44 | ||
|
|
202c1ea2ac | ||
|
|
5348d246ba | ||
|
|
37f616ee4e | ||
|
|
bf8089c37b | ||
|
|
65b3aa973a | ||
|
|
bebcb94653 | ||
|
|
19025f5cb4 | ||
|
|
327ab58a84 | ||
|
|
a697d1af87 | ||
|
|
d6270f4691 | ||
|
|
2ad9ae55c0 | ||
|
|
32e1652c9c | ||
|
|
6878c95ea8 | ||
|
|
8a9641c182 | ||
|
|
70ec2ca2e3 | ||
|
|
b58088a397 | ||
|
|
87c256aebf | ||
|
|
5f45112678 | ||
|
|
36723bc118 | ||
|
|
5c1ce1e033 | ||
|
|
6b45a943a8 | ||
|
|
ce59173f4f | ||
|
|
9d230dd132 | ||
|
|
0d471d146c | ||
|
|
da35da1d8c | ||
|
|
2469ba0a12 | ||
|
|
8a1a26018b | ||
|
|
839148bbc8 | ||
|
|
68f730355e | ||
|
|
565dbf34bd | ||
|
|
a700ec5ff2 | ||
|
|
5417561b4a | ||
|
|
ce6a8ebb08 | ||
|
|
3ce17181b6 | ||
|
|
f367935628 | ||
|
|
d580edbd40 | ||
|
|
033b290217 | ||
|
|
ea49bfc2b4 | ||
|
|
847007d48d | ||
|
|
261254f7b6 | ||
|
|
0d499d4f1a | ||
|
|
e079f9d61b | ||
|
|
ceabc0a404 | ||
|
|
523b8b44a2 | ||
|
|
d2d1796eb5 | ||
|
|
c67e5f7425 | ||
|
|
1b8686d044 | ||
|
|
a4de1428f9 | ||
|
|
524f6c0682 | ||
|
|
fa18fce7e8 | ||
|
|
96be1bb155 | ||
|
|
23c6b42b26 | ||
|
|
6307635b5f | ||
|
|
47e7cda4e9 | ||
|
|
5dd3b2bffd | ||
|
|
12f0e24519 | ||
|
|
b137741385 | ||
|
|
233804fedc | ||
|
|
0c90e57eaf | ||
|
|
8fb4ab3d92 | ||
|
|
8c9e250801 | ||
|
|
04aee56a36 | ||
|
|
4f1fabc2a4 | ||
|
|
43bc356337 |
@@ -10,6 +10,8 @@ RUN dnf -y update && dnf install -y make git golang golang-github-cpuguy83-go-md
|
||||
gnupg \
|
||||
# OpenShift deps
|
||||
which tar wget hostname util-linux bsdtar socat ethtool device-mapper iptables tree findutils nmap-ncat e2fsprogs xfsprogs lsof docker iproute \
|
||||
bats jq podman \
|
||||
golint \
|
||||
&& dnf clean all
|
||||
|
||||
# Install two versions of the registry. The first is an older version that
|
||||
@@ -43,7 +45,6 @@ RUN set -x \
|
||||
ENV GOPATH /usr/share/gocode:/go
|
||||
ENV PATH $GOPATH/bin:/usr/share/gocode/bin:$PATH
|
||||
RUN go version
|
||||
RUN go get golang.org/x/lint/golint
|
||||
WORKDIR /go/src/github.com/containers/skopeo
|
||||
COPY . /go/src/github.com/containers/skopeo
|
||||
|
||||
|
||||
@@ -2,7 +2,7 @@ FROM ubuntu:18.10
|
||||
|
||||
RUN apt-get update && apt-get install -y \
|
||||
golang \
|
||||
btrfs-tools \
|
||||
libbtrfs-dev \
|
||||
git-core \
|
||||
libdevmapper-dev \
|
||||
libgpgme11-dev \
|
||||
|
||||
39
Makefile
39
Makefile
@@ -1,6 +1,6 @@
|
||||
.PHONY: all binary build-container docs docs-in-container build-local clean install install-binary install-completions shell test-integration .install.vndr vendor
|
||||
|
||||
export GO15VENDOREXPERIMENT=1
|
||||
export GOPROXY=https://proxy.golang.org
|
||||
|
||||
ifeq ($(shell uname),Darwin)
|
||||
PREFIX ?= ${DESTDIR}/usr/local
|
||||
@@ -26,6 +26,12 @@ GO ?= go
|
||||
CONTAINER_RUNTIME := $(shell command -v podman 2> /dev/null || echo docker)
|
||||
GOMD2MAN ?= $(shell command -v go-md2man || echo '$(GOBIN)/go-md2man')
|
||||
|
||||
GO_BUILD=$(GO) build
|
||||
# Go module support: set `-mod=vendor` to use the vendored sources
|
||||
ifeq ($(shell go help mod >/dev/null 2>&1 && echo true), true)
|
||||
GO_BUILD=GO111MODULE=on $(GO) build -mod=vendor
|
||||
endif
|
||||
|
||||
ifeq ($(DEBUG), 1)
|
||||
override GOGCFLAGS += -N -l
|
||||
endif
|
||||
@@ -95,10 +101,10 @@ binary-static: cmd/skopeo
|
||||
|
||||
# Build w/o using containers
|
||||
binary-local:
|
||||
$(GPGME_ENV) $(GO) build ${GO_DYN_FLAGS} -ldflags "-X main.gitCommit=${GIT_COMMIT}" -gcflags "$(GOGCFLAGS)" -tags "$(BUILDTAGS)" -o skopeo ./cmd/skopeo
|
||||
$(GPGME_ENV) $(GO_BUILD) ${GO_DYN_FLAGS} -ldflags "-X main.gitCommit=${GIT_COMMIT}" -gcflags "$(GOGCFLAGS)" -tags "$(BUILDTAGS)" -o skopeo ./cmd/skopeo
|
||||
|
||||
binary-local-static:
|
||||
$(GPGME_ENV) $(GO) build -ldflags "-extldflags \"-static\" -X main.gitCommit=${GIT_COMMIT}" -gcflags "$(GOGCFLAGS)" -tags "$(BUILDTAGS)" -o skopeo ./cmd/skopeo
|
||||
$(GPGME_ENV) $(GO_BUILD) -ldflags "-extldflags \"-static\" -X main.gitCommit=${GIT_COMMIT}" -gcflags "$(GOGCFLAGS)" -tags "$(BUILDTAGS)" -o skopeo ./cmd/skopeo
|
||||
|
||||
build-container:
|
||||
${CONTAINER_RUNTIME} build ${BUILD_ARGS} -t "$(IMAGE)" .
|
||||
@@ -138,14 +144,25 @@ install-completions:
|
||||
shell: build-container
|
||||
$(CONTAINER_RUN) bash
|
||||
|
||||
check: validate test-unit test-integration
|
||||
check: validate test-unit test-integration test-system
|
||||
|
||||
# The tests can run out of entropy and block in containers, so replace /dev/random.
|
||||
test-integration: build-container
|
||||
$(CONTAINER_RUN) bash -c 'rm -f /dev/random; ln -sf /dev/urandom /dev/random; SKOPEO_CONTAINER_TESTS=1 BUILDTAGS="$(BUILDTAGS)" hack/make.sh test-integration'
|
||||
|
||||
# complicated set of options needed to run podman-in-podman
|
||||
test-system: build-container
|
||||
DTEMP=$(shell mktemp -d --tmpdir=/var/tmp podman-tmp.XXXXXX); \
|
||||
$(CONTAINER_CMD) --privileged --net=host \
|
||||
-v $$DTEMP:/var/lib/containers:Z \
|
||||
"$(IMAGE)" \
|
||||
bash -c 'BUILDTAGS="$(BUILDTAGS)" hack/make.sh test-system'; \
|
||||
rc=$$?; \
|
||||
$(RM) -rf $$DTEMP; \
|
||||
exit $$rc
|
||||
|
||||
test-unit: build-container
|
||||
# Just call (make test unit-local) here instead of worrying about environment differences, e.g. GO15VENDOREXPERIMENT.
|
||||
# Just call (make test unit-local) here instead of worrying about environment differences
|
||||
$(CONTAINER_RUN) make test-unit-local BUILDTAGS='$(BUILDTAGS)'
|
||||
|
||||
validate: build-container
|
||||
@@ -160,10 +177,8 @@ validate-local:
|
||||
test-unit-local:
|
||||
$(GPGME_ENV) $(GO) test -tags "$(BUILDTAGS)" $$($(GO) list -tags "$(BUILDTAGS)" -e ./... | grep -v '^github\.com/containers/skopeo/\(integration\|vendor/.*\)$$')
|
||||
|
||||
.install.vndr:
|
||||
$(GO) get -u github.com/LK4D4/vndr
|
||||
|
||||
vendor: vendor.conf .install.vndr
|
||||
$(GOPATH)/bin/vndr \
|
||||
-whitelist '^github.com/containers/image/docs/.*' \
|
||||
-whitelist '^github.com/containers/image/registries.conf'
|
||||
vendor:
|
||||
export GO111MODULE=on \
|
||||
$(GO) mod tidy && \
|
||||
$(GO) mod vendor && \
|
||||
$(GO) mod verify
|
||||
|
||||
21
README.md
21
README.md
@@ -156,10 +156,15 @@ Obtaining skopeo
|
||||
```sh
|
||||
$ sudo dnf install skopeo
|
||||
```
|
||||
for openSUSE:
|
||||
```sh
|
||||
$ sudo zypper install skopeo
|
||||
```
|
||||
|
||||
|
||||
Otherwise, read on for building and installing it from source:
|
||||
|
||||
To build the `skopeo` binary you need at least Go 1.5 because it uses the latest `GO15VENDOREXPERIMENT` flag.
|
||||
To build the `skopeo` binary you need at least Go 1.9.
|
||||
|
||||
There are two ways to build skopeo: in a container, or locally without a container. Choose the one which better matches your needs and environment.
|
||||
|
||||
@@ -171,9 +176,17 @@ Building without a container requires a bit more manual work and setup in your e
|
||||
|
||||
Install the necessary dependencies:
|
||||
```sh
|
||||
Fedora$ sudo dnf install gpgme-devel libassuan-devel btrfs-progs-devel device-mapper-devel ostree-devel
|
||||
Ubuntu$ sudo apt install libgpgme-dev libassuan-dev btrfs-progs libdevmapper-dev libostree-dev
|
||||
macOS$ brew install gpgme
|
||||
# Fedora:
|
||||
sudo dnf install gpgme-devel libassuan-devel btrfs-progs-devel device-mapper-devel ostree-devel
|
||||
|
||||
# Ubuntu (`libbtrfs-dev` requires Ubuntu 18.10 and above):
|
||||
sudo apt install libgpgme-dev libassuan-dev libbtrfs-dev libdevmapper-dev libostree-dev
|
||||
|
||||
# macOS:
|
||||
brew install gpgme
|
||||
|
||||
# openSUSE
|
||||
sudo zypper install libgpgme-devel device-mapper-devel libbtrfs-devel glib2-devel
|
||||
```
|
||||
|
||||
Make sure to clone this repository in your `GOPATH` - otherwise compilation fails.
|
||||
|
||||
@@ -6,11 +6,11 @@ import (
|
||||
"io"
|
||||
"strings"
|
||||
|
||||
"github.com/containers/image/copy"
|
||||
"github.com/containers/image/docker/reference"
|
||||
"github.com/containers/image/manifest"
|
||||
"github.com/containers/image/transports"
|
||||
"github.com/containers/image/transports/alltransports"
|
||||
"github.com/containers/image/v5/copy"
|
||||
"github.com/containers/image/v5/docker/reference"
|
||||
"github.com/containers/image/v5/manifest"
|
||||
"github.com/containers/image/v5/transports"
|
||||
"github.com/containers/image/v5/transports/alltransports"
|
||||
imgspecv1 "github.com/opencontainers/image-spec/specs-go/v1"
|
||||
"github.com/urfave/cli"
|
||||
)
|
||||
@@ -24,7 +24,7 @@ type copyOptions struct {
|
||||
signByFingerprint string // Sign the image using a GPG key with the specified fingerprint
|
||||
format optionalString // Force conversion of the image to a specified format
|
||||
quiet bool // Suppress output information when copying images
|
||||
|
||||
all bool // Copy all of the images if the source is a list
|
||||
}
|
||||
|
||||
func copyCmd(global *globalOptions) cli.Command {
|
||||
@@ -62,6 +62,11 @@ func copyCmd(global *globalOptions) cli.Command {
|
||||
Usage: "Suppress output information when copying images",
|
||||
Destination: &opts.quiet,
|
||||
},
|
||||
cli.BoolFlag{
|
||||
Name: "all, a",
|
||||
Usage: "Copy all images if SOURCE-IMAGE is a list",
|
||||
Destination: &opts.all,
|
||||
},
|
||||
cli.BoolFlag{
|
||||
Name: "remove-signatures",
|
||||
Usage: "Do not copy signatures from SOURCE-IMAGE",
|
||||
@@ -147,6 +152,10 @@ func (opts *copyOptions) run(args []string, stdout io.Writer) error {
|
||||
if opts.quiet {
|
||||
stdout = nil
|
||||
}
|
||||
imageListSelection := copy.CopySystemImage
|
||||
if opts.all {
|
||||
imageListSelection = copy.CopyAllImages
|
||||
}
|
||||
_, err = copy.Image(ctx, policyContext, destRef, srcRef, ©.Options{
|
||||
RemoveSignatures: opts.removeSignatures,
|
||||
SignBy: opts.signByFingerprint,
|
||||
@@ -154,6 +163,7 @@ func (opts *copyOptions) run(args []string, stdout io.Writer) error {
|
||||
SourceCtx: sourceCtx,
|
||||
DestinationCtx: destinationCtx,
|
||||
ForceManifestMIMEType: manifestType,
|
||||
ImageListSelection: imageListSelection,
|
||||
})
|
||||
return err
|
||||
}
|
||||
|
||||
@@ -6,8 +6,8 @@ import (
|
||||
"io"
|
||||
"strings"
|
||||
|
||||
"github.com/containers/image/transports"
|
||||
"github.com/containers/image/transports/alltransports"
|
||||
"github.com/containers/image/v5/transports"
|
||||
"github.com/containers/image/v5/transports/alltransports"
|
||||
"github.com/urfave/cli"
|
||||
)
|
||||
|
||||
|
||||
@@ -73,3 +73,37 @@ func (ob *optionalStringValue) String() string {
|
||||
}
|
||||
return ob.value
|
||||
}
|
||||
|
||||
// optionalInt is a int with a separate presence flag.
|
||||
type optionalInt struct {
|
||||
present bool
|
||||
value int
|
||||
}
|
||||
|
||||
// optionalInt is a cli.Generic == flag.Value implementation equivalent to
|
||||
// the one underlying flag.Int, except that it records whether the flag has been set.
|
||||
// This is distinct from optionalInt to (pretend to) force callers to use
|
||||
// newoptionalIntValue
|
||||
type optionalIntValue optionalInt
|
||||
|
||||
func newOptionalIntValue(p *optionalInt) cli.Generic {
|
||||
p.present = false
|
||||
return (*optionalIntValue)(p)
|
||||
}
|
||||
|
||||
func (ob *optionalIntValue) Set(s string) error {
|
||||
v, err := strconv.ParseInt(s, 0, strconv.IntSize)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
ob.value = int(v)
|
||||
ob.present = true
|
||||
return nil
|
||||
}
|
||||
|
||||
func (ob *optionalIntValue) String() string {
|
||||
if !ob.present {
|
||||
return "" // If the value is not present, just return an empty string, any other value wouldn't make sense.
|
||||
}
|
||||
return strconv.Itoa(int(ob.value))
|
||||
}
|
||||
|
||||
@@ -7,9 +7,10 @@ import (
|
||||
"strings"
|
||||
"time"
|
||||
|
||||
"github.com/containers/image/docker"
|
||||
"github.com/containers/image/manifest"
|
||||
"github.com/containers/image/transports"
|
||||
"github.com/containers/image/v5/docker"
|
||||
"github.com/containers/image/v5/image"
|
||||
"github.com/containers/image/v5/manifest"
|
||||
"github.com/containers/image/v5/transports"
|
||||
"github.com/opencontainers/go-digest"
|
||||
"github.com/pkg/errors"
|
||||
"github.com/sirupsen/logrus"
|
||||
@@ -28,6 +29,7 @@ type inspectOutput struct {
|
||||
Architecture string
|
||||
Os string
|
||||
Layers []string
|
||||
Env []string
|
||||
}
|
||||
|
||||
type inspectOptions struct {
|
||||
@@ -85,21 +87,40 @@ func (opts *inspectOptions) run(args []string, stdout io.Writer) (retErr error)
|
||||
return err
|
||||
}
|
||||
|
||||
img, err := parseImage(ctx, opts.image, imageName)
|
||||
sys, err := opts.image.newSystemContext()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
src, err := parseImageSource(ctx, opts.image, imageName)
|
||||
if err != nil {
|
||||
return fmt.Errorf("Error parsing image name %q: %v", imageName, err)
|
||||
}
|
||||
|
||||
defer func() {
|
||||
if err := img.Close(); err != nil {
|
||||
if err := src.Close(); err != nil {
|
||||
retErr = errors.Wrapf(retErr, fmt.Sprintf("(could not close image: %v) ", err))
|
||||
}
|
||||
}()
|
||||
|
||||
rawManifest, _, err := img.Manifest(ctx)
|
||||
rawManifest, _, err := src.GetManifest(ctx, nil)
|
||||
if err != nil {
|
||||
return err
|
||||
return fmt.Errorf("Error retrieving manifest for image: %v", err)
|
||||
}
|
||||
|
||||
if opts.raw && !opts.config {
|
||||
_, err := stdout.Write(rawManifest)
|
||||
if err != nil {
|
||||
return fmt.Errorf("Error writing manifest to standard output: %v", err)
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
img, err := image.FromUnparsedImage(ctx, sys, image.UnparsedInstance(src, nil))
|
||||
if err != nil {
|
||||
return fmt.Errorf("Error parsing manifest for image: %v", err)
|
||||
}
|
||||
|
||||
if opts.config && opts.raw {
|
||||
configBlob, err := img.ConfigBlob(ctx)
|
||||
if err != nil {
|
||||
@@ -110,12 +131,6 @@ func (opts *inspectOptions) run(args []string, stdout io.Writer) (retErr error)
|
||||
return fmt.Errorf("Error writing configuration blob to standard output: %v", err)
|
||||
}
|
||||
return nil
|
||||
} else if opts.raw {
|
||||
_, err := stdout.Write(rawManifest)
|
||||
if err != nil {
|
||||
return fmt.Errorf("Error writing manifest to standard output: %v", err)
|
||||
}
|
||||
return nil
|
||||
} else if opts.config {
|
||||
config, err := img.OCIConfig(ctx)
|
||||
if err != nil {
|
||||
@@ -127,6 +142,7 @@ func (opts *inspectOptions) run(args []string, stdout io.Writer) (retErr error)
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
imgInspect, err := img.Inspect(ctx)
|
||||
if err != nil {
|
||||
return err
|
||||
@@ -142,6 +158,7 @@ func (opts *inspectOptions) run(args []string, stdout io.Writer) (retErr error)
|
||||
Architecture: imgInspect.Architecture,
|
||||
Os: imgInspect.Os,
|
||||
Layers: imgInspect.Layers,
|
||||
Env: imgInspect.Env,
|
||||
}
|
||||
outputData.Digest, err = manifest.Digest(rawManifest)
|
||||
if err != nil {
|
||||
|
||||
@@ -7,10 +7,10 @@ import (
|
||||
"os"
|
||||
"strings"
|
||||
|
||||
"github.com/containers/image/directory"
|
||||
"github.com/containers/image/image"
|
||||
"github.com/containers/image/pkg/blobinfocache"
|
||||
"github.com/containers/image/types"
|
||||
"github.com/containers/image/v5/directory"
|
||||
"github.com/containers/image/v5/image"
|
||||
"github.com/containers/image/v5/pkg/blobinfocache"
|
||||
"github.com/containers/image/v5/types"
|
||||
"github.com/opencontainers/go-digest"
|
||||
"github.com/pkg/errors"
|
||||
"github.com/urfave/cli"
|
||||
@@ -142,9 +142,9 @@ func (opts *layersOptions) run(args []string, stdout io.Writer) (retErr error) {
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
if err := dest.PutManifest(ctx, manifest); err != nil {
|
||||
if err := dest.PutManifest(ctx, manifest, nil); err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
return dest.Commit(ctx)
|
||||
return dest.Commit(ctx, image.UnparsedInstance(rawSource, nil))
|
||||
}
|
||||
|
||||
@@ -6,7 +6,7 @@ import (
|
||||
"os"
|
||||
"time"
|
||||
|
||||
"github.com/containers/image/signature"
|
||||
"github.com/containers/image/v5/signature"
|
||||
"github.com/containers/skopeo/version"
|
||||
"github.com/containers/storage/pkg/reexec"
|
||||
"github.com/sirupsen/logrus"
|
||||
@@ -22,7 +22,7 @@ type globalOptions struct {
|
||||
tlsVerify optionalBool // Require HTTPS and verify certificates (for docker: and docker-daemon:)
|
||||
policyPath string // Path to a signature verification policy file
|
||||
insecurePolicy bool // Use an "allow everything" signature verification policy
|
||||
registriesDirPath string // Path to a "registries.d" registry configuratio directory
|
||||
registriesDirPath string // Path to a "registries.d" registry configuration directory
|
||||
overrideArch string // Architecture to use for choosing images, instead of the runtime one
|
||||
overrideOS string // OS to use for choosing images, instead of the runtime one
|
||||
commandTimeout time.Duration // Timeout for the command execution
|
||||
|
||||
@@ -6,7 +6,7 @@ import (
|
||||
"io"
|
||||
"io/ioutil"
|
||||
|
||||
"github.com/containers/image/manifest"
|
||||
"github.com/containers/image/v5/manifest"
|
||||
"github.com/urfave/cli"
|
||||
)
|
||||
|
||||
|
||||
@@ -7,7 +7,7 @@ import (
|
||||
"io"
|
||||
"io/ioutil"
|
||||
|
||||
"github.com/containers/image/signature"
|
||||
"github.com/containers/image/v5/signature"
|
||||
"github.com/urfave/cli"
|
||||
)
|
||||
|
||||
|
||||
@@ -7,7 +7,7 @@ import (
|
||||
"testing"
|
||||
"time"
|
||||
|
||||
"github.com/containers/image/signature"
|
||||
"github.com/containers/image/v5/signature"
|
||||
"github.com/opencontainers/go-digest"
|
||||
"github.com/stretchr/testify/assert"
|
||||
"github.com/stretchr/testify/require"
|
||||
|
||||
@@ -2,8 +2,8 @@ package main
|
||||
|
||||
import (
|
||||
"github.com/containers/buildah/pkg/unshare"
|
||||
"github.com/containers/image/storage"
|
||||
"github.com/containers/image/transports/alltransports"
|
||||
"github.com/containers/image/v5/storage"
|
||||
"github.com/containers/image/v5/transports/alltransports"
|
||||
"github.com/pkg/errors"
|
||||
"github.com/syndtr/gocapability/capability"
|
||||
)
|
||||
@@ -38,7 +38,8 @@ func maybeReexec() error {
|
||||
func reexecIfNecessaryForImages(imageNames ...string) error {
|
||||
// Check if container-storage are used before doing unshare
|
||||
for _, imageName := range imageNames {
|
||||
if alltransports.TransportFromImageName(imageName).Name() == storage.Transport.Name() {
|
||||
transport := alltransports.TransportFromImageName(imageName)
|
||||
if transport != nil && transport.Name() == storage.Transport.Name() {
|
||||
return maybeReexec()
|
||||
}
|
||||
}
|
||||
|
||||
@@ -6,8 +6,9 @@ import (
|
||||
"io"
|
||||
"strings"
|
||||
|
||||
"github.com/containers/image/transports/alltransports"
|
||||
"github.com/containers/image/types"
|
||||
"github.com/containers/image/v5/pkg/compression"
|
||||
"github.com/containers/image/v5/transports/alltransports"
|
||||
"github.com/containers/image/v5/types"
|
||||
"github.com/urfave/cli"
|
||||
)
|
||||
|
||||
@@ -147,14 +148,18 @@ func (opts *imageOptions) newSystemContext() (*types.SystemContext, error) {
|
||||
if opts.noCreds {
|
||||
ctx.DockerAuthConfig = &types.DockerAuthConfig{}
|
||||
}
|
||||
|
||||
return ctx, nil
|
||||
}
|
||||
|
||||
// imageDestOptions is a superset of imageOptions specialized for iamge destinations.
|
||||
type imageDestOptions struct {
|
||||
*imageOptions
|
||||
osTreeTmpDir string // A directory to use for OSTree temporary files
|
||||
dirForceCompression bool // Compress layers when saving to the dir: transport
|
||||
osTreeTmpDir string // A directory to use for OSTree temporary files
|
||||
dirForceCompression bool // Compress layers when saving to the dir: transport
|
||||
ociAcceptUncompressedLayers bool // Whether to accept uncompressed layers in the oci: transport
|
||||
compressionFormat string // Format to use for the compression
|
||||
compressionLevel optionalInt // Level to use for the compression
|
||||
}
|
||||
|
||||
// imageDestFlags prepares a collection of CLI flags writing into imageDestOptions, and the managed imageDestOptions structure.
|
||||
@@ -173,6 +178,21 @@ func imageDestFlags(global *globalOptions, shared *sharedImageOptions, flagPrefi
|
||||
Usage: "Compress tarball image layers when saving to directory using the 'dir' transport. (default is same compression type as source)",
|
||||
Destination: &opts.dirForceCompression,
|
||||
},
|
||||
cli.BoolFlag{
|
||||
Name: flagPrefix + "oci-accept-uncompressed-layers",
|
||||
Usage: "Allow uncompressed image layers when saving to an OCI image using the 'oci' transport. (default is to compress things that aren't compressed)",
|
||||
Destination: &opts.ociAcceptUncompressedLayers,
|
||||
},
|
||||
cli.StringFlag{
|
||||
Name: flagPrefix + "compress-format",
|
||||
Usage: "`FORMAT` to use for the compression",
|
||||
Destination: &opts.compressionFormat,
|
||||
},
|
||||
cli.GenericFlag{
|
||||
Name: flagPrefix + "compress-level",
|
||||
Usage: "`LEVEL` to use for the compression",
|
||||
Value: newOptionalIntValue(&opts.compressionLevel),
|
||||
},
|
||||
}...), &opts
|
||||
}
|
||||
|
||||
@@ -186,6 +206,17 @@ func (opts *imageDestOptions) newSystemContext() (*types.SystemContext, error) {
|
||||
|
||||
ctx.OSTreeTmpDirPath = opts.osTreeTmpDir
|
||||
ctx.DirForceCompress = opts.dirForceCompression
|
||||
ctx.OCIAcceptUncompressedLayers = opts.ociAcceptUncompressedLayers
|
||||
if opts.compressionFormat != "" {
|
||||
cf, err := compression.AlgorithmByName(opts.compressionFormat)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
ctx.CompressionFormat = &cf
|
||||
}
|
||||
if opts.compressionLevel.present {
|
||||
ctx.CompressionLevel = &opts.compressionLevel.value
|
||||
}
|
||||
return ctx, err
|
||||
}
|
||||
|
||||
|
||||
@@ -4,7 +4,7 @@ import (
|
||||
"flag"
|
||||
"testing"
|
||||
|
||||
"github.com/containers/image/types"
|
||||
"github.com/containers/image/v5/types"
|
||||
"github.com/stretchr/testify/assert"
|
||||
"github.com/stretchr/testify/require"
|
||||
)
|
||||
|
||||
@@ -1,7 +1,5 @@
|
||||
#! /bin/bash
|
||||
|
||||
: ${PROG:=$(basename ${BASH_SOURCE})}
|
||||
|
||||
_complete_() {
|
||||
local options_with_args=$1
|
||||
local boolean_options="$2 -h --help"
|
||||
@@ -10,7 +8,7 @@ _complete_() {
|
||||
local option_with_args
|
||||
for option_with_args in $options_with_args $transports
|
||||
do
|
||||
if [ "$option_with_args" == "$prev" -o "$option_with_args" == "$cur" ]
|
||||
if [ "$option_with_args" == "$prev" ] || [ "$option_with_args" == "$cur" ]
|
||||
then
|
||||
return
|
||||
fi
|
||||
@@ -18,13 +16,13 @@ _complete_() {
|
||||
|
||||
case "$cur" in
|
||||
-*)
|
||||
COMPREPLY=( $( compgen -W "$boolean_options $options_with_args" -- "$cur" ) )
|
||||
while IFS='' read -r line; do COMPREPLY+=("$line"); done < <(compgen -W "$boolean_options $options_with_args" -- "$cur")
|
||||
;;
|
||||
*)
|
||||
if [ -n "$transports" ]
|
||||
then
|
||||
compopt -o nospace
|
||||
COMPREPLY=( $( compgen -W "$transports" -- "$cur" ) )
|
||||
while IFS='' read -r line; do COMPREPLY+=("$line"); done < <(compgen -W "$transports" -- "$cur")
|
||||
fi
|
||||
;;
|
||||
esac
|
||||
@@ -33,7 +31,7 @@ _complete_() {
|
||||
_skopeo_supported_transports() {
|
||||
local subcommand=$1
|
||||
|
||||
${PROG} $subcommand --help | grep "Supported transports" -A 1 | tail -n 1 | sed -e 's/,/:/g' -e 's/$/:/'
|
||||
skopeo "$subcommand" --help | grep "Supported transports" -A 1 | tail -n 1 | sed -e 's/,/:/g' -e 's/$/:/'
|
||||
}
|
||||
|
||||
_skopeo_copy() {
|
||||
@@ -53,14 +51,17 @@ _skopeo_copy() {
|
||||
"
|
||||
|
||||
local boolean_options="
|
||||
--all
|
||||
--dest-compress
|
||||
--remove-signatures
|
||||
--src-no-creds
|
||||
--dest-no-creds
|
||||
--dest-oci-accept-uncompressed-layers
|
||||
"
|
||||
|
||||
local transports="
|
||||
$(_skopeo_supported_transports $(echo $FUNCNAME | sed 's/_skopeo_//'))
|
||||
local transports
|
||||
transports="
|
||||
$(_skopeo_supported_transports "${FUNCNAME//"_skopeo_"/}")
|
||||
"
|
||||
|
||||
_complete_ "$options_with_args" "$boolean_options" "$transports"
|
||||
@@ -79,8 +80,9 @@ _skopeo_inspect() {
|
||||
--no-creds
|
||||
"
|
||||
|
||||
local transports="
|
||||
$(_skopeo_supported_transports $(echo $FUNCNAME | sed 's/_skopeo_//'))
|
||||
local transports
|
||||
transports="
|
||||
$(_skopeo_supported_transports "${FUNCNAME//"_skopeo_"/}")
|
||||
"
|
||||
|
||||
_complete_ "$options_with_args" "$boolean_options" "$transports"
|
||||
@@ -122,8 +124,9 @@ _skopeo_delete() {
|
||||
--no-creds
|
||||
"
|
||||
|
||||
local transports="
|
||||
$(_skopeo_supported_transports $(echo $FUNCNAME | sed 's/_skopeo_//'))
|
||||
local transports
|
||||
transports="
|
||||
$(_skopeo_supported_transports "${FUNCNAME//"_skopeo_"/}")
|
||||
"
|
||||
|
||||
_complete_ "$options_with_args" "$boolean_options" "$transports"
|
||||
@@ -141,6 +144,8 @@ _skopeo_layers() {
|
||||
}
|
||||
|
||||
_skopeo_skopeo() {
|
||||
# XXX: Changes here need to be refleceted in the manually expanded
|
||||
# string in the `case` statement below as well.
|
||||
local options_with_args="
|
||||
--policy
|
||||
--registries.d
|
||||
@@ -154,26 +159,28 @@ _skopeo_skopeo() {
|
||||
--version -v
|
||||
--help -h
|
||||
"
|
||||
commands=$( ${COMP_WORDS[@]:0:$COMP_CWORD} --generate-bash-completion )
|
||||
|
||||
case "$prev" in
|
||||
$main_options_with_args_glob )
|
||||
# XXX: Changes here need to be refleceted in $options_with_args as well.
|
||||
--policy|--registries.d|--override-arch|--override-os|--command-timeout)
|
||||
return
|
||||
;;
|
||||
esac
|
||||
|
||||
case "$cur" in
|
||||
-*)
|
||||
COMPREPLY=( $( compgen -W "$boolean_options $options_with_args" -- "$cur" ) )
|
||||
while IFS='' read -r line; do COMPREPLY+=("$line"); done < <(compgen -W "$boolean_options $options_with_args" -- "$cur")
|
||||
;;
|
||||
*)
|
||||
COMPREPLY=( $( compgen -W "${commands[*]} help" -- "$cur" ) )
|
||||
commands=$( "${COMP_WORDS[@]:0:$COMP_CWORD}" --generate-bash-completion )
|
||||
|
||||
while IFS='' read -r line; do COMPREPLY+=("$line"); done < <(compgen -W "${commands[*]} help" -- "$cur")
|
||||
;;
|
||||
esac
|
||||
}
|
||||
|
||||
_cli_bash_autocomplete() {
|
||||
local cur opts base
|
||||
local cur
|
||||
|
||||
COMPREPLY=()
|
||||
cur="${COMP_WORDS[COMP_CWORD]}"
|
||||
@@ -182,15 +189,12 @@ _cli_bash_autocomplete() {
|
||||
|
||||
_get_comp_words_by_ref -n : cur prev words cword
|
||||
|
||||
local command=${PROG} cpos=0
|
||||
local command="skopeo" cpos=0
|
||||
local counter=1
|
||||
counter=1
|
||||
while [ $counter -lt $cword ]; do
|
||||
while [ $counter -lt "$cword" ]; do
|
||||
case "${words[$counter]}" in
|
||||
-*)
|
||||
;;
|
||||
*)
|
||||
command=$(echo "${words[$counter]}" | sed 's/-/_/g')
|
||||
skopeo|copy|inspect|delete|manifest-digest|standalone-sign|standalone-verify|help|h)
|
||||
command="${words[$counter]//-/_}"
|
||||
cpos=$counter
|
||||
(( cpos++ ))
|
||||
break
|
||||
@@ -200,10 +204,9 @@ _cli_bash_autocomplete() {
|
||||
done
|
||||
|
||||
local completions_func=_skopeo_${command}
|
||||
declare -F $completions_func >/dev/null && $completions_func
|
||||
declare -F "$completions_func" >/dev/null && $completions_func
|
||||
|
||||
eval "$previous_extglob_setting"
|
||||
return 0
|
||||
}
|
||||
|
||||
complete -F _cli_bash_autocomplete $PROG
|
||||
complete -F _cli_bash_autocomplete skopeo
|
||||
|
||||
@@ -17,6 +17,12 @@ Uses the system's trust policy to validate images, rejects images not trusted by
|
||||
|
||||
## OPTIONS
|
||||
|
||||
**--all**
|
||||
|
||||
If _source-image_ refers to a list of images, instead of copying just the image which matches the current OS and
|
||||
architecture (subject to the use of the global --override-os and --override-arch options), attempt to copy all of
|
||||
the images in the list, and the list itself.
|
||||
|
||||
**--authfile** _path_
|
||||
|
||||
Path of the authentication file. Default is ${XDG_RUNTIME\_DIR}/containers/auth.json, which is set using `podman login`.
|
||||
@@ -34,6 +40,8 @@ If the authorization state is not found there, $HOME/.docker/config.json is chec
|
||||
|
||||
**--dest-compress** _bool-value_ Compress tarball image layers when saving to directory using the 'dir' transport. (default is same compression type as source)
|
||||
|
||||
**--dest-oci-accept-uncompressed-layers** _bool-value_ Allow uncompressed image layers when saving to an OCI image using the 'oci' transport. (default is to compress things that aren't compressed)
|
||||
|
||||
**--dest-creds** _username[:password]_ for accessing the destination registry
|
||||
|
||||
**--src-cert-dir** _path_ Use certificates at _path_ (*.crt, *.cert, *.key) to connect to the source registry or daemon
|
||||
@@ -56,6 +64,10 @@ If the authorization state is not found there, $HOME/.docker/config.json is chec
|
||||
|
||||
Existing signatures, if any, are preserved as well.
|
||||
|
||||
**--dest-compress-format** _format_ Specifies the compression format to use. Supported values are: `gzip` and `zstd`.
|
||||
|
||||
**--dest-compress-level** _format_ Specifies the compression level to use. The value is specific to the compression algorithm used, e.g. for zstd the accepted values are in the range 1-20 (inclusive), while for gzip it is 1-9 (inclusive).
|
||||
|
||||
## EXAMPLES
|
||||
|
||||
To copy the layers of the docker.io busybox image to a local directory:
|
||||
|
||||
26
go.mod
Normal file
26
go.mod
Normal file
@@ -0,0 +1,26 @@
|
||||
module github.com/containers/skopeo
|
||||
|
||||
go 1.12
|
||||
|
||||
require (
|
||||
github.com/containers/buildah v1.8.4
|
||||
github.com/containers/image/v5 v5.0.0
|
||||
github.com/containers/storage v1.13.4
|
||||
github.com/docker/docker v0.0.0-20180522102801-da99009bbb11
|
||||
github.com/dsnet/compress v0.0.1 // indirect
|
||||
github.com/go-check/check v0.0.0-20180628173108-788fd7840127
|
||||
github.com/opencontainers/go-digest v1.0.0-rc1
|
||||
github.com/opencontainers/image-spec v1.0.2-0.20190823105129-775207bd45b6
|
||||
github.com/opencontainers/image-tools v0.0.0-20170926011501-6d941547fa1d
|
||||
github.com/opencontainers/runtime-spec v1.0.0 // indirect
|
||||
github.com/pkg/errors v0.8.1
|
||||
github.com/russross/blackfriday v2.0.0+incompatible // indirect
|
||||
github.com/shurcooL/sanitized_anchor_name v1.0.0 // indirect
|
||||
github.com/sirupsen/logrus v1.4.2
|
||||
github.com/stretchr/testify v1.4.0
|
||||
github.com/syndtr/gocapability v0.0.0-20180916011248-d98352740cb2
|
||||
github.com/urfave/cli v1.20.0
|
||||
github.com/xeipuuv/gojsonschema v1.1.0 // indirect
|
||||
go4.org v0.0.0-20190218023631-ce4c26f7be8e // indirect
|
||||
k8s.io/client-go v0.0.0-20181219152756-3dd551c0f083 // indirect
|
||||
)
|
||||
184
go.sum
Normal file
184
go.sum
Normal file
@@ -0,0 +1,184 @@
|
||||
github.com/14rcole/gopopulate v0.0.0-20180821133914-b175b219e774 h1:SCbEWT58NSt7d2mcFdvxC9uyrdcTfvBbPLThhkDmXzg=
|
||||
github.com/14rcole/gopopulate v0.0.0-20180821133914-b175b219e774/go.mod h1:6/0dYRLLXyJjbkIPeeGyoJ/eKOSI0eU6eTlCBYibgd0=
|
||||
github.com/BurntSushi/toml v0.3.1 h1:WXkYYl6Yr3qBf1K79EBnL4mak0OimBfB0XUf9Vl28OQ=
|
||||
github.com/BurntSushi/toml v0.3.1/go.mod h1:xHWCNGjB5oqiDr8zfno3MHue2Ht5sIBksp03qcyfWMU=
|
||||
github.com/DataDog/zstd v1.4.0/go.mod h1:1jcaCB/ufaK+sKp1NBhlGmpz41jOoPQ35bpF36t7BBo=
|
||||
github.com/Microsoft/go-winio v0.4.12 h1:xAfWHN1IrQ0NJ9TBC0KBZoqLjzDTr1ML+4MywiUOryc=
|
||||
github.com/Microsoft/go-winio v0.4.12/go.mod h1:VhR8bwka0BXejwEJY73c50VrPtXAaKcyvVC4A4RozmA=
|
||||
github.com/Microsoft/hcsshim v0.8.6 h1:ZfF0+zZeYdzMIVMZHKtDKJvLHj76XCuVae/jNkjj0IA=
|
||||
github.com/Microsoft/hcsshim v0.8.6/go.mod h1:Op3hHsoHPAvb6lceZHDtd9OkTew38wNoXnJs8iY7rUg=
|
||||
github.com/VividCortex/ewma v1.1.1 h1:MnEK4VOv6n0RSY4vtRe3h11qjxL3+t0B8yOL8iMXdcM=
|
||||
github.com/VividCortex/ewma v1.1.1/go.mod h1:2Tkkvm3sRDVXaiyucHiACn4cqf7DpdyLvmxzcbUokwA=
|
||||
github.com/containerd/continuity v0.0.0-20180216233310-d8fb8589b0e8 h1:ZZOFPzvZO3N0f4LIQvZi68F2XDAMl/gqBfFMVjY6B3Y=
|
||||
github.com/containerd/continuity v0.0.0-20180216233310-d8fb8589b0e8/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y=
|
||||
github.com/containers/buildah v1.8.4 h1:06c+UNeEWMa2wA1Z7muZ0ZqUzE91sDuZJbB0BiZaeYQ=
|
||||
github.com/containers/buildah v1.8.4/go.mod h1:1CsiLJvyU+h+wOjnqJJOWuJCVcMxZOr5HN/gHGdzJxY=
|
||||
github.com/containers/image/v4 v4.0.1 h1:idNGHChj0Pyv3vLrxul2oSVMZLeFqpoq3CjLeVgapSQ=
|
||||
github.com/containers/image/v4 v4.0.1/go.mod h1:0ASJH1YgJiX/eqFZObqepgsvIA4XjCgpyfwn9pDGafA=
|
||||
github.com/containers/image/v4 v4.0.2-0.20191021195858-69340234bfc6 h1:sFL2cwC0xjphJHpa6DXhka2jTLGI5HwbnAUSAKFhg2M=
|
||||
github.com/containers/image/v4 v4.0.2-0.20191021195858-69340234bfc6/go.mod h1:0ASJH1YgJiX/eqFZObqepgsvIA4XjCgpyfwn9pDGafA=
|
||||
github.com/containers/image/v5 v5.0.0 h1:arnXgbt1ucsC/ndtSpiQY87rA0UjhF+/xQnPzqdBDn4=
|
||||
github.com/containers/image/v5 v5.0.0/go.mod h1:MgiLzCfIeo8lrHi+4Lb8HP+rh513sm0Mlk6RrhjFOLY=
|
||||
github.com/containers/libtrust v0.0.0-20190913040956-14b96171aa3b h1:Q8ePgVfHDplZ7U33NwHZkrVELsZP5fYj9pM5WBZB2GE=
|
||||
github.com/containers/libtrust v0.0.0-20190913040956-14b96171aa3b/go.mod h1:9rfv8iPl1ZP7aqh9YA68wnZv2NUDbXdcdPHVz0pFbPY=
|
||||
github.com/containers/storage v1.13.4 h1:j0bBaJDKbUHtAW1MXPFnwXJtqcH+foWeuXK1YaBV5GA=
|
||||
github.com/containers/storage v1.13.4/go.mod h1:6D8nK2sU9V7nEmAraINRs88ZEscM5C5DK+8Npp27GeA=
|
||||
github.com/davecgh/go-spew v1.1.0/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
|
||||
github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c=
|
||||
github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
|
||||
github.com/docker/distribution v0.0.0-20170817175659-5f6282db7d65 h1:4zlOyrJUbYnrvlzChJ+jP2J3i77Jbhm336NEuCv7kZo=
|
||||
github.com/docker/distribution v0.0.0-20170817175659-5f6282db7d65/go.mod h1:J2gT2udsDAN96Uj4KfcMRqY0/ypR+oyYUYmja8H+y+w=
|
||||
github.com/docker/docker v0.0.0-20171019062838-86f080cff091/go.mod h1:eEKB0N0r5NX/I1kEveEz05bcu8tLC/8azJZsviup8Sk=
|
||||
github.com/docker/docker v0.0.0-20180522102801-da99009bbb11 h1:p8hSDXZgVhyh/C9bPlG8QMY64VeXtVfjmjIlzaQok5Q=
|
||||
github.com/docker/docker v0.0.0-20180522102801-da99009bbb11/go.mod h1:eEKB0N0r5NX/I1kEveEz05bcu8tLC/8azJZsviup8Sk=
|
||||
github.com/docker/docker-credential-helpers v0.6.0 h1:5bhDRLn1roGiNjz8IezRngHxMfoeaXGyr0BeMHq4rD8=
|
||||
github.com/docker/docker-credential-helpers v0.6.0/go.mod h1:WRaJzqw3CTB9bk10avuGsjVBZsD05qeibJ1/TYlvc0Y=
|
||||
github.com/docker/go-connections v0.0.0-20180212134524-7beb39f0b969 h1:p2WzwcFof6KwsloLgCiAKkU5DJSVgOKGdevswAmskvY=
|
||||
github.com/docker/go-connections v0.0.0-20180212134524-7beb39f0b969/go.mod h1:Gbd7IOopHjR8Iph03tsViu4nIes5XhDvyHbTtUxmeec=
|
||||
github.com/docker/go-units v0.4.0 h1:3uh0PgVws3nIA0Q+MwDC8yjEPf9zjRfZZWXZYDct3Tw=
|
||||
github.com/docker/go-units v0.4.0/go.mod h1:fgPhTUdO+D/Jk86RDLlptpiXQzgHJF7gydDDbaIK4Dk=
|
||||
github.com/docker/libtrust v0.0.0-20160708172513-aabc10ec26b7 h1:UhxFibDNY/bfvqU5CAUmr9zpesgbU6SWc8/B4mflAE4=
|
||||
github.com/docker/libtrust v0.0.0-20160708172513-aabc10ec26b7/go.mod h1:cyGadeNEkKy96OOhEzfZl+yxihPEzKnqJwvfuSUqbZE=
|
||||
github.com/dsnet/compress v0.0.1 h1:PlZu0n3Tuv04TzpfPbrnI0HW/YwodEXDS+oPKahKF0Q=
|
||||
github.com/dsnet/compress v0.0.1/go.mod h1:Aw8dCMJ7RioblQeTqt88akK31OvO8Dhf5JflhBbQEHo=
|
||||
github.com/dsnet/golib v0.0.0-20171103203638-1ea166775780/go.mod h1:Lj+Z9rebOhdfkVLjJ8T6VcRQv3SXugXy999NBtR9aFY=
|
||||
github.com/etcd-io/bbolt v1.3.3 h1:gSJmxrs37LgTqR/oyJBWok6k6SvXEUerFTbltIhXkBM=
|
||||
github.com/etcd-io/bbolt v1.3.3/go.mod h1:ZF2nL25h33cCyBtcyWeZ2/I3HQOfTP+0PIEvHjkjCrw=
|
||||
github.com/ghodss/yaml v0.0.0-20161207003320-04f313413ffd h1:U3yHrYB7NWH2o3UFzJ1J+TknZqM9QQtF8KVIE6Qzrfs=
|
||||
github.com/ghodss/yaml v0.0.0-20161207003320-04f313413ffd/go.mod h1:4dBDuWmgqj2HViK6kFavaiC9ZROes6MMH2rRYeMEF04=
|
||||
github.com/go-check/check v0.0.0-20180628173108-788fd7840127 h1:0gkP6mzaMqkmpcJYCFOLkIBwI7xFExG03bbkOkCvUPI=
|
||||
github.com/go-check/check v0.0.0-20180628173108-788fd7840127/go.mod h1:9ES+weclKsC9YodN5RgxqK/VD9HM9JsCSh7rNhMZE98=
|
||||
github.com/gogo/protobuf v0.0.0-20170815085658-fcdc5011193f h1:r/AdTzqktq9nQpFlFePWcp+scVi+oFRajfjRJ3UnETg=
|
||||
github.com/gogo/protobuf v0.0.0-20170815085658-fcdc5011193f/go.mod h1:r8qH/GZQm5c6nD/R0oafs1akxWv10x8SbQlK7atdtwQ=
|
||||
github.com/google/go-cmp v0.2.0 h1:+dTQ8DZQJz0Mb/HjFlkptS1FeQ4cWSnN941F8aEG4SQ=
|
||||
github.com/google/go-cmp v0.2.0/go.mod h1:oXzfMopK8JAjlY9xF4vHSVASa0yLyX7SntLO5aqRK0M=
|
||||
github.com/gorilla/context v1.1.1 h1:AWwleXJkX/nhcU9bZSnZoi3h/qGYqQAGhq6zZe/aQW8=
|
||||
github.com/gorilla/context v1.1.1/go.mod h1:kBGZzfjB9CEq2AlWe17Uuf7NDRt0dE0s8S51q0aT7Yg=
|
||||
github.com/gorilla/mux v0.0.0-20170217192616-94e7d24fd285 h1:pBGAMRKP7Tpv4mOq+RgzKz+jAj+ylo9O8PiNoMmCuu8=
|
||||
github.com/gorilla/mux v0.0.0-20170217192616-94e7d24fd285/go.mod h1:1lud6UwP+6orDFRuTfBEV8e9/aOM/c4fVVCaMa2zaAs=
|
||||
github.com/gotestyourself/gotestyourself v2.2.0+incompatible h1:AQwinXlbQR2HvPjQZOmDhRqsv5mZf+Jb1RnSLxcqZcI=
|
||||
github.com/gotestyourself/gotestyourself v2.2.0+incompatible/go.mod h1:zZKM6oeNM8k+FRljX1mnzVYeS8wiGgQyvST1/GafPbY=
|
||||
github.com/imdario/mergo v0.3.5 h1:JboBksRwiiAJWvIYJVo46AfV+IAIKZpfrSzVKj42R4Q=
|
||||
github.com/imdario/mergo v0.3.5/go.mod h1:2EnlNZ0deacrJVfApfmtdGgDfMuh/nq6Ok1EcJh5FfA=
|
||||
github.com/klauspost/compress v1.4.1 h1:8VMb5+0wMgdBykOV96DwNwKFQ+WTI4pzYURP99CcB9E=
|
||||
github.com/klauspost/compress v1.4.1/go.mod h1:RyIbtBH6LamlWaDj8nUwkbUhJ87Yi3uG0guNDohfE1A=
|
||||
github.com/klauspost/compress v1.7.2 h1:liMOoeIvFpr9kEvalrZ7VVBA4wGf7zfOgwBjzz/5g2Y=
|
||||
github.com/klauspost/compress v1.7.2/go.mod h1:RyIbtBH6LamlWaDj8nUwkbUhJ87Yi3uG0guNDohfE1A=
|
||||
github.com/klauspost/compress v1.8.1 h1:oygt2ychZFHOB6M9gUgajzgKrwRgHbGC77NwA4COVgI=
|
||||
github.com/klauspost/compress v1.8.1/go.mod h1:RyIbtBH6LamlWaDj8nUwkbUhJ87Yi3uG0guNDohfE1A=
|
||||
github.com/klauspost/cpuid v1.2.0 h1:NMpwD2G9JSFOE1/TJjGSo5zG7Yb2bTe7eq1jH+irmeE=
|
||||
github.com/klauspost/cpuid v1.2.0/go.mod h1:Pj4uuM528wm8OyEC2QMXAi2YiTZ96dNQPGgoMS4s3ek=
|
||||
github.com/klauspost/cpuid v1.2.1 h1:vJi+O/nMdFt0vqm8NZBI6wzALWdA2X+egi0ogNyrC/w=
|
||||
github.com/klauspost/cpuid v1.2.1/go.mod h1:Pj4uuM528wm8OyEC2QMXAi2YiTZ96dNQPGgoMS4s3ek=
|
||||
github.com/klauspost/pgzip v1.2.1 h1:oIPZROsWuPHpOdMVWLuJZXwgjhrW8r1yEX8UqMyeNHM=
|
||||
github.com/klauspost/pgzip v1.2.1/go.mod h1:Ch1tH69qFZu15pkjo5kYi6mth2Zzwzt50oCQKQE9RUs=
|
||||
github.com/konsorten/go-windows-terminal-sequences v1.0.1 h1:mweAR1A6xJ3oS2pRaGiHgQ4OO8tzTaLawm8vnODuwDk=
|
||||
github.com/konsorten/go-windows-terminal-sequences v1.0.1/go.mod h1:T0+1ngSBFLxvqU3pZ+m/2kptfBszLMUkC4ZK/EgS/cQ=
|
||||
github.com/konsorten/go-windows-terminal-sequences v1.0.2 h1:DB17ag19krx9CFsz4o3enTrPXyIXCl+2iCXH/aMAp9s=
|
||||
github.com/konsorten/go-windows-terminal-sequences v1.0.2/go.mod h1:T0+1ngSBFLxvqU3pZ+m/2kptfBszLMUkC4ZK/EgS/cQ=
|
||||
github.com/kr/pretty v0.1.0 h1:L/CwN0zerZDmRFUapSPitk6f+Q3+0za1rQkzVuMiMFI=
|
||||
github.com/kr/pretty v0.1.0/go.mod h1:dAy3ld7l9f0ibDNOQOHHMYYIIbhfbHSm3C4ZsoJORNo=
|
||||
github.com/kr/pty v1.1.1/go.mod h1:pFQYn66WHrOpPYNljwOMqo10TkYh1fy3cYio2l3bCsQ=
|
||||
github.com/kr/text v0.1.0 h1:45sCR5RtlFHMR4UwH9sdQ5TC8v0qDQCHnXt+kaKSTVE=
|
||||
github.com/kr/text v0.1.0/go.mod h1:4Jbv+DJW3UT/LiOwJeYQe1efqtUx/iVham/4vfdArNI=
|
||||
github.com/mattn/go-isatty v0.0.4 h1:bnP0vzxcAdeI1zdubAl5PjU6zsERjGZb7raWodagDYs=
|
||||
github.com/mattn/go-isatty v0.0.4/go.mod h1:M+lRXTBqGeGNdLjl/ufCoiOlB5xdOkqRJdNxMWT7Zi4=
|
||||
github.com/mattn/go-shellwords v1.0.5 h1:JhhFTIOslh5ZsPrpa3Wdg8bF0WI3b44EMblmU9wIsXc=
|
||||
github.com/mattn/go-shellwords v1.0.5/go.mod h1:3xCvwCdWdlDJUrvuMn7Wuy9eWs4pE8vqg+NOMyg4B2o=
|
||||
github.com/mistifyio/go-zfs v2.1.1+incompatible h1:gAMO1HM9xBRONLHHYnu5iFsOJUiJdNZo6oqSENd4eW8=
|
||||
github.com/mistifyio/go-zfs v2.1.1+incompatible/go.mod h1:8AuVvqP/mXw1px98n46wfvcGfQ4ci2FwoAjKYxuo3Z4=
|
||||
github.com/mtrmac/gpgme v0.0.0-20170102180018-b2432428689c h1:xa+eQWKuJ9MbB9FBL/eoNvDFvveAkz2LQoz8PzX7Q/4=
|
||||
github.com/mtrmac/gpgme v0.0.0-20170102180018-b2432428689c/go.mod h1:GhAqVMEWnTcW2dxoD/SO3n2enrgWl3y6Dnx4m59GvcA=
|
||||
github.com/mtrmac/image/v4 v4.0.0-20191002203927-a64d9d2717f4 h1:AE5cilZfrGtAgMg5Ed4c2Y2KczlOsMVZAK055sSq+gc=
|
||||
github.com/mtrmac/image/v4 v4.0.0-20191002203927-a64d9d2717f4/go.mod h1:0ASJH1YgJiX/eqFZObqepgsvIA4XjCgpyfwn9pDGafA=
|
||||
github.com/mtrmac/image/v4 v4.0.0-20191003181245-f4c983e93262 h1:HMUEnWU3OPT09JRFQLn8VTp3GfdfiEhDMAEhkdX8QnA=
|
||||
github.com/mtrmac/image/v4 v4.0.0-20191003181245-f4c983e93262/go.mod h1:0ASJH1YgJiX/eqFZObqepgsvIA4XjCgpyfwn9pDGafA=
|
||||
github.com/mtrmac/image/v4 v4.0.0-20191003205427-4e53c7e04270 h1:pDOlOCB9naHCcv/RXWO129Dd03r710hQ2N83egZIf7A=
|
||||
github.com/mtrmac/image/v4 v4.0.0-20191003205427-4e53c7e04270/go.mod h1:0ASJH1YgJiX/eqFZObqepgsvIA4XjCgpyfwn9pDGafA=
|
||||
github.com/opencontainers/go-digest v1.0.0-rc1 h1:WzifXhOVOEOuFYOJAW6aQqW0TooG2iki3E3Ii+WN7gQ=
|
||||
github.com/opencontainers/go-digest v1.0.0-rc1/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s=
|
||||
github.com/opencontainers/image-spec v1.0.2-0.20190823105129-775207bd45b6 h1:yN8BPXVwMBAm3Cuvh1L5XE8XpvYRMdsVLd82ILprhUU=
|
||||
github.com/opencontainers/image-spec v1.0.2-0.20190823105129-775207bd45b6/go.mod h1:BtxoFyWECRxE4U/7sNtV5W15zMzWCbyJoFRP3s7yZA0=
|
||||
github.com/opencontainers/image-tools v0.0.0-20170926011501-6d941547fa1d h1:X9WSFjjZNqYRqO2MenUgqE2nj/oydcfIzXJ0R/SVnnA=
|
||||
github.com/opencontainers/image-tools v0.0.0-20170926011501-6d941547fa1d/go.mod h1:A9btVpZLzttF4iFaKNychhPyrhfOjJ1OF5KrA8GcLj4=
|
||||
github.com/opencontainers/runc v1.0.0-rc8 h1:dDCFes8Hj1r/i5qnypONo5jdOme/8HWZC/aNDyhECt0=
|
||||
github.com/opencontainers/runc v1.0.0-rc8/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U=
|
||||
github.com/opencontainers/runtime-spec v1.0.0 h1:O6L965K88AilqnxeYPks/75HLpp4IG+FjeSCI3cVdRg=
|
||||
github.com/opencontainers/runtime-spec v1.0.0/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0=
|
||||
github.com/opencontainers/selinux v1.2.2 h1:Kx9J6eDG5/24A6DtUquGSpJQ+m2MUTahn4FtGEe8bFg=
|
||||
github.com/opencontainers/selinux v1.2.2/go.mod h1:+BLncwf63G4dgOzykXAxcmnFlUaOlkDdmw/CqsW6pjs=
|
||||
github.com/ostreedev/ostree-go v0.0.0-20190702140239-759a8c1ac913 h1:TnbXhKzrTOyuvWrjI8W6pcoI9XPbLHFXCdN2dtUw7Rw=
|
||||
github.com/ostreedev/ostree-go v0.0.0-20190702140239-759a8c1ac913/go.mod h1:J6OG6YJVEWopen4avK3VNQSnALmmjvniMmni/YFYAwc=
|
||||
github.com/pkg/errors v0.8.0/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0=
|
||||
github.com/pkg/errors v0.8.1 h1:iURUrRGxPUNPdy5/HRSm+Yj6okJ6UtLINN0Q9M4+h3I=
|
||||
github.com/pkg/errors v0.8.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0=
|
||||
github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM=
|
||||
github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4=
|
||||
github.com/pquerna/ffjson v0.0.0-20181028064349-e517b90714f7 h1:gGBSHPOU7g8YjTbhwn+lvFm2VDEhhA+PwDIlstkgSxE=
|
||||
github.com/pquerna/ffjson v0.0.0-20181028064349-e517b90714f7/go.mod h1:YARuvh7BUWHNhzDq2OM5tzR2RiCcN2D7sapiKyCel/M=
|
||||
github.com/pquerna/ffjson v0.0.0-20190813045741-dac163c6c0a9 h1:kyf9snWXHvQc+yxE9imhdI8YAm4oKeZISlaAR+x73zs=
|
||||
github.com/pquerna/ffjson v0.0.0-20190813045741-dac163c6c0a9/go.mod h1:YARuvh7BUWHNhzDq2OM5tzR2RiCcN2D7sapiKyCel/M=
|
||||
github.com/russross/blackfriday v2.0.0+incompatible h1:cBXrhZNUf9C+La9/YpS+UHpUT8YD6Td9ZMSU9APFcsk=
|
||||
github.com/russross/blackfriday v2.0.0+incompatible/go.mod h1:JO/DiYxRf+HjHt06OyowR9PTA263kcR/rfWxYHBV53g=
|
||||
github.com/shurcooL/sanitized_anchor_name v1.0.0 h1:PdmoCO6wvbs+7yrJyMORt4/BmY5IYyJwS/kOiWx8mHo=
|
||||
github.com/shurcooL/sanitized_anchor_name v1.0.0/go.mod h1:1NzhyTcUVG4SuEtjjoZeVRXNmyL/1OwPU0+IJeTBvfc=
|
||||
github.com/sirupsen/logrus v1.4.2 h1:SPIRibHv4MatM3XXNO2BJeFLZwZ2LvZgfQ5+UNI2im4=
|
||||
github.com/sirupsen/logrus v1.4.2/go.mod h1:tLMulIdttU9McNUspp0xgXVQah82FyeX6MwdIuYE2rE=
|
||||
github.com/spf13/pflag v1.0.3/go.mod h1:DYY7MBk1bdzusC3SYhjObp+wFpr4gzcvqqNjLnInEg4=
|
||||
github.com/stretchr/objx v0.1.0/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME=
|
||||
github.com/stretchr/objx v0.1.1/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME=
|
||||
github.com/stretchr/testify v1.2.2/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXfy6kDkUVs=
|
||||
github.com/stretchr/testify v1.3.0 h1:TivCn/peBQ7UY8ooIcPgZFpTNSz0Q2U6UrFlUfqbe0Q=
|
||||
github.com/stretchr/testify v1.3.0/go.mod h1:M5WIy9Dh21IEIfnGCwXGc5bZfKNJtfHm1UVUgZn+9EI=
|
||||
github.com/stretchr/testify v1.4.0 h1:2E4SXV/wtOkTonXsotYi4li6zVWxYlZuYNCXe9XRJyk=
|
||||
github.com/stretchr/testify v1.4.0/go.mod h1:j7eGeouHqKxXV5pUuKE4zz7dFj8WfuZ+81PSLYec5m4=
|
||||
github.com/syndtr/gocapability v0.0.0-20180916011248-d98352740cb2 h1:b6uOv7YOFK0TYG7HtkIgExQo+2RdLuwRft63jn2HWj8=
|
||||
github.com/syndtr/gocapability v0.0.0-20180916011248-d98352740cb2/go.mod h1:hkRG7XYTFWNJGYcbNJQlaLq0fg1yr4J4t/NcTQtrfww=
|
||||
github.com/tchap/go-patricia v2.3.0+incompatible h1:GkY4dP3cEfEASBPPkWd+AmjYxhmDkqO9/zg7R0lSQRs=
|
||||
github.com/tchap/go-patricia v2.3.0+incompatible/go.mod h1:bmLyhP68RS6kStMGxByiQ23RP/odRBOTVjwp2cDyi6I=
|
||||
github.com/ulikunitz/xz v0.5.6 h1:jGHAfXawEGZQ3blwU5wnWKQJvAraT7Ftq9EXjnXYgt8=
|
||||
github.com/ulikunitz/xz v0.5.6/go.mod h1:2bypXElzHzzJZwzH67Y6wb67pO62Rzfn7BSiF4ABRW8=
|
||||
github.com/urfave/cli v1.20.0 h1:fDqGv3UG/4jbVl/QkFwEdddtEDjh/5Ov6X+0B/3bPaw=
|
||||
github.com/urfave/cli v1.20.0/go.mod h1:70zkFmudgCuE/ngEzBv17Jvp/497gISqfk5gWijbERA=
|
||||
github.com/vbatts/tar-split v0.11.1 h1:0Odu65rhcZ3JZaPHxl7tCI3V/C/Q9Zf82UFravl02dE=
|
||||
github.com/vbatts/tar-split v0.11.1/go.mod h1:LEuURwDEiWjRjwu46yU3KVGuUdVv/dcnpcEPSzR8z6g=
|
||||
github.com/vbauerster/mpb v3.4.0+incompatible h1:mfiiYw87ARaeRW6x5gWwYRUawxaW1tLAD8IceomUCNw=
|
||||
github.com/vbauerster/mpb v3.4.0+incompatible/go.mod h1:zAHG26FUhVKETRu+MWqYXcI70POlC6N8up9p1dID7SU=
|
||||
github.com/xeipuuv/gojsonpointer v0.0.0-20180127040702-4e3ac2762d5f h1:J9EGpcZtP0E/raorCMxlFGSTBrsSlaDGf3jU/qvAE2c=
|
||||
github.com/xeipuuv/gojsonpointer v0.0.0-20180127040702-4e3ac2762d5f/go.mod h1:N2zxlSyiKSe5eX1tZViRH5QA0qijqEDrYZiPEAiq3wU=
|
||||
github.com/xeipuuv/gojsonpointer v0.0.0-20190809123943-df4f5c81cb3b h1:6cLsL+2FW6dRAdl5iMtHgRogVCff0QpRi9653YmdcJA=
|
||||
github.com/xeipuuv/gojsonpointer v0.0.0-20190809123943-df4f5c81cb3b/go.mod h1:N2zxlSyiKSe5eX1tZViRH5QA0qijqEDrYZiPEAiq3wU=
|
||||
github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415 h1:EzJWgHovont7NscjpAxXsDA8S8BMYve8Y5+7cuRE7R0=
|
||||
github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415/go.mod h1:GwrjFmJcFw6At/Gs6z4yjiIwzuJ1/+UwLxMQDVQXShQ=
|
||||
github.com/xeipuuv/gojsonschema v0.0.0-20190816131739-be0936907f66/go.mod h1:anYRn/JVcOK2ZgGU+IjEV4nwlhoK5sQluxsYJ78Id3Y=
|
||||
github.com/xeipuuv/gojsonschema v1.1.0 h1:ngVtJC9TY/lg0AA/1k48FYhBrhRoFlEmWzsehpNAaZg=
|
||||
github.com/xeipuuv/gojsonschema v1.1.0/go.mod h1:5yf86TLmAcydyeJq5YvxkGPE2fm/u4myDekKRoLuqhs=
|
||||
go.etcd.io/bbolt v1.3.3 h1:MUGmc65QhB3pIlaQ5bB4LwqSj6GIonVJXpZiaKNyaKk=
|
||||
go.etcd.io/bbolt v1.3.3/go.mod h1:IbVyRI1SCnLcuJnV2u8VeU0CEYM7e686BmAb1XKL+uU=
|
||||
go4.org v0.0.0-20190218023631-ce4c26f7be8e h1:m9LfARr2VIOW0vsV19kEKp/sWQvZnGobA8JHui/XJoY=
|
||||
go4.org v0.0.0-20190218023631-ce4c26f7be8e/go.mod h1:MkTOUMDaeVYJUOUsaDXIhWPZYa1yOyC1qaOBpL57BhE=
|
||||
golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2 h1:VklqNMn3ovrHsnt90PveolxSbWFaJdECFbxSq0Mqo2M=
|
||||
golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACkg1iLfiJU5Ep61QUkGW8qpdssI0+w=
|
||||
golang.org/x/net v0.0.0-20190628185345-da137c7871d7 h1:rTIdg5QFRR7XCaK4LCjBiPbx8j4DQRpdYMnGn/bJUEU=
|
||||
golang.org/x/net v0.0.0-20190628185345-da137c7871d7/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s=
|
||||
golang.org/x/sync v0.0.0-20181108010431-42b317875d0f h1:Bl/8QSvNqXvPGPGXa2z5xUTmV7VDcZyvRZ+QQXkXTZQ=
|
||||
golang.org/x/sync v0.0.0-20181108010431-42b317875d0f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
|
||||
golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
|
||||
golang.org/x/sys v0.0.0-20190422165155-953cdadca894/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20190626221950-04f50cda93cb h1:fgwFCsaw9buMuxNd6+DQfAuSFqbNiQZpcgJQAgJsK6k=
|
||||
golang.org/x/sys v0.0.0-20190626221950-04f50cda93cb/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20190902133755-9109b7679e13 h1:tdsQdquKbTNMsSZLqnLELJGzCANp9oXhu6zFBW6ODx4=
|
||||
golang.org/x/sys v0.0.0-20190902133755-9109b7679e13/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/text v0.3.0 h1:g61tztE5qeGQ89tm6NTjjM9VPIm088od1l6aSorWRWg=
|
||||
golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ=
|
||||
golang.org/x/tools v0.0.0-20180810170437-e96c4e24768d/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ=
|
||||
gopkg.in/check.v1 v0.0.0-20161208181325-20d25e280405/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0=
|
||||
gopkg.in/check.v1 v1.0.0-20190902080502-41f04d3bba15 h1:YR8cESwS4TdDjEe65xsg0ogRM/Nc3DYOhEAlW+xobZo=
|
||||
gopkg.in/check.v1 v1.0.0-20190902080502-41f04d3bba15/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0=
|
||||
gopkg.in/yaml.v2 v2.2.2 h1:ZCJp+EgiOT7lHqUV2J862kp8Qj64Jo6az82+3Td9dZw=
|
||||
gopkg.in/yaml.v2 v2.2.2/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
|
||||
gotest.tools v0.0.0-20190624233834-05ebafbffc79 h1:C+K4iPg1rIvmCf4JjelkbWv2jeWevEwp05Lz8XfTYgE=
|
||||
gotest.tools v0.0.0-20190624233834-05ebafbffc79/go.mod h1:R//lfYlUuTOTfblYI3lGoAAAebUdzjvbmQsuB7Ykd90=
|
||||
k8s.io/client-go v0.0.0-20170217214107-bcde30fb7eae/go.mod h1:7vJpHMYJwNQCWgzmNV+VYUl1zCObLyodBc8nIyt8L5s=
|
||||
k8s.io/client-go v0.0.0-20181219152756-3dd551c0f083 h1:+Qf/nITucAbm09aIdxvoA+7X0BwaXmQGVoR8k7Ynk9o=
|
||||
k8s.io/client-go v0.0.0-20181219152756-3dd551c0f083/go.mod h1:7vJpHMYJwNQCWgzmNV+VYUl1zCObLyodBc8nIyt8L5s=
|
||||
@@ -10,6 +10,5 @@ bundle_test_integration() {
|
||||
(
|
||||
make binary-local ${BUILDTAGS:+BUILDTAGS="$BUILDTAGS"}
|
||||
make install
|
||||
export GO15VENDOREXPERIMENT=1
|
||||
bundle_test_integration
|
||||
) 2>&1
|
||||
|
||||
18
hack/make/test-system
Executable file
18
hack/make/test-system
Executable file
@@ -0,0 +1,18 @@
|
||||
#!/bin/bash
|
||||
set -e
|
||||
|
||||
# Before running podman for the first time, make sure
|
||||
# to set storage to vfs (not overlay): podman-in-podman
|
||||
# doesn't work with overlay. And, disable mountopt,
|
||||
# which causes error with vfs.
|
||||
sed -i \
|
||||
-e 's/^driver\s*=.*/driver = "vfs"/' \
|
||||
-e 's/^mountopt/#mountopt/' \
|
||||
/etc/containers/storage.conf
|
||||
|
||||
# Build skopeo, install into /usr/bin
|
||||
make binary-local ${BUILDTAGS:+BUILDTAGS="$BUILDTAGS"}
|
||||
make install
|
||||
|
||||
# Run tests
|
||||
SKOPEO_BINARY=/usr/bin/skopeo bats --tap systemtest
|
||||
@@ -1,6 +1,11 @@
|
||||
#!/bin/bash
|
||||
if pkg-config ostree-1 2> /dev/null ; then
|
||||
echo ostree
|
||||
else
|
||||
echo containers_image_ostree_stub
|
||||
|
||||
if test $(${GO:-go} env GOOS) != "linux" ; then
|
||||
exit 0
|
||||
fi
|
||||
|
||||
if pkg-config ostree-1 &> /dev/null ; then
|
||||
# ostree: used by containers/storage
|
||||
# containers_image_ostree: used by containers/image
|
||||
echo "ostree containers_image_ostree"
|
||||
fi
|
||||
|
||||
@@ -9,7 +9,7 @@ mkdir -vp ${_containers}
|
||||
ln -vsf $(pwd) ${_containers}/skopeo
|
||||
|
||||
go version
|
||||
go get -u github.com/cpuguy83/go-md2man golang.org/x/lint/golint
|
||||
GO111MODULE=off go get -u github.com/cpuguy83/go-md2man golang.org/x/lint/golint
|
||||
|
||||
cd ${_containers}/skopeo
|
||||
make validate-local test-unit-local binary-local
|
||||
|
||||
34
integration/blocked_test.go
Normal file
34
integration/blocked_test.go
Normal file
@@ -0,0 +1,34 @@
|
||||
package main
|
||||
|
||||
import (
|
||||
"github.com/go-check/check"
|
||||
)
|
||||
|
||||
const blockedRegistriesConf = "./fixtures/blocked-registries.conf"
|
||||
const blockedErrorRegex = `.*registry registry-blocked.com is blocked in .*`
|
||||
|
||||
func (s *SkopeoSuite) TestCopyBlockedSource(c *check.C) {
|
||||
assertSkopeoFails(c, blockedErrorRegex,
|
||||
"--registries-conf", blockedRegistriesConf, "copy",
|
||||
"docker://registry-blocked.com/image:test",
|
||||
"docker://registry-unblocked.com/image:test")
|
||||
}
|
||||
|
||||
func (s *SkopeoSuite) TestCopyBlockedDestination(c *check.C) {
|
||||
assertSkopeoFails(c, blockedErrorRegex,
|
||||
"--registries-conf", blockedRegistriesConf, "copy",
|
||||
"docker://registry-unblocked.com/image:test",
|
||||
"docker://registry-blocked.com/image:test")
|
||||
}
|
||||
|
||||
func (s *SkopeoSuite) TestInspectBlocked(c *check.C) {
|
||||
assertSkopeoFails(c, blockedErrorRegex,
|
||||
"--registries-conf", blockedRegistriesConf, "inspect",
|
||||
"docker://registry-blocked.com/image:test")
|
||||
}
|
||||
|
||||
func (s *SkopeoSuite) TestDeleteBlocked(c *check.C) {
|
||||
assertSkopeoFails(c, blockedErrorRegex,
|
||||
"--registries-conf", blockedRegistriesConf, "delete",
|
||||
"docker://registry-blocked.com/image:test")
|
||||
}
|
||||
@@ -87,3 +87,7 @@ func (s *SkopeoSuite) TestNoNeedAuthToPrivateRegistryV2ImageNotFound(c *check.C)
|
||||
wanted = ".*unauthorized: authentication required.*"
|
||||
c.Assert(string(out), check.Not(check.Matches), "(?s)"+wanted) // (?s) : '.' will also match newlines
|
||||
}
|
||||
|
||||
func (s *SkopeoSuite) TestInspectFailsWhenReferenceIsInvalid(c *check.C) {
|
||||
assertSkopeoFails(c, `.*Invalid image name.*`, "inspect", "unknown")
|
||||
}
|
||||
|
||||
@@ -11,10 +11,11 @@ import (
|
||||
"path/filepath"
|
||||
"strings"
|
||||
|
||||
"github.com/containers/image/manifest"
|
||||
"github.com/containers/image/signature"
|
||||
"github.com/containers/image/v5/manifest"
|
||||
"github.com/containers/image/v5/signature"
|
||||
"github.com/containers/image/v5/types"
|
||||
"github.com/go-check/check"
|
||||
"github.com/opencontainers/go-digest"
|
||||
digest "github.com/opencontainers/go-digest"
|
||||
imgspecv1 "github.com/opencontainers/image-spec/specs-go/v1"
|
||||
"github.com/opencontainers/image-tools/image"
|
||||
)
|
||||
@@ -26,6 +27,7 @@ func init() {
|
||||
const (
|
||||
v2DockerRegistryURL = "localhost:5555" // Update also policy.json
|
||||
v2s1DockerRegistryURL = "localhost:5556"
|
||||
knownWindowsOnlyImage = "docker://mcr.microsoft.com/windows/servercore:ltsc2019"
|
||||
)
|
||||
|
||||
type CopySuite struct {
|
||||
@@ -64,7 +66,7 @@ func (s *CopySuite) SetUpSuite(c *check.C) {
|
||||
os.Setenv("GNUPGHOME", s.gpgHome)
|
||||
|
||||
for _, key := range []string{"personal", "official"} {
|
||||
batchInput := fmt.Sprintf("Key-Type: RSA\nName-Real: Test key - %s\nName-email: %s@example.com\n%%commit\n",
|
||||
batchInput := fmt.Sprintf("Key-Type: RSA\nName-Real: Test key - %s\nName-email: %s@example.com\n%%no-protection\n%%commit\n",
|
||||
key, key)
|
||||
runCommandWithInput(c, batchInput, gpgBinary, "--batch", "--gen-key")
|
||||
|
||||
@@ -97,9 +99,382 @@ func (s *CopySuite) TestCopyWithManifestList(c *check.C) {
|
||||
assertSkopeoSucceeds(c, "", "copy", "docker://estesp/busybox:latest", "dir:"+dir)
|
||||
}
|
||||
|
||||
func (s *CopySuite) TestCopyAllWithManifestList(c *check.C) {
|
||||
dir, err := ioutil.TempDir("", "copy-all-manifest-list")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(dir)
|
||||
assertSkopeoSucceeds(c, "", "copy", "--all", "docker://estesp/busybox:latest", "dir:"+dir)
|
||||
}
|
||||
|
||||
func (s *CopySuite) TestCopyAllWithManifestListRoundTrip(c *check.C) {
|
||||
oci1, err := ioutil.TempDir("", "copy-all-manifest-list-oci")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(oci1)
|
||||
oci2, err := ioutil.TempDir("", "copy-all-manifest-list-oci")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(oci2)
|
||||
dir1, err := ioutil.TempDir("", "copy-all-manifest-list-dir")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(dir1)
|
||||
dir2, err := ioutil.TempDir("", "copy-all-manifest-list-dir")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(dir2)
|
||||
assertSkopeoSucceeds(c, "", "copy", "--all", "docker://estesp/busybox:latest", "oci:"+oci1)
|
||||
assertSkopeoSucceeds(c, "", "copy", "--all", "oci:"+oci1, "dir:"+dir1)
|
||||
assertSkopeoSucceeds(c, "", "copy", "--all", "dir:"+dir1, "oci:"+oci2)
|
||||
assertSkopeoSucceeds(c, "", "copy", "--all", "oci:"+oci2, "dir:"+dir2)
|
||||
assertDirImagesAreEqual(c, dir1, dir2)
|
||||
out := combinedOutputOfCommand(c, "diff", "-urN", oci1, oci2)
|
||||
c.Assert(out, check.Equals, "")
|
||||
}
|
||||
|
||||
func (s *CopySuite) TestCopyAllWithManifestListConverge(c *check.C) {
|
||||
oci1, err := ioutil.TempDir("", "copy-all-manifest-list-oci")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(oci1)
|
||||
oci2, err := ioutil.TempDir("", "copy-all-manifest-list-oci")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(oci2)
|
||||
dir1, err := ioutil.TempDir("", "copy-all-manifest-list-dir")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(dir1)
|
||||
dir2, err := ioutil.TempDir("", "copy-all-manifest-list-dir")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(dir2)
|
||||
assertSkopeoSucceeds(c, "", "copy", "--all", "docker://estesp/busybox:latest", "oci:"+oci1)
|
||||
assertSkopeoSucceeds(c, "", "copy", "--all", "oci:"+oci1, "dir:"+dir1)
|
||||
assertSkopeoSucceeds(c, "", "copy", "--all", "--format", "oci", "docker://estesp/busybox:latest", "dir:"+dir2)
|
||||
assertSkopeoSucceeds(c, "", "copy", "--all", "dir:"+dir2, "oci:"+oci2)
|
||||
assertDirImagesAreEqual(c, dir1, dir2)
|
||||
out := combinedOutputOfCommand(c, "diff", "-urN", oci1, oci2)
|
||||
c.Assert(out, check.Equals, "")
|
||||
}
|
||||
|
||||
func (s *CopySuite) TestCopyWithManifestListConverge(c *check.C) {
|
||||
oci1, err := ioutil.TempDir("", "copy-all-manifest-list-oci")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(oci1)
|
||||
oci2, err := ioutil.TempDir("", "copy-all-manifest-list-oci")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(oci2)
|
||||
dir1, err := ioutil.TempDir("", "copy-all-manifest-list-dir")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(dir1)
|
||||
dir2, err := ioutil.TempDir("", "copy-all-manifest-list-dir")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(dir2)
|
||||
assertSkopeoSucceeds(c, "", "copy", "docker://estesp/busybox:latest", "oci:"+oci1)
|
||||
assertSkopeoSucceeds(c, "", "copy", "--all", "oci:"+oci1, "dir:"+dir1)
|
||||
assertSkopeoSucceeds(c, "", "copy", "--format", "oci", "docker://estesp/busybox:latest", "dir:"+dir2)
|
||||
assertSkopeoSucceeds(c, "", "copy", "--all", "dir:"+dir2, "oci:"+oci2)
|
||||
assertDirImagesAreEqual(c, dir1, dir2)
|
||||
out := combinedOutputOfCommand(c, "diff", "-urN", oci1, oci2)
|
||||
c.Assert(out, check.Equals, "")
|
||||
}
|
||||
|
||||
func (s *CopySuite) TestCopyAllWithManifestListStorageFails(c *check.C) {
|
||||
storage, err := ioutil.TempDir("", "copy-storage")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(storage)
|
||||
storage = fmt.Sprintf("[vfs@%s/root+%s/runroot]", storage, storage)
|
||||
assertSkopeoFails(c, `.*destination transport .* does not support copying multiple images as a group.*`, "copy", "--all", "docker://estesp/busybox:latest", "containers-storage:"+storage+"test")
|
||||
}
|
||||
|
||||
func (s *CopySuite) TestCopyWithManifestListStorage(c *check.C) {
|
||||
storage, err := ioutil.TempDir("", "copy-manifest-list-storage")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(storage)
|
||||
storage = fmt.Sprintf("[vfs@%s/root+%s/runroot]", storage, storage)
|
||||
dir1, err := ioutil.TempDir("", "copy-manifest-list-storage-dir")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(dir1)
|
||||
dir2, err := ioutil.TempDir("", "copy-manifest-list-storage-dir")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(dir2)
|
||||
assertSkopeoSucceeds(c, "", "copy", "docker://estesp/busybox:latest", "containers-storage:"+storage+"test")
|
||||
assertSkopeoSucceeds(c, "", "copy", "docker://estesp/busybox:latest", "dir:"+dir1)
|
||||
assertSkopeoSucceeds(c, "", "copy", "containers-storage:"+storage+"test", "dir:"+dir2)
|
||||
runDecompressDirs(c, "", dir1, dir2)
|
||||
assertDirImagesAreEqual(c, dir1, dir2)
|
||||
}
|
||||
|
||||
func (s *CopySuite) TestCopyWithManifestListStorageMultiple(c *check.C) {
|
||||
storage, err := ioutil.TempDir("", "copy-manifest-list-storage-multiple")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(storage)
|
||||
storage = fmt.Sprintf("[vfs@%s/root+%s/runroot]", storage, storage)
|
||||
dir1, err := ioutil.TempDir("", "copy-manifest-list-storage-multiple-dir")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(dir1)
|
||||
dir2, err := ioutil.TempDir("", "copy-manifest-list-storage-multiple-dir")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(dir2)
|
||||
assertSkopeoSucceeds(c, "", "--override-arch", "amd64", "copy", "docker://estesp/busybox:latest", "containers-storage:"+storage+"test")
|
||||
assertSkopeoSucceeds(c, "", "--override-arch", "arm64", "copy", "docker://estesp/busybox:latest", "containers-storage:"+storage+"test")
|
||||
assertSkopeoSucceeds(c, "", "--override-arch", "arm64", "copy", "docker://estesp/busybox:latest", "dir:"+dir1)
|
||||
assertSkopeoSucceeds(c, "", "copy", "containers-storage:"+storage+"test", "dir:"+dir2)
|
||||
runDecompressDirs(c, "", dir1, dir2)
|
||||
assertDirImagesAreEqual(c, dir1, dir2)
|
||||
}
|
||||
|
||||
func (s *CopySuite) TestCopyWithManifestListDigest(c *check.C) {
|
||||
dir1, err := ioutil.TempDir("", "copy-manifest-list-digest-dir")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(dir1)
|
||||
dir2, err := ioutil.TempDir("", "copy-manifest-list-digest-dir")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(dir2)
|
||||
oci1, err := ioutil.TempDir("", "copy-manifest-list-digest-oci")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(oci1)
|
||||
oci2, err := ioutil.TempDir("", "copy-manifest-list-digest-oci")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(oci2)
|
||||
m := combinedOutputOfCommand(c, skopeoBinary, "inspect", "--raw", "docker://estesp/busybox:latest")
|
||||
manifestDigest, err := manifest.Digest([]byte(m))
|
||||
c.Assert(err, check.IsNil)
|
||||
digest := manifestDigest.String()
|
||||
assertSkopeoSucceeds(c, "", "copy", "docker://estesp/busybox@"+digest, "dir:"+dir1)
|
||||
assertSkopeoSucceeds(c, "", "copy", "--all", "docker://estesp/busybox@"+digest, "dir:"+dir2)
|
||||
assertSkopeoSucceeds(c, "", "copy", "dir:"+dir1, "oci:"+oci1)
|
||||
assertSkopeoSucceeds(c, "", "copy", "dir:"+dir2, "oci:"+oci2)
|
||||
out := combinedOutputOfCommand(c, "diff", "-urN", oci1, oci2)
|
||||
c.Assert(out, check.Equals, "")
|
||||
}
|
||||
|
||||
func (s *CopySuite) TestCopyWithManifestListStorageDigest(c *check.C) {
|
||||
storage, err := ioutil.TempDir("", "copy-manifest-list-storage-digest")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(storage)
|
||||
storage = fmt.Sprintf("[vfs@%s/root+%s/runroot]", storage, storage)
|
||||
dir1, err := ioutil.TempDir("", "copy-manifest-list-storage-digest-dir")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(dir1)
|
||||
dir2, err := ioutil.TempDir("", "copy-manifest-list-storage-digest-dir")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(dir2)
|
||||
m := combinedOutputOfCommand(c, skopeoBinary, "inspect", "--raw", "docker://estesp/busybox:latest")
|
||||
manifestDigest, err := manifest.Digest([]byte(m))
|
||||
c.Assert(err, check.IsNil)
|
||||
digest := manifestDigest.String()
|
||||
assertSkopeoSucceeds(c, "", "copy", "docker://estesp/busybox@"+digest, "containers-storage:"+storage+"test@"+digest)
|
||||
assertSkopeoSucceeds(c, "", "copy", "containers-storage:"+storage+"test@"+digest, "dir:"+dir1)
|
||||
assertSkopeoSucceeds(c, "", "copy", "docker://estesp/busybox@"+digest, "dir:"+dir2)
|
||||
runDecompressDirs(c, "", dir1, dir2)
|
||||
assertDirImagesAreEqual(c, dir1, dir2)
|
||||
}
|
||||
|
||||
func (s *CopySuite) TestCopyWithManifestListStorageDigestMultipleArches(c *check.C) {
|
||||
storage, err := ioutil.TempDir("", "copy-manifest-list-storage-digest")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(storage)
|
||||
storage = fmt.Sprintf("[vfs@%s/root+%s/runroot]", storage, storage)
|
||||
dir1, err := ioutil.TempDir("", "copy-manifest-list-storage-digest-dir")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(dir1)
|
||||
dir2, err := ioutil.TempDir("", "copy-manifest-list-storage-digest-dir")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(dir2)
|
||||
m := combinedOutputOfCommand(c, skopeoBinary, "inspect", "--raw", "docker://estesp/busybox:latest")
|
||||
manifestDigest, err := manifest.Digest([]byte(m))
|
||||
c.Assert(err, check.IsNil)
|
||||
digest := manifestDigest.String()
|
||||
assertSkopeoSucceeds(c, "", "copy", "docker://estesp/busybox@"+digest, "containers-storage:"+storage+"test@"+digest)
|
||||
assertSkopeoSucceeds(c, "", "copy", "containers-storage:"+storage+"test@"+digest, "dir:"+dir1)
|
||||
assertSkopeoSucceeds(c, "", "copy", "docker://estesp/busybox@"+digest, "dir:"+dir2)
|
||||
runDecompressDirs(c, "", dir1, dir2)
|
||||
assertDirImagesAreEqual(c, dir1, dir2)
|
||||
}
|
||||
|
||||
func (s *CopySuite) TestCopyWithManifestListStorageDigestMultipleArchesBothUseListDigest(c *check.C) {
|
||||
storage, err := ioutil.TempDir("", "copy-manifest-list-storage-digest-multiple-arches-both")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(storage)
|
||||
storage = fmt.Sprintf("[vfs@%s/root+%s/runroot]", storage, storage)
|
||||
m := combinedOutputOfCommand(c, skopeoBinary, "inspect", "--raw", "docker://estesp/busybox:latest")
|
||||
manifestDigest, err := manifest.Digest([]byte(m))
|
||||
c.Assert(err, check.IsNil)
|
||||
digest := manifestDigest.String()
|
||||
_, err = manifest.ListFromBlob([]byte(m), manifest.GuessMIMEType([]byte(m)))
|
||||
c.Assert(err, check.IsNil)
|
||||
assertSkopeoSucceeds(c, "", "--override-arch=amd64", "copy", "docker://estesp/busybox@"+digest, "containers-storage:"+storage+"test@"+digest)
|
||||
assertSkopeoSucceeds(c, "", "--override-arch=arm64", "copy", "docker://estesp/busybox@"+digest, "containers-storage:"+storage+"test@"+digest)
|
||||
assertSkopeoFails(c, `.*error reading manifest for image instance.*does not exist.*`, "--override-arch=amd64", "inspect", "containers-storage:"+storage+"test@"+digest)
|
||||
assertSkopeoFails(c, `.*error reading manifest for image instance.*does not exist.*`, "--override-arch=amd64", "inspect", "--config", "containers-storage:"+storage+"test@"+digest)
|
||||
i2 := combinedOutputOfCommand(c, skopeoBinary, "--override-arch=arm64", "inspect", "--config", "containers-storage:"+storage+"test@"+digest)
|
||||
var image2 imgspecv1.Image
|
||||
err = json.Unmarshal([]byte(i2), &image2)
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Assert(image2.Architecture, check.Equals, "arm64")
|
||||
}
|
||||
|
||||
func (s *CopySuite) TestCopyWithManifestListStorageDigestMultipleArchesFirstUsesListDigest(c *check.C) {
|
||||
storage, err := ioutil.TempDir("", "copy-manifest-list-storage-digest-multiple-arches-first")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(storage)
|
||||
storage = fmt.Sprintf("[vfs@%s/root+%s/runroot]", storage, storage)
|
||||
m := combinedOutputOfCommand(c, skopeoBinary, "inspect", "--raw", "docker://estesp/busybox:latest")
|
||||
manifestDigest, err := manifest.Digest([]byte(m))
|
||||
c.Assert(err, check.IsNil)
|
||||
digest := manifestDigest.String()
|
||||
list, err := manifest.ListFromBlob([]byte(m), manifest.GuessMIMEType([]byte(m)))
|
||||
c.Assert(err, check.IsNil)
|
||||
amd64Instance, err := list.ChooseInstance(&types.SystemContext{ArchitectureChoice: "amd64"})
|
||||
c.Assert(err, check.IsNil)
|
||||
arm64Instance, err := list.ChooseInstance(&types.SystemContext{ArchitectureChoice: "arm64"})
|
||||
c.Assert(err, check.IsNil)
|
||||
assertSkopeoSucceeds(c, "", "--override-arch=amd64", "copy", "docker://estesp/busybox@"+digest, "containers-storage:"+storage+"test@"+digest)
|
||||
assertSkopeoSucceeds(c, "", "--override-arch=arm64", "copy", "docker://estesp/busybox@"+arm64Instance.String(), "containers-storage:"+storage+"test@"+arm64Instance.String())
|
||||
i1 := combinedOutputOfCommand(c, skopeoBinary, "--override-arch=amd64", "inspect", "--config", "containers-storage:"+storage+"test@"+digest)
|
||||
var image1 imgspecv1.Image
|
||||
err = json.Unmarshal([]byte(i1), &image1)
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Assert(image1.Architecture, check.Equals, "amd64")
|
||||
i2 := combinedOutputOfCommand(c, skopeoBinary, "--override-arch=amd64", "inspect", "--config", "containers-storage:"+storage+"test@"+amd64Instance.String())
|
||||
var image2 imgspecv1.Image
|
||||
err = json.Unmarshal([]byte(i2), &image2)
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Assert(image2.Architecture, check.Equals, "amd64")
|
||||
assertSkopeoFails(c, `.*error reading manifest for image instance.*does not exist.*`, "--override-arch=arm64", "inspect", "containers-storage:"+storage+"test@"+digest)
|
||||
assertSkopeoFails(c, `.*error reading manifest for image instance.*does not exist.*`, "--override-arch=arm64", "inspect", "--config", "containers-storage:"+storage+"test@"+digest)
|
||||
i3 := combinedOutputOfCommand(c, skopeoBinary, "--override-arch=arm64", "inspect", "--config", "containers-storage:"+storage+"test@"+arm64Instance.String())
|
||||
var image3 imgspecv1.Image
|
||||
err = json.Unmarshal([]byte(i3), &image3)
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Assert(image3.Architecture, check.Equals, "arm64")
|
||||
}
|
||||
|
||||
func (s *CopySuite) TestCopyWithManifestListStorageDigestMultipleArchesSecondUsesListDigest(c *check.C) {
|
||||
storage, err := ioutil.TempDir("", "copy-manifest-list-storage-digest-multiple-arches-second")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(storage)
|
||||
storage = fmt.Sprintf("[vfs@%s/root+%s/runroot]", storage, storage)
|
||||
m := combinedOutputOfCommand(c, skopeoBinary, "inspect", "--raw", "docker://estesp/busybox:latest")
|
||||
manifestDigest, err := manifest.Digest([]byte(m))
|
||||
c.Assert(err, check.IsNil)
|
||||
digest := manifestDigest.String()
|
||||
list, err := manifest.ListFromBlob([]byte(m), manifest.GuessMIMEType([]byte(m)))
|
||||
c.Assert(err, check.IsNil)
|
||||
amd64Instance, err := list.ChooseInstance(&types.SystemContext{ArchitectureChoice: "amd64"})
|
||||
c.Assert(err, check.IsNil)
|
||||
arm64Instance, err := list.ChooseInstance(&types.SystemContext{ArchitectureChoice: "arm64"})
|
||||
c.Assert(err, check.IsNil)
|
||||
assertSkopeoSucceeds(c, "", "--override-arch=amd64", "copy", "docker://estesp/busybox@"+amd64Instance.String(), "containers-storage:"+storage+"test@"+amd64Instance.String())
|
||||
assertSkopeoSucceeds(c, "", "--override-arch=arm64", "copy", "docker://estesp/busybox@"+digest, "containers-storage:"+storage+"test@"+digest)
|
||||
i1 := combinedOutputOfCommand(c, skopeoBinary, "--override-arch=amd64", "inspect", "--config", "containers-storage:"+storage+"test@"+amd64Instance.String())
|
||||
var image1 imgspecv1.Image
|
||||
err = json.Unmarshal([]byte(i1), &image1)
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Assert(image1.Architecture, check.Equals, "amd64")
|
||||
assertSkopeoFails(c, `.*error reading manifest for image instance.*does not exist.*`, "--override-arch=amd64", "inspect", "containers-storage:"+storage+"test@"+digest)
|
||||
assertSkopeoFails(c, `.*error reading manifest for image instance.*does not exist.*`, "--override-arch=amd64", "inspect", "--config", "containers-storage:"+storage+"test@"+digest)
|
||||
i2 := combinedOutputOfCommand(c, skopeoBinary, "--override-arch=arm64", "inspect", "--config", "containers-storage:"+storage+"test@"+digest)
|
||||
var image2 imgspecv1.Image
|
||||
err = json.Unmarshal([]byte(i2), &image2)
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Assert(image2.Architecture, check.Equals, "arm64")
|
||||
i3 := combinedOutputOfCommand(c, skopeoBinary, "--override-arch=arm64", "inspect", "--config", "containers-storage:"+storage+"test@"+arm64Instance.String())
|
||||
var image3 imgspecv1.Image
|
||||
err = json.Unmarshal([]byte(i3), &image3)
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Assert(image3.Architecture, check.Equals, "arm64")
|
||||
}
|
||||
|
||||
func (s *CopySuite) TestCopyWithManifestListStorageDigestMultipleArchesThirdUsesListDigest(c *check.C) {
|
||||
storage, err := ioutil.TempDir("", "copy-manifest-list-storage-digest-multiple-arches-third")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(storage)
|
||||
storage = fmt.Sprintf("[vfs@%s/root+%s/runroot]", storage, storage)
|
||||
m := combinedOutputOfCommand(c, skopeoBinary, "inspect", "--raw", "docker://estesp/busybox:latest")
|
||||
manifestDigest, err := manifest.Digest([]byte(m))
|
||||
c.Assert(err, check.IsNil)
|
||||
digest := manifestDigest.String()
|
||||
list, err := manifest.ListFromBlob([]byte(m), manifest.GuessMIMEType([]byte(m)))
|
||||
c.Assert(err, check.IsNil)
|
||||
amd64Instance, err := list.ChooseInstance(&types.SystemContext{ArchitectureChoice: "amd64"})
|
||||
c.Assert(err, check.IsNil)
|
||||
arm64Instance, err := list.ChooseInstance(&types.SystemContext{ArchitectureChoice: "arm64"})
|
||||
c.Assert(err, check.IsNil)
|
||||
assertSkopeoSucceeds(c, "", "--override-arch=amd64", "copy", "docker://estesp/busybox@"+amd64Instance.String(), "containers-storage:"+storage+"test@"+amd64Instance.String())
|
||||
assertSkopeoSucceeds(c, "", "--override-arch=amd64", "copy", "docker://estesp/busybox@"+digest, "containers-storage:"+storage+"test@"+digest)
|
||||
assertSkopeoSucceeds(c, "", "--override-arch=arm64", "copy", "docker://estesp/busybox@"+digest, "containers-storage:"+storage+"test@"+digest)
|
||||
assertSkopeoFails(c, `.*error reading manifest for image instance.*does not exist.*`, "--override-arch=amd64", "inspect", "--config", "containers-storage:"+storage+"test@"+digest)
|
||||
i1 := combinedOutputOfCommand(c, skopeoBinary, "--override-arch=amd64", "inspect", "--config", "containers-storage:"+storage+"test@"+amd64Instance.String())
|
||||
var image1 imgspecv1.Image
|
||||
err = json.Unmarshal([]byte(i1), &image1)
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Assert(image1.Architecture, check.Equals, "amd64")
|
||||
i2 := combinedOutputOfCommand(c, skopeoBinary, "--override-arch=arm64", "inspect", "--config", "containers-storage:"+storage+"test@"+digest)
|
||||
var image2 imgspecv1.Image
|
||||
err = json.Unmarshal([]byte(i2), &image2)
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Assert(image2.Architecture, check.Equals, "arm64")
|
||||
i3 := combinedOutputOfCommand(c, skopeoBinary, "--override-arch=arm64", "inspect", "--config", "containers-storage:"+storage+"test@"+arm64Instance.String())
|
||||
var image3 imgspecv1.Image
|
||||
err = json.Unmarshal([]byte(i3), &image3)
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Assert(image3.Architecture, check.Equals, "arm64")
|
||||
}
|
||||
|
||||
func (s *CopySuite) TestCopyWithManifestListStorageDigestMultipleArchesTagAndDigest(c *check.C) {
|
||||
storage, err := ioutil.TempDir("", "copy-manifest-list-storage-digest-multiple-arches-tag-digest")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(storage)
|
||||
storage = fmt.Sprintf("[vfs@%s/root+%s/runroot]", storage, storage)
|
||||
m := combinedOutputOfCommand(c, skopeoBinary, "inspect", "--raw", "docker://estesp/busybox:latest")
|
||||
manifestDigest, err := manifest.Digest([]byte(m))
|
||||
c.Assert(err, check.IsNil)
|
||||
digest := manifestDigest.String()
|
||||
list, err := manifest.ListFromBlob([]byte(m), manifest.GuessMIMEType([]byte(m)))
|
||||
c.Assert(err, check.IsNil)
|
||||
amd64Instance, err := list.ChooseInstance(&types.SystemContext{ArchitectureChoice: "amd64"})
|
||||
c.Assert(err, check.IsNil)
|
||||
arm64Instance, err := list.ChooseInstance(&types.SystemContext{ArchitectureChoice: "arm64"})
|
||||
c.Assert(err, check.IsNil)
|
||||
assertSkopeoSucceeds(c, "", "--override-arch=amd64", "copy", "docker://estesp/busybox:latest", "containers-storage:"+storage+"test:latest")
|
||||
assertSkopeoSucceeds(c, "", "--override-arch=arm64", "copy", "docker://estesp/busybox@"+digest, "containers-storage:"+storage+"test@"+digest)
|
||||
assertSkopeoFails(c, `.*error reading manifest for image instance.*does not exist.*`, "--override-arch=amd64", "inspect", "--config", "containers-storage:"+storage+"test@"+digest)
|
||||
i1 := combinedOutputOfCommand(c, skopeoBinary, "--override-arch=arm64", "inspect", "--config", "containers-storage:"+storage+"test:latest")
|
||||
var image1 imgspecv1.Image
|
||||
err = json.Unmarshal([]byte(i1), &image1)
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Assert(image1.Architecture, check.Equals, "amd64")
|
||||
i2 := combinedOutputOfCommand(c, skopeoBinary, "--override-arch=amd64", "inspect", "--config", "containers-storage:"+storage+"test@"+amd64Instance.String())
|
||||
var image2 imgspecv1.Image
|
||||
err = json.Unmarshal([]byte(i2), &image2)
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Assert(image2.Architecture, check.Equals, "amd64")
|
||||
i3 := combinedOutputOfCommand(c, skopeoBinary, "--override-arch=amd64", "inspect", "--config", "containers-storage:"+storage+"test:latest")
|
||||
var image3 imgspecv1.Image
|
||||
err = json.Unmarshal([]byte(i3), &image3)
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Assert(image3.Architecture, check.Equals, "amd64")
|
||||
i4 := combinedOutputOfCommand(c, skopeoBinary, "--override-arch=arm64", "inspect", "--config", "containers-storage:"+storage+"test@"+arm64Instance.String())
|
||||
var image4 imgspecv1.Image
|
||||
err = json.Unmarshal([]byte(i4), &image4)
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Assert(image4.Architecture, check.Equals, "arm64")
|
||||
i5 := combinedOutputOfCommand(c, skopeoBinary, "--override-arch=arm64", "inspect", "--config", "containers-storage:"+storage+"test@"+digest)
|
||||
var image5 imgspecv1.Image
|
||||
err = json.Unmarshal([]byte(i5), &image5)
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Assert(image5.Architecture, check.Equals, "arm64")
|
||||
}
|
||||
|
||||
func (s *CopySuite) TestCopyFailsWhenImageOSDoesntMatchRuntimeOS(c *check.C) {
|
||||
c.Skip("can't run this on Travis")
|
||||
assertSkopeoFails(c, `.*image operating system "windows" cannot be used on "linux".*`, "copy", "docker://microsoft/windowsservercore", "containers-storage:test")
|
||||
storage, err := ioutil.TempDir("", "copy-fails-image-doesnt-match-runtime")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(storage)
|
||||
storage = fmt.Sprintf("[vfs@%s/root+%s/runroot]", storage, storage)
|
||||
assertSkopeoFails(c, `.*no image found in manifest list for architecture .*, OS .*`, "copy", knownWindowsOnlyImage, "containers-storage:"+storage+"test")
|
||||
}
|
||||
|
||||
func (s *CopySuite) TestCopySucceedsWhenImageDoesntMatchRuntimeButWeOverride(c *check.C) {
|
||||
storage, err := ioutil.TempDir("", "copy-succeeds-image-doesnt-match-runtime-but-override")
|
||||
c.Assert(err, check.IsNil)
|
||||
defer os.RemoveAll(storage)
|
||||
storage = fmt.Sprintf("[vfs@%s/root+%s/runroot]", storage, storage)
|
||||
assertSkopeoSucceeds(c, "", "--override-os=windows", "--override-arch=amd64", "copy", knownWindowsOnlyImage, "containers-storage:"+storage+"test")
|
||||
}
|
||||
|
||||
func (s *CopySuite) TestCopySimpleAtomicRegistry(c *check.C) {
|
||||
@@ -157,7 +532,6 @@ func (s *CopySuite) TestCopySimple(c *check.C) {
|
||||
assertSkopeoSucceeds(c, "", "copy", "docker://busybox:latest", "oci:"+ociDest)
|
||||
_, err = os.Stat(ociDest)
|
||||
c.Assert(err, check.IsNil)
|
||||
|
||||
}
|
||||
|
||||
// Check whether dir: images in dir1 and dir2 are equal, ignoring schema1 signatures.
|
||||
@@ -696,3 +1070,7 @@ func (s *SkopeoSuite) TestFailureCopySrcWithMirrorAndPrefixUnavailable(c *check.
|
||||
assertSkopeoFails(c, ".*no such host.*", "--registries-conf="+regConfFixture, "copy",
|
||||
"docker://gcr.invalid/wrong/prefix/busybox", "dir:"+dir)
|
||||
}
|
||||
|
||||
func (s *CopySuite) TestCopyFailsWhenReferenceIsInvalid(c *check.C) {
|
||||
assertSkopeoFails(c, `.*Invalid image name.*`, "copy", "unknown:transport", "unknown:test")
|
||||
}
|
||||
|
||||
23
integration/decompress-dirs.sh
Executable file
23
integration/decompress-dirs.sh
Executable file
@@ -0,0 +1,23 @@
|
||||
#!/bin/bash -e
|
||||
# Account for differences between dir: images that are solely due to one being
|
||||
# compressed (fresh from a registry) and the other not being compressed (read
|
||||
# from storage, which decompressed it and had to reassemble the layer blobs).
|
||||
for dir in "$@" ; do
|
||||
# Updating the manifest's blob digests may change the formatting, so
|
||||
# use jq to get them into similar shape.
|
||||
jq -M . "${dir}"/manifest.json > "${dir}"/manifest.json.tmp && mv "${dir}"/manifest.json.tmp "${dir}"/manifest.json
|
||||
for candidate in "${dir}"/???????????????????????????????????????????????????????????????? ; do
|
||||
# If a digest-identified file looks like it was compressed,
|
||||
# decompress it, and replace its hash and size in the manifest
|
||||
# with the values for their decompressed versions.
|
||||
uncompressed=`zcat "${candidate}" 2> /dev/null | sha256sum | cut -c1-64`
|
||||
if test $? -eq 0 ; then
|
||||
if test "$uncompressed" != e3b0c44298fc1c149afbf4c8996fb92427ae41e4649b934ca495991b7852b855 ; then
|
||||
zcat "${candidate}" > "${dir}"/${uncompressed}
|
||||
sed -r -i -e "s#sha256:$(basename ${candidate})#sha256:${uncompressed}#g" "${dir}"/manifest.json
|
||||
sed -r -i -e "s#\"size\": $(wc -c < ${candidate}),#\"size\": $(wc -c < ${dir}/${uncompressed}),#g" "${dir}"/manifest.json
|
||||
rm -f "${candidate}"
|
||||
fi
|
||||
fi
|
||||
done
|
||||
done
|
||||
6
integration/fixtures/blocked-registries.conf
Normal file
6
integration/fixtures/blocked-registries.conf
Normal file
@@ -0,0 +1,6 @@
|
||||
[[registry]]
|
||||
location = "registry-unblocked.com"
|
||||
|
||||
[[registry]]
|
||||
location = "registry-blocked.com"
|
||||
blocked = true
|
||||
@@ -8,7 +8,7 @@ import (
|
||||
"os/exec"
|
||||
"strings"
|
||||
|
||||
"github.com/containers/image/signature"
|
||||
"github.com/containers/image/v5/signature"
|
||||
"github.com/go-check/check"
|
||||
)
|
||||
|
||||
@@ -44,7 +44,7 @@ func (s *SigningSuite) SetUpSuite(c *check.C) {
|
||||
c.Assert(err, check.IsNil)
|
||||
os.Setenv("GNUPGHOME", s.gpgHome)
|
||||
|
||||
runCommandWithInput(c, "Key-Type: RSA\nName-Real: Testing user\n%commit\n", gpgBinary, "--homedir", s.gpgHome, "--batch", "--gen-key")
|
||||
runCommandWithInput(c, "Key-Type: RSA\nName-Real: Testing user\n%no-protection\n%commit\n", gpgBinary, "--homedir", s.gpgHome, "--batch", "--gen-key")
|
||||
|
||||
lines, err := exec.Command(gpgBinary, "--homedir", s.gpgHome, "--with-colons", "--no-permission-warning", "--fingerprint").Output()
|
||||
c.Assert(err, check.IsNil)
|
||||
|
||||
@@ -6,6 +6,7 @@ import (
|
||||
"io/ioutil"
|
||||
"net"
|
||||
"os/exec"
|
||||
"path/filepath"
|
||||
"strings"
|
||||
"time"
|
||||
|
||||
@@ -13,6 +14,7 @@ import (
|
||||
)
|
||||
|
||||
const skopeoBinary = "skopeo"
|
||||
const decompressDirsBinary = "./decompress-dirs.sh"
|
||||
|
||||
// consumeAndLogOutputStream takes (f, err) from an exec.*Pipe(), and causes all output to it to be logged to c.
|
||||
func consumeAndLogOutputStream(c *check.C, id string, f io.ReadCloser, err error) {
|
||||
@@ -174,3 +176,27 @@ func fileFromFixture(c *check.C, inputPath string, edits map[string]string) stri
|
||||
c.Assert(err, check.IsNil)
|
||||
return path
|
||||
}
|
||||
|
||||
// runDecompressDirs runs decompress-dirs.sh using exec.Command().CombinedOutput, verifies that the exit status is 0,
|
||||
// and optionally that the output matches a multi-line regexp if it is nonempty; or terminates c on failure
|
||||
func runDecompressDirs(c *check.C, regexp string, args ...string) {
|
||||
c.Logf("Running %s %s", decompressDirsBinary, strings.Join(args, " "))
|
||||
for i, dir := range args {
|
||||
m, err := ioutil.ReadFile(filepath.Join(dir, "manifest.json"))
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Logf("manifest %d before: %s", i+1, string(m))
|
||||
}
|
||||
out, err := exec.Command(decompressDirsBinary, args...).CombinedOutput()
|
||||
c.Assert(err, check.IsNil, check.Commentf("%s", out))
|
||||
for i, dir := range args {
|
||||
if len(out) > 0 {
|
||||
c.Logf("output: %s", out)
|
||||
}
|
||||
m, err := ioutil.ReadFile(filepath.Join(dir, "manifest.json"))
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Logf("manifest %d after: %s", i+1, string(m))
|
||||
}
|
||||
if regexp != "" {
|
||||
c.Assert(string(out), check.Matches, "(?s)"+regexp) // (?s) : '.' will also match newlines
|
||||
}
|
||||
}
|
||||
|
||||
19
systemtest/001-basic.bats
Normal file
19
systemtest/001-basic.bats
Normal file
@@ -0,0 +1,19 @@
|
||||
#!/usr/bin/env bats
|
||||
#
|
||||
# Simplest set of skopeo tests. If any of these fail, we have serious problems.
|
||||
#
|
||||
|
||||
load helpers
|
||||
|
||||
# Override standard setup! We don't yet trust anything
|
||||
function setup() {
|
||||
:
|
||||
}
|
||||
|
||||
@test "skopeo version emits reasonable output" {
|
||||
run_skopeo --version
|
||||
|
||||
expect_output --substring "skopeo version [0-9.]+"
|
||||
}
|
||||
|
||||
# vim: filetype=sh
|
||||
82
systemtest/010-inspect.bats
Normal file
82
systemtest/010-inspect.bats
Normal file
@@ -0,0 +1,82 @@
|
||||
#!/usr/bin/env bats
|
||||
#
|
||||
# Simplest test for skopeo inspect
|
||||
#
|
||||
|
||||
load helpers
|
||||
|
||||
@test "inspect: basic" {
|
||||
workdir=$TESTDIR/inspect
|
||||
|
||||
remote_image=docker://quay.io/libpod/alpine_labels:latest
|
||||
# Inspect remote source, then pull it. There's a small race condition
|
||||
# in which the remote image can get updated between the inspect and
|
||||
# the copy; let's just not worry about it.
|
||||
run_skopeo inspect $remote_image
|
||||
inspect_remote=$output
|
||||
|
||||
# Now pull it into a directory
|
||||
run_skopeo copy $remote_image dir:$workdir
|
||||
expect_output --substring "Getting image source signatures"
|
||||
expect_output --substring "Writing manifest to image destination"
|
||||
|
||||
# Unpacked contents must include a manifest and version
|
||||
[ -e $workdir/manifest.json ]
|
||||
[ -e $workdir/version ]
|
||||
|
||||
# Now run inspect locally
|
||||
run_skopeo inspect dir:$workdir
|
||||
inspect_local=$output
|
||||
|
||||
# Each SHA-named file must be listed in the output of 'inspect'
|
||||
for sha in $(find $workdir -type f | xargs -l1 basename | egrep '^[0-9a-f]{64}$'); do
|
||||
expect_output --from="$inspect_local" --substring "sha256:$sha" \
|
||||
"Locally-extracted SHA file is present in 'inspect'"
|
||||
done
|
||||
|
||||
# Simple sanity check on 'inspect' output.
|
||||
# For each of the given keys (LHS of the table below):
|
||||
# 1) Get local and remote values
|
||||
# 2) Sanity-check local value using simple expression
|
||||
# 3) Confirm that local and remote values match.
|
||||
#
|
||||
# The reason for (2) is to make sure that we don't compare bad results
|
||||
#
|
||||
# The reason for a hardcoded list, instead of 'jq keys', is that RepoTags
|
||||
# is always empty locally, but a list remotely.
|
||||
while read key expect; do
|
||||
local=$(echo "$inspect_local" | jq -r ".$key")
|
||||
remote=$(echo "$inspect_remote" | jq -r ".$key")
|
||||
|
||||
expect_output --from="$local" --substring "$expect" \
|
||||
"local $key is sane"
|
||||
|
||||
expect_output --from="$remote" "$local" \
|
||||
"local $key matches remote"
|
||||
done <<END_EXPECT
|
||||
Architecture amd64
|
||||
Created [0-9-]+T[0-9:]+\.[0-9]+Z
|
||||
Digest sha256:[0-9a-f]{64}
|
||||
DockerVersion [0-9]+\.[0-9][0-9.-]+
|
||||
Labels \\\{.*PODMAN.*podman.*\\\}
|
||||
Layers \\\[.*sha256:.*\\\]
|
||||
Os linux
|
||||
END_EXPECT
|
||||
}
|
||||
|
||||
@test "inspect: env" {
|
||||
remote_image=docker://docker.io/fedora:latest
|
||||
run_skopeo inspect $remote_image
|
||||
inspect_remote=$output
|
||||
|
||||
# Simple check on 'inspect' output with environment variables.
|
||||
# 1) Get remote image values of environment variables (the value of 'Env')
|
||||
# 2) Confirm substring in check_array and the value of 'Env' match.
|
||||
check_array=(PATH=.* )
|
||||
remote=$(echo "$inspect_remote" | jq '.Env[]')
|
||||
for substr in ${check_array[@]}; do
|
||||
expect_output --from="$remote" --substring "$substr"
|
||||
done
|
||||
}
|
||||
|
||||
# vim: filetype=sh
|
||||
103
systemtest/020-copy.bats
Normal file
103
systemtest/020-copy.bats
Normal file
@@ -0,0 +1,103 @@
|
||||
#!/usr/bin/env bats
|
||||
#
|
||||
# Copy tests
|
||||
#
|
||||
|
||||
load helpers
|
||||
|
||||
function setup() {
|
||||
standard_setup
|
||||
|
||||
start_registry reg
|
||||
}
|
||||
|
||||
# From remote, to dir1, to local, to dir2;
|
||||
# compare dir1 and dir2, expect no changes
|
||||
@test "copy: dir, round trip" {
|
||||
local remote_image=docker://busybox:latest
|
||||
local localimg=docker://localhost:5000/busybox:unsigned
|
||||
|
||||
local dir1=$TESTDIR/dir1
|
||||
local dir2=$TESTDIR/dir2
|
||||
|
||||
run_skopeo copy $remote_image dir:$dir1
|
||||
run_skopeo copy --dest-tls-verify=false dir:$dir1 $localimg
|
||||
run_skopeo copy --src-tls-verify=false $localimg dir:$dir2
|
||||
|
||||
# Both extracted copies must be identical
|
||||
diff -urN $dir1 $dir2
|
||||
}
|
||||
|
||||
# Same as above, but using 'oci:' instead of 'dir:' and with a :latest tag
|
||||
@test "copy: oci, round trip" {
|
||||
local remote_image=docker://busybox:latest
|
||||
local localimg=docker://localhost:5000/busybox:unsigned
|
||||
|
||||
local dir1=$TESTDIR/oci1
|
||||
local dir2=$TESTDIR/oci2
|
||||
|
||||
run_skopeo copy $remote_image oci:$dir1:latest
|
||||
run_skopeo copy --dest-tls-verify=false oci:$dir1:latest $localimg
|
||||
run_skopeo copy --src-tls-verify=false $localimg oci:$dir2:latest
|
||||
|
||||
# Both extracted copies must be identical
|
||||
diff -urN $dir1 $dir2
|
||||
}
|
||||
|
||||
# Compression zstd
|
||||
@test "copy: oci, round trip, zstd" {
|
||||
local remote_image=docker://busybox:latest
|
||||
|
||||
local dir=$TESTDIR/dir
|
||||
|
||||
run_skopeo copy --dest-compress --dest-compress-format=zstd $remote_image oci:$dir:latest
|
||||
|
||||
# zstd magic number
|
||||
local magic=$(printf "\x28\xb5\x2f\xfd")
|
||||
|
||||
# Check there is at least one file that has the zstd magic number as the first 4 bytes
|
||||
(for i in $dir/blobs/sha256/*; do test "$(head -c 4 $i)" = $magic && exit 0; done; exit 1)
|
||||
}
|
||||
|
||||
# Same image, extracted once with :tag and once without
|
||||
@test "copy: oci w/ and w/o tags" {
|
||||
local remote_image=docker://busybox:latest
|
||||
|
||||
local dir1=$TESTDIR/dir1
|
||||
local dir2=$TESTDIR/dir2
|
||||
|
||||
run_skopeo copy $remote_image oci:$dir1
|
||||
run_skopeo copy $remote_image oci:$dir2:withtag
|
||||
|
||||
# Both extracted copies must be identical, except for index.json
|
||||
diff -urN --exclude=index.json $dir1 $dir2
|
||||
|
||||
# ...which should differ only in the tag. (But that's too hard to check)
|
||||
grep '"org.opencontainers.image.ref.name":"withtag"' $dir2/index.json
|
||||
}
|
||||
|
||||
# Registry -> storage -> oci-archive
|
||||
@test "copy: registry -> storage -> oci-archive" {
|
||||
local alpine=docker.io/library/alpine:latest
|
||||
local tmp=$TESTDIR/oci
|
||||
|
||||
run_skopeo copy docker://$alpine containers-storage:$alpine
|
||||
run_skopeo copy containers-storage:$alpine oci-archive:$tmp
|
||||
}
|
||||
|
||||
# This one seems unlikely to get fixed
|
||||
@test "copy: bug 651" {
|
||||
skip "Enable this once skopeo issue #651 has been fixed"
|
||||
|
||||
run_skopeo copy --dest-tls-verify=false \
|
||||
docker://quay.io/libpod/alpine_labels:latest \
|
||||
docker://localhost:5000/foo
|
||||
}
|
||||
|
||||
teardown() {
|
||||
podman rm -f reg
|
||||
|
||||
standard_teardown
|
||||
}
|
||||
|
||||
# vim: filetype=sh
|
||||
32
systemtest/030-local-registry-tls.bats
Normal file
32
systemtest/030-local-registry-tls.bats
Normal file
@@ -0,0 +1,32 @@
|
||||
#!/usr/bin/env bats
|
||||
#
|
||||
# Confirm that skopeo will push to and pull from a local
|
||||
# registry with locally-created TLS certificates.
|
||||
#
|
||||
load helpers
|
||||
|
||||
function setup() {
|
||||
standard_setup
|
||||
|
||||
start_registry --with-cert reg
|
||||
}
|
||||
|
||||
@test "local registry, with cert" {
|
||||
# Push to local registry...
|
||||
run_skopeo copy --dest-cert-dir=$TESTDIR/client-auth \
|
||||
docker://busybox:latest \
|
||||
docker://localhost:5000/busybox:unsigned
|
||||
|
||||
# ...and pull it back out
|
||||
run_skopeo copy --src-cert-dir=$TESTDIR/client-auth \
|
||||
docker://localhost:5000/busybox:unsigned \
|
||||
dir:$TESTDIR/extracted
|
||||
}
|
||||
|
||||
teardown() {
|
||||
podman rm -f reg
|
||||
|
||||
standard_teardown
|
||||
}
|
||||
|
||||
# vim: filetype=sh
|
||||
87
systemtest/040-local-registry-auth.bats
Normal file
87
systemtest/040-local-registry-auth.bats
Normal file
@@ -0,0 +1,87 @@
|
||||
#!/usr/bin/env bats
|
||||
#
|
||||
# Tests with a local registry with auth
|
||||
#
|
||||
|
||||
load helpers
|
||||
|
||||
function setup() {
|
||||
standard_setup
|
||||
|
||||
# Remove old/stale cred file
|
||||
_cred_dir=$TESTDIR/credentials
|
||||
export XDG_RUNTIME_DIR=$_cred_dir
|
||||
mkdir -p $_cred_dir/containers
|
||||
rm -f $_cred_dir/containers/auth.json
|
||||
|
||||
# TODO: This is here to work around
|
||||
# https://github.com/containers/libpod/issues/4227 in the
|
||||
# "auth: credentials via podman login" test.
|
||||
# It should be removed once a packaged version of podman which includes
|
||||
# that fix is available in our CI environment, since we _want_ to be
|
||||
# checking that podman and skopeo agree on the default for where registry
|
||||
# credentials should be stored.
|
||||
export REGISTRY_AUTH_FILE=$_cred_dir/containers/auth.json
|
||||
|
||||
# Start authenticated registry with random password
|
||||
testuser=testuser
|
||||
testpassword=$(random_string 15)
|
||||
|
||||
start_registry --testuser=$testuser --testpassword=$testpassword reg
|
||||
}
|
||||
|
||||
@test "auth: credentials on command line" {
|
||||
# No creds
|
||||
run_skopeo 1 inspect --tls-verify=false docker://localhost:5000/nonesuch
|
||||
expect_output --substring "unauthorized: authentication required"
|
||||
|
||||
# Wrong user
|
||||
run_skopeo 1 inspect --tls-verify=false --creds=baduser:badpassword \
|
||||
docker://localhost:5000/nonesuch
|
||||
expect_output --substring "unauthorized: authentication required"
|
||||
|
||||
# Wrong password
|
||||
run_skopeo 1 inspect --tls-verify=false --creds=$testuser:badpassword \
|
||||
docker://localhost:5000/nonesuch
|
||||
expect_output --substring "unauthorized: authentication required"
|
||||
|
||||
# Correct creds, but no such image
|
||||
run_skopeo 1 inspect --tls-verify=false --creds=$testuser:$testpassword \
|
||||
docker://localhost:5000/nonesuch
|
||||
expect_output --substring "manifest unknown: manifest unknown"
|
||||
|
||||
# These should pass
|
||||
run_skopeo copy --dest-tls-verify=false --dcreds=$testuser:$testpassword \
|
||||
docker://busybox:latest docker://localhost:5000/busybox:mine
|
||||
run_skopeo inspect --tls-verify=false --creds=$testuser:$testpassword \
|
||||
docker://localhost:5000/busybox:mine
|
||||
expect_output --substring "localhost:5000/busybox"
|
||||
}
|
||||
|
||||
@test "auth: credentials via podman login" {
|
||||
# Logged in: skopeo should work
|
||||
podman login --tls-verify=false -u $testuser -p $testpassword localhost:5000
|
||||
|
||||
run_skopeo copy --dest-tls-verify=false \
|
||||
docker://busybox:latest docker://localhost:5000/busybox:mine
|
||||
run_skopeo inspect --tls-verify=false docker://localhost:5000/busybox:mine
|
||||
expect_output --substring "localhost:5000/busybox"
|
||||
|
||||
# Logged out: should fail
|
||||
podman logout localhost:5000
|
||||
|
||||
run_skopeo 1 inspect --tls-verify=false docker://localhost:5000/busybox:mine
|
||||
expect_output --substring "unauthorized: authentication required"
|
||||
}
|
||||
|
||||
teardown() {
|
||||
podman rm -f reg
|
||||
|
||||
if [[ -n $_cred_dir ]]; then
|
||||
rm -rf $_cred_dir
|
||||
fi
|
||||
|
||||
standard_teardown
|
||||
}
|
||||
|
||||
# vim: filetype=sh
|
||||
151
systemtest/050-signing.bats
Normal file
151
systemtest/050-signing.bats
Normal file
@@ -0,0 +1,151 @@
|
||||
#!/usr/bin/env bats
|
||||
#
|
||||
# Tests with gpg signing
|
||||
#
|
||||
|
||||
load helpers
|
||||
|
||||
function setup() {
|
||||
standard_setup
|
||||
|
||||
# Create dummy gpg keys
|
||||
export GNUPGHOME=$TESTDIR/skopeo-gpg
|
||||
mkdir --mode=0700 $GNUPGHOME
|
||||
|
||||
# gpg on f30 needs this, otherwise:
|
||||
# gpg: agent_genkey failed: Inappropriate ioctl for device
|
||||
# ...but gpg on f29 (and, probably, Ubuntu) doesn't grok this
|
||||
GPGOPTS='--pinentry-mode loopback'
|
||||
if gpg --pinentry-mode asdf 2>&1 | grep -qi 'Invalid option'; then
|
||||
GPGOPTS=
|
||||
fi
|
||||
|
||||
for k in alice bob;do
|
||||
gpg --batch $GPGOPTS --gen-key --passphrase '' <<END_GPG
|
||||
Key-Type: RSA
|
||||
Name-Real: Test key - $k
|
||||
Name-email: $k@test.redhat.com
|
||||
%commit
|
||||
END_GPG
|
||||
|
||||
gpg --armor --export $k@test.redhat.com >$GNUPGHOME/pubkey-$k.gpg
|
||||
done
|
||||
|
||||
# Registries. The important part here seems to be sigstore,
|
||||
# because (I guess?) the registry itself has no mechanism
|
||||
# for storing or validating signatures.
|
||||
REGISTRIES_D=$TESTDIR/registries.d
|
||||
mkdir $REGISTRIES_D $TESTDIR/sigstore
|
||||
cat >$REGISTRIES_D/registries.yaml <<EOF
|
||||
docker:
|
||||
localhost:5000:
|
||||
sigstore: file://$TESTDIR/sigstore
|
||||
EOF
|
||||
|
||||
# Policy file. Basically, require /myns/alice and /myns/bob
|
||||
# to be signed; allow /open; and reject anything else.
|
||||
POLICY_JSON=$TESTDIR/policy.json
|
||||
cat >$POLICY_JSON <<END_POLICY_JSON
|
||||
{
|
||||
"default": [
|
||||
{
|
||||
"type": "reject"
|
||||
}
|
||||
],
|
||||
"transports": {
|
||||
"docker": {
|
||||
"localhost:5000/myns/alice": [
|
||||
{
|
||||
"type": "signedBy",
|
||||
"keyType": "GPGKeys",
|
||||
"keyPath": "$GNUPGHOME/pubkey-alice.gpg"
|
||||
}
|
||||
],
|
||||
"localhost:5000/myns/bob": [
|
||||
{
|
||||
"type": "signedBy",
|
||||
"keyType": "GPGKeys",
|
||||
"keyPath": "$GNUPGHOME/pubkey-bob.gpg"
|
||||
}
|
||||
],
|
||||
"localhost:5000/open": [
|
||||
{
|
||||
"type": "insecureAcceptAnything"
|
||||
}
|
||||
]
|
||||
}
|
||||
}
|
||||
}
|
||||
END_POLICY_JSON
|
||||
|
||||
start_registry reg
|
||||
}
|
||||
|
||||
@test "signing" {
|
||||
run_skopeo '?' standalone-sign /dev/null busybox alice@test.redhat.com -o /dev/null
|
||||
if [[ "$output" =~ 'signing is not supported' ]]; then
|
||||
skip "skopeo built without support for creating signatures"
|
||||
return 1
|
||||
fi
|
||||
if [ "$status" -ne 0 ]; then
|
||||
die "exit code is $status; expected $expected_rc"
|
||||
fi
|
||||
|
||||
# Cache local copy
|
||||
run_skopeo copy docker://busybox:latest dir:$TESTDIR/busybox
|
||||
|
||||
# Push a bunch of images. Do so *without* --policy flag; this lets us
|
||||
# sign or not, creating images that will or won't conform to policy.
|
||||
while read path sig comments; do
|
||||
local sign_opt=
|
||||
if [[ $sig != '-' ]]; then
|
||||
sign_opt="--sign-by=${sig}@test.redhat.com"
|
||||
fi
|
||||
run_skopeo --registries.d $REGISTRIES_D \
|
||||
copy --dest-tls-verify=false \
|
||||
$sign_opt \
|
||||
dir:$TESTDIR/busybox \
|
||||
docker://localhost:5000$path
|
||||
done <<END_PUSH
|
||||
/myns/alice:signed alice # Properly-signed image
|
||||
/myns/alice:unsigned - # Unsigned image to path that requires signature
|
||||
/myns/bob:signedbyalice alice # Bad signature: image under /bob
|
||||
/myns/carol:latest - # No signature
|
||||
/open/forall:latest - # No signature, but none needed
|
||||
END_PUSH
|
||||
|
||||
# Done pushing. Now try to fetch. From here on we use the --policy option.
|
||||
# The table below lists the paths to fetch, and the expected errors (or
|
||||
# none, if we expect them to pass).
|
||||
while read path expected_error; do
|
||||
expected_rc=
|
||||
if [[ -n $expected_error ]]; then
|
||||
expected_rc=1
|
||||
fi
|
||||
|
||||
rm -rf $TESTDIR/d
|
||||
run_skopeo $expected_rc \
|
||||
--registries.d $REGISTRIES_D \
|
||||
--policy $POLICY_JSON \
|
||||
copy --src-tls-verify=false \
|
||||
docker://localhost:5000$path \
|
||||
dir:$TESTDIR/d
|
||||
if [[ -n $expected_error ]]; then
|
||||
expect_output --substring "Source image rejected: $expected_error"
|
||||
fi
|
||||
done <<END_TESTS
|
||||
/myns/alice:signed
|
||||
/myns/bob:signedbyalice Invalid GPG signature
|
||||
/myns/alice:unsigned Signature for identity localhost:5000/myns/alice:signed is not accepted
|
||||
/myns/carol:latest Running image docker://localhost:5000/myns/carol:latest is rejected by policy.
|
||||
/open/forall:latest
|
||||
END_TESTS
|
||||
}
|
||||
|
||||
teardown() {
|
||||
podman rm -f reg
|
||||
|
||||
standard_teardown
|
||||
}
|
||||
|
||||
# vim: filetype=sh
|
||||
37
systemtest/060-delete.bats
Normal file
37
systemtest/060-delete.bats
Normal file
@@ -0,0 +1,37 @@
|
||||
#!/usr/bin/env bats
|
||||
#
|
||||
# Copy tests
|
||||
#
|
||||
|
||||
load helpers
|
||||
|
||||
function setup() {
|
||||
standard_setup
|
||||
|
||||
start_registry --enable-delete=true reg
|
||||
}
|
||||
|
||||
# delete image from registry
|
||||
@test "delete: remove image from registry" {
|
||||
local remote_image=docker://busybox:latest
|
||||
local localimg=docker://localhost:5000/busybox:unsigned
|
||||
local output=
|
||||
|
||||
run_skopeo copy --dest-tls-verify=false $remote_image $localimg
|
||||
output=$(run_skopeo inspect --tls-verify=false --raw $localimg)
|
||||
echo $output | grep "vnd.docker.distribution.manifest.v2+json"
|
||||
|
||||
run_skopeo delete --tls-verify=false $localimg
|
||||
|
||||
# make sure image is removed from registry
|
||||
expected_rc=1
|
||||
run_skopeo $expected_rc inspect --tls-verify=false $localimg
|
||||
}
|
||||
|
||||
teardown() {
|
||||
podman rm -f reg
|
||||
|
||||
standard_teardown
|
||||
}
|
||||
|
||||
# vim: filetype=sh
|
||||
367
systemtest/helpers.bash
Normal file
367
systemtest/helpers.bash
Normal file
@@ -0,0 +1,367 @@
|
||||
#!/bin/bash
|
||||
|
||||
SKOPEO_BINARY=${SKOPEO_BINARY:-$(dirname ${BASH_SOURCE})/../skopeo}
|
||||
|
||||
# Default timeout for a skopeo command.
|
||||
SKOPEO_TIMEOUT=${SKOPEO_TIMEOUT:-300}
|
||||
|
||||
###############################################################################
|
||||
# BEGIN setup/teardown
|
||||
|
||||
# Provide common setup and teardown functions, but do not name them such!
|
||||
# That way individual tests can override with their own setup/teardown,
|
||||
# while retaining the ability to include these if they so desire.
|
||||
|
||||
function standard_setup() {
|
||||
# Argh. Although BATS provides $BATS_TMPDIR, it's just /tmp!
|
||||
# That's bloody worthless. Let's make our own, in which subtests
|
||||
# can write whatever they like and trust that it'll be deleted
|
||||
# on cleanup.
|
||||
TESTDIR=$(mktemp -d --tmpdir=${BATS_TMPDIR:-/tmp} skopeo_bats.XXXXXX)
|
||||
}
|
||||
|
||||
function standard_teardown() {
|
||||
if [[ -n $TESTDIR ]]; then
|
||||
rm -rf $TESTDIR
|
||||
fi
|
||||
}
|
||||
|
||||
# Individual .bats files may override or extend these
|
||||
function setup() {
|
||||
standard_setup
|
||||
}
|
||||
|
||||
function teardown() {
|
||||
standard_teardown
|
||||
}
|
||||
|
||||
# END setup/teardown
|
||||
###############################################################################
|
||||
# BEGIN standard helpers for running skopeo and testing results
|
||||
|
||||
#################
|
||||
# run_skopeo # Invoke skopeo, with timeout, using BATS 'run'
|
||||
#################
|
||||
#
|
||||
# This is the preferred mechanism for invoking skopeo:
|
||||
#
|
||||
# * we use 'timeout' to abort (with a diagnostic) if something
|
||||
# takes too long; this is preferable to a CI hang.
|
||||
# * we log the command run and its output. This doesn't normally
|
||||
# appear in BATS output, but it will if there's an error.
|
||||
# * we check exit status. Since the normal desired code is 0,
|
||||
# that's the default; but the first argument can override:
|
||||
#
|
||||
# run_skopeo 125 nonexistent-subcommand
|
||||
# run_skopeo '?' some-other-command # let our caller check status
|
||||
#
|
||||
# Since we use the BATS 'run' mechanism, $output and $status will be
|
||||
# defined for our caller.
|
||||
#
|
||||
function run_skopeo() {
|
||||
# Number as first argument = expected exit code; default 0
|
||||
expected_rc=0
|
||||
case "$1" in
|
||||
[0-9]) expected_rc=$1; shift;;
|
||||
[1-9][0-9]) expected_rc=$1; shift;;
|
||||
[12][0-9][0-9]) expected_rc=$1; shift;;
|
||||
'?') expected_rc= ; shift;; # ignore exit code
|
||||
esac
|
||||
|
||||
# Remember command args, for possible use in later diagnostic messages
|
||||
MOST_RECENT_SKOPEO_COMMAND="skopeo $*"
|
||||
|
||||
# stdout is only emitted upon error; this echo is to help a debugger
|
||||
echo "\$ $SKOPEO_BINARY $*"
|
||||
run timeout --foreground --kill=10 $SKOPEO_TIMEOUT ${SKOPEO_BINARY} "$@"
|
||||
# without "quotes", multiple lines are glommed together into one
|
||||
if [ -n "$output" ]; then
|
||||
echo "$output"
|
||||
fi
|
||||
if [ "$status" -ne 0 ]; then
|
||||
echo -n "[ rc=$status ";
|
||||
if [ -n "$expected_rc" ]; then
|
||||
if [ "$status" -eq "$expected_rc" ]; then
|
||||
echo -n "(expected) ";
|
||||
else
|
||||
echo -n "(** EXPECTED $expected_rc **) ";
|
||||
fi
|
||||
fi
|
||||
echo "]"
|
||||
fi
|
||||
|
||||
if [ "$status" -eq 124 -o "$status" -eq 137 ]; then
|
||||
# FIXME: 'timeout -v' requires coreutils-8.29; travis seems to have
|
||||
# an older version. If/when travis updates, please add -v
|
||||
# to the 'timeout' command above, and un-comment this out:
|
||||
# if expr "$output" : ".*timeout: sending" >/dev/null; then
|
||||
echo "*** TIMED OUT ***"
|
||||
false
|
||||
fi
|
||||
|
||||
if [ -n "$expected_rc" ]; then
|
||||
if [ "$status" -ne "$expected_rc" ]; then
|
||||
die "exit code is $status; expected $expected_rc"
|
||||
fi
|
||||
fi
|
||||
}
|
||||
|
||||
#################
|
||||
# log_and_run # log a command for later debugging, then run it
|
||||
#################
|
||||
#
|
||||
# When diagnosing a test failure, it can be really nice to see the
|
||||
# more important commands that have been run in test setup: openssl,
|
||||
# podman registry, other complex commands that can give one a boost
|
||||
# when trying to reproduce problems. This simple wrapper takes a
|
||||
# command as its arg, echoes it to stdout (with a '$' prefix),
|
||||
# then runs the command. BATS does not show stdout unless there's
|
||||
# an error. Use this judiciously.
|
||||
#
|
||||
function log_and_run() {
|
||||
echo "\$ $*"
|
||||
"$@"
|
||||
}
|
||||
|
||||
#########
|
||||
# die # Abort with helpful message
|
||||
#########
|
||||
function die() {
|
||||
echo "#/vvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvv" >&2
|
||||
echo "#| FAIL: $*" >&2
|
||||
echo "#\\^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^" >&2
|
||||
false
|
||||
}
|
||||
|
||||
###################
|
||||
# expect_output # Compare actual vs expected string; fail if mismatch
|
||||
###################
|
||||
#
|
||||
# Compares $output against the given string argument. Optional second
|
||||
# argument is descriptive text to show as the error message (default:
|
||||
# the command most recently run by 'run_skopeo'). This text can be
|
||||
# useful to isolate a failure when there are multiple identical
|
||||
# run_skopeo invocations, and the difference is solely in the
|
||||
# config or setup; see, e.g., run.bats:run-cmd().
|
||||
#
|
||||
# By default we run an exact string comparison; use --substring to
|
||||
# look for the given string anywhere in $output.
|
||||
#
|
||||
# By default we look in "$output", which is set in run_skopeo().
|
||||
# To override, use --from="some-other-string" (e.g. "${lines[0]}")
|
||||
#
|
||||
# Examples:
|
||||
#
|
||||
# expect_output "this is exactly what we expect"
|
||||
# expect_output "foo=bar" "description of this particular test"
|
||||
# expect_output --from="${lines[0]}" "expected first line"
|
||||
#
|
||||
function expect_output() {
|
||||
# By default we examine $output, the result of run_skopeo
|
||||
local actual="$output"
|
||||
local check_substring=
|
||||
|
||||
# option processing: recognize --from="...", --substring
|
||||
local opt
|
||||
for opt; do
|
||||
local value=$(expr "$opt" : '[^=]*=\(.*\)')
|
||||
case "$opt" in
|
||||
--from=*) actual="$value"; shift;;
|
||||
--substring) check_substring=1; shift;;
|
||||
--) shift; break;;
|
||||
-*) die "Invalid option '$opt'" ;;
|
||||
*) break;;
|
||||
esac
|
||||
done
|
||||
|
||||
local expect="$1"
|
||||
local testname="${2:-${MOST_RECENT_SKOPEO_COMMAND:-[no test name given]}}"
|
||||
|
||||
if [ -z "$expect" ]; then
|
||||
if [ -z "$actual" ]; then
|
||||
return
|
||||
fi
|
||||
expect='[no output]'
|
||||
elif [ "$actual" = "$expect" ]; then
|
||||
return
|
||||
elif [ -n "$check_substring" ]; then
|
||||
if [[ "$actual" =~ $expect ]]; then
|
||||
return
|
||||
fi
|
||||
fi
|
||||
|
||||
# This is a multi-line message, which may in turn contain multi-line
|
||||
# output, so let's format it ourself, readably
|
||||
local -a actual_split
|
||||
readarray -t actual_split <<<"$actual"
|
||||
printf "#/vvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvv\n" >&2
|
||||
printf "#| FAIL: $testname\n" >&2
|
||||
printf "#| expected: '%s'\n" "$expect" >&2
|
||||
printf "#| actual: '%s'\n" "${actual_split[0]}" >&2
|
||||
local line
|
||||
for line in "${actual_split[@]:1}"; do
|
||||
printf "#| > '%s'\n" "$line" >&2
|
||||
done
|
||||
printf "#\\^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^\n" >&2
|
||||
false
|
||||
}
|
||||
|
||||
#######################
|
||||
# expect_line_count # Check the expected number of output lines
|
||||
#######################
|
||||
#
|
||||
# ...from the most recent run_skopeo command
|
||||
#
|
||||
function expect_line_count() {
|
||||
local expect="$1"
|
||||
local testname="${2:-${MOST_RECENT_SKOPEO_COMMAND:-[no test name given]}}"
|
||||
|
||||
local actual="${#lines[@]}"
|
||||
if [ "$actual" -eq "$expect" ]; then
|
||||
return
|
||||
fi
|
||||
|
||||
printf "#/vvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvv\n" >&2
|
||||
printf "#| FAIL: $testname\n" >&2
|
||||
printf "#| Expected %d lines of output, got %d\n" $expect $actual >&2
|
||||
printf "#| Output was:\n" >&2
|
||||
local line
|
||||
for line in "${lines[@]}"; do
|
||||
printf "#| >%s\n" "$line" >&2
|
||||
done
|
||||
printf "#\\^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^\n" >&2
|
||||
false
|
||||
}
|
||||
|
||||
# END standard helpers for running skopeo and testing results
|
||||
###############################################################################
|
||||
# BEGIN helpers for starting/stopping registries
|
||||
|
||||
####################
|
||||
# start_registry # Run a local registry container
|
||||
####################
|
||||
#
|
||||
# Usage: start_registry [OPTIONS] NAME
|
||||
#
|
||||
# OPTIONS
|
||||
# --port=NNNN Port to listen on (default: 5000)
|
||||
# --testuser=XXX Require authentication; this is the username
|
||||
# --testpassword=XXX ...and the password (these two go together)
|
||||
# --with-cert Create a cert for running with TLS (not working)
|
||||
# --enable-delete Set allowing registry deletions (default: false)
|
||||
#
|
||||
# NAME is the container name to assign.
|
||||
#
|
||||
start_registry() {
|
||||
local port=5000
|
||||
local testuser=
|
||||
local testpassword=
|
||||
local create_cert=
|
||||
local enable_delete=false
|
||||
|
||||
# option processing: recognize options for running the registry
|
||||
# in different modes.
|
||||
local opt
|
||||
for opt; do
|
||||
local value=$(expr "$opt" : '[^=]*=\(.*\)')
|
||||
case "$opt" in
|
||||
--port=*) port="$value"; shift;;
|
||||
--testuser=*) testuser="$value"; shift;;
|
||||
--testpassword=*) testpassword="$value"; shift;;
|
||||
--with-cert) create_cert=1; shift;;
|
||||
--enable-delete=*) enable_delete="$value"; shift;;
|
||||
-*) die "Invalid option '$opt'" ;;
|
||||
*) break;;
|
||||
esac
|
||||
done
|
||||
|
||||
local name=${1?start_registry() invoked without a NAME}
|
||||
|
||||
# Temp directory must be defined and must exist
|
||||
[[ -n $TESTDIR && -d $TESTDIR ]]
|
||||
|
||||
AUTHDIR=$TESTDIR/auth
|
||||
mkdir -p $AUTHDIR
|
||||
|
||||
local -a reg_args=(-v $AUTHDIR:/auth:Z -p $port:5000)
|
||||
if [[ "$enable_delete" == "true" ]]; then
|
||||
reg_args+=( -e REGISTRY_STORAGE_DELETE_ENABLED=true)
|
||||
fi
|
||||
|
||||
# cgroup option necessary under podman-in-podman (CI tests),
|
||||
# and doesn't seem to do any harm otherwise.
|
||||
PODMAN="podman --cgroup-manager=cgroupfs"
|
||||
|
||||
# Called with --testuser? Create an htpasswd file
|
||||
if [[ -n $testuser ]]; then
|
||||
if [[ -z $testpassword ]]; then
|
||||
die "start_registry() invoked with testuser but no testpassword"
|
||||
fi
|
||||
|
||||
if ! egrep -q "^$testuser:" $AUTHDIR/htpasswd; then
|
||||
log_and_run $PODMAN run --rm --entrypoint htpasswd registry:2 \
|
||||
-Bbn $testuser $testpassword >> $AUTHDIR/htpasswd
|
||||
fi
|
||||
|
||||
reg_args+=(
|
||||
-e REGISTRY_AUTH=htpasswd
|
||||
-e REGISTRY_AUTH_HTPASSWD_PATH=/auth/htpasswd
|
||||
-e REGISTRY_AUTH_HTPASSWD_REALM="Registry Realm"
|
||||
)
|
||||
fi
|
||||
|
||||
# Called with --with-cert? Create certificates.
|
||||
if [[ -n $create_cert ]]; then
|
||||
CERT=$AUTHDIR/domain.crt
|
||||
if [ ! -e $CERT ]; then
|
||||
log_and_run openssl req -newkey rsa:4096 -nodes -sha256 \
|
||||
-keyout $AUTHDIR/domain.key -x509 -days 2 \
|
||||
-out $CERT \
|
||||
-subj "/C=US/ST=Foo/L=Bar/O=Red Hat, Inc./CN=localhost"
|
||||
fi
|
||||
|
||||
reg_args+=(
|
||||
-e REGISTRY_HTTP_TLS_CERTIFICATE=/auth/domain.crt
|
||||
-e REGISTRY_HTTP_TLS_KEY=/auth/domain.key
|
||||
)
|
||||
|
||||
# Copy .crt file to a directory *without* the .key one, so we can
|
||||
# test the client. (If client sees a matching .key file, it fails)
|
||||
# Thanks to Miloslav Trmac for this hint.
|
||||
mkdir -p $TESTDIR/client-auth
|
||||
log_and_run cp $CERT $TESTDIR/client-auth/
|
||||
fi
|
||||
|
||||
log_and_run $PODMAN run -d --name $name "${reg_args[@]}" registry:2
|
||||
|
||||
# Wait for registry to actually come up
|
||||
timeout=10
|
||||
while [[ $timeout -ge 1 ]]; do
|
||||
if echo -n >/dev/tcp/127.0.0.1/$port; then
|
||||
return
|
||||
fi
|
||||
|
||||
timeout=$(expr $timeout - 1)
|
||||
sleep 1
|
||||
done
|
||||
die "Timed out waiting for registry container to respond on :$port"
|
||||
}
|
||||
|
||||
# END helpers for starting/stopping registries
|
||||
###############################################################################
|
||||
# BEGIN miscellaneous tools
|
||||
|
||||
###################
|
||||
# random_string # Returns a pseudorandom human-readable string
|
||||
###################
|
||||
#
|
||||
# Numeric argument, if present, is desired length of string
|
||||
#
|
||||
function random_string() {
|
||||
local length=${1:-10}
|
||||
|
||||
head /dev/urandom | tr -dc a-zA-Z0-9 | head -c$length
|
||||
}
|
||||
|
||||
# END miscellaneous tools
|
||||
###############################################################################
|
||||
16
systemtest/run-tests
Executable file
16
systemtest/run-tests
Executable file
@@ -0,0 +1,16 @@
|
||||
#!/bin/bash
|
||||
#
|
||||
# run-tests - simple wrapper allowing shortcuts on invocation
|
||||
#
|
||||
|
||||
TEST_DIR=$(dirname $0)
|
||||
TESTS=$TEST_DIR
|
||||
|
||||
for i; do
|
||||
case "$i" in
|
||||
*.bats) TESTS=$i ;;
|
||||
*) TESTS=$(echo $TEST_DIR/*$i*.bats) ;;
|
||||
esac
|
||||
done
|
||||
|
||||
bats $TESTS
|
||||
67
vendor.conf
67
vendor.conf
@@ -1,67 +0,0 @@
|
||||
|
||||
github.com/urfave/cli v1.20.0
|
||||
github.com/kr/pretty v0.1.0
|
||||
github.com/kr/text v0.1.0
|
||||
github.com/containers/image 2c0349c99af7d90694b3faa0e9bde404d407b145
|
||||
github.com/containers/buildah 810efa340ab43753034e2ed08ec290e4abab7e72
|
||||
github.com/vbauerster/mpb v3.3.4
|
||||
github.com/mattn/go-isatty v0.0.4
|
||||
github.com/VividCortex/ewma v1.1.1
|
||||
golang.org/x/sync 42b317875d0fa942474b76e1b46a6060d720ae6e
|
||||
github.com/opencontainers/go-digest c9281466c8b2f606084ac71339773efd177436e7
|
||||
github.com/containers/storage v1.12.3
|
||||
github.com/sirupsen/logrus v1.0.0
|
||||
github.com/go-check/check v1
|
||||
github.com/stretchr/testify v1.1.3
|
||||
github.com/davecgh/go-spew v1.1.1
|
||||
github.com/pmezard/go-difflib 5d4384ee4fb2527b0a1256a821ebfc92f91efefc
|
||||
github.com/pkg/errors v0.8.1
|
||||
golang.org/x/crypto a4c6cb3142f211c99e4bf4cd769535b29a9b616f
|
||||
github.com/ulikunitz/xz v0.5.4
|
||||
github.com/etcd-io/bbolt v1.3.2
|
||||
# docker deps from https://github.com/docker/docker/blob/v1.11.2/hack/vendor.sh
|
||||
github.com/docker/docker da99009bbb1165d1ac5688b5c81d2f589d418341
|
||||
github.com/docker/go-connections 7beb39f0b969b075d1325fecb092faf27fd357b6
|
||||
github.com/containerd/continuity d8fb8589b0e8e85b8c8bbaa8840226d0dfeb7371
|
||||
github.com/vbatts/tar-split v0.10.2
|
||||
github.com/gorilla/context 14f550f51a
|
||||
github.com/gorilla/mux e444e69cbd
|
||||
github.com/docker/go-units 8a7beacffa3009a9ac66bad506b18ffdd110cf97
|
||||
golang.org/x/net 45ffb0cd1ba084b73e26dee67e667e1be5acce83
|
||||
github.com/gogo/protobuf fcdc5011193ff531a548e9b0301828d5a5b97fd8
|
||||
# end docker deps
|
||||
golang.org/x/text e6919f6577db79269a6443b9dc46d18f2238fb5d
|
||||
github.com/docker/distribution 5f6282db7d65e6d72ad7c2cc66310724a57be716
|
||||
# docker/distributions dependencies
|
||||
# end of docker/distribution dependencies
|
||||
github.com/docker/libtrust aabc10ec26b754e797f9028f4589c5b7bd90dc20
|
||||
github.com/docker/docker-credential-helpers d68f9aeca33f5fd3f08eeae5e9d175edf4e731d1
|
||||
github.com/opencontainers/runc v1.0.0-rc6
|
||||
github.com/opencontainers/image-spec 7b1e489870acb042978a3935d2fb76f8a79aff81
|
||||
# -- start OCI image validation requirements.
|
||||
github.com/opencontainers/runtime-spec v1.0.0
|
||||
github.com/opencontainers/image-tools 6d941547fa1df31900990b3fb47ec2468c9c6469
|
||||
github.com/xeipuuv/gojsonpointer 4e3ac2762d5f479393488629ee9370b50873b3a6
|
||||
github.com/xeipuuv/gojsonreference bd5ef7bd5415a7ac448318e64f11a24cd21e594b
|
||||
github.com/xeipuuv/gojsonschema v1.1.0
|
||||
go4.org ce4c26f7be8eb27dc77f996b08d286dd80bc4a01 https://github.com/camlistore/go4
|
||||
github.com/ostreedev/ostree-go 56f3a639dbc0f2f5051c6d52dade28a882ba78ce
|
||||
# -- end OCI image validation requirements
|
||||
github.com/mtrmac/gpgme b2432428689ca58c2b8e8dea9449d3295cf96fc9
|
||||
# openshift/origin' k8s dependencies as of OpenShift v1.1.5
|
||||
k8s.io/client-go kubernetes-1.10.13-beta.0
|
||||
github.com/ghodss/yaml 73d445a93680fa1a78ae23a5839bad48f32ba1ee
|
||||
gopkg.in/yaml.v2 d466437aa4adc35830964cffc5b5f262c63ddcb4
|
||||
github.com/imdario/mergo 6633656539c1639d9d78127b7d47c622b5d7b6dc
|
||||
# containers/storage's dependencies that aren't already being pulled in
|
||||
github.com/mistifyio/go-zfs 22c9b32c84eb0d0c6f4043b6e90fc94073de92fa
|
||||
github.com/pborman/uuid v1.0
|
||||
github.com/opencontainers/selinux v1.1
|
||||
golang.org/x/sys 43e60d72a8e2bd92ee98319ba9a384a0e9837c08
|
||||
github.com/tchap/go-patricia v2.2.6
|
||||
github.com/BurntSushi/toml v0.3.1
|
||||
github.com/pquerna/ffjson d49c2bc1aa135aad0c6f4fc2056623ec78f5d5ac
|
||||
github.com/syndtr/gocapability d98352740cb2c55f81556b63d4a1ec64c5a319c2
|
||||
github.com/klauspost/pgzip v1.2.1
|
||||
github.com/klauspost/compress v1.4.1
|
||||
github.com/klauspost/cpuid v1.2.0
|
||||
5
vendor/github.com/BurntSushi/toml/.gitignore
generated
vendored
Normal file
5
vendor/github.com/BurntSushi/toml/.gitignore
generated
vendored
Normal file
@@ -0,0 +1,5 @@
|
||||
TAGS
|
||||
tags
|
||||
.*.swp
|
||||
tomlcheck/tomlcheck
|
||||
toml.test
|
||||
15
vendor/github.com/BurntSushi/toml/.travis.yml
generated
vendored
Normal file
15
vendor/github.com/BurntSushi/toml/.travis.yml
generated
vendored
Normal file
@@ -0,0 +1,15 @@
|
||||
language: go
|
||||
go:
|
||||
- 1.1
|
||||
- 1.2
|
||||
- 1.3
|
||||
- 1.4
|
||||
- 1.5
|
||||
- 1.6
|
||||
- tip
|
||||
install:
|
||||
- go install ./...
|
||||
- go get github.com/BurntSushi/toml-test
|
||||
script:
|
||||
- export PATH="$PATH:$HOME/gopath/bin"
|
||||
- make test
|
||||
3
vendor/github.com/BurntSushi/toml/COMPATIBLE
generated
vendored
Normal file
3
vendor/github.com/BurntSushi/toml/COMPATIBLE
generated
vendored
Normal file
@@ -0,0 +1,3 @@
|
||||
Compatible with TOML version
|
||||
[v0.4.0](https://github.com/toml-lang/toml/blob/v0.4.0/versions/en/toml-v0.4.0.md)
|
||||
|
||||
19
vendor/github.com/BurntSushi/toml/Makefile
generated
vendored
Normal file
19
vendor/github.com/BurntSushi/toml/Makefile
generated
vendored
Normal file
@@ -0,0 +1,19 @@
|
||||
install:
|
||||
go install ./...
|
||||
|
||||
test: install
|
||||
go test -v
|
||||
toml-test toml-test-decoder
|
||||
toml-test -encoder toml-test-encoder
|
||||
|
||||
fmt:
|
||||
gofmt -w *.go */*.go
|
||||
colcheck *.go */*.go
|
||||
|
||||
tags:
|
||||
find ./ -name '*.go' -print0 | xargs -0 gotags > TAGS
|
||||
|
||||
push:
|
||||
git push origin master
|
||||
git push github master
|
||||
|
||||
1
vendor/github.com/BurntSushi/toml/session.vim
generated
vendored
Normal file
1
vendor/github.com/BurntSushi/toml/session.vim
generated
vendored
Normal file
@@ -0,0 +1 @@
|
||||
au BufWritePost *.go silent!make tags > /dev/null 2>&1
|
||||
1
vendor/github.com/Microsoft/go-winio/.gitignore
generated
vendored
Normal file
1
vendor/github.com/Microsoft/go-winio/.gitignore
generated
vendored
Normal file
@@ -0,0 +1 @@
|
||||
*.exe
|
||||
22
vendor/github.com/Microsoft/go-winio/LICENSE
generated
vendored
Normal file
22
vendor/github.com/Microsoft/go-winio/LICENSE
generated
vendored
Normal file
@@ -0,0 +1,22 @@
|
||||
The MIT License (MIT)
|
||||
|
||||
Copyright (c) 2015 Microsoft
|
||||
|
||||
Permission is hereby granted, free of charge, to any person obtaining a copy
|
||||
of this software and associated documentation files (the "Software"), to deal
|
||||
in the Software without restriction, including without limitation the rights
|
||||
to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
|
||||
copies of the Software, and to permit persons to whom the Software is
|
||||
furnished to do so, subject to the following conditions:
|
||||
|
||||
The above copyright notice and this permission notice shall be included in all
|
||||
copies or substantial portions of the Software.
|
||||
|
||||
THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
|
||||
IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
|
||||
FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
|
||||
AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
|
||||
LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
|
||||
OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
|
||||
SOFTWARE.
|
||||
|
||||
22
vendor/github.com/Microsoft/go-winio/README.md
generated
vendored
Normal file
22
vendor/github.com/Microsoft/go-winio/README.md
generated
vendored
Normal file
@@ -0,0 +1,22 @@
|
||||
# go-winio
|
||||
|
||||
This repository contains utilities for efficiently performing Win32 IO operations in
|
||||
Go. Currently, this is focused on accessing named pipes and other file handles, and
|
||||
for using named pipes as a net transport.
|
||||
|
||||
This code relies on IO completion ports to avoid blocking IO on system threads, allowing Go
|
||||
to reuse the thread to schedule another goroutine. This limits support to Windows Vista and
|
||||
newer operating systems. This is similar to the implementation of network sockets in Go's net
|
||||
package.
|
||||
|
||||
Please see the LICENSE file for licensing information.
|
||||
|
||||
This project has adopted the [Microsoft Open Source Code of
|
||||
Conduct](https://opensource.microsoft.com/codeofconduct/). For more information
|
||||
see the [Code of Conduct
|
||||
FAQ](https://opensource.microsoft.com/codeofconduct/faq/) or contact
|
||||
[opencode@microsoft.com](mailto:opencode@microsoft.com) with any additional
|
||||
questions or comments.
|
||||
|
||||
Thanks to natefinch for the inspiration for this library. See https://github.com/natefinch/npipe
|
||||
for another named pipe implementation.
|
||||
@@ -1,4 +1,4 @@
|
||||
Copyright (c) 2009,2014 Google Inc. All rights reserved.
|
||||
Copyright (c) 2012 The Go Authors. All rights reserved.
|
||||
|
||||
Redistribution and use in source and binary forms, with or without
|
||||
modification, are permitted provided that the following conditions are
|
||||
344
vendor/github.com/Microsoft/go-winio/archive/tar/common.go
generated
vendored
Normal file
344
vendor/github.com/Microsoft/go-winio/archive/tar/common.go
generated
vendored
Normal file
@@ -0,0 +1,344 @@
|
||||
// Copyright 2009 The Go Authors. All rights reserved.
|
||||
// Use of this source code is governed by a BSD-style
|
||||
// license that can be found in the LICENSE file.
|
||||
|
||||
// Package tar implements access to tar archives.
|
||||
// It aims to cover most of the variations, including those produced
|
||||
// by GNU and BSD tars.
|
||||
//
|
||||
// References:
|
||||
// http://www.freebsd.org/cgi/man.cgi?query=tar&sektion=5
|
||||
// http://www.gnu.org/software/tar/manual/html_node/Standard.html
|
||||
// http://pubs.opengroup.org/onlinepubs/9699919799/utilities/pax.html
|
||||
package tar
|
||||
|
||||
import (
|
||||
"bytes"
|
||||
"errors"
|
||||
"fmt"
|
||||
"os"
|
||||
"path"
|
||||
"time"
|
||||
)
|
||||
|
||||
const (
|
||||
blockSize = 512
|
||||
|
||||
// Types
|
||||
TypeReg = '0' // regular file
|
||||
TypeRegA = '\x00' // regular file
|
||||
TypeLink = '1' // hard link
|
||||
TypeSymlink = '2' // symbolic link
|
||||
TypeChar = '3' // character device node
|
||||
TypeBlock = '4' // block device node
|
||||
TypeDir = '5' // directory
|
||||
TypeFifo = '6' // fifo node
|
||||
TypeCont = '7' // reserved
|
||||
TypeXHeader = 'x' // extended header
|
||||
TypeXGlobalHeader = 'g' // global extended header
|
||||
TypeGNULongName = 'L' // Next file has a long name
|
||||
TypeGNULongLink = 'K' // Next file symlinks to a file w/ a long name
|
||||
TypeGNUSparse = 'S' // sparse file
|
||||
)
|
||||
|
||||
// A Header represents a single header in a tar archive.
|
||||
// Some fields may not be populated.
|
||||
type Header struct {
|
||||
Name string // name of header file entry
|
||||
Mode int64 // permission and mode bits
|
||||
Uid int // user id of owner
|
||||
Gid int // group id of owner
|
||||
Size int64 // length in bytes
|
||||
ModTime time.Time // modified time
|
||||
Typeflag byte // type of header entry
|
||||
Linkname string // target name of link
|
||||
Uname string // user name of owner
|
||||
Gname string // group name of owner
|
||||
Devmajor int64 // major number of character or block device
|
||||
Devminor int64 // minor number of character or block device
|
||||
AccessTime time.Time // access time
|
||||
ChangeTime time.Time // status change time
|
||||
CreationTime time.Time // creation time
|
||||
Xattrs map[string]string
|
||||
Winheaders map[string]string
|
||||
}
|
||||
|
||||
// File name constants from the tar spec.
|
||||
const (
|
||||
fileNameSize = 100 // Maximum number of bytes in a standard tar name.
|
||||
fileNamePrefixSize = 155 // Maximum number of ustar extension bytes.
|
||||
)
|
||||
|
||||
// FileInfo returns an os.FileInfo for the Header.
|
||||
func (h *Header) FileInfo() os.FileInfo {
|
||||
return headerFileInfo{h}
|
||||
}
|
||||
|
||||
// headerFileInfo implements os.FileInfo.
|
||||
type headerFileInfo struct {
|
||||
h *Header
|
||||
}
|
||||
|
||||
func (fi headerFileInfo) Size() int64 { return fi.h.Size }
|
||||
func (fi headerFileInfo) IsDir() bool { return fi.Mode().IsDir() }
|
||||
func (fi headerFileInfo) ModTime() time.Time { return fi.h.ModTime }
|
||||
func (fi headerFileInfo) Sys() interface{} { return fi.h }
|
||||
|
||||
// Name returns the base name of the file.
|
||||
func (fi headerFileInfo) Name() string {
|
||||
if fi.IsDir() {
|
||||
return path.Base(path.Clean(fi.h.Name))
|
||||
}
|
||||
return path.Base(fi.h.Name)
|
||||
}
|
||||
|
||||
// Mode returns the permission and mode bits for the headerFileInfo.
|
||||
func (fi headerFileInfo) Mode() (mode os.FileMode) {
|
||||
// Set file permission bits.
|
||||
mode = os.FileMode(fi.h.Mode).Perm()
|
||||
|
||||
// Set setuid, setgid and sticky bits.
|
||||
if fi.h.Mode&c_ISUID != 0 {
|
||||
// setuid
|
||||
mode |= os.ModeSetuid
|
||||
}
|
||||
if fi.h.Mode&c_ISGID != 0 {
|
||||
// setgid
|
||||
mode |= os.ModeSetgid
|
||||
}
|
||||
if fi.h.Mode&c_ISVTX != 0 {
|
||||
// sticky
|
||||
mode |= os.ModeSticky
|
||||
}
|
||||
|
||||
// Set file mode bits.
|
||||
// clear perm, setuid, setgid and sticky bits.
|
||||
m := os.FileMode(fi.h.Mode) &^ 07777
|
||||
if m == c_ISDIR {
|
||||
// directory
|
||||
mode |= os.ModeDir
|
||||
}
|
||||
if m == c_ISFIFO {
|
||||
// named pipe (FIFO)
|
||||
mode |= os.ModeNamedPipe
|
||||
}
|
||||
if m == c_ISLNK {
|
||||
// symbolic link
|
||||
mode |= os.ModeSymlink
|
||||
}
|
||||
if m == c_ISBLK {
|
||||
// device file
|
||||
mode |= os.ModeDevice
|
||||
}
|
||||
if m == c_ISCHR {
|
||||
// Unix character device
|
||||
mode |= os.ModeDevice
|
||||
mode |= os.ModeCharDevice
|
||||
}
|
||||
if m == c_ISSOCK {
|
||||
// Unix domain socket
|
||||
mode |= os.ModeSocket
|
||||
}
|
||||
|
||||
switch fi.h.Typeflag {
|
||||
case TypeSymlink:
|
||||
// symbolic link
|
||||
mode |= os.ModeSymlink
|
||||
case TypeChar:
|
||||
// character device node
|
||||
mode |= os.ModeDevice
|
||||
mode |= os.ModeCharDevice
|
||||
case TypeBlock:
|
||||
// block device node
|
||||
mode |= os.ModeDevice
|
||||
case TypeDir:
|
||||
// directory
|
||||
mode |= os.ModeDir
|
||||
case TypeFifo:
|
||||
// fifo node
|
||||
mode |= os.ModeNamedPipe
|
||||
}
|
||||
|
||||
return mode
|
||||
}
|
||||
|
||||
// sysStat, if non-nil, populates h from system-dependent fields of fi.
|
||||
var sysStat func(fi os.FileInfo, h *Header) error
|
||||
|
||||
// Mode constants from the tar spec.
|
||||
const (
|
||||
c_ISUID = 04000 // Set uid
|
||||
c_ISGID = 02000 // Set gid
|
||||
c_ISVTX = 01000 // Save text (sticky bit)
|
||||
c_ISDIR = 040000 // Directory
|
||||
c_ISFIFO = 010000 // FIFO
|
||||
c_ISREG = 0100000 // Regular file
|
||||
c_ISLNK = 0120000 // Symbolic link
|
||||
c_ISBLK = 060000 // Block special file
|
||||
c_ISCHR = 020000 // Character special file
|
||||
c_ISSOCK = 0140000 // Socket
|
||||
)
|
||||
|
||||
// Keywords for the PAX Extended Header
|
||||
const (
|
||||
paxAtime = "atime"
|
||||
paxCharset = "charset"
|
||||
paxComment = "comment"
|
||||
paxCtime = "ctime" // please note that ctime is not a valid pax header.
|
||||
paxCreationTime = "LIBARCHIVE.creationtime"
|
||||
paxGid = "gid"
|
||||
paxGname = "gname"
|
||||
paxLinkpath = "linkpath"
|
||||
paxMtime = "mtime"
|
||||
paxPath = "path"
|
||||
paxSize = "size"
|
||||
paxUid = "uid"
|
||||
paxUname = "uname"
|
||||
paxXattr = "SCHILY.xattr."
|
||||
paxWindows = "MSWINDOWS."
|
||||
paxNone = ""
|
||||
)
|
||||
|
||||
// FileInfoHeader creates a partially-populated Header from fi.
|
||||
// If fi describes a symlink, FileInfoHeader records link as the link target.
|
||||
// If fi describes a directory, a slash is appended to the name.
|
||||
// Because os.FileInfo's Name method returns only the base name of
|
||||
// the file it describes, it may be necessary to modify the Name field
|
||||
// of the returned header to provide the full path name of the file.
|
||||
func FileInfoHeader(fi os.FileInfo, link string) (*Header, error) {
|
||||
if fi == nil {
|
||||
return nil, errors.New("tar: FileInfo is nil")
|
||||
}
|
||||
fm := fi.Mode()
|
||||
h := &Header{
|
||||
Name: fi.Name(),
|
||||
ModTime: fi.ModTime(),
|
||||
Mode: int64(fm.Perm()), // or'd with c_IS* constants later
|
||||
}
|
||||
switch {
|
||||
case fm.IsRegular():
|
||||
h.Mode |= c_ISREG
|
||||
h.Typeflag = TypeReg
|
||||
h.Size = fi.Size()
|
||||
case fi.IsDir():
|
||||
h.Typeflag = TypeDir
|
||||
h.Mode |= c_ISDIR
|
||||
h.Name += "/"
|
||||
case fm&os.ModeSymlink != 0:
|
||||
h.Typeflag = TypeSymlink
|
||||
h.Mode |= c_ISLNK
|
||||
h.Linkname = link
|
||||
case fm&os.ModeDevice != 0:
|
||||
if fm&os.ModeCharDevice != 0 {
|
||||
h.Mode |= c_ISCHR
|
||||
h.Typeflag = TypeChar
|
||||
} else {
|
||||
h.Mode |= c_ISBLK
|
||||
h.Typeflag = TypeBlock
|
||||
}
|
||||
case fm&os.ModeNamedPipe != 0:
|
||||
h.Typeflag = TypeFifo
|
||||
h.Mode |= c_ISFIFO
|
||||
case fm&os.ModeSocket != 0:
|
||||
h.Mode |= c_ISSOCK
|
||||
default:
|
||||
return nil, fmt.Errorf("archive/tar: unknown file mode %v", fm)
|
||||
}
|
||||
if fm&os.ModeSetuid != 0 {
|
||||
h.Mode |= c_ISUID
|
||||
}
|
||||
if fm&os.ModeSetgid != 0 {
|
||||
h.Mode |= c_ISGID
|
||||
}
|
||||
if fm&os.ModeSticky != 0 {
|
||||
h.Mode |= c_ISVTX
|
||||
}
|
||||
// If possible, populate additional fields from OS-specific
|
||||
// FileInfo fields.
|
||||
if sys, ok := fi.Sys().(*Header); ok {
|
||||
// This FileInfo came from a Header (not the OS). Use the
|
||||
// original Header to populate all remaining fields.
|
||||
h.Uid = sys.Uid
|
||||
h.Gid = sys.Gid
|
||||
h.Uname = sys.Uname
|
||||
h.Gname = sys.Gname
|
||||
h.AccessTime = sys.AccessTime
|
||||
h.ChangeTime = sys.ChangeTime
|
||||
if sys.Xattrs != nil {
|
||||
h.Xattrs = make(map[string]string)
|
||||
for k, v := range sys.Xattrs {
|
||||
h.Xattrs[k] = v
|
||||
}
|
||||
}
|
||||
if sys.Typeflag == TypeLink {
|
||||
// hard link
|
||||
h.Typeflag = TypeLink
|
||||
h.Size = 0
|
||||
h.Linkname = sys.Linkname
|
||||
}
|
||||
}
|
||||
if sysStat != nil {
|
||||
return h, sysStat(fi, h)
|
||||
}
|
||||
return h, nil
|
||||
}
|
||||
|
||||
var zeroBlock = make([]byte, blockSize)
|
||||
|
||||
// POSIX specifies a sum of the unsigned byte values, but the Sun tar uses signed byte values.
|
||||
// We compute and return both.
|
||||
func checksum(header []byte) (unsigned int64, signed int64) {
|
||||
for i := 0; i < len(header); i++ {
|
||||
if i == 148 {
|
||||
// The chksum field (header[148:156]) is special: it should be treated as space bytes.
|
||||
unsigned += ' ' * 8
|
||||
signed += ' ' * 8
|
||||
i += 7
|
||||
continue
|
||||
}
|
||||
unsigned += int64(header[i])
|
||||
signed += int64(int8(header[i]))
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
type slicer []byte
|
||||
|
||||
func (sp *slicer) next(n int) (b []byte) {
|
||||
s := *sp
|
||||
b, *sp = s[0:n], s[n:]
|
||||
return
|
||||
}
|
||||
|
||||
func isASCII(s string) bool {
|
||||
for _, c := range s {
|
||||
if c >= 0x80 {
|
||||
return false
|
||||
}
|
||||
}
|
||||
return true
|
||||
}
|
||||
|
||||
func toASCII(s string) string {
|
||||
if isASCII(s) {
|
||||
return s
|
||||
}
|
||||
var buf bytes.Buffer
|
||||
for _, c := range s {
|
||||
if c < 0x80 {
|
||||
buf.WriteByte(byte(c))
|
||||
}
|
||||
}
|
||||
return buf.String()
|
||||
}
|
||||
|
||||
// isHeaderOnlyType checks if the given type flag is of the type that has no
|
||||
// data section even if a size is specified.
|
||||
func isHeaderOnlyType(flag byte) bool {
|
||||
switch flag {
|
||||
case TypeLink, TypeSymlink, TypeChar, TypeBlock, TypeDir, TypeFifo:
|
||||
return true
|
||||
default:
|
||||
return false
|
||||
}
|
||||
}
|
||||
1002
vendor/github.com/Microsoft/go-winio/archive/tar/reader.go
generated
vendored
Normal file
1002
vendor/github.com/Microsoft/go-winio/archive/tar/reader.go
generated
vendored
Normal file
File diff suppressed because it is too large
Load Diff
32
vendor/github.com/Microsoft/go-winio/archive/tar/stat_unix.go
generated
vendored
Normal file
32
vendor/github.com/Microsoft/go-winio/archive/tar/stat_unix.go
generated
vendored
Normal file
@@ -0,0 +1,32 @@
|
||||
// Copyright 2012 The Go Authors. All rights reserved.
|
||||
// Use of this source code is governed by a BSD-style
|
||||
// license that can be found in the LICENSE file.
|
||||
|
||||
// +build linux darwin dragonfly freebsd openbsd netbsd solaris
|
||||
|
||||
package tar
|
||||
|
||||
import (
|
||||
"os"
|
||||
"syscall"
|
||||
)
|
||||
|
||||
func init() {
|
||||
sysStat = statUnix
|
||||
}
|
||||
|
||||
func statUnix(fi os.FileInfo, h *Header) error {
|
||||
sys, ok := fi.Sys().(*syscall.Stat_t)
|
||||
if !ok {
|
||||
return nil
|
||||
}
|
||||
h.Uid = int(sys.Uid)
|
||||
h.Gid = int(sys.Gid)
|
||||
// TODO(bradfitz): populate username & group. os/user
|
||||
// doesn't cache LookupId lookups, and lacks group
|
||||
// lookup functions.
|
||||
h.AccessTime = statAtime(sys)
|
||||
h.ChangeTime = statCtime(sys)
|
||||
// TODO(bradfitz): major/minor device numbers?
|
||||
return nil
|
||||
}
|
||||
444
vendor/github.com/Microsoft/go-winio/archive/tar/writer.go
generated
vendored
Normal file
444
vendor/github.com/Microsoft/go-winio/archive/tar/writer.go
generated
vendored
Normal file
@@ -0,0 +1,444 @@
|
||||
// Copyright 2009 The Go Authors. All rights reserved.
|
||||
// Use of this source code is governed by a BSD-style
|
||||
// license that can be found in the LICENSE file.
|
||||
|
||||
package tar
|
||||
|
||||
// TODO(dsymonds):
|
||||
// - catch more errors (no first header, etc.)
|
||||
|
||||
import (
|
||||
"bytes"
|
||||
"errors"
|
||||
"fmt"
|
||||
"io"
|
||||
"path"
|
||||
"sort"
|
||||
"strconv"
|
||||
"strings"
|
||||
"time"
|
||||
)
|
||||
|
||||
var (
|
||||
ErrWriteTooLong = errors.New("archive/tar: write too long")
|
||||
ErrFieldTooLong = errors.New("archive/tar: header field too long")
|
||||
ErrWriteAfterClose = errors.New("archive/tar: write after close")
|
||||
errInvalidHeader = errors.New("archive/tar: header field too long or contains invalid values")
|
||||
)
|
||||
|
||||
// A Writer provides sequential writing of a tar archive in POSIX.1 format.
|
||||
// A tar archive consists of a sequence of files.
|
||||
// Call WriteHeader to begin a new file, and then call Write to supply that file's data,
|
||||
// writing at most hdr.Size bytes in total.
|
||||
type Writer struct {
|
||||
w io.Writer
|
||||
err error
|
||||
nb int64 // number of unwritten bytes for current file entry
|
||||
pad int64 // amount of padding to write after current file entry
|
||||
closed bool
|
||||
usedBinary bool // whether the binary numeric field extension was used
|
||||
preferPax bool // use pax header instead of binary numeric header
|
||||
hdrBuff [blockSize]byte // buffer to use in writeHeader when writing a regular header
|
||||
paxHdrBuff [blockSize]byte // buffer to use in writeHeader when writing a pax header
|
||||
}
|
||||
|
||||
type formatter struct {
|
||||
err error // Last error seen
|
||||
}
|
||||
|
||||
// NewWriter creates a new Writer writing to w.
|
||||
func NewWriter(w io.Writer) *Writer { return &Writer{w: w, preferPax: true} }
|
||||
|
||||
// Flush finishes writing the current file (optional).
|
||||
func (tw *Writer) Flush() error {
|
||||
if tw.nb > 0 {
|
||||
tw.err = fmt.Errorf("archive/tar: missed writing %d bytes", tw.nb)
|
||||
return tw.err
|
||||
}
|
||||
|
||||
n := tw.nb + tw.pad
|
||||
for n > 0 && tw.err == nil {
|
||||
nr := n
|
||||
if nr > blockSize {
|
||||
nr = blockSize
|
||||
}
|
||||
var nw int
|
||||
nw, tw.err = tw.w.Write(zeroBlock[0:nr])
|
||||
n -= int64(nw)
|
||||
}
|
||||
tw.nb = 0
|
||||
tw.pad = 0
|
||||
return tw.err
|
||||
}
|
||||
|
||||
// Write s into b, terminating it with a NUL if there is room.
|
||||
func (f *formatter) formatString(b []byte, s string) {
|
||||
if len(s) > len(b) {
|
||||
f.err = ErrFieldTooLong
|
||||
return
|
||||
}
|
||||
ascii := toASCII(s)
|
||||
copy(b, ascii)
|
||||
if len(ascii) < len(b) {
|
||||
b[len(ascii)] = 0
|
||||
}
|
||||
}
|
||||
|
||||
// Encode x as an octal ASCII string and write it into b with leading zeros.
|
||||
func (f *formatter) formatOctal(b []byte, x int64) {
|
||||
s := strconv.FormatInt(x, 8)
|
||||
// leading zeros, but leave room for a NUL.
|
||||
for len(s)+1 < len(b) {
|
||||
s = "0" + s
|
||||
}
|
||||
f.formatString(b, s)
|
||||
}
|
||||
|
||||
// fitsInBase256 reports whether x can be encoded into n bytes using base-256
|
||||
// encoding. Unlike octal encoding, base-256 encoding does not require that the
|
||||
// string ends with a NUL character. Thus, all n bytes are available for output.
|
||||
//
|
||||
// If operating in binary mode, this assumes strict GNU binary mode; which means
|
||||
// that the first byte can only be either 0x80 or 0xff. Thus, the first byte is
|
||||
// equivalent to the sign bit in two's complement form.
|
||||
func fitsInBase256(n int, x int64) bool {
|
||||
var binBits = uint(n-1) * 8
|
||||
return n >= 9 || (x >= -1<<binBits && x < 1<<binBits)
|
||||
}
|
||||
|
||||
// Write x into b, as binary (GNUtar/star extension).
|
||||
func (f *formatter) formatNumeric(b []byte, x int64) {
|
||||
if fitsInBase256(len(b), x) {
|
||||
for i := len(b) - 1; i >= 0; i-- {
|
||||
b[i] = byte(x)
|
||||
x >>= 8
|
||||
}
|
||||
b[0] |= 0x80 // Highest bit indicates binary format
|
||||
return
|
||||
}
|
||||
|
||||
f.formatOctal(b, 0) // Last resort, just write zero
|
||||
f.err = ErrFieldTooLong
|
||||
}
|
||||
|
||||
var (
|
||||
minTime = time.Unix(0, 0)
|
||||
// There is room for 11 octal digits (33 bits) of mtime.
|
||||
maxTime = minTime.Add((1<<33 - 1) * time.Second)
|
||||
)
|
||||
|
||||
// WriteHeader writes hdr and prepares to accept the file's contents.
|
||||
// WriteHeader calls Flush if it is not the first header.
|
||||
// Calling after a Close will return ErrWriteAfterClose.
|
||||
func (tw *Writer) WriteHeader(hdr *Header) error {
|
||||
return tw.writeHeader(hdr, true)
|
||||
}
|
||||
|
||||
// WriteHeader writes hdr and prepares to accept the file's contents.
|
||||
// WriteHeader calls Flush if it is not the first header.
|
||||
// Calling after a Close will return ErrWriteAfterClose.
|
||||
// As this method is called internally by writePax header to allow it to
|
||||
// suppress writing the pax header.
|
||||
func (tw *Writer) writeHeader(hdr *Header, allowPax bool) error {
|
||||
if tw.closed {
|
||||
return ErrWriteAfterClose
|
||||
}
|
||||
if tw.err == nil {
|
||||
tw.Flush()
|
||||
}
|
||||
if tw.err != nil {
|
||||
return tw.err
|
||||
}
|
||||
|
||||
// a map to hold pax header records, if any are needed
|
||||
paxHeaders := make(map[string]string)
|
||||
|
||||
// TODO(shanemhansen): we might want to use PAX headers for
|
||||
// subsecond time resolution, but for now let's just capture
|
||||
// too long fields or non ascii characters
|
||||
|
||||
var f formatter
|
||||
var header []byte
|
||||
|
||||
// We need to select which scratch buffer to use carefully,
|
||||
// since this method is called recursively to write PAX headers.
|
||||
// If allowPax is true, this is the non-recursive call, and we will use hdrBuff.
|
||||
// If allowPax is false, we are being called by writePAXHeader, and hdrBuff is
|
||||
// already being used by the non-recursive call, so we must use paxHdrBuff.
|
||||
header = tw.hdrBuff[:]
|
||||
if !allowPax {
|
||||
header = tw.paxHdrBuff[:]
|
||||
}
|
||||
copy(header, zeroBlock)
|
||||
s := slicer(header)
|
||||
|
||||
// Wrappers around formatter that automatically sets paxHeaders if the
|
||||
// argument extends beyond the capacity of the input byte slice.
|
||||
var formatString = func(b []byte, s string, paxKeyword string) {
|
||||
needsPaxHeader := paxKeyword != paxNone && len(s) > len(b) || !isASCII(s)
|
||||
if needsPaxHeader {
|
||||
paxHeaders[paxKeyword] = s
|
||||
return
|
||||
}
|
||||
f.formatString(b, s)
|
||||
}
|
||||
var formatNumeric = func(b []byte, x int64, paxKeyword string) {
|
||||
// Try octal first.
|
||||
s := strconv.FormatInt(x, 8)
|
||||
if len(s) < len(b) {
|
||||
f.formatOctal(b, x)
|
||||
return
|
||||
}
|
||||
|
||||
// If it is too long for octal, and PAX is preferred, use a PAX header.
|
||||
if paxKeyword != paxNone && tw.preferPax {
|
||||
f.formatOctal(b, 0)
|
||||
s := strconv.FormatInt(x, 10)
|
||||
paxHeaders[paxKeyword] = s
|
||||
return
|
||||
}
|
||||
|
||||
tw.usedBinary = true
|
||||
f.formatNumeric(b, x)
|
||||
}
|
||||
var formatTime = func(b []byte, t time.Time, paxKeyword string) {
|
||||
var unixTime int64
|
||||
if !t.Before(minTime) && !t.After(maxTime) {
|
||||
unixTime = t.Unix()
|
||||
}
|
||||
formatNumeric(b, unixTime, paxNone)
|
||||
|
||||
// Write a PAX header if the time didn't fit precisely.
|
||||
if paxKeyword != "" && tw.preferPax && allowPax && (t.Nanosecond() != 0 || !t.Before(minTime) || !t.After(maxTime)) {
|
||||
paxHeaders[paxKeyword] = formatPAXTime(t)
|
||||
}
|
||||
}
|
||||
|
||||
// keep a reference to the filename to allow to overwrite it later if we detect that we can use ustar longnames instead of pax
|
||||
pathHeaderBytes := s.next(fileNameSize)
|
||||
|
||||
formatString(pathHeaderBytes, hdr.Name, paxPath)
|
||||
|
||||
f.formatOctal(s.next(8), hdr.Mode) // 100:108
|
||||
formatNumeric(s.next(8), int64(hdr.Uid), paxUid) // 108:116
|
||||
formatNumeric(s.next(8), int64(hdr.Gid), paxGid) // 116:124
|
||||
formatNumeric(s.next(12), hdr.Size, paxSize) // 124:136
|
||||
formatTime(s.next(12), hdr.ModTime, paxMtime) // 136:148
|
||||
s.next(8) // chksum (148:156)
|
||||
s.next(1)[0] = hdr.Typeflag // 156:157
|
||||
|
||||
formatString(s.next(100), hdr.Linkname, paxLinkpath)
|
||||
|
||||
copy(s.next(8), []byte("ustar\x0000")) // 257:265
|
||||
formatString(s.next(32), hdr.Uname, paxUname) // 265:297
|
||||
formatString(s.next(32), hdr.Gname, paxGname) // 297:329
|
||||
formatNumeric(s.next(8), hdr.Devmajor, paxNone) // 329:337
|
||||
formatNumeric(s.next(8), hdr.Devminor, paxNone) // 337:345
|
||||
|
||||
// keep a reference to the prefix to allow to overwrite it later if we detect that we can use ustar longnames instead of pax
|
||||
prefixHeaderBytes := s.next(155)
|
||||
formatString(prefixHeaderBytes, "", paxNone) // 345:500 prefix
|
||||
|
||||
// Use the GNU magic instead of POSIX magic if we used any GNU extensions.
|
||||
if tw.usedBinary {
|
||||
copy(header[257:265], []byte("ustar \x00"))
|
||||
}
|
||||
|
||||
_, paxPathUsed := paxHeaders[paxPath]
|
||||
// try to use a ustar header when only the name is too long
|
||||
if !tw.preferPax && len(paxHeaders) == 1 && paxPathUsed {
|
||||
prefix, suffix, ok := splitUSTARPath(hdr.Name)
|
||||
if ok {
|
||||
// Since we can encode in USTAR format, disable PAX header.
|
||||
delete(paxHeaders, paxPath)
|
||||
|
||||
// Update the path fields
|
||||
formatString(pathHeaderBytes, suffix, paxNone)
|
||||
formatString(prefixHeaderBytes, prefix, paxNone)
|
||||
}
|
||||
}
|
||||
|
||||
// The chksum field is terminated by a NUL and a space.
|
||||
// This is different from the other octal fields.
|
||||
chksum, _ := checksum(header)
|
||||
f.formatOctal(header[148:155], chksum) // Never fails
|
||||
header[155] = ' '
|
||||
|
||||
// Check if there were any formatting errors.
|
||||
if f.err != nil {
|
||||
tw.err = f.err
|
||||
return tw.err
|
||||
}
|
||||
|
||||
if allowPax {
|
||||
if !hdr.AccessTime.IsZero() {
|
||||
paxHeaders[paxAtime] = formatPAXTime(hdr.AccessTime)
|
||||
}
|
||||
if !hdr.ChangeTime.IsZero() {
|
||||
paxHeaders[paxCtime] = formatPAXTime(hdr.ChangeTime)
|
||||
}
|
||||
if !hdr.CreationTime.IsZero() {
|
||||
paxHeaders[paxCreationTime] = formatPAXTime(hdr.CreationTime)
|
||||
}
|
||||
for k, v := range hdr.Xattrs {
|
||||
paxHeaders[paxXattr+k] = v
|
||||
}
|
||||
for k, v := range hdr.Winheaders {
|
||||
paxHeaders[paxWindows+k] = v
|
||||
}
|
||||
}
|
||||
|
||||
if len(paxHeaders) > 0 {
|
||||
if !allowPax {
|
||||
return errInvalidHeader
|
||||
}
|
||||
if err := tw.writePAXHeader(hdr, paxHeaders); err != nil {
|
||||
return err
|
||||
}
|
||||
}
|
||||
tw.nb = int64(hdr.Size)
|
||||
tw.pad = (blockSize - (tw.nb % blockSize)) % blockSize
|
||||
|
||||
_, tw.err = tw.w.Write(header)
|
||||
return tw.err
|
||||
}
|
||||
|
||||
func formatPAXTime(t time.Time) string {
|
||||
sec := t.Unix()
|
||||
usec := t.Nanosecond()
|
||||
s := strconv.FormatInt(sec, 10)
|
||||
if usec != 0 {
|
||||
s = fmt.Sprintf("%s.%09d", s, usec)
|
||||
}
|
||||
return s
|
||||
}
|
||||
|
||||
// splitUSTARPath splits a path according to USTAR prefix and suffix rules.
|
||||
// If the path is not splittable, then it will return ("", "", false).
|
||||
func splitUSTARPath(name string) (prefix, suffix string, ok bool) {
|
||||
length := len(name)
|
||||
if length <= fileNameSize || !isASCII(name) {
|
||||
return "", "", false
|
||||
} else if length > fileNamePrefixSize+1 {
|
||||
length = fileNamePrefixSize + 1
|
||||
} else if name[length-1] == '/' {
|
||||
length--
|
||||
}
|
||||
|
||||
i := strings.LastIndex(name[:length], "/")
|
||||
nlen := len(name) - i - 1 // nlen is length of suffix
|
||||
plen := i // plen is length of prefix
|
||||
if i <= 0 || nlen > fileNameSize || nlen == 0 || plen > fileNamePrefixSize {
|
||||
return "", "", false
|
||||
}
|
||||
return name[:i], name[i+1:], true
|
||||
}
|
||||
|
||||
// writePaxHeader writes an extended pax header to the
|
||||
// archive.
|
||||
func (tw *Writer) writePAXHeader(hdr *Header, paxHeaders map[string]string) error {
|
||||
// Prepare extended header
|
||||
ext := new(Header)
|
||||
ext.Typeflag = TypeXHeader
|
||||
// Setting ModTime is required for reader parsing to
|
||||
// succeed, and seems harmless enough.
|
||||
ext.ModTime = hdr.ModTime
|
||||
// The spec asks that we namespace our pseudo files
|
||||
// with the current pid. However, this results in differing outputs
|
||||
// for identical inputs. As such, the constant 0 is now used instead.
|
||||
// golang.org/issue/12358
|
||||
dir, file := path.Split(hdr.Name)
|
||||
fullName := path.Join(dir, "PaxHeaders.0", file)
|
||||
|
||||
ascii := toASCII(fullName)
|
||||
if len(ascii) > 100 {
|
||||
ascii = ascii[:100]
|
||||
}
|
||||
ext.Name = ascii
|
||||
// Construct the body
|
||||
var buf bytes.Buffer
|
||||
|
||||
// Keys are sorted before writing to body to allow deterministic output.
|
||||
var keys []string
|
||||
for k := range paxHeaders {
|
||||
keys = append(keys, k)
|
||||
}
|
||||
sort.Strings(keys)
|
||||
|
||||
for _, k := range keys {
|
||||
fmt.Fprint(&buf, formatPAXRecord(k, paxHeaders[k]))
|
||||
}
|
||||
|
||||
ext.Size = int64(len(buf.Bytes()))
|
||||
if err := tw.writeHeader(ext, false); err != nil {
|
||||
return err
|
||||
}
|
||||
if _, err := tw.Write(buf.Bytes()); err != nil {
|
||||
return err
|
||||
}
|
||||
if err := tw.Flush(); err != nil {
|
||||
return err
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// formatPAXRecord formats a single PAX record, prefixing it with the
|
||||
// appropriate length.
|
||||
func formatPAXRecord(k, v string) string {
|
||||
const padding = 3 // Extra padding for ' ', '=', and '\n'
|
||||
size := len(k) + len(v) + padding
|
||||
size += len(strconv.Itoa(size))
|
||||
record := fmt.Sprintf("%d %s=%s\n", size, k, v)
|
||||
|
||||
// Final adjustment if adding size field increased the record size.
|
||||
if len(record) != size {
|
||||
size = len(record)
|
||||
record = fmt.Sprintf("%d %s=%s\n", size, k, v)
|
||||
}
|
||||
return record
|
||||
}
|
||||
|
||||
// Write writes to the current entry in the tar archive.
|
||||
// Write returns the error ErrWriteTooLong if more than
|
||||
// hdr.Size bytes are written after WriteHeader.
|
||||
func (tw *Writer) Write(b []byte) (n int, err error) {
|
||||
if tw.closed {
|
||||
err = ErrWriteAfterClose
|
||||
return
|
||||
}
|
||||
overwrite := false
|
||||
if int64(len(b)) > tw.nb {
|
||||
b = b[0:tw.nb]
|
||||
overwrite = true
|
||||
}
|
||||
n, err = tw.w.Write(b)
|
||||
tw.nb -= int64(n)
|
||||
if err == nil && overwrite {
|
||||
err = ErrWriteTooLong
|
||||
return
|
||||
}
|
||||
tw.err = err
|
||||
return
|
||||
}
|
||||
|
||||
// Close closes the tar archive, flushing any unwritten
|
||||
// data to the underlying writer.
|
||||
func (tw *Writer) Close() error {
|
||||
if tw.err != nil || tw.closed {
|
||||
return tw.err
|
||||
}
|
||||
tw.Flush()
|
||||
tw.closed = true
|
||||
if tw.err != nil {
|
||||
return tw.err
|
||||
}
|
||||
|
||||
// trailer: two zero blocks
|
||||
for i := 0; i < 2; i++ {
|
||||
_, tw.err = tw.w.Write(zeroBlock)
|
||||
if tw.err != nil {
|
||||
break
|
||||
}
|
||||
}
|
||||
return tw.err
|
||||
}
|
||||
280
vendor/github.com/Microsoft/go-winio/backup.go
generated
vendored
Normal file
280
vendor/github.com/Microsoft/go-winio/backup.go
generated
vendored
Normal file
@@ -0,0 +1,280 @@
|
||||
// +build windows
|
||||
|
||||
package winio
|
||||
|
||||
import (
|
||||
"encoding/binary"
|
||||
"errors"
|
||||
"fmt"
|
||||
"io"
|
||||
"io/ioutil"
|
||||
"os"
|
||||
"runtime"
|
||||
"syscall"
|
||||
"unicode/utf16"
|
||||
)
|
||||
|
||||
//sys backupRead(h syscall.Handle, b []byte, bytesRead *uint32, abort bool, processSecurity bool, context *uintptr) (err error) = BackupRead
|
||||
//sys backupWrite(h syscall.Handle, b []byte, bytesWritten *uint32, abort bool, processSecurity bool, context *uintptr) (err error) = BackupWrite
|
||||
|
||||
const (
|
||||
BackupData = uint32(iota + 1)
|
||||
BackupEaData
|
||||
BackupSecurity
|
||||
BackupAlternateData
|
||||
BackupLink
|
||||
BackupPropertyData
|
||||
BackupObjectId
|
||||
BackupReparseData
|
||||
BackupSparseBlock
|
||||
BackupTxfsData
|
||||
)
|
||||
|
||||
const (
|
||||
StreamSparseAttributes = uint32(8)
|
||||
)
|
||||
|
||||
const (
|
||||
WRITE_DAC = 0x40000
|
||||
WRITE_OWNER = 0x80000
|
||||
ACCESS_SYSTEM_SECURITY = 0x1000000
|
||||
)
|
||||
|
||||
// BackupHeader represents a backup stream of a file.
|
||||
type BackupHeader struct {
|
||||
Id uint32 // The backup stream ID
|
||||
Attributes uint32 // Stream attributes
|
||||
Size int64 // The size of the stream in bytes
|
||||
Name string // The name of the stream (for BackupAlternateData only).
|
||||
Offset int64 // The offset of the stream in the file (for BackupSparseBlock only).
|
||||
}
|
||||
|
||||
type win32StreamId struct {
|
||||
StreamId uint32
|
||||
Attributes uint32
|
||||
Size uint64
|
||||
NameSize uint32
|
||||
}
|
||||
|
||||
// BackupStreamReader reads from a stream produced by the BackupRead Win32 API and produces a series
|
||||
// of BackupHeader values.
|
||||
type BackupStreamReader struct {
|
||||
r io.Reader
|
||||
bytesLeft int64
|
||||
}
|
||||
|
||||
// NewBackupStreamReader produces a BackupStreamReader from any io.Reader.
|
||||
func NewBackupStreamReader(r io.Reader) *BackupStreamReader {
|
||||
return &BackupStreamReader{r, 0}
|
||||
}
|
||||
|
||||
// Next returns the next backup stream and prepares for calls to Read(). It skips the remainder of the current stream if
|
||||
// it was not completely read.
|
||||
func (r *BackupStreamReader) Next() (*BackupHeader, error) {
|
||||
if r.bytesLeft > 0 {
|
||||
if s, ok := r.r.(io.Seeker); ok {
|
||||
// Make sure Seek on io.SeekCurrent sometimes succeeds
|
||||
// before trying the actual seek.
|
||||
if _, err := s.Seek(0, io.SeekCurrent); err == nil {
|
||||
if _, err = s.Seek(r.bytesLeft, io.SeekCurrent); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
r.bytesLeft = 0
|
||||
}
|
||||
}
|
||||
if _, err := io.Copy(ioutil.Discard, r); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
}
|
||||
var wsi win32StreamId
|
||||
if err := binary.Read(r.r, binary.LittleEndian, &wsi); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
hdr := &BackupHeader{
|
||||
Id: wsi.StreamId,
|
||||
Attributes: wsi.Attributes,
|
||||
Size: int64(wsi.Size),
|
||||
}
|
||||
if wsi.NameSize != 0 {
|
||||
name := make([]uint16, int(wsi.NameSize/2))
|
||||
if err := binary.Read(r.r, binary.LittleEndian, name); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
hdr.Name = syscall.UTF16ToString(name)
|
||||
}
|
||||
if wsi.StreamId == BackupSparseBlock {
|
||||
if err := binary.Read(r.r, binary.LittleEndian, &hdr.Offset); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
hdr.Size -= 8
|
||||
}
|
||||
r.bytesLeft = hdr.Size
|
||||
return hdr, nil
|
||||
}
|
||||
|
||||
// Read reads from the current backup stream.
|
||||
func (r *BackupStreamReader) Read(b []byte) (int, error) {
|
||||
if r.bytesLeft == 0 {
|
||||
return 0, io.EOF
|
||||
}
|
||||
if int64(len(b)) > r.bytesLeft {
|
||||
b = b[:r.bytesLeft]
|
||||
}
|
||||
n, err := r.r.Read(b)
|
||||
r.bytesLeft -= int64(n)
|
||||
if err == io.EOF {
|
||||
err = io.ErrUnexpectedEOF
|
||||
} else if r.bytesLeft == 0 && err == nil {
|
||||
err = io.EOF
|
||||
}
|
||||
return n, err
|
||||
}
|
||||
|
||||
// BackupStreamWriter writes a stream compatible with the BackupWrite Win32 API.
|
||||
type BackupStreamWriter struct {
|
||||
w io.Writer
|
||||
bytesLeft int64
|
||||
}
|
||||
|
||||
// NewBackupStreamWriter produces a BackupStreamWriter on top of an io.Writer.
|
||||
func NewBackupStreamWriter(w io.Writer) *BackupStreamWriter {
|
||||
return &BackupStreamWriter{w, 0}
|
||||
}
|
||||
|
||||
// WriteHeader writes the next backup stream header and prepares for calls to Write().
|
||||
func (w *BackupStreamWriter) WriteHeader(hdr *BackupHeader) error {
|
||||
if w.bytesLeft != 0 {
|
||||
return fmt.Errorf("missing %d bytes", w.bytesLeft)
|
||||
}
|
||||
name := utf16.Encode([]rune(hdr.Name))
|
||||
wsi := win32StreamId{
|
||||
StreamId: hdr.Id,
|
||||
Attributes: hdr.Attributes,
|
||||
Size: uint64(hdr.Size),
|
||||
NameSize: uint32(len(name) * 2),
|
||||
}
|
||||
if hdr.Id == BackupSparseBlock {
|
||||
// Include space for the int64 block offset
|
||||
wsi.Size += 8
|
||||
}
|
||||
if err := binary.Write(w.w, binary.LittleEndian, &wsi); err != nil {
|
||||
return err
|
||||
}
|
||||
if len(name) != 0 {
|
||||
if err := binary.Write(w.w, binary.LittleEndian, name); err != nil {
|
||||
return err
|
||||
}
|
||||
}
|
||||
if hdr.Id == BackupSparseBlock {
|
||||
if err := binary.Write(w.w, binary.LittleEndian, hdr.Offset); err != nil {
|
||||
return err
|
||||
}
|
||||
}
|
||||
w.bytesLeft = hdr.Size
|
||||
return nil
|
||||
}
|
||||
|
||||
// Write writes to the current backup stream.
|
||||
func (w *BackupStreamWriter) Write(b []byte) (int, error) {
|
||||
if w.bytesLeft < int64(len(b)) {
|
||||
return 0, fmt.Errorf("too many bytes by %d", int64(len(b))-w.bytesLeft)
|
||||
}
|
||||
n, err := w.w.Write(b)
|
||||
w.bytesLeft -= int64(n)
|
||||
return n, err
|
||||
}
|
||||
|
||||
// BackupFileReader provides an io.ReadCloser interface on top of the BackupRead Win32 API.
|
||||
type BackupFileReader struct {
|
||||
f *os.File
|
||||
includeSecurity bool
|
||||
ctx uintptr
|
||||
}
|
||||
|
||||
// NewBackupFileReader returns a new BackupFileReader from a file handle. If includeSecurity is true,
|
||||
// Read will attempt to read the security descriptor of the file.
|
||||
func NewBackupFileReader(f *os.File, includeSecurity bool) *BackupFileReader {
|
||||
r := &BackupFileReader{f, includeSecurity, 0}
|
||||
return r
|
||||
}
|
||||
|
||||
// Read reads a backup stream from the file by calling the Win32 API BackupRead().
|
||||
func (r *BackupFileReader) Read(b []byte) (int, error) {
|
||||
var bytesRead uint32
|
||||
err := backupRead(syscall.Handle(r.f.Fd()), b, &bytesRead, false, r.includeSecurity, &r.ctx)
|
||||
if err != nil {
|
||||
return 0, &os.PathError{"BackupRead", r.f.Name(), err}
|
||||
}
|
||||
runtime.KeepAlive(r.f)
|
||||
if bytesRead == 0 {
|
||||
return 0, io.EOF
|
||||
}
|
||||
return int(bytesRead), nil
|
||||
}
|
||||
|
||||
// Close frees Win32 resources associated with the BackupFileReader. It does not close
|
||||
// the underlying file.
|
||||
func (r *BackupFileReader) Close() error {
|
||||
if r.ctx != 0 {
|
||||
backupRead(syscall.Handle(r.f.Fd()), nil, nil, true, false, &r.ctx)
|
||||
runtime.KeepAlive(r.f)
|
||||
r.ctx = 0
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// BackupFileWriter provides an io.WriteCloser interface on top of the BackupWrite Win32 API.
|
||||
type BackupFileWriter struct {
|
||||
f *os.File
|
||||
includeSecurity bool
|
||||
ctx uintptr
|
||||
}
|
||||
|
||||
// NewBackupFileWriter returns a new BackupFileWriter from a file handle. If includeSecurity is true,
|
||||
// Write() will attempt to restore the security descriptor from the stream.
|
||||
func NewBackupFileWriter(f *os.File, includeSecurity bool) *BackupFileWriter {
|
||||
w := &BackupFileWriter{f, includeSecurity, 0}
|
||||
return w
|
||||
}
|
||||
|
||||
// Write restores a portion of the file using the provided backup stream.
|
||||
func (w *BackupFileWriter) Write(b []byte) (int, error) {
|
||||
var bytesWritten uint32
|
||||
err := backupWrite(syscall.Handle(w.f.Fd()), b, &bytesWritten, false, w.includeSecurity, &w.ctx)
|
||||
if err != nil {
|
||||
return 0, &os.PathError{"BackupWrite", w.f.Name(), err}
|
||||
}
|
||||
runtime.KeepAlive(w.f)
|
||||
if int(bytesWritten) != len(b) {
|
||||
return int(bytesWritten), errors.New("not all bytes could be written")
|
||||
}
|
||||
return len(b), nil
|
||||
}
|
||||
|
||||
// Close frees Win32 resources associated with the BackupFileWriter. It does not
|
||||
// close the underlying file.
|
||||
func (w *BackupFileWriter) Close() error {
|
||||
if w.ctx != 0 {
|
||||
backupWrite(syscall.Handle(w.f.Fd()), nil, nil, true, false, &w.ctx)
|
||||
runtime.KeepAlive(w.f)
|
||||
w.ctx = 0
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// OpenForBackup opens a file or directory, potentially skipping access checks if the backup
|
||||
// or restore privileges have been acquired.
|
||||
//
|
||||
// If the file opened was a directory, it cannot be used with Readdir().
|
||||
func OpenForBackup(path string, access uint32, share uint32, createmode uint32) (*os.File, error) {
|
||||
winPath, err := syscall.UTF16FromString(path)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
h, err := syscall.CreateFile(&winPath[0], access, share, nil, createmode, syscall.FILE_FLAG_BACKUP_SEMANTICS|syscall.FILE_FLAG_OPEN_REPARSE_POINT, 0)
|
||||
if err != nil {
|
||||
err = &os.PathError{Op: "open", Path: path, Err: err}
|
||||
return nil, err
|
||||
}
|
||||
return os.NewFile(uintptr(h), path), nil
|
||||
}
|
||||
4
vendor/github.com/Microsoft/go-winio/backuptar/noop.go
generated
vendored
Normal file
4
vendor/github.com/Microsoft/go-winio/backuptar/noop.go
generated
vendored
Normal file
@@ -0,0 +1,4 @@
|
||||
// +build !windows
|
||||
// This file only exists to allow go get on non-Windows platforms.
|
||||
|
||||
package backuptar
|
||||
439
vendor/github.com/Microsoft/go-winio/backuptar/tar.go
generated
vendored
Normal file
439
vendor/github.com/Microsoft/go-winio/backuptar/tar.go
generated
vendored
Normal file
@@ -0,0 +1,439 @@
|
||||
// +build windows
|
||||
|
||||
package backuptar
|
||||
|
||||
import (
|
||||
"encoding/base64"
|
||||
"errors"
|
||||
"fmt"
|
||||
"io"
|
||||
"io/ioutil"
|
||||
"path/filepath"
|
||||
"strconv"
|
||||
"strings"
|
||||
"syscall"
|
||||
"time"
|
||||
|
||||
"github.com/Microsoft/go-winio"
|
||||
"github.com/Microsoft/go-winio/archive/tar" // until archive/tar supports pax extensions in its interface
|
||||
)
|
||||
|
||||
const (
|
||||
c_ISUID = 04000 // Set uid
|
||||
c_ISGID = 02000 // Set gid
|
||||
c_ISVTX = 01000 // Save text (sticky bit)
|
||||
c_ISDIR = 040000 // Directory
|
||||
c_ISFIFO = 010000 // FIFO
|
||||
c_ISREG = 0100000 // Regular file
|
||||
c_ISLNK = 0120000 // Symbolic link
|
||||
c_ISBLK = 060000 // Block special file
|
||||
c_ISCHR = 020000 // Character special file
|
||||
c_ISSOCK = 0140000 // Socket
|
||||
)
|
||||
|
||||
const (
|
||||
hdrFileAttributes = "fileattr"
|
||||
hdrSecurityDescriptor = "sd"
|
||||
hdrRawSecurityDescriptor = "rawsd"
|
||||
hdrMountPoint = "mountpoint"
|
||||
hdrEaPrefix = "xattr."
|
||||
)
|
||||
|
||||
func writeZeroes(w io.Writer, count int64) error {
|
||||
buf := make([]byte, 8192)
|
||||
c := len(buf)
|
||||
for i := int64(0); i < count; i += int64(c) {
|
||||
if int64(c) > count-i {
|
||||
c = int(count - i)
|
||||
}
|
||||
_, err := w.Write(buf[:c])
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func copySparse(t *tar.Writer, br *winio.BackupStreamReader) error {
|
||||
curOffset := int64(0)
|
||||
for {
|
||||
bhdr, err := br.Next()
|
||||
if err == io.EOF {
|
||||
err = io.ErrUnexpectedEOF
|
||||
}
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
if bhdr.Id != winio.BackupSparseBlock {
|
||||
return fmt.Errorf("unexpected stream %d", bhdr.Id)
|
||||
}
|
||||
|
||||
// archive/tar does not support writing sparse files
|
||||
// so just write zeroes to catch up to the current offset.
|
||||
err = writeZeroes(t, bhdr.Offset-curOffset)
|
||||
if bhdr.Size == 0 {
|
||||
break
|
||||
}
|
||||
n, err := io.Copy(t, br)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
curOffset = bhdr.Offset + n
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// BasicInfoHeader creates a tar header from basic file information.
|
||||
func BasicInfoHeader(name string, size int64, fileInfo *winio.FileBasicInfo) *tar.Header {
|
||||
hdr := &tar.Header{
|
||||
Name: filepath.ToSlash(name),
|
||||
Size: size,
|
||||
Typeflag: tar.TypeReg,
|
||||
ModTime: time.Unix(0, fileInfo.LastWriteTime.Nanoseconds()),
|
||||
ChangeTime: time.Unix(0, fileInfo.ChangeTime.Nanoseconds()),
|
||||
AccessTime: time.Unix(0, fileInfo.LastAccessTime.Nanoseconds()),
|
||||
CreationTime: time.Unix(0, fileInfo.CreationTime.Nanoseconds()),
|
||||
Winheaders: make(map[string]string),
|
||||
}
|
||||
hdr.Winheaders[hdrFileAttributes] = fmt.Sprintf("%d", fileInfo.FileAttributes)
|
||||
|
||||
if (fileInfo.FileAttributes & syscall.FILE_ATTRIBUTE_DIRECTORY) != 0 {
|
||||
hdr.Mode |= c_ISDIR
|
||||
hdr.Size = 0
|
||||
hdr.Typeflag = tar.TypeDir
|
||||
}
|
||||
return hdr
|
||||
}
|
||||
|
||||
// WriteTarFileFromBackupStream writes a file to a tar writer using data from a Win32 backup stream.
|
||||
//
|
||||
// This encodes Win32 metadata as tar pax vendor extensions starting with MSWINDOWS.
|
||||
//
|
||||
// The additional Win32 metadata is:
|
||||
//
|
||||
// MSWINDOWS.fileattr: The Win32 file attributes, as a decimal value
|
||||
//
|
||||
// MSWINDOWS.rawsd: The Win32 security descriptor, in raw binary format
|
||||
//
|
||||
// MSWINDOWS.mountpoint: If present, this is a mount point and not a symlink, even though the type is '2' (symlink)
|
||||
func WriteTarFileFromBackupStream(t *tar.Writer, r io.Reader, name string, size int64, fileInfo *winio.FileBasicInfo) error {
|
||||
name = filepath.ToSlash(name)
|
||||
hdr := BasicInfoHeader(name, size, fileInfo)
|
||||
|
||||
// If r can be seeked, then this function is two-pass: pass 1 collects the
|
||||
// tar header data, and pass 2 copies the data stream. If r cannot be
|
||||
// seeked, then some header data (in particular EAs) will be silently lost.
|
||||
var (
|
||||
restartPos int64
|
||||
err error
|
||||
)
|
||||
sr, readTwice := r.(io.Seeker)
|
||||
if readTwice {
|
||||
if restartPos, err = sr.Seek(0, io.SeekCurrent); err != nil {
|
||||
readTwice = false
|
||||
}
|
||||
}
|
||||
|
||||
br := winio.NewBackupStreamReader(r)
|
||||
var dataHdr *winio.BackupHeader
|
||||
for dataHdr == nil {
|
||||
bhdr, err := br.Next()
|
||||
if err == io.EOF {
|
||||
break
|
||||
}
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
switch bhdr.Id {
|
||||
case winio.BackupData:
|
||||
hdr.Mode |= c_ISREG
|
||||
if !readTwice {
|
||||
dataHdr = bhdr
|
||||
}
|
||||
case winio.BackupSecurity:
|
||||
sd, err := ioutil.ReadAll(br)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
hdr.Winheaders[hdrRawSecurityDescriptor] = base64.StdEncoding.EncodeToString(sd)
|
||||
|
||||
case winio.BackupReparseData:
|
||||
hdr.Mode |= c_ISLNK
|
||||
hdr.Typeflag = tar.TypeSymlink
|
||||
reparseBuffer, err := ioutil.ReadAll(br)
|
||||
rp, err := winio.DecodeReparsePoint(reparseBuffer)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
if rp.IsMountPoint {
|
||||
hdr.Winheaders[hdrMountPoint] = "1"
|
||||
}
|
||||
hdr.Linkname = rp.Target
|
||||
|
||||
case winio.BackupEaData:
|
||||
eab, err := ioutil.ReadAll(br)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
eas, err := winio.DecodeExtendedAttributes(eab)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
for _, ea := range eas {
|
||||
// Use base64 encoding for the binary value. Note that there
|
||||
// is no way to encode the EA's flags, since their use doesn't
|
||||
// make any sense for persisted EAs.
|
||||
hdr.Winheaders[hdrEaPrefix+ea.Name] = base64.StdEncoding.EncodeToString(ea.Value)
|
||||
}
|
||||
|
||||
case winio.BackupAlternateData, winio.BackupLink, winio.BackupPropertyData, winio.BackupObjectId, winio.BackupTxfsData:
|
||||
// ignore these streams
|
||||
default:
|
||||
return fmt.Errorf("%s: unknown stream ID %d", name, bhdr.Id)
|
||||
}
|
||||
}
|
||||
|
||||
err = t.WriteHeader(hdr)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
if readTwice {
|
||||
// Get back to the data stream.
|
||||
if _, err = sr.Seek(restartPos, io.SeekStart); err != nil {
|
||||
return err
|
||||
}
|
||||
for dataHdr == nil {
|
||||
bhdr, err := br.Next()
|
||||
if err == io.EOF {
|
||||
break
|
||||
}
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
if bhdr.Id == winio.BackupData {
|
||||
dataHdr = bhdr
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
if dataHdr != nil {
|
||||
// A data stream was found. Copy the data.
|
||||
if (dataHdr.Attributes & winio.StreamSparseAttributes) == 0 {
|
||||
if size != dataHdr.Size {
|
||||
return fmt.Errorf("%s: mismatch between file size %d and header size %d", name, size, dataHdr.Size)
|
||||
}
|
||||
_, err = io.Copy(t, br)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
} else {
|
||||
err = copySparse(t, br)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Look for streams after the data stream. The only ones we handle are alternate data streams.
|
||||
// Other streams may have metadata that could be serialized, but the tar header has already
|
||||
// been written. In practice, this means that we don't get EA or TXF metadata.
|
||||
for {
|
||||
bhdr, err := br.Next()
|
||||
if err == io.EOF {
|
||||
break
|
||||
}
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
switch bhdr.Id {
|
||||
case winio.BackupAlternateData:
|
||||
altName := bhdr.Name
|
||||
if strings.HasSuffix(altName, ":$DATA") {
|
||||
altName = altName[:len(altName)-len(":$DATA")]
|
||||
}
|
||||
if (bhdr.Attributes & winio.StreamSparseAttributes) == 0 {
|
||||
hdr = &tar.Header{
|
||||
Name: name + altName,
|
||||
Mode: hdr.Mode,
|
||||
Typeflag: tar.TypeReg,
|
||||
Size: bhdr.Size,
|
||||
ModTime: hdr.ModTime,
|
||||
AccessTime: hdr.AccessTime,
|
||||
ChangeTime: hdr.ChangeTime,
|
||||
}
|
||||
err = t.WriteHeader(hdr)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
_, err = io.Copy(t, br)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
} else {
|
||||
// Unsupported for now, since the size of the alternate stream is not present
|
||||
// in the backup stream until after the data has been read.
|
||||
return errors.New("tar of sparse alternate data streams is unsupported")
|
||||
}
|
||||
case winio.BackupEaData, winio.BackupLink, winio.BackupPropertyData, winio.BackupObjectId, winio.BackupTxfsData:
|
||||
// ignore these streams
|
||||
default:
|
||||
return fmt.Errorf("%s: unknown stream ID %d after data", name, bhdr.Id)
|
||||
}
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// FileInfoFromHeader retrieves basic Win32 file information from a tar header, using the additional metadata written by
|
||||
// WriteTarFileFromBackupStream.
|
||||
func FileInfoFromHeader(hdr *tar.Header) (name string, size int64, fileInfo *winio.FileBasicInfo, err error) {
|
||||
name = hdr.Name
|
||||
if hdr.Typeflag == tar.TypeReg || hdr.Typeflag == tar.TypeRegA {
|
||||
size = hdr.Size
|
||||
}
|
||||
fileInfo = &winio.FileBasicInfo{
|
||||
LastAccessTime: syscall.NsecToFiletime(hdr.AccessTime.UnixNano()),
|
||||
LastWriteTime: syscall.NsecToFiletime(hdr.ModTime.UnixNano()),
|
||||
ChangeTime: syscall.NsecToFiletime(hdr.ChangeTime.UnixNano()),
|
||||
CreationTime: syscall.NsecToFiletime(hdr.CreationTime.UnixNano()),
|
||||
}
|
||||
if attrStr, ok := hdr.Winheaders[hdrFileAttributes]; ok {
|
||||
attr, err := strconv.ParseUint(attrStr, 10, 32)
|
||||
if err != nil {
|
||||
return "", 0, nil, err
|
||||
}
|
||||
fileInfo.FileAttributes = uint32(attr)
|
||||
} else {
|
||||
if hdr.Typeflag == tar.TypeDir {
|
||||
fileInfo.FileAttributes |= syscall.FILE_ATTRIBUTE_DIRECTORY
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
// WriteBackupStreamFromTarFile writes a Win32 backup stream from the current tar file. Since this function may process multiple
|
||||
// tar file entries in order to collect all the alternate data streams for the file, it returns the next
|
||||
// tar file that was not processed, or io.EOF is there are no more.
|
||||
func WriteBackupStreamFromTarFile(w io.Writer, t *tar.Reader, hdr *tar.Header) (*tar.Header, error) {
|
||||
bw := winio.NewBackupStreamWriter(w)
|
||||
var sd []byte
|
||||
var err error
|
||||
// Maintaining old SDDL-based behavior for backward compatibility. All new tar headers written
|
||||
// by this library will have raw binary for the security descriptor.
|
||||
if sddl, ok := hdr.Winheaders[hdrSecurityDescriptor]; ok {
|
||||
sd, err = winio.SddlToSecurityDescriptor(sddl)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
}
|
||||
if sdraw, ok := hdr.Winheaders[hdrRawSecurityDescriptor]; ok {
|
||||
sd, err = base64.StdEncoding.DecodeString(sdraw)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
}
|
||||
if len(sd) != 0 {
|
||||
bhdr := winio.BackupHeader{
|
||||
Id: winio.BackupSecurity,
|
||||
Size: int64(len(sd)),
|
||||
}
|
||||
err := bw.WriteHeader(&bhdr)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
_, err = bw.Write(sd)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
}
|
||||
var eas []winio.ExtendedAttribute
|
||||
for k, v := range hdr.Winheaders {
|
||||
if !strings.HasPrefix(k, hdrEaPrefix) {
|
||||
continue
|
||||
}
|
||||
data, err := base64.StdEncoding.DecodeString(v)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
eas = append(eas, winio.ExtendedAttribute{
|
||||
Name: k[len(hdrEaPrefix):],
|
||||
Value: data,
|
||||
})
|
||||
}
|
||||
if len(eas) != 0 {
|
||||
eadata, err := winio.EncodeExtendedAttributes(eas)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
bhdr := winio.BackupHeader{
|
||||
Id: winio.BackupEaData,
|
||||
Size: int64(len(eadata)),
|
||||
}
|
||||
err = bw.WriteHeader(&bhdr)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
_, err = bw.Write(eadata)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
}
|
||||
if hdr.Typeflag == tar.TypeSymlink {
|
||||
_, isMountPoint := hdr.Winheaders[hdrMountPoint]
|
||||
rp := winio.ReparsePoint{
|
||||
Target: filepath.FromSlash(hdr.Linkname),
|
||||
IsMountPoint: isMountPoint,
|
||||
}
|
||||
reparse := winio.EncodeReparsePoint(&rp)
|
||||
bhdr := winio.BackupHeader{
|
||||
Id: winio.BackupReparseData,
|
||||
Size: int64(len(reparse)),
|
||||
}
|
||||
err := bw.WriteHeader(&bhdr)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
_, err = bw.Write(reparse)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
}
|
||||
if hdr.Typeflag == tar.TypeReg || hdr.Typeflag == tar.TypeRegA {
|
||||
bhdr := winio.BackupHeader{
|
||||
Id: winio.BackupData,
|
||||
Size: hdr.Size,
|
||||
}
|
||||
err := bw.WriteHeader(&bhdr)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
_, err = io.Copy(bw, t)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
}
|
||||
// Copy all the alternate data streams and return the next non-ADS header.
|
||||
for {
|
||||
ahdr, err := t.Next()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
if ahdr.Typeflag != tar.TypeReg || !strings.HasPrefix(ahdr.Name, hdr.Name+":") {
|
||||
return ahdr, nil
|
||||
}
|
||||
bhdr := winio.BackupHeader{
|
||||
Id: winio.BackupAlternateData,
|
||||
Size: ahdr.Size,
|
||||
Name: ahdr.Name[len(hdr.Name):] + ":$DATA",
|
||||
}
|
||||
err = bw.WriteHeader(&bhdr)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
_, err = io.Copy(bw, t)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
}
|
||||
}
|
||||
137
vendor/github.com/Microsoft/go-winio/ea.go
generated
vendored
Normal file
137
vendor/github.com/Microsoft/go-winio/ea.go
generated
vendored
Normal file
@@ -0,0 +1,137 @@
|
||||
package winio
|
||||
|
||||
import (
|
||||
"bytes"
|
||||
"encoding/binary"
|
||||
"errors"
|
||||
)
|
||||
|
||||
type fileFullEaInformation struct {
|
||||
NextEntryOffset uint32
|
||||
Flags uint8
|
||||
NameLength uint8
|
||||
ValueLength uint16
|
||||
}
|
||||
|
||||
var (
|
||||
fileFullEaInformationSize = binary.Size(&fileFullEaInformation{})
|
||||
|
||||
errInvalidEaBuffer = errors.New("invalid extended attribute buffer")
|
||||
errEaNameTooLarge = errors.New("extended attribute name too large")
|
||||
errEaValueTooLarge = errors.New("extended attribute value too large")
|
||||
)
|
||||
|
||||
// ExtendedAttribute represents a single Windows EA.
|
||||
type ExtendedAttribute struct {
|
||||
Name string
|
||||
Value []byte
|
||||
Flags uint8
|
||||
}
|
||||
|
||||
func parseEa(b []byte) (ea ExtendedAttribute, nb []byte, err error) {
|
||||
var info fileFullEaInformation
|
||||
err = binary.Read(bytes.NewReader(b), binary.LittleEndian, &info)
|
||||
if err != nil {
|
||||
err = errInvalidEaBuffer
|
||||
return
|
||||
}
|
||||
|
||||
nameOffset := fileFullEaInformationSize
|
||||
nameLen := int(info.NameLength)
|
||||
valueOffset := nameOffset + int(info.NameLength) + 1
|
||||
valueLen := int(info.ValueLength)
|
||||
nextOffset := int(info.NextEntryOffset)
|
||||
if valueLen+valueOffset > len(b) || nextOffset < 0 || nextOffset > len(b) {
|
||||
err = errInvalidEaBuffer
|
||||
return
|
||||
}
|
||||
|
||||
ea.Name = string(b[nameOffset : nameOffset+nameLen])
|
||||
ea.Value = b[valueOffset : valueOffset+valueLen]
|
||||
ea.Flags = info.Flags
|
||||
if info.NextEntryOffset != 0 {
|
||||
nb = b[info.NextEntryOffset:]
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
// DecodeExtendedAttributes decodes a list of EAs from a FILE_FULL_EA_INFORMATION
|
||||
// buffer retrieved from BackupRead, ZwQueryEaFile, etc.
|
||||
func DecodeExtendedAttributes(b []byte) (eas []ExtendedAttribute, err error) {
|
||||
for len(b) != 0 {
|
||||
ea, nb, err := parseEa(b)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
eas = append(eas, ea)
|
||||
b = nb
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func writeEa(buf *bytes.Buffer, ea *ExtendedAttribute, last bool) error {
|
||||
if int(uint8(len(ea.Name))) != len(ea.Name) {
|
||||
return errEaNameTooLarge
|
||||
}
|
||||
if int(uint16(len(ea.Value))) != len(ea.Value) {
|
||||
return errEaValueTooLarge
|
||||
}
|
||||
entrySize := uint32(fileFullEaInformationSize + len(ea.Name) + 1 + len(ea.Value))
|
||||
withPadding := (entrySize + 3) &^ 3
|
||||
nextOffset := uint32(0)
|
||||
if !last {
|
||||
nextOffset = withPadding
|
||||
}
|
||||
info := fileFullEaInformation{
|
||||
NextEntryOffset: nextOffset,
|
||||
Flags: ea.Flags,
|
||||
NameLength: uint8(len(ea.Name)),
|
||||
ValueLength: uint16(len(ea.Value)),
|
||||
}
|
||||
|
||||
err := binary.Write(buf, binary.LittleEndian, &info)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
_, err = buf.Write([]byte(ea.Name))
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
err = buf.WriteByte(0)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
_, err = buf.Write(ea.Value)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
_, err = buf.Write([]byte{0, 0, 0}[0 : withPadding-entrySize])
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// EncodeExtendedAttributes encodes a list of EAs into a FILE_FULL_EA_INFORMATION
|
||||
// buffer for use with BackupWrite, ZwSetEaFile, etc.
|
||||
func EncodeExtendedAttributes(eas []ExtendedAttribute) ([]byte, error) {
|
||||
var buf bytes.Buffer
|
||||
for i := range eas {
|
||||
last := false
|
||||
if i == len(eas)-1 {
|
||||
last = true
|
||||
}
|
||||
|
||||
err := writeEa(&buf, &eas[i], last)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
}
|
||||
return buf.Bytes(), nil
|
||||
}
|
||||
307
vendor/github.com/Microsoft/go-winio/file.go
generated
vendored
Normal file
307
vendor/github.com/Microsoft/go-winio/file.go
generated
vendored
Normal file
@@ -0,0 +1,307 @@
|
||||
// +build windows
|
||||
|
||||
package winio
|
||||
|
||||
import (
|
||||
"errors"
|
||||
"io"
|
||||
"runtime"
|
||||
"sync"
|
||||
"sync/atomic"
|
||||
"syscall"
|
||||
"time"
|
||||
)
|
||||
|
||||
//sys cancelIoEx(file syscall.Handle, o *syscall.Overlapped) (err error) = CancelIoEx
|
||||
//sys createIoCompletionPort(file syscall.Handle, port syscall.Handle, key uintptr, threadCount uint32) (newport syscall.Handle, err error) = CreateIoCompletionPort
|
||||
//sys getQueuedCompletionStatus(port syscall.Handle, bytes *uint32, key *uintptr, o **ioOperation, timeout uint32) (err error) = GetQueuedCompletionStatus
|
||||
//sys setFileCompletionNotificationModes(h syscall.Handle, flags uint8) (err error) = SetFileCompletionNotificationModes
|
||||
|
||||
type atomicBool int32
|
||||
|
||||
func (b *atomicBool) isSet() bool { return atomic.LoadInt32((*int32)(b)) != 0 }
|
||||
func (b *atomicBool) setFalse() { atomic.StoreInt32((*int32)(b), 0) }
|
||||
func (b *atomicBool) setTrue() { atomic.StoreInt32((*int32)(b), 1) }
|
||||
func (b *atomicBool) swap(new bool) bool {
|
||||
var newInt int32
|
||||
if new {
|
||||
newInt = 1
|
||||
}
|
||||
return atomic.SwapInt32((*int32)(b), newInt) == 1
|
||||
}
|
||||
|
||||
const (
|
||||
cFILE_SKIP_COMPLETION_PORT_ON_SUCCESS = 1
|
||||
cFILE_SKIP_SET_EVENT_ON_HANDLE = 2
|
||||
)
|
||||
|
||||
var (
|
||||
ErrFileClosed = errors.New("file has already been closed")
|
||||
ErrTimeout = &timeoutError{}
|
||||
)
|
||||
|
||||
type timeoutError struct{}
|
||||
|
||||
func (e *timeoutError) Error() string { return "i/o timeout" }
|
||||
func (e *timeoutError) Timeout() bool { return true }
|
||||
func (e *timeoutError) Temporary() bool { return true }
|
||||
|
||||
type timeoutChan chan struct{}
|
||||
|
||||
var ioInitOnce sync.Once
|
||||
var ioCompletionPort syscall.Handle
|
||||
|
||||
// ioResult contains the result of an asynchronous IO operation
|
||||
type ioResult struct {
|
||||
bytes uint32
|
||||
err error
|
||||
}
|
||||
|
||||
// ioOperation represents an outstanding asynchronous Win32 IO
|
||||
type ioOperation struct {
|
||||
o syscall.Overlapped
|
||||
ch chan ioResult
|
||||
}
|
||||
|
||||
func initIo() {
|
||||
h, err := createIoCompletionPort(syscall.InvalidHandle, 0, 0, 0xffffffff)
|
||||
if err != nil {
|
||||
panic(err)
|
||||
}
|
||||
ioCompletionPort = h
|
||||
go ioCompletionProcessor(h)
|
||||
}
|
||||
|
||||
// win32File implements Reader, Writer, and Closer on a Win32 handle without blocking in a syscall.
|
||||
// It takes ownership of this handle and will close it if it is garbage collected.
|
||||
type win32File struct {
|
||||
handle syscall.Handle
|
||||
wg sync.WaitGroup
|
||||
wgLock sync.RWMutex
|
||||
closing atomicBool
|
||||
readDeadline deadlineHandler
|
||||
writeDeadline deadlineHandler
|
||||
}
|
||||
|
||||
type deadlineHandler struct {
|
||||
setLock sync.Mutex
|
||||
channel timeoutChan
|
||||
channelLock sync.RWMutex
|
||||
timer *time.Timer
|
||||
timedout atomicBool
|
||||
}
|
||||
|
||||
// makeWin32File makes a new win32File from an existing file handle
|
||||
func makeWin32File(h syscall.Handle) (*win32File, error) {
|
||||
f := &win32File{handle: h}
|
||||
ioInitOnce.Do(initIo)
|
||||
_, err := createIoCompletionPort(h, ioCompletionPort, 0, 0xffffffff)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
err = setFileCompletionNotificationModes(h, cFILE_SKIP_COMPLETION_PORT_ON_SUCCESS|cFILE_SKIP_SET_EVENT_ON_HANDLE)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
f.readDeadline.channel = make(timeoutChan)
|
||||
f.writeDeadline.channel = make(timeoutChan)
|
||||
return f, nil
|
||||
}
|
||||
|
||||
func MakeOpenFile(h syscall.Handle) (io.ReadWriteCloser, error) {
|
||||
return makeWin32File(h)
|
||||
}
|
||||
|
||||
// closeHandle closes the resources associated with a Win32 handle
|
||||
func (f *win32File) closeHandle() {
|
||||
f.wgLock.Lock()
|
||||
// Atomically set that we are closing, releasing the resources only once.
|
||||
if !f.closing.swap(true) {
|
||||
f.wgLock.Unlock()
|
||||
// cancel all IO and wait for it to complete
|
||||
cancelIoEx(f.handle, nil)
|
||||
f.wg.Wait()
|
||||
// at this point, no new IO can start
|
||||
syscall.Close(f.handle)
|
||||
f.handle = 0
|
||||
} else {
|
||||
f.wgLock.Unlock()
|
||||
}
|
||||
}
|
||||
|
||||
// Close closes a win32File.
|
||||
func (f *win32File) Close() error {
|
||||
f.closeHandle()
|
||||
return nil
|
||||
}
|
||||
|
||||
// prepareIo prepares for a new IO operation.
|
||||
// The caller must call f.wg.Done() when the IO is finished, prior to Close() returning.
|
||||
func (f *win32File) prepareIo() (*ioOperation, error) {
|
||||
f.wgLock.RLock()
|
||||
if f.closing.isSet() {
|
||||
f.wgLock.RUnlock()
|
||||
return nil, ErrFileClosed
|
||||
}
|
||||
f.wg.Add(1)
|
||||
f.wgLock.RUnlock()
|
||||
c := &ioOperation{}
|
||||
c.ch = make(chan ioResult)
|
||||
return c, nil
|
||||
}
|
||||
|
||||
// ioCompletionProcessor processes completed async IOs forever
|
||||
func ioCompletionProcessor(h syscall.Handle) {
|
||||
for {
|
||||
var bytes uint32
|
||||
var key uintptr
|
||||
var op *ioOperation
|
||||
err := getQueuedCompletionStatus(h, &bytes, &key, &op, syscall.INFINITE)
|
||||
if op == nil {
|
||||
panic(err)
|
||||
}
|
||||
op.ch <- ioResult{bytes, err}
|
||||
}
|
||||
}
|
||||
|
||||
// asyncIo processes the return value from ReadFile or WriteFile, blocking until
|
||||
// the operation has actually completed.
|
||||
func (f *win32File) asyncIo(c *ioOperation, d *deadlineHandler, bytes uint32, err error) (int, error) {
|
||||
if err != syscall.ERROR_IO_PENDING {
|
||||
return int(bytes), err
|
||||
}
|
||||
|
||||
if f.closing.isSet() {
|
||||
cancelIoEx(f.handle, &c.o)
|
||||
}
|
||||
|
||||
var timeout timeoutChan
|
||||
if d != nil {
|
||||
d.channelLock.Lock()
|
||||
timeout = d.channel
|
||||
d.channelLock.Unlock()
|
||||
}
|
||||
|
||||
var r ioResult
|
||||
select {
|
||||
case r = <-c.ch:
|
||||
err = r.err
|
||||
if err == syscall.ERROR_OPERATION_ABORTED {
|
||||
if f.closing.isSet() {
|
||||
err = ErrFileClosed
|
||||
}
|
||||
}
|
||||
case <-timeout:
|
||||
cancelIoEx(f.handle, &c.o)
|
||||
r = <-c.ch
|
||||
err = r.err
|
||||
if err == syscall.ERROR_OPERATION_ABORTED {
|
||||
err = ErrTimeout
|
||||
}
|
||||
}
|
||||
|
||||
// runtime.KeepAlive is needed, as c is passed via native
|
||||
// code to ioCompletionProcessor, c must remain alive
|
||||
// until the channel read is complete.
|
||||
runtime.KeepAlive(c)
|
||||
return int(r.bytes), err
|
||||
}
|
||||
|
||||
// Read reads from a file handle.
|
||||
func (f *win32File) Read(b []byte) (int, error) {
|
||||
c, err := f.prepareIo()
|
||||
if err != nil {
|
||||
return 0, err
|
||||
}
|
||||
defer f.wg.Done()
|
||||
|
||||
if f.readDeadline.timedout.isSet() {
|
||||
return 0, ErrTimeout
|
||||
}
|
||||
|
||||
var bytes uint32
|
||||
err = syscall.ReadFile(f.handle, b, &bytes, &c.o)
|
||||
n, err := f.asyncIo(c, &f.readDeadline, bytes, err)
|
||||
runtime.KeepAlive(b)
|
||||
|
||||
// Handle EOF conditions.
|
||||
if err == nil && n == 0 && len(b) != 0 {
|
||||
return 0, io.EOF
|
||||
} else if err == syscall.ERROR_BROKEN_PIPE {
|
||||
return 0, io.EOF
|
||||
} else {
|
||||
return n, err
|
||||
}
|
||||
}
|
||||
|
||||
// Write writes to a file handle.
|
||||
func (f *win32File) Write(b []byte) (int, error) {
|
||||
c, err := f.prepareIo()
|
||||
if err != nil {
|
||||
return 0, err
|
||||
}
|
||||
defer f.wg.Done()
|
||||
|
||||
if f.writeDeadline.timedout.isSet() {
|
||||
return 0, ErrTimeout
|
||||
}
|
||||
|
||||
var bytes uint32
|
||||
err = syscall.WriteFile(f.handle, b, &bytes, &c.o)
|
||||
n, err := f.asyncIo(c, &f.writeDeadline, bytes, err)
|
||||
runtime.KeepAlive(b)
|
||||
return n, err
|
||||
}
|
||||
|
||||
func (f *win32File) SetReadDeadline(deadline time.Time) error {
|
||||
return f.readDeadline.set(deadline)
|
||||
}
|
||||
|
||||
func (f *win32File) SetWriteDeadline(deadline time.Time) error {
|
||||
return f.writeDeadline.set(deadline)
|
||||
}
|
||||
|
||||
func (f *win32File) Flush() error {
|
||||
return syscall.FlushFileBuffers(f.handle)
|
||||
}
|
||||
|
||||
func (d *deadlineHandler) set(deadline time.Time) error {
|
||||
d.setLock.Lock()
|
||||
defer d.setLock.Unlock()
|
||||
|
||||
if d.timer != nil {
|
||||
if !d.timer.Stop() {
|
||||
<-d.channel
|
||||
}
|
||||
d.timer = nil
|
||||
}
|
||||
d.timedout.setFalse()
|
||||
|
||||
select {
|
||||
case <-d.channel:
|
||||
d.channelLock.Lock()
|
||||
d.channel = make(chan struct{})
|
||||
d.channelLock.Unlock()
|
||||
default:
|
||||
}
|
||||
|
||||
if deadline.IsZero() {
|
||||
return nil
|
||||
}
|
||||
|
||||
timeoutIO := func() {
|
||||
d.timedout.setTrue()
|
||||
close(d.channel)
|
||||
}
|
||||
|
||||
now := time.Now()
|
||||
duration := deadline.Sub(now)
|
||||
if deadline.After(now) {
|
||||
// Deadline is in the future, set a timer to wait
|
||||
d.timer = time.AfterFunc(duration, timeoutIO)
|
||||
} else {
|
||||
// Deadline is in the past. Cancel all pending IO now.
|
||||
timeoutIO()
|
||||
}
|
||||
return nil
|
||||
}
|
||||
61
vendor/github.com/Microsoft/go-winio/fileinfo.go
generated
vendored
Normal file
61
vendor/github.com/Microsoft/go-winio/fileinfo.go
generated
vendored
Normal file
@@ -0,0 +1,61 @@
|
||||
// +build windows
|
||||
|
||||
package winio
|
||||
|
||||
import (
|
||||
"os"
|
||||
"runtime"
|
||||
"syscall"
|
||||
"unsafe"
|
||||
)
|
||||
|
||||
//sys getFileInformationByHandleEx(h syscall.Handle, class uint32, buffer *byte, size uint32) (err error) = GetFileInformationByHandleEx
|
||||
//sys setFileInformationByHandle(h syscall.Handle, class uint32, buffer *byte, size uint32) (err error) = SetFileInformationByHandle
|
||||
|
||||
const (
|
||||
fileBasicInfo = 0
|
||||
fileIDInfo = 0x12
|
||||
)
|
||||
|
||||
// FileBasicInfo contains file access time and file attributes information.
|
||||
type FileBasicInfo struct {
|
||||
CreationTime, LastAccessTime, LastWriteTime, ChangeTime syscall.Filetime
|
||||
FileAttributes uint32
|
||||
pad uint32 // padding
|
||||
}
|
||||
|
||||
// GetFileBasicInfo retrieves times and attributes for a file.
|
||||
func GetFileBasicInfo(f *os.File) (*FileBasicInfo, error) {
|
||||
bi := &FileBasicInfo{}
|
||||
if err := getFileInformationByHandleEx(syscall.Handle(f.Fd()), fileBasicInfo, (*byte)(unsafe.Pointer(bi)), uint32(unsafe.Sizeof(*bi))); err != nil {
|
||||
return nil, &os.PathError{Op: "GetFileInformationByHandleEx", Path: f.Name(), Err: err}
|
||||
}
|
||||
runtime.KeepAlive(f)
|
||||
return bi, nil
|
||||
}
|
||||
|
||||
// SetFileBasicInfo sets times and attributes for a file.
|
||||
func SetFileBasicInfo(f *os.File, bi *FileBasicInfo) error {
|
||||
if err := setFileInformationByHandle(syscall.Handle(f.Fd()), fileBasicInfo, (*byte)(unsafe.Pointer(bi)), uint32(unsafe.Sizeof(*bi))); err != nil {
|
||||
return &os.PathError{Op: "SetFileInformationByHandle", Path: f.Name(), Err: err}
|
||||
}
|
||||
runtime.KeepAlive(f)
|
||||
return nil
|
||||
}
|
||||
|
||||
// FileIDInfo contains the volume serial number and file ID for a file. This pair should be
|
||||
// unique on a system.
|
||||
type FileIDInfo struct {
|
||||
VolumeSerialNumber uint64
|
||||
FileID [16]byte
|
||||
}
|
||||
|
||||
// GetFileID retrieves the unique (volume, file ID) pair for a file.
|
||||
func GetFileID(f *os.File) (*FileIDInfo, error) {
|
||||
fileID := &FileIDInfo{}
|
||||
if err := getFileInformationByHandleEx(syscall.Handle(f.Fd()), fileIDInfo, (*byte)(unsafe.Pointer(fileID)), uint32(unsafe.Sizeof(*fileID))); err != nil {
|
||||
return nil, &os.PathError{Op: "GetFileInformationByHandleEx", Path: f.Name(), Err: err}
|
||||
}
|
||||
runtime.KeepAlive(f)
|
||||
return fileID, nil
|
||||
}
|
||||
421
vendor/github.com/Microsoft/go-winio/pipe.go
generated
vendored
Normal file
421
vendor/github.com/Microsoft/go-winio/pipe.go
generated
vendored
Normal file
@@ -0,0 +1,421 @@
|
||||
// +build windows
|
||||
|
||||
package winio
|
||||
|
||||
import (
|
||||
"errors"
|
||||
"io"
|
||||
"net"
|
||||
"os"
|
||||
"syscall"
|
||||
"time"
|
||||
"unsafe"
|
||||
)
|
||||
|
||||
//sys connectNamedPipe(pipe syscall.Handle, o *syscall.Overlapped) (err error) = ConnectNamedPipe
|
||||
//sys createNamedPipe(name string, flags uint32, pipeMode uint32, maxInstances uint32, outSize uint32, inSize uint32, defaultTimeout uint32, sa *syscall.SecurityAttributes) (handle syscall.Handle, err error) [failretval==syscall.InvalidHandle] = CreateNamedPipeW
|
||||
//sys createFile(name string, access uint32, mode uint32, sa *syscall.SecurityAttributes, createmode uint32, attrs uint32, templatefile syscall.Handle) (handle syscall.Handle, err error) [failretval==syscall.InvalidHandle] = CreateFileW
|
||||
//sys getNamedPipeInfo(pipe syscall.Handle, flags *uint32, outSize *uint32, inSize *uint32, maxInstances *uint32) (err error) = GetNamedPipeInfo
|
||||
//sys getNamedPipeHandleState(pipe syscall.Handle, state *uint32, curInstances *uint32, maxCollectionCount *uint32, collectDataTimeout *uint32, userName *uint16, maxUserNameSize uint32) (err error) = GetNamedPipeHandleStateW
|
||||
//sys localAlloc(uFlags uint32, length uint32) (ptr uintptr) = LocalAlloc
|
||||
|
||||
const (
|
||||
cERROR_PIPE_BUSY = syscall.Errno(231)
|
||||
cERROR_NO_DATA = syscall.Errno(232)
|
||||
cERROR_PIPE_CONNECTED = syscall.Errno(535)
|
||||
cERROR_SEM_TIMEOUT = syscall.Errno(121)
|
||||
|
||||
cPIPE_ACCESS_DUPLEX = 0x3
|
||||
cFILE_FLAG_FIRST_PIPE_INSTANCE = 0x80000
|
||||
cSECURITY_SQOS_PRESENT = 0x100000
|
||||
cSECURITY_ANONYMOUS = 0
|
||||
|
||||
cPIPE_REJECT_REMOTE_CLIENTS = 0x8
|
||||
|
||||
cPIPE_UNLIMITED_INSTANCES = 255
|
||||
|
||||
cNMPWAIT_USE_DEFAULT_WAIT = 0
|
||||
cNMPWAIT_NOWAIT = 1
|
||||
|
||||
cPIPE_TYPE_MESSAGE = 4
|
||||
|
||||
cPIPE_READMODE_MESSAGE = 2
|
||||
)
|
||||
|
||||
var (
|
||||
// ErrPipeListenerClosed is returned for pipe operations on listeners that have been closed.
|
||||
// This error should match net.errClosing since docker takes a dependency on its text.
|
||||
ErrPipeListenerClosed = errors.New("use of closed network connection")
|
||||
|
||||
errPipeWriteClosed = errors.New("pipe has been closed for write")
|
||||
)
|
||||
|
||||
type win32Pipe struct {
|
||||
*win32File
|
||||
path string
|
||||
}
|
||||
|
||||
type win32MessageBytePipe struct {
|
||||
win32Pipe
|
||||
writeClosed bool
|
||||
readEOF bool
|
||||
}
|
||||
|
||||
type pipeAddress string
|
||||
|
||||
func (f *win32Pipe) LocalAddr() net.Addr {
|
||||
return pipeAddress(f.path)
|
||||
}
|
||||
|
||||
func (f *win32Pipe) RemoteAddr() net.Addr {
|
||||
return pipeAddress(f.path)
|
||||
}
|
||||
|
||||
func (f *win32Pipe) SetDeadline(t time.Time) error {
|
||||
f.SetReadDeadline(t)
|
||||
f.SetWriteDeadline(t)
|
||||
return nil
|
||||
}
|
||||
|
||||
// CloseWrite closes the write side of a message pipe in byte mode.
|
||||
func (f *win32MessageBytePipe) CloseWrite() error {
|
||||
if f.writeClosed {
|
||||
return errPipeWriteClosed
|
||||
}
|
||||
err := f.win32File.Flush()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
_, err = f.win32File.Write(nil)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
f.writeClosed = true
|
||||
return nil
|
||||
}
|
||||
|
||||
// Write writes bytes to a message pipe in byte mode. Zero-byte writes are ignored, since
|
||||
// they are used to implement CloseWrite().
|
||||
func (f *win32MessageBytePipe) Write(b []byte) (int, error) {
|
||||
if f.writeClosed {
|
||||
return 0, errPipeWriteClosed
|
||||
}
|
||||
if len(b) == 0 {
|
||||
return 0, nil
|
||||
}
|
||||
return f.win32File.Write(b)
|
||||
}
|
||||
|
||||
// Read reads bytes from a message pipe in byte mode. A read of a zero-byte message on a message
|
||||
// mode pipe will return io.EOF, as will all subsequent reads.
|
||||
func (f *win32MessageBytePipe) Read(b []byte) (int, error) {
|
||||
if f.readEOF {
|
||||
return 0, io.EOF
|
||||
}
|
||||
n, err := f.win32File.Read(b)
|
||||
if err == io.EOF {
|
||||
// If this was the result of a zero-byte read, then
|
||||
// it is possible that the read was due to a zero-size
|
||||
// message. Since we are simulating CloseWrite with a
|
||||
// zero-byte message, ensure that all future Read() calls
|
||||
// also return EOF.
|
||||
f.readEOF = true
|
||||
} else if err == syscall.ERROR_MORE_DATA {
|
||||
// ERROR_MORE_DATA indicates that the pipe's read mode is message mode
|
||||
// and the message still has more bytes. Treat this as a success, since
|
||||
// this package presents all named pipes as byte streams.
|
||||
err = nil
|
||||
}
|
||||
return n, err
|
||||
}
|
||||
|
||||
func (s pipeAddress) Network() string {
|
||||
return "pipe"
|
||||
}
|
||||
|
||||
func (s pipeAddress) String() string {
|
||||
return string(s)
|
||||
}
|
||||
|
||||
// DialPipe connects to a named pipe by path, timing out if the connection
|
||||
// takes longer than the specified duration. If timeout is nil, then we use
|
||||
// a default timeout of 5 seconds. (We do not use WaitNamedPipe.)
|
||||
func DialPipe(path string, timeout *time.Duration) (net.Conn, error) {
|
||||
var absTimeout time.Time
|
||||
if timeout != nil {
|
||||
absTimeout = time.Now().Add(*timeout)
|
||||
} else {
|
||||
absTimeout = time.Now().Add(time.Second * 2)
|
||||
}
|
||||
var err error
|
||||
var h syscall.Handle
|
||||
for {
|
||||
h, err = createFile(path, syscall.GENERIC_READ|syscall.GENERIC_WRITE, 0, nil, syscall.OPEN_EXISTING, syscall.FILE_FLAG_OVERLAPPED|cSECURITY_SQOS_PRESENT|cSECURITY_ANONYMOUS, 0)
|
||||
if err != cERROR_PIPE_BUSY {
|
||||
break
|
||||
}
|
||||
if time.Now().After(absTimeout) {
|
||||
return nil, ErrTimeout
|
||||
}
|
||||
|
||||
// Wait 10 msec and try again. This is a rather simplistic
|
||||
// view, as we always try each 10 milliseconds.
|
||||
time.Sleep(time.Millisecond * 10)
|
||||
}
|
||||
if err != nil {
|
||||
return nil, &os.PathError{Op: "open", Path: path, Err: err}
|
||||
}
|
||||
|
||||
var flags uint32
|
||||
err = getNamedPipeInfo(h, &flags, nil, nil, nil)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
f, err := makeWin32File(h)
|
||||
if err != nil {
|
||||
syscall.Close(h)
|
||||
return nil, err
|
||||
}
|
||||
|
||||
// If the pipe is in message mode, return a message byte pipe, which
|
||||
// supports CloseWrite().
|
||||
if flags&cPIPE_TYPE_MESSAGE != 0 {
|
||||
return &win32MessageBytePipe{
|
||||
win32Pipe: win32Pipe{win32File: f, path: path},
|
||||
}, nil
|
||||
}
|
||||
return &win32Pipe{win32File: f, path: path}, nil
|
||||
}
|
||||
|
||||
type acceptResponse struct {
|
||||
f *win32File
|
||||
err error
|
||||
}
|
||||
|
||||
type win32PipeListener struct {
|
||||
firstHandle syscall.Handle
|
||||
path string
|
||||
securityDescriptor []byte
|
||||
config PipeConfig
|
||||
acceptCh chan (chan acceptResponse)
|
||||
closeCh chan int
|
||||
doneCh chan int
|
||||
}
|
||||
|
||||
func makeServerPipeHandle(path string, securityDescriptor []byte, c *PipeConfig, first bool) (syscall.Handle, error) {
|
||||
var flags uint32 = cPIPE_ACCESS_DUPLEX | syscall.FILE_FLAG_OVERLAPPED
|
||||
if first {
|
||||
flags |= cFILE_FLAG_FIRST_PIPE_INSTANCE
|
||||
}
|
||||
|
||||
var mode uint32 = cPIPE_REJECT_REMOTE_CLIENTS
|
||||
if c.MessageMode {
|
||||
mode |= cPIPE_TYPE_MESSAGE
|
||||
}
|
||||
|
||||
sa := &syscall.SecurityAttributes{}
|
||||
sa.Length = uint32(unsafe.Sizeof(*sa))
|
||||
if securityDescriptor != nil {
|
||||
len := uint32(len(securityDescriptor))
|
||||
sa.SecurityDescriptor = localAlloc(0, len)
|
||||
defer localFree(sa.SecurityDescriptor)
|
||||
copy((*[0xffff]byte)(unsafe.Pointer(sa.SecurityDescriptor))[:], securityDescriptor)
|
||||
}
|
||||
h, err := createNamedPipe(path, flags, mode, cPIPE_UNLIMITED_INSTANCES, uint32(c.OutputBufferSize), uint32(c.InputBufferSize), 0, sa)
|
||||
if err != nil {
|
||||
return 0, &os.PathError{Op: "open", Path: path, Err: err}
|
||||
}
|
||||
return h, nil
|
||||
}
|
||||
|
||||
func (l *win32PipeListener) makeServerPipe() (*win32File, error) {
|
||||
h, err := makeServerPipeHandle(l.path, l.securityDescriptor, &l.config, false)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
f, err := makeWin32File(h)
|
||||
if err != nil {
|
||||
syscall.Close(h)
|
||||
return nil, err
|
||||
}
|
||||
return f, nil
|
||||
}
|
||||
|
||||
func (l *win32PipeListener) makeConnectedServerPipe() (*win32File, error) {
|
||||
p, err := l.makeServerPipe()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
// Wait for the client to connect.
|
||||
ch := make(chan error)
|
||||
go func(p *win32File) {
|
||||
ch <- connectPipe(p)
|
||||
}(p)
|
||||
|
||||
select {
|
||||
case err = <-ch:
|
||||
if err != nil {
|
||||
p.Close()
|
||||
p = nil
|
||||
}
|
||||
case <-l.closeCh:
|
||||
// Abort the connect request by closing the handle.
|
||||
p.Close()
|
||||
p = nil
|
||||
err = <-ch
|
||||
if err == nil || err == ErrFileClosed {
|
||||
err = ErrPipeListenerClosed
|
||||
}
|
||||
}
|
||||
return p, err
|
||||
}
|
||||
|
||||
func (l *win32PipeListener) listenerRoutine() {
|
||||
closed := false
|
||||
for !closed {
|
||||
select {
|
||||
case <-l.closeCh:
|
||||
closed = true
|
||||
case responseCh := <-l.acceptCh:
|
||||
var (
|
||||
p *win32File
|
||||
err error
|
||||
)
|
||||
for {
|
||||
p, err = l.makeConnectedServerPipe()
|
||||
// If the connection was immediately closed by the client, try
|
||||
// again.
|
||||
if err != cERROR_NO_DATA {
|
||||
break
|
||||
}
|
||||
}
|
||||
responseCh <- acceptResponse{p, err}
|
||||
closed = err == ErrPipeListenerClosed
|
||||
}
|
||||
}
|
||||
syscall.Close(l.firstHandle)
|
||||
l.firstHandle = 0
|
||||
// Notify Close() and Accept() callers that the handle has been closed.
|
||||
close(l.doneCh)
|
||||
}
|
||||
|
||||
// PipeConfig contain configuration for the pipe listener.
|
||||
type PipeConfig struct {
|
||||
// SecurityDescriptor contains a Windows security descriptor in SDDL format.
|
||||
SecurityDescriptor string
|
||||
|
||||
// MessageMode determines whether the pipe is in byte or message mode. In either
|
||||
// case the pipe is read in byte mode by default. The only practical difference in
|
||||
// this implementation is that CloseWrite() is only supported for message mode pipes;
|
||||
// CloseWrite() is implemented as a zero-byte write, but zero-byte writes are only
|
||||
// transferred to the reader (and returned as io.EOF in this implementation)
|
||||
// when the pipe is in message mode.
|
||||
MessageMode bool
|
||||
|
||||
// InputBufferSize specifies the size the input buffer, in bytes.
|
||||
InputBufferSize int32
|
||||
|
||||
// OutputBufferSize specifies the size the input buffer, in bytes.
|
||||
OutputBufferSize int32
|
||||
}
|
||||
|
||||
// ListenPipe creates a listener on a Windows named pipe path, e.g. \\.\pipe\mypipe.
|
||||
// The pipe must not already exist.
|
||||
func ListenPipe(path string, c *PipeConfig) (net.Listener, error) {
|
||||
var (
|
||||
sd []byte
|
||||
err error
|
||||
)
|
||||
if c == nil {
|
||||
c = &PipeConfig{}
|
||||
}
|
||||
if c.SecurityDescriptor != "" {
|
||||
sd, err = SddlToSecurityDescriptor(c.SecurityDescriptor)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
}
|
||||
h, err := makeServerPipeHandle(path, sd, c, true)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
// Create a client handle and connect it. This results in the pipe
|
||||
// instance always existing, so that clients see ERROR_PIPE_BUSY
|
||||
// rather than ERROR_FILE_NOT_FOUND. This ties the first instance
|
||||
// up so that no other instances can be used. This would have been
|
||||
// cleaner if the Win32 API matched CreateFile with ConnectNamedPipe
|
||||
// instead of CreateNamedPipe. (Apparently created named pipes are
|
||||
// considered to be in listening state regardless of whether any
|
||||
// active calls to ConnectNamedPipe are outstanding.)
|
||||
h2, err := createFile(path, 0, 0, nil, syscall.OPEN_EXISTING, cSECURITY_SQOS_PRESENT|cSECURITY_ANONYMOUS, 0)
|
||||
if err != nil {
|
||||
syscall.Close(h)
|
||||
return nil, err
|
||||
}
|
||||
// Close the client handle. The server side of the instance will
|
||||
// still be busy, leading to ERROR_PIPE_BUSY instead of
|
||||
// ERROR_NOT_FOUND, as long as we don't close the server handle,
|
||||
// or disconnect the client with DisconnectNamedPipe.
|
||||
syscall.Close(h2)
|
||||
l := &win32PipeListener{
|
||||
firstHandle: h,
|
||||
path: path,
|
||||
securityDescriptor: sd,
|
||||
config: *c,
|
||||
acceptCh: make(chan (chan acceptResponse)),
|
||||
closeCh: make(chan int),
|
||||
doneCh: make(chan int),
|
||||
}
|
||||
go l.listenerRoutine()
|
||||
return l, nil
|
||||
}
|
||||
|
||||
func connectPipe(p *win32File) error {
|
||||
c, err := p.prepareIo()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
defer p.wg.Done()
|
||||
|
||||
err = connectNamedPipe(p.handle, &c.o)
|
||||
_, err = p.asyncIo(c, nil, 0, err)
|
||||
if err != nil && err != cERROR_PIPE_CONNECTED {
|
||||
return err
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func (l *win32PipeListener) Accept() (net.Conn, error) {
|
||||
ch := make(chan acceptResponse)
|
||||
select {
|
||||
case l.acceptCh <- ch:
|
||||
response := <-ch
|
||||
err := response.err
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
if l.config.MessageMode {
|
||||
return &win32MessageBytePipe{
|
||||
win32Pipe: win32Pipe{win32File: response.f, path: l.path},
|
||||
}, nil
|
||||
}
|
||||
return &win32Pipe{win32File: response.f, path: l.path}, nil
|
||||
case <-l.doneCh:
|
||||
return nil, ErrPipeListenerClosed
|
||||
}
|
||||
}
|
||||
|
||||
func (l *win32PipeListener) Close() error {
|
||||
select {
|
||||
case l.closeCh <- 1:
|
||||
<-l.doneCh
|
||||
case <-l.doneCh:
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func (l *win32PipeListener) Addr() net.Addr {
|
||||
return pipeAddress(l.path)
|
||||
}
|
||||
202
vendor/github.com/Microsoft/go-winio/privilege.go
generated
vendored
Normal file
202
vendor/github.com/Microsoft/go-winio/privilege.go
generated
vendored
Normal file
@@ -0,0 +1,202 @@
|
||||
// +build windows
|
||||
|
||||
package winio
|
||||
|
||||
import (
|
||||
"bytes"
|
||||
"encoding/binary"
|
||||
"fmt"
|
||||
"runtime"
|
||||
"sync"
|
||||
"syscall"
|
||||
"unicode/utf16"
|
||||
|
||||
"golang.org/x/sys/windows"
|
||||
)
|
||||
|
||||
//sys adjustTokenPrivileges(token windows.Token, releaseAll bool, input *byte, outputSize uint32, output *byte, requiredSize *uint32) (success bool, err error) [true] = advapi32.AdjustTokenPrivileges
|
||||
//sys impersonateSelf(level uint32) (err error) = advapi32.ImpersonateSelf
|
||||
//sys revertToSelf() (err error) = advapi32.RevertToSelf
|
||||
//sys openThreadToken(thread syscall.Handle, accessMask uint32, openAsSelf bool, token *windows.Token) (err error) = advapi32.OpenThreadToken
|
||||
//sys getCurrentThread() (h syscall.Handle) = GetCurrentThread
|
||||
//sys lookupPrivilegeValue(systemName string, name string, luid *uint64) (err error) = advapi32.LookupPrivilegeValueW
|
||||
//sys lookupPrivilegeName(systemName string, luid *uint64, buffer *uint16, size *uint32) (err error) = advapi32.LookupPrivilegeNameW
|
||||
//sys lookupPrivilegeDisplayName(systemName string, name *uint16, buffer *uint16, size *uint32, languageId *uint32) (err error) = advapi32.LookupPrivilegeDisplayNameW
|
||||
|
||||
const (
|
||||
SE_PRIVILEGE_ENABLED = 2
|
||||
|
||||
ERROR_NOT_ALL_ASSIGNED syscall.Errno = 1300
|
||||
|
||||
SeBackupPrivilege = "SeBackupPrivilege"
|
||||
SeRestorePrivilege = "SeRestorePrivilege"
|
||||
)
|
||||
|
||||
const (
|
||||
securityAnonymous = iota
|
||||
securityIdentification
|
||||
securityImpersonation
|
||||
securityDelegation
|
||||
)
|
||||
|
||||
var (
|
||||
privNames = make(map[string]uint64)
|
||||
privNameMutex sync.Mutex
|
||||
)
|
||||
|
||||
// PrivilegeError represents an error enabling privileges.
|
||||
type PrivilegeError struct {
|
||||
privileges []uint64
|
||||
}
|
||||
|
||||
func (e *PrivilegeError) Error() string {
|
||||
s := ""
|
||||
if len(e.privileges) > 1 {
|
||||
s = "Could not enable privileges "
|
||||
} else {
|
||||
s = "Could not enable privilege "
|
||||
}
|
||||
for i, p := range e.privileges {
|
||||
if i != 0 {
|
||||
s += ", "
|
||||
}
|
||||
s += `"`
|
||||
s += getPrivilegeName(p)
|
||||
s += `"`
|
||||
}
|
||||
return s
|
||||
}
|
||||
|
||||
// RunWithPrivilege enables a single privilege for a function call.
|
||||
func RunWithPrivilege(name string, fn func() error) error {
|
||||
return RunWithPrivileges([]string{name}, fn)
|
||||
}
|
||||
|
||||
// RunWithPrivileges enables privileges for a function call.
|
||||
func RunWithPrivileges(names []string, fn func() error) error {
|
||||
privileges, err := mapPrivileges(names)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
runtime.LockOSThread()
|
||||
defer runtime.UnlockOSThread()
|
||||
token, err := newThreadToken()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
defer releaseThreadToken(token)
|
||||
err = adjustPrivileges(token, privileges, SE_PRIVILEGE_ENABLED)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
return fn()
|
||||
}
|
||||
|
||||
func mapPrivileges(names []string) ([]uint64, error) {
|
||||
var privileges []uint64
|
||||
privNameMutex.Lock()
|
||||
defer privNameMutex.Unlock()
|
||||
for _, name := range names {
|
||||
p, ok := privNames[name]
|
||||
if !ok {
|
||||
err := lookupPrivilegeValue("", name, &p)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
privNames[name] = p
|
||||
}
|
||||
privileges = append(privileges, p)
|
||||
}
|
||||
return privileges, nil
|
||||
}
|
||||
|
||||
// EnableProcessPrivileges enables privileges globally for the process.
|
||||
func EnableProcessPrivileges(names []string) error {
|
||||
return enableDisableProcessPrivilege(names, SE_PRIVILEGE_ENABLED)
|
||||
}
|
||||
|
||||
// DisableProcessPrivileges disables privileges globally for the process.
|
||||
func DisableProcessPrivileges(names []string) error {
|
||||
return enableDisableProcessPrivilege(names, 0)
|
||||
}
|
||||
|
||||
func enableDisableProcessPrivilege(names []string, action uint32) error {
|
||||
privileges, err := mapPrivileges(names)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
p, _ := windows.GetCurrentProcess()
|
||||
var token windows.Token
|
||||
err = windows.OpenProcessToken(p, windows.TOKEN_ADJUST_PRIVILEGES|windows.TOKEN_QUERY, &token)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
defer token.Close()
|
||||
return adjustPrivileges(token, privileges, action)
|
||||
}
|
||||
|
||||
func adjustPrivileges(token windows.Token, privileges []uint64, action uint32) error {
|
||||
var b bytes.Buffer
|
||||
binary.Write(&b, binary.LittleEndian, uint32(len(privileges)))
|
||||
for _, p := range privileges {
|
||||
binary.Write(&b, binary.LittleEndian, p)
|
||||
binary.Write(&b, binary.LittleEndian, action)
|
||||
}
|
||||
prevState := make([]byte, b.Len())
|
||||
reqSize := uint32(0)
|
||||
success, err := adjustTokenPrivileges(token, false, &b.Bytes()[0], uint32(len(prevState)), &prevState[0], &reqSize)
|
||||
if !success {
|
||||
return err
|
||||
}
|
||||
if err == ERROR_NOT_ALL_ASSIGNED {
|
||||
return &PrivilegeError{privileges}
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func getPrivilegeName(luid uint64) string {
|
||||
var nameBuffer [256]uint16
|
||||
bufSize := uint32(len(nameBuffer))
|
||||
err := lookupPrivilegeName("", &luid, &nameBuffer[0], &bufSize)
|
||||
if err != nil {
|
||||
return fmt.Sprintf("<unknown privilege %d>", luid)
|
||||
}
|
||||
|
||||
var displayNameBuffer [256]uint16
|
||||
displayBufSize := uint32(len(displayNameBuffer))
|
||||
var langID uint32
|
||||
err = lookupPrivilegeDisplayName("", &nameBuffer[0], &displayNameBuffer[0], &displayBufSize, &langID)
|
||||
if err != nil {
|
||||
return fmt.Sprintf("<unknown privilege %s>", string(utf16.Decode(nameBuffer[:bufSize])))
|
||||
}
|
||||
|
||||
return string(utf16.Decode(displayNameBuffer[:displayBufSize]))
|
||||
}
|
||||
|
||||
func newThreadToken() (windows.Token, error) {
|
||||
err := impersonateSelf(securityImpersonation)
|
||||
if err != nil {
|
||||
return 0, err
|
||||
}
|
||||
|
||||
var token windows.Token
|
||||
err = openThreadToken(getCurrentThread(), syscall.TOKEN_ADJUST_PRIVILEGES|syscall.TOKEN_QUERY, false, &token)
|
||||
if err != nil {
|
||||
rerr := revertToSelf()
|
||||
if rerr != nil {
|
||||
panic(rerr)
|
||||
}
|
||||
return 0, err
|
||||
}
|
||||
return token, nil
|
||||
}
|
||||
|
||||
func releaseThreadToken(h windows.Token) {
|
||||
err := revertToSelf()
|
||||
if err != nil {
|
||||
panic(err)
|
||||
}
|
||||
h.Close()
|
||||
}
|
||||
128
vendor/github.com/Microsoft/go-winio/reparse.go
generated
vendored
Normal file
128
vendor/github.com/Microsoft/go-winio/reparse.go
generated
vendored
Normal file
@@ -0,0 +1,128 @@
|
||||
package winio
|
||||
|
||||
import (
|
||||
"bytes"
|
||||
"encoding/binary"
|
||||
"fmt"
|
||||
"strings"
|
||||
"unicode/utf16"
|
||||
"unsafe"
|
||||
)
|
||||
|
||||
const (
|
||||
reparseTagMountPoint = 0xA0000003
|
||||
reparseTagSymlink = 0xA000000C
|
||||
)
|
||||
|
||||
type reparseDataBuffer struct {
|
||||
ReparseTag uint32
|
||||
ReparseDataLength uint16
|
||||
Reserved uint16
|
||||
SubstituteNameOffset uint16
|
||||
SubstituteNameLength uint16
|
||||
PrintNameOffset uint16
|
||||
PrintNameLength uint16
|
||||
}
|
||||
|
||||
// ReparsePoint describes a Win32 symlink or mount point.
|
||||
type ReparsePoint struct {
|
||||
Target string
|
||||
IsMountPoint bool
|
||||
}
|
||||
|
||||
// UnsupportedReparsePointError is returned when trying to decode a non-symlink or
|
||||
// mount point reparse point.
|
||||
type UnsupportedReparsePointError struct {
|
||||
Tag uint32
|
||||
}
|
||||
|
||||
func (e *UnsupportedReparsePointError) Error() string {
|
||||
return fmt.Sprintf("unsupported reparse point %x", e.Tag)
|
||||
}
|
||||
|
||||
// DecodeReparsePoint decodes a Win32 REPARSE_DATA_BUFFER structure containing either a symlink
|
||||
// or a mount point.
|
||||
func DecodeReparsePoint(b []byte) (*ReparsePoint, error) {
|
||||
tag := binary.LittleEndian.Uint32(b[0:4])
|
||||
return DecodeReparsePointData(tag, b[8:])
|
||||
}
|
||||
|
||||
func DecodeReparsePointData(tag uint32, b []byte) (*ReparsePoint, error) {
|
||||
isMountPoint := false
|
||||
switch tag {
|
||||
case reparseTagMountPoint:
|
||||
isMountPoint = true
|
||||
case reparseTagSymlink:
|
||||
default:
|
||||
return nil, &UnsupportedReparsePointError{tag}
|
||||
}
|
||||
nameOffset := 8 + binary.LittleEndian.Uint16(b[4:6])
|
||||
if !isMountPoint {
|
||||
nameOffset += 4
|
||||
}
|
||||
nameLength := binary.LittleEndian.Uint16(b[6:8])
|
||||
name := make([]uint16, nameLength/2)
|
||||
err := binary.Read(bytes.NewReader(b[nameOffset:nameOffset+nameLength]), binary.LittleEndian, &name)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return &ReparsePoint{string(utf16.Decode(name)), isMountPoint}, nil
|
||||
}
|
||||
|
||||
func isDriveLetter(c byte) bool {
|
||||
return (c >= 'a' && c <= 'z') || (c >= 'A' && c <= 'Z')
|
||||
}
|
||||
|
||||
// EncodeReparsePoint encodes a Win32 REPARSE_DATA_BUFFER structure describing a symlink or
|
||||
// mount point.
|
||||
func EncodeReparsePoint(rp *ReparsePoint) []byte {
|
||||
// Generate an NT path and determine if this is a relative path.
|
||||
var ntTarget string
|
||||
relative := false
|
||||
if strings.HasPrefix(rp.Target, `\\?\`) {
|
||||
ntTarget = `\??\` + rp.Target[4:]
|
||||
} else if strings.HasPrefix(rp.Target, `\\`) {
|
||||
ntTarget = `\??\UNC\` + rp.Target[2:]
|
||||
} else if len(rp.Target) >= 2 && isDriveLetter(rp.Target[0]) && rp.Target[1] == ':' {
|
||||
ntTarget = `\??\` + rp.Target
|
||||
} else {
|
||||
ntTarget = rp.Target
|
||||
relative = true
|
||||
}
|
||||
|
||||
// The paths must be NUL-terminated even though they are counted strings.
|
||||
target16 := utf16.Encode([]rune(rp.Target + "\x00"))
|
||||
ntTarget16 := utf16.Encode([]rune(ntTarget + "\x00"))
|
||||
|
||||
size := int(unsafe.Sizeof(reparseDataBuffer{})) - 8
|
||||
size += len(ntTarget16)*2 + len(target16)*2
|
||||
|
||||
tag := uint32(reparseTagMountPoint)
|
||||
if !rp.IsMountPoint {
|
||||
tag = reparseTagSymlink
|
||||
size += 4 // Add room for symlink flags
|
||||
}
|
||||
|
||||
data := reparseDataBuffer{
|
||||
ReparseTag: tag,
|
||||
ReparseDataLength: uint16(size),
|
||||
SubstituteNameOffset: 0,
|
||||
SubstituteNameLength: uint16((len(ntTarget16) - 1) * 2),
|
||||
PrintNameOffset: uint16(len(ntTarget16) * 2),
|
||||
PrintNameLength: uint16((len(target16) - 1) * 2),
|
||||
}
|
||||
|
||||
var b bytes.Buffer
|
||||
binary.Write(&b, binary.LittleEndian, &data)
|
||||
if !rp.IsMountPoint {
|
||||
flags := uint32(0)
|
||||
if relative {
|
||||
flags |= 1
|
||||
}
|
||||
binary.Write(&b, binary.LittleEndian, flags)
|
||||
}
|
||||
|
||||
binary.Write(&b, binary.LittleEndian, ntTarget16)
|
||||
binary.Write(&b, binary.LittleEndian, target16)
|
||||
return b.Bytes()
|
||||
}
|
||||
98
vendor/github.com/Microsoft/go-winio/sd.go
generated
vendored
Normal file
98
vendor/github.com/Microsoft/go-winio/sd.go
generated
vendored
Normal file
@@ -0,0 +1,98 @@
|
||||
// +build windows
|
||||
|
||||
package winio
|
||||
|
||||
import (
|
||||
"syscall"
|
||||
"unsafe"
|
||||
)
|
||||
|
||||
//sys lookupAccountName(systemName *uint16, accountName string, sid *byte, sidSize *uint32, refDomain *uint16, refDomainSize *uint32, sidNameUse *uint32) (err error) = advapi32.LookupAccountNameW
|
||||
//sys convertSidToStringSid(sid *byte, str **uint16) (err error) = advapi32.ConvertSidToStringSidW
|
||||
//sys convertStringSecurityDescriptorToSecurityDescriptor(str string, revision uint32, sd *uintptr, size *uint32) (err error) = advapi32.ConvertStringSecurityDescriptorToSecurityDescriptorW
|
||||
//sys convertSecurityDescriptorToStringSecurityDescriptor(sd *byte, revision uint32, secInfo uint32, sddl **uint16, sddlSize *uint32) (err error) = advapi32.ConvertSecurityDescriptorToStringSecurityDescriptorW
|
||||
//sys localFree(mem uintptr) = LocalFree
|
||||
//sys getSecurityDescriptorLength(sd uintptr) (len uint32) = advapi32.GetSecurityDescriptorLength
|
||||
|
||||
const (
|
||||
cERROR_NONE_MAPPED = syscall.Errno(1332)
|
||||
)
|
||||
|
||||
type AccountLookupError struct {
|
||||
Name string
|
||||
Err error
|
||||
}
|
||||
|
||||
func (e *AccountLookupError) Error() string {
|
||||
if e.Name == "" {
|
||||
return "lookup account: empty account name specified"
|
||||
}
|
||||
var s string
|
||||
switch e.Err {
|
||||
case cERROR_NONE_MAPPED:
|
||||
s = "not found"
|
||||
default:
|
||||
s = e.Err.Error()
|
||||
}
|
||||
return "lookup account " + e.Name + ": " + s
|
||||
}
|
||||
|
||||
type SddlConversionError struct {
|
||||
Sddl string
|
||||
Err error
|
||||
}
|
||||
|
||||
func (e *SddlConversionError) Error() string {
|
||||
return "convert " + e.Sddl + ": " + e.Err.Error()
|
||||
}
|
||||
|
||||
// LookupSidByName looks up the SID of an account by name
|
||||
func LookupSidByName(name string) (sid string, err error) {
|
||||
if name == "" {
|
||||
return "", &AccountLookupError{name, cERROR_NONE_MAPPED}
|
||||
}
|
||||
|
||||
var sidSize, sidNameUse, refDomainSize uint32
|
||||
err = lookupAccountName(nil, name, nil, &sidSize, nil, &refDomainSize, &sidNameUse)
|
||||
if err != nil && err != syscall.ERROR_INSUFFICIENT_BUFFER {
|
||||
return "", &AccountLookupError{name, err}
|
||||
}
|
||||
sidBuffer := make([]byte, sidSize)
|
||||
refDomainBuffer := make([]uint16, refDomainSize)
|
||||
err = lookupAccountName(nil, name, &sidBuffer[0], &sidSize, &refDomainBuffer[0], &refDomainSize, &sidNameUse)
|
||||
if err != nil {
|
||||
return "", &AccountLookupError{name, err}
|
||||
}
|
||||
var strBuffer *uint16
|
||||
err = convertSidToStringSid(&sidBuffer[0], &strBuffer)
|
||||
if err != nil {
|
||||
return "", &AccountLookupError{name, err}
|
||||
}
|
||||
sid = syscall.UTF16ToString((*[0xffff]uint16)(unsafe.Pointer(strBuffer))[:])
|
||||
localFree(uintptr(unsafe.Pointer(strBuffer)))
|
||||
return sid, nil
|
||||
}
|
||||
|
||||
func SddlToSecurityDescriptor(sddl string) ([]byte, error) {
|
||||
var sdBuffer uintptr
|
||||
err := convertStringSecurityDescriptorToSecurityDescriptor(sddl, 1, &sdBuffer, nil)
|
||||
if err != nil {
|
||||
return nil, &SddlConversionError{sddl, err}
|
||||
}
|
||||
defer localFree(sdBuffer)
|
||||
sd := make([]byte, getSecurityDescriptorLength(sdBuffer))
|
||||
copy(sd, (*[0xffff]byte)(unsafe.Pointer(sdBuffer))[:len(sd)])
|
||||
return sd, nil
|
||||
}
|
||||
|
||||
func SecurityDescriptorToSddl(sd []byte) (string, error) {
|
||||
var sddl *uint16
|
||||
// The returned string length seems to including an aribtrary number of terminating NULs.
|
||||
// Don't use it.
|
||||
err := convertSecurityDescriptorToStringSecurityDescriptor(&sd[0], 1, 0xff, &sddl, nil)
|
||||
if err != nil {
|
||||
return "", err
|
||||
}
|
||||
defer localFree(uintptr(unsafe.Pointer(sddl)))
|
||||
return syscall.UTF16ToString((*[0xffff]uint16)(unsafe.Pointer(sddl))[:]), nil
|
||||
}
|
||||
3
vendor/github.com/Microsoft/go-winio/syscall.go
generated
vendored
Normal file
3
vendor/github.com/Microsoft/go-winio/syscall.go
generated
vendored
Normal file
@@ -0,0 +1,3 @@
|
||||
package winio
|
||||
|
||||
//go:generate go run $GOROOT/src/syscall/mksyscall_windows.go -output zsyscall_windows.go file.go pipe.go sd.go fileinfo.go privilege.go backup.go
|
||||
520
vendor/github.com/Microsoft/go-winio/zsyscall_windows.go
generated
vendored
Normal file
520
vendor/github.com/Microsoft/go-winio/zsyscall_windows.go
generated
vendored
Normal file
@@ -0,0 +1,520 @@
|
||||
// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT
|
||||
|
||||
package winio
|
||||
|
||||
import (
|
||||
"syscall"
|
||||
"unsafe"
|
||||
|
||||
"golang.org/x/sys/windows"
|
||||
)
|
||||
|
||||
var _ unsafe.Pointer
|
||||
|
||||
// Do the interface allocations only once for common
|
||||
// Errno values.
|
||||
const (
|
||||
errnoERROR_IO_PENDING = 997
|
||||
)
|
||||
|
||||
var (
|
||||
errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
|
||||
)
|
||||
|
||||
// errnoErr returns common boxed Errno values, to prevent
|
||||
// allocations at runtime.
|
||||
func errnoErr(e syscall.Errno) error {
|
||||
switch e {
|
||||
case 0:
|
||||
return nil
|
||||
case errnoERROR_IO_PENDING:
|
||||
return errERROR_IO_PENDING
|
||||
}
|
||||
// TODO: add more here, after collecting data on the common
|
||||
// error values see on Windows. (perhaps when running
|
||||
// all.bat?)
|
||||
return e
|
||||
}
|
||||
|
||||
var (
|
||||
modkernel32 = windows.NewLazySystemDLL("kernel32.dll")
|
||||
modadvapi32 = windows.NewLazySystemDLL("advapi32.dll")
|
||||
|
||||
procCancelIoEx = modkernel32.NewProc("CancelIoEx")
|
||||
procCreateIoCompletionPort = modkernel32.NewProc("CreateIoCompletionPort")
|
||||
procGetQueuedCompletionStatus = modkernel32.NewProc("GetQueuedCompletionStatus")
|
||||
procSetFileCompletionNotificationModes = modkernel32.NewProc("SetFileCompletionNotificationModes")
|
||||
procConnectNamedPipe = modkernel32.NewProc("ConnectNamedPipe")
|
||||
procCreateNamedPipeW = modkernel32.NewProc("CreateNamedPipeW")
|
||||
procCreateFileW = modkernel32.NewProc("CreateFileW")
|
||||
procWaitNamedPipeW = modkernel32.NewProc("WaitNamedPipeW")
|
||||
procGetNamedPipeInfo = modkernel32.NewProc("GetNamedPipeInfo")
|
||||
procGetNamedPipeHandleStateW = modkernel32.NewProc("GetNamedPipeHandleStateW")
|
||||
procLocalAlloc = modkernel32.NewProc("LocalAlloc")
|
||||
procLookupAccountNameW = modadvapi32.NewProc("LookupAccountNameW")
|
||||
procConvertSidToStringSidW = modadvapi32.NewProc("ConvertSidToStringSidW")
|
||||
procConvertStringSecurityDescriptorToSecurityDescriptorW = modadvapi32.NewProc("ConvertStringSecurityDescriptorToSecurityDescriptorW")
|
||||
procConvertSecurityDescriptorToStringSecurityDescriptorW = modadvapi32.NewProc("ConvertSecurityDescriptorToStringSecurityDescriptorW")
|
||||
procLocalFree = modkernel32.NewProc("LocalFree")
|
||||
procGetSecurityDescriptorLength = modadvapi32.NewProc("GetSecurityDescriptorLength")
|
||||
procGetFileInformationByHandleEx = modkernel32.NewProc("GetFileInformationByHandleEx")
|
||||
procSetFileInformationByHandle = modkernel32.NewProc("SetFileInformationByHandle")
|
||||
procAdjustTokenPrivileges = modadvapi32.NewProc("AdjustTokenPrivileges")
|
||||
procImpersonateSelf = modadvapi32.NewProc("ImpersonateSelf")
|
||||
procRevertToSelf = modadvapi32.NewProc("RevertToSelf")
|
||||
procOpenThreadToken = modadvapi32.NewProc("OpenThreadToken")
|
||||
procGetCurrentThread = modkernel32.NewProc("GetCurrentThread")
|
||||
procLookupPrivilegeValueW = modadvapi32.NewProc("LookupPrivilegeValueW")
|
||||
procLookupPrivilegeNameW = modadvapi32.NewProc("LookupPrivilegeNameW")
|
||||
procLookupPrivilegeDisplayNameW = modadvapi32.NewProc("LookupPrivilegeDisplayNameW")
|
||||
procBackupRead = modkernel32.NewProc("BackupRead")
|
||||
procBackupWrite = modkernel32.NewProc("BackupWrite")
|
||||
)
|
||||
|
||||
func cancelIoEx(file syscall.Handle, o *syscall.Overlapped) (err error) {
|
||||
r1, _, e1 := syscall.Syscall(procCancelIoEx.Addr(), 2, uintptr(file), uintptr(unsafe.Pointer(o)), 0)
|
||||
if r1 == 0 {
|
||||
if e1 != 0 {
|
||||
err = errnoErr(e1)
|
||||
} else {
|
||||
err = syscall.EINVAL
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func createIoCompletionPort(file syscall.Handle, port syscall.Handle, key uintptr, threadCount uint32) (newport syscall.Handle, err error) {
|
||||
r0, _, e1 := syscall.Syscall6(procCreateIoCompletionPort.Addr(), 4, uintptr(file), uintptr(port), uintptr(key), uintptr(threadCount), 0, 0)
|
||||
newport = syscall.Handle(r0)
|
||||
if newport == 0 {
|
||||
if e1 != 0 {
|
||||
err = errnoErr(e1)
|
||||
} else {
|
||||
err = syscall.EINVAL
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func getQueuedCompletionStatus(port syscall.Handle, bytes *uint32, key *uintptr, o **ioOperation, timeout uint32) (err error) {
|
||||
r1, _, e1 := syscall.Syscall6(procGetQueuedCompletionStatus.Addr(), 5, uintptr(port), uintptr(unsafe.Pointer(bytes)), uintptr(unsafe.Pointer(key)), uintptr(unsafe.Pointer(o)), uintptr(timeout), 0)
|
||||
if r1 == 0 {
|
||||
if e1 != 0 {
|
||||
err = errnoErr(e1)
|
||||
} else {
|
||||
err = syscall.EINVAL
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func setFileCompletionNotificationModes(h syscall.Handle, flags uint8) (err error) {
|
||||
r1, _, e1 := syscall.Syscall(procSetFileCompletionNotificationModes.Addr(), 2, uintptr(h), uintptr(flags), 0)
|
||||
if r1 == 0 {
|
||||
if e1 != 0 {
|
||||
err = errnoErr(e1)
|
||||
} else {
|
||||
err = syscall.EINVAL
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func connectNamedPipe(pipe syscall.Handle, o *syscall.Overlapped) (err error) {
|
||||
r1, _, e1 := syscall.Syscall(procConnectNamedPipe.Addr(), 2, uintptr(pipe), uintptr(unsafe.Pointer(o)), 0)
|
||||
if r1 == 0 {
|
||||
if e1 != 0 {
|
||||
err = errnoErr(e1)
|
||||
} else {
|
||||
err = syscall.EINVAL
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func createNamedPipe(name string, flags uint32, pipeMode uint32, maxInstances uint32, outSize uint32, inSize uint32, defaultTimeout uint32, sa *syscall.SecurityAttributes) (handle syscall.Handle, err error) {
|
||||
var _p0 *uint16
|
||||
_p0, err = syscall.UTF16PtrFromString(name)
|
||||
if err != nil {
|
||||
return
|
||||
}
|
||||
return _createNamedPipe(_p0, flags, pipeMode, maxInstances, outSize, inSize, defaultTimeout, sa)
|
||||
}
|
||||
|
||||
func _createNamedPipe(name *uint16, flags uint32, pipeMode uint32, maxInstances uint32, outSize uint32, inSize uint32, defaultTimeout uint32, sa *syscall.SecurityAttributes) (handle syscall.Handle, err error) {
|
||||
r0, _, e1 := syscall.Syscall9(procCreateNamedPipeW.Addr(), 8, uintptr(unsafe.Pointer(name)), uintptr(flags), uintptr(pipeMode), uintptr(maxInstances), uintptr(outSize), uintptr(inSize), uintptr(defaultTimeout), uintptr(unsafe.Pointer(sa)), 0)
|
||||
handle = syscall.Handle(r0)
|
||||
if handle == syscall.InvalidHandle {
|
||||
if e1 != 0 {
|
||||
err = errnoErr(e1)
|
||||
} else {
|
||||
err = syscall.EINVAL
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func createFile(name string, access uint32, mode uint32, sa *syscall.SecurityAttributes, createmode uint32, attrs uint32, templatefile syscall.Handle) (handle syscall.Handle, err error) {
|
||||
var _p0 *uint16
|
||||
_p0, err = syscall.UTF16PtrFromString(name)
|
||||
if err != nil {
|
||||
return
|
||||
}
|
||||
return _createFile(_p0, access, mode, sa, createmode, attrs, templatefile)
|
||||
}
|
||||
|
||||
func _createFile(name *uint16, access uint32, mode uint32, sa *syscall.SecurityAttributes, createmode uint32, attrs uint32, templatefile syscall.Handle) (handle syscall.Handle, err error) {
|
||||
r0, _, e1 := syscall.Syscall9(procCreateFileW.Addr(), 7, uintptr(unsafe.Pointer(name)), uintptr(access), uintptr(mode), uintptr(unsafe.Pointer(sa)), uintptr(createmode), uintptr(attrs), uintptr(templatefile), 0, 0)
|
||||
handle = syscall.Handle(r0)
|
||||
if handle == syscall.InvalidHandle {
|
||||
if e1 != 0 {
|
||||
err = errnoErr(e1)
|
||||
} else {
|
||||
err = syscall.EINVAL
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func waitNamedPipe(name string, timeout uint32) (err error) {
|
||||
var _p0 *uint16
|
||||
_p0, err = syscall.UTF16PtrFromString(name)
|
||||
if err != nil {
|
||||
return
|
||||
}
|
||||
return _waitNamedPipe(_p0, timeout)
|
||||
}
|
||||
|
||||
func _waitNamedPipe(name *uint16, timeout uint32) (err error) {
|
||||
r1, _, e1 := syscall.Syscall(procWaitNamedPipeW.Addr(), 2, uintptr(unsafe.Pointer(name)), uintptr(timeout), 0)
|
||||
if r1 == 0 {
|
||||
if e1 != 0 {
|
||||
err = errnoErr(e1)
|
||||
} else {
|
||||
err = syscall.EINVAL
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func getNamedPipeInfo(pipe syscall.Handle, flags *uint32, outSize *uint32, inSize *uint32, maxInstances *uint32) (err error) {
|
||||
r1, _, e1 := syscall.Syscall6(procGetNamedPipeInfo.Addr(), 5, uintptr(pipe), uintptr(unsafe.Pointer(flags)), uintptr(unsafe.Pointer(outSize)), uintptr(unsafe.Pointer(inSize)), uintptr(unsafe.Pointer(maxInstances)), 0)
|
||||
if r1 == 0 {
|
||||
if e1 != 0 {
|
||||
err = errnoErr(e1)
|
||||
} else {
|
||||
err = syscall.EINVAL
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func getNamedPipeHandleState(pipe syscall.Handle, state *uint32, curInstances *uint32, maxCollectionCount *uint32, collectDataTimeout *uint32, userName *uint16, maxUserNameSize uint32) (err error) {
|
||||
r1, _, e1 := syscall.Syscall9(procGetNamedPipeHandleStateW.Addr(), 7, uintptr(pipe), uintptr(unsafe.Pointer(state)), uintptr(unsafe.Pointer(curInstances)), uintptr(unsafe.Pointer(maxCollectionCount)), uintptr(unsafe.Pointer(collectDataTimeout)), uintptr(unsafe.Pointer(userName)), uintptr(maxUserNameSize), 0, 0)
|
||||
if r1 == 0 {
|
||||
if e1 != 0 {
|
||||
err = errnoErr(e1)
|
||||
} else {
|
||||
err = syscall.EINVAL
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func localAlloc(uFlags uint32, length uint32) (ptr uintptr) {
|
||||
r0, _, _ := syscall.Syscall(procLocalAlloc.Addr(), 2, uintptr(uFlags), uintptr(length), 0)
|
||||
ptr = uintptr(r0)
|
||||
return
|
||||
}
|
||||
|
||||
func lookupAccountName(systemName *uint16, accountName string, sid *byte, sidSize *uint32, refDomain *uint16, refDomainSize *uint32, sidNameUse *uint32) (err error) {
|
||||
var _p0 *uint16
|
||||
_p0, err = syscall.UTF16PtrFromString(accountName)
|
||||
if err != nil {
|
||||
return
|
||||
}
|
||||
return _lookupAccountName(systemName, _p0, sid, sidSize, refDomain, refDomainSize, sidNameUse)
|
||||
}
|
||||
|
||||
func _lookupAccountName(systemName *uint16, accountName *uint16, sid *byte, sidSize *uint32, refDomain *uint16, refDomainSize *uint32, sidNameUse *uint32) (err error) {
|
||||
r1, _, e1 := syscall.Syscall9(procLookupAccountNameW.Addr(), 7, uintptr(unsafe.Pointer(systemName)), uintptr(unsafe.Pointer(accountName)), uintptr(unsafe.Pointer(sid)), uintptr(unsafe.Pointer(sidSize)), uintptr(unsafe.Pointer(refDomain)), uintptr(unsafe.Pointer(refDomainSize)), uintptr(unsafe.Pointer(sidNameUse)), 0, 0)
|
||||
if r1 == 0 {
|
||||
if e1 != 0 {
|
||||
err = errnoErr(e1)
|
||||
} else {
|
||||
err = syscall.EINVAL
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func convertSidToStringSid(sid *byte, str **uint16) (err error) {
|
||||
r1, _, e1 := syscall.Syscall(procConvertSidToStringSidW.Addr(), 2, uintptr(unsafe.Pointer(sid)), uintptr(unsafe.Pointer(str)), 0)
|
||||
if r1 == 0 {
|
||||
if e1 != 0 {
|
||||
err = errnoErr(e1)
|
||||
} else {
|
||||
err = syscall.EINVAL
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func convertStringSecurityDescriptorToSecurityDescriptor(str string, revision uint32, sd *uintptr, size *uint32) (err error) {
|
||||
var _p0 *uint16
|
||||
_p0, err = syscall.UTF16PtrFromString(str)
|
||||
if err != nil {
|
||||
return
|
||||
}
|
||||
return _convertStringSecurityDescriptorToSecurityDescriptor(_p0, revision, sd, size)
|
||||
}
|
||||
|
||||
func _convertStringSecurityDescriptorToSecurityDescriptor(str *uint16, revision uint32, sd *uintptr, size *uint32) (err error) {
|
||||
r1, _, e1 := syscall.Syscall6(procConvertStringSecurityDescriptorToSecurityDescriptorW.Addr(), 4, uintptr(unsafe.Pointer(str)), uintptr(revision), uintptr(unsafe.Pointer(sd)), uintptr(unsafe.Pointer(size)), 0, 0)
|
||||
if r1 == 0 {
|
||||
if e1 != 0 {
|
||||
err = errnoErr(e1)
|
||||
} else {
|
||||
err = syscall.EINVAL
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func convertSecurityDescriptorToStringSecurityDescriptor(sd *byte, revision uint32, secInfo uint32, sddl **uint16, sddlSize *uint32) (err error) {
|
||||
r1, _, e1 := syscall.Syscall6(procConvertSecurityDescriptorToStringSecurityDescriptorW.Addr(), 5, uintptr(unsafe.Pointer(sd)), uintptr(revision), uintptr(secInfo), uintptr(unsafe.Pointer(sddl)), uintptr(unsafe.Pointer(sddlSize)), 0)
|
||||
if r1 == 0 {
|
||||
if e1 != 0 {
|
||||
err = errnoErr(e1)
|
||||
} else {
|
||||
err = syscall.EINVAL
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func localFree(mem uintptr) {
|
||||
syscall.Syscall(procLocalFree.Addr(), 1, uintptr(mem), 0, 0)
|
||||
return
|
||||
}
|
||||
|
||||
func getSecurityDescriptorLength(sd uintptr) (len uint32) {
|
||||
r0, _, _ := syscall.Syscall(procGetSecurityDescriptorLength.Addr(), 1, uintptr(sd), 0, 0)
|
||||
len = uint32(r0)
|
||||
return
|
||||
}
|
||||
|
||||
func getFileInformationByHandleEx(h syscall.Handle, class uint32, buffer *byte, size uint32) (err error) {
|
||||
r1, _, e1 := syscall.Syscall6(procGetFileInformationByHandleEx.Addr(), 4, uintptr(h), uintptr(class), uintptr(unsafe.Pointer(buffer)), uintptr(size), 0, 0)
|
||||
if r1 == 0 {
|
||||
if e1 != 0 {
|
||||
err = errnoErr(e1)
|
||||
} else {
|
||||
err = syscall.EINVAL
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func setFileInformationByHandle(h syscall.Handle, class uint32, buffer *byte, size uint32) (err error) {
|
||||
r1, _, e1 := syscall.Syscall6(procSetFileInformationByHandle.Addr(), 4, uintptr(h), uintptr(class), uintptr(unsafe.Pointer(buffer)), uintptr(size), 0, 0)
|
||||
if r1 == 0 {
|
||||
if e1 != 0 {
|
||||
err = errnoErr(e1)
|
||||
} else {
|
||||
err = syscall.EINVAL
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func adjustTokenPrivileges(token windows.Token, releaseAll bool, input *byte, outputSize uint32, output *byte, requiredSize *uint32) (success bool, err error) {
|
||||
var _p0 uint32
|
||||
if releaseAll {
|
||||
_p0 = 1
|
||||
} else {
|
||||
_p0 = 0
|
||||
}
|
||||
r0, _, e1 := syscall.Syscall6(procAdjustTokenPrivileges.Addr(), 6, uintptr(token), uintptr(_p0), uintptr(unsafe.Pointer(input)), uintptr(outputSize), uintptr(unsafe.Pointer(output)), uintptr(unsafe.Pointer(requiredSize)))
|
||||
success = r0 != 0
|
||||
if true {
|
||||
if e1 != 0 {
|
||||
err = errnoErr(e1)
|
||||
} else {
|
||||
err = syscall.EINVAL
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func impersonateSelf(level uint32) (err error) {
|
||||
r1, _, e1 := syscall.Syscall(procImpersonateSelf.Addr(), 1, uintptr(level), 0, 0)
|
||||
if r1 == 0 {
|
||||
if e1 != 0 {
|
||||
err = errnoErr(e1)
|
||||
} else {
|
||||
err = syscall.EINVAL
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func revertToSelf() (err error) {
|
||||
r1, _, e1 := syscall.Syscall(procRevertToSelf.Addr(), 0, 0, 0, 0)
|
||||
if r1 == 0 {
|
||||
if e1 != 0 {
|
||||
err = errnoErr(e1)
|
||||
} else {
|
||||
err = syscall.EINVAL
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func openThreadToken(thread syscall.Handle, accessMask uint32, openAsSelf bool, token *windows.Token) (err error) {
|
||||
var _p0 uint32
|
||||
if openAsSelf {
|
||||
_p0 = 1
|
||||
} else {
|
||||
_p0 = 0
|
||||
}
|
||||
r1, _, e1 := syscall.Syscall6(procOpenThreadToken.Addr(), 4, uintptr(thread), uintptr(accessMask), uintptr(_p0), uintptr(unsafe.Pointer(token)), 0, 0)
|
||||
if r1 == 0 {
|
||||
if e1 != 0 {
|
||||
err = errnoErr(e1)
|
||||
} else {
|
||||
err = syscall.EINVAL
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func getCurrentThread() (h syscall.Handle) {
|
||||
r0, _, _ := syscall.Syscall(procGetCurrentThread.Addr(), 0, 0, 0, 0)
|
||||
h = syscall.Handle(r0)
|
||||
return
|
||||
}
|
||||
|
||||
func lookupPrivilegeValue(systemName string, name string, luid *uint64) (err error) {
|
||||
var _p0 *uint16
|
||||
_p0, err = syscall.UTF16PtrFromString(systemName)
|
||||
if err != nil {
|
||||
return
|
||||
}
|
||||
var _p1 *uint16
|
||||
_p1, err = syscall.UTF16PtrFromString(name)
|
||||
if err != nil {
|
||||
return
|
||||
}
|
||||
return _lookupPrivilegeValue(_p0, _p1, luid)
|
||||
}
|
||||
|
||||
func _lookupPrivilegeValue(systemName *uint16, name *uint16, luid *uint64) (err error) {
|
||||
r1, _, e1 := syscall.Syscall(procLookupPrivilegeValueW.Addr(), 3, uintptr(unsafe.Pointer(systemName)), uintptr(unsafe.Pointer(name)), uintptr(unsafe.Pointer(luid)))
|
||||
if r1 == 0 {
|
||||
if e1 != 0 {
|
||||
err = errnoErr(e1)
|
||||
} else {
|
||||
err = syscall.EINVAL
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func lookupPrivilegeName(systemName string, luid *uint64, buffer *uint16, size *uint32) (err error) {
|
||||
var _p0 *uint16
|
||||
_p0, err = syscall.UTF16PtrFromString(systemName)
|
||||
if err != nil {
|
||||
return
|
||||
}
|
||||
return _lookupPrivilegeName(_p0, luid, buffer, size)
|
||||
}
|
||||
|
||||
func _lookupPrivilegeName(systemName *uint16, luid *uint64, buffer *uint16, size *uint32) (err error) {
|
||||
r1, _, e1 := syscall.Syscall6(procLookupPrivilegeNameW.Addr(), 4, uintptr(unsafe.Pointer(systemName)), uintptr(unsafe.Pointer(luid)), uintptr(unsafe.Pointer(buffer)), uintptr(unsafe.Pointer(size)), 0, 0)
|
||||
if r1 == 0 {
|
||||
if e1 != 0 {
|
||||
err = errnoErr(e1)
|
||||
} else {
|
||||
err = syscall.EINVAL
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func lookupPrivilegeDisplayName(systemName string, name *uint16, buffer *uint16, size *uint32, languageId *uint32) (err error) {
|
||||
var _p0 *uint16
|
||||
_p0, err = syscall.UTF16PtrFromString(systemName)
|
||||
if err != nil {
|
||||
return
|
||||
}
|
||||
return _lookupPrivilegeDisplayName(_p0, name, buffer, size, languageId)
|
||||
}
|
||||
|
||||
func _lookupPrivilegeDisplayName(systemName *uint16, name *uint16, buffer *uint16, size *uint32, languageId *uint32) (err error) {
|
||||
r1, _, e1 := syscall.Syscall6(procLookupPrivilegeDisplayNameW.Addr(), 5, uintptr(unsafe.Pointer(systemName)), uintptr(unsafe.Pointer(name)), uintptr(unsafe.Pointer(buffer)), uintptr(unsafe.Pointer(size)), uintptr(unsafe.Pointer(languageId)), 0)
|
||||
if r1 == 0 {
|
||||
if e1 != 0 {
|
||||
err = errnoErr(e1)
|
||||
} else {
|
||||
err = syscall.EINVAL
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func backupRead(h syscall.Handle, b []byte, bytesRead *uint32, abort bool, processSecurity bool, context *uintptr) (err error) {
|
||||
var _p0 *byte
|
||||
if len(b) > 0 {
|
||||
_p0 = &b[0]
|
||||
}
|
||||
var _p1 uint32
|
||||
if abort {
|
||||
_p1 = 1
|
||||
} else {
|
||||
_p1 = 0
|
||||
}
|
||||
var _p2 uint32
|
||||
if processSecurity {
|
||||
_p2 = 1
|
||||
} else {
|
||||
_p2 = 0
|
||||
}
|
||||
r1, _, e1 := syscall.Syscall9(procBackupRead.Addr(), 7, uintptr(h), uintptr(unsafe.Pointer(_p0)), uintptr(len(b)), uintptr(unsafe.Pointer(bytesRead)), uintptr(_p1), uintptr(_p2), uintptr(unsafe.Pointer(context)), 0, 0)
|
||||
if r1 == 0 {
|
||||
if e1 != 0 {
|
||||
err = errnoErr(e1)
|
||||
} else {
|
||||
err = syscall.EINVAL
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func backupWrite(h syscall.Handle, b []byte, bytesWritten *uint32, abort bool, processSecurity bool, context *uintptr) (err error) {
|
||||
var _p0 *byte
|
||||
if len(b) > 0 {
|
||||
_p0 = &b[0]
|
||||
}
|
||||
var _p1 uint32
|
||||
if abort {
|
||||
_p1 = 1
|
||||
} else {
|
||||
_p1 = 0
|
||||
}
|
||||
var _p2 uint32
|
||||
if processSecurity {
|
||||
_p2 = 1
|
||||
} else {
|
||||
_p2 = 0
|
||||
}
|
||||
r1, _, e1 := syscall.Syscall9(procBackupWrite.Addr(), 7, uintptr(h), uintptr(unsafe.Pointer(_p0)), uintptr(len(b)), uintptr(unsafe.Pointer(bytesWritten)), uintptr(_p1), uintptr(_p2), uintptr(unsafe.Pointer(context)), 0, 0)
|
||||
if r1 == 0 {
|
||||
if e1 != 0 {
|
||||
err = errnoErr(e1)
|
||||
} else {
|
||||
err = syscall.EINVAL
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
1
vendor/github.com/Microsoft/hcsshim/.gitignore
generated
vendored
Normal file
1
vendor/github.com/Microsoft/hcsshim/.gitignore
generated
vendored
Normal file
@@ -0,0 +1 @@
|
||||
*.exe
|
||||
17
vendor/github.com/Microsoft/hcsshim/.gometalinter.json
generated
vendored
Normal file
17
vendor/github.com/Microsoft/hcsshim/.gometalinter.json
generated
vendored
Normal file
@@ -0,0 +1,17 @@
|
||||
{
|
||||
"Vendor": true,
|
||||
"Deadline": "2m",
|
||||
"Sort": [
|
||||
"linter",
|
||||
"severity",
|
||||
"path",
|
||||
"line"
|
||||
],
|
||||
"Skip": [
|
||||
"internal\\schema2"
|
||||
],
|
||||
"EnableGC": true,
|
||||
"Enable": [
|
||||
"gofmt"
|
||||
]
|
||||
}
|
||||
21
vendor/github.com/Microsoft/hcsshim/LICENSE
generated
vendored
Normal file
21
vendor/github.com/Microsoft/hcsshim/LICENSE
generated
vendored
Normal file
@@ -0,0 +1,21 @@
|
||||
The MIT License (MIT)
|
||||
|
||||
Copyright (c) 2015 Microsoft
|
||||
|
||||
Permission is hereby granted, free of charge, to any person obtaining a copy
|
||||
of this software and associated documentation files (the "Software"), to deal
|
||||
in the Software without restriction, including without limitation the rights
|
||||
to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
|
||||
copies of the Software, and to permit persons to whom the Software is
|
||||
furnished to do so, subject to the following conditions:
|
||||
|
||||
The above copyright notice and this permission notice shall be included in all
|
||||
copies or substantial portions of the Software.
|
||||
|
||||
THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
|
||||
IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
|
||||
FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
|
||||
AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
|
||||
LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
|
||||
OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
|
||||
SOFTWARE.
|
||||
41
vendor/github.com/Microsoft/hcsshim/README.md
generated
vendored
Normal file
41
vendor/github.com/Microsoft/hcsshim/README.md
generated
vendored
Normal file
@@ -0,0 +1,41 @@
|
||||
# hcsshim
|
||||
|
||||
[](https://ci.appveyor.com/project/WindowsVirtualization/hcsshim/branch/master)
|
||||
|
||||
This package contains the Golang interface for using the Windows [Host Compute Service](https://blogs.technet.microsoft.com/virtualization/2017/01/27/introducing-the-host-compute-service-hcs/) (HCS) to launch and manage [Windows Containers](https://docs.microsoft.com/en-us/virtualization/windowscontainers/about/). It also contains other helpers and functions for managing Windows Containers such as the Golang interface for the Host Network Service (HNS).
|
||||
|
||||
It is primarily used in the [Moby Project](https://github.com/moby/moby), but it can be freely used by other projects as well.
|
||||
|
||||
## Contributing
|
||||
|
||||
This project welcomes contributions and suggestions. Most contributions require you to agree to a
|
||||
Contributor License Agreement (CLA) declaring that you have the right to, and actually do, grant us
|
||||
the rights to use your contribution. For details, visit https://cla.microsoft.com.
|
||||
|
||||
When you submit a pull request, a CLA-bot will automatically determine whether you need to provide
|
||||
a CLA and decorate the PR appropriately (e.g., label, comment). Simply follow the instructions
|
||||
provided by the bot. You will only need to do this once across all repos using our CLA.
|
||||
|
||||
This project has adopted the [Microsoft Open Source Code of Conduct](https://opensource.microsoft.com/codeofconduct/).
|
||||
For more information see the [Code of Conduct FAQ](https://opensource.microsoft.com/codeofconduct/faq/) or
|
||||
contact [opencode@microsoft.com](mailto:opencode@microsoft.com) with any additional questions or comments.
|
||||
|
||||
## Dependencies
|
||||
|
||||
This project requires Golang 1.9 or newer to build.
|
||||
|
||||
For system requirements to run this project, see the Microsoft docs on [Windows Container requirements](https://docs.microsoft.com/en-us/virtualization/windowscontainers/deploy-containers/system-requirements).
|
||||
|
||||
## Reporting Security Issues
|
||||
|
||||
Security issues and bugs should be reported privately, via email, to the Microsoft Security
|
||||
Response Center (MSRC) at [secure@microsoft.com](mailto:secure@microsoft.com). You should
|
||||
receive a response within 24 hours. If for some reason you do not, please follow up via
|
||||
email to ensure we received your original message. Further information, including the
|
||||
[MSRC PGP](https://technet.microsoft.com/en-us/security/dn606155) key, can be found in
|
||||
the [Security TechCenter](https://technet.microsoft.com/en-us/security/default).
|
||||
|
||||
For additional details, see [Report a Computer Security Vulnerability](https://technet.microsoft.com/en-us/security/ff852094.aspx) on Technet
|
||||
|
||||
---------------
|
||||
Copyright (c) 2018 Microsoft Corp. All rights reserved.
|
||||
29
vendor/github.com/Microsoft/hcsshim/appveyor.yml
generated
vendored
Normal file
29
vendor/github.com/Microsoft/hcsshim/appveyor.yml
generated
vendored
Normal file
@@ -0,0 +1,29 @@
|
||||
version: 0.1.{build}
|
||||
|
||||
image: Visual Studio 2017
|
||||
|
||||
clone_folder: c:\gopath\src\github.com\Microsoft\hcsshim
|
||||
|
||||
environment:
|
||||
GOPATH: c:\gopath
|
||||
PATH: C:\mingw-w64\x86_64-7.2.0-posix-seh-rt_v5-rev1\mingw64\bin;%GOPATH%\bin;C:\gometalinter-2.0.12-windows-amd64;%PATH%
|
||||
|
||||
stack: go 1.11
|
||||
|
||||
build_script:
|
||||
- appveyor DownloadFile https://github.com/alecthomas/gometalinter/releases/download/v2.0.12/gometalinter-2.0.12-windows-amd64.zip
|
||||
- 7z x gometalinter-2.0.12-windows-amd64.zip -y -oC:\ > NUL
|
||||
- gometalinter.exe --config .gometalinter.json ./...
|
||||
- go build ./cmd/wclayer
|
||||
- go build ./cmd/runhcs
|
||||
- go build ./cmd/tar2ext4
|
||||
- go test -v ./... -tags admin
|
||||
- go test -c ./test/functional/ -tags functional
|
||||
- go test -c ./test/runhcs/ -tags integration
|
||||
|
||||
artifacts:
|
||||
- path: 'wclayer.exe'
|
||||
- path: 'runhcs.exe'
|
||||
- path: 'tar2ext4.exe'
|
||||
- path: 'functional.test.exe'
|
||||
- path: 'runhcs.test.exe'
|
||||
192
vendor/github.com/Microsoft/hcsshim/container.go
generated
vendored
Normal file
192
vendor/github.com/Microsoft/hcsshim/container.go
generated
vendored
Normal file
@@ -0,0 +1,192 @@
|
||||
package hcsshim
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
"os"
|
||||
"time"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/hcs"
|
||||
"github.com/Microsoft/hcsshim/internal/mergemaps"
|
||||
"github.com/Microsoft/hcsshim/internal/schema1"
|
||||
)
|
||||
|
||||
// ContainerProperties holds the properties for a container and the processes running in that container
|
||||
type ContainerProperties = schema1.ContainerProperties
|
||||
|
||||
// MemoryStats holds the memory statistics for a container
|
||||
type MemoryStats = schema1.MemoryStats
|
||||
|
||||
// ProcessorStats holds the processor statistics for a container
|
||||
type ProcessorStats = schema1.ProcessorStats
|
||||
|
||||
// StorageStats holds the storage statistics for a container
|
||||
type StorageStats = schema1.StorageStats
|
||||
|
||||
// NetworkStats holds the network statistics for a container
|
||||
type NetworkStats = schema1.NetworkStats
|
||||
|
||||
// Statistics is the structure returned by a statistics call on a container
|
||||
type Statistics = schema1.Statistics
|
||||
|
||||
// ProcessList is the structure of an item returned by a ProcessList call on a container
|
||||
type ProcessListItem = schema1.ProcessListItem
|
||||
|
||||
// MappedVirtualDiskController is the structure of an item returned by a MappedVirtualDiskList call on a container
|
||||
type MappedVirtualDiskController = schema1.MappedVirtualDiskController
|
||||
|
||||
// Type of Request Support in ModifySystem
|
||||
type RequestType = schema1.RequestType
|
||||
|
||||
// Type of Resource Support in ModifySystem
|
||||
type ResourceType = schema1.ResourceType
|
||||
|
||||
// RequestType const
|
||||
const (
|
||||
Add = schema1.Add
|
||||
Remove = schema1.Remove
|
||||
Network = schema1.Network
|
||||
)
|
||||
|
||||
// ResourceModificationRequestResponse is the structure used to send request to the container to modify the system
|
||||
// Supported resource types are Network and Request Types are Add/Remove
|
||||
type ResourceModificationRequestResponse = schema1.ResourceModificationRequestResponse
|
||||
|
||||
type container struct {
|
||||
system *hcs.System
|
||||
}
|
||||
|
||||
// createComputeSystemAdditionalJSON is read from the environment at initialisation
|
||||
// time. It allows an environment variable to define additional JSON which
|
||||
// is merged in the CreateComputeSystem call to HCS.
|
||||
var createContainerAdditionalJSON []byte
|
||||
|
||||
func init() {
|
||||
createContainerAdditionalJSON = ([]byte)(os.Getenv("HCSSHIM_CREATECONTAINER_ADDITIONALJSON"))
|
||||
}
|
||||
|
||||
// CreateContainer creates a new container with the given configuration but does not start it.
|
||||
func CreateContainer(id string, c *ContainerConfig) (Container, error) {
|
||||
fullConfig, err := mergemaps.MergeJSON(c, createContainerAdditionalJSON)
|
||||
if err != nil {
|
||||
return nil, fmt.Errorf("failed to merge additional JSON '%s': %s", createContainerAdditionalJSON, err)
|
||||
}
|
||||
|
||||
system, err := hcs.CreateComputeSystem(id, fullConfig)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return &container{system}, err
|
||||
}
|
||||
|
||||
// OpenContainer opens an existing container by ID.
|
||||
func OpenContainer(id string) (Container, error) {
|
||||
system, err := hcs.OpenComputeSystem(id)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return &container{system}, err
|
||||
}
|
||||
|
||||
// GetContainers gets a list of the containers on the system that match the query
|
||||
func GetContainers(q ComputeSystemQuery) ([]ContainerProperties, error) {
|
||||
return hcs.GetComputeSystems(q)
|
||||
}
|
||||
|
||||
// Start synchronously starts the container.
|
||||
func (container *container) Start() error {
|
||||
return convertSystemError(container.system.Start(), container)
|
||||
}
|
||||
|
||||
// Shutdown requests a container shutdown, but it may not actually be shutdown until Wait() succeeds.
|
||||
func (container *container) Shutdown() error {
|
||||
return convertSystemError(container.system.Shutdown(), container)
|
||||
}
|
||||
|
||||
// Terminate requests a container terminate, but it may not actually be terminated until Wait() succeeds.
|
||||
func (container *container) Terminate() error {
|
||||
return convertSystemError(container.system.Terminate(), container)
|
||||
}
|
||||
|
||||
// Waits synchronously waits for the container to shutdown or terminate.
|
||||
func (container *container) Wait() error {
|
||||
return convertSystemError(container.system.Wait(), container)
|
||||
}
|
||||
|
||||
// WaitTimeout synchronously waits for the container to terminate or the duration to elapse. It
|
||||
// returns false if timeout occurs.
|
||||
func (container *container) WaitTimeout(t time.Duration) error {
|
||||
return convertSystemError(container.system.WaitTimeout(t), container)
|
||||
}
|
||||
|
||||
// Pause pauses the execution of a container.
|
||||
func (container *container) Pause() error {
|
||||
return convertSystemError(container.system.Pause(), container)
|
||||
}
|
||||
|
||||
// Resume resumes the execution of a container.
|
||||
func (container *container) Resume() error {
|
||||
return convertSystemError(container.system.Resume(), container)
|
||||
}
|
||||
|
||||
// HasPendingUpdates returns true if the container has updates pending to install
|
||||
func (container *container) HasPendingUpdates() (bool, error) {
|
||||
return false, nil
|
||||
}
|
||||
|
||||
// Statistics returns statistics for the container. This is a legacy v1 call
|
||||
func (container *container) Statistics() (Statistics, error) {
|
||||
properties, err := container.system.Properties(schema1.PropertyTypeStatistics)
|
||||
if err != nil {
|
||||
return Statistics{}, convertSystemError(err, container)
|
||||
}
|
||||
|
||||
return properties.Statistics, nil
|
||||
}
|
||||
|
||||
// ProcessList returns an array of ProcessListItems for the container. This is a legacy v1 call
|
||||
func (container *container) ProcessList() ([]ProcessListItem, error) {
|
||||
properties, err := container.system.Properties(schema1.PropertyTypeProcessList)
|
||||
if err != nil {
|
||||
return nil, convertSystemError(err, container)
|
||||
}
|
||||
|
||||
return properties.ProcessList, nil
|
||||
}
|
||||
|
||||
// This is a legacy v1 call
|
||||
func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskController, error) {
|
||||
properties, err := container.system.Properties(schema1.PropertyTypeMappedVirtualDisk)
|
||||
if err != nil {
|
||||
return nil, convertSystemError(err, container)
|
||||
}
|
||||
|
||||
return properties.MappedVirtualDiskControllers, nil
|
||||
}
|
||||
|
||||
// CreateProcess launches a new process within the container.
|
||||
func (container *container) CreateProcess(c *ProcessConfig) (Process, error) {
|
||||
p, err := container.system.CreateProcess(c)
|
||||
if err != nil {
|
||||
return nil, convertSystemError(err, container)
|
||||
}
|
||||
return &process{p}, nil
|
||||
}
|
||||
|
||||
// OpenProcess gets an interface to an existing process within the container.
|
||||
func (container *container) OpenProcess(pid int) (Process, error) {
|
||||
p, err := container.system.OpenProcess(pid)
|
||||
if err != nil {
|
||||
return nil, convertSystemError(err, container)
|
||||
}
|
||||
return &process{p}, nil
|
||||
}
|
||||
|
||||
// Close cleans up any state associated with the container but does not terminate or wait for it.
|
||||
func (container *container) Close() error {
|
||||
return convertSystemError(container.system.Close(), container)
|
||||
}
|
||||
|
||||
// Modify the System
|
||||
func (container *container) Modify(config *ResourceModificationRequestResponse) error {
|
||||
return convertSystemError(container.system.Modify(config), container)
|
||||
}
|
||||
257
vendor/github.com/Microsoft/hcsshim/errors.go
generated
vendored
Normal file
257
vendor/github.com/Microsoft/hcsshim/errors.go
generated
vendored
Normal file
@@ -0,0 +1,257 @@
|
||||
package hcsshim
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
"syscall"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/hns"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/hcs"
|
||||
"github.com/Microsoft/hcsshim/internal/hcserror"
|
||||
)
|
||||
|
||||
var (
|
||||
// ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists = hcs.exist
|
||||
ErrComputeSystemDoesNotExist = hcs.ErrComputeSystemDoesNotExist
|
||||
|
||||
// ErrElementNotFound is an error encountered when the object being referenced does not exist
|
||||
ErrElementNotFound = hcs.ErrElementNotFound
|
||||
|
||||
// ErrElementNotFound is an error encountered when the object being referenced does not exist
|
||||
ErrNotSupported = hcs.ErrNotSupported
|
||||
|
||||
// ErrInvalidData is an error encountered when the request being sent to hcs is invalid/unsupported
|
||||
// decimal -2147024883 / hex 0x8007000d
|
||||
ErrInvalidData = hcs.ErrInvalidData
|
||||
|
||||
// ErrHandleClose is an error encountered when the handle generating the notification being waited on has been closed
|
||||
ErrHandleClose = hcs.ErrHandleClose
|
||||
|
||||
// ErrAlreadyClosed is an error encountered when using a handle that has been closed by the Close method
|
||||
ErrAlreadyClosed = hcs.ErrAlreadyClosed
|
||||
|
||||
// ErrInvalidNotificationType is an error encountered when an invalid notification type is used
|
||||
ErrInvalidNotificationType = hcs.ErrInvalidNotificationType
|
||||
|
||||
// ErrInvalidProcessState is an error encountered when the process is not in a valid state for the requested operation
|
||||
ErrInvalidProcessState = hcs.ErrInvalidProcessState
|
||||
|
||||
// ErrTimeout is an error encountered when waiting on a notification times out
|
||||
ErrTimeout = hcs.ErrTimeout
|
||||
|
||||
// ErrUnexpectedContainerExit is the error encountered when a container exits while waiting for
|
||||
// a different expected notification
|
||||
ErrUnexpectedContainerExit = hcs.ErrUnexpectedContainerExit
|
||||
|
||||
// ErrUnexpectedProcessAbort is the error encountered when communication with the compute service
|
||||
// is lost while waiting for a notification
|
||||
ErrUnexpectedProcessAbort = hcs.ErrUnexpectedProcessAbort
|
||||
|
||||
// ErrUnexpectedValue is an error encountered when hcs returns an invalid value
|
||||
ErrUnexpectedValue = hcs.ErrUnexpectedValue
|
||||
|
||||
// ErrVmcomputeAlreadyStopped is an error encountered when a shutdown or terminate request is made on a stopped container
|
||||
ErrVmcomputeAlreadyStopped = hcs.ErrVmcomputeAlreadyStopped
|
||||
|
||||
// ErrVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously
|
||||
ErrVmcomputeOperationPending = hcs.ErrVmcomputeOperationPending
|
||||
|
||||
// ErrVmcomputeOperationInvalidState is an error encountered when the compute system is not in a valid state for the requested operation
|
||||
ErrVmcomputeOperationInvalidState = hcs.ErrVmcomputeOperationInvalidState
|
||||
|
||||
// ErrProcNotFound is an error encountered when the the process cannot be found
|
||||
ErrProcNotFound = hcs.ErrProcNotFound
|
||||
|
||||
// ErrVmcomputeOperationAccessIsDenied is an error which can be encountered when enumerating compute systems in RS1/RS2
|
||||
// builds when the underlying silo might be in the process of terminating. HCS was fixed in RS3.
|
||||
ErrVmcomputeOperationAccessIsDenied = hcs.ErrVmcomputeOperationAccessIsDenied
|
||||
|
||||
// ErrVmcomputeInvalidJSON is an error encountered when the compute system does not support/understand the messages sent by management
|
||||
ErrVmcomputeInvalidJSON = hcs.ErrVmcomputeInvalidJSON
|
||||
|
||||
// ErrVmcomputeUnknownMessage is an error encountered guest compute system doesn't support the message
|
||||
ErrVmcomputeUnknownMessage = hcs.ErrVmcomputeUnknownMessage
|
||||
|
||||
// ErrNotSupported is an error encountered when hcs doesn't support the request
|
||||
ErrPlatformNotSupported = hcs.ErrPlatformNotSupported
|
||||
)
|
||||
|
||||
type EndpointNotFoundError = hns.EndpointNotFoundError
|
||||
type NetworkNotFoundError = hns.NetworkNotFoundError
|
||||
|
||||
// ProcessError is an error encountered in HCS during an operation on a Process object
|
||||
type ProcessError struct {
|
||||
Process *process
|
||||
Operation string
|
||||
ExtraInfo string
|
||||
Err error
|
||||
Events []hcs.ErrorEvent
|
||||
}
|
||||
|
||||
// ContainerError is an error encountered in HCS during an operation on a Container object
|
||||
type ContainerError struct {
|
||||
Container *container
|
||||
Operation string
|
||||
ExtraInfo string
|
||||
Err error
|
||||
Events []hcs.ErrorEvent
|
||||
}
|
||||
|
||||
func (e *ContainerError) Error() string {
|
||||
if e == nil {
|
||||
return "<nil>"
|
||||
}
|
||||
|
||||
if e.Container == nil {
|
||||
return "unexpected nil container for error: " + e.Err.Error()
|
||||
}
|
||||
|
||||
s := "container " + e.Container.system.ID()
|
||||
|
||||
if e.Operation != "" {
|
||||
s += " encountered an error during " + e.Operation
|
||||
}
|
||||
|
||||
switch e.Err.(type) {
|
||||
case nil:
|
||||
break
|
||||
case syscall.Errno:
|
||||
s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, hcserror.Win32FromError(e.Err))
|
||||
default:
|
||||
s += fmt.Sprintf(": %s", e.Err.Error())
|
||||
}
|
||||
|
||||
for _, ev := range e.Events {
|
||||
s += "\n" + ev.String()
|
||||
}
|
||||
|
||||
if e.ExtraInfo != "" {
|
||||
s += " extra info: " + e.ExtraInfo
|
||||
}
|
||||
|
||||
return s
|
||||
}
|
||||
|
||||
func makeContainerError(container *container, operation string, extraInfo string, err error) error {
|
||||
// Don't double wrap errors
|
||||
if _, ok := err.(*ContainerError); ok {
|
||||
return err
|
||||
}
|
||||
containerError := &ContainerError{Container: container, Operation: operation, ExtraInfo: extraInfo, Err: err}
|
||||
return containerError
|
||||
}
|
||||
|
||||
func (e *ProcessError) Error() string {
|
||||
if e == nil {
|
||||
return "<nil>"
|
||||
}
|
||||
|
||||
if e.Process == nil {
|
||||
return "Unexpected nil process for error: " + e.Err.Error()
|
||||
}
|
||||
|
||||
s := fmt.Sprintf("process %d in container %s", e.Process.p.Pid(), e.Process.p.SystemID())
|
||||
if e.Operation != "" {
|
||||
s += " encountered an error during " + e.Operation
|
||||
}
|
||||
|
||||
switch e.Err.(type) {
|
||||
case nil:
|
||||
break
|
||||
case syscall.Errno:
|
||||
s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, hcserror.Win32FromError(e.Err))
|
||||
default:
|
||||
s += fmt.Sprintf(": %s", e.Err.Error())
|
||||
}
|
||||
|
||||
for _, ev := range e.Events {
|
||||
s += "\n" + ev.String()
|
||||
}
|
||||
|
||||
return s
|
||||
}
|
||||
|
||||
func makeProcessError(process *process, operation string, extraInfo string, err error) error {
|
||||
// Don't double wrap errors
|
||||
if _, ok := err.(*ProcessError); ok {
|
||||
return err
|
||||
}
|
||||
processError := &ProcessError{Process: process, Operation: operation, ExtraInfo: extraInfo, Err: err}
|
||||
return processError
|
||||
}
|
||||
|
||||
// IsNotExist checks if an error is caused by the Container or Process not existing.
|
||||
// Note: Currently, ErrElementNotFound can mean that a Process has either
|
||||
// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
|
||||
// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
|
||||
func IsNotExist(err error) bool {
|
||||
if _, ok := err.(EndpointNotFoundError); ok {
|
||||
return true
|
||||
}
|
||||
if _, ok := err.(NetworkNotFoundError); ok {
|
||||
return true
|
||||
}
|
||||
return hcs.IsNotExist(getInnerError(err))
|
||||
}
|
||||
|
||||
// IsAlreadyClosed checks if an error is caused by the Container or Process having been
|
||||
// already closed by a call to the Close() method.
|
||||
func IsAlreadyClosed(err error) bool {
|
||||
return hcs.IsAlreadyClosed(getInnerError(err))
|
||||
}
|
||||
|
||||
// IsPending returns a boolean indicating whether the error is that
|
||||
// the requested operation is being completed in the background.
|
||||
func IsPending(err error) bool {
|
||||
return hcs.IsPending(getInnerError(err))
|
||||
}
|
||||
|
||||
// IsTimeout returns a boolean indicating whether the error is caused by
|
||||
// a timeout waiting for the operation to complete.
|
||||
func IsTimeout(err error) bool {
|
||||
return hcs.IsTimeout(getInnerError(err))
|
||||
}
|
||||
|
||||
// IsAlreadyStopped returns a boolean indicating whether the error is caused by
|
||||
// a Container or Process being already stopped.
|
||||
// Note: Currently, ErrElementNotFound can mean that a Process has either
|
||||
// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
|
||||
// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
|
||||
func IsAlreadyStopped(err error) bool {
|
||||
return hcs.IsAlreadyStopped(getInnerError(err))
|
||||
}
|
||||
|
||||
// IsNotSupported returns a boolean indicating whether the error is caused by
|
||||
// unsupported platform requests
|
||||
// Note: Currently Unsupported platform requests can be mean either
|
||||
// ErrVmcomputeInvalidJSON, ErrInvalidData, ErrNotSupported or ErrVmcomputeUnknownMessage
|
||||
// is thrown from the Platform
|
||||
func IsNotSupported(err error) bool {
|
||||
return hcs.IsNotSupported(getInnerError(err))
|
||||
}
|
||||
|
||||
func getInnerError(err error) error {
|
||||
switch pe := err.(type) {
|
||||
case nil:
|
||||
return nil
|
||||
case *ContainerError:
|
||||
err = pe.Err
|
||||
case *ProcessError:
|
||||
err = pe.Err
|
||||
}
|
||||
return err
|
||||
}
|
||||
|
||||
func convertSystemError(err error, c *container) error {
|
||||
if serr, ok := err.(*hcs.SystemError); ok {
|
||||
return &ContainerError{Container: c, Operation: serr.Op, ExtraInfo: serr.Extra, Err: serr.Err, Events: serr.Events}
|
||||
}
|
||||
return err
|
||||
}
|
||||
|
||||
func convertProcessError(err error, p *process) error {
|
||||
if perr, ok := err.(*hcs.ProcessError); ok {
|
||||
return &ProcessError{Process: p, Operation: perr.Op, Err: perr.Err, Events: perr.Events}
|
||||
}
|
||||
return err
|
||||
}
|
||||
12
vendor/github.com/Microsoft/hcsshim/functional_tests.ps1
generated
vendored
Normal file
12
vendor/github.com/Microsoft/hcsshim/functional_tests.ps1
generated
vendored
Normal file
@@ -0,0 +1,12 @@
|
||||
# Requirements so far:
|
||||
# dockerd running
|
||||
# - image microsoft/nanoserver (matching host base image) docker load -i c:\baseimages\nanoserver.tar
|
||||
# - image alpine (linux) docker pull --platform=linux alpine
|
||||
|
||||
|
||||
# TODO: Add this a parameter for debugging. ie "functional-tests -debug=$true"
|
||||
#$env:HCSSHIM_FUNCTIONAL_TESTS_DEBUG="yes please"
|
||||
|
||||
#pushd uvm
|
||||
go test -v -tags "functional uvmcreate uvmscratch uvmscsi uvmvpmem uvmvsmb uvmp9" ./...
|
||||
#popd
|
||||
28
vendor/github.com/Microsoft/hcsshim/hcsshim.go
generated
vendored
Normal file
28
vendor/github.com/Microsoft/hcsshim/hcsshim.go
generated
vendored
Normal file
@@ -0,0 +1,28 @@
|
||||
// Shim for the Host Compute Service (HCS) to manage Windows Server
|
||||
// containers and Hyper-V containers.
|
||||
|
||||
package hcsshim
|
||||
|
||||
import (
|
||||
"syscall"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/hcserror"
|
||||
)
|
||||
|
||||
//go:generate go run mksyscall_windows.go -output zsyscall_windows.go hcsshim.go
|
||||
|
||||
//sys SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) = iphlpapi.SetCurrentThreadCompartmentId
|
||||
|
||||
const (
|
||||
// Specific user-visible exit codes
|
||||
WaitErrExecFailed = 32767
|
||||
|
||||
ERROR_GEN_FAILURE = hcserror.ERROR_GEN_FAILURE
|
||||
ERROR_SHUTDOWN_IN_PROGRESS = syscall.Errno(1115)
|
||||
WSAEINVAL = syscall.Errno(10022)
|
||||
|
||||
// Timeout on wait calls
|
||||
TimeoutInfinite = 0xFFFFFFFF
|
||||
)
|
||||
|
||||
type HcsError = hcserror.HcsError
|
||||
94
vendor/github.com/Microsoft/hcsshim/hnsendpoint.go
generated
vendored
Normal file
94
vendor/github.com/Microsoft/hcsshim/hnsendpoint.go
generated
vendored
Normal file
@@ -0,0 +1,94 @@
|
||||
package hcsshim
|
||||
|
||||
import (
|
||||
"github.com/Microsoft/hcsshim/internal/hns"
|
||||
)
|
||||
|
||||
// HNSEndpoint represents a network endpoint in HNS
|
||||
type HNSEndpoint = hns.HNSEndpoint
|
||||
|
||||
// Namespace represents a Compartment.
|
||||
type Namespace = hns.Namespace
|
||||
|
||||
//SystemType represents the type of the system on which actions are done
|
||||
type SystemType string
|
||||
|
||||
// SystemType const
|
||||
const (
|
||||
ContainerType SystemType = "Container"
|
||||
VirtualMachineType SystemType = "VirtualMachine"
|
||||
HostType SystemType = "Host"
|
||||
)
|
||||
|
||||
// EndpointAttachDetachRequest is the structure used to send request to the container to modify the system
|
||||
// Supported resource types are Network and Request Types are Add/Remove
|
||||
type EndpointAttachDetachRequest = hns.EndpointAttachDetachRequest
|
||||
|
||||
// EndpointResquestResponse is object to get the endpoint request response
|
||||
type EndpointResquestResponse = hns.EndpointResquestResponse
|
||||
|
||||
// HNSEndpointRequest makes a HNS call to modify/query a network endpoint
|
||||
func HNSEndpointRequest(method, path, request string) (*HNSEndpoint, error) {
|
||||
return hns.HNSEndpointRequest(method, path, request)
|
||||
}
|
||||
|
||||
// HNSListEndpointRequest makes a HNS call to query the list of available endpoints
|
||||
func HNSListEndpointRequest() ([]HNSEndpoint, error) {
|
||||
return hns.HNSListEndpointRequest()
|
||||
}
|
||||
|
||||
// HotAttachEndpoint makes a HCS Call to attach the endpoint to the container
|
||||
func HotAttachEndpoint(containerID string, endpointID string) error {
|
||||
return modifyNetworkEndpoint(containerID, endpointID, Add)
|
||||
}
|
||||
|
||||
// HotDetachEndpoint makes a HCS Call to detach the endpoint from the container
|
||||
func HotDetachEndpoint(containerID string, endpointID string) error {
|
||||
return modifyNetworkEndpoint(containerID, endpointID, Remove)
|
||||
}
|
||||
|
||||
// ModifyContainer corresponding to the container id, by sending a request
|
||||
func modifyContainer(id string, request *ResourceModificationRequestResponse) error {
|
||||
container, err := OpenContainer(id)
|
||||
if err != nil {
|
||||
if IsNotExist(err) {
|
||||
return ErrComputeSystemDoesNotExist
|
||||
}
|
||||
return getInnerError(err)
|
||||
}
|
||||
defer container.Close()
|
||||
err = container.Modify(request)
|
||||
if err != nil {
|
||||
if IsNotSupported(err) {
|
||||
return ErrPlatformNotSupported
|
||||
}
|
||||
return getInnerError(err)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func modifyNetworkEndpoint(containerID string, endpointID string, request RequestType) error {
|
||||
requestMessage := &ResourceModificationRequestResponse{
|
||||
Resource: Network,
|
||||
Request: request,
|
||||
Data: endpointID,
|
||||
}
|
||||
err := modifyContainer(containerID, requestMessage)
|
||||
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// GetHNSEndpointByID get the Endpoint by ID
|
||||
func GetHNSEndpointByID(endpointID string) (*HNSEndpoint, error) {
|
||||
return hns.GetHNSEndpointByID(endpointID)
|
||||
}
|
||||
|
||||
// GetHNSEndpointByName gets the endpoint filtered by Name
|
||||
func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) {
|
||||
return hns.GetHNSEndpointByName(endpointName)
|
||||
}
|
||||
16
vendor/github.com/Microsoft/hcsshim/hnsglobals.go
generated
vendored
Normal file
16
vendor/github.com/Microsoft/hcsshim/hnsglobals.go
generated
vendored
Normal file
@@ -0,0 +1,16 @@
|
||||
package hcsshim
|
||||
|
||||
import (
|
||||
"github.com/Microsoft/hcsshim/internal/hns"
|
||||
)
|
||||
|
||||
type HNSGlobals = hns.HNSGlobals
|
||||
type HNSVersion = hns.HNSVersion
|
||||
|
||||
var (
|
||||
HNSVersion1803 = hns.HNSVersion1803
|
||||
)
|
||||
|
||||
func GetHNSGlobals() (*HNSGlobals, error) {
|
||||
return hns.GetHNSGlobals()
|
||||
}
|
||||
36
vendor/github.com/Microsoft/hcsshim/hnsnetwork.go
generated
vendored
Normal file
36
vendor/github.com/Microsoft/hcsshim/hnsnetwork.go
generated
vendored
Normal file
@@ -0,0 +1,36 @@
|
||||
package hcsshim
|
||||
|
||||
import (
|
||||
"github.com/Microsoft/hcsshim/internal/hns"
|
||||
)
|
||||
|
||||
// Subnet is assoicated with a network and represents a list
|
||||
// of subnets available to the network
|
||||
type Subnet = hns.Subnet
|
||||
|
||||
// MacPool is assoicated with a network and represents a list
|
||||
// of macaddresses available to the network
|
||||
type MacPool = hns.MacPool
|
||||
|
||||
// HNSNetwork represents a network in HNS
|
||||
type HNSNetwork = hns.HNSNetwork
|
||||
|
||||
// HNSNetworkRequest makes a call into HNS to update/query a single network
|
||||
func HNSNetworkRequest(method, path, request string) (*HNSNetwork, error) {
|
||||
return hns.HNSNetworkRequest(method, path, request)
|
||||
}
|
||||
|
||||
// HNSListNetworkRequest makes a HNS call to query the list of available networks
|
||||
func HNSListNetworkRequest(method, path, request string) ([]HNSNetwork, error) {
|
||||
return hns.HNSListNetworkRequest(method, path, request)
|
||||
}
|
||||
|
||||
// GetHNSNetworkByID
|
||||
func GetHNSNetworkByID(networkID string) (*HNSNetwork, error) {
|
||||
return hns.GetHNSNetworkByID(networkID)
|
||||
}
|
||||
|
||||
// GetHNSNetworkName filtered by Name
|
||||
func GetHNSNetworkByName(networkName string) (*HNSNetwork, error) {
|
||||
return hns.GetHNSNetworkByName(networkName)
|
||||
}
|
||||
57
vendor/github.com/Microsoft/hcsshim/hnspolicy.go
generated
vendored
Normal file
57
vendor/github.com/Microsoft/hcsshim/hnspolicy.go
generated
vendored
Normal file
@@ -0,0 +1,57 @@
|
||||
package hcsshim
|
||||
|
||||
import (
|
||||
"github.com/Microsoft/hcsshim/internal/hns"
|
||||
)
|
||||
|
||||
// Type of Request Support in ModifySystem
|
||||
type PolicyType = hns.PolicyType
|
||||
|
||||
// RequestType const
|
||||
const (
|
||||
Nat = hns.Nat
|
||||
ACL = hns.ACL
|
||||
PA = hns.PA
|
||||
VLAN = hns.VLAN
|
||||
VSID = hns.VSID
|
||||
VNet = hns.VNet
|
||||
L2Driver = hns.L2Driver
|
||||
Isolation = hns.Isolation
|
||||
QOS = hns.QOS
|
||||
OutboundNat = hns.OutboundNat
|
||||
ExternalLoadBalancer = hns.ExternalLoadBalancer
|
||||
Route = hns.Route
|
||||
)
|
||||
|
||||
type NatPolicy = hns.NatPolicy
|
||||
|
||||
type QosPolicy = hns.QosPolicy
|
||||
|
||||
type IsolationPolicy = hns.IsolationPolicy
|
||||
|
||||
type VlanPolicy = hns.VlanPolicy
|
||||
|
||||
type VsidPolicy = hns.VsidPolicy
|
||||
|
||||
type PaPolicy = hns.PaPolicy
|
||||
|
||||
type OutboundNatPolicy = hns.OutboundNatPolicy
|
||||
|
||||
type ActionType = hns.ActionType
|
||||
type DirectionType = hns.DirectionType
|
||||
type RuleType = hns.RuleType
|
||||
|
||||
const (
|
||||
Allow = hns.Allow
|
||||
Block = hns.Block
|
||||
|
||||
In = hns.In
|
||||
Out = hns.Out
|
||||
|
||||
Host = hns.Host
|
||||
Switch = hns.Switch
|
||||
)
|
||||
|
||||
type ACLPolicy = hns.ACLPolicy
|
||||
|
||||
type Policy = hns.Policy
|
||||
47
vendor/github.com/Microsoft/hcsshim/hnspolicylist.go
generated
vendored
Normal file
47
vendor/github.com/Microsoft/hcsshim/hnspolicylist.go
generated
vendored
Normal file
@@ -0,0 +1,47 @@
|
||||
package hcsshim
|
||||
|
||||
import (
|
||||
"github.com/Microsoft/hcsshim/internal/hns"
|
||||
)
|
||||
|
||||
// RoutePolicy is a structure defining schema for Route based Policy
|
||||
type RoutePolicy = hns.RoutePolicy
|
||||
|
||||
// ELBPolicy is a structure defining schema for ELB LoadBalancing based Policy
|
||||
type ELBPolicy = hns.ELBPolicy
|
||||
|
||||
// LBPolicy is a structure defining schema for LoadBalancing based Policy
|
||||
type LBPolicy = hns.LBPolicy
|
||||
|
||||
// PolicyList is a structure defining schema for Policy list request
|
||||
type PolicyList = hns.PolicyList
|
||||
|
||||
// HNSPolicyListRequest makes a call into HNS to update/query a single network
|
||||
func HNSPolicyListRequest(method, path, request string) (*PolicyList, error) {
|
||||
return hns.HNSPolicyListRequest(method, path, request)
|
||||
}
|
||||
|
||||
// HNSListPolicyListRequest gets all the policy list
|
||||
func HNSListPolicyListRequest() ([]PolicyList, error) {
|
||||
return hns.HNSListPolicyListRequest()
|
||||
}
|
||||
|
||||
// PolicyListRequest makes a HNS call to modify/query a network policy list
|
||||
func PolicyListRequest(method, path, request string) (*PolicyList, error) {
|
||||
return hns.PolicyListRequest(method, path, request)
|
||||
}
|
||||
|
||||
// GetPolicyListByID get the policy list by ID
|
||||
func GetPolicyListByID(policyListID string) (*PolicyList, error) {
|
||||
return hns.GetPolicyListByID(policyListID)
|
||||
}
|
||||
|
||||
// AddLoadBalancer policy list for the specified endpoints
|
||||
func AddLoadBalancer(endpoints []HNSEndpoint, isILB bool, sourceVIP, vip string, protocol uint16, internalPort uint16, externalPort uint16) (*PolicyList, error) {
|
||||
return hns.AddLoadBalancer(endpoints, isILB, sourceVIP, vip, protocol, internalPort, externalPort)
|
||||
}
|
||||
|
||||
// AddRoute adds route policy list for the specified endpoints
|
||||
func AddRoute(endpoints []HNSEndpoint, destinationPrefix string, nextHop string, encapEnabled bool) (*PolicyList, error) {
|
||||
return hns.AddRoute(endpoints, destinationPrefix, nextHop, encapEnabled)
|
||||
}
|
||||
13
vendor/github.com/Microsoft/hcsshim/hnssupport.go
generated
vendored
Normal file
13
vendor/github.com/Microsoft/hcsshim/hnssupport.go
generated
vendored
Normal file
@@ -0,0 +1,13 @@
|
||||
package hcsshim
|
||||
|
||||
import (
|
||||
"github.com/Microsoft/hcsshim/internal/hns"
|
||||
)
|
||||
|
||||
type HNSSupportedFeatures = hns.HNSSupportedFeatures
|
||||
|
||||
type HNSAclFeatures = hns.HNSAclFeatures
|
||||
|
||||
func GetHNSSupportedFeatures() HNSSupportedFeatures {
|
||||
return hns.GetHNSSupportedFeatures()
|
||||
}
|
||||
114
vendor/github.com/Microsoft/hcsshim/interface.go
generated
vendored
Normal file
114
vendor/github.com/Microsoft/hcsshim/interface.go
generated
vendored
Normal file
@@ -0,0 +1,114 @@
|
||||
package hcsshim
|
||||
|
||||
import (
|
||||
"io"
|
||||
"time"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/schema1"
|
||||
)
|
||||
|
||||
// ProcessConfig is used as both the input of Container.CreateProcess
|
||||
// and to convert the parameters to JSON for passing onto the HCS
|
||||
type ProcessConfig = schema1.ProcessConfig
|
||||
|
||||
type Layer = schema1.Layer
|
||||
type MappedDir = schema1.MappedDir
|
||||
type MappedPipe = schema1.MappedPipe
|
||||
type HvRuntime = schema1.HvRuntime
|
||||
type MappedVirtualDisk = schema1.MappedVirtualDisk
|
||||
|
||||
// AssignedDevice represents a device that has been directly assigned to a container
|
||||
//
|
||||
// NOTE: Support added in RS5
|
||||
type AssignedDevice = schema1.AssignedDevice
|
||||
|
||||
// ContainerConfig is used as both the input of CreateContainer
|
||||
// and to convert the parameters to JSON for passing onto the HCS
|
||||
type ContainerConfig = schema1.ContainerConfig
|
||||
|
||||
type ComputeSystemQuery = schema1.ComputeSystemQuery
|
||||
|
||||
// Container represents a created (but not necessarily running) container.
|
||||
type Container interface {
|
||||
// Start synchronously starts the container.
|
||||
Start() error
|
||||
|
||||
// Shutdown requests a container shutdown, but it may not actually be shutdown until Wait() succeeds.
|
||||
Shutdown() error
|
||||
|
||||
// Terminate requests a container terminate, but it may not actually be terminated until Wait() succeeds.
|
||||
Terminate() error
|
||||
|
||||
// Waits synchronously waits for the container to shutdown or terminate.
|
||||
Wait() error
|
||||
|
||||
// WaitTimeout synchronously waits for the container to terminate or the duration to elapse. It
|
||||
// returns false if timeout occurs.
|
||||
WaitTimeout(time.Duration) error
|
||||
|
||||
// Pause pauses the execution of a container.
|
||||
Pause() error
|
||||
|
||||
// Resume resumes the execution of a container.
|
||||
Resume() error
|
||||
|
||||
// HasPendingUpdates returns true if the container has updates pending to install.
|
||||
HasPendingUpdates() (bool, error)
|
||||
|
||||
// Statistics returns statistics for a container.
|
||||
Statistics() (Statistics, error)
|
||||
|
||||
// ProcessList returns details for the processes in a container.
|
||||
ProcessList() ([]ProcessListItem, error)
|
||||
|
||||
// MappedVirtualDisks returns virtual disks mapped to a utility VM, indexed by controller
|
||||
MappedVirtualDisks() (map[int]MappedVirtualDiskController, error)
|
||||
|
||||
// CreateProcess launches a new process within the container.
|
||||
CreateProcess(c *ProcessConfig) (Process, error)
|
||||
|
||||
// OpenProcess gets an interface to an existing process within the container.
|
||||
OpenProcess(pid int) (Process, error)
|
||||
|
||||
// Close cleans up any state associated with the container but does not terminate or wait for it.
|
||||
Close() error
|
||||
|
||||
// Modify the System
|
||||
Modify(config *ResourceModificationRequestResponse) error
|
||||
}
|
||||
|
||||
// Process represents a running or exited process.
|
||||
type Process interface {
|
||||
// Pid returns the process ID of the process within the container.
|
||||
Pid() int
|
||||
|
||||
// Kill signals the process to terminate but does not wait for it to finish terminating.
|
||||
Kill() error
|
||||
|
||||
// Wait waits for the process to exit.
|
||||
Wait() error
|
||||
|
||||
// WaitTimeout waits for the process to exit or the duration to elapse. It returns
|
||||
// false if timeout occurs.
|
||||
WaitTimeout(time.Duration) error
|
||||
|
||||
// ExitCode returns the exit code of the process. The process must have
|
||||
// already terminated.
|
||||
ExitCode() (int, error)
|
||||
|
||||
// ResizeConsole resizes the console of the process.
|
||||
ResizeConsole(width, height uint16) error
|
||||
|
||||
// Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing
|
||||
// these pipes does not close the underlying pipes; it should be possible to
|
||||
// call this multiple times to get multiple interfaces.
|
||||
Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, error)
|
||||
|
||||
// CloseStdin closes the write side of the stdin pipe so that the process is
|
||||
// notified on the read side that there is no more data in stdin.
|
||||
CloseStdin() error
|
||||
|
||||
// Close cleans up any state associated with the process but does not kill
|
||||
// or wait on it.
|
||||
Close() error
|
||||
}
|
||||
100
vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go
generated
vendored
Normal file
100
vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go
generated
vendored
Normal file
@@ -0,0 +1,100 @@
|
||||
package guestrequest
|
||||
|
||||
import (
|
||||
"github.com/Microsoft/hcsshim/internal/schema2"
|
||||
)
|
||||
|
||||
// Arguably, many of these (at least CombinedLayers) should have been generated
|
||||
// by swagger.
|
||||
//
|
||||
// This will also change package name due to an inbound breaking change.
|
||||
|
||||
// This class is used by a modify request to add or remove a combined layers
|
||||
// structure in the guest. For windows, the GCS applies a filter in ContainerRootPath
|
||||
// using the specified layers as the parent content. Ignores property ScratchPath
|
||||
// since the container path is already the scratch path. For linux, the GCS unions
|
||||
// the specified layers and ScratchPath together, placing the resulting union
|
||||
// filesystem at ContainerRootPath.
|
||||
type CombinedLayers struct {
|
||||
ContainerRootPath string `json:"ContainerRootPath,omitempty"`
|
||||
Layers []hcsschema.Layer `json:"Layers,omitempty"`
|
||||
ScratchPath string `json:"ScratchPath,omitempty"`
|
||||
}
|
||||
|
||||
// Defines the schema for hosted settings passed to GCS and/or OpenGCS
|
||||
|
||||
// SCSI. Scratch space for remote file-system commands, or R/W layer for containers
|
||||
type LCOWMappedVirtualDisk struct {
|
||||
MountPath string `json:"MountPath,omitempty"` // /tmp/scratch for an LCOW utility VM being used as a service VM
|
||||
Lun uint8 `json:"Lun,omitempty"`
|
||||
Controller uint8 `json:"Controller,omitempty"`
|
||||
ReadOnly bool `json:"ReadOnly,omitempty"`
|
||||
}
|
||||
|
||||
type WCOWMappedVirtualDisk struct {
|
||||
ContainerPath string `json:"ContainerPath,omitempty"`
|
||||
Lun int32 `json:"Lun,omitempty"`
|
||||
}
|
||||
|
||||
type LCOWMappedDirectory struct {
|
||||
MountPath string `json:"MountPath,omitempty"`
|
||||
Port int32 `json:"Port,omitempty"`
|
||||
ShareName string `json:"ShareName,omitempty"` // If empty not using ANames (not currently supported)
|
||||
ReadOnly bool `json:"ReadOnly,omitempty"`
|
||||
}
|
||||
|
||||
// Read-only layers over VPMem
|
||||
type LCOWMappedVPMemDevice struct {
|
||||
DeviceNumber uint32 `json:"DeviceNumber,omitempty"`
|
||||
MountPath string `json:"MountPath,omitempty"` // /tmp/pN
|
||||
}
|
||||
|
||||
type LCOWNetworkAdapter struct {
|
||||
NamespaceID string `json:",omitempty"`
|
||||
ID string `json:",omitempty"`
|
||||
MacAddress string `json:",omitempty"`
|
||||
IPAddress string `json:",omitempty"`
|
||||
PrefixLength uint8 `json:",omitempty"`
|
||||
GatewayAddress string `json:",omitempty"`
|
||||
DNSSuffix string `json:",omitempty"`
|
||||
DNSServerList string `json:",omitempty"`
|
||||
EnableLowMetric bool `json:",omitempty"`
|
||||
EncapOverhead uint16 `json:",omitempty"`
|
||||
}
|
||||
|
||||
type ResourceType string
|
||||
|
||||
const (
|
||||
// These are constants for v2 schema modify guest requests.
|
||||
ResourceTypeMappedDirectory ResourceType = "MappedDirectory"
|
||||
ResourceTypeMappedVirtualDisk ResourceType = "MappedVirtualDisk"
|
||||
ResourceTypeNetwork ResourceType = "Network"
|
||||
ResourceTypeNetworkNamespace ResourceType = "NetworkNamespace"
|
||||
ResourceTypeCombinedLayers ResourceType = "CombinedLayers"
|
||||
ResourceTypeVPMemDevice ResourceType = "VPMemDevice"
|
||||
)
|
||||
|
||||
// GuestRequest is for modify commands passed to the guest.
|
||||
type GuestRequest struct {
|
||||
RequestType string `json:"RequestType,omitempty"`
|
||||
ResourceType ResourceType `json:"ResourceType,omitempty"`
|
||||
Settings interface{} `json:"Settings,omitempty"`
|
||||
}
|
||||
|
||||
type NetworkModifyRequest struct {
|
||||
AdapterId string `json:"AdapterId,omitempty"`
|
||||
RequestType string `json:"RequestType,omitempty"`
|
||||
Settings interface{} `json:"Settings,omitempty"`
|
||||
}
|
||||
|
||||
type RS4NetworkModifyRequest struct {
|
||||
AdapterInstanceId string `json:"AdapterInstanceId,omitempty"`
|
||||
RequestType string `json:"RequestType,omitempty"`
|
||||
Settings interface{} `json:"Settings,omitempty"`
|
||||
}
|
||||
|
||||
// SignalProcessOptions is the options passed to either WCOW or LCOW
|
||||
// to signal a given process.
|
||||
type SignalProcessOptions struct {
|
||||
Signal int `json:,omitempty`
|
||||
}
|
||||
69
vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go
generated
vendored
Normal file
69
vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go
generated
vendored
Normal file
@@ -0,0 +1,69 @@
|
||||
package guid
|
||||
|
||||
import (
|
||||
"crypto/rand"
|
||||
"encoding/json"
|
||||
"fmt"
|
||||
"io"
|
||||
"strconv"
|
||||
"strings"
|
||||
)
|
||||
|
||||
var _ = (json.Marshaler)(&GUID{})
|
||||
var _ = (json.Unmarshaler)(&GUID{})
|
||||
|
||||
type GUID [16]byte
|
||||
|
||||
func New() GUID {
|
||||
g := GUID{}
|
||||
_, err := io.ReadFull(rand.Reader, g[:])
|
||||
if err != nil {
|
||||
panic(err)
|
||||
}
|
||||
return g
|
||||
}
|
||||
|
||||
func (g GUID) String() string {
|
||||
return fmt.Sprintf("%02x%02x%02x%02x-%02x%02x-%02x%02x-%02x-%02x", g[3], g[2], g[1], g[0], g[5], g[4], g[7], g[6], g[8:10], g[10:])
|
||||
}
|
||||
|
||||
func FromString(s string) GUID {
|
||||
if len(s) != 36 {
|
||||
panic(fmt.Sprintf("invalid GUID length: %d", len(s)))
|
||||
}
|
||||
if s[8] != '-' || s[13] != '-' || s[18] != '-' || s[23] != '-' {
|
||||
panic("invalid GUID format")
|
||||
}
|
||||
indexOrder := [16]int{
|
||||
0, 2, 4, 6,
|
||||
9, 11,
|
||||
14, 16,
|
||||
19, 21,
|
||||
24, 26, 28, 30, 32, 34,
|
||||
}
|
||||
byteOrder := [16]int{
|
||||
3, 2, 1, 0,
|
||||
5, 4,
|
||||
7, 6,
|
||||
8, 9,
|
||||
10, 11, 12, 13, 14, 15,
|
||||
}
|
||||
var g GUID
|
||||
for i, x := range indexOrder {
|
||||
b, err := strconv.ParseInt(s[x:x+2], 16, 16)
|
||||
if err != nil {
|
||||
panic(err)
|
||||
}
|
||||
g[byteOrder[i]] = byte(b)
|
||||
}
|
||||
return g
|
||||
}
|
||||
|
||||
func (g GUID) MarshalJSON() ([]byte, error) {
|
||||
return json.Marshal(g.String())
|
||||
}
|
||||
|
||||
func (g *GUID) UnmarshalJSON(data []byte) error {
|
||||
*g = FromString(strings.Trim(string(data), "\""))
|
||||
return nil
|
||||
}
|
||||
104
vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go
generated
vendored
Normal file
104
vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go
generated
vendored
Normal file
@@ -0,0 +1,104 @@
|
||||
package hcs
|
||||
|
||||
import (
|
||||
"sync"
|
||||
"syscall"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/interop"
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
var (
|
||||
nextCallback uintptr
|
||||
callbackMap = map[uintptr]*notifcationWatcherContext{}
|
||||
callbackMapLock = sync.RWMutex{}
|
||||
|
||||
notificationWatcherCallback = syscall.NewCallback(notificationWatcher)
|
||||
|
||||
// Notifications for HCS_SYSTEM handles
|
||||
hcsNotificationSystemExited hcsNotification = 0x00000001
|
||||
hcsNotificationSystemCreateCompleted hcsNotification = 0x00000002
|
||||
hcsNotificationSystemStartCompleted hcsNotification = 0x00000003
|
||||
hcsNotificationSystemPauseCompleted hcsNotification = 0x00000004
|
||||
hcsNotificationSystemResumeCompleted hcsNotification = 0x00000005
|
||||
hcsNotificationSystemCrashReport hcsNotification = 0x00000006
|
||||
hcsNotificationSystemSiloJobCreated hcsNotification = 0x00000007
|
||||
hcsNotificationSystemSaveCompleted hcsNotification = 0x00000008
|
||||
hcsNotificationSystemRdpEnhancedModeStateChanged hcsNotification = 0x00000009
|
||||
hcsNotificationSystemShutdownFailed hcsNotification = 0x0000000A
|
||||
hcsNotificationSystemGetPropertiesCompleted hcsNotification = 0x0000000B
|
||||
hcsNotificationSystemModifyCompleted hcsNotification = 0x0000000C
|
||||
hcsNotificationSystemCrashInitiated hcsNotification = 0x0000000D
|
||||
hcsNotificationSystemGuestConnectionClosed hcsNotification = 0x0000000E
|
||||
|
||||
// Notifications for HCS_PROCESS handles
|
||||
hcsNotificationProcessExited hcsNotification = 0x00010000
|
||||
|
||||
// Common notifications
|
||||
hcsNotificationInvalid hcsNotification = 0x00000000
|
||||
hcsNotificationServiceDisconnect hcsNotification = 0x01000000
|
||||
)
|
||||
|
||||
type hcsNotification uint32
|
||||
type notificationChannel chan error
|
||||
|
||||
type notifcationWatcherContext struct {
|
||||
channels notificationChannels
|
||||
handle hcsCallback
|
||||
}
|
||||
|
||||
type notificationChannels map[hcsNotification]notificationChannel
|
||||
|
||||
func newChannels() notificationChannels {
|
||||
channels := make(notificationChannels)
|
||||
|
||||
channels[hcsNotificationSystemExited] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemCreateCompleted] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemStartCompleted] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemPauseCompleted] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemResumeCompleted] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationProcessExited] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationServiceDisconnect] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemCrashReport] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemSiloJobCreated] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemSaveCompleted] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemRdpEnhancedModeStateChanged] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemShutdownFailed] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemGetPropertiesCompleted] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemModifyCompleted] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemCrashInitiated] = make(notificationChannel, 1)
|
||||
channels[hcsNotificationSystemGuestConnectionClosed] = make(notificationChannel, 1)
|
||||
|
||||
return channels
|
||||
}
|
||||
|
||||
func closeChannels(channels notificationChannels) {
|
||||
for _, c := range channels {
|
||||
close(c)
|
||||
}
|
||||
}
|
||||
|
||||
func notificationWatcher(notificationType hcsNotification, callbackNumber uintptr, notificationStatus uintptr, notificationData *uint16) uintptr {
|
||||
var result error
|
||||
if int32(notificationStatus) < 0 {
|
||||
result = interop.Win32FromHresult(notificationStatus)
|
||||
}
|
||||
|
||||
callbackMapLock.RLock()
|
||||
context := callbackMap[callbackNumber]
|
||||
callbackMapLock.RUnlock()
|
||||
|
||||
if context == nil {
|
||||
return 0
|
||||
}
|
||||
|
||||
if channel, ok := context.channels[notificationType]; ok {
|
||||
channel <- result
|
||||
} else {
|
||||
logrus.WithFields(logrus.Fields{
|
||||
"notification-type": notificationType,
|
||||
}).Warn("Received a callback of an unsupported type")
|
||||
}
|
||||
|
||||
return 0
|
||||
}
|
||||
7
vendor/github.com/Microsoft/hcsshim/internal/hcs/cgo.go
generated
vendored
Normal file
7
vendor/github.com/Microsoft/hcsshim/internal/hcs/cgo.go
generated
vendored
Normal file
@@ -0,0 +1,7 @@
|
||||
package hcs
|
||||
|
||||
import "C"
|
||||
|
||||
// This import is needed to make the library compile as CGO because HCSSHIM
|
||||
// only works with CGO due to callbacks from HCS comming back from a C thread
|
||||
// which is not supported without CGO. See https://github.com/golang/go/issues/10973
|
||||
287
vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go
generated
vendored
Normal file
287
vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go
generated
vendored
Normal file
@@ -0,0 +1,287 @@
|
||||
package hcs
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"errors"
|
||||
"fmt"
|
||||
"syscall"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/interop"
|
||||
"github.com/Microsoft/hcsshim/internal/logfields"
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
var (
|
||||
// ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists
|
||||
ErrComputeSystemDoesNotExist = syscall.Errno(0xc037010e)
|
||||
|
||||
// ErrElementNotFound is an error encountered when the object being referenced does not exist
|
||||
ErrElementNotFound = syscall.Errno(0x490)
|
||||
|
||||
// ErrElementNotFound is an error encountered when the object being referenced does not exist
|
||||
ErrNotSupported = syscall.Errno(0x32)
|
||||
|
||||
// ErrInvalidData is an error encountered when the request being sent to hcs is invalid/unsupported
|
||||
// decimal -2147024883 / hex 0x8007000d
|
||||
ErrInvalidData = syscall.Errno(0xd)
|
||||
|
||||
// ErrHandleClose is an error encountered when the handle generating the notification being waited on has been closed
|
||||
ErrHandleClose = errors.New("hcsshim: the handle generating this notification has been closed")
|
||||
|
||||
// ErrAlreadyClosed is an error encountered when using a handle that has been closed by the Close method
|
||||
ErrAlreadyClosed = errors.New("hcsshim: the handle has already been closed")
|
||||
|
||||
// ErrInvalidNotificationType is an error encountered when an invalid notification type is used
|
||||
ErrInvalidNotificationType = errors.New("hcsshim: invalid notification type")
|
||||
|
||||
// ErrInvalidProcessState is an error encountered when the process is not in a valid state for the requested operation
|
||||
ErrInvalidProcessState = errors.New("the process is in an invalid state for the attempted operation")
|
||||
|
||||
// ErrTimeout is an error encountered when waiting on a notification times out
|
||||
ErrTimeout = errors.New("hcsshim: timeout waiting for notification")
|
||||
|
||||
// ErrUnexpectedContainerExit is the error encountered when a container exits while waiting for
|
||||
// a different expected notification
|
||||
ErrUnexpectedContainerExit = errors.New("unexpected container exit")
|
||||
|
||||
// ErrUnexpectedProcessAbort is the error encountered when communication with the compute service
|
||||
// is lost while waiting for a notification
|
||||
ErrUnexpectedProcessAbort = errors.New("lost communication with compute service")
|
||||
|
||||
// ErrUnexpectedValue is an error encountered when hcs returns an invalid value
|
||||
ErrUnexpectedValue = errors.New("unexpected value returned from hcs")
|
||||
|
||||
// ErrVmcomputeAlreadyStopped is an error encountered when a shutdown or terminate request is made on a stopped container
|
||||
ErrVmcomputeAlreadyStopped = syscall.Errno(0xc0370110)
|
||||
|
||||
// ErrVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously
|
||||
ErrVmcomputeOperationPending = syscall.Errno(0xC0370103)
|
||||
|
||||
// ErrVmcomputeOperationInvalidState is an error encountered when the compute system is not in a valid state for the requested operation
|
||||
ErrVmcomputeOperationInvalidState = syscall.Errno(0xc0370105)
|
||||
|
||||
// ErrProcNotFound is an error encountered when the the process cannot be found
|
||||
ErrProcNotFound = syscall.Errno(0x7f)
|
||||
|
||||
// ErrVmcomputeOperationAccessIsDenied is an error which can be encountered when enumerating compute systems in RS1/RS2
|
||||
// builds when the underlying silo might be in the process of terminating. HCS was fixed in RS3.
|
||||
ErrVmcomputeOperationAccessIsDenied = syscall.Errno(0x5)
|
||||
|
||||
// ErrVmcomputeInvalidJSON is an error encountered when the compute system does not support/understand the messages sent by management
|
||||
ErrVmcomputeInvalidJSON = syscall.Errno(0xc037010d)
|
||||
|
||||
// ErrVmcomputeUnknownMessage is an error encountered guest compute system doesn't support the message
|
||||
ErrVmcomputeUnknownMessage = syscall.Errno(0xc037010b)
|
||||
|
||||
// ErrVmcomputeUnexpectedExit is an error encountered when the compute system terminates unexpectedly
|
||||
ErrVmcomputeUnexpectedExit = syscall.Errno(0xC0370106)
|
||||
|
||||
// ErrNotSupported is an error encountered when hcs doesn't support the request
|
||||
ErrPlatformNotSupported = errors.New("unsupported platform request")
|
||||
)
|
||||
|
||||
type ErrorEvent struct {
|
||||
Message string `json:"Message,omitempty"` // Fully formated error message
|
||||
StackTrace string `json:"StackTrace,omitempty"` // Stack trace in string form
|
||||
Provider string `json:"Provider,omitempty"`
|
||||
EventID uint16 `json:"EventId,omitempty"`
|
||||
Flags uint32 `json:"Flags,omitempty"`
|
||||
Source string `json:"Source,omitempty"`
|
||||
//Data []EventData `json:"Data,omitempty"` // Omit this as HCS doesn't encode this well. It's more confusing to include. It is however logged in debug mode (see processHcsResult function)
|
||||
}
|
||||
|
||||
type hcsResult struct {
|
||||
Error int32
|
||||
ErrorMessage string
|
||||
ErrorEvents []ErrorEvent `json:"ErrorEvents,omitempty"`
|
||||
}
|
||||
|
||||
func (ev *ErrorEvent) String() string {
|
||||
evs := "[Event Detail: " + ev.Message
|
||||
if ev.StackTrace != "" {
|
||||
evs += " Stack Trace: " + ev.StackTrace
|
||||
}
|
||||
if ev.Provider != "" {
|
||||
evs += " Provider: " + ev.Provider
|
||||
}
|
||||
if ev.EventID != 0 {
|
||||
evs = fmt.Sprintf("%s EventID: %d", evs, ev.EventID)
|
||||
}
|
||||
if ev.Flags != 0 {
|
||||
evs = fmt.Sprintf("%s flags: %d", evs, ev.Flags)
|
||||
}
|
||||
if ev.Source != "" {
|
||||
evs += " Source: " + ev.Source
|
||||
}
|
||||
evs += "]"
|
||||
return evs
|
||||
}
|
||||
|
||||
func processHcsResult(resultp *uint16) []ErrorEvent {
|
||||
if resultp != nil {
|
||||
resultj := interop.ConvertAndFreeCoTaskMemString(resultp)
|
||||
logrus.WithField(logfields.JSON, resultj).
|
||||
Debug("HCS Result")
|
||||
result := &hcsResult{}
|
||||
if err := json.Unmarshal([]byte(resultj), result); err != nil {
|
||||
logrus.WithFields(logrus.Fields{
|
||||
logfields.JSON: resultj,
|
||||
logrus.ErrorKey: err,
|
||||
}).Warning("Could not unmarshal HCS result")
|
||||
return nil
|
||||
}
|
||||
return result.ErrorEvents
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
type HcsError struct {
|
||||
Op string
|
||||
Err error
|
||||
Events []ErrorEvent
|
||||
}
|
||||
|
||||
func (e *HcsError) Error() string {
|
||||
s := e.Op + ": " + e.Err.Error()
|
||||
for _, ev := range e.Events {
|
||||
s += "\n" + ev.String()
|
||||
}
|
||||
return s
|
||||
}
|
||||
|
||||
// ProcessError is an error encountered in HCS during an operation on a Process object
|
||||
type ProcessError struct {
|
||||
SystemID string
|
||||
Pid int
|
||||
Op string
|
||||
Err error
|
||||
Events []ErrorEvent
|
||||
}
|
||||
|
||||
// SystemError is an error encountered in HCS during an operation on a Container object
|
||||
type SystemError struct {
|
||||
ID string
|
||||
Op string
|
||||
Err error
|
||||
Extra string
|
||||
Events []ErrorEvent
|
||||
}
|
||||
|
||||
func (e *SystemError) Error() string {
|
||||
s := e.Op + " " + e.ID + ": " + e.Err.Error()
|
||||
for _, ev := range e.Events {
|
||||
s += "\n" + ev.String()
|
||||
}
|
||||
if e.Extra != "" {
|
||||
s += "\n(extra info: " + e.Extra + ")"
|
||||
}
|
||||
return s
|
||||
}
|
||||
|
||||
func makeSystemError(system *System, op string, extra string, err error, events []ErrorEvent) error {
|
||||
// Don't double wrap errors
|
||||
if _, ok := err.(*SystemError); ok {
|
||||
return err
|
||||
}
|
||||
return &SystemError{
|
||||
ID: system.ID(),
|
||||
Op: op,
|
||||
Extra: extra,
|
||||
Err: err,
|
||||
Events: events,
|
||||
}
|
||||
}
|
||||
|
||||
func (e *ProcessError) Error() string {
|
||||
s := fmt.Sprintf("%s %s:%d: %s", e.Op, e.SystemID, e.Pid, e.Err.Error())
|
||||
for _, ev := range e.Events {
|
||||
s += "\n" + ev.String()
|
||||
}
|
||||
return s
|
||||
}
|
||||
|
||||
func makeProcessError(process *Process, op string, err error, events []ErrorEvent) error {
|
||||
// Don't double wrap errors
|
||||
if _, ok := err.(*ProcessError); ok {
|
||||
return err
|
||||
}
|
||||
return &ProcessError{
|
||||
Pid: process.Pid(),
|
||||
SystemID: process.SystemID(),
|
||||
Op: op,
|
||||
Err: err,
|
||||
Events: events,
|
||||
}
|
||||
}
|
||||
|
||||
// IsNotExist checks if an error is caused by the Container or Process not existing.
|
||||
// Note: Currently, ErrElementNotFound can mean that a Process has either
|
||||
// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
|
||||
// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
|
||||
func IsNotExist(err error) bool {
|
||||
err = getInnerError(err)
|
||||
return err == ErrComputeSystemDoesNotExist ||
|
||||
err == ErrElementNotFound ||
|
||||
err == ErrProcNotFound
|
||||
}
|
||||
|
||||
// IsAlreadyClosed checks if an error is caused by the Container or Process having been
|
||||
// already closed by a call to the Close() method.
|
||||
func IsAlreadyClosed(err error) bool {
|
||||
err = getInnerError(err)
|
||||
return err == ErrAlreadyClosed
|
||||
}
|
||||
|
||||
// IsPending returns a boolean indicating whether the error is that
|
||||
// the requested operation is being completed in the background.
|
||||
func IsPending(err error) bool {
|
||||
err = getInnerError(err)
|
||||
return err == ErrVmcomputeOperationPending
|
||||
}
|
||||
|
||||
// IsTimeout returns a boolean indicating whether the error is caused by
|
||||
// a timeout waiting for the operation to complete.
|
||||
func IsTimeout(err error) bool {
|
||||
err = getInnerError(err)
|
||||
return err == ErrTimeout
|
||||
}
|
||||
|
||||
// IsAlreadyStopped returns a boolean indicating whether the error is caused by
|
||||
// a Container or Process being already stopped.
|
||||
// Note: Currently, ErrElementNotFound can mean that a Process has either
|
||||
// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
|
||||
// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
|
||||
func IsAlreadyStopped(err error) bool {
|
||||
err = getInnerError(err)
|
||||
return err == ErrVmcomputeAlreadyStopped ||
|
||||
err == ErrElementNotFound ||
|
||||
err == ErrProcNotFound
|
||||
}
|
||||
|
||||
// IsNotSupported returns a boolean indicating whether the error is caused by
|
||||
// unsupported platform requests
|
||||
// Note: Currently Unsupported platform requests can be mean either
|
||||
// ErrVmcomputeInvalidJSON, ErrInvalidData, ErrNotSupported or ErrVmcomputeUnknownMessage
|
||||
// is thrown from the Platform
|
||||
func IsNotSupported(err error) bool {
|
||||
err = getInnerError(err)
|
||||
// If Platform doesn't recognize or support the request sent, below errors are seen
|
||||
return err == ErrVmcomputeInvalidJSON ||
|
||||
err == ErrInvalidData ||
|
||||
err == ErrNotSupported ||
|
||||
err == ErrVmcomputeUnknownMessage
|
||||
}
|
||||
|
||||
func getInnerError(err error) error {
|
||||
switch pe := err.(type) {
|
||||
case nil:
|
||||
return nil
|
||||
case *HcsError:
|
||||
err = pe.Err
|
||||
case *SystemError:
|
||||
err = pe.Err
|
||||
case *ProcessError:
|
||||
err = pe.Err
|
||||
}
|
||||
return err
|
||||
}
|
||||
48
vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go
generated
vendored
Normal file
48
vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go
generated
vendored
Normal file
@@ -0,0 +1,48 @@
|
||||
// Shim for the Host Compute Service (HCS) to manage Windows Server
|
||||
// containers and Hyper-V containers.
|
||||
|
||||
package hcs
|
||||
|
||||
import (
|
||||
"syscall"
|
||||
)
|
||||
|
||||
//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hcs.go
|
||||
|
||||
//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems?
|
||||
//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem?
|
||||
//sys hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem?
|
||||
//sys hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem?
|
||||
//sys hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem?
|
||||
//sys hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem?
|
||||
//sys hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem?
|
||||
//sys hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem?
|
||||
//sys hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem?
|
||||
//sys hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties?
|
||||
//sys hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem?
|
||||
//sys hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback?
|
||||
//sys hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback?
|
||||
|
||||
//sys hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess?
|
||||
//sys hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess?
|
||||
//sys hcsCloseProcess(process hcsProcess) (hr error) = vmcompute.HcsCloseProcess?
|
||||
//sys hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess?
|
||||
//sys hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) = vmcompute.HcsTerminateProcess?
|
||||
//sys hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo?
|
||||
//sys hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties?
|
||||
//sys hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess?
|
||||
//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties?
|
||||
//sys hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback?
|
||||
//sys hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback?
|
||||
|
||||
type hcsSystem syscall.Handle
|
||||
type hcsProcess syscall.Handle
|
||||
type hcsCallback syscall.Handle
|
||||
|
||||
type hcsProcessInformation struct {
|
||||
ProcessId uint32
|
||||
Reserved uint32
|
||||
StdInput syscall.Handle
|
||||
StdOutput syscall.Handle
|
||||
StdError syscall.Handle
|
||||
}
|
||||
20
vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go
generated
vendored
Normal file
20
vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go
generated
vendored
Normal file
@@ -0,0 +1,20 @@
|
||||
package hcs
|
||||
|
||||
import "github.com/sirupsen/logrus"
|
||||
|
||||
func logOperationBegin(ctx logrus.Fields, msg string) {
|
||||
logrus.WithFields(ctx).Debug(msg)
|
||||
}
|
||||
|
||||
func logOperationEnd(ctx logrus.Fields, msg string, err error) {
|
||||
// Copy the log and fields first.
|
||||
log := logrus.WithFields(ctx)
|
||||
if err == nil {
|
||||
log.Debug(msg)
|
||||
} else {
|
||||
// Edit only the copied field data to avoid race conditions on the
|
||||
// write.
|
||||
log.Data[logrus.ErrorKey] = err
|
||||
log.Error(msg)
|
||||
}
|
||||
}
|
||||
459
vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go
generated
vendored
Normal file
459
vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go
generated
vendored
Normal file
@@ -0,0 +1,459 @@
|
||||
package hcs
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"io"
|
||||
"sync"
|
||||
"syscall"
|
||||
"time"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/guestrequest"
|
||||
"github.com/Microsoft/hcsshim/internal/interop"
|
||||
"github.com/Microsoft/hcsshim/internal/logfields"
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
// ContainerError is an error encountered in HCS
|
||||
type Process struct {
|
||||
handleLock sync.RWMutex
|
||||
handle hcsProcess
|
||||
processID int
|
||||
system *System
|
||||
cachedPipes *cachedPipes
|
||||
callbackNumber uintptr
|
||||
|
||||
logctx logrus.Fields
|
||||
}
|
||||
|
||||
func newProcess(process hcsProcess, processID int, computeSystem *System) *Process {
|
||||
return &Process{
|
||||
handle: process,
|
||||
processID: processID,
|
||||
system: computeSystem,
|
||||
logctx: logrus.Fields{
|
||||
logfields.ContainerID: computeSystem.ID(),
|
||||
logfields.ProcessID: processID,
|
||||
},
|
||||
}
|
||||
}
|
||||
|
||||
type cachedPipes struct {
|
||||
stdIn syscall.Handle
|
||||
stdOut syscall.Handle
|
||||
stdErr syscall.Handle
|
||||
}
|
||||
|
||||
type processModifyRequest struct {
|
||||
Operation string
|
||||
ConsoleSize *consoleSize `json:",omitempty"`
|
||||
CloseHandle *closeHandle `json:",omitempty"`
|
||||
}
|
||||
|
||||
type consoleSize struct {
|
||||
Height uint16
|
||||
Width uint16
|
||||
}
|
||||
|
||||
type closeHandle struct {
|
||||
Handle string
|
||||
}
|
||||
|
||||
type ProcessStatus struct {
|
||||
ProcessID uint32
|
||||
Exited bool
|
||||
ExitCode uint32
|
||||
LastWaitResult int32
|
||||
}
|
||||
|
||||
const (
|
||||
stdIn string = "StdIn"
|
||||
stdOut string = "StdOut"
|
||||
stdErr string = "StdErr"
|
||||
)
|
||||
|
||||
const (
|
||||
modifyConsoleSize string = "ConsoleSize"
|
||||
modifyCloseHandle string = "CloseHandle"
|
||||
)
|
||||
|
||||
// Pid returns the process ID of the process within the container.
|
||||
func (process *Process) Pid() int {
|
||||
return process.processID
|
||||
}
|
||||
|
||||
// SystemID returns the ID of the process's compute system.
|
||||
func (process *Process) SystemID() string {
|
||||
return process.system.ID()
|
||||
}
|
||||
|
||||
func (process *Process) logOperationBegin(operation string) {
|
||||
logOperationBegin(
|
||||
process.logctx,
|
||||
operation+" - Begin Operation")
|
||||
}
|
||||
|
||||
func (process *Process) logOperationEnd(operation string, err error) {
|
||||
var result string
|
||||
if err == nil {
|
||||
result = "Success"
|
||||
} else {
|
||||
result = "Error"
|
||||
}
|
||||
|
||||
logOperationEnd(
|
||||
process.logctx,
|
||||
operation+" - End Operation - "+result,
|
||||
err)
|
||||
}
|
||||
|
||||
// Signal signals the process with `options`.
|
||||
func (process *Process) Signal(options guestrequest.SignalProcessOptions) (err error) {
|
||||
process.handleLock.RLock()
|
||||
defer process.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::Process::Signal"
|
||||
process.logOperationBegin(operation)
|
||||
defer func() { process.logOperationEnd(operation, err) }()
|
||||
|
||||
if process.handle == 0 {
|
||||
return makeProcessError(process, operation, ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
optionsb, err := json.Marshal(options)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
optionsStr := string(optionsb)
|
||||
|
||||
var resultp *uint16
|
||||
syscallWatcher(process.logctx, func() {
|
||||
err = hcsSignalProcess(process.handle, optionsStr, &resultp)
|
||||
})
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return makeProcessError(process, operation, err, events)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// Kill signals the process to terminate but does not wait for it to finish terminating.
|
||||
func (process *Process) Kill() (err error) {
|
||||
process.handleLock.RLock()
|
||||
defer process.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::Process::Kill"
|
||||
process.logOperationBegin(operation)
|
||||
defer func() { process.logOperationEnd(operation, err) }()
|
||||
|
||||
if process.handle == 0 {
|
||||
return makeProcessError(process, operation, ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
var resultp *uint16
|
||||
syscallWatcher(process.logctx, func() {
|
||||
err = hcsTerminateProcess(process.handle, &resultp)
|
||||
})
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return makeProcessError(process, operation, err, events)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// Wait waits for the process to exit.
|
||||
func (process *Process) Wait() (err error) {
|
||||
operation := "hcsshim::Process::Wait"
|
||||
process.logOperationBegin(operation)
|
||||
defer func() { process.logOperationEnd(operation, err) }()
|
||||
|
||||
err = waitForNotification(process.callbackNumber, hcsNotificationProcessExited, nil)
|
||||
if err != nil {
|
||||
return makeProcessError(process, operation, err, nil)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// WaitTimeout waits for the process to exit or the duration to elapse. It returns
|
||||
// false if timeout occurs.
|
||||
func (process *Process) WaitTimeout(timeout time.Duration) (err error) {
|
||||
operation := "hcssshim::Process::WaitTimeout"
|
||||
process.logOperationBegin(operation)
|
||||
defer func() { process.logOperationEnd(operation, err) }()
|
||||
|
||||
err = waitForNotification(process.callbackNumber, hcsNotificationProcessExited, &timeout)
|
||||
if err != nil {
|
||||
return makeProcessError(process, operation, err, nil)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// ResizeConsole resizes the console of the process.
|
||||
func (process *Process) ResizeConsole(width, height uint16) (err error) {
|
||||
process.handleLock.RLock()
|
||||
defer process.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::Process::ResizeConsole"
|
||||
process.logOperationBegin(operation)
|
||||
defer func() { process.logOperationEnd(operation, err) }()
|
||||
|
||||
if process.handle == 0 {
|
||||
return makeProcessError(process, operation, ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
modifyRequest := processModifyRequest{
|
||||
Operation: modifyConsoleSize,
|
||||
ConsoleSize: &consoleSize{
|
||||
Height: height,
|
||||
Width: width,
|
||||
},
|
||||
}
|
||||
|
||||
modifyRequestb, err := json.Marshal(modifyRequest)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
modifyRequestStr := string(modifyRequestb)
|
||||
|
||||
var resultp *uint16
|
||||
err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp)
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return makeProcessError(process, operation, err, events)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (process *Process) Properties() (_ *ProcessStatus, err error) {
|
||||
process.handleLock.RLock()
|
||||
defer process.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::Process::Properties"
|
||||
process.logOperationBegin(operation)
|
||||
defer func() { process.logOperationEnd(operation, err) }()
|
||||
|
||||
if process.handle == 0 {
|
||||
return nil, makeProcessError(process, operation, ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
var (
|
||||
resultp *uint16
|
||||
propertiesp *uint16
|
||||
)
|
||||
syscallWatcher(process.logctx, func() {
|
||||
err = hcsGetProcessProperties(process.handle, &propertiesp, &resultp)
|
||||
})
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return nil, makeProcessError(process, operation, err, events)
|
||||
}
|
||||
|
||||
if propertiesp == nil {
|
||||
return nil, ErrUnexpectedValue
|
||||
}
|
||||
propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp)
|
||||
|
||||
properties := &ProcessStatus{}
|
||||
if err := json.Unmarshal(propertiesRaw, properties); err != nil {
|
||||
return nil, makeProcessError(process, operation, err, nil)
|
||||
}
|
||||
|
||||
return properties, nil
|
||||
}
|
||||
|
||||
// ExitCode returns the exit code of the process. The process must have
|
||||
// already terminated.
|
||||
func (process *Process) ExitCode() (_ int, err error) {
|
||||
operation := "hcsshim::Process::ExitCode"
|
||||
process.logOperationBegin(operation)
|
||||
defer func() { process.logOperationEnd(operation, err) }()
|
||||
|
||||
properties, err := process.Properties()
|
||||
if err != nil {
|
||||
return 0, makeProcessError(process, operation, err, nil)
|
||||
}
|
||||
|
||||
if properties.Exited == false {
|
||||
return 0, makeProcessError(process, operation, ErrInvalidProcessState, nil)
|
||||
}
|
||||
|
||||
if properties.LastWaitResult != 0 {
|
||||
return 0, makeProcessError(process, operation, syscall.Errno(properties.LastWaitResult), nil)
|
||||
}
|
||||
|
||||
return int(properties.ExitCode), nil
|
||||
}
|
||||
|
||||
// Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing
|
||||
// these pipes does not close the underlying pipes; it should be possible to
|
||||
// call this multiple times to get multiple interfaces.
|
||||
func (process *Process) Stdio() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadCloser, err error) {
|
||||
process.handleLock.RLock()
|
||||
defer process.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::Process::Stdio"
|
||||
process.logOperationBegin(operation)
|
||||
defer func() { process.logOperationEnd(operation, err) }()
|
||||
|
||||
if process.handle == 0 {
|
||||
return nil, nil, nil, makeProcessError(process, operation, ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
var stdIn, stdOut, stdErr syscall.Handle
|
||||
|
||||
if process.cachedPipes == nil {
|
||||
var (
|
||||
processInfo hcsProcessInformation
|
||||
resultp *uint16
|
||||
)
|
||||
err = hcsGetProcessInfo(process.handle, &processInfo, &resultp)
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return nil, nil, nil, makeProcessError(process, operation, err, events)
|
||||
}
|
||||
|
||||
stdIn, stdOut, stdErr = processInfo.StdInput, processInfo.StdOutput, processInfo.StdError
|
||||
} else {
|
||||
// Use cached pipes
|
||||
stdIn, stdOut, stdErr = process.cachedPipes.stdIn, process.cachedPipes.stdOut, process.cachedPipes.stdErr
|
||||
|
||||
// Invalidate the cache
|
||||
process.cachedPipes = nil
|
||||
}
|
||||
|
||||
pipes, err := makeOpenFiles([]syscall.Handle{stdIn, stdOut, stdErr})
|
||||
if err != nil {
|
||||
return nil, nil, nil, makeProcessError(process, operation, err, nil)
|
||||
}
|
||||
|
||||
return pipes[0], pipes[1], pipes[2], nil
|
||||
}
|
||||
|
||||
// CloseStdin closes the write side of the stdin pipe so that the process is
|
||||
// notified on the read side that there is no more data in stdin.
|
||||
func (process *Process) CloseStdin() (err error) {
|
||||
process.handleLock.RLock()
|
||||
defer process.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::Process::CloseStdin"
|
||||
process.logOperationBegin(operation)
|
||||
defer func() { process.logOperationEnd(operation, err) }()
|
||||
|
||||
if process.handle == 0 {
|
||||
return makeProcessError(process, operation, ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
modifyRequest := processModifyRequest{
|
||||
Operation: modifyCloseHandle,
|
||||
CloseHandle: &closeHandle{
|
||||
Handle: stdIn,
|
||||
},
|
||||
}
|
||||
|
||||
modifyRequestb, err := json.Marshal(modifyRequest)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
modifyRequestStr := string(modifyRequestb)
|
||||
|
||||
var resultp *uint16
|
||||
err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp)
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return makeProcessError(process, operation, err, events)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// Close cleans up any state associated with the process but does not kill
|
||||
// or wait on it.
|
||||
func (process *Process) Close() (err error) {
|
||||
process.handleLock.Lock()
|
||||
defer process.handleLock.Unlock()
|
||||
|
||||
operation := "hcsshim::Process::Close"
|
||||
process.logOperationBegin(operation)
|
||||
defer func() { process.logOperationEnd(operation, err) }()
|
||||
|
||||
// Don't double free this
|
||||
if process.handle == 0 {
|
||||
return nil
|
||||
}
|
||||
|
||||
if err = process.unregisterCallback(); err != nil {
|
||||
return makeProcessError(process, operation, err, nil)
|
||||
}
|
||||
|
||||
if err = hcsCloseProcess(process.handle); err != nil {
|
||||
return makeProcessError(process, operation, err, nil)
|
||||
}
|
||||
|
||||
process.handle = 0
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (process *Process) registerCallback() error {
|
||||
context := ¬ifcationWatcherContext{
|
||||
channels: newChannels(),
|
||||
}
|
||||
|
||||
callbackMapLock.Lock()
|
||||
callbackNumber := nextCallback
|
||||
nextCallback++
|
||||
callbackMap[callbackNumber] = context
|
||||
callbackMapLock.Unlock()
|
||||
|
||||
var callbackHandle hcsCallback
|
||||
err := hcsRegisterProcessCallback(process.handle, notificationWatcherCallback, callbackNumber, &callbackHandle)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
context.handle = callbackHandle
|
||||
process.callbackNumber = callbackNumber
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (process *Process) unregisterCallback() error {
|
||||
callbackNumber := process.callbackNumber
|
||||
|
||||
callbackMapLock.RLock()
|
||||
context := callbackMap[callbackNumber]
|
||||
callbackMapLock.RUnlock()
|
||||
|
||||
if context == nil {
|
||||
return nil
|
||||
}
|
||||
|
||||
handle := context.handle
|
||||
|
||||
if handle == 0 {
|
||||
return nil
|
||||
}
|
||||
|
||||
// hcsUnregisterProcessCallback has its own syncronization
|
||||
// to wait for all callbacks to complete. We must NOT hold the callbackMapLock.
|
||||
err := hcsUnregisterProcessCallback(handle)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
closeChannels(context.channels)
|
||||
|
||||
callbackMapLock.Lock()
|
||||
callbackMap[callbackNumber] = nil
|
||||
callbackMapLock.Unlock()
|
||||
|
||||
handle = 0
|
||||
|
||||
return nil
|
||||
}
|
||||
685
vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go
generated
vendored
Normal file
685
vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go
generated
vendored
Normal file
@@ -0,0 +1,685 @@
|
||||
package hcs
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"os"
|
||||
"strconv"
|
||||
"sync"
|
||||
"syscall"
|
||||
"time"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/interop"
|
||||
"github.com/Microsoft/hcsshim/internal/logfields"
|
||||
"github.com/Microsoft/hcsshim/internal/schema1"
|
||||
"github.com/Microsoft/hcsshim/internal/timeout"
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
// currentContainerStarts is used to limit the number of concurrent container
|
||||
// starts.
|
||||
var currentContainerStarts containerStarts
|
||||
|
||||
type containerStarts struct {
|
||||
maxParallel int
|
||||
inProgress int
|
||||
sync.Mutex
|
||||
}
|
||||
|
||||
func init() {
|
||||
mpsS := os.Getenv("HCSSHIM_MAX_PARALLEL_START")
|
||||
if len(mpsS) > 0 {
|
||||
mpsI, err := strconv.Atoi(mpsS)
|
||||
if err != nil || mpsI < 0 {
|
||||
return
|
||||
}
|
||||
currentContainerStarts.maxParallel = mpsI
|
||||
}
|
||||
}
|
||||
|
||||
type System struct {
|
||||
handleLock sync.RWMutex
|
||||
handle hcsSystem
|
||||
id string
|
||||
callbackNumber uintptr
|
||||
|
||||
logctx logrus.Fields
|
||||
}
|
||||
|
||||
func newSystem(id string) *System {
|
||||
return &System{
|
||||
id: id,
|
||||
logctx: logrus.Fields{
|
||||
logfields.ContainerID: id,
|
||||
},
|
||||
}
|
||||
}
|
||||
|
||||
func (computeSystem *System) logOperationBegin(operation string) {
|
||||
logOperationBegin(
|
||||
computeSystem.logctx,
|
||||
operation+" - Begin Operation")
|
||||
}
|
||||
|
||||
func (computeSystem *System) logOperationEnd(operation string, err error) {
|
||||
var result string
|
||||
if err == nil {
|
||||
result = "Success"
|
||||
} else {
|
||||
result = "Error"
|
||||
}
|
||||
|
||||
logOperationEnd(
|
||||
computeSystem.logctx,
|
||||
operation+" - End Operation - "+result,
|
||||
err)
|
||||
}
|
||||
|
||||
// CreateComputeSystem creates a new compute system with the given configuration but does not start it.
|
||||
func CreateComputeSystem(id string, hcsDocumentInterface interface{}) (_ *System, err error) {
|
||||
operation := "hcsshim::CreateComputeSystem"
|
||||
|
||||
computeSystem := newSystem(id)
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||
|
||||
hcsDocumentB, err := json.Marshal(hcsDocumentInterface)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
hcsDocument := string(hcsDocumentB)
|
||||
|
||||
logrus.WithFields(computeSystem.logctx).
|
||||
WithField(logfields.JSON, hcsDocument).
|
||||
Debug("HCS ComputeSystem Document")
|
||||
|
||||
var (
|
||||
resultp *uint16
|
||||
identity syscall.Handle
|
||||
createError error
|
||||
)
|
||||
syscallWatcher(computeSystem.logctx, func() {
|
||||
createError = hcsCreateComputeSystem(id, hcsDocument, identity, &computeSystem.handle, &resultp)
|
||||
})
|
||||
|
||||
if createError == nil || IsPending(createError) {
|
||||
if err = computeSystem.registerCallback(); err != nil {
|
||||
// Terminate the compute system if it still exists. We're okay to
|
||||
// ignore a failure here.
|
||||
computeSystem.Terminate()
|
||||
return nil, makeSystemError(computeSystem, operation, "", err, nil)
|
||||
}
|
||||
}
|
||||
|
||||
events, err := processAsyncHcsResult(createError, resultp, computeSystem.callbackNumber, hcsNotificationSystemCreateCompleted, &timeout.SystemCreate)
|
||||
if err != nil {
|
||||
if err == ErrTimeout {
|
||||
// Terminate the compute system if it still exists. We're okay to
|
||||
// ignore a failure here.
|
||||
computeSystem.Terminate()
|
||||
}
|
||||
return nil, makeSystemError(computeSystem, operation, hcsDocument, err, events)
|
||||
}
|
||||
|
||||
return computeSystem, nil
|
||||
}
|
||||
|
||||
// OpenComputeSystem opens an existing compute system by ID.
|
||||
func OpenComputeSystem(id string) (_ *System, err error) {
|
||||
operation := "hcsshim::OpenComputeSystem"
|
||||
|
||||
computeSystem := newSystem(id)
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() {
|
||||
if IsNotExist(err) {
|
||||
computeSystem.logOperationEnd(operation, nil)
|
||||
} else {
|
||||
computeSystem.logOperationEnd(operation, err)
|
||||
}
|
||||
}()
|
||||
|
||||
var (
|
||||
handle hcsSystem
|
||||
resultp *uint16
|
||||
)
|
||||
err = hcsOpenComputeSystem(id, &handle, &resultp)
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return nil, makeSystemError(computeSystem, operation, "", err, events)
|
||||
}
|
||||
|
||||
computeSystem.handle = handle
|
||||
|
||||
if err = computeSystem.registerCallback(); err != nil {
|
||||
return nil, makeSystemError(computeSystem, operation, "", err, nil)
|
||||
}
|
||||
|
||||
return computeSystem, nil
|
||||
}
|
||||
|
||||
// GetComputeSystems gets a list of the compute systems on the system that match the query
|
||||
func GetComputeSystems(q schema1.ComputeSystemQuery) (_ []schema1.ContainerProperties, err error) {
|
||||
operation := "hcsshim::GetComputeSystems"
|
||||
fields := logrus.Fields{}
|
||||
logOperationBegin(
|
||||
fields,
|
||||
operation+" - Begin Operation")
|
||||
|
||||
defer func() {
|
||||
var result string
|
||||
if err == nil {
|
||||
result = "Success"
|
||||
} else {
|
||||
result = "Error"
|
||||
}
|
||||
|
||||
logOperationEnd(
|
||||
fields,
|
||||
operation+" - End Operation - "+result,
|
||||
err)
|
||||
}()
|
||||
|
||||
queryb, err := json.Marshal(q)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
query := string(queryb)
|
||||
|
||||
logrus.WithFields(fields).
|
||||
WithField(logfields.JSON, query).
|
||||
Debug("HCS ComputeSystem Query")
|
||||
|
||||
var (
|
||||
resultp *uint16
|
||||
computeSystemsp *uint16
|
||||
)
|
||||
|
||||
syscallWatcher(fields, func() {
|
||||
err = hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp)
|
||||
})
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return nil, &HcsError{Op: operation, Err: err, Events: events}
|
||||
}
|
||||
|
||||
if computeSystemsp == nil {
|
||||
return nil, ErrUnexpectedValue
|
||||
}
|
||||
computeSystemsRaw := interop.ConvertAndFreeCoTaskMemBytes(computeSystemsp)
|
||||
computeSystems := []schema1.ContainerProperties{}
|
||||
if err = json.Unmarshal(computeSystemsRaw, &computeSystems); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return computeSystems, nil
|
||||
}
|
||||
|
||||
// Start synchronously starts the computeSystem.
|
||||
func (computeSystem *System) Start() (err error) {
|
||||
computeSystem.handleLock.RLock()
|
||||
defer computeSystem.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::ComputeSystem::Start"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||
|
||||
if computeSystem.handle == 0 {
|
||||
return makeSystemError(computeSystem, "Start", "", ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
// This is a very simple backoff-retry loop to limit the number
|
||||
// of parallel container starts if environment variable
|
||||
// HCSSHIM_MAX_PARALLEL_START is set to a positive integer.
|
||||
// It should generally only be used as a workaround to various
|
||||
// platform issues that exist between RS1 and RS4 as of Aug 2018
|
||||
if currentContainerStarts.maxParallel > 0 {
|
||||
for {
|
||||
currentContainerStarts.Lock()
|
||||
if currentContainerStarts.inProgress < currentContainerStarts.maxParallel {
|
||||
currentContainerStarts.inProgress++
|
||||
currentContainerStarts.Unlock()
|
||||
break
|
||||
}
|
||||
if currentContainerStarts.inProgress == currentContainerStarts.maxParallel {
|
||||
currentContainerStarts.Unlock()
|
||||
time.Sleep(100 * time.Millisecond)
|
||||
}
|
||||
}
|
||||
// Make sure we decrement the count when we are done.
|
||||
defer func() {
|
||||
currentContainerStarts.Lock()
|
||||
currentContainerStarts.inProgress--
|
||||
currentContainerStarts.Unlock()
|
||||
}()
|
||||
}
|
||||
|
||||
var resultp *uint16
|
||||
syscallWatcher(computeSystem.logctx, func() {
|
||||
err = hcsStartComputeSystem(computeSystem.handle, "", &resultp)
|
||||
})
|
||||
events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemStartCompleted, &timeout.SystemStart)
|
||||
if err != nil {
|
||||
return makeSystemError(computeSystem, "Start", "", err, events)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// ID returns the compute system's identifier.
|
||||
func (computeSystem *System) ID() string {
|
||||
return computeSystem.id
|
||||
}
|
||||
|
||||
// Shutdown requests a compute system shutdown, if IsPending() on the error returned is true,
|
||||
// it may not actually be shut down until Wait() succeeds.
|
||||
func (computeSystem *System) Shutdown() (err error) {
|
||||
computeSystem.handleLock.RLock()
|
||||
defer computeSystem.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::ComputeSystem::Shutdown"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() {
|
||||
if IsAlreadyStopped(err) {
|
||||
computeSystem.logOperationEnd(operation, nil)
|
||||
} else {
|
||||
computeSystem.logOperationEnd(operation, err)
|
||||
}
|
||||
}()
|
||||
|
||||
if computeSystem.handle == 0 {
|
||||
return makeSystemError(computeSystem, "Shutdown", "", ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
var resultp *uint16
|
||||
syscallWatcher(computeSystem.logctx, func() {
|
||||
err = hcsShutdownComputeSystem(computeSystem.handle, "", &resultp)
|
||||
})
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return makeSystemError(computeSystem, "Shutdown", "", err, events)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// Terminate requests a compute system terminate, if IsPending() on the error returned is true,
|
||||
// it may not actually be shut down until Wait() succeeds.
|
||||
func (computeSystem *System) Terminate() (err error) {
|
||||
computeSystem.handleLock.RLock()
|
||||
defer computeSystem.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::ComputeSystem::Terminate"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() {
|
||||
if IsPending(err) {
|
||||
computeSystem.logOperationEnd(operation, nil)
|
||||
} else {
|
||||
computeSystem.logOperationEnd(operation, err)
|
||||
}
|
||||
}()
|
||||
|
||||
if computeSystem.handle == 0 {
|
||||
return makeSystemError(computeSystem, "Terminate", "", ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
var resultp *uint16
|
||||
syscallWatcher(computeSystem.logctx, func() {
|
||||
err = hcsTerminateComputeSystem(computeSystem.handle, "", &resultp)
|
||||
})
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil && err != ErrVmcomputeAlreadyStopped {
|
||||
return makeSystemError(computeSystem, "Terminate", "", err, events)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// Wait synchronously waits for the compute system to shutdown or terminate.
|
||||
func (computeSystem *System) Wait() (err error) {
|
||||
operation := "hcsshim::ComputeSystem::Wait"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||
|
||||
err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, nil)
|
||||
if err != nil {
|
||||
return makeSystemError(computeSystem, "Wait", "", err, nil)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// WaitExpectedError synchronously waits for the compute system to shutdown or
|
||||
// terminate, and ignores the passed error if it occurs.
|
||||
func (computeSystem *System) WaitExpectedError(expected error) (err error) {
|
||||
operation := "hcsshim::ComputeSystem::WaitExpectedError"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||
|
||||
err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, nil)
|
||||
if err != nil && getInnerError(err) != expected {
|
||||
return makeSystemError(computeSystem, "WaitExpectedError", "", err, nil)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// WaitTimeout synchronously waits for the compute system to terminate or the duration to elapse.
|
||||
// If the timeout expires, IsTimeout(err) == true
|
||||
func (computeSystem *System) WaitTimeout(timeout time.Duration) (err error) {
|
||||
operation := "hcsshim::ComputeSystem::WaitTimeout"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||
|
||||
err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, &timeout)
|
||||
if err != nil {
|
||||
return makeSystemError(computeSystem, "WaitTimeout", "", err, nil)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (computeSystem *System) Properties(types ...schema1.PropertyType) (_ *schema1.ContainerProperties, err error) {
|
||||
computeSystem.handleLock.RLock()
|
||||
defer computeSystem.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::ComputeSystem::Properties"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||
|
||||
queryj, err := json.Marshal(schema1.PropertyQuery{types})
|
||||
if err != nil {
|
||||
return nil, makeSystemError(computeSystem, "Properties", "", err, nil)
|
||||
}
|
||||
|
||||
logrus.WithFields(computeSystem.logctx).
|
||||
WithField(logfields.JSON, queryj).
|
||||
Debug("HCS ComputeSystem Properties Query")
|
||||
|
||||
var resultp, propertiesp *uint16
|
||||
syscallWatcher(computeSystem.logctx, func() {
|
||||
err = hcsGetComputeSystemProperties(computeSystem.handle, string(queryj), &propertiesp, &resultp)
|
||||
})
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return nil, makeSystemError(computeSystem, "Properties", "", err, events)
|
||||
}
|
||||
|
||||
if propertiesp == nil {
|
||||
return nil, ErrUnexpectedValue
|
||||
}
|
||||
propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp)
|
||||
properties := &schema1.ContainerProperties{}
|
||||
if err := json.Unmarshal(propertiesRaw, properties); err != nil {
|
||||
return nil, makeSystemError(computeSystem, "Properties", "", err, nil)
|
||||
}
|
||||
|
||||
return properties, nil
|
||||
}
|
||||
|
||||
// Pause pauses the execution of the computeSystem. This feature is not enabled in TP5.
|
||||
func (computeSystem *System) Pause() (err error) {
|
||||
computeSystem.handleLock.RLock()
|
||||
defer computeSystem.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::ComputeSystem::Pause"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||
|
||||
if computeSystem.handle == 0 {
|
||||
return makeSystemError(computeSystem, "Pause", "", ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
var resultp *uint16
|
||||
syscallWatcher(computeSystem.logctx, func() {
|
||||
err = hcsPauseComputeSystem(computeSystem.handle, "", &resultp)
|
||||
})
|
||||
events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemPauseCompleted, &timeout.SystemPause)
|
||||
if err != nil {
|
||||
return makeSystemError(computeSystem, "Pause", "", err, events)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// Resume resumes the execution of the computeSystem. This feature is not enabled in TP5.
|
||||
func (computeSystem *System) Resume() (err error) {
|
||||
computeSystem.handleLock.RLock()
|
||||
defer computeSystem.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::ComputeSystem::Resume"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||
|
||||
if computeSystem.handle == 0 {
|
||||
return makeSystemError(computeSystem, "Resume", "", ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
var resultp *uint16
|
||||
syscallWatcher(computeSystem.logctx, func() {
|
||||
err = hcsResumeComputeSystem(computeSystem.handle, "", &resultp)
|
||||
})
|
||||
events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemResumeCompleted, &timeout.SystemResume)
|
||||
if err != nil {
|
||||
return makeSystemError(computeSystem, "Resume", "", err, events)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// CreateProcess launches a new process within the computeSystem.
|
||||
func (computeSystem *System) CreateProcess(c interface{}) (_ *Process, err error) {
|
||||
computeSystem.handleLock.RLock()
|
||||
defer computeSystem.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::ComputeSystem::CreateProcess"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||
|
||||
var (
|
||||
processInfo hcsProcessInformation
|
||||
processHandle hcsProcess
|
||||
resultp *uint16
|
||||
)
|
||||
|
||||
if computeSystem.handle == 0 {
|
||||
return nil, makeSystemError(computeSystem, "CreateProcess", "", ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
configurationb, err := json.Marshal(c)
|
||||
if err != nil {
|
||||
return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil)
|
||||
}
|
||||
|
||||
configuration := string(configurationb)
|
||||
|
||||
logrus.WithFields(computeSystem.logctx).
|
||||
WithField(logfields.JSON, configuration).
|
||||
Debug("HCS ComputeSystem Process Document")
|
||||
|
||||
syscallWatcher(computeSystem.logctx, func() {
|
||||
err = hcsCreateProcess(computeSystem.handle, configuration, &processInfo, &processHandle, &resultp)
|
||||
})
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return nil, makeSystemError(computeSystem, "CreateProcess", configuration, err, events)
|
||||
}
|
||||
|
||||
logrus.WithFields(computeSystem.logctx).
|
||||
WithField(logfields.ProcessID, processInfo.ProcessId).
|
||||
Debug("HCS ComputeSystem CreateProcess PID")
|
||||
|
||||
process := newProcess(processHandle, int(processInfo.ProcessId), computeSystem)
|
||||
process.cachedPipes = &cachedPipes{
|
||||
stdIn: processInfo.StdInput,
|
||||
stdOut: processInfo.StdOutput,
|
||||
stdErr: processInfo.StdError,
|
||||
}
|
||||
|
||||
if err = process.registerCallback(); err != nil {
|
||||
return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil)
|
||||
}
|
||||
|
||||
return process, nil
|
||||
}
|
||||
|
||||
// OpenProcess gets an interface to an existing process within the computeSystem.
|
||||
func (computeSystem *System) OpenProcess(pid int) (_ *Process, err error) {
|
||||
computeSystem.handleLock.RLock()
|
||||
defer computeSystem.handleLock.RUnlock()
|
||||
|
||||
// Add PID for the context of this operation
|
||||
computeSystem.logctx[logfields.ProcessID] = pid
|
||||
defer delete(computeSystem.logctx, logfields.ProcessID)
|
||||
|
||||
operation := "hcsshim::ComputeSystem::OpenProcess"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||
|
||||
var (
|
||||
processHandle hcsProcess
|
||||
resultp *uint16
|
||||
)
|
||||
|
||||
if computeSystem.handle == 0 {
|
||||
return nil, makeSystemError(computeSystem, "OpenProcess", "", ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
syscallWatcher(computeSystem.logctx, func() {
|
||||
err = hcsOpenProcess(computeSystem.handle, uint32(pid), &processHandle, &resultp)
|
||||
})
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return nil, makeSystemError(computeSystem, "OpenProcess", "", err, events)
|
||||
}
|
||||
|
||||
process := newProcess(processHandle, pid, computeSystem)
|
||||
if err = process.registerCallback(); err != nil {
|
||||
return nil, makeSystemError(computeSystem, "OpenProcess", "", err, nil)
|
||||
}
|
||||
|
||||
return process, nil
|
||||
}
|
||||
|
||||
// Close cleans up any state associated with the compute system but does not terminate or wait for it.
|
||||
func (computeSystem *System) Close() (err error) {
|
||||
computeSystem.handleLock.Lock()
|
||||
defer computeSystem.handleLock.Unlock()
|
||||
|
||||
operation := "hcsshim::ComputeSystem::Close"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||
|
||||
// Don't double free this
|
||||
if computeSystem.handle == 0 {
|
||||
return nil
|
||||
}
|
||||
|
||||
if err = computeSystem.unregisterCallback(); err != nil {
|
||||
return makeSystemError(computeSystem, "Close", "", err, nil)
|
||||
}
|
||||
|
||||
syscallWatcher(computeSystem.logctx, func() {
|
||||
err = hcsCloseComputeSystem(computeSystem.handle)
|
||||
})
|
||||
if err != nil {
|
||||
return makeSystemError(computeSystem, "Close", "", err, nil)
|
||||
}
|
||||
|
||||
computeSystem.handle = 0
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (computeSystem *System) registerCallback() error {
|
||||
context := ¬ifcationWatcherContext{
|
||||
channels: newChannels(),
|
||||
}
|
||||
|
||||
callbackMapLock.Lock()
|
||||
callbackNumber := nextCallback
|
||||
nextCallback++
|
||||
callbackMap[callbackNumber] = context
|
||||
callbackMapLock.Unlock()
|
||||
|
||||
var callbackHandle hcsCallback
|
||||
err := hcsRegisterComputeSystemCallback(computeSystem.handle, notificationWatcherCallback, callbackNumber, &callbackHandle)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
context.handle = callbackHandle
|
||||
computeSystem.callbackNumber = callbackNumber
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (computeSystem *System) unregisterCallback() error {
|
||||
callbackNumber := computeSystem.callbackNumber
|
||||
|
||||
callbackMapLock.RLock()
|
||||
context := callbackMap[callbackNumber]
|
||||
callbackMapLock.RUnlock()
|
||||
|
||||
if context == nil {
|
||||
return nil
|
||||
}
|
||||
|
||||
handle := context.handle
|
||||
|
||||
if handle == 0 {
|
||||
return nil
|
||||
}
|
||||
|
||||
// hcsUnregisterComputeSystemCallback has its own syncronization
|
||||
// to wait for all callbacks to complete. We must NOT hold the callbackMapLock.
|
||||
err := hcsUnregisterComputeSystemCallback(handle)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
closeChannels(context.channels)
|
||||
|
||||
callbackMapLock.Lock()
|
||||
callbackMap[callbackNumber] = nil
|
||||
callbackMapLock.Unlock()
|
||||
|
||||
handle = 0
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// Modify the System by sending a request to HCS
|
||||
func (computeSystem *System) Modify(config interface{}) (err error) {
|
||||
computeSystem.handleLock.RLock()
|
||||
defer computeSystem.handleLock.RUnlock()
|
||||
|
||||
operation := "hcsshim::ComputeSystem::Modify"
|
||||
computeSystem.logOperationBegin(operation)
|
||||
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||
|
||||
if computeSystem.handle == 0 {
|
||||
return makeSystemError(computeSystem, "Modify", "", ErrAlreadyClosed, nil)
|
||||
}
|
||||
|
||||
requestJSON, err := json.Marshal(config)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
requestString := string(requestJSON)
|
||||
|
||||
logrus.WithFields(computeSystem.logctx).
|
||||
WithField(logfields.JSON, requestString).
|
||||
Debug("HCS ComputeSystem Modify Document")
|
||||
|
||||
var resultp *uint16
|
||||
syscallWatcher(computeSystem.logctx, func() {
|
||||
err = hcsModifyComputeSystem(computeSystem.handle, requestString, &resultp)
|
||||
})
|
||||
events := processHcsResult(resultp)
|
||||
if err != nil {
|
||||
return makeSystemError(computeSystem, "Modify", requestString, err, events)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
33
vendor/github.com/Microsoft/hcsshim/internal/hcs/utils.go
generated
vendored
Normal file
33
vendor/github.com/Microsoft/hcsshim/internal/hcs/utils.go
generated
vendored
Normal file
@@ -0,0 +1,33 @@
|
||||
package hcs
|
||||
|
||||
import (
|
||||
"io"
|
||||
"syscall"
|
||||
|
||||
"github.com/Microsoft/go-winio"
|
||||
)
|
||||
|
||||
// makeOpenFiles calls winio.MakeOpenFile for each handle in a slice but closes all the handles
|
||||
// if there is an error.
|
||||
func makeOpenFiles(hs []syscall.Handle) (_ []io.ReadWriteCloser, err error) {
|
||||
fs := make([]io.ReadWriteCloser, len(hs))
|
||||
for i, h := range hs {
|
||||
if h != syscall.Handle(0) {
|
||||
if err == nil {
|
||||
fs[i], err = winio.MakeOpenFile(h)
|
||||
}
|
||||
if err != nil {
|
||||
syscall.Close(h)
|
||||
}
|
||||
}
|
||||
}
|
||||
if err != nil {
|
||||
for _, f := range fs {
|
||||
if f != nil {
|
||||
f.Close()
|
||||
}
|
||||
}
|
||||
return nil, err
|
||||
}
|
||||
return fs, nil
|
||||
}
|
||||
63
vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go
generated
vendored
Normal file
63
vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go
generated
vendored
Normal file
@@ -0,0 +1,63 @@
|
||||
package hcs
|
||||
|
||||
import (
|
||||
"time"
|
||||
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
func processAsyncHcsResult(err error, resultp *uint16, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) ([]ErrorEvent, error) {
|
||||
events := processHcsResult(resultp)
|
||||
if IsPending(err) {
|
||||
return nil, waitForNotification(callbackNumber, expectedNotification, timeout)
|
||||
}
|
||||
|
||||
return events, err
|
||||
}
|
||||
|
||||
func waitForNotification(callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error {
|
||||
callbackMapLock.RLock()
|
||||
channels := callbackMap[callbackNumber].channels
|
||||
callbackMapLock.RUnlock()
|
||||
|
||||
expectedChannel := channels[expectedNotification]
|
||||
if expectedChannel == nil {
|
||||
logrus.Errorf("unknown notification type in waitForNotification %x", expectedNotification)
|
||||
return ErrInvalidNotificationType
|
||||
}
|
||||
|
||||
var c <-chan time.Time
|
||||
if timeout != nil {
|
||||
timer := time.NewTimer(*timeout)
|
||||
c = timer.C
|
||||
defer timer.Stop()
|
||||
}
|
||||
|
||||
select {
|
||||
case err, ok := <-expectedChannel:
|
||||
if !ok {
|
||||
return ErrHandleClose
|
||||
}
|
||||
return err
|
||||
case err, ok := <-channels[hcsNotificationSystemExited]:
|
||||
if !ok {
|
||||
return ErrHandleClose
|
||||
}
|
||||
// If the expected notification is hcsNotificationSystemExited which of the two selects
|
||||
// chosen is random. Return the raw error if hcsNotificationSystemExited is expected
|
||||
if channels[hcsNotificationSystemExited] == expectedChannel {
|
||||
return err
|
||||
}
|
||||
return ErrUnexpectedContainerExit
|
||||
case _, ok := <-channels[hcsNotificationServiceDisconnect]:
|
||||
if !ok {
|
||||
return ErrHandleClose
|
||||
}
|
||||
// hcsNotificationServiceDisconnect should never be an expected notification
|
||||
// it does not need the same handling as hcsNotificationSystemExited
|
||||
return ErrUnexpectedProcessAbort
|
||||
case <-c:
|
||||
return ErrTimeout
|
||||
}
|
||||
return nil
|
||||
}
|
||||
41
vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go
generated
vendored
Normal file
41
vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go
generated
vendored
Normal file
@@ -0,0 +1,41 @@
|
||||
package hcs
|
||||
|
||||
import (
|
||||
"context"
|
||||
|
||||
"github.com/Microsoft/hcsshim/internal/logfields"
|
||||
"github.com/Microsoft/hcsshim/internal/timeout"
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
// syscallWatcher is used as a very simple goroutine around calls into
|
||||
// the platform. In some cases, we have seen HCS APIs not returning due to
|
||||
// various bugs, and the goroutine making the syscall ends up not returning,
|
||||
// prior to its async callback. By spinning up a syscallWatcher, it allows
|
||||
// us to at least log a warning if a syscall doesn't complete in a reasonable
|
||||
// amount of time.
|
||||
//
|
||||
// Usage is:
|
||||
//
|
||||
// syscallWatcher(logContext, func() {
|
||||
// err = <syscall>(args...)
|
||||
// })
|
||||
//
|
||||
|
||||
func syscallWatcher(logContext logrus.Fields, syscallLambda func()) {
|
||||
ctx, cancel := context.WithTimeout(context.Background(), timeout.SyscallWatcher)
|
||||
defer cancel()
|
||||
go watchFunc(ctx, logContext)
|
||||
syscallLambda()
|
||||
}
|
||||
|
||||
func watchFunc(ctx context.Context, logContext logrus.Fields) {
|
||||
select {
|
||||
case <-ctx.Done():
|
||||
if ctx.Err() != context.Canceled {
|
||||
logrus.WithFields(logContext).
|
||||
WithField(logfields.Timeout, timeout.SyscallWatcher).
|
||||
Warning("Syscall did not complete within operation timeout. This may indicate a platform issue. If it appears to be making no forward progress, obtain the stacks and see if there is a syscall stuck in the platform API for a significant length of time.")
|
||||
}
|
||||
}
|
||||
}
|
||||
533
vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go
generated
vendored
Normal file
533
vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go
generated
vendored
Normal file
@@ -0,0 +1,533 @@
|
||||
// Code generated mksyscall_windows.exe DO NOT EDIT
|
||||
|
||||
package hcs
|
||||
|
||||
import (
|
||||
"syscall"
|
||||
"unsafe"
|
||||
|
||||
"golang.org/x/sys/windows"
|
||||
)
|
||||
|
||||
var _ unsafe.Pointer
|
||||
|
||||
// Do the interface allocations only once for common
|
||||
// Errno values.
|
||||
const (
|
||||
errnoERROR_IO_PENDING = 997
|
||||
)
|
||||
|
||||
var (
|
||||
errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
|
||||
)
|
||||
|
||||
// errnoErr returns common boxed Errno values, to prevent
|
||||
// allocations at runtime.
|
||||
func errnoErr(e syscall.Errno) error {
|
||||
switch e {
|
||||
case 0:
|
||||
return nil
|
||||
case errnoERROR_IO_PENDING:
|
||||
return errERROR_IO_PENDING
|
||||
}
|
||||
// TODO: add more here, after collecting data on the common
|
||||
// error values see on Windows. (perhaps when running
|
||||
// all.bat?)
|
||||
return e
|
||||
}
|
||||
|
||||
var (
|
||||
modvmcompute = windows.NewLazySystemDLL("vmcompute.dll")
|
||||
|
||||
procHcsEnumerateComputeSystems = modvmcompute.NewProc("HcsEnumerateComputeSystems")
|
||||
procHcsCreateComputeSystem = modvmcompute.NewProc("HcsCreateComputeSystem")
|
||||
procHcsOpenComputeSystem = modvmcompute.NewProc("HcsOpenComputeSystem")
|
||||
procHcsCloseComputeSystem = modvmcompute.NewProc("HcsCloseComputeSystem")
|
||||
procHcsStartComputeSystem = modvmcompute.NewProc("HcsStartComputeSystem")
|
||||
procHcsShutdownComputeSystem = modvmcompute.NewProc("HcsShutdownComputeSystem")
|
||||
procHcsTerminateComputeSystem = modvmcompute.NewProc("HcsTerminateComputeSystem")
|
||||
procHcsPauseComputeSystem = modvmcompute.NewProc("HcsPauseComputeSystem")
|
||||
procHcsResumeComputeSystem = modvmcompute.NewProc("HcsResumeComputeSystem")
|
||||
procHcsGetComputeSystemProperties = modvmcompute.NewProc("HcsGetComputeSystemProperties")
|
||||
procHcsModifyComputeSystem = modvmcompute.NewProc("HcsModifyComputeSystem")
|
||||
procHcsRegisterComputeSystemCallback = modvmcompute.NewProc("HcsRegisterComputeSystemCallback")
|
||||
procHcsUnregisterComputeSystemCallback = modvmcompute.NewProc("HcsUnregisterComputeSystemCallback")
|
||||
procHcsCreateProcess = modvmcompute.NewProc("HcsCreateProcess")
|
||||
procHcsOpenProcess = modvmcompute.NewProc("HcsOpenProcess")
|
||||
procHcsCloseProcess = modvmcompute.NewProc("HcsCloseProcess")
|
||||
procHcsTerminateProcess = modvmcompute.NewProc("HcsTerminateProcess")
|
||||
|
||||
procHcsGetProcessInfo = modvmcompute.NewProc("HcsGetProcessInfo")
|
||||
procHcsGetProcessProperties = modvmcompute.NewProc("HcsGetProcessProperties")
|
||||
procHcsModifyProcess = modvmcompute.NewProc("HcsModifyProcess")
|
||||
procHcsGetServiceProperties = modvmcompute.NewProc("HcsGetServiceProperties")
|
||||
procHcsRegisterProcessCallback = modvmcompute.NewProc("HcsRegisterProcessCallback")
|
||||
procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback")
|
||||
)
|
||||
|
||||
func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(query)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsEnumerateComputeSystems(_p0, computeSystems, result)
|
||||
}
|
||||
|
||||
func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsEnumerateComputeSystems.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsEnumerateComputeSystems.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(computeSystems)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(id)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
var _p1 *uint16
|
||||
_p1, hr = syscall.UTF16PtrFromString(configuration)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsCreateComputeSystem(_p0, _p1, identity, computeSystem, result)
|
||||
}
|
||||
|
||||
func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) {
|
||||
if hr = procHcsCreateComputeSystem.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall6(procHcsCreateComputeSystem.Addr(), 5, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(configuration)), uintptr(identity), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)), 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(id)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsOpenComputeSystem(_p0, computeSystem, result)
|
||||
}
|
||||
|
||||
func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16) (hr error) {
|
||||
if hr = procHcsOpenComputeSystem.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsOpenComputeSystem.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) {
|
||||
if hr = procHcsCloseComputeSystem.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsCloseComputeSystem.Addr(), 1, uintptr(computeSystem), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(options)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsStartComputeSystem(computeSystem, _p0, result)
|
||||
}
|
||||
|
||||
func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsStartComputeSystem.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsStartComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(options)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsShutdownComputeSystem(computeSystem, _p0, result)
|
||||
}
|
||||
|
||||
func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsShutdownComputeSystem.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsShutdownComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(options)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsTerminateComputeSystem(computeSystem, _p0, result)
|
||||
}
|
||||
|
||||
func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsTerminateComputeSystem.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsTerminateComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(options)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsPauseComputeSystem(computeSystem, _p0, result)
|
||||
}
|
||||
|
||||
func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsPauseComputeSystem.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsPauseComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(options)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsResumeComputeSystem(computeSystem, _p0, result)
|
||||
}
|
||||
|
||||
func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsResumeComputeSystem.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsResumeComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(propertyQuery)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsGetComputeSystemProperties(computeSystem, _p0, properties, result)
|
||||
}
|
||||
|
||||
func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsGetComputeSystemProperties.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall6(procHcsGetComputeSystemProperties.Addr(), 4, uintptr(computeSystem), uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(configuration)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsModifyComputeSystem(computeSystem, _p0, result)
|
||||
}
|
||||
|
||||
func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsModifyComputeSystem.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsModifyComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(configuration)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) {
|
||||
if hr = procHcsRegisterComputeSystemCallback.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall6(procHcsRegisterComputeSystemCallback.Addr(), 4, uintptr(computeSystem), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) {
|
||||
if hr = procHcsUnregisterComputeSystemCallback.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsUnregisterComputeSystemCallback.Addr(), 1, uintptr(callbackHandle), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(processParameters)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsCreateProcess(computeSystem, _p0, processInformation, process, result)
|
||||
}
|
||||
|
||||
func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) {
|
||||
if hr = procHcsCreateProcess.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall6(procHcsCreateProcess.Addr(), 5, uintptr(computeSystem), uintptr(unsafe.Pointer(processParameters)), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) {
|
||||
if hr = procHcsOpenProcess.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall6(procHcsOpenProcess.Addr(), 4, uintptr(computeSystem), uintptr(pid), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsCloseProcess(process hcsProcess) (hr error) {
|
||||
if hr = procHcsCloseProcess.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsCloseProcess.Addr(), 1, uintptr(process), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) {
|
||||
if hr = procHcsTerminateProcess.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 2, uintptr(process), uintptr(unsafe.Pointer(result)), 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(options)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsSignalProcess(process, _p0, result)
|
||||
}
|
||||
|
||||
func _hcsSignalProcess(process hcsProcess, options *uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsTerminateProcess.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) {
|
||||
if hr = procHcsGetProcessInfo.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsGetProcessInfo.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsGetProcessProperties.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsGetProcessProperties.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processProperties)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(settings)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsModifyProcess(process, _p0, result)
|
||||
}
|
||||
|
||||
func _hcsModifyProcess(process hcsProcess, settings *uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsModifyProcess.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsModifyProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) {
|
||||
var _p0 *uint16
|
||||
_p0, hr = syscall.UTF16PtrFromString(propertyQuery)
|
||||
if hr != nil {
|
||||
return
|
||||
}
|
||||
return _hcsGetServiceProperties(_p0, properties, result)
|
||||
}
|
||||
|
||||
func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result **uint16) (hr error) {
|
||||
if hr = procHcsGetServiceProperties.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsGetServiceProperties.Addr(), 3, uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)))
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) {
|
||||
if hr = procHcsRegisterProcessCallback.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall6(procHcsRegisterProcessCallback.Addr(), 4, uintptr(process), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) {
|
||||
if hr = procHcsUnregisterProcessCallback.Find(); hr != nil {
|
||||
return
|
||||
}
|
||||
r0, _, _ := syscall.Syscall(procHcsUnregisterProcessCallback.Addr(), 1, uintptr(callbackHandle), 0, 0)
|
||||
if int32(r0) < 0 {
|
||||
if r0&0x1fff0000 == 0x00070000 {
|
||||
r0 &= 0xffff
|
||||
}
|
||||
hr = syscall.Errno(r0)
|
||||
}
|
||||
return
|
||||
}
|
||||
47
vendor/github.com/Microsoft/hcsshim/internal/hcserror/hcserror.go
generated
vendored
Normal file
47
vendor/github.com/Microsoft/hcsshim/internal/hcserror/hcserror.go
generated
vendored
Normal file
@@ -0,0 +1,47 @@
|
||||
package hcserror
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
"syscall"
|
||||
)
|
||||
|
||||
const ERROR_GEN_FAILURE = syscall.Errno(31)
|
||||
|
||||
type HcsError struct {
|
||||
title string
|
||||
rest string
|
||||
Err error
|
||||
}
|
||||
|
||||
func (e *HcsError) Error() string {
|
||||
s := e.title
|
||||
if len(s) > 0 && s[len(s)-1] != ' ' {
|
||||
s += " "
|
||||
}
|
||||
s += fmt.Sprintf("failed in Win32: %s (0x%x)", e.Err, Win32FromError(e.Err))
|
||||
if e.rest != "" {
|
||||
if e.rest[0] != ' ' {
|
||||
s += " "
|
||||
}
|
||||
s += e.rest
|
||||
}
|
||||
return s
|
||||
}
|
||||
|
||||
func New(err error, title, rest string) error {
|
||||
// Pass through DLL errors directly since they do not originate from HCS.
|
||||
if _, ok := err.(*syscall.DLLError); ok {
|
||||
return err
|
||||
}
|
||||
return &HcsError{title, rest, err}
|
||||
}
|
||||
|
||||
func Win32FromError(err error) uint32 {
|
||||
if herr, ok := err.(*HcsError); ok {
|
||||
return Win32FromError(herr.Err)
|
||||
}
|
||||
if code, ok := err.(syscall.Errno); ok {
|
||||
return uint32(code)
|
||||
}
|
||||
return uint32(ERROR_GEN_FAILURE)
|
||||
}
|
||||
23
vendor/github.com/Microsoft/hcsshim/internal/hns/hns.go
generated
vendored
Normal file
23
vendor/github.com/Microsoft/hcsshim/internal/hns/hns.go
generated
vendored
Normal file
@@ -0,0 +1,23 @@
|
||||
package hns
|
||||
|
||||
import "fmt"
|
||||
|
||||
//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hns.go
|
||||
|
||||
//sys _hnsCall(method string, path string, object string, response **uint16) (hr error) = vmcompute.HNSCall?
|
||||
|
||||
type EndpointNotFoundError struct {
|
||||
EndpointName string
|
||||
}
|
||||
|
||||
func (e EndpointNotFoundError) Error() string {
|
||||
return fmt.Sprintf("Endpoint %s not found", e.EndpointName)
|
||||
}
|
||||
|
||||
type NetworkNotFoundError struct {
|
||||
NetworkName string
|
||||
}
|
||||
|
||||
func (e NetworkNotFoundError) Error() string {
|
||||
return fmt.Sprintf("Network %s not found", e.NetworkName)
|
||||
}
|
||||
262
vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go
generated
vendored
Normal file
262
vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go
generated
vendored
Normal file
@@ -0,0 +1,262 @@
|
||||
package hns
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"net"
|
||||
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
// HNSEndpoint represents a network endpoint in HNS
|
||||
type HNSEndpoint struct {
|
||||
Id string `json:"ID,omitempty"`
|
||||
Name string `json:",omitempty"`
|
||||
VirtualNetwork string `json:",omitempty"`
|
||||
VirtualNetworkName string `json:",omitempty"`
|
||||
Policies []json.RawMessage `json:",omitempty"`
|
||||
MacAddress string `json:",omitempty"`
|
||||
IPAddress net.IP `json:",omitempty"`
|
||||
DNSSuffix string `json:",omitempty"`
|
||||
DNSServerList string `json:",omitempty"`
|
||||
GatewayAddress string `json:",omitempty"`
|
||||
EnableInternalDNS bool `json:",omitempty"`
|
||||
DisableICC bool `json:",omitempty"`
|
||||
PrefixLength uint8 `json:",omitempty"`
|
||||
IsRemoteEndpoint bool `json:",omitempty"`
|
||||
EnableLowMetric bool `json:",omitempty"`
|
||||
Namespace *Namespace `json:",omitempty"`
|
||||
EncapOverhead uint16 `json:",omitempty"`
|
||||
}
|
||||
|
||||
//SystemType represents the type of the system on which actions are done
|
||||
type SystemType string
|
||||
|
||||
// SystemType const
|
||||
const (
|
||||
ContainerType SystemType = "Container"
|
||||
VirtualMachineType SystemType = "VirtualMachine"
|
||||
HostType SystemType = "Host"
|
||||
)
|
||||
|
||||
// EndpointAttachDetachRequest is the structure used to send request to the container to modify the system
|
||||
// Supported resource types are Network and Request Types are Add/Remove
|
||||
type EndpointAttachDetachRequest struct {
|
||||
ContainerID string `json:"ContainerId,omitempty"`
|
||||
SystemType SystemType `json:"SystemType"`
|
||||
CompartmentID uint16 `json:"CompartmentId,omitempty"`
|
||||
VirtualNICName string `json:"VirtualNicName,omitempty"`
|
||||
}
|
||||
|
||||
// EndpointResquestResponse is object to get the endpoint request response
|
||||
type EndpointResquestResponse struct {
|
||||
Success bool
|
||||
Error string
|
||||
}
|
||||
|
||||
// HNSEndpointRequest makes a HNS call to modify/query a network endpoint
|
||||
func HNSEndpointRequest(method, path, request string) (*HNSEndpoint, error) {
|
||||
endpoint := &HNSEndpoint{}
|
||||
err := hnsCall(method, "/endpoints/"+path, request, &endpoint)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return endpoint, nil
|
||||
}
|
||||
|
||||
// HNSListEndpointRequest makes a HNS call to query the list of available endpoints
|
||||
func HNSListEndpointRequest() ([]HNSEndpoint, error) {
|
||||
var endpoint []HNSEndpoint
|
||||
err := hnsCall("GET", "/endpoints/", "", &endpoint)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return endpoint, nil
|
||||
}
|
||||
|
||||
// GetHNSEndpointByID get the Endpoint by ID
|
||||
func GetHNSEndpointByID(endpointID string) (*HNSEndpoint, error) {
|
||||
return HNSEndpointRequest("GET", endpointID, "")
|
||||
}
|
||||
|
||||
// GetHNSEndpointByName gets the endpoint filtered by Name
|
||||
func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) {
|
||||
hnsResponse, err := HNSListEndpointRequest()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
for _, hnsEndpoint := range hnsResponse {
|
||||
if hnsEndpoint.Name == endpointName {
|
||||
return &hnsEndpoint, nil
|
||||
}
|
||||
}
|
||||
return nil, EndpointNotFoundError{EndpointName: endpointName}
|
||||
}
|
||||
|
||||
// Create Endpoint by sending EndpointRequest to HNS. TODO: Create a separate HNS interface to place all these methods
|
||||
func (endpoint *HNSEndpoint) Create() (*HNSEndpoint, error) {
|
||||
operation := "Create"
|
||||
title := "hcsshim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
|
||||
jsonString, err := json.Marshal(endpoint)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return HNSEndpointRequest("POST", "", string(jsonString))
|
||||
}
|
||||
|
||||
// Delete Endpoint by sending EndpointRequest to HNS
|
||||
func (endpoint *HNSEndpoint) Delete() (*HNSEndpoint, error) {
|
||||
operation := "Delete"
|
||||
title := "hcsshim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
|
||||
return HNSEndpointRequest("DELETE", endpoint.Id, "")
|
||||
}
|
||||
|
||||
// Update Endpoint
|
||||
func (endpoint *HNSEndpoint) Update() (*HNSEndpoint, error) {
|
||||
operation := "Update"
|
||||
title := "hcsshim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
jsonString, err := json.Marshal(endpoint)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
err = hnsCall("POST", "/endpoints/"+endpoint.Id, string(jsonString), &endpoint)
|
||||
|
||||
return endpoint, err
|
||||
}
|
||||
|
||||
// ApplyACLPolicy applies a set of ACL Policies on the Endpoint
|
||||
func (endpoint *HNSEndpoint) ApplyACLPolicy(policies ...*ACLPolicy) error {
|
||||
operation := "ApplyACLPolicy"
|
||||
title := "hcsshim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
|
||||
for _, policy := range policies {
|
||||
if policy == nil {
|
||||
continue
|
||||
}
|
||||
jsonString, err := json.Marshal(policy)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
endpoint.Policies = append(endpoint.Policies, jsonString)
|
||||
}
|
||||
|
||||
_, err := endpoint.Update()
|
||||
return err
|
||||
}
|
||||
|
||||
// ContainerAttach attaches an endpoint to container
|
||||
func (endpoint *HNSEndpoint) ContainerAttach(containerID string, compartmentID uint16) error {
|
||||
operation := "ContainerAttach"
|
||||
title := "hcsshim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
|
||||
requestMessage := &EndpointAttachDetachRequest{
|
||||
ContainerID: containerID,
|
||||
CompartmentID: compartmentID,
|
||||
SystemType: ContainerType,
|
||||
}
|
||||
response := &EndpointResquestResponse{}
|
||||
jsonString, err := json.Marshal(requestMessage)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
|
||||
}
|
||||
|
||||
// ContainerDetach detaches an endpoint from container
|
||||
func (endpoint *HNSEndpoint) ContainerDetach(containerID string) error {
|
||||
operation := "ContainerDetach"
|
||||
title := "hcsshim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
|
||||
requestMessage := &EndpointAttachDetachRequest{
|
||||
ContainerID: containerID,
|
||||
SystemType: ContainerType,
|
||||
}
|
||||
response := &EndpointResquestResponse{}
|
||||
|
||||
jsonString, err := json.Marshal(requestMessage)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
|
||||
}
|
||||
|
||||
// HostAttach attaches a nic on the host
|
||||
func (endpoint *HNSEndpoint) HostAttach(compartmentID uint16) error {
|
||||
operation := "HostAttach"
|
||||
title := "hcsshim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
requestMessage := &EndpointAttachDetachRequest{
|
||||
CompartmentID: compartmentID,
|
||||
SystemType: HostType,
|
||||
}
|
||||
response := &EndpointResquestResponse{}
|
||||
|
||||
jsonString, err := json.Marshal(requestMessage)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
|
||||
|
||||
}
|
||||
|
||||
// HostDetach detaches a nic on the host
|
||||
func (endpoint *HNSEndpoint) HostDetach() error {
|
||||
operation := "HostDetach"
|
||||
title := "hcsshim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
requestMessage := &EndpointAttachDetachRequest{
|
||||
SystemType: HostType,
|
||||
}
|
||||
response := &EndpointResquestResponse{}
|
||||
|
||||
jsonString, err := json.Marshal(requestMessage)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
|
||||
}
|
||||
|
||||
// VirtualMachineNICAttach attaches a endpoint to a virtual machine
|
||||
func (endpoint *HNSEndpoint) VirtualMachineNICAttach(virtualMachineNICName string) error {
|
||||
operation := "VirtualMachineNicAttach"
|
||||
title := "hcsshim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
requestMessage := &EndpointAttachDetachRequest{
|
||||
VirtualNICName: virtualMachineNICName,
|
||||
SystemType: VirtualMachineType,
|
||||
}
|
||||
response := &EndpointResquestResponse{}
|
||||
|
||||
jsonString, err := json.Marshal(requestMessage)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
|
||||
}
|
||||
|
||||
// VirtualMachineNICDetach detaches a endpoint from a virtual machine
|
||||
func (endpoint *HNSEndpoint) VirtualMachineNICDetach() error {
|
||||
operation := "VirtualMachineNicDetach"
|
||||
title := "hcsshim::HNSEndpoint::" + operation
|
||||
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||
|
||||
requestMessage := &EndpointAttachDetachRequest{
|
||||
SystemType: VirtualMachineType,
|
||||
}
|
||||
response := &EndpointResquestResponse{}
|
||||
|
||||
jsonString, err := json.Marshal(requestMessage)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
|
||||
}
|
||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user