release v0.1.38

* vendor github.com/containers/image@v3.0.0
* enforce blocking of registries
* Fix lowest possible go version to be 1.9
* man pages: add --dest-oci-accept-uncompressed-layers
* bash completion: add --dest-oci-accept-uncompressed-layers
* README.md: skopeo on openSUSE
* copy: add a CLI flag for OCIAcceptUncompressedLayers
* migrate to go modules
* README: Clarify use of `libbtrfs-dev` on Ubuntu

Signed-off-by: Valentin Rothberg <rothberg@redhat.com>

Dockerfile

@@ -10,6 +10,8 @@ RUN dnf -y update && dnf install -y make git golang golang-github-cpuguy83-go-md
 	gnupg \
 	# OpenShift deps
 	which tar wget hostname util-linux bsdtar socat ethtool device-mapper iptables tree findutils nmap-ncat e2fsprogs xfsprogs lsof docker iproute \
+        bats jq podman \
+	golint \
 	&& dnf clean all
 
 # Install two versions of the registry. The first is an older version that
@@ -43,7 +45,6 @@ RUN set -x \
 ENV GOPATH /usr/share/gocode:/go
 ENV PATH $GOPATH/bin:/usr/share/gocode/bin:$PATH
 RUN go version
-RUN go get golang.org/x/lint/golint
 WORKDIR /go/src/github.com/containers/skopeo
 COPY . /go/src/github.com/containers/skopeo
 

Dockerfile.build

@@ -2,7 +2,7 @@ FROM ubuntu:18.10
 
 RUN apt-get update && apt-get install -y \
     golang \
-    btrfs-tools \
+    libbtrfs-dev \
     git-core \
     libdevmapper-dev \
     libgpgme11-dev \

Makefile

@@ -1,7 +1,5 @@
 .PHONY: all binary build-container docs docs-in-container build-local clean install install-binary install-completions shell test-integration .install.vndr vendor
 
-export GO15VENDOREXPERIMENT=1
-
 ifeq ($(shell uname),Darwin)
 PREFIX ?= ${DESTDIR}/usr/local
 DARWIN_BUILD_TAG=containers_image_ostree_stub
@@ -26,6 +24,12 @@ GO ?= go
 CONTAINER_RUNTIME := $(shell command -v podman 2> /dev/null || echo docker)
 GOMD2MAN ?= $(shell command -v go-md2man || echo '$(GOBIN)/go-md2man')
 
+GO_BUILD=$(GO) build
+# Go module support: set `-mod=vendor` to use the vendored sources
+ifeq ($(shell go help mod >/dev/null 2>&1 && echo true), true)
+  GO_BUILD=GO111MODULE=on $(GO) build -mod=vendor
+endif
+
 ifeq ($(DEBUG), 1)
   override GOGCFLAGS += -N -l
 endif
@@ -95,10 +99,10 @@ binary-static: cmd/skopeo
 
 # Build w/o using containers
 binary-local:
-	$(GPGME_ENV) $(GO) build ${GO_DYN_FLAGS} -ldflags "-X main.gitCommit=${GIT_COMMIT}" -gcflags "$(GOGCFLAGS)" -tags "$(BUILDTAGS)" -o skopeo ./cmd/skopeo
+	$(GPGME_ENV) $(GO_BUILD) ${GO_DYN_FLAGS} -ldflags "-X main.gitCommit=${GIT_COMMIT}" -gcflags "$(GOGCFLAGS)" -tags "$(BUILDTAGS)" -o skopeo ./cmd/skopeo
 
 binary-local-static:
-	$(GPGME_ENV) $(GO) build -ldflags "-extldflags \"-static\" -X main.gitCommit=${GIT_COMMIT}" -gcflags "$(GOGCFLAGS)" -tags "$(BUILDTAGS)" -o skopeo ./cmd/skopeo
+	$(GPGME_ENV) $(GO_BUILD) -ldflags "-extldflags \"-static\" -X main.gitCommit=${GIT_COMMIT}" -gcflags "$(GOGCFLAGS)" -tags "$(BUILDTAGS)" -o skopeo ./cmd/skopeo
 
 build-container:
 	${CONTAINER_RUNTIME} build ${BUILD_ARGS} -t "$(IMAGE)" .
@@ -138,14 +142,25 @@ install-completions:
 shell: build-container
 	$(CONTAINER_RUN) bash
 
-check: validate test-unit test-integration
+check: validate test-unit test-integration test-system
 
 # The tests can run out of entropy and block in containers, so replace /dev/random.
 test-integration: build-container
 	$(CONTAINER_RUN) bash -c 'rm -f /dev/random; ln -sf /dev/urandom /dev/random; SKOPEO_CONTAINER_TESTS=1 BUILDTAGS="$(BUILDTAGS)" hack/make.sh test-integration'
 
+# complicated set of options needed to run podman-in-podman
+test-system: build-container
+	DTEMP=$(shell mktemp -d --tmpdir=/var/tmp podman-tmp.XXXXXX); \
+	$(CONTAINER_CMD) --privileged --net=host \
+	    -v $$DTEMP:/var/lib/containers:Z \
+            "$(IMAGE)" \
+            bash -c 'BUILDTAGS="$(BUILDTAGS)" hack/make.sh test-system'; \
+	rc=$$?; \
+	$(RM) -rf $$DTEMP; \
+	exit $$rc
+
 test-unit: build-container
-	# Just call (make test unit-local) here instead of worrying about environment differences, e.g. GO15VENDOREXPERIMENT.
+	# Just call (make test unit-local) here instead of worrying about environment differences
 	$(CONTAINER_RUN) make test-unit-local BUILDTAGS='$(BUILDTAGS)'
 
 validate: build-container
@@ -160,10 +175,8 @@ validate-local:
 test-unit-local:
 	$(GPGME_ENV) $(GO) test -tags "$(BUILDTAGS)" $$($(GO) list -tags "$(BUILDTAGS)" -e ./... | grep -v '^github\.com/containers/skopeo/\(integration\|vendor/.*\)$$')
 
-.install.vndr:
-	$(GO) get -u github.com/LK4D4/vndr
-
-vendor: vendor.conf .install.vndr
-	$(GOPATH)/bin/vndr \
-		-whitelist '^github.com/containers/image/docs/.*' \
-		-whitelist '^github.com/containers/image/registries.conf'
+vendor:
+	export GO111MODULE=on \
+		$(GO) mod tidy && \
+		$(GO) mod vendor && \
+		$(GO) mod verify

README.md

@@ -156,10 +156,15 @@ Obtaining skopeo
 ```sh
 $ sudo dnf install skopeo
 ```
+for openSUSE:
+```sh
+$ sudo zypper install skopeo
+```
+
 
 Otherwise, read on for building and installing it from source:
 
-To build the `skopeo` binary you need at least Go 1.5 because it uses the latest `GO15VENDOREXPERIMENT` flag.
+To build the `skopeo` binary you need at least Go 1.9.
 
 There are two ways to build skopeo: in a container, or locally without a container.  Choose the one which better matches your needs and environment.
 
@@ -171,9 +176,17 @@ Building without a container requires a bit more manual work and setup in your e
 
 Install the necessary dependencies:
 ```sh
-Fedora$ sudo dnf install gpgme-devel libassuan-devel btrfs-progs-devel device-mapper-devel ostree-devel
-Ubuntu$ sudo apt install libgpgme-dev libassuan-dev btrfs-progs libdevmapper-dev libostree-dev
-macOS$ brew install gpgme
+# Fedora:
+sudo dnf install gpgme-devel libassuan-devel btrfs-progs-devel device-mapper-devel ostree-devel
+
+# Ubuntu (`libbtrfs-dev` requires Ubuntu 18.10 and above):
+sudo apt install libgpgme-dev libassuan-dev libbtrfs-dev libdevmapper-dev libostree-dev
+
+# macOS:
+brew install gpgme
+
+# openSUSE
+sudo zypper install libgpgme-devel device-mapper-devel libbtrfs-devel glib2-devel
 ```
 
 Make sure to clone this repository in your `GOPATH` - otherwise compilation fails.

cmd/skopeo/unshare_linux.go

@@ -38,7 +38,8 @@ func maybeReexec() error {
 func reexecIfNecessaryForImages(imageNames ...string) error {
 	// Check if container-storage are used before doing unshare
 	for _, imageName := range imageNames {
-		if alltransports.TransportFromImageName(imageName).Name() == storage.Transport.Name() {
+		transport := alltransports.TransportFromImageName(imageName)
+		if transport != nil && transport.Name() == storage.Transport.Name() {
 			return maybeReexec()
 		}
 	}

cmd/skopeo/utils.go

@@ -153,8 +153,9 @@ func (opts *imageOptions) newSystemContext() (*types.SystemContext, error) {
 // imageDestOptions is a superset of imageOptions specialized for iamge destinations.
 type imageDestOptions struct {
 	*imageOptions
-	osTreeTmpDir        string // A directory to use for OSTree temporary files
-	dirForceCompression bool   // Compress layers when saving to the dir: transport
+	osTreeTmpDir                string // A directory to use for OSTree temporary files
+	dirForceCompression         bool   // Compress layers when saving to the dir: transport
+	ociAcceptUncompressedLayers bool   // Whether to accept uncompressed layers in the oci: transport
 }
 
 // imageDestFlags prepares a collection of CLI flags writing into imageDestOptions, and the managed imageDestOptions structure.
@@ -173,6 +174,11 @@ func imageDestFlags(global *globalOptions, shared *sharedImageOptions, flagPrefi
 			Usage:       "Compress tarball image layers when saving to directory using the 'dir' transport. (default is same compression type as source)",
 			Destination: &opts.dirForceCompression,
 		},
+		cli.BoolFlag{
+			Name:        flagPrefix + "oci-accept-uncompressed-layers",
+			Usage:       "Allow uncompressed image layers when saving to an OCI image using the 'oci' transport. (default is to compress things that aren't compressed)",
+			Destination: &opts.ociAcceptUncompressedLayers,
+		},
 	}...), &opts
 }
 
@@ -186,6 +192,7 @@ func (opts *imageDestOptions) newSystemContext() (*types.SystemContext, error) {
 
 	ctx.OSTreeTmpDirPath = opts.osTreeTmpDir
 	ctx.DirForceCompress = opts.dirForceCompression
+	ctx.OCIAcceptUncompressedLayers = opts.ociAcceptUncompressedLayers
 	return ctx, err
 }
 

completions/bash/skopeo

@@ -57,6 +57,7 @@ _skopeo_copy() {
     --remove-signatures
     --src-no-creds
     --dest-no-creds
+    --dest-oci-accept-uncompressed-layers
     "
 
     local transports="

docs/skopeo-copy.1.md

@@ -34,6 +34,8 @@ If the authorization state is not found there, $HOME/.docker/config.json is chec
 
 **--dest-compress** _bool-value_ Compress tarball image layers when saving to directory using the 'dir' transport. (default is same compression type as source)
 
+**--dest-oci-accept-uncompressed-layers** _bool-value_ Allow uncompressed image layers when saving to an OCI image using the 'oci' transport. (default is to compress things that aren't compressed)
+
 **--dest-creds** _username[:password]_ for accessing the destination registry
 
 **--src-cert-dir** _path_ Use certificates at _path_ (*.crt, *.cert, *.key) to connect to the source registry or daemon

go.mod

@@ -0,0 +1,66 @@
+module github.com/containers/skopeo
+
+go 1.12
+
+require (
+	github.com/BurntSushi/toml v0.3.1 // indirect
+	github.com/Microsoft/go-winio v0.4.12 // indirect
+	github.com/Microsoft/hcsshim v0.8.6 // indirect
+	github.com/VividCortex/ewma v1.1.1 // indirect
+	github.com/containerd/continuity v0.0.0-20180216233310-d8fb8589b0e8 // indirect
+	github.com/containers/buildah v1.8.4
+	github.com/containers/image v3.0.0+incompatible
+	github.com/containers/storage v1.12.10
+	github.com/davecgh/go-spew v1.1.1 // indirect
+	github.com/docker/distribution v0.0.0-20170817175659-5f6282db7d65 // indirect
+	github.com/docker/docker v0.0.0-20180522102801-da99009bbb11
+	github.com/docker/docker-credential-helpers v0.6.0 // indirect
+	github.com/docker/go-connections v0.0.0-20180212134524-7beb39f0b969 // indirect
+	github.com/docker/go-units v0.0.0-20161020213227-8a7beacffa30 // indirect
+	github.com/docker/libtrust v0.0.0-20160708172513-aabc10ec26b7 // indirect
+	github.com/etcd-io/bbolt v1.3.2 // indirect
+	github.com/ghodss/yaml v0.0.0-20150909031657-73d445a93680 // indirect
+	github.com/go-check/check v0.0.0-20180628173108-788fd7840127
+	github.com/gogo/protobuf v0.0.0-20170815085658-fcdc5011193f // indirect
+	github.com/gorilla/context v0.0.0-20140604161150-14f550f51af5 // indirect
+	github.com/gorilla/mux v0.0.0-20140926153814-e444e69cbd2e // indirect
+	github.com/imdario/mergo v0.0.0-20141206190957-6633656539c1 // indirect
+	github.com/klauspost/compress v1.4.1 // indirect
+	github.com/klauspost/cpuid v1.2.0 // indirect
+	github.com/klauspost/pgzip v1.2.1 // indirect
+	github.com/kr/pretty v0.1.0 // indirect
+	github.com/mattn/go-isatty v0.0.4 // indirect
+	github.com/mattn/go-shellwords v1.0.5 // indirect
+	github.com/mistifyio/go-zfs v0.0.0-20160425201758-22c9b32c84eb // indirect
+	github.com/mtrmac/gpgme v0.0.0-20170102180018-b2432428689c // indirect
+	github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2
+	github.com/opencontainers/image-spec v0.0.0-20180918080442-7b1e489870ac
+	github.com/opencontainers/image-tools v0.0.0-20170926011501-6d941547fa1d
+	github.com/opencontainers/runc v1.0.0-rc6 // indirect
+	github.com/opencontainers/runtime-spec v1.0.0 // indirect
+	github.com/opencontainers/selinux v0.0.0-20190118194635-b707dfcb00a1 // indirect
+	github.com/ostreedev/ostree-go v0.0.0-20181204105935-56f3a639dbc0 // indirect
+	github.com/pborman/uuid v0.0.0-20160209185913-a97ce2ca70fa // indirect
+	github.com/pkg/errors v0.8.1
+	github.com/pmezard/go-difflib v0.0.0-20181226105442-5d4384ee4fb2 // indirect
+	github.com/pquerna/ffjson v0.0.0-20171002144729-d49c2bc1aa13 // indirect
+	github.com/sirupsen/logrus v1.0.0
+	github.com/stretchr/testify v1.1.3
+	github.com/syndtr/gocapability v0.0.0-20180916011248-d98352740cb2
+	github.com/tchap/go-patricia v2.2.6+incompatible // indirect
+	github.com/ulikunitz/xz v0.5.4 // indirect
+	github.com/urfave/cli v1.20.0
+	github.com/vbatts/tar-split v0.10.2 // indirect
+	github.com/vbauerster/mpb v3.4.0+incompatible // indirect
+	github.com/xeipuuv/gojsonpointer v0.0.0-20180127040702-4e3ac2762d5f // indirect
+	github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415 // indirect
+	github.com/xeipuuv/gojsonschema v1.1.0 // indirect
+	go4.org v0.0.0-20190218023631-ce4c26f7be8e // indirect
+	golang.org/x/crypto v0.0.0-20190219172222-a4c6cb3142f2 // indirect
+	golang.org/x/net v0.0.0-20190107210223-45ffb0cd1ba0 // indirect
+	golang.org/x/sync v0.0.0-20181108010431-42b317875d0f // indirect
+	golang.org/x/sys v0.0.0-20170817234608-43e60d72a8e2 // indirect
+	golang.org/x/text v0.0.0-20181227161524-e6919f6577db // indirect
+	gopkg.in/yaml.v2 v2.0.0-20141029210843-d466437aa4ad // indirect
+	k8s.io/client-go v0.0.0-20181219152756-3dd551c0f083 // indirect
+)

go.sum

@@ -0,0 +1,138 @@
+github.com/BurntSushi/toml v0.3.1 h1:WXkYYl6Yr3qBf1K79EBnL4mak0OimBfB0XUf9Vl28OQ=
+github.com/BurntSushi/toml v0.3.1/go.mod h1:xHWCNGjB5oqiDr8zfno3MHue2Ht5sIBksp03qcyfWMU=
+github.com/Microsoft/go-winio v0.4.12 h1:xAfWHN1IrQ0NJ9TBC0KBZoqLjzDTr1ML+4MywiUOryc=
+github.com/Microsoft/go-winio v0.4.12/go.mod h1:VhR8bwka0BXejwEJY73c50VrPtXAaKcyvVC4A4RozmA=
+github.com/Microsoft/hcsshim v0.8.6 h1:ZfF0+zZeYdzMIVMZHKtDKJvLHj76XCuVae/jNkjj0IA=
+github.com/Microsoft/hcsshim v0.8.6/go.mod h1:Op3hHsoHPAvb6lceZHDtd9OkTew38wNoXnJs8iY7rUg=
+github.com/VividCortex/ewma v1.1.1 h1:MnEK4VOv6n0RSY4vtRe3h11qjxL3+t0B8yOL8iMXdcM=
+github.com/VividCortex/ewma v1.1.1/go.mod h1:2Tkkvm3sRDVXaiyucHiACn4cqf7DpdyLvmxzcbUokwA=
+github.com/containerd/continuity v0.0.0-20180216233310-d8fb8589b0e8 h1:ZZOFPzvZO3N0f4LIQvZi68F2XDAMl/gqBfFMVjY6B3Y=
+github.com/containerd/continuity v0.0.0-20180216233310-d8fb8589b0e8/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y=
+github.com/containers/buildah v1.8.4 h1:06c+UNeEWMa2wA1Z7muZ0ZqUzE91sDuZJbB0BiZaeYQ=
+github.com/containers/buildah v1.8.4/go.mod h1:1CsiLJvyU+h+wOjnqJJOWuJCVcMxZOr5HN/gHGdzJxY=
+github.com/containers/image v1.5.2-0.20190620105408-93b1deece293 h1:EalCgZ875kDCN2HcOch50q48GKerWGc5eV0BllCvln8=
+github.com/containers/image v1.5.2-0.20190620105408-93b1deece293/go.mod h1:8Vtij257IWSanUQKe1tAeNOm2sRVkSqQTVQ1IlwI3+M=
+github.com/containers/image v1.5.2-0.20190717062552-2178abd5f9b1 h1:RGlzwWSoGBbc5fgGysRrGAPLn8xQwihzRVPVDW5yQlo=
+github.com/containers/image v1.5.2-0.20190717062552-2178abd5f9b1/go.mod h1:8Vtij257IWSanUQKe1tAeNOm2sRVkSqQTVQ1IlwI3+M=
+github.com/containers/image v1.5.2-0.20190725091050-48acc3dcbb76 h1:+9unAKrV92Jvifb06UK8H4xTKf7h7XQDOsn4EC9eqH4=
+github.com/containers/image v1.5.2-0.20190725091050-48acc3dcbb76/go.mod h1:8Vtij257IWSanUQKe1tAeNOm2sRVkSqQTVQ1IlwI3+M=
+github.com/containers/image v2.0.0+incompatible h1:FTr6Br7jlIKNCKMjSOMbAxKp2keQ0//jzJaYNTVhauk=
+github.com/containers/image v2.0.0+incompatible/go.mod h1:8Vtij257IWSanUQKe1tAeNOm2sRVkSqQTVQ1IlwI3+M=
+github.com/containers/image v3.0.0+incompatible h1:pdUHY//H+3jYNnoTt+rqY8NsStX4ZBLKzPTlMC+XvnU=
+github.com/containers/image v3.0.0+incompatible/go.mod h1:8Vtij257IWSanUQKe1tAeNOm2sRVkSqQTVQ1IlwI3+M=
+github.com/containers/storage v1.12.10 h1:vw1aiLsZ1LvO09ELMxVBTe35tThRiMftI2cPeH+G5ow=
+github.com/containers/storage v1.12.10/go.mod h1:+RirK6VQAqskQlaTBrOG6ulDvn4si2QjFE1NZCn06MM=
+github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c=
+github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
+github.com/docker/distribution v0.0.0-20170817175659-5f6282db7d65 h1:4zlOyrJUbYnrvlzChJ+jP2J3i77Jbhm336NEuCv7kZo=
+github.com/docker/distribution v0.0.0-20170817175659-5f6282db7d65/go.mod h1:J2gT2udsDAN96Uj4KfcMRqY0/ypR+oyYUYmja8H+y+w=
+github.com/docker/docker v0.0.0-20180522102801-da99009bbb11 h1:p8hSDXZgVhyh/C9bPlG8QMY64VeXtVfjmjIlzaQok5Q=
+github.com/docker/docker v0.0.0-20180522102801-da99009bbb11/go.mod h1:eEKB0N0r5NX/I1kEveEz05bcu8tLC/8azJZsviup8Sk=
+github.com/docker/docker-credential-helpers v0.6.0 h1:5bhDRLn1roGiNjz8IezRngHxMfoeaXGyr0BeMHq4rD8=
+github.com/docker/docker-credential-helpers v0.6.0/go.mod h1:WRaJzqw3CTB9bk10avuGsjVBZsD05qeibJ1/TYlvc0Y=
+github.com/docker/go-connections v0.0.0-20180212134524-7beb39f0b969 h1:p2WzwcFof6KwsloLgCiAKkU5DJSVgOKGdevswAmskvY=
+github.com/docker/go-connections v0.0.0-20180212134524-7beb39f0b969/go.mod h1:Gbd7IOopHjR8Iph03tsViu4nIes5XhDvyHbTtUxmeec=
+github.com/docker/go-units v0.0.0-20161020213227-8a7beacffa30 h1:dDGntbHn0CUgKCyVvmHcD+spha+/4+8hJv5nbZVS6R8=
+github.com/docker/go-units v0.0.0-20161020213227-8a7beacffa30/go.mod h1:fgPhTUdO+D/Jk86RDLlptpiXQzgHJF7gydDDbaIK4Dk=
+github.com/docker/libtrust v0.0.0-20160708172513-aabc10ec26b7 h1:UhxFibDNY/bfvqU5CAUmr9zpesgbU6SWc8/B4mflAE4=
+github.com/docker/libtrust v0.0.0-20160708172513-aabc10ec26b7/go.mod h1:cyGadeNEkKy96OOhEzfZl+yxihPEzKnqJwvfuSUqbZE=
+github.com/etcd-io/bbolt v1.3.2 h1:RLRQ0TKLX7DlBRXAJHvbmXL17Q3KNnTBtZ9B6Qo+/Y0=
+github.com/etcd-io/bbolt v1.3.2/go.mod h1:ZF2nL25h33cCyBtcyWeZ2/I3HQOfTP+0PIEvHjkjCrw=
+github.com/ghodss/yaml v0.0.0-20150909031657-73d445a93680 h1:ZktWZesgun21uEDrwW7iEV1zPCGQldM2atlJZ3TdvVM=
+github.com/ghodss/yaml v0.0.0-20150909031657-73d445a93680/go.mod h1:4dBDuWmgqj2HViK6kFavaiC9ZROes6MMH2rRYeMEF04=
+github.com/go-check/check v0.0.0-20180628173108-788fd7840127 h1:0gkP6mzaMqkmpcJYCFOLkIBwI7xFExG03bbkOkCvUPI=
+github.com/go-check/check v0.0.0-20180628173108-788fd7840127/go.mod h1:9ES+weclKsC9YodN5RgxqK/VD9HM9JsCSh7rNhMZE98=
+github.com/gogo/protobuf v0.0.0-20170815085658-fcdc5011193f h1:r/AdTzqktq9nQpFlFePWcp+scVi+oFRajfjRJ3UnETg=
+github.com/gogo/protobuf v0.0.0-20170815085658-fcdc5011193f/go.mod h1:r8qH/GZQm5c6nD/R0oafs1akxWv10x8SbQlK7atdtwQ=
+github.com/gorilla/context v0.0.0-20140604161150-14f550f51af5 h1:yCHB2BCyFu0V6ChUHb8sF2VodD5B0PAgPDoCxBE7ICQ=
+github.com/gorilla/context v0.0.0-20140604161150-14f550f51af5/go.mod h1:kBGZzfjB9CEq2AlWe17Uuf7NDRt0dE0s8S51q0aT7Yg=
+github.com/gorilla/mux v0.0.0-20140926153814-e444e69cbd2e h1:nH09qCdJVZxw0nRVfm14xjXkw2puLyLPN56n4u+vTC0=
+github.com/gorilla/mux v0.0.0-20140926153814-e444e69cbd2e/go.mod h1:1lud6UwP+6orDFRuTfBEV8e9/aOM/c4fVVCaMa2zaAs=
+github.com/imdario/mergo v0.0.0-20141206190957-6633656539c1 h1:FeeCi0I2Fu8kA8IXrdVPtGzym+mW9bzfj9f26EaES9k=
+github.com/imdario/mergo v0.0.0-20141206190957-6633656539c1/go.mod h1:2EnlNZ0deacrJVfApfmtdGgDfMuh/nq6Ok1EcJh5FfA=
+github.com/klauspost/compress v1.4.1 h1:8VMb5+0wMgdBykOV96DwNwKFQ+WTI4pzYURP99CcB9E=
+github.com/klauspost/compress v1.4.1/go.mod h1:RyIbtBH6LamlWaDj8nUwkbUhJ87Yi3uG0guNDohfE1A=
+github.com/klauspost/cpuid v1.2.0 h1:NMpwD2G9JSFOE1/TJjGSo5zG7Yb2bTe7eq1jH+irmeE=
+github.com/klauspost/cpuid v1.2.0/go.mod h1:Pj4uuM528wm8OyEC2QMXAi2YiTZ96dNQPGgoMS4s3ek=
+github.com/klauspost/pgzip v1.2.1 h1:oIPZROsWuPHpOdMVWLuJZXwgjhrW8r1yEX8UqMyeNHM=
+github.com/klauspost/pgzip v1.2.1/go.mod h1:Ch1tH69qFZu15pkjo5kYi6mth2Zzwzt50oCQKQE9RUs=
+github.com/kr/pretty v0.1.0 h1:L/CwN0zerZDmRFUapSPitk6f+Q3+0za1rQkzVuMiMFI=
+github.com/kr/pretty v0.1.0/go.mod h1:dAy3ld7l9f0ibDNOQOHHMYYIIbhfbHSm3C4ZsoJORNo=
+github.com/kr/pty v1.1.1/go.mod h1:pFQYn66WHrOpPYNljwOMqo10TkYh1fy3cYio2l3bCsQ=
+github.com/kr/text v0.1.0 h1:45sCR5RtlFHMR4UwH9sdQ5TC8v0qDQCHnXt+kaKSTVE=
+github.com/kr/text v0.1.0/go.mod h1:4Jbv+DJW3UT/LiOwJeYQe1efqtUx/iVham/4vfdArNI=
+github.com/mattn/go-isatty v0.0.4 h1:bnP0vzxcAdeI1zdubAl5PjU6zsERjGZb7raWodagDYs=
+github.com/mattn/go-isatty v0.0.4/go.mod h1:M+lRXTBqGeGNdLjl/ufCoiOlB5xdOkqRJdNxMWT7Zi4=
+github.com/mattn/go-shellwords v1.0.5 h1:JhhFTIOslh5ZsPrpa3Wdg8bF0WI3b44EMblmU9wIsXc=
+github.com/mattn/go-shellwords v1.0.5/go.mod h1:3xCvwCdWdlDJUrvuMn7Wuy9eWs4pE8vqg+NOMyg4B2o=
+github.com/mistifyio/go-zfs v0.0.0-20160425201758-22c9b32c84eb h1:iTqJ2fjDnaldY7BXhfc15HkT769kWAstiz2bCmUrKAw=
+github.com/mistifyio/go-zfs v0.0.0-20160425201758-22c9b32c84eb/go.mod h1:8AuVvqP/mXw1px98n46wfvcGfQ4ci2FwoAjKYxuo3Z4=
+github.com/mtrmac/gpgme v0.0.0-20170102180018-b2432428689c h1:xa+eQWKuJ9MbB9FBL/eoNvDFvveAkz2LQoz8PzX7Q/4=
+github.com/mtrmac/gpgme v0.0.0-20170102180018-b2432428689c/go.mod h1:GhAqVMEWnTcW2dxoD/SO3n2enrgWl3y6Dnx4m59GvcA=
+github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2 h1:QhPf3A2AZW3tTGvHPg0TA+CR3oHbVLlXUhlghqISp1I=
+github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s=
+github.com/opencontainers/image-spec v0.0.0-20180918080442-7b1e489870ac h1:Y0AqP4onEqgQST60GE172L61SAFMZMHQgXbwLMyj418=
+github.com/opencontainers/image-spec v0.0.0-20180918080442-7b1e489870ac/go.mod h1:BtxoFyWECRxE4U/7sNtV5W15zMzWCbyJoFRP3s7yZA0=
+github.com/opencontainers/image-tools v0.0.0-20170926011501-6d941547fa1d h1:X9WSFjjZNqYRqO2MenUgqE2nj/oydcfIzXJ0R/SVnnA=
+github.com/opencontainers/image-tools v0.0.0-20170926011501-6d941547fa1d/go.mod h1:A9btVpZLzttF4iFaKNychhPyrhfOjJ1OF5KrA8GcLj4=
+github.com/opencontainers/runc v1.0.0-rc6 h1:7AoN22rYxxkmsJS48wFaziH/n0OvrZVqL/TglgHKbKQ=
+github.com/opencontainers/runc v1.0.0-rc6/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U=
+github.com/opencontainers/runtime-spec v1.0.0 h1:O6L965K88AilqnxeYPks/75HLpp4IG+FjeSCI3cVdRg=
+github.com/opencontainers/runtime-spec v1.0.0/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0=
+github.com/opencontainers/selinux v0.0.0-20190118194635-b707dfcb00a1 h1:V8Icxoi2vzXvXaH0wuUZR+oyDvyRISW/1fXiK69le8E=
+github.com/opencontainers/selinux v0.0.0-20190118194635-b707dfcb00a1/go.mod h1:+BLncwf63G4dgOzykXAxcmnFlUaOlkDdmw/CqsW6pjs=
+github.com/ostreedev/ostree-go v0.0.0-20181204105935-56f3a639dbc0 h1:l8oDb3Ln30sysfGafRZJ9zNnzYfNyWy+w4fGZjii5rQ=
+github.com/ostreedev/ostree-go v0.0.0-20181204105935-56f3a639dbc0/go.mod h1:J6OG6YJVEWopen4avK3VNQSnALmmjvniMmni/YFYAwc=
+github.com/pborman/uuid v0.0.0-20160209185913-a97ce2ca70fa h1:l8VQbMdmwFH37kOOaWQ/cw24/u8AuBz5lUym13Wcu0Y=
+github.com/pborman/uuid v0.0.0-20160209185913-a97ce2ca70fa/go.mod h1:VyrYX9gd7irzKovcSS6BIIEwPRkP2Wm2m9ufcdFSJ34=
+github.com/pkg/errors v0.8.1 h1:iURUrRGxPUNPdy5/HRSm+Yj6okJ6UtLINN0Q9M4+h3I=
+github.com/pkg/errors v0.8.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0=
+github.com/pmezard/go-difflib v0.0.0-20181226105442-5d4384ee4fb2 h1:Dp6WLvjytJLgEEknBM9ie5JffieQzzdv2pNpwCJ6lQQ=
+github.com/pmezard/go-difflib v0.0.0-20181226105442-5d4384ee4fb2/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4=
+github.com/pquerna/ffjson v0.0.0-20171002144729-d49c2bc1aa13 h1:AUK/hm/tPsiNNASdb3J8fySVRZoI7fnK5mlOvdFD43o=
+github.com/pquerna/ffjson v0.0.0-20171002144729-d49c2bc1aa13/go.mod h1:YARuvh7BUWHNhzDq2OM5tzR2RiCcN2D7sapiKyCel/M=
+github.com/sirupsen/logrus v1.0.0 h1:XM8X4m/9ACaclZMs946FQNEZBZafvToJLTR4007drwo=
+github.com/sirupsen/logrus v1.0.0/go.mod h1:pMByvHTf9Beacp5x1UXfOR9xyW/9antXMhjMPG0dEzc=
+github.com/stretchr/testify v1.1.3 h1:76sIvNG1I8oBerx/MvuVHh5HBWBW7oxfsi3snKIsz5w=
+github.com/stretchr/testify v1.1.3/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXfy6kDkUVs=
+github.com/syndtr/gocapability v0.0.0-20180916011248-d98352740cb2 h1:b6uOv7YOFK0TYG7HtkIgExQo+2RdLuwRft63jn2HWj8=
+github.com/syndtr/gocapability v0.0.0-20180916011248-d98352740cb2/go.mod h1:hkRG7XYTFWNJGYcbNJQlaLq0fg1yr4J4t/NcTQtrfww=
+github.com/tchap/go-patricia v2.2.6+incompatible h1:JvoDL7JSoIP2HDE8AbDH3zC8QBPxmzYe32HHy5yQ+Ck=
+github.com/tchap/go-patricia v2.2.6+incompatible/go.mod h1:bmLyhP68RS6kStMGxByiQ23RP/odRBOTVjwp2cDyi6I=
+github.com/ulikunitz/xz v0.5.4 h1:zATC2OoZ8H1TZll3FpbX+ikwmadbO699PE06cIkm9oU=
+github.com/ulikunitz/xz v0.5.4/go.mod h1:2bypXElzHzzJZwzH67Y6wb67pO62Rzfn7BSiF4ABRW8=
+github.com/urfave/cli v1.20.0 h1:fDqGv3UG/4jbVl/QkFwEdddtEDjh/5Ov6X+0B/3bPaw=
+github.com/urfave/cli v1.20.0/go.mod h1:70zkFmudgCuE/ngEzBv17Jvp/497gISqfk5gWijbERA=
+github.com/vbatts/tar-split v0.10.2 h1:CXd7HEKGkTLjBMinpObcJZU5Hm8EKlor2a1JtX6msXQ=
+github.com/vbatts/tar-split v0.10.2/go.mod h1:LEuURwDEiWjRjwu46yU3KVGuUdVv/dcnpcEPSzR8z6g=
+github.com/vbauerster/mpb v3.3.4+incompatible h1:DDIhnwmgTQIDZo+SWlEr5d6mJBxkOLBwCXPzunhEfJ4=
+github.com/vbauerster/mpb v3.3.4+incompatible/go.mod h1:zAHG26FUhVKETRu+MWqYXcI70POlC6N8up9p1dID7SU=
+github.com/vbauerster/mpb v3.4.0+incompatible h1:mfiiYw87ARaeRW6x5gWwYRUawxaW1tLAD8IceomUCNw=
+github.com/vbauerster/mpb v3.4.0+incompatible/go.mod h1:zAHG26FUhVKETRu+MWqYXcI70POlC6N8up9p1dID7SU=
+github.com/vrothberg/image v0.0.0-20190717060034-cd5ce8239f51 h1:u4Hw4D3PLODtsZJ1FKi7j8bkd+zyJOc28dRSiVTOgyE=
+github.com/vrothberg/image v0.0.0-20190717060034-cd5ce8239f51/go.mod h1:/hIyjuUvIY6X2wGj/fbsA9zwlfAize8B2DLPishEHHg=
+github.com/vrothberg/image v0.0.0-20190718162835-cdafe647d2d8 h1:LpqO8V+oaT3eXrvKSminmqKWo2vhOdLgu1kp2/+fHAI=
+github.com/vrothberg/image v0.0.0-20190718162835-cdafe647d2d8/go.mod h1:/hIyjuUvIY6X2wGj/fbsA9zwlfAize8B2DLPishEHHg=
+github.com/xeipuuv/gojsonpointer v0.0.0-20180127040702-4e3ac2762d5f h1:J9EGpcZtP0E/raorCMxlFGSTBrsSlaDGf3jU/qvAE2c=
+github.com/xeipuuv/gojsonpointer v0.0.0-20180127040702-4e3ac2762d5f/go.mod h1:N2zxlSyiKSe5eX1tZViRH5QA0qijqEDrYZiPEAiq3wU=
+github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415 h1:EzJWgHovont7NscjpAxXsDA8S8BMYve8Y5+7cuRE7R0=
+github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415/go.mod h1:GwrjFmJcFw6At/Gs6z4yjiIwzuJ1/+UwLxMQDVQXShQ=
+github.com/xeipuuv/gojsonschema v1.1.0 h1:ngVtJC9TY/lg0AA/1k48FYhBrhRoFlEmWzsehpNAaZg=
+github.com/xeipuuv/gojsonschema v1.1.0/go.mod h1:5yf86TLmAcydyeJq5YvxkGPE2fm/u4myDekKRoLuqhs=
+go4.org v0.0.0-20190218023631-ce4c26f7be8e h1:m9LfARr2VIOW0vsV19kEKp/sWQvZnGobA8JHui/XJoY=
+go4.org v0.0.0-20190218023631-ce4c26f7be8e/go.mod h1:MkTOUMDaeVYJUOUsaDXIhWPZYa1yOyC1qaOBpL57BhE=
+golang.org/x/crypto v0.0.0-20190219172222-a4c6cb3142f2 h1:NwxKRvbkH5MsNkvOtPZi3/3kmI8CAzs3mtv+GLQMkNo=
+golang.org/x/crypto v0.0.0-20190219172222-a4c6cb3142f2/go.mod h1:6SG95UA2DQfeDnfUPMdvaQW0Q7yPrPDi9nlGo2tz2b4=
+golang.org/x/net v0.0.0-20190107210223-45ffb0cd1ba0 h1:1DW40AJQ7AP4nY6ORUGUdkpXyEC9W2GAXcOPaMZK0K8=
+golang.org/x/net v0.0.0-20190107210223-45ffb0cd1ba0/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
+golang.org/x/sync v0.0.0-20181108010431-42b317875d0f h1:Bl/8QSvNqXvPGPGXa2z5xUTmV7VDcZyvRZ+QQXkXTZQ=
+golang.org/x/sync v0.0.0-20181108010431-42b317875d0f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
+golang.org/x/sys v0.0.0-20170817234608-43e60d72a8e2 h1:90z1vgEVOG718nzy69KGhEtYepBetip3OSWJjMnI8Bw=
+golang.org/x/sys v0.0.0-20170817234608-43e60d72a8e2/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
+golang.org/x/text v0.0.0-20181227161524-e6919f6577db h1:ERgn/rMlavvbd/tNSkNoiKxiwdqWKnOfIB/X6qFxWsM=
+golang.org/x/text v0.0.0-20181227161524-e6919f6577db/go.mod h1:bEr9sfX3Q8Zfm5fL9x+3itogRgK3+ptLWKqgva+5dAk=
+golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ=
+gopkg.in/yaml.v2 v2.0.0-20141029210843-d466437aa4ad h1:3SOi6w/NEma/Ir04qIGumn/RZwbXRhJSM7gN9YN8Ajc=
+gopkg.in/yaml.v2 v2.0.0-20141029210843-d466437aa4ad/go.mod h1:JAlM8MvJe8wmxCU4Bli9HhUf9+ttbYbLASfIpnQbh74=
+k8s.io/client-go v0.0.0-20181219152756-3dd551c0f083 h1:+Qf/nITucAbm09aIdxvoA+7X0BwaXmQGVoR8k7Ynk9o=
+k8s.io/client-go v0.0.0-20181219152756-3dd551c0f083/go.mod h1:7vJpHMYJwNQCWgzmNV+VYUl1zCObLyodBc8nIyt8L5s=

hack/make/test-integration

@@ -10,6 +10,5 @@ bundle_test_integration() {
 (
 	make binary-local ${BUILDTAGS:+BUILDTAGS="$BUILDTAGS"}
 	make install
-	export GO15VENDOREXPERIMENT=1
 	bundle_test_integration
 ) 2>&1

hack/make/test-system

@@ -0,0 +1,18 @@
+#!/bin/bash
+set -e
+
+# Before running podman for the first time, make sure
+# to set storage to vfs (not overlay): podman-in-podman
+# doesn't work with overlay. And, disable mountopt,
+# which causes error with vfs.
+sed -i \
+    -e 's/^driver\s*=.*/driver = "vfs"/' \
+    -e 's/^mountopt/#mountopt/' \
+    /etc/containers/storage.conf
+
+# Build skopeo, install into /usr/bin
+make binary-local ${BUILDTAGS:+BUILDTAGS="$BUILDTAGS"}
+make install
+
+# Run tests
+SKOPEO_BINARY=/usr/bin/skopeo bats --tap systemtest

hack/travis_osx.sh

@@ -9,7 +9,7 @@ mkdir -vp ${_containers}
 ln -vsf $(pwd) ${_containers}/skopeo
 
 go version
-go get -u github.com/cpuguy83/go-md2man golang.org/x/lint/golint
+GO111MODULE=off go get -u github.com/cpuguy83/go-md2man golang.org/x/lint/golint
 
 cd ${_containers}/skopeo
 make validate-local test-unit-local binary-local

integration/blocked_test.go

@@ -0,0 +1,34 @@
+package main
+
+import (
+	"github.com/go-check/check"
+)
+
+const blockedRegistriesConf = "./fixtures/blocked-registries.conf"
+const blockedErrorRegex = `.*registry registry-blocked.com is blocked in .*`
+
+func (s *SkopeoSuite) TestCopyBlockedSource(c *check.C) {
+	assertSkopeoFails(c, blockedErrorRegex,
+		"--registries-conf", blockedRegistriesConf, "copy",
+		"docker://registry-blocked.com/image:test",
+		"docker://registry-unblocked.com/image:test")
+}
+
+func (s *SkopeoSuite) TestCopyBlockedDestination(c *check.C) {
+	assertSkopeoFails(c, blockedErrorRegex,
+		"--registries-conf", blockedRegistriesConf, "copy",
+		"docker://registry-unblocked.com/image:test",
+		"docker://registry-blocked.com/image:test")
+}
+
+func (s *SkopeoSuite) TestInspectBlocked(c *check.C) {
+	assertSkopeoFails(c, blockedErrorRegex,
+		"--registries-conf", blockedRegistriesConf, "inspect",
+		"docker://registry-blocked.com/image:test")
+}
+
+func (s *SkopeoSuite) TestDeleteBlocked(c *check.C) {
+	assertSkopeoFails(c, blockedErrorRegex,
+		"--registries-conf", blockedRegistriesConf, "delete",
+		"docker://registry-blocked.com/image:test")
+}

integration/check_test.go

@@ -87,3 +87,7 @@ func (s *SkopeoSuite) TestNoNeedAuthToPrivateRegistryV2ImageNotFound(c *check.C)
 	wanted = ".*unauthorized: authentication required.*"
 	c.Assert(string(out), check.Not(check.Matches), "(?s)"+wanted) // (?s) : '.' will also match newlines
 }
+
+func (s *SkopeoSuite) TestInspectFailsWhenReferenceIsInvalid(c *check.C) {
+	assertSkopeoFails(c, `.*Invalid image name.*`, "inspect", "unknown")
+}

integration/copy_test.go

@@ -14,7 +14,7 @@ import (
 	"github.com/containers/image/manifest"
 	"github.com/containers/image/signature"
 	"github.com/go-check/check"
-	"github.com/opencontainers/go-digest"
+	digest "github.com/opencontainers/go-digest"
 	imgspecv1 "github.com/opencontainers/image-spec/specs-go/v1"
 	"github.com/opencontainers/image-tools/image"
 )
@@ -64,7 +64,7 @@ func (s *CopySuite) SetUpSuite(c *check.C) {
 	os.Setenv("GNUPGHOME", s.gpgHome)
 
 	for _, key := range []string{"personal", "official"} {
-		batchInput := fmt.Sprintf("Key-Type: RSA\nName-Real: Test key - %s\nName-email: %s@example.com\n%%commit\n",
+		batchInput := fmt.Sprintf("Key-Type: RSA\nName-Real: Test key - %s\nName-email: %s@example.com\n%%no-protection\n%%commit\n",
 			key, key)
 		runCommandWithInput(c, batchInput, gpgBinary, "--batch", "--gen-key")
 
@@ -696,3 +696,7 @@ func (s *SkopeoSuite) TestFailureCopySrcWithMirrorAndPrefixUnavailable(c *check.
 	assertSkopeoFails(c, ".*no such host.*", "--registries-conf="+regConfFixture, "copy",
 		"docker://gcr.invalid/wrong/prefix/busybox", "dir:"+dir)
 }
+
+func (s *CopySuite) TestCopyFailsWhenReferenceIsInvalid(c *check.C) {
+	assertSkopeoFails(c, `.*Invalid image name.*`, "copy", "unknown:transport", "unknown:test")
+}

integration/fixtures/blocked-registries.conf

@@ -0,0 +1,6 @@
+[[registry]]
+location = "registry-unblocked.com"
+
+[[registry]]
+location = "registry-blocked.com"
+blocked = true

integration/signing_test.go

@@ -44,7 +44,7 @@ func (s *SigningSuite) SetUpSuite(c *check.C) {
 	c.Assert(err, check.IsNil)
 	os.Setenv("GNUPGHOME", s.gpgHome)
 
-	runCommandWithInput(c, "Key-Type: RSA\nName-Real: Testing user\n%commit\n", gpgBinary, "--homedir", s.gpgHome, "--batch", "--gen-key")
+	runCommandWithInput(c, "Key-Type: RSA\nName-Real: Testing user\n%no-protection\n%commit\n", gpgBinary, "--homedir", s.gpgHome, "--batch", "--gen-key")
 
 	lines, err := exec.Command(gpgBinary, "--homedir", s.gpgHome, "--with-colons", "--no-permission-warning", "--fingerprint").Output()
 	c.Assert(err, check.IsNil)

systemtest/001-basic.bats

@@ -0,0 +1,19 @@
+#!/usr/bin/env bats
+#
+# Simplest set of skopeo tests. If any of these fail, we have serious problems.
+#
+
+load helpers
+
+# Override standard setup! We don't yet trust anything
+function setup() {
+    :
+}
+
+@test "skopeo version emits reasonable output" {
+    run_skopeo --version
+
+    expect_output --substring "skopeo version [0-9.]+"
+}
+
+# vim: filetype=sh

systemtest/010-inspect.bats

@@ -0,0 +1,67 @@
+#!/usr/bin/env bats
+#
+# Simplest test for skopeo inspect
+#
+
+load helpers
+
+@test "inspect: basic" {
+    workdir=$TESTDIR/inspect
+
+    remote_image=docker://quay.io/libpod/alpine_labels:latest
+    # Inspect remote source, then pull it. There's a small race condition
+    # in which the remote image can get updated between the inspect and
+    # the copy; let's just not worry about it.
+    run_skopeo inspect $remote_image
+    inspect_remote=$output
+
+    # Now pull it into a directory
+    run_skopeo copy $remote_image dir:$workdir
+    expect_output --substring "Getting image source signatures"
+    expect_output --substring "Writing manifest to image destination"
+
+    # Unpacked contents must include a manifest and version
+    [ -e $workdir/manifest.json ]
+    [ -e $workdir/version ]
+
+    # Now run inspect locally
+    run_skopeo inspect dir:$workdir
+    inspect_local=$output
+
+    # Each SHA-named file must be listed in the output of 'inspect'
+    for sha in $(find $workdir -type f | xargs -l1 basename | egrep '^[0-9a-f]{64}$'); do
+        expect_output --from="$inspect_local" --substring "sha256:$sha" \
+                      "Locally-extracted SHA file is present in 'inspect'"
+    done
+
+    # Simple sanity check on 'inspect' output.
+    # For each of the given keys (LHS of the table below):
+    #    1) Get local and remote values
+    #    2) Sanity-check local value using simple expression
+    #    3) Confirm that local and remote values match.
+    #
+    # The reason for (2) is to make sure that we don't compare bad results
+    #
+    # The reason for a hardcoded list, instead of 'jq keys', is that RepoTags
+    # is always empty locally, but a list remotely.
+    while read key expect; do
+        local=$(echo "$inspect_local" | jq -r ".$key")
+        remote=$(echo "$inspect_remote" | jq -r ".$key")
+
+        expect_output --from="$local" --substring "$expect" \
+                  "local $key is sane"
+
+        expect_output --from="$remote" "$local" \
+                      "local $key matches remote"
+    done <<END_EXPECT
+Architecture       amd64
+Created            [0-9-]+T[0-9:]+\.[0-9]+Z
+Digest             sha256:[0-9a-f]{64}
+DockerVersion      [0-9]+\.[0-9][0-9.-]+
+Labels             \\\{.*PODMAN.*podman.*\\\}
+Layers             \\\[.*sha256:.*\\\]
+Os                 linux
+END_EXPECT
+}
+
+# vim: filetype=sh

systemtest/020-copy.bats

@@ -0,0 +1,79 @@
+#!/usr/bin/env bats
+#
+# Copy tests
+#
+
+load helpers
+
+function setup() {
+    standard_setup
+
+    start_registry reg
+}
+
+# From remote, to dir1, to local, to dir2;
+# compare dir1 and dir2, expect no changes
+@test "copy: dir, round trip" {
+    local remote_image=docker://busybox:latest
+    local localimg=docker://localhost:5000/busybox:unsigned
+
+    local dir1=$TESTDIR/dir1
+    local dir2=$TESTDIR/dir2
+
+    run_skopeo copy          $remote_image  dir:$dir1
+    run_skopeo copy --dest-tls-verify=false dir:$dir1  $localimg
+    run_skopeo copy  --src-tls-verify=false            $localimg  dir:$dir2
+
+    # Both extracted copies must be identical
+    diff -urN $dir1 $dir2
+}
+
+# Same as above, but using 'oci:' instead of 'dir:' and with a :latest tag
+@test "copy: oci, round trip" {
+    local remote_image=docker://busybox:latest
+    local localimg=docker://localhost:5000/busybox:unsigned
+
+    local dir1=$TESTDIR/oci1
+    local dir2=$TESTDIR/oci2
+
+    run_skopeo copy          $remote_image  oci:$dir1:latest
+    run_skopeo copy --dest-tls-verify=false oci:$dir1:latest  $localimg
+    run_skopeo copy  --src-tls-verify=false                   $localimg  oci:$dir2:latest
+
+    # Both extracted copies must be identical
+    diff -urN $dir1 $dir2
+}
+
+# Same image, extracted once with :tag and once without
+@test "copy: oci w/ and w/o tags" {
+    local remote_image=docker://busybox:latest
+
+    local dir1=$TESTDIR/dir1
+    local dir2=$TESTDIR/dir2
+
+    run_skopeo copy $remote_image oci:$dir1
+    run_skopeo copy $remote_image oci:$dir2:withtag
+
+    # Both extracted copies must be identical, except for index.json
+    diff -urN --exclude=index.json $dir1 $dir2
+
+    # ...which should differ only in the tag. (But that's too hard to check)
+    grep '"org.opencontainers.image.ref.name":"withtag"' $dir2/index.json
+}
+
+# This one seems unlikely to get fixed
+@test "copy: bug 651" {
+    skip "Enable this once skopeo issue #651 has been fixed"
+
+    run_skopeo copy --dest-tls-verify=false \
+               docker://quay.io/libpod/alpine_labels:latest \
+               docker://localhost:5000/foo
+}
+
+teardown() {
+    podman rm -f reg
+
+    standard_teardown
+}
+
+# vim: filetype=sh

systemtest/030-local-registry-tls.bats

@@ -0,0 +1,32 @@
+#!/usr/bin/env bats
+#
+# Confirm that skopeo will push to and pull from a local
+# registry with locally-created TLS certificates.
+#
+load helpers
+
+function setup() {
+    standard_setup
+
+    start_registry --with-cert reg
+}
+
+@test "local registry, with cert" {
+    # Push to local registry...
+    run_skopeo copy --dest-cert-dir=$TESTDIR/client-auth \
+               docker://busybox:latest \
+               docker://localhost:5000/busybox:unsigned
+
+    # ...and pull it back out
+    run_skopeo copy --src-cert-dir=$TESTDIR/client-auth \
+               docker://localhost:5000/busybox:unsigned \
+               dir:$TESTDIR/extracted
+}
+
+teardown() {
+    podman rm -f reg
+
+    standard_teardown
+}
+
+# vim: filetype=sh

systemtest/040-local-registry-auth.bats

@@ -0,0 +1,78 @@
+#!/usr/bin/env bats
+#
+# Tests with a local registry with auth
+#
+
+load helpers
+
+function setup() {
+    standard_setup
+
+    # Remove old/stale cred file
+    _cred_dir=$TESTDIR/credentials
+    export XDG_RUNTIME_DIR=$_cred_dir
+    mkdir -p $_cred_dir/containers
+    rm -f $_cred_dir/containers/auth.json
+
+    # Start authenticated registry with random password
+    testuser=testuser
+    testpassword=$(random_string 15)
+
+    start_registry --testuser=$testuser --testpassword=$testpassword reg
+}
+
+@test "auth: credentials on command line" {
+    # No creds
+    run_skopeo 1 inspect --tls-verify=false docker://localhost:5000/nonesuch
+    expect_output --substring "unauthorized: authentication required"
+
+    # Wrong user
+    run_skopeo 1 inspect --tls-verify=false --creds=baduser:badpassword \
+               docker://localhost:5000/nonesuch
+    expect_output --substring "unauthorized: authentication required"
+
+    # Wrong password
+    run_skopeo 1 inspect --tls-verify=false --creds=$testuser:badpassword \
+               docker://localhost:5000/nonesuch
+    expect_output --substring "unauthorized: authentication required"
+
+    # Correct creds, but no such image
+    run_skopeo 1 inspect --tls-verify=false --creds=$testuser:$testpassword \
+               docker://localhost:5000/nonesuch
+    expect_output --substring "manifest unknown: manifest unknown"
+
+    # These should pass
+    run_skopeo copy --dest-tls-verify=false --dcreds=$testuser:$testpassword \
+               docker://busybox:latest docker://localhost:5000/busybox:mine
+    run_skopeo inspect --tls-verify=false --creds=$testuser:$testpassword \
+               docker://localhost:5000/busybox:mine
+    expect_output --substring "localhost:5000/busybox"
+}
+
+@test "auth: credentials via podman login" {
+    # Logged in: skopeo should work
+    podman login --tls-verify=false -u $testuser -p $testpassword localhost:5000
+
+    run_skopeo copy --dest-tls-verify=false \
+               docker://busybox:latest docker://localhost:5000/busybox:mine
+    run_skopeo inspect --tls-verify=false docker://localhost:5000/busybox:mine
+    expect_output --substring "localhost:5000/busybox"
+
+    # Logged out: should fail
+    podman logout localhost:5000
+
+    run_skopeo 1 inspect --tls-verify=false docker://localhost:5000/busybox:mine
+    expect_output --substring "unauthorized: authentication required"
+}
+
+teardown() {
+    podman rm -f reg
+
+    if [[ -n $_cred_dir ]]; then
+        rm -rf $_cred_dir
+    fi
+
+    standard_teardown
+}
+
+# vim: filetype=sh

systemtest/050-signing.bats

@@ -0,0 +1,151 @@
+#!/usr/bin/env bats
+#
+# Tests with gpg signing
+#
+
+load helpers
+
+function setup() {
+    standard_setup
+
+    # Create dummy gpg keys
+    export GNUPGHOME=$TESTDIR/skopeo-gpg
+    mkdir --mode=0700 $GNUPGHOME
+
+    # gpg on f30 needs this, otherwise:
+    #   gpg: agent_genkey failed: Inappropriate ioctl for device
+    # ...but gpg on f29 (and, probably, Ubuntu) doesn't grok this
+    GPGOPTS='--pinentry-mode loopback'
+    if gpg --pinentry-mode asdf 2>&1 | grep -qi 'Invalid option'; then
+        GPGOPTS=
+    fi
+
+    for k in alice bob;do
+        gpg --batch $GPGOPTS --gen-key --passphrase '' <<END_GPG
+Key-Type: RSA
+Name-Real: Test key - $k
+Name-email: $k@test.redhat.com
+%commit
+END_GPG
+
+        gpg --armor --export $k@test.redhat.com >$GNUPGHOME/pubkey-$k.gpg
+    done
+
+    # Registries. The important part here seems to be sigstore,
+    # because (I guess?) the registry itself has no mechanism
+    # for storing or validating signatures.
+    REGISTRIES_D=$TESTDIR/registries.d
+    mkdir $REGISTRIES_D $TESTDIR/sigstore
+    cat >$REGISTRIES_D/registries.yaml <<EOF
+docker:
+   localhost:5000:
+        sigstore: file://$TESTDIR/sigstore
+EOF
+
+    # Policy file. Basically, require /myns/alice and /myns/bob
+    # to be signed; allow /open; and reject anything else.
+    POLICY_JSON=$TESTDIR/policy.json
+    cat >$POLICY_JSON <<END_POLICY_JSON
+{
+    "default": [
+        {
+            "type": "reject"
+        }
+    ],
+    "transports": {
+        "docker": {
+            "localhost:5000/myns/alice": [
+                {
+                    "type": "signedBy",
+                    "keyType": "GPGKeys",
+                    "keyPath": "$GNUPGHOME/pubkey-alice.gpg"
+                }
+            ],
+            "localhost:5000/myns/bob": [
+                {
+                    "type": "signedBy",
+                    "keyType": "GPGKeys",
+                    "keyPath": "$GNUPGHOME/pubkey-bob.gpg"
+                }
+            ],
+            "localhost:5000/open": [
+                {
+                    "type": "insecureAcceptAnything"
+                }
+            ]
+        }
+    }
+}
+END_POLICY_JSON
+
+    start_registry reg
+}
+
+@test "signing" {
+    run_skopeo '?' standalone-sign /dev/null busybox alice@test.redhat.com -o /dev/null
+    if [[ "$output" =~ 'signing is not supported' ]]; then
+        skip "skopeo built without support for creating signatures"
+        return 1
+    fi
+    if [ "$status" -ne 0 ]; then
+        die "exit code is $status; expected $expected_rc"
+    fi
+
+    # Cache local copy
+    run_skopeo copy docker://busybox:latest dir:$TESTDIR/busybox
+
+    # Push a bunch of images. Do so *without* --policy flag; this lets us
+    # sign or not, creating images that will or won't conform to policy.
+    while read path sig comments; do
+        local sign_opt=
+        if [[ $sig != '-' ]]; then
+            sign_opt="--sign-by=${sig}@test.redhat.com"
+        fi
+        run_skopeo --registries.d $REGISTRIES_D \
+                   copy --dest-tls-verify=false \
+                   $sign_opt \
+                   dir:$TESTDIR/busybox \
+                   docker://localhost:5000$path
+    done <<END_PUSH
+/myns/alice:signed        alice    # Properly-signed image
+/myns/alice:unsigned      -        # Unsigned image to path that requires signature
+/myns/bob:signedbyalice   alice    # Bad signature: image under /bob
+/myns/carol:latest        -        # No signature
+/open/forall:latest       -        # No signature, but none needed
+END_PUSH
+
+    # Done pushing. Now try to fetch. From here on we use the --policy option.
+    # The table below lists the paths to fetch, and the expected errors (or
+    # none, if we expect them to pass).
+    while read path expected_error; do
+        expected_rc=
+        if [[ -n $expected_error ]]; then
+            expected_rc=1
+        fi
+
+        rm -rf $TESTDIR/d
+        run_skopeo $expected_rc \
+                   --registries.d $REGISTRIES_D \
+                   --policy $POLICY_JSON \
+                   copy --src-tls-verify=false \
+                   docker://localhost:5000$path \
+                   dir:$TESTDIR/d
+        if [[ -n $expected_error ]]; then
+            expect_output --substring "Source image rejected: $expected_error"
+        fi
+    done <<END_TESTS
+/myns/alice:signed
+/myns/bob:signedbyalice    Invalid GPG signature
+/myns/alice:unsigned       Signature for identity localhost:5000/myns/alice:signed is not accepted
+/myns/carol:latest         Running image docker://localhost:5000/myns/carol:latest is rejected by policy.
+/open/forall:latest
+END_TESTS
+}
+
+teardown() {
+    podman rm -f reg
+
+    standard_teardown
+}
+
+# vim: filetype=sh

systemtest/060-delete.bats

@@ -0,0 +1,37 @@
+#!/usr/bin/env bats
+#
+# Copy tests
+#
+
+load helpers
+
+function setup() {
+    standard_setup
+
+    start_registry --enable-delete=true reg
+}
+
+# delete image from registry
+@test "delete: remove image from registry" {
+    local remote_image=docker://busybox:latest
+    local localimg=docker://localhost:5000/busybox:unsigned
+    local output=
+
+    run_skopeo copy --dest-tls-verify=false $remote_image $localimg
+    output=$(run_skopeo inspect --tls-verify=false --raw $localimg)
+    echo $output | grep "vnd.docker.distribution.manifest.v2+json"
+
+    run_skopeo delete --tls-verify=false $localimg
+
+    # make sure image is removed from registry
+    expected_rc=1
+    run_skopeo $expected_rc inspect --tls-verify=false $localimg
+}
+
+teardown() {
+    podman rm -f reg
+
+    standard_teardown
+}
+
+# vim: filetype=sh

systemtest/helpers.bash

@@ -0,0 +1,350 @@
+#!/bin/bash
+
+SKOPEO_BINARY=${SKOPEO_BINARY:-$(dirname ${BASH_SOURCE})/../skopeo}
+
+# Default timeout for a skopeo command.
+SKOPEO_TIMEOUT=${SKOPEO_TIMEOUT:-300}
+
+###############################################################################
+# BEGIN setup/teardown
+
+# Provide common setup and teardown functions, but do not name them such!
+# That way individual tests can override with their own setup/teardown,
+# while retaining the ability to include these if they so desire.
+
+function standard_setup() {
+    # Argh. Although BATS provides $BATS_TMPDIR, it's just /tmp!
+    # That's bloody worthless. Let's make our own, in which subtests
+    # can write whatever they like and trust that it'll be deleted
+    # on cleanup.
+    TESTDIR=$(mktemp -d --tmpdir=${BATS_TMPDIR:-/tmp} skopeo_bats.XXXXXX)
+}
+
+function standard_teardown() {
+    if [[ -n $TESTDIR ]]; then
+        rm -rf $TESTDIR
+    fi
+}
+
+# Individual .bats files may override or extend these
+function setup() {
+    standard_setup
+}
+
+function teardown() {
+    standard_teardown
+}
+
+# END   setup/teardown
+###############################################################################
+# BEGIN standard helpers for running skopeo and testing results
+
+#################
+#  run_skopeo  #  Invoke skopeo, with timeout, using BATS 'run'
+#################
+#
+# This is the preferred mechanism for invoking skopeo:
+#
+#  * we use 'timeout' to abort (with a diagnostic) if something
+#    takes too long; this is preferable to a CI hang.
+#  * we log the command run and its output. This doesn't normally
+#    appear in BATS output, but it will if there's an error.
+#  * we check exit status. Since the normal desired code is 0,
+#    that's the default; but the first argument can override:
+#
+#     run_skopeo 125  nonexistent-subcommand
+#     run_skopeo '?'  some-other-command       # let our caller check status
+#
+# Since we use the BATS 'run' mechanism, $output and $status will be
+# defined for our caller.
+#
+function run_skopeo() {
+    # Number as first argument = expected exit code; default 0
+    expected_rc=0
+    case "$1" in
+        [0-9])           expected_rc=$1; shift;;
+        [1-9][0-9])      expected_rc=$1; shift;;
+        [12][0-9][0-9])  expected_rc=$1; shift;;
+        '?')             expected_rc=  ; shift;;  # ignore exit code
+    esac
+
+    # Remember command args, for possible use in later diagnostic messages
+    MOST_RECENT_SKOPEO_COMMAND="skopeo $*"
+
+    # stdout is only emitted upon error; this echo is to help a debugger
+    echo "\$ $SKOPEO_BINARY $*"
+    run timeout --foreground --kill=10 $SKOPEO_TIMEOUT ${SKOPEO_BINARY} "$@"
+    # without "quotes", multiple lines are glommed together into one
+    if [ -n "$output" ]; then
+        echo "$output"
+    fi
+    if [ "$status" -ne 0 ]; then
+        echo -n "[ rc=$status ";
+        if [ -n "$expected_rc" ]; then
+            if [ "$status" -eq "$expected_rc" ]; then
+                echo -n "(expected) ";
+            else
+                echo -n "(** EXPECTED $expected_rc **) ";
+            fi
+        fi
+        echo "]"
+    fi
+
+    if [ "$status" -eq 124 -o "$status" -eq 137 ]; then
+        # FIXME: 'timeout -v' requires coreutils-8.29; travis seems to have
+        #        an older version. If/when travis updates, please add -v
+        #        to the 'timeout' command above, and un-comment this out:
+        # if expr "$output" : ".*timeout: sending" >/dev/null; then
+        echo "*** TIMED OUT ***"
+        false
+    fi
+
+    if [ -n "$expected_rc" ]; then
+        if [ "$status" -ne "$expected_rc" ]; then
+            die "exit code is $status; expected $expected_rc"
+        fi
+    fi
+}
+
+#########
+#  die  #  Abort with helpful message
+#########
+function die() {
+    echo "#/vvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvv"  >&2
+    echo "#| FAIL: $*"                                           >&2
+    echo "#\\^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^" >&2
+    false
+}
+
+###################
+#  expect_output  #  Compare actual vs expected string; fail if mismatch
+###################
+#
+# Compares $output against the given string argument. Optional second
+# argument is descriptive text to show as the error message (default:
+# the command most recently run by 'run_skopeo'). This text can be
+# useful to isolate a failure when there are multiple identical
+# run_skopeo invocations, and the difference is solely in the
+# config or setup; see, e.g., run.bats:run-cmd().
+#
+# By default we run an exact string comparison; use --substring to
+# look for the given string anywhere in $output.
+#
+# By default we look in "$output", which is set in run_skopeo().
+# To override, use --from="some-other-string" (e.g. "${lines[0]}")
+#
+# Examples:
+#
+#   expect_output "this is exactly what we expect"
+#   expect_output "foo=bar"  "description of this particular test"
+#   expect_output --from="${lines[0]}"  "expected first line"
+#
+function expect_output() {
+    # By default we examine $output, the result of run_skopeo
+    local actual="$output"
+    local check_substring=
+
+    # option processing: recognize --from="...", --substring
+    local opt
+    for opt; do
+        local value=$(expr "$opt" : '[^=]*=\(.*\)')
+        case "$opt" in
+            --from=*)       actual="$value";   shift;;
+            --substring)    check_substring=1; shift;;
+            --)             shift; break;;
+            -*)             die "Invalid option '$opt'" ;;
+            *)              break;;
+        esac
+    done
+
+    local expect="$1"
+    local testname="${2:-${MOST_RECENT_SKOPEO_COMMAND:-[no test name given]}}"
+
+    if [ -z "$expect" ]; then
+        if [ -z "$actual" ]; then
+            return
+        fi
+        expect='[no output]'
+    elif [ "$actual" = "$expect" ]; then
+	return
+    elif [ -n "$check_substring" ]; then
+        if [[ "$actual" =~ $expect ]]; then
+            return
+        fi
+    fi
+
+    # This is a multi-line message, which may in turn contain multi-line
+    # output, so let's format it ourself, readably
+    local -a actual_split
+    readarray -t actual_split <<<"$actual"
+    printf "#/vvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvv\n" >&2
+    printf "#|     FAIL: $testname\n"                          >&2
+    printf "#| expected: '%s'\n" "$expect"                     >&2
+    printf "#|   actual: '%s'\n" "${actual_split[0]}"          >&2
+    local line
+    for line in "${actual_split[@]:1}"; do
+        printf "#|         > '%s'\n" "$line"                   >&2
+    done
+    printf "#\\^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^\n" >&2
+    false
+}
+
+#######################
+#  expect_line_count  #  Check the expected number of output lines
+#######################
+#
+# ...from the most recent run_skopeo command
+#
+function expect_line_count() {
+    local expect="$1"
+    local testname="${2:-${MOST_RECENT_SKOPEO_COMMAND:-[no test name given]}}"
+
+    local actual="${#lines[@]}"
+    if [ "$actual" -eq "$expect" ]; then
+        return
+    fi
+
+    printf "#/vvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvv\n"          >&2
+    printf "#| FAIL: $testname\n"                                       >&2
+    printf "#| Expected %d lines of output, got %d\n" $expect $actual   >&2
+    printf "#| Output was:\n"                                           >&2
+    local line
+    for line in "${lines[@]}"; do
+        printf "#| >%s\n" "$line"                                       >&2
+    done
+    printf "#\\^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^\n"         >&2
+    false
+}
+
+# END   standard helpers for running skopeo and testing results
+###############################################################################
+# BEGIN helpers for starting/stopping registries
+
+####################
+#  start_registry  #  Run a local registry container
+####################
+#
+# Usage:  start_registry [OPTIONS] NAME
+#
+#   OPTIONS
+#       --port=NNNN         Port to listen on (default: 5000)
+#       --testuser=XXX      Require authentication; this is the username
+#       --testpassword=XXX  ...and the password (these two go together)
+#       --with-cert         Create a cert for running with TLS (not working)
+#       --enable-delete     Set allowing registry deletions (default: false)
+#
+#   NAME is the container name to assign.
+#
+start_registry() {
+    local port=5000
+    local testuser=
+    local testpassword=
+    local create_cert=
+    local enable_delete=false
+
+    # option processing: recognize options for running the registry
+    # in different modes.
+    local opt
+    for opt; do
+        local value=$(expr "$opt" : '[^=]*=\(.*\)')
+        case "$opt" in
+            --port=*)           port="$value";          shift;;
+            --testuser=*)       testuser="$value";      shift;;
+            --testpassword=*)   testpassword="$value";  shift;;
+            --with-cert)        create_cert=1;          shift;;
+            --enable-delete=*)  enable_delete="$value"; shift;;
+            -*)                 die "Invalid option '$opt'" ;;
+            *)                  break;;
+        esac
+    done
+
+    local name=${1?start_registry() invoked without a NAME}
+
+    # Temp directory must be defined and must exist
+    [[ -n $TESTDIR && -d $TESTDIR ]]
+
+    AUTHDIR=$TESTDIR/auth
+    mkdir -p $AUTHDIR
+
+    local -a reg_args=(-v $AUTHDIR:/auth:Z -p $port:5000)
+    if [[ "$enable_delete" == "true" ]]; then
+        reg_args+=( -e REGISTRY_STORAGE_DELETE_ENABLED=true)
+    fi
+
+    # cgroup option necessary under podman-in-podman (CI tests),
+    # and doesn't seem to do any harm otherwise.
+    PODMAN="podman --cgroup-manager=cgroupfs"
+
+    # Called with --testuser? Create an htpasswd file
+    if [[ -n $testuser ]]; then
+        if [[ -z $testpassword ]]; then
+            die "start_registry() invoked with testuser but no testpassword"
+        fi
+
+        if ! egrep -q "^$testuser:" $AUTHDIR/htpasswd; then
+            $PODMAN run --rm --entrypoint htpasswd registry:2 \
+                   -Bbn $testuser $testpassword >> $AUTHDIR/htpasswd
+        fi
+
+        reg_args+=(
+            -e REGISTRY_AUTH=htpasswd
+            -e REGISTRY_AUTH_HTPASSWD_PATH=/auth/htpasswd
+            -e REGISTRY_AUTH_HTPASSWD_REALM="Registry Realm"
+        )
+    fi
+
+    # Called with --with-cert? Create certificates.
+    if [[ -n $create_cert ]]; then
+        CERT=$AUTHDIR/domain.crt
+        if [ ! -e $CERT ]; then
+            openssl req -newkey rsa:4096 -nodes -sha256 \
+                    -keyout $AUTHDIR/domain.key -x509 -days 2 \
+                    -out $CERT \
+                    -subj "/C=US/ST=Foo/L=Bar/O=Red Hat, Inc./CN=localhost"
+        fi
+
+        reg_args+=(
+            -e REGISTRY_HTTP_TLS_CERTIFICATE=/auth/domain.crt
+            -e REGISTRY_HTTP_TLS_KEY=/auth/domain.key
+        )
+
+        # Copy .crt file to a directory *without* the .key one, so we can
+        # test the client. (If client sees a matching .key file, it fails)
+        # Thanks to Miloslav Trmac for this hint.
+        mkdir -p $TESTDIR/client-auth
+        cp $CERT $TESTDIR/client-auth/
+    fi
+
+    $PODMAN run -d --name $name "${reg_args[@]}" registry:2
+
+    # Wait for registry to actually come up
+    timeout=10
+    while [[ $timeout -ge 1 ]]; do
+        if curl localhost:$port/; then
+            return
+        fi
+
+        timeout=$(expr $timeout - 1)
+        sleep 1
+    done
+    die "Timed out waiting for registry container to respond on :$port"
+}
+
+# END   helpers for starting/stopping registries
+###############################################################################
+# BEGIN miscellaneous tools
+
+###################
+#  random_string  #  Returns a pseudorandom human-readable string
+###################
+#
+# Numeric argument, if present, is desired length of string
+#
+function random_string() {
+    local length=${1:-10}
+
+    head /dev/urandom | tr -dc a-zA-Z0-9 | head -c$length
+}
+
+# END   miscellaneous tools
+###############################################################################

systemtest/run-tests

@@ -0,0 +1,16 @@
+#!/bin/bash
+#
+# run-tests - simple wrapper allowing shortcuts on invocation
+#
+
+TEST_DIR=$(dirname $0)
+TESTS=$TEST_DIR
+
+for i; do
+    case "$i" in
+        *.bats)    TESTS=$i ;;
+        *)         TESTS=$(echo $TEST_DIR/*$i*.bats) ;;
+    esac
+done
+
+bats $TESTS

vendor.conf

@@ -1,67 +0,0 @@
-
-github.com/urfave/cli v1.20.0
-github.com/kr/pretty v0.1.0
-github.com/kr/text v0.1.0
-github.com/containers/image 2c0349c99af7d90694b3faa0e9bde404d407b145
-github.com/containers/buildah 810efa340ab43753034e2ed08ec290e4abab7e72
-github.com/vbauerster/mpb v3.3.4
-github.com/mattn/go-isatty v0.0.4
-github.com/VividCortex/ewma v1.1.1
-golang.org/x/sync 42b317875d0fa942474b76e1b46a6060d720ae6e
-github.com/opencontainers/go-digest c9281466c8b2f606084ac71339773efd177436e7
-github.com/containers/storage v1.12.3
-github.com/sirupsen/logrus v1.0.0
-github.com/go-check/check v1
-github.com/stretchr/testify v1.1.3
-github.com/davecgh/go-spew v1.1.1
-github.com/pmezard/go-difflib 5d4384ee4fb2527b0a1256a821ebfc92f91efefc
-github.com/pkg/errors v0.8.1
-golang.org/x/crypto a4c6cb3142f211c99e4bf4cd769535b29a9b616f
-github.com/ulikunitz/xz v0.5.4
-github.com/etcd-io/bbolt v1.3.2
-# docker deps from https://github.com/docker/docker/blob/v1.11.2/hack/vendor.sh
-github.com/docker/docker da99009bbb1165d1ac5688b5c81d2f589d418341
-github.com/docker/go-connections 7beb39f0b969b075d1325fecb092faf27fd357b6
-github.com/containerd/continuity d8fb8589b0e8e85b8c8bbaa8840226d0dfeb7371
-github.com/vbatts/tar-split v0.10.2
-github.com/gorilla/context 14f550f51a
-github.com/gorilla/mux e444e69cbd
-github.com/docker/go-units 8a7beacffa3009a9ac66bad506b18ffdd110cf97
-golang.org/x/net 45ffb0cd1ba084b73e26dee67e667e1be5acce83
-github.com/gogo/protobuf fcdc5011193ff531a548e9b0301828d5a5b97fd8
-# end docker deps
-golang.org/x/text e6919f6577db79269a6443b9dc46d18f2238fb5d
-github.com/docker/distribution 5f6282db7d65e6d72ad7c2cc66310724a57be716
-# docker/distributions dependencies
-# end of docker/distribution dependencies
-github.com/docker/libtrust aabc10ec26b754e797f9028f4589c5b7bd90dc20
-github.com/docker/docker-credential-helpers d68f9aeca33f5fd3f08eeae5e9d175edf4e731d1
-github.com/opencontainers/runc v1.0.0-rc6
-github.com/opencontainers/image-spec 7b1e489870acb042978a3935d2fb76f8a79aff81
-# -- start OCI image validation requirements.
-github.com/opencontainers/runtime-spec v1.0.0
-github.com/opencontainers/image-tools 6d941547fa1df31900990b3fb47ec2468c9c6469
-github.com/xeipuuv/gojsonpointer 4e3ac2762d5f479393488629ee9370b50873b3a6
-github.com/xeipuuv/gojsonreference bd5ef7bd5415a7ac448318e64f11a24cd21e594b
-github.com/xeipuuv/gojsonschema v1.1.0
-go4.org ce4c26f7be8eb27dc77f996b08d286dd80bc4a01 https://github.com/camlistore/go4
-github.com/ostreedev/ostree-go 56f3a639dbc0f2f5051c6d52dade28a882ba78ce
-# -- end OCI image validation requirements
-github.com/mtrmac/gpgme b2432428689ca58c2b8e8dea9449d3295cf96fc9
-# openshift/origin' k8s dependencies as of OpenShift v1.1.5
-k8s.io/client-go kubernetes-1.10.13-beta.0
-github.com/ghodss/yaml 73d445a93680fa1a78ae23a5839bad48f32ba1ee
-gopkg.in/yaml.v2 d466437aa4adc35830964cffc5b5f262c63ddcb4
-github.com/imdario/mergo 6633656539c1639d9d78127b7d47c622b5d7b6dc
-# containers/storage's dependencies that aren't already being pulled in
-github.com/mistifyio/go-zfs 22c9b32c84eb0d0c6f4043b6e90fc94073de92fa
-github.com/pborman/uuid v1.0
-github.com/opencontainers/selinux v1.1
-golang.org/x/sys 43e60d72a8e2bd92ee98319ba9a384a0e9837c08
-github.com/tchap/go-patricia v2.2.6
-github.com/BurntSushi/toml v0.3.1
-github.com/pquerna/ffjson d49c2bc1aa135aad0c6f4fc2056623ec78f5d5ac
-github.com/syndtr/gocapability d98352740cb2c55f81556b63d4a1ec64c5a319c2
-github.com/klauspost/pgzip v1.2.1
-github.com/klauspost/compress v1.4.1
-github.com/klauspost/cpuid v1.2.0

vendor/github.com/BurntSushi/toml/.gitignore

@@ -0,0 +1,5 @@
+TAGS
+tags
+.*.swp
+tomlcheck/tomlcheck
+toml.test

vendor/github.com/BurntSushi/toml/.travis.yml

@@ -0,0 +1,15 @@
+language: go
+go:
+  - 1.1
+  - 1.2
+  - 1.3
+  - 1.4
+  - 1.5
+  - 1.6
+  - tip
+install:
+  - go install ./...
+  - go get github.com/BurntSushi/toml-test
+script:
+  - export PATH="$PATH:$HOME/gopath/bin"
+  - make test

vendor/github.com/BurntSushi/toml/COMPATIBLE

@@ -0,0 +1,3 @@
+Compatible with TOML version
+[v0.4.0](https://github.com/toml-lang/toml/blob/v0.4.0/versions/en/toml-v0.4.0.md)
+

vendor/github.com/BurntSushi/toml/Makefile

@@ -0,0 +1,19 @@
+install:
+	go install ./...
+
+test: install
+	go test -v
+	toml-test toml-test-decoder
+	toml-test -encoder toml-test-encoder
+
+fmt:
+	gofmt -w *.go */*.go
+	colcheck *.go */*.go
+
+tags:
+	find ./ -name '*.go' -print0 | xargs -0 gotags > TAGS
+
+push:
+	git push origin master
+	git push github master
+

vendor/github.com/BurntSushi/toml/session.vim

@@ -0,0 +1 @@
+au BufWritePost *.go silent!make tags > /dev/null 2>&1

vendor/github.com/Microsoft/go-winio/.gitignore

@@ -0,0 +1 @@
+*.exe

vendor/github.com/Microsoft/go-winio/LICENSE

@@ -0,0 +1,22 @@
+The MIT License (MIT)
+
+Copyright (c) 2015 Microsoft
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
+

vendor/github.com/Microsoft/go-winio/README.md

@@ -0,0 +1,22 @@
+# go-winio
+
+This repository contains utilities for efficiently performing Win32 IO operations in
+Go. Currently, this is focused on accessing named pipes and other file handles, and
+for using named pipes as a net transport.
+
+This code relies on IO completion ports to avoid blocking IO on system threads, allowing Go
+to reuse the thread to schedule another goroutine. This limits support to Windows Vista and
+newer operating systems. This is similar to the implementation of network sockets in Go's net
+package.
+
+Please see the LICENSE file for licensing information.
+
+This project has adopted the [Microsoft Open Source Code of
+Conduct](https://opensource.microsoft.com/codeofconduct/). For more information
+see the [Code of Conduct
+FAQ](https://opensource.microsoft.com/codeofconduct/faq/) or contact
+[opencode@microsoft.com](mailto:opencode@microsoft.com) with any additional
+questions or comments.
+
+Thanks to natefinch for the inspiration for this library. See https://github.com/natefinch/npipe
+for another named pipe implementation.

vendor/github.com/Microsoft/go-winio/archive/tar/LICENSE

@@ -0,0 +1,27 @@
+Copyright (c) 2012 The Go Authors. All rights reserved.
+
+Redistribution and use in source and binary forms, with or without
+modification, are permitted provided that the following conditions are
+met:
+
+   * Redistributions of source code must retain the above copyright
+notice, this list of conditions and the following disclaimer.
+   * Redistributions in binary form must reproduce the above
+copyright notice, this list of conditions and the following disclaimer
+in the documentation and/or other materials provided with the
+distribution.
+   * Neither the name of Google Inc. nor the names of its
+contributors may be used to endorse or promote products derived from
+this software without specific prior written permission.
+
+THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS
+"AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT
+LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR
+A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT
+OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL,
+SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT
+LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,
+DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY
+THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
+(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE
+OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.

vendor/github.com/Microsoft/go-winio/archive/tar/common.go

@@ -0,0 +1,344 @@
+// Copyright 2009 The Go Authors. All rights reserved.
+// Use of this source code is governed by a BSD-style
+// license that can be found in the LICENSE file.
+
+// Package tar implements access to tar archives.
+// It aims to cover most of the variations, including those produced
+// by GNU and BSD tars.
+//
+// References:
+//   http://www.freebsd.org/cgi/man.cgi?query=tar&sektion=5
+//   http://www.gnu.org/software/tar/manual/html_node/Standard.html
+//   http://pubs.opengroup.org/onlinepubs/9699919799/utilities/pax.html
+package tar
+
+import (
+	"bytes"
+	"errors"
+	"fmt"
+	"os"
+	"path"
+	"time"
+)
+
+const (
+	blockSize = 512
+
+	// Types
+	TypeReg           = '0'    // regular file
+	TypeRegA          = '\x00' // regular file
+	TypeLink          = '1'    // hard link
+	TypeSymlink       = '2'    // symbolic link
+	TypeChar          = '3'    // character device node
+	TypeBlock         = '4'    // block device node
+	TypeDir           = '5'    // directory
+	TypeFifo          = '6'    // fifo node
+	TypeCont          = '7'    // reserved
+	TypeXHeader       = 'x'    // extended header
+	TypeXGlobalHeader = 'g'    // global extended header
+	TypeGNULongName   = 'L'    // Next file has a long name
+	TypeGNULongLink   = 'K'    // Next file symlinks to a file w/ a long name
+	TypeGNUSparse     = 'S'    // sparse file
+)
+
+// A Header represents a single header in a tar archive.
+// Some fields may not be populated.
+type Header struct {
+	Name         string    // name of header file entry
+	Mode         int64     // permission and mode bits
+	Uid          int       // user id of owner
+	Gid          int       // group id of owner
+	Size         int64     // length in bytes
+	ModTime      time.Time // modified time
+	Typeflag     byte      // type of header entry
+	Linkname     string    // target name of link
+	Uname        string    // user name of owner
+	Gname        string    // group name of owner
+	Devmajor     int64     // major number of character or block device
+	Devminor     int64     // minor number of character or block device
+	AccessTime   time.Time // access time
+	ChangeTime   time.Time // status change time
+	CreationTime time.Time // creation time
+	Xattrs       map[string]string
+	Winheaders   map[string]string
+}
+
+// File name constants from the tar spec.
+const (
+	fileNameSize       = 100 // Maximum number of bytes in a standard tar name.
+	fileNamePrefixSize = 155 // Maximum number of ustar extension bytes.
+)
+
+// FileInfo returns an os.FileInfo for the Header.
+func (h *Header) FileInfo() os.FileInfo {
+	return headerFileInfo{h}
+}
+
+// headerFileInfo implements os.FileInfo.
+type headerFileInfo struct {
+	h *Header
+}
+
+func (fi headerFileInfo) Size() int64        { return fi.h.Size }
+func (fi headerFileInfo) IsDir() bool        { return fi.Mode().IsDir() }
+func (fi headerFileInfo) ModTime() time.Time { return fi.h.ModTime }
+func (fi headerFileInfo) Sys() interface{}   { return fi.h }
+
+// Name returns the base name of the file.
+func (fi headerFileInfo) Name() string {
+	if fi.IsDir() {
+		return path.Base(path.Clean(fi.h.Name))
+	}
+	return path.Base(fi.h.Name)
+}
+
+// Mode returns the permission and mode bits for the headerFileInfo.
+func (fi headerFileInfo) Mode() (mode os.FileMode) {
+	// Set file permission bits.
+	mode = os.FileMode(fi.h.Mode).Perm()
+
+	// Set setuid, setgid and sticky bits.
+	if fi.h.Mode&c_ISUID != 0 {
+		// setuid
+		mode |= os.ModeSetuid
+	}
+	if fi.h.Mode&c_ISGID != 0 {
+		// setgid
+		mode |= os.ModeSetgid
+	}
+	if fi.h.Mode&c_ISVTX != 0 {
+		// sticky
+		mode |= os.ModeSticky
+	}
+
+	// Set file mode bits.
+	// clear perm, setuid, setgid and sticky bits.
+	m := os.FileMode(fi.h.Mode) &^ 07777
+	if m == c_ISDIR {
+		// directory
+		mode |= os.ModeDir
+	}
+	if m == c_ISFIFO {
+		// named pipe (FIFO)
+		mode |= os.ModeNamedPipe
+	}
+	if m == c_ISLNK {
+		// symbolic link
+		mode |= os.ModeSymlink
+	}
+	if m == c_ISBLK {
+		// device file
+		mode |= os.ModeDevice
+	}
+	if m == c_ISCHR {
+		// Unix character device
+		mode |= os.ModeDevice
+		mode |= os.ModeCharDevice
+	}
+	if m == c_ISSOCK {
+		// Unix domain socket
+		mode |= os.ModeSocket
+	}
+
+	switch fi.h.Typeflag {
+	case TypeSymlink:
+		// symbolic link
+		mode |= os.ModeSymlink
+	case TypeChar:
+		// character device node
+		mode |= os.ModeDevice
+		mode |= os.ModeCharDevice
+	case TypeBlock:
+		// block device node
+		mode |= os.ModeDevice
+	case TypeDir:
+		// directory
+		mode |= os.ModeDir
+	case TypeFifo:
+		// fifo node
+		mode |= os.ModeNamedPipe
+	}
+
+	return mode
+}
+
+// sysStat, if non-nil, populates h from system-dependent fields of fi.
+var sysStat func(fi os.FileInfo, h *Header) error
+
+// Mode constants from the tar spec.
+const (
+	c_ISUID  = 04000   // Set uid
+	c_ISGID  = 02000   // Set gid
+	c_ISVTX  = 01000   // Save text (sticky bit)
+	c_ISDIR  = 040000  // Directory
+	c_ISFIFO = 010000  // FIFO
+	c_ISREG  = 0100000 // Regular file
+	c_ISLNK  = 0120000 // Symbolic link
+	c_ISBLK  = 060000  // Block special file
+	c_ISCHR  = 020000  // Character special file
+	c_ISSOCK = 0140000 // Socket
+)
+
+// Keywords for the PAX Extended Header
+const (
+	paxAtime        = "atime"
+	paxCharset      = "charset"
+	paxComment      = "comment"
+	paxCtime        = "ctime" // please note that ctime is not a valid pax header.
+	paxCreationTime = "LIBARCHIVE.creationtime"
+	paxGid          = "gid"
+	paxGname        = "gname"
+	paxLinkpath     = "linkpath"
+	paxMtime        = "mtime"
+	paxPath         = "path"
+	paxSize         = "size"
+	paxUid          = "uid"
+	paxUname        = "uname"
+	paxXattr        = "SCHILY.xattr."
+	paxWindows      = "MSWINDOWS."
+	paxNone         = ""
+)
+
+// FileInfoHeader creates a partially-populated Header from fi.
+// If fi describes a symlink, FileInfoHeader records link as the link target.
+// If fi describes a directory, a slash is appended to the name.
+// Because os.FileInfo's Name method returns only the base name of
+// the file it describes, it may be necessary to modify the Name field
+// of the returned header to provide the full path name of the file.
+func FileInfoHeader(fi os.FileInfo, link string) (*Header, error) {
+	if fi == nil {
+		return nil, errors.New("tar: FileInfo is nil")
+	}
+	fm := fi.Mode()
+	h := &Header{
+		Name:    fi.Name(),
+		ModTime: fi.ModTime(),
+		Mode:    int64(fm.Perm()), // or'd with c_IS* constants later
+	}
+	switch {
+	case fm.IsRegular():
+		h.Mode |= c_ISREG
+		h.Typeflag = TypeReg
+		h.Size = fi.Size()
+	case fi.IsDir():
+		h.Typeflag = TypeDir
+		h.Mode |= c_ISDIR
+		h.Name += "/"
+	case fm&os.ModeSymlink != 0:
+		h.Typeflag = TypeSymlink
+		h.Mode |= c_ISLNK
+		h.Linkname = link
+	case fm&os.ModeDevice != 0:
+		if fm&os.ModeCharDevice != 0 {
+			h.Mode |= c_ISCHR
+			h.Typeflag = TypeChar
+		} else {
+			h.Mode |= c_ISBLK
+			h.Typeflag = TypeBlock
+		}
+	case fm&os.ModeNamedPipe != 0:
+		h.Typeflag = TypeFifo
+		h.Mode |= c_ISFIFO
+	case fm&os.ModeSocket != 0:
+		h.Mode |= c_ISSOCK
+	default:
+		return nil, fmt.Errorf("archive/tar: unknown file mode %v", fm)
+	}
+	if fm&os.ModeSetuid != 0 {
+		h.Mode |= c_ISUID
+	}
+	if fm&os.ModeSetgid != 0 {
+		h.Mode |= c_ISGID
+	}
+	if fm&os.ModeSticky != 0 {
+		h.Mode |= c_ISVTX
+	}
+	// If possible, populate additional fields from OS-specific
+	// FileInfo fields.
+	if sys, ok := fi.Sys().(*Header); ok {
+		// This FileInfo came from a Header (not the OS). Use the
+		// original Header to populate all remaining fields.
+		h.Uid = sys.Uid
+		h.Gid = sys.Gid
+		h.Uname = sys.Uname
+		h.Gname = sys.Gname
+		h.AccessTime = sys.AccessTime
+		h.ChangeTime = sys.ChangeTime
+		if sys.Xattrs != nil {
+			h.Xattrs = make(map[string]string)
+			for k, v := range sys.Xattrs {
+				h.Xattrs[k] = v
+			}
+		}
+		if sys.Typeflag == TypeLink {
+			// hard link
+			h.Typeflag = TypeLink
+			h.Size = 0
+			h.Linkname = sys.Linkname
+		}
+	}
+	if sysStat != nil {
+		return h, sysStat(fi, h)
+	}
+	return h, nil
+}
+
+var zeroBlock = make([]byte, blockSize)
+
+// POSIX specifies a sum of the unsigned byte values, but the Sun tar uses signed byte values.
+// We compute and return both.
+func checksum(header []byte) (unsigned int64, signed int64) {
+	for i := 0; i < len(header); i++ {
+		if i == 148 {
+			// The chksum field (header[148:156]) is special: it should be treated as space bytes.
+			unsigned += ' ' * 8
+			signed += ' ' * 8
+			i += 7
+			continue
+		}
+		unsigned += int64(header[i])
+		signed += int64(int8(header[i]))
+	}
+	return
+}
+
+type slicer []byte
+
+func (sp *slicer) next(n int) (b []byte) {
+	s := *sp
+	b, *sp = s[0:n], s[n:]
+	return
+}
+
+func isASCII(s string) bool {
+	for _, c := range s {
+		if c >= 0x80 {
+			return false
+		}
+	}
+	return true
+}
+
+func toASCII(s string) string {
+	if isASCII(s) {
+		return s
+	}
+	var buf bytes.Buffer
+	for _, c := range s {
+		if c < 0x80 {
+			buf.WriteByte(byte(c))
+		}
+	}
+	return buf.String()
+}
+
+// isHeaderOnlyType checks if the given type flag is of the type that has no
+// data section even if a size is specified.
+func isHeaderOnlyType(flag byte) bool {
+	switch flag {
+	case TypeLink, TypeSymlink, TypeChar, TypeBlock, TypeDir, TypeFifo:
+		return true
+	default:
+		return false
+	}
+}

vendor/github.com/Microsoft/go-winio/archive/tar/stat_atim.go

@@ -0,0 +1,20 @@
+// Copyright 2012 The Go Authors. All rights reserved.
+// Use of this source code is governed by a BSD-style
+// license that can be found in the LICENSE file.
+
+// +build linux dragonfly openbsd solaris
+
+package tar
+
+import (
+	"syscall"
+	"time"
+)
+
+func statAtime(st *syscall.Stat_t) time.Time {
+	return time.Unix(st.Atim.Unix())
+}
+
+func statCtime(st *syscall.Stat_t) time.Time {
+	return time.Unix(st.Ctim.Unix())
+}

vendor/github.com/Microsoft/go-winio/archive/tar/stat_atimespec.go

@@ -0,0 +1,20 @@
+// Copyright 2012 The Go Authors. All rights reserved.
+// Use of this source code is governed by a BSD-style
+// license that can be found in the LICENSE file.
+
+// +build darwin freebsd netbsd
+
+package tar
+
+import (
+	"syscall"
+	"time"
+)
+
+func statAtime(st *syscall.Stat_t) time.Time {
+	return time.Unix(st.Atimespec.Unix())
+}
+
+func statCtime(st *syscall.Stat_t) time.Time {
+	return time.Unix(st.Ctimespec.Unix())
+}

vendor/github.com/Microsoft/go-winio/archive/tar/stat_unix.go

@@ -0,0 +1,32 @@
+// Copyright 2012 The Go Authors. All rights reserved.
+// Use of this source code is governed by a BSD-style
+// license that can be found in the LICENSE file.
+
+// +build linux darwin dragonfly freebsd openbsd netbsd solaris
+
+package tar
+
+import (
+	"os"
+	"syscall"
+)
+
+func init() {
+	sysStat = statUnix
+}
+
+func statUnix(fi os.FileInfo, h *Header) error {
+	sys, ok := fi.Sys().(*syscall.Stat_t)
+	if !ok {
+		return nil
+	}
+	h.Uid = int(sys.Uid)
+	h.Gid = int(sys.Gid)
+	// TODO(bradfitz): populate username & group.  os/user
+	// doesn't cache LookupId lookups, and lacks group
+	// lookup functions.
+	h.AccessTime = statAtime(sys)
+	h.ChangeTime = statCtime(sys)
+	// TODO(bradfitz): major/minor device numbers?
+	return nil
+}

vendor/github.com/Microsoft/go-winio/archive/tar/writer.go

@@ -0,0 +1,444 @@
+// Copyright 2009 The Go Authors. All rights reserved.
+// Use of this source code is governed by a BSD-style
+// license that can be found in the LICENSE file.
+
+package tar
+
+// TODO(dsymonds):
+// - catch more errors (no first header, etc.)
+
+import (
+	"bytes"
+	"errors"
+	"fmt"
+	"io"
+	"path"
+	"sort"
+	"strconv"
+	"strings"
+	"time"
+)
+
+var (
+	ErrWriteTooLong    = errors.New("archive/tar: write too long")
+	ErrFieldTooLong    = errors.New("archive/tar: header field too long")
+	ErrWriteAfterClose = errors.New("archive/tar: write after close")
+	errInvalidHeader   = errors.New("archive/tar: header field too long or contains invalid values")
+)
+
+// A Writer provides sequential writing of a tar archive in POSIX.1 format.
+// A tar archive consists of a sequence of files.
+// Call WriteHeader to begin a new file, and then call Write to supply that file's data,
+// writing at most hdr.Size bytes in total.
+type Writer struct {
+	w          io.Writer
+	err        error
+	nb         int64 // number of unwritten bytes for current file entry
+	pad        int64 // amount of padding to write after current file entry
+	closed     bool
+	usedBinary bool            // whether the binary numeric field extension was used
+	preferPax  bool            // use pax header instead of binary numeric header
+	hdrBuff    [blockSize]byte // buffer to use in writeHeader when writing a regular header
+	paxHdrBuff [blockSize]byte // buffer to use in writeHeader when writing a pax header
+}
+
+type formatter struct {
+	err error // Last error seen
+}
+
+// NewWriter creates a new Writer writing to w.
+func NewWriter(w io.Writer) *Writer { return &Writer{w: w, preferPax: true} }
+
+// Flush finishes writing the current file (optional).
+func (tw *Writer) Flush() error {
+	if tw.nb > 0 {
+		tw.err = fmt.Errorf("archive/tar: missed writing %d bytes", tw.nb)
+		return tw.err
+	}
+
+	n := tw.nb + tw.pad
+	for n > 0 && tw.err == nil {
+		nr := n
+		if nr > blockSize {
+			nr = blockSize
+		}
+		var nw int
+		nw, tw.err = tw.w.Write(zeroBlock[0:nr])
+		n -= int64(nw)
+	}
+	tw.nb = 0
+	tw.pad = 0
+	return tw.err
+}
+
+// Write s into b, terminating it with a NUL if there is room.
+func (f *formatter) formatString(b []byte, s string) {
+	if len(s) > len(b) {
+		f.err = ErrFieldTooLong
+		return
+	}
+	ascii := toASCII(s)
+	copy(b, ascii)
+	if len(ascii) < len(b) {
+		b[len(ascii)] = 0
+	}
+}
+
+// Encode x as an octal ASCII string and write it into b with leading zeros.
+func (f *formatter) formatOctal(b []byte, x int64) {
+	s := strconv.FormatInt(x, 8)
+	// leading zeros, but leave room for a NUL.
+	for len(s)+1 < len(b) {
+		s = "0" + s
+	}
+	f.formatString(b, s)
+}
+
+// fitsInBase256 reports whether x can be encoded into n bytes using base-256
+// encoding. Unlike octal encoding, base-256 encoding does not require that the
+// string ends with a NUL character. Thus, all n bytes are available for output.
+//
+// If operating in binary mode, this assumes strict GNU binary mode; which means
+// that the first byte can only be either 0x80 or 0xff. Thus, the first byte is
+// equivalent to the sign bit in two's complement form.
+func fitsInBase256(n int, x int64) bool {
+	var binBits = uint(n-1) * 8
+	return n >= 9 || (x >= -1<<binBits && x < 1<<binBits)
+}
+
+// Write x into b, as binary (GNUtar/star extension).
+func (f *formatter) formatNumeric(b []byte, x int64) {
+	if fitsInBase256(len(b), x) {
+		for i := len(b) - 1; i >= 0; i-- {
+			b[i] = byte(x)
+			x >>= 8
+		}
+		b[0] |= 0x80 // Highest bit indicates binary format
+		return
+	}
+
+	f.formatOctal(b, 0) // Last resort, just write zero
+	f.err = ErrFieldTooLong
+}
+
+var (
+	minTime = time.Unix(0, 0)
+	// There is room for 11 octal digits (33 bits) of mtime.
+	maxTime = minTime.Add((1<<33 - 1) * time.Second)
+)
+
+// WriteHeader writes hdr and prepares to accept the file's contents.
+// WriteHeader calls Flush if it is not the first header.
+// Calling after a Close will return ErrWriteAfterClose.
+func (tw *Writer) WriteHeader(hdr *Header) error {
+	return tw.writeHeader(hdr, true)
+}
+
+// WriteHeader writes hdr and prepares to accept the file's contents.
+// WriteHeader calls Flush if it is not the first header.
+// Calling after a Close will return ErrWriteAfterClose.
+// As this method is called internally by writePax header to allow it to
+// suppress writing the pax header.
+func (tw *Writer) writeHeader(hdr *Header, allowPax bool) error {
+	if tw.closed {
+		return ErrWriteAfterClose
+	}
+	if tw.err == nil {
+		tw.Flush()
+	}
+	if tw.err != nil {
+		return tw.err
+	}
+
+	// a map to hold pax header records, if any are needed
+	paxHeaders := make(map[string]string)
+
+	// TODO(shanemhansen): we might want to use PAX headers for
+	// subsecond time resolution, but for now let's just capture
+	// too long fields or non ascii characters
+
+	var f formatter
+	var header []byte
+
+	// We need to select which scratch buffer to use carefully,
+	// since this method is called recursively to write PAX headers.
+	// If allowPax is true, this is the non-recursive call, and we will use hdrBuff.
+	// If allowPax is false, we are being called by writePAXHeader, and hdrBuff is
+	// already being used by the non-recursive call, so we must use paxHdrBuff.
+	header = tw.hdrBuff[:]
+	if !allowPax {
+		header = tw.paxHdrBuff[:]
+	}
+	copy(header, zeroBlock)
+	s := slicer(header)
+
+	// Wrappers around formatter that automatically sets paxHeaders if the
+	// argument extends beyond the capacity of the input byte slice.
+	var formatString = func(b []byte, s string, paxKeyword string) {
+		needsPaxHeader := paxKeyword != paxNone && len(s) > len(b) || !isASCII(s)
+		if needsPaxHeader {
+			paxHeaders[paxKeyword] = s
+			return
+		}
+		f.formatString(b, s)
+	}
+	var formatNumeric = func(b []byte, x int64, paxKeyword string) {
+		// Try octal first.
+		s := strconv.FormatInt(x, 8)
+		if len(s) < len(b) {
+			f.formatOctal(b, x)
+			return
+		}
+
+		// If it is too long for octal, and PAX is preferred, use a PAX header.
+		if paxKeyword != paxNone && tw.preferPax {
+			f.formatOctal(b, 0)
+			s := strconv.FormatInt(x, 10)
+			paxHeaders[paxKeyword] = s
+			return
+		}
+
+		tw.usedBinary = true
+		f.formatNumeric(b, x)
+	}
+	var formatTime = func(b []byte, t time.Time, paxKeyword string) {
+		var unixTime int64
+		if !t.Before(minTime) && !t.After(maxTime) {
+			unixTime = t.Unix()
+		}
+		formatNumeric(b, unixTime, paxNone)
+
+		// Write a PAX header if the time didn't fit precisely.
+		if paxKeyword != "" && tw.preferPax && allowPax && (t.Nanosecond() != 0 || !t.Before(minTime) || !t.After(maxTime)) {
+			paxHeaders[paxKeyword] = formatPAXTime(t)
+		}
+	}
+
+	// keep a reference to the filename to allow to overwrite it later if we detect that we can use ustar longnames instead of pax
+	pathHeaderBytes := s.next(fileNameSize)
+
+	formatString(pathHeaderBytes, hdr.Name, paxPath)
+
+	f.formatOctal(s.next(8), hdr.Mode)               // 100:108
+	formatNumeric(s.next(8), int64(hdr.Uid), paxUid) // 108:116
+	formatNumeric(s.next(8), int64(hdr.Gid), paxGid) // 116:124
+	formatNumeric(s.next(12), hdr.Size, paxSize)     // 124:136
+	formatTime(s.next(12), hdr.ModTime, paxMtime)    // 136:148
+	s.next(8)                                        // chksum (148:156)
+	s.next(1)[0] = hdr.Typeflag                      // 156:157
+
+	formatString(s.next(100), hdr.Linkname, paxLinkpath)
+
+	copy(s.next(8), []byte("ustar\x0000"))          // 257:265
+	formatString(s.next(32), hdr.Uname, paxUname)   // 265:297
+	formatString(s.next(32), hdr.Gname, paxGname)   // 297:329
+	formatNumeric(s.next(8), hdr.Devmajor, paxNone) // 329:337
+	formatNumeric(s.next(8), hdr.Devminor, paxNone) // 337:345
+
+	// keep a reference to the prefix to allow to overwrite it later if we detect that we can use ustar longnames instead of pax
+	prefixHeaderBytes := s.next(155)
+	formatString(prefixHeaderBytes, "", paxNone) // 345:500  prefix
+
+	// Use the GNU magic instead of POSIX magic if we used any GNU extensions.
+	if tw.usedBinary {
+		copy(header[257:265], []byte("ustar  \x00"))
+	}
+
+	_, paxPathUsed := paxHeaders[paxPath]
+	// try to use a ustar header when only the name is too long
+	if !tw.preferPax && len(paxHeaders) == 1 && paxPathUsed {
+		prefix, suffix, ok := splitUSTARPath(hdr.Name)
+		if ok {
+			// Since we can encode in USTAR format, disable PAX header.
+			delete(paxHeaders, paxPath)
+
+			// Update the path fields
+			formatString(pathHeaderBytes, suffix, paxNone)
+			formatString(prefixHeaderBytes, prefix, paxNone)
+		}
+	}
+
+	// The chksum field is terminated by a NUL and a space.
+	// This is different from the other octal fields.
+	chksum, _ := checksum(header)
+	f.formatOctal(header[148:155], chksum) // Never fails
+	header[155] = ' '
+
+	// Check if there were any formatting errors.
+	if f.err != nil {
+		tw.err = f.err
+		return tw.err
+	}
+
+	if allowPax {
+		if !hdr.AccessTime.IsZero() {
+			paxHeaders[paxAtime] = formatPAXTime(hdr.AccessTime)
+		}
+		if !hdr.ChangeTime.IsZero() {
+			paxHeaders[paxCtime] = formatPAXTime(hdr.ChangeTime)
+		}
+		if !hdr.CreationTime.IsZero() {
+			paxHeaders[paxCreationTime] = formatPAXTime(hdr.CreationTime)
+		}
+		for k, v := range hdr.Xattrs {
+			paxHeaders[paxXattr+k] = v
+		}
+		for k, v := range hdr.Winheaders {
+			paxHeaders[paxWindows+k] = v
+		}
+	}
+
+	if len(paxHeaders) > 0 {
+		if !allowPax {
+			return errInvalidHeader
+		}
+		if err := tw.writePAXHeader(hdr, paxHeaders); err != nil {
+			return err
+		}
+	}
+	tw.nb = int64(hdr.Size)
+	tw.pad = (blockSize - (tw.nb % blockSize)) % blockSize
+
+	_, tw.err = tw.w.Write(header)
+	return tw.err
+}
+
+func formatPAXTime(t time.Time) string {
+	sec := t.Unix()
+	usec := t.Nanosecond()
+	s := strconv.FormatInt(sec, 10)
+	if usec != 0 {
+		s = fmt.Sprintf("%s.%09d", s, usec)
+	}
+	return s
+}
+
+// splitUSTARPath splits a path according to USTAR prefix and suffix rules.
+// If the path is not splittable, then it will return ("", "", false).
+func splitUSTARPath(name string) (prefix, suffix string, ok bool) {
+	length := len(name)
+	if length <= fileNameSize || !isASCII(name) {
+		return "", "", false
+	} else if length > fileNamePrefixSize+1 {
+		length = fileNamePrefixSize + 1
+	} else if name[length-1] == '/' {
+		length--
+	}
+
+	i := strings.LastIndex(name[:length], "/")
+	nlen := len(name) - i - 1 // nlen is length of suffix
+	plen := i                 // plen is length of prefix
+	if i <= 0 || nlen > fileNameSize || nlen == 0 || plen > fileNamePrefixSize {
+		return "", "", false
+	}
+	return name[:i], name[i+1:], true
+}
+
+// writePaxHeader writes an extended pax header to the
+// archive.
+func (tw *Writer) writePAXHeader(hdr *Header, paxHeaders map[string]string) error {
+	// Prepare extended header
+	ext := new(Header)
+	ext.Typeflag = TypeXHeader
+	// Setting ModTime is required for reader parsing to
+	// succeed, and seems harmless enough.
+	ext.ModTime = hdr.ModTime
+	// The spec asks that we namespace our pseudo files
+	// with the current pid.  However, this results in differing outputs
+	// for identical inputs.  As such, the constant 0 is now used instead.
+	// golang.org/issue/12358
+	dir, file := path.Split(hdr.Name)
+	fullName := path.Join(dir, "PaxHeaders.0", file)
+
+	ascii := toASCII(fullName)
+	if len(ascii) > 100 {
+		ascii = ascii[:100]
+	}
+	ext.Name = ascii
+	// Construct the body
+	var buf bytes.Buffer
+
+	// Keys are sorted before writing to body to allow deterministic output.
+	var keys []string
+	for k := range paxHeaders {
+		keys = append(keys, k)
+	}
+	sort.Strings(keys)
+
+	for _, k := range keys {
+		fmt.Fprint(&buf, formatPAXRecord(k, paxHeaders[k]))
+	}
+
+	ext.Size = int64(len(buf.Bytes()))
+	if err := tw.writeHeader(ext, false); err != nil {
+		return err
+	}
+	if _, err := tw.Write(buf.Bytes()); err != nil {
+		return err
+	}
+	if err := tw.Flush(); err != nil {
+		return err
+	}
+	return nil
+}
+
+// formatPAXRecord formats a single PAX record, prefixing it with the
+// appropriate length.
+func formatPAXRecord(k, v string) string {
+	const padding = 3 // Extra padding for ' ', '=', and '\n'
+	size := len(k) + len(v) + padding
+	size += len(strconv.Itoa(size))
+	record := fmt.Sprintf("%d %s=%s\n", size, k, v)
+
+	// Final adjustment if adding size field increased the record size.
+	if len(record) != size {
+		size = len(record)
+		record = fmt.Sprintf("%d %s=%s\n", size, k, v)
+	}
+	return record
+}
+
+// Write writes to the current entry in the tar archive.
+// Write returns the error ErrWriteTooLong if more than
+// hdr.Size bytes are written after WriteHeader.
+func (tw *Writer) Write(b []byte) (n int, err error) {
+	if tw.closed {
+		err = ErrWriteAfterClose
+		return
+	}
+	overwrite := false
+	if int64(len(b)) > tw.nb {
+		b = b[0:tw.nb]
+		overwrite = true
+	}
+	n, err = tw.w.Write(b)
+	tw.nb -= int64(n)
+	if err == nil && overwrite {
+		err = ErrWriteTooLong
+		return
+	}
+	tw.err = err
+	return
+}
+
+// Close closes the tar archive, flushing any unwritten
+// data to the underlying writer.
+func (tw *Writer) Close() error {
+	if tw.err != nil || tw.closed {
+		return tw.err
+	}
+	tw.Flush()
+	tw.closed = true
+	if tw.err != nil {
+		return tw.err
+	}
+
+	// trailer: two zero blocks
+	for i := 0; i < 2; i++ {
+		_, tw.err = tw.w.Write(zeroBlock)
+		if tw.err != nil {
+			break
+		}
+	}
+	return tw.err
+}

vendor/github.com/Microsoft/go-winio/backup.go

@@ -0,0 +1,280 @@
+// +build windows
+
+package winio
+
+import (
+	"encoding/binary"
+	"errors"
+	"fmt"
+	"io"
+	"io/ioutil"
+	"os"
+	"runtime"
+	"syscall"
+	"unicode/utf16"
+)
+
+//sys backupRead(h syscall.Handle, b []byte, bytesRead *uint32, abort bool, processSecurity bool, context *uintptr) (err error) = BackupRead
+//sys backupWrite(h syscall.Handle, b []byte, bytesWritten *uint32, abort bool, processSecurity bool, context *uintptr) (err error) = BackupWrite
+
+const (
+	BackupData = uint32(iota + 1)
+	BackupEaData
+	BackupSecurity
+	BackupAlternateData
+	BackupLink
+	BackupPropertyData
+	BackupObjectId
+	BackupReparseData
+	BackupSparseBlock
+	BackupTxfsData
+)
+
+const (
+	StreamSparseAttributes = uint32(8)
+)
+
+const (
+	WRITE_DAC              = 0x40000
+	WRITE_OWNER            = 0x80000
+	ACCESS_SYSTEM_SECURITY = 0x1000000
+)
+
+// BackupHeader represents a backup stream of a file.
+type BackupHeader struct {
+	Id         uint32 // The backup stream ID
+	Attributes uint32 // Stream attributes
+	Size       int64  // The size of the stream in bytes
+	Name       string // The name of the stream (for BackupAlternateData only).
+	Offset     int64  // The offset of the stream in the file (for BackupSparseBlock only).
+}
+
+type win32StreamId struct {
+	StreamId   uint32
+	Attributes uint32
+	Size       uint64
+	NameSize   uint32
+}
+
+// BackupStreamReader reads from a stream produced by the BackupRead Win32 API and produces a series
+// of BackupHeader values.
+type BackupStreamReader struct {
+	r         io.Reader
+	bytesLeft int64
+}
+
+// NewBackupStreamReader produces a BackupStreamReader from any io.Reader.
+func NewBackupStreamReader(r io.Reader) *BackupStreamReader {
+	return &BackupStreamReader{r, 0}
+}
+
+// Next returns the next backup stream and prepares for calls to Read(). It skips the remainder of the current stream if
+// it was not completely read.
+func (r *BackupStreamReader) Next() (*BackupHeader, error) {
+	if r.bytesLeft > 0 {
+		if s, ok := r.r.(io.Seeker); ok {
+			// Make sure Seek on io.SeekCurrent sometimes succeeds
+			// before trying the actual seek.
+			if _, err := s.Seek(0, io.SeekCurrent); err == nil {
+				if _, err = s.Seek(r.bytesLeft, io.SeekCurrent); err != nil {
+					return nil, err
+				}
+				r.bytesLeft = 0
+			}
+		}
+		if _, err := io.Copy(ioutil.Discard, r); err != nil {
+			return nil, err
+		}
+	}
+	var wsi win32StreamId
+	if err := binary.Read(r.r, binary.LittleEndian, &wsi); err != nil {
+		return nil, err
+	}
+	hdr := &BackupHeader{
+		Id:         wsi.StreamId,
+		Attributes: wsi.Attributes,
+		Size:       int64(wsi.Size),
+	}
+	if wsi.NameSize != 0 {
+		name := make([]uint16, int(wsi.NameSize/2))
+		if err := binary.Read(r.r, binary.LittleEndian, name); err != nil {
+			return nil, err
+		}
+		hdr.Name = syscall.UTF16ToString(name)
+	}
+	if wsi.StreamId == BackupSparseBlock {
+		if err := binary.Read(r.r, binary.LittleEndian, &hdr.Offset); err != nil {
+			return nil, err
+		}
+		hdr.Size -= 8
+	}
+	r.bytesLeft = hdr.Size
+	return hdr, nil
+}
+
+// Read reads from the current backup stream.
+func (r *BackupStreamReader) Read(b []byte) (int, error) {
+	if r.bytesLeft == 0 {
+		return 0, io.EOF
+	}
+	if int64(len(b)) > r.bytesLeft {
+		b = b[:r.bytesLeft]
+	}
+	n, err := r.r.Read(b)
+	r.bytesLeft -= int64(n)
+	if err == io.EOF {
+		err = io.ErrUnexpectedEOF
+	} else if r.bytesLeft == 0 && err == nil {
+		err = io.EOF
+	}
+	return n, err
+}
+
+// BackupStreamWriter writes a stream compatible with the BackupWrite Win32 API.
+type BackupStreamWriter struct {
+	w         io.Writer
+	bytesLeft int64
+}
+
+// NewBackupStreamWriter produces a BackupStreamWriter on top of an io.Writer.
+func NewBackupStreamWriter(w io.Writer) *BackupStreamWriter {
+	return &BackupStreamWriter{w, 0}
+}
+
+// WriteHeader writes the next backup stream header and prepares for calls to Write().
+func (w *BackupStreamWriter) WriteHeader(hdr *BackupHeader) error {
+	if w.bytesLeft != 0 {
+		return fmt.Errorf("missing %d bytes", w.bytesLeft)
+	}
+	name := utf16.Encode([]rune(hdr.Name))
+	wsi := win32StreamId{
+		StreamId:   hdr.Id,
+		Attributes: hdr.Attributes,
+		Size:       uint64(hdr.Size),
+		NameSize:   uint32(len(name) * 2),
+	}
+	if hdr.Id == BackupSparseBlock {
+		// Include space for the int64 block offset
+		wsi.Size += 8
+	}
+	if err := binary.Write(w.w, binary.LittleEndian, &wsi); err != nil {
+		return err
+	}
+	if len(name) != 0 {
+		if err := binary.Write(w.w, binary.LittleEndian, name); err != nil {
+			return err
+		}
+	}
+	if hdr.Id == BackupSparseBlock {
+		if err := binary.Write(w.w, binary.LittleEndian, hdr.Offset); err != nil {
+			return err
+		}
+	}
+	w.bytesLeft = hdr.Size
+	return nil
+}
+
+// Write writes to the current backup stream.
+func (w *BackupStreamWriter) Write(b []byte) (int, error) {
+	if w.bytesLeft < int64(len(b)) {
+		return 0, fmt.Errorf("too many bytes by %d", int64(len(b))-w.bytesLeft)
+	}
+	n, err := w.w.Write(b)
+	w.bytesLeft -= int64(n)
+	return n, err
+}
+
+// BackupFileReader provides an io.ReadCloser interface on top of the BackupRead Win32 API.
+type BackupFileReader struct {
+	f               *os.File
+	includeSecurity bool
+	ctx             uintptr
+}
+
+// NewBackupFileReader returns a new BackupFileReader from a file handle. If includeSecurity is true,
+// Read will attempt to read the security descriptor of the file.
+func NewBackupFileReader(f *os.File, includeSecurity bool) *BackupFileReader {
+	r := &BackupFileReader{f, includeSecurity, 0}
+	return r
+}
+
+// Read reads a backup stream from the file by calling the Win32 API BackupRead().
+func (r *BackupFileReader) Read(b []byte) (int, error) {
+	var bytesRead uint32
+	err := backupRead(syscall.Handle(r.f.Fd()), b, &bytesRead, false, r.includeSecurity, &r.ctx)
+	if err != nil {
+		return 0, &os.PathError{"BackupRead", r.f.Name(), err}
+	}
+	runtime.KeepAlive(r.f)
+	if bytesRead == 0 {
+		return 0, io.EOF
+	}
+	return int(bytesRead), nil
+}
+
+// Close frees Win32 resources associated with the BackupFileReader. It does not close
+// the underlying file.
+func (r *BackupFileReader) Close() error {
+	if r.ctx != 0 {
+		backupRead(syscall.Handle(r.f.Fd()), nil, nil, true, false, &r.ctx)
+		runtime.KeepAlive(r.f)
+		r.ctx = 0
+	}
+	return nil
+}
+
+// BackupFileWriter provides an io.WriteCloser interface on top of the BackupWrite Win32 API.
+type BackupFileWriter struct {
+	f               *os.File
+	includeSecurity bool
+	ctx             uintptr
+}
+
+// NewBackupFileWriter returns a new BackupFileWriter from a file handle. If includeSecurity is true,
+// Write() will attempt to restore the security descriptor from the stream.
+func NewBackupFileWriter(f *os.File, includeSecurity bool) *BackupFileWriter {
+	w := &BackupFileWriter{f, includeSecurity, 0}
+	return w
+}
+
+// Write restores a portion of the file using the provided backup stream.
+func (w *BackupFileWriter) Write(b []byte) (int, error) {
+	var bytesWritten uint32
+	err := backupWrite(syscall.Handle(w.f.Fd()), b, &bytesWritten, false, w.includeSecurity, &w.ctx)
+	if err != nil {
+		return 0, &os.PathError{"BackupWrite", w.f.Name(), err}
+	}
+	runtime.KeepAlive(w.f)
+	if int(bytesWritten) != len(b) {
+		return int(bytesWritten), errors.New("not all bytes could be written")
+	}
+	return len(b), nil
+}
+
+// Close frees Win32 resources associated with the BackupFileWriter. It does not
+// close the underlying file.
+func (w *BackupFileWriter) Close() error {
+	if w.ctx != 0 {
+		backupWrite(syscall.Handle(w.f.Fd()), nil, nil, true, false, &w.ctx)
+		runtime.KeepAlive(w.f)
+		w.ctx = 0
+	}
+	return nil
+}
+
+// OpenForBackup opens a file or directory, potentially skipping access checks if the backup
+// or restore privileges have been acquired.
+//
+// If the file opened was a directory, it cannot be used with Readdir().
+func OpenForBackup(path string, access uint32, share uint32, createmode uint32) (*os.File, error) {
+	winPath, err := syscall.UTF16FromString(path)
+	if err != nil {
+		return nil, err
+	}
+	h, err := syscall.CreateFile(&winPath[0], access, share, nil, createmode, syscall.FILE_FLAG_BACKUP_SEMANTICS|syscall.FILE_FLAG_OPEN_REPARSE_POINT, 0)
+	if err != nil {
+		err = &os.PathError{Op: "open", Path: path, Err: err}
+		return nil, err
+	}
+	return os.NewFile(uintptr(h), path), nil
+}

vendor/github.com/Microsoft/go-winio/backuptar/noop.go

@@ -0,0 +1,4 @@
+// +build !windows
+// This file only exists to allow go get on non-Windows platforms.
+
+package backuptar

vendor/github.com/Microsoft/go-winio/backuptar/tar.go

@@ -0,0 +1,439 @@
+// +build windows
+
+package backuptar
+
+import (
+	"encoding/base64"
+	"errors"
+	"fmt"
+	"io"
+	"io/ioutil"
+	"path/filepath"
+	"strconv"
+	"strings"
+	"syscall"
+	"time"
+
+	"github.com/Microsoft/go-winio"
+	"github.com/Microsoft/go-winio/archive/tar" // until archive/tar supports pax extensions in its interface
+)
+
+const (
+	c_ISUID  = 04000   // Set uid
+	c_ISGID  = 02000   // Set gid
+	c_ISVTX  = 01000   // Save text (sticky bit)
+	c_ISDIR  = 040000  // Directory
+	c_ISFIFO = 010000  // FIFO
+	c_ISREG  = 0100000 // Regular file
+	c_ISLNK  = 0120000 // Symbolic link
+	c_ISBLK  = 060000  // Block special file
+	c_ISCHR  = 020000  // Character special file
+	c_ISSOCK = 0140000 // Socket
+)
+
+const (
+	hdrFileAttributes        = "fileattr"
+	hdrSecurityDescriptor    = "sd"
+	hdrRawSecurityDescriptor = "rawsd"
+	hdrMountPoint            = "mountpoint"
+	hdrEaPrefix              = "xattr."
+)
+
+func writeZeroes(w io.Writer, count int64) error {
+	buf := make([]byte, 8192)
+	c := len(buf)
+	for i := int64(0); i < count; i += int64(c) {
+		if int64(c) > count-i {
+			c = int(count - i)
+		}
+		_, err := w.Write(buf[:c])
+		if err != nil {
+			return err
+		}
+	}
+	return nil
+}
+
+func copySparse(t *tar.Writer, br *winio.BackupStreamReader) error {
+	curOffset := int64(0)
+	for {
+		bhdr, err := br.Next()
+		if err == io.EOF {
+			err = io.ErrUnexpectedEOF
+		}
+		if err != nil {
+			return err
+		}
+		if bhdr.Id != winio.BackupSparseBlock {
+			return fmt.Errorf("unexpected stream %d", bhdr.Id)
+		}
+
+		// archive/tar does not support writing sparse files
+		// so just write zeroes to catch up to the current offset.
+		err = writeZeroes(t, bhdr.Offset-curOffset)
+		if bhdr.Size == 0 {
+			break
+		}
+		n, err := io.Copy(t, br)
+		if err != nil {
+			return err
+		}
+		curOffset = bhdr.Offset + n
+	}
+	return nil
+}
+
+// BasicInfoHeader creates a tar header from basic file information.
+func BasicInfoHeader(name string, size int64, fileInfo *winio.FileBasicInfo) *tar.Header {
+	hdr := &tar.Header{
+		Name:         filepath.ToSlash(name),
+		Size:         size,
+		Typeflag:     tar.TypeReg,
+		ModTime:      time.Unix(0, fileInfo.LastWriteTime.Nanoseconds()),
+		ChangeTime:   time.Unix(0, fileInfo.ChangeTime.Nanoseconds()),
+		AccessTime:   time.Unix(0, fileInfo.LastAccessTime.Nanoseconds()),
+		CreationTime: time.Unix(0, fileInfo.CreationTime.Nanoseconds()),
+		Winheaders:   make(map[string]string),
+	}
+	hdr.Winheaders[hdrFileAttributes] = fmt.Sprintf("%d", fileInfo.FileAttributes)
+
+	if (fileInfo.FileAttributes & syscall.FILE_ATTRIBUTE_DIRECTORY) != 0 {
+		hdr.Mode |= c_ISDIR
+		hdr.Size = 0
+		hdr.Typeflag = tar.TypeDir
+	}
+	return hdr
+}
+
+// WriteTarFileFromBackupStream writes a file to a tar writer using data from a Win32 backup stream.
+//
+// This encodes Win32 metadata as tar pax vendor extensions starting with MSWINDOWS.
+//
+// The additional Win32 metadata is:
+//
+// MSWINDOWS.fileattr: The Win32 file attributes, as a decimal value
+//
+// MSWINDOWS.rawsd: The Win32 security descriptor, in raw binary format
+//
+// MSWINDOWS.mountpoint: If present, this is a mount point and not a symlink, even though the type is '2' (symlink)
+func WriteTarFileFromBackupStream(t *tar.Writer, r io.Reader, name string, size int64, fileInfo *winio.FileBasicInfo) error {
+	name = filepath.ToSlash(name)
+	hdr := BasicInfoHeader(name, size, fileInfo)
+
+	// If r can be seeked, then this function is two-pass: pass 1 collects the
+	// tar header data, and pass 2 copies the data stream. If r cannot be
+	// seeked, then some header data (in particular EAs) will be silently lost.
+	var (
+		restartPos int64
+		err        error
+	)
+	sr, readTwice := r.(io.Seeker)
+	if readTwice {
+		if restartPos, err = sr.Seek(0, io.SeekCurrent); err != nil {
+			readTwice = false
+		}
+	}
+
+	br := winio.NewBackupStreamReader(r)
+	var dataHdr *winio.BackupHeader
+	for dataHdr == nil {
+		bhdr, err := br.Next()
+		if err == io.EOF {
+			break
+		}
+		if err != nil {
+			return err
+		}
+		switch bhdr.Id {
+		case winio.BackupData:
+			hdr.Mode |= c_ISREG
+			if !readTwice {
+				dataHdr = bhdr
+			}
+		case winio.BackupSecurity:
+			sd, err := ioutil.ReadAll(br)
+			if err != nil {
+				return err
+			}
+			hdr.Winheaders[hdrRawSecurityDescriptor] = base64.StdEncoding.EncodeToString(sd)
+
+		case winio.BackupReparseData:
+			hdr.Mode |= c_ISLNK
+			hdr.Typeflag = tar.TypeSymlink
+			reparseBuffer, err := ioutil.ReadAll(br)
+			rp, err := winio.DecodeReparsePoint(reparseBuffer)
+			if err != nil {
+				return err
+			}
+			if rp.IsMountPoint {
+				hdr.Winheaders[hdrMountPoint] = "1"
+			}
+			hdr.Linkname = rp.Target
+
+		case winio.BackupEaData:
+			eab, err := ioutil.ReadAll(br)
+			if err != nil {
+				return err
+			}
+			eas, err := winio.DecodeExtendedAttributes(eab)
+			if err != nil {
+				return err
+			}
+			for _, ea := range eas {
+				// Use base64 encoding for the binary value. Note that there
+				// is no way to encode the EA's flags, since their use doesn't
+				// make any sense for persisted EAs.
+				hdr.Winheaders[hdrEaPrefix+ea.Name] = base64.StdEncoding.EncodeToString(ea.Value)
+			}
+
+		case winio.BackupAlternateData, winio.BackupLink, winio.BackupPropertyData, winio.BackupObjectId, winio.BackupTxfsData:
+			// ignore these streams
+		default:
+			return fmt.Errorf("%s: unknown stream ID %d", name, bhdr.Id)
+		}
+	}
+
+	err = t.WriteHeader(hdr)
+	if err != nil {
+		return err
+	}
+
+	if readTwice {
+		// Get back to the data stream.
+		if _, err = sr.Seek(restartPos, io.SeekStart); err != nil {
+			return err
+		}
+		for dataHdr == nil {
+			bhdr, err := br.Next()
+			if err == io.EOF {
+				break
+			}
+			if err != nil {
+				return err
+			}
+			if bhdr.Id == winio.BackupData {
+				dataHdr = bhdr
+			}
+		}
+	}
+
+	if dataHdr != nil {
+		// A data stream was found. Copy the data.
+		if (dataHdr.Attributes & winio.StreamSparseAttributes) == 0 {
+			if size != dataHdr.Size {
+				return fmt.Errorf("%s: mismatch between file size %d and header size %d", name, size, dataHdr.Size)
+			}
+			_, err = io.Copy(t, br)
+			if err != nil {
+				return err
+			}
+		} else {
+			err = copySparse(t, br)
+			if err != nil {
+				return err
+			}
+		}
+	}
+
+	// Look for streams after the data stream. The only ones we handle are alternate data streams.
+	// Other streams may have metadata that could be serialized, but the tar header has already
+	// been written. In practice, this means that we don't get EA or TXF metadata.
+	for {
+		bhdr, err := br.Next()
+		if err == io.EOF {
+			break
+		}
+		if err != nil {
+			return err
+		}
+		switch bhdr.Id {
+		case winio.BackupAlternateData:
+			altName := bhdr.Name
+			if strings.HasSuffix(altName, ":$DATA") {
+				altName = altName[:len(altName)-len(":$DATA")]
+			}
+			if (bhdr.Attributes & winio.StreamSparseAttributes) == 0 {
+				hdr = &tar.Header{
+					Name:       name + altName,
+					Mode:       hdr.Mode,
+					Typeflag:   tar.TypeReg,
+					Size:       bhdr.Size,
+					ModTime:    hdr.ModTime,
+					AccessTime: hdr.AccessTime,
+					ChangeTime: hdr.ChangeTime,
+				}
+				err = t.WriteHeader(hdr)
+				if err != nil {
+					return err
+				}
+				_, err = io.Copy(t, br)
+				if err != nil {
+					return err
+				}
+
+			} else {
+				// Unsupported for now, since the size of the alternate stream is not present
+				// in the backup stream until after the data has been read.
+				return errors.New("tar of sparse alternate data streams is unsupported")
+			}
+		case winio.BackupEaData, winio.BackupLink, winio.BackupPropertyData, winio.BackupObjectId, winio.BackupTxfsData:
+			// ignore these streams
+		default:
+			return fmt.Errorf("%s: unknown stream ID %d after data", name, bhdr.Id)
+		}
+	}
+	return nil
+}
+
+// FileInfoFromHeader retrieves basic Win32 file information from a tar header, using the additional metadata written by
+// WriteTarFileFromBackupStream.
+func FileInfoFromHeader(hdr *tar.Header) (name string, size int64, fileInfo *winio.FileBasicInfo, err error) {
+	name = hdr.Name
+	if hdr.Typeflag == tar.TypeReg || hdr.Typeflag == tar.TypeRegA {
+		size = hdr.Size
+	}
+	fileInfo = &winio.FileBasicInfo{
+		LastAccessTime: syscall.NsecToFiletime(hdr.AccessTime.UnixNano()),
+		LastWriteTime:  syscall.NsecToFiletime(hdr.ModTime.UnixNano()),
+		ChangeTime:     syscall.NsecToFiletime(hdr.ChangeTime.UnixNano()),
+		CreationTime:   syscall.NsecToFiletime(hdr.CreationTime.UnixNano()),
+	}
+	if attrStr, ok := hdr.Winheaders[hdrFileAttributes]; ok {
+		attr, err := strconv.ParseUint(attrStr, 10, 32)
+		if err != nil {
+			return "", 0, nil, err
+		}
+		fileInfo.FileAttributes = uint32(attr)
+	} else {
+		if hdr.Typeflag == tar.TypeDir {
+			fileInfo.FileAttributes |= syscall.FILE_ATTRIBUTE_DIRECTORY
+		}
+	}
+	return
+}
+
+// WriteBackupStreamFromTarFile writes a Win32 backup stream from the current tar file. Since this function may process multiple
+// tar file entries in order to collect all the alternate data streams for the file, it returns the next
+// tar file that was not processed, or io.EOF is there are no more.
+func WriteBackupStreamFromTarFile(w io.Writer, t *tar.Reader, hdr *tar.Header) (*tar.Header, error) {
+	bw := winio.NewBackupStreamWriter(w)
+	var sd []byte
+	var err error
+	// Maintaining old SDDL-based behavior for backward compatibility.  All new tar headers written
+	// by this library will have raw binary for the security descriptor.
+	if sddl, ok := hdr.Winheaders[hdrSecurityDescriptor]; ok {
+		sd, err = winio.SddlToSecurityDescriptor(sddl)
+		if err != nil {
+			return nil, err
+		}
+	}
+	if sdraw, ok := hdr.Winheaders[hdrRawSecurityDescriptor]; ok {
+		sd, err = base64.StdEncoding.DecodeString(sdraw)
+		if err != nil {
+			return nil, err
+		}
+	}
+	if len(sd) != 0 {
+		bhdr := winio.BackupHeader{
+			Id:   winio.BackupSecurity,
+			Size: int64(len(sd)),
+		}
+		err := bw.WriteHeader(&bhdr)
+		if err != nil {
+			return nil, err
+		}
+		_, err = bw.Write(sd)
+		if err != nil {
+			return nil, err
+		}
+	}
+	var eas []winio.ExtendedAttribute
+	for k, v := range hdr.Winheaders {
+		if !strings.HasPrefix(k, hdrEaPrefix) {
+			continue
+		}
+		data, err := base64.StdEncoding.DecodeString(v)
+		if err != nil {
+			return nil, err
+		}
+		eas = append(eas, winio.ExtendedAttribute{
+			Name:  k[len(hdrEaPrefix):],
+			Value: data,
+		})
+	}
+	if len(eas) != 0 {
+		eadata, err := winio.EncodeExtendedAttributes(eas)
+		if err != nil {
+			return nil, err
+		}
+		bhdr := winio.BackupHeader{
+			Id:   winio.BackupEaData,
+			Size: int64(len(eadata)),
+		}
+		err = bw.WriteHeader(&bhdr)
+		if err != nil {
+			return nil, err
+		}
+		_, err = bw.Write(eadata)
+		if err != nil {
+			return nil, err
+		}
+	}
+	if hdr.Typeflag == tar.TypeSymlink {
+		_, isMountPoint := hdr.Winheaders[hdrMountPoint]
+		rp := winio.ReparsePoint{
+			Target:       filepath.FromSlash(hdr.Linkname),
+			IsMountPoint: isMountPoint,
+		}
+		reparse := winio.EncodeReparsePoint(&rp)
+		bhdr := winio.BackupHeader{
+			Id:   winio.BackupReparseData,
+			Size: int64(len(reparse)),
+		}
+		err := bw.WriteHeader(&bhdr)
+		if err != nil {
+			return nil, err
+		}
+		_, err = bw.Write(reparse)
+		if err != nil {
+			return nil, err
+		}
+	}
+	if hdr.Typeflag == tar.TypeReg || hdr.Typeflag == tar.TypeRegA {
+		bhdr := winio.BackupHeader{
+			Id:   winio.BackupData,
+			Size: hdr.Size,
+		}
+		err := bw.WriteHeader(&bhdr)
+		if err != nil {
+			return nil, err
+		}
+		_, err = io.Copy(bw, t)
+		if err != nil {
+			return nil, err
+		}
+	}
+	// Copy all the alternate data streams and return the next non-ADS header.
+	for {
+		ahdr, err := t.Next()
+		if err != nil {
+			return nil, err
+		}
+		if ahdr.Typeflag != tar.TypeReg || !strings.HasPrefix(ahdr.Name, hdr.Name+":") {
+			return ahdr, nil
+		}
+		bhdr := winio.BackupHeader{
+			Id:   winio.BackupAlternateData,
+			Size: ahdr.Size,
+			Name: ahdr.Name[len(hdr.Name):] + ":$DATA",
+		}
+		err = bw.WriteHeader(&bhdr)
+		if err != nil {
+			return nil, err
+		}
+		_, err = io.Copy(bw, t)
+		if err != nil {
+			return nil, err
+		}
+	}
+}

vendor/github.com/Microsoft/go-winio/ea.go

@@ -0,0 +1,137 @@
+package winio
+
+import (
+	"bytes"
+	"encoding/binary"
+	"errors"
+)
+
+type fileFullEaInformation struct {
+	NextEntryOffset uint32
+	Flags           uint8
+	NameLength      uint8
+	ValueLength     uint16
+}
+
+var (
+	fileFullEaInformationSize = binary.Size(&fileFullEaInformation{})
+
+	errInvalidEaBuffer = errors.New("invalid extended attribute buffer")
+	errEaNameTooLarge  = errors.New("extended attribute name too large")
+	errEaValueTooLarge = errors.New("extended attribute value too large")
+)
+
+// ExtendedAttribute represents a single Windows EA.
+type ExtendedAttribute struct {
+	Name  string
+	Value []byte
+	Flags uint8
+}
+
+func parseEa(b []byte) (ea ExtendedAttribute, nb []byte, err error) {
+	var info fileFullEaInformation
+	err = binary.Read(bytes.NewReader(b), binary.LittleEndian, &info)
+	if err != nil {
+		err = errInvalidEaBuffer
+		return
+	}
+
+	nameOffset := fileFullEaInformationSize
+	nameLen := int(info.NameLength)
+	valueOffset := nameOffset + int(info.NameLength) + 1
+	valueLen := int(info.ValueLength)
+	nextOffset := int(info.NextEntryOffset)
+	if valueLen+valueOffset > len(b) || nextOffset < 0 || nextOffset > len(b) {
+		err = errInvalidEaBuffer
+		return
+	}
+
+	ea.Name = string(b[nameOffset : nameOffset+nameLen])
+	ea.Value = b[valueOffset : valueOffset+valueLen]
+	ea.Flags = info.Flags
+	if info.NextEntryOffset != 0 {
+		nb = b[info.NextEntryOffset:]
+	}
+	return
+}
+
+// DecodeExtendedAttributes decodes a list of EAs from a FILE_FULL_EA_INFORMATION
+// buffer retrieved from BackupRead, ZwQueryEaFile, etc.
+func DecodeExtendedAttributes(b []byte) (eas []ExtendedAttribute, err error) {
+	for len(b) != 0 {
+		ea, nb, err := parseEa(b)
+		if err != nil {
+			return nil, err
+		}
+
+		eas = append(eas, ea)
+		b = nb
+	}
+	return
+}
+
+func writeEa(buf *bytes.Buffer, ea *ExtendedAttribute, last bool) error {
+	if int(uint8(len(ea.Name))) != len(ea.Name) {
+		return errEaNameTooLarge
+	}
+	if int(uint16(len(ea.Value))) != len(ea.Value) {
+		return errEaValueTooLarge
+	}
+	entrySize := uint32(fileFullEaInformationSize + len(ea.Name) + 1 + len(ea.Value))
+	withPadding := (entrySize + 3) &^ 3
+	nextOffset := uint32(0)
+	if !last {
+		nextOffset = withPadding
+	}
+	info := fileFullEaInformation{
+		NextEntryOffset: nextOffset,
+		Flags:           ea.Flags,
+		NameLength:      uint8(len(ea.Name)),
+		ValueLength:     uint16(len(ea.Value)),
+	}
+
+	err := binary.Write(buf, binary.LittleEndian, &info)
+	if err != nil {
+		return err
+	}
+
+	_, err = buf.Write([]byte(ea.Name))
+	if err != nil {
+		return err
+	}
+
+	err = buf.WriteByte(0)
+	if err != nil {
+		return err
+	}
+
+	_, err = buf.Write(ea.Value)
+	if err != nil {
+		return err
+	}
+
+	_, err = buf.Write([]byte{0, 0, 0}[0 : withPadding-entrySize])
+	if err != nil {
+		return err
+	}
+
+	return nil
+}
+
+// EncodeExtendedAttributes encodes a list of EAs into a FILE_FULL_EA_INFORMATION
+// buffer for use with BackupWrite, ZwSetEaFile, etc.
+func EncodeExtendedAttributes(eas []ExtendedAttribute) ([]byte, error) {
+	var buf bytes.Buffer
+	for i := range eas {
+		last := false
+		if i == len(eas)-1 {
+			last = true
+		}
+
+		err := writeEa(&buf, &eas[i], last)
+		if err != nil {
+			return nil, err
+		}
+	}
+	return buf.Bytes(), nil
+}

vendor/github.com/Microsoft/go-winio/file.go

@@ -0,0 +1,307 @@
+// +build windows
+
+package winio
+
+import (
+	"errors"
+	"io"
+	"runtime"
+	"sync"
+	"sync/atomic"
+	"syscall"
+	"time"
+)
+
+//sys cancelIoEx(file syscall.Handle, o *syscall.Overlapped) (err error) = CancelIoEx
+//sys createIoCompletionPort(file syscall.Handle, port syscall.Handle, key uintptr, threadCount uint32) (newport syscall.Handle, err error) = CreateIoCompletionPort
+//sys getQueuedCompletionStatus(port syscall.Handle, bytes *uint32, key *uintptr, o **ioOperation, timeout uint32) (err error) = GetQueuedCompletionStatus
+//sys setFileCompletionNotificationModes(h syscall.Handle, flags uint8) (err error) = SetFileCompletionNotificationModes
+
+type atomicBool int32
+
+func (b *atomicBool) isSet() bool { return atomic.LoadInt32((*int32)(b)) != 0 }
+func (b *atomicBool) setFalse()   { atomic.StoreInt32((*int32)(b), 0) }
+func (b *atomicBool) setTrue()    { atomic.StoreInt32((*int32)(b), 1) }
+func (b *atomicBool) swap(new bool) bool {
+	var newInt int32
+	if new {
+		newInt = 1
+	}
+	return atomic.SwapInt32((*int32)(b), newInt) == 1
+}
+
+const (
+	cFILE_SKIP_COMPLETION_PORT_ON_SUCCESS = 1
+	cFILE_SKIP_SET_EVENT_ON_HANDLE        = 2
+)
+
+var (
+	ErrFileClosed = errors.New("file has already been closed")
+	ErrTimeout    = &timeoutError{}
+)
+
+type timeoutError struct{}
+
+func (e *timeoutError) Error() string   { return "i/o timeout" }
+func (e *timeoutError) Timeout() bool   { return true }
+func (e *timeoutError) Temporary() bool { return true }
+
+type timeoutChan chan struct{}
+
+var ioInitOnce sync.Once
+var ioCompletionPort syscall.Handle
+
+// ioResult contains the result of an asynchronous IO operation
+type ioResult struct {
+	bytes uint32
+	err   error
+}
+
+// ioOperation represents an outstanding asynchronous Win32 IO
+type ioOperation struct {
+	o  syscall.Overlapped
+	ch chan ioResult
+}
+
+func initIo() {
+	h, err := createIoCompletionPort(syscall.InvalidHandle, 0, 0, 0xffffffff)
+	if err != nil {
+		panic(err)
+	}
+	ioCompletionPort = h
+	go ioCompletionProcessor(h)
+}
+
+// win32File implements Reader, Writer, and Closer on a Win32 handle without blocking in a syscall.
+// It takes ownership of this handle and will close it if it is garbage collected.
+type win32File struct {
+	handle        syscall.Handle
+	wg            sync.WaitGroup
+	wgLock        sync.RWMutex
+	closing       atomicBool
+	readDeadline  deadlineHandler
+	writeDeadline deadlineHandler
+}
+
+type deadlineHandler struct {
+	setLock     sync.Mutex
+	channel     timeoutChan
+	channelLock sync.RWMutex
+	timer       *time.Timer
+	timedout    atomicBool
+}
+
+// makeWin32File makes a new win32File from an existing file handle
+func makeWin32File(h syscall.Handle) (*win32File, error) {
+	f := &win32File{handle: h}
+	ioInitOnce.Do(initIo)
+	_, err := createIoCompletionPort(h, ioCompletionPort, 0, 0xffffffff)
+	if err != nil {
+		return nil, err
+	}
+	err = setFileCompletionNotificationModes(h, cFILE_SKIP_COMPLETION_PORT_ON_SUCCESS|cFILE_SKIP_SET_EVENT_ON_HANDLE)
+	if err != nil {
+		return nil, err
+	}
+	f.readDeadline.channel = make(timeoutChan)
+	f.writeDeadline.channel = make(timeoutChan)
+	return f, nil
+}
+
+func MakeOpenFile(h syscall.Handle) (io.ReadWriteCloser, error) {
+	return makeWin32File(h)
+}
+
+// closeHandle closes the resources associated with a Win32 handle
+func (f *win32File) closeHandle() {
+	f.wgLock.Lock()
+	// Atomically set that we are closing, releasing the resources only once.
+	if !f.closing.swap(true) {
+		f.wgLock.Unlock()
+		// cancel all IO and wait for it to complete
+		cancelIoEx(f.handle, nil)
+		f.wg.Wait()
+		// at this point, no new IO can start
+		syscall.Close(f.handle)
+		f.handle = 0
+	} else {
+		f.wgLock.Unlock()
+	}
+}
+
+// Close closes a win32File.
+func (f *win32File) Close() error {
+	f.closeHandle()
+	return nil
+}
+
+// prepareIo prepares for a new IO operation.
+// The caller must call f.wg.Done() when the IO is finished, prior to Close() returning.
+func (f *win32File) prepareIo() (*ioOperation, error) {
+	f.wgLock.RLock()
+	if f.closing.isSet() {
+		f.wgLock.RUnlock()
+		return nil, ErrFileClosed
+	}
+	f.wg.Add(1)
+	f.wgLock.RUnlock()
+	c := &ioOperation{}
+	c.ch = make(chan ioResult)
+	return c, nil
+}
+
+// ioCompletionProcessor processes completed async IOs forever
+func ioCompletionProcessor(h syscall.Handle) {
+	for {
+		var bytes uint32
+		var key uintptr
+		var op *ioOperation
+		err := getQueuedCompletionStatus(h, &bytes, &key, &op, syscall.INFINITE)
+		if op == nil {
+			panic(err)
+		}
+		op.ch <- ioResult{bytes, err}
+	}
+}
+
+// asyncIo processes the return value from ReadFile or WriteFile, blocking until
+// the operation has actually completed.
+func (f *win32File) asyncIo(c *ioOperation, d *deadlineHandler, bytes uint32, err error) (int, error) {
+	if err != syscall.ERROR_IO_PENDING {
+		return int(bytes), err
+	}
+
+	if f.closing.isSet() {
+		cancelIoEx(f.handle, &c.o)
+	}
+
+	var timeout timeoutChan
+	if d != nil {
+		d.channelLock.Lock()
+		timeout = d.channel
+		d.channelLock.Unlock()
+	}
+
+	var r ioResult
+	select {
+	case r = <-c.ch:
+		err = r.err
+		if err == syscall.ERROR_OPERATION_ABORTED {
+			if f.closing.isSet() {
+				err = ErrFileClosed
+			}
+		}
+	case <-timeout:
+		cancelIoEx(f.handle, &c.o)
+		r = <-c.ch
+		err = r.err
+		if err == syscall.ERROR_OPERATION_ABORTED {
+			err = ErrTimeout
+		}
+	}
+
+	// runtime.KeepAlive is needed, as c is passed via native
+	// code to ioCompletionProcessor, c must remain alive
+	// until the channel read is complete.
+	runtime.KeepAlive(c)
+	return int(r.bytes), err
+}
+
+// Read reads from a file handle.
+func (f *win32File) Read(b []byte) (int, error) {
+	c, err := f.prepareIo()
+	if err != nil {
+		return 0, err
+	}
+	defer f.wg.Done()
+
+	if f.readDeadline.timedout.isSet() {
+		return 0, ErrTimeout
+	}
+
+	var bytes uint32
+	err = syscall.ReadFile(f.handle, b, &bytes, &c.o)
+	n, err := f.asyncIo(c, &f.readDeadline, bytes, err)
+	runtime.KeepAlive(b)
+
+	// Handle EOF conditions.
+	if err == nil && n == 0 && len(b) != 0 {
+		return 0, io.EOF
+	} else if err == syscall.ERROR_BROKEN_PIPE {
+		return 0, io.EOF
+	} else {
+		return n, err
+	}
+}
+
+// Write writes to a file handle.
+func (f *win32File) Write(b []byte) (int, error) {
+	c, err := f.prepareIo()
+	if err != nil {
+		return 0, err
+	}
+	defer f.wg.Done()
+
+	if f.writeDeadline.timedout.isSet() {
+		return 0, ErrTimeout
+	}
+
+	var bytes uint32
+	err = syscall.WriteFile(f.handle, b, &bytes, &c.o)
+	n, err := f.asyncIo(c, &f.writeDeadline, bytes, err)
+	runtime.KeepAlive(b)
+	return n, err
+}
+
+func (f *win32File) SetReadDeadline(deadline time.Time) error {
+	return f.readDeadline.set(deadline)
+}
+
+func (f *win32File) SetWriteDeadline(deadline time.Time) error {
+	return f.writeDeadline.set(deadline)
+}
+
+func (f *win32File) Flush() error {
+	return syscall.FlushFileBuffers(f.handle)
+}
+
+func (d *deadlineHandler) set(deadline time.Time) error {
+	d.setLock.Lock()
+	defer d.setLock.Unlock()
+
+	if d.timer != nil {
+		if !d.timer.Stop() {
+			<-d.channel
+		}
+		d.timer = nil
+	}
+	d.timedout.setFalse()
+
+	select {
+	case <-d.channel:
+		d.channelLock.Lock()
+		d.channel = make(chan struct{})
+		d.channelLock.Unlock()
+	default:
+	}
+
+	if deadline.IsZero() {
+		return nil
+	}
+
+	timeoutIO := func() {
+		d.timedout.setTrue()
+		close(d.channel)
+	}
+
+	now := time.Now()
+	duration := deadline.Sub(now)
+	if deadline.After(now) {
+		// Deadline is in the future, set a timer to wait
+		d.timer = time.AfterFunc(duration, timeoutIO)
+	} else {
+		// Deadline is in the past. Cancel all pending IO now.
+		timeoutIO()
+	}
+	return nil
+}

vendor/github.com/Microsoft/go-winio/fileinfo.go

@@ -0,0 +1,61 @@
+// +build windows
+
+package winio
+
+import (
+	"os"
+	"runtime"
+	"syscall"
+	"unsafe"
+)
+
+//sys getFileInformationByHandleEx(h syscall.Handle, class uint32, buffer *byte, size uint32) (err error) = GetFileInformationByHandleEx
+//sys setFileInformationByHandle(h syscall.Handle, class uint32, buffer *byte, size uint32) (err error) = SetFileInformationByHandle
+
+const (
+	fileBasicInfo = 0
+	fileIDInfo    = 0x12
+)
+
+// FileBasicInfo contains file access time and file attributes information.
+type FileBasicInfo struct {
+	CreationTime, LastAccessTime, LastWriteTime, ChangeTime syscall.Filetime
+	FileAttributes                                          uint32
+	pad                                                     uint32 // padding
+}
+
+// GetFileBasicInfo retrieves times and attributes for a file.
+func GetFileBasicInfo(f *os.File) (*FileBasicInfo, error) {
+	bi := &FileBasicInfo{}
+	if err := getFileInformationByHandleEx(syscall.Handle(f.Fd()), fileBasicInfo, (*byte)(unsafe.Pointer(bi)), uint32(unsafe.Sizeof(*bi))); err != nil {
+		return nil, &os.PathError{Op: "GetFileInformationByHandleEx", Path: f.Name(), Err: err}
+	}
+	runtime.KeepAlive(f)
+	return bi, nil
+}
+
+// SetFileBasicInfo sets times and attributes for a file.
+func SetFileBasicInfo(f *os.File, bi *FileBasicInfo) error {
+	if err := setFileInformationByHandle(syscall.Handle(f.Fd()), fileBasicInfo, (*byte)(unsafe.Pointer(bi)), uint32(unsafe.Sizeof(*bi))); err != nil {
+		return &os.PathError{Op: "SetFileInformationByHandle", Path: f.Name(), Err: err}
+	}
+	runtime.KeepAlive(f)
+	return nil
+}
+
+// FileIDInfo contains the volume serial number and file ID for a file. This pair should be
+// unique on a system.
+type FileIDInfo struct {
+	VolumeSerialNumber uint64
+	FileID             [16]byte
+}
+
+// GetFileID retrieves the unique (volume, file ID) pair for a file.
+func GetFileID(f *os.File) (*FileIDInfo, error) {
+	fileID := &FileIDInfo{}
+	if err := getFileInformationByHandleEx(syscall.Handle(f.Fd()), fileIDInfo, (*byte)(unsafe.Pointer(fileID)), uint32(unsafe.Sizeof(*fileID))); err != nil {
+		return nil, &os.PathError{Op: "GetFileInformationByHandleEx", Path: f.Name(), Err: err}
+	}
+	runtime.KeepAlive(f)
+	return fileID, nil
+}

vendor/github.com/Microsoft/go-winio/pipe.go

@@ -0,0 +1,421 @@
+// +build windows
+
+package winio
+
+import (
+	"errors"
+	"io"
+	"net"
+	"os"
+	"syscall"
+	"time"
+	"unsafe"
+)
+
+//sys connectNamedPipe(pipe syscall.Handle, o *syscall.Overlapped) (err error) = ConnectNamedPipe
+//sys createNamedPipe(name string, flags uint32, pipeMode uint32, maxInstances uint32, outSize uint32, inSize uint32, defaultTimeout uint32, sa *syscall.SecurityAttributes) (handle syscall.Handle, err error)  [failretval==syscall.InvalidHandle] = CreateNamedPipeW
+//sys createFile(name string, access uint32, mode uint32, sa *syscall.SecurityAttributes, createmode uint32, attrs uint32, templatefile syscall.Handle) (handle syscall.Handle, err error) [failretval==syscall.InvalidHandle] = CreateFileW
+//sys getNamedPipeInfo(pipe syscall.Handle, flags *uint32, outSize *uint32, inSize *uint32, maxInstances *uint32) (err error) = GetNamedPipeInfo
+//sys getNamedPipeHandleState(pipe syscall.Handle, state *uint32, curInstances *uint32, maxCollectionCount *uint32, collectDataTimeout *uint32, userName *uint16, maxUserNameSize uint32) (err error) = GetNamedPipeHandleStateW
+//sys localAlloc(uFlags uint32, length uint32) (ptr uintptr) = LocalAlloc
+
+const (
+	cERROR_PIPE_BUSY      = syscall.Errno(231)
+	cERROR_NO_DATA        = syscall.Errno(232)
+	cERROR_PIPE_CONNECTED = syscall.Errno(535)
+	cERROR_SEM_TIMEOUT    = syscall.Errno(121)
+
+	cPIPE_ACCESS_DUPLEX            = 0x3
+	cFILE_FLAG_FIRST_PIPE_INSTANCE = 0x80000
+	cSECURITY_SQOS_PRESENT         = 0x100000
+	cSECURITY_ANONYMOUS            = 0
+
+	cPIPE_REJECT_REMOTE_CLIENTS = 0x8
+
+	cPIPE_UNLIMITED_INSTANCES = 255
+
+	cNMPWAIT_USE_DEFAULT_WAIT = 0
+	cNMPWAIT_NOWAIT           = 1
+
+	cPIPE_TYPE_MESSAGE = 4
+
+	cPIPE_READMODE_MESSAGE = 2
+)
+
+var (
+	// ErrPipeListenerClosed is returned for pipe operations on listeners that have been closed.
+	// This error should match net.errClosing since docker takes a dependency on its text.
+	ErrPipeListenerClosed = errors.New("use of closed network connection")
+
+	errPipeWriteClosed = errors.New("pipe has been closed for write")
+)
+
+type win32Pipe struct {
+	*win32File
+	path string
+}
+
+type win32MessageBytePipe struct {
+	win32Pipe
+	writeClosed bool
+	readEOF     bool
+}
+
+type pipeAddress string
+
+func (f *win32Pipe) LocalAddr() net.Addr {
+	return pipeAddress(f.path)
+}
+
+func (f *win32Pipe) RemoteAddr() net.Addr {
+	return pipeAddress(f.path)
+}
+
+func (f *win32Pipe) SetDeadline(t time.Time) error {
+	f.SetReadDeadline(t)
+	f.SetWriteDeadline(t)
+	return nil
+}
+
+// CloseWrite closes the write side of a message pipe in byte mode.
+func (f *win32MessageBytePipe) CloseWrite() error {
+	if f.writeClosed {
+		return errPipeWriteClosed
+	}
+	err := f.win32File.Flush()
+	if err != nil {
+		return err
+	}
+	_, err = f.win32File.Write(nil)
+	if err != nil {
+		return err
+	}
+	f.writeClosed = true
+	return nil
+}
+
+// Write writes bytes to a message pipe in byte mode. Zero-byte writes are ignored, since
+// they are used to implement CloseWrite().
+func (f *win32MessageBytePipe) Write(b []byte) (int, error) {
+	if f.writeClosed {
+		return 0, errPipeWriteClosed
+	}
+	if len(b) == 0 {
+		return 0, nil
+	}
+	return f.win32File.Write(b)
+}
+
+// Read reads bytes from a message pipe in byte mode. A read of a zero-byte message on a message
+// mode pipe will return io.EOF, as will all subsequent reads.
+func (f *win32MessageBytePipe) Read(b []byte) (int, error) {
+	if f.readEOF {
+		return 0, io.EOF
+	}
+	n, err := f.win32File.Read(b)
+	if err == io.EOF {
+		// If this was the result of a zero-byte read, then
+		// it is possible that the read was due to a zero-size
+		// message. Since we are simulating CloseWrite with a
+		// zero-byte message, ensure that all future Read() calls
+		// also return EOF.
+		f.readEOF = true
+	} else if err == syscall.ERROR_MORE_DATA {
+		// ERROR_MORE_DATA indicates that the pipe's read mode is message mode
+		// and the message still has more bytes. Treat this as a success, since
+		// this package presents all named pipes as byte streams.
+		err = nil
+	}
+	return n, err
+}
+
+func (s pipeAddress) Network() string {
+	return "pipe"
+}
+
+func (s pipeAddress) String() string {
+	return string(s)
+}
+
+// DialPipe connects to a named pipe by path, timing out if the connection
+// takes longer than the specified duration. If timeout is nil, then we use
+// a default timeout of 5 seconds.  (We do not use WaitNamedPipe.)
+func DialPipe(path string, timeout *time.Duration) (net.Conn, error) {
+	var absTimeout time.Time
+	if timeout != nil {
+		absTimeout = time.Now().Add(*timeout)
+	} else {
+		absTimeout = time.Now().Add(time.Second * 2)
+	}
+	var err error
+	var h syscall.Handle
+	for {
+		h, err = createFile(path, syscall.GENERIC_READ|syscall.GENERIC_WRITE, 0, nil, syscall.OPEN_EXISTING, syscall.FILE_FLAG_OVERLAPPED|cSECURITY_SQOS_PRESENT|cSECURITY_ANONYMOUS, 0)
+		if err != cERROR_PIPE_BUSY {
+			break
+		}
+		if time.Now().After(absTimeout) {
+			return nil, ErrTimeout
+		}
+
+		// Wait 10 msec and try again. This is a rather simplistic
+		// view, as we always try each 10 milliseconds.
+		time.Sleep(time.Millisecond * 10)
+	}
+	if err != nil {
+		return nil, &os.PathError{Op: "open", Path: path, Err: err}
+	}
+
+	var flags uint32
+	err = getNamedPipeInfo(h, &flags, nil, nil, nil)
+	if err != nil {
+		return nil, err
+	}
+
+	f, err := makeWin32File(h)
+	if err != nil {
+		syscall.Close(h)
+		return nil, err
+	}
+
+	// If the pipe is in message mode, return a message byte pipe, which
+	// supports CloseWrite().
+	if flags&cPIPE_TYPE_MESSAGE != 0 {
+		return &win32MessageBytePipe{
+			win32Pipe: win32Pipe{win32File: f, path: path},
+		}, nil
+	}
+	return &win32Pipe{win32File: f, path: path}, nil
+}
+
+type acceptResponse struct {
+	f   *win32File
+	err error
+}
+
+type win32PipeListener struct {
+	firstHandle        syscall.Handle
+	path               string
+	securityDescriptor []byte
+	config             PipeConfig
+	acceptCh           chan (chan acceptResponse)
+	closeCh            chan int
+	doneCh             chan int
+}
+
+func makeServerPipeHandle(path string, securityDescriptor []byte, c *PipeConfig, first bool) (syscall.Handle, error) {
+	var flags uint32 = cPIPE_ACCESS_DUPLEX | syscall.FILE_FLAG_OVERLAPPED
+	if first {
+		flags |= cFILE_FLAG_FIRST_PIPE_INSTANCE
+	}
+
+	var mode uint32 = cPIPE_REJECT_REMOTE_CLIENTS
+	if c.MessageMode {
+		mode |= cPIPE_TYPE_MESSAGE
+	}
+
+	sa := &syscall.SecurityAttributes{}
+	sa.Length = uint32(unsafe.Sizeof(*sa))
+	if securityDescriptor != nil {
+		len := uint32(len(securityDescriptor))
+		sa.SecurityDescriptor = localAlloc(0, len)
+		defer localFree(sa.SecurityDescriptor)
+		copy((*[0xffff]byte)(unsafe.Pointer(sa.SecurityDescriptor))[:], securityDescriptor)
+	}
+	h, err := createNamedPipe(path, flags, mode, cPIPE_UNLIMITED_INSTANCES, uint32(c.OutputBufferSize), uint32(c.InputBufferSize), 0, sa)
+	if err != nil {
+		return 0, &os.PathError{Op: "open", Path: path, Err: err}
+	}
+	return h, nil
+}
+
+func (l *win32PipeListener) makeServerPipe() (*win32File, error) {
+	h, err := makeServerPipeHandle(l.path, l.securityDescriptor, &l.config, false)
+	if err != nil {
+		return nil, err
+	}
+	f, err := makeWin32File(h)
+	if err != nil {
+		syscall.Close(h)
+		return nil, err
+	}
+	return f, nil
+}
+
+func (l *win32PipeListener) makeConnectedServerPipe() (*win32File, error) {
+	p, err := l.makeServerPipe()
+	if err != nil {
+		return nil, err
+	}
+
+	// Wait for the client to connect.
+	ch := make(chan error)
+	go func(p *win32File) {
+		ch <- connectPipe(p)
+	}(p)
+
+	select {
+	case err = <-ch:
+		if err != nil {
+			p.Close()
+			p = nil
+		}
+	case <-l.closeCh:
+		// Abort the connect request by closing the handle.
+		p.Close()
+		p = nil
+		err = <-ch
+		if err == nil || err == ErrFileClosed {
+			err = ErrPipeListenerClosed
+		}
+	}
+	return p, err
+}
+
+func (l *win32PipeListener) listenerRoutine() {
+	closed := false
+	for !closed {
+		select {
+		case <-l.closeCh:
+			closed = true
+		case responseCh := <-l.acceptCh:
+			var (
+				p   *win32File
+				err error
+			)
+			for {
+				p, err = l.makeConnectedServerPipe()
+				// If the connection was immediately closed by the client, try
+				// again.
+				if err != cERROR_NO_DATA {
+					break
+				}
+			}
+			responseCh <- acceptResponse{p, err}
+			closed = err == ErrPipeListenerClosed
+		}
+	}
+	syscall.Close(l.firstHandle)
+	l.firstHandle = 0
+	// Notify Close() and Accept() callers that the handle has been closed.
+	close(l.doneCh)
+}
+
+// PipeConfig contain configuration for the pipe listener.
+type PipeConfig struct {
+	// SecurityDescriptor contains a Windows security descriptor in SDDL format.
+	SecurityDescriptor string
+
+	// MessageMode determines whether the pipe is in byte or message mode. In either
+	// case the pipe is read in byte mode by default. The only practical difference in
+	// this implementation is that CloseWrite() is only supported for message mode pipes;
+	// CloseWrite() is implemented as a zero-byte write, but zero-byte writes are only
+	// transferred to the reader (and returned as io.EOF in this implementation)
+	// when the pipe is in message mode.
+	MessageMode bool
+
+	// InputBufferSize specifies the size the input buffer, in bytes.
+	InputBufferSize int32
+
+	// OutputBufferSize specifies the size the input buffer, in bytes.
+	OutputBufferSize int32
+}
+
+// ListenPipe creates a listener on a Windows named pipe path, e.g. \\.\pipe\mypipe.
+// The pipe must not already exist.
+func ListenPipe(path string, c *PipeConfig) (net.Listener, error) {
+	var (
+		sd  []byte
+		err error
+	)
+	if c == nil {
+		c = &PipeConfig{}
+	}
+	if c.SecurityDescriptor != "" {
+		sd, err = SddlToSecurityDescriptor(c.SecurityDescriptor)
+		if err != nil {
+			return nil, err
+		}
+	}
+	h, err := makeServerPipeHandle(path, sd, c, true)
+	if err != nil {
+		return nil, err
+	}
+	// Create a client handle and connect it.  This results in the pipe
+	// instance always existing, so that clients see ERROR_PIPE_BUSY
+	// rather than ERROR_FILE_NOT_FOUND.  This ties the first instance
+	// up so that no other instances can be used.  This would have been
+	// cleaner if the Win32 API matched CreateFile with ConnectNamedPipe
+	// instead of CreateNamedPipe.  (Apparently created named pipes are
+	// considered to be in listening state regardless of whether any
+	// active calls to ConnectNamedPipe are outstanding.)
+	h2, err := createFile(path, 0, 0, nil, syscall.OPEN_EXISTING, cSECURITY_SQOS_PRESENT|cSECURITY_ANONYMOUS, 0)
+	if err != nil {
+		syscall.Close(h)
+		return nil, err
+	}
+	// Close the client handle. The server side of the instance will
+	// still be busy, leading to ERROR_PIPE_BUSY instead of
+	// ERROR_NOT_FOUND, as long as we don't close the server handle,
+	// or disconnect the client with DisconnectNamedPipe.
+	syscall.Close(h2)
+	l := &win32PipeListener{
+		firstHandle:        h,
+		path:               path,
+		securityDescriptor: sd,
+		config:             *c,
+		acceptCh:           make(chan (chan acceptResponse)),
+		closeCh:            make(chan int),
+		doneCh:             make(chan int),
+	}
+	go l.listenerRoutine()
+	return l, nil
+}
+
+func connectPipe(p *win32File) error {
+	c, err := p.prepareIo()
+	if err != nil {
+		return err
+	}
+	defer p.wg.Done()
+
+	err = connectNamedPipe(p.handle, &c.o)
+	_, err = p.asyncIo(c, nil, 0, err)
+	if err != nil && err != cERROR_PIPE_CONNECTED {
+		return err
+	}
+	return nil
+}
+
+func (l *win32PipeListener) Accept() (net.Conn, error) {
+	ch := make(chan acceptResponse)
+	select {
+	case l.acceptCh <- ch:
+		response := <-ch
+		err := response.err
+		if err != nil {
+			return nil, err
+		}
+		if l.config.MessageMode {
+			return &win32MessageBytePipe{
+				win32Pipe: win32Pipe{win32File: response.f, path: l.path},
+			}, nil
+		}
+		return &win32Pipe{win32File: response.f, path: l.path}, nil
+	case <-l.doneCh:
+		return nil, ErrPipeListenerClosed
+	}
+}
+
+func (l *win32PipeListener) Close() error {
+	select {
+	case l.closeCh <- 1:
+		<-l.doneCh
+	case <-l.doneCh:
+	}
+	return nil
+}
+
+func (l *win32PipeListener) Addr() net.Addr {
+	return pipeAddress(l.path)
+}

vendor/github.com/Microsoft/go-winio/privilege.go

@@ -0,0 +1,202 @@
+// +build windows
+
+package winio
+
+import (
+	"bytes"
+	"encoding/binary"
+	"fmt"
+	"runtime"
+	"sync"
+	"syscall"
+	"unicode/utf16"
+
+	"golang.org/x/sys/windows"
+)
+
+//sys adjustTokenPrivileges(token windows.Token, releaseAll bool, input *byte, outputSize uint32, output *byte, requiredSize *uint32) (success bool, err error) [true] = advapi32.AdjustTokenPrivileges
+//sys impersonateSelf(level uint32) (err error) = advapi32.ImpersonateSelf
+//sys revertToSelf() (err error) = advapi32.RevertToSelf
+//sys openThreadToken(thread syscall.Handle, accessMask uint32, openAsSelf bool, token *windows.Token) (err error) = advapi32.OpenThreadToken
+//sys getCurrentThread() (h syscall.Handle) = GetCurrentThread
+//sys lookupPrivilegeValue(systemName string, name string, luid *uint64) (err error) = advapi32.LookupPrivilegeValueW
+//sys lookupPrivilegeName(systemName string, luid *uint64, buffer *uint16, size *uint32) (err error) = advapi32.LookupPrivilegeNameW
+//sys lookupPrivilegeDisplayName(systemName string, name *uint16, buffer *uint16, size *uint32, languageId *uint32) (err error) = advapi32.LookupPrivilegeDisplayNameW
+
+const (
+	SE_PRIVILEGE_ENABLED = 2
+
+	ERROR_NOT_ALL_ASSIGNED syscall.Errno = 1300
+
+	SeBackupPrivilege  = "SeBackupPrivilege"
+	SeRestorePrivilege = "SeRestorePrivilege"
+)
+
+const (
+	securityAnonymous = iota
+	securityIdentification
+	securityImpersonation
+	securityDelegation
+)
+
+var (
+	privNames     = make(map[string]uint64)
+	privNameMutex sync.Mutex
+)
+
+// PrivilegeError represents an error enabling privileges.
+type PrivilegeError struct {
+	privileges []uint64
+}
+
+func (e *PrivilegeError) Error() string {
+	s := ""
+	if len(e.privileges) > 1 {
+		s = "Could not enable privileges "
+	} else {
+		s = "Could not enable privilege "
+	}
+	for i, p := range e.privileges {
+		if i != 0 {
+			s += ", "
+		}
+		s += `"`
+		s += getPrivilegeName(p)
+		s += `"`
+	}
+	return s
+}
+
+// RunWithPrivilege enables a single privilege for a function call.
+func RunWithPrivilege(name string, fn func() error) error {
+	return RunWithPrivileges([]string{name}, fn)
+}
+
+// RunWithPrivileges enables privileges for a function call.
+func RunWithPrivileges(names []string, fn func() error) error {
+	privileges, err := mapPrivileges(names)
+	if err != nil {
+		return err
+	}
+	runtime.LockOSThread()
+	defer runtime.UnlockOSThread()
+	token, err := newThreadToken()
+	if err != nil {
+		return err
+	}
+	defer releaseThreadToken(token)
+	err = adjustPrivileges(token, privileges, SE_PRIVILEGE_ENABLED)
+	if err != nil {
+		return err
+	}
+	return fn()
+}
+
+func mapPrivileges(names []string) ([]uint64, error) {
+	var privileges []uint64
+	privNameMutex.Lock()
+	defer privNameMutex.Unlock()
+	for _, name := range names {
+		p, ok := privNames[name]
+		if !ok {
+			err := lookupPrivilegeValue("", name, &p)
+			if err != nil {
+				return nil, err
+			}
+			privNames[name] = p
+		}
+		privileges = append(privileges, p)
+	}
+	return privileges, nil
+}
+
+// EnableProcessPrivileges enables privileges globally for the process.
+func EnableProcessPrivileges(names []string) error {
+	return enableDisableProcessPrivilege(names, SE_PRIVILEGE_ENABLED)
+}
+
+// DisableProcessPrivileges disables privileges globally for the process.
+func DisableProcessPrivileges(names []string) error {
+	return enableDisableProcessPrivilege(names, 0)
+}
+
+func enableDisableProcessPrivilege(names []string, action uint32) error {
+	privileges, err := mapPrivileges(names)
+	if err != nil {
+		return err
+	}
+
+	p, _ := windows.GetCurrentProcess()
+	var token windows.Token
+	err = windows.OpenProcessToken(p, windows.TOKEN_ADJUST_PRIVILEGES|windows.TOKEN_QUERY, &token)
+	if err != nil {
+		return err
+	}
+
+	defer token.Close()
+	return adjustPrivileges(token, privileges, action)
+}
+
+func adjustPrivileges(token windows.Token, privileges []uint64, action uint32) error {
+	var b bytes.Buffer
+	binary.Write(&b, binary.LittleEndian, uint32(len(privileges)))
+	for _, p := range privileges {
+		binary.Write(&b, binary.LittleEndian, p)
+		binary.Write(&b, binary.LittleEndian, action)
+	}
+	prevState := make([]byte, b.Len())
+	reqSize := uint32(0)
+	success, err := adjustTokenPrivileges(token, false, &b.Bytes()[0], uint32(len(prevState)), &prevState[0], &reqSize)
+	if !success {
+		return err
+	}
+	if err == ERROR_NOT_ALL_ASSIGNED {
+		return &PrivilegeError{privileges}
+	}
+	return nil
+}
+
+func getPrivilegeName(luid uint64) string {
+	var nameBuffer [256]uint16
+	bufSize := uint32(len(nameBuffer))
+	err := lookupPrivilegeName("", &luid, &nameBuffer[0], &bufSize)
+	if err != nil {
+		return fmt.Sprintf("<unknown privilege %d>", luid)
+	}
+
+	var displayNameBuffer [256]uint16
+	displayBufSize := uint32(len(displayNameBuffer))
+	var langID uint32
+	err = lookupPrivilegeDisplayName("", &nameBuffer[0], &displayNameBuffer[0], &displayBufSize, &langID)
+	if err != nil {
+		return fmt.Sprintf("<unknown privilege %s>", string(utf16.Decode(nameBuffer[:bufSize])))
+	}
+
+	return string(utf16.Decode(displayNameBuffer[:displayBufSize]))
+}
+
+func newThreadToken() (windows.Token, error) {
+	err := impersonateSelf(securityImpersonation)
+	if err != nil {
+		return 0, err
+	}
+
+	var token windows.Token
+	err = openThreadToken(getCurrentThread(), syscall.TOKEN_ADJUST_PRIVILEGES|syscall.TOKEN_QUERY, false, &token)
+	if err != nil {
+		rerr := revertToSelf()
+		if rerr != nil {
+			panic(rerr)
+		}
+		return 0, err
+	}
+	return token, nil
+}
+
+func releaseThreadToken(h windows.Token) {
+	err := revertToSelf()
+	if err != nil {
+		panic(err)
+	}
+	h.Close()
+}

vendor/github.com/Microsoft/go-winio/reparse.go

@@ -0,0 +1,128 @@
+package winio
+
+import (
+	"bytes"
+	"encoding/binary"
+	"fmt"
+	"strings"
+	"unicode/utf16"
+	"unsafe"
+)
+
+const (
+	reparseTagMountPoint = 0xA0000003
+	reparseTagSymlink    = 0xA000000C
+)
+
+type reparseDataBuffer struct {
+	ReparseTag           uint32
+	ReparseDataLength    uint16
+	Reserved             uint16
+	SubstituteNameOffset uint16
+	SubstituteNameLength uint16
+	PrintNameOffset      uint16
+	PrintNameLength      uint16
+}
+
+// ReparsePoint describes a Win32 symlink or mount point.
+type ReparsePoint struct {
+	Target       string
+	IsMountPoint bool
+}
+
+// UnsupportedReparsePointError is returned when trying to decode a non-symlink or
+// mount point reparse point.
+type UnsupportedReparsePointError struct {
+	Tag uint32
+}
+
+func (e *UnsupportedReparsePointError) Error() string {
+	return fmt.Sprintf("unsupported reparse point %x", e.Tag)
+}
+
+// DecodeReparsePoint decodes a Win32 REPARSE_DATA_BUFFER structure containing either a symlink
+// or a mount point.
+func DecodeReparsePoint(b []byte) (*ReparsePoint, error) {
+	tag := binary.LittleEndian.Uint32(b[0:4])
+	return DecodeReparsePointData(tag, b[8:])
+}
+
+func DecodeReparsePointData(tag uint32, b []byte) (*ReparsePoint, error) {
+	isMountPoint := false
+	switch tag {
+	case reparseTagMountPoint:
+		isMountPoint = true
+	case reparseTagSymlink:
+	default:
+		return nil, &UnsupportedReparsePointError{tag}
+	}
+	nameOffset := 8 + binary.LittleEndian.Uint16(b[4:6])
+	if !isMountPoint {
+		nameOffset += 4
+	}
+	nameLength := binary.LittleEndian.Uint16(b[6:8])
+	name := make([]uint16, nameLength/2)
+	err := binary.Read(bytes.NewReader(b[nameOffset:nameOffset+nameLength]), binary.LittleEndian, &name)
+	if err != nil {
+		return nil, err
+	}
+	return &ReparsePoint{string(utf16.Decode(name)), isMountPoint}, nil
+}
+
+func isDriveLetter(c byte) bool {
+	return (c >= 'a' && c <= 'z') || (c >= 'A' && c <= 'Z')
+}
+
+// EncodeReparsePoint encodes a Win32 REPARSE_DATA_BUFFER structure describing a symlink or
+// mount point.
+func EncodeReparsePoint(rp *ReparsePoint) []byte {
+	// Generate an NT path and determine if this is a relative path.
+	var ntTarget string
+	relative := false
+	if strings.HasPrefix(rp.Target, `\\?\`) {
+		ntTarget = `\??\` + rp.Target[4:]
+	} else if strings.HasPrefix(rp.Target, `\\`) {
+		ntTarget = `\??\UNC\` + rp.Target[2:]
+	} else if len(rp.Target) >= 2 && isDriveLetter(rp.Target[0]) && rp.Target[1] == ':' {
+		ntTarget = `\??\` + rp.Target
+	} else {
+		ntTarget = rp.Target
+		relative = true
+	}
+
+	// The paths must be NUL-terminated even though they are counted strings.
+	target16 := utf16.Encode([]rune(rp.Target + "\x00"))
+	ntTarget16 := utf16.Encode([]rune(ntTarget + "\x00"))
+
+	size := int(unsafe.Sizeof(reparseDataBuffer{})) - 8
+	size += len(ntTarget16)*2 + len(target16)*2
+
+	tag := uint32(reparseTagMountPoint)
+	if !rp.IsMountPoint {
+		tag = reparseTagSymlink
+		size += 4 // Add room for symlink flags
+	}
+
+	data := reparseDataBuffer{
+		ReparseTag:           tag,
+		ReparseDataLength:    uint16(size),
+		SubstituteNameOffset: 0,
+		SubstituteNameLength: uint16((len(ntTarget16) - 1) * 2),
+		PrintNameOffset:      uint16(len(ntTarget16) * 2),
+		PrintNameLength:      uint16((len(target16) - 1) * 2),
+	}
+
+	var b bytes.Buffer
+	binary.Write(&b, binary.LittleEndian, &data)
+	if !rp.IsMountPoint {
+		flags := uint32(0)
+		if relative {
+			flags |= 1
+		}
+		binary.Write(&b, binary.LittleEndian, flags)
+	}
+
+	binary.Write(&b, binary.LittleEndian, ntTarget16)
+	binary.Write(&b, binary.LittleEndian, target16)
+	return b.Bytes()
+}

vendor/github.com/Microsoft/go-winio/sd.go

@@ -0,0 +1,98 @@
+// +build windows
+
+package winio
+
+import (
+	"syscall"
+	"unsafe"
+)
+
+//sys lookupAccountName(systemName *uint16, accountName string, sid *byte, sidSize *uint32, refDomain *uint16, refDomainSize *uint32, sidNameUse *uint32) (err error) = advapi32.LookupAccountNameW
+//sys convertSidToStringSid(sid *byte, str **uint16) (err error) = advapi32.ConvertSidToStringSidW
+//sys convertStringSecurityDescriptorToSecurityDescriptor(str string, revision uint32, sd *uintptr, size *uint32) (err error) = advapi32.ConvertStringSecurityDescriptorToSecurityDescriptorW
+//sys convertSecurityDescriptorToStringSecurityDescriptor(sd *byte, revision uint32, secInfo uint32, sddl **uint16, sddlSize *uint32) (err error) = advapi32.ConvertSecurityDescriptorToStringSecurityDescriptorW
+//sys localFree(mem uintptr) = LocalFree
+//sys getSecurityDescriptorLength(sd uintptr) (len uint32) = advapi32.GetSecurityDescriptorLength
+
+const (
+	cERROR_NONE_MAPPED = syscall.Errno(1332)
+)
+
+type AccountLookupError struct {
+	Name string
+	Err  error
+}
+
+func (e *AccountLookupError) Error() string {
+	if e.Name == "" {
+		return "lookup account: empty account name specified"
+	}
+	var s string
+	switch e.Err {
+	case cERROR_NONE_MAPPED:
+		s = "not found"
+	default:
+		s = e.Err.Error()
+	}
+	return "lookup account " + e.Name + ": " + s
+}
+
+type SddlConversionError struct {
+	Sddl string
+	Err  error
+}
+
+func (e *SddlConversionError) Error() string {
+	return "convert " + e.Sddl + ": " + e.Err.Error()
+}
+
+// LookupSidByName looks up the SID of an account by name
+func LookupSidByName(name string) (sid string, err error) {
+	if name == "" {
+		return "", &AccountLookupError{name, cERROR_NONE_MAPPED}
+	}
+
+	var sidSize, sidNameUse, refDomainSize uint32
+	err = lookupAccountName(nil, name, nil, &sidSize, nil, &refDomainSize, &sidNameUse)
+	if err != nil && err != syscall.ERROR_INSUFFICIENT_BUFFER {
+		return "", &AccountLookupError{name, err}
+	}
+	sidBuffer := make([]byte, sidSize)
+	refDomainBuffer := make([]uint16, refDomainSize)
+	err = lookupAccountName(nil, name, &sidBuffer[0], &sidSize, &refDomainBuffer[0], &refDomainSize, &sidNameUse)
+	if err != nil {
+		return "", &AccountLookupError{name, err}
+	}
+	var strBuffer *uint16
+	err = convertSidToStringSid(&sidBuffer[0], &strBuffer)
+	if err != nil {
+		return "", &AccountLookupError{name, err}
+	}
+	sid = syscall.UTF16ToString((*[0xffff]uint16)(unsafe.Pointer(strBuffer))[:])
+	localFree(uintptr(unsafe.Pointer(strBuffer)))
+	return sid, nil
+}
+
+func SddlToSecurityDescriptor(sddl string) ([]byte, error) {
+	var sdBuffer uintptr
+	err := convertStringSecurityDescriptorToSecurityDescriptor(sddl, 1, &sdBuffer, nil)
+	if err != nil {
+		return nil, &SddlConversionError{sddl, err}
+	}
+	defer localFree(sdBuffer)
+	sd := make([]byte, getSecurityDescriptorLength(sdBuffer))
+	copy(sd, (*[0xffff]byte)(unsafe.Pointer(sdBuffer))[:len(sd)])
+	return sd, nil
+}
+
+func SecurityDescriptorToSddl(sd []byte) (string, error) {
+	var sddl *uint16
+	// The returned string length seems to including an aribtrary number of terminating NULs.
+	// Don't use it.
+	err := convertSecurityDescriptorToStringSecurityDescriptor(&sd[0], 1, 0xff, &sddl, nil)
+	if err != nil {
+		return "", err
+	}
+	defer localFree(uintptr(unsafe.Pointer(sddl)))
+	return syscall.UTF16ToString((*[0xffff]uint16)(unsafe.Pointer(sddl))[:]), nil
+}

vendor/github.com/Microsoft/go-winio/syscall.go

@@ -0,0 +1,3 @@
+package winio
+
+//go:generate go run $GOROOT/src/syscall/mksyscall_windows.go -output zsyscall_windows.go file.go pipe.go sd.go fileinfo.go privilege.go backup.go

vendor/github.com/Microsoft/go-winio/zsyscall_windows.go

@@ -0,0 +1,520 @@
+// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT
+
+package winio
+
+import (
+	"syscall"
+	"unsafe"
+
+	"golang.org/x/sys/windows"
+)
+
+var _ unsafe.Pointer
+
+// Do the interface allocations only once for common
+// Errno values.
+const (
+	errnoERROR_IO_PENDING = 997
+)
+
+var (
+	errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
+)
+
+// errnoErr returns common boxed Errno values, to prevent
+// allocations at runtime.
+func errnoErr(e syscall.Errno) error {
+	switch e {
+	case 0:
+		return nil
+	case errnoERROR_IO_PENDING:
+		return errERROR_IO_PENDING
+	}
+	// TODO: add more here, after collecting data on the common
+	// error values see on Windows. (perhaps when running
+	// all.bat?)
+	return e
+}
+
+var (
+	modkernel32 = windows.NewLazySystemDLL("kernel32.dll")
+	modadvapi32 = windows.NewLazySystemDLL("advapi32.dll")
+
+	procCancelIoEx                                           = modkernel32.NewProc("CancelIoEx")
+	procCreateIoCompletionPort                               = modkernel32.NewProc("CreateIoCompletionPort")
+	procGetQueuedCompletionStatus                            = modkernel32.NewProc("GetQueuedCompletionStatus")
+	procSetFileCompletionNotificationModes                   = modkernel32.NewProc("SetFileCompletionNotificationModes")
+	procConnectNamedPipe                                     = modkernel32.NewProc("ConnectNamedPipe")
+	procCreateNamedPipeW                                     = modkernel32.NewProc("CreateNamedPipeW")
+	procCreateFileW                                          = modkernel32.NewProc("CreateFileW")
+	procWaitNamedPipeW                                       = modkernel32.NewProc("WaitNamedPipeW")
+	procGetNamedPipeInfo                                     = modkernel32.NewProc("GetNamedPipeInfo")
+	procGetNamedPipeHandleStateW                             = modkernel32.NewProc("GetNamedPipeHandleStateW")
+	procLocalAlloc                                           = modkernel32.NewProc("LocalAlloc")
+	procLookupAccountNameW                                   = modadvapi32.NewProc("LookupAccountNameW")
+	procConvertSidToStringSidW                               = modadvapi32.NewProc("ConvertSidToStringSidW")
+	procConvertStringSecurityDescriptorToSecurityDescriptorW = modadvapi32.NewProc("ConvertStringSecurityDescriptorToSecurityDescriptorW")
+	procConvertSecurityDescriptorToStringSecurityDescriptorW = modadvapi32.NewProc("ConvertSecurityDescriptorToStringSecurityDescriptorW")
+	procLocalFree                                            = modkernel32.NewProc("LocalFree")
+	procGetSecurityDescriptorLength                          = modadvapi32.NewProc("GetSecurityDescriptorLength")
+	procGetFileInformationByHandleEx                         = modkernel32.NewProc("GetFileInformationByHandleEx")
+	procSetFileInformationByHandle                           = modkernel32.NewProc("SetFileInformationByHandle")
+	procAdjustTokenPrivileges                                = modadvapi32.NewProc("AdjustTokenPrivileges")
+	procImpersonateSelf                                      = modadvapi32.NewProc("ImpersonateSelf")
+	procRevertToSelf                                         = modadvapi32.NewProc("RevertToSelf")
+	procOpenThreadToken                                      = modadvapi32.NewProc("OpenThreadToken")
+	procGetCurrentThread                                     = modkernel32.NewProc("GetCurrentThread")
+	procLookupPrivilegeValueW                                = modadvapi32.NewProc("LookupPrivilegeValueW")
+	procLookupPrivilegeNameW                                 = modadvapi32.NewProc("LookupPrivilegeNameW")
+	procLookupPrivilegeDisplayNameW                          = modadvapi32.NewProc("LookupPrivilegeDisplayNameW")
+	procBackupRead                                           = modkernel32.NewProc("BackupRead")
+	procBackupWrite                                          = modkernel32.NewProc("BackupWrite")
+)
+
+func cancelIoEx(file syscall.Handle, o *syscall.Overlapped) (err error) {
+	r1, _, e1 := syscall.Syscall(procCancelIoEx.Addr(), 2, uintptr(file), uintptr(unsafe.Pointer(o)), 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func createIoCompletionPort(file syscall.Handle, port syscall.Handle, key uintptr, threadCount uint32) (newport syscall.Handle, err error) {
+	r0, _, e1 := syscall.Syscall6(procCreateIoCompletionPort.Addr(), 4, uintptr(file), uintptr(port), uintptr(key), uintptr(threadCount), 0, 0)
+	newport = syscall.Handle(r0)
+	if newport == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func getQueuedCompletionStatus(port syscall.Handle, bytes *uint32, key *uintptr, o **ioOperation, timeout uint32) (err error) {
+	r1, _, e1 := syscall.Syscall6(procGetQueuedCompletionStatus.Addr(), 5, uintptr(port), uintptr(unsafe.Pointer(bytes)), uintptr(unsafe.Pointer(key)), uintptr(unsafe.Pointer(o)), uintptr(timeout), 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func setFileCompletionNotificationModes(h syscall.Handle, flags uint8) (err error) {
+	r1, _, e1 := syscall.Syscall(procSetFileCompletionNotificationModes.Addr(), 2, uintptr(h), uintptr(flags), 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func connectNamedPipe(pipe syscall.Handle, o *syscall.Overlapped) (err error) {
+	r1, _, e1 := syscall.Syscall(procConnectNamedPipe.Addr(), 2, uintptr(pipe), uintptr(unsafe.Pointer(o)), 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func createNamedPipe(name string, flags uint32, pipeMode uint32, maxInstances uint32, outSize uint32, inSize uint32, defaultTimeout uint32, sa *syscall.SecurityAttributes) (handle syscall.Handle, err error) {
+	var _p0 *uint16
+	_p0, err = syscall.UTF16PtrFromString(name)
+	if err != nil {
+		return
+	}
+	return _createNamedPipe(_p0, flags, pipeMode, maxInstances, outSize, inSize, defaultTimeout, sa)
+}
+
+func _createNamedPipe(name *uint16, flags uint32, pipeMode uint32, maxInstances uint32, outSize uint32, inSize uint32, defaultTimeout uint32, sa *syscall.SecurityAttributes) (handle syscall.Handle, err error) {
+	r0, _, e1 := syscall.Syscall9(procCreateNamedPipeW.Addr(), 8, uintptr(unsafe.Pointer(name)), uintptr(flags), uintptr(pipeMode), uintptr(maxInstances), uintptr(outSize), uintptr(inSize), uintptr(defaultTimeout), uintptr(unsafe.Pointer(sa)), 0)
+	handle = syscall.Handle(r0)
+	if handle == syscall.InvalidHandle {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func createFile(name string, access uint32, mode uint32, sa *syscall.SecurityAttributes, createmode uint32, attrs uint32, templatefile syscall.Handle) (handle syscall.Handle, err error) {
+	var _p0 *uint16
+	_p0, err = syscall.UTF16PtrFromString(name)
+	if err != nil {
+		return
+	}
+	return _createFile(_p0, access, mode, sa, createmode, attrs, templatefile)
+}
+
+func _createFile(name *uint16, access uint32, mode uint32, sa *syscall.SecurityAttributes, createmode uint32, attrs uint32, templatefile syscall.Handle) (handle syscall.Handle, err error) {
+	r0, _, e1 := syscall.Syscall9(procCreateFileW.Addr(), 7, uintptr(unsafe.Pointer(name)), uintptr(access), uintptr(mode), uintptr(unsafe.Pointer(sa)), uintptr(createmode), uintptr(attrs), uintptr(templatefile), 0, 0)
+	handle = syscall.Handle(r0)
+	if handle == syscall.InvalidHandle {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func waitNamedPipe(name string, timeout uint32) (err error) {
+	var _p0 *uint16
+	_p0, err = syscall.UTF16PtrFromString(name)
+	if err != nil {
+		return
+	}
+	return _waitNamedPipe(_p0, timeout)
+}
+
+func _waitNamedPipe(name *uint16, timeout uint32) (err error) {
+	r1, _, e1 := syscall.Syscall(procWaitNamedPipeW.Addr(), 2, uintptr(unsafe.Pointer(name)), uintptr(timeout), 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func getNamedPipeInfo(pipe syscall.Handle, flags *uint32, outSize *uint32, inSize *uint32, maxInstances *uint32) (err error) {
+	r1, _, e1 := syscall.Syscall6(procGetNamedPipeInfo.Addr(), 5, uintptr(pipe), uintptr(unsafe.Pointer(flags)), uintptr(unsafe.Pointer(outSize)), uintptr(unsafe.Pointer(inSize)), uintptr(unsafe.Pointer(maxInstances)), 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func getNamedPipeHandleState(pipe syscall.Handle, state *uint32, curInstances *uint32, maxCollectionCount *uint32, collectDataTimeout *uint32, userName *uint16, maxUserNameSize uint32) (err error) {
+	r1, _, e1 := syscall.Syscall9(procGetNamedPipeHandleStateW.Addr(), 7, uintptr(pipe), uintptr(unsafe.Pointer(state)), uintptr(unsafe.Pointer(curInstances)), uintptr(unsafe.Pointer(maxCollectionCount)), uintptr(unsafe.Pointer(collectDataTimeout)), uintptr(unsafe.Pointer(userName)), uintptr(maxUserNameSize), 0, 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func localAlloc(uFlags uint32, length uint32) (ptr uintptr) {
+	r0, _, _ := syscall.Syscall(procLocalAlloc.Addr(), 2, uintptr(uFlags), uintptr(length), 0)
+	ptr = uintptr(r0)
+	return
+}
+
+func lookupAccountName(systemName *uint16, accountName string, sid *byte, sidSize *uint32, refDomain *uint16, refDomainSize *uint32, sidNameUse *uint32) (err error) {
+	var _p0 *uint16
+	_p0, err = syscall.UTF16PtrFromString(accountName)
+	if err != nil {
+		return
+	}
+	return _lookupAccountName(systemName, _p0, sid, sidSize, refDomain, refDomainSize, sidNameUse)
+}
+
+func _lookupAccountName(systemName *uint16, accountName *uint16, sid *byte, sidSize *uint32, refDomain *uint16, refDomainSize *uint32, sidNameUse *uint32) (err error) {
+	r1, _, e1 := syscall.Syscall9(procLookupAccountNameW.Addr(), 7, uintptr(unsafe.Pointer(systemName)), uintptr(unsafe.Pointer(accountName)), uintptr(unsafe.Pointer(sid)), uintptr(unsafe.Pointer(sidSize)), uintptr(unsafe.Pointer(refDomain)), uintptr(unsafe.Pointer(refDomainSize)), uintptr(unsafe.Pointer(sidNameUse)), 0, 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func convertSidToStringSid(sid *byte, str **uint16) (err error) {
+	r1, _, e1 := syscall.Syscall(procConvertSidToStringSidW.Addr(), 2, uintptr(unsafe.Pointer(sid)), uintptr(unsafe.Pointer(str)), 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func convertStringSecurityDescriptorToSecurityDescriptor(str string, revision uint32, sd *uintptr, size *uint32) (err error) {
+	var _p0 *uint16
+	_p0, err = syscall.UTF16PtrFromString(str)
+	if err != nil {
+		return
+	}
+	return _convertStringSecurityDescriptorToSecurityDescriptor(_p0, revision, sd, size)
+}
+
+func _convertStringSecurityDescriptorToSecurityDescriptor(str *uint16, revision uint32, sd *uintptr, size *uint32) (err error) {
+	r1, _, e1 := syscall.Syscall6(procConvertStringSecurityDescriptorToSecurityDescriptorW.Addr(), 4, uintptr(unsafe.Pointer(str)), uintptr(revision), uintptr(unsafe.Pointer(sd)), uintptr(unsafe.Pointer(size)), 0, 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func convertSecurityDescriptorToStringSecurityDescriptor(sd *byte, revision uint32, secInfo uint32, sddl **uint16, sddlSize *uint32) (err error) {
+	r1, _, e1 := syscall.Syscall6(procConvertSecurityDescriptorToStringSecurityDescriptorW.Addr(), 5, uintptr(unsafe.Pointer(sd)), uintptr(revision), uintptr(secInfo), uintptr(unsafe.Pointer(sddl)), uintptr(unsafe.Pointer(sddlSize)), 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func localFree(mem uintptr) {
+	syscall.Syscall(procLocalFree.Addr(), 1, uintptr(mem), 0, 0)
+	return
+}
+
+func getSecurityDescriptorLength(sd uintptr) (len uint32) {
+	r0, _, _ := syscall.Syscall(procGetSecurityDescriptorLength.Addr(), 1, uintptr(sd), 0, 0)
+	len = uint32(r0)
+	return
+}
+
+func getFileInformationByHandleEx(h syscall.Handle, class uint32, buffer *byte, size uint32) (err error) {
+	r1, _, e1 := syscall.Syscall6(procGetFileInformationByHandleEx.Addr(), 4, uintptr(h), uintptr(class), uintptr(unsafe.Pointer(buffer)), uintptr(size), 0, 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func setFileInformationByHandle(h syscall.Handle, class uint32, buffer *byte, size uint32) (err error) {
+	r1, _, e1 := syscall.Syscall6(procSetFileInformationByHandle.Addr(), 4, uintptr(h), uintptr(class), uintptr(unsafe.Pointer(buffer)), uintptr(size), 0, 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func adjustTokenPrivileges(token windows.Token, releaseAll bool, input *byte, outputSize uint32, output *byte, requiredSize *uint32) (success bool, err error) {
+	var _p0 uint32
+	if releaseAll {
+		_p0 = 1
+	} else {
+		_p0 = 0
+	}
+	r0, _, e1 := syscall.Syscall6(procAdjustTokenPrivileges.Addr(), 6, uintptr(token), uintptr(_p0), uintptr(unsafe.Pointer(input)), uintptr(outputSize), uintptr(unsafe.Pointer(output)), uintptr(unsafe.Pointer(requiredSize)))
+	success = r0 != 0
+	if true {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func impersonateSelf(level uint32) (err error) {
+	r1, _, e1 := syscall.Syscall(procImpersonateSelf.Addr(), 1, uintptr(level), 0, 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func revertToSelf() (err error) {
+	r1, _, e1 := syscall.Syscall(procRevertToSelf.Addr(), 0, 0, 0, 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func openThreadToken(thread syscall.Handle, accessMask uint32, openAsSelf bool, token *windows.Token) (err error) {
+	var _p0 uint32
+	if openAsSelf {
+		_p0 = 1
+	} else {
+		_p0 = 0
+	}
+	r1, _, e1 := syscall.Syscall6(procOpenThreadToken.Addr(), 4, uintptr(thread), uintptr(accessMask), uintptr(_p0), uintptr(unsafe.Pointer(token)), 0, 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func getCurrentThread() (h syscall.Handle) {
+	r0, _, _ := syscall.Syscall(procGetCurrentThread.Addr(), 0, 0, 0, 0)
+	h = syscall.Handle(r0)
+	return
+}
+
+func lookupPrivilegeValue(systemName string, name string, luid *uint64) (err error) {
+	var _p0 *uint16
+	_p0, err = syscall.UTF16PtrFromString(systemName)
+	if err != nil {
+		return
+	}
+	var _p1 *uint16
+	_p1, err = syscall.UTF16PtrFromString(name)
+	if err != nil {
+		return
+	}
+	return _lookupPrivilegeValue(_p0, _p1, luid)
+}
+
+func _lookupPrivilegeValue(systemName *uint16, name *uint16, luid *uint64) (err error) {
+	r1, _, e1 := syscall.Syscall(procLookupPrivilegeValueW.Addr(), 3, uintptr(unsafe.Pointer(systemName)), uintptr(unsafe.Pointer(name)), uintptr(unsafe.Pointer(luid)))
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func lookupPrivilegeName(systemName string, luid *uint64, buffer *uint16, size *uint32) (err error) {
+	var _p0 *uint16
+	_p0, err = syscall.UTF16PtrFromString(systemName)
+	if err != nil {
+		return
+	}
+	return _lookupPrivilegeName(_p0, luid, buffer, size)
+}
+
+func _lookupPrivilegeName(systemName *uint16, luid *uint64, buffer *uint16, size *uint32) (err error) {
+	r1, _, e1 := syscall.Syscall6(procLookupPrivilegeNameW.Addr(), 4, uintptr(unsafe.Pointer(systemName)), uintptr(unsafe.Pointer(luid)), uintptr(unsafe.Pointer(buffer)), uintptr(unsafe.Pointer(size)), 0, 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func lookupPrivilegeDisplayName(systemName string, name *uint16, buffer *uint16, size *uint32, languageId *uint32) (err error) {
+	var _p0 *uint16
+	_p0, err = syscall.UTF16PtrFromString(systemName)
+	if err != nil {
+		return
+	}
+	return _lookupPrivilegeDisplayName(_p0, name, buffer, size, languageId)
+}
+
+func _lookupPrivilegeDisplayName(systemName *uint16, name *uint16, buffer *uint16, size *uint32, languageId *uint32) (err error) {
+	r1, _, e1 := syscall.Syscall6(procLookupPrivilegeDisplayNameW.Addr(), 5, uintptr(unsafe.Pointer(systemName)), uintptr(unsafe.Pointer(name)), uintptr(unsafe.Pointer(buffer)), uintptr(unsafe.Pointer(size)), uintptr(unsafe.Pointer(languageId)), 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func backupRead(h syscall.Handle, b []byte, bytesRead *uint32, abort bool, processSecurity bool, context *uintptr) (err error) {
+	var _p0 *byte
+	if len(b) > 0 {
+		_p0 = &b[0]
+	}
+	var _p1 uint32
+	if abort {
+		_p1 = 1
+	} else {
+		_p1 = 0
+	}
+	var _p2 uint32
+	if processSecurity {
+		_p2 = 1
+	} else {
+		_p2 = 0
+	}
+	r1, _, e1 := syscall.Syscall9(procBackupRead.Addr(), 7, uintptr(h), uintptr(unsafe.Pointer(_p0)), uintptr(len(b)), uintptr(unsafe.Pointer(bytesRead)), uintptr(_p1), uintptr(_p2), uintptr(unsafe.Pointer(context)), 0, 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func backupWrite(h syscall.Handle, b []byte, bytesWritten *uint32, abort bool, processSecurity bool, context *uintptr) (err error) {
+	var _p0 *byte
+	if len(b) > 0 {
+		_p0 = &b[0]
+	}
+	var _p1 uint32
+	if abort {
+		_p1 = 1
+	} else {
+		_p1 = 0
+	}
+	var _p2 uint32
+	if processSecurity {
+		_p2 = 1
+	} else {
+		_p2 = 0
+	}
+	r1, _, e1 := syscall.Syscall9(procBackupWrite.Addr(), 7, uintptr(h), uintptr(unsafe.Pointer(_p0)), uintptr(len(b)), uintptr(unsafe.Pointer(bytesWritten)), uintptr(_p1), uintptr(_p2), uintptr(unsafe.Pointer(context)), 0, 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}

vendor/github.com/Microsoft/hcsshim/.gitignore

@@ -0,0 +1 @@
+*.exe

vendor/github.com/Microsoft/hcsshim/.gometalinter.json

@@ -0,0 +1,17 @@
+{
+    "Vendor": true,
+    "Deadline": "2m",
+    "Sort": [
+        "linter",
+        "severity",
+        "path",
+        "line"
+    ],
+    "Skip": [
+        "internal\\schema2"
+    ],
+    "EnableGC": true,
+    "Enable": [
+        "gofmt"
+    ]
+}

vendor/github.com/Microsoft/hcsshim/LICENSE

@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2015 Microsoft
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.

vendor/github.com/Microsoft/hcsshim/README.md

@@ -0,0 +1,41 @@
+# hcsshim
+
+[![Build status](https://ci.appveyor.com/api/projects/status/nbcw28mnkqml0loa/branch/master?svg=true)](https://ci.appveyor.com/project/WindowsVirtualization/hcsshim/branch/master)
+
+This package contains the Golang interface for using the Windows [Host Compute Service](https://blogs.technet.microsoft.com/virtualization/2017/01/27/introducing-the-host-compute-service-hcs/) (HCS) to launch and manage [Windows Containers](https://docs.microsoft.com/en-us/virtualization/windowscontainers/about/). It also contains other helpers and functions for managing Windows Containers such as the Golang interface for the Host Network Service (HNS).
+
+It is primarily used in the [Moby Project](https://github.com/moby/moby), but it can be freely used by other projects as well.
+
+## Contributing
+
+This project welcomes contributions and suggestions.  Most contributions require you to agree to a
+Contributor License Agreement (CLA) declaring that you have the right to, and actually do, grant us
+the rights to use your contribution. For details, visit https://cla.microsoft.com.
+
+When you submit a pull request, a CLA-bot will automatically determine whether you need to provide
+a CLA and decorate the PR appropriately (e.g., label, comment). Simply follow the instructions
+provided by the bot. You will only need to do this once across all repos using our CLA.
+
+This project has adopted the [Microsoft Open Source Code of Conduct](https://opensource.microsoft.com/codeofconduct/).
+For more information see the [Code of Conduct FAQ](https://opensource.microsoft.com/codeofconduct/faq/) or
+contact [opencode@microsoft.com](mailto:opencode@microsoft.com) with any additional questions or comments.
+
+## Dependencies
+
+This project requires Golang 1.9 or newer to build.
+
+For system requirements to run this project, see the Microsoft docs on [Windows Container requirements](https://docs.microsoft.com/en-us/virtualization/windowscontainers/deploy-containers/system-requirements).
+
+## Reporting Security Issues
+
+Security issues and bugs should be reported privately, via email, to the Microsoft Security
+Response Center (MSRC) at [secure@microsoft.com](mailto:secure@microsoft.com). You should
+receive a response within 24 hours. If for some reason you do not, please follow up via
+email to ensure we received your original message. Further information, including the
+[MSRC PGP](https://technet.microsoft.com/en-us/security/dn606155) key, can be found in
+the [Security TechCenter](https://technet.microsoft.com/en-us/security/default).
+
+For additional details, see [Report a Computer Security Vulnerability](https://technet.microsoft.com/en-us/security/ff852094.aspx) on Technet
+
+---------------
+Copyright (c) 2018 Microsoft Corp.  All rights reserved.

vendor/github.com/Microsoft/hcsshim/appveyor.yml

@@ -0,0 +1,29 @@
+version: 0.1.{build}
+
+image: Visual Studio 2017
+
+clone_folder: c:\gopath\src\github.com\Microsoft\hcsshim
+
+environment:
+  GOPATH: c:\gopath
+  PATH: C:\mingw-w64\x86_64-7.2.0-posix-seh-rt_v5-rev1\mingw64\bin;%GOPATH%\bin;C:\gometalinter-2.0.12-windows-amd64;%PATH%
+
+stack: go 1.11
+
+build_script:
+  - appveyor DownloadFile https://github.com/alecthomas/gometalinter/releases/download/v2.0.12/gometalinter-2.0.12-windows-amd64.zip
+  - 7z x gometalinter-2.0.12-windows-amd64.zip -y -oC:\ > NUL
+  - gometalinter.exe --config .gometalinter.json ./...
+  - go build ./cmd/wclayer
+  - go build ./cmd/runhcs
+  - go build ./cmd/tar2ext4
+  - go test -v ./... -tags admin
+  - go test -c ./test/functional/ -tags functional
+  - go test -c ./test/runhcs/ -tags integration
+
+artifacts:
+  - path: 'wclayer.exe'
+  - path: 'runhcs.exe'
+  - path: 'tar2ext4.exe'
+  - path: 'functional.test.exe'
+  - path: 'runhcs.test.exe'

vendor/github.com/Microsoft/hcsshim/container.go

@@ -0,0 +1,192 @@
+package hcsshim
+
+import (
+	"fmt"
+	"os"
+	"time"
+
+	"github.com/Microsoft/hcsshim/internal/hcs"
+	"github.com/Microsoft/hcsshim/internal/mergemaps"
+	"github.com/Microsoft/hcsshim/internal/schema1"
+)
+
+// ContainerProperties holds the properties for a container and the processes running in that container
+type ContainerProperties = schema1.ContainerProperties
+
+// MemoryStats holds the memory statistics for a container
+type MemoryStats = schema1.MemoryStats
+
+// ProcessorStats holds the processor statistics for a container
+type ProcessorStats = schema1.ProcessorStats
+
+// StorageStats holds the storage statistics for a container
+type StorageStats = schema1.StorageStats
+
+// NetworkStats holds the network statistics for a container
+type NetworkStats = schema1.NetworkStats
+
+// Statistics is the structure returned by a statistics call on a container
+type Statistics = schema1.Statistics
+
+// ProcessList is the structure of an item returned by a ProcessList call on a container
+type ProcessListItem = schema1.ProcessListItem
+
+// MappedVirtualDiskController is the structure of an item returned by a MappedVirtualDiskList call on a container
+type MappedVirtualDiskController = schema1.MappedVirtualDiskController
+
+// Type of Request Support in ModifySystem
+type RequestType = schema1.RequestType
+
+// Type of Resource Support in ModifySystem
+type ResourceType = schema1.ResourceType
+
+// RequestType const
+const (
+	Add     = schema1.Add
+	Remove  = schema1.Remove
+	Network = schema1.Network
+)
+
+// ResourceModificationRequestResponse is the structure used to send request to the container to modify the system
+// Supported resource types are Network and Request Types are Add/Remove
+type ResourceModificationRequestResponse = schema1.ResourceModificationRequestResponse
+
+type container struct {
+	system *hcs.System
+}
+
+// createComputeSystemAdditionalJSON is read from the environment at initialisation
+// time. It allows an environment variable to define additional JSON which
+// is merged in the CreateComputeSystem call to HCS.
+var createContainerAdditionalJSON []byte
+
+func init() {
+	createContainerAdditionalJSON = ([]byte)(os.Getenv("HCSSHIM_CREATECONTAINER_ADDITIONALJSON"))
+}
+
+// CreateContainer creates a new container with the given configuration but does not start it.
+func CreateContainer(id string, c *ContainerConfig) (Container, error) {
+	fullConfig, err := mergemaps.MergeJSON(c, createContainerAdditionalJSON)
+	if err != nil {
+		return nil, fmt.Errorf("failed to merge additional JSON '%s': %s", createContainerAdditionalJSON, err)
+	}
+
+	system, err := hcs.CreateComputeSystem(id, fullConfig)
+	if err != nil {
+		return nil, err
+	}
+	return &container{system}, err
+}
+
+// OpenContainer opens an existing container by ID.
+func OpenContainer(id string) (Container, error) {
+	system, err := hcs.OpenComputeSystem(id)
+	if err != nil {
+		return nil, err
+	}
+	return &container{system}, err
+}
+
+// GetContainers gets a list of the containers on the system that match the query
+func GetContainers(q ComputeSystemQuery) ([]ContainerProperties, error) {
+	return hcs.GetComputeSystems(q)
+}
+
+// Start synchronously starts the container.
+func (container *container) Start() error {
+	return convertSystemError(container.system.Start(), container)
+}
+
+// Shutdown requests a container shutdown, but it may not actually be shutdown until Wait() succeeds.
+func (container *container) Shutdown() error {
+	return convertSystemError(container.system.Shutdown(), container)
+}
+
+// Terminate requests a container terminate, but it may not actually be terminated until Wait() succeeds.
+func (container *container) Terminate() error {
+	return convertSystemError(container.system.Terminate(), container)
+}
+
+// Waits synchronously waits for the container to shutdown or terminate.
+func (container *container) Wait() error {
+	return convertSystemError(container.system.Wait(), container)
+}
+
+// WaitTimeout synchronously waits for the container to terminate or the duration to elapse. It
+// returns false if timeout occurs.
+func (container *container) WaitTimeout(t time.Duration) error {
+	return convertSystemError(container.system.WaitTimeout(t), container)
+}
+
+// Pause pauses the execution of a container.
+func (container *container) Pause() error {
+	return convertSystemError(container.system.Pause(), container)
+}
+
+// Resume resumes the execution of a container.
+func (container *container) Resume() error {
+	return convertSystemError(container.system.Resume(), container)
+}
+
+// HasPendingUpdates returns true if the container has updates pending to install
+func (container *container) HasPendingUpdates() (bool, error) {
+	return false, nil
+}
+
+// Statistics returns statistics for the container. This is a legacy v1 call
+func (container *container) Statistics() (Statistics, error) {
+	properties, err := container.system.Properties(schema1.PropertyTypeStatistics)
+	if err != nil {
+		return Statistics{}, convertSystemError(err, container)
+	}
+
+	return properties.Statistics, nil
+}
+
+// ProcessList returns an array of ProcessListItems for the container. This is a legacy v1 call
+func (container *container) ProcessList() ([]ProcessListItem, error) {
+	properties, err := container.system.Properties(schema1.PropertyTypeProcessList)
+	if err != nil {
+		return nil, convertSystemError(err, container)
+	}
+
+	return properties.ProcessList, nil
+}
+
+// This is a legacy v1 call
+func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskController, error) {
+	properties, err := container.system.Properties(schema1.PropertyTypeMappedVirtualDisk)
+	if err != nil {
+		return nil, convertSystemError(err, container)
+	}
+
+	return properties.MappedVirtualDiskControllers, nil
+}
+
+// CreateProcess launches a new process within the container.
+func (container *container) CreateProcess(c *ProcessConfig) (Process, error) {
+	p, err := container.system.CreateProcess(c)
+	if err != nil {
+		return nil, convertSystemError(err, container)
+	}
+	return &process{p}, nil
+}
+
+// OpenProcess gets an interface to an existing process within the container.
+func (container *container) OpenProcess(pid int) (Process, error) {
+	p, err := container.system.OpenProcess(pid)
+	if err != nil {
+		return nil, convertSystemError(err, container)
+	}
+	return &process{p}, nil
+}
+
+// Close cleans up any state associated with the container but does not terminate or wait for it.
+func (container *container) Close() error {
+	return convertSystemError(container.system.Close(), container)
+}
+
+// Modify the System
+func (container *container) Modify(config *ResourceModificationRequestResponse) error {
+	return convertSystemError(container.system.Modify(config), container)
+}

vendor/github.com/Microsoft/hcsshim/errors.go

@@ -0,0 +1,257 @@
+package hcsshim
+
+import (
+	"fmt"
+	"syscall"
+
+	"github.com/Microsoft/hcsshim/internal/hns"
+
+	"github.com/Microsoft/hcsshim/internal/hcs"
+	"github.com/Microsoft/hcsshim/internal/hcserror"
+)
+
+var (
+	// ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists = hcs.exist
+	ErrComputeSystemDoesNotExist = hcs.ErrComputeSystemDoesNotExist
+
+	// ErrElementNotFound is an error encountered when the object being referenced does not exist
+	ErrElementNotFound = hcs.ErrElementNotFound
+
+	// ErrElementNotFound is an error encountered when the object being referenced does not exist
+	ErrNotSupported = hcs.ErrNotSupported
+
+	// ErrInvalidData is an error encountered when the request being sent to hcs is invalid/unsupported
+	// decimal -2147024883 / hex 0x8007000d
+	ErrInvalidData = hcs.ErrInvalidData
+
+	// ErrHandleClose is an error encountered when the handle generating the notification being waited on has been closed
+	ErrHandleClose = hcs.ErrHandleClose
+
+	// ErrAlreadyClosed is an error encountered when using a handle that has been closed by the Close method
+	ErrAlreadyClosed = hcs.ErrAlreadyClosed
+
+	// ErrInvalidNotificationType is an error encountered when an invalid notification type is used
+	ErrInvalidNotificationType = hcs.ErrInvalidNotificationType
+
+	// ErrInvalidProcessState is an error encountered when the process is not in a valid state for the requested operation
+	ErrInvalidProcessState = hcs.ErrInvalidProcessState
+
+	// ErrTimeout is an error encountered when waiting on a notification times out
+	ErrTimeout = hcs.ErrTimeout
+
+	// ErrUnexpectedContainerExit is the error encountered when a container exits while waiting for
+	// a different expected notification
+	ErrUnexpectedContainerExit = hcs.ErrUnexpectedContainerExit
+
+	// ErrUnexpectedProcessAbort is the error encountered when communication with the compute service
+	// is lost while waiting for a notification
+	ErrUnexpectedProcessAbort = hcs.ErrUnexpectedProcessAbort
+
+	// ErrUnexpectedValue is an error encountered when hcs returns an invalid value
+	ErrUnexpectedValue = hcs.ErrUnexpectedValue
+
+	// ErrVmcomputeAlreadyStopped is an error encountered when a shutdown or terminate request is made on a stopped container
+	ErrVmcomputeAlreadyStopped = hcs.ErrVmcomputeAlreadyStopped
+
+	// ErrVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously
+	ErrVmcomputeOperationPending = hcs.ErrVmcomputeOperationPending
+
+	// ErrVmcomputeOperationInvalidState is an error encountered when the compute system is not in a valid state for the requested operation
+	ErrVmcomputeOperationInvalidState = hcs.ErrVmcomputeOperationInvalidState
+
+	// ErrProcNotFound is an error encountered when the the process cannot be found
+	ErrProcNotFound = hcs.ErrProcNotFound
+
+	// ErrVmcomputeOperationAccessIsDenied is an error which can be encountered when enumerating compute systems in RS1/RS2
+	// builds when the underlying silo might be in the process of terminating. HCS was fixed in RS3.
+	ErrVmcomputeOperationAccessIsDenied = hcs.ErrVmcomputeOperationAccessIsDenied
+
+	// ErrVmcomputeInvalidJSON is an error encountered when the compute system does not support/understand the messages sent by management
+	ErrVmcomputeInvalidJSON = hcs.ErrVmcomputeInvalidJSON
+
+	// ErrVmcomputeUnknownMessage is an error encountered guest compute system doesn't support the message
+	ErrVmcomputeUnknownMessage = hcs.ErrVmcomputeUnknownMessage
+
+	// ErrNotSupported is an error encountered when hcs doesn't support the request
+	ErrPlatformNotSupported = hcs.ErrPlatformNotSupported
+)
+
+type EndpointNotFoundError = hns.EndpointNotFoundError
+type NetworkNotFoundError = hns.NetworkNotFoundError
+
+// ProcessError is an error encountered in HCS during an operation on a Process object
+type ProcessError struct {
+	Process   *process
+	Operation string
+	ExtraInfo string
+	Err       error
+	Events    []hcs.ErrorEvent
+}
+
+// ContainerError is an error encountered in HCS during an operation on a Container object
+type ContainerError struct {
+	Container *container
+	Operation string
+	ExtraInfo string
+	Err       error
+	Events    []hcs.ErrorEvent
+}
+
+func (e *ContainerError) Error() string {
+	if e == nil {
+		return "<nil>"
+	}
+
+	if e.Container == nil {
+		return "unexpected nil container for error: " + e.Err.Error()
+	}
+
+	s := "container " + e.Container.system.ID()
+
+	if e.Operation != "" {
+		s += " encountered an error during " + e.Operation
+	}
+
+	switch e.Err.(type) {
+	case nil:
+		break
+	case syscall.Errno:
+		s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, hcserror.Win32FromError(e.Err))
+	default:
+		s += fmt.Sprintf(": %s", e.Err.Error())
+	}
+
+	for _, ev := range e.Events {
+		s += "\n" + ev.String()
+	}
+
+	if e.ExtraInfo != "" {
+		s += " extra info: " + e.ExtraInfo
+	}
+
+	return s
+}
+
+func makeContainerError(container *container, operation string, extraInfo string, err error) error {
+	// Don't double wrap errors
+	if _, ok := err.(*ContainerError); ok {
+		return err
+	}
+	containerError := &ContainerError{Container: container, Operation: operation, ExtraInfo: extraInfo, Err: err}
+	return containerError
+}
+
+func (e *ProcessError) Error() string {
+	if e == nil {
+		return "<nil>"
+	}
+
+	if e.Process == nil {
+		return "Unexpected nil process for error: " + e.Err.Error()
+	}
+
+	s := fmt.Sprintf("process %d in container %s", e.Process.p.Pid(), e.Process.p.SystemID())
+	if e.Operation != "" {
+		s += " encountered an error during " + e.Operation
+	}
+
+	switch e.Err.(type) {
+	case nil:
+		break
+	case syscall.Errno:
+		s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, hcserror.Win32FromError(e.Err))
+	default:
+		s += fmt.Sprintf(": %s", e.Err.Error())
+	}
+
+	for _, ev := range e.Events {
+		s += "\n" + ev.String()
+	}
+
+	return s
+}
+
+func makeProcessError(process *process, operation string, extraInfo string, err error) error {
+	// Don't double wrap errors
+	if _, ok := err.(*ProcessError); ok {
+		return err
+	}
+	processError := &ProcessError{Process: process, Operation: operation, ExtraInfo: extraInfo, Err: err}
+	return processError
+}
+
+// IsNotExist checks if an error is caused by the Container or Process not existing.
+// Note: Currently, ErrElementNotFound can mean that a Process has either
+// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
+// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
+func IsNotExist(err error) bool {
+	if _, ok := err.(EndpointNotFoundError); ok {
+		return true
+	}
+	if _, ok := err.(NetworkNotFoundError); ok {
+		return true
+	}
+	return hcs.IsNotExist(getInnerError(err))
+}
+
+// IsAlreadyClosed checks if an error is caused by the Container or Process having been
+// already closed by a call to the Close() method.
+func IsAlreadyClosed(err error) bool {
+	return hcs.IsAlreadyClosed(getInnerError(err))
+}
+
+// IsPending returns a boolean indicating whether the error is that
+// the requested operation is being completed in the background.
+func IsPending(err error) bool {
+	return hcs.IsPending(getInnerError(err))
+}
+
+// IsTimeout returns a boolean indicating whether the error is caused by
+// a timeout waiting for the operation to complete.
+func IsTimeout(err error) bool {
+	return hcs.IsTimeout(getInnerError(err))
+}
+
+// IsAlreadyStopped returns a boolean indicating whether the error is caused by
+// a Container or Process being already stopped.
+// Note: Currently, ErrElementNotFound can mean that a Process has either
+// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
+// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
+func IsAlreadyStopped(err error) bool {
+	return hcs.IsAlreadyStopped(getInnerError(err))
+}
+
+// IsNotSupported returns a boolean indicating whether the error is caused by
+// unsupported platform requests
+// Note: Currently Unsupported platform requests can be mean either
+// ErrVmcomputeInvalidJSON, ErrInvalidData, ErrNotSupported or ErrVmcomputeUnknownMessage
+// is thrown from the Platform
+func IsNotSupported(err error) bool {
+	return hcs.IsNotSupported(getInnerError(err))
+}
+
+func getInnerError(err error) error {
+	switch pe := err.(type) {
+	case nil:
+		return nil
+	case *ContainerError:
+		err = pe.Err
+	case *ProcessError:
+		err = pe.Err
+	}
+	return err
+}
+
+func convertSystemError(err error, c *container) error {
+	if serr, ok := err.(*hcs.SystemError); ok {
+		return &ContainerError{Container: c, Operation: serr.Op, ExtraInfo: serr.Extra, Err: serr.Err, Events: serr.Events}
+	}
+	return err
+}
+
+func convertProcessError(err error, p *process) error {
+	if perr, ok := err.(*hcs.ProcessError); ok {
+		return &ProcessError{Process: p, Operation: perr.Op, Err: perr.Err, Events: perr.Events}
+	}
+	return err
+}

vendor/github.com/Microsoft/hcsshim/functional_tests.ps1

@@ -0,0 +1,12 @@
+# Requirements so far:
+# dockerd running
+#  - image microsoft/nanoserver (matching host base image)  docker load -i c:\baseimages\nanoserver.tar
+#  - image alpine (linux) docker pull --platform=linux alpine
+
+
+# TODO: Add this a parameter for debugging. ie "functional-tests -debug=$true"
+#$env:HCSSHIM_FUNCTIONAL_TESTS_DEBUG="yes please"
+
+#pushd uvm
+go test -v -tags "functional uvmcreate uvmscratch uvmscsi uvmvpmem uvmvsmb uvmp9" ./...
+#popd

vendor/github.com/Microsoft/hcsshim/hcsshim.go

@@ -0,0 +1,28 @@
+// Shim for the Host Compute Service (HCS) to manage Windows Server
+// containers and Hyper-V containers.
+
+package hcsshim
+
+import (
+	"syscall"
+
+	"github.com/Microsoft/hcsshim/internal/hcserror"
+)
+
+//go:generate go run mksyscall_windows.go -output zsyscall_windows.go hcsshim.go
+
+//sys SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) = iphlpapi.SetCurrentThreadCompartmentId
+
+const (
+	// Specific user-visible exit codes
+	WaitErrExecFailed = 32767
+
+	ERROR_GEN_FAILURE          = hcserror.ERROR_GEN_FAILURE
+	ERROR_SHUTDOWN_IN_PROGRESS = syscall.Errno(1115)
+	WSAEINVAL                  = syscall.Errno(10022)
+
+	// Timeout on wait calls
+	TimeoutInfinite = 0xFFFFFFFF
+)
+
+type HcsError = hcserror.HcsError

vendor/github.com/Microsoft/hcsshim/hnsendpoint.go

@@ -0,0 +1,94 @@
+package hcsshim
+
+import (
+	"github.com/Microsoft/hcsshim/internal/hns"
+)
+
+// HNSEndpoint represents a network endpoint in HNS
+type HNSEndpoint = hns.HNSEndpoint
+
+// Namespace represents a Compartment.
+type Namespace = hns.Namespace
+
+//SystemType represents the type of the system on which actions are done
+type SystemType string
+
+// SystemType const
+const (
+	ContainerType      SystemType = "Container"
+	VirtualMachineType SystemType = "VirtualMachine"
+	HostType           SystemType = "Host"
+)
+
+// EndpointAttachDetachRequest is the structure used to send request to the container to modify the system
+// Supported resource types are Network and Request Types are Add/Remove
+type EndpointAttachDetachRequest = hns.EndpointAttachDetachRequest
+
+// EndpointResquestResponse is object to get the endpoint request response
+type EndpointResquestResponse = hns.EndpointResquestResponse
+
+// HNSEndpointRequest makes a HNS call to modify/query a network endpoint
+func HNSEndpointRequest(method, path, request string) (*HNSEndpoint, error) {
+	return hns.HNSEndpointRequest(method, path, request)
+}
+
+// HNSListEndpointRequest makes a HNS call to query the list of available endpoints
+func HNSListEndpointRequest() ([]HNSEndpoint, error) {
+	return hns.HNSListEndpointRequest()
+}
+
+// HotAttachEndpoint makes a HCS Call to attach the endpoint to the container
+func HotAttachEndpoint(containerID string, endpointID string) error {
+	return modifyNetworkEndpoint(containerID, endpointID, Add)
+}
+
+// HotDetachEndpoint makes a HCS Call to detach the endpoint from the container
+func HotDetachEndpoint(containerID string, endpointID string) error {
+	return modifyNetworkEndpoint(containerID, endpointID, Remove)
+}
+
+// ModifyContainer corresponding to the container id, by sending a request
+func modifyContainer(id string, request *ResourceModificationRequestResponse) error {
+	container, err := OpenContainer(id)
+	if err != nil {
+		if IsNotExist(err) {
+			return ErrComputeSystemDoesNotExist
+		}
+		return getInnerError(err)
+	}
+	defer container.Close()
+	err = container.Modify(request)
+	if err != nil {
+		if IsNotSupported(err) {
+			return ErrPlatformNotSupported
+		}
+		return getInnerError(err)
+	}
+
+	return nil
+}
+
+func modifyNetworkEndpoint(containerID string, endpointID string, request RequestType) error {
+	requestMessage := &ResourceModificationRequestResponse{
+		Resource: Network,
+		Request:  request,
+		Data:     endpointID,
+	}
+	err := modifyContainer(containerID, requestMessage)
+
+	if err != nil {
+		return err
+	}
+
+	return nil
+}
+
+// GetHNSEndpointByID get the Endpoint by ID
+func GetHNSEndpointByID(endpointID string) (*HNSEndpoint, error) {
+	return hns.GetHNSEndpointByID(endpointID)
+}
+
+// GetHNSEndpointByName gets the endpoint filtered by Name
+func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) {
+	return hns.GetHNSEndpointByName(endpointName)
+}

vendor/github.com/Microsoft/hcsshim/hnsglobals.go

@@ -0,0 +1,16 @@
+package hcsshim
+
+import (
+	"github.com/Microsoft/hcsshim/internal/hns"
+)
+
+type HNSGlobals = hns.HNSGlobals
+type HNSVersion = hns.HNSVersion
+
+var (
+	HNSVersion1803 = hns.HNSVersion1803
+)
+
+func GetHNSGlobals() (*HNSGlobals, error) {
+	return hns.GetHNSGlobals()
+}

vendor/github.com/Microsoft/hcsshim/hnsnetwork.go

@@ -0,0 +1,36 @@
+package hcsshim
+
+import (
+	"github.com/Microsoft/hcsshim/internal/hns"
+)
+
+// Subnet is assoicated with a network and represents a list
+// of subnets available to the network
+type Subnet = hns.Subnet
+
+// MacPool is assoicated with a network and represents a list
+// of macaddresses available to the network
+type MacPool = hns.MacPool
+
+// HNSNetwork represents a network in HNS
+type HNSNetwork = hns.HNSNetwork
+
+// HNSNetworkRequest makes a call into HNS to update/query a single network
+func HNSNetworkRequest(method, path, request string) (*HNSNetwork, error) {
+	return hns.HNSNetworkRequest(method, path, request)
+}
+
+// HNSListNetworkRequest makes a HNS call to query the list of available networks
+func HNSListNetworkRequest(method, path, request string) ([]HNSNetwork, error) {
+	return hns.HNSListNetworkRequest(method, path, request)
+}
+
+// GetHNSNetworkByID
+func GetHNSNetworkByID(networkID string) (*HNSNetwork, error) {
+	return hns.GetHNSNetworkByID(networkID)
+}
+
+// GetHNSNetworkName filtered by Name
+func GetHNSNetworkByName(networkName string) (*HNSNetwork, error) {
+	return hns.GetHNSNetworkByName(networkName)
+}

vendor/github.com/Microsoft/hcsshim/hnspolicy.go

@@ -0,0 +1,57 @@
+package hcsshim
+
+import (
+	"github.com/Microsoft/hcsshim/internal/hns"
+)
+
+// Type of Request Support in ModifySystem
+type PolicyType = hns.PolicyType
+
+// RequestType const
+const (
+	Nat                  = hns.Nat
+	ACL                  = hns.ACL
+	PA                   = hns.PA
+	VLAN                 = hns.VLAN
+	VSID                 = hns.VSID
+	VNet                 = hns.VNet
+	L2Driver             = hns.L2Driver
+	Isolation            = hns.Isolation
+	QOS                  = hns.QOS
+	OutboundNat          = hns.OutboundNat
+	ExternalLoadBalancer = hns.ExternalLoadBalancer
+	Route                = hns.Route
+)
+
+type NatPolicy = hns.NatPolicy
+
+type QosPolicy = hns.QosPolicy
+
+type IsolationPolicy = hns.IsolationPolicy
+
+type VlanPolicy = hns.VlanPolicy
+
+type VsidPolicy = hns.VsidPolicy
+
+type PaPolicy = hns.PaPolicy
+
+type OutboundNatPolicy = hns.OutboundNatPolicy
+
+type ActionType = hns.ActionType
+type DirectionType = hns.DirectionType
+type RuleType = hns.RuleType
+
+const (
+	Allow = hns.Allow
+	Block = hns.Block
+
+	In  = hns.In
+	Out = hns.Out
+
+	Host   = hns.Host
+	Switch = hns.Switch
+)
+
+type ACLPolicy = hns.ACLPolicy
+
+type Policy = hns.Policy

vendor/github.com/Microsoft/hcsshim/hnspolicylist.go

@@ -0,0 +1,47 @@
+package hcsshim
+
+import (
+	"github.com/Microsoft/hcsshim/internal/hns"
+)
+
+// RoutePolicy is a structure defining schema for Route based Policy
+type RoutePolicy = hns.RoutePolicy
+
+// ELBPolicy is a structure defining schema for ELB LoadBalancing based Policy
+type ELBPolicy = hns.ELBPolicy
+
+// LBPolicy is a structure defining schema for LoadBalancing based Policy
+type LBPolicy = hns.LBPolicy
+
+// PolicyList is a structure defining schema for Policy list request
+type PolicyList = hns.PolicyList
+
+// HNSPolicyListRequest makes a call into HNS to update/query a single network
+func HNSPolicyListRequest(method, path, request string) (*PolicyList, error) {
+	return hns.HNSPolicyListRequest(method, path, request)
+}
+
+// HNSListPolicyListRequest gets all the policy list
+func HNSListPolicyListRequest() ([]PolicyList, error) {
+	return hns.HNSListPolicyListRequest()
+}
+
+// PolicyListRequest makes a HNS call to modify/query a network policy list
+func PolicyListRequest(method, path, request string) (*PolicyList, error) {
+	return hns.PolicyListRequest(method, path, request)
+}
+
+// GetPolicyListByID get the policy list by ID
+func GetPolicyListByID(policyListID string) (*PolicyList, error) {
+	return hns.GetPolicyListByID(policyListID)
+}
+
+// AddLoadBalancer policy list for the specified endpoints
+func AddLoadBalancer(endpoints []HNSEndpoint, isILB bool, sourceVIP, vip string, protocol uint16, internalPort uint16, externalPort uint16) (*PolicyList, error) {
+	return hns.AddLoadBalancer(endpoints, isILB, sourceVIP, vip, protocol, internalPort, externalPort)
+}
+
+// AddRoute adds route policy list for the specified endpoints
+func AddRoute(endpoints []HNSEndpoint, destinationPrefix string, nextHop string, encapEnabled bool) (*PolicyList, error) {
+	return hns.AddRoute(endpoints, destinationPrefix, nextHop, encapEnabled)
+}

vendor/github.com/Microsoft/hcsshim/hnssupport.go

@@ -0,0 +1,13 @@
+package hcsshim
+
+import (
+	"github.com/Microsoft/hcsshim/internal/hns"
+)
+
+type HNSSupportedFeatures = hns.HNSSupportedFeatures
+
+type HNSAclFeatures = hns.HNSAclFeatures
+
+func GetHNSSupportedFeatures() HNSSupportedFeatures {
+	return hns.GetHNSSupportedFeatures()
+}

vendor/github.com/Microsoft/hcsshim/interface.go

@@ -0,0 +1,114 @@
+package hcsshim
+
+import (
+	"io"
+	"time"
+
+	"github.com/Microsoft/hcsshim/internal/schema1"
+)
+
+// ProcessConfig is used as both the input of Container.CreateProcess
+// and to convert the parameters to JSON for passing onto the HCS
+type ProcessConfig = schema1.ProcessConfig
+
+type Layer = schema1.Layer
+type MappedDir = schema1.MappedDir
+type MappedPipe = schema1.MappedPipe
+type HvRuntime = schema1.HvRuntime
+type MappedVirtualDisk = schema1.MappedVirtualDisk
+
+// AssignedDevice represents a device that has been directly assigned to a container
+//
+// NOTE: Support added in RS5
+type AssignedDevice = schema1.AssignedDevice
+
+// ContainerConfig is used as both the input of CreateContainer
+// and to convert the parameters to JSON for passing onto the HCS
+type ContainerConfig = schema1.ContainerConfig
+
+type ComputeSystemQuery = schema1.ComputeSystemQuery
+
+// Container represents a created (but not necessarily running) container.
+type Container interface {
+	// Start synchronously starts the container.
+	Start() error
+
+	// Shutdown requests a container shutdown, but it may not actually be shutdown until Wait() succeeds.
+	Shutdown() error
+
+	// Terminate requests a container terminate, but it may not actually be terminated until Wait() succeeds.
+	Terminate() error
+
+	// Waits synchronously waits for the container to shutdown or terminate.
+	Wait() error
+
+	// WaitTimeout synchronously waits for the container to terminate or the duration to elapse. It
+	// returns false if timeout occurs.
+	WaitTimeout(time.Duration) error
+
+	// Pause pauses the execution of a container.
+	Pause() error
+
+	// Resume resumes the execution of a container.
+	Resume() error
+
+	// HasPendingUpdates returns true if the container has updates pending to install.
+	HasPendingUpdates() (bool, error)
+
+	// Statistics returns statistics for a container.
+	Statistics() (Statistics, error)
+
+	// ProcessList returns details for the processes in a container.
+	ProcessList() ([]ProcessListItem, error)
+
+	// MappedVirtualDisks returns virtual disks mapped to a utility VM, indexed by controller
+	MappedVirtualDisks() (map[int]MappedVirtualDiskController, error)
+
+	// CreateProcess launches a new process within the container.
+	CreateProcess(c *ProcessConfig) (Process, error)
+
+	// OpenProcess gets an interface to an existing process within the container.
+	OpenProcess(pid int) (Process, error)
+
+	// Close cleans up any state associated with the container but does not terminate or wait for it.
+	Close() error
+
+	// Modify the System
+	Modify(config *ResourceModificationRequestResponse) error
+}
+
+// Process represents a running or exited process.
+type Process interface {
+	// Pid returns the process ID of the process within the container.
+	Pid() int
+
+	// Kill signals the process to terminate but does not wait for it to finish terminating.
+	Kill() error
+
+	// Wait waits for the process to exit.
+	Wait() error
+
+	// WaitTimeout waits for the process to exit or the duration to elapse. It returns
+	// false if timeout occurs.
+	WaitTimeout(time.Duration) error
+
+	// ExitCode returns the exit code of the process. The process must have
+	// already terminated.
+	ExitCode() (int, error)
+
+	// ResizeConsole resizes the console of the process.
+	ResizeConsole(width, height uint16) error
+
+	// Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing
+	// these pipes does not close the underlying pipes; it should be possible to
+	// call this multiple times to get multiple interfaces.
+	Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, error)
+
+	// CloseStdin closes the write side of the stdin pipe so that the process is
+	// notified on the read side that there is no more data in stdin.
+	CloseStdin() error
+
+	// Close cleans up any state associated with the process but does not kill
+	// or wait on it.
+	Close() error
+}

vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go

@@ -0,0 +1,100 @@
+package guestrequest
+
+import (
+	"github.com/Microsoft/hcsshim/internal/schema2"
+)
+
+// Arguably, many of these (at least CombinedLayers) should have been generated
+// by swagger.
+//
+// This will also change package name due to an inbound breaking change.
+
+// This class is used by a modify request to add or remove a combined layers
+// structure in the guest. For windows, the GCS applies a filter in ContainerRootPath
+// using the specified layers as the parent content. Ignores property ScratchPath
+// since the container path is already the scratch path. For linux, the GCS unions
+// the specified layers and ScratchPath together, placing the resulting union
+// filesystem at ContainerRootPath.
+type CombinedLayers struct {
+	ContainerRootPath string            `json:"ContainerRootPath,omitempty"`
+	Layers            []hcsschema.Layer `json:"Layers,omitempty"`
+	ScratchPath       string            `json:"ScratchPath,omitempty"`
+}
+
+// Defines the schema for hosted settings passed to GCS and/or OpenGCS
+
+// SCSI. Scratch space for remote file-system commands, or R/W layer for containers
+type LCOWMappedVirtualDisk struct {
+	MountPath  string `json:"MountPath,omitempty"` // /tmp/scratch for an LCOW utility VM being used as a service VM
+	Lun        uint8  `json:"Lun,omitempty"`
+	Controller uint8  `json:"Controller,omitempty"`
+	ReadOnly   bool   `json:"ReadOnly,omitempty"`
+}
+
+type WCOWMappedVirtualDisk struct {
+	ContainerPath string `json:"ContainerPath,omitempty"`
+	Lun           int32  `json:"Lun,omitempty"`
+}
+
+type LCOWMappedDirectory struct {
+	MountPath string `json:"MountPath,omitempty"`
+	Port      int32  `json:"Port,omitempty"`
+	ShareName string `json:"ShareName,omitempty"` // If empty not using ANames (not currently supported)
+	ReadOnly  bool   `json:"ReadOnly,omitempty"`
+}
+
+// Read-only layers over VPMem
+type LCOWMappedVPMemDevice struct {
+	DeviceNumber uint32 `json:"DeviceNumber,omitempty"`
+	MountPath    string `json:"MountPath,omitempty"` // /tmp/pN
+}
+
+type LCOWNetworkAdapter struct {
+	NamespaceID     string `json:",omitempty"`
+	ID              string `json:",omitempty"`
+	MacAddress      string `json:",omitempty"`
+	IPAddress       string `json:",omitempty"`
+	PrefixLength    uint8  `json:",omitempty"`
+	GatewayAddress  string `json:",omitempty"`
+	DNSSuffix       string `json:",omitempty"`
+	DNSServerList   string `json:",omitempty"`
+	EnableLowMetric bool   `json:",omitempty"`
+	EncapOverhead   uint16 `json:",omitempty"`
+}
+
+type ResourceType string
+
+const (
+	// These are constants for v2 schema modify guest requests.
+	ResourceTypeMappedDirectory   ResourceType = "MappedDirectory"
+	ResourceTypeMappedVirtualDisk ResourceType = "MappedVirtualDisk"
+	ResourceTypeNetwork           ResourceType = "Network"
+	ResourceTypeNetworkNamespace  ResourceType = "NetworkNamespace"
+	ResourceTypeCombinedLayers    ResourceType = "CombinedLayers"
+	ResourceTypeVPMemDevice       ResourceType = "VPMemDevice"
+)
+
+// GuestRequest is for modify commands passed to the guest.
+type GuestRequest struct {
+	RequestType  string       `json:"RequestType,omitempty"`
+	ResourceType ResourceType `json:"ResourceType,omitempty"`
+	Settings     interface{}  `json:"Settings,omitempty"`
+}
+
+type NetworkModifyRequest struct {
+	AdapterId   string      `json:"AdapterId,omitempty"`
+	RequestType string      `json:"RequestType,omitempty"`
+	Settings    interface{} `json:"Settings,omitempty"`
+}
+
+type RS4NetworkModifyRequest struct {
+	AdapterInstanceId string      `json:"AdapterInstanceId,omitempty"`
+	RequestType       string      `json:"RequestType,omitempty"`
+	Settings          interface{} `json:"Settings,omitempty"`
+}
+
+// SignalProcessOptions is the options passed to either WCOW or LCOW
+// to signal a given process.
+type SignalProcessOptions struct {
+	Signal int `json:,omitempty`
+}

vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go

@@ -0,0 +1,69 @@
+package guid
+
+import (
+	"crypto/rand"
+	"encoding/json"
+	"fmt"
+	"io"
+	"strconv"
+	"strings"
+)
+
+var _ = (json.Marshaler)(&GUID{})
+var _ = (json.Unmarshaler)(&GUID{})
+
+type GUID [16]byte
+
+func New() GUID {
+	g := GUID{}
+	_, err := io.ReadFull(rand.Reader, g[:])
+	if err != nil {
+		panic(err)
+	}
+	return g
+}
+
+func (g GUID) String() string {
+	return fmt.Sprintf("%02x%02x%02x%02x-%02x%02x-%02x%02x-%02x-%02x", g[3], g[2], g[1], g[0], g[5], g[4], g[7], g[6], g[8:10], g[10:])
+}
+
+func FromString(s string) GUID {
+	if len(s) != 36 {
+		panic(fmt.Sprintf("invalid GUID length: %d", len(s)))
+	}
+	if s[8] != '-' || s[13] != '-' || s[18] != '-' || s[23] != '-' {
+		panic("invalid GUID format")
+	}
+	indexOrder := [16]int{
+		0, 2, 4, 6,
+		9, 11,
+		14, 16,
+		19, 21,
+		24, 26, 28, 30, 32, 34,
+	}
+	byteOrder := [16]int{
+		3, 2, 1, 0,
+		5, 4,
+		7, 6,
+		8, 9,
+		10, 11, 12, 13, 14, 15,
+	}
+	var g GUID
+	for i, x := range indexOrder {
+		b, err := strconv.ParseInt(s[x:x+2], 16, 16)
+		if err != nil {
+			panic(err)
+		}
+		g[byteOrder[i]] = byte(b)
+	}
+	return g
+}
+
+func (g GUID) MarshalJSON() ([]byte, error) {
+	return json.Marshal(g.String())
+}
+
+func (g *GUID) UnmarshalJSON(data []byte) error {
+	*g = FromString(strings.Trim(string(data), "\""))
+	return nil
+}

vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go

@@ -0,0 +1,104 @@
+package hcs
+
+import (
+	"sync"
+	"syscall"
+
+	"github.com/Microsoft/hcsshim/internal/interop"
+	"github.com/sirupsen/logrus"
+)
+
+var (
+	nextCallback    uintptr
+	callbackMap     = map[uintptr]*notifcationWatcherContext{}
+	callbackMapLock = sync.RWMutex{}
+
+	notificationWatcherCallback = syscall.NewCallback(notificationWatcher)
+
+	// Notifications for HCS_SYSTEM handles
+	hcsNotificationSystemExited                      hcsNotification = 0x00000001
+	hcsNotificationSystemCreateCompleted             hcsNotification = 0x00000002
+	hcsNotificationSystemStartCompleted              hcsNotification = 0x00000003
+	hcsNotificationSystemPauseCompleted              hcsNotification = 0x00000004
+	hcsNotificationSystemResumeCompleted             hcsNotification = 0x00000005
+	hcsNotificationSystemCrashReport                 hcsNotification = 0x00000006
+	hcsNotificationSystemSiloJobCreated              hcsNotification = 0x00000007
+	hcsNotificationSystemSaveCompleted               hcsNotification = 0x00000008
+	hcsNotificationSystemRdpEnhancedModeStateChanged hcsNotification = 0x00000009
+	hcsNotificationSystemShutdownFailed              hcsNotification = 0x0000000A
+	hcsNotificationSystemGetPropertiesCompleted      hcsNotification = 0x0000000B
+	hcsNotificationSystemModifyCompleted             hcsNotification = 0x0000000C
+	hcsNotificationSystemCrashInitiated              hcsNotification = 0x0000000D
+	hcsNotificationSystemGuestConnectionClosed       hcsNotification = 0x0000000E
+
+	// Notifications for HCS_PROCESS handles
+	hcsNotificationProcessExited hcsNotification = 0x00010000
+
+	// Common notifications
+	hcsNotificationInvalid           hcsNotification = 0x00000000
+	hcsNotificationServiceDisconnect hcsNotification = 0x01000000
+)
+
+type hcsNotification uint32
+type notificationChannel chan error
+
+type notifcationWatcherContext struct {
+	channels notificationChannels
+	handle   hcsCallback
+}
+
+type notificationChannels map[hcsNotification]notificationChannel
+
+func newChannels() notificationChannels {
+	channels := make(notificationChannels)
+
+	channels[hcsNotificationSystemExited] = make(notificationChannel, 1)
+	channels[hcsNotificationSystemCreateCompleted] = make(notificationChannel, 1)
+	channels[hcsNotificationSystemStartCompleted] = make(notificationChannel, 1)
+	channels[hcsNotificationSystemPauseCompleted] = make(notificationChannel, 1)
+	channels[hcsNotificationSystemResumeCompleted] = make(notificationChannel, 1)
+	channels[hcsNotificationProcessExited] = make(notificationChannel, 1)
+	channels[hcsNotificationServiceDisconnect] = make(notificationChannel, 1)
+	channels[hcsNotificationSystemCrashReport] = make(notificationChannel, 1)
+	channels[hcsNotificationSystemSiloJobCreated] = make(notificationChannel, 1)
+	channels[hcsNotificationSystemSaveCompleted] = make(notificationChannel, 1)
+	channels[hcsNotificationSystemRdpEnhancedModeStateChanged] = make(notificationChannel, 1)
+	channels[hcsNotificationSystemShutdownFailed] = make(notificationChannel, 1)
+	channels[hcsNotificationSystemGetPropertiesCompleted] = make(notificationChannel, 1)
+	channels[hcsNotificationSystemModifyCompleted] = make(notificationChannel, 1)
+	channels[hcsNotificationSystemCrashInitiated] = make(notificationChannel, 1)
+	channels[hcsNotificationSystemGuestConnectionClosed] = make(notificationChannel, 1)
+
+	return channels
+}
+
+func closeChannels(channels notificationChannels) {
+	for _, c := range channels {
+		close(c)
+	}
+}
+
+func notificationWatcher(notificationType hcsNotification, callbackNumber uintptr, notificationStatus uintptr, notificationData *uint16) uintptr {
+	var result error
+	if int32(notificationStatus) < 0 {
+		result = interop.Win32FromHresult(notificationStatus)
+	}
+
+	callbackMapLock.RLock()
+	context := callbackMap[callbackNumber]
+	callbackMapLock.RUnlock()
+
+	if context == nil {
+		return 0
+	}
+
+	if channel, ok := context.channels[notificationType]; ok {
+		channel <- result
+	} else {
+		logrus.WithFields(logrus.Fields{
+			"notification-type": notificationType,
+		}).Warn("Received a callback of an unsupported type")
+	}
+
+	return 0
+}

vendor/github.com/Microsoft/hcsshim/internal/hcs/cgo.go

@@ -0,0 +1,7 @@
+package hcs
+
+import "C"
+
+// This import is needed to make the library compile as CGO because HCSSHIM
+// only works with CGO due to callbacks from HCS comming back from a C thread
+// which is not supported without CGO. See https://github.com/golang/go/issues/10973

vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go

@@ -0,0 +1,287 @@
+package hcs
+
+import (
+	"encoding/json"
+	"errors"
+	"fmt"
+	"syscall"
+
+	"github.com/Microsoft/hcsshim/internal/interop"
+	"github.com/Microsoft/hcsshim/internal/logfields"
+	"github.com/sirupsen/logrus"
+)
+
+var (
+	// ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists
+	ErrComputeSystemDoesNotExist = syscall.Errno(0xc037010e)
+
+	// ErrElementNotFound is an error encountered when the object being referenced does not exist
+	ErrElementNotFound = syscall.Errno(0x490)
+
+	// ErrElementNotFound is an error encountered when the object being referenced does not exist
+	ErrNotSupported = syscall.Errno(0x32)
+
+	// ErrInvalidData is an error encountered when the request being sent to hcs is invalid/unsupported
+	// decimal -2147024883 / hex 0x8007000d
+	ErrInvalidData = syscall.Errno(0xd)
+
+	// ErrHandleClose is an error encountered when the handle generating the notification being waited on has been closed
+	ErrHandleClose = errors.New("hcsshim: the handle generating this notification has been closed")
+
+	// ErrAlreadyClosed is an error encountered when using a handle that has been closed by the Close method
+	ErrAlreadyClosed = errors.New("hcsshim: the handle has already been closed")
+
+	// ErrInvalidNotificationType is an error encountered when an invalid notification type is used
+	ErrInvalidNotificationType = errors.New("hcsshim: invalid notification type")
+
+	// ErrInvalidProcessState is an error encountered when the process is not in a valid state for the requested operation
+	ErrInvalidProcessState = errors.New("the process is in an invalid state for the attempted operation")
+
+	// ErrTimeout is an error encountered when waiting on a notification times out
+	ErrTimeout = errors.New("hcsshim: timeout waiting for notification")
+
+	// ErrUnexpectedContainerExit is the error encountered when a container exits while waiting for
+	// a different expected notification
+	ErrUnexpectedContainerExit = errors.New("unexpected container exit")
+
+	// ErrUnexpectedProcessAbort is the error encountered when communication with the compute service
+	// is lost while waiting for a notification
+	ErrUnexpectedProcessAbort = errors.New("lost communication with compute service")
+
+	// ErrUnexpectedValue is an error encountered when hcs returns an invalid value
+	ErrUnexpectedValue = errors.New("unexpected value returned from hcs")
+
+	// ErrVmcomputeAlreadyStopped is an error encountered when a shutdown or terminate request is made on a stopped container
+	ErrVmcomputeAlreadyStopped = syscall.Errno(0xc0370110)
+
+	// ErrVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously
+	ErrVmcomputeOperationPending = syscall.Errno(0xC0370103)
+
+	// ErrVmcomputeOperationInvalidState is an error encountered when the compute system is not in a valid state for the requested operation
+	ErrVmcomputeOperationInvalidState = syscall.Errno(0xc0370105)
+
+	// ErrProcNotFound is an error encountered when the the process cannot be found
+	ErrProcNotFound = syscall.Errno(0x7f)
+
+	// ErrVmcomputeOperationAccessIsDenied is an error which can be encountered when enumerating compute systems in RS1/RS2
+	// builds when the underlying silo might be in the process of terminating. HCS was fixed in RS3.
+	ErrVmcomputeOperationAccessIsDenied = syscall.Errno(0x5)
+
+	// ErrVmcomputeInvalidJSON is an error encountered when the compute system does not support/understand the messages sent by management
+	ErrVmcomputeInvalidJSON = syscall.Errno(0xc037010d)
+
+	// ErrVmcomputeUnknownMessage is an error encountered guest compute system doesn't support the message
+	ErrVmcomputeUnknownMessage = syscall.Errno(0xc037010b)
+
+	// ErrVmcomputeUnexpectedExit is an error encountered when the compute system terminates unexpectedly
+	ErrVmcomputeUnexpectedExit = syscall.Errno(0xC0370106)
+
+	// ErrNotSupported is an error encountered when hcs doesn't support the request
+	ErrPlatformNotSupported = errors.New("unsupported platform request")
+)
+
+type ErrorEvent struct {
+	Message    string `json:"Message,omitempty"`    // Fully formated error message
+	StackTrace string `json:"StackTrace,omitempty"` // Stack trace in string form
+	Provider   string `json:"Provider,omitempty"`
+	EventID    uint16 `json:"EventId,omitempty"`
+	Flags      uint32 `json:"Flags,omitempty"`
+	Source     string `json:"Source,omitempty"`
+	//Data       []EventData `json:"Data,omitempty"`  // Omit this as HCS doesn't encode this well. It's more confusing to include. It is however logged in debug mode (see processHcsResult function)
+}
+
+type hcsResult struct {
+	Error        int32
+	ErrorMessage string
+	ErrorEvents  []ErrorEvent `json:"ErrorEvents,omitempty"`
+}
+
+func (ev *ErrorEvent) String() string {
+	evs := "[Event Detail: " + ev.Message
+	if ev.StackTrace != "" {
+		evs += " Stack Trace: " + ev.StackTrace
+	}
+	if ev.Provider != "" {
+		evs += " Provider: " + ev.Provider
+	}
+	if ev.EventID != 0 {
+		evs = fmt.Sprintf("%s EventID: %d", evs, ev.EventID)
+	}
+	if ev.Flags != 0 {
+		evs = fmt.Sprintf("%s flags: %d", evs, ev.Flags)
+	}
+	if ev.Source != "" {
+		evs += " Source: " + ev.Source
+	}
+	evs += "]"
+	return evs
+}
+
+func processHcsResult(resultp *uint16) []ErrorEvent {
+	if resultp != nil {
+		resultj := interop.ConvertAndFreeCoTaskMemString(resultp)
+		logrus.WithField(logfields.JSON, resultj).
+			Debug("HCS Result")
+		result := &hcsResult{}
+		if err := json.Unmarshal([]byte(resultj), result); err != nil {
+			logrus.WithFields(logrus.Fields{
+				logfields.JSON:  resultj,
+				logrus.ErrorKey: err,
+			}).Warning("Could not unmarshal HCS result")
+			return nil
+		}
+		return result.ErrorEvents
+	}
+	return nil
+}
+
+type HcsError struct {
+	Op     string
+	Err    error
+	Events []ErrorEvent
+}
+
+func (e *HcsError) Error() string {
+	s := e.Op + ": " + e.Err.Error()
+	for _, ev := range e.Events {
+		s += "\n" + ev.String()
+	}
+	return s
+}
+
+// ProcessError is an error encountered in HCS during an operation on a Process object
+type ProcessError struct {
+	SystemID string
+	Pid      int
+	Op       string
+	Err      error
+	Events   []ErrorEvent
+}
+
+// SystemError is an error encountered in HCS during an operation on a Container object
+type SystemError struct {
+	ID     string
+	Op     string
+	Err    error
+	Extra  string
+	Events []ErrorEvent
+}
+
+func (e *SystemError) Error() string {
+	s := e.Op + " " + e.ID + ": " + e.Err.Error()
+	for _, ev := range e.Events {
+		s += "\n" + ev.String()
+	}
+	if e.Extra != "" {
+		s += "\n(extra info: " + e.Extra + ")"
+	}
+	return s
+}
+
+func makeSystemError(system *System, op string, extra string, err error, events []ErrorEvent) error {
+	// Don't double wrap errors
+	if _, ok := err.(*SystemError); ok {
+		return err
+	}
+	return &SystemError{
+		ID:     system.ID(),
+		Op:     op,
+		Extra:  extra,
+		Err:    err,
+		Events: events,
+	}
+}
+
+func (e *ProcessError) Error() string {
+	s := fmt.Sprintf("%s %s:%d: %s", e.Op, e.SystemID, e.Pid, e.Err.Error())
+	for _, ev := range e.Events {
+		s += "\n" + ev.String()
+	}
+	return s
+}
+
+func makeProcessError(process *Process, op string, err error, events []ErrorEvent) error {
+	// Don't double wrap errors
+	if _, ok := err.(*ProcessError); ok {
+		return err
+	}
+	return &ProcessError{
+		Pid:      process.Pid(),
+		SystemID: process.SystemID(),
+		Op:       op,
+		Err:      err,
+		Events:   events,
+	}
+}
+
+// IsNotExist checks if an error is caused by the Container or Process not existing.
+// Note: Currently, ErrElementNotFound can mean that a Process has either
+// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
+// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
+func IsNotExist(err error) bool {
+	err = getInnerError(err)
+	return err == ErrComputeSystemDoesNotExist ||
+		err == ErrElementNotFound ||
+		err == ErrProcNotFound
+}
+
+// IsAlreadyClosed checks if an error is caused by the Container or Process having been
+// already closed by a call to the Close() method.
+func IsAlreadyClosed(err error) bool {
+	err = getInnerError(err)
+	return err == ErrAlreadyClosed
+}
+
+// IsPending returns a boolean indicating whether the error is that
+// the requested operation is being completed in the background.
+func IsPending(err error) bool {
+	err = getInnerError(err)
+	return err == ErrVmcomputeOperationPending
+}
+
+// IsTimeout returns a boolean indicating whether the error is caused by
+// a timeout waiting for the operation to complete.
+func IsTimeout(err error) bool {
+	err = getInnerError(err)
+	return err == ErrTimeout
+}
+
+// IsAlreadyStopped returns a boolean indicating whether the error is caused by
+// a Container or Process being already stopped.
+// Note: Currently, ErrElementNotFound can mean that a Process has either
+// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
+// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
+func IsAlreadyStopped(err error) bool {
+	err = getInnerError(err)
+	return err == ErrVmcomputeAlreadyStopped ||
+		err == ErrElementNotFound ||
+		err == ErrProcNotFound
+}
+
+// IsNotSupported returns a boolean indicating whether the error is caused by
+// unsupported platform requests
+// Note: Currently Unsupported platform requests can be mean either
+// ErrVmcomputeInvalidJSON, ErrInvalidData, ErrNotSupported or ErrVmcomputeUnknownMessage
+// is thrown from the Platform
+func IsNotSupported(err error) bool {
+	err = getInnerError(err)
+	// If Platform doesn't recognize or support the request sent, below errors are seen
+	return err == ErrVmcomputeInvalidJSON ||
+		err == ErrInvalidData ||
+		err == ErrNotSupported ||
+		err == ErrVmcomputeUnknownMessage
+}
+
+func getInnerError(err error) error {
+	switch pe := err.(type) {
+	case nil:
+		return nil
+	case *HcsError:
+		err = pe.Err
+	case *SystemError:
+		err = pe.Err
+	case *ProcessError:
+		err = pe.Err
+	}
+	return err
+}

vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go

@@ -0,0 +1,48 @@
+// Shim for the Host Compute Service (HCS) to manage Windows Server
+// containers and Hyper-V containers.
+
+package hcs
+
+import (
+	"syscall"
+)
+
+//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hcs.go
+
+//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems?
+//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem?
+//sys hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem?
+//sys hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem?
+//sys hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem?
+//sys hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem?
+//sys hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem?
+//sys hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem?
+//sys hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem?
+//sys hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties?
+//sys hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem?
+//sys hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback?
+//sys hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback?
+
+//sys hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess?
+//sys hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess?
+//sys hcsCloseProcess(process hcsProcess) (hr error) = vmcompute.HcsCloseProcess?
+//sys hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess?
+//sys hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) = vmcompute.HcsTerminateProcess?
+//sys hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo?
+//sys hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties?
+//sys hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess?
+//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties?
+//sys hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback?
+//sys hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback?
+
+type hcsSystem syscall.Handle
+type hcsProcess syscall.Handle
+type hcsCallback syscall.Handle
+
+type hcsProcessInformation struct {
+	ProcessId uint32
+	Reserved  uint32
+	StdInput  syscall.Handle
+	StdOutput syscall.Handle
+	StdError  syscall.Handle
+}

vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go

@@ -0,0 +1,20 @@
+package hcs
+
+import "github.com/sirupsen/logrus"
+
+func logOperationBegin(ctx logrus.Fields, msg string) {
+	logrus.WithFields(ctx).Debug(msg)
+}
+
+func logOperationEnd(ctx logrus.Fields, msg string, err error) {
+	// Copy the log and fields first.
+	log := logrus.WithFields(ctx)
+	if err == nil {
+		log.Debug(msg)
+	} else {
+		// Edit only the copied field data to avoid race conditions on the
+		// write.
+		log.Data[logrus.ErrorKey] = err
+		log.Error(msg)
+	}
+}

vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go

@@ -0,0 +1,459 @@
+package hcs
+
+import (
+	"encoding/json"
+	"io"
+	"sync"
+	"syscall"
+	"time"
+
+	"github.com/Microsoft/hcsshim/internal/guestrequest"
+	"github.com/Microsoft/hcsshim/internal/interop"
+	"github.com/Microsoft/hcsshim/internal/logfields"
+	"github.com/sirupsen/logrus"
+)
+
+// ContainerError is an error encountered in HCS
+type Process struct {
+	handleLock     sync.RWMutex
+	handle         hcsProcess
+	processID      int
+	system         *System
+	cachedPipes    *cachedPipes
+	callbackNumber uintptr
+
+	logctx logrus.Fields
+}
+
+func newProcess(process hcsProcess, processID int, computeSystem *System) *Process {
+	return &Process{
+		handle:    process,
+		processID: processID,
+		system:    computeSystem,
+		logctx: logrus.Fields{
+			logfields.ContainerID: computeSystem.ID(),
+			logfields.ProcessID:   processID,
+		},
+	}
+}
+
+type cachedPipes struct {
+	stdIn  syscall.Handle
+	stdOut syscall.Handle
+	stdErr syscall.Handle
+}
+
+type processModifyRequest struct {
+	Operation   string
+	ConsoleSize *consoleSize `json:",omitempty"`
+	CloseHandle *closeHandle `json:",omitempty"`
+}
+
+type consoleSize struct {
+	Height uint16
+	Width  uint16
+}
+
+type closeHandle struct {
+	Handle string
+}
+
+type ProcessStatus struct {
+	ProcessID      uint32
+	Exited         bool
+	ExitCode       uint32
+	LastWaitResult int32
+}
+
+const (
+	stdIn  string = "StdIn"
+	stdOut string = "StdOut"
+	stdErr string = "StdErr"
+)
+
+const (
+	modifyConsoleSize string = "ConsoleSize"
+	modifyCloseHandle string = "CloseHandle"
+)
+
+// Pid returns the process ID of the process within the container.
+func (process *Process) Pid() int {
+	return process.processID
+}
+
+// SystemID returns the ID of the process's compute system.
+func (process *Process) SystemID() string {
+	return process.system.ID()
+}
+
+func (process *Process) logOperationBegin(operation string) {
+	logOperationBegin(
+		process.logctx,
+		operation+" - Begin Operation")
+}
+
+func (process *Process) logOperationEnd(operation string, err error) {
+	var result string
+	if err == nil {
+		result = "Success"
+	} else {
+		result = "Error"
+	}
+
+	logOperationEnd(
+		process.logctx,
+		operation+" - End Operation - "+result,
+		err)
+}
+
+// Signal signals the process with `options`.
+func (process *Process) Signal(options guestrequest.SignalProcessOptions) (err error) {
+	process.handleLock.RLock()
+	defer process.handleLock.RUnlock()
+
+	operation := "hcsshim::Process::Signal"
+	process.logOperationBegin(operation)
+	defer func() { process.logOperationEnd(operation, err) }()
+
+	if process.handle == 0 {
+		return makeProcessError(process, operation, ErrAlreadyClosed, nil)
+	}
+
+	optionsb, err := json.Marshal(options)
+	if err != nil {
+		return err
+	}
+
+	optionsStr := string(optionsb)
+
+	var resultp *uint16
+	syscallWatcher(process.logctx, func() {
+		err = hcsSignalProcess(process.handle, optionsStr, &resultp)
+	})
+	events := processHcsResult(resultp)
+	if err != nil {
+		return makeProcessError(process, operation, err, events)
+	}
+
+	return nil
+}
+
+// Kill signals the process to terminate but does not wait for it to finish terminating.
+func (process *Process) Kill() (err error) {
+	process.handleLock.RLock()
+	defer process.handleLock.RUnlock()
+
+	operation := "hcsshim::Process::Kill"
+	process.logOperationBegin(operation)
+	defer func() { process.logOperationEnd(operation, err) }()
+
+	if process.handle == 0 {
+		return makeProcessError(process, operation, ErrAlreadyClosed, nil)
+	}
+
+	var resultp *uint16
+	syscallWatcher(process.logctx, func() {
+		err = hcsTerminateProcess(process.handle, &resultp)
+	})
+	events := processHcsResult(resultp)
+	if err != nil {
+		return makeProcessError(process, operation, err, events)
+	}
+
+	return nil
+}
+
+// Wait waits for the process to exit.
+func (process *Process) Wait() (err error) {
+	operation := "hcsshim::Process::Wait"
+	process.logOperationBegin(operation)
+	defer func() { process.logOperationEnd(operation, err) }()
+
+	err = waitForNotification(process.callbackNumber, hcsNotificationProcessExited, nil)
+	if err != nil {
+		return makeProcessError(process, operation, err, nil)
+	}
+
+	return nil
+}
+
+// WaitTimeout waits for the process to exit or the duration to elapse. It returns
+// false if timeout occurs.
+func (process *Process) WaitTimeout(timeout time.Duration) (err error) {
+	operation := "hcssshim::Process::WaitTimeout"
+	process.logOperationBegin(operation)
+	defer func() { process.logOperationEnd(operation, err) }()
+
+	err = waitForNotification(process.callbackNumber, hcsNotificationProcessExited, &timeout)
+	if err != nil {
+		return makeProcessError(process, operation, err, nil)
+	}
+
+	return nil
+}
+
+// ResizeConsole resizes the console of the process.
+func (process *Process) ResizeConsole(width, height uint16) (err error) {
+	process.handleLock.RLock()
+	defer process.handleLock.RUnlock()
+
+	operation := "hcsshim::Process::ResizeConsole"
+	process.logOperationBegin(operation)
+	defer func() { process.logOperationEnd(operation, err) }()
+
+	if process.handle == 0 {
+		return makeProcessError(process, operation, ErrAlreadyClosed, nil)
+	}
+
+	modifyRequest := processModifyRequest{
+		Operation: modifyConsoleSize,
+		ConsoleSize: &consoleSize{
+			Height: height,
+			Width:  width,
+		},
+	}
+
+	modifyRequestb, err := json.Marshal(modifyRequest)
+	if err != nil {
+		return err
+	}
+
+	modifyRequestStr := string(modifyRequestb)
+
+	var resultp *uint16
+	err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp)
+	events := processHcsResult(resultp)
+	if err != nil {
+		return makeProcessError(process, operation, err, events)
+	}
+
+	return nil
+}
+
+func (process *Process) Properties() (_ *ProcessStatus, err error) {
+	process.handleLock.RLock()
+	defer process.handleLock.RUnlock()
+
+	operation := "hcsshim::Process::Properties"
+	process.logOperationBegin(operation)
+	defer func() { process.logOperationEnd(operation, err) }()
+
+	if process.handle == 0 {
+		return nil, makeProcessError(process, operation, ErrAlreadyClosed, nil)
+	}
+
+	var (
+		resultp     *uint16
+		propertiesp *uint16
+	)
+	syscallWatcher(process.logctx, func() {
+		err = hcsGetProcessProperties(process.handle, &propertiesp, &resultp)
+	})
+	events := processHcsResult(resultp)
+	if err != nil {
+		return nil, makeProcessError(process, operation, err, events)
+	}
+
+	if propertiesp == nil {
+		return nil, ErrUnexpectedValue
+	}
+	propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp)
+
+	properties := &ProcessStatus{}
+	if err := json.Unmarshal(propertiesRaw, properties); err != nil {
+		return nil, makeProcessError(process, operation, err, nil)
+	}
+
+	return properties, nil
+}
+
+// ExitCode returns the exit code of the process. The process must have
+// already terminated.
+func (process *Process) ExitCode() (_ int, err error) {
+	operation := "hcsshim::Process::ExitCode"
+	process.logOperationBegin(operation)
+	defer func() { process.logOperationEnd(operation, err) }()
+
+	properties, err := process.Properties()
+	if err != nil {
+		return 0, makeProcessError(process, operation, err, nil)
+	}
+
+	if properties.Exited == false {
+		return 0, makeProcessError(process, operation, ErrInvalidProcessState, nil)
+	}
+
+	if properties.LastWaitResult != 0 {
+		return 0, makeProcessError(process, operation, syscall.Errno(properties.LastWaitResult), nil)
+	}
+
+	return int(properties.ExitCode), nil
+}
+
+// Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing
+// these pipes does not close the underlying pipes; it should be possible to
+// call this multiple times to get multiple interfaces.
+func (process *Process) Stdio() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadCloser, err error) {
+	process.handleLock.RLock()
+	defer process.handleLock.RUnlock()
+
+	operation := "hcsshim::Process::Stdio"
+	process.logOperationBegin(operation)
+	defer func() { process.logOperationEnd(operation, err) }()
+
+	if process.handle == 0 {
+		return nil, nil, nil, makeProcessError(process, operation, ErrAlreadyClosed, nil)
+	}
+
+	var stdIn, stdOut, stdErr syscall.Handle
+
+	if process.cachedPipes == nil {
+		var (
+			processInfo hcsProcessInformation
+			resultp     *uint16
+		)
+		err = hcsGetProcessInfo(process.handle, &processInfo, &resultp)
+		events := processHcsResult(resultp)
+		if err != nil {
+			return nil, nil, nil, makeProcessError(process, operation, err, events)
+		}
+
+		stdIn, stdOut, stdErr = processInfo.StdInput, processInfo.StdOutput, processInfo.StdError
+	} else {
+		// Use cached pipes
+		stdIn, stdOut, stdErr = process.cachedPipes.stdIn, process.cachedPipes.stdOut, process.cachedPipes.stdErr
+
+		// Invalidate the cache
+		process.cachedPipes = nil
+	}
+
+	pipes, err := makeOpenFiles([]syscall.Handle{stdIn, stdOut, stdErr})
+	if err != nil {
+		return nil, nil, nil, makeProcessError(process, operation, err, nil)
+	}
+
+	return pipes[0], pipes[1], pipes[2], nil
+}
+
+// CloseStdin closes the write side of the stdin pipe so that the process is
+// notified on the read side that there is no more data in stdin.
+func (process *Process) CloseStdin() (err error) {
+	process.handleLock.RLock()
+	defer process.handleLock.RUnlock()
+
+	operation := "hcsshim::Process::CloseStdin"
+	process.logOperationBegin(operation)
+	defer func() { process.logOperationEnd(operation, err) }()
+
+	if process.handle == 0 {
+		return makeProcessError(process, operation, ErrAlreadyClosed, nil)
+	}
+
+	modifyRequest := processModifyRequest{
+		Operation: modifyCloseHandle,
+		CloseHandle: &closeHandle{
+			Handle: stdIn,
+		},
+	}
+
+	modifyRequestb, err := json.Marshal(modifyRequest)
+	if err != nil {
+		return err
+	}
+
+	modifyRequestStr := string(modifyRequestb)
+
+	var resultp *uint16
+	err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp)
+	events := processHcsResult(resultp)
+	if err != nil {
+		return makeProcessError(process, operation, err, events)
+	}
+
+	return nil
+}
+
+// Close cleans up any state associated with the process but does not kill
+// or wait on it.
+func (process *Process) Close() (err error) {
+	process.handleLock.Lock()
+	defer process.handleLock.Unlock()
+
+	operation := "hcsshim::Process::Close"
+	process.logOperationBegin(operation)
+	defer func() { process.logOperationEnd(operation, err) }()
+
+	// Don't double free this
+	if process.handle == 0 {
+		return nil
+	}
+
+	if err = process.unregisterCallback(); err != nil {
+		return makeProcessError(process, operation, err, nil)
+	}
+
+	if err = hcsCloseProcess(process.handle); err != nil {
+		return makeProcessError(process, operation, err, nil)
+	}
+
+	process.handle = 0
+
+	return nil
+}
+
+func (process *Process) registerCallback() error {
+	context := &notifcationWatcherContext{
+		channels: newChannels(),
+	}
+
+	callbackMapLock.Lock()
+	callbackNumber := nextCallback
+	nextCallback++
+	callbackMap[callbackNumber] = context
+	callbackMapLock.Unlock()
+
+	var callbackHandle hcsCallback
+	err := hcsRegisterProcessCallback(process.handle, notificationWatcherCallback, callbackNumber, &callbackHandle)
+	if err != nil {
+		return err
+	}
+	context.handle = callbackHandle
+	process.callbackNumber = callbackNumber
+
+	return nil
+}
+
+func (process *Process) unregisterCallback() error {
+	callbackNumber := process.callbackNumber
+
+	callbackMapLock.RLock()
+	context := callbackMap[callbackNumber]
+	callbackMapLock.RUnlock()
+
+	if context == nil {
+		return nil
+	}
+
+	handle := context.handle
+
+	if handle == 0 {
+		return nil
+	}
+
+	// hcsUnregisterProcessCallback has its own syncronization
+	// to wait for all callbacks to complete. We must NOT hold the callbackMapLock.
+	err := hcsUnregisterProcessCallback(handle)
+	if err != nil {
+		return err
+	}
+
+	closeChannels(context.channels)
+
+	callbackMapLock.Lock()
+	callbackMap[callbackNumber] = nil
+	callbackMapLock.Unlock()
+
+	handle = 0
+
+	return nil
+}

vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go

@@ -0,0 +1,685 @@
+package hcs
+
+import (
+	"encoding/json"
+	"os"
+	"strconv"
+	"sync"
+	"syscall"
+	"time"
+
+	"github.com/Microsoft/hcsshim/internal/interop"
+	"github.com/Microsoft/hcsshim/internal/logfields"
+	"github.com/Microsoft/hcsshim/internal/schema1"
+	"github.com/Microsoft/hcsshim/internal/timeout"
+	"github.com/sirupsen/logrus"
+)
+
+// currentContainerStarts is used to limit the number of concurrent container
+// starts.
+var currentContainerStarts containerStarts
+
+type containerStarts struct {
+	maxParallel int
+	inProgress  int
+	sync.Mutex
+}
+
+func init() {
+	mpsS := os.Getenv("HCSSHIM_MAX_PARALLEL_START")
+	if len(mpsS) > 0 {
+		mpsI, err := strconv.Atoi(mpsS)
+		if err != nil || mpsI < 0 {
+			return
+		}
+		currentContainerStarts.maxParallel = mpsI
+	}
+}
+
+type System struct {
+	handleLock     sync.RWMutex
+	handle         hcsSystem
+	id             string
+	callbackNumber uintptr
+
+	logctx logrus.Fields
+}
+
+func newSystem(id string) *System {
+	return &System{
+		id: id,
+		logctx: logrus.Fields{
+			logfields.ContainerID: id,
+		},
+	}
+}
+
+func (computeSystem *System) logOperationBegin(operation string) {
+	logOperationBegin(
+		computeSystem.logctx,
+		operation+" - Begin Operation")
+}
+
+func (computeSystem *System) logOperationEnd(operation string, err error) {
+	var result string
+	if err == nil {
+		result = "Success"
+	} else {
+		result = "Error"
+	}
+
+	logOperationEnd(
+		computeSystem.logctx,
+		operation+" - End Operation - "+result,
+		err)
+}
+
+// CreateComputeSystem creates a new compute system with the given configuration but does not start it.
+func CreateComputeSystem(id string, hcsDocumentInterface interface{}) (_ *System, err error) {
+	operation := "hcsshim::CreateComputeSystem"
+
+	computeSystem := newSystem(id)
+	computeSystem.logOperationBegin(operation)
+	defer func() { computeSystem.logOperationEnd(operation, err) }()
+
+	hcsDocumentB, err := json.Marshal(hcsDocumentInterface)
+	if err != nil {
+		return nil, err
+	}
+
+	hcsDocument := string(hcsDocumentB)
+
+	logrus.WithFields(computeSystem.logctx).
+		WithField(logfields.JSON, hcsDocument).
+		Debug("HCS ComputeSystem Document")
+
+	var (
+		resultp     *uint16
+		identity    syscall.Handle
+		createError error
+	)
+	syscallWatcher(computeSystem.logctx, func() {
+		createError = hcsCreateComputeSystem(id, hcsDocument, identity, &computeSystem.handle, &resultp)
+	})
+
+	if createError == nil || IsPending(createError) {
+		if err = computeSystem.registerCallback(); err != nil {
+			// Terminate the compute system if it still exists. We're okay to
+			// ignore a failure here.
+			computeSystem.Terminate()
+			return nil, makeSystemError(computeSystem, operation, "", err, nil)
+		}
+	}
+
+	events, err := processAsyncHcsResult(createError, resultp, computeSystem.callbackNumber, hcsNotificationSystemCreateCompleted, &timeout.SystemCreate)
+	if err != nil {
+		if err == ErrTimeout {
+			// Terminate the compute system if it still exists. We're okay to
+			// ignore a failure here.
+			computeSystem.Terminate()
+		}
+		return nil, makeSystemError(computeSystem, operation, hcsDocument, err, events)
+	}
+
+	return computeSystem, nil
+}
+
+// OpenComputeSystem opens an existing compute system by ID.
+func OpenComputeSystem(id string) (_ *System, err error) {
+	operation := "hcsshim::OpenComputeSystem"
+
+	computeSystem := newSystem(id)
+	computeSystem.logOperationBegin(operation)
+	defer func() {
+		if IsNotExist(err) {
+			computeSystem.logOperationEnd(operation, nil)
+		} else {
+			computeSystem.logOperationEnd(operation, err)
+		}
+	}()
+
+	var (
+		handle  hcsSystem
+		resultp *uint16
+	)
+	err = hcsOpenComputeSystem(id, &handle, &resultp)
+	events := processHcsResult(resultp)
+	if err != nil {
+		return nil, makeSystemError(computeSystem, operation, "", err, events)
+	}
+
+	computeSystem.handle = handle
+
+	if err = computeSystem.registerCallback(); err != nil {
+		return nil, makeSystemError(computeSystem, operation, "", err, nil)
+	}
+
+	return computeSystem, nil
+}
+
+// GetComputeSystems gets a list of the compute systems on the system that match the query
+func GetComputeSystems(q schema1.ComputeSystemQuery) (_ []schema1.ContainerProperties, err error) {
+	operation := "hcsshim::GetComputeSystems"
+	fields := logrus.Fields{}
+	logOperationBegin(
+		fields,
+		operation+" - Begin Operation")
+
+	defer func() {
+		var result string
+		if err == nil {
+			result = "Success"
+		} else {
+			result = "Error"
+		}
+
+		logOperationEnd(
+			fields,
+			operation+" - End Operation - "+result,
+			err)
+	}()
+
+	queryb, err := json.Marshal(q)
+	if err != nil {
+		return nil, err
+	}
+
+	query := string(queryb)
+
+	logrus.WithFields(fields).
+		WithField(logfields.JSON, query).
+		Debug("HCS ComputeSystem Query")
+
+	var (
+		resultp         *uint16
+		computeSystemsp *uint16
+	)
+
+	syscallWatcher(fields, func() {
+		err = hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp)
+	})
+	events := processHcsResult(resultp)
+	if err != nil {
+		return nil, &HcsError{Op: operation, Err: err, Events: events}
+	}
+
+	if computeSystemsp == nil {
+		return nil, ErrUnexpectedValue
+	}
+	computeSystemsRaw := interop.ConvertAndFreeCoTaskMemBytes(computeSystemsp)
+	computeSystems := []schema1.ContainerProperties{}
+	if err = json.Unmarshal(computeSystemsRaw, &computeSystems); err != nil {
+		return nil, err
+	}
+
+	return computeSystems, nil
+}
+
+// Start synchronously starts the computeSystem.
+func (computeSystem *System) Start() (err error) {
+	computeSystem.handleLock.RLock()
+	defer computeSystem.handleLock.RUnlock()
+
+	operation := "hcsshim::ComputeSystem::Start"
+	computeSystem.logOperationBegin(operation)
+	defer func() { computeSystem.logOperationEnd(operation, err) }()
+
+	if computeSystem.handle == 0 {
+		return makeSystemError(computeSystem, "Start", "", ErrAlreadyClosed, nil)
+	}
+
+	// This is a very simple backoff-retry loop to limit the number
+	// of parallel container starts if environment variable
+	// HCSSHIM_MAX_PARALLEL_START is set to a positive integer.
+	// It should generally only be used as a workaround to various
+	// platform issues that exist between RS1 and RS4 as of Aug 2018
+	if currentContainerStarts.maxParallel > 0 {
+		for {
+			currentContainerStarts.Lock()
+			if currentContainerStarts.inProgress < currentContainerStarts.maxParallel {
+				currentContainerStarts.inProgress++
+				currentContainerStarts.Unlock()
+				break
+			}
+			if currentContainerStarts.inProgress == currentContainerStarts.maxParallel {
+				currentContainerStarts.Unlock()
+				time.Sleep(100 * time.Millisecond)
+			}
+		}
+		// Make sure we decrement the count when we are done.
+		defer func() {
+			currentContainerStarts.Lock()
+			currentContainerStarts.inProgress--
+			currentContainerStarts.Unlock()
+		}()
+	}
+
+	var resultp *uint16
+	syscallWatcher(computeSystem.logctx, func() {
+		err = hcsStartComputeSystem(computeSystem.handle, "", &resultp)
+	})
+	events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemStartCompleted, &timeout.SystemStart)
+	if err != nil {
+		return makeSystemError(computeSystem, "Start", "", err, events)
+	}
+
+	return nil
+}
+
+// ID returns the compute system's identifier.
+func (computeSystem *System) ID() string {
+	return computeSystem.id
+}
+
+// Shutdown requests a compute system shutdown, if IsPending() on the error returned is true,
+// it may not actually be shut down until Wait() succeeds.
+func (computeSystem *System) Shutdown() (err error) {
+	computeSystem.handleLock.RLock()
+	defer computeSystem.handleLock.RUnlock()
+
+	operation := "hcsshim::ComputeSystem::Shutdown"
+	computeSystem.logOperationBegin(operation)
+	defer func() {
+		if IsAlreadyStopped(err) {
+			computeSystem.logOperationEnd(operation, nil)
+		} else {
+			computeSystem.logOperationEnd(operation, err)
+		}
+	}()
+
+	if computeSystem.handle == 0 {
+		return makeSystemError(computeSystem, "Shutdown", "", ErrAlreadyClosed, nil)
+	}
+
+	var resultp *uint16
+	syscallWatcher(computeSystem.logctx, func() {
+		err = hcsShutdownComputeSystem(computeSystem.handle, "", &resultp)
+	})
+	events := processHcsResult(resultp)
+	if err != nil {
+		return makeSystemError(computeSystem, "Shutdown", "", err, events)
+	}
+
+	return nil
+}
+
+// Terminate requests a compute system terminate, if IsPending() on the error returned is true,
+// it may not actually be shut down until Wait() succeeds.
+func (computeSystem *System) Terminate() (err error) {
+	computeSystem.handleLock.RLock()
+	defer computeSystem.handleLock.RUnlock()
+
+	operation := "hcsshim::ComputeSystem::Terminate"
+	computeSystem.logOperationBegin(operation)
+	defer func() {
+		if IsPending(err) {
+			computeSystem.logOperationEnd(operation, nil)
+		} else {
+			computeSystem.logOperationEnd(operation, err)
+		}
+	}()
+
+	if computeSystem.handle == 0 {
+		return makeSystemError(computeSystem, "Terminate", "", ErrAlreadyClosed, nil)
+	}
+
+	var resultp *uint16
+	syscallWatcher(computeSystem.logctx, func() {
+		err = hcsTerminateComputeSystem(computeSystem.handle, "", &resultp)
+	})
+	events := processHcsResult(resultp)
+	if err != nil && err != ErrVmcomputeAlreadyStopped {
+		return makeSystemError(computeSystem, "Terminate", "", err, events)
+	}
+
+	return nil
+}
+
+// Wait synchronously waits for the compute system to shutdown or terminate.
+func (computeSystem *System) Wait() (err error) {
+	operation := "hcsshim::ComputeSystem::Wait"
+	computeSystem.logOperationBegin(operation)
+	defer func() { computeSystem.logOperationEnd(operation, err) }()
+
+	err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, nil)
+	if err != nil {
+		return makeSystemError(computeSystem, "Wait", "", err, nil)
+	}
+
+	return nil
+}
+
+// WaitExpectedError synchronously waits for the compute system to shutdown or
+// terminate, and ignores the passed error if it occurs.
+func (computeSystem *System) WaitExpectedError(expected error) (err error) {
+	operation := "hcsshim::ComputeSystem::WaitExpectedError"
+	computeSystem.logOperationBegin(operation)
+	defer func() { computeSystem.logOperationEnd(operation, err) }()
+
+	err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, nil)
+	if err != nil && getInnerError(err) != expected {
+		return makeSystemError(computeSystem, "WaitExpectedError", "", err, nil)
+	}
+
+	return nil
+}
+
+// WaitTimeout synchronously waits for the compute system to terminate or the duration to elapse.
+// If the timeout expires, IsTimeout(err) == true
+func (computeSystem *System) WaitTimeout(timeout time.Duration) (err error) {
+	operation := "hcsshim::ComputeSystem::WaitTimeout"
+	computeSystem.logOperationBegin(operation)
+	defer func() { computeSystem.logOperationEnd(operation, err) }()
+
+	err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, &timeout)
+	if err != nil {
+		return makeSystemError(computeSystem, "WaitTimeout", "", err, nil)
+	}
+
+	return nil
+}
+
+func (computeSystem *System) Properties(types ...schema1.PropertyType) (_ *schema1.ContainerProperties, err error) {
+	computeSystem.handleLock.RLock()
+	defer computeSystem.handleLock.RUnlock()
+
+	operation := "hcsshim::ComputeSystem::Properties"
+	computeSystem.logOperationBegin(operation)
+	defer func() { computeSystem.logOperationEnd(operation, err) }()
+
+	queryj, err := json.Marshal(schema1.PropertyQuery{types})
+	if err != nil {
+		return nil, makeSystemError(computeSystem, "Properties", "", err, nil)
+	}
+
+	logrus.WithFields(computeSystem.logctx).
+		WithField(logfields.JSON, queryj).
+		Debug("HCS ComputeSystem Properties Query")
+
+	var resultp, propertiesp *uint16
+	syscallWatcher(computeSystem.logctx, func() {
+		err = hcsGetComputeSystemProperties(computeSystem.handle, string(queryj), &propertiesp, &resultp)
+	})
+	events := processHcsResult(resultp)
+	if err != nil {
+		return nil, makeSystemError(computeSystem, "Properties", "", err, events)
+	}
+
+	if propertiesp == nil {
+		return nil, ErrUnexpectedValue
+	}
+	propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp)
+	properties := &schema1.ContainerProperties{}
+	if err := json.Unmarshal(propertiesRaw, properties); err != nil {
+		return nil, makeSystemError(computeSystem, "Properties", "", err, nil)
+	}
+
+	return properties, nil
+}
+
+// Pause pauses the execution of the computeSystem. This feature is not enabled in TP5.
+func (computeSystem *System) Pause() (err error) {
+	computeSystem.handleLock.RLock()
+	defer computeSystem.handleLock.RUnlock()
+
+	operation := "hcsshim::ComputeSystem::Pause"
+	computeSystem.logOperationBegin(operation)
+	defer func() { computeSystem.logOperationEnd(operation, err) }()
+
+	if computeSystem.handle == 0 {
+		return makeSystemError(computeSystem, "Pause", "", ErrAlreadyClosed, nil)
+	}
+
+	var resultp *uint16
+	syscallWatcher(computeSystem.logctx, func() {
+		err = hcsPauseComputeSystem(computeSystem.handle, "", &resultp)
+	})
+	events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemPauseCompleted, &timeout.SystemPause)
+	if err != nil {
+		return makeSystemError(computeSystem, "Pause", "", err, events)
+	}
+
+	return nil
+}
+
+// Resume resumes the execution of the computeSystem. This feature is not enabled in TP5.
+func (computeSystem *System) Resume() (err error) {
+	computeSystem.handleLock.RLock()
+	defer computeSystem.handleLock.RUnlock()
+
+	operation := "hcsshim::ComputeSystem::Resume"
+	computeSystem.logOperationBegin(operation)
+	defer func() { computeSystem.logOperationEnd(operation, err) }()
+
+	if computeSystem.handle == 0 {
+		return makeSystemError(computeSystem, "Resume", "", ErrAlreadyClosed, nil)
+	}
+
+	var resultp *uint16
+	syscallWatcher(computeSystem.logctx, func() {
+		err = hcsResumeComputeSystem(computeSystem.handle, "", &resultp)
+	})
+	events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemResumeCompleted, &timeout.SystemResume)
+	if err != nil {
+		return makeSystemError(computeSystem, "Resume", "", err, events)
+	}
+
+	return nil
+}
+
+// CreateProcess launches a new process within the computeSystem.
+func (computeSystem *System) CreateProcess(c interface{}) (_ *Process, err error) {
+	computeSystem.handleLock.RLock()
+	defer computeSystem.handleLock.RUnlock()
+
+	operation := "hcsshim::ComputeSystem::CreateProcess"
+	computeSystem.logOperationBegin(operation)
+	defer func() { computeSystem.logOperationEnd(operation, err) }()
+
+	var (
+		processInfo   hcsProcessInformation
+		processHandle hcsProcess
+		resultp       *uint16
+	)
+
+	if computeSystem.handle == 0 {
+		return nil, makeSystemError(computeSystem, "CreateProcess", "", ErrAlreadyClosed, nil)
+	}
+
+	configurationb, err := json.Marshal(c)
+	if err != nil {
+		return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil)
+	}
+
+	configuration := string(configurationb)
+
+	logrus.WithFields(computeSystem.logctx).
+		WithField(logfields.JSON, configuration).
+		Debug("HCS ComputeSystem Process Document")
+
+	syscallWatcher(computeSystem.logctx, func() {
+		err = hcsCreateProcess(computeSystem.handle, configuration, &processInfo, &processHandle, &resultp)
+	})
+	events := processHcsResult(resultp)
+	if err != nil {
+		return nil, makeSystemError(computeSystem, "CreateProcess", configuration, err, events)
+	}
+
+	logrus.WithFields(computeSystem.logctx).
+		WithField(logfields.ProcessID, processInfo.ProcessId).
+		Debug("HCS ComputeSystem CreateProcess PID")
+
+	process := newProcess(processHandle, int(processInfo.ProcessId), computeSystem)
+	process.cachedPipes = &cachedPipes{
+		stdIn:  processInfo.StdInput,
+		stdOut: processInfo.StdOutput,
+		stdErr: processInfo.StdError,
+	}
+
+	if err = process.registerCallback(); err != nil {
+		return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil)
+	}
+
+	return process, nil
+}
+
+// OpenProcess gets an interface to an existing process within the computeSystem.
+func (computeSystem *System) OpenProcess(pid int) (_ *Process, err error) {
+	computeSystem.handleLock.RLock()
+	defer computeSystem.handleLock.RUnlock()
+
+	// Add PID for the context of this operation
+	computeSystem.logctx[logfields.ProcessID] = pid
+	defer delete(computeSystem.logctx, logfields.ProcessID)
+
+	operation := "hcsshim::ComputeSystem::OpenProcess"
+	computeSystem.logOperationBegin(operation)
+	defer func() { computeSystem.logOperationEnd(operation, err) }()
+
+	var (
+		processHandle hcsProcess
+		resultp       *uint16
+	)
+
+	if computeSystem.handle == 0 {
+		return nil, makeSystemError(computeSystem, "OpenProcess", "", ErrAlreadyClosed, nil)
+	}
+
+	syscallWatcher(computeSystem.logctx, func() {
+		err = hcsOpenProcess(computeSystem.handle, uint32(pid), &processHandle, &resultp)
+	})
+	events := processHcsResult(resultp)
+	if err != nil {
+		return nil, makeSystemError(computeSystem, "OpenProcess", "", err, events)
+	}
+
+	process := newProcess(processHandle, pid, computeSystem)
+	if err = process.registerCallback(); err != nil {
+		return nil, makeSystemError(computeSystem, "OpenProcess", "", err, nil)
+	}
+
+	return process, nil
+}
+
+// Close cleans up any state associated with the compute system but does not terminate or wait for it.
+func (computeSystem *System) Close() (err error) {
+	computeSystem.handleLock.Lock()
+	defer computeSystem.handleLock.Unlock()
+
+	operation := "hcsshim::ComputeSystem::Close"
+	computeSystem.logOperationBegin(operation)
+	defer func() { computeSystem.logOperationEnd(operation, err) }()
+
+	// Don't double free this
+	if computeSystem.handle == 0 {
+		return nil
+	}
+
+	if err = computeSystem.unregisterCallback(); err != nil {
+		return makeSystemError(computeSystem, "Close", "", err, nil)
+	}
+
+	syscallWatcher(computeSystem.logctx, func() {
+		err = hcsCloseComputeSystem(computeSystem.handle)
+	})
+	if err != nil {
+		return makeSystemError(computeSystem, "Close", "", err, nil)
+	}
+
+	computeSystem.handle = 0
+
+	return nil
+}
+
+func (computeSystem *System) registerCallback() error {
+	context := &notifcationWatcherContext{
+		channels: newChannels(),
+	}
+
+	callbackMapLock.Lock()
+	callbackNumber := nextCallback
+	nextCallback++
+	callbackMap[callbackNumber] = context
+	callbackMapLock.Unlock()
+
+	var callbackHandle hcsCallback
+	err := hcsRegisterComputeSystemCallback(computeSystem.handle, notificationWatcherCallback, callbackNumber, &callbackHandle)
+	if err != nil {
+		return err
+	}
+	context.handle = callbackHandle
+	computeSystem.callbackNumber = callbackNumber
+
+	return nil
+}
+
+func (computeSystem *System) unregisterCallback() error {
+	callbackNumber := computeSystem.callbackNumber
+
+	callbackMapLock.RLock()
+	context := callbackMap[callbackNumber]
+	callbackMapLock.RUnlock()
+
+	if context == nil {
+		return nil
+	}
+
+	handle := context.handle
+
+	if handle == 0 {
+		return nil
+	}
+
+	// hcsUnregisterComputeSystemCallback has its own syncronization
+	// to wait for all callbacks to complete. We must NOT hold the callbackMapLock.
+	err := hcsUnregisterComputeSystemCallback(handle)
+	if err != nil {
+		return err
+	}
+
+	closeChannels(context.channels)
+
+	callbackMapLock.Lock()
+	callbackMap[callbackNumber] = nil
+	callbackMapLock.Unlock()
+
+	handle = 0
+
+	return nil
+}
+
+// Modify the System by sending a request to HCS
+func (computeSystem *System) Modify(config interface{}) (err error) {
+	computeSystem.handleLock.RLock()
+	defer computeSystem.handleLock.RUnlock()
+
+	operation := "hcsshim::ComputeSystem::Modify"
+	computeSystem.logOperationBegin(operation)
+	defer func() { computeSystem.logOperationEnd(operation, err) }()
+
+	if computeSystem.handle == 0 {
+		return makeSystemError(computeSystem, "Modify", "", ErrAlreadyClosed, nil)
+	}
+
+	requestJSON, err := json.Marshal(config)
+	if err != nil {
+		return err
+	}
+
+	requestString := string(requestJSON)
+
+	logrus.WithFields(computeSystem.logctx).
+		WithField(logfields.JSON, requestString).
+		Debug("HCS ComputeSystem Modify Document")
+
+	var resultp *uint16
+	syscallWatcher(computeSystem.logctx, func() {
+		err = hcsModifyComputeSystem(computeSystem.handle, requestString, &resultp)
+	})
+	events := processHcsResult(resultp)
+	if err != nil {
+		return makeSystemError(computeSystem, "Modify", requestString, err, events)
+	}
+
+	return nil
+}

vendor/github.com/Microsoft/hcsshim/internal/hcs/utils.go

@@ -0,0 +1,33 @@
+package hcs
+
+import (
+	"io"
+	"syscall"
+
+	"github.com/Microsoft/go-winio"
+)
+
+// makeOpenFiles calls winio.MakeOpenFile for each handle in a slice but closes all the handles
+// if there is an error.
+func makeOpenFiles(hs []syscall.Handle) (_ []io.ReadWriteCloser, err error) {
+	fs := make([]io.ReadWriteCloser, len(hs))
+	for i, h := range hs {
+		if h != syscall.Handle(0) {
+			if err == nil {
+				fs[i], err = winio.MakeOpenFile(h)
+			}
+			if err != nil {
+				syscall.Close(h)
+			}
+		}
+	}
+	if err != nil {
+		for _, f := range fs {
+			if f != nil {
+				f.Close()
+			}
+		}
+		return nil, err
+	}
+	return fs, nil
+}

vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go

@@ -0,0 +1,63 @@
+package hcs
+
+import (
+	"time"
+
+	"github.com/sirupsen/logrus"
+)
+
+func processAsyncHcsResult(err error, resultp *uint16, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) ([]ErrorEvent, error) {
+	events := processHcsResult(resultp)
+	if IsPending(err) {
+		return nil, waitForNotification(callbackNumber, expectedNotification, timeout)
+	}
+
+	return events, err
+}
+
+func waitForNotification(callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error {
+	callbackMapLock.RLock()
+	channels := callbackMap[callbackNumber].channels
+	callbackMapLock.RUnlock()
+
+	expectedChannel := channels[expectedNotification]
+	if expectedChannel == nil {
+		logrus.Errorf("unknown notification type in waitForNotification %x", expectedNotification)
+		return ErrInvalidNotificationType
+	}
+
+	var c <-chan time.Time
+	if timeout != nil {
+		timer := time.NewTimer(*timeout)
+		c = timer.C
+		defer timer.Stop()
+	}
+
+	select {
+	case err, ok := <-expectedChannel:
+		if !ok {
+			return ErrHandleClose
+		}
+		return err
+	case err, ok := <-channels[hcsNotificationSystemExited]:
+		if !ok {
+			return ErrHandleClose
+		}
+		// If the expected notification is hcsNotificationSystemExited which of the two selects
+		// chosen is random. Return the raw error if hcsNotificationSystemExited is expected
+		if channels[hcsNotificationSystemExited] == expectedChannel {
+			return err
+		}
+		return ErrUnexpectedContainerExit
+	case _, ok := <-channels[hcsNotificationServiceDisconnect]:
+		if !ok {
+			return ErrHandleClose
+		}
+		// hcsNotificationServiceDisconnect should never be an expected notification
+		// it does not need the same handling as hcsNotificationSystemExited
+		return ErrUnexpectedProcessAbort
+	case <-c:
+		return ErrTimeout
+	}
+	return nil
+}

vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go

@@ -0,0 +1,41 @@
+package hcs
+
+import (
+	"context"
+
+	"github.com/Microsoft/hcsshim/internal/logfields"
+	"github.com/Microsoft/hcsshim/internal/timeout"
+	"github.com/sirupsen/logrus"
+)
+
+// syscallWatcher is used as a very simple goroutine around calls into
+// the platform. In some cases, we have seen HCS APIs not returning due to
+// various bugs, and the goroutine making the syscall ends up not returning,
+// prior to its async callback. By spinning up a syscallWatcher, it allows
+// us to at least log a warning if a syscall doesn't complete in a reasonable
+// amount of time.
+//
+// Usage is:
+//
+// syscallWatcher(logContext, func() {
+//    err = <syscall>(args...)
+// })
+//
+
+func syscallWatcher(logContext logrus.Fields, syscallLambda func()) {
+	ctx, cancel := context.WithTimeout(context.Background(), timeout.SyscallWatcher)
+	defer cancel()
+	go watchFunc(ctx, logContext)
+	syscallLambda()
+}
+
+func watchFunc(ctx context.Context, logContext logrus.Fields) {
+	select {
+	case <-ctx.Done():
+		if ctx.Err() != context.Canceled {
+			logrus.WithFields(logContext).
+				WithField(logfields.Timeout, timeout.SyscallWatcher).
+				Warning("Syscall did not complete within operation timeout. This may indicate a platform issue. If it appears to be making no forward progress, obtain the stacks and see if there is a syscall stuck in the platform API for a significant length of time.")
+		}
+	}
+}

vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go

@@ -0,0 +1,533 @@
+// Code generated mksyscall_windows.exe DO NOT EDIT
+
+package hcs
+
+import (
+	"syscall"
+	"unsafe"
+
+	"golang.org/x/sys/windows"
+)
+
+var _ unsafe.Pointer
+
+// Do the interface allocations only once for common
+// Errno values.
+const (
+	errnoERROR_IO_PENDING = 997
+)
+
+var (
+	errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
+)
+
+// errnoErr returns common boxed Errno values, to prevent
+// allocations at runtime.
+func errnoErr(e syscall.Errno) error {
+	switch e {
+	case 0:
+		return nil
+	case errnoERROR_IO_PENDING:
+		return errERROR_IO_PENDING
+	}
+	// TODO: add more here, after collecting data on the common
+	// error values see on Windows. (perhaps when running
+	// all.bat?)
+	return e
+}
+
+var (
+	modvmcompute = windows.NewLazySystemDLL("vmcompute.dll")
+
+	procHcsEnumerateComputeSystems         = modvmcompute.NewProc("HcsEnumerateComputeSystems")
+	procHcsCreateComputeSystem             = modvmcompute.NewProc("HcsCreateComputeSystem")
+	procHcsOpenComputeSystem               = modvmcompute.NewProc("HcsOpenComputeSystem")
+	procHcsCloseComputeSystem              = modvmcompute.NewProc("HcsCloseComputeSystem")
+	procHcsStartComputeSystem              = modvmcompute.NewProc("HcsStartComputeSystem")
+	procHcsShutdownComputeSystem           = modvmcompute.NewProc("HcsShutdownComputeSystem")
+	procHcsTerminateComputeSystem          = modvmcompute.NewProc("HcsTerminateComputeSystem")
+	procHcsPauseComputeSystem              = modvmcompute.NewProc("HcsPauseComputeSystem")
+	procHcsResumeComputeSystem             = modvmcompute.NewProc("HcsResumeComputeSystem")
+	procHcsGetComputeSystemProperties      = modvmcompute.NewProc("HcsGetComputeSystemProperties")
+	procHcsModifyComputeSystem             = modvmcompute.NewProc("HcsModifyComputeSystem")
+	procHcsRegisterComputeSystemCallback   = modvmcompute.NewProc("HcsRegisterComputeSystemCallback")
+	procHcsUnregisterComputeSystemCallback = modvmcompute.NewProc("HcsUnregisterComputeSystemCallback")
+	procHcsCreateProcess                   = modvmcompute.NewProc("HcsCreateProcess")
+	procHcsOpenProcess                     = modvmcompute.NewProc("HcsOpenProcess")
+	procHcsCloseProcess                    = modvmcompute.NewProc("HcsCloseProcess")
+	procHcsTerminateProcess                = modvmcompute.NewProc("HcsTerminateProcess")
+
+	procHcsGetProcessInfo            = modvmcompute.NewProc("HcsGetProcessInfo")
+	procHcsGetProcessProperties      = modvmcompute.NewProc("HcsGetProcessProperties")
+	procHcsModifyProcess             = modvmcompute.NewProc("HcsModifyProcess")
+	procHcsGetServiceProperties      = modvmcompute.NewProc("HcsGetServiceProperties")
+	procHcsRegisterProcessCallback   = modvmcompute.NewProc("HcsRegisterProcessCallback")
+	procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback")
+)
+
+func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(query)
+	if hr != nil {
+		return
+	}
+	return _hcsEnumerateComputeSystems(_p0, computeSystems, result)
+}
+
+func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result **uint16) (hr error) {
+	if hr = procHcsEnumerateComputeSystems.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsEnumerateComputeSystems.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(computeSystems)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(id)
+	if hr != nil {
+		return
+	}
+	var _p1 *uint16
+	_p1, hr = syscall.UTF16PtrFromString(configuration)
+	if hr != nil {
+		return
+	}
+	return _hcsCreateComputeSystem(_p0, _p1, identity, computeSystem, result)
+}
+
+func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) {
+	if hr = procHcsCreateComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHcsCreateComputeSystem.Addr(), 5, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(configuration)), uintptr(identity), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)), 0)
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(id)
+	if hr != nil {
+		return
+	}
+	return _hcsOpenComputeSystem(_p0, computeSystem, result)
+}
+
+func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16) (hr error) {
+	if hr = procHcsOpenComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsOpenComputeSystem.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) {
+	if hr = procHcsCloseComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsCloseComputeSystem.Addr(), 1, uintptr(computeSystem), 0, 0)
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(options)
+	if hr != nil {
+		return
+	}
+	return _hcsStartComputeSystem(computeSystem, _p0, result)
+}
+
+func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
+	if hr = procHcsStartComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsStartComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(options)
+	if hr != nil {
+		return
+	}
+	return _hcsShutdownComputeSystem(computeSystem, _p0, result)
+}
+
+func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
+	if hr = procHcsShutdownComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsShutdownComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(options)
+	if hr != nil {
+		return
+	}
+	return _hcsTerminateComputeSystem(computeSystem, _p0, result)
+}
+
+func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
+	if hr = procHcsTerminateComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsTerminateComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(options)
+	if hr != nil {
+		return
+	}
+	return _hcsPauseComputeSystem(computeSystem, _p0, result)
+}
+
+func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
+	if hr = procHcsPauseComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsPauseComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(options)
+	if hr != nil {
+		return
+	}
+	return _hcsResumeComputeSystem(computeSystem, _p0, result)
+}
+
+func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
+	if hr = procHcsResumeComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsResumeComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(propertyQuery)
+	if hr != nil {
+		return
+	}
+	return _hcsGetComputeSystemProperties(computeSystem, _p0, properties, result)
+}
+
+func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) {
+	if hr = procHcsGetComputeSystemProperties.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHcsGetComputeSystemProperties.Addr(), 4, uintptr(computeSystem), uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0)
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(configuration)
+	if hr != nil {
+		return
+	}
+	return _hcsModifyComputeSystem(computeSystem, _p0, result)
+}
+
+func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, result **uint16) (hr error) {
+	if hr = procHcsModifyComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsModifyComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(configuration)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) {
+	if hr = procHcsRegisterComputeSystemCallback.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHcsRegisterComputeSystemCallback.Addr(), 4, uintptr(computeSystem), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0)
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) {
+	if hr = procHcsUnregisterComputeSystemCallback.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsUnregisterComputeSystemCallback.Addr(), 1, uintptr(callbackHandle), 0, 0)
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(processParameters)
+	if hr != nil {
+		return
+	}
+	return _hcsCreateProcess(computeSystem, _p0, processInformation, process, result)
+}
+
+func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) {
+	if hr = procHcsCreateProcess.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHcsCreateProcess.Addr(), 5, uintptr(computeSystem), uintptr(unsafe.Pointer(processParameters)), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0)
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) {
+	if hr = procHcsOpenProcess.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHcsOpenProcess.Addr(), 4, uintptr(computeSystem), uintptr(pid), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0, 0)
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsCloseProcess(process hcsProcess) (hr error) {
+	if hr = procHcsCloseProcess.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsCloseProcess.Addr(), 1, uintptr(process), 0, 0)
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) {
+	if hr = procHcsTerminateProcess.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 2, uintptr(process), uintptr(unsafe.Pointer(result)), 0)
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(options)
+	if hr != nil {
+		return
+	}
+	return _hcsSignalProcess(process, _p0, result)
+}
+
+func _hcsSignalProcess(process hcsProcess, options *uint16, result **uint16) (hr error) {
+	if hr = procHcsTerminateProcess.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) {
+	if hr = procHcsGetProcessInfo.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsGetProcessInfo.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) {
+	if hr = procHcsGetProcessProperties.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsGetProcessProperties.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processProperties)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(settings)
+	if hr != nil {
+		return
+	}
+	return _hcsModifyProcess(process, _p0, result)
+}
+
+func _hcsModifyProcess(process hcsProcess, settings *uint16, result **uint16) (hr error) {
+	if hr = procHcsModifyProcess.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsModifyProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(propertyQuery)
+	if hr != nil {
+		return
+	}
+	return _hcsGetServiceProperties(_p0, properties, result)
+}
+
+func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result **uint16) (hr error) {
+	if hr = procHcsGetServiceProperties.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsGetServiceProperties.Addr(), 3, uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) {
+	if hr = procHcsRegisterProcessCallback.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHcsRegisterProcessCallback.Addr(), 4, uintptr(process), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0)
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) {
+	if hr = procHcsUnregisterProcessCallback.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsUnregisterProcessCallback.Addr(), 1, uintptr(callbackHandle), 0, 0)
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}

vendor/github.com/Microsoft/hcsshim/internal/hcserror/hcserror.go

@@ -0,0 +1,47 @@
+package hcserror
+
+import (
+	"fmt"
+	"syscall"
+)
+
+const ERROR_GEN_FAILURE = syscall.Errno(31)
+
+type HcsError struct {
+	title string
+	rest  string
+	Err   error
+}
+
+func (e *HcsError) Error() string {
+	s := e.title
+	if len(s) > 0 && s[len(s)-1] != ' ' {
+		s += " "
+	}
+	s += fmt.Sprintf("failed in Win32: %s (0x%x)", e.Err, Win32FromError(e.Err))
+	if e.rest != "" {
+		if e.rest[0] != ' ' {
+			s += " "
+		}
+		s += e.rest
+	}
+	return s
+}
+
+func New(err error, title, rest string) error {
+	// Pass through DLL errors directly since they do not originate from HCS.
+	if _, ok := err.(*syscall.DLLError); ok {
+		return err
+	}
+	return &HcsError{title, rest, err}
+}
+
+func Win32FromError(err error) uint32 {
+	if herr, ok := err.(*HcsError); ok {
+		return Win32FromError(herr.Err)
+	}
+	if code, ok := err.(syscall.Errno); ok {
+		return uint32(code)
+	}
+	return uint32(ERROR_GEN_FAILURE)
+}

vendor/github.com/Microsoft/hcsshim/internal/hns/hns.go

@@ -0,0 +1,23 @@
+package hns
+
+import "fmt"
+
+//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hns.go
+
+//sys _hnsCall(method string, path string, object string, response **uint16) (hr error) = vmcompute.HNSCall?
+
+type EndpointNotFoundError struct {
+	EndpointName string
+}
+
+func (e EndpointNotFoundError) Error() string {
+	return fmt.Sprintf("Endpoint %s not found", e.EndpointName)
+}
+
+type NetworkNotFoundError struct {
+	NetworkName string
+}
+
+func (e NetworkNotFoundError) Error() string {
+	return fmt.Sprintf("Network %s not found", e.NetworkName)
+}

vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go

@@ -0,0 +1,262 @@
+package hns
+
+import (
+	"encoding/json"
+	"net"
+
+	"github.com/sirupsen/logrus"
+)
+
+// HNSEndpoint represents a network endpoint in HNS
+type HNSEndpoint struct {
+	Id                 string            `json:"ID,omitempty"`
+	Name               string            `json:",omitempty"`
+	VirtualNetwork     string            `json:",omitempty"`
+	VirtualNetworkName string            `json:",omitempty"`
+	Policies           []json.RawMessage `json:",omitempty"`
+	MacAddress         string            `json:",omitempty"`
+	IPAddress          net.IP            `json:",omitempty"`
+	DNSSuffix          string            `json:",omitempty"`
+	DNSServerList      string            `json:",omitempty"`
+	GatewayAddress     string            `json:",omitempty"`
+	EnableInternalDNS  bool              `json:",omitempty"`
+	DisableICC         bool              `json:",omitempty"`
+	PrefixLength       uint8             `json:",omitempty"`
+	IsRemoteEndpoint   bool              `json:",omitempty"`
+	EnableLowMetric    bool              `json:",omitempty"`
+	Namespace          *Namespace        `json:",omitempty"`
+	EncapOverhead      uint16            `json:",omitempty"`
+}
+
+//SystemType represents the type of the system on which actions are done
+type SystemType string
+
+// SystemType const
+const (
+	ContainerType      SystemType = "Container"
+	VirtualMachineType SystemType = "VirtualMachine"
+	HostType           SystemType = "Host"
+)
+
+// EndpointAttachDetachRequest is the structure used to send request to the container to modify the system
+// Supported resource types are Network and Request Types are Add/Remove
+type EndpointAttachDetachRequest struct {
+	ContainerID    string     `json:"ContainerId,omitempty"`
+	SystemType     SystemType `json:"SystemType"`
+	CompartmentID  uint16     `json:"CompartmentId,omitempty"`
+	VirtualNICName string     `json:"VirtualNicName,omitempty"`
+}
+
+// EndpointResquestResponse is object to get the endpoint request response
+type EndpointResquestResponse struct {
+	Success bool
+	Error   string
+}
+
+// HNSEndpointRequest makes a HNS call to modify/query a network endpoint
+func HNSEndpointRequest(method, path, request string) (*HNSEndpoint, error) {
+	endpoint := &HNSEndpoint{}
+	err := hnsCall(method, "/endpoints/"+path, request, &endpoint)
+	if err != nil {
+		return nil, err
+	}
+
+	return endpoint, nil
+}
+
+// HNSListEndpointRequest makes a HNS call to query the list of available endpoints
+func HNSListEndpointRequest() ([]HNSEndpoint, error) {
+	var endpoint []HNSEndpoint
+	err := hnsCall("GET", "/endpoints/", "", &endpoint)
+	if err != nil {
+		return nil, err
+	}
+
+	return endpoint, nil
+}
+
+// GetHNSEndpointByID get the Endpoint by ID
+func GetHNSEndpointByID(endpointID string) (*HNSEndpoint, error) {
+	return HNSEndpointRequest("GET", endpointID, "")
+}
+
+// GetHNSEndpointByName gets the endpoint filtered by Name
+func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) {
+	hnsResponse, err := HNSListEndpointRequest()
+	if err != nil {
+		return nil, err
+	}
+	for _, hnsEndpoint := range hnsResponse {
+		if hnsEndpoint.Name == endpointName {
+			return &hnsEndpoint, nil
+		}
+	}
+	return nil, EndpointNotFoundError{EndpointName: endpointName}
+}
+
+// Create Endpoint by sending EndpointRequest to HNS. TODO: Create a separate HNS interface to place all these methods
+func (endpoint *HNSEndpoint) Create() (*HNSEndpoint, error) {
+	operation := "Create"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+
+	jsonString, err := json.Marshal(endpoint)
+	if err != nil {
+		return nil, err
+	}
+	return HNSEndpointRequest("POST", "", string(jsonString))
+}
+
+// Delete Endpoint by sending EndpointRequest to HNS
+func (endpoint *HNSEndpoint) Delete() (*HNSEndpoint, error) {
+	operation := "Delete"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+
+	return HNSEndpointRequest("DELETE", endpoint.Id, "")
+}
+
+// Update Endpoint
+func (endpoint *HNSEndpoint) Update() (*HNSEndpoint, error) {
+	operation := "Update"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+	jsonString, err := json.Marshal(endpoint)
+	if err != nil {
+		return nil, err
+	}
+	err = hnsCall("POST", "/endpoints/"+endpoint.Id, string(jsonString), &endpoint)
+
+	return endpoint, err
+}
+
+// ApplyACLPolicy applies a set of ACL Policies on the Endpoint
+func (endpoint *HNSEndpoint) ApplyACLPolicy(policies ...*ACLPolicy) error {
+	operation := "ApplyACLPolicy"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+
+	for _, policy := range policies {
+		if policy == nil {
+			continue
+		}
+		jsonString, err := json.Marshal(policy)
+		if err != nil {
+			return err
+		}
+		endpoint.Policies = append(endpoint.Policies, jsonString)
+	}
+
+	_, err := endpoint.Update()
+	return err
+}
+
+// ContainerAttach attaches an endpoint to container
+func (endpoint *HNSEndpoint) ContainerAttach(containerID string, compartmentID uint16) error {
+	operation := "ContainerAttach"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+
+	requestMessage := &EndpointAttachDetachRequest{
+		ContainerID:   containerID,
+		CompartmentID: compartmentID,
+		SystemType:    ContainerType,
+	}
+	response := &EndpointResquestResponse{}
+	jsonString, err := json.Marshal(requestMessage)
+	if err != nil {
+		return err
+	}
+	return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
+}
+
+// ContainerDetach detaches an endpoint from container
+func (endpoint *HNSEndpoint) ContainerDetach(containerID string) error {
+	operation := "ContainerDetach"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+
+	requestMessage := &EndpointAttachDetachRequest{
+		ContainerID: containerID,
+		SystemType:  ContainerType,
+	}
+	response := &EndpointResquestResponse{}
+
+	jsonString, err := json.Marshal(requestMessage)
+	if err != nil {
+		return err
+	}
+	return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
+}
+
+// HostAttach attaches a nic on the host
+func (endpoint *HNSEndpoint) HostAttach(compartmentID uint16) error {
+	operation := "HostAttach"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+	requestMessage := &EndpointAttachDetachRequest{
+		CompartmentID: compartmentID,
+		SystemType:    HostType,
+	}
+	response := &EndpointResquestResponse{}
+
+	jsonString, err := json.Marshal(requestMessage)
+	if err != nil {
+		return err
+	}
+	return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
+
+}
+
+// HostDetach detaches a nic on the host
+func (endpoint *HNSEndpoint) HostDetach() error {
+	operation := "HostDetach"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+	requestMessage := &EndpointAttachDetachRequest{
+		SystemType: HostType,
+	}
+	response := &EndpointResquestResponse{}
+
+	jsonString, err := json.Marshal(requestMessage)
+	if err != nil {
+		return err
+	}
+	return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
+}
+
+// VirtualMachineNICAttach attaches a endpoint to a virtual machine
+func (endpoint *HNSEndpoint) VirtualMachineNICAttach(virtualMachineNICName string) error {
+	operation := "VirtualMachineNicAttach"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+	requestMessage := &EndpointAttachDetachRequest{
+		VirtualNICName: virtualMachineNICName,
+		SystemType:     VirtualMachineType,
+	}
+	response := &EndpointResquestResponse{}
+
+	jsonString, err := json.Marshal(requestMessage)
+	if err != nil {
+		return err
+	}
+	return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
+}
+
+// VirtualMachineNICDetach detaches a endpoint  from a virtual machine
+func (endpoint *HNSEndpoint) VirtualMachineNICDetach() error {
+	operation := "VirtualMachineNicDetach"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+
+	requestMessage := &EndpointAttachDetachRequest{
+		SystemType: VirtualMachineType,
+	}
+	response := &EndpointResquestResponse{}
+
+	jsonString, err := json.Marshal(requestMessage)
+	if err != nil {
+		return err
+	}
+	return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
+}

vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go

@@ -0,0 +1,42 @@
+package hns
+
+import (
+	"encoding/json"
+	"fmt"
+
+	"github.com/Microsoft/hcsshim/internal/hcserror"
+	"github.com/Microsoft/hcsshim/internal/interop"
+	"github.com/sirupsen/logrus"
+)
+
+func hnsCall(method, path, request string, returnResponse interface{}) error {
+	var responseBuffer *uint16
+	logrus.Debugf("[%s]=>[%s] Request : %s", method, path, request)
+
+	err := _hnsCall(method, path, request, &responseBuffer)
+	if err != nil {
+		return hcserror.New(err, "hnsCall ", "")
+	}
+	response := interop.ConvertAndFreeCoTaskMemString(responseBuffer)
+
+	hnsresponse := &hnsResponse{}
+	if err = json.Unmarshal([]byte(response), &hnsresponse); err != nil {
+		return err
+	}
+
+	if !hnsresponse.Success {
+		return fmt.Errorf("HNS failed with error : %s", hnsresponse.Error)
+	}
+
+	if len(hnsresponse.Output) == 0 {
+		return nil
+	}
+
+	logrus.Debugf("Network Response : %s", hnsresponse.Output)
+	err = json.Unmarshal(hnsresponse.Output, returnResponse)
+	if err != nil {
+		return err
+	}
+
+	return nil
+}

vendor/github.com/Microsoft/hcsshim/internal/hns/hnsglobals.go

@@ -0,0 +1,28 @@
+package hns
+
+type HNSGlobals struct {
+	Version HNSVersion `json:"Version"`
+}
+
+type HNSVersion struct {
+	Major int `json:"Major"`
+	Minor int `json:"Minor"`
+}
+
+var (
+	HNSVersion1803 = HNSVersion{Major: 7, Minor: 2}
+)
+
+func GetHNSGlobals() (*HNSGlobals, error) {
+	var version HNSVersion
+	err := hnsCall("GET", "/globals/version", "", &version)
+	if err != nil {
+		return nil, err
+	}
+
+	globals := &HNSGlobals{
+		Version: version,
+	}
+
+	return globals, nil
+}

vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go

@@ -0,0 +1,141 @@
+package hns
+
+import (
+	"encoding/json"
+	"net"
+
+	"github.com/sirupsen/logrus"
+)
+
+// Subnet is assoicated with a network and represents a list
+// of subnets available to the network
+type Subnet struct {
+	AddressPrefix  string            `json:",omitempty"`
+	GatewayAddress string            `json:",omitempty"`
+	Policies       []json.RawMessage `json:",omitempty"`
+}
+
+// MacPool is assoicated with a network and represents a list
+// of macaddresses available to the network
+type MacPool struct {
+	StartMacAddress string `json:",omitempty"`
+	EndMacAddress   string `json:",omitempty"`
+}
+
+// HNSNetwork represents a network in HNS
+type HNSNetwork struct {
+	Id                   string            `json:"ID,omitempty"`
+	Name                 string            `json:",omitempty"`
+	Type                 string            `json:",omitempty"`
+	NetworkAdapterName   string            `json:",omitempty"`
+	SourceMac            string            `json:",omitempty"`
+	Policies             []json.RawMessage `json:",omitempty"`
+	MacPools             []MacPool         `json:",omitempty"`
+	Subnets              []Subnet          `json:",omitempty"`
+	DNSSuffix            string            `json:",omitempty"`
+	DNSServerList        string            `json:",omitempty"`
+	DNSServerCompartment uint32            `json:",omitempty"`
+	ManagementIP         string            `json:",omitempty"`
+	AutomaticDNS         bool              `json:",omitempty"`
+}
+
+type hnsNetworkResponse struct {
+	Success bool
+	Error   string
+	Output  HNSNetwork
+}
+
+type hnsResponse struct {
+	Success bool
+	Error   string
+	Output  json.RawMessage
+}
+
+// HNSNetworkRequest makes a call into HNS to update/query a single network
+func HNSNetworkRequest(method, path, request string) (*HNSNetwork, error) {
+	var network HNSNetwork
+	err := hnsCall(method, "/networks/"+path, request, &network)
+	if err != nil {
+		return nil, err
+	}
+
+	return &network, nil
+}
+
+// HNSListNetworkRequest makes a HNS call to query the list of available networks
+func HNSListNetworkRequest(method, path, request string) ([]HNSNetwork, error) {
+	var network []HNSNetwork
+	err := hnsCall(method, "/networks/"+path, request, &network)
+	if err != nil {
+		return nil, err
+	}
+
+	return network, nil
+}
+
+// GetHNSNetworkByID
+func GetHNSNetworkByID(networkID string) (*HNSNetwork, error) {
+	return HNSNetworkRequest("GET", networkID, "")
+}
+
+// GetHNSNetworkName filtered by Name
+func GetHNSNetworkByName(networkName string) (*HNSNetwork, error) {
+	hsnnetworks, err := HNSListNetworkRequest("GET", "", "")
+	if err != nil {
+		return nil, err
+	}
+	for _, hnsnetwork := range hsnnetworks {
+		if hnsnetwork.Name == networkName {
+			return &hnsnetwork, nil
+		}
+	}
+	return nil, NetworkNotFoundError{NetworkName: networkName}
+}
+
+// Create Network by sending NetworkRequest to HNS.
+func (network *HNSNetwork) Create() (*HNSNetwork, error) {
+	operation := "Create"
+	title := "hcsshim::HNSNetwork::" + operation
+	logrus.Debugf(title+" id=%s", network.Id)
+
+	jsonString, err := json.Marshal(network)
+	if err != nil {
+		return nil, err
+	}
+	return HNSNetworkRequest("POST", "", string(jsonString))
+}
+
+// Delete Network by sending NetworkRequest to HNS
+func (network *HNSNetwork) Delete() (*HNSNetwork, error) {
+	operation := "Delete"
+	title := "hcsshim::HNSNetwork::" + operation
+	logrus.Debugf(title+" id=%s", network.Id)
+
+	return HNSNetworkRequest("DELETE", network.Id, "")
+}
+
+// Creates an endpoint on the Network.
+func (network *HNSNetwork) NewEndpoint(ipAddress net.IP, macAddress net.HardwareAddr) *HNSEndpoint {
+	return &HNSEndpoint{
+		VirtualNetwork: network.Id,
+		IPAddress:      ipAddress,
+		MacAddress:     string(macAddress),
+	}
+}
+
+func (network *HNSNetwork) CreateEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) {
+	operation := "CreateEndpoint"
+	title := "hcsshim::HNSNetwork::" + operation
+	logrus.Debugf(title+" id=%s, endpointId=%s", network.Id, endpoint.Id)
+
+	endpoint.VirtualNetwork = network.Id
+	return endpoint.Create()
+}
+
+func (network *HNSNetwork) CreateRemoteEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) {
+	operation := "CreateRemoteEndpoint"
+	title := "hcsshim::HNSNetwork::" + operation
+	logrus.Debugf(title+" id=%s", network.Id)
+	endpoint.IsRemoteEndpoint = true
+	return network.CreateEndpoint(endpoint)
+}

vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go

@@ -0,0 +1,98 @@
+package hns
+
+// Type of Request Support in ModifySystem
+type PolicyType string
+
+// RequestType const
+const (
+	Nat                  PolicyType = "NAT"
+	ACL                  PolicyType = "ACL"
+	PA                   PolicyType = "PA"
+	VLAN                 PolicyType = "VLAN"
+	VSID                 PolicyType = "VSID"
+	VNet                 PolicyType = "VNET"
+	L2Driver             PolicyType = "L2Driver"
+	Isolation            PolicyType = "Isolation"
+	QOS                  PolicyType = "QOS"
+	OutboundNat          PolicyType = "OutBoundNAT"
+	ExternalLoadBalancer PolicyType = "ELB"
+	Route                PolicyType = "ROUTE"
+)
+
+type NatPolicy struct {
+	Type         PolicyType `json:"Type"`
+	Protocol     string
+	InternalPort uint16
+	ExternalPort uint16
+}
+
+type QosPolicy struct {
+	Type                            PolicyType `json:"Type"`
+	MaximumOutgoingBandwidthInBytes uint64
+}
+
+type IsolationPolicy struct {
+	Type               PolicyType `json:"Type"`
+	VLAN               uint
+	VSID               uint
+	InDefaultIsolation bool
+}
+
+type VlanPolicy struct {
+	Type PolicyType `json:"Type"`
+	VLAN uint
+}
+
+type VsidPolicy struct {
+	Type PolicyType `json:"Type"`
+	VSID uint
+}
+
+type PaPolicy struct {
+	Type PolicyType `json:"Type"`
+	PA   string     `json:"PA"`
+}
+
+type OutboundNatPolicy struct {
+	Policy
+	VIP        string   `json:"VIP,omitempty"`
+	Exceptions []string `json:"ExceptionList,omitempty"`
+}
+
+type ActionType string
+type DirectionType string
+type RuleType string
+
+const (
+	Allow ActionType = "Allow"
+	Block ActionType = "Block"
+
+	In  DirectionType = "In"
+	Out DirectionType = "Out"
+
+	Host   RuleType = "Host"
+	Switch RuleType = "Switch"
+)
+
+type ACLPolicy struct {
+	Type            PolicyType `json:"Type"`
+	Id              string     `json:"Id,omitempty"`
+	Protocol        uint16
+	Protocols       string `json:"Protocols,omitempty"`
+	InternalPort    uint16
+	Action          ActionType
+	Direction       DirectionType
+	LocalAddresses  string
+	RemoteAddresses string
+	LocalPorts      string `json:"LocalPorts,omitempty"`
+	LocalPort       uint16
+	RemotePorts     string `json:"RemotePorts,omitempty"`
+	RemotePort      uint16
+	RuleType        RuleType `json:"RuleType,omitempty"`
+	Priority        uint16
+	ServiceName     string
+}
+
+type Policy struct {
+	Type PolicyType `json:"Type"`
+}

vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicylist.go

@@ -0,0 +1,201 @@
+package hns
+
+import (
+	"encoding/json"
+
+	"github.com/sirupsen/logrus"
+)
+
+// RoutePolicy is a structure defining schema for Route based Policy
+type RoutePolicy struct {
+	Policy
+	DestinationPrefix string `json:"DestinationPrefix,omitempty"`
+	NextHop           string `json:"NextHop,omitempty"`
+	EncapEnabled      bool   `json:"NeedEncap,omitempty"`
+}
+
+// ELBPolicy is a structure defining schema for ELB LoadBalancing based Policy
+type ELBPolicy struct {
+	LBPolicy
+	SourceVIP string   `json:"SourceVIP,omitempty"`
+	VIPs      []string `json:"VIPs,omitempty"`
+	ILB       bool     `json:"ILB,omitempty"`
+	DSR       bool     `json:"IsDSR,omitempty"`
+}
+
+// LBPolicy is a structure defining schema for LoadBalancing based Policy
+type LBPolicy struct {
+	Policy
+	Protocol     uint16 `json:"Protocol,omitempty"`
+	InternalPort uint16
+	ExternalPort uint16
+}
+
+// PolicyList is a structure defining schema for Policy list request
+type PolicyList struct {
+	ID                 string            `json:"ID,omitempty"`
+	EndpointReferences []string          `json:"References,omitempty"`
+	Policies           []json.RawMessage `json:"Policies,omitempty"`
+}
+
+// HNSPolicyListRequest makes a call into HNS to update/query a single network
+func HNSPolicyListRequest(method, path, request string) (*PolicyList, error) {
+	var policy PolicyList
+	err := hnsCall(method, "/policylists/"+path, request, &policy)
+	if err != nil {
+		return nil, err
+	}
+
+	return &policy, nil
+}
+
+// HNSListPolicyListRequest gets all the policy list
+func HNSListPolicyListRequest() ([]PolicyList, error) {
+	var plist []PolicyList
+	err := hnsCall("GET", "/policylists/", "", &plist)
+	if err != nil {
+		return nil, err
+	}
+
+	return plist, nil
+}
+
+// PolicyListRequest makes a HNS call to modify/query a network policy list
+func PolicyListRequest(method, path, request string) (*PolicyList, error) {
+	policylist := &PolicyList{}
+	err := hnsCall(method, "/policylists/"+path, request, &policylist)
+	if err != nil {
+		return nil, err
+	}
+
+	return policylist, nil
+}
+
+// GetPolicyListByID get the policy list by ID
+func GetPolicyListByID(policyListID string) (*PolicyList, error) {
+	return PolicyListRequest("GET", policyListID, "")
+}
+
+// Create PolicyList by sending PolicyListRequest to HNS.
+func (policylist *PolicyList) Create() (*PolicyList, error) {
+	operation := "Create"
+	title := "hcsshim::PolicyList::" + operation
+	logrus.Debugf(title+" id=%s", policylist.ID)
+	jsonString, err := json.Marshal(policylist)
+	if err != nil {
+		return nil, err
+	}
+	return PolicyListRequest("POST", "", string(jsonString))
+}
+
+// Delete deletes PolicyList
+func (policylist *PolicyList) Delete() (*PolicyList, error) {
+	operation := "Delete"
+	title := "hcsshim::PolicyList::" + operation
+	logrus.Debugf(title+" id=%s", policylist.ID)
+
+	return PolicyListRequest("DELETE", policylist.ID, "")
+}
+
+// AddEndpoint add an endpoint to a Policy List
+func (policylist *PolicyList) AddEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) {
+	operation := "AddEndpoint"
+	title := "hcsshim::PolicyList::" + operation
+	logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id)
+
+	_, err := policylist.Delete()
+	if err != nil {
+		return nil, err
+	}
+
+	// Add Endpoint to the Existing List
+	policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
+
+	return policylist.Create()
+}
+
+// RemoveEndpoint removes an endpoint from the Policy List
+func (policylist *PolicyList) RemoveEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) {
+	operation := "RemoveEndpoint"
+	title := "hcsshim::PolicyList::" + operation
+	logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id)
+
+	_, err := policylist.Delete()
+	if err != nil {
+		return nil, err
+	}
+
+	elementToRemove := "/endpoints/" + endpoint.Id
+
+	var references []string
+
+	for _, endpointReference := range policylist.EndpointReferences {
+		if endpointReference == elementToRemove {
+			continue
+		}
+		references = append(references, endpointReference)
+	}
+	policylist.EndpointReferences = references
+	return policylist.Create()
+}
+
+// AddLoadBalancer policy list for the specified endpoints
+func AddLoadBalancer(endpoints []HNSEndpoint, isILB bool, sourceVIP, vip string, protocol uint16, internalPort uint16, externalPort uint16) (*PolicyList, error) {
+	operation := "AddLoadBalancer"
+	title := "hcsshim::PolicyList::" + operation
+	logrus.Debugf(title+" endpointId=%v, isILB=%v, sourceVIP=%s, vip=%s, protocol=%v, internalPort=%v, externalPort=%v", endpoints, isILB, sourceVIP, vip, protocol, internalPort, externalPort)
+
+	policylist := &PolicyList{}
+
+	elbPolicy := &ELBPolicy{
+		SourceVIP: sourceVIP,
+		ILB:       isILB,
+	}
+
+	if len(vip) > 0 {
+		elbPolicy.VIPs = []string{vip}
+	}
+	elbPolicy.Type = ExternalLoadBalancer
+	elbPolicy.Protocol = protocol
+	elbPolicy.InternalPort = internalPort
+	elbPolicy.ExternalPort = externalPort
+
+	for _, endpoint := range endpoints {
+		policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
+	}
+
+	jsonString, err := json.Marshal(elbPolicy)
+	if err != nil {
+		return nil, err
+	}
+	policylist.Policies = append(policylist.Policies, jsonString)
+	return policylist.Create()
+}
+
+// AddRoute adds route policy list for the specified endpoints
+func AddRoute(endpoints []HNSEndpoint, destinationPrefix string, nextHop string, encapEnabled bool) (*PolicyList, error) {
+	operation := "AddRoute"
+	title := "hcsshim::PolicyList::" + operation
+	logrus.Debugf(title+" destinationPrefix:%s", destinationPrefix)
+
+	policylist := &PolicyList{}
+
+	rPolicy := &RoutePolicy{
+		DestinationPrefix: destinationPrefix,
+		NextHop:           nextHop,
+		EncapEnabled:      encapEnabled,
+	}
+	rPolicy.Type = Route
+
+	for _, endpoint := range endpoints {
+		policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
+	}
+
+	jsonString, err := json.Marshal(rPolicy)
+	if err != nil {
+		return nil, err
+	}
+
+	policylist.Policies = append(policylist.Policies, jsonString)
+	return policylist.Create()
+}

vendor/github.com/Microsoft/hcsshim/internal/hns/hnssupport.go

@@ -0,0 +1,49 @@
+package hns
+
+import (
+	"github.com/sirupsen/logrus"
+)
+
+type HNSSupportedFeatures struct {
+	Acl HNSAclFeatures `json:"ACL"`
+}
+
+type HNSAclFeatures struct {
+	AclAddressLists       bool `json:"AclAddressLists"`
+	AclNoHostRulePriority bool `json:"AclHostRulePriority"`
+	AclPortRanges         bool `json:"AclPortRanges"`
+	AclRuleId             bool `json:"AclRuleId"`
+}
+
+func GetHNSSupportedFeatures() HNSSupportedFeatures {
+	var hnsFeatures HNSSupportedFeatures
+
+	globals, err := GetHNSGlobals()
+	if err != nil {
+		// Expected on pre-1803 builds, all features will be false/unsupported
+		logrus.Debugf("Unable to obtain HNS globals: %s", err)
+		return hnsFeatures
+	}
+
+	hnsFeatures.Acl = HNSAclFeatures{
+		AclAddressLists:       isHNSFeatureSupported(globals.Version, HNSVersion1803),
+		AclNoHostRulePriority: isHNSFeatureSupported(globals.Version, HNSVersion1803),
+		AclPortRanges:         isHNSFeatureSupported(globals.Version, HNSVersion1803),
+		AclRuleId:             isHNSFeatureSupported(globals.Version, HNSVersion1803),
+	}
+
+	return hnsFeatures
+}
+
+func isHNSFeatureSupported(currentVersion HNSVersion, minVersionSupported HNSVersion) bool {
+	if currentVersion.Major < minVersionSupported.Major {
+		return false
+	}
+	if currentVersion.Major > minVersionSupported.Major {
+		return true
+	}
+	if currentVersion.Minor < minVersionSupported.Minor {
+		return false
+	}
+	return true
+}

vendor/github.com/Microsoft/hcsshim/internal/hns/namespace.go

@@ -0,0 +1,110 @@
+package hns
+
+import (
+	"encoding/json"
+	"fmt"
+	"os"
+	"path"
+	"strings"
+)
+
+type namespaceRequest struct {
+	IsDefault bool `json:",omitempty"`
+}
+
+type namespaceEndpointRequest struct {
+	ID string `json:"Id"`
+}
+
+type NamespaceResource struct {
+	Type string
+	Data json.RawMessage
+}
+
+type namespaceResourceRequest struct {
+	Type string
+	Data interface{}
+}
+
+type Namespace struct {
+	ID           string
+	IsDefault    bool                `json:",omitempty"`
+	ResourceList []NamespaceResource `json:",omitempty"`
+}
+
+func issueNamespaceRequest(id *string, method, subpath string, request interface{}) (*Namespace, error) {
+	var err error
+	hnspath := "/namespaces/"
+	if id != nil {
+		hnspath = path.Join(hnspath, *id)
+	}
+	if subpath != "" {
+		hnspath = path.Join(hnspath, subpath)
+	}
+	var reqJSON []byte
+	if request != nil {
+		if reqJSON, err = json.Marshal(request); err != nil {
+			return nil, err
+		}
+	}
+	var ns Namespace
+	err = hnsCall(method, hnspath, string(reqJSON), &ns)
+	if err != nil {
+		if strings.Contains(err.Error(), "Element not found.") {
+			return nil, os.ErrNotExist
+		}
+		return nil, fmt.Errorf("%s %s: %s", method, hnspath, err)
+	}
+	return &ns, err
+}
+
+func CreateNamespace() (string, error) {
+	req := namespaceRequest{}
+	ns, err := issueNamespaceRequest(nil, "POST", "", &req)
+	if err != nil {
+		return "", err
+	}
+	return ns.ID, nil
+}
+
+func RemoveNamespace(id string) error {
+	_, err := issueNamespaceRequest(&id, "DELETE", "", nil)
+	return err
+}
+
+func GetNamespaceEndpoints(id string) ([]string, error) {
+	ns, err := issueNamespaceRequest(&id, "GET", "", nil)
+	if err != nil {
+		return nil, err
+	}
+	var endpoints []string
+	for _, rsrc := range ns.ResourceList {
+		if rsrc.Type == "Endpoint" {
+			var endpoint namespaceEndpointRequest
+			err = json.Unmarshal(rsrc.Data, &endpoint)
+			if err != nil {
+				return nil, fmt.Errorf("unmarshal endpoint: %s", err)
+			}
+			endpoints = append(endpoints, endpoint.ID)
+		}
+	}
+	return endpoints, nil
+}
+
+func AddNamespaceEndpoint(id string, endpointID string) error {
+	resource := namespaceResourceRequest{
+		Type: "Endpoint",
+		Data: namespaceEndpointRequest{endpointID},
+	}
+	_, err := issueNamespaceRequest(&id, "POST", "addresource", &resource)
+	return err
+}
+
+func RemoveNamespaceEndpoint(id string, endpointID string) error {
+	resource := namespaceResourceRequest{
+		Type: "Endpoint",
+		Data: namespaceEndpointRequest{endpointID},
+	}
+	_, err := issueNamespaceRequest(&id, "POST", "removeresource", &resource)
+	return err
+}

vendor/github.com/Microsoft/hcsshim/internal/hns/zsyscall_windows.go

@@ -0,0 +1,76 @@
+// Code generated mksyscall_windows.exe DO NOT EDIT
+
+package hns
+
+import (
+	"syscall"
+	"unsafe"
+
+	"golang.org/x/sys/windows"
+)
+
+var _ unsafe.Pointer
+
+// Do the interface allocations only once for common
+// Errno values.
+const (
+	errnoERROR_IO_PENDING = 997
+)
+
+var (
+	errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
+)
+
+// errnoErr returns common boxed Errno values, to prevent
+// allocations at runtime.
+func errnoErr(e syscall.Errno) error {
+	switch e {
+	case 0:
+		return nil
+	case errnoERROR_IO_PENDING:
+		return errERROR_IO_PENDING
+	}
+	// TODO: add more here, after collecting data on the common
+	// error values see on Windows. (perhaps when running
+	// all.bat?)
+	return e
+}
+
+var (
+	modvmcompute = windows.NewLazySystemDLL("vmcompute.dll")
+
+	procHNSCall = modvmcompute.NewProc("HNSCall")
+)
+
+func _hnsCall(method string, path string, object string, response **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(method)
+	if hr != nil {
+		return
+	}
+	var _p1 *uint16
+	_p1, hr = syscall.UTF16PtrFromString(path)
+	if hr != nil {
+		return
+	}
+	var _p2 *uint16
+	_p2, hr = syscall.UTF16PtrFromString(object)
+	if hr != nil {
+		return
+	}
+	return __hnsCall(_p0, _p1, _p2, response)
+}
+
+func __hnsCall(method *uint16, path *uint16, object *uint16, response **uint16) (hr error) {
+	if hr = procHNSCall.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHNSCall.Addr(), 4, uintptr(unsafe.Pointer(method)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(object)), uintptr(unsafe.Pointer(response)), 0, 0)
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}

vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go

@@ -0,0 +1,27 @@
+package interop
+
+import (
+	"syscall"
+	"unsafe"
+)
+
+//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go interop.go
+
+//sys coTaskMemFree(buffer unsafe.Pointer) = api_ms_win_core_com_l1_1_0.CoTaskMemFree
+
+func ConvertAndFreeCoTaskMemString(buffer *uint16) string {
+	str := syscall.UTF16ToString((*[1 << 29]uint16)(unsafe.Pointer(buffer))[:])
+	coTaskMemFree(unsafe.Pointer(buffer))
+	return str
+}
+
+func ConvertAndFreeCoTaskMemBytes(buffer *uint16) []byte {
+	return []byte(ConvertAndFreeCoTaskMemString(buffer))
+}
+
+func Win32FromHresult(hr uintptr) syscall.Errno {
+	if hr&0x1fff0000 == 0x00070000 {
+		return syscall.Errno(hr & 0xffff)
+	}
+	return syscall.Errno(hr)
+}

vendor/github.com/Microsoft/hcsshim/internal/interop/zsyscall_windows.go

@@ -0,0 +1,48 @@
+// Code generated mksyscall_windows.exe DO NOT EDIT
+
+package interop
+
+import (
+	"syscall"
+	"unsafe"
+
+	"golang.org/x/sys/windows"
+)
+
+var _ unsafe.Pointer
+
+// Do the interface allocations only once for common
+// Errno values.
+const (
+	errnoERROR_IO_PENDING = 997
+)
+
+var (
+	errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
+)
+
+// errnoErr returns common boxed Errno values, to prevent
+// allocations at runtime.
+func errnoErr(e syscall.Errno) error {
+	switch e {
+	case 0:
+		return nil
+	case errnoERROR_IO_PENDING:
+		return errERROR_IO_PENDING
+	}
+	// TODO: add more here, after collecting data on the common
+	// error values see on Windows. (perhaps when running
+	// all.bat?)
+	return e
+}
+
+var (
+	modapi_ms_win_core_com_l1_1_0 = windows.NewLazySystemDLL("api-ms-win-core-com-l1-1-0.dll")
+
+	procCoTaskMemFree = modapi_ms_win_core_com_l1_1_0.NewProc("CoTaskMemFree")
+)
+
+func coTaskMemFree(buffer unsafe.Pointer) {
+	syscall.Syscall(procCoTaskMemFree.Addr(), 1, uintptr(buffer), 0, 0)
+	return
+}

vendor/github.com/Microsoft/hcsshim/internal/logfields/fields.go

@@ -0,0 +1,32 @@
+package logfields
+
+const (
+	// Identifiers
+
+	ContainerID = "cid"
+	UVMID       = "uvm-id"
+	ProcessID   = "pid"
+
+	// Common Misc
+
+	// Timeout represents an operation timeout.
+	Timeout = "timeout"
+	JSON    = "json"
+
+	// Keys/values
+
+	Field         = "field"
+	OCIAnnotation = "oci-annotation"
+	Value         = "value"
+
+	// Golang type's
+
+	ExpectedType = "expected-type"
+	Bool         = "bool"
+	Uint32       = "uint32"
+	Uint64       = "uint64"
+
+	// runhcs
+
+	VMShimOperation = "vmshim-op"
+)

vendor/github.com/Microsoft/hcsshim/internal/longpath/longpath.go

@@ -0,0 +1,24 @@
+package longpath
+
+import (
+	"path/filepath"
+	"strings"
+)
+
+// LongAbs makes a path absolute and returns it in NT long path form.
+func LongAbs(path string) (string, error) {
+	if strings.HasPrefix(path, `\\?\`) || strings.HasPrefix(path, `\\.\`) {
+		return path, nil
+	}
+	if !filepath.IsAbs(path) {
+		absPath, err := filepath.Abs(path)
+		if err != nil {
+			return "", err
+		}
+		path = absPath
+	}
+	if strings.HasPrefix(path, `\\`) {
+		return `\\?\UNC\` + path[2:], nil
+	}
+	return `\\?\` + path, nil
+}

vendor/github.com/Microsoft/hcsshim/internal/mergemaps/merge.go

@@ -0,0 +1,52 @@
+package mergemaps
+
+import "encoding/json"
+
+// Merge recursively merges map `fromMap` into map `ToMap`. Any pre-existing values
+// in ToMap are overwritten. Values in fromMap are added to ToMap.
+// From http://stackoverflow.com/questions/40491438/merging-two-json-strings-in-golang
+func Merge(fromMap, ToMap interface{}) interface{} {
+	switch fromMap := fromMap.(type) {
+	case map[string]interface{}:
+		ToMap, ok := ToMap.(map[string]interface{})
+		if !ok {
+			return fromMap
+		}
+		for keyToMap, valueToMap := range ToMap {
+			if valueFromMap, ok := fromMap[keyToMap]; ok {
+				fromMap[keyToMap] = Merge(valueFromMap, valueToMap)
+			} else {
+				fromMap[keyToMap] = valueToMap
+			}
+		}
+	case nil:
+		// merge(nil, map[string]interface{...}) -> map[string]interface{...}
+		ToMap, ok := ToMap.(map[string]interface{})
+		if ok {
+			return ToMap
+		}
+	}
+	return fromMap
+}
+
+// MergeJSON merges the contents of a JSON string into an object representation,
+// returning a new object suitable for translating to JSON.
+func MergeJSON(object interface{}, additionalJSON []byte) (interface{}, error) {
+	if len(additionalJSON) == 0 {
+		return object, nil
+	}
+	objectJSON, err := json.Marshal(object)
+	if err != nil {
+		return nil, err
+	}
+	var objectMap, newMap map[string]interface{}
+	err = json.Unmarshal(objectJSON, &objectMap)
+	if err != nil {
+		return nil, err
+	}
+	err = json.Unmarshal(additionalJSON, &newMap)
+	if err != nil {
+		return nil, err
+	}
+	return Merge(newMap, objectMap), nil
+}